diff --git "a/src/backend/gradio_cofoldinginput/templates/component/index.js" "b/src/backend/gradio_cofoldinginput/templates/component/index.js"
--- "a/src/backend/gradio_cofoldinginput/templates/component/index.js"
+++ "b/src/backend/gradio_cofoldinginput/templates/component/index.js"
@@ -19,11 +19,11 @@ const Block_svelte_svelte_type_style_lang = "", {
} = window.__gradio__svelte__internal;
function create_dynamic_element(y) {
let s, e, l;
- const g = (
+ const p = (
/*#slots*/
y[18].default
), _ = create_slot$3(
- g,
+ p,
y,
/*$$scope*/
y[17],
@@ -43,8 +43,8 @@ function create_dynamic_element(y) {
y[3].join(" ") + " svelte-1t38q2d"
}
], o = {};
- for (let p = 0; p < x.length; p += 1)
- o = assign$1(o, x[p]);
+ for (let g = 0; g < x.length; g += 1)
+ o = assign$1(o, x[g]);
return {
c() {
s = element$c(
@@ -104,110 +104,110 @@ function create_dynamic_element(y) {
), set_style$3(s, "min-width", `calc(min(${/*min_width*/
y[13]}px, 100%))`), set_style$3(s, "border-width", "var(--block-border-width)");
},
- m(p, E) {
- insert$f(p, s, E), _ && _.m(s, null), l = !0;
+ m(g, E) {
+ insert$f(g, s, E), _ && _.m(s, null), l = !0;
},
- p(p, E) {
+ p(g, E) {
_ && _.p && (!l || E & /*$$scope*/
131072) && update_slot_base$3(
_,
- g,
p,
+ g,
/*$$scope*/
- p[17],
+ g[17],
l ? get_slot_changes$3(
- g,
+ p,
/*$$scope*/
- p[17],
+ g[17],
E,
null
) : get_all_dirty_from_scope$3(
/*$$scope*/
- p[17]
+ g[17]
),
null
), set_dynamic_element_data(
/*tag*/
- p[14]
+ g[14]
)(s, o = get_spread_update$1(x, [
(!l || E & /*test_id*/
128) && { "data-testid": (
/*test_id*/
- p[7]
+ g[7]
) },
(!l || E & /*elem_id*/
4) && { id: (
/*elem_id*/
- p[2]
+ g[2]
) },
(!l || E & /*elem_classes*/
8 && e !== (e = "block " + /*elem_classes*/
- p[3].join(" ") + " svelte-1t38q2d")) && { class: e }
+ g[3].join(" ") + " svelte-1t38q2d")) && { class: e }
])), toggle_class$7(
s,
"hidden",
/*visible*/
- p[10] === !1
+ g[10] === !1
), toggle_class$7(
s,
"padded",
/*padding*/
- p[6]
+ g[6]
), toggle_class$7(
s,
"border_focus",
/*border_mode*/
- p[5] === "focus"
+ g[5] === "focus"
), toggle_class$7(s, "hide-container", !/*explicit_call*/
- p[8] && !/*container*/
- p[9]), E & /*height*/
+ g[8] && !/*container*/
+ g[9]), E & /*height*/
1 && set_style$3(
s,
"height",
/*get_dimension*/
- p[15](
+ g[15](
/*height*/
- p[0]
+ g[0]
)
), E & /*width*/
2 && set_style$3(s, "width", typeof /*width*/
- p[1] == "number" ? `calc(min(${/*width*/
- p[1]}px, 100%))` : (
+ g[1] == "number" ? `calc(min(${/*width*/
+ g[1]}px, 100%))` : (
/*get_dimension*/
- p[15](
+ g[15](
/*width*/
- p[1]
+ g[1]
)
)), E & /*variant*/
16 && set_style$3(
s,
"border-style",
/*variant*/
- p[4]
+ g[4]
), E & /*allow_overflow*/
2048 && set_style$3(
s,
"overflow",
/*allow_overflow*/
- p[11] ? "visible" : "hidden"
+ g[11] ? "visible" : "hidden"
), E & /*scale*/
4096 && set_style$3(
s,
"flex-grow",
/*scale*/
- p[12]
+ g[12]
), E & /*min_width*/
8192 && set_style$3(s, "min-width", `calc(min(${/*min_width*/
- p[13]}px, 100%))`);
+ g[13]}px, 100%))`);
},
- i(p) {
- l || (transition_in$7(_, p), l = !0);
+ i(g) {
+ l || (transition_in$7(_, g), l = !0);
},
- o(p) {
- transition_out$7(_, p), l = !1;
+ o(g) {
+ transition_out$7(_, g), l = !1;
},
- d(p) {
- p && detach$f(s), _ && _.d(p);
+ d(g) {
+ g && detach$f(s), _ && _.d(g);
}
};
}
@@ -220,12 +220,12 @@ function create_fragment$f(y) {
c() {
e && e.c();
},
- m(l, g) {
- e && e.m(l, g), s = !0;
+ m(l, p) {
+ e && e.m(l, p), s = !0;
},
- p(l, [g]) {
+ p(l, [p]) {
/*tag*/
- l[14] && e.p(l, g);
+ l[14] && e.p(l, p);
},
i(l) {
s || (transition_in$7(e, l), s = !0);
@@ -239,7 +239,7 @@ function create_fragment$f(y) {
};
}
function instance$d(y, s, e) {
- let { $$slots: l = {}, $$scope: g } = s, { height: _ = void 0 } = s, { width: x = void 0 } = s, { elem_id: o = "" } = s, { elem_classes: p = [] } = s, { variant: E = "solid" } = s, { border_mode: u = "base" } = s, { padding: A = !0 } = s, { type: C = "normal" } = s, { test_id: L = void 0 } = s, { explicit_call: D = !1 } = s, { container: r = !0 } = s, { visible: n = !0 } = s, { allow_overflow: b = !0 } = s, { scale: f = null } = s, { min_width: c = 0 } = s, t = C === "fieldset" ? "fieldset" : "div";
+ let { $$slots: l = {}, $$scope: p } = s, { height: _ = void 0 } = s, { width: x = void 0 } = s, { elem_id: o = "" } = s, { elem_classes: g = [] } = s, { variant: E = "solid" } = s, { border_mode: u = "base" } = s, { padding: A = !0 } = s, { type: L = "normal" } = s, { test_id: C = void 0 } = s, { explicit_call: D = !1 } = s, { container: r = !0 } = s, { visible: n = !0 } = s, { allow_overflow: b = !0 } = s, { scale: f = null } = s, { min_width: c = 0 } = s, t = L === "fieldset" ? "fieldset" : "div";
const a = (h) => {
if (h !== void 0) {
if (typeof h == "number")
@@ -249,16 +249,16 @@ function instance$d(y, s, e) {
}
};
return y.$$set = (h) => {
- "height" in h && e(0, _ = h.height), "width" in h && e(1, x = h.width), "elem_id" in h && e(2, o = h.elem_id), "elem_classes" in h && e(3, p = h.elem_classes), "variant" in h && e(4, E = h.variant), "border_mode" in h && e(5, u = h.border_mode), "padding" in h && e(6, A = h.padding), "type" in h && e(16, C = h.type), "test_id" in h && e(7, L = h.test_id), "explicit_call" in h && e(8, D = h.explicit_call), "container" in h && e(9, r = h.container), "visible" in h && e(10, n = h.visible), "allow_overflow" in h && e(11, b = h.allow_overflow), "scale" in h && e(12, f = h.scale), "min_width" in h && e(13, c = h.min_width), "$$scope" in h && e(17, g = h.$$scope);
+ "height" in h && e(0, _ = h.height), "width" in h && e(1, x = h.width), "elem_id" in h && e(2, o = h.elem_id), "elem_classes" in h && e(3, g = h.elem_classes), "variant" in h && e(4, E = h.variant), "border_mode" in h && e(5, u = h.border_mode), "padding" in h && e(6, A = h.padding), "type" in h && e(16, L = h.type), "test_id" in h && e(7, C = h.test_id), "explicit_call" in h && e(8, D = h.explicit_call), "container" in h && e(9, r = h.container), "visible" in h && e(10, n = h.visible), "allow_overflow" in h && e(11, b = h.allow_overflow), "scale" in h && e(12, f = h.scale), "min_width" in h && e(13, c = h.min_width), "$$scope" in h && e(17, p = h.$$scope);
}, [
_,
x,
o,
- p,
+ g,
E,
u,
A,
- L,
+ C,
D,
r,
n,
@@ -267,8 +267,8 @@ function instance$d(y, s, e) {
c,
t,
a,
- C,
- g,
+ L,
+ p,
l
];
}
@@ -313,7 +313,7 @@ function create_fragment$e(y) {
const l = (
/*#slots*/
y[1].default
- ), g = create_slot$2(
+ ), p = create_slot$2(
l,
y,
/*$$scope*/
@@ -322,15 +322,15 @@ function create_fragment$e(y) {
);
return {
c() {
- s = element$b("div"), g && g.c(), attr$d(s, "class", "svelte-1hnfib2");
+ s = element$b("div"), p && p.c(), attr$d(s, "class", "svelte-1hnfib2");
},
m(_, x) {
- insert$e(_, s, x), g && g.m(s, null), e = !0;
+ insert$e(_, s, x), p && p.m(s, null), e = !0;
},
p(_, [x]) {
- g && g.p && (!e || x & /*$$scope*/
+ p && p.p && (!e || x & /*$$scope*/
1) && update_slot_base$2(
- g,
+ p,
l,
_,
/*$$scope*/
@@ -349,21 +349,21 @@ function create_fragment$e(y) {
);
},
i(_) {
- e || (transition_in$6(g, _), e = !0);
+ e || (transition_in$6(p, _), e = !0);
},
o(_) {
- transition_out$6(g, _), e = !1;
+ transition_out$6(p, _), e = !1;
},
d(_) {
- _ && detach$e(s), g && g.d(_);
+ _ && detach$e(s), p && p.d(_);
}
};
}
function instance$c(y, s, e) {
- let { $$slots: l = {}, $$scope: g } = s;
+ let { $$slots: l = {}, $$scope: p } = s;
return y.$$set = (_) => {
- "$$scope" in _ && e(0, g = _.$$scope);
- }, [g, l];
+ "$$scope" in _ && e(0, p = _.$$scope);
+ }, [p, l];
}
class Info extends SvelteComponent$e {
constructor(s) {
@@ -406,13 +406,13 @@ function create_if_block$7(y) {
c() {
create_component$5(s.$$.fragment);
},
- m(l, g) {
- mount_component$5(s, l, g), e = !0;
+ m(l, p) {
+ mount_component$5(s, l, p), e = !0;
},
- p(l, g) {
+ p(l, p) {
const _ = {};
- g & /*$$scope, info*/
- 10 && (_.$$scope = { dirty: g, ctx: l }), s.$set(_);
+ p & /*$$scope, info*/
+ 10 && (_.$$scope = { dirty: p, ctx: l }), s.$set(_);
},
i(l) {
e || (transition_in$5(s.$$.fragment, l), e = !0);
@@ -451,7 +451,7 @@ function create_default_slot$2(y) {
};
}
function create_fragment$d(y) {
- let s, e, l, g;
+ let s, e, l, p;
const _ = (
/*#slots*/
y[2].default
@@ -477,60 +477,60 @@ function create_fragment$d(y) {
y[1] != null
);
},
- m(p, E) {
- insert$d(p, s, E), x && x.m(s, null), insert$d(p, e, E), o && o.m(p, E), insert$d(p, l, E), g = !0;
+ m(g, E) {
+ insert$d(g, s, E), x && x.m(s, null), insert$d(g, e, E), o && o.m(g, E), insert$d(g, l, E), p = !0;
},
- p(p, [E]) {
- x && x.p && (!g || E & /*$$scope*/
+ p(g, [E]) {
+ x && x.p && (!p || E & /*$$scope*/
8) && update_slot_base$1(
x,
_,
- p,
+ g,
/*$$scope*/
- p[3],
- g ? get_slot_changes$1(
+ g[3],
+ p ? get_slot_changes$1(
_,
/*$$scope*/
- p[3],
+ g[3],
E,
null
) : get_all_dirty_from_scope$1(
/*$$scope*/
- p[3]
+ g[3]
),
null
- ), (!g || E & /*show_label*/
+ ), (!p || E & /*show_label*/
1) && toggle_class$6(s, "sr-only", !/*show_label*/
- p[0]), (!g || E & /*show_label*/
+ g[0]), (!p || E & /*show_label*/
1) && toggle_class$6(s, "hide", !/*show_label*/
- p[0]), (!g || E & /*info*/
+ g[0]), (!p || E & /*info*/
2) && toggle_class$6(
s,
"has-info",
/*info*/
- p[1] != null
+ g[1] != null
), /*info*/
- p[1] ? o ? (o.p(p, E), E & /*info*/
- 2 && transition_in$5(o, 1)) : (o = create_if_block$7(p), o.c(), transition_in$5(o, 1), o.m(l.parentNode, l)) : o && (group_outros$5(), transition_out$5(o, 1, 1, () => {
+ g[1] ? o ? (o.p(g, E), E & /*info*/
+ 2 && transition_in$5(o, 1)) : (o = create_if_block$7(g), o.c(), transition_in$5(o, 1), o.m(l.parentNode, l)) : o && (group_outros$5(), transition_out$5(o, 1, 1, () => {
o = null;
}), check_outros$5());
},
- i(p) {
- g || (transition_in$5(x, p), transition_in$5(o), g = !0);
+ i(g) {
+ p || (transition_in$5(x, g), transition_in$5(o), p = !0);
},
- o(p) {
- transition_out$5(x, p), transition_out$5(o), g = !1;
+ o(g) {
+ transition_out$5(x, g), transition_out$5(o), p = !1;
},
- d(p) {
- p && (detach$d(s), detach$d(e), detach$d(l)), x && x.d(p), o && o.d(p);
+ d(g) {
+ g && (detach$d(s), detach$d(e), detach$d(l)), x && x.d(g), o && o.d(g);
}
};
}
function instance$b(y, s, e) {
- let { $$slots: l = {}, $$scope: g } = s, { show_label: _ = !0 } = s, { info: x = void 0 } = s;
+ let { $$slots: l = {}, $$scope: p } = s, { show_label: _ = !0 } = s, { info: x = void 0 } = s;
return y.$$set = (o) => {
- "show_label" in o && e(0, _ = o.show_label), "info" in o && e(1, x = o.info), "$$scope" in o && e(3, g = o.$$scope);
- }, [_, x, l, g];
+ "show_label" in o && e(0, _ = o.show_label), "info" in o && e(1, x = o.info), "$$scope" in o && e(3, p = o.$$scope);
+ }, [_, x, l, p];
}
class BlockTitle extends SvelteComponent$d {
constructor(s) {
@@ -554,8 +554,8 @@ function create_fragment$c(y) {
c() {
s = svg_element$3("svg"), e = svg_element$3("polyline"), attr$b(e, "points", "20 6 9 17 4 12"), attr$b(s, "xmlns", "http://www.w3.org/2000/svg"), attr$b(s, "viewBox", "2 0 20 20"), attr$b(s, "fill", "none"), attr$b(s, "stroke", "currentColor"), attr$b(s, "stroke-width", "3"), attr$b(s, "stroke-linecap", "round"), attr$b(s, "stroke-linejoin", "round");
},
- m(l, g) {
- insert$c(l, s, g), append$a(s, e);
+ m(l, p) {
+ insert$c(l, s, p), append$a(s, e);
},
p: noop$c,
i: noop$c,
@@ -587,14 +587,14 @@ function create_fragment$b(y) {
c() {
s = svg_element$2("svg"), e = svg_element$2("path"), l = svg_element$2("path"), attr$a(e, "fill", "currentColor"), attr$a(e, "d", "M28 10v18H10V10h18m0-2H10a2 2 0 0 0-2 2v18a2 2 0 0 0 2 2h18a2 2 0 0 0 2-2V10a2 2 0 0 0-2-2Z"), attr$a(l, "fill", "currentColor"), attr$a(l, "d", "M4 18H2V4a2 2 0 0 1 2-2h14v2H4Z"), attr$a(s, "xmlns", "http://www.w3.org/2000/svg"), attr$a(s, "viewBox", "0 0 33 33"), attr$a(s, "color", "currentColor");
},
- m(g, _) {
- insert$b(g, s, _), append$9(s, e), append$9(s, l);
+ m(p, _) {
+ insert$b(p, s, _), append$9(s, e), append$9(s, l);
},
p: noop$b,
i: noop$b,
o: noop$b,
- d(g) {
- g && detach$b(s);
+ d(p) {
+ p && detach$b(s);
}
};
}
@@ -937,8 +937,8 @@ function create_if_block$6(y) {
c() {
s = element$9("button"), s.innerHTML = ' Covalent modifcation', attr$9(s, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx");
},
- m(g, _) {
- insert$a(g, s, _), e || (l = listen$4(
+ m(p, _) {
+ insert$a(p, s, _), e || (l = listen$4(
s,
"click",
/*click_handler_3*/
@@ -946,22 +946,22 @@ function create_if_block$6(y) {
), e = !0);
},
p: noop$a,
- d(g) {
- g && detach$a(s), e = !1, l();
+ d(p) {
+ p && detach$a(s), e = !1, l();
}
};
}
function create_fragment$a(y) {
- let s, e, l, g, _, x, o, p, E, u, A = (
+ let s, e, l, p, _, x, o, g, E, u, A = (
/*displayCovMod*/
y[0] && create_if_block$6(y)
);
