| multitask-text-and-chemistry-t5-small-augm,retrosynthesis,CCS(=O)c1ccc(CCN)cc1,10 | |
| multitask-text-and-chemistry-t5-small-augm,paragraph to actions,"The reaction mixture was filtered, the filter cake was washed with Et2O (30 mL) and the filtrate was concentrated under reduced pressure.",10 | |
| multitask-text-and-chemistry-t5-small-augm,molecular captioning,C[C@@H](C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)O)N,10 | |
| multitask-text-and-chemistry-t5-small-augm,text-conditional de novo generation,"The molecule is a tripeptide composed of L-alanine, L-aspartic acid, and glycine units joined in sequence by peptide linkages. It has a role as a metabolite. It derives from a L-alanine, a L-aspartic acid and a glycine.",10 |