diff --git "a/Build/202407250727.framework.js" "b/Build/202407250727.framework.js" new file mode 100644--- /dev/null +++ "b/Build/202407250727.framework.js" @@ -0,0 +1,20752 @@ + +var unityFramework = (() => { + var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined; + if (typeof __filename !== 'undefined') _scriptDir = _scriptDir || __filename; + return ( +function(unityFramework) { + unityFramework = unityFramework || {}; + + + +// The Module object: Our interface to the outside world. We import +// and export values on it. There are various ways Module can be used: +// 1. Not defined. We create it here +// 2. A function parameter, function(Module) { ..generated code.. } +// 3. pre-run appended it, var Module = {}; ..generated code.. +// 4. External script tag defines var Module. +// We need to check if Module already exists (e.g. case 3 above). +// Substitution will be replaced with actual code on later stage of the build, +// this way Closure Compiler will not mangle it (e.g. case 4. above). +// Note that if you want to run closure, and also to use Module +// after the generated code, you will need to define var Module = {}; +// before the code. Then that object will be used in the code, and you +// can continue to use Module afterwards as well. +var Module = typeof unityFramework != 'undefined' ? unityFramework : {}; + +// See https://caniuse.com/mdn-javascript_builtins_object_assign + +// Set up the promise that indicates the Module is initialized +var readyPromiseResolve, readyPromiseReject; +Module['ready'] = new Promise(function(resolve, reject) { + readyPromiseResolve = resolve; + readyPromiseReject = reject; +}); + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_main')) { + Object.defineProperty(Module['ready'], '_main', { configurable: true, get: function() { abort('You are getting _main on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_main', { configurable: true, set: function() { abort('You are setting _main on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_ReleaseKeys')) { + Object.defineProperty(Module['ready'], '_ReleaseKeys', { configurable: true, get: function() { abort('You are getting _ReleaseKeys on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_ReleaseKeys', { configurable: true, set: function() { abort('You are setting _ReleaseKeys on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_getMemInfo')) { + Object.defineProperty(Module['ready'], '_getMemInfo', { configurable: true, get: function() { abort('You are getting _getMemInfo on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_getMemInfo', { configurable: true, set: function() { abort('You are setting _getMemInfo on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_SendMessageFloat')) { + Object.defineProperty(Module['ready'], '_SendMessageFloat', { configurable: true, get: function() { abort('You are getting _SendMessageFloat on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_SendMessageFloat', { configurable: true, set: function() { abort('You are setting _SendMessageFloat on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_SendMessageString')) { + Object.defineProperty(Module['ready'], '_SendMessageString', { configurable: true, get: function() { abort('You are getting _SendMessageString on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_SendMessageString', { configurable: true, set: function() { abort('You are setting _SendMessageString on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_SendMessage')) { + Object.defineProperty(Module['ready'], '_SendMessage', { configurable: true, get: function() { abort('You are getting _SendMessage on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_SendMessage', { configurable: true, set: function() { abort('You are setting _SendMessage on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_SetFullscreen')) { + Object.defineProperty(Module['ready'], '_SetFullscreen', { configurable: true, get: function() { abort('You are getting _SetFullscreen on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_SetFullscreen', { configurable: true, set: function() { abort('You are setting _SetFullscreen on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '_InjectProfilerSample')) { + Object.defineProperty(Module['ready'], '_InjectProfilerSample', { configurable: true, get: function() { abort('You are getting _InjectProfilerSample on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '_InjectProfilerSample', { configurable: true, set: function() { abort('You are setting _InjectProfilerSample on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], '___stdio_exit')) { + Object.defineProperty(Module['ready'], '___stdio_exit', { configurable: true, get: function() { abort('You are getting ___stdio_exit on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], '___stdio_exit', { configurable: true, set: function() { abort('You are setting ___stdio_exit on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + + if (!Object.getOwnPropertyDescriptor(Module['ready'], 'onRuntimeInitialized')) { + Object.defineProperty(Module['ready'], 'onRuntimeInitialized', { configurable: true, get: function() { abort('You are getting onRuntimeInitialized on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + Object.defineProperty(Module['ready'], 'onRuntimeInitialized', { configurable: true, set: function() { abort('You are setting onRuntimeInitialized on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js') } }); + } + + +// --pre-jses are emitted after the Module integration code, so that they can +// refer to Module (if they choose; they can also define Module) + + + +// Emscripten 1.x had a function Pointer_stringify() to marshal C strings to JS strings. That has been obsoleted by the new UTF8/16/32ToString() API family. +function Pointer_stringify(s, len) { + warnOnce("The JavaScript function 'Pointer_stringify(ptrToSomeCString)' is obsoleted and will be removed in a future Unity version. Please call 'UTF8ToString(ptrToSomeCString)' instead."); + return UTF8ToString(s, len); +} +Module['Pointer_stringify'] = Pointer_stringify; +var stackTraceReference = "(^|\\n)(\\s+at\\s+|)jsStackTrace(\\s+\\(|@)([^\\n]+):\\d+:\\d+(\\)|)(\\n|$)"; +var stackTraceReferenceMatch = jsStackTrace().match(new RegExp(stackTraceReference)); +if (stackTraceReferenceMatch) + Module.stackTraceRegExp = new RegExp(stackTraceReference.replace("([^\\n]+)", stackTraceReferenceMatch[4].replace(/[\\^${}[\]().*+?|]/g,"\\$&")).replace("jsStackTrace", "[^\\n]+")); + +var abort = function (what) { + if (ABORT) + return; + ABORT = true; + EXITSTATUS = 1; + if (typeof ENVIRONMENT_IS_PTHREAD !== "undefined" && ENVIRONMENT_IS_PTHREAD) + console.error("Pthread aborting at " + new Error().stack); + if (what !== undefined) { + out(what); + err(what); + what = JSON.stringify(what) + } else { + what = ""; + } + var message = "abort(" + what + ") at " + stackTrace(); + if (Module.abortHandler && Module.abortHandler(message)) + return; + throw message; +} + +Module["SetFullscreen"] = function (fullscreen) { + if (typeof runtimeInitialized === 'undefined' || !runtimeInitialized) { + console.log ("Runtime not initialized yet."); + } else if (typeof JSEvents === 'undefined') { + console.log ("Player not loaded yet."); + } else { + var tmp = JSEvents.canPerformEventHandlerRequests; + JSEvents.canPerformEventHandlerRequests = function () { return 1; }; + Module.ccall("SetFullscreen", null, ["number"], [fullscreen]); + JSEvents.canPerformEventHandlerRequests = tmp; + } +}; +if (!Module['ENVIRONMENT_IS_PTHREAD']) { + Module['preRun'].push(function () { + // Initialize the IndexedDB based file system. Module['unityFileSystemInit'] allows + // developers to override this with their own function, when they want to do cloud storage + // instead. + var unityFileSystemInit = Module['unityFileSystemInit'] || function () { + FS.mkdir('/idbfs'); + FS.mount(IDBFS, {}, '/idbfs'); + Module.addRunDependency('JS_FileSystem_Mount'); + FS.syncfs(true, function (err) { + if (err) + console.log('IndexedDB is not available. Data will not persist in cache and PlayerPrefs will not be saved.'); + Module.removeRunDependency('JS_FileSystem_Mount'); + }); + }; + unityFileSystemInit(); + }); +} + +var videoInputDevices = []; // Set to null to disable video input devices altogether. +var videoInputDevicesEnumerated = false; +var removeEnumerateMediaDevicesRunDependency; +var enumerateWatchdog = null; + +// Bug/limitation: Chrome does not specify deviceIds for any MediaDeviceInfo input devices at least in Chrome 85 on Windows 10 +// This means that we need to use an awkward heuristic way of matching old video input connections to new ones. +function matchToOldDevice(newDevice) { + var oldDevices = Object.keys(videoInputDevices); + // First match by deviceId + for(var i = 0; i < oldDevices.length; ++i) { + var old = videoInputDevices[oldDevices[i]]; + if (old.deviceId && old.deviceId == newDevice.deviceId) return old; + } + // Then by object identity, in case that is supported. + for(var i = 0; i < oldDevices.length; ++i) { + var old = videoInputDevices[oldDevices[i]]; + if (old == newDevice) return old; + } + // Then by label + for(var i = 0; i < oldDevices.length; ++i) { + var old = videoInputDevices[oldDevices[i]]; + if (old.label && old.label == newDevice.label) return old; + } + // Last, by groupId + kind combination + for(var i = 0; i < oldDevices.length; ++i) { + var old = videoInputDevices[oldDevices[i]]; + if (old.groupId && old.kind && old.groupId == newDevice.groupId && old.kind == newDevice.kind) return old; + } +} + +function assignNewVideoInputId() { + for(var i = 0;; ++i) { + if (!videoInputDevices[i]) return i; + } +} + +function updateVideoInputDevices(devices) { + removeEnumerateMediaDevicesRunDependency(); + // we're going to clear the list of videoInputDevices and regenerate it to get more accurate info after being granted camera access + videoInputDevices = []; + var retainedDevices = {}; + var newDevices = []; + + // Find devices that still exist + devices.forEach(function (device) { + if (device.kind === 'videoinput') { // Only interested in WebCam inputs + var oldDevice = matchToOldDevice(device); + if (oldDevice) { + retainedDevices[oldDevice.id] = oldDevice; + } else { + newDevices.push(device); + } + } + }); + videoInputDevices = retainedDevices; + + // Assign IDs to video input devices that are new + newDevices.forEach(function (device) { + if (!device.id) { + device.id = assignNewVideoInputId(); + // Attempt to name the device. In both Firefox and Chrome, label is null. + // In Chrome, deviceId is null. (could use it here, but human-readable + // name is probably better than a long hash) + device.name = device.label || ("Video input #" + (device.id + 1)); + + // Chrome 85 on Android labels camera provides devices with labels like + // "camera2 0, facing back" and "camera2 1, facing front", use that to + // determine whether the device is front facing or not. + // some labels don't provide that info, like the camera on a 2019 MacbookPro: FaceTime HD Camera (Built-in) + // so if there's no "front" or "back" in the label or name, we're going to assume it's front facing + + + device.isFrontFacing = device.name.toLowerCase().includes('front') || (!(device.name.toLowerCase().includes('front')) && !(device.name.toLowerCase().includes('back'))); + + videoInputDevices[device.id] = device; + } + }); +} + +function enumerateMediaDeviceList() { + if (!videoInputDevices) return; + // Bug/limitation: If there are multiple video or audio devices connected, + // Chrome only lists one of each category (audioinput/videoinput/audioutput) (tested Chrome 85 on Windows 10) + navigator.mediaDevices.enumerateDevices().then(function(devices) { + updateVideoInputDevices(devices); + videoInputDevicesEnumerated = true; + }).catch(function(e) { + console.warn('Unable to enumerate media devices: ' + e + '\nWebcams will not be available.'); + disableAccessToMediaDevices(); + }); + + // Work around Firefox 81 bug on Windows: + // https://bugzilla.mozilla.org/show_bug.cgi?id=1397977, devicechange + // events do not fire, so resort to polling for device changes once every + // 60 seconds. + if (/Firefox/.test(navigator.userAgent)) { + setTimeout(enumerateMediaDeviceList, 60000); + warnOnce('Applying workaround to Firefox bug https://bugzilla.mozilla.org/show_bug.cgi?id=1397977'); + } +} + +function disableAccessToMediaDevices() { + // Safari 11 has navigator.mediaDevices, but navigator.mediaDevices.add/removeEventListener is undefined + if (navigator.mediaDevices && navigator.mediaDevices.removeEventListener) { + navigator.mediaDevices.removeEventListener('devicechange', enumerateMediaDeviceList); + } + videoInputDevices = null; +} +Module['disableAccessToMediaDevices'] = disableAccessToMediaDevices; + +if (!navigator.mediaDevices) { + console.warn('navigator.mediaDevices not supported by this browser. Webcam access will not be available.' + (location.protocol == 'https:' ? '' : ' Try hosting the page over HTTPS, because some browsers disable webcam access when insecure HTTP is being used.')); + disableAccessToMediaDevices(); +} else if (typeof ENVIRONMENT_IS_PTHREAD === "undefined" || !ENVIRONMENT_IS_PTHREAD) setTimeout(function() { + try { + // Do not start engine main() until we have completed enumeration. + addRunDependency('enumerateMediaDevices'); + removeEnumerateMediaDevicesRunDependency = function() { + if (enumerateWatchdog !== null) clearTimeout(enumerateWatchdog); + removeRunDependency('enumerateMediaDevices'); + if (navigator.mediaDevices) console.log('navigator.mediaDevices support available'); + removeEnumerateMediaDevicesRunDependency = function(){}; + } + // Enumerate media devices now at startup.. + enumerateMediaDeviceList(); + // Firefox won't complete device enumeration if the window isn't in focus causing the startup to hang, so we + // wait a second before removing the dependency and starting with an empty list of devices. Moving forward it's + // likely more browsers will assume this standard. + // See https://w3c.github.io/mediacapture-main/#dom-mediadevices-enumeratedevices + enumerateWatchdog = setTimeout(removeEnumerateMediaDevicesRunDependency, 1000); + + // .. and whenever the connected devices list changes. + navigator.mediaDevices.addEventListener('devicechange', enumerateMediaDeviceList); + } catch(e) { + console.warn('Unable to enumerate media devices: ' + e); + disableAccessToMediaDevices(); + } +}, 0); + +function SendMessage(gameObject, func, param) { + var func_cstr = stringToNewUTF8(func); + var gameObject_cstr = stringToNewUTF8(gameObject); + var param_cstr = 0; + + try { + if (param === undefined) + _SendMessage(gameObject_cstr, func_cstr); + else if (typeof param === "string") { + param_cstr = stringToNewUTF8(param); + _SendMessageString(gameObject_cstr, func_cstr, param_cstr); + } + else if (typeof param === "number") + _SendMessageFloat(gameObject_cstr, func_cstr, param); + else + throw "" + param + " is does not have a type which is supported by SendMessage."; + + } finally { + _free(param_cstr); + _free(gameObject_cstr); + _free(func_cstr); + } +} +Module["SendMessage"] = SendMessage; // to avoid emscripten stripping + +// Sometimes an existing Module object exists with properties +// meant to overwrite the default module functionality. Here +// we collect those properties and reapply _after_ we configure +// the current environment's defaults to avoid having to be so +// defensive during initialization. +var moduleOverrides = Object.assign({}, Module); + +var arguments_ = []; +var thisProgram = './this.program'; +var quit_ = (status, toThrow) => { + throw toThrow; +}; + +// Determine the runtime environment we are in. You can customize this by +// setting the ENVIRONMENT setting at compile time (see settings.js). + +// Attempt to auto-detect the environment +var ENVIRONMENT_IS_WEB = typeof window == 'object'; +var ENVIRONMENT_IS_WORKER = typeof importScripts == 'function'; +// N.b. Electron.js environment is simultaneously a NODE-environment, but +// also a web environment. +var ENVIRONMENT_IS_NODE = typeof process == 'object' && typeof process.versions == 'object' && typeof process.versions.node == 'string'; +var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; + +if (Module['ENVIRONMENT']) { + throw new Error('Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)'); +} + +// `/` should be present at the end if `scriptDirectory` is not empty +var scriptDirectory = ''; +function locateFile(path) { + if (Module['locateFile']) { + return Module['locateFile'](path, scriptDirectory); + } + return scriptDirectory + path; +} + +// Hooks that are implemented differently in different runtime environments. +var read_, + readAsync, + readBinary, + setWindowTitle; + +// Normally we don't log exceptions but instead let them bubble out the top +// level where the embedding environment (e.g. the browser) can handle +// them. +// However under v8 and node we sometimes exit the process direcly in which case +// its up to use us to log the exception before exiting. +// If we fix https://github.com/emscripten-core/emscripten/issues/15080 +// this may no longer be needed under node. +function logExceptionOnExit(e) { + if (e instanceof ExitStatus) return; + let toLog = e; + if (e && typeof e == 'object' && e.stack) { + toLog = [e, e.stack]; + } + err('exiting due to exception: ' + toLog); +} + +var fs; +var nodePath; +var requireNodeFS; + +if (ENVIRONMENT_IS_NODE) { + if (!(typeof process == 'object' && typeof require == 'function')) throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + if (ENVIRONMENT_IS_WORKER) { + scriptDirectory = require('path').dirname(scriptDirectory) + '/'; + } else { + scriptDirectory = __dirname + '/'; + } + +// include: node_shell_read.js + + +requireNodeFS = () => { + // Use nodePath as the indicator for these not being initialized, + // since in some environments a global fs may have already been + // created. + if (!nodePath) { + fs = require('fs'); + nodePath = require('path'); + } +}; + +read_ = function shell_read(filename, binary) { + requireNodeFS(); + filename = nodePath['normalize'](filename); + return fs.readFileSync(filename, binary ? undefined : 'utf8'); +}; + +readBinary = (filename) => { + var ret = read_(filename, true); + if (!ret.buffer) { + ret = new Uint8Array(ret); + } + assert(ret.buffer); + return ret; +}; + +readAsync = (filename, onload, onerror) => { + requireNodeFS(); + filename = nodePath['normalize'](filename); + fs.readFile(filename, function(err, data) { + if (err) onerror(err); + else onload(data.buffer); + }); +}; + +// end include: node_shell_read.js + if (process['argv'].length > 1) { + thisProgram = process['argv'][1].replace(/\\/g, '/'); + } + + arguments_ = process['argv'].slice(2); + + // MODULARIZE will export the module in the proper place outside, we don't need to export here + + process['on']('uncaughtException', function(ex) { + // suppress ExitStatus exceptions from showing an error + if (!(ex instanceof ExitStatus)) { + throw ex; + } + }); + + // Without this older versions of node (< v15) will log unhandled rejections + // but return 0, which is not normally the desired behaviour. This is + // not be needed with node v15 and about because it is now the default + // behaviour: + // See https://nodejs.org/api/cli.html#cli_unhandled_rejections_mode + process['on']('unhandledRejection', function(reason) { throw reason; }); + + quit_ = (status, toThrow) => { + if (keepRuntimeAlive()) { + process['exitCode'] = status; + throw toThrow; + } + logExceptionOnExit(toThrow); + process['exit'](status); + }; + + Module['inspect'] = function () { return '[Emscripten Module object]'; }; + +} else +if (ENVIRONMENT_IS_SHELL) { + + if ((typeof process == 'object' && typeof require === 'function') || typeof window == 'object' || typeof importScripts == 'function') throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + + if (typeof read != 'undefined') { + read_ = function shell_read(f) { + return read(f); + }; + } + + readBinary = function readBinary(f) { + let data; + if (typeof readbuffer == 'function') { + return new Uint8Array(readbuffer(f)); + } + data = read(f, 'binary'); + assert(typeof data == 'object'); + return data; + }; + + readAsync = function readAsync(f, onload, onerror) { + setTimeout(() => onload(readBinary(f)), 0); + }; + + if (typeof scriptArgs != 'undefined') { + arguments_ = scriptArgs; + } else if (typeof arguments != 'undefined') { + arguments_ = arguments; + } + + if (typeof quit == 'function') { + quit_ = (status, toThrow) => { + logExceptionOnExit(toThrow); + quit(status); + }; + } + + if (typeof print != 'undefined') { + // Prefer to use print/printErr where they exist, as they usually work better. + if (typeof console == 'undefined') console = /** @type{!Console} */({}); + console.log = /** @type{!function(this:Console, ...*): undefined} */ (print); + console.warn = console.error = /** @type{!function(this:Console, ...*): undefined} */ (typeof printErr != 'undefined' ? printErr : print); + } + +} else + +// Note that this includes Node.js workers when relevant (pthreads is enabled). +// Node.js workers are detected as a combination of ENVIRONMENT_IS_WORKER and +// ENVIRONMENT_IS_NODE. +if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + if (ENVIRONMENT_IS_WORKER) { // Check worker, not web, since window could be polyfilled + scriptDirectory = self.location.href; + } else if (typeof document != 'undefined' && document.currentScript) { // web + scriptDirectory = document.currentScript.src; + } + // When MODULARIZE, this JS may be executed later, after document.currentScript + // is gone, so we saved it, and we use it here instead of any other info. + if (_scriptDir) { + scriptDirectory = _scriptDir; + } + // blob urls look like blob:http://site.com/etc/etc and we cannot infer anything from them. + // otherwise, slice off the final part of the url to find the script directory. + // if scriptDirectory does not contain a slash, lastIndexOf will return -1, + // and scriptDirectory will correctly be replaced with an empty string. + // If scriptDirectory contains a query (starting with ?) or a fragment (starting with #), + // they are removed because they could contain a slash. + if (scriptDirectory.indexOf('blob:') !== 0) { + scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf('/')+1); + } else { + scriptDirectory = ''; + } + + if (!(typeof window == 'object' || typeof importScripts == 'function')) throw new Error('not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)'); + + // Differentiate the Web Worker from the Node Worker case, as reading must + // be done differently. + { +// include: web_or_worker_shell_read.js + + + read_ = (url) => { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.send(null); + return xhr.responseText; + } + + if (ENVIRONMENT_IS_WORKER) { + readBinary = (url) => { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.responseType = 'arraybuffer'; + xhr.send(null); + return new Uint8Array(/** @type{!ArrayBuffer} */(xhr.response)); + }; + } + + readAsync = (url, onload, onerror) => { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, true); + xhr.responseType = 'arraybuffer'; + xhr.onload = () => { + if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + onload(xhr.response); + return; + } + onerror(); + }; + xhr.onerror = onerror; + xhr.send(null); + } + +// end include: web_or_worker_shell_read.js + } + + setWindowTitle = (title) => document.title = title; +} else +{ + throw new Error('environment detection error'); +} + +var out = Module['print'] || console.log.bind(console); +var err = Module['printErr'] || console.warn.bind(console); + +// Merge back in the overrides +Object.assign(Module, moduleOverrides); +// Free the object hierarchy contained in the overrides, this lets the GC +// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. +moduleOverrides = null; +checkIncomingModuleAPI(); + +// Emit code to handle expected values on the Module object. This applies Module.x +// to the proper local x. This has two benefits: first, we only emit it if it is +// expected to arrive, and second, by using a local everywhere else that can be +// minified. + +if (Module['arguments']) arguments_ = Module['arguments'];legacyModuleProp('arguments', 'arguments_'); + +if (Module['thisProgram']) thisProgram = Module['thisProgram'];legacyModuleProp('thisProgram', 'thisProgram'); + +if (Module['quit']) quit_ = Module['quit'];legacyModuleProp('quit', 'quit_'); + +// perform assertions in shell.js after we set up out() and err(), as otherwise if an assertion fails it cannot print the message +// Assertions on removed incoming Module JS APIs. +assert(typeof Module['memoryInitializerPrefixURL'] == 'undefined', 'Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['pthreadMainPrefixURL'] == 'undefined', 'Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['cdInitializerPrefixURL'] == 'undefined', 'Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['filePackagePrefixURL'] == 'undefined', 'Module.filePackagePrefixURL option was removed, use Module.locateFile instead'); +assert(typeof Module['read'] == 'undefined', 'Module.read option was removed (modify read_ in JS)'); +assert(typeof Module['readAsync'] == 'undefined', 'Module.readAsync option was removed (modify readAsync in JS)'); +assert(typeof Module['readBinary'] == 'undefined', 'Module.readBinary option was removed (modify readBinary in JS)'); +assert(typeof Module['setWindowTitle'] == 'undefined', 'Module.setWindowTitle option was removed (modify setWindowTitle in JS)'); +assert(typeof Module['TOTAL_MEMORY'] == 'undefined', 'Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY'); +legacyModuleProp('read', 'read_'); +legacyModuleProp('readAsync', 'readAsync'); +legacyModuleProp('readBinary', 'readBinary'); +legacyModuleProp('setWindowTitle', 'setWindowTitle'); + +var PROXYFS = 'PROXYFS is no longer included by default; build with -lproxyfs.js'; +var WORKERFS = 'WORKERFS is no longer included by default; build with -lworkerfs.js'; +var NODEFS = 'NODEFS is no longer included by default; build with -lnodefs.js'; + + +assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time. Add 'shell' to `-s ENVIRONMENT` to enable."); + + + + +var STACK_ALIGN = 16; +var POINTER_SIZE = 4; + +function getNativeTypeSize(type) { + switch (type) { + case 'i1': case 'i8': return 1; + case 'i16': return 2; + case 'i32': return 4; + case 'i64': return 8; + case 'float': return 4; + case 'double': return 8; + default: { + if (type[type.length - 1] === '*') { + return POINTER_SIZE; + } else if (type[0] === 'i') { + const bits = Number(type.substr(1)); + assert(bits % 8 === 0, 'getNativeTypeSize invalid bits ' + bits + ', type ' + type); + return bits / 8; + } else { + return 0; + } + } + } +} + +function warnOnce(text) { + if (!warnOnce.shown) warnOnce.shown = {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + err(text); + } +} + +// include: runtime_functions.js + + +// Wraps a JS function as a wasm function with a given signature. +function convertJsFunctionToWasm(func, sig) { + + // If the type reflection proposal is available, use the new + // "WebAssembly.Function" constructor. + // Otherwise, construct a minimal wasm module importing the JS function and + // re-exporting it. + if (typeof WebAssembly.Function == "function") { + var typeNames = { + 'i': 'i32', + 'j': 'i64', + 'f': 'f32', + 'd': 'f64' + }; + var type = { + parameters: [], + results: sig[0] == 'v' ? [] : [typeNames[sig[0]]] + }; + for (var i = 1; i < sig.length; ++i) { + type.parameters.push(typeNames[sig[i]]); + } + return new WebAssembly.Function(type, func); + } + + // The module is static, with the exception of the type section, which is + // generated based on the signature passed in. + var typeSection = [ + 0x01, // id: section, + 0x00, // length: 0 (placeholder) + 0x01, // count: 1 + 0x60, // form: func + ]; + var sigRet = sig.slice(0, 1); + var sigParam = sig.slice(1); + var typeCodes = { + 'i': 0x7f, // i32 + 'j': 0x7e, // i64 + 'f': 0x7d, // f32 + 'd': 0x7c, // f64 + }; + + // Parameters, length + signatures + typeSection.push(sigParam.length); + for (var i = 0; i < sigParam.length; ++i) { + typeSection.push(typeCodes[sigParam[i]]); + } + + // Return values, length + signatures + // With no multi-return in MVP, either 0 (void) or 1 (anything else) + if (sigRet == 'v') { + typeSection.push(0x00); + } else { + typeSection = typeSection.concat([0x01, typeCodes[sigRet]]); + } + + // Write the overall length of the type section back into the section header + // (excepting the 2 bytes for the section id and length) + typeSection[1] = typeSection.length - 2; + + // Rest of the module is static + var bytes = new Uint8Array([ + 0x00, 0x61, 0x73, 0x6d, // magic ("\0asm") + 0x01, 0x00, 0x00, 0x00, // version: 1 + ].concat(typeSection, [ + 0x02, 0x07, // import section + // (import "e" "f" (func 0 (type 0))) + 0x01, 0x01, 0x65, 0x01, 0x66, 0x00, 0x00, + 0x07, 0x05, // export section + // (export "f" (func 0 (type 0))) + 0x01, 0x01, 0x66, 0x00, 0x00, + ])); + + // We can compile this wasm module synchronously because it is very small. + // This accepts an import (at "e.f"), that it reroutes to an export (at "f") + var module = new WebAssembly.Module(bytes); + var instance = new WebAssembly.Instance(module, { + 'e': { + 'f': func + } + }); + var wrappedFunc = instance.exports['f']; + return wrappedFunc; +} + +var freeTableIndexes = []; + +// Weak map of functions in the table to their indexes, created on first use. +var functionsInTableMap; + +function getEmptyTableSlot() { + // Reuse a free index if there is one, otherwise grow. + if (freeTableIndexes.length) { + return freeTableIndexes.pop(); + } + // Grow the table + try { + wasmTable.grow(1); + } catch (err) { + if (!(err instanceof RangeError)) { + throw err; + } + throw 'Unable to grow wasm table. Set ALLOW_TABLE_GROWTH.'; + } + return wasmTable.length - 1; +} + +function updateTableMap(offset, count) { + for (var i = offset; i < offset + count; i++) { + var item = getWasmTableEntry(i); + // Ignore null values. + if (item) { + functionsInTableMap.set(item, i); + } + } +} + +/** + * Add a function to the table. + * 'sig' parameter is required if the function being added is a JS function. + * @param {string=} sig + */ +function addFunction(func, sig) { + assert(typeof func != 'undefined'); + + // Check if the function is already in the table, to ensure each function + // gets a unique index. First, create the map if this is the first use. + if (!functionsInTableMap) { + functionsInTableMap = new WeakMap(); + updateTableMap(0, wasmTable.length); + } + if (functionsInTableMap.has(func)) { + return functionsInTableMap.get(func); + } + + // It's not in the table, add it now. + + var ret = getEmptyTableSlot(); + + // Set the new value. + try { + // Attempting to call this with JS function will cause of table.set() to fail + setWasmTableEntry(ret, func); + } catch (err) { + if (!(err instanceof TypeError)) { + throw err; + } + assert(typeof sig != 'undefined', 'Missing signature argument to addFunction: ' + func); + var wrapped = convertJsFunctionToWasm(func, sig); + setWasmTableEntry(ret, wrapped); + } + + functionsInTableMap.set(func, ret); + + return ret; +} + +function removeFunction(index) { + functionsInTableMap.delete(getWasmTableEntry(index)); + freeTableIndexes.push(index); +} + +// end include: runtime_functions.js +// include: runtime_debug.js + + +function legacyModuleProp(prop, newName) { + if (!Object.getOwnPropertyDescriptor(Module, prop)) { + Object.defineProperty(Module, prop, { + configurable: true, + get: function() { + abort('Module.' + prop + ' has been replaced with plain ' + newName + ' (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)'); + } + }); + } +} + +function ignoredModuleProp(prop) { + if (Object.getOwnPropertyDescriptor(Module, prop)) { + abort('`Module.' + prop + '` was supplied but `' + prop + '` not included in INCOMING_MODULE_JS_API'); + } +} + +function unexportedMessage(sym, isFSSybol) { + var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)"; + if (isFSSybol) { + msg += '. Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you'; + } + return msg; +} + +function unexportedRuntimeSymbol(sym, isFSSybol) { + if (!Object.getOwnPropertyDescriptor(Module, sym)) { + Object.defineProperty(Module, sym, { + configurable: true, + get: function() { + abort(unexportedMessage(sym, isFSSybol)); + } + }); + } +} + +function unexportedRuntimeFunction(sym, isFSSybol) { + if (!Object.getOwnPropertyDescriptor(Module, sym)) { + Module[sym] = () => abort(unexportedMessage(sym, isFSSybol)); + } +} + +// end include: runtime_debug.js +var tempRet0 = 0; +var setTempRet0 = (value) => { tempRet0 = value; }; +var getTempRet0 = () => tempRet0; + + + +// === Preamble library stuff === + +// Documentation for the public APIs defined in this file must be updated in: +// site/source/docs/api_reference/preamble.js.rst +// A prebuilt local version of the documentation is available at: +// site/build/text/docs/api_reference/preamble.js.txt +// You can also build docs locally as HTML or other formats in site/ +// An online HTML version (which may be of a different version of Emscripten) +// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + +var wasmBinary; +if (Module['wasmBinary']) wasmBinary = Module['wasmBinary'];legacyModuleProp('wasmBinary', 'wasmBinary'); +var noExitRuntime = Module['noExitRuntime'] || true;legacyModuleProp('noExitRuntime', 'noExitRuntime'); + +if (typeof WebAssembly != 'object') { + abort('no native wasm support detected'); +} + +// include: runtime_safe_heap.js + + +// In MINIMAL_RUNTIME, setValue() and getValue() are only available when building with safe heap enabled, for heap safety checking. +// In traditional runtime, setValue() and getValue() are always available (although their use is highly discouraged due to perf penalties) + +/** @param {number} ptr + @param {number} value + @param {string} type + @param {number|boolean=} noSafe */ +function setValue(ptr, value, type = 'i8', noSafe) { + if (type.charAt(type.length-1) === '*') type = 'i32'; + switch (type) { + case 'i1': HEAP8[((ptr)>>0)] = value; break; + case 'i8': HEAP8[((ptr)>>0)] = value; break; + case 'i16': HEAP16[((ptr)>>1)] = value; break; + case 'i32': HEAP32[((ptr)>>2)] = value; break; + case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)] = tempI64[0],HEAP32[(((ptr)+(4))>>2)] = tempI64[1]); break; + case 'float': HEAPF32[((ptr)>>2)] = value; break; + case 'double': HEAPF64[((ptr)>>3)] = value; break; + default: abort('invalid type for setValue: ' + type); + } +} + +/** @param {number} ptr + @param {string} type + @param {number|boolean=} noSafe */ +function getValue(ptr, type = 'i8', noSafe) { + if (type.charAt(type.length-1) === '*') type = 'i32'; + switch (type) { + case 'i1': return HEAP8[((ptr)>>0)]; + case 'i8': return HEAP8[((ptr)>>0)]; + case 'i16': return HEAP16[((ptr)>>1)]; + case 'i32': return HEAP32[((ptr)>>2)]; + case 'i64': return HEAP32[((ptr)>>2)]; + case 'float': return HEAPF32[((ptr)>>2)]; + case 'double': return Number(HEAPF64[((ptr)>>3)]); + default: abort('invalid type for getValue: ' + type); + } + return null; +} + +// end include: runtime_safe_heap.js +// Wasm globals + +var wasmMemory; + +//======================================== +// Runtime essentials +//======================================== + +// whether we are quitting the application. no code should run after this. +// set in exit() and abort() +var ABORT = false; + +// set by exit() and abort(). Passed to 'onExit' handler. +// NOTE: This is also used as the process return code code in shell environments +// but only when noExitRuntime is false. +var EXITSTATUS; + +/** @type {function(*, string=)} */ +function assert(condition, text) { + if (!condition) { + abort('Assertion failed' + (text ? ': ' + text : '')); + } +} + +// Returns the C function with a specified identifier (for C++, you need to do manual name mangling) +function getCFunc(ident) { + var func = Module['_' + ident]; // closure exported function + assert(func, 'Cannot call unknown function ' + ident + ', make sure it is exported'); + return func; +} + +// C calling interface. +/** @param {string|null=} returnType + @param {Array=} argTypes + @param {Arguments|Array=} args + @param {Object=} opts */ +function ccall(ident, returnType, argTypes, args, opts) { + // For fast lookup of conversion functions + var toC = { + 'string': function(str) { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { // null string + // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' + var len = (str.length << 2) + 1; + ret = stackAlloc(len); + stringToUTF8(str, ret, len); + } + return ret; + }, + 'array': function(arr) { + var ret = stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + } + }; + + function convertReturnValue(ret) { + if (returnType === 'string') return UTF8ToString(ret); + if (returnType === 'boolean') return Boolean(ret); + return ret; + } + + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + assert(returnType !== 'array', 'Return type should not be "array".'); + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func.apply(null, cArgs); + function onDone(ret) { + if (stack !== 0) stackRestore(stack); + return convertReturnValue(ret); + } + + ret = onDone(ret); + return ret; +} + +/** @param {string=} returnType + @param {Array=} argTypes + @param {Object=} opts */ +function cwrap(ident, returnType, argTypes, opts) { + return function() { + return ccall(ident, returnType, argTypes, arguments, opts); + } +} + +// We used to include malloc/free by default in the past. Show a helpful error in +// builds with assertions. + +// include: runtime_legacy.js + + +var ALLOC_NORMAL = 0; // Tries to use _malloc() +var ALLOC_STACK = 1; // Lives for the duration of the current function call + +/** + * allocate(): This function is no longer used by emscripten but is kept around to avoid + * breaking external users. + * You should normally not use allocate(), and instead allocate + * memory using _malloc()/stackAlloc(), initialize it with + * setValue(), and so forth. + * @param {(Uint8Array|Array)} slab: An array of data. + * @param {number=} allocator : How to allocate memory, see ALLOC_* + */ +function allocate(slab, allocator) { + var ret; + assert(typeof allocator == 'number', 'allocate no longer takes a type argument') + assert(typeof slab != 'number', 'allocate no longer takes a number as arg0') + + if (allocator == ALLOC_STACK) { + ret = stackAlloc(slab.length); + } else { + ret = _malloc(slab.length); + } + + if (!slab.subarray && !slab.slice) { + slab = new Uint8Array(slab); + } + HEAPU8.set(slab, ret); + return ret; +} + +// end include: runtime_legacy.js +// include: runtime_strings.js + + +// runtime_strings.js: Strings related runtime functions that are part of both MINIMAL_RUNTIME and regular runtime. + +var UTF8Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf8') : undefined; + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns +// a copy of that string as a Javascript String object. +/** + * heapOrArray is either a regular array, or a JavaScript typed array view. + * @param {number} idx + * @param {number=} maxBytesToRead + * @return {string} + */ +function UTF8ArrayToString(heapOrArray, idx, maxBytesToRead) { + var endIdx = idx + maxBytesToRead; + var endPtr = idx; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + // (As a tiny code save trick, compare endPtr against endIdx using a negation, so that undefined means Infinity) + while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr; + + if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) { + return UTF8Decoder.decode(heapOrArray.subarray(idx, endPtr)); + } else { + var str = ''; + // If building with TextDecoder, we have already computed the string length above, so test loop end condition against that + while (idx < endPtr) { + // For UTF8 byte structure, see: + // http://en.wikipedia.org/wiki/UTF-8#Description + // https://www.ietf.org/rfc/rfc2279.txt + // https://tools.ietf.org/html/rfc3629 + var u0 = heapOrArray[idx++]; + if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } + var u1 = heapOrArray[idx++] & 63; + if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } + var u2 = heapOrArray[idx++] & 63; + if ((u0 & 0xF0) == 0xE0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + if ((u0 & 0xF8) != 0xF0) warnOnce('Invalid UTF-8 leading byte 0x' + u0.toString(16) + ' encountered when deserializing a UTF-8 string in wasm memory to a JS string!'); + u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | (heapOrArray[idx++] & 63); + } + + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } + } + } + return str; +} + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns a +// copy of that string as a Javascript String object. +// maxBytesToRead: an optional length that specifies the maximum number of bytes to read. You can omit +// this parameter to scan the string until the first \0 byte. If maxBytesToRead is +// passed, and the string at [ptr, ptr+maxBytesToReadr[ contains a null byte in the +// middle, then the string will cut short at that byte index (i.e. maxBytesToRead will +// not produce a string of exact length [ptr, ptr+maxBytesToRead[) +// N.B. mixing frequent uses of UTF8ToString() with and without maxBytesToRead may +// throw JS JIT optimizations off, so it is worth to consider consistently using one +// style or the other. +/** + * @param {number} ptr + * @param {number=} maxBytesToRead + * @return {string} + */ +function UTF8ToString(ptr, maxBytesToRead) { + ; + return ptr ? UTF8ArrayToString(HEAPU8, ptr, maxBytesToRead) : ''; +} + +// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', +// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// heap: the array to copy to. Each index in this array is assumed to be one 8-byte element. +// outIdx: The starting offset in the array to begin the copying. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. +// This count should include the null terminator, +// i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. +// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) { + if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. + return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) { + var u1 = str.charCodeAt(++i); + u = 0x10000 + ((u & 0x3FF) << 10) | (u1 & 0x3FF); + } + if (u <= 0x7F) { + if (outIdx >= endIdx) break; + heap[outIdx++] = u; + } else if (u <= 0x7FF) { + if (outIdx + 1 >= endIdx) break; + heap[outIdx++] = 0xC0 | (u >> 6); + heap[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xFFFF) { + if (outIdx + 2 >= endIdx) break; + heap[outIdx++] = 0xE0 | (u >> 12); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 3 >= endIdx) break; + if (u > 0x10FFFF) warnOnce('Invalid Unicode code point 0x' + u.toString(16) + ' encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF).'); + heap[outIdx++] = 0xF0 | (u >> 18); + heap[outIdx++] = 0x80 | ((u >> 12) & 63); + heap[outIdx++] = 0x80 | ((u >> 6) & 63); + heap[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + heap[outIdx] = 0; + return outIdx - startIdx; +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8(str, outPtr, maxBytesToWrite) { + assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. +function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); + if (u <= 0x7F) ++len; + else if (u <= 0x7FF) len += 2; + else if (u <= 0xFFFF) len += 3; + else len += 4; + } + return len; +} + +// end include: runtime_strings.js +// include: runtime_strings_extra.js + + +// runtime_strings_extra.js: Strings related runtime functions that are available only in regular runtime. + +// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function AsciiToString(ptr) { + var str = ''; + while (1) { + var ch = HEAPU8[((ptr++)>>0)]; + if (!ch) return str; + str += String.fromCharCode(ch); + } +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. + +function stringToAscii(str, outPtr) { + return writeAsciiToMemory(str, outPtr, false); +} + +// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +var UTF16Decoder = typeof TextDecoder != 'undefined' ? new TextDecoder('utf-16le') : undefined; + +function UTF16ToString(ptr, maxBytesToRead) { + assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!'); + var endPtr = ptr; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + var idx = endPtr >> 1; + var maxIdx = idx + maxBytesToRead / 2; + // If maxBytesToRead is not passed explicitly, it will be undefined, and this + // will always evaluate to true. This saves on code size. + while (!(idx >= maxIdx) && HEAPU16[idx]) ++idx; + endPtr = idx << 1; + + if (endPtr - ptr > 32 && UTF16Decoder) { + return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr)); + } else { + var str = ''; + + // If maxBytesToRead is not passed explicitly, it will be undefined, and the for-loop's condition + // will always evaluate to true. The loop is then terminated on the first null char. + for (var i = 0; !(i >= maxBytesToRead / 2); ++i) { + var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; + if (codeUnit == 0) break; + // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. + str += String.fromCharCode(codeUnit); + } + + return str; + } +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. +// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. +// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF16(str, outPtr, maxBytesToWrite) { + assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 2) return 0; + maxBytesToWrite -= 2; // Null terminator. + var startPtr = outPtr; + var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; + for (var i = 0; i < numCharsToWrite; ++i) { + // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + HEAP16[((outPtr)>>1)] = codeUnit; + outPtr += 2; + } + // Null-terminate the pointer to the HEAP. + HEAP16[((outPtr)>>1)] = 0; + return outPtr - startPtr; +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF16(str) { + return str.length*2; +} + +function UTF32ToString(ptr, maxBytesToRead) { + assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!'); + var i = 0; + + var str = ''; + // If maxBytesToRead is not passed explicitly, it will be undefined, and this + // will always evaluate to true. This saves on code size. + while (!(i >= maxBytesToRead / 4)) { + var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; + if (utf32 == 0) break; + ++i; + // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + if (utf32 >= 0x10000) { + var ch = utf32 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } else { + str += String.fromCharCode(utf32); + } + } + return str; +} + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. +// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. +// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF32(str, outPtr, maxBytesToWrite) { + assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 4) return 0; + var startPtr = outPtr; + var endPtr = startPtr + maxBytesToWrite - 4; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { + var trailSurrogate = str.charCodeAt(++i); + codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); + } + HEAP32[((outPtr)>>2)] = codeUnit; + outPtr += 4; + if (outPtr + 4 > endPtr) break; + } + // Null-terminate the pointer to the HEAP. + HEAP32[((outPtr)>>2)] = 0; + return outPtr - startPtr; +} + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF32(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. + len += 4; + } + + return len; +} + +// Allocate heap space for a JS string, and write it there. +// It is the responsibility of the caller to free() that memory. +function allocateUTF8(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = _malloc(size); + if (ret) stringToUTF8Array(str, HEAP8, ret, size); + return ret; +} + +// Allocate stack space for a JS string, and write it there. +function allocateUTF8OnStack(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = stackAlloc(size); + stringToUTF8Array(str, HEAP8, ret, size); + return ret; +} + +// Deprecated: This function should not be called because it is unsafe and does not provide +// a maximum length limit of how many bytes it is allowed to write. Prefer calling the +// function stringToUTF8Array() instead, which takes in a maximum length that can be used +// to be secure from out of bounds writes. +/** @deprecated + @param {boolean=} dontAddNull */ +function writeStringToMemory(string, buffer, dontAddNull) { + warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!'); + + var /** @type {number} */ lastChar, /** @type {number} */ end; + if (dontAddNull) { + // stringToUTF8Array always appends null. If we don't want to do that, remember the + // character that existed at the location where the null will be placed, and restore + // that after the write (below). + end = buffer + lengthBytesUTF8(string); + lastChar = HEAP8[end]; + } + stringToUTF8(string, buffer, Infinity); + if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character. +} + +function writeArrayToMemory(array, buffer) { + assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)') + HEAP8.set(array, buffer); +} + +/** @param {boolean=} dontAddNull */ +function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + assert(str.charCodeAt(i) === (str.charCodeAt(i) & 0xff)); + HEAP8[((buffer++)>>0)] = str.charCodeAt(i); + } + // Null-terminate the pointer to the HEAP. + if (!dontAddNull) HEAP8[((buffer)>>0)] = 0; +} + +// end include: runtime_strings_extra.js +// Memory management + +var HEAP, +/** @type {!ArrayBuffer} */ + buffer, +/** @type {!Int8Array} */ + HEAP8, +/** @type {!Uint8Array} */ + HEAPU8, +/** @type {!Int16Array} */ + HEAP16, +/** @type {!Uint16Array} */ + HEAPU16, +/** @type {!Int32Array} */ + HEAP32, +/** @type {!Uint32Array} */ + HEAPU32, +/** @type {!Float32Array} */ + HEAPF32, +/** @type {!Float64Array} */ + HEAPF64; + +function updateGlobalBufferAndViews(buf) { + buffer = buf; + Module['HEAP8'] = HEAP8 = new Int8Array(buf); + Module['HEAP16'] = HEAP16 = new Int16Array(buf); + Module['HEAP32'] = HEAP32 = new Int32Array(buf); + Module['HEAPU8'] = HEAPU8 = new Uint8Array(buf); + Module['HEAPU16'] = HEAPU16 = new Uint16Array(buf); + Module['HEAPU32'] = HEAPU32 = new Uint32Array(buf); + Module['HEAPF32'] = HEAPF32 = new Float32Array(buf); + Module['HEAPF64'] = HEAPF64 = new Float64Array(buf); +} + +var TOTAL_STACK = 5242880; +if (Module['TOTAL_STACK']) assert(TOTAL_STACK === Module['TOTAL_STACK'], 'the stack size can no longer be determined at runtime') + +var INITIAL_MEMORY = Module['INITIAL_MEMORY'] || 33554432;legacyModuleProp('INITIAL_MEMORY', 'INITIAL_MEMORY'); + +assert(INITIAL_MEMORY >= TOTAL_STACK, 'INITIAL_MEMORY should be larger than TOTAL_STACK, was ' + INITIAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')'); + +// check for full engine support (use string 'subarray' to avoid closure compiler confusion) +assert(typeof Int32Array != 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined, + 'JS engine does not provide full typed array support'); + +// If memory is defined in wasm, the user can't provide it. +assert(!Module['wasmMemory'], 'Use of `wasmMemory` detected. Use -s IMPORTED_MEMORY to define wasmMemory externally'); +assert(INITIAL_MEMORY == 33554432, 'Detected runtime INITIAL_MEMORY setting. Use -s IMPORTED_MEMORY to define wasmMemory dynamically'); + +// include: runtime_init_table.js +// In regular non-RELOCATABLE mode the table is exported +// from the wasm module and this will be assigned once +// the exports are available. +var wasmTable; + +// end include: runtime_init_table.js +// include: runtime_stack_check.js + + +// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode. +function writeStackCookie() { + var max = _emscripten_stack_get_end(); + assert((max & 3) == 0); + // The stack grow downwards towards _emscripten_stack_get_end. + // We write cookies to the final two words in the stack and detect if they are + // ever overwritten. + HEAP32[((max)>>2)] = 0x2135467; + HEAP32[(((max)+(4))>>2)] = 0x89BACDFE; + // Also test the global address 0 for integrity. + HEAP32[0] = 0x63736d65; /* 'emsc' */ +} + +function checkStackCookie() { + if (ABORT) return; + var max = _emscripten_stack_get_end(); + var cookie1 = HEAPU32[((max)>>2)]; + var cookie2 = HEAPU32[(((max)+(4))>>2)]; + if (cookie1 != 0x2135467 || cookie2 != 0x89BACDFE) { + abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x2135467, but received 0x' + cookie2.toString(16) + ' 0x' + cookie1.toString(16)); + } + // Also test the global address 0 for integrity. + if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) abort('Runtime error: The application has corrupted its heap memory area (address zero)!'); +} + +// end include: runtime_stack_check.js +// include: runtime_assertions.js + + +// Endianness check +(function() { + var h16 = new Int16Array(1); + var h8 = new Int8Array(h16.buffer); + h16[0] = 0x6373; + if (h8[0] !== 0x73 || h8[1] !== 0x63) throw 'Runtime error: expected the system to be little-endian! (Run with -s SUPPORT_BIG_ENDIAN=1 to bypass)'; +})(); + +// end include: runtime_assertions.js +var __ATPRERUN__ = []; // functions called before the runtime is initialized +var __ATINIT__ = []; // functions called during startup +var __ATMAIN__ = []; // functions called when main() is to be run +var __ATEXIT__ = []; // functions called during shutdown +var __ATPOSTRUN__ = []; // functions called after the main() is called + +var runtimeInitialized = false; + +function keepRuntimeAlive() { + return noExitRuntime; +} + +function preRun() { + + if (Module['preRun']) { + if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; + while (Module['preRun'].length) { + addOnPreRun(Module['preRun'].shift()); + } + } + + callRuntimeCallbacks(__ATPRERUN__); +} + +function initRuntime() { + checkStackCookie(); + assert(!runtimeInitialized); + runtimeInitialized = true; + + +if (!Module["noFSInit"] && !FS.init.initialized) + FS.init(); +FS.ignorePermissions = false; + +TTY.init(); +SOCKFS.root = FS.mount(SOCKFS, {}, null); +PIPEFS.root = FS.mount(PIPEFS, {}, null); + callRuntimeCallbacks(__ATINIT__); +} + +function preMain() { + checkStackCookie(); + + callRuntimeCallbacks(__ATMAIN__); +} + +function postRun() { + checkStackCookie(); + + if (Module['postRun']) { + if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; + while (Module['postRun'].length) { + addOnPostRun(Module['postRun'].shift()); + } + } + + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} + +function addOnPreMain(cb) { + __ATMAIN__.unshift(cb); +} + +function addOnExit(cb) { +} + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} + +// include: runtime_math.js + + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/imul + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/fround + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/clz32 + +// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Math/trunc + +assert(Math.imul, 'This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.fround, 'This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.clz32, 'This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); +assert(Math.trunc, 'This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill'); + +// end include: runtime_math.js +// A counter of dependencies for calling run(). If we need to +// do asynchronous work before running, increment this and +// decrement it. Incrementing must happen in a place like +// Module.preRun (used by emcc to add file preloading). +// Note that you can add dependencies in preRun, even though +// it happens right before run - run will be postponed until +// the dependencies are met. +var runDependencies = 0; +var runDependencyWatcher = null; +var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled +var runDependencyTracking = {}; + +function getUniqueRunDependency(id) { + var orig = id; + while (1) { + if (!runDependencyTracking[id]) return id; + id = orig + Math.random(); + } +} + +function addRunDependency(id) { + runDependencies++; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(!runDependencyTracking[id]); + runDependencyTracking[id] = 1; + if (runDependencyWatcher === null && typeof setInterval != 'undefined') { + // Check for missing dependencies every few seconds + runDependencyWatcher = setInterval(function() { + if (ABORT) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + return; + } + var shown = false; + for (var dep in runDependencyTracking) { + if (!shown) { + shown = true; + err('still waiting on run dependencies:'); + } + err('dependency: ' + dep); + } + if (shown) { + err('(end of list)'); + } + }, 10000); + } + } else { + err('warning: run dependency added without ID'); + } +} + +function removeRunDependency(id) { + runDependencies--; + + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + + if (id) { + assert(runDependencyTracking[id]); + delete runDependencyTracking[id]; + } else { + err('warning: run dependency removed without ID'); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } +} + +Module["preloadedImages"] = {}; // maps url to image data +Module["preloadedAudios"] = {}; // maps url to audio data + +/** @param {string|number=} what */ +function abort(what) { + { + if (Module['onAbort']) { + Module['onAbort'](what); + } + } + + what = 'Aborted(' + what + ')'; + // TODO(sbc): Should we remove printing and leave it up to whoever + // catches the exception? + err(what); + + ABORT = true; + EXITSTATUS = 1; + + // Use a wasm runtime error, because a JS error might be seen as a foreign + // exception, which means we'd run destructors on it. We need the error to + // simply make the program stop. + + // Suppress closure compiler warning here. Closure compiler's builtin extern + // defintion for WebAssembly.RuntimeError claims it takes no arguments even + // though it can. + // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure gets fixed. + + /** @suppress {checkTypes} */ + var e = new WebAssembly.RuntimeError(what); + + readyPromiseReject(e); + // Throw the error whether or not MODULARIZE is set because abort is used + // in code paths apart from instantiation where an exception is expected + // to be thrown when abort is called. + throw e; +} + +// {{MEM_INITIALIZER}} + +// include: memoryprofiler.js + + +// end include: memoryprofiler.js +// include: URIUtils.js + + +// Prefix of data URIs emitted by SINGLE_FILE and related options. +var dataURIPrefix = 'data:application/octet-stream;base64,'; + +// Indicates whether filename is a base64 data URI. +function isDataURI(filename) { + // Prefix of data URIs emitted by SINGLE_FILE and related options. + return filename.startsWith(dataURIPrefix); +} + +// Indicates whether filename is delivered via file protocol (as opposed to http/https) +function isFileURI(filename) { + return filename.startsWith('file://'); +} + +// end include: URIUtils.js +/** @param {boolean=} fixedasm */ +function createExportWrapper(name, fixedasm) { + return function() { + var displayName = name; + var asm = fixedasm; + if (!fixedasm) { + asm = Module['asm']; + } + assert(runtimeInitialized, 'native function `' + displayName + '` called before runtime initialization'); + if (!asm[name]) { + assert(asm[name], 'exported native function `' + displayName + '` not found'); + } + return asm[name].apply(null, arguments); + }; +} + +var wasmBinaryFile; + wasmBinaryFile = 'build.wasm'; + if (!isDataURI(wasmBinaryFile)) { + wasmBinaryFile = locateFile(wasmBinaryFile); + } + +function getBinary(file) { + try { + if (file == wasmBinaryFile && wasmBinary) { + return new Uint8Array(wasmBinary); + } + if (readBinary) { + return readBinary(file); + } else { + throw "both async and sync fetching of the wasm failed"; + } + } + catch (err) { + abort(err); + } +} + +function getBinaryPromise() { + // If we don't have the binary yet, try to to load it asynchronously. + // Fetch has some additional restrictions over XHR, like it can't be used on a file:// url. + // See https://github.com/github/fetch/pull/92#issuecomment-140665932 + // Cordova or Electron apps are typically loaded from a file:// url. + // So use fetch if it is available and the url is not a file, otherwise fall back to XHR. + if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) { + if (typeof fetch == 'function' + && !isFileURI(wasmBinaryFile) + ) { + return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) { + if (!response['ok']) { + throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; + } + return response['arrayBuffer'](); + }).catch(function () { + return getBinary(wasmBinaryFile); + }); + } + else { + if (readAsync) { + // fetch is not available or url is file => try XHR (readAsync uses XHR internally) + return new Promise(function(resolve, reject) { + readAsync(wasmBinaryFile, function(response) { resolve(new Uint8Array(/** @type{!ArrayBuffer} */(response))) }, reject) + }); + } + } + } + + // Otherwise, getBinary should be able to get it synchronously + return Promise.resolve().then(function() { return getBinary(wasmBinaryFile); }); +} + +// Create the wasm instance. +// Receives the wasm imports, returns the exports. +function createWasm() { + // prepare imports + var info = { + 'env': asmLibraryArg, + 'wasi_snapshot_preview1': asmLibraryArg, + }; + // Load the wasm module and create an instance of using native support in the JS engine. + // handle a generated wasm instance, receiving its exports and + // performing other necessary setup + /** @param {WebAssembly.Module=} module*/ + function receiveInstance(instance, module) { + var exports = instance.exports; + + Module['asm'] = exports; + + wasmMemory = Module['asm']['memory']; + assert(wasmMemory, "memory not found in wasm exports"); + // This assertion doesn't hold when emscripten is run in --post-link + // mode. + // TODO(sbc): Read INITIAL_MEMORY out of the wasm file in post-link mode. + //assert(wasmMemory.buffer.byteLength === 33554432); + updateGlobalBufferAndViews(wasmMemory.buffer); + + wasmTable = Module['asm']['__indirect_function_table']; + assert(wasmTable, "table not found in wasm exports"); + + addOnInit(Module['asm']['__wasm_call_ctors']); + + removeRunDependency('wasm-instantiate'); + + } + // we can't run yet (except in a pthread, where we have a custom sync instantiator) + addRunDependency('wasm-instantiate'); + + // Prefer streaming instantiation if available. + // Async compilation can be confusing when an error on the page overwrites Module + // (for example, if the order of elements is wrong, and the one defining Module is + // later), so we save Module and check it later. + var trueModule = Module; + function receiveInstantiationResult(result) { + // 'result' is a ResultObject object which has both the module and instance. + // receiveInstance() will swap in the exports (to Module.asm) so they can be called + assert(Module === trueModule, 'the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?'); + trueModule = null; + // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, the above line no longer optimizes out down to the following line. + // When the regression is fixed, can restore the above USE_PTHREADS-enabled path. + receiveInstance(result['instance']); + } + + function instantiateArrayBuffer(receiver) { + return getBinaryPromise().then(function(binary) { + return WebAssembly.instantiate(binary, info); + }).then(function (instance) { + return instance; + }).then(receiver, function(reason) { + err('failed to asynchronously prepare wasm: ' + reason); + + // Warn on some common problems. + if (isFileURI(wasmBinaryFile)) { + err('warning: Loading from a file URI (' + wasmBinaryFile + ') is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing'); + } + abort(reason); + }); + } + + function instantiateAsync() { + if (!wasmBinary && + typeof WebAssembly.instantiateStreaming == 'function' && + !isDataURI(wasmBinaryFile) && + // Don't use streaming for file:// delivered objects in a webview, fetch them synchronously. + !isFileURI(wasmBinaryFile) && + typeof fetch == 'function') { + return fetch(wasmBinaryFile, { credentials: 'same-origin' }).then(function(response) { + // Suppress closure warning here since the upstream definition for + // instantiateStreaming only allows Promise rather than + // an actual Response. + // TODO(https://github.com/google/closure-compiler/pull/3913): Remove if/when upstream closure is fixed. + /** @suppress {checkTypes} */ + var result = WebAssembly.instantiateStreaming(response, info); + + return result.then( + receiveInstantiationResult, + function(reason) { + // We expect the most common failure cause to be a bad MIME type for the binary, + // in which case falling back to ArrayBuffer instantiation should work. + err('wasm streaming compile failed: ' + reason); + err('falling back to ArrayBuffer instantiation'); + return instantiateArrayBuffer(receiveInstantiationResult); + }); + }); + } else { + return instantiateArrayBuffer(receiveInstantiationResult); + } + } + + // User shell pages can write their own Module.instantiateWasm = function(imports, successCallback) callback + // to manually instantiate the Wasm module themselves. This allows pages to run the instantiation parallel + // to any other async startup actions they are performing. + // Also pthreads and wasm workers initialize the wasm instance through this path. + if (Module['instantiateWasm']) { + try { + var exports = Module['instantiateWasm'](info, receiveInstance); + return exports; + } catch(e) { + err('Module.instantiateWasm callback failed with error: ' + e); + return false; + } + } + + // If instantiation fails, reject the module ready promise. + instantiateAsync().catch(readyPromiseReject); + return {}; // no exports yet; we'll fill them in later +} + +// Globals used by JS i64 conversions (see makeSetValue) +var tempDouble; +var tempI64; + +// === Body === + +var ASM_CONSTS = { + 8490800: function() {return Module.webglContextAttributes.premultipliedAlpha;}, + 8490861: function() {return Module.webglContextAttributes.preserveDrawingBuffer;}, + 8490925: function() {return Module.webglContextAttributes.powerPreference;}, + 8490983: function() {Module['emscripten_get_now_backup'] = performance.now;}, + 8491038: function($0) {performance.now = function() { return $0; };}, + 8491086: function($0) {performance.now = function() { return $0; };}, + 8491134: function() {performance.now = Module['emscripten_get_now_backup'];} +}; + + + + + + + function callRuntimeCallbacks(callbacks) { + while (callbacks.length > 0) { + var callback = callbacks.shift(); + if (typeof callback == 'function') { + callback(Module); // Pass the module as the first argument. + continue; + } + var func = callback.func; + if (typeof func == 'number') { + if (callback.arg === undefined) { + // Run the wasm function ptr with signature 'v'. If no function + // with such signature was exported, this call does not need + // to be emitted (and would confuse Closure) + (function() { dynCall_v.call(null, func); })(); + } else { + // If any function with signature 'vi' was exported, run + // the callback with that signature. + (function(a1) { dynCall_vi.apply(null, [func, a1]); })(callback.arg); + } + } else { + func(callback.arg === undefined ? null : callback.arg); + } + } + } + + function withStackSave(f) { + var stack = stackSave(); + var ret = f(); + stackRestore(stack); + return ret; + } + function demangle(func) { + // If demangle has failed before, stop demangling any further function names + // This avoids an infinite recursion with malloc()->abort()->stackTrace()->demangle()->malloc()->... + demangle.recursionGuard = (demangle.recursionGuard|0)+1; + if (demangle.recursionGuard > 1) return func; + var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle']; + assert(__cxa_demangle_func); + return withStackSave(function() { + try { + var s = func; + if (s.startsWith('__Z')) + s = s.substr(1); + var len = lengthBytesUTF8(s)+1; + var buf = stackAlloc(len); + stringToUTF8(s, buf, len); + var status = stackAlloc(4); + var ret = __cxa_demangle_func(buf, 0, 0, status); + if (HEAP32[((status)>>2)] === 0 && ret) { + return UTF8ToString(ret); + } + // otherwise, libcxxabi failed + } catch(e) { + } finally { + _free(ret); + if (demangle.recursionGuard < 2) --demangle.recursionGuard; + } + // failure when using libcxxabi, don't demangle + return func; + }); + } + + function demangleAll(text) { + var regex = + /\b_Z[\w\d_]+/g; + return text.replace(regex, + function(x) { + var y = demangle(x); + return x === y ? x : (y + ' [' + x + ']'); + }); + } + + function dynCallLegacy(sig, ptr, args) { + assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); + if (args && args.length) { + // j (64-bit integer) must be passed in as two numbers [low 32, high 32]. + assert(args.length === sig.substring(1).replace(/j/g, '--').length); + } else { + assert(sig.length == 1); + } + var f = Module["dynCall_" + sig]; + return args && args.length ? f.apply(null, [ptr].concat(args)) : f.call(null, ptr); + } + + var wasmTableMirror = []; + function getWasmTableEntry(funcPtr) { + var func = wasmTableMirror[funcPtr]; + if (!func) { + if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1; + wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr); + } + assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!"); + return func; + } + /** @param {Object=} args */ + function dynCall(sig, ptr, args) { + return dynCallLegacy(sig, ptr, args); + } + + + function handleException(e) { + // Certain exception types we do not treat as errors since they are used for + // internal control flow. + // 1. ExitStatus, which is thrown by exit() + // 2. "unwind", which is thrown by emscripten_unwind_to_js_event_loop() and others + // that wish to return to JS event loop. + if (e instanceof ExitStatus || e == 'unwind') { + return EXITSTATUS; + } + quit_(1, e); + } + + function jsStackTrace() { + var error = new Error(); + if (!error.stack) { + // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, + // so try that as a special-case. + try { + throw new Error(); + } catch(e) { + error = e; + } + if (!error.stack) { + return '(no stack trace available)'; + } + } + return error.stack.toString(); + } + + function setWasmTableEntry(idx, func) { + wasmTable.set(idx, func); + wasmTableMirror[idx] = func; + } + + function stackTrace() { + var js = jsStackTrace(); + if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace'](); + return demangleAll(js); + } + + function _CreateObjectUrl(array, size) + { + // Copy the input data (`array`) from the heap to + // a separate array (`copy`). This is necessary + // because any views on the heap (e.g. `slice` below) + // are invalidated when Unity increases the + // the heap size. It is safe to use the data in + // place if it is used immediately (i.e. before + // this function returns). + // + // For background info, see: + // https://emscripten.org/docs/porting/connecting_cpp_and_javascript/Interacting-with-code.html#access-memory-from-javascript + + var slice = new Uint8Array(HEAPU8.buffer, array, size); + var copy = new Uint8Array(slice); + var blob = new Blob([copy], {type: 'application/octet-stream'}); + var url = URL.createObjectURL(blob); + + // Return a C# string to the caller. + // + // For discussion, see: + // https://docs.unity3d.com/Manual/webgl-interactingwithbrowserscripting.html + + var bufferSize = lengthBytesUTF8(url) + 1; + var buffer = _malloc(bufferSize); + stringToUTF8(url, buffer, bufferSize); + + return buffer; + } + + function _DownloadFile(gameObjectNamePtr, methodNamePtr, filenamePtr, byteArray, byteArraySize) { + var gameObjectName = UTF8ToString(gameObjectNamePtr); + var methodName = UTF8ToString(methodNamePtr); + var filename = UTF8ToString(filenamePtr); + var bytes = new Uint8Array(byteArraySize); + for (var i = 0; i < byteArraySize; i++) { + bytes[i] = HEAPU8[byteArray + i]; + } + var downloader = window.document.createElement('a'); + downloader.setAttribute('id', gameObjectName); + downloader.href = window.URL.createObjectURL(new Blob([bytes], { + type: 'application/octet-stream' + })); + downloader.download = filename; + document.body.appendChild(downloader); + document.onmouseup = function() { + downloader.click(); + document.body.removeChild(downloader); + document.onmouseup = null; + SendMessage(gameObjectName, methodName); + }; + } + + function _GetJSMemoryInfo(totalJSptr, usedJSptr) { + if (performance.memory) { + HEAPF64[totalJSptr >> 3] = performance.memory.totalJSHeapSize; + HEAPF64[usedJSptr >> 3] = performance.memory.usedJSHeapSize; + } else { + HEAPF64[totalJSptr >> 3] = NaN; + HEAPF64[usedJSptr >> 3] = NaN; + } + } + + var JS_Accelerometer = null; + + var JS_Accelerometer_callback = 0; + function _JS_Accelerometer_IsRunning() { + // Sensor is running if there is an activated new JS_Accelerometer; or the JS_Accelerometer_callback is hooked up + return (JS_Accelerometer && JS_Accelerometer.activated) || (JS_Accelerometer_callback != 0); + } + + var JS_Accelerometer_multiplier = 1; + + var JS_Accelerometer_lastValue = {x:0,y:0,z:0}; + function JS_Accelerometer_eventHandler() { + // Record the last value for gravity computation + JS_Accelerometer_lastValue = { + x: JS_Accelerometer.x * JS_Accelerometer_multiplier, + y: JS_Accelerometer.y * JS_Accelerometer_multiplier, + z: JS_Accelerometer.z * JS_Accelerometer_multiplier + }; + if (JS_Accelerometer_callback != 0) + dynCall_vfff(JS_Accelerometer_callback, JS_Accelerometer_lastValue.x, JS_Accelerometer_lastValue.y, JS_Accelerometer_lastValue.z); + } + + var JS_Accelerometer_frequencyRequest = 0; + + var JS_Accelerometer_frequency = 0; + + var JS_LinearAccelerationSensor_callback = 0; + + var JS_GravitySensor_callback = 0; + + var JS_Gyroscope_callback = 0; + + function JS_ComputeGravity(accelerometerValue, linearAccelerationValue) { + // On some Android devices, the linear acceleration direction is reversed compared to its accelerometer + // So, compute both the difference and sum (difference of the negative) and return the one that's the smallest in magnitude + var difference = { + x: accelerometerValue.x - linearAccelerationValue.x, + y: accelerometerValue.y - linearAccelerationValue.y, + z: accelerometerValue.z - linearAccelerationValue.z + }; + var differenceMagnitudeSq = difference.x*difference.x + difference.y*difference.y + difference.z*difference.z; + + var sum = { + x: accelerometerValue.x + linearAccelerationValue.x, + y: accelerometerValue.y + linearAccelerationValue.y, + z: accelerometerValue.z + linearAccelerationValue.z + }; + var sumMagnitudeSq = sum.x*sum.x + sum.y*sum.y + sum.z*sum.z; + + return (differenceMagnitudeSq <= sumMagnitudeSq) ? difference : sum; + } + function JS_DeviceMotion_eventHandler(event) { + // The accelerationIncludingGravity property is the amount of acceleration recorded by the device, in meters per second squared (m/s2). + // Its value is the sum of the acceleration of the device as induced by the user and the acceleration caused by gravity. + // Apply the JS_Accelerometer_multiplier to convert to g + var accelerometerValue = { + x: event.accelerationIncludingGravity.x * JS_Accelerometer_multiplier, + y: event.accelerationIncludingGravity.y * JS_Accelerometer_multiplier, + z: event.accelerationIncludingGravity.z * JS_Accelerometer_multiplier + }; + if (JS_Accelerometer_callback != 0) + dynCall_vfff(JS_Accelerometer_callback, accelerometerValue.x, accelerometerValue.y, accelerometerValue.z); + + // The acceleration property is the amount of acceleration recorded by the device, in meters per second squared (m/s2), compensated for gravity. + // Apply the JS_Accelerometer_multiplier to convert to g + var linearAccelerationValue = { + x: event.acceleration.x * JS_Accelerometer_multiplier, + y: event.acceleration.y * JS_Accelerometer_multiplier, + z: event.acceleration.z * JS_Accelerometer_multiplier + }; + if (JS_LinearAccelerationSensor_callback != 0) + dynCall_vfff(JS_LinearAccelerationSensor_callback, linearAccelerationValue.x, linearAccelerationValue.y, linearAccelerationValue.z); + + // Compute and raise the gravity sensor vector + if (JS_GravitySensor_callback != 0) { + assert(typeof GravitySensor === 'undefined'); + var gravityValue = JS_ComputeGravity(accelerometerValue, linearAccelerationValue); + dynCall_vfff(JS_GravitySensor_callback, gravityValue.x, gravityValue.y, gravityValue.z); + } + + // The rotationRate property describes the rotation rates of the device around each of its axes (deg/s), but we want in radians/s so must scale + // Note that the spec here has been updated so x,y,z axes are alpha,beta,gamma. + // Therefore the order of axes at https://developer.mozilla.org/en-US/docs/Web/API/DeviceMotionEvent/rotationRate is incorrect + // + // There is a bug in Chrome < M66 where rotationRate values are not in deg/s https://bugs.chromium.org/p/chromium/issues/detail?id=541607 + // But that version is too old to include a check here + if (JS_Gyroscope_callback != 0) { + var degToRad = Math.PI / 180; + dynCall_vfff(JS_Gyroscope_callback, event.rotationRate.alpha * degToRad, event.rotationRate.beta * degToRad, event.rotationRate.gamma * degToRad); + } + } + + var JS_DeviceSensorPermissions = 0; + function JS_RequestDeviceSensorPermissions(permissions) { + // iOS requires that we request permissions before using device sensor events + if (permissions & 1/*DeviceOrientationEvent permission*/) { + if (typeof DeviceOrientationEvent.requestPermission === 'function') { + DeviceOrientationEvent.requestPermission() + .then(function(permissionState) { + if (permissionState === 'granted') { + JS_DeviceSensorPermissions &= ~1; // Remove DeviceOrientationEvent permission bit + } else { + warnOnce("DeviceOrientationEvent permission not granted"); + } + }) + .catch(function(err) { + // Permissions cannot be requested unless on a user interaction (a touch event) + // So in this case set JS_DeviceSensorPermissions and we will try again on a touch event + warnOnce(err); + JS_DeviceSensorPermissions |= 1/*DeviceOrientationEvent permission*/; + }); + } + } + if (permissions & 2/*DeviceMotionEvent permission*/) { + if (typeof DeviceMotionEvent.requestPermission === 'function') { + DeviceMotionEvent.requestPermission() + .then(function(permissionState) { + if (permissionState === 'granted') { + JS_DeviceSensorPermissions &= ~2; // Remove DeviceMotionEvent permission bit + } else { + warnOnce("DeviceMotionEvent permission not granted"); + } + }) + .catch(function(err) { + // Permissions cannot be requested unless on a user interaction (a touch event) + // So in this case set JS_DeviceSensorPermissions and we will try again on a touch event + warnOnce(err); + JS_DeviceSensorPermissions |= 2/*DeviceMotionEvent permission*/; + }); + } + } + } + function JS_DeviceMotion_add() { + // Only add the event listener if we don't yet have any of the motion callbacks set + if (JS_Accelerometer_callback == 0 && + JS_LinearAccelerationSensor_callback == 0 && + JS_GravitySensor_callback == 0 && + JS_Gyroscope_callback == 0) { + JS_RequestDeviceSensorPermissions(2/*DeviceMotionEvent permission*/); + window.addEventListener('devicemotion', JS_DeviceMotion_eventHandler); + } + } + + function JS_DefineAccelerometerMultiplier() { + // Earth's gravity in m/s^2, same as ASENSOR_STANDARD_GRAVITY + var g = 9.80665; + + // Multiplier is 1/g to normalize acceleration + // iOS has its direction opposite to Android and Windows (tested Surface Pro tablet) + // We include Macintosh in the test to capture Safari on iOS viewing in Desktop mode (the default now on iPads) + JS_Accelerometer_multiplier = (/(iPhone|iPad|Macintosh)/i.test(navigator.userAgent)) ? 