return {
c() {
- s = element$9("div"), e = element$9("div"), l = element$9("button"), l.innerHTML = ' Protein', g = space$8(), _ = element$9("button"), _.innerHTML = ' Nucleic acid', x = space$8(), o = element$9("button"), o.innerHTML = ' Small molecule', p = space$8(), A && A.c(), attr$9(l, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(_, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(o, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(e, "class", "flex justify-center mt-2 svelte-8wrmgx"), attr$9(s, "class", "svelte-8wrmgx");
+ s = element$9("div"), e = element$9("div"), l = element$9("button"), l.innerHTML = ' Protein', p = space$8(), _ = element$9("button"), _.innerHTML = ' Nucleic acid', x = space$8(), o = element$9("button"), o.innerHTML = ' Small molecule', g = space$8(), A && A.c(), attr$9(l, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(_, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(o, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(e, "class", "flex justify-center mt-2 svelte-8wrmgx"), attr$9(s, "class", "svelte-8wrmgx");
},
- m(C, L) {
- insert$a(C, s, L), append$8(s, e), append$8(e, l), append$8(e, g), append$8(e, _), append$8(e, x), append$8(e, o), append$8(e, p), A && A.m(e, null), E || (u = [
+ m(L, C) {
+ insert$a(L, s, C), append$8(s, e), append$8(e, l), append$8(e, p), append$8(e, _), append$8(e, x), append$8(e, o), append$8(e, g), A && A.m(e, null), E || (u = [
listen$4(
l,
"click",
@@ -982,28 +982,28 @@ function create_fragment$a(y) {
)
], E = !0);
},
- p(C, [L]) {
+ p(L, [C]) {
/*displayCovMod*/
- C[0] ? A ? A.p(C, L) : (A = create_if_block$6(C), A.c(), A.m(e, null)) : A && (A.d(1), A = null);
+ L[0] ? A ? A.p(L, C) : (A = create_if_block$6(L), A.c(), A.m(e, null)) : A && (A.d(1), A = null);
},
i: noop$a,
o: noop$a,
- d(C) {
- C && detach$a(s), A && A.d(), E = !1, run_all$4(u);
+ d(L) {
+ L && detach$a(s), A && A.d(), E = !1, run_all$4(u);
}
};
}
function instance$a(y, s, e) {
const l = createEventDispatcher$5();
- let { vals: g = [] } = s;
- function _(C) {
- l("addNewChain", { type: C });
+ let { vals: p = [] } = s;
+ function _(L) {
+ l("addNewChain", { type: L });
}
function x() {
l("addCovalentModification");
}
let o = !1;
- const p = () => {
+ const g = () => {
_("protein");
}, E = () => {
_("DNA");
@@ -1012,17 +1012,17 @@ function instance$a(y, s, e) {
}, A = () => {
x();
};
- return y.$$set = (C) => {
- "vals" in C && e(3, g = C.vals);
+ return y.$$set = (L) => {
+ "vals" in L && e(3, p = L.vals);
}, y.$$.update = () => {
y.$$.dirty & /*vals*/
- 8 && e(0, o = g.filter((C) => C.class === "protein" && C.sequence.length > 0).length > 0 && g.filter((C) => C.class === "ligand" && C.sdf != "").length > 0);
+ 8 && e(0, o = p.filter((L) => L.class === "protein" && L.sequence.length > 0).length > 0 && p.filter((L) => L.class === "ligand" && L.sdf != "").length > 0);
}, [
o,
_,
x,
- g,
p,
+ g,
E,
u,
A
@@ -1050,17 +1050,17 @@ const SearchInput_svelte_svelte_type_style_lang = "", {
text: text$7
} = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$4 } = window.__gradio__svelte__internal;
function create_fragment$9(y) {
- let s, e, l, g, _, x = (
+ let s, e, l, p, _, x = (
/*databases*/
y[1][
/*currentSel*/
y[3]
] + ""
- ), o, p, E, u, A, C, L, D, r, n;
+ ), o, g, E, u, A, L, C, D, r, n;
return {
c() {
- s = element$8("form"), e = element$8("div"), l = element$8("label"), l.textContent = "Search", g = space$7(), _ = element$8("button"), o = text$7(x), p = space$7(), E = element$8("div"), E.innerHTML = '
', u = space$7(), A = element$8("div"), C = element$8("input"), L = space$7(), D = element$8("button"), D.innerHTML = ' Search', attr$8(l, "for", "search-dropdown"), attr$8(l, "class", "mb-2 text-sm font-medium text-gray-900 sr-only dark:text-white svelte-8wrmgx"), attr$8(_, "id", "dropdown-button"), attr$8(_, "data-dropdown-toggle", "dropdown"), attr$8(_, "class", "flex-shrink-0 z-10 inline-flex items-center py-2.5 px-4 text-sm font-medium text-center text-gray-900 bg-gray-100 border border-gray-300 rounded-s-lg hover:bg-gray-200 focus:ring-4 focus:outline-none focus:ring-gray-100 dark:bg-gray-700 dark:hover:bg-gray-600 dark:focus:ring-gray-700 dark:text-white dark:border-gray-600 svelte-8wrmgx"), attr$8(_, "type", "button"), attr$8(E, "id", "dropdown"), attr$8(E, "class", "z-10 hidden bg-white divide-y divide-gray-100 rounded-lg shadow w-44 dark:bg-gray-700 svelte-8wrmgx"), attr$8(C, "type", "search"), attr$8(C, "id", "search-dropdown"), attr$8(C, "class", "block p-2.5 w-full z-20 text-sm text-gray-900 bg-gray-50 rounded-e-lg border-s-gray-50 border-s-2 border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-s-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:border-blue-500 svelte-8wrmgx"), attr$8(
- C,
+ s = element$8("form"), e = element$8("div"), l = element$8("label"), l.textContent = "Search", p = space$7(), _ = element$8("button"), o = text$7(x), g = space$7(), E = element$8("div"), E.innerHTML = '
', u = space$7(), A = element$8("div"), L = element$8("input"), C = space$7(), D = element$8("button"), D.innerHTML = ' Search', attr$8(l, "for", "search-dropdown"), attr$8(l, "class", "mb-2 text-sm font-medium text-gray-900 sr-only dark:text-white svelte-8wrmgx"), attr$8(_, "id", "dropdown-button"), attr$8(_, "data-dropdown-toggle", "dropdown"), attr$8(_, "class", "flex-shrink-0 z-10 inline-flex items-center py-2.5 px-4 text-sm font-medium text-center text-gray-900 bg-gray-100 border border-gray-300 rounded-s-lg hover:bg-gray-200 focus:ring-4 focus:outline-none focus:ring-gray-100 dark:bg-gray-700 dark:hover:bg-gray-600 dark:focus:ring-gray-700 dark:text-white dark:border-gray-600 svelte-8wrmgx"), attr$8(_, "type", "button"), attr$8(E, "id", "dropdown"), attr$8(E, "class", "z-10 hidden bg-white divide-y divide-gray-100 rounded-lg shadow w-44 dark:bg-gray-700 svelte-8wrmgx"), attr$8(L, "type", "search"), attr$8(L, "id", "search-dropdown"), attr$8(L, "class", "block p-2.5 w-full z-20 text-sm text-gray-900 bg-gray-50 rounded-e-lg border-s-gray-50 border-s-2 border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-s-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:border-blue-500 svelte-8wrmgx"), attr$8(
+ L,
"placeholder",
/*placeholder*/
y[2][
@@ -1070,9 +1070,9 @@ function create_fragment$9(y) {
), attr$8(D, "type", "submit"), attr$8(D, "class", "absolute top-0 end-0 p-2.5 text-sm font-medium h-full text-white bg-blue-700 rounded-e-lg border border-blue-700 hover:bg-blue-800 focus:ring-4 focus:outline-none focus:ring-blue-300 dark:bg-blue-600 dark:hover:bg-blue-700 dark:focus:ring-blue-800 svelte-8wrmgx"), attr$8(A, "class", "relative w-full svelte-8wrmgx"), attr$8(e, "class", "flex svelte-8wrmgx"), attr$8(s, "class", "max-w-lg mx-auto mb-2 my-2 svelte-8wrmgx");
},
m(b, f) {
- insert$9(b, s, f), append$7(s, e), append$7(e, l), append$7(e, g), append$7(e, _), append$7(_, o), append$7(e, p), append$7(e, E), append$7(e, u), append$7(e, A), append$7(A, C), append$7(A, L), append$7(A, D), r || (n = [
+ insert$9(b, s, f), append$7(s, e), append$7(e, l), append$7(e, p), append$7(e, _), append$7(_, o), append$7(e, g), append$7(e, E), append$7(e, u), append$7(e, A), append$7(A, L), append$7(A, C), append$7(A, D), r || (n = [
listen$3(
- C,
+ L,
"input",
/*input_handler*/
y[7]
@@ -1093,7 +1093,7 @@ function create_fragment$9(y) {
}
function instance$9(y, s, e) {
const l = createEventDispatcher$4();
- let { database: g = "rcsb-bioass" } = s, { index: _ = 0 } = s, x = {
+ let { database: p = "rcsb-bioass" } = s, { index: _ = 0 } = s, x = {
"rcsb-3ligand": "RCSB 3-Letter Codes",
pubchem: "Pubchem",
"rcsb-bioass": "RCSB BioAssembly"
@@ -1101,24 +1101,24 @@ function instance$9(y, s, e) {
"rcsb-3ligand": "e.g HEM, ZN, K, GOL ...",
pubchem: "molecule name",
"rcsb-bioass": "4 Letter PDB Code"
- }, p = g, E = "";
+ }, g = p, E = "";
function u() {
l("triggerFetch", {
text: E,
- database: p,
+ database: g,
index: _
});
}
- const A = (C) => e(0, E = C.target.value);
- return y.$$set = (C) => {
- "database" in C && e(5, g = C.database), "index" in C && e(6, _ = C.index);
+ const A = (L) => e(0, E = L.target.value);
+ return y.$$set = (L) => {
+ "database" in L && e(5, p = L.database), "index" in L && e(6, _ = L.index);
}, [
E,
x,
o,
- p,
- u,
g,
+ u,
+ p,
_,
A
];
@@ -1156,10 +1156,10 @@ function create_each_block_1$2(y) {
let s, e, l = (
/*letter*/
y[6] + ""
- ), g;
+ ), p;
return {
c() {
- s = element$7("span"), e = element$7("div"), g = text$6(l), attr$7(e, "class", "inline-block p-0.5 svelte-hhspdt"), attr$7(e, "title", "residue " + /*chunk_ids*/
+ s = element$7("span"), e = element$7("div"), p = text$6(l), attr$7(e, "class", "inline-block p-0.5 svelte-hhspdt"), attr$7(e, "title", "residue " + /*chunk_ids*/
y[1][
/*i*/
y[5]
@@ -1169,7 +1169,7 @@ function create_each_block_1$2(y) {
]), attr$7(s, "class", "p-0.1 text-center w-full inline hover:font-bold cursor-pointer item-selectable ds-selectable svelte-hhspdt"), set_style$2(s, "font-family", "monospace");
},
m(_, x) {
- insert$8(_, s, x), append$6(s, e), append$6(e, g);
+ insert$8(_, s, x), append$6(s, e), append$6(e, p);
},
p: noop$8,
d(_) {
@@ -1181,20 +1181,20 @@ function create_each_block$2(y) {
let s, e, l = ensure_array_like$2(
/*chunk*/
y[3]
- ), g = [];
+ ), p = [];
for (let _ = 0; _ < l.length; _ += 1)
- g[_] = create_each_block_1$2(get_each_context_1$2(y, l, _));
+ p[_] = create_each_block_1$2(get_each_context_1$2(y, l, _));
return {
c() {
s = element$7("div");
- for (let _ = 0; _ < g.length; _ += 1)
- g[_].c();
+ for (let _ = 0; _ < p.length; _ += 1)
+ p[_].c();
e = space$6(), attr$7(s, "class", "sequence__chunk svelte-hhspdt");
},
m(_, x) {
insert$8(_, s, x);
- for (let o = 0; o < g.length; o += 1)
- g[o] && g[o].m(s, null);
+ for (let o = 0; o < p.length; o += 1)
+ p[o] && p[o].m(s, null);
append$6(s, e);
},
p(_, x) {
@@ -1206,16 +1206,16 @@ function create_each_block$2(y) {
);
let o;
for (o = 0; o < l.length; o += 1) {
- const p = get_each_context_1$2(_, l, o);
- g[o] ? g[o].p(p, x) : (g[o] = create_each_block_1$2(p), g[o].c(), g[o].m(s, e));
+ const g = get_each_context_1$2(_, l, o);
+ p[o] ? p[o].p(g, x) : (p[o] = create_each_block_1$2(g), p[o].c(), p[o].m(s, e));
}
- for (; o < g.length; o += 1)
- g[o].d(1);
- g.length = l.length;
+ for (; o < p.length; o += 1)
+ p[o].d(1);
+ p.length = l.length;
}
},
d(_) {
- _ && detach$8(s), destroy_each$2(g, _);
+ _ && detach$8(s), destroy_each$2(p, _);
}
};
}
@@ -1224,30 +1224,30 @@ function create_fragment$8(y) {
/*chunked_seq*/
y[0]
), l = [];
- for (let g = 0; g < e.length; g += 1)
- l[g] = create_each_block$2(get_each_context$2(y, e, g));
+ for (let p = 0; p < e.length; p += 1)
+ l[p] = create_each_block$2(get_each_context$2(y, e, p));
return {
c() {
s = element$7("div");
- for (let g = 0; g < l.length; g += 1)
- l[g].c();
+ for (let p = 0; p < l.length; p += 1)
+ l[p].c();
attr$7(s, "class", "sequence_container text-xs svelte-hhspdt");
},
- m(g, _) {
- insert$8(g, s, _);
+ m(p, _) {
+ insert$8(p, s, _);
for (let x = 0; x < l.length; x += 1)
l[x] && l[x].m(s, null);
},
- p(g, [_]) {
+ p(p, [_]) {
if (_ & /*chunked_seq, chunk_ids*/
3) {
e = ensure_array_like$2(
/*chunked_seq*/
- g[0]
+ p[0]
);
let x;
for (x = 0; x < e.length; x += 1) {
- const o = get_each_context$2(g, e, x);
+ const o = get_each_context$2(p, e, x);
l[x] ? l[x].p(o, _) : (l[x] = create_each_block$2(o), l[x].c(), l[x].m(s, null));
}
for (; x < l.length; x += 1)
@@ -1257,16 +1257,16 @@ function create_fragment$8(y) {
},
i: noop$8,
o: noop$8,
- d(g) {
- g && detach$8(s), destroy_each$2(l, g);
+ d(p) {
+ p && detach$8(s), destroy_each$2(l, p);
}
};
}
function instance$8(y, s, e) {
- let { seq: l = "" } = s, g = l.match(/.{1,10}/g), _ = g.map((x, o) => x.split("").map((p, E) => o * 10 + E + 1));
+ let { seq: l = "" } = s, p = l.match(/.{1,10}/g), _ = p.map((x, o) => x.split("").map((g, E) => o * 10 + E + 1));
return y.$$set = (x) => {
"seq" in x && e(2, l = x.seq);
- }, [g, _, l];
+ }, [p, _, l];
}
class Sequence extends SvelteComponent$8 {
constructor(s) {
@@ -1309,9 +1309,9 @@ var _3Dmol = { exports: {} };
/*! ./text */
"./node_modules/iobuffer/lib-esm/text.browser.js"
);
- const g = 1024 * 8, _ = (() => {
- const p = new Uint8Array(4), E = new Uint32Array(p.buffer);
- return !((E[0] = 1) & p[0]);
+ const p = 1024 * 8, _ = (() => {
+ const g = new Uint8Array(4), E = new Uint32Array(g.buffer);
+ return !((E[0] = 1) & g[0]);
})(), x = {
int8: globalThis.Int8Array,
uint8: globalThis.Uint8Array,
@@ -1333,12 +1333,12 @@ var _3Dmol = { exports: {} };
* or a Node.js Buffer, a view will be created over the underlying ArrayBuffer.
* @param options
*/
- constructor(E = g, u = {}) {
+ constructor(E = p, u = {}) {
let A = !1;
typeof E == "number" ? E = new ArrayBuffer(E) : (A = !0, this.lastWrittenByte = E.byteLength);
- const C = u.offset ? u.offset >>> 0 : 0, L = E.byteLength - C;
- let D = C;
- (ArrayBuffer.isView(E) || E instanceof o) && (E.byteLength !== E.buffer.byteLength && (D = E.byteOffset + C), E = E.buffer), A ? this.lastWrittenByte = L : this.lastWrittenByte = 0, this.buffer = E, this.length = L, this.byteLength = L, this.byteOffset = D, this.offset = 0, this.littleEndian = !0, this._data = new DataView(this.buffer, D, L), this._mark = 0, this._marks = [];
+ const L = u.offset ? u.offset >>> 0 : 0, C = E.byteLength - L;
+ let D = L;
+ (ArrayBuffer.isView(E) || E instanceof o) && (E.byteLength !== E.buffer.byteLength && (D = E.byteOffset + L), E = E.buffer), A ? this.lastWrittenByte = C : this.lastWrittenByte = 0, this.buffer = E, this.length = C, this.byteLength = C, this.byteOffset = D, this.offset = 0, this.littleEndian = !0, this._data = new DataView(this.buffer, D, C), this._mark = 0, this._marks = [];
}
/**
* Checks if the memory allocated to the buffer is sufficient to store more
@@ -1444,8 +1444,8 @@ var _3Dmol = { exports: {} };
*/
ensureAvailable(E = 1) {
if (!this.available(E)) {
- const A = (this.offset + E) * 2, C = new Uint8Array(A);
- C.set(new Uint8Array(this.buffer)), this.buffer = C.buffer, this.length = this.byteLength = A, this._data = new DataView(this.buffer);
+ const A = (this.offset + E) * 2, L = new Uint8Array(A);
+ L.set(new Uint8Array(this.buffer)), this.buffer = L.buffer, this.length = this.byteLength = A, this._data = new DataView(this.buffer);
}
return this;
}
@@ -1487,14 +1487,14 @@ var _3Dmol = { exports: {} };
* @param type - number type of elements to read
*/
readArray(E, u) {
- const A = x[u].BYTES_PER_ELEMENT * E, C = this.byteOffset + this.offset, L = this.buffer.slice(C, C + A);
+ const A = x[u].BYTES_PER_ELEMENT * E, L = this.byteOffset + this.offset, C = this.buffer.slice(L, L + A);
if (this.littleEndian === _ && u !== "uint8" && u !== "int8") {
- const r = new Uint8Array(this.buffer.slice(C, C + A));
+ const r = new Uint8Array(this.buffer.slice(L, L + A));
r.reverse();
const n = new x[u](r.buffer);
return this.offset += A, n.reverse(), n;
}
- const D = new x[u](L);
+ const D = new x[u](C);
return this.offset += A, D;
}
/**
@@ -1732,12 +1732,12 @@ var _3Dmol = { exports: {} };
}
Object.defineProperty(s.prototype, "encoding", {
value: "utf-8"
- }), s.prototype.encode = function(l, g = { stream: !1 }) {
- if (g.stream)
+ }), s.prototype.encode = function(l, p = { stream: !1 }) {
+ if (p.stream)
throw new Error("Failed to encode: the 'stream' option is unsupported.");
let _ = 0;
const x = l.length;
- let o = 0, p = Math.max(32, x + (x >> 1) + 7), E = new Uint8Array(p >> 3 << 3);
+ let o = 0, g = Math.max(32, x + (x >> 1) + 7), E = new Uint8Array(g >> 3 << 3);
for (; _ < x; ) {
let u = l.charCodeAt(_++);
if (u >= 55296 && u <= 56319) {
@@ -1749,8 +1749,8 @@ var _3Dmol = { exports: {} };
continue;
}
if (o + 4 > E.length) {
- p += 8, p *= 1 + _ / l.length * 2, p = p >> 3 << 3;
- const A = new Uint8Array(p);
+ g += 8, g *= 1 + _ / l.length * 2, g = g >> 3 << 3;
+ const A = new Uint8Array(g);
A.set(E), E = A;
}
if (u & 4294967168)
@@ -1770,41 +1770,41 @@ var _3Dmol = { exports: {} };
}
return E.slice(0, o);
};
- function e(l = "utf-8", g = { fatal: !1 }) {
+ function e(l = "utf-8", p = { fatal: !1 }) {
if (l !== "utf-8")
throw new RangeError(`Failed to construct 'TextDecoder': The encoding label provided ('${l}') is invalid.`);
- if (g.fatal)
+ if (p.fatal)
throw new Error("Failed to construct 'TextDecoder': the 'fatal' option is unsupported.");
}
Object.defineProperty(e.prototype, "encoding", {
value: "utf-8"
}), Object.defineProperty(e.prototype, "fatal", { value: !1 }), Object.defineProperty(e.prototype, "ignoreBOM", {
value: !1
- }), e.prototype.decode = function(l, g = { stream: !1 }) {
- if (g.stream)
+ }), e.prototype.decode = function(l, p = { stream: !1 }) {
+ if (p.stream)
throw new Error("Failed to decode: the 'stream' option is unsupported.");
const _ = new Uint8Array(l);
let x = 0;
- const o = _.length, p = [];
+ const o = _.length, g = [];
for (; x < o; ) {
const E = _[x++];
if (E === 0)
break;
if (!(E & 128))
- p.push(E);
+ g.push(E);
else if ((E & 224) === 192) {
const u = _[x++] & 63;
- p.push((E & 31) << 6 | u);
+ g.push((E & 31) << 6 | u);
} else if ((E & 240) === 224) {
const u = _[x++] & 63, A = _[x++] & 63;
- p.push((E & 31) << 12 | u << 6 | A);
+ g.push((E & 31) << 12 | u << 6 | A);
} else if ((E & 248) === 240) {
- const u = _[x++] & 63, A = _[x++] & 63, C = _[x++] & 63;
- let L = (E & 7) << 18 | u << 12 | A << 6 | C;
- L > 65535 && (L -= 65536, p.push(L >>> 10 & 1023 | 55296), L = 56320 | L & 1023), p.push(L);
+ const u = _[x++] & 63, A = _[x++] & 63, L = _[x++] & 63;
+ let C = (E & 7) << 18 | u << 12 | A << 6 | L;
+ C > 65535 && (C -= 65536, g.push(C >>> 10 & 1023 | 55296), C = 56320 | C & 1023), g.push(C);
}
}
- return String.fromCharCode.apply(null, p);
+ return String.fromCharCode.apply(null, g);
}, y.TextEncoder = s, y.TextDecoder = e;
})(typeof window < "u" ? window : typeof self < "u" ? self : this);
}
@@ -1835,9 +1835,9 @@ var _3Dmol = { exports: {} };
function l(x, o = "utf8") {
return new TextDecoder(o).decode(x);
}
- const g = new TextEncoder();
+ const p = new TextEncoder();
function _(x) {
- return g.encode(x);
+ return p.encode(x);
}
}
),
@@ -1852,7 +1852,7 @@ var _3Dmol = { exports: {} };
/* harmony export */
nonRecord: () => (
/* binding */
- g
+ p
),
/* harmony export */
record: () => (
@@ -1865,22 +1865,22 @@ var _3Dmol = { exports: {} };
/*! ./types */
"./node_modules/netcdfjs/lib-esm/types.js"
);
- function g(x, o) {
- const p = (0, l.str2num)(o.type), E = o.size / (0, l.num2bytes)(p), u = new Array(E);
+ function p(x, o) {
+ const g = (0, l.str2num)(o.type), E = o.size / (0, l.num2bytes)(g), u = new Array(E);
for (let A = 0; A < E; A++)
- u[A] = (0, l.readType)(x, p, 1);
+ u[A] = (0, l.readType)(x, g, 1);
return u;
}
- function _(x, o, p) {
- const E = (0, l.str2num)(o.type), u = o.size ? o.size / (0, l.num2bytes)(E) : 1, A = p.length, C = new Array(A), L = p.recordStep;
- if (L)
+ function _(x, o, g) {
+ const E = (0, l.str2num)(o.type), u = o.size ? o.size / (0, l.num2bytes)(E) : 1, A = g.length, L = new Array(A), C = g.recordStep;
+ if (C)
for (let D = 0; D < A; D++) {
const r = x.offset;
- C[D] = (0, l.readType)(x, E, u), x.seek(r + L);
+ L[D] = (0, l.readType)(x, E, u), x.seek(r + C);
}
else
throw new Error("recordDimension.recordStep is undefined");
- return C;
+ return L;
}
}
),
@@ -1902,17 +1902,17 @@ var _3Dmol = { exports: {} };
var l = e(
/*! ./types */
"./node_modules/netcdfjs/lib-esm/types.js"
- ), g = e(
+ ), p = e(
/*! ./utils */
"./node_modules/netcdfjs/lib-esm/utils.js"
);
- const _ = 0, x = 10, o = 11, p = 12, E = 0;
+ const _ = 0, x = 10, o = 11, g = 12, E = 0;
function u(D, r) {
const n = { version: r }, b = {
length: D.readUint32()
}, f = A(D);
- Array.isArray(f) || (b.id = f.recordId, b.name = f.recordName, n.dimensions = f.dimensions), n.globalAttributes = C(D);
- const c = L(D, b == null ? void 0 : b.id, r);
+ Array.isArray(f) || (b.id = f.recordId, b.name = f.recordName, n.dimensions = f.dimensions), n.globalAttributes = L(D);
+ const c = C(D, b == null ? void 0 : b.id, r);
return Array.isArray(c) || (n.variables = c.variables, b.recordStep = c.recordStep), n.recordDimension = b, n;
}
function A(D) {
@@ -1921,13 +1921,13 @@ var _3Dmol = { exports: {} };
const f = D.readUint32();
let c;
if (f === _)
- return (0, g.notNetcdf)(D.readUint32() !== _, "wrong empty tag for list of dimensions"), [];
+ return (0, p.notNetcdf)(D.readUint32() !== _, "wrong empty tag for list of dimensions"), [];
{
- (0, g.notNetcdf)(f !== x, "wrong tag for list of dimensions");
+ (0, p.notNetcdf)(f !== x, "wrong tag for list of dimensions");
const t = D.readUint32();
c = new Array(t);
for (let a = 0; a < t; a++) {
- const h = (0, g.readName)(D), M = D.readUint32();
+ const h = (0, p.readName)(D), M = D.readUint32();
M === E && (n = a, b = h), c[a] = {
name: h,
size: M
@@ -1936,20 +1936,20 @@ var _3Dmol = { exports: {} };
}
return n !== void 0 && (r.recordId = n), b !== void 0 && (r.recordName = b), r.dimensions = c, r;
}
- function C(D) {
+ function L(D) {
const r = D.readUint32();
let n;
if (r === _)
- return (0, g.notNetcdf)(D.readUint32() !== _, "wrong empty tag for list of attributes"), [];
+ return (0, p.notNetcdf)(D.readUint32() !== _, "wrong empty tag for list of attributes"), [];
{
- (0, g.notNetcdf)(r !== p, "wrong tag for list of attributes");
+ (0, p.notNetcdf)(r !== g, "wrong tag for list of attributes");
const b = D.readUint32();
n = new Array(b);
for (let f = 0; f < b; f++) {
- const c = (0, g.readName)(D), t = D.readUint32();
- (0, g.notNetcdf)(t < 1 || t > 6, `non valid type ${t}`);
+ const c = (0, p.readName)(D), t = D.readUint32();
+ (0, p.notNetcdf)(t < 1 || t > 6, `non valid type ${t}`);
const a = D.readUint32(), h = (0, l.readType)(D, t, a);
- (0, g.padding)(D), n[f] = {
+ (0, p.padding)(D), n[f] = {
name: c,
type: (0, l.num2str)(t),
value: h
@@ -1958,24 +1958,24 @@ var _3Dmol = { exports: {} };
}
return n;
}
- function L(D, r, n) {
+ function C(D, r, n) {
const b = D.readUint32();
let f = 0, c;
if (b === _)
- return (0, g.notNetcdf)(D.readUint32() !== _, "wrong empty tag for list of variables"), [];
+ return (0, p.notNetcdf)(D.readUint32() !== _, "wrong empty tag for list of variables"), [];
{
- (0, g.notNetcdf)(b !== o, "wrong tag for list of variables");
+ (0, p.notNetcdf)(b !== o, "wrong tag for list of variables");
const t = D.readUint32();
c = new Array(t);
for (let a = 0; a < t; a++) {
- const h = (0, g.readName)(D), M = D.readUint32(), w = new Array(M);
+ const h = (0, p.readName)(D), M = D.readUint32(), w = new Array(M);
for (let B = 0; B < M; B++)
w[B] = D.readUint32();
- const S = C(D), T = D.readUint32();
- (0, g.notNetcdf)(T < 1 && T > 6, `non valid type ${T}`);
+ const S = L(D), T = D.readUint32();
+ (0, p.notNetcdf)(T < 1 && T > 6, `non valid type ${T}`);
const R = D.readUint32();
- let z = D.readUint32();
- n === 2 && ((0, g.notNetcdf)(z > 0, "offsets larger than 4GB not supported"), z = D.readUint32());
+ let $ = D.readUint32();
+ n === 2 && ((0, p.notNetcdf)($ > 0, "offsets larger than 4GB not supported"), $ = D.readUint32());
let P = !1;
typeof r < "u" && w[0] === r && (f += R, P = !0), c[a] = {
name: h,
@@ -1983,7 +1983,7 @@ var _3Dmol = { exports: {} };
attributes: S,
type: (0, l.num2str)(T),
size: R,
- offset: z,
+ offset: $,
record: P
};
}
@@ -2027,14 +2027,14 @@ var _3Dmol = { exports: {} };
/* harmony export */
NetCDFReader: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! iobuffer */
"./node_modules/iobuffer/lib-esm/IOBuffer.js"
- ), g = e(
+ ), p = e(
/*! ./data */
"./node_modules/netcdfjs/lib-esm/data.js"
), _ = e(
@@ -2047,13 +2047,13 @@ var _3Dmol = { exports: {} };
/*! ./utils */
"./node_modules/netcdfjs/lib-esm/utils.js"
);
- class p {
+ class g {
constructor(u) {
this.toString = x.toString;
const A = new l.IOBuffer(u);
A.setBigEndian(), (0, o.notNetcdf)(A.readChars(3) !== "CDF", "should start with CDF");
- const C = A.readByte();
- (0, o.notNetcdf)(C > 2, "unknown version"), this.header = (0, _.header)(A, C), this.buffer = A;
+ const L = A.readByte();
+ (0, o.notNetcdf)(L > 2, "unknown version"), this.header = (0, _.header)(A, L), this.buffer = A;
}
/**
* @return - Version for the NetCDF format
@@ -2094,7 +2094,7 @@ var _3Dmol = { exports: {} };
* @return - Value of the attributeName or null
*/
getAttribute(u) {
- const A = this.globalAttributes.find((C) => C.name === u);
+ const A = this.globalAttributes.find((L) => L.name === u);
return A ? A.value : null;
}
/**
@@ -2116,9 +2116,9 @@ var _3Dmol = { exports: {} };
*/
getDataVariable(u) {
let A;
- if (typeof u == "string" ? A = this.header.variables.find((C) => C.name === u) : A = u, A === void 0)
+ if (typeof u == "string" ? A = this.header.variables.find((L) => L.name === u) : A = u, A === void 0)
throw new Error("Not a valid NetCDF v3.x file: variable not found");
- return this.buffer.seek(A.offset), A.record ? (0, g.record)(this.buffer, A, this.header.recordDimension) : (0, g.nonRecord)(this.buffer, A);
+ return this.buffer.seek(A.offset), A.record ? (0, p.record)(this.buffer, A, this.header.recordDimension) : (0, p.nonRecord)(this.buffer, A);
}
/**
* Check if a dataVariable exists
@@ -2126,7 +2126,7 @@ var _3Dmol = { exports: {} };
* @return boolean