1/g : -1/g; + } + function _JS_Accelerometer_Start(callback, frequency) { + // callback can be zero here when called via JS_GravitySensor_Start + + JS_DefineAccelerometerMultiplier(); + + // If we don't have new sensor API, fallback to old DeviceMotionEvent + if (typeof Accelerometer === 'undefined') { + JS_DeviceMotion_add(); // Must call before we set the callback + if (callback != 0) JS_Accelerometer_callback = callback; + return; + } + + if (callback != 0) JS_Accelerometer_callback = callback; + + function InitializeAccelerometer(frequency) { + // Use device referenceFrame, since New Input System package does its own compensation + JS_Accelerometer = new Accelerometer({ frequency: frequency, referenceFrame: 'device' }); + JS_Accelerometer.addEventListener('reading', JS_Accelerometer_eventHandler); + JS_Accelerometer.addEventListener('error', function(e) { + // e.error could be DOMException: Could not connect to a sensor + warnOnce((e.error) ? e.error : e); + }); + JS_Accelerometer.start(); + JS_Accelerometer_frequency = frequency; + } + + // If the sensor is already created, stop and re-create it with new frequency + if (JS_Accelerometer) { + if (JS_Accelerometer_frequency != frequency) { + JS_Accelerometer.stop(); + JS_Accelerometer.removeEventListener('reading', JS_Accelerometer_eventHandler); + InitializeAccelerometer(frequency); + } + } + else if (JS_Accelerometer_frequencyRequest != 0) { + // If the permissions promise is currently in progress, then note new frequency only + JS_Accelerometer_frequencyRequest = frequency; + } + else { + JS_Accelerometer_frequencyRequest = frequency; + + // Request required permission for the Accelerometer + navigator.permissions.query({name: 'accelerometer'}) + .then(function(result) { + if (result.state === "granted") { + InitializeAccelerometer(JS_Accelerometer_frequencyRequest); + } else { + warnOnce("No permission to use Accelerometer."); + } + JS_Accelerometer_frequencyRequest = 0; + }); + } + } + + function JS_DeviceMotion_remove() { + // If we've removed the last callback, remove the devicemotion event listener + if (JS_Accelerometer_callback == 0 && + JS_LinearAccelerationSensor_callback == 0 && + JS_GravitySensor_callback == 0 && + JS_Gyroscope_callback == 0 ) { + window.removeEventListener('devicemotion', JS_DeviceOrientation_eventHandler); + } + } + function _JS_Accelerometer_Stop() { + if (JS_Accelerometer) { + // Only actually stop the accelerometer if we don't need it to compute gravity values + if (typeof GravitySensor !== 'undefined' || JS_GravitySensor_callback == 0) { + JS_Accelerometer.stop(); + JS_Accelerometer.removeEventListener('reading', JS_Accelerometer_eventHandler); + JS_Accelerometer = null; + } + JS_Accelerometer_callback = 0; + JS_Accelerometer_frequency = 0; + } + else if (JS_Accelerometer_callback != 0) { + JS_Accelerometer_callback = 0; + JS_DeviceMotion_remove(); + } + } + + var ExceptionsSeen = 0; + function _JS_CallAsLongAsNoExceptionsSeen(cb) { + if (!ExceptionsSeen) { + try { + (function() { dynCall_v.call(null, cb); })(); + } catch(e) { + ExceptionsSeen = 1; + console.error('Uncaught exception from main loop:'); + console.error(e); + console.error('Halting program.'); + if (Module.errorHandler) Module.errorHandler(e); + throw e; + } + } + } + + function _JS_Cursor_SetImage(ptr, length) { + var binary = ""; + for (var i = 0; i < length; i++) + binary += String.fromCharCode(HEAPU8[ptr + i]); + Module.canvas.style.cursor = "url(data:image/cur;base64," + btoa(binary) + "),default"; + } + + function _JS_Cursor_SetShow(show) { + Module.canvas.style.cursor = show ? "default" : "none"; + } + + function jsDomCssEscapeId(id) { + // Use CSS Object Model to escape ID if feature is present + if (typeof window.CSS !== "undefined" && typeof window.CSS.escape !== "undefined") { + return window.CSS.escape(id); + } + + // Fallback: Escape special characters with RegExp. This handles most cases but not all! + return id.replace(/(#|\.|\+|\[|\]|\(|\)|\{|\})/g, "\\$1"); + } + function jsCanvasSelector() { + // This lookup specifies the target canvas that different DOM + // events are registered to, like keyboard and mouse events. + // This requires that Module['canvas'] must have a CSS ID associated + // with it, it cannot be empty. Override Module['canvas'] to specify + // some other target to use, e.g. if the page contains multiple Unity + // game instances. + if (Module['canvas'] && !Module['canvas'].id) throw 'Module["canvas"] must have a CSS ID associated with it!'; + var canvasId = Module['canvas'] ? Module['canvas'].id : 'unity-canvas'; + return '#' + jsDomCssEscapeId(canvasId); + } + function _JS_DOM_MapViewportCoordinateToElementLocalCoordinate(viewportX, viewportY, targetX, targetY) { + var canvas = document.querySelector(jsCanvasSelector()); + var rect = canvas && canvas.getBoundingClientRect(); + HEAPU32[targetX >> 2] = viewportX - (rect ? rect.left : 0); + HEAPU32[targetY >> 2] = viewportY - (rect ? rect.top : 0); + } + + function stringToNewUTF8(jsString) { + var length = lengthBytesUTF8(jsString)+1; + var cString = _malloc(length); + stringToUTF8(jsString, cString, length); + return cString; + } + function _JS_DOM_UnityCanvasSelector() { + var canvasSelector = jsCanvasSelector(); + if (_JS_DOM_UnityCanvasSelector.selector != canvasSelector) { + _free(_JS_DOM_UnityCanvasSelector.ptr); + _JS_DOM_UnityCanvasSelector.ptr = stringToNewUTF8(canvasSelector); + _JS_DOM_UnityCanvasSelector.selector = canvasSelector; + } + return _JS_DOM_UnityCanvasSelector.ptr; + } + + function _JS_Eval_OpenURL(ptr) + { + var str = UTF8ToString(ptr); + window.open(str, '_blank', ''); + } + + var fs = {numPendingSync:0,syncInternal:1000,syncInProgress:false,sync:function(onlyPendingSync) + { + if (onlyPendingSync) { + if (fs.numPendingSync == 0) + return; + } + else if (fs.syncInProgress) { + // this is to avoid indexedDB memory leak when FS.syncfs is executed before the previous one completed. + fs.numPendingSync++; + return; + } + + fs.syncInProgress = true; + FS.syncfs(false, (function(err) { + fs.syncInProgress = false; + })); + fs.numPendingSync = 0; + }}; + function _JS_FileSystem_Initialize() + { + Module.setInterval(function(){ + fs.sync(true); + }, fs.syncInternal); + } + + function _JS_FileSystem_Sync() + { + fs.sync(false); + } + + var JS_GravitySensor = null; + function _JS_GravitySensor_IsRunning() { + return (typeof GravitySensor !== 'undefined') ? (JS_GravitySensor && JS_GravitySensor.activated) : JS_GravitySensor_callback != 0; + } + + function JS_GravitySensor_eventHandler() { + if (JS_GravitySensor_callback != 0) + dynCall_vfff(JS_GravitySensor_callback, + JS_GravitySensor.x * JS_Accelerometer_multiplier, + JS_GravitySensor.y * JS_Accelerometer_multiplier, + JS_GravitySensor.z * JS_Accelerometer_multiplier); + } + + var JS_GravitySensor_frequencyRequest = 0; + + var JS_LinearAccelerationSensor = null; + + function JS_LinearAccelerationSensor_eventHandler() { + var linearAccelerationValue = { + x: JS_LinearAccelerationSensor.x * JS_Accelerometer_multiplier, + y: JS_LinearAccelerationSensor.y * JS_Accelerometer_multiplier, + z: JS_LinearAccelerationSensor.z * JS_Accelerometer_multiplier + }; + if (JS_LinearAccelerationSensor_callback != 0) + dynCall_vfff(JS_LinearAccelerationSensor_callback, linearAccelerationValue.x, linearAccelerationValue.y, linearAccelerationValue.z); + + // Calculate and call the Gravity callback if the Gravity Sensor API isn't present + if (JS_GravitySensor_callback != 0 && typeof GravitySensor === 'undefined') { + var gravityValue = JS_ComputeGravity(JS_Accelerometer_lastValue, linearAccelerationValue); + dynCall_vfff(JS_GravitySensor_callback, gravityValue.x, gravityValue.y, gravityValue.z); + } + } + + var JS_LinearAccelerationSensor_frequencyRequest = 0; + + var JS_LinearAccelerationSensor_frequency = 0; + function _JS_LinearAccelerationSensor_Start(callback, frequency) { + // callback can be zero here when called via JS_GravitySensor_Start + + JS_DefineAccelerometerMultiplier(); + + // If we don't have new sensor API, fallback to old DeviceMotionEvent + if (typeof LinearAccelerationSensor === 'undefined') { + JS_DeviceMotion_add(); // Must call before we set the callback + if (callback != 0) JS_LinearAccelerationSensor_callback = callback; + return; + } + + if (callback != 0) JS_LinearAccelerationSensor_callback = callback; + + function InitializeLinearAccelerationSensor(frequency) { + // Use device referenceFrame, since New Input System package does its own compensation + JS_LinearAccelerationSensor = new LinearAccelerationSensor({ frequency: frequency, referenceFrame: 'device' }); + JS_LinearAccelerationSensor.addEventListener('reading', JS_LinearAccelerationSensor_eventHandler); + JS_LinearAccelerationSensor.addEventListener('error', function(e) { + // e.error could be DOMException: Could not connect to a sensor + warnOnce((e.error) ? e.error : e); + }); + JS_LinearAccelerationSensor.start(); + JS_LinearAccelerationSensor_frequency = frequency; + } + + // If the sensor is already created, stop and re-create it with new frequency + if (JS_LinearAccelerationSensor) { + if (JS_LinearAccelerationSensor_frequency != frequency) { + JS_LinearAccelerationSensor.stop(); + JS_LinearAccelerationSensor.removeEventListener('reading', JS_LinearAccelerationSensor_eventHandler); + InitializeLinearAccelerationSensor(frequency); + } + } + else if (JS_LinearAccelerationSensor_frequencyRequest != 0) { + // If the permissions promise is currently in progress, then note new frequency only + JS_LinearAccelerationSensor_frequencyRequest = frequency; + } + else { + JS_LinearAccelerationSensor_frequencyRequest = frequency; + + // Request required permission for the LinearAccelerationSensor + navigator.permissions.query({name: 'accelerometer'}) + .then(function(result) { + if (result.state === "granted") { + InitializeLinearAccelerationSensor(JS_LinearAccelerationSensor_frequencyRequest); + } else { + warnOnce("No permission to use LinearAccelerationSensor."); + } + JS_LinearAccelerationSensor_frequencyRequest = 0; + }); + } + } + function _JS_GravitySensor_Start(callback, frequency) { + assert(callback != 0, 'Invalid callback passed to JS_GravitySensor_Start'); + + // If we don't have explicit new Gravity Sensor API, start the Accelerometer and LinearAccelerationSensor + // and we will compute the gravity value from those readings + if (typeof GravitySensor === 'undefined') { + // Start both Accelerometer and LinearAccelerationSensor + _JS_Accelerometer_Start(0, Math.max(frequency, JS_Accelerometer_frequency)); + _JS_LinearAccelerationSensor_Start(0, Math.max(frequency, JS_LinearAccelerationSensor_frequency)); + + // Add the gravity sensor callback (must be after Accelerometer and LinearAccelerationSensor start) + JS_GravitySensor_callback = callback; + return; + } + + JS_DefineAccelerometerMultiplier(); + + JS_GravitySensor_callback = callback; + + function InitializeGravitySensor(frequency) { + // Use device referenceFrame, since New Input System package does its own compensation + JS_GravitySensor = new GravitySensor({ frequency: frequency, referenceFrame: 'device' }); + JS_GravitySensor.addEventListener('reading', JS_GravitySensor_eventHandler); + JS_GravitySensor.addEventListener('error', function(e) { + // e.error could be DOMException: Could not connect to a sensor + warnOnce((e.error) ? e.error : e); + }); + JS_GravitySensor.start(); + } + + // If the sensor is already created, stop and re-create it with new frequency + if (JS_GravitySensor) { + JS_GravitySensor.stop(); + JS_GravitySensor.removeEventListener('reading', JS_GravitySensor_eventHandler); + InitializeGravitySensor(frequency); + } + else if (JS_GravitySensor_frequencyRequest != 0) { + // If the permissions promise is currently in progress, then note new frequency only + JS_GravitySensor_frequencyRequest = frequency; + } + else { + JS_GravitySensor_frequencyRequest = frequency; + + // Request required permission for the GravitySensor + navigator.permissions.query({name: 'accelerometer'}) + .then(function(result) { + if (result.state === "granted") { + InitializeGravitySensor(JS_GravitySensor_frequencyRequest); + } else { + warnOnce("No permission to use GravitySensor."); + } + JS_GravitySensor_frequencyRequest = 0; + }); + } + } + + function _JS_LinearAccelerationSensor_Stop() { + if (JS_LinearAccelerationSensor) { + // Only actually stop the Linear Acceleration Sensor if we don't need it to compute gravity values + if (typeof GravitySensor !== 'undefined' || JS_GravitySensor_callback == 0) { + JS_LinearAccelerationSensor.stop(); + JS_LinearAccelerationSensor.removeEventListener('reading', JS_LinearAccelerationSensor_eventHandler); + JS_LinearAccelerationSensor = null; + } + JS_LinearAccelerationSensor_callback = 0; + JS_LinearAccelerationSensor_frequency = 0; + } + else if (JS_LinearAccelerationSensor_callback != 0) { + JS_LinearAccelerationSensor_callback = 0; + JS_DeviceMotion_remove(); + } + } + function _JS_GravitySensor_Stop() { + JS_GravitySensor_callback = 0; + + // If we don't have Gravity Sensor API, stop the Accelerometer and LinearAccelerationSensor + if (typeof GravitySensor === 'undefined') { + // Stop the source sensors if they're not used explicitly by Unity + if (JS_Accelerometer_callback == 0) _JS_Accelerometer_Stop(); + if (JS_LinearAccelerationSensor_callback == 0) _JS_LinearAccelerationSensor_Stop(); + return; + } + + if (JS_GravitySensor) { + JS_GravitySensor.stop(); + JS_GravitySensor.removeEventListener('reading', JS_GravitySensor_eventHandler); + JS_GravitySensor = null; + } + } + + function _JS_GuardAgainstJsExceptions(cb) { + try { + (function() { dynCall_v.call(null, cb); })(); + } catch(e) { + console.warn(e); + } + } + + var JS_Gyroscope = null; + function _JS_Gyroscope_IsRunning() { + // Sensor is running if there is an activated new JS_Gyroscope; or the JS_Gyroscope_callback is hooked up + return (JS_Gyroscope && JS_Gyroscope.activated) || (JS_Gyroscope_callback != 0); + } + + function JS_Gyroscope_eventHandler() { + // Radians per second + if (JS_Gyroscope_callback != 0) + dynCall_vfff(JS_Gyroscope_callback, JS_Gyroscope.x, JS_Gyroscope.y, JS_Gyroscope.z); + } + + var JS_Gyroscope_frequencyRequest = 0; + function _JS_Gyroscope_Start(callback, frequency) { + assert(callback != 0, 'Invalid callback passed to JS_Gyroscope_Start'); + + // If we don't have new sensor API, fallback to old DeviceMotionEvent + if (typeof Gyroscope === 'undefined') { + JS_DeviceMotion_add(); // Must call before we set the callback + JS_Gyroscope_callback = callback; + return; + } + + JS_Gyroscope_callback = callback; + + function InitializeGyroscope(frequency) { + // Use device referenceFrame, since New Input System package does its own compensation + JS_Gyroscope = new Gyroscope({ frequency: frequency, referenceFrame: 'device' }); + JS_Gyroscope.addEventListener('reading', JS_Gyroscope_eventHandler); + JS_Gyroscope.addEventListener('error', function(e) { + // e.error could be DOMException: Could not connect to a sensor + warnOnce((e.error) ? e.error : e); + }); + JS_Gyroscope.start(); + } + + // If the sensor is already created, stop and re-create it with new frequency + if (JS_Gyroscope) { + JS_Gyroscope.stop(); + JS_Gyroscope.removeEventListener('reading', JS_Gyroscope_eventHandler); + InitializeGyroscope(frequency); + } + else if (JS_Gyroscope_frequencyRequest != 0) { + // If the permissions promise is currently in progress, then note new frequency only + JS_Gyroscope_frequencyRequest = frequency; + } + else { + JS_Gyroscope_frequencyRequest = frequency; + + // Request required permission for the Gyroscope + navigator.permissions.query({name: 'gyroscope'}) + .then(function(result) { + if (result.state === "granted") { + InitializeGyroscope(JS_Gyroscope_frequencyRequest); + } else { + warnOnce("No permission to use Gyroscope."); + } + JS_Gyroscope_frequencyRequest = 0; + }); + } + } + + function _JS_Gyroscope_Stop() { + if (JS_Gyroscope) { + JS_Gyroscope.stop(); + JS_Gyroscope.removeEventListener('reading', JS_Gyroscope_eventHandler); + JS_Gyroscope = null; + JS_Gyroscope_callback = 0; + } + else if (JS_Gyroscope_callback != 0) { + JS_Gyroscope_callback = 0; + JS_DeviceMotion_remove(); + } + } + + function _JS_Init_ContextMenuHandler() { + const _handleContextMenu = function (event){ + if(event.target.localName !== "canvas") + _ReleaseKeys(); + } + + document.addEventListener("contextmenu", _handleContextMenu); + + Module.deinitializers.push(function() { + document.removeEventListener("contextmenu", _handleContextMenu); + }); + } + + function _JS_LinearAccelerationSensor_IsRunning() { + // Sensor is running if there is an activated new JS_LinearAccelerationSensor; or the JS_LinearAccelerationSensor_callback is hooked up + return (JS_LinearAccelerationSensor && JS_LinearAccelerationSensor.activated) || (JS_LinearAccelerationSensor_callback != 0); + } + + + + function _JS_Log_Dump(ptr, type) + { + var str = UTF8ToString(ptr); + if (typeof dump == 'function') + dump (str); + switch (type) + { + case 0: //LogType_Error + case 1: //LogType_Assert + case 4: //LogType_Exception + console.error (str); + return; + + case 2: //LogType_Warning + console.warn (str); + return; + + case 3: //LogType_Log + case 5: //LogType_Debug + console.log (str); + return; + + default: + console.error ("Unknown console message type!") + console.error (str); + } + } + + function _JS_Log_StackTrace(buffer, bufferSize) + { + var trace = stackTrace(); + if (buffer) + stringToUTF8(trace, buffer, bufferSize); + return lengthBytesUTF8(trace); + } + + var mobile_input_hide_delay = null; + var mobile_input_text = null; + var mobile_input = null; + var mobile_input_ignore_blur_event = false; + function _JS_MobileKeybard_GetIgnoreBlurEvent() { + // On some platforms, such as iOS15, a blur event is sent to the window after the keyboard + // is closed. This causes the game to be paused in the blur event handler in ScreenManagerWebGL. + // It checks this return value to see if it should ignore the blur event. + return mobile_input_ignore_blur_event; + } + + function _JS_MobileKeyboard_GetKeyboardStatus() + { + var kKeyboardStatusVisible = 0; + var kKeyboardStatusDone = 1; + //var kKeyboardStatusCanceled = 2; + //var kKeyboardStatusLostFocus = 3; + if (!mobile_input) return kKeyboardStatusDone; + return kKeyboardStatusVisible; + } + + function _JS_MobileKeyboard_GetText(buffer, bufferSize) + { + // If the keyboard was closed, use the cached version of the input's text so that Unity can + // still ask for it. + var text = mobile_input && mobile_input.input ? mobile_input.input.value : + mobile_input_text ? mobile_input_text : + ""; + if (buffer) stringToUTF8(text, buffer, bufferSize); + return lengthBytesUTF8(text); + } + + function _JS_MobileKeyboard_GetTextSelection(outStart, outLength) + { + if (!mobile_input) { + HEAP32[outStart >> 2] = 0; + HEAP32[outLength >> 2] = 0; + return; + } + HEAP32[outStart >> 2] = mobile_input.input.selectionStart; + HEAP32[outLength >> 2] = mobile_input.input.selectionEnd - mobile_input.input.selectionStart; + } + + function _JS_MobileKeyboard_Hide(delay) + { + if (mobile_input_hide_delay) return; + mobile_input_ignore_blur_event = true; + + function hideMobileKeyboard() { + if (mobile_input && mobile_input.input) { + mobile_input_text = mobile_input.input.value; + mobile_input.input = null; + if (mobile_input.parentNode && mobile_input.parentNode) { + mobile_input.parentNode.removeChild(mobile_input); + } + } + mobile_input = null; + mobile_input_hide_delay = null; + + // mobile_input_ignore_blur_event was set to true so that ScreenManagerWebGL will ignore + // the blur event it might get from the closing of the keyboard. But it might not get that + // blur event, too, depending on the browser. So we want to clear the flag, as soon as we + // can, but some time after the blur event has been potentially fired. + setTimeout(function() { + mobile_input_ignore_blur_event = false; + }, 100); + } + + if (delay) { + // Delaying the hide of the input/keyboard allows a new input to be selected and re-use the + // existing control. This fixes a problem where a quick tap select of a new element would + // cause it to not be displayed because it tried to be focused before the old keyboard finished + // sliding away. + var hideDelay = 200; + mobile_input_hide_delay = setTimeout(hideMobileKeyboard, hideDelay); + } else { + hideMobileKeyboard(); + } + } + + function _JS_MobileKeyboard_SetCharacterLimit(limit) + { + if (!mobile_input) return; + mobile_input.input.maxLength = limit; + } + + function _JS_MobileKeyboard_SetText(text) + { + if (!mobile_input) return; + text = UTF8ToString(text); + mobile_input.input.value = text; + } + + function _JS_MobileKeyboard_SetTextSelection(start, length) + { + if (!mobile_input) return; + if(mobile_input.input.type === "number"){ // The type of input field has to be changed to use setSelectionRange + mobile_input.input.type = "text"; + mobile_input.input.setSelectionRange(start, start + length); + mobile_input.input.type = "number"; + } else { + mobile_input.input.setSelectionRange(start, start + length); + } + } + + function _JS_MobileKeyboard_Show(text, keyboardType, autocorrection, multiline, secure, alert, + placeholder, characterLimit) + { + if (mobile_input_hide_delay) { + clearTimeout(mobile_input_hide_delay); + mobile_input_hide_delay = null; + } + + text = UTF8ToString(text); + mobile_input_text = text; + + placeholder = UTF8ToString(placeholder); + + var container = document.body; + + var hasExistingMobileInput = !!mobile_input; + + // From KeyboardOnScreen::KeyboardTypes + var input_type; + var KEYBOARD_TYPE_NUMBERS_AND_PUNCTUATION = 2; + var KEYBOARD_TYPE_URL = 3; + var KEYBOARD_TYPE_NUMBER_PAD = 4; + var KEYBOARD_TYPE_PHONE_PAD = 5; + var KEYBOARD_TYPE_EMAIL_ADDRESS = 7; + if (!secure) { + switch (keyboardType) { + case KEYBOARD_TYPE_EMAIL_ADDRESS: + input_type = "email"; + break; + case KEYBOARD_TYPE_URL: + input_type = "url"; + break; + case KEYBOARD_TYPE_NUMBERS_AND_PUNCTUATION: + case KEYBOARD_TYPE_NUMBER_PAD: + case KEYBOARD_TYPE_PHONE_PAD: + input_type = "number"; + break; + default: + input_type = "text"; + break; + } + } else { + input_type = "password"; + } + + if (hasExistingMobileInput) { + if (mobile_input.multiline != multiline) { + _JS_MobileKeyboard_Hide(false); + return; + } + } + + var inputContainer = mobile_input || document.createElement("div"); + if (!hasExistingMobileInput) { + inputContainer.style = "width:100%; position:fixed; bottom:0px; margin:0px; padding:0px; left:0px; border: 1px solid #000; border-radius: 5px; background-color:#fff; font-size:14pt;"; + container.appendChild(inputContainer); + mobile_input = inputContainer; + } + + var input = hasExistingMobileInput ? + mobile_input.input : + document.createElement(multiline ? "textarea" : "input"); + + mobile_input.multiline = multiline; + mobile_input.secure = secure; + mobile_input.keyboardType = keyboardType; + mobile_input.inputType = input_type; + + input.type = input_type; + input.style = "width:calc(100% - 85px); " + (multiline ? "height:100px;" : "") + "vertical-align:top; border-radius: 5px; outline:none; cursor:default; resize:none; border:0px; padding:10px 0px 10px 10px;"; + + input.spellcheck = autocorrection ? true : false; + input.maxLength = characterLimit > 0 ? characterLimit : 524288; + input.value = text; + input.placeholder = placeholder; + + if (!hasExistingMobileInput) { + inputContainer.appendChild(input); + inputContainer.input = input; + } + + if (!hasExistingMobileInput) { + var okButton = document.createElement("button"); + okButton.innerText = "OK"; + okButton.style = "border:0; position:absolute; left:calc(100% - 75px); top:0px; width:75px; height:100%; margin:0; padding:0; border-radius: 5px; background-color:#fff"; + okButton.addEventListener("touchend", function() { + _JS_MobileKeyboard_Hide(true); + }); + + inputContainer.appendChild(okButton); + inputContainer.okButton = okButton; + + // For single-line text input, enter key will close the keyboard. + input.addEventListener('keyup', function(e) { + if (input.parentNode.multiline) return; + if (e.code == 'Enter' || e.which == 13 || e.keyCode == 13) { + _JS_MobileKeyboard_Hide(true); + } + }); + + // On iOS, the keyboard has a done button that hides the keyboard. The only way to detect + // when this happens seems to be when the HTML input looses focus, so we watch for the blur + // event on the input element and close the element/keybaord when it's gotten. + input.addEventListener("blur", function(e) { + _JS_MobileKeyboard_Hide(true); + e.stopPropagation(); + e.preventDefault(); + }); + + input.select(); + input.focus(); + } else { + input.select(); + } + } + + var JS_OrientationSensor = null; + + var JS_OrientationSensor_callback = 0; + function _JS_OrientationSensor_IsRunning() { + // Sensor is running if there is an activated new JS_OrientationSensor; or the DeviceOrientation handler is hooked up + return (JS_OrientationSensor && JS_OrientationSensor.activated) || (JS_OrientationSensor_callback != 0); + } + + function JS_OrientationSensor_eventHandler() { + if (JS_OrientationSensor_callback != 0) + dynCall_vffff(JS_OrientationSensor_callback, JS_OrientationSensor.quaternion[0], JS_OrientationSensor.quaternion[1], JS_OrientationSensor.quaternion[2], JS_OrientationSensor.quaternion[3]); + } + + var JS_OrientationSensor_frequencyRequest = 0; + + function JS_DeviceOrientation_eventHandler(event) { + if (JS_OrientationSensor_callback) { + // OBSERVATION: On Android Firefox, absolute = false, webkitCompassHeading = null + // OBSERVATION: On iOS Safari, absolute is undefined, webkitCompassHeading and webkitCompassAccuracy are set + + // Convert alpha, beta, gamma Euler angles to a quaternion + var degToRad = Math.PI / 180; + var x = event.beta * degToRad; + var y = event.gamma * degToRad; + var z = event.alpha * degToRad; + + var cx = Math.cos(x/2); + var sx = Math.sin(x/2); + var cy = Math.cos(y/2); + var sy = Math.sin(y/2); + var cz = Math.cos(z/2); + var sz = Math.sin(z/2); + + var qx = sx * cy * cz - cx * sy * sz; + var qy = cx * sy * cz + sx * cy * sz; + var qz = cx * cy * sz + sx * sy * cz; + var qw = cx * cy * cz - sx * sy * sz; + + dynCall_vffff(JS_OrientationSensor_callback, qx, qy, qz, qw); + } + } + function _JS_OrientationSensor_Start(callback, frequency) { + assert(callback != 0, 'Invalid callback passed to JS_OrientationSensor_Start'); + + // If we don't have new sensor API, fallback to old DeviceOrientationEvent + if (typeof RelativeOrientationSensor === 'undefined') { + if (JS_OrientationSensor_callback == 0) { + JS_OrientationSensor_callback = callback; + JS_RequestDeviceSensorPermissions(1/*DeviceOrientationEvent permission*/); + window.addEventListener('deviceorientation', JS_DeviceOrientation_eventHandler); + } + return; + } + + JS_OrientationSensor_callback = callback; + + function InitializeOrientationSensor(frequency) { + // Use device referenceFrame, since New Input System package does its own compensation + // Use relative orientation to match native players + JS_OrientationSensor = new RelativeOrientationSensor({ frequency: frequency, referenceFrame: 'device' }); + JS_OrientationSensor.addEventListener('reading', JS_OrientationSensor_eventHandler); + JS_OrientationSensor.addEventListener('error', function(e) { + // e.error could be DOMException: Could not connect to a sensor + warnOnce((e.error) ? e.error : e); + }); + JS_OrientationSensor.start(); + } + + // If the sensor is already created, stop and re-create it with new frequency + if (JS_OrientationSensor) { + JS_OrientationSensor.stop(); + JS_OrientationSensor.removeEventListener('reading', JS_OrientationSensor_eventHandler); + InitializeOrientationSensor(frequency); + } + else if (JS_OrientationSensor_frequencyRequest != 0) { + // If the permissions promise is currently in progress, then note new frequency only + JS_OrientationSensor_frequencyRequest = frequency; + } + else { + JS_OrientationSensor_frequencyRequest = frequency; + + // Request required permissions for the RelativeOrientationSensor + Promise.all([navigator.permissions.query({ name: "accelerometer" }), + navigator.permissions.query({ name: "gyroscope" })]) + .then(function(results) { + if (results.every(function(result) {return(result.state === "granted");})) { + InitializeOrientationSensor(JS_OrientationSensor_frequencyRequest); + } else { + warnOnce("No permissions to use RelativeOrientationSensor."); + } + JS_OrientationSensor_frequencyRequest = 0; + }); + } + } + + function _JS_OrientationSensor_Stop() { + if (JS_OrientationSensor) { + JS_OrientationSensor.stop(); + JS_OrientationSensor.removeEventListener('reading', JS_OrientationSensor_eventHandler); + JS_OrientationSensor = null; + } + else if (JS_OrientationSensor_callback != 0) { + window.removeEventListener('deviceorientation', JS_DeviceOrientation_eventHandler); + } + JS_OrientationSensor_callback = 0; + } + + function _JS_Profiler_InjectJobs() + { + for (var jobname in Module["Jobs"]) + { + var job = Module["Jobs"][jobname]; + if (typeof job["endtime"] != "undefined") + Module.ccall("InjectProfilerSample", null, ["string", "number", "number"], [jobname, job.starttime, job.endtime]); + } + } + + function _JS_RequestDeviceSensorPermissionsOnTouch() { + if (JS_DeviceSensorPermissions == 0) return; + + // Re-request any required device sensor permissions (iOS requires that permissions are requested on a user interaction event) + JS_RequestDeviceSensorPermissions(JS_DeviceSensorPermissions); + } + + function _JS_RunQuitCallbacks() { + Module.QuitCleanup(); + } + + var JS_ScreenOrientation_callback = 0; + function JS_ScreenOrientation_eventHandler() { + if (JS_ScreenOrientation_callback) dynCall_viii(JS_ScreenOrientation_callback, window.innerWidth, window.innerHeight, screen.orientation ? screen.orientation.angle : window.orientation); + } + function _JS_ScreenOrientation_DeInit() { + JS_ScreenOrientation_callback = 0; + window.removeEventListener('resize', JS_ScreenOrientation_eventHandler); + if (screen.orientation) { + screen.orientation.removeEventListener('change', JS_ScreenOrientation_eventHandler); + } + } + + function _JS_ScreenOrientation_Init(callback) { + // Only register if not yet registered + if (!JS_ScreenOrientation_callback) { + if (screen.orientation) { + // Use Screen Orientation API if available: + // - https://www.w3.org/TR/screen-orientation/ + // - https://caniuse.com/screen-orientation + // - https://developer.mozilla.org/en-US/docs/Web/API/Screen/orientation + // (Firefox, Chrome, Chrome for Android, Firefox for Android) + screen.orientation.addEventListener('change', JS_ScreenOrientation_eventHandler); + } + + // As a fallback, use deprecated DOM window.orientation field if available: + // - https://compat.spec.whatwg.org/#dom-window-orientation + // - https://developer.mozilla.org/en-US/docs/Web/API/Window/orientation + // (Safari for iOS) + // Listening to resize event also helps emulate landscape/portrait transitions on desktop + // browsers when the browser window is scaled to narrow/wide configurations. + window.addEventListener('resize', JS_ScreenOrientation_eventHandler); + + JS_ScreenOrientation_callback = callback; + + // Trigger the event handler immediately after the engine initialization is done to start up + // ScreenManager with the initial state. + setTimeout(JS_ScreenOrientation_eventHandler, 0); + } + } + + var JS_ScreenOrientation_requestedLockType = -1; + + var JS_ScreenOrientation_appliedLockType = -1; + + var JS_ScreenOrientation_timeoutID = -1; + function _JS_ScreenOrientation_Lock(orientationLockType) { + // We will use the Screen Orientation API if available, and silently return if not available + // - https://www.w3.org/TR/screen-orientation/ + // - https://caniuse.com/screen-orientation + // - https://developer.mozilla.org/en-US/docs/Web/API/Screen/orientation + if (!screen.orientation || !screen.orientation.lock) { + // As of writing, this is only not implemented on Safari + return; + } + + // Callback to apply the lock + function applyLock() { + JS_ScreenOrientation_appliedLockType = JS_ScreenOrientation_requestedLockType; + + // Index must match enum class OrientationLockType in ScreenOrientation.h + var screenOrientations = ['any', 0/*natural*/, 'landscape', 'portrait', 'portrait-primary', 'portrait-secondary', 'landscape-primary', 'landscape-secondary' ]; + var type = screenOrientations[JS_ScreenOrientation_appliedLockType]; + + assert(type, 'Invalid orientationLockType passed to JS_ScreenOrientation_Lock'); + + // Apply the lock, which is done asynchronously and returns a Promise + screen.orientation.lock(type).then(function() { + // Upon success, see if the JS_ScreenOrientation_requestedLockType value has changed, in which case, we will now need to queue another applyLock + if (JS_ScreenOrientation_requestedLockType != JS_ScreenOrientation_appliedLockType) { + JS_ScreenOrientation_timeoutID = setTimeout(applyLock, 0); + } + else { + JS_ScreenOrientation_timeoutID = -1; + } + }).catch(function(err) { + // When screen.orientation.lock() is called on a desktop browser, a DOMException is thrown by the promise + warnOnce(err); + JS_ScreenOrientation_timeoutID = -1; + }); + + // Note, there is also an screen.orientation.unlock() which unlocks auto rotate to default orientation. + // On my Google Pixel 5, this allows 'portrait-primary' AND 'landscape', but will differ depending on device. + } + + // Request this orientationLockType be applied on the callback + JS_ScreenOrientation_requestedLockType = orientationLockType; + + // Queue applyLock callback if there is not already a callback or a screen.orientation.lock call in progress + if (JS_ScreenOrientation_timeoutID == -1 && orientationLockType != JS_ScreenOrientation_appliedLockType) { + JS_ScreenOrientation_timeoutID = setTimeout(applyLock, 0); + } + } + + var WEBAudio = {audioInstanceIdCounter:0,audioInstances:{},audioContext:null,audioWebEnabled:0,audioCache:[],pendingAudioSources:{}}; + function jsAudioMixinSetPitch(source) { + // Add a helper to AudioBufferSourceNode which gives the current playback position of the clip in seconds. + source.estimatePlaybackPosition = function () { + var t = (WEBAudio.audioContext.currentTime - source.playbackStartTime) * source.playbackRate.value; + // Collapse extra times that the audio clip has looped through. + if (source.loop && t >= source.loopStart) { + t = (t - source.loopStart) % (source.loopEnd - source.loopStart) + source.loopStart; + } + return t; + } + + // Add a helper to AudioBufferSourceNode to allow adjusting pitch in a way that keeps playback position estimation functioning. + source.setPitch = function (newPitch) { + var curPosition = source.estimatePlaybackPosition(); + if (curPosition >= 0) { // If negative, the clip has not begun to play yet (that delay is not scaled by pitch) + source.playbackStartTime = WEBAudio.audioContext.currentTime - curPosition / newPitch; + } + if (source.playbackRate.value !== newPitch) source.playbackRate.value = newPitch; + } + } + function jsAudioCreateUncompressedSoundClip(buffer, error) { + var soundClip = { + buffer: buffer, + error: error + }; + + /** + * Release resources of a sound clip + */ + soundClip.release = function () { }; + + /** + * Get length of sound clip in number of samples + * @returns {number} + */ + soundClip.getLength = function () { + if (!this.buffer) { + console.log ("Trying to get length of sound which is not loaded."); + return 0; + } + + // Fakemod assumes sample rate is 44100, though that's not necessarily the case, + // depending on OS, if the audio file was not imported by our pipeline. + // Therefore we need to recalculate the length based on the actual samplerate. + var sampleRateRatio = 44100 / this.buffer.sampleRate; + return this.buffer.length * sampleRateRatio; + } + + /** + * Gets uncompressed audio data from sound clip. + * If output buffer is smaller than the sound data only the first portion + * of the sound data is read. + * Sound clips with multiple channels will be stored one after the other. + * + * @param {number} ptr Pointer to the output buffer + * @param {number} length Size of output buffer in bytes + * @returns Size of data in bytes written to output buffer + */ + soundClip.getData = function (ptr, length) { + if (!this.buffer) { + console.log ("Trying to get data of sound which is not loaded."); + return 0; + } + + // Get output buffer + var startOutputBuffer = ptr >> 2; + var output = HEAPF32.subarray(startOutputBuffer, startOutputBuffer + (length >> 2)); + var numMaxSamples = Math.floor((length >> 2) / this.buffer.numberOfChannels); + var numReadSamples = Math.min(this.buffer.length, numMaxSamples); + + // Copy audio data to outputbuffer + for (var i = 0; i < this.buffer.numberOfChannels; i++) { + var channelData = this.buffer.getChannelData(i).subarray(0, numReadSamples); + output.set(channelData, i * numReadSamples); + } + + return numReadSamples * this.buffer.numberOfChannels * 4; + } + + /** + * Gets number of channels of soundclip + * @returns {number} + */ + soundClip.getNumberOfChannels = function () { + if (!this.buffer) { + console.log ("Trying to get metadata of sound which is not loaded."); + return 0; + } + + return this.buffer.numberOfChannels; + } + + /** + * Gets sampling rate in Hz + * @returns {number} + */ + soundClip.getFrequency = function () { + if (!this.buffer) { + console.log ("Trying to get metadata of sound which is not loaded."); + return 0; + } + + return this.buffer.sampleRate; + } + + /** + * Create an audio source node. + * @returns {AudioBufferSourceNode} + */ + soundClip.createSourceNode = function () { + if (!this.buffer) { + console.log ("Trying to play sound which is not loaded."); + } + + var source = WEBAudio.audioContext.createBufferSource(); + source.buffer = this.buffer; + jsAudioMixinSetPitch(source); + + return source; + }; + + return soundClip; + } + function jsAudioCreateChannel(callback, userData) { + var channel = { + callback: callback, + userData: userData, + source: null, + gain: WEBAudio.audioContext.createGain(), + panner: WEBAudio.audioContext.createPanner(), + threeD: false, + loop: false, + loopStart: 0, + loopEnd: 0, + pitch: 1.0 + }; + + channel.panner.rolloffFactor = 0; // We calculate rolloff ourselves. + + /** + * Release internal resources. + */ + channel.release = function () { + // Explicitly disconnect audio nodes related to this audio channel when the channel should be + // GCd to work around Safari audio performance bug that resulted in crackling audio; as suggested + // in https://bugs.webkit.org/show_bug.cgi?id=222098#c23 + this.disconnectSource(); + this.gain.disconnect(); + this.panner.disconnect(); + } + + /** + * Play a sound clip on the channel + * @param {UncompressedSoundClip|CompressedSoundClip} soundClip + * @param {number} startTime Scheduled start time in seconds + * @param {number} startOffset Start offset in seconds + */ + channel.playSoundClip = function (soundClip, startTime, startOffset) { + try { + var self = this; + this.source = soundClip.createSourceNode(); + this.setupPanning(); + + // Setup on ended callback + this.source.onended = function () { + self.source.isStopped = true; + self.disconnectSource(); + if (self.callback) { + dynCall("vi", self.callback, [self.userData]); + } + }; + + this.source.loop = this.loop; + this.source.loopStart = this.loopStart; + this.source.loopEnd = this.loopEnd; + this.source.start(startTime, startOffset); + this.source.playbackStartTime = startTime - startOffset / this.source.playbackRate.value; + this.source.setPitch(this.pitch); + } catch (e) { + // Need to catch exception, otherwise execution will stop on Safari if audio output is missing/broken + console.error("Channel.playSoundClip error. Exception: " + e); + } + }; + + /** + * Stop playback on channel + */ + channel.stop = function (delay) { + if (!this.source) { + return; + } + + // stop source currently playing. + try { + channel.source.stop(WEBAudio.audioContext.currentTime + delay); + } catch (e) { + // when stop() is used more than once for the same source in Safari it causes the following exception: + // InvalidStateError: DOM Exception 11: An attempt was made to use an object that is not, or is no longer, usable. + // Ignore that exception. + } + + if (delay == 0) { + this.disconnectSource(); + } + }; + + /** + * Return wether the channel is currently paused + * @returns {boolean} + */ + channel.isPaused = function () { + if (!this.source) { + return true; + } + + if (this.source.isPausedMockNode) { + return true; + } + + if (this.source.mediaElement) { + return this.source.mediaElement.paused || this.source.pauseRequested; + } + + return false; + }; + + /** + * Pause playback of channel + */ + channel.pause = function () { + if (!this.source || this.source.isPausedMockNode) { + return; + } + + if (this.source.mediaElement) { + this.source._pauseMediaElement(); + return; + } + + // WebAudio does not have support for pausing and resuming AudioBufferSourceNodes (they are a fire-once abstraction) + // When we want to pause a node, create a mocked object in its place that represents the needed state that is required + // for resuming the clip. + var pausedSource = { + isPausedMockNode: true, + buffer: this.source.buffer, + loop: this.source.loop, + loopStart: this.source.loopStart, + loopEnd: this.source.loopEnd, + playbackRate: this.source.playbackRate.value, + scheduledStopTime: undefined, + // Specifies in seconds the time at the clip where the playback was paused at. + // Can be negative if the audio clip has not started yet. + playbackPausedAtPosition: this.source.estimatePlaybackPosition(), + setPitch: function (v) { this.playbackRate = v; }, + stop: function(when) { this.scheduledStopTime = when; } + }; + // Stop and clear the real audio source... + this.stop(0); + this.disconnectSource(); + // .. and replace the source with a paused mock version. + this.source = pausedSource; + }; + + /** + * Resume playback on channel. + */ + channel.resume = function () { + // If the source is a compressed audio MediaElement, it was directly paused so we can + // directly play it again. + if (this.source && this.source.mediaElement) { + this.source.start(undefined, this.source.currentTime); + return; + } + + // N.B. We only resume a source that has been previously paused. That is, resume() cannot be used to start playback if + // channel was not playing an audio clip before, but playSoundClip() is to be used. + if (!this.source || !this.source.isPausedMockNode) { + return; + } + + var pausedSource = this.source; + var soundClip = jsAudioCreateUncompressedSoundClip(pausedSource.buffer, false); + this.playSoundClip(soundClip, WEBAudio.audioContext.currentTime, Math.max(0, pausedSource.playbackPausedAtPosition)); + this.source.loop = pausedSource.loop; + this.source.loopStart = pausedSource.loopStart; + this.source.loopEnd = pausedSource.loopEnd; + this.source.setPitch(pausedSource.playbackRate); + + // Apply scheduled stop of source if present + if (typeof pausedSource.scheduledStopTime !== "undefined") { + var delay = Math.max(pausedSource.scheduledStopTime - WEBAudio.audioContext.currentTime, 0); + this.stop(delay); + } + }; + + /** + * Set loop mode + * @param {boolean} loop If true audio will be looped. + */ + channel.setLoop = function (loop) { + this.loop = loop; + if (!this.source || this.source.loop == loop) { + return; + } + + this.source.loop = loop; + } + + /** + * Set loop start and end + * @param {number} loopStart Start of the loop in seconds. + * @param {number} loopEnd End of the loop in seconds. + */ + channel.setLoopPoints = function (loopStart, loopEnd) { + this.loopStart = loopStart; + this.loopEnd = loopEnd; + if (!this.source) { + return; + } + + if (this.source.loopStart !== loopStart) { + this.source.loopStart = loopStart; + } + + if (this.source.loopEnd !== loopEnd) { + this.source.loopEnd = loopEnd; + } + } + + /** + * Set channel 3D mode + * @param {boolean} threeD If true the channel will be played back as 3D audio + */ + channel.set3D = function (threeD) { + if (this.threeD == threeD) { + return; + } + this.threeD = threeD; + + // Only update node graph is source is initialized + if (!this.source) { + return; + } + + this.setupPanning(); + } + + /** + * Set the pitch of the channel + * @param {number} pitch Pitch of the channel + */ + channel.setPitch = function (pitch) { + this.pitch = pitch; + + // Only update pitch if source is initialized + if (!this.source) { + return; + } + + this.source.setPitch(pitch); + } + + /** + * Set volume of channel + * @param {number} volume Volume of channel + */ + channel.setVolume = function (volume) { + // Work around WebKit bug https://bugs.webkit.org/show_bug.cgi?id=222098 + // Updating volume only if it changes reduces sound distortion over time. + // See case 1350204, 1348348 and 1352665 + if (this.gain.gain.value == volume) { + return; + } + + this.gain.gain.value = volume; + } + + /** + * Set the 3D position of the audio channel + * @param {number} x + * @param {number} y + * @param {number} z + */ + channel.setPosition = function (x, y, z) { + var p = this.panner; + + // Work around Chrome performance bug https://bugs.chromium.org/p/chromium/issues/detail?id=1133233 + // by only updating the PannerNode position if it has changed. + // See case 1270768. + if (p.positionX) { + // Use new properties if they exist ... + if (p.positionX.value !== x) p.positionX.value = x; + if (p.positionY.value !== y) p.positionY.value = y; + if (p.positionZ.value !== z) p.positionZ.value = z; + } else if (p._x !== x || p._y !== y || p._z !== z) { + // ... or the deprecated set function if they don't (and shadow cache the set values to avoid re-setting later) + p.setPosition(x, y, z); + p._x = x; + p._y = y; + p._z = z; + } + } + + /** + * Disconnect source node from graph + */ + channel.disconnectSource = function () { + if (!this.source || this.source.isPausedMockNode) { + return; + } + + if (this.source.mediaElement) { + // Pause playback of media element + this.source._pauseMediaElement(); + } + + this.source.onended = null; + this.source.disconnect(); + delete this.source; + }; + + /** + * Changes this audio channel to either 3D panning or 2D mode (no panning) + */ + channel.setupPanning = function () { + // We have a mocked paused object in effect? + if (this.source.isPausedMockNode) return; + + // Configure audio panning options either for 3D or 2D. + this.source.disconnect(); + this.panner.disconnect(); + this.gain.disconnect(); + if (this.threeD) { + // In 3D: AudioBufferSourceNode/MediaElementSourceNode -> PannerNode -> GainNode -> AudioContext.destination + this.source.connect(this.panner); + this.panner.connect(this.gain); + } else { + // In 2D: AudioBufferSourceNode/MediaElementSourceNode -> GainNode -> AudioContext.destination + this.source.connect(this.gain); + } + this.gain.connect(WEBAudio.audioContext.destination); + } + + /** + * Returns wether playback on a channel is stopped. + * @returns {boolean} Returns true if playback on channel is stopped. + */ + channel.isStopped = function () { + if (!this.source) { + // Uncompressed audio + // No playback source -> channel is stopped + return true; + } + + if (this.source.mediaElement) { + // Compressed audio + return this.source.isStopped; + } + + return false; + } + + return channel; + } + function _JS_Sound_Create_Channel(callback, userData) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + WEBAudio.audioInstances[++WEBAudio.audioInstanceIdCounter] = jsAudioCreateChannel(callback, userData); + return WEBAudio.audioInstanceIdCounter; + } + + function _JS_Sound_GetData(bufferInstance, ptr, length) + { + if (WEBAudio.audioWebEnabled == 0) + return 0; + + var soundClip = WEBAudio.audioInstances[bufferInstance]; + + if (!soundClip) + return 0; + + return soundClip.getData(ptr, length); + } + + function _JS_Sound_GetLength(bufferInstance) + { + if (WEBAudio.audioWebEnabled == 0) + return 0; + + var soundClip = WEBAudio.audioInstances[bufferInstance]; + + if (!soundClip) + return 0; + + return soundClip.getLength(); + } + + function _JS_Sound_GetLoadState(bufferInstance) + { + if (WEBAudio.audioWebEnabled == 0) + return 2; + + var sound = WEBAudio.audioInstances[bufferInstance]; + if (sound.error) + return 2; + if (sound.buffer || sound.url) + return 0; + return 1; + } + + function _JS_Sound_GetMetaData(bufferInstance, metaData) + { + if (WEBAudio.audioWebEnabled == 0) + { + HEAPU32[metaData >> 2] = 0; + HEAPU32[(metaData >> 2) + 1] = 0; + return false; + } + + var soundClip = WEBAudio.audioInstances[bufferInstance]; + + if (!soundClip) + { + + HEAPU32[metaData >> 2] = 0; + HEAPU32[(metaData >> 2) + 1] = 0; + return false; + } + + HEAPU32[metaData >> 2] = soundClip.getNumberOfChannels(); + HEAPU32[(metaData >> 2) + 1] = soundClip.getFrequency(); + + return true; + } + + function jsAudioPlayPendingBlockedAudio(soundId) { + var pendingAudio = WEBAudio.pendingAudioSources[soundId]; + pendingAudio.sourceNode._startPlayback(pendingAudio.offset); + delete WEBAudio.pendingAudioSources[soundId]; + } + function jsAudioPlayBlockedAudios() { + Object.keys(WEBAudio.pendingAudioSources).forEach(function (audioId) { + jsAudioPlayPendingBlockedAudio(audioId); + }); + } + function _JS_Sound_Init() { + try { + window.AudioContext = window.AudioContext || window.webkitAudioContext; + WEBAudio.audioContext = new AudioContext(); + + var tryToResumeAudioContext = function () { + if (WEBAudio.audioContext.state === 'suspended') + WEBAudio.audioContext.resume().catch(function (error) { + console.warn("Could not resume audio context. Exception: " + error); + }); + else + Module.clearInterval(resumeInterval); + }; + var resumeInterval = Module.setInterval(tryToResumeAudioContext, 400); + + WEBAudio.audioWebEnabled = 1; + + // Safari has the restriction where Audio elements need to be created from a direct user event, + // even if the rest of the audio playback requirements is that a user event has happeend + // at some point previously. The AudioContext also needs to be resumed, if paused, from a + // direct user event. Catch user events here and use them to fill a cache of Audio + // elements to be used by the rest of the system. + var _userEventCallback = function () { + try { + // On Safari, resuming the audio context needs to happen from a user event. + // The AudioContext is suspended by default, and on iOS if the user switches tabs + // and comes back, it will be interrupted. Touching the page will resume audio + // playback. + if (WEBAudio.audioContext.state !== "running" && WEBAudio.audioContext.state !== "closed") { + WEBAudio.audioContext.resume().catch(function (error) { + console.warn("Could not resume audio context. Exception: " + error); + }); + } + + // Play blocked audio elements + jsAudioPlayBlockedAudios(); + + // How many audio elements should we cache? How many compressed audio channels might + // be played at a single time? + var audioCacheSize = 20; + while (WEBAudio.audioCache.length < audioCacheSize) { + var audio = new Audio(); + audio.autoplay = false; + WEBAudio.audioCache.push(audio); + } + } catch (e) { + // Audio error, but don't need to notify here, they would have already been + // informed of audio errors. + } + }; + window.addEventListener("mousedown", _userEventCallback); + window.addEventListener("touchstart", _userEventCallback); + + // Make sure we release the event listeners when the app quits to avoid leaking memory. + Module.deinitializers.push(function () { + window.removeEventListener("mousedown", _userEventCallback); + window.removeEventListener("touchstart", _userEventCallback); + }); + } + catch (e) { + alert('Web Audio API is not supported in this browser'); + } + } + + function _JS_Sound_IsStopped(channelInstance) + { + if (WEBAudio.audioWebEnabled == 0) + return true; + + var channel = WEBAudio.audioInstances[channelInstance]; + if (!channel) + return true; + + return channel.isStopped(); + } + + function jsAudioCreateUncompressedSoundClipFromCompressedAudio(audioData) { + var soundClip = jsAudioCreateUncompressedSoundClip(null, false); + + WEBAudio.audioContext.decodeAudioData( + audioData, + function (_buffer) { + soundClip.buffer = _buffer; + }, + function (_error) { + soundClip.error = true; + console.log("Decode error: " + _error); + } + ); + + return soundClip; + } + + function jsAudioAddPendingBlockedAudio(sourceNode, offset) { + WEBAudio.pendingAudioSources[sourceNode.mediaElement.src] = { + sourceNode: sourceNode, + offset: offset + }; + } + + function jsAudioGetMimeTypeFromType(fmodSoundType) { + switch(fmodSoundType) + { + case 13: // FMOD_SOUND_TYPE_MPEG + return "audio/mpeg"; + case 20: // FMOD_SOUND_TYPE_WAV + return "audio/wav"; + default: // Fallback to mp4 audio file for other types or if not set (works on most browsers) + return "audio/mp4"; + } + } + function jsAudioCreateCompressedSoundClip(audioData, fmodSoundType) { + var mimeType = jsAudioGetMimeTypeFromType(fmodSoundType); + var blob = new Blob([audioData], { type: mimeType }); + + var soundClip = { + url: URL.createObjectURL(blob), + error: false, + mediaElement: new Audio() + }; + + // An Audio element is created for the buffer so that we can access properties like duration + // in JS_Sound_GetLength, which knows about the buffer object, but not the channel object. + // This Audio element is used for metadata properties only, not for playback. Trying to play + // back this Audio element would cause an error on Safari because it's not created in a + // direct user event handler. + soundClip.mediaElement.preload = "metadata"; + soundClip.mediaElement.src = soundClip.url; + + /** + * Release resources of a sound clip + */ + soundClip.release = function () { + if (!this.mediaElement) { + return; + } + + this.mediaElement.src = ""; + URL.revokeObjectURL(this.url); + delete this.mediaElement; + delete this.url; + } + + /** + * Get length of sound clip in number of samples + * @returns {number} + */ + soundClip.getLength = function () { + // Convert duration (seconds) to number of samples. + return this.mediaElement.duration * 44100; + } + /** + * Gets uncompressed audio data from sound clip. + * If output buffer is smaller than the sound data only the first portion + * of the sound data is read. + * Sound clips with multiple channels will be stored one after the other. + * + * @param {number} ptr Pointer to the output buffer + * @param {number} length Size of output buffer in bytes + * @returns Size of data in bytes written to output buffer + */ + soundClip.getData = function (ptr, length) { + console.warn("getData() is not supported for compressed sound."); + + return 0; + } + + /** + * Gets number of channels of soundclip + * @returns {number} + */ + soundClip.getNumberOfChannels = function () { + console.warn("getNumberOfChannels() is not supported for compressed sound."); + + return 0; + } + + /** + * Gets sampling rate in Hz + * @returns {number} + */ + soundClip.getFrequency = function () { + console.warn("getFrequency() is not supported for compressed sound."); + + return 0; + } + + /** + * Create an audio source node + * @returns {MediaElementAudioSourceNode} + */ + soundClip.createSourceNode = function () { + var self = this; + var mediaElement = WEBAudio.audioCache.length ? WEBAudio.audioCache.pop() : new Audio();; + mediaElement.preload = "metadata"; + mediaElement.src = this.url; + var source = WEBAudio.audioContext.createMediaElementSource(mediaElement); + + Object.defineProperty(source, "loop", { + get: function () { + return source.mediaElement.loop; + }, + set: function (v) { + if (source.mediaElement.loop !== v) source.mediaElement.loop = v; + } + }); + + source.playbackRate = {}; + Object.defineProperty(source.playbackRate, "value", { + get: function () { + return source.mediaElement.playbackRate; + }, + set: function (v) { + if (source.mediaElement.playbackRate !== v) source.mediaElement.playbackRate = v; + } + }); + Object.defineProperty(source, "currentTime", { + get: function () { + return source.mediaElement.currentTime; + }, + set: function (v) { + if (source.mediaElement.currentTime !== v) source.mediaElement.currentTime = v; + } + }); + Object.defineProperty(source, "mute", { + get: function () { + return source.mediaElement.mute; + }, + set: function (v) { + if (source.mediaElement.mute !== v) source.mediaElement.mute = v; + } + }); + Object.defineProperty(source, "onended", { + get: function () { + return source.mediaElement.onended; + }, + set: function (onended) { + source.mediaElement.onended = onended; + } + }); + + source.playPromise = null; + source.playTimeout = null; + source.pauseRequested = false; + source.isStopped = false; + + source._pauseMediaElement = function () { + // If there is a play request still pending, then pausing now would cause an + // error. Instead, mark that we want the audio paused as soon as it can be, + // which will be when the play promise resolves. + if (source.playPromise || source.playTimeout) { + source.pauseRequested = true; + } else { + // If there is no play request pending, we can pause immediately. + source.mediaElement.pause(); + } + }; + + source._startPlayback = function (offset) { + if (source.playPromise || source.playTimeout) { + source.mediaElement.currentTime = offset; + source.pauseRequested = false; + return; + } + + source.mediaElement.currentTime = offset; + source.playPromise = source.mediaElement.play(); + + if (source.playPromise) { + source.playPromise.then(function () { + // If a pause was requested between play() and the MediaElement actually + // starting, then pause it now. + if (source.pauseRequested) { + source.mediaElement.pause(); + source.pauseRequested = false; + } + source.playPromise = null; + }).catch(function (error) { + source.playPromise = null; + if (error.name !== 'NotAllowedError') + throw error; + + // Playing a media element may fail if there was no previous user interaction + // Retry playback when there was a user interaction + jsAudioAddPendingBlockedAudio(source, offset); + }); + } + }; + + source.start = function (startTime, offset) { + if (typeof startTime === "undefined") { + startTime = WEBAudio.audioContext.currentTime; + } + + if (typeof offset === "undefined") { + offset = 0.0; + } + + // Compare startTime to WEBAudio context currentTime, and if + // startTime is more than about 4 msecs in the future, do a setTimeout() wait + // for the remaining duration, and only then play. 4 msecs boundary because + // setTimeout() is specced to throttle <= 4 msec waits if repeatedly called. + var startDelayThresholdMS = 4; + // Convert startTime and currentTime to milliseconds + var startDelayMS = (startTime - WEBAudio.audioContext.currentTime) * 1000; + if (startDelayMS > startDelayThresholdMS) { + source.playTimeout = setTimeout(function () { + source.playTimeout = null; + source._startPlayback(offset); + }, startDelayMS); + } else { + source._startPlayback(offset); + } + }; + + source.stop = function (stopTime) { + if (typeof stopTime === "undefined") { + stopTime = WEBAudio.audioContext.currentTime; + } + + // Compare stopTime to WEBAudio context currentTime, and if + // stopTime is more than about 4 msecs in the future, do a setTimeout() wait + // for the remaining duration, and only then stop. 4 msecs boundary because + // setTimeout() is specced to throttle <= 4 msec waits if repeatedly called. + var stopDelayThresholdMS = 4; + // Convert startTime and currentTime to milliseconds + var stopDelayMS = (stopTime - WEBAudio.audioContext.currentTime) * 1000; + + if (stopDelayMS > stopDelayThresholdMS) { + setTimeout(function () { + source._pauseMediaElement(); + source.isStopped = true; + }, stopDelayMS); + } else { + source._pauseMediaElement(); + source.isStopped = true; + } + }; + + jsAudioMixinSetPitch(source); + + return source; + } + + return soundClip; + } + function _JS_Sound_Load(ptr, length, decompress, fmodSoundType) { + if (WEBAudio.audioWebEnabled == 0) + return 0; + + var audioData = HEAPU8.buffer.slice(ptr, ptr + length); + + // We don't ever want to play back really small audio clips as compressed, the compressor has a startup CPU cost, + // and replaying the same audio clip multiple times (either individually or when looping) has an unwanted CPU + // overhead if the same data will be decompressed on demand again and again. Hence we want to play back small + // audio files always as fully uncompressed in memory. + + // However this will be a memory usage tradeoff. + + // Tests with aac audio sizes in a .m4a container shows: + // 2.11MB stereo 44.1kHz .m4a file containing 90 seconds of 196kbps aac audio decompresses to 30.3MB of float32 PCM data. (~14.3x size increase) + // 721KB stereo 44.1kHz .m4a file 29 seconds of 196kbps aac audio decompresses to 10.0MB of float32 PCM data. (~14x size increase) + // 6.07KB mono 44.1kHZ .m4a file containing 1 second of 101kbps aac audio decompresses to 72kB of float32 PCM data. (~11x size increase) + // -> overall AAC compression factor is ~10x-15x. + + // Based on above, take 128KB as a cutoff size: if we have a .m4a clip that is smaller than this, + // we always uncompress it up front, receiving at most ~1.8MB of raw audio data, which can hold about ~10 seconds of mono audio. + // In other words, heuristically all audio clips <= mono ~10 seconds (5 seconds if stereo) in duration will be always fully uncompressed in memory. + if (length < 131072) decompress = 1; + + var sound; + if (decompress) { + sound = jsAudioCreateUncompressedSoundClipFromCompressedAudio(audioData); + } else { + sound = jsAudioCreateCompressedSoundClip(audioData, fmodSoundType); + } + + WEBAudio.audioInstances[++WEBAudio.audioInstanceIdCounter] = sound; + + return WEBAudio.audioInstanceIdCounter; + } + + function jsAudioCreateUncompressedSoundClipFromPCM(channels, length, sampleRate, ptr) { + var buffer = WEBAudio.audioContext.createBuffer(channels, length, sampleRate); + + // Copy audio data to buffer + for (var i = 0; i < channels; i++) { + var offs = (ptr >> 2) + length * i; + var copyToChannel = buffer['copyToChannel'] || function (source, channelNumber, startInChannel) { + // Shim for copyToChannel on browsers which don't support it like Safari. + var clipped = source.subarray(0, Math.min(source.length, this.length - (startInChannel | 0))); + this.getChannelData(channelNumber | 0).set(clipped, startInChannel | 0); + }; + copyToChannel.apply(buffer, [HEAPF32.subarray(offs, offs + length), i, 0]); + } + + return jsAudioCreateUncompressedSoundClip(buffer, false); + } + function _JS_Sound_Load_PCM(channels, length, sampleRate, ptr) { + if (WEBAudio.audioWebEnabled == 0) + return 0; + + var sound = jsAudioCreateUncompressedSoundClipFromPCM(channels, length, sampleRate, ptr); + + WEBAudio.audioInstances[++WEBAudio.audioInstanceIdCounter] = sound; + return WEBAudio.audioInstanceIdCounter; + } + + function _JS_Sound_Play(bufferInstance, channelInstance, offset, delay) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + // stop sound clip which is currently playing in the channel. + _JS_Sound_Stop(channelInstance, 0); + + var soundClip = WEBAudio.audioInstances[bufferInstance]; + var channel = WEBAudio.audioInstances[channelInstance]; + + if (!soundClip) { + console.log("Trying to play sound which is not loaded."); + return; + } + + try { + channel.playSoundClip(soundClip, WEBAudio.audioContext.currentTime + delay, offset); + } catch (error) { + console.error("playSoundClip error. Exception: " + e); + } + } + + function _JS_Sound_ReleaseInstance(instance) { + var object = WEBAudio.audioInstances[instance]; + if (object) { + object.release(); + } + + // Let the GC free up the audio object. + delete WEBAudio.audioInstances[instance]; + } + + function _JS_Sound_ResumeIfNeeded() + { + if (WEBAudio.audioWebEnabled == 0) + return; + + if (WEBAudio.audioContext.state === 'suspended') + WEBAudio.audioContext.resume().catch(function (error) { + console.warn("Could not resume audio context. Exception: " + error); + }); + + } + + function _JS_Sound_Set3D(channelInstance, threeD) + { + var channel = WEBAudio.audioInstances[channelInstance]; + channel.set3D(threeD); + } + + function _JS_Sound_SetListenerOrientation(x, y, z, xUp, yUp, zUp) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + // Web Audio uses a RHS coordinate system, Unity uses LHS, causing orientations to be flipped. + // So we pass a negative direction here to compensate, otherwise channels will be flipped. + x = -x; + y = -y; + z = -z; + + var l = WEBAudio.audioContext.listener; + + // Do not re-set same values here if the orientation has not changed. This avoid unpredictable performance issues in Chrome + // and Safari Web Audio implementations. + if (l.forwardX) { + // Use new properties if they exist ... + if (l.forwardX.value !== x) l.forwardX.value = x; + if (l.forwardY.value !== y) l.forwardY.value = y; + if (l.forwardZ.value !== z) l.forwardZ.value = z; + + if (l.upX.value !== xUp) l.upX.value = xUp; + if (l.upY.value !== yUp) l.upY.value = yUp; + if (l.upZ.value !== zUp) l.upZ.value = zUp; + } else if (l._forwardX !== x || l._forwardY !== y || l._forwardZ !== z || l._upX !== xUp || l._upY !== yUp || l._upZ !== zUp) { + // ... and old deprecated setOrientation if new properties are not supported. + l.setOrientation(x, y, z, xUp, yUp, zUp); + l._forwardX = x; + l._forwardY = y; + l._forwardZ = z; + l._upX = xUp; + l._upY = yUp; + l._upZ = zUp; + } + } + + function _JS_Sound_SetListenerPosition(x, y, z) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + var l = WEBAudio.audioContext.listener; + + // Do not re-set same values here if the orientation has not changed. This avoid unpredictable performance issues in Chrome + // and Safari Web Audio implementations. + if (l.positionX) { + // Use new properties if they exist ... + if (l.positionX.value !== x) l.positionX.value = x; + if (l.positionY.value !== y) l.positionY.value = y; + if (l.positionZ.value !== z) l.positionZ.value = z; + } else if (l._positionX !== x || l._positionY !== y || l._positionZ !== z) { + // ... and old deprecated setPosition if new properties are not supported. + l.setPosition(x, y, z); + l._positionX = x; + l._positionY = y; + l._positionZ = z; + } + } + + function _JS_Sound_SetLoop(channelInstance, loop) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + var channel = WEBAudio.audioInstances[channelInstance]; + channel.setLoop(loop); + } + + function _JS_Sound_SetLoopPoints(channelInstance, loopStart, loopEnd) + { + if (WEBAudio.audioWebEnabled == 0) + return; + var channel = WEBAudio.audioInstances[channelInstance]; + channel.setLoopPoints(loopStart, loopEnd); + } + + function _JS_Sound_SetPaused(channelInstance, paused) + { + if (WEBAudio.audioWebEnabled == 0) + return; + var channel = WEBAudio.audioInstances[channelInstance]; + if (paused != channel.isPaused()) { + if (paused) channel.pause(); + else channel.resume(); + } + } + + function _JS_Sound_SetPitch(channelInstance, v) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + try { + var channel = WEBAudio.audioInstances[channelInstance]; + channel.setPitch(v); + } catch (e) { + console.error('JS_Sound_SetPitch(channel=' + channelInstance + ', pitch=' + v + ') threw an exception: ' + e); + } + } + + function _JS_Sound_SetPosition(channelInstance, x, y, z) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + var channel = WEBAudio.audioInstances[channelInstance]; + channel.setPosition(x, y, z); + } + + function _JS_Sound_SetVolume(channelInstance, v) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + try { + var channel = WEBAudio.audioInstances[channelInstance]; + channel.setVolume(v); + } catch (e) { + console.error('JS_Sound_SetVolume(channel=' + channelInstance + ', volume=' + v + ') threw an exception: ' + e); + } + } + + function _JS_Sound_Stop(channelInstance, delay) + { + if (WEBAudio.audioWebEnabled == 0) + return; + + var channel = WEBAudio.audioInstances[channelInstance]; + channel.stop(delay); + } + + function _JS_SystemInfo_GetBrowserName(buffer, bufferSize) + { + var browser = Module.SystemInfo.browser; + if (buffer) + stringToUTF8(browser, buffer, bufferSize); + return lengthBytesUTF8(browser); + } + + function _JS_SystemInfo_GetBrowserVersionString(buffer, bufferSize) + { + var browserVer = Module.SystemInfo.browserVersion; + if (buffer) + stringToUTF8(browserVer, buffer, bufferSize); + return lengthBytesUTF8(browserVer); + } + + function _JS_SystemInfo_GetCanvasClientSize(domElementSelector, outWidth, outHeight) + { + var selector = UTF8ToString(domElementSelector); + var canvas = (selector == '#canvas') ? Module['canvas'] : document.querySelector(selector); + var w = 0, h = 0; + if (canvas) { + var size = canvas.getBoundingClientRect(); + w = size.width; + h = size.height; + } + HEAPF64[outWidth >> 3] = w; + HEAPF64[outHeight >> 3] = h; + } + + function _JS_SystemInfo_GetDocumentURL(buffer, bufferSize) + { + if (buffer) + stringToUTF8(document.URL, buffer, bufferSize); + return lengthBytesUTF8(document.URL); + } + + function _JS_SystemInfo_GetGPUInfo(buffer, bufferSize) + { + var gpuinfo = Module.SystemInfo.gpu; + if (buffer) + stringToUTF8(gpuinfo, buffer, bufferSize); + return lengthBytesUTF8(gpuinfo); + } + + function _JS_SystemInfo_GetLanguage(buffer, bufferSize) + { + var language = Module.SystemInfo.language; + if (buffer) + stringToUTF8(language, buffer, bufferSize); + return lengthBytesUTF8(language); + } + + function _JS_SystemInfo_GetMatchWebGLToCanvasSize() + { + // If matchWebGLToCanvasSize is not present, it is + // same as true, to keep backwards compatibility with user page templates + // that are not setting this field. + return Module.matchWebGLToCanvasSize || Module.matchWebGLToCanvasSize === undefined; + } + + function _JS_SystemInfo_GetMemory() + { + return HEAPU8.length/(1024*1024); + } + + function _JS_SystemInfo_GetOS(buffer, bufferSize) + { + var browser = Module.SystemInfo.os + " " + Module.SystemInfo.osVersion; + if (buffer) + stringToUTF8(browser, buffer, bufferSize); + return lengthBytesUTF8(browser); + } + + function _JS_SystemInfo_GetPreferredDevicePixelRatio() + { + return Module.matchWebGLToCanvasSize == false ? 1 : Module.devicePixelRatio || window.devicePixelRatio || 1; + } + + function _JS_SystemInfo_GetScreenSize(outWidth, outHeight) + { + HEAPF64[outWidth >> 3] = Module.SystemInfo.width; + HEAPF64[outHeight >> 3] = Module.SystemInfo.height; + } + + function _JS_SystemInfo_GetStreamingAssetsURL(buffer, bufferSize) + { + if (buffer) + stringToUTF8(Module.streamingAssetsUrl, buffer, bufferSize); + return lengthBytesUTF8(Module.streamingAssetsUrl); + } + + function _JS_SystemInfo_HasAstcHdr() + { + var ext = GLctx.getExtension('WEBGL_compressed_texture_astc'); + if (ext && ext.getSupportedProfiles) { + return ext.getSupportedProfiles().includes("hdr"); + } + return false; + } + + function _JS_SystemInfo_HasCursorLock() + { + return Module.SystemInfo.hasCursorLock; + } + + function _JS_SystemInfo_HasFullscreen() + { + return Module.SystemInfo.hasFullscreen; + } + + function _JS_SystemInfo_HasWebGL() + { + return Module.SystemInfo.hasWebGL; + } + + function _JS_SystemInfo_IsMobile() + { + return Module.SystemInfo.mobile; + } + + function _JS_UnityEngineShouldQuit() { + return !!Module.shouldQuit; + } + + var wr = {requests:{},responses:{},abortControllers:{},timer:{},nextRequestId:1}; + function _JS_WebRequest_Abort(requestId) + { + var abortController = wr.abortControllers[requestId]; + if (!abortController || abortController.signal.aborted) { + return; + } + + abortController.abort(); + } + + function _JS_WebRequest_Create(url, method) + { + var _url = UTF8ToString(url); + var _method = UTF8ToString(method); + var abortController = new AbortController(); + var requestOptions = { + url: _url, + init: { + method: _method, + signal: abortController.signal, + headers: {}, + enableStreamingDownload: true + }, + tempBuffer: null, + tempBufferSize: 0 + }; + + wr.abortControllers[wr.nextRequestId] = abortController; + wr.requests[wr.nextRequestId] = requestOptions; + + return wr.nextRequestId++; + } + + function jsWebRequestGetResponseHeaderString(requestId) { + var response = wr.responses[requestId]; + if (!response) { + return ""; + } + + // Use cached value of response header string if present + if (response.headerString) { + return response.headerString; + } + + // Create response header string from headers object + var headers = ""; + var entries = response.headers.entries(); + for (var result = entries.next(); !result.done; result = entries.next()) { + headers += result.value[0] + ": " + result.value[1] + "\r\n"; + } + response.headerString = headers; + + return headers; + } + function _JS_WebRequest_GetResponseMetaData(requestId, headerBuffer, headerSize, responseUrlBuffer, responseUrlSize) + { + var response = wr.responses[requestId]; + if (!response) { + stringToUTF8("", headerBuffer, headerSize); + stringToUTF8("", responseUrlBuffer, responseUrlSize); + return; + } + + if (headerBuffer) { + var headers = jsWebRequestGetResponseHeaderString(requestId); + stringToUTF8(headers, headerBuffer, headerSize); + } + + if (responseUrlBuffer) { + stringToUTF8(response.url, responseUrlBuffer, responseUrlSize); + } + } + + function _JS_WebRequest_GetResponseMetaDataLengths(requestId, buffer) + { + var response = wr.responses[requestId]; + if (!response) { + HEAPU32[buffer >> 2] = 0; + HEAPU32[(buffer >> 2) + 1] = 0; + return; + } + + var headers = jsWebRequestGetResponseHeaderString(requestId); + + // Set length of header and response url to output buffer + HEAPU32[buffer >> 2] = lengthBytesUTF8(headers); + HEAPU32[(buffer >> 2) + 1] = lengthBytesUTF8(response.url); + } + + function _JS_WebRequest_Release(requestId) + { + // Clear timeout + if (wr.timer[requestId]) { + clearTimeout(wr.timer[requestId]); + } + + // Remove all resources for request + delete wr.requests[requestId]; + delete wr.responses[requestId]; + delete wr.abortControllers[requestId]; + delete wr.timer[requestId]; + } + + function _JS_WebRequest_Send(requestId, ptr, length, arg, onresponse, onprogress) + { + var requestOptions = wr.requests[requestId]; + var abortController = wr.abortControllers[requestId]; + + function getTempBuffer(size) { + // Allocate new temp buffer if none has been allocated + if (!requestOptions.tempBuffer) { + const initialSize = Math.max(size, 1024); // Use 1 kB as minimal temp buffer size to prevent too many reallocations + requestOptions.tempBuffer = _malloc(initialSize); + requestOptions.tempBufferSize = initialSize; + } + + // Increase size of temp buffer if necessary + if (requestOptions.tempBufferSize < size) { + _free(requestOptions.tempBuffer); + requestOptions.tempBuffer = _malloc(size); + requestOptions.tempBufferSize = size; + } + + return requestOptions.tempBuffer; + } + + function ClearTimeout() { + if (wr.timer[requestId]) { + clearTimeout(wr.timer[requestId]); + delete wr.timer[requestId]; + } + } + + function HandleSuccess(response, body) { + ClearTimeout(); + + if (!onresponse) { + return; + } + + var kWebRequestOK = 0; + // 200 is successful http request, 0 is returned by non-http requests (file:). + if (requestOptions.init.enableStreamingDownload) { + // Body was streamed only send final body length + dynCall('viiiiii', onresponse, [arg, response.status, 0, body.length, 0, kWebRequestOK]); + } else if (body.length != 0) { + // Send whole body at once + var buffer = _malloc(body.length); + HEAPU8.set(body, buffer); + dynCall('viiiiii', onresponse, [arg, response.status, buffer, body.length, 0, kWebRequestOK]); + } else { + dynCall('viiiiii', onresponse, [arg, response.status, 0, 0, 0, kWebRequestOK]); + } + + // Cleanup temp buffer + if (requestOptions.tempBuffer) { + _free(requestOptions.tempBuffer); + } + } + + function HandleError(err, code) { + ClearTimeout(); + + if (!onresponse) { + return; + } + + var len = lengthBytesUTF8(err) + 1; + var buffer = _malloc(len); + stringToUTF8(err, buffer, len); + dynCall('viiiiii', onresponse, [arg, 500, 0, 0, buffer, code]); + _free(buffer); + + // Clean up temp buffer + if (requestOptions.tempBuffer) { + _free(requestOptions.tempBuffer); + } + } + + function HandleProgress(e) { + if (!onprogress || !e.lengthComputable) { + return; + } + + var response = e.response; + wr.responses[requestId] = response; + + if (e.chunk) { + // Response body streaming is enabled copy data to new buffer + var buffer = getTempBuffer(e.chunk.length); + HEAPU8.set(e.chunk, buffer); + dynCall('viiiiii', onprogress, [arg, response.status, e.loaded, e.total, buffer, e.chunk.length]); + } else { + // no response body streaming + dynCall('viiiiii', onprogress, [arg, response.status, e.loaded, e.total, 0, 0]); + } + } + + try { + if (length > 0) { + var postData = HEAPU8.subarray(ptr, ptr+length); + requestOptions.init.body = new Blob([postData]); + } + + // Add timeout handler if timeout is set + if (requestOptions.timeout) { + wr.timer[requestId] = setTimeout(function () { + requestOptions.isTimedOut = true; + abortController.abort(); + }, requestOptions.timeout); + } + + var fetchImpl = Module.fetchWithProgress; + requestOptions.init.onProgress = HandleProgress; + if (Module.companyName && Module.productName && Module.cachedFetch) { + fetchImpl = Module.cachedFetch; + requestOptions.init.companyName = Module.companyName; + requestOptions.init.productName = Module.productName; + requestOptions.init.productVersion = Module.productVersion; + requestOptions.init.control = Module.cacheControl(requestOptions.url); + } + + fetchImpl(requestOptions.url, requestOptions.init).then(function (response) { + wr.responses[requestId] = response; + + HandleSuccess(response, response.parsedBody); + }).catch(function (error) { + var kWebErrorUnknown = 2; + var kWebErrorAborted = 17; + var kWebErrorTimeout = 14; + + if (requestOptions.isTimedOut) { + HandleError("Connection timed out.", kWebErrorTimeout); + } else if (abortController.signal.aborted) { + HandleError("Aborted.", kWebErrorAborted); + } else { + HandleError(error.message, kWebErrorUnknown); + } + }); + } catch(error) { + var kWebErrorUnknown = 2; + HandleError(error.message, kWebErrorUnknown); + } + } + + function _JS_WebRequest_SetRedirectLimit(request, redirectLimit) + { + var requestOptions = wr.requests[request]; + if (!requestOptions) { + return; + } + + // Disable redirects if redirectLimit == 0 otherwise use browser defined redirect limit + requestOptions.init.redirect = redirectLimit === 0 ? "error" : "follow"; + } + + function _JS_WebRequest_SetRequestHeader(requestId, header, value) + { + var requestOptions = wr.requests[requestId]; + if (!requestOptions) { + return; + } + + var _header = UTF8ToString(header); + var _value = UTF8ToString(value); + requestOptions.init.headers[_header] = _value; + } + + function _JS_WebRequest_SetTimeout(requestId, timeout) + { + var requestOptions = wr.requests[requestId]; + if (!requestOptions) { + return; + } + + requestOptions.timeout = timeout; + } + + function _PasteManagerSetup() { + document.body.addEventListener("paste", function(e) { + e.preventDefault(); + var text = (e.originalEvent || e).clipboardData.getData('text/plain'); + SendMessage("PasteManager", "Paste", text); + }); + } + + function _UploadFile(gameObjectNamePtr, methodNamePtr, filterPtr, multiselect) { + var gameObjectName = UTF8ToString(gameObjectNamePtr); + var methodName = UTF8ToString(methodNamePtr); + var filter = UTF8ToString(filterPtr); + var fileInput = document.getElementById(this.oldGameObjectName); + if (fileInput) { + document.body.removeChild(fileInput); + } + fileInput = document.createElement('input'); + fileInput.setAttribute('id', gameObjectName); + fileInput.setAttribute('type', 'file'); + fileInput.setAttribute('class', 'standalone-file-picker'); + if (multiselect) { + fileInput.setAttribute('multiple', 'multiple'); + } + if (filter) { + fileInput.setAttribute('accept', filter); + } + fileInput.onclick = function(event) { + event.stopPropagation(); + this.value = null; + }; + fileInput.onchange = function(event) { + event.stopPropagation(); + var urls = []; + for (var i = 0; i < event.target.files.length; i++) { + urls.push({ + "name": event.target.files[i].name, + "url": URL.createObjectURL(event.target.files[i]) + }); + } + SendMessage(gameObjectName, methodName, JSON.stringify(urls)); + document.body.removeChild(fileInput); + }; + document.body.appendChild(fileInput); + fileInput.focus(); + fileInput.click(); + this.oldGameObjectName = gameObjectName; + } + + function ___assert_fail(condition, filename, line, func) { + abort('Assertion failed: ' + UTF8ToString(condition) + ', at: ' + [filename ? UTF8ToString(filename) : 'unknown filename', line, func ? UTF8ToString(func) : 'unknown function']); + } + + function ___cxa_allocate_exception(size) { + // Thrown object is prepended by exception metadata block + return _malloc(size + 16) + 16; + } + + /** @constructor */ + function ExceptionInfo(excPtr) { + this.excPtr = excPtr; + this.ptr = excPtr - 16; + + this.set_type = function(type) { + HEAP32[(((this.ptr)+(4))>>2)] = type; + }; + + this.get_type = function() { + return HEAP32[(((this.ptr)+(4))>>2)]; + }; + + this.set_destructor = function(destructor) { + HEAP32[(((this.ptr)+(8))>>2)] = destructor; + }; + + this.get_destructor = function() { + return HEAP32[(((this.ptr)+(8))>>2)]; + }; + + this.set_refcount = function(refcount) { + HEAP32[((this.ptr)>>2)] = refcount; + }; + + this.set_caught = function (caught) { + caught = caught ? 