*/
dataVariableExists(u) {
- return this.header.variables.find((C) => C.name === u) !== void 0;
+ return this.header.variables.find((L) => L.name === u) !== void 0;
}
/**
* Check if an attribute exists
@@ -2134,7 +2134,7 @@ var _3Dmol = { exports: {} };
* @return boolean
*/
attributeExists(u) {
- return this.globalAttributes.find((C) => C.name === u) !== void 0;
+ return this.globalAttributes.find((L) => L.name === u) !== void 0;
}
}
}
@@ -2155,21 +2155,21 @@ var _3Dmol = { exports: {} };
/* harmony export */
});
function l() {
- const g = [];
- g.push("DIMENSIONS");
+ const p = [];
+ p.push("DIMENSIONS");
for (const x of this.dimensions)
- g.push(` ${x.name.padEnd(30)} = size: ${x.size}`);
- g.push(""), g.push("GLOBAL ATTRIBUTES");
+ p.push(` ${x.name.padEnd(30)} = size: ${x.size}`);
+ p.push(""), p.push("GLOBAL ATTRIBUTES");
for (const x of this.globalAttributes)
- g.push(` ${x.name.padEnd(30)} = ${x.value}`);
+ p.push(` ${x.name.padEnd(30)} = ${x.value}`);
const _ = JSON.parse(JSON.stringify(this.variables));
- g.push(""), g.push("VARIABLES:");
+ p.push(""), p.push("VARIABLES:");
for (const x of _) {
x.value = this.getDataVariable(x);
let o = JSON.stringify(x.value);
- o.length > 50 && (o = o.substring(0, 50)), isNaN(x.value.length) || (o += ` (length: ${x.value.length})`), g.push(` ${x.name.padEnd(30)} = ${o}`);
+ o.length > 50 && (o = o.substring(0, 50)), isNaN(x.value.length) || (o += ` (length: ${x.value.length})`), p.push(` ${x.name.padEnd(30)} = ${o}`);
}
- return g.join(`
+ return p.join(`
`);
}
}
@@ -2190,12 +2190,12 @@ var _3Dmol = { exports: {} };
/* harmony export */
num2str: () => (
/* binding */
- g
+ p
),
/* harmony export */
readType: () => (
/* binding */
- p
+ g
),
/* harmony export */
str2num: () => (
@@ -2212,7 +2212,7 @@ var _3Dmol = { exports: {} };
FLOAT: 5,
DOUBLE: 6
};
- function g(u) {
+ function p(u) {
switch (Number(u)) {
case l.BYTE:
return "byte";
@@ -2268,27 +2268,27 @@ var _3Dmol = { exports: {} };
}
function o(u, A) {
if (u !== 1) {
- const C = new Array(u);
- for (let L = 0; L < u; L++)
- C[L] = A();
- return C;
+ const L = new Array(u);
+ for (let C = 0; C < u; C++)
+ L[C] = A();
+ return L;
} else
return A();
}
- function p(u, A, C) {
+ function g(u, A, L) {
switch (A) {
case l.BYTE:
- return Array.from(u.readBytes(C));
+ return Array.from(u.readBytes(L));
case l.CHAR:
- return E(u.readChars(C));
+ return E(u.readChars(L));
case l.SHORT:
- return o(C, u.readInt16.bind(u));
+ return o(L, u.readInt16.bind(u));
case l.INT:
- return o(C, u.readInt32.bind(u));
+ return o(L, u.readInt32.bind(u));
case l.FLOAT:
- return o(C, u.readFloat32.bind(u));
+ return o(L, u.readFloat32.bind(u));
case l.DOUBLE:
- return o(C, u.readFloat64.bind(u));
+ return o(L, u.readFloat64.bind(u));
default:
throw new Error(`non valid type ${A}`);
}
@@ -2314,7 +2314,7 @@ var _3Dmol = { exports: {} };
/* harmony export */
padding: () => (
/* binding */
- g
+ p
),
/* harmony export */
readName: () => (
@@ -2327,12 +2327,12 @@ var _3Dmol = { exports: {} };
if (x)
throw new TypeError(`Not a valid NetCDF v3.x file: ${o}`);
}
- function g(x) {
+ function p(x) {
x.offset % 4 !== 0 && x.skip(4 - x.offset % 4);
}
function _(x) {
- const o = x.readUint32(), p = x.readChars(o);
- return g(x), p;
+ const o = x.readUint32(), g = x.readChars(o);
+ return p(x), g;
}
}
),
@@ -3594,7 +3594,7 @@ void main() {
/* harmony export */
CAP: () => (
/* binding */
- g
+ p
),
/* harmony export */
GLDraw: () => (
@@ -3606,10 +3606,10 @@ void main() {
var l = e(
/*! ./WebGL/math */
"./src/WebGL/math/index.ts"
- ), g;
+ ), p;
(function(x) {
x[x.NONE = 0] = "NONE", x[x.FLAT = 1] = "FLAT", x[x.ROUND = 2] = "ROUND";
- })(g || (g = {}));
+ })(p || (p = {}));
var _;
(function(x) {
function o(r, n, b) {
@@ -3618,7 +3618,7 @@ void main() {
var w = new Float32Array(9);
return w[0] = a, w[1] = t, w[2] = 0, w[3] = -t * M, w[4] = a * M, w[5] = h, w[6] = t * h, w[7] = -a * h, w[8] = M, w;
}
- class p {
+ class g {
constructor() {
this.cache = {};
let n = [], b = 4, f = Math.pow(2, b), c = 2, t = Math.pow(2, c), a = f / t, h;
@@ -3634,67 +3634,67 @@ void main() {
return this.cache[n][b + f];
for (var c = this.basisVectors.length, t = [], a = [], h, M = 0; M < c; M++)
t.push(this.basisVectors[M].clone().multiplyScalar(n)), t.push(this.basisVectors[M].clone().multiplyScalar(n)), h = this.basisVectors[M].clone().normalize(), a.push(h), a.push(h);
- var w = [], S = 10, T = c, R = 0, z = Math.PI * 2, P = 0, B = Math.PI, U, F, $ = !1, W = !1;
- for (F = 0; F <= S; F++) {
- $ = F === 0 || F === S, W = F === S / 2;
- var N = [], G = [];
- for (U = 0; U <= T; U++) {
+ var w = [], S = 10, T = c, R = 0, $ = Math.PI * 2, P = 0, B = Math.PI, F, U, z = !1, W = !1;
+ for (U = 0; U <= S; U++) {
+ z = U === 0 || U === S, W = U === S / 2;
+ var V = [], N = [];
+ for (F = 0; F <= T; F++) {
if (W) {
- var k = U < T ? 2 * U : 0;
- G.push(k + 1), N.push(k);
+ var k = F < T ? 2 * F : 0;
+ N.push(k + 1), V.push(k);
continue;
}
- var j = U / T, Q = F / S;
- if (!$ || U === 0)
- if (U < T) {
+ var G = F / T, Q = U / S;
+ if (!z || F === 0)
+ if (F < T) {
var ie = new l.Vector3();
- ie.x = -n * Math.cos(R + j * z) * Math.sin(P + Q * B), b == 1 ? ie.y = 0 : ie.y = n * Math.cos(P + Q * B), ie.z = n * Math.sin(R + j * z) * Math.sin(P + Q * B), Math.abs(ie.x) < 1e-5 && (ie.x = 0), Math.abs(ie.y) < 1e-5 && (ie.y = 0), Math.abs(ie.z) < 1e-5 && (ie.z = 0), b == g.FLAT ? (h = new l.Vector3(0, Math.cos(P + Q * B), 0), h.normalize()) : (h = new l.Vector3(ie.x, ie.y, ie.z), h.normalize()), t.push(ie), a.push(h), N.push(t.length - 1);
+ ie.x = -n * Math.cos(R + G * $) * Math.sin(P + Q * B), b == 1 ? ie.y = 0 : ie.y = n * Math.cos(P + Q * B), ie.z = n * Math.sin(R + G * $) * Math.sin(P + Q * B), Math.abs(ie.x) < 1e-5 && (ie.x = 0), Math.abs(ie.y) < 1e-5 && (ie.y = 0), Math.abs(ie.z) < 1e-5 && (ie.z = 0), b == p.FLAT ? (h = new l.Vector3(0, Math.cos(P + Q * B), 0), h.normalize()) : (h = new l.Vector3(ie.x, ie.y, ie.z), h.normalize()), t.push(ie), a.push(h), V.push(t.length - 1);
} else
- N.push(t.length - T);
+ V.push(t.length - T);
else
- $ && N.push(t.length - 1);
+ z && V.push(t.length - 1);
}
- W && w.push(G), w.push(N);
+ W && w.push(N), w.push(V);
}
- var pe = {
+ var ge = {
vertices: t,
normals: a,
verticesRows: w,
w: T,
h: S
};
- return n in this.cache || (this.cache[n] = {}), this.cache[n][b + f] = pe, pe;
+ return n in this.cache || (this.cache[n] = {}), this.cache[n][b + f] = ge, ge;
}
}
- var E = new p();
+ var E = new g();
function u(r, n, b, f, c, t = 0, a = 0) {
if (!n || !b)
return;
let h = function(Ee) {
if (typeof Ee == "string") {
let He = Ee;
- return He.toLowerCase() == "flat" ? g.FLAT : He.toLowerCase() == "round" ? g.ROUND : g.NONE;
+ return He.toLowerCase() == "flat" ? p.FLAT : He.toLowerCase() == "round" ? p.ROUND : p.NONE;
} else
return Ee;
};
t = h(t), a = h(a);
var M = a || t;
c = c || { r: 0, g: 0, b: 0 };
- var w = o(b.x - n.x, b.y - n.y, b.z - n.z), S = E.getVerticesForRadius(f, a, "to"), T = S.w, R = S.h, z = M ? R * T + 2 : 2 * T, P = r.updateGeoGroup(z), B = S.vertices, U = S.normals, F = S.verticesRows, $ = F[R / 2], W = F[R / 2 + 1], N = P.vertices, G, k, j, Q, ie, pe, he = P.vertexArray, ue = P.normalArray, se = P.colorArray, ae = P.faceArray;
- for (j = 0; j < T; ++j) {
- var we = 2 * j;
- Q = w[0] * B[we].x + w[3] * B[we].y + w[6] * B[we].z, ie = w[1] * B[we].x + w[4] * B[we].y + w[7] * B[we].z, pe = w[5] * B[we].y + w[8] * B[we].z, G = 3 * (N + we), k = P.faceidx, he[G] = Q + n.x, he[G + 1] = ie + n.y, he[G + 2] = pe + n.z, he[G + 3] = Q + b.x, he[G + 4] = ie + b.y, he[G + 5] = pe + b.z, ue[G] = Q, ue[G + 3] = Q, ue[G + 1] = ie, ue[G + 4] = ie, ue[G + 2] = pe, ue[G + 5] = pe, se[G] = c.r, se[G + 3] = c.r, se[G + 1] = c.g, se[G + 4] = c.g, se[G + 2] = c.b, se[G + 5] = c.b, ae[k] = W[j] + N, ae[k + 1] = W[j + 1] + N, ae[k + 2] = $[j] + N, ae[k + 3] = $[j] + N, ae[k + 4] = W[j + 1] + N, ae[k + 5] = $[j + 1] + N, P.faceidx += 6;
+ var w = o(b.x - n.x, b.y - n.y, b.z - n.z), S = E.getVerticesForRadius(f, a, "to"), T = S.w, R = S.h, $ = M ? R * T + 2 : 2 * T, P = r.updateGeoGroup($), B = S.vertices, F = S.normals, U = S.verticesRows, z = U[R / 2], W = U[R / 2 + 1], V = P.vertices, N, k, G, Q, ie, ge, le = P.vertexArray, oe = P.normalArray, he = P.colorArray, se = P.faceArray;
+ for (G = 0; G < T; ++G) {
+ var xe = 2 * G;
+ Q = w[0] * B[xe].x + w[3] * B[xe].y + w[6] * B[xe].z, ie = w[1] * B[xe].x + w[4] * B[xe].y + w[7] * B[xe].z, ge = w[5] * B[xe].y + w[8] * B[xe].z, N = 3 * (V + xe), k = P.faceidx, le[N] = Q + n.x, le[N + 1] = ie + n.y, le[N + 2] = ge + n.z, le[N + 3] = Q + b.x, le[N + 4] = ie + b.y, le[N + 5] = ge + b.z, oe[N] = Q, oe[N + 3] = Q, oe[N + 1] = ie, oe[N + 4] = ie, oe[N + 2] = ge, oe[N + 5] = ge, he[N] = c.r, he[N + 3] = c.r, he[N + 1] = c.g, he[N + 4] = c.g, he[N + 2] = c.b, he[N + 5] = c.b, se[k] = W[G] + V, se[k + 1] = W[G + 1] + V, se[k + 2] = z[G] + V, se[k + 3] = z[G] + V, se[k + 4] = W[G + 1] + V, se[k + 5] = z[G + 1] + V, P.faceidx += 6;
}
if (M) {
- var xe = a ? 0 : R / 2, Ie = t ? R + 1 : R / 2 + 1, oe, ve, re, Se, ze, Ge, $e, Re, Be, ke, We, Te, je, Fe, X, Z, q, fe, _e, Me, Ae, H, ce, ye, Pe, le, De, K, Oe, Ne, I, me;
- for (ie = xe; ie < Ie; ie++)
+ var ye = a ? 0 : R / 2, Pe = t ? R + 1 : R / 2 + 1, de, pe, re, Se, ke, $e, ze, Re, Fe, Ie, We, Ue, Be, Ne, H, K, q, fe, _e, Me, Ae, Z, ue, we, Te, ae, De, Y, Oe, Ve, I, me;
+ for (ie = ye; ie < Pe; ie++)
if (ie !== R / 2) {
- var ge = ie <= R / 2 ? b : n, Y = E.getVerticesForRadius(f, a, "to"), ne = E.getVerticesForRadius(f, t, "from");
- for (ge === b ? (B = Y.vertices, U = Y.normals, F = Y.verticesRows) : ge == n && (B = ne.vertices, U = ne.normals, F = ne.verticesRows), Q = 0; Q < T; Q++)
- k = P.faceidx, oe = F[ie][Q + 1], Oe = (oe + N) * 3, ve = F[ie][Q], Ne = (ve + N) * 3, re = F[ie + 1][Q], I = (re + N) * 3, Se = F[ie + 1][Q + 1], me = (Se + N) * 3, ze = w[0] * B[oe].x + w[3] * B[oe].y + w[6] * B[oe].z, Ge = w[0] * B[ve].x + w[3] * B[ve].y + w[6] * B[ve].z, $e = w[0] * B[re].x + w[3] * B[re].y + w[6] * B[re].z, Re = w[0] * B[Se].x + w[3] * B[Se].y + w[6] * B[Se].z, Be = w[1] * B[oe].x + w[4] * B[oe].y + w[7] * B[oe].z, ke = w[1] * B[ve].x + w[4] * B[ve].y + w[7] * B[ve].z, We = w[1] * B[re].x + w[4] * B[re].y + w[7] * B[re].z, Te = w[1] * B[Se].x + w[4] * B[Se].y + w[7] * B[Se].z, je = w[5] * B[oe].y + w[8] * B[oe].z, Fe = w[5] * B[ve].y + w[8] * B[ve].z, X = w[5] * B[re].y + w[8] * B[re].z, Z = w[5] * B[Se].y + w[8] * B[Se].z, he[Oe] = ze + ge.x, he[Ne] = Ge + ge.x, he[I] = $e + ge.x, he[me] = Re + ge.x, he[Oe + 1] = Be + ge.y, he[Ne + 1] = ke + ge.y, he[I + 1] = We + ge.y, he[me + 1] = Te + ge.y, he[Oe + 2] = je + ge.z, he[Ne + 2] = Fe + ge.z, he[I + 2] = X + ge.z, he[me + 2] = Z + ge.z, se[Oe] = c.r, se[Ne] = c.r, se[I] = c.r, se[me] = c.r, se[Oe + 1] = c.g, se[Ne + 1] = c.g, se[I + 1] = c.g, se[me + 1] = c.g, se[Oe + 2] = c.b, se[Ne + 2] = c.b, se[I + 2] = c.b, se[me + 2] = c.b, q = w[0] * U[oe].x + w[3] * U[oe].y + w[6] * U[oe].z, fe = w[0] * U[ve].x + w[3] * U[ve].y + w[6] * U[ve].z, _e = w[0] * U[re].x + w[3] * U[re].y + w[6] * U[re].z, Me = w[0] * U[Se].x + w[3] * U[Se].y + w[6] * U[Se].z, Ae = w[1] * U[oe].x + w[4] * U[oe].y + w[7] * U[oe].z, H = w[1] * U[ve].x + w[4] * U[ve].y + w[7] * U[ve].z, ce = w[1] * U[re].x + w[4] * U[re].y + w[7] * U[re].z, ye = w[1] * U[Se].x + w[4] * U[Se].y + w[7] * U[Se].z, Pe = w[5] * U[oe].y + w[8] * U[oe].z, le = w[5] * U[ve].y + w[8] * U[ve].z, De = w[5] * U[re].y + w[8] * U[re].z, K = w[5] * U[Se].y + w[8] * U[Se].z, ie === 0 ? (ue[Oe] = q, ue[I] = _e, ue[me] = Me, ue[Oe + 1] = Ae, ue[I + 1] = ce, ue[me + 1] = ye, ue[Oe + 2] = Pe, ue[I + 2] = De, ue[me + 2] = K, ae[k] = oe + N, ae[k + 1] = re + N, ae[k + 2] = Se + N, P.faceidx += 3) : ie === Ie - 1 ? (ue[Oe] = q, ue[Ne] = fe, ue[I] = _e, ue[Oe + 1] = Ae, ue[Ne + 1] = H, ue[I + 1] = ce, ue[Oe + 2] = Pe, ue[Ne + 2] = le, ue[I + 2] = De, ae[k] = oe + N, ae[k + 1] = ve + N, ae[k + 2] = re + N, P.faceidx += 3) : (ue[Oe] = q, ue[Ne] = fe, ue[me] = Me, ue[Oe + 1] = Ae, ue[Ne + 1] = H, ue[me + 1] = ye, ue[Oe + 2] = Pe, ue[Ne + 2] = le, ue[me + 2] = K, ue[Ne] = fe, ue[I] = _e, ue[me] = Me, ue[Ne + 1] = H, ue[I + 1] = ce, ue[me + 1] = ye, ue[Ne + 2] = le, ue[I + 2] = De, ue[me + 2] = K, ae[k] = oe + N, ae[k + 1] = ve + N, ae[k + 2] = Se + N, ae[k + 3] = ve + N, ae[k + 4] = re + N, ae[k + 5] = Se + N, P.faceidx += 6);
+ var ve = ie <= R / 2 ? b : n, X = E.getVerticesForRadius(f, a, "to"), ne = E.getVerticesForRadius(f, t, "from");
+ for (ve === b ? (B = X.vertices, F = X.normals, U = X.verticesRows) : ve == n && (B = ne.vertices, F = ne.normals, U = ne.verticesRows), Q = 0; Q < T; Q++)
+ k = P.faceidx, de = U[ie][Q + 1], Oe = (de + V) * 3, pe = U[ie][Q], Ve = (pe + V) * 3, re = U[ie + 1][Q], I = (re + V) * 3, Se = U[ie + 1][Q + 1], me = (Se + V) * 3, ke = w[0] * B[de].x + w[3] * B[de].y + w[6] * B[de].z, $e = w[0] * B[pe].x + w[3] * B[pe].y + w[6] * B[pe].z, ze = w[0] * B[re].x + w[3] * B[re].y + w[6] * B[re].z, Re = w[0] * B[Se].x + w[3] * B[Se].y + w[6] * B[Se].z, Fe = w[1] * B[de].x + w[4] * B[de].y + w[7] * B[de].z, Ie = w[1] * B[pe].x + w[4] * B[pe].y + w[7] * B[pe].z, We = w[1] * B[re].x + w[4] * B[re].y + w[7] * B[re].z, Ue = w[1] * B[Se].x + w[4] * B[Se].y + w[7] * B[Se].z, Be = w[5] * B[de].y + w[8] * B[de].z, Ne = w[5] * B[pe].y + w[8] * B[pe].z, H = w[5] * B[re].y + w[8] * B[re].z, K = w[5] * B[Se].y + w[8] * B[Se].z, le[Oe] = ke + ve.x, le[Ve] = $e + ve.x, le[I] = ze + ve.x, le[me] = Re + ve.x, le[Oe + 1] = Fe + ve.y, le[Ve + 1] = Ie + ve.y, le[I + 1] = We + ve.y, le[me + 1] = Ue + ve.y, le[Oe + 2] = Be + ve.z, le[Ve + 2] = Ne + ve.z, le[I + 2] = H + ve.z, le[me + 2] = K + ve.z, he[Oe] = c.r, he[Ve] = c.r, he[I] = c.r, he[me] = c.r, he[Oe + 1] = c.g, he[Ve + 1] = c.g, he[I + 1] = c.g, he[me + 1] = c.g, he[Oe + 2] = c.b, he[Ve + 2] = c.b, he[I + 2] = c.b, he[me + 2] = c.b, q = w[0] * F[de].x + w[3] * F[de].y + w[6] * F[de].z, fe = w[0] * F[pe].x + w[3] * F[pe].y + w[6] * F[pe].z, _e = w[0] * F[re].x + w[3] * F[re].y + w[6] * F[re].z, Me = w[0] * F[Se].x + w[3] * F[Se].y + w[6] * F[Se].z, Ae = w[1] * F[de].x + w[4] * F[de].y + w[7] * F[de].z, Z = w[1] * F[pe].x + w[4] * F[pe].y + w[7] * F[pe].z, ue = w[1] * F[re].x + w[4] * F[re].y + w[7] * F[re].z, we = w[1] * F[Se].x + w[4] * F[Se].y + w[7] * F[Se].z, Te = w[5] * F[de].y + w[8] * F[de].z, ae = w[5] * F[pe].y + w[8] * F[pe].z, De = w[5] * F[re].y + w[8] * F[re].z, Y = w[5] * F[Se].y + w[8] * F[Se].z, ie === 0 ? (oe[Oe] = q, oe[I] = _e, oe[me] = Me, oe[Oe + 1] = Ae, oe[I + 1] = ue, oe[me + 1] = we, oe[Oe + 2] = Te, oe[I + 2] = De, oe[me + 2] = Y, se[k] = de + V, se[k + 1] = re + V, se[k + 2] = Se + V, P.faceidx += 3) : ie === Pe - 1 ? (oe[Oe] = q, oe[Ve] = fe, oe[I] = _e, oe[Oe + 1] = Ae, oe[Ve + 1] = Z, oe[I + 1] = ue, oe[Oe + 2] = Te, oe[Ve + 2] = ae, oe[I + 2] = De, se[k] = de + V, se[k + 1] = pe + V, se[k + 2] = re + V, P.faceidx += 3) : (oe[Oe] = q, oe[Ve] = fe, oe[me] = Me, oe[Oe + 1] = Ae, oe[Ve + 1] = Z, oe[me + 1] = we, oe[Oe + 2] = Te, oe[Ve + 2] = ae, oe[me + 2] = Y, oe[Ve] = fe, oe[I] = _e, oe[me] = Me, oe[Ve + 1] = Z, oe[I + 1] = ue, oe[me + 1] = we, oe[Ve + 2] = ae, oe[I + 2] = De, oe[me + 2] = Y, se[k] = de + V, se[k + 1] = pe + V, se[k + 2] = Se + V, se[k + 3] = pe + V, se[k + 4] = re + V, se[k + 5] = Se + V, P.faceidx += 6);
}
}
- P.vertices += z;
+ P.vertices += $;
}
x.drawCylinder = u;
function A(r, n, b, f, c) {
@@ -3704,19 +3704,19 @@ void main() {
let t = new l.Vector3(b.x - n.x, b.y - n.y, b.z - n.z);
var a = o(t.x, t.y, t.z);
t = t.normalize();
- var h = E.basisVectors.length, M = E.basisVectors, w = h + 2, S = r.updateGeoGroup(w), T = S.vertices, R, z, P, B, U, F, $ = S.vertexArray, W = S.normalArray, N = S.colorArray, G = S.faceArray;
- for (R = T * 3, $[R] = n.x, $[R + 1] = n.y, $[R + 2] = n.z, W[R] = -t.x, W[R + 1] = -t.y, W[R + 2] = -t.z, N[R] = c.r, N[R + 1] = c.g, N[R + 2] = c.b, $[R + 3] = b.x, $[R + 4] = b.y, $[R + 5] = b.z, W[R + 3] = t.x, W[R + 4] = t.y, W[R + 5] = t.z, N[R + 3] = c.r, N[R + 4] = c.g, N[R + 5] = c.b, R += 6, P = 0; P < h; ++P) {
+ var h = E.basisVectors.length, M = E.basisVectors, w = h + 2, S = r.updateGeoGroup(w), T = S.vertices, R, $, P, B, F, U, z = S.vertexArray, W = S.normalArray, V = S.colorArray, N = S.faceArray;
+ for (R = T * 3, z[R] = n.x, z[R + 1] = n.y, z[R + 2] = n.z, W[R] = -t.x, W[R + 1] = -t.y, W[R + 2] = -t.z, V[R] = c.r, V[R + 1] = c.g, V[R + 2] = c.b, z[R + 3] = b.x, z[R + 4] = b.y, z[R + 5] = b.z, W[R + 3] = t.x, W[R + 4] = t.y, W[R + 5] = t.z, V[R + 3] = c.r, V[R + 4] = c.g, V[R + 5] = c.b, R += 6, P = 0; P < h; ++P) {
var k = M[P].clone();
- k.multiplyScalar(f), B = a[0] * k.x + a[3] * k.y + a[6] * k.z, U = a[1] * k.x + a[4] * k.y + a[7] * k.z, F = a[5] * k.y + a[8] * k.z, $[R] = B + n.x, $[R + 1] = U + n.y, $[R + 2] = F + n.z, W[R] = B, W[R + 1] = U, W[R + 2] = F, N[R] = c.r, N[R + 1] = c.g, N[R + 2] = c.b, R += 3;
+ k.multiplyScalar(f), B = a[0] * k.x + a[3] * k.y + a[6] * k.z, F = a[1] * k.x + a[4] * k.y + a[7] * k.z, U = a[5] * k.y + a[8] * k.z, z[R] = B + n.x, z[R + 1] = F + n.y, z[R + 2] = U + n.z, W[R] = B, W[R + 1] = F, W[R + 2] = U, V[R] = c.r, V[R + 1] = c.g, V[R + 2] = c.b, R += 3;
}
- for (S.vertices += h + 2, z = S.faceidx, P = 0; P < h; P++) {
- var j = T + 2 + P, Q = T + 2 + (P + 1) % h;
- G[z] = j, G[z + 1] = Q, G[z + 2] = T, z += 3, G[z] = j, G[z + 1] = Q, G[z + 2] = T + 1, z += 3;
+ for (S.vertices += h + 2, $ = S.faceidx, P = 0; P < h; P++) {
+ var G = T + 2 + P, Q = T + 2 + (P + 1) % h;
+ N[$] = G, N[$ + 1] = Q, N[$ + 2] = T, $ += 3, N[$] = G, N[$ + 1] = Q, N[$ + 2] = T + 1, $ += 3;
}
S.faceidx += 6 * h;
}
x.drawCone = A;
- class C {
+ class L {
constructor() {
this.cache = /* @__PURE__ */ new Map();
}
@@ -3735,29 +3735,29 @@ void main() {
for (R = 0; R <= a; R++) {
let P = [];
for (T = 0; T <= t; T++) {
- let B = T / t, U = R / a, F = -n * Math.cos(h + B * M) * Math.sin(w + U * S), $ = n * Math.cos(w + U * S), W = n * Math.sin(h + B * M) * Math.sin(w + U * S);
- var z = new l.Vector3(F, $, W);
- z.normalize(), c.vertices.push({ x: F, y: $, z: W }), c.normals.push(z), P.push(c.vertices.length - 1);
+ let B = T / t, F = R / a, U = -n * Math.cos(h + B * M) * Math.sin(w + F * S), z = n * Math.cos(w + F * S), W = n * Math.sin(h + B * M) * Math.sin(w + F * S);
+ var $ = new l.Vector3(U, z, W);
+ $.normalize(), c.vertices.push({ x: U, y: z, z: W }), c.normals.push($), P.push(c.vertices.length - 1);
}
c.verticesRows.push(P);
}
return f.set(n, c), c;
}
}
- var L = new C();
+ var C = new L();
function D(r, n, b, f, c) {
- var t = L.getVerticesForRadius(b, c), a = t.vertices, h = t.normals, M = r.updateGeoGroup(a.length), w = M.vertices, S = M.vertexArray, T = M.colorArray, R = M.faceArray, z = M.lineArray, P = M.normalArray;
- for (let F = 0, $ = a.length; F < $; ++F) {
- let W = 3 * (w + F), N = a[F];
- S[W] = N.x + n.x, S[W + 1] = N.y + n.y, S[W + 2] = N.z + n.z, T[W] = f.r, T[W + 1] = f.g, T[W + 2] = f.b;
+ var t = C.getVerticesForRadius(b, c), a = t.vertices, h = t.normals, M = r.updateGeoGroup(a.length), w = M.vertices, S = M.vertexArray, T = M.colorArray, R = M.faceArray, $ = M.lineArray, P = M.normalArray;
+ for (let U = 0, z = a.length; U < z; ++U) {
+ let W = 3 * (w + U), V = a[U];
+ S[W] = V.x + n.x, S[W + 1] = V.y + n.y, S[W + 2] = V.z + n.z, T[W] = f.r, T[W + 1] = f.g, T[W + 2] = f.b;
}
M.vertices += a.length;
- let B = t.verticesRows, U = B.length - 1;
- for (let F = 0; F < U; F++) {
- let $ = B[F].length - 1;
- for (let W = 0; W < $; W++) {
- let N = M.faceidx, G = M.lineidx, k = B[F][W + 1] + w, j = k * 3, Q = B[F][W] + w, ie = Q * 3, pe = B[F + 1][W] + w, he = pe * 3, ue = B[F + 1][W + 1] + w, se = ue * 3, ae = h[k - w], we = h[Q - w], xe = h[pe - w], Ie = h[ue - w];
- Math.abs(a[k - w].y) === b ? (P[j] = ae.x, P[he] = xe.x, P[se] = Ie.x, P[j + 1] = ae.y, P[he + 1] = xe.y, P[se + 1] = Ie.y, P[j + 2] = ae.z, P[he + 2] = xe.z, P[se + 2] = Ie.z, R[N] = k, R[N + 1] = pe, R[N + 2] = ue, z[G] = k, z[G + 1] = pe, z[G + 2] = k, z[G + 3] = ue, z[G + 4] = pe, z[G + 5] = ue, M.faceidx += 3, M.lineidx += 6) : Math.abs(a[pe - w].y) === b ? (P[j] = ae.x, P[ie] = we.x, P[he] = xe.x, P[j + 1] = ae.y, P[ie + 1] = we.y, P[he + 1] = xe.y, P[j + 2] = ae.z, P[ie + 2] = we.z, P[he + 2] = xe.z, R[N] = k, R[N + 1] = Q, R[N + 2] = pe, z[G] = k, z[G + 1] = Q, z[G + 2] = k, z[G + 3] = pe, z[G + 4] = Q, z[G + 5] = pe, M.faceidx += 3, M.lineidx += 6) : (P[j] = ae.x, P[ie] = we.x, P[se] = Ie.x, P[j + 1] = ae.y, P[ie + 1] = we.y, P[se + 1] = Ie.y, P[j + 2] = ae.z, P[ie + 2] = we.z, P[se + 2] = Ie.z, P[ie] = we.x, P[he] = xe.x, P[se] = Ie.x, P[ie + 1] = we.y, P[he + 1] = xe.y, P[se + 1] = Ie.y, P[ie + 2] = we.z, P[he + 2] = xe.z, P[se + 2] = Ie.z, R[N] = k, R[N + 1] = Q, R[N + 2] = ue, R[N + 3] = Q, R[N + 4] = pe, R[N + 5] = ue, z[G] = k, z[G + 1] = Q, z[G + 2] = k, z[G + 3] = ue, z[G + 4] = Q, z[G + 5] = pe, z[G + 6] = pe, z[G + 7] = ue, M.faceidx += 6, M.lineidx += 8);
+ let B = t.verticesRows, F = B.length - 1;
+ for (let U = 0; U < F; U++) {
+ let z = B[U].length - 1;
+ for (let W = 0; W < z; W++) {
+ let V = M.faceidx, N = M.lineidx, k = B[U][W + 1] + w, G = k * 3, Q = B[U][W] + w, ie = Q * 3, ge = B[U + 1][W] + w, le = ge * 3, oe = B[U + 1][W + 1] + w, he = oe * 3, se = h[k - w], xe = h[Q - w], ye = h[ge - w], Pe = h[oe - w];
+ Math.abs(a[k - w].y) === b ? (P[G] = se.x, P[le] = ye.x, P[he] = Pe.x, P[G + 1] = se.y, P[le + 1] = ye.y, P[he + 1] = Pe.y, P[G + 2] = se.z, P[le + 2] = ye.z, P[he + 2] = Pe.z, R[V] = k, R[V + 1] = ge, R[V + 2] = oe, $[N] = k, $[N + 1] = ge, $[N + 2] = k, $[N + 3] = oe, $[N + 4] = ge, $[N + 5] = oe, M.faceidx += 3, M.lineidx += 6) : Math.abs(a[ge - w].y) === b ? (P[G] = se.x, P[ie] = xe.x, P[le] = ye.x, P[G + 1] = se.y, P[ie + 1] = xe.y, P[le + 1] = ye.y, P[G + 2] = se.z, P[ie + 2] = xe.z, P[le + 2] = ye.z, R[V] = k, R[V + 1] = Q, R[V + 2] = ge, $[N] = k, $[N + 1] = Q, $[N + 2] = k, $[N + 3] = ge, $[N + 4] = Q, $[N + 5] = ge, M.faceidx += 3, M.lineidx += 6) : (P[G] = se.x, P[ie] = xe.x, P[he] = Pe.x, P[G + 1] = se.y, P[ie + 1] = xe.y, P[he + 1] = Pe.y, P[G + 2] = se.z, P[ie + 2] = xe.z, P[he + 2] = Pe.z, P[ie] = xe.x, P[le] = ye.x, P[he] = Pe.x, P[ie + 1] = xe.y, P[le + 1] = ye.y, P[he + 1] = Pe.y, P[ie + 2] = xe.z, P[le + 2] = ye.z, P[he + 2] = Pe.z, R[V] = k, R[V + 1] = Q, R[V + 2] = oe, R[V + 3] = Q, R[V + 4] = ge, R[V + 5] = oe, $[N] = k, $[N + 1] = Q, $[N + 2] = k, $[N + 3] = oe, $[N + 4] = Q, $[N + 5] = ge, $[N + 6] = ge, $[N + 7] = oe, M.faceidx += 6, M.lineidx += 8);
}
}
}
@@ -3783,7 +3783,7 @@ void main() {
var l = e(
/*! ./WebGL */
"./src/WebGL/index.ts"
- ), g = e(
+ ), p = e(
/*! ./WebGL/shapes */
"./src/WebGL/shapes/index.ts"
), _ = e(
@@ -3795,7 +3795,7 @@ void main() {
), o = e(
/*! ./GLDraw */
"./src/GLDraw.ts"
- ), p = e(
+ ), g = e(
/*! ./glcartoon */
"./src/glcartoon.ts"
), E = e(
@@ -3807,10 +3807,10 @@ void main() {
), A = e(
/*! ./parsers */
"./src/parsers/index.ts"
- ), C = e(
+ ), L = e(
/*! netcdfjs */
"./node_modules/netcdfjs/lib-esm/index.js"
- ), L = e(
+ ), C = e(
/*! pako */
"./node_modules/pako/dist/pako.esm.mjs"
), D = e(
@@ -3819,7 +3819,7 @@ void main() {
);
function r(b) {
let f;
- return typeof b == "string" ? f = new TextEncoder().encode(b) : f = new Uint8Array(b), (0, L.inflate)(f, {
+ return typeof b == "string" ? f = new TextEncoder().encode(b) : f = new Uint8Array(b), (0, C.inflate)(f, {
to: "string"
});
}
@@ -3873,11 +3873,11 @@ void main() {
[0, 0, -M]
], S = f.clickable || f.hoverable;
S && f.intersectionShape === void 0 && (f.intersectionShape = { sphere: [], cylinder: [], line: [] });
- for (var T = (0, E.getColorFromStyle)(f, t), R = h.vertexArray, z = h.colorArray, P = 0; P < 6; P++) {
+ for (var T = (0, E.getColorFromStyle)(f, t), R = h.vertexArray, $ = h.colorArray, P = 0; P < 6; P++) {
var B = h.vertices * 3;
- if (h.vertices++, R[B] = f.x + w[P][0], R[B + 1] = f.y + w[P][1], R[B + 2] = f.z + w[P][2], z[B] = T.r, z[B + 1] = T.g, z[B + 2] = T.b, S) {
- var U = new _.Vector3(w[P][0], w[P][1], w[P][2]);
- U.multiplyScalar(0.1), U.set(U.x + f.x, U.y + f.y, U.z + f.z), f.intersectionShape.line.push(U);
+ if (h.vertices++, R[B] = f.x + w[P][0], R[B + 1] = f.y + w[P][1], R[B + 2] = f.z + w[P][2], $[B] = T.r, $[B + 1] = T.g, $[B + 2] = T.b, S) {
+ var F = new _.Vector3(w[P][0], w[P][1], w[P][2]);
+ F.multiplyScalar(0.1), F.set(F.x + f.x, F.y + f.y, F.z + f.z), f.intersectionShape.line.push(F);
}
}
}
@@ -3886,12 +3886,12 @@ void main() {
getGoodCross(f, c, t, a) {
for (var h = null, M = -1, w = 0, S = f.bonds.length; w < S; w++)
if (f.bonds[w] != c.index) {
- let R = f.bonds[w], z = this.atoms[R], B = new _.Vector3(z.x, z.y, z.z).clone();
+ let R = f.bonds[w], $ = this.atoms[R], B = new _.Vector3($.x, $.y, $.z).clone();
B.sub(t);
- let U = B.clone();
- U.cross(a);
- var T = U.lengthSq();
- if (T > M && (M = T, h = U, M > 0.1))
+ let F = B.clone();
+ F.cross(a);
+ var T = F.lengthSq();
+ if (T > M && (M = T, h = F, M > 0.1))
return h;
}
return h;
@@ -3899,14 +3899,14 @@ void main() {
//from atom, return a normalized vector v that is orthogonal and along which
//it is appropraite to draw multiple bonds