1 : 0; + HEAP8[(((this.ptr)+(12))>>0)] = caught; + }; + + this.get_caught = function () { + return HEAP8[(((this.ptr)+(12))>>0)] != 0; + }; + + this.set_rethrown = function (rethrown) { + rethrown = rethrown ? 1 : 0; + HEAP8[(((this.ptr)+(13))>>0)] = rethrown; + }; + + this.get_rethrown = function () { + return HEAP8[(((this.ptr)+(13))>>0)] != 0; + }; + + // Initialize native structure fields. Should be called once after allocated. + this.init = function(type, destructor) { + this.set_type(type); + this.set_destructor(destructor); + this.set_refcount(0); + this.set_caught(false); + this.set_rethrown(false); + } + + this.add_ref = function() { + var value = HEAP32[((this.ptr)>>2)]; + HEAP32[((this.ptr)>>2)] = value + 1; + }; + + // Returns true if last reference released. + this.release_ref = function() { + var prev = HEAP32[((this.ptr)>>2)]; + HEAP32[((this.ptr)>>2)] = prev - 1; + assert(prev > 0); + return prev === 1; + }; + } + + /** + * @constructor + * @param {number=} ptr + */ + function CatchInfo(ptr) { + + this.free = function() { + _free(this.ptr); + this.ptr = 0; + }; + + this.set_base_ptr = function(basePtr) { + HEAP32[((this.ptr)>>2)] = basePtr; + }; + + this.get_base_ptr = function() { + return HEAP32[((this.ptr)>>2)]; + }; + + this.set_adjusted_ptr = function(adjustedPtr) { + HEAP32[(((this.ptr)+(4))>>2)] = adjustedPtr; + }; + + this.get_adjusted_ptr_addr = function() { + return this.ptr + 4; + } + + this.get_adjusted_ptr = function() { + return HEAP32[(((this.ptr)+(4))>>2)]; + }; + + // Get pointer which is expected to be received by catch clause in C++ code. It may be adjusted + // when the pointer is casted to some of the exception object base classes (e.g. when virtual + // inheritance is used). When a pointer is thrown this method should return the thrown pointer + // itself. + this.get_exception_ptr = function() { + // Work around a fastcomp bug, this code is still included for some reason in a build without + // exceptions support. + var isPointer = ___cxa_is_pointer_type( + this.get_exception_info().get_type()); + if (isPointer) { + return HEAP32[((this.get_base_ptr())>>2)]; + } + var adjusted = this.get_adjusted_ptr(); + if (adjusted !== 0) return adjusted; + return this.get_base_ptr(); + }; + + this.get_exception_info = function() { + return new ExceptionInfo(this.get_base_ptr()); + }; + + if (ptr === undefined) { + this.ptr = _malloc(8); + this.set_adjusted_ptr(0); + } else { + this.ptr = ptr; + } + } + + var exceptionCaught = []; + + function exception_addRef(info) { + info.add_ref(); + } + + var uncaughtExceptionCount = 0; + function ___cxa_begin_catch(ptr) { + var catchInfo = new CatchInfo(ptr); + var info = catchInfo.get_exception_info(); + if (!info.get_caught()) { + info.set_caught(true); + uncaughtExceptionCount--; + } + info.set_rethrown(false); + exceptionCaught.push(catchInfo); + exception_addRef(info); + return catchInfo.get_exception_ptr(); + } + + var exceptionLast = 0; + + function ___cxa_free_exception(ptr) { + try { + return _free(new ExceptionInfo(ptr).ptr); + } catch(e) { + err('exception during cxa_free_exception: ' + e); + } + } + function exception_decRef(info) { + // A rethrown exception can reach refcount 0; it must not be discarded + // Its next handler will clear the rethrown flag and addRef it, prior to + // final decRef and destruction here + if (info.release_ref() && !info.get_rethrown()) { + var destructor = info.get_destructor(); + if (destructor) { + // In Wasm, destructors return 'this' as in ARM + (function(a1) { return dynCall_ii.apply(null, [destructor, a1]); })(info.excPtr); + } + ___cxa_free_exception(info.excPtr); + } + } + function ___cxa_end_catch() { + // Clear state flag. + _setThrew(0); + assert(exceptionCaught.length > 0); + // Call destructor if one is registered then clear it. + var catchInfo = exceptionCaught.pop(); + + exception_decRef(catchInfo.get_exception_info()); + catchInfo.free(); + exceptionLast = 0; // XXX in decRef? + } + + function ___resumeException(catchInfoPtr) { + var catchInfo = new CatchInfo(catchInfoPtr); + var ptr = catchInfo.get_base_ptr(); + if (!exceptionLast) { exceptionLast = ptr; } + catchInfo.free(); + throw ptr; + } + function ___cxa_find_matching_catch_2() { + var thrown = exceptionLast; + if (!thrown) { + // just pass through the null ptr + setTempRet0(0); return ((0)|0); + } + var info = new ExceptionInfo(thrown); + var thrownType = info.get_type(); + var catchInfo = new CatchInfo(); + catchInfo.set_base_ptr(thrown); + catchInfo.set_adjusted_ptr(thrown); + if (!thrownType) { + // just pass through the thrown ptr + setTempRet0(0); return ((catchInfo.ptr)|0); + } + var typeArray = Array.prototype.slice.call(arguments); + + // can_catch receives a **, add indirection + // The different catch blocks are denoted by different types. + // Due to inheritance, those types may not precisely match the + // type of the thrown object. Find one which matches, and + // return the type of the catch block which should be called. + for (var i = 0; i < typeArray.length; i++) { + var caughtType = typeArray[i]; + if (caughtType === 0 || caughtType === thrownType) { + // Catch all clause matched or exactly the same type is caught + break; + } + if (___cxa_can_catch(caughtType, thrownType, catchInfo.get_adjusted_ptr_addr())) { + setTempRet0(caughtType); return ((catchInfo.ptr)|0); + } + } + setTempRet0(thrownType); return ((catchInfo.ptr)|0); + } + + function ___cxa_find_matching_catch_3() { + var thrown = exceptionLast; + if (!thrown) { + // just pass through the null ptr + setTempRet0(0); return ((0)|0); + } + var info = new ExceptionInfo(thrown); + var thrownType = info.get_type(); + var catchInfo = new CatchInfo(); + catchInfo.set_base_ptr(thrown); + catchInfo.set_adjusted_ptr(thrown); + if (!thrownType) { + // just pass through the thrown ptr + setTempRet0(0); return ((catchInfo.ptr)|0); + } + var typeArray = Array.prototype.slice.call(arguments); + + // can_catch receives a **, add indirection + // The different catch blocks are denoted by different types. + // Due to inheritance, those types may not precisely match the + // type of the thrown object. Find one which matches, and + // return the type of the catch block which should be called. + for (var i = 0; i < typeArray.length; i++) { + var caughtType = typeArray[i]; + if (caughtType === 0 || caughtType === thrownType) { + // Catch all clause matched or exactly the same type is caught + break; + } + if (___cxa_can_catch(caughtType, thrownType, catchInfo.get_adjusted_ptr_addr())) { + setTempRet0(caughtType); return ((catchInfo.ptr)|0); + } + } + setTempRet0(thrownType); return ((catchInfo.ptr)|0); + } + + function ___cxa_find_matching_catch_4() { + var thrown = exceptionLast; + if (!thrown) { + // just pass through the null ptr + setTempRet0(0); return ((0)|0); + } + var info = new ExceptionInfo(thrown); + var thrownType = info.get_type(); + var catchInfo = new CatchInfo(); + catchInfo.set_base_ptr(thrown); + catchInfo.set_adjusted_ptr(thrown); + if (!thrownType) { + // just pass through the thrown ptr + setTempRet0(0); return ((catchInfo.ptr)|0); + } + var typeArray = Array.prototype.slice.call(arguments); + + // can_catch receives a **, add indirection + // The different catch blocks are denoted by different types. + // Due to inheritance, those types may not precisely match the + // type of the thrown object. Find one which matches, and + // return the type of the catch block which should be called. + for (var i = 0; i < typeArray.length; i++) { + var caughtType = typeArray[i]; + if (caughtType === 0 || caughtType === thrownType) { + // Catch all clause matched or exactly the same type is caught + break; + } + if (___cxa_can_catch(caughtType, thrownType, catchInfo.get_adjusted_ptr_addr())) { + setTempRet0(caughtType); return ((catchInfo.ptr)|0); + } + } + setTempRet0(thrownType); return ((catchInfo.ptr)|0); + } + + + function ___cxa_rethrow() { + var catchInfo = exceptionCaught.pop(); + if (!catchInfo) { + abort('no exception to throw'); + } + var info = catchInfo.get_exception_info(); + var ptr = catchInfo.get_base_ptr(); + if (!info.get_rethrown()) { + // Only pop if the corresponding push was through rethrow_primary_exception + exceptionCaught.push(catchInfo); + info.set_rethrown(true); + info.set_caught(false); + uncaughtExceptionCount++; + } else { + catchInfo.free(); + } + exceptionLast = ptr; + throw ptr; + } + + function ___cxa_throw(ptr, type, destructor) { + var info = new ExceptionInfo(ptr); + // Initialize ExceptionInfo content after it was allocated in __cxa_allocate_exception. + info.init(type, destructor); + exceptionLast = ptr; + uncaughtExceptionCount++; + throw ptr; + } + + + var PATH = {splitPath:function(filename) { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + },normalizeArray:function(parts, allowAboveRoot) { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift('..'); + } + } + return parts; + },normalize:function(path) { + var isAbsolute = path.charAt(0) === '/', + trailingSlash = path.substr(-1) === '/'; + // Normalize the path + path = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), !isAbsolute).join('/'); + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + return (isAbsolute ? '/' : '') + path; + },dirname:function(path) { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + },basename:function(path) { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === '/') return '/'; + path = PATH.normalize(path); + path = path.replace(/\/$/, ""); + var lastSlash = path.lastIndexOf('/'); + if (lastSlash === -1) return path; + return path.substr(lastSlash+1); + },extname:function(path) { + return PATH.splitPath(path)[3]; + },join:function() { + var paths = Array.prototype.slice.call(arguments, 0); + return PATH.normalize(paths.join('/')); + },join2:function(l, r) { + return PATH.normalize(l + '/' + r); + }}; + + function getRandomDevice() { + if (typeof crypto == 'object' && typeof crypto['getRandomValues'] == 'function') { + // for modern web browsers + var randomBuffer = new Uint8Array(1); + return function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; + } else + if (ENVIRONMENT_IS_NODE) { + // for nodejs with or without crypto support included + try { + var crypto_module = require('crypto'); + // nodejs has crypto support + return function() { return crypto_module['randomBytes'](1)[0]; }; + } catch (e) { + // nodejs doesn't have crypto support + } + } + // we couldn't find a proper implementation, as Math.random() is not suitable for /dev/random, see emscripten-core/emscripten/pull/7096 + return function() { abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };"); }; + } + + var PATH_FS = {resolve:function() { + var resolvedPath = '', + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path != 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + return ''; // an invalid portion invalidates the whole thing + } + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = path.charAt(0) === '/'; + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { + return !!p; + }), !resolvedAbsolute).join('/'); + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; + },relative:function(from, to) { + from = PATH_FS.resolve(from).substr(1); + to = PATH_FS.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join('/'); + }}; + + var TTY = {ttys:[],init:function () { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process['stdin']['setEncoding']('utf8'); + // } + },shutdown:function() { + // https://github.com/emscripten-core/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process['stdin']['pause'](); + // } + },register:function(dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + },stream_ops:{open:function(stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(43); + } + stream.tty = tty; + stream.seekable = false; + },close:function(stream) { + // flush any pending line data + stream.tty.ops.flush(stream.tty); + },flush:function(stream) { + stream.tty.ops.flush(stream.tty); + },read:function(stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(60); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + },write:function(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(60); + } + try { + for (var i = 0; i < length; i++) { + stream.tty.ops.put_char(stream.tty, buffer[offset+i]); + } + } catch (e) { + throw new FS.ErrnoError(29); + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + }},default_tty_ops:{get_char:function(tty) { + if (!tty.input.length) { + var result = null; + if (ENVIRONMENT_IS_NODE) { + // we will read data by chunks of BUFSIZE + var BUFSIZE = 256; + var buf = Buffer.alloc(BUFSIZE); + var bytesRead = 0; + + try { + bytesRead = fs.readSync(process.stdin.fd, buf, 0, BUFSIZE, -1); + } catch(e) { + // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, + // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. + if (e.toString().includes('EOF')) bytesRead = 0; + else throw e; + } + + if (bytesRead > 0) { + result = buf.slice(0, bytesRead).toString('utf-8'); + } else { + result = null; + } + } else + if (typeof window != 'undefined' && + typeof window.prompt == 'function') { + // Browser. + result = window.prompt('Input: '); // returns null on cancel + if (result !== null) { + result += '\n'; + } + } else if (typeof readline == 'function') { + // Command line. + result = readline(); + if (result !== null) { + result += '\n'; + } + } + if (!result) { + return null; + } + tty.input = intArrayFromString(result, true); + } + return tty.input.shift(); + },put_char:function(tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + },flush:function(tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }},default_tty1_ops:{put_char:function(tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + },flush:function(tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }}}; + + function zeroMemory(address, size) { + HEAPU8.fill(0, address, address + size); + } + + function alignMemory(size, alignment) { + assert(alignment, "alignment argument is required"); + return Math.ceil(size / alignment) * alignment; + } + function mmapAlloc(size) { + size = alignMemory(size, 65536); + var ptr = _emscripten_builtin_memalign(65536, size); + if (!ptr) return 0; + zeroMemory(ptr, size); + return ptr; + } + var MEMFS = {ops_table:null,mount:function(mount) { + return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createNode:function(parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(63); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + parent.timestamp = node.timestamp; + } + return node; + },getFileDataAsTypedArray:function(node) { + if (!node.contents) return new Uint8Array(0); + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + },expandFileStorage:function(node, newCapacity) { + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) >>> 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + },resizeFileStorage:function(node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + } else { + var oldContents = node.contents; + node.contents = new Uint8Array(newSize); // Allocate new storage. + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + } + },node_ops:{getattr:function(node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + },setattr:function(node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + },lookup:function(parent, name) { + throw FS.genericErrors[44]; + },mknod:function(parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + },rename:function(old_node, new_dir, new_name) { + // if we're overwriting a directory at new_name, make sure it's empty. + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + } + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(55); + } + } + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + old_node.parent.timestamp = Date.now() + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + new_dir.timestamp = old_node.parent.timestamp; + old_node.parent = new_dir; + },unlink:function(parent, name) { + delete parent.contents[name]; + parent.timestamp = Date.now(); + },rmdir:function(parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(55); + } + delete parent.contents[name]; + parent.timestamp = Date.now(); + },readdir:function(node) { + var entries = ['.', '..']; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function(parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); + node.link = oldpath; + return node; + },readlink:function(node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(28); + } + return node.link; + }},stream_ops:{read:function(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + },write:function(stream, buffer, offset, length, position, canOwn) { + // The data buffer should be a typed array view + assert(!(buffer instanceof ArrayBuffer)); + // If the buffer is located in main memory (HEAP), and if + // memory can grow, we can't hold on to references of the + // memory buffer, as they may get invalidated. That means we + // need to do copy its contents. + if (buffer.buffer === HEAP8.buffer) { + canOwn = false; + } + + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? + if (canOwn) { + assert(position === 0, 'canOwn must imply no weird position inside the file'); + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = buffer.slice(offset, offset + length); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position+length); + if (node.contents.subarray && buffer.subarray) { + // Use typed array write which is available. + node.contents.set(buffer.subarray(offset, offset + length), position); + } else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position + length); + return length; + },llseek:function(stream, offset, whence) { + var position = offset; + if (whence === 1) { + position += stream.position; + } else if (whence === 2) { + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(28); + } + return position; + },allocate:function(stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + },mmap:function(stream, address, length, position, prot, flags) { + if (address !== 0) { + // We don't currently support location hints for the address of the mapping + throw new FS.ErrnoError(28); + } + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if (!(flags & 2) && contents.buffer === buffer) { + // We can't emulate MAP_SHARED when the file is not backed by the buffer + // we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < contents.length) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + HEAP8.set(contents, ptr); + } + return { ptr: ptr, allocated: allocated }; + },msync:function(stream, buffer, offset, length, mmapFlags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (mmapFlags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + + var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }}}; + + /** @param {boolean=} noRunDep */ + function asyncLoad(url, onload, onerror, noRunDep) { + var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : ''; + readAsync(url, function(arrayBuffer) { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep); + }, function(event) { + if (onerror) { + onerror(); + } else { + throw 'Loading data file "' + url + '" failed.'; + } + }); + if (dep) addRunDependency(dep); + } + + var IDBFS = {dbs:{},indexedDB:() => { + if (typeof indexedDB != 'undefined') return indexedDB; + var ret = null; + if (typeof window == 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + assert(ret, 'IDBFS used, but indexedDB not supported'); + return ret; + },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function(mount) { + // reuse all of the core MEMFS functionality + return MEMFS.mount.apply(null, arguments); + },syncfs:(mount, populate, callback) => { + IDBFS.getLocalSet(mount, (err, local) => { + if (err) return callback(err); + + IDBFS.getRemoteSet(mount, (err, remote) => { + if (err) return callback(err); + + var src = populate ? remote : local; + var dst = populate ? local : remote; + + IDBFS.reconcile(src, dst, callback); + }); + }); + },getDB:(name, callback) => { + // check the cache first + var db = IDBFS.dbs[name]; + if (db) { + return callback(null, db); + } + + var req; + try { + req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); + } catch (e) { + return callback(e); + } + if (!req) { + return callback("Unable to connect to IndexedDB"); + } + req.onupgradeneeded = (e) => { + var db = /** @type {IDBDatabase} */ (e.target.result); + var transaction = e.target.transaction; + + var fileStore; + + if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { + fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); + } else { + fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); + } + + if (!fileStore.indexNames.contains('timestamp')) { + fileStore.createIndex('timestamp', 'timestamp', { unique: false }); + } + }; + req.onsuccess = () => { + db = /** @type {IDBDatabase} */ (req.result); + + // add to the cache + IDBFS.dbs[name] = db; + callback(null, db); + }; + req.onerror = (e) => { + callback(this.error); + e.preventDefault(); + }; + },getLocalSet:(mount, callback) => { + var entries = {}; + + function isRealDir(p) { + return p !== '.' && p !== '..'; + }; + function toAbsolute(root) { + return (p) => { + return PATH.join2(root, p); + } + }; + + var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); + + while (check.length) { + var path = check.pop(); + var stat; + + try { + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); + } + + entries[path] = { 'timestamp': stat.mtime }; + } + + return callback(null, { type: 'local', entries: entries }); + },getRemoteSet:(mount, callback) => { + var entries = {}; + + IDBFS.getDB(mount.mountpoint, (err, db) => { + if (err) return callback(err); + + try { + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); + transaction.onerror = (e) => { + callback(this.error); + e.preventDefault(); + }; + + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + var index = store.index('timestamp'); + + index.openKeyCursor().onsuccess = (event) => { + var cursor = event.target.result; + + if (!cursor) { + return callback(null, { type: 'remote', db: db, entries: entries }); + } + + entries[cursor.primaryKey] = { 'timestamp': cursor.key }; + + cursor.continue(); + }; + } catch (e) { + return callback(e); + } + }); + },loadLocalEntry:(path, callback) => { + var stat, node; + + try { + var lookup = FS.lookupPath(path); + node = lookup.node; + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + return callback(null, { 'timestamp': stat.mtime, 'mode': stat.mode }); + } else if (FS.isFile(stat.mode)) { + // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. + // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. + node.contents = MEMFS.getFileDataAsTypedArray(node); + return callback(null, { 'timestamp': stat.mtime, 'mode': stat.mode, 'contents': node.contents }); + } else { + return callback(new Error('node type not supported')); + } + },storeLocalEntry:(path, entry, callback) => { + try { + if (FS.isDir(entry['mode'])) { + FS.mkdirTree(path, entry['mode']); + } else if (FS.isFile(entry['mode'])) { + FS.writeFile(path, entry['contents'], { canOwn: true }); + } else { + return callback(new Error('node type not supported')); + } + + FS.chmod(path, entry['mode']); + FS.utime(path, entry['timestamp'], entry['timestamp']); + } catch (e) { + return callback(e); + } + + callback(null); + },removeLocalEntry:(path, callback) => { + try { + var lookup = FS.lookupPath(path); + var stat = FS.stat(path); + + if (FS.isDir(stat.mode)) { + FS.rmdir(path); + } else if (FS.isFile(stat.mode)) { + FS.unlink(path); + } + } catch (e) { + return callback(e); + } + + callback(null); + },loadRemoteEntry:(store, path, callback) => { + var req = store.get(path); + req.onsuccess = (event) => { callback(null, event.target.result); }; + req.onerror = (e) => { + callback(this.error); + e.preventDefault(); + }; + },storeRemoteEntry:(store, path, entry, callback) => { + try { + var req = store.put(entry, path); + } catch (e) { + callback(e); + return; + } + req.onsuccess = () => { callback(null); }; + req.onerror = (e) => { + callback(this.error); + e.preventDefault(); + }; + },removeRemoteEntry:(store, path, callback) => { + var req = store.delete(path); + req.onsuccess = () => { callback(null); }; + req.onerror = (e) => { + callback(this.error); + e.preventDefault(); + }; + },reconcile:(src, dst, callback) => { + var total = 0; + + var create = []; + Object.keys(src.entries).forEach(function (key) { + var e = src.entries[key]; + var e2 = dst.entries[key]; + if (!e2 || e['timestamp'].getTime() != e2['timestamp'].getTime()) { + create.push(key); + total++; + } + }); + + var remove = []; + Object.keys(dst.entries).forEach(function (key) { + if (!src.entries[key]) { + remove.push(key); + total++; + } + }); + + if (!total) { + return callback(null); + } + + var errored = false; + var db = src.type === 'remote' ? src.db : dst.db; + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + + function done(err) { + if (err && !errored) { + errored = true; + return callback(err); + } + }; + + transaction.onerror = (e) => { + done(this.error); + e.preventDefault(); + }; + + transaction.oncomplete = (e) => { + if (!errored) { + callback(null); + } + }; + + // sort paths in ascending order so directory entries are created + // before the files inside them + create.sort().forEach((path) => { + if (dst.type === 'local') { + IDBFS.loadRemoteEntry(store, path, (err, entry) => { + if (err) return done(err); + IDBFS.storeLocalEntry(path, entry, done); + }); + } else { + IDBFS.loadLocalEntry(path, (err, entry) => { + if (err) return done(err); + IDBFS.storeRemoteEntry(store, path, entry, done); + }); + } + }); + + // sort paths in descending order so files are deleted before their + // parent directories + remove.sort().reverse().forEach((path) => { + if (dst.type === 'local') { + IDBFS.removeLocalEntry(path, done); + } else { + IDBFS.removeRemoteEntry(store, path, done); + } + }); + }}; + + var ERRNO_MESSAGES = {0:"Success",1:"Arg list too long",2:"Permission denied",3:"Address already in use",4:"Address not available",5:"Address family not supported by protocol family",6:"No more processes",7:"Socket already connected",8:"Bad file number",9:"Trying to read unreadable message",10:"Mount device busy",11:"Operation canceled",12:"No children",13:"Connection aborted",14:"Connection refused",15:"Connection reset by peer",16:"File locking deadlock error",17:"Destination address required",18:"Math arg out of domain of func",19:"Quota exceeded",20:"File exists",21:"Bad address",22:"File too large",23:"Host is unreachable",24:"Identifier removed",25:"Illegal byte sequence",26:"Connection already in progress",27:"Interrupted system call",28:"Invalid argument",29:"I/O error",30:"Socket is already connected",31:"Is a directory",32:"Too many symbolic links",33:"Too many open files",34:"Too many links",35:"Message too long",36:"Multihop attempted",37:"File or path name too long",38:"Network interface is not configured",39:"Connection reset by network",40:"Network is unreachable",41:"Too many open files in system",42:"No buffer space available",43:"No such device",44:"No such file or directory",45:"Exec format error",46:"No record locks available",47:"The link has been severed",48:"Not enough core",49:"No message of desired type",50:"Protocol not available",51:"No space left on device",52:"Function not implemented",53:"Socket is not connected",54:"Not a directory",55:"Directory not empty",56:"State not recoverable",57:"Socket operation on non-socket",59:"Not a typewriter",60:"No such device or address",61:"Value too large for defined data type",62:"Previous owner died",63:"Not super-user",64:"Broken pipe",65:"Protocol error",66:"Unknown protocol",67:"Protocol wrong type for socket",68:"Math result not representable",69:"Read only file system",70:"Illegal seek",71:"No such process",72:"Stale file handle",73:"Connection timed out",74:"Text file busy",75:"Cross-device link",100:"Device not a stream",101:"Bad font file fmt",102:"Invalid slot",103:"Invalid request code",104:"No anode",105:"Block device required",106:"Channel number out of range",107:"Level 3 halted",108:"Level 3 reset",109:"Link number out of range",110:"Protocol driver not attached",111:"No CSI structure available",112:"Level 2 halted",113:"Invalid exchange",114:"Invalid request descriptor",115:"Exchange full",116:"No data (for no delay io)",117:"Timer expired",118:"Out of streams resources",119:"Machine is not on the network",120:"Package not installed",121:"The object is remote",122:"Advertise error",123:"Srmount error",124:"Communication error on send",125:"Cross mount point (not really error)",126:"Given log. name not unique",127:"f.d. invalid for this operation",128:"Remote address changed",129:"Can access a needed shared lib",130:"Accessing a corrupted shared lib",131:".lib section in a.out corrupted",132:"Attempting to link in too many libs",133:"Attempting to exec a shared library",135:"Streams pipe error",136:"Too many users",137:"Socket type not supported",138:"Not supported",139:"Protocol family not supported",140:"Can't send after socket shutdown",141:"Too many references",142:"Host is down",148:"No medium (in tape drive)",156:"Level 2 not synchronized"}; + + var ERRNO_CODES = {}; + var FS = {root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,lookupPath:(path, opts = {}) => { + path = PATH_FS.resolve(FS.cwd(), path); + + if (!path) return { path: '', node: null }; + + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + opts = Object.assign(defaults, opts) + + if (opts.recurse_count > 8) { // max recursive lookup of 8 + throw new FS.ErrnoError(32); + } + + // split the path + var parts = PATH.normalizeArray(path.split('/').filter((p) => !!p), false); + + // start at the root + var current = FS.root; + var current_path = '/'; + + for (var i = 0; i < parts.length; i++) { + var islast = (i === parts.length-1); + if (islast && opts.parent) { + // stop resolving + break; + } + + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current)) { + if (!islast || (islast && opts.follow_mount)) { + current = current.mounted.root; + } + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH_FS.resolve(PATH.dirname(current_path), link); + + var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count + 1 }); + current = lookup.node; + + if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + throw new FS.ErrnoError(32); + } + } + } + } + + return { path: current_path, node: current }; + },getPath:(node) => { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; + } + path = path ? node.name + '/' + path : node.name; + node = node.parent; + } + },hashName:(parentid, name) => { + var hash = 0; + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + },hashAddNode:(node) => { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + },hashRemoveNode:(node) => { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + },lookupNode:(parent, name) => { + var errCode = FS.mayLookup(parent); + if (errCode) { + throw new FS.ErrnoError(errCode, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + },createNode:(parent, name, mode, rdev) => { + assert(typeof parent == 'object') + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + },destroyNode:(node) => { + FS.hashRemoveNode(node); + },isRoot:(node) => { + return node === node.parent; + },isMountpoint:(node) => { + return !!node.mounted; + },isFile:(mode) => { + return (mode & 61440) === 32768; + },isDir:(mode) => { + return (mode & 61440) === 16384; + },isLink:(mode) => { + return (mode & 61440) === 40960; + },isChrdev:(mode) => { + return (mode & 61440) === 8192; + },isBlkdev:(mode) => { + return (mode & 61440) === 24576; + },isFIFO:(mode) => { + return (mode & 61440) === 4096; + },isSocket:(mode) => { + return (mode & 49152) === 49152; + },flagModes:{"r":0,"r+":2,"w":577,"w+":578,"a":1089,"a+":1090},modeStringToFlags:(str) => { + var flags = FS.flagModes[str]; + if (typeof flags == 'undefined') { + throw new Error('Unknown file open mode: ' + str); + } + return flags; + },flagsToPermissionString:(flag) => { + var perms = ['r', 'w', 'rw'][flag & 3]; + if ((flag & 512)) { + perms += 'w'; + } + return perms; + },nodePermissions:(node, perms) => { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.includes('r') && !(node.mode & 292)) { + return 2; + } else if (perms.includes('w') && !(node.mode & 146)) { + return 2; + } else if (perms.includes('x') && !(node.mode & 73)) { + return 2; + } + return 0; + },mayLookup:(dir) => { + var errCode = FS.nodePermissions(dir, 'x'); + if (errCode) return errCode; + if (!dir.node_ops.lookup) return 2; + return 0; + },mayCreate:(dir, name) => { + try { + var node = FS.lookupNode(dir, name); + return 20; + } catch (e) { + } + return FS.nodePermissions(dir, 'wx'); + },mayDelete:(dir, name, isdir) => { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var errCode = FS.nodePermissions(dir, 'wx'); + if (errCode) { + return errCode; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return 54; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return 10; + } + } else { + if (FS.isDir(node.mode)) { + return 31; + } + } + return 0; + },mayOpen:(node, flags) => { + if (!node) { + return 44; + } + if (FS.isLink(node.mode)) { + return 32; + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write + (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) + return 31; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + },MAX_OPEN_FDS:4096,nextfd:(fd_start = 0, fd_end = FS.MAX_OPEN_FDS) => { + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(33); + },getStream:(fd) => FS.streams[fd],createStream:(stream, fd_start, fd_end) => { + if (!FS.FSStream) { + FS.FSStream = /** @constructor */ function(){}; + FS.FSStream.prototype = { + object: { + get: function() { return this.node; }, + set: function(val) { this.node = val; } + }, + isRead: { + get: function() { return (this.flags & 2097155) !== 1; } + }, + isWrite: { + get: function() { return (this.flags & 2097155) !== 0; } + }, + isAppend: { + get: function() { return (this.flags & 1024); } + } + }; + } + // clone it, so we can return an instance of FSStream + stream = Object.assign(new FS.FSStream(), stream); + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + },closeStream:(fd) => { + FS.streams[fd] = null; + },chrdev_stream_ops:{open:(stream) => { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + },llseek:() => { + throw new FS.ErrnoError(70); + }},major:(dev) => ((dev) >> 8),minor:(dev) => ((dev) & 0xff),makedev:(ma, mi) => ((ma) << 8 | (mi)),registerDevice:(dev, ops) => { + FS.devices[dev] = { stream_ops: ops }; + },getDevice:(dev) => FS.devices[dev],getMounts:(mount) => { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push.apply(check, m.mounts); + } + + return mounts; + },syncfs:(populate, callback) => { + if (typeof populate == 'function') { + callback = populate; + populate = false; + } + + FS.syncFSRequests++; + + if (FS.syncFSRequests > 1) { + err('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work'); + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(errCode) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(errCode); + } + + function done(errCode) { + if (errCode) { + if (!done.errored) { + done.errored = true; + return doCallback(errCode); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + }; + + // sync all mounts + mounts.forEach((mount) => { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + },mount:(type, opts, mountpoint) => { + if (typeof type == 'string') { + // The filesystem was not included, and instead we have an error + // message stored in the variable. + throw type; + } + var root = mountpoint === '/'; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(10); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + } + + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + },unmount:(mountpoint) => { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(28); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach((hash) => { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.includes(current.mount)) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + },lookup:(parent, name) => { + return parent.node_ops.lookup(parent, name); + },mknod:(path, mode, dev) => { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === '.' || name === '..') { + throw new FS.ErrnoError(28); + } + var errCode = FS.mayCreate(parent, name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.mknod(parent, name, mode, dev); + },create:(path, mode) => { + mode = mode !== undefined ? mode : 438 /* 0666 */; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + },mkdir:(path, mode) => { + mode = mode !== undefined ? mode : 511 /* 0777 */; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + },mkdirTree:(path, mode) => { + var dirs = path.split('/'); + var d = ''; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += '/' + dirs[i]; + try { + FS.mkdir(d, mode); + } catch(e) { + if (e.errno != 20) throw e; + } + } + },mkdev:(path, mode, dev) => { + if (typeof dev == 'undefined') { + dev = mode; + mode = 438 /* 0666 */; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + },symlink:(oldpath, newpath) => { + if (!PATH_FS.resolve(oldpath)) { + throw new FS.ErrnoError(44); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var newname = PATH.basename(newpath); + var errCode = FS.mayCreate(parent, newname); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.symlink(parent, newname, oldpath); + },rename:(old_path, new_path) => { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + + // let the errors from non existant directories percolate up + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + + if (!old_dir || !new_dir) throw new FS.ErrnoError(44); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(75); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH_FS.relative(old_path, new_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(28); + } + // new path should not be an ancestor of the old path + relative = PATH_FS.relative(new_path, old_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(55); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var errCode = FS.mayDelete(old_dir, old_name, isdir); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + errCode = new_node ? + FS.mayDelete(new_dir, new_name, isdir) : + FS.mayCreate(new_dir, new_name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { + throw new FS.ErrnoError(10); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + errCode = FS.nodePermissions(old_dir, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + },rmdir:(path) => { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, true); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + },readdir:(path) => { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(54); + } + return node.node_ops.readdir(node); + },unlink:(path) => { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, false); + if (errCode) { + // According to POSIX, we should map EISDIR to EPERM, but + // we instead do what Linux does (and we must, as we use + // the musl linux libc). + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + },readlink:(path) => { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(44); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(28); + } + return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + },stat:(path, dontFollow) => { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(44); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(63); + } + return node.node_ops.getattr(node); + },lstat:(path) => { + return FS.stat(path, true); + },chmod:(path, mode, dontFollow) => { + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + timestamp: Date.now() + }); + },lchmod:(path, mode) => { + FS.chmod(path, mode, true); + },fchmod:(fd, mode) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chmod(stream.node, mode); + },chown:(path, uid, gid, dontFollow) => { + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + // we ignore the uid / gid for now + }); + },lchown:(path, uid, gid) => { + FS.chown(path, uid, gid, true); + },fchown:(fd, uid, gid) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chown(stream.node, uid, gid); + },truncate:(path, len) => { + if (len < 0) { + throw new FS.ErrnoError(28); + } + var node; + if (typeof path == 'string') { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(31); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(28); + } + var errCode = FS.nodePermissions(node, 'w'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + },ftruncate:(fd, len) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(28); + } + FS.truncate(stream.node, len); + },utime:(path, atime, mtime) => { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + },open:(path, flags, mode, fd_start, fd_end) => { + if (path === "") { + throw new FS.ErrnoError(44); + } + flags = typeof flags == 'string' ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode == 'undefined' ? 438 /* 0666 */ : mode; + if ((flags & 64)) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path == 'object') { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) { + // ignore + } + } + // perhaps we need to create the node + var created = false; + if ((flags & 64)) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if ((flags & 128)) { + throw new FS.ErrnoError(20); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(44); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if ((flags & 65536) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var errCode = FS.mayOpen(node, flags); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + // do truncation if necessary + if ((flags & 512)) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512 | 131072); + + // register the stream with the filesystem + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), // we want the absolute path to the node + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false + }, fd_start, fd_end); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module['logReadFiles'] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + } + } + return stream; + },close:(stream) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + stream.fd = null; + },isClosed:(stream) => { + return stream.fd === null; + },llseek:(stream, offset, whence) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(70); + } + if (whence != 0 && whence != 1 && whence != 2) { + throw new FS.ErrnoError(28); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + },read:(stream, buffer, offset, length, position) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(28); + } + var seeking = typeof position != 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + },write:(stream, buffer, offset, length, position, canOwn) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(28); + } + if (stream.seekable && stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = typeof position != 'undefined'; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + return bytesWritten; + },allocate:(stream, offset, length) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(28); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(138); + } + stream.stream_ops.allocate(stream, offset, length); + },mmap:(stream, address, length, position, prot, flags) => { + // User requests writing to file (prot & PROT_WRITE != 0). + // Checking if we have permissions to write to the file unless + // MAP_PRIVATE flag is set. According to POSIX spec it is possible + // to write to file opened in read-only mode with MAP_PRIVATE flag, + // as all modifications will be visible only in the memory of + // the current process. + if ((prot & 2) !== 0 + && (flags & 2) === 0 + && (stream.flags & 2097155) !== 2) { + throw new FS.ErrnoError(2); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(2); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(43); + } + return stream.stream_ops.mmap(stream, address, length, position, prot, flags); + },msync:(stream, buffer, offset, length, mmapFlags) => { + if (!stream || !stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + },munmap:(stream) => 0,ioctl:(stream, cmd, arg) => { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(59); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + },readFile:(path, opts = {}) => { + opts.flags = opts.flags || 0; + opts.encoding = opts.encoding || 'binary'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === 'utf8') { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === 'binary') { + ret = buf; + } + FS.close(stream); + return ret; + },writeFile:(path, data, opts = {}) => { + opts.flags = opts.flags || 577; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data == 'string') { + var buf = new Uint8Array(lengthBytesUTF8(data)+1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); + } else { + throw new Error('Unsupported data type'); + } + FS.close(stream); + },cwd:() => FS.currentPath,chdir:(path) => { + var lookup = FS.lookupPath(path, { follow: true }); + if (lookup.node === null) { + throw new FS.ErrnoError(44); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(54); + } + var errCode = FS.nodePermissions(lookup.node, 'x'); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + FS.currentPath = lookup.path; + },createDefaultDirectories:() => { + FS.mkdir('/tmp'); + FS.mkdir('/home'); + FS.mkdir('/home/web_user'); + },createDefaultDevices:() => { + // create /dev + FS.mkdir('/dev'); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: () => 0, + write: (stream, buffer, offset, length, pos) => length, + }); + FS.mkdev('/dev/null', FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using err() rather than out() + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev('/dev/tty', FS.makedev(5, 0)); + FS.mkdev('/dev/tty1', FS.makedev(6, 0)); + // setup /dev/[u]random + var random_device = getRandomDevice(); + FS.createDevice('/dev', 'random', random_device); + FS.createDevice('/dev', 'urandom', random_device); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir('/dev/shm'); + FS.mkdir('/dev/shm/tmp'); + },createSpecialDirectories:() => { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the + // name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir('/proc'); + var proc_self = FS.mkdir('/proc/self'); + FS.mkdir('/proc/self/fd'); + FS.mount({ + mount: () => { + var node = FS.createNode(proc_self, 'fd', 16384 | 511 /* 0777 */, 73); + node.node_ops = { + lookup: (parent, name) => { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + var ret = { + parent: null, + mount: { mountpoint: 'fake' }, + node_ops: { readlink: () => stream.path }, + }; + ret.parent = ret; // make it look like a simple root node + return ret; + } + }; + return node; + } + }, {}, '/proc/self/fd'); + },createStandardStreams:() => { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (Module['stdin']) { + FS.createDevice('/dev', 'stdin', Module['stdin']); + } else { + FS.symlink('/dev/tty', '/dev/stdin'); + } + if (Module['stdout']) { + FS.createDevice('/dev', 'stdout', null, Module['stdout']); + } else { + FS.symlink('/dev/tty', '/dev/stdout'); + } + if (Module['stderr']) { + FS.createDevice('/dev', 'stderr', null, Module['stderr']); + } else { + FS.symlink('/dev/tty1', '/dev/stderr'); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open('/dev/stdin', 0); + var stdout = FS.open('/dev/stdout', 1); + var stderr = FS.open('/dev/stderr', 1); + assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); + assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); + assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); + },ensureErrnoError:() => { + if (FS.ErrnoError) return; + FS.ErrnoError = /** @this{Object} */ function ErrnoError(errno, node) { + this.node = node; + this.setErrno = /** @this{Object} */ function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + + // Try to get a maximally helpful stack trace. On Node.js, getting Error.stack + // now ensures it shows what we want. + if (this.stack) { + // Define the stack property for Node.js 4, which otherwise errors on the next line. + Object.defineProperty(this, "stack", { value: (new Error).stack, writable: true }); + this.stack = demangleAll(this.stack); + } + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) + [44].forEach((code) => { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = ''; + }); + },staticInit:() => { + FS.ensureErrnoError(); + + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, '/'); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + 'MEMFS': MEMFS, + 'IDBFS': IDBFS, + }; + },init:(input, output, error) => { + assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); + FS.init.initialized = true; + + FS.ensureErrnoError(); + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + Module['stdin'] = input || Module['stdin']; + Module['stdout'] = output || Module['stdout']; + Module['stderr'] = error || Module['stderr']; + + FS.createStandardStreams(); + },quit:() => { + FS.init.initialized = false; + // Call musl-internal function to close all stdio streams, so nothing is + // left in internal buffers. + ___stdio_exit(); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + },getMode:(canRead, canWrite) => { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + },findObject:(path, dontResolveLastLink) => { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (ret.exists) { + return ret.object; + } else { + return null; + } + },analyzePath:(path, dontResolveLastLink) => { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) { + } + var ret = { + isRoot: false, exists: false, error: 0, name: null, path: null, object: null, + parentExists: false, parentPath: null, parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === '/'; + } catch (e) { + ret.error = e.errno; + }; + return ret; + },createPath:(parent, path, canRead, canWrite) => { + parent = typeof parent == 'string' ? parent : FS.getPath(parent); + var parts = path.split('/').reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + },createFile:(parent, name, properties, canRead, canWrite) => { + var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode); + },createDataFile:(parent, name, data, canRead, canWrite, canOwn) => { + var path = name; + if (parent) { + parent = typeof parent == 'string' ? parent : FS.getPath(parent); + path = name ? PATH.join2(parent, name) : parent; + } + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data == 'string') { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 577); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + },createDevice:(parent, name, input, output) => { + var path = PATH.join2(typeof parent == 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open: (stream) => { + stream.seekable = false; + }, + close: (stream) => { + // flush any pending line data + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read: (stream, buffer, offset, length, pos /* ignored */) => { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: (stream, buffer, offset, length, pos) => { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(29); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + },forceLoadFile:(obj) => { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + if (typeof XMLHttpRequest != 'undefined') { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (read_) { + // Command-line. + try { + // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as + // read() will try to parse UTF8. + obj.contents = intArrayFromString(read_(obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + throw new FS.ErrnoError(29); + } + } else { + throw new Error('Cannot load without read() or XMLHttpRequest.'); + } + },createLazyFile:(parent, name, url, canRead, canWrite) => { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. + /** @constructor */ + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; // Loaded chunks. Index is the chunk number + } + LazyUint8Array.prototype.get = /** @this{Object} */ function LazyUint8Array_get(idx) { + if (idx > this.length-1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize)|0; + return this.getter(chunkNum)[chunkOffset]; + }; + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + }; + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open('HEAD', url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + + var chunkSize = 1024*1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (from, to) => { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + xhr.responseType = 'arraybuffer'; + if (xhr.overrideMimeType) { + xhr.overrideMimeType('text/plain; charset=x-user-defined'); + } + + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(/** @type{Array} */(xhr.response || [])); + } else { + return intArrayFromString(xhr.responseText || '', true); + } + }; + var lazyArray = this; + lazyArray.setDataGetter((chunkNum) => { + var start = chunkNum * chunkSize; + var end = (chunkNum+1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block + if (typeof lazyArray.chunks[chunkNum] == 'undefined') { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof lazyArray.chunks[chunkNum] == 'undefined') throw new Error('doXHR failed!'); + return lazyArray.chunks[chunkNum]; + }); + + if (usesGzip || !datalength) { + // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length + chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file + datalength = this.getter(0).length; + chunkSize = datalength; + out("LazyFiles on gzip forces download of the whole file when length is accessed"); + } + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + }; + if (typeof XMLHttpRequest != 'undefined') { + if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; + var lazyArray = new LazyUint8Array(); + Object.defineProperties(lazyArray, { + length: { + get: /** @this{Object} */ function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }, + chunkSize: { + get: /** @this{Object} */ function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + }); + + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperties(node, { + usedBytes: { + get: /** @this {FSNode} */ function() { return this.contents.length; } + } + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach((key) => { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + FS.forceLoadFile(node); + return fn.apply(null, arguments); + }; + }); + // use a custom read function + stream_ops.read = (stream, buffer, offset, length, position) => { + FS.forceLoadFile(node); + var contents = stream.node.contents; + if (position >= contents.length) + return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + }; + node.stream_ops = stream_ops; + return node; + },createPreloadedFile:(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => { + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + if (Browser.handledByPreloadPlugin(byteArray, fullname, finish, () => { + if (onerror) onerror(); + removeRunDependency(dep); + })) { + return; + } + finish(byteArray); + } + addRunDependency(dep); + if (typeof url == 'string') { + asyncLoad(url, (byteArray) => processData(byteArray), onerror); + } else { + processData(url); + } + },indexedDB:() => { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + },DB_NAME:() => { + return 'EM_FS_' + window.location.pathname; + },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:(paths, onload, onerror) => { + onload = onload || (() => {}); + onerror = onerror || (() => {}); + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = () => { + out('creating db'); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME); + }; + openRequest.onsuccess = () => { + var db = openRequest.result; + var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach((path) => { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = () => { ok++; if (ok + fail == total) finish() }; + putRequest.onerror = () => { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },loadFilesFromDB:(paths, onload, onerror) => { + onload = onload || (() => {}); + onerror = onerror || (() => {}); + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = onerror; // no database to load from + openRequest.onsuccess = () => { + var db = openRequest.result; + try { + var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); + } catch(e) { + onerror(e); + return; + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach((path) => { + var getRequest = files.get(path); + getRequest.onsuccess = () => { + if (FS.analyzePath(path).exists) { + FS.unlink(path); + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish(); + }; + getRequest.onerror = () => { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },absolutePath:() => { + abort('FS.absolutePath has been removed; use PATH_FS.resolve instead'); + },createFolder:() => { + abort('FS.createFolder has been removed; use FS.mkdir instead'); + },createLink:() => { + abort('FS.createLink has been removed; use FS.symlink instead'); + },joinPath:() => { + abort('FS.joinPath has been removed; use PATH.join instead'); + },mmapAlloc:() => { + abort('FS.mmapAlloc has been replaced by the top level function mmapAlloc'); + },standardizePath:() => { + abort('FS.standardizePath has been removed; use PATH.normalize instead'); + }}; + var SYSCALLS = {DEFAULT_POLLMASK:5,calculateAt:function(dirfd, path, allowEmpty) { + if (path[0] === '/') { + return path; + } + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = FS.getStream(dirfd); + if (!dirstream) throw new FS.ErrnoError(8); + dir = dirstream.path; + } + if (path.length == 0) { + if (!allowEmpty) { + throw new FS.ErrnoError(44);; + } + return dir; + } + return PATH.join2(dir, path); + },doStat:function(func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + // an error occurred while trying to look up the path; we should just report ENOTDIR + return -54; + } + throw e; + } + HEAP32[((buf)>>2)] = stat.dev; + HEAP32[(((buf)+(4))>>2)] = 0; + HEAP32[(((buf)+(8))>>2)] = stat.ino; + HEAP32[(((buf)+(12))>>2)] = stat.mode; + HEAP32[(((buf)+(16))>>2)] = stat.nlink; + HEAP32[(((buf)+(20))>>2)] = stat.uid; + HEAP32[(((buf)+(24))>>2)] = stat.gid; + HEAP32[(((buf)+(28))>>2)] = stat.rdev; + HEAP32[(((buf)+(32))>>2)] = 0; + (tempI64 = [stat.size>>>0,(tempDouble=stat.size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(40))>>2)] = tempI64[0],HEAP32[(((buf)+(44))>>2)] = tempI64[1]); + HEAP32[(((buf)+(48))>>2)] = 4096; + HEAP32[(((buf)+(52))>>2)] = stat.blocks; + HEAP32[(((buf)+(56))>>2)] = (stat.atime.getTime() / 1000)|0; + HEAP32[(((buf)+(60))>>2)] = 0; + HEAP32[(((buf)+(64))>>2)] = (stat.mtime.getTime() / 1000)|0; + HEAP32[(((buf)+(68))>>2)] = 0; + HEAP32[(((buf)+(72))>>2)] = (stat.ctime.getTime() / 1000)|0; + HEAP32[(((buf)+(76))>>2)] = 0; + (tempI64 = [stat.ino>>>0,(tempDouble=stat.ino,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((buf)+(80))>>2)] = tempI64[0],HEAP32[(((buf)+(84))>>2)] = tempI64[1]); + return 0; + },doMsync:function(addr, stream, len, flags, offset) { + var buffer = HEAPU8.slice(addr, addr + len); + FS.msync(stream, buffer, offset, len, flags); + },doMkdir:function(path, mode) { + // remove a trailing slash, if one - /a/b/ has basename of '', but + // we want to create b in the context of this function + path = PATH.normalize(path); + if (path[path.length-1] === '/') path = path.substr(0, path.length-1); + FS.mkdir(path, mode, 0); + return 0; + },doMknod:function(path, mode, dev) { + // we don't want this in the JS API as it uses mknod to create all nodes. + switch (mode & 61440) { + case 32768: + case 8192: + case 24576: + case 4096: + case 49152: + break; + default: return -28; + } + FS.mknod(path, mode, dev); + return 0; + },doReadlink:function(path, buf, bufsize) { + if (bufsize <= 0) return -28; + var ret = FS.readlink(path); + + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = HEAP8[buf+len]; + stringToUTF8(ret, buf, bufsize+1); + // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) + // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. + HEAP8[buf+len] = endChar; + + return len; + },doAccess:function(path, amode) { + if (amode & ~7) { + // need a valid mode + return -28; + } + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node) { + return -44; + } + var perms = ''; + if (amode & 4) perms += 'r'; + if (amode & 2) perms += 'w'; + if (amode & 1) perms += 'x'; + if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { + return -2; + } + return 0; + },doReadv:function(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.read(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + } + return ret; + },doWritev:function(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.write(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + } + return ret; + },varargs:undefined,get:function() { + assert(SYSCALLS.varargs != undefined); + SYSCALLS.varargs += 4; + var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; + return ret; + },getStr:function(ptr) { + var ret = UTF8ToString(ptr); + return ret; + },getStreamFromFD:function(fd) { + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + return stream; + },get64:function(low, high) { + if (low >= 0) assert(high === 0); + else assert(high === -1); + return low; + }}; + function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) { + try { + + // readfds are supported, + // writefds checks socket open status + // exceptfds not supported + // timeout is always 0 - fully async + assert(nfds <= 64, 'nfds must be less than or equal to 64'); // fd sets have 64 bits // TODO: this could be 1024 based on current musl headers + assert(!exceptfds, 'exceptfds not supported'); + + var total = 0; + + var srcReadLow = (readfds ? HEAP32[((readfds)>>2)] : 0), + srcReadHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0); + var srcWriteLow = (writefds ? HEAP32[((writefds)>>2)] : 0), + srcWriteHigh = (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0); + var srcExceptLow = (exceptfds ? HEAP32[((exceptfds)>>2)] : 0), + srcExceptHigh = (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0); + + var dstReadLow = 0, + dstReadHigh = 0; + var dstWriteLow = 0, + dstWriteHigh = 0; + var dstExceptLow = 0, + dstExceptHigh = 0; + + var allLow = (readfds ? HEAP32[((readfds)>>2)] : 0) | + (writefds ? HEAP32[((writefds)>>2)] : 0) | + (exceptfds ? HEAP32[((exceptfds)>>2)] : 0); + var allHigh = (readfds ? HEAP32[(((readfds)+(4))>>2)] : 0) | + (writefds ? HEAP32[(((writefds)+(4))>>2)] : 0) | + (exceptfds ? HEAP32[(((exceptfds)+(4))>>2)] : 0); + + var check = function(fd, low, high, val) { + return (fd < 32 ? (low & val) : (high & val)); + }; + + for (var fd = 0; fd < nfds; fd++) { + var mask = 1 << (fd % 32); + if (!(check(fd, allLow, allHigh, mask))) { + continue; // index isn't in the set + } + + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + + var flags = SYSCALLS.DEFAULT_POLLMASK; + + if (stream.stream_ops.poll) { + flags = stream.stream_ops.poll(stream); + } + + if ((flags & 1) && check(fd, srcReadLow, srcReadHigh, mask)) { + fd < 32 ? (dstReadLow = dstReadLow | mask) : (dstReadHigh = dstReadHigh | mask); + total++; + } + if ((flags & 4) && check(fd, srcWriteLow, srcWriteHigh, mask)) { + fd < 32 ? (dstWriteLow = dstWriteLow | mask) : (dstWriteHigh = dstWriteHigh | mask); + total++; + } + if ((flags & 2) && check(fd, srcExceptLow, srcExceptHigh, mask)) { + fd < 32 ? (dstExceptLow = dstExceptLow | mask) : (dstExceptHigh = dstExceptHigh | mask); + total++; + } + } + + if (readfds) { + HEAP32[((readfds)>>2)] = dstReadLow; + HEAP32[(((readfds)+(4))>>2)] = dstReadHigh; + } + if (writefds) { + HEAP32[((writefds)>>2)] = dstWriteLow; + HEAP32[(((writefds)+(4))>>2)] = dstWriteHigh; + } + if (exceptfds) { + HEAP32[((exceptfds)>>2)] = dstExceptLow; + HEAP32[(((exceptfds)+(4))>>2)] = dstExceptHigh; + } + + return total; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + var SOCKFS = {mount:function(mount) { + // If Module['websocket'] has already been defined (e.g. for configuring + // the subprotocol/url) use that, if not initialise it to a new object. + Module['websocket'] = (Module['websocket'] && + ('object' === typeof Module['websocket'])) ? Module['websocket'] : {}; + + // Add the Event registration mechanism to the exported websocket configuration + // object so we can register network callbacks from native JavaScript too. + // For more documentation see system/include/emscripten/emscripten.h + Module['websocket']._callbacks = {}; + Module['websocket']['on'] = /** @this{Object} */ function(event, callback) { + if ('function' === typeof callback) { + this._callbacks[event] = callback; + } + return this; + }; + + Module['websocket'].emit = /** @this{Object} */ function(event, param) { + if ('function' === typeof this._callbacks[event]) { + this._callbacks[event].call(this, param); + } + }; + + // If debug is enabled register simple default logging callbacks for each Event. + + return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createSocket:function(family, type, protocol) { + type &= ~526336; // Some applications may pass it; it makes no sense for a single process. + var streaming = type == 1; + if (streaming && protocol && protocol != 6) { + throw new FS.ErrnoError(66); // if SOCK_STREAM, must be tcp or 0. + } + + // create our internal socket structure + var sock = { + family: family, + type: type, + protocol: protocol, + server: null, + error: null, // Used in getsockopt for SOL_SOCKET/SO_ERROR test + peers: {}, + pending: [], + recv_queue: [], + sock_ops: SOCKFS.websocket_sock_ops + }; + + // create the filesystem node to store the socket structure + var name = SOCKFS.nextname(); + var node = FS.createNode(SOCKFS.root, name, 49152, 0); + node.sock = sock; + + // and the wrapping stream that enables library functions such + // as read and write to indirectly interact with the socket + var stream = FS.createStream({ + path: name, + node: node, + flags: 2, + seekable: false, + stream_ops: SOCKFS.stream_ops + }); + + // map the new stream to the socket structure (sockets have a 1:1 + // relationship with a stream) + sock.stream = stream; + + return sock; + },getSocket:function(fd) { + var stream = FS.getStream(fd); + if (!stream || !FS.isSocket(stream.node.mode)) { + return null; + } + return stream.node.sock; + },stream_ops:{poll:function(stream) { + var sock = stream.node.sock; + return sock.sock_ops.poll(sock); + },ioctl:function(stream, request, varargs) { + var sock = stream.node.sock; + return sock.sock_ops.ioctl(sock, request, varargs); + },read:function(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + var msg = sock.sock_ops.recvmsg(sock, length); + if (!msg) { + // socket is closed + return 0; + } + buffer.set(msg.buffer, offset); + return msg.buffer.length; + },write:function(stream, buffer, offset, length, position /* ignored */) { + var sock = stream.node.sock; + return sock.sock_ops.sendmsg(sock, buffer, offset, length); + },close:function(stream) { + var sock = stream.node.sock; + sock.sock_ops.close(sock); + }},nextname:function() { + if (!SOCKFS.nextname.current) { + SOCKFS.nextname.current = 0; + } + return 'socket[' + (SOCKFS.nextname.current++) + ']'; + },websocket_sock_ops:{createPeer:function(sock, addr, port) { + var ws; + + if (typeof addr == 'object') { + ws = addr; + addr = null; + port = null; + } + + if (ws) { + // for sockets that've already connected (e.g. we're the server) + // we can inspect the _socket property for the address + if (ws._socket) { + addr = ws._socket.remoteAddress; + port = ws._socket.remotePort; + } + // if we're just now initializing a connection to the remote, + // inspect the url property + else { + var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url); + if (!result) { + throw new Error('WebSocket URL must be in the format ws(s)://address:port'); + } + addr = result[1]; + port = parseInt(result[2], 10); + } + } else { + // create the actual websocket object and connect + try { + // runtimeConfig gets set to true if WebSocket runtime configuration is available. + var runtimeConfig = (Module['websocket'] && ('object' === typeof Module['websocket'])); + + // The default value is 'ws://' the replace is needed because the compiler replaces '//' comments with '#' + // comments without checking context, so we'd end up with ws:#, the replace swaps the '#' for '//' again. + var url = 'ws:#'.replace('#', '//'); + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['url']) { + url = Module['websocket']['url']; // Fetch runtime WebSocket URL config. + } + } + + if (url === 'ws://' || url === 'wss://') { // Is the supplied URL config just a prefix, if so complete it. + var parts = addr.split('/'); + url = url + parts[0] + ":" + port + "/" + parts.slice(1).join('/'); + } + + // Make the WebSocket subprotocol (Sec-WebSocket-Protocol) default to binary if no configuration is set. + var subProtocols = 'binary'; // The default value is 'binary' + + if (runtimeConfig) { + if ('string' === typeof Module['websocket']['subprotocol']) { + subProtocols = Module['websocket']['subprotocol']; // Fetch runtime WebSocket subprotocol config. + } + } + + // The default WebSocket options + var opts = undefined; + + if (subProtocols !== 'null') { + // The regex trims the string (removes spaces at the beginning and end, then splits the string by + // , into an Array. Whitespace removal is important for Websockify and ws. + subProtocols = subProtocols.replace(/^ +| +$/g,"").split(/ *, */); + + // The node ws library API for specifying optional subprotocol is slightly different than the browser's. + opts = ENVIRONMENT_IS_NODE ? {'protocol': subProtocols.toString()} : subProtocols; + } + + // some webservers (azure) does not support subprotocol header + if (runtimeConfig && null === Module['websocket']['subprotocol']) { + subProtocols = 'null'; + opts = undefined; + } + + // If node we use the ws library. + var WebSocketConstructor; + if (ENVIRONMENT_IS_NODE) { + WebSocketConstructor = /** @type{(typeof WebSocket)} */(require('ws')); + } else + { + WebSocketConstructor = WebSocket; + } + ws = new WebSocketConstructor(url, opts); + ws.binaryType = 'arraybuffer'; + } catch (e) { + throw new FS.ErrnoError(23); + } + } + + var peer = { + addr: addr, + port: port, + socket: ws, + dgram_send_queue: [] + }; + + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer); + + // if this is a bound dgram socket, send the port number first to allow + // us to override the ephemeral port reported to us by remotePort on the + // remote end. + if (sock.type === 2 && typeof sock.sport != 'undefined') { + peer.dgram_send_queue.push(new Uint8Array([ + 255, 255, 255, 255, + 'p'.charCodeAt(0), 'o'.charCodeAt(0), 'r'.charCodeAt(0), 't'.charCodeAt(0), + ((sock.sport & 0xff00) >> 8) , (sock.sport & 0xff) + ])); + } + + return peer; + },getPeer:function(sock, addr, port) { + return sock.peers[addr + ':' + port]; + },addPeer:function(sock, peer) { + sock.peers[peer.addr + ':' + peer.port] = peer; + },removePeer:function(sock, peer) { + delete sock.peers[peer.addr + ':' + peer.port]; + },handlePeerEvents:function(sock, peer) { + var first = true; + + var handleOpen = function () { + + Module['websocket'].emit('open', sock.stream.fd); + + try { + var queued = peer.dgram_send_queue.shift(); + while (queued) { + peer.socket.send(queued); + queued = peer.dgram_send_queue.shift(); + } + } catch (e) { + // not much we can do here in the way of proper error handling as we've already + // lied and said this data was sent. shut it down. + peer.socket.close(); + } + }; + + function handleMessage(data) { + if (typeof data == 'string') { + var encoder = new TextEncoder(); // should be utf-8 + data = encoder.encode(data); // make a typed array from the string + } else { + assert(data.byteLength !== undefined); // must receive an ArrayBuffer + if (data.byteLength == 0) { + // An empty ArrayBuffer will emit a pseudo disconnect event + // as recv/recvmsg will return zero which indicates that a socket + // has performed a shutdown although the connection has not been disconnected yet. + return; + } else { + data = new Uint8Array(data); // make a typed array view on the array buffer + } + } + + // if this is the port message, override the peer's port with it + var wasfirst = first; + first = false; + if (wasfirst && + data.length === 10 && + data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && + data[4] === 'p'.charCodeAt(0) && data[5] === 'o'.charCodeAt(0) && data[6] === 'r'.charCodeAt(0) && data[7] === 't'.charCodeAt(0)) { + // update the peer's port and it's key in the peer map + var newport = ((data[8] << 8) | data[9]); + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + peer.port = newport; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + return; + } + + sock.recv_queue.push({ addr: peer.addr, port: peer.port, data: data }); + Module['websocket'].emit('message', sock.stream.fd); + }; + + if (ENVIRONMENT_IS_NODE) { + peer.socket.on('open', handleOpen); + peer.socket.on('message', function(data, flags) { + if (!flags.binary) { + return; + } + handleMessage((new Uint8Array(data)).buffer); // copy from node Buffer -> ArrayBuffer + }); + peer.socket.on('close', function() { + Module['websocket'].emit('close', sock.stream.fd); + }); + peer.socket.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using ECONNREFUSED + // is still probably the most useful thing to do. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + // don't throw + }); + } else { + peer.socket.onopen = handleOpen; + peer.socket.onclose = function() { + Module['websocket'].emit('close', sock.stream.fd); + }; + peer.socket.onmessage = function peer_socket_onmessage(event) { + handleMessage(event.data); + }; + peer.socket.onerror = function(error) { + // The WebSocket spec only allows a 'simple event' to be thrown on error, + // so we only really know as much as ECONNREFUSED. + sock.error = 14; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'ECONNREFUSED: Connection refused']); + }; + } + },poll:function(sock) { + if (sock.type === 1 && sock.server) { + // listen sockets should only say they're available for reading + // if there are pending clients. + return sock.pending.length ? (64 | 1) : 0; + } + + var mask = 0; + var dest = sock.type === 1 ? // we only care about the socket state for connection-based sockets + SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : + null; + + if (sock.recv_queue.length || + !dest || // connection-less sockets are always ready to read + (dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { // let recv return 0 once closed + mask |= (64 | 1); + } + + if (!dest || // connection-less sockets are always ready to write + (dest && dest.socket.readyState === dest.socket.OPEN)) { + mask |= 4; + } + + if ((dest && dest.socket.readyState === dest.socket.CLOSING) || + (dest && dest.socket.readyState === dest.socket.CLOSED)) { + mask |= 16; + } + + return mask; + },ioctl:function(sock, request, arg) { + switch (request) { + case 21531: + var bytes = 0; + if (sock.recv_queue.length) { + bytes = sock.recv_queue[0].data.length; + } + HEAP32[((arg)>>2)] = bytes; + return 0; + default: + return 28; + } + },close:function(sock) { + // if we've spawned a listen server, close it + if (sock.server) { + try { + sock.server.close(); + } catch (e) { + } + sock.server = null; + } + // close any peer connections + var peers = Object.keys(sock.peers); + for (var i = 0; i < peers.length; i++) { + var peer = sock.peers[peers[i]]; + try { + peer.socket.close(); + } catch (e) { + } + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + } + return 0; + },bind:function(sock, addr, port) { + if (typeof sock.saddr != 'undefined' || typeof sock.sport != 'undefined') { + throw new FS.ErrnoError(28); // already bound + } + sock.saddr = addr; + sock.sport = port; + // in order to emulate dgram sockets, we need to launch a listen server when + // binding on a connection-less socket + // note: this is only required on the server side + if (sock.type === 2) { + // close the existing server if it exists + if (sock.server) { + sock.server.close(); + sock.server = null; + } + // swallow error operation not supported error that occurs when binding in the + // browser where this isn't supported + try { + sock.sock_ops.listen(sock, 0); + } catch (e) { + if (!(e instanceof FS.ErrnoError)) throw e; + if (e.errno !