getSideBondV(f, c, t) {
- var a, h, M, w, S, T = new _.Vector3(f.x, f.y, f.z), R = new _.Vector3(c.x, c.y, c.z), z = R.clone(), P = null;
- if (z.sub(T), f.bonds.length === 1)
- c.bonds.length === 1 ? (P = z.clone(), Math.abs(P.x) > 1e-4 ? P.y += 1 : P.x += 1) : (a = (t + 1) % c.bonds.length, h = c.bonds[a], M = this.atoms[h], M.index == f.index && (a = (a + 1) % c.bonds.length, h = c.bonds[a], M = this.atoms[h]), w = new _.Vector3(M.x, M.y, M.z), S = w.clone(), S.sub(T), P = S.clone(), P.cross(z));
- else if (P = this.getGoodCross(f, c, T, z), P.lengthSq() < 0.01) {
- var B = this.getGoodCross(c, f, T, z);
+ var a, h, M, w, S, T = new _.Vector3(f.x, f.y, f.z), R = new _.Vector3(c.x, c.y, c.z), $ = R.clone(), P = null;
+ if ($.sub(T), f.bonds.length === 1)
+ c.bonds.length === 1 ? (P = $.clone(), Math.abs(P.x) > 1e-4 ? P.y += 1 : P.x += 1) : (a = (t + 1) % c.bonds.length, h = c.bonds[a], M = this.atoms[h], M.index == f.index && (a = (a + 1) % c.bonds.length, h = c.bonds[a], M = this.atoms[h]), w = new _.Vector3(M.x, M.y, M.z), S = w.clone(), S.sub(T), P = S.clone(), P.cross($));
+ else if (P = this.getGoodCross(f, c, T, $), P.lengthSq() < 0.01) {
+ var B = this.getGoodCross(c, f, T, $);
B != null && (P = B);
}
- return P.lengthSq() < 0.01 && (P = z.clone(), Math.abs(P.x) > 1e-4 ? P.y += 1 : P.x += 1), P.cross(z), P.normalize(), P;
+ return P.lengthSq() < 0.01 && (P = $.clone(), Math.abs(P.x) > 1e-4 ? P.y += 1 : P.x += 1), P.cross($), P.normalize(), P;
}
addLine(f, c, t, a, h, M) {
f[t] = a.x, f[t + 1] = a.y, f[t + 2] = a.z, c[t] = M.r, c[t + 1] = M.g, c[t + 2] = M.b, f[t + 3] = h.x, f[t + 4] = h.y, f[t + 5] = h.z, c[t + 3] = M.r, c[t + 4] = M.g, c[t + 5] = M.b;
@@ -3926,24 +3926,24 @@ void main() {
if (!a.hidden) {
var h, M, w, S, T = a.linewidth || n.defaultlineWidth;
t[T] || (t[T] = new l.Geometry());
- for (var R = t[T].updateGeoGroup(6 * f.bonds.length), z = R.vertexArray, P = R.colorArray, B = 0; B < f.bonds.length; B++) {
- var U = f.bonds[B], F = c[U];
- if (F.style.line && !(f.index >= F.index)) {
- var $ = new _.Vector3(f.x, f.y, f.z), W = new _.Vector3(F.x, F.y, F.z), N = $.clone().add(W).multiplyScalar(0.5), G = !1, k = f.clickable || f.hoverable, j = F.clickable || F.hoverable;
- (k || j) && (k && (f.intersectionShape === void 0 && (f.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), f.intersectionShape.line.push($), f.intersectionShape.line.push(N)), j && (F.intersectionShape === void 0 && (F.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), F.intersectionShape.line.push(N), F.intersectionShape.line.push(W)));
- var Q = (0, E.getColorFromStyle)(f, f.style.line), ie = (0, E.getColorFromStyle)(F, F.style.line);
+ for (var R = t[T].updateGeoGroup(6 * f.bonds.length), $ = R.vertexArray, P = R.colorArray, B = 0; B < f.bonds.length; B++) {
+ var F = f.bonds[B], U = c[F];
+ if (U.style.line && !(f.index >= U.index)) {
+ var z = new _.Vector3(f.x, f.y, f.z), W = new _.Vector3(U.x, U.y, U.z), V = z.clone().add(W).multiplyScalar(0.5), N = !1, k = f.clickable || f.hoverable, G = U.clickable || U.hoverable;
+ (k || G) && (k && (f.intersectionShape === void 0 && (f.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), f.intersectionShape.line.push(z), f.intersectionShape.line.push(V)), G && (U.intersectionShape === void 0 && (U.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), U.intersectionShape.line.push(V), U.intersectionShape.line.push(W)));
+ var Q = (0, E.getColorFromStyle)(f, f.style.line), ie = (0, E.getColorFromStyle)(U, U.style.line);
if (f.bondStyles && f.bondStyles[B]) {
- var pe = f.bondStyles[B];
- if (!pe.iswire)
+ var ge = f.bondStyles[B];
+ if (!ge.iswire)
continue;
- pe.singleBond && (G = !0), typeof pe.color1 < "u" && (Q = x.CC.color(pe.color1)), typeof pe.color2 < "u" && (ie = x.CC.color(pe.color2));
+ ge.singleBond && (N = !0), typeof ge.color1 < "u" && (Q = x.CC.color(ge.color1)), typeof ge.color2 < "u" && (ie = x.CC.color(ge.color2));
}
- var he = R.vertices * 3, ue, se;
- if (f.bondOrder[B] > 1 && f.bondOrder[B] < 4 && !G) {
- var ae = this.getSideBondV(f, F, B), we = W.clone();
- we.sub($), f.bondOrder[B] == 2 ? (ae.multiplyScalar(0.1), h = $.clone(), h.add(ae), M = $.clone(), M.sub(ae), w = h.clone(), w.add(we), S = M.clone(), S.add(we), Q == ie ? (R.vertices += 4, this.addLine(z, P, he, h, w, Q), this.addLine(z, P, he + 6, M, S, Q)) : (R.vertices += 8, we.multiplyScalar(0.5), ue = h.clone(), ue.add(we), se = M.clone(), se.add(we), this.addLine(z, P, he, h, ue, Q), this.addLine(z, P, he + 6, ue, w, ie), this.addLine(z, P, he + 12, M, se, Q), this.addLine(z, P, he + 18, se, S, ie))) : f.bondOrder[B] == 3 && (ae.multiplyScalar(0.1), h = $.clone(), h.add(ae), M = $.clone(), M.sub(ae), w = h.clone(), w.add(we), S = M.clone(), S.add(we), Q == ie ? (R.vertices += 6, this.addLine(z, P, he, $, W, Q), this.addLine(z, P, he + 6, h, w, Q), this.addLine(z, P, he + 12, M, S, Q)) : (R.vertices += 12, we.multiplyScalar(0.5), ue = h.clone(), ue.add(we), se = M.clone(), se.add(we), this.addLine(z, P, he, $, N, Q), this.addLine(z, P, he + 6, N, W, ie), this.addLine(z, P, he + 12, h, ue, Q), this.addLine(z, P, he + 18, ue, w, ie), this.addLine(z, P, he + 24, M, se, Q), this.addLine(z, P, he + 30, se, S, ie)));
+ var le = R.vertices * 3, oe, he;
+ if (f.bondOrder[B] > 1 && f.bondOrder[B] < 4 && !N) {
+ var se = this.getSideBondV(f, U, B), xe = W.clone();
+ xe.sub(z), f.bondOrder[B] == 2 ? (se.multiplyScalar(0.1), h = z.clone(), h.add(se), M = z.clone(), M.sub(se), w = h.clone(), w.add(xe), S = M.clone(), S.add(xe), Q == ie ? (R.vertices += 4, this.addLine($, P, le, h, w, Q), this.addLine($, P, le + 6, M, S, Q)) : (R.vertices += 8, xe.multiplyScalar(0.5), oe = h.clone(), oe.add(xe), he = M.clone(), he.add(xe), this.addLine($, P, le, h, oe, Q), this.addLine($, P, le + 6, oe, w, ie), this.addLine($, P, le + 12, M, he, Q), this.addLine($, P, le + 18, he, S, ie))) : f.bondOrder[B] == 3 && (se.multiplyScalar(0.1), h = z.clone(), h.add(se), M = z.clone(), M.sub(se), w = h.clone(), w.add(xe), S = M.clone(), S.add(xe), Q == ie ? (R.vertices += 6, this.addLine($, P, le, z, W, Q), this.addLine($, P, le + 6, h, w, Q), this.addLine($, P, le + 12, M, S, Q)) : (R.vertices += 12, xe.multiplyScalar(0.5), oe = h.clone(), oe.add(xe), he = M.clone(), he.add(xe), this.addLine($, P, le, z, V, Q), this.addLine($, P, le + 6, V, W, ie), this.addLine($, P, le + 12, h, oe, Q), this.addLine($, P, le + 18, oe, w, ie), this.addLine($, P, le + 24, M, he, Q), this.addLine($, P, le + 30, he, S, ie)));
} else
- Q == ie ? (R.vertices += 2, this.addLine(z, P, he, $, W, Q)) : (R.vertices += 4, this.addLine(z, P, he, $, N, Q), this.addLine(z, P, he + 6, N, W, ie));
+ Q == ie ? (R.vertices += 2, this.addLine($, P, le, z, W, Q)) : (R.vertices += 4, this.addLine($, P, le, z, V, Q), this.addLine($, P, le + 6, V, W, ie));
}
}
}
@@ -3963,7 +3963,7 @@ void main() {
var a = (0, E.getColorFromStyle)(f, t), h = this.getRadiusFromStyle(f, t);
if ((f.clickable === !0 || f.hoverable) && f.intersectionShape !== void 0) {
var M = new _.Vector3(f.x, f.y, f.z);
- f.intersectionShape.sphere.push(new g.Sphere(M, h));
+ f.intersectionShape.sphere.push(new p.Sphere(M, h));
}
o.GLDraw.drawSphere(c, f, h, a);
}
@@ -3977,7 +3977,7 @@ void main() {
var t = this.getRadiusFromStyle(f, c);
if ((f.clickable === !0 || f.hoverable) && f.intersectionShape !== void 0) {
var a = new _.Vector3(f.x, f.y, f.z);
- f.intersectionShape.sphere.push(new g.Sphere(a, t));
+ f.intersectionShape.sphere.push(new p.Sphere(a, t));
}
}
}
@@ -3986,10 +3986,10 @@ void main() {
if (f.style.sphere) {
var t = f.style.sphere;
if (!t.hidden) {
- var a = this.getRadiusFromStyle(f, t), h = (0, E.getColorFromStyle)(f, t), M = c.updateGeoGroup(1), w = M.vertices, S = w * 3, T = M.vertexArray, R = M.colorArray, z = M.radiusArray;
- if (T[S] = f.x, T[S + 1] = f.y, T[S + 2] = f.z, R[S] = h.r, R[S + 1] = h.g, R[S + 2] = h.b, z[w] = a, (f.clickable === !0 || f.hoverable) && f.intersectionShape !== void 0) {
+ var a = this.getRadiusFromStyle(f, t), h = (0, E.getColorFromStyle)(f, t), M = c.updateGeoGroup(1), w = M.vertices, S = w * 3, T = M.vertexArray, R = M.colorArray, $ = M.radiusArray;
+ if (T[S] = f.x, T[S + 1] = f.y, T[S + 2] = f.z, R[S] = h.r, R[S + 1] = h.g, R[S + 2] = h.b, $[w] = a, (f.clickable === !0 || f.hoverable) && f.intersectionShape !== void 0) {
var P = new _.Vector3(f.x, f.y, f.z);
- f.intersectionShape.sphere.push(new g.Sphere(P, a));
+ f.intersectionShape.sphere.push(new p.Sphere(P, a));
}
M.vertices += 1;
}
@@ -3999,10 +3999,10 @@ void main() {
var h = f.updateGeoGroup(4), M, w = h.vertices, S = w * 3, T = h.vertexArray, R = h.colorArray;
for (M = 0; M < 4; M++)
T[S + 3 * M] = c.x, T[S + 3 * M + 1] = c.y, T[S + 3 * M + 2] = c.z;
- var z = h.normalArray;
+ var $ = h.normalArray;
for (M = 0; M < 4; M++)
R[S + 3 * M] = a.r, R[S + 3 * M + 1] = a.g, R[S + 3 * M + 2] = a.b;
- z[S + 0] = -t, z[S + 1] = t, z[S + 2] = 0, z[S + 3] = -t, z[S + 4] = -t, z[S + 5] = 0, z[S + 6] = t, z[S + 7] = -t, z[S + 8] = 0, z[S + 9] = t, z[S + 10] = t, z[S + 11] = 0, h.vertices += 4;
+ $[S + 0] = -t, $[S + 1] = t, $[S + 2] = 0, $[S + 3] = -t, $[S + 4] = -t, $[S + 5] = 0, $[S + 6] = t, $[S + 7] = -t, $[S + 8] = 0, $[S + 9] = t, $[S + 10] = t, $[S + 11] = 0, h.vertices += 4;
var P = h.faceArray, B = h.faceidx;
P[B + 0] = w, P[B + 1] = w + 1, P[B + 2] = w + 2, P[B + 3] = w + 2, P[B + 4] = w + 3, P[B + 5] = w, h.faceidx += 6;
}
@@ -4014,7 +4014,7 @@ void main() {
var a = this.getRadiusFromStyle(f, t), h = (0, E.getColorFromStyle)(f, t);
if ((f.clickable === !0 || f.hoverable) && f.intersectionShape !== void 0) {
var M = new _.Vector3(f.x, f.y, f.z);
- f.intersectionShape.sphere.push(new g.Sphere(M, a));
+ f.intersectionShape.sphere.push(new p.Sphere(M, a));
}
this.drawSphereImposter(c, f, a, h);
}
@@ -4025,19 +4025,19 @@ void main() {
t = Math.max(t, 0), h = Math.max(h, 0) + 2 * t, a = Math.max(a, 1e-3), a + h > M && (a = M, h = 0);
var w = Math.floor((M - a) / (a + h)) + 1, S = w * a;
h = (M - S) / w;
- for (var T, R = new _.Vector3(f.x, f.y, f.z), z = new _.Vector3((c.x - f.x) / (M / h), (c.y - f.y) / (M / h), (c.z - f.z) / (M / h)), P = new _.Vector3((c.x - f.x) / (M / a), (c.y - f.y) / (M / a), (c.z - f.z) / (M / a)), B = [], U = 0; U < w; U++)
- T = new _.Vector3(R.x + P.x, R.y + P.y, R.z + P.z), B.push({ from: R, to: T }), R = new _.Vector3(T.x + z.x, T.y + z.y, T.z + z.z);
+ for (var T, R = new _.Vector3(f.x, f.y, f.z), $ = new _.Vector3((c.x - f.x) / (M / h), (c.y - f.y) / (M / h), (c.z - f.z) / (M / h)), P = new _.Vector3((c.x - f.x) / (M / a), (c.y - f.y) / (M / a), (c.z - f.z) / (M / a)), B = [], F = 0; F < w; F++)
+ T = new _.Vector3(R.x + P.x, R.y + P.y, R.z + P.z), B.push({ from: R, to: T }), R = new _.Vector3(T.x + $.x, T.y + $.y, T.z + $.z);
return B;
}
static drawStickImposter(f, c, t, a, h, M = 0, w = 0) {
- for (var S = f.updateGeoGroup(4), T = S.vertices, R = T * 3, z = S.vertexArray, P = S.colorArray, B = S.radiusArray, U = S.normalArray, F = h.r, $ = h.g, W = h.b, N = function(ie) {
- var pe = -ie;
- return pe == 0 && (pe = -1e-4), pe;
- }, G = R, k = 0; k < 4; k++)
- z[G] = c.x, U[G] = t.x, P[G] = F, G++, z[G] = c.y, U[G] = t.y, P[G] = $, G++, z[G] = c.z, U[G] = t.z, k < 2 ? P[G] = W : P[G] = N(W), G++;
+ for (var S = f.updateGeoGroup(4), T = S.vertices, R = T * 3, $ = S.vertexArray, P = S.colorArray, B = S.radiusArray, F = S.normalArray, U = h.r, z = h.g, W = h.b, V = function(ie) {
+ var ge = -ie;
+ return ge == 0 && (ge = -1e-4), ge;
+ }, N = R, k = 0; k < 4; k++)
+ $[N] = c.x, F[N] = t.x, P[N] = U, N++, $[N] = c.y, F[N] = t.y, P[N] = z, N++, $[N] = c.z, F[N] = t.z, k < 2 ? P[N] = W : P[N] = V(W), N++;
S.vertices += 4, B[T] = -a, B[T + 1] = a, B[T + 2] = -a, B[T + 3] = a;
- var j = S.faceArray, Q = S.faceidx;
- j[Q + 0] = T, j[Q + 1] = T + 1, j[Q + 2] = T + 2, j[Q + 3] = T + 2, j[Q + 4] = T + 3, j[Q + 5] = T, S.faceidx += 6;
+ var G = S.faceArray, Q = S.faceidx;
+ G[Q + 0] = T, G[Q + 1] = T + 1, G[Q + 2] = T + 2, G[Q + 3] = T + 2, G[Q + 4] = T + 3, G[Q + 5] = T, S.faceidx += 6;
}
// draws cylinders and small spheres (at bond radius)
drawBondSticks(f, c, t) {
@@ -4045,55 +4045,55 @@ void main() {
if (f.style.stick) {
var M = f.style.stick;
if (!M.hidden) {
- var w = M.radius || this.defaultStickRadius, S = M.doubleBondScaling || 0.4, T = M.tripleBondScaling || 0.25, R = ((a = M.dashedBondConfig) === null || a === void 0 ? void 0 : a.dashLength) || 0.1, z = ((h = M.dashedBondConfig) === null || h === void 0 ? void 0 : h.gapLength) || 0.25, P = w, B = M.singleBonds || !1, U = M.dashedBonds || !1, F = 0, $ = 0, W, N, G, k, j, Q, ie, pe, he, ue, se, ae = (0, E.getColorFromStyle)(f, M), we, xe, Ie;
- !f.capDrawn && f.bonds.length < 4 && (F = 2);
- var oe = (Pe) => {
- var le = t.imposter ? n.drawStickImposter : o.GLDraw.drawCylinder;
- return !U && Pe >= 1 ? le : (De, K, Oe, Ne, I, me = 0, ge = 0, Y = 0.1, ne = 0.25) => {
- var Ee = this.calculateDashes(K, Oe, Ne, Y, ne);
+ var w = M.radius || this.defaultStickRadius, S = M.doubleBondScaling || 0.4, T = M.tripleBondScaling || 0.25, R = ((a = M.dashedBondConfig) === null || a === void 0 ? void 0 : a.dashLength) || 0.1, $ = ((h = M.dashedBondConfig) === null || h === void 0 ? void 0 : h.gapLength) || 0.25, P = w, B = M.singleBonds || !1, F = M.dashedBonds || !1, U = 0, z = 0, W, V, N, k, G, Q, ie, ge, le, oe, he, se = (0, E.getColorFromStyle)(f, M), xe, ye, Pe;
+ !f.capDrawn && f.bonds.length < 4 && (U = 2);
+ var de = (Te) => {
+ var ae = t.imposter ? n.drawStickImposter : o.GLDraw.drawCylinder;
+ return !F && Te >= 1 ? ae : (De, Y, Oe, Ve, I, me = 0, ve = 0, X = 0.1, ne = 0.25) => {
+ var Ee = this.calculateDashes(Y, Oe, Ve, X, ne);
Ee.forEach((He) => {
- le(De, He.from, He.to, Ne, I, me, ge);
+ ae(De, He.from, He.to, Ve, I, me, ve);
});
};
};
- for (G = 0; G < f.bonds.length; G++) {
- var ve = oe(f.bondOrder[G]), re = f.bonds[G], Se = c[re];
- if (we = xe = Ie = null, f.index < Se.index) {
- var ze = Se.style;
- if (!ze.stick || ze.stick.hidden)
+ for (N = 0; N < f.bonds.length; N++) {
+ var pe = de(f.bondOrder[N]), re = f.bonds[N], Se = c[re];
+ if (xe = ye = Pe = null, f.index < Se.index) {
+ var ke = Se.style;
+ if (!ke.stick || ke.stick.hidden)
continue;
- var Ge = (0, E.getColorFromStyle)(Se, ze.stick);
- if (P = w, k = B, f.bondStyles && f.bondStyles[G]) {
- if (j = f.bondStyles[G], j.iswire)
+ var $e = (0, E.getColorFromStyle)(Se, ke.stick);
+ if (P = w, k = B, f.bondStyles && f.bondStyles[N]) {
+ if (G = f.bondStyles[N], G.iswire)
continue;
- j.radius && (P = j.radius), j.singleBond && (k = !0), typeof j.color1 < "u" && (ae = x.CC.color(j.color1)), typeof j.color2 < "u" && (Ge = x.CC.color(j.color2));
+ G.radius && (P = G.radius), G.singleBond && (k = !0), typeof G.color1 < "u" && (se = x.CC.color(G.color1)), typeof G.color2 < "u" && ($e = x.CC.color(G.color2));
}
- var $e = new _.Vector3(f.x, f.y, f.z), Re = new _.Vector3(Se.x, Se.y, Se.z);
- if (f.bondOrder[G] <= 1 || k || f.bondOrder[G] > 3) {
- if (f.bondOrder[G] < 1 && (P *= f.bondOrder[G]), !Se.capDrawn && Se.bonds.length < 4 && ($ = 2), ae != Ge ? (we = new _.Vector3().addVectors($e, Re).multiplyScalar(0.5), ve(t, $e, we, P, ae, F, 0, R, z), ve(t, we, Re, P, Ge, 0, $, R, z)) : ve(t, $e, Re, P, ae, F, $, R, z), W = f.clickable || f.hoverable, N = Se.clickable || Se.hoverable, W || N) {
- if (we || (we = new _.Vector3().addVectors($e, Re).multiplyScalar(0.5)), W) {
- var Be = new g.Cylinder($e, we, P), ke = new g.Sphere($e, P);
- f.intersectionShape.cylinder.push(Be), f.intersectionShape.sphere.push(ke);
+ var ze = new _.Vector3(f.x, f.y, f.z), Re = new _.Vector3(Se.x, Se.y, Se.z);
+ if (f.bondOrder[N] <= 1 || k || f.bondOrder[N] > 3) {
+ if (f.bondOrder[N] < 1 && (P *= f.bondOrder[N]), !Se.capDrawn && Se.bonds.length < 4 && (z = 2), se != $e ? (xe = new _.Vector3().addVectors(ze, Re).multiplyScalar(0.5), pe(t, ze, xe, P, se, U, 0, R, $), pe(t, xe, Re, P, $e, 0, z, R, $)) : pe(t, ze, Re, P, se, U, z, R, $), W = f.clickable || f.hoverable, V = Se.clickable || Se.hoverable, W || V) {
+ if (xe || (xe = new _.Vector3().addVectors(ze, Re).multiplyScalar(0.5)), W) {
+ var Fe = new p.Cylinder(ze, xe, P), Ie = new p.Sphere(ze, P);
+ f.intersectionShape.cylinder.push(Fe), f.intersectionShape.sphere.push(Ie);
}
- if (N) {
- var We = new g.Cylinder(Re, we, P), Te = new g.Sphere(Re, P);
- Se.intersectionShape.cylinder.push(We), Se.intersectionShape.sphere.push(Te);
+ if (V) {
+ var We = new p.Cylinder(Re, xe, P), Ue = new p.Sphere(Re, P);
+ Se.intersectionShape.cylinder.push(We), Se.intersectionShape.sphere.push(Ue);
}
}
- } else if (f.bondOrder[G] > 1) {
- var je = 0, Fe = 0;
- P != w && (je = 2, Fe = 2);
- var X = Re.clone(), Z = null;
- X.sub($e);
+ } else if (f.bondOrder[N] > 1) {
+ var Be = 0, Ne = 0;
+ P != w && (Be = 2, Ne = 2);
+ var H = Re.clone(), K = null;
+ H.sub(ze);
var q, fe, _e, Me, Ae;
- Z = this.getSideBondV(f, Se, G), f.bondOrder[G] == 2 ? (q = P * S, Z.multiplyScalar(q * 1.5), fe = $e.clone(), fe.add(Z), _e = $e.clone(), _e.sub(Z), Me = fe.clone(), Me.add(X), Ae = _e.clone(), Ae.add(X), ae != Ge ? (we = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5), xe = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5), ve(t, fe, we, q, ae, je, 0), ve(t, we, Me, q, Ge, 0, Fe), ve(t, _e, xe, q, ae, je, 0), ve(t, xe, Ae, q, Ge, 0, Fe)) : (ve(t, fe, Me, q, ae, je, Fe), ve(t, _e, Ae, q, ae, je, Fe)), W = f.clickable || f.hoverable, N = Se.clickable || Se.hoverable, (W || N) && (we || (we = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5)), xe || (xe = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5)), W && (Q = new g.Cylinder(fe, we, q), ie = new g.Cylinder(_e, xe, q), f.intersectionShape.cylinder.push(Q), f.intersectionShape.cylinder.push(ie)), N && (he = new g.Cylinder(Me, we, q), ue = new g.Cylinder(Ae, xe, q), Se.intersectionShape.cylinder.push(he), Se.intersectionShape.cylinder.push(ue)))) : f.bondOrder[G] == 3 && (q = P * T, Z.cross(X), Z.normalize(), Z.multiplyScalar(q * 3), fe = $e.clone(), fe.add(Z), _e = $e.clone(), _e.sub(Z), Me = fe.clone(), Me.add(X), Ae = _e.clone(), Ae.add(X), ae != Ge ? (we = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5), xe = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5), Ie = new _.Vector3().addVectors($e, Re).multiplyScalar(0.5), ve(t, fe, we, q, ae, je, 0), ve(t, we, Me, q, Ge, 0, Fe), ve(t, $e, Ie, q, ae, F, 0), ve(t, Ie, Re, q, Ge, 0, $), ve(t, _e, xe, q, ae, je, 0), ve(t, xe, Ae, q, Ge, 0, Fe)) : (ve(t, fe, Me, q, ae, je, Fe), ve(t, $e, Re, q, ae, F, $), ve(t, _e, Ae, q, ae, je, Fe)), W = f.clickable || f.hoverable, N = Se.clickable || Se.hoverable, (W || N) && (we || (we = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5)), xe || (xe = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5)), Ie || (Ie = new _.Vector3().addVectors($e, Re).multiplyScalar(0.5)), W && (Q = new g.Cylinder(fe.clone(), we.clone(), q), ie = new g.Cylinder(_e.clone(), xe.clone(), q), pe = new g.Cylinder($e.clone(), Ie.clone(), q), f.intersectionShape.cylinder.push(Q), f.intersectionShape.cylinder.push(ie), f.intersectionShape.cylinder.push(pe)), N && (he = new g.Cylinder(Me.clone(), we.clone(), q), ue = new g.Cylinder(Ae.clone(), xe.clone(), q), se = new g.Cylinder(Re.clone(), Ie.clone(), q), Se.intersectionShape.cylinder.push(he), Se.intersectionShape.cylinder.push(ue), Se.intersectionShape.cylinder.push(se))));
+ K = this.getSideBondV(f, Se, N), f.bondOrder[N] == 2 ? (q = P * S, K.multiplyScalar(q * 1.5), fe = ze.clone(), fe.add(K), _e = ze.clone(), _e.sub(K), Me = fe.clone(), Me.add(H), Ae = _e.clone(), Ae.add(H), se != $e ? (xe = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5), ye = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5), pe(t, fe, xe, q, se, Be, 0), pe(t, xe, Me, q, $e, 0, Ne), pe(t, _e, ye, q, se, Be, 0), pe(t, ye, Ae, q, $e, 0, Ne)) : (pe(t, fe, Me, q, se, Be, Ne), pe(t, _e, Ae, q, se, Be, Ne)), W = f.clickable || f.hoverable, V = Se.clickable || Se.hoverable, (W || V) && (xe || (xe = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5)), ye || (ye = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5)), W && (Q = new p.Cylinder(fe, xe, q), ie = new p.Cylinder(_e, ye, q), f.intersectionShape.cylinder.push(Q), f.intersectionShape.cylinder.push(ie)), V && (le = new p.Cylinder(Me, xe, q), oe = new p.Cylinder(Ae, ye, q), Se.intersectionShape.cylinder.push(le), Se.intersectionShape.cylinder.push(oe)))) : f.bondOrder[N] == 3 && (q = P * T, K.cross(H), K.normalize(), K.multiplyScalar(q * 3), fe = ze.clone(), fe.add(K), _e = ze.clone(), _e.sub(K), Me = fe.clone(), Me.add(H), Ae = _e.clone(), Ae.add(H), se != $e ? (xe = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5), ye = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5), Pe = new _.Vector3().addVectors(ze, Re).multiplyScalar(0.5), pe(t, fe, xe, q, se, Be, 0), pe(t, xe, Me, q, $e, 0, Ne), pe(t, ze, Pe, q, se, U, 0), pe(t, Pe, Re, q, $e, 0, z), pe(t, _e, ye, q, se, Be, 0), pe(t, ye, Ae, q, $e, 0, Ne)) : (pe(t, fe, Me, q, se, Be, Ne), pe(t, ze, Re, q, se, U, z), pe(t, _e, Ae, q, se, Be, Ne)), W = f.clickable || f.hoverable, V = Se.clickable || Se.hoverable, (W || V) && (xe || (xe = new _.Vector3().addVectors(fe, Me).multiplyScalar(0.5)), ye || (ye = new _.Vector3().addVectors(_e, Ae).multiplyScalar(0.5)), Pe || (Pe = new _.Vector3().addVectors(ze, Re).multiplyScalar(0.5)), W && (Q = new p.Cylinder(fe.clone(), xe.clone(), q), ie = new p.Cylinder(_e.clone(), ye.clone(), q), ge = new p.Cylinder(ze.clone(), Pe.clone(), q), f.intersectionShape.cylinder.push(Q), f.intersectionShape.cylinder.push(ie), f.intersectionShape.cylinder.push(ge)), V && (le = new p.Cylinder(Me.clone(), xe.clone(), q), oe = new p.Cylinder(Ae.clone(), ye.clone(), q), he = new p.Cylinder(Re.clone(), Pe.clone(), q), Se.intersectionShape.cylinder.push(le), Se.intersectionShape.cylinder.push(oe), Se.intersectionShape.cylinder.push(he))));
}
}
}
- var H = !1, ce = 0, ye = !1;
- for (G = 0; G < f.bonds.length; G++)
- k = B, f.bondStyles && f.bondStyles[G] && (j = f.bondStyles[G], j.singleBond && (k = !0), j.radius && j.radius != w && (ye = !0)), (k || f.bondOrder[G] == 1) && ce++;
- ye ? ce > 0 && (H = !0) : ce == 0 && (f.bonds.length > 0 || M.showNonBonded) && (H = !0), H && (P = w, t.imposter ? this.drawSphereImposter(t.sphereGeometry, f, P, ae) : o.GLDraw.drawSphere(t, f, P, ae));
+ var Z = !1, ue = 0, we = !1;
+ for (N = 0; N < f.bonds.length; N++)
+ k = B, f.bondStyles && f.bondStyles[N] && (G = f.bondStyles[N], G.singleBond && (k = !0), G.radius && G.radius != w && (we = !0)), (k || f.bondOrder[N] == 1) && ue++;
+ we ? ue > 0 && (Z = !0) : ue == 0 && (f.bonds.length > 0 || M.showNonBonded) && (Z = !0), Z && (P = w, t.imposter ? this.drawSphereImposter(t.sphereGeometry, f, P, se) : o.GLDraw.drawSphere(t, f, P, se));
}
}
}
@@ -4107,77 +4107,77 @@ void main() {
c = c || {};
var t = new l.Object3D(), a = [], h = {}, M = {}, w = this.drawAtomSphere, S = null, T = null;
c.supportsImposters ? (w = this.drawAtomImposter, S = new l.Geometry(!0), S.imposter = !0, T = new l.Geometry(!0, !0), T.imposter = !0, T.sphereGeometry = new l.Geometry(!0), T.sphereGeometry.imposter = !0, T.drawnCaps = {}) : c.supportsAIA ? (w = this.drawAtomInstanced, S = new l.Geometry(!1, !0, !0), S.instanced = !0, T = new l.Geometry(!0)) : (S = new l.Geometry(!0), T = new l.Geometry(!0));
- var R, z, P, B, U = {}, F = [Number.POSITIVE_INFINITY, Number.NEGATIVE_INFINITY];
+ var R, $, P, B, F = {}, U = [Number.POSITIVE_INFINITY, Number.NEGATIVE_INFINITY];
for (R = 0, P = f.length; R < P; R++) {
- var $ = f[R];
- if ($ && $.style) {
- ($.clickable || $.hoverable) && $.intersectionShape === void 0 && ($.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), B = { line: void 0, cross: void 0, stick: void 0, sphere: void 0 };
- for (z in B)
- $.style[z] ? $.style[z].opacity ? B[z] = parseFloat($.style[z].opacity) : B[z] = 1 : B[z] = void 0, U[z] ? B[z] != null && U[z] != B[z] && (console.log("Warning: " + z + " opacity is ambiguous"), U[z] = 1) : U[z] = B[z];
- w.call(this, $, S), this.drawAtomClickSphere($), this.drawAtomCross($, M), this.drawBondLines($, f, h), this.drawBondSticks($, f, T), typeof $.style.cartoon < "u" && !$.style.cartoon.hidden && ($.style.cartoon.color === "spectrum" && typeof $.resi == "number" && !$.hetflag && ($.resi < F[0] && (F[0] = $.resi), $.resi > F[1] && (F[1] = $.resi)), a.push($));
+ var z = f[R];
+ if (z && z.style) {
+ (z.clickable || z.hoverable) && z.intersectionShape === void 0 && (z.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), B = { line: void 0, cross: void 0, stick: void 0, sphere: void 0 };
+ for ($ in B)
+ z.style[$] ? z.style[$].opacity ? B[$] = parseFloat(z.style[$].opacity) : B[$] = 1 : B[$] = void 0, F[$] ? B[$] != null && F[$] != B[$] && (console.log("Warning: " + $ + " opacity is ambiguous"), F[$] = 1) : F[$] = B[$];
+ w.call(this, z, S), this.drawAtomClickSphere(z), this.drawAtomCross(z, M), this.drawBondLines(z, f, h), this.drawBondSticks(z, f, T), typeof z.style.cartoon < "u" && !z.style.cartoon.hidden && (z.style.cartoon.color === "spectrum" && typeof z.resi == "number" && !z.hetflag && (z.resi < U[0] && (U[0] = z.resi), z.resi > U[1] && (U[1] = z.resi)), a.push(z));