== 138) throw e; + } + } + },connect:function(sock, addr, port) { + if (sock.server) { + throw new FS.ErrnoError(138); + } + + // TODO autobind + // if (!sock.addr && sock.type == 2) { + // } + + // early out if we're already connected / in the middle of connecting + if (typeof sock.daddr != 'undefined' && typeof sock.dport != 'undefined') { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (dest) { + if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(7); + } else { + throw new FS.ErrnoError(30); + } + } + } + + // add the socket to our peer list and set our + // destination address / port to match + var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + sock.daddr = peer.addr; + sock.dport = peer.port; + + // always "fail" in non-blocking mode + throw new FS.ErrnoError(26); + },listen:function(sock, backlog) { + if (!ENVIRONMENT_IS_NODE) { + throw new FS.ErrnoError(138); + } + if (sock.server) { + throw new FS.ErrnoError(28); // already listening + } + var WebSocketServer = require('ws').Server; + var host = sock.saddr; + sock.server = new WebSocketServer({ + host: host, + port: sock.sport + // TODO support backlog + }); + Module['websocket'].emit('listen', sock.stream.fd); // Send Event with listen fd. + + sock.server.on('connection', function(ws) { + if (sock.type === 1) { + var newsock = SOCKFS.createSocket(sock.family, sock.type, sock.protocol); + + // create a peer on the new socket + var peer = SOCKFS.websocket_sock_ops.createPeer(newsock, ws); + newsock.daddr = peer.addr; + newsock.dport = peer.port; + + // push to queue for accept to pick up + sock.pending.push(newsock); + Module['websocket'].emit('connection', newsock.stream.fd); + } else { + // create a peer on the listen socket so calling sendto + // with the listen socket and an address will resolve + // to the correct client + SOCKFS.websocket_sock_ops.createPeer(sock, ws); + Module['websocket'].emit('connection', sock.stream.fd); + } + }); + sock.server.on('closed', function() { + Module['websocket'].emit('close', sock.stream.fd); + sock.server = null; + }); + sock.server.on('error', function(error) { + // Although the ws library may pass errors that may be more descriptive than + // ECONNREFUSED they are not necessarily the expected error code e.g. + // ENOTFOUND on getaddrinfo seems to be node.js specific, so using EHOSTUNREACH + // is still probably the most useful thing to do. This error shouldn't + // occur in a well written app as errors should get trapped in the compiled + // app's own getaddrinfo call. + sock.error = 23; // Used in getsockopt for SOL_SOCKET/SO_ERROR test. + Module['websocket'].emit('error', [sock.stream.fd, sock.error, 'EHOSTUNREACH: Host is unreachable']); + // don't throw + }); + },accept:function(listensock) { + if (!listensock.server || !listensock.pending.length) { + throw new FS.ErrnoError(28); + } + var newsock = listensock.pending.shift(); + newsock.stream.flags = listensock.stream.flags; + return newsock; + },getname:function(sock, peer) { + var addr, port; + if (peer) { + if (sock.daddr === undefined || sock.dport === undefined) { + throw new FS.ErrnoError(53); + } + addr = sock.daddr; + port = sock.dport; + } else { + // TODO saddr and sport will be set for bind()'d UDP sockets, but what + // should we be returning for TCP sockets that've been connect()'d? + addr = sock.saddr || 0; + port = sock.sport || 0; + } + return { addr: addr, port: port }; + },sendmsg:function(sock, buffer, offset, length, addr, port) { + if (sock.type === 2) { + // connection-less sockets will honor the message address, + // and otherwise fall back to the bound destination address + if (addr === undefined || port === undefined) { + addr = sock.daddr; + port = sock.dport; + } + // if there was no address to fall back to, error out + if (addr === undefined || port === undefined) { + throw new FS.ErrnoError(17); + } + } else { + // connection-based sockets will only use the bound + addr = sock.daddr; + port = sock.dport; + } + + // find the peer for the destination address + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port); + + // early out if not connected with a connection-based socket + if (sock.type === 1) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + throw new FS.ErrnoError(53); + } else if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(6); + } + } + + // create a copy of the incoming data to send, as the WebSocket API + // doesn't work entirely with an ArrayBufferView, it'll just send + // the entire underlying buffer + if (ArrayBuffer.isView(buffer)) { + offset += buffer.byteOffset; + buffer = buffer.buffer; + } + + var data; + data = buffer.slice(offset, offset + length); + + // if we're emulating a connection-less dgram socket and don't have + // a cached connection, queue the buffer to send upon connect and + // lie, saying the data was sent now. + if (sock.type === 2) { + if (!dest || dest.socket.readyState !== dest.socket.OPEN) { + // if we're not connected, open a new connection + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + } + dest.dgram_send_queue.push(data); + return length; + } + } + + try { + // send the actual data + dest.socket.send(data); + return length; + } catch (e) { + throw new FS.ErrnoError(28); + } + },recvmsg:function(sock, length) { + // http://pubs.opengroup.org/onlinepubs/7908799/xns/recvmsg.html + if (sock.type === 1 && sock.server) { + // tcp servers should not be recv()'ing on the listen socket + throw new FS.ErrnoError(53); + } + + var queued = sock.recv_queue.shift(); + if (!queued) { + if (sock.type === 1) { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + + if (!dest) { + // if we have a destination address but are not connected, error out + throw new FS.ErrnoError(53); + } + else if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + // return null if the socket has closed + return null; + } + else { + // else, our socket is in a valid state but truly has nothing available + throw new FS.ErrnoError(6); + } + } else { + throw new FS.ErrnoError(6); + } + } + + // queued.data will be an ArrayBuffer if it's unadulterated, but if it's + // requeued TCP data it'll be an ArrayBufferView + var queuedLength = queued.data.byteLength || queued.data.length; + var queuedOffset = queued.data.byteOffset || 0; + var queuedBuffer = queued.data.buffer || queued.data; + var bytesRead = Math.min(length, queuedLength); + var res = { + buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), + addr: queued.addr, + port: queued.port + }; + + // push back any unread data for TCP connections + if (sock.type === 1 && bytesRead < queuedLength) { + var bytesRemaining = queuedLength - bytesRead; + queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining); + sock.recv_queue.unshift(queued); + } + + return res; + }}}; + function getSocketFromFD(fd) { + var socket = SOCKFS.getSocket(fd); + if (!socket) throw new FS.ErrnoError(8); + return socket; + } + + function setErrNo(value) { + HEAP32[((___errno_location())>>2)] = value; + return value; + } + var Sockets = {BUFFER_SIZE:10240,MAX_BUFFER_SIZE:10485760,nextFd:1,fds:{},nextport:1,maxport:65535,peer:null,connections:{},portmap:{},localAddr:4261412874,addrPool:[33554442,50331658,67108874,83886090,100663306,117440522,134217738,150994954,167772170,184549386,201326602,218103818,234881034]}; + + function inetPton4(str) { + var b = str.split('.'); + for (var i = 0; i < 4; i++) { + var tmp = Number(b[i]); + if (isNaN(tmp)) return null; + b[i] = tmp; + } + return (b[0] | (b[1] << 8) | (b[2] << 16) | (b[3] << 24)) >>> 0; + } + + /** @suppress {checkTypes} */ + function jstoi_q(str) { + return parseInt(str); + } + function inetPton6(str) { + var words; + var w, offset, z, i; + /* http://home.deds.nl/~aeron/regex/ */ + var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i + var parts = []; + if (!valid6regx.test(str)) { + return null; + } + if (str === "::") { + return [0, 0, 0, 0, 0, 0, 0, 0]; + } + // Z placeholder to keep track of zeros when splitting the string on ":" + if (str.startsWith("::")) { + str = str.replace("::", "Z:"); // leading zeros case + } else { + str = str.replace("::", ":Z:"); + } + + if (str.indexOf(".") > 0) { + // parse IPv4 embedded stress + str = str.replace(new RegExp('[.]', 'g'), ":"); + words = str.split(":"); + words[words.length-4] = jstoi_q(words[words.length-4]) + jstoi_q(words[words.length-3])*256; + words[words.length-3] = jstoi_q(words[words.length-2]) + jstoi_q(words[words.length-1])*256; + words = words.slice(0, words.length-2); + } else { + words = str.split(":"); + } + + offset = 0; z = 0; + for (w=0; w < words.length; w++) { + if (typeof words[w] == 'string') { + if (words[w] === 'Z') { + // compressed zeros - write appropriate number of zero words + for (z = 0; z < (8 - words.length+1); z++) { + parts[w+z] = 0; + } + offset = z-1; + } else { + // parse hex to field to 16-bit value and write it in network byte-order + parts[w+offset] = _htons(parseInt(words[w],16)); + } + } else { + // parsed IPv4 words + parts[w+offset] = words[w]; + } + } + return [ + (parts[1] << 16) | parts[0], + (parts[3] << 16) | parts[2], + (parts[5] << 16) | parts[4], + (parts[7] << 16) | parts[6] + ]; + } + /** @param {number=} addrlen */ + function writeSockaddr(sa, family, addr, port, addrlen) { + switch (family) { + case 2: + addr = inetPton4(addr); + zeroMemory(sa, 16); + if (addrlen) { + HEAP32[((addrlen)>>2)] = 16; + } + HEAP16[((sa)>>1)] = family; + HEAP32[(((sa)+(4))>>2)] = addr; + HEAP16[(((sa)+(2))>>1)] = _htons(port); + break; + case 10: + addr = inetPton6(addr); + zeroMemory(sa, 28); + if (addrlen) { + HEAP32[((addrlen)>>2)] = 28; + } + HEAP32[((sa)>>2)] = family; + HEAP32[(((sa)+(8))>>2)] = addr[0]; + HEAP32[(((sa)+(12))>>2)] = addr[1]; + HEAP32[(((sa)+(16))>>2)] = addr[2]; + HEAP32[(((sa)+(20))>>2)] = addr[3]; + HEAP16[(((sa)+(2))>>1)] = _htons(port); + break; + default: + return 5; + } + return 0; + } + + var DNS = {address_map:{id:1,addrs:{},names:{}},lookup_name:function (name) { + // If the name is already a valid ipv4 / ipv6 address, don't generate a fake one. + var res = inetPton4(name); + if (res !== null) { + return name; + } + res = inetPton6(name); + if (res !== null) { + return name; + } + + // See if this name is already mapped. + var addr; + + if (DNS.address_map.addrs[name]) { + addr = DNS.address_map.addrs[name]; + } else { + var id = DNS.address_map.id++; + assert(id < 65535, 'exceeded max address mappings of 65535'); + + addr = '172.29.' + (id & 0xff) + '.' + (id & 0xff00); + + DNS.address_map.names[addr] = name; + DNS.address_map.addrs[name] = addr; + } + + return addr; + },lookup_addr:function (addr) { + if (DNS.address_map.names[addr]) { + return DNS.address_map.names[addr]; + } + + return null; + }}; + function ___syscall_accept4(fd, addr, addrlen, flags) { + try { + + var sock = getSocketFromFD(fd); + var newsock = sock.sock_ops.accept(sock); + if (addr) { + var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen); + assert(!errno); + } + return newsock.stream.fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function inetNtop4(addr) { + return (addr & 0xff) + '.' + ((addr >> 8) & 0xff) + '.' + ((addr >> 16) & 0xff) + '.' + ((addr >> 24) & 0xff) + } + + function inetNtop6(ints) { + // ref: http://www.ietf.org/rfc/rfc2373.txt - section 2.5.4 + // Format for IPv4 compatible and mapped 128-bit IPv6 Addresses + // 128-bits are split into eight 16-bit words + // stored in network byte order (big-endian) + // | 80 bits | 16 | 32 bits | + // +-----------------------------------------------------------------+ + // | 10 bytes | 2 | 4 bytes | + // +--------------------------------------+--------------------------+ + // + 5 words | 1 | 2 words | + // +--------------------------------------+--------------------------+ + // |0000..............................0000|0000| IPv4 ADDRESS | (compatible) + // +--------------------------------------+----+---------------------+ + // |0000..............................0000|FFFF| IPv4 ADDRESS | (mapped) + // +--------------------------------------+----+---------------------+ + var str = ""; + var word = 0; + var longest = 0; + var lastzero = 0; + var zstart = 0; + var len = 0; + var i = 0; + var parts = [ + ints[0] & 0xffff, + (ints[0] >> 16), + ints[1] & 0xffff, + (ints[1] >> 16), + ints[2] & 0xffff, + (ints[2] >> 16), + ints[3] & 0xffff, + (ints[3] >> 16) + ]; + + // Handle IPv4-compatible, IPv4-mapped, loopback and any/unspecified addresses + + var hasipv4 = true; + var v4part = ""; + // check if the 10 high-order bytes are all zeros (first 5 words) + for (i = 0; i < 5; i++) { + if (parts[i] !== 0) { hasipv4 = false; break; } + } + + if (hasipv4) { + // low-order 32-bits store an IPv4 address (bytes 13 to 16) (last 2 words) + v4part = inetNtop4(parts[6] | (parts[7] << 16)); + // IPv4-mapped IPv6 address if 16-bit value (bytes 11 and 12) == 0xFFFF (6th word) + if (parts[5] === -1) { + str = "::ffff:"; + str += v4part; + return str; + } + // IPv4-compatible IPv6 address if 16-bit value (bytes 11 and 12) == 0x0000 (6th word) + if (parts[5] === 0) { + str = "::"; + //special case IPv6 addresses + if (v4part === "0.0.0.0") v4part = ""; // any/unspecified address + if (v4part === "0.0.0.1") v4part = "1";// loopback address + str += v4part; + return str; + } + } + + // Handle all other IPv6 addresses + + // first run to find the longest contiguous zero words + for (word = 0; word < 8; word++) { + if (parts[word] === 0) { + if (word - lastzero > 1) { + len = 0; + } + lastzero = word; + len++; + } + if (len > longest) { + longest = len; + zstart = word - longest + 1; + } + } + + for (word = 0; word < 8; word++) { + if (longest > 1) { + // compress contiguous zeros - to produce "::" + if (parts[word] === 0 && word >= zstart && word < (zstart + longest) ) { + if (word === zstart) { + str += ":"; + if (zstart === 0) str += ":"; //leading zeros case + } + continue; + } + } + // converts 16-bit words from big-endian to little-endian before converting to hex string + str += Number(_ntohs(parts[word] & 0xffff)).toString(16); + str += word < 7 ? ":" : ""; + } + return str; + } + function readSockaddr(sa, salen) { + // family / port offsets are common to both sockaddr_in and sockaddr_in6 + var family = HEAP16[((sa)>>1)]; + var port = _ntohs(HEAPU16[(((sa)+(2))>>1)]); + var addr; + + switch (family) { + case 2: + if (salen !== 16) { + return { errno: 28 }; + } + addr = HEAP32[(((sa)+(4))>>2)]; + addr = inetNtop4(addr); + break; + case 10: + if (salen !== 28) { + return { errno: 28 }; + } + addr = [ + HEAP32[(((sa)+(8))>>2)], + HEAP32[(((sa)+(12))>>2)], + HEAP32[(((sa)+(16))>>2)], + HEAP32[(((sa)+(20))>>2)] + ]; + addr = inetNtop6(addr); + break; + default: + return { errno: 5 }; + } + + return { family: family, addr: addr, port: port }; + } + /** @param {boolean=} allowNull */ + function getSocketAddress(addrp, addrlen, allowNull) { + if (allowNull && addrp === 0) return null; + var info = readSockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + } + function ___syscall_bind(fd, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.bind(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_chmod(path, mode) { + try { + + path = SYSCALLS.getStr(path); + FS.chmod(path, mode); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_connect(fd, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.connect(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_dup3(fd, suggestFD, flags) { + try { + + var old = SYSCALLS.getStreamFromFD(fd); + assert(!flags); + if (old.fd === suggestFD) return -28; + var suggest = FS.getStream(suggestFD); + if (suggest) FS.close(suggest); + return FS.open(old.path, old.flags, 0, suggestFD, suggestFD).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_faccessat(dirfd, path, amode, flags) { + try { + + path = SYSCALLS.getStr(path); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path); + return SYSCALLS.doAccess(path, amode); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_fchmod(fd, mode) { + try { + + FS.fchmod(fd, mode); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_fcntl64(fd, cmd, varargs) { + SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (cmd) { + case 0: { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -28; + } + var newStream; + newStream = FS.open(stream.path, stream.flags, 0, arg); + return newStream.fd; + } + case 1: + case 2: + return 0; // FD_CLOEXEC makes no sense for a single process. + case 3: + return stream.flags; + case 4: { + var arg = SYSCALLS.get(); + stream.flags |= arg; + return 0; + } + case 5: + /* case 5: Currently in musl F_GETLK64 has same value as F_GETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ { + + var arg = SYSCALLS.get(); + var offset = 0; + // We're always unlocked. + HEAP16[(((arg)+(offset))>>1)] = 2; + return 0; + } + case 6: + case 7: + /* case 6: Currently in musl F_SETLK64 has same value as F_SETLK, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ + /* case 7: Currently in musl F_SETLKW64 has same value as F_SETLKW, so omitted to avoid duplicate case blocks. If that changes, uncomment this */ + + + return 0; // Pretend that the locking is successful. + case 16: + case 8: + return -28; // These are for sockets. We don't have them fully implemented yet. + case 9: + // musl trusts getown return values, due to a bug where they must be, as they overlap with errors. just return -1 here, so fnctl() returns that, and we set errno ourselves. + setErrNo(28); + return -1; + default: { + return -28; + } + } + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_fstat64(fd, buf) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + return SYSCALLS.doStat(FS.stat, stream.path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_ftruncate64(fd, low, high) { + try { + + var length = SYSCALLS.get64(low, high); + FS.ftruncate(fd, length); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_getcwd(buf, size) { + try { + + if (size === 0) return -28; + var cwd = FS.cwd(); + var cwdLengthInBytes = lengthBytesUTF8(cwd); + if (size < cwdLengthInBytes + 1) return -68; + stringToUTF8(cwd, buf, size); + return buf; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_getdents64(fd, dirp, count) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd) + if (!stream.getdents) { + stream.getdents = FS.readdir(stream.path); + } + + var struct_size = 280; + var pos = 0; + var off = FS.llseek(stream, 0, 1); + + var idx = Math.floor(off / struct_size); + + while (idx < stream.getdents.length && pos + struct_size <= count) { + var id; + var type; + var name = stream.getdents[idx]; + if (name === '.') { + id = stream.node.id; + type = 4; // DT_DIR + } + else if (name === '..') { + var lookup = FS.lookupPath(stream.path, { parent: true }); + id = lookup.node.id; + type = 4; // DT_DIR + } + else { + var child = FS.lookupNode(stream.node, name); + id = child.id; + type = FS.isChrdev(child.mode) ? 2 : // DT_CHR, character device. + FS.isDir(child.mode) ? 4 : // DT_DIR, directory. + FS.isLink(child.mode) ? 10 : // DT_LNK, symbolic link. + 8; // DT_REG, regular file. + } + assert(id); + (tempI64 = [id>>>0,(tempDouble=id,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((dirp + pos)>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(4))>>2)] = tempI64[1]); + (tempI64 = [(idx + 1) * struct_size>>>0,(tempDouble=(idx + 1) * struct_size,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((dirp + pos)+(8))>>2)] = tempI64[0],HEAP32[(((dirp + pos)+(12))>>2)] = tempI64[1]); + HEAP16[(((dirp + pos)+(16))>>1)] = 280; + HEAP8[(((dirp + pos)+(18))>>0)] = type; + stringToUTF8(name, dirp + pos + 19, 256); + pos += struct_size; + idx += 1; + } + FS.llseek(stream, idx * struct_size, 0); + return pos; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_getpeername(fd, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + if (!sock.daddr) { + return -53; // The socket is not connected. + } + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.daddr), sock.dport, addrlen); + assert(!errno); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_getsockname(fd, addr, addrlen) { + try { + + err("__syscall_getsockname " + fd); + var sock = getSocketFromFD(fd); + // TODO: sock.saddr should never be undefined, see TODO in websocket_sock_ops.getname + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || '0.0.0.0'), sock.sport, addrlen); + assert(!errno); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_getsockopt(fd, level, optname, optval, optlen) { + try { + + var sock = getSocketFromFD(fd); + // Minimal getsockopt aimed at resolving https://github.com/emscripten-core/emscripten/issues/2211 + // so only supports SOL_SOCKET with SO_ERROR. + if (level === 1) { + if (optname === 4) { + HEAP32[((optval)>>2)] = sock.error; + HEAP32[((optlen)>>2)] = 4; + sock.error = null; // Clear the error (The SO_ERROR option obtains and then clears this field). + return 0; + } + } + return -50; // The option is unknown at the level indicated. + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_ioctl(fd, op, varargs) { + SYSCALLS.varargs = varargs; + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + switch (op) { + case 21509: + case 21505: { + if (!stream.tty) return -59; + return 0; + } + case 21510: + case 21511: + case 21512: + case 21506: + case 21507: + case 21508: { + if (!stream.tty) return -59; + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -59; + var argp = SYSCALLS.get(); + HEAP32[((argp)>>2)] = 0; + return 0; + } + case 21520: { + if (!stream.tty) return -59; + return -28; // not supported + } + case 21531: { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp); + } + case 21523: { + // TODO: in theory we should write to the winsize struct that gets + // passed in, but for now musl doesn't read anything on it + if (!stream.tty) return -59; + return 0; + } + case 21524: { + // TODO: technically, this ioctl call should change the window size. + // but, since emscripten doesn't have any concept of a terminal window + // yet, we'll just silently throw it away as we do TIOCGWINSZ + if (!stream.tty) return -59; + return 0; + } + default: abort('bad ioctl syscall ' + op); + } + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_listen(fd, backlog) { + try { + + var sock = getSocketFromFD(fd); + sock.sock_ops.listen(sock, backlog); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_lstat64(path, buf) { + try { + + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.lstat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_mkdir(path, mode) { + try { + + path = SYSCALLS.getStr(path); + return SYSCALLS.doMkdir(path, mode); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_newfstatat(dirfd, path, buf, flags) { + try { + + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + var allowEmpty = flags & 4096; + flags = flags & (~4352); + assert(!flags, flags); + path = SYSCALLS.calculateAt(dirfd, path, allowEmpty); + return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_openat(dirfd, path, flags, varargs) { + SYSCALLS.varargs = varargs; + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + var mode = varargs ? SYSCALLS.get() : 0; + return FS.open(path, flags, mode).fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + var PIPEFS = {BUCKET_BUFFER_SIZE:8192,mount:function (mount) { + // Do not pollute the real root directory or its child nodes with pipes + // Looks like it is OK to create another pseudo-root node not linked to the FS.root hierarchy this way + return FS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createPipe:function () { + var pipe = { + buckets: [], + // refcnt 2 because pipe has a read end and a write end. We need to be + // able to read from the read end after write end is closed. + refcnt : 2, + }; + + pipe.buckets.push({ + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: 0, + roffset: 0 + }); + + var rName = PIPEFS.nextname(); + var wName = PIPEFS.nextname(); + var rNode = FS.createNode(PIPEFS.root, rName, 4096, 0); + var wNode = FS.createNode(PIPEFS.root, wName, 4096, 0); + + rNode.pipe = pipe; + wNode.pipe = pipe; + + var readableStream = FS.createStream({ + path: rName, + node: rNode, + flags: 0, + seekable: false, + stream_ops: PIPEFS.stream_ops + }); + rNode.stream = readableStream; + + var writableStream = FS.createStream({ + path: wName, + node: wNode, + flags: 1, + seekable: false, + stream_ops: PIPEFS.stream_ops + }); + wNode.stream = writableStream; + + return { + readable_fd: readableStream.fd, + writable_fd: writableStream.fd + }; + },stream_ops:{poll:function (stream) { + var pipe = stream.node.pipe; + + if ((stream.flags & 2097155) === 1) { + return (256 | 4); + } else { + if (pipe.buckets.length > 0) { + for (var i = 0; i < pipe.buckets.length; i++) { + var bucket = pipe.buckets[i]; + if (bucket.offset - bucket.roffset > 0) { + return (64 | 1); + } + } + } + } + + return 0; + },ioctl:function (stream, request, varargs) { + return 28; + },fsync:function (stream) { + return 28; + },read:function (stream, buffer, offset, length, position /* ignored */) { + var pipe = stream.node.pipe; + var currentLength = 0; + + for (var i = 0; i < pipe.buckets.length; i++) { + var bucket = pipe.buckets[i]; + currentLength += bucket.offset - bucket.roffset; + } + + assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer)); + var data = buffer.subarray(offset, offset + length); + + if (length <= 0) { + return 0; + } + if (currentLength == 0) { + // Behave as if the read end is always non-blocking + throw new FS.ErrnoError(6); + } + var toRead = Math.min(currentLength, length); + + var totalRead = toRead; + var toRemove = 0; + + for (var i = 0; i < pipe.buckets.length; i++) { + var currBucket = pipe.buckets[i]; + var bucketSize = currBucket.offset - currBucket.roffset; + + if (toRead <= bucketSize) { + var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset); + if (toRead < bucketSize) { + tmpSlice = tmpSlice.subarray(0, toRead); + currBucket.roffset += toRead; + } else { + toRemove++; + } + data.set(tmpSlice); + break; + } else { + var tmpSlice = currBucket.buffer.subarray(currBucket.roffset, currBucket.offset); + data.set(tmpSlice); + data = data.subarray(tmpSlice.byteLength); + toRead -= tmpSlice.byteLength; + toRemove++; + } + } + + if (toRemove && toRemove == pipe.buckets.length) { + // Do not generate excessive garbage in use cases such as + // write several bytes, read everything, write several bytes, read everything... + toRemove--; + pipe.buckets[toRemove].offset = 0; + pipe.buckets[toRemove].roffset = 0; + } + + pipe.buckets.splice(0, toRemove); + + return totalRead; + },write:function (stream, buffer, offset, length, position /* ignored */) { + var pipe = stream.node.pipe; + + assert(buffer instanceof ArrayBuffer || ArrayBuffer.isView(buffer)); + var data = buffer.subarray(offset, offset + length); + + var dataLen = data.byteLength; + if (dataLen <= 0) { + return 0; + } + + var currBucket = null; + + if (pipe.buckets.length == 0) { + currBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: 0, + roffset: 0 + }; + pipe.buckets.push(currBucket); + } else { + currBucket = pipe.buckets[pipe.buckets.length - 1]; + } + + assert(currBucket.offset <= PIPEFS.BUCKET_BUFFER_SIZE); + + var freeBytesInCurrBuffer = PIPEFS.BUCKET_BUFFER_SIZE - currBucket.offset; + if (freeBytesInCurrBuffer >= dataLen) { + currBucket.buffer.set(data, currBucket.offset); + currBucket.offset += dataLen; + return dataLen; + } else if (freeBytesInCurrBuffer > 0) { + currBucket.buffer.set(data.subarray(0, freeBytesInCurrBuffer), currBucket.offset); + currBucket.offset += freeBytesInCurrBuffer; + data = data.subarray(freeBytesInCurrBuffer, data.byteLength); + } + + var numBuckets = (data.byteLength / PIPEFS.BUCKET_BUFFER_SIZE) | 0; + var remElements = data.byteLength % PIPEFS.BUCKET_BUFFER_SIZE; + + for (var i = 0; i < numBuckets; i++) { + var newBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: PIPEFS.BUCKET_BUFFER_SIZE, + roffset: 0 + }; + pipe.buckets.push(newBucket); + newBucket.buffer.set(data.subarray(0, PIPEFS.BUCKET_BUFFER_SIZE)); + data = data.subarray(PIPEFS.BUCKET_BUFFER_SIZE, data.byteLength); + } + + if (remElements > 0) { + var newBucket = { + buffer: new Uint8Array(PIPEFS.BUCKET_BUFFER_SIZE), + offset: data.byteLength, + roffset: 0 + }; + pipe.buckets.push(newBucket); + newBucket.buffer.set(data); + } + + return dataLen; + },close:function (stream) { + var pipe = stream.node.pipe; + pipe.refcnt--; + if (pipe.refcnt === 0) { + pipe.buckets = null; + } + }},nextname:function () { + if (!PIPEFS.nextname.current) { + PIPEFS.nextname.current = 0; + } + return 'pipe[' + (PIPEFS.nextname.current++) + ']'; + }}; + function ___syscall_pipe(fdPtr) { + try { + + if (fdPtr == 0) { + throw new FS.ErrnoError(21); + } + + var res = PIPEFS.createPipe(); + + HEAP32[((fdPtr)>>2)] = res.readable_fd; + HEAP32[(((fdPtr)+(4))>>2)] = res.writable_fd; + + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_poll(fds, nfds, timeout) { + try { + + var nonzero = 0; + for (var i = 0; i < nfds; i++) { + var pollfd = fds + 8 * i; + var fd = HEAP32[((pollfd)>>2)]; + var events = HEAP16[(((pollfd)+(4))>>1)]; + var mask = 32; + var stream = FS.getStream(fd); + if (stream) { + mask = SYSCALLS.DEFAULT_POLLMASK; + if (stream.stream_ops.poll) { + mask = stream.stream_ops.poll(stream); + } + } + mask &= events | 8 | 16; + if (mask) nonzero++; + HEAP16[(((pollfd)+(6))>>1)] = mask; + } + return nonzero; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_readlinkat(dirfd, path, buf, bufsize) { + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + return SYSCALLS.doReadlink(path, buf, bufsize); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) { + try { + + var sock = getSocketFromFD(fd); + var msg = sock.sock_ops.recvmsg(sock, len); + if (!msg) return 0; // socket is closed + if (addr) { + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen); + assert(!errno); + } + HEAPU8.set(msg.buffer, buf); + return msg.buffer.byteLength; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_recvmsg(fd, message, flags) { + try { + + var sock = getSocketFromFD(fd); + var iov = HEAP32[(((message)+(8))>>2)]; + var num = HEAP32[(((message)+(12))>>2)]; + // get the total amount of data we can read across all arrays + var total = 0; + for (var i = 0; i < num; i++) { + total += HEAP32[(((iov)+((8 * i) + 4))>>2)]; + } + // try to read total data + var msg = sock.sock_ops.recvmsg(sock, total); + if (!msg) return 0; // socket is closed + + // TODO honor flags: + // MSG_OOB + // Requests out-of-band data. The significance and semantics of out-of-band data are protocol-specific. + // MSG_PEEK + // Peeks at the incoming message. + // MSG_WAITALL + // Requests that the function block until the full amount of data requested can be returned. The function may return a smaller amount of data if a signal is caught, if the connection is terminated, if MSG_PEEK was specified, or if an error is pending for the socket. + + // write the source address out + var name = HEAP32[((message)>>2)]; + if (name) { + var errno = writeSockaddr(name, sock.family, DNS.lookup_name(msg.addr), msg.port); + assert(!errno); + } + // write the buffer out to the scatter-gather arrays + var bytesRead = 0; + var bytesRemaining = msg.buffer.byteLength; + for (var i = 0; bytesRemaining > 0 && i < num; i++) { + var iovbase = HEAP32[(((iov)+((8 * i) + 0))>>2)]; + var iovlen = HEAP32[(((iov)+((8 * i) + 4))>>2)]; + if (!iovlen) { + continue; + } + var length = Math.min(iovlen, bytesRemaining); + var buf = msg.buffer.subarray(bytesRead, bytesRead + length); + HEAPU8.set(buf, iovbase + bytesRead); + bytesRead += length; + bytesRemaining -= length; + } + + // TODO set msghdr.msg_flags + // MSG_EOR + // End of record was received (if supported by the protocol). + // MSG_OOB + // Out-of-band data was received. + // MSG_TRUNC + // Normal data was truncated. + // MSG_CTRUNC + + return bytesRead; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) { + try { + + oldpath = SYSCALLS.getStr(oldpath); + newpath = SYSCALLS.getStr(newpath); + oldpath = SYSCALLS.calculateAt(olddirfd, oldpath); + newpath = SYSCALLS.calculateAt(newdirfd, newpath); + FS.rename(oldpath, newpath); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_rmdir(path) { + try { + + path = SYSCALLS.getStr(path); + FS.rmdir(path); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_sendmsg(fd, message, flags) { + try { + + var sock = getSocketFromFD(fd); + var iov = HEAP32[(((message)+(8))>>2)]; + var num = HEAP32[(((message)+(12))>>2)]; + // read the address and port to send to + var addr, port; + var name = HEAP32[((message)>>2)]; + var namelen = HEAP32[(((message)+(4))>>2)]; + if (name) { + var info = readSockaddr(name, namelen); + if (info.errno) return -info.errno; + port = info.port; + addr = DNS.lookup_addr(info.addr) || info.addr; + } + // concatenate scatter-gather arrays into one message buffer + var total = 0; + for (var i = 0; i < num; i++) { + total += HEAP32[(((iov)+((8 * i) + 4))>>2)]; + } + var view = new Uint8Array(total); + var offset = 0; + for (var i = 0; i < num; i++) { + var iovbase = HEAP32[(((iov)+((8 * i) + 0))>>2)]; + var iovlen = HEAP32[(((iov)+((8 * i) + 4))>>2)]; + for (var j = 0; j < iovlen; j++) { + view[offset++] = HEAP8[(((iovbase)+(j))>>0)]; + } + } + // write the buffer + return sock.sock_ops.sendmsg(sock, view, 0, total, addr, port); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_sendto(fd, message, length, flags, addr, addr_len) { + try { + + var sock = getSocketFromFD(fd); + var dest = getSocketAddress(addr, addr_len, true); + if (!dest) { + // send, no address provided + return FS.write(sock.stream, HEAP8,message, length); + } else { + // sendto an address + return sock.sock_ops.sendmsg(sock, HEAP8,message, length, dest.addr, dest.port); + } + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_socket(domain, type, protocol) { + try { + + var sock = SOCKFS.createSocket(domain, type, protocol); + assert(sock.stream.fd < 64); // XXX ? select() assumes socket fd values are in 0..63 + return sock.stream.fd; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_stat64(path, buf) { + try { + + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.stat, path, buf); + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_statfs64(path, size, buf) { + try { + + path = SYSCALLS.getStr(path); + assert(size === 64); + // NOTE: None of the constants here are true. We're just returning safe and + // sane values. + HEAP32[(((buf)+(4))>>2)] = 4096; + HEAP32[(((buf)+(40))>>2)] = 4096; + HEAP32[(((buf)+(8))>>2)] = 1000000; + HEAP32[(((buf)+(12))>>2)] = 500000; + HEAP32[(((buf)+(16))>>2)] = 500000; + HEAP32[(((buf)+(20))>>2)] = FS.nextInode; + HEAP32[(((buf)+(24))>>2)] = 1000000; + HEAP32[(((buf)+(28))>>2)] = 42; + HEAP32[(((buf)+(44))>>2)] = 2; // ST_NOSUID + HEAP32[(((buf)+(36))>>2)] = 255; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_symlink(target, linkpath) { + try { + + target = SYSCALLS.getStr(target); + linkpath = SYSCALLS.getStr(linkpath); + FS.symlink(target, linkpath); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_truncate64(path, low, high) { + try { + + path = SYSCALLS.getStr(path); + var length = SYSCALLS.get64(low, high); + FS.truncate(path, length); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_unlinkat(dirfd, path, flags) { + try { + + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (flags === 0) { + FS.unlink(path); + } else if (flags === 512) { + FS.rmdir(path); + } else { + abort('Invalid flags passed to unlinkat'); + } + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function ___syscall_utimensat(dirfd, path, times, flags) { + try { + + path = SYSCALLS.getStr(path); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path, true); + if (!times) { + var atime = Date.now(); + var mtime = atime; + } else { + var seconds = HEAP32[((times)>>2)]; + var nanoseconds = HEAP32[(((times)+(4))>>2)]; + atime = (seconds*1000) + (nanoseconds/(1000*1000)); + times += 8; + seconds = HEAP32[((times)>>2)]; + nanoseconds = HEAP32[(((times)+(4))>>2)]; + mtime = (seconds*1000) + (nanoseconds/(1000*1000)); + } + FS.utime(path, atime, mtime); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + var dlopen_main_init = 0; + function __dlopen_js(handle) { + warnOnce('Unable to open DLL! Dynamic linking is not supported in WebAssembly builds due to limitations to performance and code size. Please statically link in the needed libraries.'); + // Do not abort here - IL2CPP will throw a managed exception. + + // Return dummy success for the first dlopen since that is the __main__ module (so it gets past its assert checks), + // and false otherwise. TODO: After Emscripten is updated to a version newer than 3.1.8-unity, this logic can be + // dropped: https://github.com/emscripten-core/emscripten/issues/16790 + var ret = !dlopen_main_init; + dlopen_main_init = 1; + return ret; + } + + function __dlsym_js(handle, symbol) { + return 0; + } + + function __emscripten_date_now() { + return Date.now(); + } + + var nowIsMonotonic = true;; + function __emscripten_get_now_is_monotonic() { + return nowIsMonotonic; + } + + function __emscripten_throw_longjmp() { throw Infinity; } + + function __gmtime_js(time, tmPtr) { + var date = new Date(HEAP32[((time)>>2)]*1000); + HEAP32[((tmPtr)>>2)] = date.getUTCSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getUTCMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getUTCHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getUTCDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getUTCMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getUTCFullYear()-1900; + HEAP32[(((tmPtr)+(24))>>2)] = date.getUTCDay(); + var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0); + var yday = ((date.getTime() - start) / (1000 * 60 * 60 * 24))|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + } + + function __localtime_js(time, tmPtr) { + var date = new Date(HEAP32[((time)>>2)]*1000); + HEAP32[((tmPtr)>>2)] = date.getSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth(); + HEAP32[(((tmPtr)+(20))>>2)] = date.getFullYear()-1900; + HEAP32[(((tmPtr)+(24))>>2)] = date.getDay(); + + var start = new Date(date.getFullYear(), 0, 1); + var yday = ((date.getTime() - start.getTime()) / (1000 * 60 * 60 * 24))|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + HEAP32[(((tmPtr)+(36))>>2)] = -(date.getTimezoneOffset() * 60); + + // Attention: DST is in December in South, and some regions don't have DST at all. + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset))|0; + HEAP32[(((tmPtr)+(32))>>2)] = dst; + } + + function __mktime_js(tmPtr) { + var date = new Date(HEAP32[(((tmPtr)+(20))>>2)] + 1900, + HEAP32[(((tmPtr)+(16))>>2)], + HEAP32[(((tmPtr)+(12))>>2)], + HEAP32[(((tmPtr)+(8))>>2)], + HEAP32[(((tmPtr)+(4))>>2)], + HEAP32[((tmPtr)>>2)], + 0); + + // There's an ambiguous hour when the time goes back; the tm_isdst field is + // used to disambiguate it. Date() basically guesses, so we fix it up if it + // guessed wrong, or fill in tm_isdst with the guess if it's -1. + var dst = HEAP32[(((tmPtr)+(32))>>2)]; + var guessedOffset = date.getTimezoneOffset(); + var start = new Date(date.getFullYear(), 0, 1); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dstOffset = Math.min(winterOffset, summerOffset); // DST is in December in South + if (dst < 0) { + // Attention: some regions don't have DST at all. + HEAP32[(((tmPtr)+(32))>>2)] = Number(summerOffset != winterOffset && dstOffset == guessedOffset); + } else if ((dst > 0) != (dstOffset == guessedOffset)) { + var nonDstOffset = Math.max(winterOffset, summerOffset); + var trueOffset = dst > 0 ? dstOffset : nonDstOffset; + // Don't try setMinutes(date.getMinutes() + ...) -- it's messed up. + date.setTime(date.getTime() + (trueOffset - guessedOffset)*60000); + } + + HEAP32[(((tmPtr)+(24))>>2)] = date.getDay(); + var yday = ((date.getTime() - start.getTime()) / (1000 * 60 * 60 * 24))|0; + HEAP32[(((tmPtr)+(28))>>2)] = yday; + // To match expected behavior, update fields from date + HEAP32[((tmPtr)>>2)] = date.getSeconds(); + HEAP32[(((tmPtr)+(4))>>2)] = date.getMinutes(); + HEAP32[(((tmPtr)+(8))>>2)] = date.getHours(); + HEAP32[(((tmPtr)+(12))>>2)] = date.getDate(); + HEAP32[(((tmPtr)+(16))>>2)] = date.getMonth(); + + return (date.getTime() / 1000)|0; + } + + function __mmap_js(addr, len, prot, flags, fd, off, allocated, builtin) { + try { + + var info = FS.getStream(fd); + if (!info) return -8; + var res = FS.mmap(info, addr, len, off, prot, flags); + var ptr = res.ptr; + HEAP32[((allocated)>>2)] = res.allocated; + return ptr; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function __munmap_js(addr, len, prot, flags, fd, offset) { + try { + + var stream = FS.getStream(fd); + if (stream) { + if (prot & 2) { + SYSCALLS.doMsync(addr, stream, len, flags, offset); + } + FS.munmap(stream); + } + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } + } + + function _tzset_impl(timezone, daylight, tzname) { + var currentYear = new Date().getFullYear(); + var winter = new Date(currentYear, 0, 1); + var summer = new Date(currentYear, 6, 1); + var winterOffset = winter.getTimezoneOffset(); + var summerOffset = summer.getTimezoneOffset(); + + // Local standard timezone offset. Local standard time is not adjusted for daylight savings. + // This code uses the fact that getTimezoneOffset returns a greater value during Standard Time versus Daylight Saving Time (DST). + // Thus it determines the expected output during Standard Time, and it compares whether the output of the given date the same (Standard) or less (DST). + var stdTimezoneOffset = Math.max(winterOffset, summerOffset); + + // timezone is specified as seconds west of UTC ("The external variable + // `timezone` shall be set to the difference, in seconds, between + // Coordinated Universal Time (UTC) and local standard time."), the same + // as returned by stdTimezoneOffset. + // See http://pubs.opengroup.org/onlinepubs/009695399/functions/tzset.html + HEAP32[((timezone)>>2)] = stdTimezoneOffset * 60; + + HEAP32[((daylight)>>2)] = Number(winterOffset != summerOffset); + + function extractZone(date) { + var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/); + return match ? match[1] : "GMT"; + }; + var winterName = extractZone(winter); + var summerName = extractZone(summer); + var winterNamePtr = allocateUTF8(winterName); + var summerNamePtr = allocateUTF8(summerName); + if (summerOffset < winterOffset) { + // Northern hemisphere + HEAP32[((tzname)>>2)] = winterNamePtr; + HEAP32[(((tzname)+(4))>>2)] = summerNamePtr; + } else { + HEAP32[((tzname)>>2)] = summerNamePtr; + HEAP32[(((tzname)+(4))>>2)] = winterNamePtr; + } + } + function __tzset_js(timezone, daylight, tzname) { + // TODO: Use (malleable) environment variables instead of system settings. + if (__tzset_js.called) return; + __tzset_js.called = true; + _tzset_impl(timezone, daylight, tzname); + } + + function _abort() { + abort('native code called abort()'); + } + + var readAsmConstArgsArray = []; + function readAsmConstArgs(sigPtr, buf) { + ; + // Nobody should have mutated _readAsmConstArgsArray underneath us to be something else than an array. + assert(Array.isArray(readAsmConstArgsArray)); + // The input buffer is allocated on the stack, so it must be stack-aligned. + assert(buf % 16 == 0); + readAsmConstArgsArray.length = 0; + var ch; + // Most arguments are i32s, so shift the buffer pointer so it is a plain + // index into HEAP32. + buf >>= 2; + while (ch = HEAPU8[sigPtr++]) { + assert(ch === 100/*'d'*/ || ch === 102/*'f'*/ || ch === 105 /*'i'*/, 'Invalid character ' + ch + '("' + String.fromCharCode(ch) + '") in readAsmConstArgs! Use only "d", "f" or "i", and do not specify "v" for void return argument.'); + // A double takes two 32-bit slots, and must also be aligned - the backend + // will emit padding to avoid that. + var readAsmConstArgsDouble = ch < 105; + if (readAsmConstArgsDouble && (buf & 1)) buf++; + readAsmConstArgsArray.push(readAsmConstArgsDouble ? HEAPF64[buf++ >> 1] : HEAP32[buf]); + ++buf; + } + return readAsmConstArgsArray; + } + function _emscripten_asm_const_int(code, sigPtr, argbuf) { + var args = readAsmConstArgs(sigPtr, argbuf); + if (!ASM_CONSTS.hasOwnProperty(code)) abort('No EM_ASM constant found at address ' + code); + return ASM_CONSTS[code].apply(null, args); + } + + function mainThreadEM_ASM(code, sigPtr, argbuf, sync) { + var args = readAsmConstArgs(sigPtr, argbuf); + if (!ASM_CONSTS.hasOwnProperty(code)) abort('No EM_ASM constant found at address ' + code); + return ASM_CONSTS[code].apply(null, args); + } + function _emscripten_asm_const_int_sync_on_main_thread(code, sigPtr, argbuf) { + return mainThreadEM_ASM(code, sigPtr, argbuf, 1); + } + + function _emscripten_set_main_loop_timing(mode, value) { + Browser.mainLoop.timingMode = mode; + Browser.mainLoop.timingValue = value; + + if (!Browser.mainLoop.func) { + err('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.'); + return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. + } + + if (!Browser.mainLoop.running) { + + Browser.mainLoop.running = true; + } + if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { + var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0; + setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop + }; + Browser.mainLoop.method = 'timeout'; + } else if (mode == 1 /*EM_TIMING_RAF*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { + Browser.requestAnimationFrame(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'rAF'; + } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { + if (typeof setImmediate == 'undefined') { + // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) + var setImmediates = []; + var emscriptenMainLoopMessageId = 'setimmediate'; + var Browser_setImmediate_messageHandler = function(/** @type {Event} */ event) { + // When called in current thread or Worker, the main loop ID is structured slightly different to accommodate for --proxy-to-worker runtime listening to Worker events, + // so check for both cases. + if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) { + event.stopPropagation(); + setImmediates.shift()(); + } + } + addEventListener("message", Browser_setImmediate_messageHandler, true); + setImmediate = /** @type{function(function(): ?, ...?): number} */(function Browser_emulated_setImmediate(func) { + setImmediates.push(func); + if (ENVIRONMENT_IS_WORKER) { + if (Module['setImmediates'] === undefined) Module['setImmediates'] = []; + Module['setImmediates'].push(func); + postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js + } else postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself. + }) + } + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { + setImmediate(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'immediate'; + } + return 0; + } + + var _emscripten_get_now;if (ENVIRONMENT_IS_NODE) { + _emscripten_get_now = () => { + var t = process['hrtime'](); + return t[0] * 1e3 + t[1] / 1e6; + }; + } else _emscripten_get_now = () => performance.now(); + ; + + function runtimeKeepalivePush() { + } + + function _exit(status) { + // void _exit(int status); + // http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html + exit(status); + } + function maybeExit() { + } + + /** + * @param {number=} arg + * @param {boolean=} noSetTiming + */ + function setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop, arg, noSetTiming) { + assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); + + Browser.mainLoop.func = browserIterationFunc; + Browser.mainLoop.arg = arg; + + var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; + function checkIsRunning() { + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) { + + maybeExit(); + return false; + } + return true; + } + + // We create the loop runner here but it is not actually running until + // _emscripten_set_main_loop_timing is called (which might happen a + // later time). This member signifies that the current runner has not + // yet been started so that we can call runtimeKeepalivePush when it + // gets it timing set for the first time. + Browser.mainLoop.running = false; + Browser.mainLoop.runner = function Browser_mainLoop_runner() { + if (ABORT) return; + if (Browser.mainLoop.queue.length > 0) { + var start = Date.now(); + var blocker = Browser.mainLoop.queue.shift(); + blocker.func(blocker.arg); + if (Browser.mainLoop.remainingBlockers) { + var remaining = Browser.mainLoop.remainingBlockers; + var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); + if (blocker.counted) { + Browser.mainLoop.remainingBlockers = next; + } else { + // not counted, but move the progress along a tiny bit + next = next + 0.5; // do not steal all the next one's progress + Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; + } + } + out('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); + Browser.mainLoop.updateStatus(); + + // catches pause/resume main loop from blocker execution + if (!checkIsRunning()) return; + + setTimeout(Browser.mainLoop.runner, 0); + return; + } + + // catch pauses from non-main loop sources + if (!checkIsRunning()) return; + + // Implement very basic swap interval control + Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; + if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { + // Not the scheduled time to render this frame - skip. + Browser.mainLoop.scheduler(); + return; + } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.tickStartTime = _emscripten_get_now(); + } + + // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize + // VBO double-buffering and reduce GPU stalls. + GL.newRenderingFrameStarted(); + + if (Browser.mainLoop.method === 'timeout' && Module.ctx) { + warnOnce('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); + Browser.mainLoop.method = ''; // just warn once per call to set main loop + } + + Browser.mainLoop.runIter(browserIterationFunc); + + checkStackCookie(); + + // catch pauses from the main loop itself + if (!checkIsRunning()) return; + + // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able + // to queue the newest produced audio samples. + // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() + // do not need to be hardcoded into this function, but can be more generic. + if (typeof SDL == 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); + + Browser.mainLoop.scheduler(); + } + + if (!noSetTiming) { + if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) + + Browser.mainLoop.scheduler(); + } + + if (simulateInfiniteLoop) { + throw 'unwind'; + } + } + + /** @param {boolean=} synchronous */ + function callUserCallback(func, synchronous) { + if (ABORT) { + err('user callback triggered after runtime exited or application aborted. Ignoring.'); + return; + } + // For synchronous calls, let any exceptions propagate, and don't let the runtime exit. + if (synchronous) { + func(); + return; + } + try { + func(); + } catch (e) { + handleException(e); + } + } + + function runtimeKeepalivePop() { + } + /** @param {number=} timeout */ + function safeSetTimeout(func, timeout) { + + return setTimeout(function() { + + callUserCallback(func); + }, timeout); + } + var Browser = {mainLoop:{running:false,scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function() { + Browser.mainLoop.scheduler = null; + // Incrementing this signals the previous main loop that it's now become old, and it must return. + Browser.mainLoop.currentlyRunningMainloop++; + },resume:function() { + Browser.mainLoop.currentlyRunningMainloop++; + var timingMode = Browser.mainLoop.timingMode; + var timingValue = Browser.mainLoop.timingValue; + var func = Browser.mainLoop.func; + Browser.mainLoop.func = null; + // do not set timing and call scheduler, we will do it on the next lines + setMainLoop(func, 0, false, Browser.mainLoop.arg, true); + _emscripten_set_main_loop_timing(timingMode, timingValue); + Browser.mainLoop.scheduler(); + },updateStatus:function() { + if (Module['setStatus']) { + var message = Module['statusMessage'] || 'Please wait...'; + var remaining = Browser.mainLoop.remainingBlockers; + var expected = Browser.mainLoop.expectedBlockers; + if (remaining) { + if (remaining < expected) { + Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); + } else { + Module['setStatus'](message); + } + } else { + Module['setStatus'](''); + } + } + },runIter:function(func) { + if (ABORT) return; + if (Module['preMainLoop']) { + var preRet = Module['preMainLoop'](); + if (preRet === false) { + return; // |return false| skips a frame + } + } + callUserCallback(func); + if (Module['postMainLoop']) Module['postMainLoop'](); + }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function() { + if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers + + if (Browser.initted) return; + Browser.initted = true; + + try { + new Blob(); + Browser.hasBlobConstructor = true; + } catch(e) { + Browser.hasBlobConstructor = false; + out("warning: no blob constructor, cannot create blobs with mimetypes"); + } + Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? out("warning: no BlobBuilder") : null)); + Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; + if (!Module.noImageDecoding && typeof Browser.URLObject == 'undefined') { + out("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); + Module.noImageDecoding = true; + } + + // Support for plugins that can process preloaded files. You can add more of these to + // your app by creating and appending to Module.preloadPlugins. + // + // Each plugin is asked if it can handle a file based on the file's name. If it can, + // it is given the file's raw data. When it is done, it calls a callback with the file's + // (possibly modified) data. For example, a plugin might decompress a file, or it + // might create some side data structure for use later (like an Image element, etc.). + + var imagePlugin = {}; + imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { + return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); + }; + imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { + var b = null; + if (Browser.hasBlobConstructor) { + try { + b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + if (b.size !== byteArray.length) { // Safari bug #118630 + // Safari's Blob can only take an ArrayBuffer + b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); + } + } catch(e) { + warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); + } + } + if (!b) { + var bb = new Browser.BlobBuilder(); + bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range + b = bb.getBlob(); + } + var url = Browser.URLObject.createObjectURL(b); + assert(typeof url == 'string', 'createObjectURL must return a url as a string'); + var img = new Image(); + img.onload = () => { + assert(img.complete, 'Image ' + name + ' could not be decoded'); + var canvas = /** @type {!HTMLCanvasElement} */ (document.createElement('canvas')); + canvas.width = img.width; + canvas.height = img.height; + var ctx = canvas.getContext('2d'); + ctx.drawImage(img, 0, 0); + Module["preloadedImages"][name] = canvas; + Browser.URLObject.revokeObjectURL(url); + if (onload) onload(byteArray); + }; + img.onerror = (event) => { + out('Image ' + url + ' could not be decoded'); + if (onerror) onerror(); + }; + img.src = url; + }; + Module['preloadPlugins'].push(imagePlugin); + + var audioPlugin = {}; + audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { + return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; + }; + audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { + var done = false; + function finish(audio) { + if (done) return; + done = true; + Module["preloadedAudios"][name] = audio; + if (onload) onload(byteArray); + } + function fail() { + if (done) return; + done = true; + Module["preloadedAudios"][name] = new Audio(); // empty shim + if (onerror) onerror(); + } + if (Browser.hasBlobConstructor) { + try { + var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + } catch(e) { + return fail(); + } + var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! + assert(typeof url == 'string', 'createObjectURL must return a url as a string'); + var audio = new Audio(); + audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 + audio.onerror = function audio_onerror(event) { + if (done) return; + out('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); + function encode64(data) { + var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; + var PAD = '='; + var ret = ''; + var leftchar = 0; + var leftbits = 0; + for (var i = 0; i < data.length; i++) { + leftchar = (leftchar << 8) | data[i]; + leftbits += 8; + while (leftbits >= 6) { + var curr = (leftchar >> (leftbits-6)) & 0x3f; + leftbits -= 6; + ret += BASE[curr]; + } + } + if (leftbits == 2) { + ret += BASE[(leftchar&3) << 4]; + ret += PAD + PAD; + } else if (leftbits == 4) { + ret += BASE[(leftchar&0xf) << 2]; + ret += PAD; + } + return ret; + } + audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); + finish(audio); // we don't wait for confirmation this worked - but it's worth trying + }; + audio.src = url; + // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror + safeSetTimeout(function() { + finish(audio); // try to use it even though it is not necessarily ready to play + }, 10000); + } else { + return fail(); + } + }; + Module['preloadPlugins'].push(audioPlugin); + + // Canvas event setup + + function pointerLockChange() { + Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] || + document['mozPointerLockElement'] === Module['canvas'] || + document['webkitPointerLockElement'] === Module['canvas'] || + document['msPointerLockElement'] === Module['canvas']; + } + var canvas = Module['canvas']; + if (canvas) { + // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module + // Module['forcedAspectRatio'] = 4 / 3; + + canvas.requestPointerLock = canvas['requestPointerLock'] || + canvas['mozRequestPointerLock'] || + canvas['webkitRequestPointerLock'] || + canvas['msRequestPointerLock'] || + function(){}; + canvas.exitPointerLock = document['exitPointerLock'] || + document['mozExitPointerLock'] || + document['webkitExitPointerLock'] || + document['msExitPointerLock'] || + function(){}; // no-op if function does not exist + canvas.exitPointerLock = canvas.exitPointerLock.bind(document); + + document.addEventListener('pointerlockchange', pointerLockChange, false); + document.addEventListener('mozpointerlockchange', pointerLockChange, false); + document.addEventListener('webkitpointerlockchange', pointerLockChange, false); + document.addEventListener('mspointerlockchange', pointerLockChange, false); + + if (Module['elementPointerLock']) { + canvas.addEventListener("click", function(ev) { + if (!Browser.pointerLock && Module['canvas'].requestPointerLock) { + Module['canvas'].requestPointerLock(); + ev.preventDefault(); + } + }, false); + } + } + },handledByPreloadPlugin:function(byteArray, fullname, finish, onerror) { + // Ensure plugins are ready. + Browser.init(); + + var handled = false; + Module['preloadPlugins'].forEach(function(plugin) { + if (handled) return; + if (plugin['canHandle'](fullname)) { + plugin['handle'](byteArray, fullname, finish, onerror); + handled = true; + } + }); + return handled; + },createContext:function(/** @type {HTMLCanvasElement} */ canvas, useWebGL, setInModule, webGLContextAttributes) { + if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. + + var ctx; + var contextHandle; + if (useWebGL) { + // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. + var contextAttributes = { + antialias: false, + alpha: false, + majorVersion: (typeof WebGL2RenderingContext != 'undefined') ? 2 : 1, + }; + + if (webGLContextAttributes) { + for (var attribute in webGLContextAttributes) { + contextAttributes[attribute] = webGLContextAttributes[attribute]; + } + } + + // This check of existence of GL is here to satisfy Closure compiler, which yells if variable GL is referenced below but GL object is not + // actually compiled in because application is not doing any GL operations. TODO: Ideally if GL is not being used, this function + // Browser.createContext() should not even be emitted. + if (typeof GL != 'undefined') { + contextHandle = GL.createContext(canvas, contextAttributes); + if (contextHandle) { + ctx = GL.getContext(contextHandle).GLctx; + } + } + } else { + ctx = canvas.getContext('2d'); + } + + if (!ctx) return null; + + if (setInModule) { + if (!useWebGL) assert(typeof GLctx == 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); + + Module.ctx = ctx; + if (useWebGL) GL.makeContextCurrent(contextHandle); + Module.useWebGL = useWebGL; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); + Browser.init(); + } + return ctx; + },destroyContext:function(canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function(lockPointer, resizeCanvas) { + Browser.lockPointer = lockPointer; + Browser.resizeCanvas = resizeCanvas; + if (typeof Browser.lockPointer == 'undefined') Browser.lockPointer = true; + if (typeof Browser.resizeCanvas == 'undefined') Browser.resizeCanvas = false; + + var canvas = Module['canvas']; + function fullscreenChange() { + Browser.isFullscreen = false; + var canvasContainer = canvas.parentNode; + if ((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvasContainer) { + canvas.exitFullscreen = Browser.exitFullscreen; + if (Browser.lockPointer) canvas.requestPointerLock(); + Browser.isFullscreen = true; + if (Browser.resizeCanvas) { + Browser.setFullscreenCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } else { + // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen + canvasContainer.parentNode.insertBefore(canvas, canvasContainer); + canvasContainer.parentNode.removeChild(canvasContainer); + + if (Browser.resizeCanvas) { + Browser.setWindowedCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } + if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen); + if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen); + } + + if (!Browser.fullscreenHandlersInstalled) { + Browser.fullscreenHandlersInstalled = true; + document.addEventListener('fullscreenchange', fullscreenChange, false); + document.addEventListener('mozfullscreenchange', fullscreenChange, false); + document.addEventListener('webkitfullscreenchange', fullscreenChange, false); + document.addEventListener('MSFullscreenChange', fullscreenChange, false); + } + + // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root + var canvasContainer = document.createElement("div"); + canvas.parentNode.insertBefore(canvasContainer, canvas); + canvasContainer.appendChild(canvas); + + // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) + canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] || + canvasContainer['mozRequestFullScreen'] || + canvasContainer['msRequestFullscreen'] || + (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) || + (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); + + canvasContainer.requestFullscreen(); + },requestFullScreen:function() { + abort('Module.requestFullScreen has been replaced by Module.requestFullscreen (without a capital S)'); + },exitFullscreen:function() { + // This is workaround for chrome. Trying to exit from fullscreen + // not in fullscreen state will cause "TypeError: Document not active" + // in chrome. See https://github.com/emscripten-core/emscripten/pull/8236 + if (!Browser.isFullscreen) { + return false; + } + + var CFS = document['exitFullscreen'] || + document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['msExitFullscreen'] || + document['webkitCancelFullScreen'] || + (function() {}); + CFS.apply(document, []); + return true; + },nextRAF:0,fakeRequestAnimationFrame:function(func) { + // try to keep 60fps between calls to here + var now = Date.now(); + if (Browser.nextRAF === 0) { + Browser.nextRAF = now + 1000/60; + } else { + while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 + Browser.nextRAF += 1000/60; + } + } + var delay = Math.max(Browser.nextRAF - now, 0); + setTimeout(func, delay); + },requestAnimationFrame:function(func) { + if (typeof requestAnimationFrame == 'function') { + requestAnimationFrame(func); + return; + } + var RAF = Browser.fakeRequestAnimationFrame; + RAF(func); + },safeSetTimeout:function(func) { + // Legacy function, this is used by the SDL2 port so we need to keep it + // around at least until that is updated. + return safeSetTimeout(func); + },safeRequestAnimationFrame:function(func) { + + return Browser.requestAnimationFrame(function() { + + callUserCallback(func); + }); + },getMimetype:function(name) { + return { + 'jpg': 'image/jpeg', + 'jpeg': 'image/jpeg', + 'png': 'image/png', + 'bmp': 'image/bmp', + 'ogg': 'audio/ogg', + 'wav': 'audio/wav', + 'mp3': 'audio/mpeg' + }[name.substr(name.lastIndexOf('.')+1)]; + },getUserMedia:function(func) { + if (!window.getUserMedia) { + window.getUserMedia = navigator['getUserMedia'] || + navigator['mozGetUserMedia']; + } + window.getUserMedia(func); + },getMovementX:function(event) { + return event['movementX'] || + event['mozMovementX'] || + event['webkitMovementX'] || + 0; + },getMovementY:function(event) { + return event['movementY'] || + event['mozMovementY'] || + event['webkitMovementY'] || + 0; + },getMouseWheelDelta:function(event) { + var delta = 0; + switch (event.type) { + case 'DOMMouseScroll': + // 3 lines make up a step + delta = event.detail / 3; + break; + case 'mousewheel': + // 120 units make up a step + delta = event.wheelDelta / 120; + break; + case 'wheel': + delta = event.deltaY + switch (event.deltaMode) { + case 0: + // DOM_DELTA_PIXEL: 100 pixels make up a step + delta /= 100; + break; + case 1: + // DOM_DELTA_LINE: 3 lines make up a step + delta /= 3; + break; + case 2: + // DOM_DELTA_PAGE: A page makes up 80 steps + delta *= 80; + break; + default: + throw 'unrecognized mouse wheel delta mode: ' + event.deltaMode; + } + break; + default: + throw 'unrecognized mouse wheel event: ' + event.type; + } + return delta; + },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function(event) { // event should be mousemove, mousedown or mouseup + if (Browser.pointerLock) { + // When the pointer is locked, calculate the coordinates + // based on the movement of the mouse. + // Workaround for Firefox bug 764498 + if (event.type != 'mousemove' && + ('mozMovementX' in event)) { + Browser.mouseMovementX = Browser.mouseMovementY = 0; + } else { + Browser.mouseMovementX = Browser.getMovementX(event); + Browser.mouseMovementY = Browser.getMovementY(event); + } + + // check if SDL is available + if (typeof SDL != "undefined") { + Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; + Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; + } else { + // just add the mouse delta to the current absolut mouse position + // FIXME: ideally this should be clamped against the canvas size and zero + Browser.mouseX += Browser.mouseMovementX; + Browser.mouseY += Browser.mouseMovementY; + } + } else { + // Otherwise, calculate the movement based on the changes + // in the coordinates. + var rect = Module["canvas"].getBoundingClientRect(); + var cw = Module["canvas"].width; + var ch = Module["canvas"].height; + + // Neither .scrollX or .pageXOffset are defined in a spec, but + // we prefer .scrollX because it is currently in a spec draft. + // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) + var scrollX = ((typeof window.scrollX != 'undefined') ? window.scrollX : window.pageXOffset); + var scrollY = ((typeof window.scrollY != 'undefined') ? window.scrollY : window.pageYOffset); + // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset + // and we have no viable fallback. + assert((typeof scrollX != 'undefined') && (typeof scrollY != 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.'); + + if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { + var touch = event.touch; + if (touch === undefined) { + return; // the "touch" property is only defined in SDL + + } + var adjustedX = touch.pageX - (scrollX + rect.left); + var adjustedY = touch.pageY - (scrollY + rect.top); + + adjustedX = adjustedX * (cw / rect.width); + adjustedY = adjustedY * (ch / rect.height); + + var coords = { x: adjustedX, y: adjustedY }; + + if (event.type === 'touchstart') { + Browser.lastTouches[touch.identifier] = coords; + Browser.touches[touch.identifier] = coords; + } else if (event.type === 'touchend' || event.type === 'touchmove') { + var last = Browser.touches[touch.identifier]; + if (!last) last = coords; + Browser.lastTouches[touch.identifier] = last; + Browser.touches[touch.identifier] = coords; + } + return; + } + + var x = event.pageX - (scrollX + rect.left); + var y = event.pageY - (scrollY + rect.top); + + // the canvas might be CSS-scaled compared to its backbuffer; + // SDL-using content will want mouse coordinates in terms + // of backbuffer units. + x = x * (cw / rect.width); + y = y * (ch / rect.height); + + Browser.mouseMovementX = x - Browser.mouseX; + Browser.mouseMovementY = y - Browser.mouseY; + Browser.mouseX = x; + Browser.mouseY = y; + } + },resizeListeners:[],updateResizeListeners:function() { + var canvas = Module['canvas']; + Browser.resizeListeners.forEach(function(listener) { + listener(canvas.width, canvas.height); + }); + },setCanvasSize:function(width, height, noUpdates) { + var canvas = Module['canvas']; + Browser.updateCanvasDimensions(canvas, width, height); + if (!noUpdates) Browser.updateResizeListeners(); + },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function() { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen)>>2)]; + flags = flags | 0x00800000; // set SDL_FULLSCREEN flag + HEAP32[((SDL.screen)>>2)] = flags; + } + Browser.updateCanvasDimensions(Module['canvas']); + Browser.updateResizeListeners(); + },setWindowedCanvasSize:function() { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen)>>2)]; + flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag + HEAP32[((SDL.screen)>>2)] = flags; + } + Browser.updateCanvasDimensions(Module['canvas']); + Browser.updateResizeListeners(); + },updateCanvasDimensions:function(canvas, wNative, hNative) { + if (wNative && hNative) { + canvas.widthNative = wNative; + canvas.heightNative = hNative; + } else { + wNative = canvas.widthNative; + hNative = canvas.heightNative; + } + var w = wNative; + var h = hNative; + if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { + if (w/h < Module['forcedAspectRatio']) { + w = Math.round(h * Module['forcedAspectRatio']); + } else { + h = Math.round(w / Module['forcedAspectRatio']); + } + } + if (((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { + var factor = Math.min(screen.width / w, screen.height / h); + w = Math.round(w * factor); + h = Math.round(h * factor); + } + if (Browser.resizeCanvas) { + if (canvas.width != w) canvas.width = w; + if (canvas.height != h) canvas.height = h; + if (typeof canvas.style != 'undefined') { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } else { + if (canvas.width != wNative) canvas.width = wNative; + if (canvas.height != hNative) canvas.height = hNative; + if (typeof canvas.style != 'undefined') { + if (w != wNative || h != hNative) { + canvas.style.setProperty( "width", w + "px", "important"); + canvas.style.setProperty("height", h + "px", "important"); + } else { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } + } + }}; + function _emscripten_cancel_main_loop() { + Browser.mainLoop.pause(); + Browser.mainLoop.func = null; + } + + function _emscripten_clear_interval(id) { + + clearInterval(id); + } + + function _emscripten_console_error(str) { + assert(typeof str == 'number'); + console.error(UTF8ToString(str)); + } + + var JSEvents = {inEventHandler:0,removeAllEventListeners:function() { + for (var i = JSEvents.eventHandlers.length-1; i >= 0; --i) { + JSEvents._removeHandler(i); + } + JSEvents.eventHandlers = []; + JSEvents.deferredCalls = []; + },registerRemoveEventListeners:function() { + if (!JSEvents.removeEventListenersRegistered) { + __ATEXIT__.push(JSEvents.removeAllEventListeners); + JSEvents.removeEventListenersRegistered = true; + } + },deferredCalls:[],deferCall:function(targetFunction, precedence, argsList) { + function arraysHaveEqualContent(arrA, arrB) { + if (arrA.length != arrB.length) return false; + + for (var i in arrA) { + if (arrA[i] != arrB[i]) return false; + } + return true; + } + // Test if the given call was already queued, and if so, don't add it again. + for (var i in JSEvents.deferredCalls) { + var call = JSEvents.deferredCalls[i]; + if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { + return; + } + } + JSEvents.deferredCalls.push({ + targetFunction: targetFunction, + precedence: precedence, + argsList: argsList + }); + + JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; }); + },removeDeferredCalls:function(targetFunction) { + for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { + if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { + JSEvents.deferredCalls.splice(i, 1); + --i; + } + } + },canPerformEventHandlerRequests:function() { + return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; + },runDeferredCalls:function() { + if (!JSEvents.canPerformEventHandlerRequests()) { + return; + } + for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { + var call = JSEvents.deferredCalls[i]; + JSEvents.deferredCalls.splice(i, 1); + --i; + call.targetFunction.apply(null, call.argsList); + } + },eventHandlers:[],removeAllHandlersOnTarget:function(target, eventTypeString) { + for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == target && + (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { + JSEvents._removeHandler(i--); + } + } + },_removeHandler:function(i) { + var h = JSEvents.eventHandlers[i]; + h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); + JSEvents.eventHandlers.splice(i, 1); + },registerOrRemoveHandler:function(eventHandler) { + var jsEventHandler = function jsEventHandler(event) { + // Increment nesting count for the event handler. + ++JSEvents.inEventHandler; + JSEvents.currentEventHandler = eventHandler; + // Process any old deferred calls the user has placed. + JSEvents.runDeferredCalls(); + // Process the actual event, calls back to user C code handler. + eventHandler.handlerFunc(event); + // Process any new deferred calls that were placed right now from this event handler. + JSEvents.runDeferredCalls(); + // Out of event handler - restore nesting count. + --JSEvents.inEventHandler; + }; + + if (eventHandler.callbackfunc) { + eventHandler.eventListenerFunc = jsEventHandler; + eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); + JSEvents.eventHandlers.push(eventHandler); + JSEvents.registerRemoveEventListeners(); + } else { + for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == eventHandler.target + && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { + JSEvents._removeHandler(i--); + } + } + } + },getNodeNameForTarget:function(target) { + if (!target) return ''; + if (target == window) return '#window'; + if (target == screen) return '#screen'; + return (target && target.nodeName) ? target.nodeName : ''; + },fullscreenEnabled:function() { + return document.fullscreenEnabled + // Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitFullscreenEnabled. + // TODO: If Safari at some point ships with unprefixed version, update the version check above. + || document.webkitFullscreenEnabled + ; + }}; + + var currentFullscreenStrategy = {}; + + function maybeCStringToJsString(cString) { + // "cString > 2" checks if the input is a number, and isn't of the special + // values we accept here, EMSCRIPTEN_EVENT_TARGET_* (which map to 0, 1, 2). + // In other words, if cString > 2 then it's a pointer to a valid place in + // memory, and points to a C string. + return cString > 2 ? UTF8ToString(cString) : cString; + } + + var specialHTMLTargets = [0, typeof document != 'undefined' ? document : 0, typeof window != 'undefined' ? window : 0]; + function findEventTarget(target) { + target = maybeCStringToJsString(target); + var domElement = specialHTMLTargets[target] || (typeof document != 'undefined' ? document.querySelector(target) : undefined); + return domElement; + } + function findCanvasEventTarget(target) { return findEventTarget(target); } + function _emscripten_get_canvas_element_size(target, width, height) { + var canvas = findCanvasEventTarget(target); + if (!canvas) return -4; + HEAP32[((width)>>2)] = canvas.width; + HEAP32[((height)>>2)] = canvas.height; + } + function getCanvasElementSize(target) { + return withStackSave(function() { + var w = stackAlloc(8); + var h = w + 4; + + var targetInt = stackAlloc(target.id.length+1); + stringToUTF8(target.id, targetInt, target.id.length+1); + var ret = _emscripten_get_canvas_element_size(targetInt, w, h); + var size = [HEAP32[((w)>>2)], HEAP32[((h)>>2)]]; + return size; + }); + } + + function _emscripten_set_canvas_element_size(target, width, height) { + var canvas = findCanvasEventTarget(target); + if (!canvas) return -4; + canvas.width = width; + canvas.height = height; + return 0; + } + function setCanvasElementSize(target, width, height) { + if (!target.controlTransferredOffscreen) { + target.width = width; + target.height = height; + } else { + // This function is being called from high-level JavaScript code instead of asm.js/Wasm, + // and it needs to synchronously proxy over to another thread, so marshal the string onto the heap to do the call. + withStackSave(function() { + var targetInt = stackAlloc(target.id.length+1); + stringToUTF8(target.id, targetInt, target.id.length+1); + _emscripten_set_canvas_element_size(targetInt, width, height); + }); + } + } + function registerRestoreOldStyle(canvas) { + var canvasSize = getCanvasElementSize(canvas); + var oldWidth = canvasSize[0]; + var oldHeight = canvasSize[1]; + var oldCssWidth = canvas.style.width; + var oldCssHeight = canvas.style.height; + var oldBackgroundColor = canvas.style.backgroundColor; // Chrome reads color from here. + var oldDocumentBackgroundColor = document.body.style.backgroundColor; // IE11 reads color from here. + // Firefox always has black background color. + var oldPaddingLeft = canvas.style.paddingLeft; // Chrome, FF, Safari + var oldPaddingRight = canvas.style.paddingRight; + var oldPaddingTop = canvas.style.paddingTop; + var oldPaddingBottom = canvas.style.paddingBottom; + var oldMarginLeft = canvas.style.marginLeft; // IE11 + var oldMarginRight = canvas.style.marginRight; + var oldMarginTop = canvas.style.marginTop; + var oldMarginBottom = canvas.style.marginBottom; + var oldDocumentBodyMargin = document.body.style.margin; + var oldDocumentOverflow = document.documentElement.style.overflow; // Chrome, Firefox + var oldDocumentScroll = document.body.scroll; // IE + var oldImageRendering = canvas.style.imageRendering; + + function restoreOldStyle() { + var fullscreenElement = document.fullscreenElement + || document.webkitFullscreenElement + || document.msFullscreenElement + ; + if (!fullscreenElement) { + document.removeEventListener('fullscreenchange', restoreOldStyle); + + // Unprefixed Fullscreen API shipped in Chromium 71 (https://bugs.chromium.org/p/chromium/issues/detail?id=383813) + // As of Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitfullscreenchange. TODO: revisit this check once Safari ships unprefixed version. + document.removeEventListener('webkitfullscreenchange', restoreOldStyle); + + setCanvasElementSize(canvas, oldWidth, oldHeight); + + canvas.style.width = oldCssWidth; + canvas.style.height = oldCssHeight; + canvas.style.backgroundColor = oldBackgroundColor; // Chrome + // IE11 hack: assigning 'undefined' or an empty string to document.body.style.backgroundColor has no effect, so first assign back the default color + // before setting the undefined value. Setting undefined value is also important, or otherwise we would later treat that as something that the user + // had explicitly set so subsequent fullscreen transitions would not set background color properly. + if (!oldDocumentBackgroundColor) document.body.style.backgroundColor = 'white'; + document.body.style.backgroundColor = oldDocumentBackgroundColor; // IE11 + canvas.style.paddingLeft = oldPaddingLeft; // Chrome, FF, Safari + canvas.style.paddingRight = oldPaddingRight; + canvas.style.paddingTop = oldPaddingTop; + canvas.style.paddingBottom = oldPaddingBottom; + canvas.style.marginLeft = oldMarginLeft; // IE11 + canvas.style.marginRight = oldMarginRight; + canvas.style.marginTop = oldMarginTop; + canvas.style.marginBottom = oldMarginBottom; + document.body.style.margin = oldDocumentBodyMargin; + document.documentElement.style.overflow = oldDocumentOverflow; // Chrome, Firefox + document.body.scroll = oldDocumentScroll; // IE + canvas.style.imageRendering = oldImageRendering; + if (canvas.GLctxObject) canvas.GLctxObject.GLctx.viewport(0, 0, oldWidth, oldHeight); + + if (currentFullscreenStrategy.canvasResizedCallback) { + (function(a1, a2, a3) { return dynCall_iiii.apply(null, [currentFullscreenStrategy.canvasResizedCallback, a1, a2, a3]); })(37, 0, currentFullscreenStrategy.canvasResizedCallbackUserData); + } + } + } + document.addEventListener('fullscreenchange', restoreOldStyle); + // Unprefixed Fullscreen API shipped in Chromium 71 (https://bugs.chromium.org/p/chromium/issues/detail?id=383813) + // As of Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitfullscreenchange. TODO: revisit this check once Safari ships unprefixed version. + document.addEventListener('webkitfullscreenchange', restoreOldStyle); + return restoreOldStyle; + } + + function setLetterbox(element, topBottom, leftRight) { + // Cannot use margin to specify letterboxes in FF or Chrome, since those ignore margins in fullscreen mode. + element.style.paddingLeft = element.style.paddingRight = leftRight + 'px'; + element.style.paddingTop = element.style.paddingBottom = topBottom + 'px'; + } + + function getBoundingClientRect(e) { + return specialHTMLTargets.indexOf(e) < 0 ? e.getBoundingClientRect() : {'left':0,'top':0}; + } + function _JSEvents_resizeCanvasForFullscreen(target, strategy) { + var restoreOldStyle = registerRestoreOldStyle(target); + var cssWidth = strategy.softFullscreen ? innerWidth : screen.width; + var cssHeight = strategy.softFullscreen ? innerHeight : screen.height; + var rect = getBoundingClientRect(target); + var windowedCssWidth = rect.width; + var windowedCssHeight = rect.height; + var canvasSize = getCanvasElementSize(target); + var windowedRttWidth = canvasSize[0]; + var windowedRttHeight = canvasSize[1]; + + if (strategy.scaleMode == 3) { + setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); + cssWidth = windowedCssWidth; + cssHeight = windowedCssHeight; + } else if (strategy.scaleMode == 2) { + if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) { + var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth; + setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); + cssHeight = desiredCssHeight; + } else { + var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight; + setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); + cssWidth = desiredCssWidth; + } + } + + // If we are adding padding, must choose a background color or otherwise Chrome will give the + // padding a default white color. Do it only if user has not customized their own background color. + if (!target.style.backgroundColor) target.style.backgroundColor = 'black'; + // IE11 does the same, but requires the color to be set in the document body. + if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11 + // Firefox always shows black letterboxes independent of style color. + + target.style.width = cssWidth + 'px'; + target.style.height = cssHeight + 'px'; + + if (strategy.filteringMode == 1) { + target.style.imageRendering = 'optimizeSpeed'; + target.style.imageRendering = '-moz-crisp-edges'; + target.style.imageRendering = '-o-crisp-edges'; + target.style.imageRendering = '-webkit-optimize-contrast'; + target.style.imageRendering = 'optimize-contrast'; + target.style.imageRendering = 'crisp-edges'; + target.style.imageRendering = 'pixelated'; + } + + var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? devicePixelRatio : 1; + if (strategy.canvasResolutionScaleMode != 0) { + var newWidth = (cssWidth * dpiScale)|0; + var newHeight = (cssHeight * dpiScale)|0; + setCanvasElementSize(target, newWidth, newHeight); + if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, newWidth, newHeight); + } + return restoreOldStyle; + } + function _JSEvents_requestFullscreen(target, strategy) { + // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements. + if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { + _JSEvents_resizeCanvasForFullscreen(target, strategy); + } + + if (target.requestFullscreen) { + target.requestFullscreen(); + } else if (target.webkitRequestFullscreen) { + target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); + } else { + return JSEvents.fullscreenEnabled() ? -3 : -1; + } + + currentFullscreenStrategy = strategy; + + if (strategy.canvasResizedCallback) { + (function(a1, a2, a3) { return dynCall_iiii.apply(null, [strategy.canvasResizedCallback, a1, a2, a3]); })(37, 0, strategy.canvasResizedCallbackUserData); + } + + return 0; + } + function _emscripten_exit_fullscreen() { + if (!JSEvents.fullscreenEnabled()) return -1; + // Make sure no queued up calls will fire after this. + JSEvents.removeDeferredCalls(_JSEvents_requestFullscreen); + + var d = specialHTMLTargets[1]; + if (d.exitFullscreen) { + d.fullscreenElement && d.exitFullscreen(); + } else if (d.webkitExitFullscreen) { + d.webkitFullscreenElement && d.webkitExitFullscreen(); + } else { + return -1; + } + + return 0; + } + + function requestPointerLock(target) { + if (target.requestPointerLock) { + target.requestPointerLock(); + } else if (target.msRequestPointerLock) { + target.msRequestPointerLock(); + } else { + // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element, + // or if the whole browser just doesn't support the feature. + if (document.body.requestPointerLock + || document.body.msRequestPointerLock + ) { + return -3; + } else { + return -1; + } + } + return 0; + } + function _emscripten_exit_pointerlock() { + // Make sure no queued up calls will fire after this. + JSEvents.removeDeferredCalls(requestPointerLock); + + if (document.exitPointerLock) { + document.exitPointerLock(); + } else if (document.msExitPointerLock) { + document.msExitPointerLock(); + } else { + return -1; + } + return 0; + } + + + function fillFullscreenChangeEventData(eventStruct) { + var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; + var isFullscreen = !!fullscreenElement; + // Assigning a boolean to HEAP32 with expected type coercion. + /** @suppress{checkTypes} */ + HEAP32[((eventStruct)>>2)] = isFullscreen; + HEAP32[(((eventStruct)+(4))>>2)] = JSEvents.fullscreenEnabled(); + // If transitioning to fullscreen, report info about the element that is now fullscreen. + // If transitioning to windowed mode, report info about the element that just was fullscreen. + var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; + var nodeName = JSEvents.getNodeNameForTarget(reportedElement); + var id = (reportedElement && reportedElement.id) ? reportedElement.id : ''; + stringToUTF8(nodeName, eventStruct + 8, 128); + stringToUTF8(id, eventStruct + 136, 128); + HEAP32[(((eventStruct)+(264))>>2)] = reportedElement ? reportedElement.clientWidth : 0; + HEAP32[(((eventStruct)+(268))>>2)] = reportedElement ? reportedElement.clientHeight : 0; + HEAP32[(((eventStruct)+(272))>>2)] = screen.width; + HEAP32[(((eventStruct)+(276))>>2)] = screen.height; + if (isFullscreen) { + JSEvents.previousFullscreenElement = fullscreenElement; + } + } + function _emscripten_get_fullscreen_status(fullscreenStatus) { + if (!JSEvents.fullscreenEnabled()) return -1; + fillFullscreenChangeEventData(fullscreenStatus); + return 0; + } + + function fillGamepadEventData(eventStruct, e) { + HEAPF64[((eventStruct)>>3)] = e.timestamp; + for (var i = 0; i < e.axes.length; ++i) { + HEAPF64[(((eventStruct+i*8)+(16))>>3)] = e.axes[i]; + } + for (var i = 0; i < e.buttons.length; ++i) { + if (typeof e.buttons[i] == 'object') { + HEAPF64[(((eventStruct+i*8)+(528))>>3)] = e.buttons[i].value; + } else { + HEAPF64[(((eventStruct+i*8)+(528))>>3)] = e.buttons[i]; + } + } + for (var i = 0; i < e.buttons.length; ++i) { + if (typeof e.buttons[i] == 'object') { + HEAP32[(((eventStruct+i*4)+(1040))>>2)] = e.buttons[i].pressed; + } else { + // Assigning a boolean to HEAP32, that's ok, but Closure would like to warn about it: + /** @suppress {checkTypes} */ + HEAP32[(((eventStruct+i*4)+(1040))>>2)] = e.buttons[i] == 1; + } + } + HEAP32[(((eventStruct)+(1296))>>2)] = e.connected; + HEAP32[(((eventStruct)+(1300))>>2)] = e.index; + HEAP32[(((eventStruct)+(8))>>2)] = e.axes.length; + HEAP32[(((eventStruct)+(12))>>2)] = e.buttons.length; + stringToUTF8(e.id, eventStruct + 1304, 64); + stringToUTF8(e.mapping, eventStruct + 1368, 64); + } + function _emscripten_get_gamepad_status(index, gamepadState) { + if (!JSEvents.lastGamepadState) throw 'emscripten_get_gamepad_status() can only be called after having first called emscripten_sample_gamepad_data() and that function has returned EMSCRIPTEN_RESULT_SUCCESS!'; + + // INVALID_PARAM is returned on a Gamepad index that never was there. + if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5; + + // NO_DATA is returned on a Gamepad index that was removed. + // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index. + // This is because gamepads must keep their original position in the array. + // For example, removing the first of two gamepads produces [null/undefined/false, gamepad]. + if (!JSEvents.lastGamepadState[index]) return -7; + + fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]); + return 0; + } + + function _emscripten_get_heap_max() { + // Stay one Wasm page short of 4GB: while e.g. Chrome is able to allocate + // full 4GB Wasm memories, the size will wrap back to 0 bytes in Wasm side + // for any code that deals with heap sizes, which would require special + // casing all heap size related code to treat 0 specially. + return 2147483648; + } + + + function _emscripten_get_now_res() { // return resolution of get_now, in nanoseconds + if (ENVIRONMENT_IS_NODE) { + return 1; // nanoseconds + } else + // Modern environment where performance.now() is supported: + return 1000; // microseconds (1/1000 of a millisecond) + } + + function _emscripten_get_num_gamepads() { + if (!JSEvents.lastGamepadState) throw 'emscripten_get_num_gamepads() can only be called after having first called emscripten_sample_gamepad_data() and that function has returned EMSCRIPTEN_RESULT_SUCCESS!'; + // N.B. Do not call emscripten_get_num_gamepads() unless having first called emscripten_sample_gamepad_data(), and that has returned EMSCRIPTEN_RESULT_SUCCESS. + // Otherwise the following line will throw an exception. + return JSEvents.lastGamepadState.length; + } + + function _emscripten_html5_remove_all_event_listeners() { + JSEvents.removeAllEventListeners(); + } + + function _emscripten_is_webgl_context_lost(contextHandle) { + return !GL.contexts[contextHandle] || GL.contexts[contextHandle].GLctx.isContextLost(); // No context ~> lost context. + } + + function reallyNegative(x) { + return x < 0 || (x === 0 && (1/x) === -Infinity); + } + + function convertI32PairToI53(lo, hi) { + // This function should not be getting called with too large unsigned numbers + // in high part (if hi >= 0x7FFFFFFFF, one should have been calling + // convertU32PairToI53()) + assert(hi === (hi|0)); + return (lo >>> 0) + hi * 4294967296; + } + + function convertU32PairToI53(lo, hi) { + return (lo >>> 0) + (hi >>> 0) * 4294967296; + } + + function reSign(value, bits) { + if (value <= 0) { + return value; + } + var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 + : Math.pow(2, bits-1); + // for huge values, we can hit the precision limit and always get true here. + // so don't do that but, in general there is no perfect solution here. With + // 64-bit ints, we get rounding and errors + // TODO: In i64 mode 1, resign the two parts separately and safely + if (value >= half && (bits <= 32 || value > half)) { + // Cannot bitshift half, as it may be at the limit of the bits JS uses in + // bitshifts + value = -2*half + value; + } + return value; + } + + function unSign(value, bits) { + if (value >= 0) { + return value; + } + // Need some trickery, since if bits == 32, we are right at the limit of the + // bits JS uses in bitshifts + return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value + : Math.pow(2, bits) + value; + } + function formatString(format, varargs) { + ; + assert((varargs & 3) === 0); + var textIndex = format; + var argIndex = varargs; + // This must be called before reading a double or i64 vararg. It will bump the pointer properly. + // It also does an assert on i32 values, so it's nice to call it before all varargs calls. + function prepVararg(ptr, type) { + if (type === 'double' || type === 'i64') { + // move so the load is aligned + if (ptr & 7) { + assert((ptr & 7) === 4); + ptr += 4; + } + } else { + assert((ptr & 3) === 0); + } + return ptr; + } + function getNextArg(type) { + // NOTE: Explicitly ignoring type safety. Otherwise this fails: + // int x = 4; printf("%c\n", (char)x); + var ret; + argIndex = prepVararg(argIndex, type); + if (type === 'double') { + ret = Number(HEAPF64[((argIndex)>>3)]); + argIndex += 8; + } else if (type == 'i64') { + ret = [HEAP32[((argIndex)>>2)], + HEAP32[(((argIndex)+(4))>>2)]]; + argIndex += 8; + } else { + assert((argIndex & 3) === 0); + type = 'i32'; // varargs are always i32, i64, or double + ret = HEAP32[((argIndex)>>2)]; + argIndex += 4; + } + return ret; + } + + var ret = []; + var curr, next, currArg; + while (1) { + var startTextIndex = textIndex; + curr = HEAP8[((textIndex)>>0)]; + if (curr === 0) break; + next = HEAP8[((textIndex+1)>>0)]; + if (curr == 37) { + // Handle flags. + var flagAlwaysSigned = false; + var flagLeftAlign = false; + var flagAlternative = false; + var flagZeroPad = false; + var flagPadSign = false; + flagsLoop: while (1) { + switch (next) { + case 43: + flagAlwaysSigned = true; + break; + case 45: + flagLeftAlign = true; + break; + case 35: + flagAlternative = true; + break; + case 48: + if (flagZeroPad) { + break flagsLoop; + } else { + flagZeroPad = true; + break; + } + case 32: + flagPadSign = true; + break; + default: + break flagsLoop; + } + textIndex++; + next = HEAP8[((textIndex+1)>>0)]; + } + + // Handle width. + var width = 0; + if (next == 42) { + width = getNextArg('i32'); + textIndex++; + next = HEAP8[((textIndex+1)>>0)]; + } else { + while (next >= 48 && next <= 57) { + width = width * 10 + (next - 48); + textIndex++; + next = HEAP8[((textIndex+1)>>0)]; + } + } + + // Handle precision. + var precisionSet = false, precision = -1; + if (next == 46) { + precision = 0; + precisionSet = true; + textIndex++; + next = HEAP8[((textIndex+1)>>0)]; + if (next == 42) { + precision = getNextArg('i32'); + textIndex++; + } else { + while (1) { + var precisionChr = HEAP8[((textIndex+1)>>0)]; + if (precisionChr < 48 || + precisionChr > 57) break; + precision = precision * 10 + (precisionChr - 48); + textIndex++; + } + } + next = HEAP8[((textIndex+1)>>0)]; + } + if (precision < 0) { + precision = 6; // Standard default. + precisionSet = false; + } + + // Handle integer sizes. WARNING: These assume a 32-bit architecture! + var argSize; + switch (String.fromCharCode(next)) { + case 'h': + var nextNext = HEAP8[((textIndex+2)>>0)]; + if (nextNext == 104) { + textIndex++; + argSize = 1; // char (actually i32 in varargs) + } else { + argSize = 2; // short (actually i32 in varargs) + } + break; + case 'l': + var nextNext = HEAP8[((textIndex+2)>>0)]; + if (nextNext == 108) { + textIndex++; + argSize = 8; // long long + } else { + argSize = 4; // long + } + break; + case 'L': // long long + case 'q': // int64_t + case 'j': // intmax_t + argSize = 8; + break; + case 'z': // size_t + case 't': // ptrdiff_t + case 'I': // signed ptrdiff_t or unsigned size_t + argSize = 4; + break; + default: + argSize = null; + } + if (argSize) textIndex++; + next = HEAP8[((textIndex+1)>>0)]; + + // Handle type specifier. + switch (String.fromCharCode(next)) { + case 'd': case 'i': case 'u': case 'o': case 'x': case 'X': case 'p': { + // Integer. + var signed = next == 100 || next == 105; + argSize = argSize || 4; + currArg = getNextArg('i' + (argSize * 8)); + var argText; + // Flatten i64-1 [low, high] into a (slightly rounded) double + if (argSize == 8) { + currArg = next == 117 ? convertU32PairToI53(currArg[0], currArg[1]) : convertI32PairToI53(currArg[0], currArg[1]); + } + // Truncate to requested size. + if (argSize <= 4) { + var limit = Math.pow(256, argSize) - 1; + currArg = (signed ? reSign : unSign)(currArg & limit, argSize * 8); + } + // Format the number. + var currAbsArg = Math.abs(currArg); + var prefix = ''; + if (next == 100 || next == 105) { + argText = reSign(currArg, 8 * argSize).toString(10); + } else if (next == 117) { + argText = unSign(currArg, 8 * argSize).toString(10); + currArg = Math.abs(currArg); + } else if (next == 111) { + argText = (flagAlternative ? '0' : '') + currAbsArg.toString(8); + } else if (next == 120 || next == 88) { + prefix = (flagAlternative && currArg != 0) ? '0x' : ''; + if (currArg < 0) { + // Represent negative numbers in hex as 2's complement. + currArg = -currArg; + argText = (currAbsArg - 1).toString(16); + var buffer = []; + for (var i = 0; i < argText.length; i++) { + buffer.push((0xF - parseInt(argText[i], 16)).toString(16)); + } + argText = buffer.join(''); + while (argText.length < argSize * 2) argText = 'f' + argText; + } else { + argText = currAbsArg.toString(16); + } + if (next == 88) { + prefix = prefix.toUpperCase(); + argText = argText.toUpperCase(); + } + } else if (next == 112) { + if (currAbsArg === 0) { + argText = '(nil)'; + } else { + prefix = '0x'; + argText = currAbsArg.toString(16); + } + } + if (precisionSet) { + while (argText.length < precision) { + argText = '0' + argText; + } + } + + // Add sign if needed + if (currArg >= 0) { + if (flagAlwaysSigned) { + prefix = '+' + prefix; + } else if (flagPadSign) { + prefix = ' ' + prefix; + } + } + + // Move sign to prefix so we zero-pad after the sign + if (argText.charAt(0) == '-') { + prefix = '-' + prefix; + argText = argText.substr(1); + } + + // Add padding. + while (prefix.length + argText.length < width) { + if (flagLeftAlign) { + argText += ' '; + } else { + if (flagZeroPad) { + argText = '0' + argText; + } else { + prefix = ' ' + prefix; + } + } + } + + // Insert the result into the buffer. + argText = prefix + argText; + argText.split('').forEach(function(chr) { + ret.push(chr.charCodeAt(0)); + }); + break; + } + case 'f': case 'F': case 'e': case 'E': case 'g': case 'G': { + // Float. + currArg = getNextArg('double'); + var argText; + if (isNaN(currArg)) { + argText = 'nan'; + flagZeroPad = false; + } else if (!isFinite(currArg)) { + argText = (currArg < 0 ? '-' : '') + 'inf'; + flagZeroPad = false; + } else { + var isGeneral = false; + var effectivePrecision = Math.min(precision, 20); + + // Convert g/G to f/F or e/E, as per: + // http://pubs.opengroup.org/onlinepubs/9699919799/functions/printf.html + if (next == 103 || next == 71) { + isGeneral = true; + precision = precision || 1; + var exponent = parseInt(currArg.toExponential(effectivePrecision).split('e')[1], 10); + if (precision > exponent && exponent >= -4) { + next = ((next == 103) ? 'f' : 'F').charCodeAt(0); + precision -= exponent + 1; + } else { + next = ((next == 103) ? 'e' : 'E').charCodeAt(0); + precision--; + } + effectivePrecision = Math.min(precision, 20); + } + + if (next == 101 || next == 69) { + argText = currArg.toExponential(effectivePrecision); + // Make sure the exponent has at least 2 digits. + if (/[eE][-+]\d$/.test(argText)) { + argText = argText.slice(0, -1) + '0' + argText.slice(-1); + } + } else if (next == 102 || next == 70) { + argText = currArg.toFixed(effectivePrecision); + if (currArg === 0 && reallyNegative(currArg)) { + argText = '-' + argText; + } + } + + var parts = argText.split('e'); + if (isGeneral && !flagAlternative) { + // Discard trailing zeros and periods. + while (parts[0].length > 1 && parts[0].includes('.') && + (parts[0].slice(-1) == '0' || parts[0].slice(-1) == '.')) { + parts[0] = parts[0].slice(0, -1); + } + } else { + // Make sure we have a period in alternative mode. + if (flagAlternative && argText.indexOf('.') == -1) parts[0] += '.'; + // Zero pad until required precision. + while (precision > effectivePrecision++) parts[0] += '0'; + } + argText = parts[0] + (parts.length > 1 ? 'e' + parts[1] : ''); + + // Capitalize 'E' if needed. + if (next == 69) argText = argText.toUpperCase(); + + // Add sign. + if (currArg >= 0) { + if (flagAlwaysSigned) { + argText = '+' + argText; + } else if (flagPadSign) { + argText = ' ' + argText; + } + } + } + + // Add padding. + while (argText.length < width) { + if (flagLeftAlign) { + argText += ' '; + } else { + if (flagZeroPad && (argText[0] == '-' || argText[0] == '+')) { + argText = argText[0] + '0' + argText.slice(1); + } else { + argText = (flagZeroPad ? '0' : ' ') + argText; + } + } + } + + // Adjust case. + if (next < 97) argText = argText.toUpperCase(); + + // Insert the result into the buffer. + argText.split('').forEach(function(chr) { + ret.push(chr.charCodeAt(0)); + }); + break; + } + case 's': { + // String. + var arg = getNextArg('i8*'); + var argLength = arg ? _strlen(arg) : '(null)'.length; + if (precisionSet) argLength = Math.min(argLength, precision); + if (!flagLeftAlign) { + while (argLength < width--) { + ret.push(32); + } + } + if (arg) { + for (var i = 0; i < argLength; i++) { + ret.push(HEAPU8[((arg++)>>0)]); + } + } else { + ret = ret.concat(intArrayFromString('(null)'.substr(0, argLength), true)); + } + if (flagLeftAlign) { + while (argLength < width--) { + ret.push(32); + } + } + break; + } + case 'c': { + // Character. + if (flagLeftAlign) ret.push(getNextArg('i8')); + while (--width > 0) { + ret.push(32); + } + if (!flagLeftAlign) ret.push(getNextArg('i8')); + break; + } + case 'n': { + // Write the length written so far to the next parameter. + var ptr = getNextArg('i32*'); + HEAP32[((ptr)>>2)] = ret.length; + break; + } + case '%': { + // Literal percent sign. + ret.push(curr); + break; + } + default: { + // Unknown specifiers remain untouched. + for (var i = startTextIndex; i < textIndex + 2; i++) { + ret.push(HEAP8[((i)>>0)]); + } + } + } + textIndex += 2; + // TODO: Support a/A (hex float) and m (last error) specifiers. + // TODO: Support %1${specifier} for arg selection. + } else { + ret.push(curr); + textIndex += 1; + } + } + return ret; + } + + function traverseStack(args) { + if (!args || !args.callee || !args.callee.name) { + return [null, '', '']; + } + + var funstr = args.callee.toString(); + var funcname = args.callee.name; + var str = '('; + var first = true; + for (var i in args) { + var a = args[i]; + if (!first) { + str += ", "; + } + first = false; + if (typeof a == 'number' || typeof a == 'string') { + str += a; + } else { + str += '(' + typeof a + ')'; + } + } + str += ')'; + var caller = args.callee.caller; + args = caller ? caller.arguments : []; + if (first) + str = ''; + return [args, funcname, str]; + } + /** @param {number=} flags */ + function _emscripten_get_callstack_js(flags) { + var callstack = jsStackTrace(); + + // Find the symbols in the callstack that corresponds to the functions that report callstack information, and remove everything up to these from the output. + var iThisFunc = callstack.lastIndexOf('_emscripten_log'); + var iThisFunc2 = callstack.lastIndexOf('_emscripten_get_callstack'); + var iNextLine = callstack.indexOf('\n', Math.max(iThisFunc, iThisFunc2))+1; + callstack = callstack.slice(iNextLine); + + if (flags & 32) { + warnOnce('EM_LOG_DEMANGLE is deprecated; ignoring'); + } + + // If user requested to see the original source stack, but no source map information is available, just fall back to showing the JS stack. + if (flags & 8 && typeof emscripten_source_map == 'undefined') { + warnOnce('Source map information is not available, emscripten_log with EM_LOG_C_STACK will be ignored. Build with "--pre-js $EMSCRIPTEN/src/emscripten-source-map.min.js" linker flag to add source map loading to code.'); + flags ^= 8; + flags |= 16; + } + + var stack_args = null; + if (flags & 128) { + // To get the actual parameters to the functions, traverse the stack via the unfortunately deprecated 'arguments.callee' method, if it works: + stack_args = traverseStack(arguments); + while (stack_args[1].includes('_emscripten_')) + stack_args = traverseStack(stack_args[0]); + } + + // Process all lines: + var lines = callstack.split('\n'); + callstack = ''; + var newFirefoxRe = new RegExp('\\s*(.*?)@(.*?):([0-9]+):([0-9]+)'); // New FF30 with column info: extract components of form ' Object._main@http://server.com:4324:12' + var firefoxRe = new RegExp('\\s*(.*?)@(.*):(.*)(:(.*))?'); // Old FF without column info: extract components of form ' Object._main@http://server.com:4324' + var chromeRe = new RegExp('\\s*at (.*?) \\\((.*):(.*):(.*)\\\)'); // Extract components of form ' at Object._main (http://server.com/file.html:4324:12)' + + for (var l in lines) { + var line = lines[l]; + + var symbolName = ''; + var file = ''; + var lineno = 0; + var column = 0; + + var parts = chromeRe.exec(line); + if (parts && parts.length == 5) { + symbolName = parts[1]; + file = parts[2]; + lineno = parts[3]; + column = parts[4]; + } else { + parts = newFirefoxRe.exec(line); + if (!parts) parts = firefoxRe.exec(line); + if (parts && parts.length >= 4) { + symbolName = parts[1]; + file = parts[2]; + lineno = parts[3]; + column = parts[4]|0; // Old Firefox doesn't carry column information, but in new FF30, it is present. See https://bugzilla.mozilla.org/show_bug.cgi?id=762556 + } else { + // Was not able to extract this line for demangling/sourcemapping purposes. Output it as-is. + callstack += line + '\n'; + continue; + } + } + + var haveSourceMap = false; + + if (flags & 8) { + var orig = emscripten_source_map.originalPositionFor({line: lineno, column: column}); + haveSourceMap = (orig && orig.source); + if (haveSourceMap) { + if (flags & 64) { + orig.source = orig.source.substring(orig.source.replace(/\\/g, "/").lastIndexOf('/')+1); + } + callstack += ' at ' + symbolName + ' (' + orig.source + ':' + orig.line + ':' + orig.column + ')\n'; + } + } + if ((flags & 16) || !haveSourceMap) { + if (flags & 64) { + file = file.substring(file.replace(/\\/g, "/").lastIndexOf('/')+1); + } + callstack += (haveSourceMap ? (' = ' + symbolName) : (' at '+ symbolName)) + ' (' + file + ':' + lineno + ':' + column + ')\n'; + } + + // If we are still keeping track with the callstack by traversing via 'arguments.callee', print the function parameters as well. + if (flags & 128 && stack_args[0]) { + if (stack_args[1] == symbolName && stack_args[2].length > 0) { + callstack = callstack.replace(/\s+$/, ''); + callstack += ' with values: ' + stack_args[1] + stack_args[2] + '\n'; + } + stack_args = traverseStack(stack_args[0]); + } + } + // Trim extra whitespace at the end of the output. + callstack = callstack.replace(/\s+$/, ''); + return callstack; + } + function _emscripten_log_js(flags, str) { + if (flags & 24) { + str = str.replace(/\s+$/, ''); // Ensure the message and the callstack are joined cleanly with exactly one newline. + str += (str.length > 0 ? '\n' : '') + _emscripten_get_callstack_js(flags); + } + + if (flags & 1) { + if (flags & 4) { + console.error(str); + } else if (flags & 2) { + console.warn(str); + } else if (flags & 512) { + console.info(str); + } else if (flags & 256) { + console.debug(str); + } else { + console.log(str); + } + } else if (flags & 6) { + err(str); + } else { + out(str); + } + } + function _emscripten_log(flags, format, varargs) { + var result = formatString(format, varargs); + var str = UTF8ArrayToString(result, 0); + _emscripten_log_js(flags, str); + } + + function _emscripten_memcpy_big(dest, src, num) { + HEAPU8.copyWithin(dest, src, src + num); + } + + function doRequestFullscreen(target, strategy) { + if (!JSEvents.fullscreenEnabled()) return -1; + target = findEventTarget(target); + if (!target) return -4; + + if (!target.requestFullscreen + && !target.webkitRequestFullscreen + ) { + return -3; + } + + var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); + + // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so. + if (!canPerformRequests) { + if (strategy.deferUntilInEventHandler) { + JSEvents.deferCall(_JSEvents_requestFullscreen, 1 /* priority over pointer lock */, [target, strategy]); + return 1; + } else { + return -2; + } + } + + return _JSEvents_requestFullscreen(target, strategy); + } + function _emscripten_request_fullscreen(target, deferUntilInEventHandler) { + var strategy = { + // These options perform no added logic, but just bare request fullscreen. + scaleMode: 0, + canvasResolutionScaleMode: 0, + filteringMode: 0, + deferUntilInEventHandler: deferUntilInEventHandler, + canvasResizedCallbackTargetThread: 2 + }; + return doRequestFullscreen(target, strategy); + } + + function _emscripten_request_pointerlock(target, deferUntilInEventHandler) { + target = findEventTarget(target); + if (!target) return -4; + if (!target.requestPointerLock + && !target.msRequestPointerLock + ) { + return -1; + } + + var canPerformRequests = JSEvents.canPerformEventHandlerRequests(); + + // Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so. + if (!canPerformRequests) { + if (deferUntilInEventHandler) { + JSEvents.deferCall(requestPointerLock, 2 /* priority below fullscreen */, [target]); + return 1; + } else { + return -2; + } + } + + return requestPointerLock(target); + } + + function emscripten_realloc_buffer(size) { + try { + // round size grow request up to wasm page size (fixed 64KB per spec) + wasmMemory.grow((size - buffer.byteLength + 65535) >>> 16); // .grow() takes a delta compared to the previous size + updateGlobalBufferAndViews(wasmMemory.buffer); + return 1 /*success*/; + } catch(e) { + err('emscripten_realloc_buffer: Attempted to grow heap from ' + buffer.byteLength + ' bytes to ' + size + ' bytes, but got error: ' + e); + } + // implicit 0 return to save code size (caller will cast "undefined" into 0 + // anyhow) + } + function _emscripten_resize_heap(requestedSize) { + var oldSize = HEAPU8.length; + requestedSize = requestedSize >>> 0; + // With multithreaded builds, races can happen (another thread might increase the size + // in between), so return a failure, and let the caller retry. + assert(requestedSize > oldSize); + + // Memory resize rules: + // 1. Always increase heap size to at least the requested size, rounded up + // to next page multiple. + // 2a. If MEMORY_GROWTH_LINEAR_STEP == -1, excessively resize the heap + // geometrically: increase the heap size according to + // MEMORY_GROWTH_GEOMETRIC_STEP factor (default +20%), At most + // overreserve by MEMORY_GROWTH_GEOMETRIC_CAP bytes (default 96MB). + // 2b. If MEMORY_GROWTH_LINEAR_STEP != -1, excessively resize the heap + // linearly: increase the heap size by at least + // MEMORY_GROWTH_LINEAR_STEP bytes. + // 3. Max size for the heap is capped at 2048MB-WASM_PAGE_SIZE, or by + // MAXIMUM_MEMORY, or by ASAN limit, depending on which is smallest + // 4. If we were unable to allocate as much memory, it may be due to + // over-eager decision to excessively reserve due to (3) above. + // Hence if an allocation fails, cut down on the amount of excess + // growth, in an attempt to succeed to perform a smaller allocation. + + // A limit is set for how much we can grow. We should not exceed that + // (the wasm binary specifies it, so if we tried, we'd fail anyhow). + var maxHeapSize = _emscripten_get_heap_max(); + if (requestedSize > maxHeapSize) { + err('Cannot enlarge memory, asked to go up to ' + requestedSize + ' bytes, but the limit is ' + maxHeapSize + ' bytes!'); + return false; + } + + let alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple; + + // Loop through potential heap size increases. If we attempt a too eager + // reservation that fails, cut down on the attempted size and reserve a + // smaller bump instead. (max 3 times, chosen somewhat arbitrarily) + for (var cutDown = 1; cutDown <= 4; cutDown *= 2) { + var overGrownHeapSize = oldSize * (1 + 0.2 / cutDown); // ensure geometric growth + // but limit overreserving (default to capping at +96MB overgrowth at most) + overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296 ); + + var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536)); + + var replacement = emscripten_realloc_buffer(newSize); + if (replacement) { + + return true; + } + } + err('Failed to grow the heap from ' + oldSize + ' bytes to ' + newSize + ' bytes, not enough memory!'); + return false; + } + + /** @suppress {checkTypes} */ + function _emscripten_sample_gamepad_data() { + try { + if (navigator.getGamepads) return (JSEvents.lastGamepadState = navigator.getGamepads()) + ? 0 /*EMSCRIPTEN_RESULT_SUCCESS*/ : -1 /*EMSCRIPTEN_RESULT_NOT_SUPPORTED*/; + } catch(e) { + err(`navigator.getGamepads() exists, but failed to execute with exception ${e}. Disabling Gamepad access.`); + navigator.getGamepads = null; // Disable getGamepads() so that it won't be attempted to be used again. + } + return -1 /*EMSCRIPTEN_RESULT_NOT_SUPPORTED*/; + } + + function registerFocusEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.focusEvent) JSEvents.focusEvent = _malloc( 256 ); + + var focusEventHandlerFunc = function(ev) { + var e = ev || event; + + var nodeName = JSEvents.getNodeNameForTarget(e.target); + var id = e.target.id ? e.target.id : ''; + + var focusEvent = JSEvents.focusEvent; + stringToUTF8(nodeName, focusEvent + 0, 128); + stringToUTF8(id, focusEvent + 128, 128); + + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, focusEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: findEventTarget(target), + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: focusEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + function _emscripten_set_blur_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerFocusEventCallback(target, userData, useCapture, callbackfunc, 12, "blur", targetThread); + return 0; + } + + + function _emscripten_set_focus_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerFocusEventCallback(target, userData, useCapture, callbackfunc, 13, "focus", targetThread); + return 0; + } + + function registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.fullscreenChangeEvent) JSEvents.fullscreenChangeEvent = _malloc( 280 ); + + var fullscreenChangeEventhandlerFunc = function(ev) { + var e = ev || event; + + var fullscreenChangeEvent = JSEvents.fullscreenChangeEvent; + + fillFullscreenChangeEventData(fullscreenChangeEvent); + + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, fullscreenChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: fullscreenChangeEventhandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + function _emscripten_set_fullscreenchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + if (!JSEvents.fullscreenEnabled()) return -1; + target = findEventTarget(target); + if (!target) return -4; + registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange", targetThread); + + // Unprefixed Fullscreen API shipped in Chromium 71 (https://bugs.chromium.org/p/chromium/issues/detail?id=383813) + // As of Safari 13.0.3 on macOS Catalina 10.15.1 still ships with prefixed webkitfullscreenchange. TODO: revisit this check once Safari ships unprefixed version. + registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange", targetThread); + + return 0; + } + + function registerGamepadEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.gamepadEvent) JSEvents.gamepadEvent = _malloc( 1432 ); + + var gamepadEventHandlerFunc = function(ev) { + var e = ev || event; + + var gamepadEvent = JSEvents.gamepadEvent; + fillGamepadEventData(gamepadEvent, e["gamepad"]); + + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, gamepadEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: findEventTarget(target), + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: gamepadEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + function _emscripten_set_gamepadconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { + if (_emscripten_sample_gamepad_data()) return -1 /*EMSCRIPTEN_RESULT_NOT_SUPPORTED*/; + return registerGamepadEventCallback(2 /*EMSCRIPTEN_EVENT_TARGET_WINDOW*/, userData, useCapture, callbackfunc, 26 /*EMSCRIPTEN_EVENT_GAMEPADCONNECTED*/, "gamepadconnected", targetThread); + } + + function _emscripten_set_gamepaddisconnected_callback_on_thread(userData, useCapture, callbackfunc, targetThread) { + if (_emscripten_sample_gamepad_data()) return -1 /*EMSCRIPTEN_RESULT_NOT_SUPPORTED*/; + return registerGamepadEventCallback(2 /*EMSCRIPTEN_EVENT_TARGET_WINDOW*/, userData, useCapture, callbackfunc, 27 /*EMSCRIPTEN_EVENT_GAMEPADDISCONNECTED*/, "gamepaddisconnected", targetThread); + } + + function _emscripten_set_interval(cb, msecs, userData) { + + return setInterval(function() { + callUserCallback(function() { + (function(a1) { dynCall_vi.apply(null, [cb, a1]); })(userData) + }); + }, msecs); + } + + function registerKeyEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.keyEvent) JSEvents.keyEvent = _malloc( 176 ); + + var keyEventHandlerFunc = function(e) { + assert(e); + + var keyEventData = JSEvents.keyEvent; + HEAPF64[((keyEventData)>>3)] = e.timeStamp; + + var idx = keyEventData >> 2; + + HEAP32[idx + 2] = e.location; + HEAP32[idx + 3] = e.ctrlKey; + HEAP32[idx + 4] = e.shiftKey; + HEAP32[idx + 5] = e.altKey; + HEAP32[idx + 6] = e.metaKey; + HEAP32[idx + 7] = e.repeat; + HEAP32[idx + 8] = e.charCode; + HEAP32[idx + 9] = e.keyCode; + HEAP32[idx + 10] = e.which; + stringToUTF8(e.key || '', keyEventData + 44, 32); + stringToUTF8(e.code || '', keyEventData + 76, 32); + stringToUTF8(e.char || '', keyEventData + 108, 32); + stringToUTF8(e.locale || '', keyEventData + 140, 32); + + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, keyEventData, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: findEventTarget(target), + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: keyEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + function _emscripten_set_keydown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerKeyEventCallback(target, userData, useCapture, callbackfunc, 2, "keydown", targetThread); + return 0; + } + + function _emscripten_set_keypress_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress", targetThread); + return 0; + } + + function _emscripten_set_keyup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerKeyEventCallback(target, userData, useCapture, callbackfunc, 3, "keyup", targetThread); + return 0; + } + + function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop) { + var browserIterationFunc = (function() { dynCall_v.call(null, func); }); + setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop); + } + + + function fillMouseEventData(eventStruct, e, target) { + assert(eventStruct % 4 == 0); + HEAPF64[((eventStruct)>>3)] = e.timeStamp; + var idx = eventStruct >> 2; + HEAP32[idx + 2] = e.screenX; + HEAP32[idx + 3] = e.screenY; + HEAP32[idx + 4] = e.clientX; + HEAP32[idx + 5] = e.clientY; + HEAP32[idx + 6] = e.ctrlKey; + HEAP32[idx + 7] = e.shiftKey; + HEAP32[idx + 8] = e.altKey; + HEAP32[idx + 9] = e.metaKey; + HEAP16[idx*2 + 20] = e.button; + HEAP16[idx*2 + 21] = e.buttons; + + HEAP32[idx + 11] = e["movementX"] + ; + + HEAP32[idx + 12] = e["movementY"] + ; + + var rect = getBoundingClientRect(target); + HEAP32[idx + 13] = e.clientX - rect.left; + HEAP32[idx + 14] = e.clientY - rect.top; + + } + function registerMouseEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.mouseEvent) JSEvents.mouseEvent = _malloc( 72 ); + target = findEventTarget(target); + + var mouseEventHandlerFunc = function(ev) { + var e = ev || event; + + // TODO: Make this access thread safe, or this could update live while app is reading it. + fillMouseEventData(JSEvents.mouseEvent, e, target); + + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, JSEvents.mouseEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them! + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: mouseEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + function _emscripten_set_mousedown_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerMouseEventCallback(target, userData, useCapture, callbackfunc, 5, "mousedown", targetThread); + return 0; + } + + function _emscripten_set_mousemove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerMouseEventCallback(target, userData, useCapture, callbackfunc, 8, "mousemove", targetThread); + return 0; + } + + function _emscripten_set_mouseup_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerMouseEventCallback(target, userData, useCapture, callbackfunc, 6, "mouseup", targetThread); + return 0; + } + + function fillPointerlockChangeEventData(eventStruct) { + var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; + var isPointerlocked = !!pointerLockElement; + // Assigning a boolean to HEAP32 with expected type coercion. + /** @suppress{checkTypes} */ + HEAP32[((eventStruct)>>2)] = isPointerlocked; + var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); + var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : ''; + stringToUTF8(nodeName, eventStruct + 4, 128); + stringToUTF8(id, eventStruct + 132, 128); + } + function registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.pointerlockChangeEvent) JSEvents.pointerlockChangeEvent = _malloc( 260 ); + + var pointerlockChangeEventHandlerFunc = function(ev) { + var e = ev || event; + + var pointerlockChangeEvent = JSEvents.pointerlockChangeEvent; + fillPointerlockChangeEventData(pointerlockChangeEvent); + + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, pointerlockChangeEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: pointerlockChangeEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + /** @suppress {missingProperties} */ + function _emscripten_set_pointerlockchange_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + // TODO: Currently not supported in pthreads or in --proxy-to-worker mode. (In pthreads mode, document object is not defined) + if (!document || !document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) { + return -1; + } + + target = findEventTarget(target); + if (!target) return -4; + registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "pointerlockchange", targetThread); + registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "mozpointerlockchange", targetThread); + registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "webkitpointerlockchange", targetThread); + registerPointerlockChangeEventCallback(target, userData, useCapture, callbackfunc, 20, "mspointerlockchange", targetThread); + return 0; + } + + function registerTouchEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.touchEvent) JSEvents.touchEvent = _malloc( 1696 ); + + target = findEventTarget(target); + + var touchEventHandlerFunc = function(e) { + assert(e); + var t, touches = {}, et = e.touches; + // To ease marshalling different kinds of touches that browser reports (all touches are listed in e.touches, + // only changed touches in e.changedTouches, and touches on target at a.targetTouches), mark a boolean in + // each Touch object so that we can later loop only once over all touches we see to marshall over to Wasm. + + for (var i = 0; i < et.length; ++i) { + t = et[i]; + // Browser might recycle the generated Touch objects between each frame (Firefox on Android), so reset any + // changed/target states we may have set from previous frame. + t.isChanged = t.onTarget = 0; + touches[t.identifier] = t; + } + + // Mark which touches are part of the changedTouches list. + for (var i = 0; i < e.changedTouches.length; ++i) { + t = e.changedTouches[i]; + t.isChanged = 1; + touches[t.identifier] = t; + } + // Mark which touches are part of the targetTouches list. + for (var i = 0; i < e.targetTouches.length; ++i) { + touches[e.targetTouches[i].identifier].onTarget = 1; + } + + var touchEvent = JSEvents.touchEvent; + var idx = touchEvent>>2; // Pre-shift the ptr to index to HEAP32 to save code size + HEAP32[idx + 3] = e.ctrlKey; + HEAP32[idx + 4] = e.shiftKey; + HEAP32[idx + 5] = e.altKey; + HEAP32[idx + 6] = e.metaKey; + idx += 7; // Advance to the start of the touch array. + var targetRect = getBoundingClientRect(target); + var numTouches = 0; + for (var i in touches) { + var t = touches[i]; + HEAP32[idx + 0] = t.identifier; + HEAP32[idx + 1] = t.screenX; + HEAP32[idx + 2] = t.screenY; + HEAP32[idx + 3] = t.clientX; + HEAP32[idx + 4] = t.clientY; + HEAP32[idx + 5] = t.pageX; + HEAP32[idx + 6] = t.pageY; + HEAP32[idx + 7] = t.isChanged; + HEAP32[idx + 8] = t.onTarget; + HEAP32[idx + 9] = t.clientX - targetRect.left; + HEAP32[idx + 10] = t.clientY - targetRect.top; + + idx += 13; + + if (++numTouches > 31) { + break; + } + } + HEAP32[(((touchEvent)+(8))>>2)] = numTouches; + + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, touchEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString == 'touchstart' || eventTypeString == 'touchend', + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: touchEventHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + function _emscripten_set_touchcancel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel", targetThread); + return 0; + } + + function _emscripten_set_touchend_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend", targetThread); + return 0; + } + + function _emscripten_set_touchmove_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove", targetThread); + return 0; + } + + function _emscripten_set_touchstart_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart", targetThread); + return 0; + } + + function registerWheelEventCallback(target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString, targetThread) { + if (!JSEvents.wheelEvent) JSEvents.wheelEvent = _malloc( 104 ); + + // The DOM Level 3 events spec event 'wheel' + var wheelHandlerFunc = function(ev) { + var e = ev || event; + var wheelEvent = JSEvents.wheelEvent; + fillMouseEventData(wheelEvent, e, target); + HEAPF64[(((wheelEvent)+(72))>>3)] = e["deltaX"]; + HEAPF64[(((wheelEvent)+(80))>>3)] = e["deltaY"]; + HEAPF64[(((wheelEvent)+(88))>>3)] = e["deltaZ"]; + HEAP32[(((wheelEvent)+(96))>>2)] = e["deltaMode"]; + if ((function(a1, a2, a3) { return dynCall_iiii.apply(null, [callbackfunc, a1, a2, a3]); })(eventTypeId, wheelEvent, userData)) e.preventDefault(); + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: wheelHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + } + function _emscripten_set_wheel_callback_on_thread(target, userData, useCapture, callbackfunc, targetThread) { + target = findEventTarget(target); + if (typeof target.onwheel != 'undefined') { + registerWheelEventCallback(target, userData, useCapture, callbackfunc, 9, "wheel", targetThread); + return 0; + } else { + return -1; + } + } + + function __webgl_enable_ANGLE_instanced_arrays(ctx) { + // Extension available in WebGL 1 from Firefox 26 and Google Chrome 30 onwards. Core feature in WebGL 2. + var ext = ctx.getExtension('ANGLE_instanced_arrays'); + if (ext) { + ctx['vertexAttribDivisor'] = function(index, divisor) { ext['vertexAttribDivisorANGLE'](index, divisor); }; + ctx['drawArraysInstanced'] = function(mode, first, count, primcount) { ext['drawArraysInstancedANGLE'](mode, first, count, primcount); }; + ctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { ext['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); }; + return 1; + } + } + + function __webgl_enable_OES_vertex_array_object(ctx) { + // Extension available in WebGL 1 from Firefox 25 and WebKit 536.28/desktop Safari 6.0.3 onwards. Core feature in WebGL 2. + var ext = ctx.getExtension('OES_vertex_array_object'); + if (ext) { + ctx['createVertexArray'] = function() { return ext['createVertexArrayOES'](); }; + ctx['deleteVertexArray'] = function(vao) { ext['deleteVertexArrayOES'](vao); }; + ctx['bindVertexArray'] = function(vao) { ext['bindVertexArrayOES'](vao); }; + ctx['isVertexArray'] = function(vao) { return ext['isVertexArrayOES'](vao); }; + return 1; + } + } + + function __webgl_enable_WEBGL_draw_buffers(ctx) { + // Extension available in WebGL 1 from Firefox 28 onwards. Core feature in WebGL 2. + var ext = ctx.getExtension('WEBGL_draw_buffers'); + if (ext) { + ctx['drawBuffers'] = function(n, bufs) { ext['drawBuffersWEBGL'](n, bufs); }; + return 1; + } + } + + function __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(ctx) { + // Closure is expected to be allowed to minify the '.dibvbi' property, so not accessing it quoted. + return !!(ctx.dibvbi = ctx.getExtension('WEBGL_draw_instanced_base_vertex_base_instance')); + } + + function __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(ctx) { + // Closure is expected to be allowed to minify the '.mdibvbi' property, so not accessing it quoted. + return !!(ctx.mdibvbi = ctx.getExtension('WEBGL_multi_draw_instanced_base_vertex_base_instance')); + } + + function __webgl_enable_WEBGL_multi_draw(ctx) { + // Closure is expected to be allowed to minify the '.multiDrawWebgl' property, so not accessing it quoted. + return !!(ctx.multiDrawWebgl = ctx.getExtension('WEBGL_multi_draw')); + } + var GL = {counter:1,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],shaders:[],vaos:[],contexts:[],offscreenCanvases:{},queries:[],samplers:[],transformFeedbacks:[],syncs:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],stringCache:{},stringiCache:{},unpackAlignment:4,recordError:function recordError(errorCode) { + if (!GL.lastError) { + GL.lastError = errorCode; + } + },getNewId:function(table) { + var ret = GL.counter++; + for (var i = table.length; i < ret; i++) { + table[i] = null; + } + return ret; + },MAX_TEMP_BUFFER_SIZE:2097152,numTempVertexBuffersPerSize:64,log2ceilLookup:function(i) { + return 32 - Math.clz32(i === 0 ? 0 : i - 1); + },generateTempBuffers:function(quads, context) { + var largestIndex = GL.log2ceilLookup(GL.MAX_TEMP_BUFFER_SIZE); + context.tempVertexBufferCounters1 = []; + context.tempVertexBufferCounters2 = []; + context.tempVertexBufferCounters1.length = context.tempVertexBufferCounters2.length = largestIndex+1; + context.tempVertexBuffers1 = []; + context.tempVertexBuffers2 = []; + context.tempVertexBuffers1.length = context.tempVertexBuffers2.length = largestIndex+1; + context.tempIndexBuffers = []; + context.tempIndexBuffers.length = largestIndex+1; + for (var i = 0; i <= largestIndex; ++i) { + context.tempIndexBuffers[i] = null; // Created on-demand + context.tempVertexBufferCounters1[i] = context.tempVertexBufferCounters2[i] = 0; + var ringbufferLength = GL.numTempVertexBuffersPerSize; + context.tempVertexBuffers1[i] = []; + context.tempVertexBuffers2[i] = []; + var ringbuffer1 = context.tempVertexBuffers1[i]; + var ringbuffer2 = context.tempVertexBuffers2[i]; + ringbuffer1.length = ringbuffer2.length = ringbufferLength; + for (var j = 0; j < ringbufferLength; ++j) { + ringbuffer1[j] = ringbuffer2[j] = null; // Created on-demand + } + } + + if (quads) { + // GL_QUAD indexes can be precalculated + context.tempQuadIndexBuffer = GLctx.createBuffer(); + context.GLctx.bindBuffer(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, context.tempQuadIndexBuffer); + var numIndexes = GL.MAX_TEMP_BUFFER_SIZE >> 1; + var quadIndexes = new Uint16Array(numIndexes); + var i = 0, v = 0; + while (1) { + quadIndexes[i++] = v; + if (i >= numIndexes) break; + quadIndexes[i++] = v+1; + if (i >= numIndexes) break; + quadIndexes[i++] = v+2; + if (i >= numIndexes) break; + quadIndexes[i++] = v; + if (i >= numIndexes) break; + quadIndexes[i++] = v+2; + if (i >= numIndexes) break; + quadIndexes[i++] = v+3; + if (i >= numIndexes) break; + v += 4; + } + context.GLctx.bufferData(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, quadIndexes, 0x88E4 /*GL_STATIC_DRAW*/); + context.GLctx.bindBuffer(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, null); + } + },getTempVertexBuffer:function getTempVertexBuffer(sizeBytes) { + var idx = GL.log2ceilLookup(sizeBytes); + var ringbuffer = GL.currentContext.tempVertexBuffers1[idx]; + var nextFreeBufferIndex = GL.currentContext.tempVertexBufferCounters1[idx]; + GL.currentContext.tempVertexBufferCounters1[idx] = (GL.currentContext.tempVertexBufferCounters1[idx]+1) & (GL.numTempVertexBuffersPerSize-1); + var vbo = ringbuffer[nextFreeBufferIndex]; + if (vbo) { + return vbo; + } + var prevVBO = GLctx.getParameter(0x8894 /*GL_ARRAY_BUFFER_BINDING*/); + ringbuffer[nextFreeBufferIndex] = GLctx.createBuffer(); + GLctx.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, ringbuffer[nextFreeBufferIndex]); + GLctx.bufferData(0x8892 /*GL_ARRAY_BUFFER*/, 1 << idx, 0x88E8 /*GL_DYNAMIC_DRAW*/); + GLctx.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, prevVBO); + return ringbuffer[nextFreeBufferIndex]; + },getTempIndexBuffer:function getTempIndexBuffer(sizeBytes) { + var idx = GL.log2ceilLookup(sizeBytes); + var ibo = GL.currentContext.tempIndexBuffers[idx]; + if (ibo) { + return ibo; + } + var prevIBO = GLctx.getParameter(0x8895 /*ELEMENT_ARRAY_BUFFER_BINDING*/); + GL.currentContext.tempIndexBuffers[idx] = GLctx.createBuffer(); + GLctx.bindBuffer(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, GL.currentContext.tempIndexBuffers[idx]); + GLctx.bufferData(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, 1 << idx, 0x88E8 /*GL_DYNAMIC_DRAW*/); + GLctx.bindBuffer(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, prevIBO); + return GL.currentContext.tempIndexBuffers[idx]; + },newRenderingFrameStarted:function newRenderingFrameStarted() { + if (!GL.currentContext) { + return; + } + var vb = GL.currentContext.tempVertexBuffers1; + GL.currentContext.tempVertexBuffers1 = GL.currentContext.tempVertexBuffers2; + GL.currentContext.tempVertexBuffers2 = vb; + vb = GL.currentContext.tempVertexBufferCounters1; + GL.currentContext.tempVertexBufferCounters1 = GL.currentContext.tempVertexBufferCounters2; + GL.currentContext.tempVertexBufferCounters2 = vb; + var largestIndex = GL.log2ceilLookup(GL.MAX_TEMP_BUFFER_SIZE); + for (var i = 0; i <= largestIndex; ++i) { + GL.currentContext.tempVertexBufferCounters1[i] = 0; + } + },getSource:function(shader, count, string, length) { + var source = ''; + for (var i = 0; i < count; ++i) { + var len = length ? HEAP32[(((length)+(i*4))>>2)] : -1; + source += UTF8ToString(HEAP32[(((string)+(i*4))>>2)], len < 0 ? undefined : len); + } + return source; + },calcBufLength:function calcBufLength(size, type, stride, count) { + if (stride > 0) { + return count * stride; // XXXvlad this is not exactly correct I don't think + } + var typeSize = GL.byteSizeByType[type - GL.byteSizeByTypeRoot]; + return size * typeSize * count; + },usedTempBuffers:[],preDrawHandleClientVertexAttribBindings:function preDrawHandleClientVertexAttribBindings(count) { + GL.resetBufferBinding = false; + + // TODO: initial pass to detect ranges we need to upload, might not need an upload per attrib + for (var i = 0; i < GL.currentContext.maxVertexAttribs; ++i) { + var cb = GL.currentContext.clientBuffers[i]; + if (!cb.clientside || !cb.enabled) continue; + + GL.resetBufferBinding = true; + + var size = GL.calcBufLength(cb.size, cb.type, cb.stride, count); + var buf = GL.getTempVertexBuffer(size); + GLctx.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, buf); + GLctx.bufferSubData(0x8892 /*GL_ARRAY_BUFFER*/, + 0, + HEAPU8.subarray(cb.ptr, cb.ptr + size)); + cb.vertexAttribPointerAdaptor.call(GLctx, i, cb.size, cb.type, cb.normalized, cb.stride, 0); + } + },postDrawHandleClientVertexAttribBindings:function postDrawHandleClientVertexAttribBindings() { + if (GL.resetBufferBinding) { + GLctx.bindBuffer(0x8892 /*GL_ARRAY_BUFFER*/, GL.buffers[GLctx.currentArrayBufferBinding]); + } + },createContext:function(/** @type {HTMLCanvasElement} */ canvas, webGLContextAttributes) { + + // BUG: Workaround Safari WebGL issue: After successfully acquiring WebGL context on a canvas, + // calling .getContext() will always return that context independent of which 'webgl' or 'webgl2' + // context version was passed. See https://bugs.webkit.org/show_bug.cgi?id=222758 and + // https://github.com/emscripten-core/emscripten/issues/13295. + // TODO: Once the bug is fixed and shipped in Safari, adjust the Safari version field in above check. + if (!canvas.getContextSafariWebGL2Fixed) { + canvas.getContextSafariWebGL2Fixed = canvas.getContext; + /** @type {function(this:HTMLCanvasElement, string, (Object|null)=): (Object|null)} */ + function fixedGetContext(ver, attrs) { + var gl = canvas.getContextSafariWebGL2Fixed(ver, attrs); + return ((ver == 'webgl') == (gl instanceof WebGLRenderingContext)) ? gl : null; + } + canvas.getContext = fixedGetContext; + } + + var ctx = + (webGLContextAttributes.majorVersion > 1) + ? + canvas.getContext("webgl2", webGLContextAttributes) + : + (canvas.getContext("webgl", webGLContextAttributes) + // https://caniuse.com/#feat=webgl + ); + + if (!ctx) return 0; + + var handle = GL.registerContext(ctx, webGLContextAttributes); + + return handle; + },registerContext:function(ctx, webGLContextAttributes) { + // without pthreads a context is just an integer ID + var handle = GL.getNewId(GL.contexts); + + var context = { + handle: handle, + attributes: webGLContextAttributes, + version: webGLContextAttributes.majorVersion, + GLctx: ctx + }; + + // Store the created context object so that we can access the context given a canvas without having to pass the parameters again. + if (ctx.canvas) ctx.canvas.GLctxObject = context; + GL.contexts[handle] = context; + if (typeof webGLContextAttributes.enableExtensionsByDefault == 'undefined' || webGLContextAttributes.enableExtensionsByDefault) { + GL.initExtensions(context); + } + + context.maxVertexAttribs = context.GLctx.getParameter(0x8869 /*GL_MAX_VERTEX_ATTRIBS*/); + context.clientBuffers = []; + for (var i = 0; i < context.maxVertexAttribs; i++) { + context.clientBuffers[i] = { enabled: false, clientside: false, size: 0, type: 0, normalized: 0, stride: 0, ptr: 0, vertexAttribPointerAdaptor: null }; + } + + GL.generateTempBuffers(false, context); + + return handle; + },makeContextCurrent:function(contextHandle) { + + GL.currentContext = GL.contexts[contextHandle]; // Active Emscripten GL layer context object. + Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx; // Active WebGL context object. + return !(contextHandle && !GLctx); + },getContext:function(contextHandle) { + return GL.contexts[contextHandle]; + },deleteContext:function(contextHandle) { + if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; + if (typeof JSEvents == 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted. + if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises. + GL.contexts[contextHandle] = null; + },initExtensions:function(context) { + // If this function is called without a specific context object, init the extensions of the currently active context. + if (!context) context = GL.currentContext; + + if (context.initExtensionsDone) return; + context.initExtensionsDone = true; + + var GLctx = context.GLctx; + + // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. + + // Extensions that are only available in WebGL 1 (the calls will be no-ops if called on a WebGL 2 context active) + __webgl_enable_ANGLE_instanced_arrays(GLctx); + __webgl_enable_OES_vertex_array_object(GLctx); + __webgl_enable_WEBGL_draw_buffers(GLctx); + // Extensions that are available from WebGL >= 2 (no-op if called on a WebGL 1 context active) + __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx); + __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx); + + // On WebGL 2, EXT_disjoint_timer_query is replaced with an alternative + // that's based on core APIs, and exposes only the queryCounterEXT() + // entrypoint. + if (context.version >= 2) { + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query_webgl2"); + } + + // However, Firefox exposes the WebGL 1 version on WebGL 2 as well and + // thus we look for the WebGL 1 version again if the WebGL 2 version + // isn't present. https://bugzilla.mozilla.org/show_bug.cgi?id=1328882 + if (context.version < 2 || !GLctx.disjointTimerQueryExt) + { + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query"); + } + + __webgl_enable_WEBGL_multi_draw(GLctx); + + // .getSupportedExtensions() can return null if context is lost, so coerce to empty array. + var exts = GLctx.getSupportedExtensions() || []; + exts.forEach(function(ext) { + // WEBGL_lose_context, WEBGL_debug_renderer_info and WEBGL_debug_shaders are not enabled by default. + if (!ext.includes('lose_context') && !ext.includes('debug')) { + // Call .getExtension() to enable that extension permanently. + GLctx.getExtension(ext); + } + }); + }}; + + var __emscripten_webgl_power_preferences = ['default', 'low-power', 'high-performance']; + function _emscripten_webgl_do_create_context(target, attributes) { + assert(attributes); + var a = attributes >> 2; + var powerPreference = HEAP32[a + (24>>2)]; + var contextAttributes = { + 'alpha': !!HEAP32[a + (0>>2)], + 'depth': !!HEAP32[a + (4>>2)], + 'stencil': !!HEAP32[a + (8>>2)], + 'antialias': !!HEAP32[a + (12>>2)], + 'premultipliedAlpha': !!HEAP32[a + (16>>2)], + 'preserveDrawingBuffer': !!HEAP32[a + (20>>2)], + 'powerPreference': __emscripten_webgl_power_preferences[powerPreference], + 'failIfMajorPerformanceCaveat': !!HEAP32[a + (28>>2)], + // The following are not predefined WebGL context attributes in the WebGL specification, so the property names can be minified by Closure. + majorVersion: HEAP32[a + (32>>2)], + minorVersion: HEAP32[a + (36>>2)], + enableExtensionsByDefault: HEAP32[a + (40>>2)], + explicitSwapControl: HEAP32[a + (44>>2)], + proxyContextToMainThread: HEAP32[a + (48>>2)], + renderViaOffscreenBackBuffer: HEAP32[a + (52>>2)] + }; + + var canvas = findCanvasEventTarget(target); + + if (!canvas) { + return 0; + } + + if (contextAttributes.explicitSwapControl) { + return 0; + } + + var contextHandle = GL.createContext(canvas, contextAttributes); + return contextHandle; + } + function _emscripten_webgl_create_context(a0,a1 + ) { + return _emscripten_webgl_do_create_context(a0,a1); + } + + function _emscripten_webgl_destroy_context(contextHandle) { + if (GL.currentContext == contextHandle) GL.currentContext = 0; + GL.deleteContext(contextHandle); + } + + function _emscripten_webgl_enable_extension(contextHandle, extension) { + var context = GL.getContext(contextHandle); + var extString = UTF8ToString(extension); + if (extString.startsWith('GL_')) extString = extString.substr(3); // Allow enabling extensions both with "GL_" prefix and without. + + // Switch-board that pulls in code for all GL extensions, even if those are not used :/ + // Build with -s GL_SUPPORT_SIMPLE_ENABLE_EXTENSIONS = 0 to avoid this. + + // Obtain function entry points to WebGL 1 extension related functions. + if (extString == 'ANGLE_instanced_arrays') __webgl_enable_ANGLE_instanced_arrays(GLctx); + if (extString == 'OES_vertex_array_object') __webgl_enable_OES_vertex_array_object(GLctx); + if (extString == 'WEBGL_draw_buffers') __webgl_enable_WEBGL_draw_buffers(GLctx); + + if (extString == 'WEBGL_draw_instanced_base_vertex_base_instance') __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx); + if (extString == 'WEBGL_multi_draw_instanced_base_vertex_base_instance') __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx); + + if (extString == 'WEBGL_multi_draw') __webgl_enable_WEBGL_multi_draw(GLctx); + + var ext = context.GLctx.getExtension(extString); + return !!ext; + } + + function _emscripten_webgl_do_get_current_context() { + return GL.currentContext ? GL.currentContext.handle : 0; + } + function _emscripten_webgl_get_current_context( + ) { + return _emscripten_webgl_do_get_current_context(); + } + + function _emscripten_webgl_init_context_attributes(attributes) { + assert(attributes); + var a = attributes >> 2; + for (var i = 0; i < (56>>2); ++i) { + HEAP32[a+i] = 0; + } + + HEAP32[a + (0>>2)] = + HEAP32[a + (4>>2)] = + HEAP32[a + (12>>2)] = + HEAP32[a + (16>>2)] = + HEAP32[a + (32>>2)] = + HEAP32[a + (40>>2)] = 1; + + } + + function _emscripten_webgl_make_context_current(contextHandle) { + var success = GL.makeContextCurrent(contextHandle); + return success ? 0 : -5; + } + + var ENV = {}; + + function getExecutableName() { + return thisProgram || './this.program'; + } + function getEnvStrings() { + if (!getEnvStrings.strings) { + // Default values. + // Browser language detection #8751 + var lang = ((typeof navigator == 'object' && navigator.languages && navigator.languages[0]) || 'C').replace('-', '_') + '.UTF-8'; + var env = { + 'USER': 'web_user', + 'LOGNAME': 'web_user', + 'PATH': '/', + 'PWD': '/', + 'HOME': '/home/web_user', + 'LANG': lang, + '_': getExecutableName() + }; + // Apply the user-provided values, if any. + for (var x in ENV) { + // x is a key in ENV; if ENV[x] is undefined, that means it was + // explicitly set to be so. We allow user code to do that to + // force variables with default values to remain unset. + if (ENV[x] === undefined) delete env[x]; + else env[x] = ENV[x]; + } + var strings = []; + for (var x in env) { + strings.push(x + '=' + env[x]); + } + getEnvStrings.strings = strings; + } + return getEnvStrings.strings; + } + function _environ_get(__environ, environ_buf) { + var bufSize = 0; + getEnvStrings().forEach(function(string, i) { + var ptr = environ_buf + bufSize; + HEAP32[(((__environ)+(i * 4))>>2)] = ptr; + writeAsciiToMemory(string, ptr); + bufSize += string.length + 1; + }); + return 0; + } + + function _environ_sizes_get(penviron_count, penviron_buf_size) { + var strings = getEnvStrings(); + HEAP32[((penviron_count)>>2)] = strings.length; + var bufSize = 0; + strings.forEach(function(string) { + bufSize += string.length + 1; + }); + HEAP32[((penviron_buf_size)>>2)] = bufSize; + return 0; + } + + + function _fd_close(fd) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _fd_fdstat_get(fd, pbuf) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + // All character devices are terminals (other things a Linux system would + // assume is a character device, like the mouse, we have special APIs for). + var type = stream.tty ? 2 : + FS.isDir(stream.mode) ? 3 : + FS.isLink(stream.mode) ? 7 : + 4; + HEAP8[((pbuf)>>0)] = type; + // TODO HEAP16[(((pbuf)+(2))>>1)] = ?; + // TODO (tempI64 = [?>>>0,(tempDouble=?,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((pbuf)+(8))>>2)] = tempI64[0],HEAP32[(((pbuf)+(12))>>2)] = tempI64[1]); + // TODO (tempI64 = [?>>>0,(tempDouble=?,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[(((pbuf)+(16))>>2)] = tempI64[0],HEAP32[(((pbuf)+(20))>>2)] = tempI64[1]); + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _fd_read(fd, iov, iovcnt, pnum) { + try { + + var stream = SYSCALLS.getStreamFromFD(fd); + var num = SYSCALLS.doReadv(stream, iov, iovcnt); + HEAP32[((pnum)>>2)] = num; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _fd_seek(fd, offset_low, offset_high, whence, newOffset) { + try { + + + var stream = SYSCALLS.getStreamFromFD(fd); + var HIGH_OFFSET = 0x100000000; // 2^32 + // use an unsigned operator on low and shift high by 32-bits + var offset = offset_high * HIGH_OFFSET + (offset_low >>> 0); + + var DOUBLE_LIMIT = 0x20000000000000; // 2^53 + // we also check for equality since DOUBLE_LIMIT + 1 == DOUBLE_LIMIT + if (offset <= -DOUBLE_LIMIT || offset >= DOUBLE_LIMIT) { + return -61; + } + + FS.llseek(stream, offset, whence); + (tempI64 = [stream.position>>>0,(tempDouble=stream.position,(+(Math.abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math.min((+(Math.floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math.ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((newOffset)>>2)] = tempI64[0],HEAP32[(((newOffset)+(4))>>2)] = tempI64[1]); + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _fd_write(fd, iov, iovcnt, pnum) { + try { + + ; + var stream = SYSCALLS.getStreamFromFD(fd); + var num = SYSCALLS.doWritev(stream, iov, iovcnt); + HEAP32[((pnum)>>2)] = num; + return 0; + } catch (e) { + if (typeof FS == 'undefined' || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } + } + + function _getTempRet0() { + return getTempRet0(); + } + + function _getaddrinfo(node, service, hint, out) { + // Note getaddrinfo currently only returns a single addrinfo with ai_next defaulting to NULL. When NULL + // hints are specified or ai_family set to AF_UNSPEC or ai_socktype or ai_protocol set to 0 then we + // really should provide a linked list of suitable addrinfo values. + var addrs = []; + var canon = null; + var addr = 0; + var port = 0; + var flags = 0; + var family = 0; + var type = 0; + var proto = 0; + var ai, last; + + function allocaddrinfo(family, type, proto, canon, addr, port) { + var sa, salen, ai; + var errno; + + salen = family === 10 ? + 28 : + 16; + addr = family === 10 ? + inetNtop6(addr) : + inetNtop4(addr); + sa = _malloc(salen); + errno = writeSockaddr(sa, family, addr, port); + assert(!errno); + + ai = _malloc(32); + HEAP32[(((ai)+(4))>>2)] = family; + HEAP32[(((ai)+(8))>>2)] = type; + HEAP32[(((ai)+(12))>>2)] = proto; + HEAP32[(((ai)+(24))>>2)] = canon; + HEAP32[(((ai)+(20))>>2)] = sa; + if (family === 10) { + HEAP32[(((ai)+(16))>>2)] = 28; + } else { + HEAP32[(((ai)+(16))>>2)] = 16; + } + HEAP32[(((ai)+(28))>>2)] = 0; + + return ai; + } + + if (hint) { + flags = HEAP32[((hint)>>2)]; + family = HEAP32[(((hint)+(4))>>2)]; + type = HEAP32[(((hint)+(8))>>2)]; + proto = HEAP32[(((hint)+(12))>>2)]; + } + if (type && !proto) { + proto = type === 2 ? 17 : 6; + } + if (!type && proto) { + type = proto === 17 ? 2 : 1; + } + + // If type or proto are set to zero in hints we should really be returning multiple addrinfo values, but for + // now default to a TCP STREAM socket so we can at least return a sensible addrinfo given NULL hints. + if (proto === 0) { + proto = 6; + } + if (type === 0) { + type = 1; + } + + if (!node && !service) { + return -2; + } + if (flags & ~(1|2|4| + 1024|8|16|32)) { + return -1; + } + if (hint !== 0 && (HEAP32[((hint)>>2)] & 2) && !node) { + return -1; + } + if (flags & 32) { + // TODO + return -2; + } + if (type !== 0 && type !== 1 && type !== 2) { + return -7; + } + if (family !== 0 && family !== 2 && family !== 10) { + return -6; + } + + if (service) { + service = UTF8ToString(service); + port = parseInt(service, 10); + + if (isNaN(port)) { + if (flags & 1024) { + return -2; + } + // TODO support resolving well-known service names from: + // http://www.iana.org/assignments/service-names-port-numbers/service-names-port-numbers.txt + return -8; + } + } + + if (!node) { + if (family === 0) { + family = 2; + } + if ((flags & 1) === 0) { + if (family === 2) { + addr = _htonl(2130706433); + } else { + addr = [0, 0, 0, 1]; + } + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAP32[((out)>>2)] = ai; + return 0; + } + + // + // try as a numeric address + // + node = UTF8ToString(node); + addr = inetPton4(node); + if (addr !== null) { + // incoming node is a valid ipv4 address + if (family === 0 || family === 2) { + family = 2; + } + else if (family === 10 && (flags & 8)) { + addr = [0, 0, _htonl(0xffff), addr]; + family = 10; + } else { + return -2; + } + } else { + addr = inetPton6(node); + if (addr !== null) { + // incoming node is a valid ipv6 address + if (family === 0 || family === 10) { + family = 10; + } else { + return -2; + } + } + } + if (addr != null) { + ai = allocaddrinfo(family, type, proto, node, addr, port); + HEAP32[((out)>>2)] = ai; + return 0; + } + if (flags & 4) { + return -2; + } + + // + // try as a hostname + // + // resolve the hostname to a temporary fake address + node = DNS.lookup_name(node); + addr = inetPton4(node); + if (family === 0) { + family = 2; + } else if (family === 10) { + addr = [0, 0, _htonl(0xffff), addr]; + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + HEAP32[((out)>>2)] = ai; + return 0; + } + + function getHostByName(name) { + // generate hostent + var ret = _malloc(20); // XXX possibly leaked, as are others here + var nameBuf = _malloc(name.length+1); + stringToUTF8(name, nameBuf, name.length+1); + HEAP32[((ret)>>2)] = nameBuf; + var aliasesBuf = _malloc(4); + HEAP32[((aliasesBuf)>>2)] = 0; + HEAP32[(((ret)+(4))>>2)] = aliasesBuf; + var afinet = 2; + HEAP32[(((ret)+(8))>>2)] = afinet; + HEAP32[(((ret)+(12))>>2)] = 4; + var addrListBuf = _malloc(12); + HEAP32[((addrListBuf)>>2)] = addrListBuf+8; + HEAP32[(((addrListBuf)+(4))>>2)] = 0; + HEAP32[(((addrListBuf)+(8))>>2)] = inetPton4(DNS.lookup_name(name)); + HEAP32[(((ret)+(16))>>2)] = addrListBuf; + return ret; + } + function _gethostbyaddr(addr, addrlen, type) { + if (type !== 2) { + setErrNo(5); + // TODO: set h_errno + return null; + } + addr = HEAP32[((addr)>>2)]; // addr is in_addr + var host = inetNtop4(addr); + var lookup = DNS.lookup_addr(host); + if (lookup) { + host = lookup; + } + return getHostByName(host); + } + + function _gethostbyname(name) { + return getHostByName(UTF8ToString(name)); + } + + function _getnameinfo(sa, salen, node, nodelen, serv, servlen, flags) { + var info = readSockaddr(sa, salen); + if (info.errno) { + return -6; + } + var port = info.port; + var addr = info.addr; + + var overflowed = false; + + if (node && nodelen) { + var lookup; + if ((flags & 1) || !(lookup = DNS.lookup_addr(addr))) { + if (flags & 8) { + return -2; + } + } else { + addr = lookup; + } + var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen); + + if (numBytesWrittenExclNull+1 >= nodelen) { + overflowed = true; + } + } + + if (serv && servlen) { + port = '' + port; + var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen); + + if (numBytesWrittenExclNull+1 >= servlen) { + overflowed = true; + } + } + + if (overflowed) { + // Note: even when we overflow, getnameinfo() is specced to write out the truncated results. + return -12; + } + + return 0; + } + + function _glActiveTexture(x0) { GLctx['activeTexture'](x0) } + + function _glAttachShader(program, shader) { + program = GL.programs[program]; + shader = GL.shaders[shader]; + program[shader.shaderType] = shader; + GLctx.attachShader(program, shader); + } + + function _glBeginQuery(target, id) { + GLctx['beginQuery'](target, GL.queries[id]); + } + + function _glBindAttribLocation(program, index, name) { + GLctx.bindAttribLocation(GL.programs[program], index, UTF8ToString(name)); + } + + function _glBindBuffer(target, buffer) { + if (target == 0x8892 /*GL_ARRAY_BUFFER*/) { + GLctx.currentArrayBufferBinding = buffer; + } else if (target == 0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/) { + GLctx.currentElementArrayBufferBinding = buffer; + } + + if (target == 0x88EB /*GL_PIXEL_PACK_BUFFER*/) { + // In WebGL 2 glReadPixels entry point, we need to use a different WebGL 2 API function call when a buffer is bound to + // GL_PIXEL_PACK_BUFFER_BINDING point, so must keep track whether that binding point is non-null to know what is + // the proper API function to call. + GLctx.currentPixelPackBufferBinding = buffer; + } else if (target == 0x88EC /*GL_PIXEL_UNPACK_BUFFER*/) { + // In WebGL 2 gl(Compressed)Tex(Sub)Image[23]D entry points, we need to + // use a different WebGL 2 API function call when a buffer is bound to + // GL_PIXEL_UNPACK_BUFFER_BINDING point, so must keep track whether that + // binding point is non-null to know what is the proper API function to + // call. + GLctx.currentPixelUnpackBufferBinding = buffer; + } + GLctx.bindBuffer(target, GL.buffers[buffer]); + } + + function _glBindBufferBase(target, index, buffer) { + GLctx['bindBufferBase'](target, index, GL.buffers[buffer]); + } + + function _glBindBufferRange(target, index, buffer, offset, ptrsize) { + GLctx['bindBufferRange'](target, index, GL.buffers[buffer], offset, ptrsize); + } + + function _glBindFramebuffer(target, framebuffer) { + + GLctx.bindFramebuffer(target, GL.framebuffers[framebuffer]); + + } + + function _glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]); + } + + function _glBindSampler(unit, sampler) { + GLctx['bindSampler'](unit, GL.samplers[sampler]); + } + + function _glBindTexture(target, texture) { + GLctx.bindTexture(target, GL.textures[texture]); + } + + function _glBindVertexArray(vao) { + GLctx['bindVertexArray'](GL.vaos[vao]); + var ibo = GLctx.getParameter(0x8895 /*ELEMENT_ARRAY_BUFFER_BINDING*/); + GLctx.currentElementArrayBufferBinding = ibo ? (ibo.name | 0) : 0; + } + + function _glBlendEquation(x0) { GLctx['blendEquation'](x0) } + + function _glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) } + + function _glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) } + + function _glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) { GLctx['blitFramebuffer'](x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) } + + function _glBufferData(target, size, data, usage) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + if (data) { + GLctx.bufferData(target, HEAPU8, usage, data, size); + } else { + GLctx.bufferData(target, size, usage); + } + } else { + // N.b. here first form specifies a heap subarray, second form an integer size, so the ?: code here is polymorphic. It is advised to avoid + // randomly mixing both uses in calling code, to avoid any potential JS engine JIT issues. + GLctx.bufferData(target, data ? HEAPU8.subarray(data, data+size) : size, usage); + } + } + + function _glBufferSubData(target, offset, size, data) { + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.bufferSubData(target, offset, HEAPU8, data, size); + return; + } + GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size)); + } + + function _glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) } + + function _glClear(x0) { GLctx['clear'](x0) } + + function _glClearBufferfi(x0, x1, x2, x3) { GLctx['clearBufferfi'](x0, x1, x2, x3) } + + function _glClearBufferfv(buffer, drawbuffer, value) { + + GLctx['clearBufferfv'](buffer, drawbuffer, HEAPF32, value>>2); + } + + function _glClearBufferuiv(buffer, drawbuffer, value) { + + GLctx['clearBufferuiv'](buffer, drawbuffer, HEAPU32, value>>2); + } + + function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) } + + function _glClearDepthf(x0) { GLctx['clearDepth'](x0) } + + function _glClearStencil(x0) { GLctx['clearStencil'](x0) } + + function _glClientWaitSync(sync, flags, timeoutLo, timeoutHi) { + // WebGL2 vs GLES3 differences: in GLES3, the timeout parameter is a uint64, where 0xFFFFFFFFFFFFFFFFULL means GL_TIMEOUT_IGNORED. + // In JS, there's no 64-bit value types, so instead timeout is taken to be signed, and GL_TIMEOUT_IGNORED is given value -1. + // Inherently the value accepted in the timeout is lossy, and can't take in arbitrary u64 bit pattern (but most likely doesn't matter) + // See https://www.khronos.org/registry/webgl/specs/latest/2.0/#5.15 + return GLctx.clientWaitSync(GL.syncs[sync], flags, convertI32PairToI53(timeoutLo, timeoutHi)); + } + + function _glColorMask(red, green, blue, alpha) { + GLctx.colorMask(!!red, !!green, !!blue, !!alpha); + } + + function _glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, imageSize, data); + } else { + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, HEAPU8, data, imageSize); + } + return; + } + GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data), (data+imageSize)) : null); + } + + function _glCompressedTexImage3D(target, level, internalFormat, width, height, depth, border, imageSize, data) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx['compressedTexImage3D'](target, level, internalFormat, width, height, depth, border, imageSize, data); + } else { + GLctx['compressedTexImage3D'](target, level, internalFormat, width, height, depth, border, HEAPU8, data, imageSize); + } + } + + function _glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) { + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, imageSize, data); + } else { + GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, HEAPU8, data, imageSize); + } + return; + } + GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data), (data+imageSize)) : null); + } + + function _glCompressedTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx['compressedTexSubImage3D'](target, level, xoffset, yoffset, zoffset, width, height, depth, format, imageSize, data); + } else { + GLctx['compressedTexSubImage3D'](target, level, xoffset, yoffset, zoffset, width, height, depth, format, HEAPU8, data, imageSize); + } + } + + function _glCopyBufferSubData(x0, x1, x2, x3, x4) { GLctx['copyBufferSubData'](x0, x1, x2, x3, x4) } + + function _glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) } + + function _glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) } + + function _glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + // Store additional information needed for each shader program: + program.name = id; + // Lazy cache results of glGetProgramiv(GL_ACTIVE_UNIFORM_MAX_LENGTH/GL_ACTIVE_ATTRIBUTE_MAX_LENGTH/GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH) + program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0; + program.uniformIdCounter = 1; + GL.programs[id] = program; + return id; + } + + function _glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + + // GL_VERTEX_SHADER = 0x8B31, GL_FRAGMENT_SHADER = 0x8B30 + GL.shaders[id].shaderType = shaderType&1?'vs':'fs'; + + return id; + } + + function _glCullFace(x0) { GLctx['cullFace'](x0) } + + function _glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((buffers)+(i*4))>>2)]; + var buffer = GL.buffers[id]; + + // From spec: "glDeleteBuffers silently ignores 0's and names that do not + // correspond to existing buffer objects." + if (!buffer) continue; + + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + + if (id == GLctx.currentArrayBufferBinding) GLctx.currentArrayBufferBinding = 0; + if (id == GLctx.currentElementArrayBufferBinding) GLctx.currentElementArrayBufferBinding = 0; + if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0; + if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0; + } + } + + function _glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = HEAP32[(((framebuffers)+(i*4))>>2)]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects". + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null; + } + } + + function _glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; + } + + function _glDeleteQueries(n, ids) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((ids)+(i*4))>>2)]; + var query = GL.queries[id]; + if (!query) continue; // GL spec: "unused names in ids are ignored, as is the name zero." + GLctx['deleteQuery'](query); + GL.queries[id] = null; + } + } + + function _glDeleteRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((renderbuffers)+(i*4))>>2)]; + var renderbuffer = GL.renderbuffers[id]; + if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects". + GLctx.deleteRenderbuffer(renderbuffer); + renderbuffer.name = 0; + GL.renderbuffers[id] = null; + } + } + + function _glDeleteSamplers(n, samplers) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((samplers)+(i*4))>>2)]; + var sampler = GL.samplers[id]; + if (!sampler) continue; + GLctx['deleteSampler'](sampler); + sampler.name = 0; + GL.samplers[id] = null; + } + } + + function _glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; + } + + function _glDeleteSync(id) { + if (!id) return; + var sync = GL.syncs[id]; + if (!sync) { // glDeleteSync signals an error when deleting a nonexisting object, unlike some other GL delete functions. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx.deleteSync(sync); + sync.name = 0; + GL.syncs[id] = null; + } + + function _glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((textures)+(i*4))>>2)]; + var texture = GL.textures[id]; + if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures". + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } + } + + function _glDeleteVertexArrays(n, vaos) { + for (var i = 0; i < n; i++) { + var id = HEAP32[(((vaos)+(i*4))>>2)]; + GLctx['deleteVertexArray'](GL.vaos[id]); + GL.vaos[id] = null; + } + } + + function _glDepthFunc(x0) { GLctx['depthFunc'](x0) } + + function _glDepthMask(flag) { + GLctx.depthMask(!!flag); + } + + function _glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], GL.shaders[shader]); + } + + function _glDisable(x0) { GLctx['disable'](x0) } + + function _glDisableVertexAttribArray(index) { + var cb = GL.currentContext.clientBuffers[index]; + cb.enabled = false; + GLctx.disableVertexAttribArray(index); + } + + function _glDrawArrays(mode, first, count) { + // bind any client-side buffers + GL.preDrawHandleClientVertexAttribBindings(first + count); + + GLctx.drawArrays(mode, first, count); + + GL.postDrawHandleClientVertexAttribBindings(); + } + + function _glDrawArraysInstanced(mode, first, count, primcount) { + GLctx['drawArraysInstanced'](mode, first, count, primcount); + } + + var tempFixedLengthArray = []; + function _glDrawBuffers(n, bufs) { + + var bufArray = tempFixedLengthArray[n]; + for (var i = 0; i < n; i++) { + bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)]; + } + + GLctx['drawBuffers'](bufArray); + } + + function _glDrawElements(mode, count, type, indices) { + var buf; + if (!GLctx.currentElementArrayBufferBinding) { + var size = GL.calcBufLength(1, type, 0, count); + buf = GL.getTempIndexBuffer(size); + GLctx.bindBuffer(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, buf); + GLctx.bufferSubData(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, + 0, + HEAPU8.subarray(indices, indices + size)); + // the index is now 0 + indices = 0; + } + + // bind any client-side buffers + GL.preDrawHandleClientVertexAttribBindings(count); + + GLctx.drawElements(mode, count, type, indices); + + GL.postDrawHandleClientVertexAttribBindings(count); + + if (!GLctx.currentElementArrayBufferBinding) { + GLctx.bindBuffer(0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/, null); + } + } + + function _glDrawElementsInstanced(mode, count, type, indices, primcount) { + GLctx['drawElementsInstanced'](mode, count, type, indices, primcount); + } + + function _glEnable(x0) { GLctx['enable'](x0) } + + function _glEnableVertexAttribArray(index) { + var cb = GL.currentContext.clientBuffers[index]; + cb.enabled = true; + GLctx.enableVertexAttribArray(index); + } + + function _glEndQuery(x0) { GLctx['endQuery'](x0) } + + function _glFenceSync(condition, flags) { + var sync = GLctx.fenceSync(condition, flags); + if (sync) { + var id = GL.getNewId(GL.syncs); + sync.name = id; + GL.syncs[id] = sync; + return id; + } else { + return 0; // Failed to create a sync object + } + } + + function _glFinish() { GLctx['finish']() } + + function _glFlush() { GLctx['flush']() } + + function emscriptenWebGLGetBufferBinding(target) { + switch (target) { + case 0x8892 /*GL_ARRAY_BUFFER*/: target = 0x8894 /*GL_ARRAY_BUFFER_BINDING*/; break; + case 0x8893 /*GL_ELEMENT_ARRAY_BUFFER*/: target = 0x8895 /*GL_ELEMENT_ARRAY_BUFFER_BINDING*/; break; + case 0x88EB /*GL_PIXEL_PACK_BUFFER*/: target = 0x88ED /*GL_PIXEL_PACK_BUFFER_BINDING*/; break; + case 0x88EC /*GL_PIXEL_UNPACK_BUFFER*/: target = 0x88EF /*GL_PIXEL_UNPACK_BUFFER_BINDING*/; break; + case 0x8C8E /*GL_TRANSFORM_FEEDBACK_BUFFER*/: target = 0x8C8F /*GL_TRANSFORM_FEEDBACK_BUFFER_BINDING*/; break; + case 0x8F36 /*GL_COPY_READ_BUFFER*/: target = 0x8F36 /*GL_COPY_READ_BUFFER_BINDING*/; break; + case 0x8F37 /*GL_COPY_WRITE_BUFFER*/: target = 0x8F37 /*GL_COPY_WRITE_BUFFER_BINDING*/; break; + case 0x8A11 /*GL_UNIFORM_BUFFER*/: target = 0x8A28 /*GL_UNIFORM_BUFFER_BINDING*/; break; + // In default case, fall through and assume passed one of the _BINDING enums directly. + } + var buffer = GLctx.getParameter(target); + if (buffer) return buffer.name|0; + else return 0; + } + + function emscriptenWebGLValidateMapBufferTarget(target) { + switch (target) { + case 0x8892: // GL_ARRAY_BUFFER + case 0x8893: // GL_ELEMENT_ARRAY_BUFFER + case 0x8F36: // GL_COPY_READ_BUFFER + case 0x8F37: // GL_COPY_WRITE_BUFFER + case 0x88EB: // GL_PIXEL_PACK_BUFFER + case 0x88EC: // GL_PIXEL_UNPACK_BUFFER + case 0x8C2A: // GL_TEXTURE_BUFFER + case 0x8C8E: // GL_TRANSFORM_FEEDBACK_BUFFER + case 0x8A11: // GL_UNIFORM_BUFFER + return true; + default: + return false; + } + } + function _glFlushMappedBufferRange(target, offset, length) { + if (!emscriptenWebGLValidateMapBufferTarget(target)) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + err('GL_INVALID_ENUM in glFlushMappedBufferRange'); + return; + } + + var mapping = GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)]; + if (!mapping) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + err('buffer was never mapped in glFlushMappedBufferRange'); + return; + } + + if (!(mapping.access & 0x10)) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + err('buffer was not mapped with GL_MAP_FLUSH_EXPLICIT_BIT in glFlushMappedBufferRange'); + return; + } + if (offset < 0 || length < 0 || offset + length > mapping.length) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + err('invalid range in glFlushMappedBufferRange'); + return; + } + + GLctx.bufferSubData( + target, + mapping.offset, + HEAPU8.subarray(mapping.mem + offset, mapping.mem + offset + length)); + } + + function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, + GL.renderbuffers[renderbuffer]); + } + + function _glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, + GL.textures[texture], level); + } + + function _glFramebufferTextureLayer(target, attachment, texture, level, layer) { + GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer); + } + + function _glFrontFace(x0) { GLctx['frontFace'](x0) } + + function __glGenObject(n, buffers, createFunction, objectTable + ) { + for (var i = 0; i < n; i++) { + var buffer = GLctx[createFunction](); + var id = buffer && GL.getNewId(objectTable); + if (buffer) { + buffer.name = id; + objectTable[id] = buffer; + } else { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + } + HEAP32[(((buffers)+(i*4))>>2)] = id; + } + } + function _glGenBuffers(n, buffers) { + __glGenObject(n, buffers, 'createBuffer', GL.buffers + ); + } + + function _glGenFramebuffers(n, ids) { + __glGenObject(n, ids, 'createFramebuffer', GL.framebuffers + ); + } + + function _glGenQueries(n, ids) { + __glGenObject(n, ids, 'createQuery', GL.queries + ); + } + + function _glGenRenderbuffers(n, renderbuffers) { + __glGenObject(n, renderbuffers, 'createRenderbuffer', GL.renderbuffers + ); + } + + function _glGenSamplers(n, samplers) { + __glGenObject(n, samplers, 'createSampler', GL.samplers + ); + } + + function _glGenTextures(n, textures) { + __glGenObject(n, textures, 'createTexture', GL.textures + ); + } + + function _glGenVertexArrays(n, arrays) { + __glGenObject(n, arrays, 'createVertexArray', GL.vaos + ); + } + + function _glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) } + + function __glGetActiveAttribOrUniform(funcName, program, index, bufSize, length, size, type, name) { + program = GL.programs[program]; + var info = GLctx[funcName](program, index); + if (info) { // If an error occurs, nothing will be written to length, size and type and name. + var numBytesWrittenExclNull = name && stringToUTF8(info.name, name, bufSize); + if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull; + if (size) HEAP32[((size)>>2)] = info.size; + if (type) HEAP32[((type)>>2)] = info.type; + } + } + function _glGetActiveAttrib(program, index, bufSize, length, size, type, name) { + __glGetActiveAttribOrUniform('getActiveAttrib', program, index, bufSize, length, size, type, name); + } + + function _glGetActiveUniform(program, index, bufSize, length, size, type, name) { + __glGetActiveAttribOrUniform('getActiveUniform', program, index, bufSize, length, size, type, name); + } + + function _glGetActiveUniformBlockName(program, uniformBlockIndex, bufSize, length, uniformBlockName) { + program = GL.programs[program]; + + var result = GLctx['getActiveUniformBlockName'](program, uniformBlockIndex); + if (!result) return; // If an error occurs, nothing will be written to uniformBlockName or length. + if (uniformBlockName && bufSize > 0) { + var numBytesWrittenExclNull = stringToUTF8(result, uniformBlockName, bufSize); + if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull; + } else { + if (length) HEAP32[((length)>>2)] = 0; + } + } + + function _glGetActiveUniformBlockiv(program, uniformBlockIndex, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + program = GL.programs[program]; + + if (pname == 0x8A41 /* GL_UNIFORM_BLOCK_NAME_LENGTH */) { + var name = GLctx['getActiveUniformBlockName'](program, uniformBlockIndex); + HEAP32[((params)>>2)] = name.length+1; + return; + } + + var result = GLctx['getActiveUniformBlockParameter'](program, uniformBlockIndex, pname); + if (result === null) return; // If an error occurs, nothing should be written to params. + if (pname == 0x8A43 /*GL_UNIFORM_BLOCK_ACTIVE_UNIFORM_INDICES*/) { + for (var i = 0; i < result.length; i++) { + HEAP32[(((params)+(i*4))>>2)] = result[i]; + } + } else { + HEAP32[((params)>>2)] = result; + } + } + + function _glGetActiveUniformsiv(program, uniformCount, uniformIndices, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + if (uniformCount > 0 && uniformIndices == 0) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + program = GL.programs[program]; + var ids = []; + for (var i = 0; i < uniformCount; i++) { + ids.push(HEAP32[(((uniformIndices)+(i*4))>>2)]); + } + + var result = GLctx['getActiveUniforms'](program, ids, pname); + if (!result) return; // GL spec: If an error is generated, nothing is written out to params. + + var len = result.length; + for (var i = 0; i < len; i++) { + HEAP32[(((params)+(i*4))>>2)] = result[i]; + } + } + + function _glGetAttribLocation(program, name) { + return GLctx.getAttribLocation(GL.programs[program], UTF8ToString(name)); + } + + function _glGetBufferSubData(target, offset, size, data) { + if (!data) { + // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense + // if data == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + GLctx['getBufferSubData'](target, offset, HEAPU8, data, size); + } + + function _glGetError() { + var error = GLctx.getError() || GL.lastError; + GL.lastError = 0/*GL_NO_ERROR*/; + return error; + } + + function _glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) { + var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname); + if (result instanceof WebGLRenderbuffer || + result instanceof WebGLTexture) { + result = result.name | 0; + } + HEAP32[((params)>>2)] = result; + } + + function readI53FromI64(ptr) { + return HEAPU32[ptr>>2] + HEAP32[ptr+4>>2] * 4294967296; + } + + function readI53FromU64(ptr) { + return HEAPU32[ptr>>2] + HEAPU32[ptr+4>>2] * 4294967296; + } + function writeI53ToI64(ptr, num) { + HEAPU32[ptr>>2] = num; + HEAPU32[ptr+4>>2] = (num - HEAPU32[ptr>>2])/4294967296; + var deserialized = (num >= 0) ? readI53FromU64(ptr) : readI53FromI64(ptr); + if (deserialized != num) warnOnce('writeI53ToI64() out of range: serialized JS Number ' + num + ' to Wasm heap as bytes lo=0x' + HEAPU32[ptr>>2].toString(16) + ', hi=0x' + HEAPU32[ptr+4>>2].toString(16) + ', which deserializes back to ' + deserialized + ' instead!'); + } + function emscriptenWebGLGetIndexed(target, index, data, type) { + if (!data) { + // GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense + // if data == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var result = GLctx['getIndexedParameter'](target, index); + var ret; + switch (typeof result) { + case 'boolean': + ret = result ? 1 : 0; + break; + case 'number': + ret = result; + break; + case 'object': + if (result === null) { + switch (target) { + case 0x8C8F: // TRANSFORM_FEEDBACK_BUFFER_BINDING + case 0x8A28: // UNIFORM_BUFFER_BINDING + ret = 0; + break; + default: { + GL.recordError(0x500); // GL_INVALID_ENUM + return; + } + } + } else if (result instanceof WebGLBuffer) { + ret = result.name | 0; + } else { + GL.recordError(0x500); // GL_INVALID_ENUM + return; + } + break; + default: + GL.recordError(0x500); // GL_INVALID_ENUM + return; + } + + switch (type) { + case 1: writeI53ToI64(data, ret); break; + case 0: HEAP32[((data)>>2)] = ret; break; + case 2: HEAPF32[((data)>>2)] = ret; break; + case 4: HEAP8[((data)>>0)] = ret ? 1 : 0; break; + default: throw 'internal emscriptenWebGLGetIndexed() error, bad type: ' + type; + } + } + function _glGetIntegeri_v(target, index, data) { + emscriptenWebGLGetIndexed(target, index, data, 0); + } + + function emscriptenWebGLGet(name_, p, type) { + // Guard against user passing a null pointer. + // Note that GLES2 spec does not say anything about how passing a null pointer should be treated. + // Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but + // better to report an error instead of doing anything random. + if (!p) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var ret = undefined; + switch (name_) { // Handle a few trivial GLES values + case 0x8DFA: // GL_SHADER_COMPILER + ret = 1; + break; + case 0x8DF8: // GL_SHADER_BINARY_FORMATS + if (type != 0 && type != 1) { + GL.recordError(0x500); // GL_INVALID_ENUM + } + return; // Do not write anything to the out pointer, since no binary formats are supported. + case 0x87FE: // GL_NUM_PROGRAM_BINARY_FORMATS + case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS + ret = 0; + break; + case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS + // WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length), + // so implement it ourselves to allow C++ GLES2 code get the length. + var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/); + ret = formats ? formats.length : 0; + break; + case 0x826E: // GL_MAX_UNIFORM_LOCATIONS + // This is an arbitrary limit, must be large enough to allow practical + // use, but small enough to still keep a range for automatic uniform + // locations, which get assigned numbers larger than this. + ret = 1048576; + break; + + case 0x821D: // GL_NUM_EXTENSIONS + if (GL.currentContext.version < 2) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); // Calling GLES3/WebGL2 function with a GLES2/WebGL1 context + return; + } + // .getSupportedExtensions() can return null if context is lost, so coerce to empty array. + var exts = GLctx.getSupportedExtensions() || []; + ret = 2 * exts.length; // each extension is duplicated, first in unprefixed WebGL form, and then a second time with "GL_" prefix. + break; + case 0x821B: // GL_MAJOR_VERSION + case 0x821C: // GL_MINOR_VERSION + if (GL.currentContext.version < 2) { + GL.recordError(0x500); // GL_INVALID_ENUM + return; + } + ret = name_ == 0x821B ? 3 : 0; // return version 3.0 + break; + } + + if (ret === undefined) { + var result = GLctx.getParameter(name_); + switch (typeof result) { + case "number": + ret = result; + break; + case "boolean": + ret = result ? 1 : 0; + break; + case "string": + GL.recordError(0x500); // GL_INVALID_ENUM + return; + case "object": + if (result === null) { + // null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise + // can mean an invalid name_, which we need to report as an error + switch (name_) { + case 0x8894: // ARRAY_BUFFER_BINDING + case 0x8B8D: // CURRENT_PROGRAM + case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING + case 0x8CA6: // FRAMEBUFFER_BINDING or DRAW_FRAMEBUFFER_BINDING + case 0x8CA7: // RENDERBUFFER_BINDING + case 0x8069: // TEXTURE_BINDING_2D + case 0x85B5: // WebGL 2 GL_VERTEX_ARRAY_BINDING, or WebGL 1 extension OES_vertex_array_object GL_VERTEX_ARRAY_BINDING_OES + case 0x8F36: // COPY_READ_BUFFER_BINDING or COPY_READ_BUFFER + case 0x8F37: // COPY_WRITE_BUFFER_BINDING or COPY_WRITE_BUFFER + case 0x88ED: // PIXEL_PACK_BUFFER_BINDING + case 0x88EF: // PIXEL_UNPACK_BUFFER_BINDING + case 0x8CAA: // READ_FRAMEBUFFER_BINDING + case 0x8919: // SAMPLER_BINDING + case 0x8C1D: // TEXTURE_BINDING_2D_ARRAY + case 0x806A: // TEXTURE_BINDING_3D + case 0x8E25: // TRANSFORM_FEEDBACK_BINDING + case 0x8C8F: // TRANSFORM_FEEDBACK_BUFFER_BINDING + case 0x8A28: // UNIFORM_BUFFER_BINDING + case 0x8514: { // TEXTURE_BINDING_CUBE_MAP + ret = 0; + break; + } + default: { + GL.recordError(0x500); // GL_INVALID_ENUM + return; + } + } + } else if (result instanceof Float32Array || + result instanceof Uint32Array || + result instanceof Int32Array || + result instanceof Array) { + for (var i = 0; i < result.length; ++i) { + switch (type) { + case 0: HEAP32[(((p)+(i*4))>>2)] = result[i]; break; + case 2: HEAPF32[(((p)+(i*4))>>2)] = result[i]; break; + case 4: HEAP8[(((p)+(i))>>0)] = result[i] ? 1 : 0; break; + } + } + return; + } else { + try { + ret = result.name | 0; + } catch(e) { + GL.recordError(0x500); // GL_INVALID_ENUM + err('GL_INVALID_ENUM in glGet' + type + 'v: Unknown object returned from WebGL getParameter(' + name_ + ')! (error: ' + e + ')'); + return; + } + } + break; + default: + GL.recordError(0x500); // GL_INVALID_ENUM + err('GL_INVALID_ENUM in glGet' + type + 'v: Native code calling glGet' + type + 'v(' + name_ + ') and it returns ' + result + ' of type ' + typeof(result) + '!'); + return; + } + } + + switch (type) { + case 1: writeI53ToI64(p, ret); break; + case 0: HEAP32[((p)>>2)] = ret; break; + case 2: HEAPF32[((p)>>2)] = ret; break; + case 4: HEAP8[((p)>>0)] = ret ? 1 : 0; break; + } + } + function _glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 0); + } + + function _glGetInternalformativ(target, internalformat, pname, bufSize, params) { + if (bufSize < 0) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + if (!params) { + // GLES3 specification does not specify how to behave if values is a null pointer. Since calling this function does not make sense + // if values == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var ret = GLctx['getInternalformatParameter'](target, internalformat, pname); + if (ret === null) return; + for (var i = 0; i < ret.length && i < bufSize; ++i) { + HEAP32[(((params)+(i*4))>>2)] = ret[i]; + } + } + + function _glGetProgramBinary(program, bufSize, length, binaryFormat, binary) { + GL.recordError(0x502/*GL_INVALID_OPERATION*/); + } + + function _glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = '(unknown error)'; + var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull; + } + + function _glGetProgramiv(program, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + + if (program >= GL.counter) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + + program = GL.programs[program]; + + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getProgramInfoLog(program); + if (log === null) log = '(unknown error)'; + HEAP32[((p)>>2)] = log.length + 1; + } else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) { + if (!program.maxUniformLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) { + program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length+1); + } + } + HEAP32[((p)>>2)] = program.maxUniformLength; + } else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) { + if (!program.maxAttributeLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 0x8B89/*GL_ACTIVE_ATTRIBUTES*/); ++i) { + program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length+1); + } + } + HEAP32[((p)>>2)] = program.maxAttributeLength; + } else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) { + if (!program.maxUniformBlockNameLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 0x8A36/*GL_ACTIVE_UNIFORM_BLOCKS*/); ++i) { + program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length+1); + } + } + HEAP32[((p)>>2)] = program.maxUniformBlockNameLength; + } else { + HEAP32[((p)>>2)] = GLctx.getProgramParameter(program, pname); + } + } + + function _glGetQueryObjectuiv(id, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + var query = GL.queries[id]; + var param = GLctx['getQueryParameter'](query, pname); + var ret; + if (typeof param == 'boolean') { + ret = param ? 1 : 0; + } else { + ret = param; + } + HEAP32[((params)>>2)] = ret; + } + + function _glGetQueryiv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)] = GLctx['getQuery'](target, pname); + } + + function _glGetRenderbufferParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)] = GLctx.getRenderbufferParameter(target, pname); + } + + function _glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + var numBytesWrittenExclNull = (maxLength > 0 && infoLog) ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull; + } + + function _glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) { + var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType); + HEAP32[((range)>>2)] = result.rangeMin; + HEAP32[(((range)+(4))>>2)] = result.rangeMax; + HEAP32[((precision)>>2)] = result.precision; + } + + function _glGetShaderSource(shader, bufSize, length, source) { + var result = GLctx.getShaderSource(GL.shaders[shader]); + if (!result) return; // If an error occurs, nothing will be written to length or source. + var numBytesWrittenExclNull = (bufSize > 0 && source) ? stringToUTF8(result, source, bufSize) : 0; + if (length) HEAP32[((length)>>2)] = numBytesWrittenExclNull; + } + + function _glGetShaderiv(shader, pname, p) { + if (!p) { + // GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = '(unknown error)'; + // The GLES2 specification says that if the shader has an empty info log, + // a value of 0 is returned. Otherwise the log has a null char appended. + // (An empty string is falsey, so we can just check that instead of + // looking at log.length.) + var logLength = log ? log.length + 1 : 0; + HEAP32[((p)>>2)] = logLength; + } else if (pname == 0x8B88) { // GL_SHADER_SOURCE_LENGTH + var source = GLctx.getShaderSource(GL.shaders[shader]); + // source may be a null, or the empty string, both of which are falsey + // values that we report a 0 length for. + var sourceLength = source ? source.length + 1 : 0; + HEAP32[((p)>>2)] = sourceLength; + } else { + HEAP32[((p)>>2)] = GLctx.getShaderParameter(GL.shaders[shader], pname); + } + } + + function _glGetString(name_) { + var ret = GL.stringCache[name_]; + if (!ret) { + switch (name_) { + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions() || []; // .getSupportedExtensions() can return null if context is lost, so coerce to empty array. + exts = exts.concat(exts.map(function(e) { return "GL_" + e; })); + ret = stringToNewUTF8(exts.join(' ')); + break; + case 0x1F00 /* GL_VENDOR */: + case 0x1F01 /* GL_RENDERER */: + case 0x9245 /* UNMASKED_VENDOR_WEBGL */: + case 0x9246 /* UNMASKED_RENDERER_WEBGL */: + var s = GLctx.getParameter(name_); + if (!s) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + } + ret = s && stringToNewUTF8(s); + break; + + case 0x1F02 /* GL_VERSION */: + var glVersion = GLctx.getParameter(0x1F02 /*GL_VERSION*/); + // return GLES version string corresponding to the version of the WebGL context + if (GL.currentContext.version >= 2) glVersion = 'OpenGL ES 3.0 (' + glVersion + ')'; + else + { + glVersion = 'OpenGL ES 2.0 (' + glVersion + ')'; + } + ret = stringToNewUTF8(glVersion); + break; + case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: + var glslVersion = GLctx.getParameter(0x8B8C /*GL_SHADING_LANGUAGE_VERSION*/); + // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...' + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits + glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')'; + } + ret = stringToNewUTF8(glslVersion); + break; + default: + GL.recordError(0x500/*GL_INVALID_ENUM*/); + // fall through + } + GL.stringCache[name_] = ret; + } + return ret; + } + + function _glGetStringi(name, index) { + if (GL.currentContext.version < 2) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); // Calling GLES3/WebGL2 function with a GLES2/WebGL1 context + return 0; + } + var stringiCache = GL.stringiCache[name]; + if (stringiCache) { + if (index < 0 || index >= stringiCache.length) { + GL.recordError(0x501/*GL_INVALID_VALUE*/); + return 0; + } + return stringiCache[index]; + } + switch (name) { + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions() || []; // .getSupportedExtensions() can return null if context is lost, so coerce to empty array. + exts = exts.concat(exts.map(function(e) { return "GL_" + e; })); + exts = exts.map(function(e) { return stringToNewUTF8(e); }); + + stringiCache = GL.stringiCache[name] = exts; + if (index < 0 || index >= stringiCache.length) { + GL.recordError(0x501/*GL_INVALID_VALUE*/); + return 0; + } + return stringiCache[index]; + default: + GL.recordError(0x500/*GL_INVALID_ENUM*/); + return 0; + } + } + + function _glGetTexParameteriv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + HEAP32[((params)>>2)] = GLctx.getTexParameter(target, pname); + } + + function _glGetUniformBlockIndex(program, uniformBlockName) { + return GLctx['getUniformBlockIndex'](GL.programs[program], UTF8ToString(uniformBlockName)); + } + + function _glGetUniformIndices(program, uniformCount, uniformNames, uniformIndices) { + if (!uniformIndices) { + // GLES2 specification does not specify how to behave if uniformIndices is a null pointer. Since calling this function does not make sense + // if uniformIndices == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + if (uniformCount > 0 && (uniformNames == 0 || uniformIndices == 0)) { + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + program = GL.programs[program]; + var names = []; + for (var i = 0; i < uniformCount; i++) + names.push(UTF8ToString(HEAP32[(((uniformNames)+(i*4))>>2)])); + + var result = GLctx['getUniformIndices'](program, names); + if (!result) return; // GL spec: If an error is generated, nothing is written out to uniformIndices. + + var len = result.length; + for (var i = 0; i < len; i++) { + HEAP32[(((uniformIndices)+(i*4))>>2)] = result[i]; + } + } + + /** @noinline */ + function webglGetLeftBracePos(name) { + return name.slice(-1) == ']' && name.lastIndexOf('['); + } + function webglPrepareUniformLocationsBeforeFirstUse(program) { + var uniformLocsById = program.uniformLocsById, // Maps GLuint -> WebGLUniformLocation + uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, // Maps name -> [uniform array length, GLuint] + i, j; + + // On the first time invocation of glGetUniformLocation on this shader program: + // initialize cache data structures and discover which uniforms are arrays. + if (!uniformLocsById) { + // maps GLint integer locations to WebGLUniformLocations + program.uniformLocsById = uniformLocsById = {}; + // maps integer locations back to uniform name strings, so that we can lazily fetch uniform array locations + program.uniformArrayNamesById = {}; + + for (i = 0; i < GLctx.getProgramParameter(program, 0x8B86/*GL_ACTIVE_UNIFORMS*/); ++i) { + var u = GLctx.getActiveUniform(program, i); + var nm = u.name; + var sz = u.size; + var lb = webglGetLeftBracePos(nm); + var arrayName = lb > 0 ? nm.slice(0, lb) : nm; + + // Acquire the preset location from the explicit uniform location if one was specified, or + // programmatically assign a new one if not. + var id = uniformSizeAndIdsByName[arrayName] ? uniformSizeAndIdsByName[arrayName][1] : program.uniformIdCounter; + program.uniformIdCounter = Math.max(id + sz, program.uniformIdCounter); + // Eagerly get the location of the uniformArray[0] base element. + // The remaining indices >0 will be left for lazy evaluation to + // improve performance. Those may never be needed to fetch, if the + // application fills arrays always in full starting from the first + // element of the array. + uniformSizeAndIdsByName[arrayName] = [sz, id]; + + // Store placeholder integers in place that highlight that these + // >0 index locations are array indices pending population. + for(j = 0; j < sz; ++j) { + uniformLocsById[id] = j; + program.uniformArrayNamesById[id++] = arrayName; + } + } + } + } + function _glGetUniformLocation(program, name) { + + name = UTF8ToString(name); + + if (program = GL.programs[program]) { + webglPrepareUniformLocationsBeforeFirstUse(program); + var uniformLocsById = program.uniformLocsById; // Maps GLuint -> WebGLUniformLocation + var arrayIndex = 0; + var uniformBaseName = name; + + // Invariant: when populating integer IDs for uniform locations, we must maintain the precondition that + // arrays reside in contiguous addresses, i.e. for a 'vec4 colors[10];', colors[4] must be at location colors[0]+4. + // However, user might call glGetUniformLocation(program, "colors") for an array, so we cannot discover based on the user + // input arguments whether the uniform we are dealing with is an array. The only way to discover which uniforms are arrays + // is to enumerate over all the active uniforms in the program. + var leftBrace = webglGetLeftBracePos(name); + + // If user passed an array accessor "[index]", parse the array index off the accessor. + if (leftBrace > 0) { + arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0; // "index]", coerce parseInt(']') with >>>0 to treat "foo[]" as "foo[0]" and foo[-1] as unsigned out-of-bounds. + uniformBaseName = name.slice(0, leftBrace); + } + + // Have we cached the location of this uniform before? + var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName]; // A pair [array length, GLint of the uniform location] + + // If an uniform with this name exists, and if its index is within the array limits (if it's even an array), + // query the WebGLlocation, or return an existing cached location. + if (sizeAndId && arrayIndex < sizeAndId[0]) { + arrayIndex += sizeAndId[1]; // Add the base location of the uniform to the array index offset. + if ((uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name))) { + return arrayIndex; + } + } + } + else { + // N.b. we are currently unable to distinguish between GL program IDs that never existed vs GL program IDs that have been deleted, + // so report GL_INVALID_VALUE in both cases. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + } + return -1; + } + + function webglGetUniformLocation(location) { + var p = GLctx.currentProgram; + + if (p) { + var webglLoc = p.uniformLocsById[location]; + // p.uniformLocsById[location] stores either an integer, or a WebGLUniformLocation. + + // If an integer, we have not yet bound the location, so do it now. The integer value specifies the array index + // we should bind to. + if (typeof webglLoc == 'number') { + p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? '[' + webglLoc + ']' : '')); + } + // Else an already cached WebGLUniformLocation, return it. + return webglLoc; + } else { + GL.recordError(0x502/*GL_INVALID_OPERATION*/); + } + } + /** @suppress{checkTypes} */ + function emscriptenWebGLGetUniform(program, location, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + program = GL.programs[program]; + webglPrepareUniformLocationsBeforeFirstUse(program); + var data = GLctx.getUniform(program, webglGetUniformLocation(location)); + if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 0: HEAP32[((params)>>2)] = data; break; + case 2: HEAPF32[((params)>>2)] = data; break; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 0: HEAP32[(((params)+(i*4))>>2)] = data[i]; break; + case 2: HEAPF32[(((params)+(i*4))>>2)] = data[i]; break; + } + } + } + } + function _glGetUniformiv(program, location, params) { + emscriptenWebGLGetUniform(program, location, params, 0); + } + + /** @suppress{checkTypes} */ + function emscriptenWebGLGetVertexAttrib(index, pname, params, type) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if params == null, issue a GL error to notify user about it. + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + if (GL.currentContext.clientBuffers[index].enabled) { + err("glGetVertexAttrib*v on client-side array: not supported, bad data returned"); + } + var data = GLctx.getVertexAttrib(index, pname); + if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) { + HEAP32[((params)>>2)] = data && data["name"]; + } else if (typeof data == 'number' || typeof data == 'boolean') { + switch (type) { + case 0: HEAP32[((params)>>2)] = data; break; + case 2: HEAPF32[((params)>>2)] = data; break; + case 5: HEAP32[((params)>>2)] = Math.fround(data); break; + } + } else { + for (var i = 0; i < data.length; i++) { + switch (type) { + case 0: HEAP32[(((params)+(i*4))>>2)] = data[i]; break; + case 2: HEAPF32[(((params)+(i*4))>>2)] = data[i]; break; + case 5: HEAP32[(((params)+(i*4))>>2)] = Math.fround(data[i]); break; + } + } + } + } + function _glGetVertexAttribiv(index, pname, params) { + // N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(), + // otherwise the results are undefined. (GLES3 spec 6.1.12) + emscriptenWebGLGetVertexAttrib(index, pname, params, 5); + } + + function _glInvalidateFramebuffer(target, numAttachments, attachments) { + var list = tempFixedLengthArray[numAttachments]; + for (var i = 0; i < numAttachments; i++) { + list[i] = HEAP32[(((attachments)+(i*4))>>2)]; + } + + GLctx['invalidateFramebuffer'](target, list); + } + + function _glIsEnabled(x0) { return GLctx['isEnabled'](x0) } + + function _glIsVertexArray(array) { + + var vao = GL.vaos[array]; + if (!vao) return 0; + return GLctx['isVertexArray'](vao); + } + + function _glLinkProgram(program) { + program = GL.programs[program]; + GLctx.linkProgram(program); + // Invalidate earlier computed uniform->ID mappings, those have now become stale + program.uniformLocsById = 0; // Mark as null-like so that glGetUniformLocation() knows to populate this again. + program.uniformSizeAndIdsByName = {}; + + // Collect explicit uniform locations from the vertex and fragment shaders. + [program['vs'], program['fs']].forEach(function(s) { + Object.keys(s.explicitUniformLocations).forEach(function(shaderLocation) { + var loc = s.explicitUniformLocations[shaderLocation]; + // Record each explicit uniform location temporarily as a non-array uniform + // with size=1. This is not true, but on the first glGetUniformLocation() call + // the array sizes will get populated to correct sizes. + program.uniformSizeAndIdsByName[shaderLocation] = [1, loc]; + + // Make sure we will never automatically assign locations within the range + // used for explicit layout(location=x) variables. + program.uniformIdCounter = Math.max(program.uniformIdCounter, loc + 1); + }); + }); + + function copyKeys(dst, src) { + Object.keys(src).forEach(function(key) { + dst[key] = src[key]; + }); + } + // Collect sampler and ubo binding locations from the vertex and fragment shaders. + program.explicitUniformBindings = {}; + program.explicitSamplerBindings = {}; + [program['vs'], program['fs']].forEach(function(s) { + copyKeys(program.explicitUniformBindings, s.explicitUniformBindings); + copyKeys(program.explicitSamplerBindings, s.explicitSamplerBindings); + }); + // Record that we need to apply these explicit bindings when glUseProgram() is + // first called on this program. + program.explicitProgramBindingsApplied = 0; + } + + function _glMapBufferRange(target, offset, length, access) { + if (access != 0x1A && access != 0xA) { + err("glMapBufferRange is only supported when access is MAP_WRITE|INVALIDATE_BUFFER"); + return 0; + } + + if (!emscriptenWebGLValidateMapBufferTarget(target)) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + err('GL_INVALID_ENUM in glMapBufferRange'); + return 0; + } + + var mem = _malloc(length); + if (!mem) return 0; + + GL.mappedBuffers[emscriptenWebGLGetBufferBinding(target)] = { + offset: offset, + length: length, + mem: mem, + access: access, + }; + return mem; + } + + function _glPixelStorei(pname, param) { + if (pname == 0xCF5 /* GL_UNPACK_ALIGNMENT */) { + GL.unpackAlignment = param; + } + GLctx.pixelStorei(pname, param); + } + + function _glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) } + + function _glProgramBinary(program, binaryFormat, binary, length) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + } + + function _glProgramParameteri(program, pname, value) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + } + + function _glReadBuffer(x0) { GLctx['readBuffer'](x0) } + + function computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) { + function roundedToNextMultipleOf(x, y) { + return (x + y - 1) & -y; + } + var plainRowSize = width * sizePerPixel; + var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); + return height * alignedRowSize; + } + + function __colorChannelsInGlTextureFormat(format) { + // Micro-optimizations for size: map format to size by subtracting smallest enum value (0x1902) from all values first. + // Also omit the most common size value (1) from the list, which is assumed by formats not on the list. + var colorChannels = { + // 0x1902 /* GL_DEPTH_COMPONENT */ - 0x1902: 1, + // 0x1906 /* GL_ALPHA */ - 0x1902: 1, + 5: 3, + 6: 4, + // 0x1909 /* GL_LUMINANCE */ - 0x1902: 1, + 8: 2, + 29502: 3, + 29504: 4, + // 0x1903 /* GL_RED */ - 0x1902: 1, + 26917: 2, + 26918: 2, + // 0x8D94 /* GL_RED_INTEGER */ - 0x1902: 1, + 29846: 3, + 29847: 4 + }; + return colorChannels[format - 0x1902]||1; + } + + function heapObjectForWebGLType(type) { + // Micro-optimization for size: Subtract lowest GL enum number (0x1400/* GL_BYTE */) from type to compare + // smaller values for the heap, for shorter generated code size. + // Also the type HEAPU16 is not tested for explicitly, but any unrecognized type will return out HEAPU16. + // (since most types are HEAPU16) + type -= 0x1400; + if (type == 0) return HEAP8; + + if (type == 1) return HEAPU8; + + if (type == 2) return HEAP16; + + if (type == 4) return HEAP32; + + if (type == 6) return HEAPF32; + + if (type == 5 + || type == 28922 + || type == 28520 + || type == 30779 + || type == 30782 + ) + return HEAPU32; + + return HEAPU16; + } + + function heapAccessShiftForWebGLHeap(heap) { + return 31 - Math.clz32(heap.BYTES_PER_ELEMENT); + } + function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { + var heap = heapObjectForWebGLType(type); + var shift = heapAccessShiftForWebGLHeap(heap); + var byteSize = 1<> shift, pixels + bytes >> shift); + } + function _glReadPixels(x, y, width, height, format, type, pixels) { + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + if (GLctx.currentPixelPackBufferBinding) { + GLctx.readPixels(x, y, width, height, format, type, pixels); + } else { + var heap = heapObjectForWebGLType(type); + GLctx.readPixels(x, y, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } + return; + } + var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); + if (!pixelData) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + return; + } + GLctx.readPixels(x, y, width, height, format, type, pixelData); + } + + function _glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) } + + function _glRenderbufferStorageMultisample(x0, x1, x2, x3, x4) { GLctx['renderbufferStorageMultisample'](x0, x1, x2, x3, x4) } + + function _glSamplerParameteri(sampler, pname, param) { + GLctx['samplerParameteri'](GL.samplers[sampler], pname, param); + } + + function _glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) } + + function find_closing_parens_index(arr, i, opening='(', closing=')') { + for(var nesting = 0; i < arr.length; ++i) { + if (arr[i] == opening) ++nesting; + if (arr[i] == closing && --nesting == 0) { + return i; + } + } + } + function preprocess_c_code(code, defs = {}) { + var i = 0, // iterator over the input string + len = code.length, // cache input length + out = '', // generates the preprocessed output string + stack = [1]; // preprocessing stack (state of active/inactive #ifdef/#else blocks we are currently inside) + // a mapping 'symbolname' -> function(args) which evaluates the given cpp macro, e.g. #define FOO(x) x+10. + defs['defined'] = (args) => { // built-in "#if defined(x)"" macro. + assert(args.length == 1); + return defs[args[0]] ? 1 : 0; + }; + + // Returns true if str[i] is whitespace. + function isWhitespace(str, i) { + return !(str.charCodeAt(i) > 32); // Compare as negation to treat end-of-string undefined as whitespace + } + + // Returns index to the next whitespace character starting at str[i]. + function nextWhitespace(str, i) { + while(!isWhitespace(str, i)) ++i; + return i; + } + + // Returns an integer ID classification of the character at str[idx], used for tokenization purposes. + function classifyChar(str, idx) { + var cc = str.charCodeAt(idx); + assert(!(cc > 127), "Only 7-bit ASCII can be used in preprocessor #if/#ifdef/#define statements!"); + if (cc > 32) { + if (cc < 48) return 1; // an operator symbol, any of !"#$%&'()*+,-./ + if (cc < 58) return 2; // a number 0123456789 + if (cc < 65) return 1; // an operator symbol, any of :;<=>?@ + if (cc < 91 || cc == 95/*_*/) return 3; // a character, any of A-Z or _ + if (cc < 97) return 1; // an operator symbol, any of [\]^` + if (cc < 123) return 3; // a character, any of a-z + return 1; // an operator symbol, any of {|}~ + } + return cc < 33 ? 0 : 4; // 0=whitespace, 4=end-of-string + } + + // Returns a tokenized array of the given string expression, i.e. "FOO > BAR && BAZ" -> ["FOO", ">", "BAR", "&&", "BAZ"] + // Optionally keeps whitespace as tokens to be able to reconstruct the original input string. + function tokenize(exprString, keepWhitespace) { + var out = [], len = exprString.length; + for(var i = 0; i <= len; ++i) { + var kind = classifyChar(exprString, i); + if (kind == 2/*0-9*/ || kind == 3/*a-z*/) { // a character or a number + for(var j = i+1; j <= len; ++j) { + var kind2 = classifyChar(exprString, j); + if (kind2 != kind && (kind2 != 2/*0-9*/ || kind != 3/*a-z*/)) { // parse number sequence "423410", and identifier sequence "FOO32BAR" + out.push(exprString.substring(i, j)); + i = j-1; + break; + } + } + } else if (kind == 1/*operator symbol*/) { + // Lookahead for two-character operators. + var op2 = exprString.substr(i, 2); + if (['<=', '>=', '==', '!=', '&&', '||'].includes(op2)) { + out.push(op2); + ++i; + } else { + out.push(exprString[i]); + } + } + } + return out; + } + + // Expands preprocessing macros on substring str[lineStart...lineEnd] + function expandMacros(str, lineStart, lineEnd) { + if (lineEnd === undefined) lineEnd = str.length; + var len = str.length; + var out = ''; + for(var i = lineStart; i < lineEnd; ++i) { + var kind = classifyChar(str, i); + if (kind == 3/*a-z*/) { + for(var j = i + 1; j <= lineEnd; ++j) { + var kind2 = classifyChar(str, j); + if (kind2 != 2/*0-9*/ && kind2 != 3/*a-z*/) { + var symbol = str.substring(i, j); + var pp = defs[symbol]; + if (pp) { + var expanded = str.substring(lineStart, i); + if (pp.length && str[j] == '(') { // Expanding a macro? (#define FOO(X) ...) + var closeParens = find_closing_parens_index(str, j); + assert(str[closeParens] == ')'); + expanded += pp(str.substring(j+1, closeParens).split(',')) + str.substring(closeParens+1, lineEnd); + } else { // Expanding a non-macro (#define FOO BAR) + expanded += pp() + str.substring(j, lineEnd); + } + return expandMacros(expanded, 0); + } else { + out += symbol; + i = j-1; + break; + } + } + } + } else { + out += str[i]; + } + } + return out; + } + + // Given a token list e.g. ['2', '>', '1'], returns a function that evaluates that token list. + function buildExprTree(tokens) { + // Consume tokens array into a function tree until the tokens array is exhausted + // to a single root node that evaluates it. + while (tokens.length > 1 || typeof tokens[0] != 'function') { + tokens = (function(tokens) { + // Find the index 'i' of the operator we should evaluate next: + var i, j, p, operatorAndPriority = -2; + for(j = 0; j < tokens.length; ++j) { + if ((p = ['*', '/', '+', '-', '!', '<', '<=', '>', '>=', '==', '!=', '&&', '||', '('].indexOf(tokens[j])) > operatorAndPriority) { + i = j; + operatorAndPriority = p; + } + } + + if (operatorAndPriority == 13 /* parens '(' */) { + // Find the closing parens position + var j = find_closing_parens_index(tokens, i); + if (j) { + tokens.splice(i, j+1-i, buildExprTree(tokens.slice(i+1, j))); + return tokens; + } + } + + if (operatorAndPriority == 4 /* unary ! */) { + // Special case: the unary operator ! needs to evaluate right-to-left. + i = tokens.lastIndexOf('!'); + var innerExpr = buildExprTree(tokens.slice(i+1, i+2)); + tokens.splice(i, 2, function() { return !innerExpr(); }) + return tokens; + } + + // A binary operator: + if (operatorAndPriority >= 0) { + var left = buildExprTree(tokens.slice(0, i)); + var right = buildExprTree(tokens.slice(i+1)); + switch(tokens[i]) { + case '&&': return [function() { return left() && right(); }]; + case '||': return [function() { return left() || right(); }]; + case '==': return [function() { return left() == right(); }]; + case '!=': return [function() { return left() != right(); }]; + case '<' : return [function() { return left() < right(); }]; + case '<=': return [function() { return left() <= right(); }]; + case '>' : return [function() { return left() > right(); }]; + case '>=': return [function() { return left() >= right(); }]; + case '+': return [function() { return left() + right(); }]; + case '-': return [function() { return left() - right(); }]; + case '*': return [function() { return left() * right(); }]; + case '/': return [function() { return Math.floor(left() / right()); }]; + } + } + // else a number: + if (tokens[i] == ')') throw 'Parsing failure, mismatched parentheses in parsing!' + tokens.toString(); + assert(operatorAndPriority == -1); + var num = jstoi_q(tokens[i]); + return [function() { return num; }] + })(tokens); + } + return tokens[0]; + } + + // Preprocess the input one line at a time. + for(; i < len; ++i) { + // Find the start of the current line. + var lineStart = i; + + // Seek iterator to end of current line. + i = code.indexOf('\n', i); + if (i < 0) i = len; + + // Find the first non-whitespace character on the line. + for(var j = lineStart; j < i && isWhitespace(code, j); ++j); + + // Is this a non-preprocessor directive line? + var thisLineIsInActivePreprocessingBlock = stack[stack.length-1]; + if (code[j] != '#') { // non-preprocessor line? + if (thisLineIsInActivePreprocessingBlock) { + out += expandMacros(code, lineStart, i) + '\n'; + } + continue; + } + // This is a preprocessor directive line, e.g. #ifdef or #define. + + // Parse the line as # + var space = nextWhitespace(code, j); + var directive = code.substring(j+1, space); + var expression = code.substring(space, i).trim(); + switch(directive) { + case 'if': + var tokens = tokenize(expandMacros(expression, 0)); + var exprTree = buildExprTree(tokens); + var evaluated = exprTree(); + stack.push(!!evaluated * stack[stack.length-1]); + break; + case 'ifdef': stack.push(!!defs[expression] * stack[stack.length-1]); break; + case 'ifndef': stack.push(!defs[expression] * stack[stack.length-1]); break; + case 'else': stack[stack.length-1] = 1-stack[stack.length-1]; break; + case 'endif': stack.pop(); break; + case 'define': + if (thisLineIsInActivePreprocessingBlock) { + // This could either be a macro with input args (#define MACRO(x,y) x+y), or a direct expansion #define FOO 2, + // figure out which. + var macroStart = expression.indexOf('('); + var firstWs = nextWhitespace(expression, 0); + if (firstWs < macroStart) macroStart = 0; + if (macroStart > 0) { // #define MACRO( x , y , z ) + var macroEnd = expression.indexOf(')', macroStart); + let params = expression.substring(macroStart+1, macroEnd).split(',').map(x => x.trim()); + let value = tokenize(expression.substring(macroEnd+1).trim()) + defs[expression.substring(0, macroStart)] = (args) => { + var ret = ''; + value.forEach((x) => { + var argIndex = params.indexOf(x); + ret += (argIndex >= 0) ? args[argIndex] : x; + }); + return ret; + }; + } else { // #define FOO (x + y + z) + let value = expandMacros(expression.substring(firstWs+1).trim(), 0); + defs[expression.substring(0, firstWs)] = () => value; + } + } + break; + case 'undef': if (thisLineIsInActivePreprocessingBlock) delete defs[expression]; break; + default: + if (directive != 'version' && directive != 'pragma' && directive != 'extension') { // GLSL shader compiler specific #directives. + err('Unrecognized preprocessor directive #' + directive + '!'); + } + + // Unknown preprocessor macro, just pass through the line to output. + out += expandMacros(code, lineStart, i) + '\n'; + } + } + return out; + } + + function remove_cpp_comments_in_shaders(code) { + var i = 0, out = '', ch, next, len = code.length; + for(; i < len; ++i) { + ch = code[i]; + if (ch == '/') { + next = code[i+1]; + if (next == '/') { + while(i < len && code[i+1] != '\n') ++i; + } else if (next == '*') { + while(i < len && (code[i-1] != '*' || code[i] != '/')) ++i; + } else { + out += ch; + } + } else { + out += ch; + } + } + return out; + } + function _glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + + // These are not expected to be meaningful in WebGL, but issue a warning if they are present, to give some diagnostics about if they are present. + if (source.includes('__FILE__')) warnOnce('When compiling shader: ' + source + ': Preprocessor variable __FILE__ is not handled by -sGL_EXPLICIT_UNIFORM_LOCATION/-sGL_EXPLICIT_UNIFORM_BINDING options!'); + if (source.includes('__LINE__')) warnOnce('When compiling shader: ' + source + ': Preprocessor variable __LINE__ is not handled by -sGL_EXPLICIT_UNIFORM_LOCATION/-sGL_EXPLICIT_UNIFORM_BINDING options!'); + // Remove comments and C-preprocess the input shader first, so that we can appropriately + // parse the layout location directives. + source = preprocess_c_code(remove_cpp_comments_in_shaders(source), { + 'GL_FRAGMENT_PRECISION_HIGH': () => 1, + 'GL_ES': () => 1, + '__VERSION__': () => source.includes('#version 300') ? 300 : 100 + }); + + // Extract the layout(location = x) directives. + var regex = /layout\s*\(\s*location\s*=\s*(-?\d+)\s*\)\s*(uniform\s+((lowp|mediump|highp)\s+)?\w+\s+(\w+))/g, explicitUniformLocations = {}, match; + while(match = regex.exec(source)) { + explicitUniformLocations[match[5]] = jstoi_q(match[1]); + if (!(explicitUniformLocations[match[5]] >= 0 && explicitUniformLocations[match[5]] < 1048576)) { + err('Specified an out of range layout(location=x) directive "' + explicitUniformLocations[match[5]] + '"! (' + match[0] + ')'); + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + } + + // Remove all the layout(location = x) directives so that they do not make + // their way to the actual WebGL shader compiler. + source = source.replace(regex, '$2'); + + // Remember all the directives to be handled after glLinkProgram is called. + GL.shaders[shader].explicitUniformLocations = explicitUniformLocations; + + // Extract the layout(binding = x) directives. Four types we need to handle: + // layout(binding = 3) uniform sampler2D mainTexture; + // layout(binding = 1, std140) uniform MainBlock { ... }; + // layout(std140, binding = 1) uniform MainBlock { ... }; + // layout(binding = 1) uniform MainBlock { ... }; + var bindingRegex = /layout\s*\(.*?binding\s*=\s*(-?\d+).*?\)\s*uniform\s+(\w+)\s+(\w+)?/g, samplerBindings = {}, uniformBindings = {}, bindingMatch; + while(bindingMatch = bindingRegex.exec(source)) { + // We have a layout(binding=x) enabled uniform. Parse the array length of that uniform, if it is an array, i.e. a + // layout(binding = 3) uniform sampler2D mainTexture[arrayLength]; + // or + // layout(binding = 1, std140) uniform MainBlock { ... } name[arrayLength]; + var arrayLength = 1; + for(var i = bindingMatch.index; i < source.length && source[i] != ';'; ++i) { + if (source[i] == '[') { + arrayLength = jstoi_q(source.slice(i+1)); + break; + } + if (source[i] == '{') i = find_closing_parens_index(source, i, '{', '}') - 1; + } + var binding = jstoi_q(bindingMatch[1]); + var bindingsType = 0x8872/*GL_MAX_TEXTURE_IMAGE_UNITS*/; + if (bindingMatch[3] && bindingMatch[2].indexOf('sampler') != -1) { + samplerBindings[bindingMatch[3]] = [binding, arrayLength]; + } else { + bindingsType = 0x8A2E/*GL_MAX_COMBINED_UNIFORM_BLOCKS*/; + uniformBindings[bindingMatch[2]] = [binding, arrayLength]; + } + var numBindingPoints = GLctx.getParameter(bindingsType); + if (!(binding >= 0 && binding + arrayLength <= numBindingPoints)) { + err('Specified an out of range layout(binding=x) directive "' + binding + '"! (' + bindingMatch[0] + '). Valid range is [0, ' + numBindingPoints + '-1]'); + GL.recordError(0x501 /* GL_INVALID_VALUE */); + return; + } + } + + // Remove all the layout(binding = x) directives so that they do not make + // their way to the actual WebGL shader compiler. These regexes get quite hairy, check against + // https://regex101.com/ when working on these. + source = source.replace(/layout\s*\(.*?binding\s*=\s*([-\d]+).*?\)/g, ''); // "layout(binding = 3)" -> "" + source = source.replace(/(layout\s*\((.*?)),\s*binding\s*=\s*([-\d]+)\)/g, '$1)'); // "layout(std140, binding = 1)" -> "layout(std140)" + source = source.replace(/layout\s*\(\s*binding\s*=\s*([-\d]+)\s*,(.*?)\)/g, 'layout($2)'); // "layout(binding = 1, std140)" -> "layout(std140)" + + // Remember all the directives to be handled after glLinkProgram is called. + GL.shaders[shader].explicitSamplerBindings = samplerBindings; + GL.shaders[shader].explicitUniformBindings = uniformBindings; + + GLctx.shaderSource(GL.shaders[shader], source); + } + + function _glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) } + + function _glStencilMask(x0) { GLctx['stencilMask'](x0) } + + function _glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) } + + function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + if (GL.currentContext.version >= 2) { + // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels); + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } else { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null); + } + return; + } + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null); + } + + function _glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx['texImage3D'](target, level, internalFormat, width, height, depth, border, format, type, pixels); + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx['texImage3D'](target, level, internalFormat, width, height, depth, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } else { + GLctx['texImage3D'](target, level, internalFormat, width, height, depth, border, format, type, null); + } + } + + function _glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) } + + function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) } + + function _glTexParameteriv(target, pname, params) { + var param = HEAP32[((params)>>2)]; + GLctx.texParameteri(target, pname, param); + } + + function _glTexStorage2D(x0, x1, x2, x3, x4) { GLctx['texStorage2D'](x0, x1, x2, x3, x4) } + + function _glTexStorage3D(x0, x1, x2, x3, x4, x5) { GLctx['texStorage3D'](x0, x1, x2, x3, x4, x5) } + + function _glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) { + if (GL.currentContext.version >= 2) { + // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels); + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } else { + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, null); + } + return; + } + var pixelData = null; + if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0); + GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData); + } + + function _glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx['texSubImage3D'](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels); + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx['texSubImage3D'](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } else { + GLctx['texSubImage3D'](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null); + } + } + + var miniTempWebGLFloatBuffers = []; + function _glUniform1fv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform1fv(webglGetUniformLocation(location), HEAPF32, value>>2, count); + return; + } + + if (count <= 288) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[count-1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2, (value+count*4)>>2); + } + GLctx.uniform1fv(webglGetUniformLocation(location), view); + } + + function _glUniform1i(location, v0) { + GLctx.uniform1i(webglGetUniformLocation(location), v0); + } + + var __miniTempWebGLIntBuffers = []; + function _glUniform1iv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform1iv(webglGetUniformLocation(location), HEAP32, value>>2, count); + return; + } + + if (count <= 288) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[count-1]; + for (var i = 0; i < count; ++i) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2, (value+count*4)>>2); + } + GLctx.uniform1iv(webglGetUniformLocation(location), view); + } + + function _glUniform1uiv(location, count, value) { + GLctx.uniform1uiv(webglGetUniformLocation(location), HEAPU32, value>>2, count); + } + + function _glUniform2fv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform2fv(webglGetUniformLocation(location), HEAPF32, value>>2, count*2); + return; + } + + if (count <= 144) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[2*count-1]; + for (var i = 0; i < 2*count; i += 2) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2, (value+count*8)>>2); + } + GLctx.uniform2fv(webglGetUniformLocation(location), view); + } + + function _glUniform2iv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform2iv(webglGetUniformLocation(location), HEAP32, value>>2, count*2); + return; + } + + if (count <= 144) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[2*count-1]; + for (var i = 0; i < 2*count; i += 2) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + view[i+1] = HEAP32[(((value)+(4*i+4))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2, (value+count*8)>>2); + } + GLctx.uniform2iv(webglGetUniformLocation(location), view); + } + + function _glUniform2uiv(location, count, value) { + GLctx.uniform2uiv(webglGetUniformLocation(location), HEAPU32, value>>2, count*2); + } + + function _glUniform3fv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform3fv(webglGetUniformLocation(location), HEAPF32, value>>2, count*3); + return; + } + + if (count <= 96) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[3*count-1]; + for (var i = 0; i < 3*count; i += 3) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2, (value+count*12)>>2); + } + GLctx.uniform3fv(webglGetUniformLocation(location), view); + } + + function _glUniform3iv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform3iv(webglGetUniformLocation(location), HEAP32, value>>2, count*3); + return; + } + + if (count <= 96) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[3*count-1]; + for (var i = 0; i < 3*count; i += 3) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + view[i+1] = HEAP32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAP32[(((value)+(4*i+8))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2, (value+count*12)>>2); + } + GLctx.uniform3iv(webglGetUniformLocation(location), view); + } + + function _glUniform3uiv(location, count, value) { + GLctx.uniform3uiv(webglGetUniformLocation(location), HEAPU32, value>>2, count*3); + } + + function _glUniform4fv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform4fv(webglGetUniformLocation(location), HEAPF32, value>>2, count*4); + return; + } + + if (count <= 72) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[4*count-1]; + // hoist the heap out of the loop for size and for pthreads+growth. + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 4 * count; i += 4) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + } + } else + { + var view = HEAPF32.subarray((value)>>2, (value+count*16)>>2); + } + GLctx.uniform4fv(webglGetUniformLocation(location), view); + } + + function _glUniform4iv(location, count, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniform4iv(webglGetUniformLocation(location), HEAP32, value>>2, count*4); + return; + } + + if (count <= 72) { + // avoid allocation when uploading few enough uniforms + var view = __miniTempWebGLIntBuffers[4*count-1]; + for (var i = 0; i < 4*count; i += 4) { + view[i] = HEAP32[(((value)+(4*i))>>2)]; + view[i+1] = HEAP32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAP32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAP32[(((value)+(4*i+12))>>2)]; + } + } else + { + var view = HEAP32.subarray((value)>>2, (value+count*16)>>2); + } + GLctx.uniform4iv(webglGetUniformLocation(location), view); + } + + function _glUniform4uiv(location, count, value) { + GLctx.uniform4uiv(webglGetUniformLocation(location), HEAPU32, value>>2, count*4); + } + + function _glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) { + program = GL.programs[program]; + + GLctx['uniformBlockBinding'](program, uniformBlockIndex, uniformBlockBinding); + } + + function _glUniformMatrix3fv(location, count, transpose, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value>>2, count*9); + return; + } + + if (count <= 32) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[9*count-1]; + for (var i = 0; i < 9*count; i += 9) { + view[i] = HEAPF32[(((value)+(4*i))>>2)]; + view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)]; + view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)]; + view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)]; + view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)]; + view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)]; + view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)]; + view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)]; + view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)]; + } + } else + { + var view = HEAPF32.subarray((value)>>2, (value+count*36)>>2); + } + GLctx.uniformMatrix3fv(webglGetUniformLocation(location), !!transpose, view); + } + + function _glUniformMatrix4fv(location, count, transpose, value) { + + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, HEAPF32, value>>2, count*16); + return; + } + + if (count <= 18) { + // avoid allocation when uploading few enough uniforms + var view = miniTempWebGLFloatBuffers[16*count-1]; + // hoist the heap out of the loop for size and for pthreads+growth. + var heap = HEAPF32; + value >>= 2; + for (var i = 0; i < 16 * count; i += 16) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + view[i + 4] = heap[dst + 4]; + view[i + 5] = heap[dst + 5]; + view[i + 6] = heap[dst + 6]; + view[i + 7] = heap[dst + 7]; + view[i + 8] = heap[dst + 8]; + view[i + 9] = heap[dst + 9]; + view[i + 10] = heap[dst + 10]; + view[i + 11] = heap[dst + 11]; + view[i + 12] = heap[dst + 12]; + view[i + 13] = heap[dst + 13]; + view[i + 14] = heap[dst + 14]; + view[i + 15] = heap[dst + 15]; + } + } else + { + var view = HEAPF32.subarray((value)>>2, (value+count*64)>>2); + } + GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view); + } + + function _glUnmapBuffer(target) { + if (!emscriptenWebGLValidateMapBufferTarget(target)) { + GL.recordError(0x500/*GL_INVALID_ENUM*/); + err('GL_INVALID_ENUM in glUnmapBuffer'); + return 0; + } + + var buffer = emscriptenWebGLGetBufferBinding(target); + var mapping = GL.mappedBuffers[buffer]; + if (!mapping) { + GL.recordError(0x502 /* GL_INVALID_OPERATION */); + err('buffer was never mapped in glUnmapBuffer'); + return 0; + } + GL.mappedBuffers[buffer] = null; + + if (!(mapping.access & 0x10)) /* GL_MAP_FLUSH_EXPLICIT_BIT */ + if (GL.currentContext.version >= 2) { // WebGL 2 provides new garbage-free entry points to call to WebGL. Use those always when possible. + GLctx.bufferSubData(target, mapping.offset, HEAPU8, mapping.mem, mapping.length); + } else { + GLctx.bufferSubData(target, mapping.offset, HEAPU8.subarray(mapping.mem, mapping.mem+mapping.length)); + } + _free(mapping.mem); + return 1; + } + + function webglApplyExplicitProgramBindings() { + var p = GLctx.currentProgram; + if (!p.explicitProgramBindingsApplied) { + if (GL.currentContext.version >= 2) { + Object.keys(p.explicitUniformBindings).forEach(function(ubo) { + var bindings = p.explicitUniformBindings[ubo]; + for(var i = 0; i < bindings[1]; ++i) { + var blockIndex = GLctx.getUniformBlockIndex(p, ubo + (bindings[1] > 1 ? '[' + i + ']' : '')); + GLctx.uniformBlockBinding(p, blockIndex, bindings[0]+i); + } + }); + } + Object.keys(p.explicitSamplerBindings).forEach(function(sampler) { + var bindings = p.explicitSamplerBindings[sampler]; + for(var i = 0; i < bindings[1]; ++i) { + GLctx.uniform1i(GLctx.getUniformLocation(p, sampler + (i ? '['+i+']' : '')), bindings[0]+i); + } + }); + p.explicitProgramBindingsApplied = 1; + } + } + function _glUseProgram(program) { + program = GL.programs[program]; + GLctx.useProgram(program); + // Record the currently active program so that we can access the uniform + // mapping table of that program. + if ((GLctx.currentProgram = program)) { + webglApplyExplicitProgramBindings(); + } + } + + function _glValidateProgram(program) { + GLctx.validateProgram(GL.programs[program]); + } + + function _glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) } + + function _glVertexAttrib4fv(index, v) { + + GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]); + } + + function _glVertexAttribIPointer(index, size, type, stride, ptr) { + var cb = GL.currentContext.clientBuffers[index]; + if (!GLctx.currentArrayBufferBinding) { + cb.size = size; + cb.type = type; + cb.normalized = false; + cb.stride = stride; + cb.ptr = ptr; + cb.clientside = true; + cb.vertexAttribPointerAdaptor = function(index, size, type, normalized, stride, ptr) { + this.vertexAttribIPointer(index, size, type, stride, ptr); + }; + return; + } + cb.clientside = false; + GLctx['vertexAttribIPointer'](index, size, type, stride, ptr); + } + + function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + var cb = GL.currentContext.clientBuffers[index]; + if (!GLctx.currentArrayBufferBinding) { + cb.size = size; + cb.type = type; + cb.normalized = normalized; + cb.stride = stride; + cb.ptr = ptr; + cb.clientside = true; + cb.vertexAttribPointerAdaptor = function(index, size, type, normalized, stride, ptr) { + this.vertexAttribPointer(index, size, type, normalized, stride, ptr); + }; + return; + } + cb.clientside = false; + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr); + } + + function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) } + + function _llvm_eh_typeid_for(type) { + return type; + } + + function _setTempRet0(val) { + setTempRet0(val); + } + + function __isLeapYear(year) { + return year%4 === 0 && (year%100 !== 0 || year%400 === 0); + } + + function __arraySum(array, index) { + var sum = 0; + for (var i = 0; i <= index; sum += array[i++]) { + // no-op + } + return sum; + } + + var __MONTH_DAYS_LEAP = [31,29,31,30,31,30,31,31,30,31,30,31]; + + var __MONTH_DAYS_REGULAR = [31,28,31,30,31,30,31,31,30,31,30,31]; + function __addDays(date, days) { + var newDate = new Date(date.getTime()); + while (days > 0) { + var leap = __isLeapYear(newDate.getFullYear()); + var currentMonth = newDate.getMonth(); + var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; + + if (days > daysInCurrentMonth-newDate.getDate()) { + // we spill over to next month + days -= (daysInCurrentMonth-newDate.getDate()+1); + newDate.setDate(1); + if (currentMonth < 11) { + newDate.setMonth(currentMonth+1) + } else { + newDate.setMonth(0); + newDate.setFullYear(newDate.getFullYear()+1); + } + } else { + // we stay in current month + newDate.setDate(newDate.getDate()+days); + return newDate; + } + } + + return newDate; + } + function _strftime(s, maxsize, format, tm) { + // size_t strftime(char *restrict s, size_t maxsize, const char *restrict format, const struct tm *restrict timeptr); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/strftime.html + + var tm_zone = HEAP32[(((tm)+(40))>>2)]; + + var date = { + tm_sec: HEAP32[((tm)>>2)], + tm_min: HEAP32[(((tm)+(4))>>2)], + tm_hour: HEAP32[(((tm)+(8))>>2)], + tm_mday: HEAP32[(((tm)+(12))>>2)], + tm_mon: HEAP32[(((tm)+(16))>>2)], + tm_year: HEAP32[(((tm)+(20))>>2)], + tm_wday: HEAP32[(((tm)+(24))>>2)], + tm_yday: HEAP32[(((tm)+(28))>>2)], + tm_isdst: HEAP32[(((tm)+(32))>>2)], + tm_gmtoff: HEAP32[(((tm)+(36))>>2)], + tm_zone: tm_zone ? UTF8ToString(tm_zone) : '' + }; + + var pattern = UTF8ToString(format); + + // expand format + var EXPANSION_RULES_1 = { + '%c': '%a %b %d %H:%M:%S %Y', // Replaced by the locale's appropriate date and time representation - e.g., Mon Aug 3 14:02:01 2013 + '%D': '%m/%d/%y', // Equivalent to %m / %d / %y + '%F': '%Y-%m-%d', // Equivalent to %Y - %m - %d + '%h': '%b', // Equivalent to %b + '%r': '%I:%M:%S %p', // Replaced by the time in a.m. and p.m. notation + '%R': '%H:%M', // Replaced by the time in 24-hour notation + '%T': '%H:%M:%S', // Replaced by the time + '%x': '%m/%d/%y', // Replaced by the locale's appropriate date representation + '%X': '%H:%M:%S', // Replaced by the locale's appropriate time representation + // Modified Conversion Specifiers + '%Ec': '%c', // Replaced by the locale's alternative appropriate date and time representation. + '%EC': '%C', // Replaced by the name of the base year (period) in the locale's alternative representation. + '%Ex': '%m/%d/%y', // Replaced by the locale's alternative date representation. + '%EX': '%H:%M:%S', // Replaced by the locale's alternative time representation. + '%Ey': '%y', // Replaced by the offset from %EC (year only) in the locale's alternative representation. + '%EY': '%Y', // Replaced by the full alternative year representation. + '%Od': '%d', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading zeros if there is any alternative symbol for zero; otherwise, with leading characters. + '%Oe': '%e', // Replaced by the day of the month, using the locale's alternative numeric symbols, filled as needed with leading characters. + '%OH': '%H', // Replaced by the hour (24-hour clock) using the locale's alternative numeric symbols. + '%OI': '%I', // Replaced by the hour (12-hour clock) using the locale's alternative numeric symbols. + '%Om': '%m', // Replaced by the month using the locale's alternative numeric symbols. + '%OM': '%M', // Replaced by the minutes using the locale's alternative numeric symbols. + '%OS': '%S', // Replaced by the seconds using the locale's alternative numeric symbols. + '%Ou': '%u', // Replaced by the weekday as a number in the locale's alternative representation (Monday=1). + '%OU': '%U', // Replaced by the week number of the year (Sunday as the first day of the week, rules corresponding to %U ) using the locale's alternative numeric symbols. + '%OV': '%V', // Replaced by the week number of the year (Monday as the first day of the week, rules corresponding to %V ) using the locale's alternative numeric symbols. + '%Ow': '%w', // Replaced by the number of the weekday (Sunday=0) using the locale's alternative numeric symbols. + '%OW': '%W', // Replaced by the week number of the year (Monday as the first day of the week) using the locale's alternative numeric symbols. + '%Oy': '%y', // Replaced by the year (offset from %C ) using the locale's alternative numeric symbols. + }; + for (var rule in EXPANSION_RULES_1) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_1[rule]); + } + + var WEEKDAYS = ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday']; + var MONTHS = ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']; + + function leadingSomething(value, digits, character) { + var str = typeof value == 'number' ? value.toString() : (value || ''); + while (str.length < digits) { + str = character[0]+str; + } + return str; + } + + function leadingNulls(value, digits) { + return leadingSomething(value, digits, '0'); + } + + function compareByDay(date1, date2) { + function sgn(value) { + return value < 0 ? -1 : (value > 0 ? 1 : 0); + } + + var compare; + if ((compare = sgn(date1.getFullYear()-date2.getFullYear())) === 0) { + if ((compare = sgn(date1.getMonth()-date2.getMonth())) === 0) { + compare = sgn(date1.getDate()-date2.getDate()); + } + } + return compare; + } + + function getFirstWeekStartDate(janFourth) { + switch (janFourth.getDay()) { + case 0: // Sunday + return new Date(janFourth.getFullYear()-1, 11, 29); + case 1: // Monday + return janFourth; + case 2: // Tuesday + return new Date(janFourth.getFullYear(), 0, 3); + case 3: // Wednesday + return new Date(janFourth.getFullYear(), 0, 2); + case 4: // Thursday + return new Date(janFourth.getFullYear(), 0, 1); + case 5: // Friday + return new Date(janFourth.getFullYear()-1, 11, 31); + case 6: // Saturday + return new Date(janFourth.getFullYear()-1, 11, 30); + } + } + + function getWeekBasedYear(date) { + var thisDate = __addDays(new Date(date.tm_year+1900, 0, 1), date.tm_yday); + + var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); + var janFourthNextYear = new Date(thisDate.getFullYear()+1, 0, 4); + + var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); + var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); + + if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { + // this date is after the start of the first week of this year + if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { + return thisDate.getFullYear()+1; + } else { + return thisDate.getFullYear(); + } + } else { + return thisDate.getFullYear()-1; + } + } + + var EXPANSION_RULES_2 = { + '%a': function(date) { + return WEEKDAYS[date.tm_wday].substring(0,3); + }, + '%A': function(date) { + return WEEKDAYS[date.tm_wday]; + }, + '%b': function(date) { + return MONTHS[date.tm_mon].substring(0,3); + }, + '%B': function(date) { + return MONTHS[date.tm_mon]; + }, + '%C': function(date) { + var year = date.tm_year+1900; + return leadingNulls((year/100)|0,2); + }, + '%d': function(date) { + return leadingNulls(date.tm_mday, 2); + }, + '%e': function(date) { + return leadingSomething(date.tm_mday, 2, ' '); + }, + '%g': function(date) { + // %g, %G, and %V give values according to the ISO 8601:2000 standard week-based year. + // In this system, weeks begin on a Monday and week 1 of the year is the week that includes + // January 4th, which is also the week that includes the first Thursday of the year, and + // is also the first week that contains at least four days in the year. + // If the first Monday of January is the 2nd, 3rd, or 4th, the preceding days are part of + // the last week of the preceding year; thus, for Saturday 2nd January 1999, + // %G is replaced by 1998 and %V is replaced by 53. If December 29th, 30th, + // or 31st is a Monday, it and any following days are part of week 1 of the following year. + // Thus, for Tuesday 30th December 1997, %G is replaced by 1998 and %V is replaced by 01. + + return getWeekBasedYear(date).toString().substring(2); + }, + '%G': function(date) { + return getWeekBasedYear(date); + }, + '%H': function(date) { + return leadingNulls(date.tm_hour, 2); + }, + '%I': function(date) { + var twelveHour = date.tm_hour; + if (twelveHour == 0) twelveHour = 12; + else if (twelveHour > 12) twelveHour -= 12; + return leadingNulls(twelveHour, 2); + }, + '%j': function(date) { + // Day of the year (001-366) + return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon-1), 3); + }, + '%m': function(date) { + return leadingNulls(date.tm_mon+1, 2); + }, + '%M': function(date) { + return leadingNulls(date.tm_min, 2); + }, + '%n': function() { + return '\n'; + }, + '%p': function(date) { + if (date.tm_hour >= 0 && date.tm_hour < 12) { + return 'AM'; + } else { + return 'PM'; + } + }, + '%S': function(date) { + return leadingNulls(date.tm_sec, 2); + }, + '%t': function() { + return '\t'; + }, + '%u': function(date) { + return date.tm_wday || 7; + }, + '%U': function(date) { + var days = date.tm_yday + 7 - date.tm_wday; + return leadingNulls(Math.floor(days / 7), 2); + }, + '%V': function(date) { + // Replaced by the week number of the year (Monday as the first day of the week) + // as a decimal number [01,53]. If the week containing 1 January has four + // or more days in the new year, then it is considered week 1. + // Otherwise, it is the last week of the previous year, and the next week is week 1. + // Both January 4th and the first Thursday of January are always in week 1. [ tm_year, tm_wday, tm_yday] + var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7 ) / 7); + // If 1 Jan is just 1-3 days past Monday, the previous week + // is also in this year. + if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) { + val++; + } + if (!val) { + val = 52; + // If 31 December of prev year a Thursday, or Friday of a + // leap year, then the prev year has 53 weeks. + var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7; + if (dec31 == 4 || (dec31 == 5 && __isLeapYear(date.tm_year%400-1))) { + val++; + } + } else if (val == 53) { + // If 1 January is not a Thursday, and not a Wednesday of a + // leap year, then this year has only 52 weeks. + var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7; + if (jan1 != 4 && (jan1 != 3 || !__isLeapYear(date.tm_year))) + val = 1; + } + return leadingNulls(val, 2); + }, + '%w': function(date) { + return date.tm_wday; + }, + '%W': function(date) { + var days = date.tm_yday + 7 - ((date.tm_wday + 6) % 7); + return leadingNulls(Math.floor(days / 7), 2); + }, + '%y': function(date) { + // Replaced by the last two digits of the year as a decimal number [00,99]. [ tm_year] + return (date.tm_year+1900).toString().substring(2); + }, + '%Y': function(date) { + // Replaced by the year as a decimal number (for example, 1997). [ tm_year] + return date.tm_year+1900; + }, + '%z': function(date) { + // Replaced by the offset from UTC in the ISO 8601:2000 standard format ( +hhmm or -hhmm ). + // For example, "-0430" means 4 hours 30 minutes behind UTC (west of Greenwich). + var off = date.tm_gmtoff; + var ahead = off >= 0; + off = Math.abs(off) / 60; + // convert from minutes into hhmm format (which means 60 minutes = 100 units) + off = (off / 60)*100 + (off % 60); + return (ahead ? '+' : '-') + String("0000" + off).slice(-4); + }, + '%Z': function(date) { + return date.tm_zone; + }, + '%%': function() { + return '%'; + } + }; + + // Replace %% with a pair of NULLs (which cannot occur in a C string), then + // re-inject them after processing. + pattern = pattern.replace(/%%/g, '\0\0') + for (var rule in EXPANSION_RULES_2) { + if (pattern.includes(rule)) { + pattern = pattern.replace(new RegExp(rule, 'g'), EXPANSION_RULES_2[rule](date)); + } + } + pattern = pattern.replace(/\0\0/g, '%') + + var bytes = intArrayFromString(pattern, false); + if (bytes.length > maxsize) { + return 0; + } + + writeArrayToMemory(bytes, s); + return bytes.length-1; + } + + var FSNode = /** @constructor */ function(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; + }; + var readMode = 292/*292*/ | 73/*73*/; + var writeMode = 146/*146*/; + Object.defineProperties(FSNode.prototype, { + read: { + get: /** @this{FSNode} */function() { + return (this.mode & readMode) === readMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= readMode : this.mode &= ~readMode; + } + }, + write: { + get: /** @this{FSNode} */function() { + return (this.mode & writeMode) === writeMode; + }, + set: /** @this{FSNode} */function(val) { + val ? this.mode |= writeMode : this.mode &= ~writeMode; + } + }, + isFolder: { + get: /** @this{FSNode} */function() { + return FS.isDir(this.mode); + } + }, + isDevice: { + get: /** @this{FSNode} */function() { + return FS.isChrdev(this.mode); + } + } + }); + FS.FSNode = FSNode; + FS.staticInit();Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;; +ERRNO_CODES = { + 'EPERM': 63, + 'ENOENT': 44, + 'ESRCH': 71, + 'EINTR': 27, + 'EIO': 29, + 'ENXIO': 60, + 'E2BIG': 1, + 'ENOEXEC': 45, + 'EBADF': 8, + 'ECHILD': 12, + 'EAGAIN': 6, + 'EWOULDBLOCK': 6, + 'ENOMEM': 48, + 'EACCES': 2, + 'EFAULT': 21, + 'ENOTBLK': 105, + 'EBUSY': 10, + 'EEXIST': 20, + 'EXDEV': 75, + 'ENODEV': 43, + 'ENOTDIR': 54, + 'EISDIR': 31, + 'EINVAL': 28, + 'ENFILE': 41, + 'EMFILE': 33, + 'ENOTTY': 59, + 'ETXTBSY': 74, + 'EFBIG': 22, + 'ENOSPC': 51, + 'ESPIPE': 70, + 'EROFS': 69, + 'EMLINK': 34, + 'EPIPE': 64, + 'EDOM': 18, + 'ERANGE': 68, + 'ENOMSG': 49, + 'EIDRM': 24, + 'ECHRNG': 106, + 'EL2NSYNC': 156, + 'EL3HLT': 107, + 'EL3RST': 108, + 'ELNRNG': 109, + 'EUNATCH': 110, + 'ENOCSI': 111, + 'EL2HLT': 112, + 'EDEADLK': 16, + 'ENOLCK': 46, + 'EBADE': 113, + 'EBADR': 114, + 'EXFULL': 115, + 'ENOANO': 104, + 'EBADRQC': 103, + 'EBADSLT': 102, + 'EDEADLOCK': 16, + 'EBFONT': 101, + 'ENOSTR': 100, + 'ENODATA': 116, + 'ETIME': 117, + 'ENOSR': 118, + 'ENONET': 119, + 'ENOPKG': 120, + 'EREMOTE': 121, + 'ENOLINK': 47, + 'EADV': 122, + 'ESRMNT': 123, + 'ECOMM': 124, + 'EPROTO': 65, + 'EMULTIHOP': 36, + 'EDOTDOT': 125, + 'EBADMSG': 9, + 'ENOTUNIQ': 126, + 'EBADFD': 127, + 'EREMCHG': 128, + 'ELIBACC': 129, + 'ELIBBAD': 130, + 'ELIBSCN': 131, + 'ELIBMAX': 132, + 'ELIBEXEC': 133, + 'ENOSYS': 52, + 'ENOTEMPTY': 55, + 'ENAMETOOLONG': 37, + 'ELOOP': 32, + 'EOPNOTSUPP': 138, + 'EPFNOSUPPORT': 139, + 'ECONNRESET': 15, + 'ENOBUFS': 42, + 'EAFNOSUPPORT': 5, + 'EPROTOTYPE': 67, + 'ENOTSOCK': 57, + 'ENOPROTOOPT': 50, + 'ESHUTDOWN': 140, + 'ECONNREFUSED': 14, + 'EADDRINUSE': 3, + 'ECONNABORTED': 13, + 'ENETUNREACH': 40, + 'ENETDOWN': 38, + 'ETIMEDOUT': 73, + 'EHOSTDOWN': 142, + 'EHOSTUNREACH': 23, + 'EINPROGRESS': 26, + 'EALREADY': 7, + 'EDESTADDRREQ': 17, + 'EMSGSIZE': 35, + 'EPROTONOSUPPORT': 66, + 'ESOCKTNOSUPPORT': 137, + 'EADDRNOTAVAIL': 4, + 'ENETRESET': 39, + 'EISCONN': 30, + 'ENOTCONN': 53, + 'ETOOMANYREFS': 141, + 'EUSERS': 136, + 'EDQUOT': 19, + 'ESTALE': 72, + 'ENOTSUP': 138, + 'ENOMEDIUM': 148, + 'EILSEQ': 25, + 'EOVERFLOW': 61, + 'ECANCELED': 11, + 'ENOTRECOVERABLE': 56, + 'EOWNERDEAD': 62, + 'ESTRPIPE': 135, + };; +Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas) { Browser.requestFullscreen(lockPointer, resizeCanvas) }; + Module["requestFullScreen"] = function Module_requestFullScreen() { Browser.requestFullScreen() }; + Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) }; + Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) }; + Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() }; + Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() }; + Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() } + Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) }; +var GLctx;; +for (var i = 0; i < 32; ++i) tempFixedLengthArray.push(new Array(i));; +var miniTempWebGLFloatBuffersStorage = new Float32Array(288); + for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) { + miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i+1); + } + ; +var __miniTempWebGLIntBuffersStorage = new Int32Array(288); + for (/**@suppress{duplicate}*/var i = 0; i < 288; ++i) { + __miniTempWebGLIntBuffers[i] = __miniTempWebGLIntBuffersStorage.subarray(0, i+1); + } + ; +var ASSERTIONS = true; + + + +/** @type {function(string, boolean=, number=)} */ +function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; +} + +function intArrayToString(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + var chr = array[i]; + if (chr > 0xFF) { + if (ASSERTIONS) { + assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.'); + } + chr &= 0xFF; + } + ret.push(String.fromCharCode(chr)); + } + return ret.join(''); +} + + +function checkIncomingModuleAPI() { + ignoredModuleProp('fetchSettings'); +} +var asmLibraryArg = { + "CreateObjectUrl": _CreateObjectUrl, + "DownloadFile": _DownloadFile, + "GetJSMemoryInfo": _GetJSMemoryInfo, + "JS_Accelerometer_IsRunning": _JS_Accelerometer_IsRunning, + "JS_Accelerometer_Start": _JS_Accelerometer_Start, + "JS_Accelerometer_Stop": _JS_Accelerometer_Stop, + "JS_CallAsLongAsNoExceptionsSeen": _JS_CallAsLongAsNoExceptionsSeen, + "JS_Cursor_SetImage": _JS_Cursor_SetImage, + "JS_Cursor_SetShow": _JS_Cursor_SetShow, + "JS_DOM_MapViewportCoordinateToElementLocalCoordinate": _JS_DOM_MapViewportCoordinateToElementLocalCoordinate, + "JS_DOM_UnityCanvasSelector": _JS_DOM_UnityCanvasSelector, + "JS_Eval_OpenURL": _JS_Eval_OpenURL, + "JS_FileSystem_Initialize": _JS_FileSystem_Initialize, + "JS_FileSystem_Sync": _JS_FileSystem_Sync, + "JS_GravitySensor_IsRunning": _JS_GravitySensor_IsRunning, + "JS_GravitySensor_Start": _JS_GravitySensor_Start, + "JS_GravitySensor_Stop": _JS_GravitySensor_Stop, + "JS_GuardAgainstJsExceptions": _JS_GuardAgainstJsExceptions, + "JS_Gyroscope_IsRunning": _JS_Gyroscope_IsRunning, + "JS_Gyroscope_Start": _JS_Gyroscope_Start, + "JS_Gyroscope_Stop": _JS_Gyroscope_Stop, + "JS_Init_ContextMenuHandler": _JS_Init_ContextMenuHandler, + "JS_LinearAccelerationSensor_IsRunning": _JS_LinearAccelerationSensor_IsRunning, + "JS_LinearAccelerationSensor_Start": _JS_LinearAccelerationSensor_Start, + "JS_LinearAccelerationSensor_Stop": _JS_LinearAccelerationSensor_Stop, + "JS_Log_Dump": _JS_Log_Dump, + "JS_Log_StackTrace": _JS_Log_StackTrace, + "JS_MobileKeybard_GetIgnoreBlurEvent": _JS_MobileKeybard_GetIgnoreBlurEvent, + "JS_MobileKeyboard_GetKeyboardStatus": _JS_MobileKeyboard_GetKeyboardStatus, + "JS_MobileKeyboard_GetText": _JS_MobileKeyboard_GetText, + "JS_MobileKeyboard_GetTextSelection": _JS_MobileKeyboard_GetTextSelection, + "JS_MobileKeyboard_Hide": _JS_MobileKeyboard_Hide, + "JS_MobileKeyboard_SetCharacterLimit": _JS_MobileKeyboard_SetCharacterLimit, + "JS_MobileKeyboard_SetText": _JS_MobileKeyboard_SetText, + "JS_MobileKeyboard_SetTextSelection": _JS_MobileKeyboard_SetTextSelection, + "JS_MobileKeyboard_Show": _JS_MobileKeyboard_Show, + "JS_OrientationSensor_IsRunning": _JS_OrientationSensor_IsRunning, + "JS_OrientationSensor_Start": _JS_OrientationSensor_Start, + "JS_OrientationSensor_Stop": _JS_OrientationSensor_Stop, + "JS_Profiler_InjectJobs": _JS_Profiler_InjectJobs, + "JS_RequestDeviceSensorPermissionsOnTouch": _JS_RequestDeviceSensorPermissionsOnTouch, + "JS_RunQuitCallbacks": _JS_RunQuitCallbacks, + "JS_ScreenOrientation_DeInit": _JS_ScreenOrientation_DeInit, + "JS_ScreenOrientation_Init": _JS_ScreenOrientation_Init, + "JS_ScreenOrientation_Lock": _JS_ScreenOrientation_Lock, + "JS_Sound_Create_Channel": _JS_Sound_Create_Channel, + "JS_Sound_GetData": _JS_Sound_GetData, + "JS_Sound_GetLength": _JS_Sound_GetLength, + "JS_Sound_GetLoadState": _JS_Sound_GetLoadState, + "JS_Sound_GetMetaData": _JS_Sound_GetMetaData, + "JS_Sound_Init": _JS_Sound_Init, + "JS_Sound_IsStopped": _JS_Sound_IsStopped, + "JS_Sound_Load": _JS_Sound_Load, + "JS_Sound_Load_PCM": _JS_Sound_Load_PCM, + "JS_Sound_Play": _JS_Sound_Play, + "JS_Sound_ReleaseInstance": _JS_Sound_ReleaseInstance, + "JS_Sound_ResumeIfNeeded": _JS_Sound_ResumeIfNeeded, + "JS_Sound_Set3D": _JS_Sound_Set3D, + "JS_Sound_SetListenerOrientation": _JS_Sound_SetListenerOrientation, + "JS_Sound_SetListenerPosition": _JS_Sound_SetListenerPosition, + "JS_Sound_SetLoop": _JS_Sound_SetLoop, + "JS_Sound_SetLoopPoints": _JS_Sound_SetLoopPoints, + "JS_Sound_SetPaused": _JS_Sound_SetPaused, + "JS_Sound_SetPitch": _JS_Sound_SetPitch, + "JS_Sound_SetPosition": _JS_Sound_SetPosition, + "JS_Sound_SetVolume": _JS_Sound_SetVolume, + "JS_Sound_Stop": _JS_Sound_Stop, + "JS_SystemInfo_GetBrowserName": _JS_SystemInfo_GetBrowserName, + "JS_SystemInfo_GetBrowserVersionString": _JS_SystemInfo_GetBrowserVersionString, + "JS_SystemInfo_GetCanvasClientSize": _JS_SystemInfo_GetCanvasClientSize, + "JS_SystemInfo_GetDocumentURL": _JS_SystemInfo_GetDocumentURL, + "JS_SystemInfo_GetGPUInfo": _JS_SystemInfo_GetGPUInfo, + "JS_SystemInfo_GetLanguage": _JS_SystemInfo_GetLanguage, + "JS_SystemInfo_GetMatchWebGLToCanvasSize": _JS_SystemInfo_GetMatchWebGLToCanvasSize, + "JS_SystemInfo_GetMemory": _JS_SystemInfo_GetMemory, + "JS_SystemInfo_GetOS": _JS_SystemInfo_GetOS, + "JS_SystemInfo_GetPreferredDevicePixelRatio": _JS_SystemInfo_GetPreferredDevicePixelRatio, + "JS_SystemInfo_GetScreenSize": _JS_SystemInfo_GetScreenSize, + "JS_SystemInfo_GetStreamingAssetsURL": _JS_SystemInfo_GetStreamingAssetsURL, + "JS_SystemInfo_HasAstcHdr": _JS_SystemInfo_HasAstcHdr, + "JS_SystemInfo_HasCursorLock": _JS_SystemInfo_HasCursorLock, + "JS_SystemInfo_HasFullscreen": _JS_SystemInfo_HasFullscreen, + "JS_SystemInfo_HasWebGL": _JS_SystemInfo_HasWebGL, + "JS_SystemInfo_IsMobile": _JS_SystemInfo_IsMobile, + "JS_UnityEngineShouldQuit": _JS_UnityEngineShouldQuit, + "JS_WebRequest_Abort": _JS_WebRequest_Abort, + "JS_WebRequest_Create": _JS_WebRequest_Create, + "JS_WebRequest_GetResponseMetaData": _JS_WebRequest_GetResponseMetaData, + "JS_WebRequest_GetResponseMetaDataLengths": _JS_WebRequest_GetResponseMetaDataLengths, + "JS_WebRequest_Release": _JS_WebRequest_Release, + "JS_WebRequest_Send": _JS_WebRequest_Send, + "JS_WebRequest_SetRedirectLimit": _JS_WebRequest_SetRedirectLimit, + "JS_WebRequest_SetRequestHeader": _JS_WebRequest_SetRequestHeader, + "JS_WebRequest_SetTimeout": _JS_WebRequest_SetTimeout, + "PasteManagerSetup": _PasteManagerSetup, + "UploadFile": _UploadFile, + "__assert_fail": ___assert_fail, + "__cxa_allocate_exception": ___cxa_allocate_exception, + "__cxa_begin_catch": ___cxa_begin_catch, + "__cxa_end_catch": ___cxa_end_catch, + "__cxa_find_matching_catch_2": ___cxa_find_matching_catch_2, + "__cxa_find_matching_catch_3": ___cxa_find_matching_catch_3, + "__cxa_find_matching_catch_4": ___cxa_find_matching_catch_4, + "__cxa_free_exception": ___cxa_free_exception, + "__cxa_rethrow": ___cxa_rethrow, + "__cxa_throw": ___cxa_throw, + "__resumeException": ___resumeException, + "__syscall__newselect": ___syscall__newselect, + "__syscall_accept4": ___syscall_accept4, + "__syscall_bind": ___syscall_bind, + "__syscall_chmod": ___syscall_chmod, + "__syscall_connect": ___syscall_connect, + "__syscall_dup3": ___syscall_dup3, + "__syscall_faccessat": ___syscall_faccessat, + "__syscall_fchmod": ___syscall_fchmod, + "__syscall_fcntl64": ___syscall_fcntl64, + "__syscall_fstat64": ___syscall_fstat64, + "__syscall_ftruncate64": ___syscall_ftruncate64, + "__syscall_getcwd": ___syscall_getcwd, + "__syscall_getdents64": ___syscall_getdents64, + "__syscall_getpeername": ___syscall_getpeername, + "__syscall_getsockname": ___syscall_getsockname, + "__syscall_getsockopt": ___syscall_getsockopt, + "__syscall_ioctl": ___syscall_ioctl, + "__syscall_listen": ___syscall_listen, + "__syscall_lstat64": ___syscall_lstat64, + "__syscall_mkdir": ___syscall_mkdir, + "__syscall_newfstatat": ___syscall_newfstatat, + "__syscall_openat": ___syscall_openat, + "__syscall_pipe": ___syscall_pipe, + "__syscall_poll": ___syscall_poll, + "__syscall_readlinkat": ___syscall_readlinkat, + "__syscall_recvfrom": ___syscall_recvfrom, + "__syscall_recvmsg": ___syscall_recvmsg, + "__syscall_renameat": ___syscall_renameat, + "__syscall_rmdir": ___syscall_rmdir, + "__syscall_sendmsg": ___syscall_sendmsg, + "__syscall_sendto": ___syscall_sendto, + "__syscall_socket": ___syscall_socket, + "__syscall_stat64": ___syscall_stat64, + "__syscall_statfs64": ___syscall_statfs64, + "__syscall_symlink": ___syscall_symlink, + "__syscall_truncate64": ___syscall_truncate64, + "__syscall_unlinkat": ___syscall_unlinkat, + "__syscall_utimensat": ___syscall_utimensat, + "_dlopen_js": __dlopen_js, + "_dlsym_js": __dlsym_js, + "_emscripten_date_now": __emscripten_date_now, + "_emscripten_get_now_is_monotonic": __emscripten_get_now_is_monotonic, + "_emscripten_throw_longjmp": __emscripten_throw_longjmp, + "_gmtime_js": __gmtime_js, + "_localtime_js": __localtime_js, + "_mktime_js": __mktime_js, + "_mmap_js": __mmap_js, + "_munmap_js": __munmap_js, + "_tzset_js": __tzset_js, + "abort": _abort, + "emscripten_asm_const_int": _emscripten_asm_const_int, + "emscripten_asm_const_int_sync_on_main_thread": _emscripten_asm_const_int_sync_on_main_thread, + "emscripten_cancel_main_loop": _emscripten_cancel_main_loop, + "emscripten_clear_interval": _emscripten_clear_interval, + "emscripten_console_error": _emscripten_console_error, + "emscripten_exit_fullscreen": _emscripten_exit_fullscreen, + "emscripten_exit_pointerlock": _emscripten_exit_pointerlock, + "emscripten_get_canvas_element_size": _emscripten_get_canvas_element_size, + "emscripten_get_fullscreen_status": _emscripten_get_fullscreen_status, + "emscripten_get_gamepad_status": _emscripten_get_gamepad_status, + "emscripten_get_heap_max": _emscripten_get_heap_max, + "emscripten_get_now": _emscripten_get_now, + "emscripten_get_now_res": _emscripten_get_now_res, + "emscripten_get_num_gamepads": _emscripten_get_num_gamepads, + "emscripten_html5_remove_all_event_listeners": _emscripten_html5_remove_all_event_listeners, + "emscripten_is_webgl_context_lost": _emscripten_is_webgl_context_lost, + "emscripten_log": _emscripten_log, + "emscripten_memcpy_big": _emscripten_memcpy_big, + "emscripten_request_fullscreen": _emscripten_request_fullscreen, + "emscripten_request_pointerlock": _emscripten_request_pointerlock, + "emscripten_resize_heap": _emscripten_resize_heap, + "emscripten_sample_gamepad_data": _emscripten_sample_gamepad_data, + "emscripten_set_blur_callback_on_thread": _emscripten_set_blur_callback_on_thread, + "emscripten_set_canvas_element_size": _emscripten_set_canvas_element_size, + "emscripten_set_focus_callback_on_thread": _emscripten_set_focus_callback_on_thread, + "emscripten_set_fullscreenchange_callback_on_thread": _emscripten_set_fullscreenchange_callback_on_thread, + "emscripten_set_gamepadconnected_callback_on_thread": _emscripten_set_gamepadconnected_callback_on_thread, + "emscripten_set_gamepaddisconnected_callback_on_thread": _emscripten_set_gamepaddisconnected_callback_on_thread, + "emscripten_set_interval": _emscripten_set_interval, + "emscripten_set_keydown_callback_on_thread": _emscripten_set_keydown_callback_on_thread, + "emscripten_set_keypress_callback_on_thread": _emscripten_set_keypress_callback_on_thread, + "emscripten_set_keyup_callback_on_thread": _emscripten_set_keyup_callback_on_thread, + "emscripten_set_main_loop": _emscripten_set_main_loop, + "emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, + "emscripten_set_mousedown_callback_on_thread": _emscripten_set_mousedown_callback_on_thread, + "emscripten_set_mousemove_callback_on_thread": _emscripten_set_mousemove_callback_on_thread, + "emscripten_set_mouseup_callback_on_thread": _emscripten_set_mouseup_callback_on_thread, + "emscripten_set_pointerlockchange_callback_on_thread": _emscripten_set_pointerlockchange_callback_on_thread, + "emscripten_set_touchcancel_callback_on_thread": _emscripten_set_touchcancel_callback_on_thread, + "emscripten_set_touchend_callback_on_thread": _emscripten_set_touchend_callback_on_thread, + "emscripten_set_touchmove_callback_on_thread": _emscripten_set_touchmove_callback_on_thread, + "emscripten_set_touchstart_callback_on_thread": _emscripten_set_touchstart_callback_on_thread, + "emscripten_set_wheel_callback_on_thread": _emscripten_set_wheel_callback_on_thread, + "emscripten_webgl_create_context": _emscripten_webgl_create_context, + "emscripten_webgl_destroy_context": _emscripten_webgl_destroy_context, + "emscripten_webgl_enable_extension": _emscripten_webgl_enable_extension, + "emscripten_webgl_get_current_context": _emscripten_webgl_get_current_context, + "emscripten_webgl_init_context_attributes": _emscripten_webgl_init_context_attributes, + "emscripten_webgl_make_context_current": _emscripten_webgl_make_context_current, + "environ_get": _environ_get, + "environ_sizes_get": _environ_sizes_get, + "exit": _exit, + "fd_close": _fd_close, + "fd_fdstat_get": _fd_fdstat_get, + "fd_read": _fd_read, + "fd_seek": _fd_seek, + "fd_write": _fd_write, + "getTempRet0": _getTempRet0, + "getaddrinfo": _getaddrinfo, + "gethostbyaddr": _gethostbyaddr, + "gethostbyname": _gethostbyname, + "getnameinfo": _getnameinfo, + "glActiveTexture": _glActiveTexture, + "glAttachShader": _glAttachShader, + "glBeginQuery": _glBeginQuery, + "glBindAttribLocation": _glBindAttribLocation, + "glBindBuffer": _glBindBuffer, + "glBindBufferBase": _glBindBufferBase, + "glBindBufferRange": _glBindBufferRange, + "glBindFramebuffer": _glBindFramebuffer, + "glBindRenderbuffer": _glBindRenderbuffer, + "glBindSampler": _glBindSampler, + "glBindTexture": _glBindTexture, + "glBindVertexArray": _glBindVertexArray, + "glBlendEquation": _glBlendEquation, + "glBlendEquationSeparate": _glBlendEquationSeparate, + "glBlendFuncSeparate": _glBlendFuncSeparate, + "glBlitFramebuffer": _glBlitFramebuffer, + "glBufferData": _glBufferData, + "glBufferSubData": _glBufferSubData, + "glCheckFramebufferStatus": _glCheckFramebufferStatus, + "glClear": _glClear, + "glClearBufferfi": _glClearBufferfi, + "glClearBufferfv": _glClearBufferfv, + "glClearBufferuiv": _glClearBufferuiv, + "glClearColor": _glClearColor, + "glClearDepthf": _glClearDepthf, + "glClearStencil": _glClearStencil, + "glClientWaitSync": _glClientWaitSync, + "glColorMask": _glColorMask, + "glCompileShader": _glCompileShader, + "glCompressedTexImage2D": _glCompressedTexImage2D, + "glCompressedTexImage3D": _glCompressedTexImage3D, + "glCompressedTexSubImage2D": _glCompressedTexSubImage2D, + "glCompressedTexSubImage3D": _glCompressedTexSubImage3D, + "glCopyBufferSubData": _glCopyBufferSubData, + "glCopyTexImage2D": _glCopyTexImage2D, + "glCopyTexSubImage2D": _glCopyTexSubImage2D, + "glCreateProgram": _glCreateProgram, + "glCreateShader": _glCreateShader, + "glCullFace": _glCullFace, + "glDeleteBuffers": _glDeleteBuffers, + "glDeleteFramebuffers": _glDeleteFramebuffers, + "glDeleteProgram": _glDeleteProgram, + "glDeleteQueries": _glDeleteQueries, + "glDeleteRenderbuffers": _glDeleteRenderbuffers, + "glDeleteSamplers": _glDeleteSamplers, + "glDeleteShader": _glDeleteShader, + "glDeleteSync": _glDeleteSync, + "glDeleteTextures": _glDeleteTextures, + "glDeleteVertexArrays": _glDeleteVertexArrays, + "glDepthFunc": _glDepthFunc, + "glDepthMask": _glDepthMask, + "glDetachShader": _glDetachShader, + "glDisable": _glDisable, + "glDisableVertexAttribArray": _glDisableVertexAttribArray, + "glDrawArrays": _glDrawArrays, + "glDrawArraysInstanced": _glDrawArraysInstanced, + "glDrawBuffers": _glDrawBuffers, + "glDrawElements": _glDrawElements, + "glDrawElementsInstanced": _glDrawElementsInstanced, + "glEnable": _glEnable, + "glEnableVertexAttribArray": _glEnableVertexAttribArray, + "glEndQuery": _glEndQuery, + "glFenceSync": _glFenceSync, + "glFinish": _glFinish, + "glFlush": _glFlush, + "glFlushMappedBufferRange": _glFlushMappedBufferRange, + "glFramebufferRenderbuffer": _glFramebufferRenderbuffer, + "glFramebufferTexture2D": _glFramebufferTexture2D, + "glFramebufferTextureLayer": _glFramebufferTextureLayer, + "glFrontFace": _glFrontFace, + "glGenBuffers": _glGenBuffers, + "glGenFramebuffers": _glGenFramebuffers, + "glGenQueries": _glGenQueries, + "glGenRenderbuffers": _glGenRenderbuffers, + "glGenSamplers": _glGenSamplers, + "glGenTextures": _glGenTextures, + "glGenVertexArrays": _glGenVertexArrays, + "glGenerateMipmap": _glGenerateMipmap, + "glGetActiveAttrib": _glGetActiveAttrib, + "glGetActiveUniform": _glGetActiveUniform, + "glGetActiveUniformBlockName": _glGetActiveUniformBlockName, + "glGetActiveUniformBlockiv": _glGetActiveUniformBlockiv, + "glGetActiveUniformsiv": _glGetActiveUniformsiv, + "glGetAttribLocation": _glGetAttribLocation, + "glGetBufferSubData": _glGetBufferSubData, + "glGetError": _glGetError, + "glGetFramebufferAttachmentParameteriv": _glGetFramebufferAttachmentParameteriv, + "glGetIntegeri_v": _glGetIntegeri_v, + "glGetIntegerv": _glGetIntegerv, + "glGetInternalformativ": _glGetInternalformativ, + "glGetProgramBinary": _glGetProgramBinary, + "glGetProgramInfoLog": _glGetProgramInfoLog, + "glGetProgramiv": _glGetProgramiv, + "glGetQueryObjectuiv": _glGetQueryObjectuiv, + "glGetQueryiv": _glGetQueryiv, + "glGetRenderbufferParameteriv": _glGetRenderbufferParameteriv, + "glGetShaderInfoLog": _glGetShaderInfoLog, + "glGetShaderPrecisionFormat": _glGetShaderPrecisionFormat, + "glGetShaderSource": _glGetShaderSource, + "glGetShaderiv": _glGetShaderiv, + "glGetString": _glGetString, + "glGetStringi": _glGetStringi, + "glGetTexParameteriv": _glGetTexParameteriv, + "glGetUniformBlockIndex": _glGetUniformBlockIndex, + "glGetUniformIndices": _glGetUniformIndices, + "glGetUniformLocation": _glGetUniformLocation, + "glGetUniformiv": _glGetUniformiv, + "glGetVertexAttribiv": _glGetVertexAttribiv, + "glInvalidateFramebuffer": _glInvalidateFramebuffer, + "glIsEnabled": _glIsEnabled, + "glIsVertexArray": _glIsVertexArray, + "glLinkProgram": _glLinkProgram, + "glMapBufferRange": _glMapBufferRange, + "glPixelStorei": _glPixelStorei, + "glPolygonOffset": _glPolygonOffset, + "glProgramBinary": _glProgramBinary, + "glProgramParameteri": _glProgramParameteri, + "glReadBuffer": _glReadBuffer, + "glReadPixels": _glReadPixels, + "glRenderbufferStorage": _glRenderbufferStorage, + "glRenderbufferStorageMultisample": _glRenderbufferStorageMultisample, + "glSamplerParameteri": _glSamplerParameteri, + "glScissor": _glScissor, + "glShaderSource": _glShaderSource, + "glStencilFuncSeparate": _glStencilFuncSeparate, + "glStencilMask": _glStencilMask, + "glStencilOpSeparate": _glStencilOpSeparate, + "glTexImage2D": _glTexImage2D, + "glTexImage3D": _glTexImage3D, + "glTexParameterf": _glTexParameterf, + "glTexParameteri": _glTexParameteri, + "glTexParameteriv": _glTexParameteriv, + "glTexStorage2D": _glTexStorage2D, + "glTexStorage3D": _glTexStorage3D, + "glTexSubImage2D": _glTexSubImage2D, + "glTexSubImage3D": _glTexSubImage3D, + "glUniform1fv": _glUniform1fv, + "glUniform1i": _glUniform1i, + "glUniform1iv": _glUniform1iv, + "glUniform1uiv": _glUniform1uiv, + "glUniform2fv": _glUniform2fv, + "glUniform2iv": _glUniform2iv, + "glUniform2uiv": _glUniform2uiv, + "glUniform3fv": _glUniform3fv, + "glUniform3iv": _glUniform3iv, + "glUniform3uiv": _glUniform3uiv, + "glUniform4fv": _glUniform4fv, + "glUniform4iv": _glUniform4iv, + "glUniform4uiv": _glUniform4uiv, + "glUniformBlockBinding": _glUniformBlockBinding, + "glUniformMatrix3fv": _glUniformMatrix3fv, + "glUniformMatrix4fv": _glUniformMatrix4fv, + "glUnmapBuffer": _glUnmapBuffer, + "glUseProgram": _glUseProgram, + "glValidateProgram": _glValidateProgram, + "glVertexAttrib4f": _glVertexAttrib4f, + "glVertexAttrib4fv": _glVertexAttrib4fv, + "glVertexAttribIPointer": _glVertexAttribIPointer, + "glVertexAttribPointer": _glVertexAttribPointer, + "glViewport": _glViewport, + "invoke_dddi": invoke_dddi, + "invoke_ddiii": invoke_ddiii, + "invoke_di": invoke_di, + "invoke_dii": invoke_dii, + "invoke_diii": invoke_diii, + "invoke_diiii": invoke_diiii, + "invoke_dji": invoke_dji, + "invoke_fffi": invoke_fffi, + "invoke_ffi": invoke_ffi, + "invoke_fi": invoke_fi, + "invoke_fifi": invoke_fifi, + "invoke_fii": invoke_fii, + "invoke_fiii": invoke_fiii, + "invoke_fiiii": invoke_fiiii, + "invoke_fiiiii": invoke_fiiiii, + "invoke_i": invoke_i, + "invoke_ifi": invoke_ifi, + "invoke_ii": invoke_ii, + "invoke_iiffi": invoke_iiffi, + "invoke_iifi": invoke_iifi, + "invoke_iifii": invoke_iifii, + "invoke_iifiiii": invoke_iifiiii, + "invoke_iii": invoke_iii, + "invoke_iiifi": invoke_iiifi, + "invoke_iiifii": invoke_iiifii, + "invoke_iiii": invoke_iiii, + "invoke_iiiidii": invoke_iiiidii, + "invoke_iiiifi": invoke_iiiifi, + "invoke_iiiifii": invoke_iiiifii, + "invoke_iiiii": invoke_iiiii, + "invoke_iiiiifiiiii": invoke_iiiiifiiiii, + "invoke_iiiiii": invoke_iiiiii, + "invoke_iiiiiifii": invoke_iiiiiifii, + "invoke_iiiiiii": invoke_iiiiiii, + "invoke_iiiiiiidii": invoke_iiiiiiidii, + "invoke_iiiiiiifii": invoke_iiiiiiifii, + "invoke_iiiiiiii": invoke_iiiiiiii, + "invoke_iiiiiiiifiii": invoke_iiiiiiiifiii, + "invoke_iiiiiiiii": invoke_iiiiiiiii, + "invoke_iiiiiiiiii": invoke_iiiiiiiiii, + "invoke_iiiiiiiiiii": invoke_iiiiiiiiiii, + "invoke_iiiiiiiiiiii": invoke_iiiiiiiiiiii, + "invoke_iiiiiiiiiiiiii": invoke_iiiiiiiiiiiiii, + "invoke_iiiiiiiiiiiiiii": invoke_iiiiiiiiiiiiiii, + "invoke_iiiiiiiiiiiijiii": invoke_iiiiiiiiiiiijiii, + "invoke_iiiiiiiiiji": invoke_iiiiiiiiiji, + "invoke_iiiiij": invoke_iiiiij, + "invoke_iiiijii": invoke_iiiijii, + "invoke_iiiijjii": invoke_iiiijjii, + "invoke_iiijii": invoke_iiijii, + "invoke_iiijiii": invoke_iiijiii, + "invoke_iij": invoke_iij, + "invoke_iiji": invoke_iiji, + "invoke_iijii": invoke_iijii, + "invoke_iijiii": invoke_iijiii, + "invoke_iijiiiiii": invoke_iijiiiiii, + "invoke_iijji": invoke_iijji, + "invoke_iijjiiiiii": invoke_iijjiiiiii, + "invoke_iji": invoke_iji, + "invoke_ijji": invoke_ijji, + "invoke_j": invoke_j, + "invoke_jdi": invoke_jdi, + "invoke_ji": invoke_ji, + "invoke_jii": invoke_jii, + "invoke_jiii": invoke_jiii, + "invoke_jiiii": invoke_jiiii, + "invoke_jiiiii": invoke_jiiiii, + "invoke_jiiiiiiiiii": invoke_jiiiiiiiiii, + "invoke_jiijiii": invoke_jiijiii, + "invoke_jiji": invoke_jiji, + "invoke_jijii": invoke_jijii, + "invoke_jji": invoke_jji, + "invoke_jjii": invoke_jjii, + "invoke_jjji": invoke_jjji, + "invoke_v": invoke_v, + "invoke_vfi": invoke_vfi, + "invoke_vi": invoke_vi, + "invoke_vidd": invoke_vidd, + "invoke_viddii": invoke_viddii, + "invoke_vidi": invoke_vidi, + "invoke_viffffi": invoke_viffffi, + "invoke_vifffi": invoke_vifffi, + "invoke_viffi": invoke_viffi, + "invoke_vifi": invoke_vifi, + "invoke_vififi": invoke_vififi, + "invoke_vifii": invoke_vifii, + "invoke_vii": invoke_vii, + "invoke_viidi": invoke_viidi, + "invoke_viidii": invoke_viidii, + "invoke_viidiji": invoke_viidiji, + "invoke_viifffffi": invoke_viifffffi, + "invoke_viiffi": invoke_viiffi, + "invoke_viifi": invoke_viifi, + "invoke_viifii": invoke_viifii, + "invoke_viifiiiiii": invoke_viifiiiiii, + "invoke_viii": invoke_viii, + "invoke_viiiffffiiiiiiifi": invoke_viiiffffiiiiiiifi, + "invoke_viiiffiii": invoke_viiiffiii, + "invoke_viiiffiiii": invoke_viiiffiiii, + "invoke_viiifi": invoke_viiifi, + "invoke_viiifii": invoke_viiifii, + "invoke_viiii": invoke_viiii, + "invoke_viiiidi": invoke_viiiidi, + "invoke_viiiiffiiiiii": invoke_viiiiffiiiiii, + "invoke_viiiiffiiiiiiiii": invoke_viiiiffiiiiiiiii, + "invoke_viiiifi": invoke_viiiifi, + "invoke_viiiii": invoke_viiiii, + "invoke_viiiiifffiii": invoke_viiiiifffiii, + "invoke_viiiiiffi": invoke_viiiiiffi, + "invoke_viiiiifi": invoke_viiiiifi, + "invoke_viiiiii": invoke_viiiiii, + "invoke_viiiiiii": invoke_viiiiiii, + "invoke_viiiiiiii": invoke_viiiiiiii, + "invoke_viiiiiiiii": invoke_viiiiiiiii, + "invoke_viiiiiiiiii": invoke_viiiiiiiiii, + "invoke_viiiiiiiiiiii": invoke_viiiiiiiiiiii, + "invoke_viiiiiiiiiiiii": invoke_viiiiiiiiiiiii, + "invoke_viiiiiiiiiiiiii": invoke_viiiiiiiiiiiiii, + "invoke_viiiiiijjiiiii": invoke_viiiiiijjiiiii, + "invoke_viiiiiijjiiiiiiiiiiiiii": invoke_viiiiiijjiiiiiiiiiiiiii, + "invoke_viiiijii": invoke_viiiijii, + "invoke_viiiijiiji": invoke_viiiijiiji, + "invoke_viiiji": invoke_viiiji, + "invoke_viiijii": invoke_viiijii, + "invoke_viiijiii": invoke_viiijiii, + "invoke_viiji": invoke_viiji, + "invoke_viijii": invoke_viijii, + "invoke_viijiiijiiii": invoke_viijiiijiiii, + "invoke_viji": invoke_viji, + "invoke_vijii": invoke_vijii, + "invoke_vijiii": invoke_vijiii, + "invoke_vijiiii": invoke_vijiiii, + "invoke_vijji": invoke_vijji, + "invoke_vijjji": invoke_vijjji, + "invoke_vijjjii": invoke_vijjjii, + "invoke_vji": invoke_vji, + "invoke_vjiiiii": invoke_vjiiiii, + "invoke_vjjjiiii": invoke_vjjjiiii, + "llvm_eh_typeid_for": _llvm_eh_typeid_for, + "setTempRet0": _setTempRet0, + "strftime": _strftime +}; +var asm = createWasm(); +/** @type {function(...*):?} */ +var ___wasm_call_ctors = Module["___wasm_call_ctors"] = createExportWrapper("__wasm_call_ctors"); + +/** @type {function(...*):?} */ +var _ReleaseKeys = Module["_ReleaseKeys"] = createExportWrapper("ReleaseKeys"); + +/** @type {function(...*):?} */ +var _getMemInfo = Module["_getMemInfo"] = createExportWrapper("getMemInfo"); + +/** @type {function(...*):?} */ +var _SendMessageFloat = Module["_SendMessageFloat"] = createExportWrapper("SendMessageFloat"); + +/** @type {function(...*):?} */ +var _SendMessageString = Module["_SendMessageString"] = createExportWrapper("SendMessageString"); + +/** @type {function(...*):?} */ +var _SendMessage = Module["_SendMessage"] = createExportWrapper("SendMessage"); + +/** @type {function(...*):?} */ +var _SetFullscreen = Module["_SetFullscreen"] = createExportWrapper("SetFullscreen"); + +/** @type {function(...*):?} */ +var _main = Module["_main"] = createExportWrapper("main"); + +/** @type {function(...*):?} */ +var _InjectProfilerSample = Module["_InjectProfilerSample"] = createExportWrapper("InjectProfilerSample"); + +/** @type {function(...*):?} */ +var ___errno_location = Module["___errno_location"] = createExportWrapper("__errno_location"); + +/** @type {function(...*):?} */ +var ___stdio_exit = Module["___stdio_exit"] = createExportWrapper("__stdio_exit"); + +/** @type {function(...*):?} */ +var ___dl_seterr = Module["___dl_seterr"] = createExportWrapper("__dl_seterr"); + +/** @type {function(...*):?} */ +var _htonl = Module["_htonl"] = createExportWrapper("htonl"); + +/** @type {function(...*):?} */ +var _htons = Module["_htons"] = createExportWrapper("htons"); + +/** @type {function(...*):?} */ +var _ntohs = Module["_ntohs"] = createExportWrapper("ntohs"); + +/** @type {function(...*):?} */ +var _strlen = Module["_strlen"] = createExportWrapper("strlen"); + +/** @type {function(...*):?} */ +var _malloc = Module["_malloc"] = createExportWrapper("malloc"); + +/** @type {function(...*):?} */ +var _free = Module["_free"] = createExportWrapper("free"); + +/** @type {function(...*):?} */ +var _emscripten_builtin_memalign = Module["_emscripten_builtin_memalign"] = createExportWrapper("emscripten_builtin_memalign"); + +/** @type {function(...*):?} */ +var _setThrew = Module["_setThrew"] = createExportWrapper("setThrew"); + +/** @type {function(...*):?} */ +var _saveSetjmp = Module["_saveSetjmp"] = createExportWrapper("saveSetjmp"); + +/** @type {function(...*):?} */ +var _emscripten_stack_init = Module["_emscripten_stack_init"] = function() { + return (_emscripten_stack_init = Module["_emscripten_stack_init"] = Module["asm"]["emscripten_stack_init"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var _emscripten_stack_get_free = Module["_emscripten_stack_get_free"] = function() { + return (_emscripten_stack_get_free = Module["_emscripten_stack_get_free"] = Module["asm"]["emscripten_stack_get_free"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var _emscripten_stack_get_base = Module["_emscripten_stack_get_base"] = function() { + return (_emscripten_stack_get_base = Module["_emscripten_stack_get_base"] = Module["asm"]["emscripten_stack_get_base"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var _emscripten_stack_get_end = Module["_emscripten_stack_get_end"] = function() { + return (_emscripten_stack_get_end = Module["_emscripten_stack_get_end"] = Module["asm"]["emscripten_stack_get_end"]).apply(null, arguments); +}; + +/** @type {function(...*):?} */ +var stackSave = Module["stackSave"] = createExportWrapper("stackSave"); + +/** @type {function(...*):?} */ +var stackRestore = Module["stackRestore"] = createExportWrapper("stackRestore"); + +/** @type {function(...*):?} */ +var stackAlloc = Module["stackAlloc"] = createExportWrapper("stackAlloc"); + +/** @type {function(...*):?} */ +var ___cxa_demangle = Module["___cxa_demangle"] = createExportWrapper("__cxa_demangle"); + +/** @type {function(...*):?} */ +var ___cxa_can_catch = Module["___cxa_can_catch"] = createExportWrapper("__cxa_can_catch"); + +/** @type {function(...*):?} */ +var ___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = createExportWrapper("__cxa_is_pointer_type"); + +/** @type {function(...*):?} */ +var dynCall_iidiiii = Module["dynCall_iidiiii"] = createExportWrapper("dynCall_iidiiii"); + +/** @type {function(...*):?} */ +var dynCall_vii = Module["dynCall_vii"] = createExportWrapper("dynCall_vii"); + +/** @type {function(...*):?} */ +var dynCall_iiii = Module["dynCall_iiii"] = createExportWrapper("dynCall_iiii"); + +/** @type {function(...*):?} */ +var dynCall_v = Module["dynCall_v"] = createExportWrapper("dynCall_v"); + +/** @type {function(...*):?} */ +var dynCall_vi = Module["dynCall_vi"] = createExportWrapper("dynCall_vi"); + +/** @type {function(...*):?} */ +var dynCall_viii = Module["dynCall_viii"] = createExportWrapper("dynCall_viii"); + +/** @type {function(...*):?} */ +var dynCall_jiji = Module["dynCall_jiji"] = createExportWrapper("dynCall_jiji"); + +/** @type {function(...*):?} */ +var dynCall_ii = Module["dynCall_ii"] = createExportWrapper("dynCall_ii"); + +/** @type {function(...*):?} */ +var dynCall_iiiii = Module["dynCall_iiiii"] = createExportWrapper("dynCall_iiiii"); + +/** @type {function(...*):?} */ +var dynCall_iii = Module["dynCall_iii"] = createExportWrapper("dynCall_iii"); + +/** @type {function(...*):?} */ +var dynCall_viiii = Module["dynCall_viiii"] = createExportWrapper("dynCall_viiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiii = Module["dynCall_viiiiii"] = createExportWrapper("dynCall_viiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiii = Module["dynCall_viiiii"] = createExportWrapper("dynCall_viiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiii = Module["dynCall_iiiiii"] = createExportWrapper("dynCall_iiiiii"); + +/** @type {function(...*):?} */ +var dynCall_i = Module["dynCall_i"] = createExportWrapper("dynCall_i"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = createExportWrapper("dynCall_iiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiijiii = Module["dynCall_iiijiii"] = createExportWrapper("dynCall_iiijiii"); + +/** @type {function(...*):?} */ +var dynCall_iij = Module["dynCall_iij"] = createExportWrapper("dynCall_iij"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = createExportWrapper("dynCall_iiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_jii = Module["dynCall_jii"] = createExportWrapper("dynCall_jii"); + +/** @type {function(...*):?} */ +var dynCall_iiiijii = Module["dynCall_iiiijii"] = createExportWrapper("dynCall_iiiijii"); + +/** @type {function(...*):?} */ +var dynCall_iiiidii = Module["dynCall_iiiidii"] = createExportWrapper("dynCall_iiiidii"); + +/** @type {function(...*):?} */ +var dynCall_vidi = Module["dynCall_vidi"] = createExportWrapper("dynCall_vidi"); + +/** @type {function(...*):?} */ +var dynCall_viidi = Module["dynCall_viidi"] = createExportWrapper("dynCall_viidi"); + +/** @type {function(...*):?} */ +var dynCall_viji = Module["dynCall_viji"] = createExportWrapper("dynCall_viji"); + +/** @type {function(...*):?} */ +var dynCall_viiji = Module["dynCall_viiji"] = createExportWrapper("dynCall_viiji"); + +/** @type {function(...*):?} */ +var dynCall_iiijii = Module["dynCall_iiijii"] = createExportWrapper("dynCall_iiijii"); + +/** @type {function(...*):?} */ +var dynCall_iiiifii = Module["dynCall_iiiifii"] = createExportWrapper("dynCall_iiiifii"); + +/** @type {function(...*):?} */ +var dynCall_vifi = Module["dynCall_vifi"] = createExportWrapper("dynCall_vifi"); + +/** @type {function(...*):?} */ +var dynCall_viifi = Module["dynCall_viifi"] = createExportWrapper("dynCall_viifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiifi = Module["dynCall_iiiifi"] = createExportWrapper("dynCall_iiiifi"); + +/** @type {function(...*):?} */ +var dynCall_viiiidi = Module["dynCall_viiiidi"] = createExportWrapper("dynCall_viiiidi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fiii = Module["dynCall_fiii"] = createExportWrapper("dynCall_fiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiidii = Module["dynCall_iiiiiiidii"] = createExportWrapper("dynCall_iiiiiiidii"); + +/** @type {function(...*):?} */ +var dynCall_dii = Module["dynCall_dii"] = createExportWrapper("dynCall_dii"); + +/** @type {function(...*):?} */ +var dynCall_ji = Module["dynCall_ji"] = createExportWrapper("dynCall_ji"); + +/** @type {function(...*):?} */ +var dynCall_viiffi = Module["dynCall_viiffi"] = createExportWrapper("dynCall_viiffi"); + +/** @type {function(...*):?} */ +var dynCall_iiifii = Module["dynCall_iiifii"] = createExportWrapper("dynCall_iiifii"); + +/** @type {function(...*):?} */ +var dynCall_viiiji = Module["dynCall_viiiji"] = createExportWrapper("dynCall_viiiji"); + +/** @type {function(...*):?} */ +var dynCall_iifi = Module["dynCall_iifi"] = createExportWrapper("dynCall_iifi"); + +/** @type {function(...*):?} */ +var dynCall_j = Module["dynCall_j"] = createExportWrapper("dynCall_j"); + +/** @type {function(...*):?} */ +var dynCall_viiiijiiji = Module["dynCall_viiiijiiji"] = createExportWrapper("dynCall_viiiijiiji"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiii = Module["dynCall_viiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = createExportWrapper("dynCall_viiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_jjji = Module["dynCall_jjji"] = createExportWrapper("dynCall_jjji"); + +/** @type {function(...*):?} */ +var dynCall_jji = Module["dynCall_jji"] = createExportWrapper("dynCall_jji"); + +/** @type {function(...*):?} */ +var dynCall_jiijiii = Module["dynCall_jiijiii"] = createExportWrapper("dynCall_jiijiii"); + +/** @type {function(...*):?} */ +var dynCall_jiiii = Module["dynCall_jiiii"] = createExportWrapper("dynCall_jiiii"); + +/** @type {function(...*):?} */ +var dynCall_vijjjii = Module["dynCall_vijjjii"] = createExportWrapper("dynCall_vijjjii"); + +/** @type {function(...*):?} */ +var dynCall_viiiijii = Module["dynCall_viiiijii"] = createExportWrapper("dynCall_viiiijii"); + +/** @type {function(...*):?} */ +var dynCall_fii = Module["dynCall_fii"] = createExportWrapper("dynCall_fii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = createExportWrapper("dynCall_viiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiji = Module["dynCall_iiiiji"] = createExportWrapper("dynCall_iiiiji"); + +/** @type {function(...*):?} */ +var dynCall_ijji = Module["dynCall_ijji"] = createExportWrapper("dynCall_ijji"); + +/** @type {function(...*):?} */ +var dynCall_jdi = Module["dynCall_jdi"] = createExportWrapper("dynCall_jdi"); + +/** @type {function(...*):?} */ +var dynCall_iijiii = Module["dynCall_iijiii"] = createExportWrapper("dynCall_iijiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiij = Module["dynCall_iiiiij"] = createExportWrapper("dynCall_iiiiij"); + +/** @type {function(...*):?} */ +var dynCall_vijjji = Module["dynCall_vijjji"] = createExportWrapper("dynCall_vijjji"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiii = Module["dynCall_iiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viijiiijiiii = Module["dynCall_viijiiijiiii"] = createExportWrapper("dynCall_viijiiijiiii"); + +/** @type {function(...*):?} */ +var dynCall_diii = Module["dynCall_diii"] = createExportWrapper("dynCall_diii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiji = Module["dynCall_iiiiiiiiiji"] = createExportWrapper("dynCall_iiiiiiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_vji = Module["dynCall_vji"] = createExportWrapper("dynCall_vji"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viifffffi = Module["dynCall_viifffffi"] = createExportWrapper("dynCall_viifffffi"); + +/** @type {function(...*):?} */ +var dynCall_fifi = Module["dynCall_fifi"] = createExportWrapper("dynCall_fifi"); + +/** @type {function(...*):?} */ +var dynCall_fiiiii = Module["dynCall_fiiiii"] = createExportWrapper("dynCall_fiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiifffiii = Module["dynCall_viiiiifffiii"] = createExportWrapper("dynCall_viiiiifffiii"); + +/** @type {function(...*):?} */ +var dynCall_fffi = Module["dynCall_fffi"] = createExportWrapper("dynCall_fffi"); + +/** @type {function(...*):?} */ +var dynCall_iiji = Module["dynCall_iiji"] = createExportWrapper("dynCall_iiji"); + +/** @type {function(...*):?} */ +var dynCall_vijii = Module["dynCall_vijii"] = createExportWrapper("dynCall_vijii"); + +/** @type {function(...*):?} */ +var dynCall_jiii = Module["dynCall_jiii"] = createExportWrapper("dynCall_jiii"); + +/** @type {function(...*):?} */ +var dynCall_iidi = Module["dynCall_iidi"] = createExportWrapper("dynCall_iidi"); + +/** @type {function(...*):?} */ +var dynCall_viiiifii = Module["dynCall_viiiifii"] = createExportWrapper("dynCall_viiiifii"); + +/** @type {function(...*):?} */ +var dynCall_viiiifi = Module["dynCall_viiiifi"] = createExportWrapper("dynCall_viiiifi"); + +/** @type {function(...*):?} */ +var dynCall_viijii = Module["dynCall_viijii"] = createExportWrapper("dynCall_viijii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifii = Module["dynCall_iiiiiifii"] = createExportWrapper("dynCall_iiiiiifii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiifiii = Module["dynCall_iiiiiiiifiii"] = createExportWrapper("dynCall_iiiiiiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiifi = Module["dynCall_viiiiifi"] = createExportWrapper("dynCall_viiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifiiiii = Module["dynCall_iiiiifiiiii"] = createExportWrapper("dynCall_iiiiifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_dddi = Module["dynCall_dddi"] = createExportWrapper("dynCall_dddi"); + +/** @type {function(...*):?} */ +var dynCall_viffi = Module["dynCall_viffi"] = createExportWrapper("dynCall_viffi"); + +/** @type {function(...*):?} */ +var dynCall_viiifi = Module["dynCall_viiifi"] = createExportWrapper("dynCall_viiifi"); + +/** @type {function(...*):?} */ +var dynCall_ffi = Module["dynCall_ffi"] = createExportWrapper("dynCall_ffi"); + +/** @type {function(...*):?} */ +var dynCall_fi = Module["dynCall_fi"] = createExportWrapper("dynCall_fi"); + +/** @type {function(...*):?} */ +var dynCall_ifi = Module["dynCall_ifi"] = createExportWrapper("dynCall_ifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiifii = Module["dynCall_iiiiiiifii"] = createExportWrapper("dynCall_iiiiiiifii"); + +/** @type {function(...*):?} */ +var dynCall_viifiiiiii = Module["dynCall_viifiiiiii"] = createExportWrapper("dynCall_viifiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iifii = Module["dynCall_iifii"] = createExportWrapper("dynCall_iifii"); + +/** @type {function(...*):?} */ +var dynCall_vfi = Module["dynCall_vfi"] = createExportWrapper("dynCall_vfi"); + +/** @type {function(...*):?} */ +var dynCall_fiiii = Module["dynCall_fiiii"] = createExportWrapper("dynCall_fiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiffi = Module["dynCall_viiiiiffi"] = createExportWrapper("dynCall_viiiiiffi"); + +/** @type {function(...*):?} */ +var dynCall_viifii = Module["dynCall_viifii"] = createExportWrapper("dynCall_viifii"); + +/** @type {function(...*):?} */ +var dynCall_vifffi = Module["dynCall_vifffi"] = createExportWrapper("dynCall_vifffi"); + +/** @type {function(...*):?} */ +var dynCall_viiifii = Module["dynCall_viiifii"] = createExportWrapper("dynCall_viiifii"); + +/** @type {function(...*):?} */ +var dynCall_viffffi = Module["dynCall_viffffi"] = createExportWrapper("dynCall_viffffi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiii = Module["dynCall_viiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vijji = Module["dynCall_vijji"] = createExportWrapper("dynCall_vijji"); + +/** @type {function(...*):?} */ +var dynCall_viidiji = Module["dynCall_viidiji"] = createExportWrapper("dynCall_viidiji"); + +/** @type {function(...*):?} */ +var dynCall_viidjii = Module["dynCall_viidjii"] = createExportWrapper("dynCall_viidjii"); + +/** @type {function(...*):?} */ +var dynCall_viiijji = Module["dynCall_viiijji"] = createExportWrapper("dynCall_viiijji"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiii = Module["dynCall_viiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiii = Module["dynCall_iiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fiiffi = Module["dynCall_fiiffi"] = createExportWrapper("dynCall_fiiffi"); + +/** @type {function(...*):?} */ +var dynCall_viiififii = Module["dynCall_viiififii"] = createExportWrapper("dynCall_viiififii"); + +/** @type {function(...*):?} */ +var dynCall_vijiiii = Module["dynCall_vijiiii"] = createExportWrapper("dynCall_vijiiii"); + +/** @type {function(...*):?} */ +var dynCall_dji = Module["dynCall_dji"] = createExportWrapper("dynCall_dji"); + +/** @type {function(...*):?} */ +var dynCall_iijiiii = Module["dynCall_iijiiii"] = createExportWrapper("dynCall_iijiiii"); + +/** @type {function(...*):?} */ +var dynCall_jijiii = Module["dynCall_jijiii"] = createExportWrapper("dynCall_jijiii"); + +/** @type {function(...*):?} */ +var dynCall_iijiiiiii = Module["dynCall_iijiiiiii"] = createExportWrapper("dynCall_iijiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iijjiiiiii = Module["dynCall_iijjiiiiii"] = createExportWrapper("dynCall_iijjiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiijjii = Module["dynCall_iiiijjii"] = createExportWrapper("dynCall_iiiijjii"); + +/** @type {function(...*):?} */ +var dynCall_iijii = Module["dynCall_iijii"] = createExportWrapper("dynCall_iijii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_didi = Module["dynCall_didi"] = createExportWrapper("dynCall_didi"); + +/** @type {function(...*):?} */ +var dynCall_di = Module["dynCall_di"] = createExportWrapper("dynCall_di"); + +/** @type {function(...*):?} */ +var dynCall_vifii = Module["dynCall_vifii"] = createExportWrapper("dynCall_vifii"); + +/** @type {function(...*):?} */ +var dynCall_viiiijjiii = Module["dynCall_viiiijjiii"] = createExportWrapper("dynCall_viiiijjiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiii = Module["dynCall_iiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_diiii = Module["dynCall_diiii"] = createExportWrapper("dynCall_diiii"); + +/** @type {function(...*):?} */ +var dynCall_viidii = Module["dynCall_viidii"] = createExportWrapper("dynCall_viidii"); + +/** @type {function(...*):?} */ +var dynCall_fiifii = Module["dynCall_fiifii"] = createExportWrapper("dynCall_fiifii"); + +/** @type {function(...*):?} */ +var dynCall_iiifi = Module["dynCall_iiifi"] = createExportWrapper("dynCall_iiifi"); + +/** @type {function(...*):?} */ +var dynCall_iiidi = Module["dynCall_iiidi"] = createExportWrapper("dynCall_iiidi"); + +/** @type {function(...*):?} */ +var dynCall_iiiji = Module["dynCall_iiiji"] = createExportWrapper("dynCall_iiiji"); + +/** @type {function(...*):?} */ +var dynCall_iidii = Module["dynCall_iidii"] = createExportWrapper("dynCall_iidii"); + +/** @type {function(...*):?} */ +var dynCall_iiddi = Module["dynCall_iiddi"] = createExportWrapper("dynCall_iiddi"); + +/** @type {function(...*):?} */ +var dynCall_iidji = Module["dynCall_iidji"] = createExportWrapper("dynCall_iidji"); + +/** @type {function(...*):?} */ +var dynCall_iidfi = Module["dynCall_iidfi"] = createExportWrapper("dynCall_iidfi"); + +/** @type {function(...*):?} */ +var dynCall_iijdi = Module["dynCall_iijdi"] = createExportWrapper("dynCall_iijdi"); + +/** @type {function(...*):?} */ +var dynCall_iijji = Module["dynCall_iijji"] = createExportWrapper("dynCall_iijji"); + +/** @type {function(...*):?} */ +var dynCall_iijfi = Module["dynCall_iijfi"] = createExportWrapper("dynCall_iijfi"); + +/** @type {function(...*):?} */ +var dynCall_diidi = Module["dynCall_diidi"] = createExportWrapper("dynCall_diidi"); + +/** @type {function(...*):?} */ +var dynCall_jiiji = Module["dynCall_jiiji"] = createExportWrapper("dynCall_jiiji"); + +/** @type {function(...*):?} */ +var dynCall_fiifi = Module["dynCall_fiifi"] = createExportWrapper("dynCall_fiifi"); + +/** @type {function(...*):?} */ +var dynCall_iifdi = Module["dynCall_iifdi"] = createExportWrapper("dynCall_iifdi"); + +/** @type {function(...*):?} */ +var dynCall_iifji = Module["dynCall_iifji"] = createExportWrapper("dynCall_iifji"); + +/** @type {function(...*):?} */ +var dynCall_iiffi = Module["dynCall_iiffi"] = createExportWrapper("dynCall_iiffi"); + +/** @type {function(...*):?} */ +var dynCall_fiffi = Module["dynCall_fiffi"] = createExportWrapper("dynCall_fiffi"); + +/** @type {function(...*):?} */ +var dynCall_iiidii = Module["dynCall_iiidii"] = createExportWrapper("dynCall_iiidii"); + +/** @type {function(...*):?} */ +var dynCall_iji = Module["dynCall_iji"] = createExportWrapper("dynCall_iji"); + +/** @type {function(...*):?} */ +var dynCall_ddiii = Module["dynCall_ddiii"] = createExportWrapper("dynCall_ddiii"); + +/** @type {function(...*):?} */ +var dynCall_jiiijii = Module["dynCall_jiiijii"] = createExportWrapper("dynCall_jiiijii"); + +/** @type {function(...*):?} */ +var dynCall_viiijiii = Module["dynCall_viiijiii"] = createExportWrapper("dynCall_viiijiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiffiiiiii = Module["dynCall_viiiiffiiiiii"] = createExportWrapper("dynCall_viiiiffiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiffiiiiiiiii = Module["dynCall_viiiiffiiiiiiiii"] = createExportWrapper("dynCall_viiiiffiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_jjii = Module["dynCall_jjii"] = createExportWrapper("dynCall_jjii"); + +/** @type {function(...*):?} */ +var dynCall_vijiii = Module["dynCall_vijiii"] = createExportWrapper("dynCall_vijiii"); + +/** @type {function(...*):?} */ +var dynCall_vjjjiiii = Module["dynCall_vjjjiiii"] = createExportWrapper("dynCall_vjjjiiii"); + +/** @type {function(...*):?} */ +var dynCall_vjiiiii = Module["dynCall_vjiiiii"] = createExportWrapper("dynCall_vjiiiii"); + +/** @type {function(...*):?} */ +var dynCall_jijii = Module["dynCall_jijii"] = createExportWrapper("dynCall_jijii"); + +/** @type {function(...*):?} */ +var dynCall_jiiiii = Module["dynCall_jiiiii"] = createExportWrapper("dynCall_jiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffffiiiiiiifi = Module["dynCall_viiiffffiiiiiiifi"] = createExportWrapper("dynCall_viiiffffiiiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifiii = Module["dynCall_iiiiifiii"] = createExportWrapper("dynCall_iiiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiifiii = Module["dynCall_iiiifiifiii"] = createExportWrapper("dynCall_iiiifiifiii"); + +/** @type {function(...*):?} */ +var dynCall_iiifiifiii = Module["dynCall_iiifiifiii"] = createExportWrapper("dynCall_iiifiifiii"); + +/** @type {function(...*):?} */ +var dynCall_iiifiii = Module["dynCall_iiifiii"] = createExportWrapper("dynCall_iiifiii"); + +/** @type {function(...*):?} */ +var dynCall_iifiiii = Module["dynCall_iifiiii"] = createExportWrapper("dynCall_iifiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiffi = Module["dynCall_iiiffi"] = createExportWrapper("dynCall_iiiffi"); + +/** @type {function(...*):?} */ +var dynCall_vfii = Module["dynCall_vfii"] = createExportWrapper("dynCall_vfii"); + +/** @type {function(...*):?} */ +var dynCall_vifiifiii = Module["dynCall_vifiifiii"] = createExportWrapper("dynCall_vifiifiii"); + +/** @type {function(...*):?} */ +var dynCall_vifiii = Module["dynCall_vifiii"] = createExportWrapper("dynCall_vifiii"); + +/** @type {function(...*):?} */ +var dynCall_fifffi = Module["dynCall_fifffi"] = createExportWrapper("dynCall_fifffi"); + +/** @type {function(...*):?} */ +var dynCall_ffii = Module["dynCall_ffii"] = createExportWrapper("dynCall_ffii"); + +/** @type {function(...*):?} */ +var dynCall_fffffi = Module["dynCall_fffffi"] = createExportWrapper("dynCall_fffffi"); + +/** @type {function(...*):?} */ +var dynCall_ffffi = Module["dynCall_ffffi"] = createExportWrapper("dynCall_ffffi"); + +/** @type {function(...*):?} */ +var dynCall_viffiiiiii = Module["dynCall_viffiiiiii"] = createExportWrapper("dynCall_viffiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fffii = Module["dynCall_fffii"] = createExportWrapper("dynCall_fffii"); + +/** @type {function(...*):?} */ +var dynCall_viiifiii = Module["dynCall_viiifiii"] = createExportWrapper("dynCall_viiifiii"); + +/** @type {function(...*):?} */ +var dynCall_iifiii = Module["dynCall_iifiii"] = createExportWrapper("dynCall_iifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffffi = Module["dynCall_viiffffi"] = createExportWrapper("dynCall_viiffffi"); + +/** @type {function(...*):?} */ +var dynCall_viifffi = Module["dynCall_viifffi"] = createExportWrapper("dynCall_viifffi"); + +/** @type {function(...*):?} */ +var dynCall_fiiiffi = Module["dynCall_fiiiffi"] = createExportWrapper("dynCall_fiiiffi"); + +/** @type {function(...*):?} */ +var dynCall_fiiifffi = Module["dynCall_fiiifffi"] = createExportWrapper("dynCall_fiiifffi"); + +/** @type {function(...*):?} */ +var dynCall_viffffffiifi = Module["dynCall_viffffffiifi"] = createExportWrapper("dynCall_viffffffiifi"); + +/** @type {function(...*):?} */ +var dynCall_vifffifi = Module["dynCall_vifffifi"] = createExportWrapper("dynCall_vifffifi"); + +/** @type {function(...*):?} */ +var dynCall_viiiifffi = Module["dynCall_viiiifffi"] = createExportWrapper("dynCall_viiiifffi"); + +/** @type {function(...*):?} */ +var dynCall_viffffii = Module["dynCall_viffffii"] = createExportWrapper("dynCall_viffffii"); + +/** @type {function(...*):?} */ +var dynCall_viifiii = Module["dynCall_viifiii"] = createExportWrapper("dynCall_viifiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiffifi = Module["dynCall_iiiiiiffifi"] = createExportWrapper("dynCall_iiiiiiffifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifi = Module["dynCall_iiiiifi"] = createExportWrapper("dynCall_iiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_viffffiiii = Module["dynCall_viffffiiii"] = createExportWrapper("dynCall_viffffiiii"); + +/** @type {function(...*):?} */ +var dynCall_vifffii = Module["dynCall_vifffii"] = createExportWrapper("dynCall_vifffii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiffii = Module["dynCall_iiiiiffii"] = createExportWrapper("dynCall_iiiiiffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiifffii = Module["dynCall_viiiifffii"] = createExportWrapper("dynCall_viiiifffii"); + +/** @type {function(...*):?} */ +var dynCall_vifffffffi = Module["dynCall_vifffffffi"] = createExportWrapper("dynCall_vifffffffi"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiifiiiii = Module["dynCall_iiiifiifiiiii"] = createExportWrapper("dynCall_iiiifiifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiifiifiiiii = Module["dynCall_iiifiifiiiii"] = createExportWrapper("dynCall_iiifiifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viffii = Module["dynCall_viffii"] = createExportWrapper("dynCall_viffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffi = Module["dynCall_viiiffi"] = createExportWrapper("dynCall_viiiffi"); + +/** @type {function(...*):?} */ +var dynCall_vifffffi = Module["dynCall_vifffffi"] = createExportWrapper("dynCall_vifffffi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifi = Module["dynCall_iiiiiifi"] = createExportWrapper("dynCall_iiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_viififfi = Module["dynCall_viififfi"] = createExportWrapper("dynCall_viififfi"); + +/** @type {function(...*):?} */ +var dynCall_fiffffi = Module["dynCall_fiffffi"] = createExportWrapper("dynCall_fiffffi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiiiiiffi = Module["dynCall_viiiiiiiiiiiiiiiiffi"] = createExportWrapper("dynCall_viiiiiiiiiiiiiiiiffi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiififi = Module["dynCall_viiiiififi"] = createExportWrapper("dynCall_viiiiififi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiififi = Module["dynCall_viiiiiififi"] = createExportWrapper("dynCall_viiiiiififi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiifi = Module["dynCall_viiiiiifi"] = createExportWrapper("dynCall_viiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_viiiffifii = Module["dynCall_viiiffifii"] = createExportWrapper("dynCall_viiiffifii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiffii = Module["dynCall_viiiiffii"] = createExportWrapper("dynCall_viiiiffii"); + +/** @type {function(...*):?} */ +var dynCall_fiiifi = Module["dynCall_fiiifi"] = createExportWrapper("dynCall_fiiifi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiffi = Module["dynCall_viiiiffi"] = createExportWrapper("dynCall_viiiiffi"); + +/** @type {function(...*):?} */ +var dynCall_viffiiiii = Module["dynCall_viffiiiii"] = createExportWrapper("dynCall_viffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fiffii = Module["dynCall_fiffii"] = createExportWrapper("dynCall_fiffii"); + +/** @type {function(...*):?} */ +var dynCall_viiifffi = Module["dynCall_viiifffi"] = createExportWrapper("dynCall_viiifffi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiifi = Module["dynCall_iiiiiiiiifi"] = createExportWrapper("dynCall_iiiiiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_vifffifiii = Module["dynCall_vifffifiii"] = createExportWrapper("dynCall_vifffifiii"); + +/** @type {function(...*):?} */ +var dynCall_viifffiii = Module["dynCall_viifffiii"] = createExportWrapper("dynCall_viifffiii"); + +/** @type {function(...*):?} */ +var dynCall_viifffiiiii = Module["dynCall_viifffiiiii"] = createExportWrapper("dynCall_viifffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiifiifii = Module["dynCall_viiifiifii"] = createExportWrapper("dynCall_viiifiifii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffffiiii = Module["dynCall_viiiffffiiii"] = createExportWrapper("dynCall_viiiffffiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiifffii = Module["dynCall_viiiiiiifffii"] = createExportWrapper("dynCall_viiiiiiifffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffffii = Module["dynCall_viiiffffii"] = createExportWrapper("dynCall_viiiffffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiifffii = Module["dynCall_viiiiifffii"] = createExportWrapper("dynCall_viiiiifffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiififiii = Module["dynCall_viiiififiii"] = createExportWrapper("dynCall_viiiififiii"); + +/** @type {function(...*):?} */ +var dynCall_viiijii = Module["dynCall_viiijii"] = createExportWrapper("dynCall_viiijii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiijiii = Module["dynCall_iiiiiiiiiiiijiii"] = createExportWrapper("dynCall_iiiiiiiiiiiijiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiijjiiiiiiiiiiiiii = Module["dynCall_viiiiiijjiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiijjiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiijjiiiii = Module["dynCall_viiiiiijjiiiii"] = createExportWrapper("dynCall_viiiiiijjiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffiiii = Module["dynCall_viiiffiiii"] = createExportWrapper("dynCall_viiiffiiii"); + +/** @type {function(...*):?} */ +var dynCall_vififi = Module["dynCall_vififi"] = createExportWrapper("dynCall_vififi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiifii = Module["dynCall_viiiiifii"] = createExportWrapper("dynCall_viiiiifii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiifii = Module["dynCall_viiiiiifii"] = createExportWrapper("dynCall_viiiiiifii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiffii = Module["dynCall_viiiiiffii"] = createExportWrapper("dynCall_viiiiiffii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifiiii = Module["dynCall_iiiiifiiii"] = createExportWrapper("dynCall_iiiiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_viifiiii = Module["dynCall_viifiiii"] = createExportWrapper("dynCall_viifiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiffi = Module["dynCall_iiiiiffi"] = createExportWrapper("dynCall_iiiiiffi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiifiii = Module["dynCall_viiiiiiifiii"] = createExportWrapper("dynCall_viiiiiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_fiiifii = Module["dynCall_fiiifii"] = createExportWrapper("dynCall_fiiifii"); + +/** @type {function(...*):?} */ +var dynCall_fifii = Module["dynCall_fifii"] = createExportWrapper("dynCall_fifii"); + +/** @type {function(...*):?} */ +var dynCall_iiiffii = Module["dynCall_iiiffii"] = createExportWrapper("dynCall_iiiffii"); + +/** @type {function(...*):?} */ +var dynCall_fifiii = Module["dynCall_fifiii"] = createExportWrapper("dynCall_fifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiifffi = Module["dynCall_viiiiifffi"] = createExportWrapper("dynCall_viiiiifffi"); + +/** @type {function(...*):?} */ +var dynCall_fifiiiii = Module["dynCall_fifiiiii"] = createExportWrapper("dynCall_fifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiifiiii = Module["dynCall_iiifiiii"] = createExportWrapper("dynCall_iiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_vifiiiii = Module["dynCall_vifiiiii"] = createExportWrapper("dynCall_vifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viffiifffiii = Module["dynCall_viffiifffiii"] = createExportWrapper("dynCall_viffiifffiii"); + +/** @type {function(...*):?} */ +var dynCall_ffffffi = Module["dynCall_ffffffi"] = createExportWrapper("dynCall_ffffffi"); + +/** @type {function(...*):?} */ +var dynCall_fiiiiii = Module["dynCall_fiiiiii"] = createExportWrapper("dynCall_fiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iifiifiii = Module["dynCall_iifiifiii"] = createExportWrapper("dynCall_iifiifiii"); + +/** @type {function(...*):?} */ +var dynCall_viddi = Module["dynCall_viddi"] = createExportWrapper("dynCall_viddi"); + +/** @type {function(...*):?} */ +var dynCall_vijjjji = Module["dynCall_vijjjji"] = createExportWrapper("dynCall_vijjjji"); + +/** @type {function(...*):?} */ +var dynCall_idi = Module["dynCall_idi"] = createExportWrapper("dynCall_idi"); + +/** @type {function(...*):?} */ +var dynCall_iijjjji = Module["dynCall_iijjjji"] = createExportWrapper("dynCall_iijjjji"); + +/** @type {function(...*):?} */ +var dynCall_iijjjjiii = Module["dynCall_iijjjjiii"] = createExportWrapper("dynCall_iijjjjiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiidi = Module["dynCall_iiiidi"] = createExportWrapper("dynCall_iiiidi"); + +/** @type {function(...*):?} */ +var dynCall_viiidi = Module["dynCall_viiidi"] = createExportWrapper("dynCall_viiidi"); + +/** @type {function(...*):?} */ +var dynCall_viijjji = Module["dynCall_viijjji"] = createExportWrapper("dynCall_viijjji"); + +/** @type {function(...*):?} */ +var dynCall_viiiiji = Module["dynCall_viiiiji"] = createExportWrapper("dynCall_viiiiji"); + +/** @type {function(...*):?} */ +var dynCall_viijji = Module["dynCall_viijji"] = createExportWrapper("dynCall_viijji"); + +/** @type {function(...*):?} */ +var dynCall_ijiiii = Module["dynCall_ijiiii"] = createExportWrapper("dynCall_ijiiii"); + +/** @type {function(...*):?} */ +var dynCall_vjiiii = Module["dynCall_vjiiii"] = createExportWrapper("dynCall_vjiiii"); + +/** @type {function(...*):?} */ +var dynCall_viijjjji = Module["dynCall_viijjjji"] = createExportWrapper("dynCall_viijjjji"); + +/** @type {function(...*):?} */ +var dynCall_viiiijiii = Module["dynCall_viiiijiii"] = createExportWrapper("dynCall_viiiijiii"); + +/** @type {function(...*):?} */ +var dynCall_viddddi = Module["dynCall_viddddi"] = createExportWrapper("dynCall_viddddi"); + +/** @type {function(...*):?} */ +var dynCall_viddddddddddddi = Module["dynCall_viddddddddddddi"] = createExportWrapper("dynCall_viddddddddddddi"); + +/** @type {function(...*):?} */ +var dynCall_vidddi = Module["dynCall_vidddi"] = createExportWrapper("dynCall_vidddi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiififi = Module["dynCall_viiiiiiiiiififi"] = createExportWrapper("dynCall_viiiiiiiiiififi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiffi = Module["dynCall_viiiiiiffi"] = createExportWrapper("dynCall_viiiiiiffi"); + +/** @type {function(...*):?} */ +var dynCall_viffifii = Module["dynCall_viffifii"] = createExportWrapper("dynCall_viffifii"); + +/** @type {function(...*):?} */ +var dynCall_viiffii = Module["dynCall_viiffii"] = createExportWrapper("dynCall_viiffii"); + +/** @type {function(...*):?} */ +var dynCall_viiffffffi = Module["dynCall_viiffffffi"] = createExportWrapper("dynCall_viiffffffi"); + +/** @type {function(...*):?} */ +var dynCall_iiiifffiii = Module["dynCall_iiiifffiii"] = createExportWrapper("dynCall_iiiifffiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffiii = Module["dynCall_viiiffiii"] = createExportWrapper("dynCall_viiiffiii"); + +/** @type {function(...*):?} */ +var dynCall_fiifiii = Module["dynCall_fiifiii"] = createExportWrapper("dynCall_fiifiii"); + +/** @type {function(...*):?} */ +var dynCall_fiifiiii = Module["dynCall_fiifiiii"] = createExportWrapper("dynCall_fiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiifiii = Module["dynCall_iiiiiiifiii"] = createExportWrapper("dynCall_iiiiiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiiii = Module["dynCall_iiiifiiii"] = createExportWrapper("dynCall_iiiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifiii = Module["dynCall_iiiiiifiii"] = createExportWrapper("dynCall_iiiiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiifiiii = Module["dynCall_iiiiiiifiiii"] = createExportWrapper("dynCall_iiiiiiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiifififi = Module["dynCall_viiifififi"] = createExportWrapper("dynCall_viiifififi"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiiiiiiiiiiii = Module["dynCall_iiiifiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiifiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiifiiiiii = Module["dynCall_viiifiiiiii"] = createExportWrapper("dynCall_viiifiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiii = Module["dynCall_iiiifiii"] = createExportWrapper("dynCall_iiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiifiii = Module["dynCall_viiiiiifiii"] = createExportWrapper("dynCall_viiiiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffiiifffiiii = Module["dynCall_viiffiiifffiiii"] = createExportWrapper("dynCall_viiffiiifffiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffiii = Module["dynCall_viiffiii"] = createExportWrapper("dynCall_viiffiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffii = Module["dynCall_viiiffii"] = createExportWrapper("dynCall_viiiffii"); + +/** @type {function(...*):?} */ +var dynCall_iiifffi = Module["dynCall_iiifffi"] = createExportWrapper("dynCall_iiifffi"); + +/** @type {function(...*):?} */ +var dynCall_vifffiii = Module["dynCall_vifffiii"] = createExportWrapper("dynCall_vifffiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifffiiffii = Module["dynCall_iiiiiifffiiffii"] = createExportWrapper("dynCall_iiiiiifffiiffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiifffiffii = Module["dynCall_viiiifffiffii"] = createExportWrapper("dynCall_viiiifffiffii"); + +/** @type {function(...*):?} */ +var dynCall_vifiiffffi = Module["dynCall_vifiiffffi"] = createExportWrapper("dynCall_vifiiffffi"); + +/** @type {function(...*):?} */ +var dynCall_viiiifiii = Module["dynCall_viiiifiii"] = createExportWrapper("dynCall_viiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiifiiiiiiiiiiiii = Module["dynCall_viiiiiiiiifiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiifiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iifffi = Module["dynCall_iifffi"] = createExportWrapper("dynCall_iifffi"); + +/** @type {function(...*):?} */ +var dynCall_viiifiiii = Module["dynCall_viiifiiii"] = createExportWrapper("dynCall_viiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiifiiii = Module["dynCall_iiiifiifiiii"] = createExportWrapper("dynCall_iiiifiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifii = Module["dynCall_iiiiifii"] = createExportWrapper("dynCall_iiiiifii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifffiiiii = Module["dynCall_iiiiifffiiiii"] = createExportWrapper("dynCall_iiiiifffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiffffiiiii = Module["dynCall_iiiiiffffiiiii"] = createExportWrapper("dynCall_iiiiiffffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifffffiiiii = Module["dynCall_iiiiifffffiiiii"] = createExportWrapper("dynCall_iiiiifffffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fiiiiiiiii = Module["dynCall_fiiiiiiiii"] = createExportWrapper("dynCall_fiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viffffffffffffffffi = Module["dynCall_viffffffffffffffffi"] = createExportWrapper("dynCall_viffffffffffffffffi"); + +/** @type {function(...*):?} */ +var dynCall_viiiidii = Module["dynCall_viiiidii"] = createExportWrapper("dynCall_viiiidii"); + +/** @type {function(...*):?} */ +var dynCall_ijiii = Module["dynCall_ijiii"] = createExportWrapper("dynCall_ijiii"); + +/** @type {function(...*):?} */ +var dynCall_ifiiii = Module["dynCall_ifiiii"] = createExportWrapper("dynCall_ifiiii"); + +/** @type {function(...*):?} */ +var dynCall_idiiiii = Module["dynCall_idiiiii"] = createExportWrapper("dynCall_idiiiii"); + +/** @type {function(...*):?} */ +var dynCall_idiiii = Module["dynCall_idiiii"] = createExportWrapper("dynCall_idiiii"); + +/** @type {function(...*):?} */ +var dynCall_idii = Module["dynCall_idii"] = createExportWrapper("dynCall_idii"); + +/** @type {function(...*):?} */ +var dynCall_ijii = Module["dynCall_ijii"] = createExportWrapper("dynCall_ijii"); + +/** @type {function(...*):?} */ +var dynCall_iiijiiii = Module["dynCall_iiijiiii"] = createExportWrapper("dynCall_iiijiiii"); + +/** @type {function(...*):?} */ +var dynCall_iddi = Module["dynCall_iddi"] = createExportWrapper("dynCall_iddi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiffii = Module["dynCall_iiiiffii"] = createExportWrapper("dynCall_iiiiffii"); + +/** @type {function(...*):?} */ +var dynCall_iffii = Module["dynCall_iffii"] = createExportWrapper("dynCall_iffii"); + +/** @type {function(...*):?} */ +var dynCall_iffiii = Module["dynCall_iffiii"] = createExportWrapper("dynCall_iffiii"); + +/** @type {function(...*):?} */ +var dynCall_ifffi = Module["dynCall_ifffi"] = createExportWrapper("dynCall_ifffi"); + +/** @type {function(...*):?} */ +var dynCall_ifffiii = Module["dynCall_ifffiii"] = createExportWrapper("dynCall_ifffiii"); + +/** @type {function(...*):?} */ +var dynCall_ififfffi = Module["dynCall_ififfffi"] = createExportWrapper("dynCall_ififfffi"); + +/** @type {function(...*):?} */ +var dynCall_ifiii = Module["dynCall_ifiii"] = createExportWrapper("dynCall_ifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiifiifii = Module["dynCall_viiiiiifiifii"] = createExportWrapper("dynCall_viiiiiifiifii"); + +/** @type {function(...*):?} */ +var dynCall_viiififi = Module["dynCall_viiififi"] = createExportWrapper("dynCall_viiififi"); + +/** @type {function(...*):?} */ +var dynCall_viifffiiii = Module["dynCall_viifffiiii"] = createExportWrapper("dynCall_viifffiiii"); + +/** @type {function(...*):?} */ +var dynCall_viifffiiiiiiii = Module["dynCall_viifffiiiiiiii"] = createExportWrapper("dynCall_viifffiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiifi = Module["dynCall_viiiiiiiiifi"] = createExportWrapper("dynCall_viiiiiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiifii = Module["dynCall_iiiiiiiifii"] = createExportWrapper("dynCall_iiiiiiiifii"); + +/** @type {function(...*):?} */ +var dynCall_iififi = Module["dynCall_iififi"] = createExportWrapper("dynCall_iififi"); + +/** @type {function(...*):?} */ +var dynCall_viiiffffiiiiiiii = Module["dynCall_viiiffffiiiiiiii"] = createExportWrapper("dynCall_viiiffffiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffffiiiiiiffiii = Module["dynCall_viiiffffiiiiiiffiii"] = createExportWrapper("dynCall_viiiffffiiiiiiffiii"); + +/** @type {function(...*):?} */ +var dynCall_viiifffiiiiiiifi = Module["dynCall_viiifffiiiiiiifi"] = createExportWrapper("dynCall_viiifffiiiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiji = Module["dynCall_iiiiiji"] = createExportWrapper("dynCall_iiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_idiii = Module["dynCall_idiii"] = createExportWrapper("dynCall_idiii"); + +/** @type {function(...*):?} */ +var dynCall_vidiii = Module["dynCall_vidiii"] = createExportWrapper("dynCall_vidiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiji = Module["dynCall_viiiiiiiji"] = createExportWrapper("dynCall_viiiiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_iidiii = Module["dynCall_iidiii"] = createExportWrapper("dynCall_iidiii"); + +/** @type {function(...*):?} */ +var dynCall_jidi = Module["dynCall_jidi"] = createExportWrapper("dynCall_jidi"); + +/** @type {function(...*):?} */ +var dynCall_diji = Module["dynCall_diji"] = createExportWrapper("dynCall_diji"); + +/** @type {function(...*):?} */ +var dynCall_fidi = Module["dynCall_fidi"] = createExportWrapper("dynCall_fidi"); + +/** @type {function(...*):?} */ +var dynCall_vidjii = Module["dynCall_vidjii"] = createExportWrapper("dynCall_vidjii"); + +/** @type {function(...*):?} */ +var dynCall_jiiiiii = Module["dynCall_jiiiiii"] = createExportWrapper("dynCall_jiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fffffffi = Module["dynCall_fffffffi"] = createExportWrapper("dynCall_fffffffi"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiifiiiiiii = Module["dynCall_viiiiiiifiiiiiii"] = createExportWrapper("dynCall_viiiiiiifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vifiiiiiiii = Module["dynCall_vifiiiiiiii"] = createExportWrapper("dynCall_vifiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iffiiiifi = Module["dynCall_iffiiiifi"] = createExportWrapper("dynCall_iffiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_viiifiiiiiii = Module["dynCall_viiifiiiiiii"] = createExportWrapper("dynCall_viiifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vifiiiiii = Module["dynCall_vifiiiiii"] = createExportWrapper("dynCall_vifiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiifiiiiiiiiiii = Module["dynCall_viiiifiiiiiiiiiii"] = createExportWrapper("dynCall_viiiifiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiifiiiiiiii = Module["dynCall_viiiifiiiiiiii"] = createExportWrapper("dynCall_viiiifiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viifiiiiiii = Module["dynCall_viifiiiiiii"] = createExportWrapper("dynCall_viifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiifiiii = Module["dynCall_viiiifiiii"] = createExportWrapper("dynCall_viiiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiijiii = Module["dynCall_iiiiijiii"] = createExportWrapper("dynCall_iiiiijiii"); + +/** @type {function(...*):?} */ +var dynCall_diiiii = Module["dynCall_diiiii"] = createExportWrapper("dynCall_diiiii"); + +/** @type {function(...*):?} */ +var dynCall_vijiiiii = Module["dynCall_vijiiiii"] = createExportWrapper("dynCall_vijiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vijiiiiiiiii = Module["dynCall_vijiiiiiiiii"] = createExportWrapper("dynCall_vijiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fijii = Module["dynCall_fijii"] = createExportWrapper("dynCall_fijii"); + +/** @type {function(...*):?} */ +var dynCall_fffffffifi = Module["dynCall_fffffffifi"] = createExportWrapper("dynCall_fffffffifi"); + +/** @type {function(...*):?} */ +var dynCall_fffffffffiffi = Module["dynCall_fffffffffiffi"] = createExportWrapper("dynCall_fffffffffiffi"); + +/** @type {function(...*):?} */ +var dynCall_fififi = Module["dynCall_fififi"] = createExportWrapper("dynCall_fififi"); + +/** @type {function(...*):?} */ +var dynCall_fiji = Module["dynCall_fiji"] = createExportWrapper("dynCall_fiji"); + +/** @type {function(...*):?} */ +var dynCall_fifiiiiii = Module["dynCall_fifiiiiii"] = createExportWrapper("dynCall_fifiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fiiiiiii = Module["dynCall_fiiiiiii"] = createExportWrapper("dynCall_fiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iijiifi = Module["dynCall_iijiifi"] = createExportWrapper("dynCall_iijiifi"); + +/** @type {function(...*):?} */ +var dynCall_fijifi = Module["dynCall_fijifi"] = createExportWrapper("dynCall_fijifi"); + +/** @type {function(...*):?} */ +var dynCall_jiiiiiii = Module["dynCall_jiiiiiii"] = createExportWrapper("dynCall_jiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fdi = Module["dynCall_fdi"] = createExportWrapper("dynCall_fdi"); + +/** @type {function(...*):?} */ +var dynCall_viififi = Module["dynCall_viififi"] = createExportWrapper("dynCall_viififi"); + +/** @type {function(...*):?} */ +var dynCall_vjii = Module["dynCall_vjii"] = createExportWrapper("dynCall_vjii"); + +/** @type {function(...*):?} */ +var dynCall_ijjiii = Module["dynCall_ijjiii"] = createExportWrapper("dynCall_ijjiii"); + +/** @type {function(...*):?} */ +var dynCall_viffffffi = Module["dynCall_viffffffi"] = createExportWrapper("dynCall_viffffffi"); + +/** @type {function(...*):?} */ +var dynCall_iffffi = Module["dynCall_iffffi"] = createExportWrapper("dynCall_iffffi"); + +/** @type {function(...*):?} */ +var dynCall_vfffi = Module["dynCall_vfffi"] = createExportWrapper("dynCall_vfffi"); + +/** @type {function(...*):?} */ +var dynCall_vffi = Module["dynCall_vffi"] = createExportWrapper("dynCall_vffi"); + +/** @type {function(...*):?} */ +var dynCall_vffffi = Module["dynCall_vffffi"] = createExportWrapper("dynCall_vffffi"); + +/** @type {function(...*):?} */ +var dynCall_vffffffii = Module["dynCall_vffffffii"] = createExportWrapper("dynCall_vffffffii"); + +/** @type {function(...*):?} */ +var dynCall_vffffii = Module["dynCall_vffffii"] = createExportWrapper("dynCall_vffffii"); + +/** @type {function(...*):?} */ +var dynCall_vfiii = Module["dynCall_vfiii"] = createExportWrapper("dynCall_vfiii"); + +/** @type {function(...*):?} */ +var dynCall_iffi = Module["dynCall_iffi"] = createExportWrapper("dynCall_iffi"); + +/** @type {function(...*):?} */ +var dynCall_fffifi = Module["dynCall_fffifi"] = createExportWrapper("dynCall_fffifi"); + +/** @type {function(...*):?} */ +var dynCall_fffifffi = Module["dynCall_fffifffi"] = createExportWrapper("dynCall_fffifffi"); + +/** @type {function(...*):?} */ +var dynCall_ddi = Module["dynCall_ddi"] = createExportWrapper("dynCall_ddi"); + +/** @type {function(...*):?} */ +var dynCall_ddddi = Module["dynCall_ddddi"] = createExportWrapper("dynCall_ddddi"); + +/** @type {function(...*):?} */ +var dynCall_jjjji = Module["dynCall_jjjji"] = createExportWrapper("dynCall_jjjji"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiiiiii = Module["dynCall_iiiifiiiiii"] = createExportWrapper("dynCall_iiiifiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiifiiiii = Module["dynCall_iiiifiiiii"] = createExportWrapper("dynCall_iiiifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vijjii = Module["dynCall_vijjii"] = createExportWrapper("dynCall_vijjii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiijijiii = Module["dynCall_viiiiiiiijijiii"] = createExportWrapper("dynCall_viiiiiiiijijiii"); + +/** @type {function(...*):?} */ +var dynCall_vjji = Module["dynCall_vjji"] = createExportWrapper("dynCall_vjji"); + +/** @type {function(...*):?} */ +var dynCall_iiiiffiiiiii = Module["dynCall_iiiiffiiiiii"] = createExportWrapper("dynCall_iiiiffiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viffiii = Module["dynCall_viffiii"] = createExportWrapper("dynCall_viffiii"); + +/** @type {function(...*):?} */ +var dynCall_viffffiii = Module["dynCall_viffffiii"] = createExportWrapper("dynCall_viffffiii"); + +/** @type {function(...*):?} */ +var dynCall_vifiiii = Module["dynCall_vifiiii"] = createExportWrapper("dynCall_vifiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiififfi = Module["dynCall_viiififfi"] = createExportWrapper("dynCall_viiififfi"); + +/** @type {function(...*):?} */ +var dynCall_iifiifii = Module["dynCall_iifiifii"] = createExportWrapper("dynCall_iifiifii"); + +/** @type {function(...*):?} */ +var dynCall_iififiii = Module["dynCall_iififiii"] = createExportWrapper("dynCall_iififiii"); + +/** @type {function(...*):?} */ +var dynCall_iififii = Module["dynCall_iififii"] = createExportWrapper("dynCall_iififii"); + +/** @type {function(...*):?} */ +var dynCall_iiiififiiii = Module["dynCall_iiiififiiii"] = createExportWrapper("dynCall_iiiififiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiififiiii = Module["dynCall_iiififiiii"] = createExportWrapper("dynCall_iiififiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifiiii = Module["dynCall_iiiiiifiiii"] = createExportWrapper("dynCall_iiiiiifiiii"); + +/** @type {function(...*):?} */ +var dynCall_viffiiii = Module["dynCall_viffiiii"] = createExportWrapper("dynCall_viffiiii"); + +/** @type {function(...*):?} */ +var dynCall_viifffffffiiiii = Module["dynCall_viifffffffiiiii"] = createExportWrapper("dynCall_viifffffffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiffiiiiiiiiiffffiiii = Module["dynCall_iiiiiiffiiiiiiiiiffffiiii"] = createExportWrapper("dynCall_iiiiiiffiiiiiiiiiffffiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiffiiiiiiiiiiiiiii = Module["dynCall_iiiiiiffiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiffiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vififiii = Module["dynCall_vififiii"] = createExportWrapper("dynCall_vififiii"); + +/** @type {function(...*):?} */ +var dynCall_viififii = Module["dynCall_viififii"] = createExportWrapper("dynCall_viififii"); + +/** @type {function(...*):?} */ +var dynCall_jijji = Module["dynCall_jijji"] = createExportWrapper("dynCall_jijji"); + +/** @type {function(...*):?} */ +var dynCall_viffifi = Module["dynCall_viffifi"] = createExportWrapper("dynCall_viffifi"); + +/** @type {function(...*):?} */ +var dynCall_viiffifi = Module["dynCall_viiffifi"] = createExportWrapper("dynCall_viiffifi"); + +/** @type {function(...*):?} */ +var dynCall_viiiffiiiiiiiii = Module["dynCall_viiiffiiiiiiiii"] = createExportWrapper("dynCall_viiiffiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffiiiiii = Module["dynCall_viiiffiiiiii"] = createExportWrapper("dynCall_viiiffiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffiiiiiiiiii = Module["dynCall_viiffiiiiiiiiii"] = createExportWrapper("dynCall_viiffiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffiiiiiii = Module["dynCall_viiffiiiiiii"] = createExportWrapper("dynCall_viiffiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiffiiii = Module["dynCall_iiiffiiii"] = createExportWrapper("dynCall_iiiffiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiffiiii = Module["dynCall_iiiiffiiii"] = createExportWrapper("dynCall_iiiiffiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiijiiii = Module["dynCall_viiiiiiiijiiii"] = createExportWrapper("dynCall_viiiiiiiijiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiifiiiiii = Module["dynCall_viiiiiifiiiiii"] = createExportWrapper("dynCall_viiiiiifiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viijjii = Module["dynCall_viijjii"] = createExportWrapper("dynCall_viijjii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiifffii = Module["dynCall_viiiiiifffii"] = createExportWrapper("dynCall_viiiiiifffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiifffii = Module["dynCall_viiiiiiiifffii"] = createExportWrapper("dynCall_viiiiiiiifffii"); + +/** @type {function(...*):?} */ +var dynCall_viiidii = Module["dynCall_viiidii"] = createExportWrapper("dynCall_viiidii"); + +/** @type {function(...*):?} */ +var dynCall_ijiiiiiiiii = Module["dynCall_ijiiiiiiiii"] = createExportWrapper("dynCall_ijiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiijiiiii = Module["dynCall_iiijiiiii"] = createExportWrapper("dynCall_iiijiiiii"); + +/** @type {function(...*):?} */ +var dynCall_ffiii = Module["dynCall_ffiii"] = createExportWrapper("dynCall_ffiii"); + +/** @type {function(...*):?} */ +var dynCall_fffiii = Module["dynCall_fffiii"] = createExportWrapper("dynCall_fffiii"); + +/** @type {function(...*):?} */ +var dynCall_dddiii = Module["dynCall_dddiii"] = createExportWrapper("dynCall_dddiii"); + +/** @type {function(...*):?} */ +var dynCall_jjiii = Module["dynCall_jjiii"] = createExportWrapper("dynCall_jjiii"); + +/** @type {function(...*):?} */ +var dynCall_jddi = Module["dynCall_jddi"] = createExportWrapper("dynCall_jddi"); + +/** @type {function(...*):?} */ +var dynCall_jjjii = Module["dynCall_jjjii"] = createExportWrapper("dynCall_jjjii"); + +/** @type {function(...*):?} */ +var dynCall_ifii = Module["dynCall_ifii"] = createExportWrapper("dynCall_ifii"); + +/** @type {function(...*):?} */ +var dynCall_jdii = Module["dynCall_jdii"] = createExportWrapper("dynCall_jdii"); + +/** @type {function(...*):?} */ +var dynCall_djii = Module["dynCall_djii"] = createExportWrapper("dynCall_djii"); + +/** @type {function(...*):?} */ +var dynCall_jjiiii = Module["dynCall_jjiiii"] = createExportWrapper("dynCall_jjiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiii = Module["dynCall_viiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viffffffffi = Module["dynCall_viffffffffi"] = createExportWrapper("dynCall_viffffffffi"); + +/** @type {function(...*):?} */ +var dynCall_ddii = Module["dynCall_ddii"] = createExportWrapper("dynCall_ddii"); + +/** @type {function(...*):?} */ +var dynCall_jjiji = Module["dynCall_jjiji"] = createExportWrapper("dynCall_jjiji"); + +/** @type {function(...*):?} */ +var dynCall_jjijji = Module["dynCall_jjijji"] = createExportWrapper("dynCall_jjijji"); + +/** @type {function(...*):?} */ +var dynCall_jjijii = Module["dynCall_jjijii"] = createExportWrapper("dynCall_jjijii"); + +/** @type {function(...*):?} */ +var dynCall_vjiii = Module["dynCall_vjiii"] = createExportWrapper("dynCall_vjiii"); + +/** @type {function(...*):?} */ +var dynCall_viifffii = Module["dynCall_viifffii"] = createExportWrapper("dynCall_viifffii"); + +/** @type {function(...*):?} */ +var dynCall_viifiifi = Module["dynCall_viifiifi"] = createExportWrapper("dynCall_viifiifi"); + +/** @type {function(...*):?} */ +var dynCall_iijjijii = Module["dynCall_iijjijii"] = createExportWrapper("dynCall_iijjijii"); + +/** @type {function(...*):?} */ +var dynCall_jiijiji = Module["dynCall_jiijiji"] = createExportWrapper("dynCall_jiijiji"); + +/** @type {function(...*):?} */ +var dynCall_viijijii = Module["dynCall_viijijii"] = createExportWrapper("dynCall_viijijii"); + +/** @type {function(...*):?} */ +var dynCall_jijiji = Module["dynCall_jijiji"] = createExportWrapper("dynCall_jijiji"); + +/** @type {function(...*):?} */ +var dynCall_jiijii = Module["dynCall_jiijii"] = createExportWrapper("dynCall_jiijii"); + +/** @type {function(...*):?} */ +var dynCall_vijijii = Module["dynCall_vijijii"] = createExportWrapper("dynCall_vijijii"); + +/** @type {function(...*):?} */ +var dynCall_viijiii = Module["dynCall_viijiii"] = createExportWrapper("dynCall_viijiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiji = Module["dynCall_viiiiiji"] = createExportWrapper("dynCall_viiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_iiiijiiii = Module["dynCall_iiiijiiii"] = createExportWrapper("dynCall_iiiijiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiijiiiii = Module["dynCall_iiiijiiiii"] = createExportWrapper("dynCall_iiiijiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vidiiiii = Module["dynCall_vidiiiii"] = createExportWrapper("dynCall_vidiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiidjii = Module["dynCall_viiidjii"] = createExportWrapper("dynCall_viiidjii"); + +/** @type {function(...*):?} */ +var dynCall_viijijji = Module["dynCall_viijijji"] = createExportWrapper("dynCall_viijijji"); + +/** @type {function(...*):?} */ +var dynCall_vijijji = Module["dynCall_vijijji"] = createExportWrapper("dynCall_vijijji"); + +/** @type {function(...*):?} */ +var dynCall_vidii = Module["dynCall_vidii"] = createExportWrapper("dynCall_vidii"); + +/** @type {function(...*):?} */ +var dynCall_viddddddi = Module["dynCall_viddddddi"] = createExportWrapper("dynCall_viddddddi"); + +/** @type {function(...*):?} */ +var dynCall_viddddddddi = Module["dynCall_viddddddddi"] = createExportWrapper("dynCall_viddddddddi"); + +/** @type {function(...*):?} */ +var dynCall_vidddddddddi = Module["dynCall_vidddddddddi"] = createExportWrapper("dynCall_vidddddddddi"); + +/** @type {function(...*):?} */ +var dynCall_viddii = Module["dynCall_viddii"] = createExportWrapper("dynCall_viddii"); + +/** @type {function(...*):?} */ +var dynCall_vididi = Module["dynCall_vididi"] = createExportWrapper("dynCall_vididi"); + +/** @type {function(...*):?} */ +var dynCall_viiddi = Module["dynCall_viiddi"] = createExportWrapper("dynCall_viiddi"); + +/** @type {function(...*):?} */ +var dynCall_viddddddddddddddddi = Module["dynCall_viddddddddddddddddi"] = createExportWrapper("dynCall_viddddddddddddddddi"); + +/** @type {function(...*):?} */ +var dynCall_vifffffffffi = Module["dynCall_vifffffffffi"] = createExportWrapper("dynCall_vifffffffffi"); + +/** @type {function(...*):?} */ +var dynCall_viffffffffffffi = Module["dynCall_viffffffffffffi"] = createExportWrapper("dynCall_viffffffffffffi"); + +/** @type {function(...*):?} */ +var dynCall_ddddddi = Module["dynCall_ddddddi"] = createExportWrapper("dynCall_ddddddi"); + +/** @type {function(...*):?} */ +var dynCall_dddii = Module["dynCall_dddii"] = createExportWrapper("dynCall_dddii"); + +/** @type {function(...*):?} */ +var dynCall_vdiii = Module["dynCall_vdiii"] = createExportWrapper("dynCall_vdiii"); + +/** @type {function(...*):?} */ +var dynCall_diddi = Module["dynCall_diddi"] = createExportWrapper("dynCall_diddi"); + +/** @type {function(...*):?} */ +var dynCall_viiffiffiiiiiiiiiiiiiiiiiiii = Module["dynCall_viiffiffiiiiiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiffiffiiiiiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffiffiiiiiiiiiiiiiiiiiiiiiiii = Module["dynCall_viiffiffiiiiiiiiiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_viiffiffiiiiiiiiiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiffiiiii = Module["dynCall_viiiiiffiiiii"] = createExportWrapper("dynCall_viiiiiffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiifiiiiiii = Module["dynCall_iiiiiiiiiiiiiifiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiiiifiiiiiii = Module["dynCall_iiiiiiiiiiiiiiiifiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiiiifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiifiiiiiii = Module["dynCall_iiiiiiiiiiiiifiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiiifiiiiiii = Module["dynCall_iiiiiiiiiiiiiiifiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiiifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiiiiifiiiiiii = Module["dynCall_iiiiiiiiiiiiiiiiifiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiiiiifiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiffffi = Module["dynCall_viiiffffi"] = createExportWrapper("dynCall_viiiffffi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiifi = Module["dynCall_iiiiiiifi"] = createExportWrapper("dynCall_iiiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiifiiiii = Module["dynCall_iiiiiiiifiiiii"] = createExportWrapper("dynCall_iiiiiiiifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vffiii = Module["dynCall_vffiii"] = createExportWrapper("dynCall_vffiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiffiii = Module["dynCall_iiiffiii"] = createExportWrapper("dynCall_iiiffiii"); + +/** @type {function(...*):?} */ +var dynCall_ifiiiifiii = Module["dynCall_ifiiiifiii"] = createExportWrapper("dynCall_ifiiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffffiiiii = Module["dynCall_viiffffiiiii"] = createExportWrapper("dynCall_viiffffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vifiifiifi = Module["dynCall_vifiifiifi"] = createExportWrapper("dynCall_vifiifiifi"); + +/** @type {function(...*):?} */ +var dynCall_vififiiii = Module["dynCall_vififiiii"] = createExportWrapper("dynCall_vififiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiifi = Module["dynCall_viiiiiiifi"] = createExportWrapper("dynCall_viiiiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_iiffiiiiiiiiii = Module["dynCall_iiffiiiiiiiiii"] = createExportWrapper("dynCall_iiffiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiffiii = Module["dynCall_viiiiiiiiiiffiii"] = createExportWrapper("dynCall_viiiiiiiiiiffiii"); + +/** @type {function(...*):?} */ +var dynCall_viifffffffi = Module["dynCall_viifffffffi"] = createExportWrapper("dynCall_viifffffffi"); + +/** @type {function(...*):?} */ +var dynCall_viiffffffffi = Module["dynCall_viiffffffffi"] = createExportWrapper("dynCall_viiffffffffi"); + +/** @type {function(...*):?} */ +var dynCall_viiffffffffiii = Module["dynCall_viiffffffffiii"] = createExportWrapper("dynCall_viiffffffffiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiffffii = Module["dynCall_viiiiffffii"] = createExportWrapper("dynCall_viiiiffffii"); + +/** @type {function(...*):?} */ +var dynCall_ddidi = Module["dynCall_ddidi"] = createExportWrapper("dynCall_ddidi"); + +/** @type {function(...*):?} */ +var dynCall_jfi = Module["dynCall_jfi"] = createExportWrapper("dynCall_jfi"); + +/** @type {function(...*):?} */ +var dynCall_fji = Module["dynCall_fji"] = createExportWrapper("dynCall_fji"); + +/** @type {function(...*):?} */ +var dynCall_viiiiddi = Module["dynCall_viiiiddi"] = createExportWrapper("dynCall_viiiiddi"); + +/** @type {function(...*):?} */ +var dynCall_iiiddi = Module["dynCall_iiiddi"] = createExportWrapper("dynCall_iiiddi"); + +/** @type {function(...*):?} */ +var dynCall_viddiiii = Module["dynCall_viddiiii"] = createExportWrapper("dynCall_viddiiii"); + +/** @type {function(...*):?} */ +var dynCall_vdi = Module["dynCall_vdi"] = createExportWrapper("dynCall_vdi"); + +/** @type {function(...*):?} */ +var dynCall_idddi = Module["dynCall_idddi"] = createExportWrapper("dynCall_idddi"); + +/** @type {function(...*):?} */ +var dynCall_iddii = Module["dynCall_iddii"] = createExportWrapper("dynCall_iddii"); + +/** @type {function(...*):?} */ +var dynCall_vijiiiiiii = Module["dynCall_vijiiiiiii"] = createExportWrapper("dynCall_vijiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vijiiiiiiii = Module["dynCall_vijiiiiiiii"] = createExportWrapper("dynCall_vijiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_jjiiiii = Module["dynCall_jjiiiii"] = createExportWrapper("dynCall_jjiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viijiiiiii = Module["dynCall_viijiiiiii"] = createExportWrapper("dynCall_viijiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_jijjji = Module["dynCall_jijjji"] = createExportWrapper("dynCall_jijjji"); + +/** @type {function(...*):?} */ +var dynCall_jijjjii = Module["dynCall_jijjjii"] = createExportWrapper("dynCall_jijjjii"); + +/** @type {function(...*):?} */ +var dynCall_ijijiiiii = Module["dynCall_ijijiiiii"] = createExportWrapper("dynCall_ijijiiiii"); + +/** @type {function(...*):?} */ +var dynCall_ijjjiii = Module["dynCall_ijjjiii"] = createExportWrapper("dynCall_ijjjiii"); + +/** @type {function(...*):?} */ +var dynCall_vijjjiijii = Module["dynCall_vijjjiijii"] = createExportWrapper("dynCall_vijjjiijii"); + +/** @type {function(...*):?} */ +var dynCall_ijjjiijii = Module["dynCall_ijjjiijii"] = createExportWrapper("dynCall_ijjjiijii"); + +/** @type {function(...*):?} */ +var dynCall_vijiiiiii = Module["dynCall_vijiiiiii"] = createExportWrapper("dynCall_vijiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_dfi = Module["dynCall_dfi"] = createExportWrapper("dynCall_dfi"); + +/** @type {function(...*):?} */ +var dynCall_jidii = Module["dynCall_jidii"] = createExportWrapper("dynCall_jidii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiji = Module["dynCall_viiiiiiiiji"] = createExportWrapper("dynCall_viiiiiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiji = Module["dynCall_viiiiiiiiiji"] = createExportWrapper("dynCall_viiiiiiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_ijiijii = Module["dynCall_ijiijii"] = createExportWrapper("dynCall_ijiijii"); + +/** @type {function(...*):?} */ +var dynCall_vjjiiiii = Module["dynCall_vjjiiiii"] = createExportWrapper("dynCall_vjjiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vjjii = Module["dynCall_vjjii"] = createExportWrapper("dynCall_vjjii"); + +/** @type {function(...*):?} */ +var dynCall_ijiiji = Module["dynCall_ijiiji"] = createExportWrapper("dynCall_ijiiji"); + +/** @type {function(...*):?} */ +var dynCall_ijiiiii = Module["dynCall_ijiiiii"] = createExportWrapper("dynCall_ijiiiii"); + +/** @type {function(...*):?} */ +var dynCall_ijiiiiji = Module["dynCall_ijiiiiji"] = createExportWrapper("dynCall_ijiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_ifiiiii = Module["dynCall_ifiiiii"] = createExportWrapper("dynCall_ifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iijjji = Module["dynCall_iijjji"] = createExportWrapper("dynCall_iijjji"); + +/** @type {function(...*):?} */ +var dynCall_vdii = Module["dynCall_vdii"] = createExportWrapper("dynCall_vdii"); + +/** @type {function(...*):?} */ +var dynCall_iijjii = Module["dynCall_iijjii"] = createExportWrapper("dynCall_iijjii"); + +/** @type {function(...*):?} */ +var dynCall_viijijiii = Module["dynCall_viijijiii"] = createExportWrapper("dynCall_viijijiii"); + +/** @type {function(...*):?} */ +var dynCall_vijiji = Module["dynCall_vijiji"] = createExportWrapper("dynCall_vijiji"); + +/** @type {function(...*):?} */ +var dynCall_viijiijiii = Module["dynCall_viijiijiii"] = createExportWrapper("dynCall_viijiijiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiijiiii = Module["dynCall_viiiijiiii"] = createExportWrapper("dynCall_viiiijiiii"); + +/** @type {function(...*):?} */ +var dynCall_jiiiiiiiii = Module["dynCall_jiiiiiiiii"] = createExportWrapper("dynCall_jiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_jiiiiiiiiii = Module["dynCall_jiiiiiiiiii"] = createExportWrapper("dynCall_jiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiijii = Module["dynCall_iiiiijii"] = createExportWrapper("dynCall_iiiiijii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiidii = Module["dynCall_iiiiidii"] = createExportWrapper("dynCall_iiiiidii"); + +/** @type {function(...*):?} */ +var dynCall_iiidiii = Module["dynCall_iiidiii"] = createExportWrapper("dynCall_iiidiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiffiiiji = Module["dynCall_iiiiffiiiji"] = createExportWrapper("dynCall_iiiiffiiiji"); + +/** @type {function(...*):?} */ +var dynCall_vjjiii = Module["dynCall_vjjiii"] = createExportWrapper("dynCall_vjjiii"); + +/** @type {function(...*):?} */ +var dynCall_viijiiii = Module["dynCall_viijiiii"] = createExportWrapper("dynCall_viijiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiffiiiii = Module["dynCall_iiiiffiiiii"] = createExportWrapper("dynCall_iiiiffiiiii"); + +/** @type {function(...*):?} */ +var dynCall_diiiidi = Module["dynCall_diiiidi"] = createExportWrapper("dynCall_diiiidi"); + +/** @type {function(...*):?} */ +var dynCall_jiiiiji = Module["dynCall_jiiiiji"] = createExportWrapper("dynCall_jiiiiji"); + +/** @type {function(...*):?} */ +var dynCall_fiiiifi = Module["dynCall_fiiiifi"] = createExportWrapper("dynCall_fiiiifi"); + +/** @type {function(...*):?} */ +var dynCall_didii = Module["dynCall_didii"] = createExportWrapper("dynCall_didii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiiiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiiiiiiiii"] = createExportWrapper("dynCall_iiiiiiiiiiiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_vidiji = Module["dynCall_vidiji"] = createExportWrapper("dynCall_vidiji"); + +/** @type {function(...*):?} */ +var dynCall_viiijjiii = Module["dynCall_viiijjiii"] = createExportWrapper("dynCall_viiijjiii"); + +/** @type {function(...*):?} */ +var dynCall_idji = Module["dynCall_idji"] = createExportWrapper("dynCall_idji"); + +/** @type {function(...*):?} */ +var dynCall_idfi = Module["dynCall_idfi"] = createExportWrapper("dynCall_idfi"); + +/** @type {function(...*):?} */ +var dynCall_ijdi = Module["dynCall_ijdi"] = createExportWrapper("dynCall_ijdi"); + +/** @type {function(...*):?} */ +var dynCall_ijfi = Module["dynCall_ijfi"] = createExportWrapper("dynCall_ijfi"); + +/** @type {function(...*):?} */ +var dynCall_ifdi = Module["dynCall_ifdi"] = createExportWrapper("dynCall_ifdi"); + +/** @type {function(...*):?} */ +var dynCall_ifji = Module["dynCall_ifji"] = createExportWrapper("dynCall_ifji"); + +/** @type {function(...*):?} */ +var dynCall_iiijjii = Module["dynCall_iiijjii"] = createExportWrapper("dynCall_iiijjii"); + +/** @type {function(...*):?} */ +var dynCall_ijiiiiii = Module["dynCall_ijiiiiii"] = createExportWrapper("dynCall_ijiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_ijjiiiiii = Module["dynCall_ijjiiiiii"] = createExportWrapper("dynCall_ijjiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_fff = Module["dynCall_fff"] = createExportWrapper("dynCall_fff"); + +/** @type {function(...*):?} */ +var dynCall_ijj = Module["dynCall_ijj"] = createExportWrapper("dynCall_ijj"); + +/** @type {function(...*):?} */ +var dynCall_ij = Module["dynCall_ij"] = createExportWrapper("dynCall_ij"); + +/** @type {function(...*):?} */ +var dynCall_vif = Module["dynCall_vif"] = createExportWrapper("dynCall_vif"); + +/** @type {function(...*):?} */ +var dynCall_viif = Module["dynCall_viif"] = createExportWrapper("dynCall_viif"); + +/** @type {function(...*):?} */ +var dynCall_vjiiiiiii = Module["dynCall_vjiiiiiii"] = createExportWrapper("dynCall_vjiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viffff = Module["dynCall_viffff"] = createExportWrapper("dynCall_viffff"); + +/** @type {function(...*):?} */ +var dynCall_vid = Module["dynCall_vid"] = createExportWrapper("dynCall_vid"); + +/** @type {function(...*):?} */ +var dynCall_viiiiif = Module["dynCall_viiiiif"] = createExportWrapper("dynCall_viiiiif"); + +/** @type {function(...*):?} */ +var dynCall_viiiif = Module["dynCall_viiiif"] = createExportWrapper("dynCall_viiiif"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiif = Module["dynCall_viiiiiif"] = createExportWrapper("dynCall_viiiiiif"); + +/** @type {function(...*):?} */ +var dynCall_iiiijiii = Module["dynCall_iiiijiii"] = createExportWrapper("dynCall_iiiijiii"); + +/** @type {function(...*):?} */ +var dynCall_iiiij = Module["dynCall_iiiij"] = createExportWrapper("dynCall_iiiij"); + +/** @type {function(...*):?} */ +var dynCall_iiif = Module["dynCall_iiif"] = createExportWrapper("dynCall_iiif"); + +/** @type {function(...*):?} */ +var dynCall_fif = Module["dynCall_fif"] = createExportWrapper("dynCall_fif"); + +/** @type {function(...*):?} */ +var dynCall_viff = Module["dynCall_viff"] = createExportWrapper("dynCall_viff"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifff = Module["dynCall_iiiiiifff"] = createExportWrapper("dynCall_iiiiiifff"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifiif = Module["dynCall_iiiiiifiif"] = createExportWrapper("dynCall_iiiiiifiif"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiifiif = Module["dynCall_iiiiiiifiif"] = createExportWrapper("dynCall_iiiiiiifiif"); + +/** @type {function(...*):?} */ +var dynCall_fiff = Module["dynCall_fiff"] = createExportWrapper("dynCall_fiff"); + +/** @type {function(...*):?} */ +var dynCall_fiiiiiifiifif = Module["dynCall_fiiiiiifiifif"] = createExportWrapper("dynCall_fiiiiiifiifif"); + +/** @type {function(...*):?} */ +var dynCall_fiiiiiifiiiif = Module["dynCall_fiiiiiifiiiif"] = createExportWrapper("dynCall_fiiiiiifiiiif"); + +/** @type {function(...*):?} */ +var dynCall_iifiiiijii = Module["dynCall_iifiiiijii"] = createExportWrapper("dynCall_iifiiiijii"); + +/** @type {function(...*):?} */ +var dynCall_vifif = Module["dynCall_vifif"] = createExportWrapper("dynCall_vifif"); + +/** @type {function(...*):?} */ +var dynCall_vifijii = Module["dynCall_vifijii"] = createExportWrapper("dynCall_vifijii"); + +/** @type {function(...*):?} */ +var dynCall_iiiifffffi = Module["dynCall_iiiifffffi"] = createExportWrapper("dynCall_iiiifffffi"); + +/** @type {function(...*):?} */ +var dynCall_viffiiiif = Module["dynCall_viffiiiif"] = createExportWrapper("dynCall_viffiiiif"); + +/** @type {function(...*):?} */ +var dynCall_viffiifffffiii = Module["dynCall_viffiifffffiii"] = createExportWrapper("dynCall_viffiifffffiii"); + +/** @type {function(...*):?} */ +var dynCall_viffffiifffiiiiif = Module["dynCall_viffffiifffiiiiif"] = createExportWrapper("dynCall_viffffiifffiiiiif"); + +/** @type {function(...*):?} */ +var dynCall_iiiifffffii = Module["dynCall_iiiifffffii"] = createExportWrapper("dynCall_iiiifffffii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiiiiifii = Module["dynCall_viiiiiiiiiiifii"] = createExportWrapper("dynCall_viiiiiiiiiiifii"); + +/** @type {function(...*):?} */ +var dynCall_iiiiifiiiiif = Module["dynCall_iiiiifiiiiif"] = createExportWrapper("dynCall_iiiiifiiiiif"); + +/** @type {function(...*):?} */ +var dynCall_viiff = Module["dynCall_viiff"] = createExportWrapper("dynCall_viiff"); + +/** @type {function(...*):?} */ +var dynCall_viiifiiiii = Module["dynCall_viiifiiiii"] = createExportWrapper("dynCall_viiifiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiifiiiiif = Module["dynCall_viiiifiiiiif"] = createExportWrapper("dynCall_viiiifiiiiif"); + +/** @type {function(...*):?} */ +var dynCall_iifff = Module["dynCall_iifff"] = createExportWrapper("dynCall_iifff"); + +/** @type {function(...*):?} */ +var dynCall_iif = Module["dynCall_iif"] = createExportWrapper("dynCall_iif"); + +/** @type {function(...*):?} */ +var dynCall_viij = Module["dynCall_viij"] = createExportWrapper("dynCall_viij"); + +/** @type {function(...*):?} */ +var dynCall_viijijj = Module["dynCall_viijijj"] = createExportWrapper("dynCall_viijijj"); + +/** @type {function(...*):?} */ +var dynCall_viijj = Module["dynCall_viijj"] = createExportWrapper("dynCall_viijj"); + +/** @type {function(...*):?} */ +var dynCall_viiiij = Module["dynCall_viiiij"] = createExportWrapper("dynCall_viiiij"); + +/** @type {function(...*):?} */ +var dynCall_iiijji = Module["dynCall_iiijji"] = createExportWrapper("dynCall_iiijji"); + +/** @type {function(...*):?} */ +var dynCall_ijjiiiii = Module["dynCall_ijjiiiii"] = createExportWrapper("dynCall_ijjiiiii"); + +/** @type {function(...*):?} */ +var dynCall_iiij = Module["dynCall_iiij"] = createExportWrapper("dynCall_iiij"); + +/** @type {function(...*):?} */ +var dynCall_vidd = Module["dynCall_vidd"] = createExportWrapper("dynCall_vidd"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiifffiiifiii = Module["dynCall_iiiiiifffiiifiii"] = createExportWrapper("dynCall_iiiiiifffiiifiii"); + +/** @type {function(...*):?} */ +var dynCall_viid = Module["dynCall_viid"] = createExportWrapper("dynCall_viid"); + +/** @type {function(...*):?} */ +var dynCall_viiif = Module["dynCall_viiif"] = createExportWrapper("dynCall_viiif"); + +/** @type {function(...*):?} */ +var dynCall_fiiiif = Module["dynCall_fiiiif"] = createExportWrapper("dynCall_fiiiif"); + +/** @type {function(...*):?} */ +var dynCall_viiffiiii = Module["dynCall_viiffiiii"] = createExportWrapper("dynCall_viiffiiii"); + +/** @type {function(...*):?} */ +var dynCall_ff = Module["dynCall_ff"] = createExportWrapper("dynCall_ff"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiff = Module["dynCall_iiiiiff"] = createExportWrapper("dynCall_iiiiiff"); + +/** @type {function(...*):?} */ +var dynCall_vf = Module["dynCall_vf"] = createExportWrapper("dynCall_vf"); + +/** @type {function(...*):?} */ +var dynCall_vffff = Module["dynCall_vffff"] = createExportWrapper("dynCall_vffff"); + +/** @type {function(...*):?} */ +var dynCall_vff = Module["dynCall_vff"] = createExportWrapper("dynCall_vff"); + +/** @type {function(...*):?} */ +var dynCall_vifff = Module["dynCall_vifff"] = createExportWrapper("dynCall_vifff"); + +/** @type {function(...*):?} */ +var dynCall_viifff = Module["dynCall_viifff"] = createExportWrapper("dynCall_viifff"); + +/** @type {function(...*):?} */ +var dynCall_vij = Module["dynCall_vij"] = createExportWrapper("dynCall_vij"); + +/** @type {function(...*):?} */ +var dynCall_vfff = Module["dynCall_vfff"] = createExportWrapper("dynCall_vfff"); + +/** @type {function(...*):?} */ +var dynCall_iiff = Module["dynCall_iiff"] = createExportWrapper("dynCall_iiff"); + +/** @type {function(...*):?} */ +var dynCall_f = Module["dynCall_f"] = createExportWrapper("dynCall_f"); + +/** @type {function(...*):?} */ +var dynCall_vffffffi = Module["dynCall_vffffffi"] = createExportWrapper("dynCall_vffffffi"); + +/** @type {function(...*):?} */ +var dynCall_if = Module["dynCall_if"] = createExportWrapper("dynCall_if"); + +/** @type {function(...*):?} */ +var dynCall_vifffff = Module["dynCall_vifffff"] = createExportWrapper("dynCall_vifffff"); + +/** @type {function(...*):?} */ +var dynCall_viififf = Module["dynCall_viififf"] = createExportWrapper("dynCall_viififf"); + +/** @type {function(...*):?} */ +var dynCall_iiiififiii = Module["dynCall_iiiififiii"] = createExportWrapper("dynCall_iiiififiii"); + +/** @type {function(...*):?} */ +var dynCall_iiififiii = Module["dynCall_iiififiii"] = createExportWrapper("dynCall_iiififiii"); + +/** @type {function(...*):?} */ +var dynCall_iiifiifii = Module["dynCall_iiifiifii"] = createExportWrapper("dynCall_iiifiifii"); + +/** @type {function(...*):?} */ +var dynCall_fiif = Module["dynCall_fiif"] = createExportWrapper("dynCall_fiif"); + +/** @type {function(...*):?} */ +var dynCall_iiiiiiffiiiiiiiiiffffiii = Module["dynCall_iiiiiiffiiiiiiiiiffffiii"] = createExportWrapper("dynCall_iiiiiiffiiiiiiiiiffffiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffiiiiiiiii = Module["dynCall_viiffiiiiiiiii"] = createExportWrapper("dynCall_viiffiiiiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiffiiiiii = Module["dynCall_viiffiiiiii"] = createExportWrapper("dynCall_viiffiiiiii"); + +/** @type {function(...*):?} */ +var dynCall_viiiiiiiijiii = Module["dynCall_viiiiiiiijiii"] = createExportWrapper("dynCall_viiiiiiiijiii"); + +/** @type {function(...*):?} */ +var dynCall_d = Module["dynCall_d"] = createExportWrapper("dynCall_d"); + + +function invoke_ii(index,a1) { + var sp = stackSave(); + try { + return dynCall_ii(index,a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vii(index,a1,a2) { + var sp = stackSave(); + try { + dynCall_vii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_v(index) { + var sp = stackSave(); + try { + dynCall_v(index); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iii(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_iii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vi(index,a1) { + var sp = stackSave(); + try { + dynCall_vi(index,a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiii(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_iiii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_iiiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_iiiiii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viii(index,a1,a2,a3) { + var sp = stackSave(); + try { + dynCall_viii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_i(index) { + var sp = stackSave(); + try { + return dynCall_i(index); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + dynCall_viiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iiiiiii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + return dynCall_iiiiiiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_fiii(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_fiii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_diii(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_diii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) { + var sp = stackSave(); + try { + dynCall_viiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ddiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_ddiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_fii(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_fii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iifi(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_iifi(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iifii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_iifii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viiiii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiidii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iiiidii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vidi(index,a1,a2,a3) { + var sp = stackSave(); + try { + dynCall_vidi(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viidi(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + dynCall_viidi(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_dii(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_dii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiifii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iiiifii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiifi(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viiiifi(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vifi(index,a1,a2,a3) { + var sp = stackSave(); + try { + dynCall_vifi(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viifi(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + dynCall_viifi(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiifi(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_iiiifi(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiidi(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viiiidi(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiidii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return dynCall_iiiiiiidii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiffi(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viiffi(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiifii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_iiifii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12) { + var sp = stackSave(); + try { + dynCall_viiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13) { + var sp = stackSave(); + try { + dynCall_viiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viifffffi(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_viifffffi(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_fifi(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_fifi(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_fiiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_fiiiii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiifffiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) { + var sp = stackSave(); + try { + dynCall_viiiiifffiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_fffi(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_fffi(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiffiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_viiiffiii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiifii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + return dynCall_iiiiiifii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiifiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiifiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiifi(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_viiiiifi(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiifiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) { + var sp = stackSave(); + try { + return dynCall_iiiiifiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_dddi(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_dddi(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viffi(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + dynCall_viffi(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiifi(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viiifi(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ffi(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_ffi(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_fi(index,a1) { + var sp = stackSave(); + try { + return dynCall_fi(index,a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ifi(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_ifi(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiifii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return dynCall_iiiiiiifii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viifiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + dynCall_viifiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_fiiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_fiiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vfi(index,a1,a2) { + var sp = stackSave(); + try { + dynCall_vfi(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiffi(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_viiiiiffi(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viifii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viifii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vifffi(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_vifffi(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiifii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viiifii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viffffi(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viffffi(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_di(index,a1) { + var sp = stackSave(); + try { + return dynCall_di(index,a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vifii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + dynCall_vifii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_diiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_diiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viddii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viddii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viidii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viidii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiifi(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_iiifi(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14) { + var sp = stackSave(); + try { + dynCall_viiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiffiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12) { + var sp = stackSave(); + try { + dynCall_viiiiffiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiffiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15) { + var sp = stackSave(); + try { + dynCall_viiiiffiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiffffiiiiiiifi(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15,a16) { + var sp = stackSave(); + try { + dynCall_viiiffffiiiiiiifi(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15,a16); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiffi(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_iiffi(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vififi(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_vififi(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiffiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + dynCall_viiiffiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iifiiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iifiiii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vidd(index,a1,a2,a3) { + var sp = stackSave(); + try { + dynCall_vidd(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iij(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_iij(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiijiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + return dynCall_iiijiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jiiii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_jiiii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ji(index,a1) { + var sp = stackSave(); + try { + return dynCall_ji(index,a1); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jii(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_jii(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viijii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viijii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiij(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iiiiij(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_j(index) { + var sp = stackSave(); + try { + return dynCall_j(index); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiji(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_iiji(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iijii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_iijii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jiii(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_jiii(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiijii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + return dynCall_iiiijii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viji(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + dynCall_viji(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiji(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_viiji(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiijii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iiijii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iijiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iijiii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vijii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + dynCall_vijii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viidiji(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_viidiji(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiji(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_viiiji(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiji(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiji(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiijiiji(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) { + var sp = stackSave(); + try { + dynCall_viiiijiiji(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jjji(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_jjji(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jji(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_jji(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jijii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_jijii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vijjjii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + dynCall_vijjjii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jiijiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + return dynCall_jiijiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiijii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_viiiijii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ijji(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_ijji(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jdi(index,a1,a2) { + var sp = stackSave(); + try { + return dynCall_jdi(index,a1,a2); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vijjji(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_vijjji(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viijiiijiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13) { + var sp = stackSave(); + try { + dynCall_viijiiijiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vji(index,a1,a2,a3) { + var sp = stackSave(); + try { + dynCall_vji(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vijiiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_vijiiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_dji(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_dji(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiijjii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return dynCall_iiiijjii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iijjiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11) { + var sp = stackSave(); + try { + return dynCall_iijjiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iijiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) { + var sp = stackSave(); + try { + return dynCall_iijiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jiji(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_jiji(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vijji(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_vijji(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iijji(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + return dynCall_iijji(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iji(index,a1,a2,a3) { + var sp = stackSave(); + try { + return dynCall_iji(index,a1,a2,a3); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) { + var sp = stackSave(); + try { + return dynCall_jiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jjii(index,a1,a2,a3,a4) { + var sp = stackSave(); + try { + return dynCall_jjii(index,a1,a2,a3,a4); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vijiii(index,a1,a2,a3,a4,a5,a6) { + var sp = stackSave(); + try { + dynCall_vijiii(index,a1,a2,a3,a4,a5,a6); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vjjjiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10) { + var sp = stackSave(); + try { + dynCall_vjjjiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vjiiiii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_vjiiiii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_jiiiii(index,a1,a2,a3,a4,a5) { + var sp = stackSave(); + try { + return dynCall_jiiiii(index,a1,a2,a3,a4,a5); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiijii(index,a1,a2,a3,a4,a5,a6,a7) { + var sp = stackSave(); + try { + dynCall_viiijii(index,a1,a2,a3,a4,a5,a6,a7); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiijiii(index,a1,a2,a3,a4,a5,a6,a7,a8) { + var sp = stackSave(); + try { + dynCall_viiijiii(index,a1,a2,a3,a4,a5,a6,a7,a8); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiiiiiiiijiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15,a16) { + var sp = stackSave(); + try { + return dynCall_iiiiiiiiiiiijiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15,a16); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiijjiiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15,a16,a17,a18,a19,a20,a21,a22,a23,a24) { + var sp = stackSave(); + try { + dynCall_viiiiiijjiiiiiiiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15,a16,a17,a18,a19,a20,a21,a22,a23,a24); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiijjiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15) { + var sp = stackSave(); + try { + dynCall_viiiiiijjiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9,a10,a11,a12,a13,a14,a15); + } catch(e) { + stackRestore(sp); + if (e !== e+0) throw e; + _setThrew(1, 0); + } +} + + + + +// === Auto-generated postamble setup entry stuff === + +unexportedRuntimeFunction('intArrayFromString', false); +unexportedRuntimeFunction('intArrayToString', false); +Module["ccall"] = ccall; +Module["cwrap"] = cwrap; +unexportedRuntimeFunction('setValue', false); +unexportedRuntimeFunction('getValue', false); +unexportedRuntimeFunction('allocate', false); +unexportedRuntimeFunction('UTF8ArrayToString', false); +unexportedRuntimeFunction('UTF8ToString', false); +unexportedRuntimeFunction('stringToUTF8Array', false); +unexportedRuntimeFunction('stringToUTF8', false); +unexportedRuntimeFunction('lengthBytesUTF8', false); +Module["stackTrace"] = stackTrace; +unexportedRuntimeFunction('addOnPreRun', false); +unexportedRuntimeFunction('addOnInit', false); +unexportedRuntimeFunction('addOnPreMain', false); +unexportedRuntimeFunction('addOnExit', false); +unexportedRuntimeFunction('addOnPostRun', false); +unexportedRuntimeFunction('writeStringToMemory', false); +unexportedRuntimeFunction('writeArrayToMemory', false); +unexportedRuntimeFunction('writeAsciiToMemory', false); +Module["addRunDependency"] = addRunDependency; +Module["removeRunDependency"] = removeRunDependency; +unexportedRuntimeFunction('FS_createFolder', false); +Module["FS_createPath"] = FS.createPath; +Module["FS_createDataFile"] = FS.createDataFile; +unexportedRuntimeFunction('FS_createPreloadedFile', true); +unexportedRuntimeFunction('FS_createLazyFile', true); +unexportedRuntimeFunction('FS_createLink', false); +unexportedRuntimeFunction('FS_createDevice', true); +unexportedRuntimeFunction('FS_unlink', true); +unexportedRuntimeFunction('getLEB', false); +unexportedRuntimeFunction('getFunctionTables', false); +unexportedRuntimeFunction('alignFunctionTables', false); +unexportedRuntimeFunction('registerFunctions', false); +unexportedRuntimeFunction('addFunction', false); +unexportedRuntimeFunction('removeFunction', false); +unexportedRuntimeFunction('getFuncWrapper', false); +unexportedRuntimeFunction('prettyPrint', false); +unexportedRuntimeFunction('dynCall', false); +unexportedRuntimeFunction('getCompilerSetting', false); +unexportedRuntimeFunction('print', false); +unexportedRuntimeFunction('printErr', false); +unexportedRuntimeFunction('getTempRet0', false); +unexportedRuntimeFunction('setTempRet0', false); +unexportedRuntimeFunction('callMain', false); +unexportedRuntimeFunction('abort', false); +unexportedRuntimeFunction('keepRuntimeAlive', false); +unexportedRuntimeFunction('zeroMemory', false); +unexportedRuntimeFunction('stringToNewUTF8', false); +unexportedRuntimeFunction('emscripten_realloc_buffer', false); +unexportedRuntimeFunction('ENV', false); +unexportedRuntimeFunction('ERRNO_CODES', false); +unexportedRuntimeFunction('ERRNO_MESSAGES', false); +unexportedRuntimeFunction('setErrNo', false); +unexportedRuntimeFunction('inetPton4', false); +unexportedRuntimeFunction('inetNtop4', false); +unexportedRuntimeFunction('inetPton6', false); +unexportedRuntimeFunction('inetNtop6', false); +unexportedRuntimeFunction('readSockaddr', false); +unexportedRuntimeFunction('writeSockaddr', false); +unexportedRuntimeFunction('DNS', false); +unexportedRuntimeFunction('getHostByName', false); +unexportedRuntimeFunction('Protocols', false); +unexportedRuntimeFunction('Sockets', false); +unexportedRuntimeFunction('getRandomDevice', false); +unexportedRuntimeFunction('traverseStack', false); +unexportedRuntimeFunction('UNWIND_CACHE', false); +unexportedRuntimeFunction('convertPCtoSourceLocation', false); +unexportedRuntimeFunction('readAsmConstArgsArray', false); +unexportedRuntimeFunction('readAsmConstArgs', false); +unexportedRuntimeFunction('mainThreadEM_ASM', false); +unexportedRuntimeFunction('jstoi_q', false); +unexportedRuntimeFunction('jstoi_s', false); +unexportedRuntimeFunction('getExecutableName', false); +unexportedRuntimeFunction('listenOnce', false); +unexportedRuntimeFunction('autoResumeAudioContext', false); +unexportedRuntimeFunction('dynCallLegacy', false); +unexportedRuntimeFunction('getDynCaller', false); +unexportedRuntimeFunction('dynCall', false); +unexportedRuntimeFunction('handleException', false); +unexportedRuntimeFunction('runtimeKeepalivePush', false); +unexportedRuntimeFunction('runtimeKeepalivePop', false); +unexportedRuntimeFunction('callUserCallback', false); +unexportedRuntimeFunction('maybeExit', false); +unexportedRuntimeFunction('safeSetTimeout', false); +unexportedRuntimeFunction('asmjsMangle', false); +unexportedRuntimeFunction('asyncLoad', false); +unexportedRuntimeFunction('alignMemory', false); +unexportedRuntimeFunction('mmapAlloc', false); +unexportedRuntimeFunction('reallyNegative', false); +unexportedRuntimeFunction('unSign', false); +unexportedRuntimeFunction('reSign', false); +unexportedRuntimeFunction('formatString', false); +unexportedRuntimeFunction('PATH', false); +unexportedRuntimeFunction('PATH_FS', false); +unexportedRuntimeFunction('SYSCALLS', false); +unexportedRuntimeFunction('getSocketFromFD', false); +unexportedRuntimeFunction('getSocketAddress', false); +unexportedRuntimeFunction('JSEvents', false); +unexportedRuntimeFunction('registerKeyEventCallback', false); +unexportedRuntimeFunction('specialHTMLTargets', false); +unexportedRuntimeFunction('maybeCStringToJsString', false); +unexportedRuntimeFunction('findEventTarget', false); +unexportedRuntimeFunction('findCanvasEventTarget', false); +unexportedRuntimeFunction('getBoundingClientRect', false); +unexportedRuntimeFunction('fillMouseEventData', false); +unexportedRuntimeFunction('registerMouseEventCallback', false); +unexportedRuntimeFunction('registerWheelEventCallback', false); +unexportedRuntimeFunction('registerUiEventCallback', false); +unexportedRuntimeFunction('registerFocusEventCallback', false); +unexportedRuntimeFunction('fillDeviceOrientationEventData', false); +unexportedRuntimeFunction('registerDeviceOrientationEventCallback', false); +unexportedRuntimeFunction('fillDeviceMotionEventData', false); +unexportedRuntimeFunction('registerDeviceMotionEventCallback', false); +unexportedRuntimeFunction('screenOrientation', false); +unexportedRuntimeFunction('fillOrientationChangeEventData', false); +unexportedRuntimeFunction('registerOrientationChangeEventCallback', false); +unexportedRuntimeFunction('fillFullscreenChangeEventData', false); +unexportedRuntimeFunction('registerFullscreenChangeEventCallback', false); +unexportedRuntimeFunction('registerRestoreOldStyle', false); +unexportedRuntimeFunction('hideEverythingExceptGivenElement', false); +unexportedRuntimeFunction('restoreHiddenElements', false); +unexportedRuntimeFunction('setLetterbox', false); +unexportedRuntimeFunction('currentFullscreenStrategy', false); +unexportedRuntimeFunction('restoreOldWindowedStyle', false); +unexportedRuntimeFunction('softFullscreenResizeWebGLRenderTarget', false); +unexportedRuntimeFunction('doRequestFullscreen', false); +unexportedRuntimeFunction('fillPointerlockChangeEventData', false); +unexportedRuntimeFunction('registerPointerlockChangeEventCallback', false); +unexportedRuntimeFunction('registerPointerlockErrorEventCallback', false); +unexportedRuntimeFunction('requestPointerLock', false); +unexportedRuntimeFunction('fillVisibilityChangeEventData', false); +unexportedRuntimeFunction('registerVisibilityChangeEventCallback', false); +unexportedRuntimeFunction('registerTouchEventCallback', false); +unexportedRuntimeFunction('fillGamepadEventData', false); +unexportedRuntimeFunction('registerGamepadEventCallback', false); +unexportedRuntimeFunction('registerBeforeUnloadEventCallback', false); +unexportedRuntimeFunction('fillBatteryEventData', false); +unexportedRuntimeFunction('battery', false); +unexportedRuntimeFunction('registerBatteryEventCallback', false); +unexportedRuntimeFunction('setCanvasElementSize', false); +unexportedRuntimeFunction('getCanvasElementSize', false); +unexportedRuntimeFunction('demangle', false); +unexportedRuntimeFunction('demangleAll', false); +unexportedRuntimeFunction('jsStackTrace', false); +Module["stackTrace"] = stackTrace; +unexportedRuntimeFunction('getEnvStrings', false); +unexportedRuntimeFunction('checkWasiClock', false); +unexportedRuntimeFunction('writeI53ToI64', false); +unexportedRuntimeFunction('writeI53ToI64Clamped', false); +unexportedRuntimeFunction('writeI53ToI64Signaling', false); +unexportedRuntimeFunction('writeI53ToU64Clamped', false); +unexportedRuntimeFunction('writeI53ToU64Signaling', false); +unexportedRuntimeFunction('readI53FromI64', false); +unexportedRuntimeFunction('readI53FromU64', false); +unexportedRuntimeFunction('convertI32PairToI53', false); +unexportedRuntimeFunction('convertU32PairToI53', false); +unexportedRuntimeFunction('setImmediateWrapped', false); +unexportedRuntimeFunction('clearImmediateWrapped', false); +unexportedRuntimeFunction('polyfillSetImmediate', false); +unexportedRuntimeFunction('uncaughtExceptionCount', false); +unexportedRuntimeFunction('exceptionLast', false); +unexportedRuntimeFunction('exceptionCaught', false); +unexportedRuntimeFunction('ExceptionInfo', false); +unexportedRuntimeFunction('CatchInfo', false); +unexportedRuntimeFunction('exception_addRef', false); +unexportedRuntimeFunction('exception_decRef', false); +unexportedRuntimeFunction('formatException', false); +unexportedRuntimeFunction('Browser', false); +unexportedRuntimeFunction('funcWrappers', false); +unexportedRuntimeFunction('getFuncWrapper', false); +unexportedRuntimeFunction('setMainLoop', false); +unexportedRuntimeFunction('wget', false); +unexportedRuntimeFunction('FS', false); +unexportedRuntimeFunction('MEMFS', false); +unexportedRuntimeFunction('TTY', false); +unexportedRuntimeFunction('PIPEFS', false); +unexportedRuntimeFunction('SOCKFS', false); +unexportedRuntimeFunction('_setNetworkCallback', false); +unexportedRuntimeFunction('tempFixedLengthArray', false); +unexportedRuntimeFunction('miniTempWebGLFloatBuffers', false); +unexportedRuntimeFunction('heapObjectForWebGLType', false); +unexportedRuntimeFunction('heapAccessShiftForWebGLHeap', false); +unexportedRuntimeFunction('GL', false); +unexportedRuntimeFunction('emscriptenWebGLGet', false); +unexportedRuntimeFunction('computeUnpackAlignedImageSize', false); +unexportedRuntimeFunction('emscriptenWebGLGetTexPixelData', false); +unexportedRuntimeFunction('emscriptenWebGLGetUniform', false); +unexportedRuntimeFunction('webglGetUniformLocation', false); +unexportedRuntimeFunction('webglPrepareUniformLocationsBeforeFirstUse', false); +unexportedRuntimeFunction('webglGetLeftBracePos', false); +unexportedRuntimeFunction('emscriptenWebGLGetVertexAttrib', false); +unexportedRuntimeFunction('webglApplyExplicitProgramBindings', false); +unexportedRuntimeFunction('emscriptenWebGLGetBufferBinding', false); +unexportedRuntimeFunction('emscriptenWebGLValidateMapBufferTarget', false); +unexportedRuntimeFunction('writeGLArray', false); +unexportedRuntimeFunction('AL', false); +unexportedRuntimeFunction('SDL_unicode', false); +unexportedRuntimeFunction('SDL_ttfContext', false); +unexportedRuntimeFunction('SDL_audio', false); +unexportedRuntimeFunction('SDL', false); +unexportedRuntimeFunction('SDL_gfx', false); +unexportedRuntimeFunction('GLUT', false); +unexportedRuntimeFunction('EGL', false); +unexportedRuntimeFunction('GLFW_Window', false); +unexportedRuntimeFunction('GLFW', false); +unexportedRuntimeFunction('GLEW', false); +unexportedRuntimeFunction('IDBStore', false); +unexportedRuntimeFunction('runAndAbortIfError', false); +unexportedRuntimeFunction('emscriptenWebGLGetIndexed', false); +unexportedRuntimeFunction('remove_cpp_comments_in_shaders', false); +unexportedRuntimeFunction('find_closing_parens_index', false); +unexportedRuntimeFunction('preprocess_c_code', false); +unexportedRuntimeFunction('WEBAudio', false); +unexportedRuntimeFunction('WEBAudio__user', false); +unexportedRuntimeFunction('jsAudioAddPendingBlockedAudio', false); +unexportedRuntimeFunction('jsAudioAddPendingBlockedAudio__user', false); +unexportedRuntimeFunction('jsAudioPlayPendingBlockedAudio', false); +unexportedRuntimeFunction('jsAudioPlayPendingBlockedAudio__user', false); +unexportedRuntimeFunction('jsAudioPlayBlockedAudios', false); +unexportedRuntimeFunction('jsAudioPlayBlockedAudios__user', false); +unexportedRuntimeFunction('jsAudioMixinSetPitch', false); +unexportedRuntimeFunction('jsAudioMixinSetPitch__user', false); +unexportedRuntimeFunction('jsAudioGetMimeTypeFromType', false); +unexportedRuntimeFunction('jsAudioGetMimeTypeFromType__user', false); +unexportedRuntimeFunction('jsAudioCreateCompressedSoundClip', false); +unexportedRuntimeFunction('jsAudioCreateCompressedSoundClip__user', false); +unexportedRuntimeFunction('jsAudioCreateUncompressedSoundClip', false); +unexportedRuntimeFunction('jsAudioCreateUncompressedSoundClip__user', false); +unexportedRuntimeFunction('jsAudioCreateUncompressedSoundClipFromPCM', false); +unexportedRuntimeFunction('jsAudioCreateUncompressedSoundClipFromPCM__user', false); +unexportedRuntimeFunction('jsAudioCreateUncompressedSoundClipFromCompressedAudio', false); +unexportedRuntimeFunction('jsAudioCreateUncompressedSoundClipFromCompressedAudio__user', false); +unexportedRuntimeFunction('jsAudioCreateChannel', false); +unexportedRuntimeFunction('jsAudioCreateChannel__user', false); +unexportedRuntimeFunction('registerTouchEventCallback__user', false); +unexportedRuntimeFunction('dlopen_main_init', false); +unexportedRuntimeFunction('dlopen_main_init__user', false); +unexportedRuntimeFunction('jsDomCssEscapeId', false); +unexportedRuntimeFunction('jsDomCssEscapeId__user', false); +unexportedRuntimeFunction('jsCanvasSelector', false); +unexportedRuntimeFunction('jsCanvasSelector__user', false); +unexportedRuntimeFunction('fs', false); +unexportedRuntimeFunction('fs__user', false); +unexportedRuntimeFunction('ExceptionsSeen', false); +unexportedRuntimeFunction('ExceptionsSeen__user', false); +unexportedRuntimeFunction('IDBFS', false); +unexportedRuntimeFunction('mobile_input', false); +unexportedRuntimeFunction('mobile_input__user', false); +unexportedRuntimeFunction('mobile_input_text', false); +unexportedRuntimeFunction('mobile_input_text__user', false); +unexportedRuntimeFunction('mobile_input_hide_delay', false); +unexportedRuntimeFunction('mobile_input_hide_delay__user', false); +unexportedRuntimeFunction('mobile_input_ignore_blur_event', false); +unexportedRuntimeFunction('mobile_input_ignore_blur_event__user', false); +unexportedRuntimeFunction('JS_ScreenOrientation_callback', false); +unexportedRuntimeFunction('JS_ScreenOrientation_callback__user', false); +unexportedRuntimeFunction('JS_ScreenOrientation_eventHandler', false); +unexportedRuntimeFunction('JS_ScreenOrientation_eventHandler__user', false); +unexportedRuntimeFunction('JS_ScreenOrientation_requestedLockType', false); +unexportedRuntimeFunction('JS_ScreenOrientation_requestedLockType__user', false); +unexportedRuntimeFunction('JS_ScreenOrientation_appliedLockType', false); +unexportedRuntimeFunction('JS_ScreenOrientation_appliedLockType__user', false); +unexportedRuntimeFunction('JS_ScreenOrientation_timeoutID', false); +unexportedRuntimeFunction('JS_ScreenOrientation_timeoutID__user', false); +unexportedRuntimeFunction('JS_OrientationSensor_frequencyRequest', false); +unexportedRuntimeFunction('JS_OrientationSensor_frequencyRequest__user', false); +unexportedRuntimeFunction('JS_OrientationSensor_callback', false); +unexportedRuntimeFunction('JS_OrientationSensor_callback__user', false); +unexportedRuntimeFunction('JS_OrientationSensor', false); +unexportedRuntimeFunction('JS_OrientationSensor__user', false); +unexportedRuntimeFunction('JS_Accelerometer_frequencyRequest', false); +unexportedRuntimeFunction('JS_Accelerometer_frequencyRequest__user', false); +unexportedRuntimeFunction('JS_Accelerometer_callback', false); +unexportedRuntimeFunction('JS_Accelerometer_callback__user', false); +unexportedRuntimeFunction('JS_Accelerometer', false); +unexportedRuntimeFunction('JS_Accelerometer__user', false); +unexportedRuntimeFunction('JS_Accelerometer_multiplier', false); +unexportedRuntimeFunction('JS_Accelerometer_multiplier__user', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_frequencyRequest', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_frequencyRequest__user', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_callback', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_callback__user', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor__user', false); +unexportedRuntimeFunction('JS_GravitySensor_frequencyRequest', false); +unexportedRuntimeFunction('JS_GravitySensor_frequencyRequest__user', false); +unexportedRuntimeFunction('JS_GravitySensor_callback', false); +unexportedRuntimeFunction('JS_GravitySensor_callback__user', false); +unexportedRuntimeFunction('JS_GravitySensor', false); +unexportedRuntimeFunction('JS_GravitySensor__user', false); +unexportedRuntimeFunction('JS_Accelerometer_frequency', false); +unexportedRuntimeFunction('JS_Accelerometer_frequency__user', false); +unexportedRuntimeFunction('JS_Accelerometer_lastValue', false); +unexportedRuntimeFunction('JS_Accelerometer_lastValue__user', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_frequency', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_frequency__user', false); +unexportedRuntimeFunction('JS_Gyroscope_frequencyRequest', false); +unexportedRuntimeFunction('JS_Gyroscope_frequencyRequest__user', false); +unexportedRuntimeFunction('JS_Gyroscope_callback', false); +unexportedRuntimeFunction('JS_Gyroscope_callback__user', false); +unexportedRuntimeFunction('JS_Gyroscope', false); +unexportedRuntimeFunction('JS_Gyroscope__user', false); +unexportedRuntimeFunction('JS_DeviceSensorPermissions', false); +unexportedRuntimeFunction('JS_DeviceSensorPermissions__user', false); +unexportedRuntimeFunction('JS_DefineAccelerometerMultiplier', false); +unexportedRuntimeFunction('JS_DefineAccelerometerMultiplier__user', false); +unexportedRuntimeFunction('JS_RequestDeviceSensorPermissions', false); +unexportedRuntimeFunction('JS_RequestDeviceSensorPermissions__user', false); +unexportedRuntimeFunction('JS_OrientationSensor_eventHandler', false); +unexportedRuntimeFunction('JS_OrientationSensor_eventHandler__user', false); +unexportedRuntimeFunction('JS_Accelerometer_eventHandler', false); +unexportedRuntimeFunction('JS_Accelerometer_eventHandler__user', false); +unexportedRuntimeFunction('JS_ComputeGravity', false); +unexportedRuntimeFunction('JS_ComputeGravity__user', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_eventHandler', false); +unexportedRuntimeFunction('JS_LinearAccelerationSensor_eventHandler__user', false); +unexportedRuntimeFunction('JS_GravitySensor_eventHandler', false); +unexportedRuntimeFunction('JS_GravitySensor_eventHandler__user', false); +unexportedRuntimeFunction('JS_Gyroscope_eventHandler', false); +unexportedRuntimeFunction('JS_Gyroscope_eventHandler__user', false); +unexportedRuntimeFunction('JS_DeviceOrientation_eventHandler', false); +unexportedRuntimeFunction('JS_DeviceOrientation_eventHandler__user', false); +unexportedRuntimeFunction('JS_DeviceMotion_eventHandler', false); +unexportedRuntimeFunction('JS_DeviceMotion_eventHandler__user', false); +unexportedRuntimeFunction('JS_DeviceMotion_add', false); +unexportedRuntimeFunction('JS_DeviceMotion_add__user', false); +unexportedRuntimeFunction('JS_DeviceMotion_remove', false); +unexportedRuntimeFunction('JS_DeviceMotion_remove__user', false); +unexportedRuntimeFunction('UNETWebSocketsInstances', false); +unexportedRuntimeFunction('UNETWebSocketsInstances__user', false); +unexportedRuntimeFunction('videoInstances', false); +unexportedRuntimeFunction('videoInstances__user', false); +unexportedRuntimeFunction('videoInstanceIdCounter', false); +unexportedRuntimeFunction('videoInstanceIdCounter__user', false); +unexportedRuntimeFunction('hasSRGBATextures', false); +unexportedRuntimeFunction('hasSRGBATextures__user', false); +unexportedRuntimeFunction('s2lTexture', false); +unexportedRuntimeFunction('s2lTexture__user', false); +unexportedRuntimeFunction('s2lFBO', false); +unexportedRuntimeFunction('s2lFBO__user', false); +unexportedRuntimeFunction('s2lVBO', false); +unexportedRuntimeFunction('s2lVBO__user', false); +unexportedRuntimeFunction('s2lProgram', false); +unexportedRuntimeFunction('s2lProgram__user', false); +unexportedRuntimeFunction('s2lVertexPositionNDC', false); +unexportedRuntimeFunction('s2lVertexPositionNDC__user', false); +unexportedRuntimeFunction('jsVideoEnded', false); +unexportedRuntimeFunction('jsVideoEnded__user', false); +unexportedRuntimeFunction('jsVideoAllAudioTracksAreDisabled', false); +unexportedRuntimeFunction('jsVideoAllAudioTracksAreDisabled__user', false); +unexportedRuntimeFunction('jsVideoPendingBlockedVideos', false); +unexportedRuntimeFunction('jsVideoPendingBlockedVideos__user', false); +unexportedRuntimeFunction('jsVideoAddPendingBlockedVideo', false); +unexportedRuntimeFunction('jsVideoAddPendingBlockedVideo__user', false); +unexportedRuntimeFunction('jsVideoPlayPendingBlockedVideo', false); +unexportedRuntimeFunction('jsVideoPlayPendingBlockedVideo__user', false); +unexportedRuntimeFunction('jsVideoRemovePendingBlockedVideo', false); +unexportedRuntimeFunction('jsVideoRemovePendingBlockedVideo__user', false); +unexportedRuntimeFunction('jsVideoAttemptToPlayBlockedVideos', false); +unexportedRuntimeFunction('jsVideoAttemptToPlayBlockedVideos__user', false); +unexportedRuntimeFunction('jsVideoCreateTexture2D', false); +unexportedRuntimeFunction('jsVideoCreateTexture2D__user', false); +unexportedRuntimeFunction('jsSupportedVideoFormats', false); +unexportedRuntimeFunction('jsSupportedVideoFormats__user', false); +unexportedRuntimeFunction('jsUnsupportedVideoFormats', false); +unexportedRuntimeFunction('jsUnsupportedVideoFormats__user', false); +unexportedRuntimeFunction('activeWebCams', false); +unexportedRuntimeFunction('activeWebCams__user', false); +unexportedRuntimeFunction('cameraAccess', false); +unexportedRuntimeFunction('cameraAccess__user', false); +unexportedRuntimeFunction('wr', false); +unexportedRuntimeFunction('wr__user', false); +unexportedRuntimeFunction('jsWebRequestGetResponseHeaderString', false); +unexportedRuntimeFunction('jsWebRequestGetResponseHeaderString__user', false); +unexportedRuntimeFunction('warnOnce', false); +unexportedRuntimeFunction('stackSave', false); +unexportedRuntimeFunction('stackRestore', false); +unexportedRuntimeFunction('stackAlloc', false); +unexportedRuntimeFunction('AsciiToString', false); +unexportedRuntimeFunction('stringToAscii', false); +unexportedRuntimeFunction('UTF16ToString', false); +unexportedRuntimeFunction('stringToUTF16', false); +unexportedRuntimeFunction('lengthBytesUTF16', false); +unexportedRuntimeFunction('UTF32ToString', false); +unexportedRuntimeFunction('stringToUTF32', false); +unexportedRuntimeFunction('lengthBytesUTF32', false); +unexportedRuntimeFunction('allocateUTF8', false); +unexportedRuntimeFunction('allocateUTF8OnStack', false); +Module["writeStackCookie"] = writeStackCookie; +Module["checkStackCookie"] = checkStackCookie; +unexportedRuntimeSymbol('ALLOC_NORMAL', false); +unexportedRuntimeSymbol('ALLOC_STACK', false); + +var calledRun; + +/** + * @constructor + * @this {ExitStatus} + */ +function ExitStatus(status) { + this.name = "ExitStatus"; + this.message = "Program terminated with exit(" + status + ")"; + this.status = status; +} + +var calledMain = false; + +dependenciesFulfilled = function runCaller() { + // If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false) + if (!calledRun) run(); + if (!calledRun) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled +}; + +function callMain(args) { + assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on Module["onRuntimeInitialized"])'); + assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called'); + + var entryFunction = Module['_main']; + + args = args || []; + + var argc = args.length+1; + var argv = stackAlloc((argc + 1) * 4); + HEAP32[argv >> 2] = allocateUTF8OnStack(thisProgram); + for (var i = 1; i < argc; i++) { + HEAP32[(argv >> 2) + i] = allocateUTF8OnStack(args[i - 1]); + } + HEAP32[(argv >> 2) + argc] = 0; + + try { + + var ret = entryFunction(argc, argv); + + // In PROXY_TO_PTHREAD builds, we should never exit the runtime below, as + // execution is asynchronously handed off to a pthread. + // if we're not running an evented main loop, it's time to exit + exit(ret, /* implicit = */ true); + return ret; + } + catch (e) { + return handleException(e); + } finally { + calledMain = true; + + } +} + +function stackCheckInit() { + // This is normally called automatically during __wasm_call_ctors but need to + // get these values before even running any of the ctors so we call it redundantly + // here. + // TODO(sbc): Move writeStackCookie to native to to avoid this. + _emscripten_stack_init(); + writeStackCookie(); +} + +/** @type {function(Array=)} */ +function run(args) { + args = args || arguments_; + + if (runDependencies > 0) { + return; + } + + stackCheckInit(); + + preRun(); + + // a preRun added a dependency, run will be called later + if (runDependencies > 0) { + return; + } + + function doRun() { + // run may have just been called through dependencies being fulfilled just in this very frame, + // or while the async setStatus time below was happening + if (calledRun) return; + calledRun = true; + Module['calledRun'] = true; + + if (ABORT) return; + + initRuntime(); + + preMain(); + + readyPromiseResolve(Module); + if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized'](); + + if (shouldRunNow) callMain(args); + + postRun(); + } + + if (Module['setStatus']) { + Module['setStatus']('Running...'); + setTimeout(function() { + setTimeout(function() { + Module['setStatus'](''); + }, 1); + doRun(); + }, 1); + } else + { + doRun(); + } + checkStackCookie(); +} +Module['run'] = run; + +function checkUnflushedContent() { + // Compiler settings do not allow exiting the runtime, so flushing + // the streams is not possible. but in ASSERTIONS mode we check + // if there was something to flush, and if so tell the user they + // should request that the runtime be exitable. + // Normally we would not even include flush() at all, but in ASSERTIONS + // builds we do so just for this check, and here we see if there is any + // content to flush, that is, we check if there would have been + // something a non-ASSERTIONS build would have not seen. + // How we flush the streams depends on whether we are in SYSCALLS_REQUIRE_FILESYSTEM=0 + // mode (which has its own special function for this; otherwise, all + // the code is inside libc) + var oldOut = out; + var oldErr = err; + var has = false; + out = err = (x) => { + has = true; + } + try { // it doesn't matter if it fails + ___stdio_exit(); + // also flush in the JS FS layer + ['stdout', 'stderr'].forEach(function(name) { + var info = FS.analyzePath('/dev/' + name); + if (!info) return; + var stream = info.object; + var rdev = stream.rdev; + var tty = TTY.ttys[rdev]; + if (tty && tty.output && tty.output.length) { + has = true; + } + }); + } catch(e) {} + out = oldOut; + err = oldErr; + if (has) { + warnOnce('stdio streams had content in them that was not flushed. you should set EXIT_RUNTIME to 1 (see the FAQ), or make sure to emit a newline when you printf etc.'); + } +} + +/** @param {boolean|number=} implicit */ +function exit(status, implicit) { + EXITSTATUS = status; + + checkUnflushedContent(); + + // if exit() was called explicitly, warn the user if the runtime isn't actually being shut down + if (keepRuntimeAlive() && !implicit) { + var msg = 'program exited (with status: ' + status + '), but EXIT_RUNTIME is not set, so halting execution but not exiting the runtime or preventing further async execution (build with EXIT_RUNTIME=1, if you want a true shutdown)'; + readyPromiseReject(msg); + err(msg); + } + + procExit(status); +} + +function procExit(code) { + EXITSTATUS = code; + if (!keepRuntimeAlive()) { + if (Module['onExit']) Module['onExit'](code); + ABORT = true; + } + quit_(code, new ExitStatus(code)); +} + +if (Module['preInit']) { + if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']]; + while (Module['preInit'].length > 0) { + Module['preInit'].pop()(); + } +} + +// shouldRunNow refers to calling main(), not run(). +var shouldRunNow = true; + +if (Module['noInitialRun']) shouldRunNow = false; + +run(); + + + + + + + + return unityFramework.ready +} +); +})(); +if (typeof exports === 'object' && typeof module === 'object') + module.exports = unityFramework; +else if (typeof define === 'function' && define['amd']) + define([], function() { return unityFramework; }); +else if (typeof exports === 'object') + exports["unityFramework"] = unityFramework;