}
}
- if (a.length > 0 && (0, p.drawCartoon)(t, a, F, this.defaultCartoonQuality), S && S.vertices > 0) {
+ if (a.length > 0 && (0, g.drawCartoon)(t, a, U, this.defaultCartoonQuality), S && S.vertices > 0) {
S.initTypedArrays();
- var W = null, N = null;
+ var W = null, V = null;
S.imposter ? W = new l.SphereImposterMaterial({
ambient: 0,
vertexColors: !0,
reflectivity: 0
- }) : S.instanced ? (N = new l.Geometry(!0), o.GLDraw.drawSphere(N, { x: 0, y: 0, z: 0 }, 1, new x.Color(0.5, 0.5, 0.5)), N.initTypedArrays(), W = new l.InstancedMaterial({
+ }) : S.instanced ? (V = new l.Geometry(!0), o.GLDraw.drawSphere(V, { x: 0, y: 0, z: 0 }, 1, new x.Color(0.5, 0.5, 0.5)), V.initTypedArrays(), W = new l.InstancedMaterial({
sphereMaterial: new l.MeshLambertMaterial({
ambient: 0,
vertexColors: !0,
reflectivity: 0
}),
- sphere: N
+ sphere: V
})) : W = new l.MeshLambertMaterial({
ambient: 0,
vertexColors: !0,
reflectivity: 0
- }), U.sphere < 1 && U.sphere >= 0 && (W.transparent = !0, W.opacity = U.sphere), N = new l.Mesh(S, W), t.add(N);
+ }), F.sphere < 1 && F.sphere >= 0 && (W.transparent = !0, W.opacity = F.sphere), V = new l.Mesh(S, W), t.add(V);
}
if (T.vertices > 0) {
- var G = null, k = null, j = T.sphereGeometry;
- (!j || typeof j.vertices > "u" || j.vertices == 0) && (j = null), T.initTypedArrays(), j && j.initTypedArrays();
+ var N = null, k = null, G = T.sphereGeometry;
+ (!G || typeof G.vertices > "u" || G.vertices == 0) && (G = null), T.initTypedArrays(), G && G.initTypedArrays();
var Q = { ambient: 0, vertexColors: !0, reflectivity: 0 };
- T.imposter ? (G = new l.StickImposterMaterial(Q), k = new l.SphereImposterMaterial(Q)) : (G = new l.MeshLambertMaterial(Q), k = new l.MeshLambertMaterial(Q), G.wireframe && (T.setUpWireframe(), j && j.setUpWireframe())), U.stick < 1 && U.stick >= 0 && (G.transparent = !0, G.opacity = U.stick, k.transparent = !0, k.opacity = U.stick);
- var ie = new l.Mesh(T, G);
- if (t.add(ie), j) {
- var pe = new l.Mesh(j, k);
- t.add(pe);
+ T.imposter ? (N = new l.StickImposterMaterial(Q), k = new l.SphereImposterMaterial(Q)) : (N = new l.MeshLambertMaterial(Q), k = new l.MeshLambertMaterial(Q), N.wireframe && (T.setUpWireframe(), G && G.setUpWireframe())), F.stick < 1 && F.stick >= 0 && (N.transparent = !0, N.opacity = F.stick, k.transparent = !0, k.opacity = F.stick);
+ var ie = new l.Mesh(T, N);
+ if (t.add(ie), G) {
+ var ge = new l.Mesh(G, k);
+ t.add(ge);
}
}
- var he;
+ var le;
for (R in h)
if (h.hasOwnProperty(R)) {
- he = R;
- var ue = new l.LineBasicMaterial({
- linewidth: he,
+ le = R;
+ var oe = new l.LineBasicMaterial({
+ linewidth: le,
vertexColors: !0
});
- U.line < 1 && U.line >= 0 && (ue.transparent = !0, ue.opacity = U.line), h[R].initTypedArrays();
- var se = new l.Line(h[R], ue, l.LineStyle.LinePieces);
- t.add(se);
+ F.line < 1 && F.line >= 0 && (oe.transparent = !0, oe.opacity = F.line), h[R].initTypedArrays();
+ var he = new l.Line(h[R], oe, l.LineStyle.LinePieces);
+ t.add(he);
}
for (R in M)
if (M.hasOwnProperty(R)) {
- he = R;
- var ae = new l.LineBasicMaterial({
- linewidth: he,
+ le = R;
+ var se = new l.LineBasicMaterial({
+ linewidth: le,
vertexColors: !0
});
- U.cross < 1 && U.cross >= 0 && (ae.transparent = !0, ae.opacity = U.cross), M[R].initTypedArrays();
- var we = new l.Line(M[R], ae, l.LineStyle.LinePieces);
- t.add(we);
+ F.cross < 1 && F.cross >= 0 && (se.transparent = !0, se.opacity = F.cross), M[R].initTypedArrays();
+ var xe = new l.Line(M[R], se, l.LineStyle.LinePieces);
+ t.add(xe);
}
if (this.dontDuplicateAtoms && this.modelData.symmetries && this.modelData.symmetries.length > 0) {
- var xe = new l.Object3D(), Ie;
- for (Ie = 0; Ie < this.modelData.symmetries.length; Ie++) {
- var oe = new l.Object3D();
- oe = t.clone(), oe.matrix.copy(this.modelData.symmetries[Ie]), oe.matrixAutoUpdate = !1, xe.add(oe);
+ var ye = new l.Object3D(), Pe;
+ for (Pe = 0; Pe < this.modelData.symmetries.length; Pe++) {
+ var de = new l.Object3D();
+ de = t.clone(), de.matrix.copy(this.modelData.symmetries[Pe]), de.matrixAutoUpdate = !1, ye.add(de);
}
- return xe;
+ return ye;
}
return t;
}
@@ -4296,8 +4296,8 @@ void main() {
if (this.box && this.atomdfs)
for (var f = this.box[0], c = this.box[1], t = this.box[2], a = f * 0.9, h = c * 0.9, M = t * 0.9, w = 0; w < this.atomdfs.length; w++)
for (var S = this.atomdfs[w], T = 1; T < S.length; T++) {
- var R = this.atoms[S[T][0]], z = this.atoms[S[T][1]];
- R.x = this.adjustCoord(z.x, R.x, a, f), R.y = this.adjustCoord(z.y, R.y, h, c), R.z = this.adjustCoord(z.z, R.z, M, t);
+ var R = this.atoms[S[T][0]], $ = this.atoms[S[T][1]];
+ R.x = this.adjustCoord($.x, R.x, a, f), R.y = this.adjustCoord($.y, R.y, h, c), R.z = this.adjustCoord($.z, R.z, M, t);
}
}
/**
@@ -4314,8 +4314,8 @@ void main() {
if (t == 0 && h(), (f < 0 || f >= t) && (f = t - 1), a.frames.url != null) {
var w = a.frames.url;
(0, E.getbin)(w + "/traj/frame/" + f + "/" + a.frames.path, void 0, "POST", void 0).then(function(S) {
- for (var T = new Float32Array(S, 44), R = 0, z = 0; z < a.atoms.length; z++)
- a.atoms[z].x = T[R++], a.atoms[z].y = T[R++], a.atoms[z].z = T[R++];
+ for (var T = new Float32Array(S, 44), R = 0, $ = 0; $ < a.atoms.length; $++)
+ a.atoms[$].x = T[R++], a.atoms[$].y = T[R++], a.atoms[$].z = T[R++];
a.box && a.atomdfs && a.adjustCoordinatesToBox(), h();
}).catch(M);
} else
@@ -4360,17 +4360,17 @@ void main() {
this.frames.push(this.atoms);
continue;
}
- for (var z = 0; z < this.atoms.length; z++) {
- var P = (0, E.getAtomProperty)(this.atoms[z], "dx"), B = (0, E.getAtomProperty)(this.atoms[z], "dy"), U = (0, E.getAtomProperty)(this.atoms[z], "dz"), F = new _.Vector3(P, B, U), $ = new _.Vector3(this.atoms[z].x, this.atoms[z].y, this.atoms[z].z), W = S * c / f;
- F.multiplyScalar(W), $.add(F);
- var N = {};
- for (var G in this.atoms[z])
- N[G] = this.atoms[z][G];
- if (N.x = $.x, N.y = $.y, N.z = $.z, T.push(N), a && h) {
- var k = (0, E.extend)({}, h), j = new _.Vector3(P, B, U);
- if (j.multiplyScalar(c), j.add($), k.start = $, k.end = j, k.frame = R, !k.color) {
- var Q = N.style.sphere;
- Q || (Q = N.style.stick), Q || (Q = N.style.line), k.color = (0, E.getColorFromStyle)(N, Q);
+ for (var $ = 0; $ < this.atoms.length; $++) {
+ var P = (0, E.getAtomProperty)(this.atoms[$], "dx"), B = (0, E.getAtomProperty)(this.atoms[$], "dy"), F = (0, E.getAtomProperty)(this.atoms[$], "dz"), U = new _.Vector3(P, B, F), z = new _.Vector3(this.atoms[$].x, this.atoms[$].y, this.atoms[$].z), W = S * c / f;
+ U.multiplyScalar(W), z.add(U);
+ var V = {};
+ for (var N in this.atoms[$])
+ V[N] = this.atoms[$][N];
+ if (V.x = z.x, V.y = z.y, V.z = z.z, T.push(V), a && h) {
+ var k = (0, E.extend)({}, h), G = new _.Vector3(P, B, F);
+ if (G.multiplyScalar(c), G.add(z), k.start = z, k.end = G, k.frame = R, !k.color) {
+ var Q = V.style.sphere;
+ Q || (Q = V.style.stick), Q || (Q = V.style.line), k.color = (0, E.getColorFromStyle)(V, Q);
}
a.addArrow(k);
}
@@ -4459,10 +4459,10 @@ void main() {
}
if (a == "and") {
const w = function(T, R) {
- const z = /* @__PURE__ */ new Set();
+ const $ = /* @__PURE__ */ new Set();
for (const P of R)
- T.has(P) && z.add(P);
- return z;
+ T.has(P) && $.add(P);
+ return $;
};
let S = new Set(M[0]);
for (const T of M.splice(1))
@@ -4530,8 +4530,8 @@ void main() {
}
} else if (Array.isArray(c[h])) {
var T = c[h], R = f[h];
- for (let z = 0; z < T.length; z++)
- if (this.propertyMatches(R, T[z])) {
+ for (let $ = 0; $ < T.length; $++)
+ if (this.propertyMatches(R, T[$])) {
w = !0;
break;
}
@@ -4540,8 +4540,8 @@ void main() {
break;
}
} else {
- let z = c[h];
- if (!this.propertyMatches(f[h], z)) {
+ let $ = c[h];
+ if (!this.propertyMatches(f[h], $)) {
a = !1;
break;
}
@@ -4599,22 +4599,22 @@ void main() {
M && this.atomIsSelected(M, f) && t.push(M);
}
if (f.hasOwnProperty("expand")) {
- const N = n.getFloat(f.expand);
- let G = this.expandAtomList(t, N), k = t.length;
- const j = N * N;
- for (let Q = 0; Q < G.length; Q++)
+ const V = n.getFloat(f.expand);
+ let N = this.expandAtomList(t, V), k = t.length;
+ const G = V * V;
+ for (let Q = 0; Q < N.length; Q++)
for (let ie = 0; ie < k; ie++) {
- var w = n.squaredDistance(G[Q], t[ie]);
- w < j && w > 0 && t.push(G[Q]);
+ var w = n.squaredDistance(N[Q], t[ie]);
+ w < G && w > 0 && t.push(N[Q]);
}
}
if (f.hasOwnProperty("within") && f.within.hasOwnProperty("sel") && f.within.hasOwnProperty("distance")) {
var S = this.selectedAtoms(f.within.sel, this.atoms), T = {};
- const N = n.getFloat(f.within.distance), G = N * N;
+ const V = n.getFloat(f.within.distance), N = V * V;
for (let k = 0; k < S.length; k++)
- for (let j = 0; j < t.length; j++) {
- let Q = n.squaredDistance(S[k], t[j]);
- Q < G && Q > 0 && (T[j] = 1);
+ for (let G = 0; G < t.length; G++) {
+ let Q = n.squaredDistance(S[k], t[G]);
+ Q < N && Q > 0 && (T[G] = 1);
}
var R = [];
if (f.within.invert)
@@ -4626,17 +4626,17 @@ void main() {
t = R;
}
if (f.hasOwnProperty("byres")) {
- var z = {}, P = [], B = [];
- for (let N = 0; N < t.length; N++) {
- let G = t[N];
- var U = G.chain, F = G.resi;
- if (z[U] === void 0 && (z[U] = {}), G.hasOwnProperty("resi") && z[U][F] === void 0) {
- for (z[U][F] = !0, B.push(G); B.length > 0; )
- if (G = B.pop(), U = G.chain, F = G.resi, P[G.index] === void 0) {
- P[G.index] = !0;
- for (var $ = 0; $ < G.bonds.length; $++) {
- var W = this.atoms[G.bonds[$]];
- P[W.index] === void 0 && W.hasOwnProperty("resi") && W.chain == U && W.resi == F && (B.push(W), t.push(W));
+ var $ = {}, P = [], B = [];
+ for (let V = 0; V < t.length; V++) {
+ let N = t[V];
+ var F = N.chain, U = N.resi;
+ if ($[F] === void 0 && ($[F] = {}), N.hasOwnProperty("resi") && $[F][U] === void 0) {
+ for ($[F][U] = !0, B.push(N); B.length > 0; )
+ if (N = B.pop(), F = N.chain, U = N.resi, P[N.index] === void 0) {
+ P[N.index] = !0;
+ for (var z = 0; z < N.bonds.length; z++) {
+ var W = this.atoms[N.bonds[z]];
+ P[W.index] === void 0 && W.hasOwnProperty("resi") && W.chain == F && W.resi == U && (B.push(W), t.push(W));
}
}
}
@@ -4723,8 +4723,8 @@ void main() {
S[R] && (S[R].capDrawn = !1);
for (let R = 0; R < T.length; R++) {
a = !0, (T[R].clickable || T[R].hoverable) && (T[R].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), t || (T[R].style = {});
- for (let z in c)
- c.hasOwnProperty(z) && (T[R].style[z] = T[R].style[z] || {}, Object.assign(T[R].style[z], c[z]));
+ for (let $ in c)
+ c.hasOwnProperty($) && (T[R].style[$] = T[R].style[$] || {}, Object.assign(T[R].style[$], c[$]));
}
};
if (f.frame !== void 0 && f.frame < this.frames.length) {
@@ -4866,8 +4866,8 @@ void main() {
let R = {
b: S,
e: T
- }, z = M.bondOrder[w];
- z != 1 && (R.o = z), c.b.push(R);
+ }, $ = M.bondOrder[w];
+ $ != 1 && (R.o = $), c.b.push(R);
}
}
return c;
@@ -4949,24 +4949,24 @@ void main() {
*/
addResLabels(f, c, t, a = !1) {
var h = [], M = function(S, T) {
- for (var R = S.selectedAtoms(f, R), z = {}, P = 0; P < R.length; P++) {
- var B = R[P], U = B.chain, F = B.resn, $ = B.resi, W = F + "" + $;
- z[U] || (z[U] = {}), z[U][W] || (z[U][W] = []), z[U][W].push(B);
+ for (var R = S.selectedAtoms(f, R), $ = {}, P = 0; P < R.length; P++) {
+ var B = R[P], F = B.chain, U = B.resn, z = B.resi, W = U + "" + z;
+ $[F] || ($[F] = {}), $[F][W] || ($[F][W] = []), $[F][W].push(B);
}
- var N = (0, E.deepCopy)(t);
- for (let k in z)
- if (z.hasOwnProperty(k)) {
- var G = z[k];
- for (let j in G)
- if (G.hasOwnProperty(j)) {
- let Q = G[j], ie = new _.Vector3(0, 0, 0);
- for (let he = 0; he < Q.length; he++) {
- let ue = Q[he];
- ie.x += ue.x, ie.y += ue.y, ie.z += ue.z;
+ var V = (0, E.deepCopy)(t);
+ for (let k in $)
+ if ($.hasOwnProperty(k)) {
+ var N = $[k];
+ for (let G in N)
+ if (N.hasOwnProperty(G)) {
+ let Q = N[G], ie = new _.Vector3(0, 0, 0);
+ for (let le = 0; le < Q.length; le++) {
+ let oe = Q[le];
+ ie.x += oe.x, ie.y += oe.y, ie.z += oe.z;
}
- ie.divideScalar(Q.length), N.position = ie, N.frame = T;
- let pe = c.addLabel(j, N, void 0, !0);
- h.push(pe);
+ ie.divideScalar(Q.length), V.position = ie, V.frame = T;
+ let ge = c.addLabel(G, V, void 0, !0);
+ h.push(ge);
}
}
};
@@ -4989,8 +4989,8 @@ void main() {
T.push([w, S]);
var R = f.atoms[w];
c[w] = 1;
- for (var z = 0; z < R.bonds.length; z++) {
- var P = R.bonds[z];
+ for (var $ = 0; $ < R.bonds.length; $++) {
+ var P = R.bonds[$];
f.atoms[P] && !c[P] && t(P, w, T);
}
}, a = 0; a < this.atoms.length; a++) {
@@ -5036,8 +5036,8 @@ void main() {
c = c.replace(/\.gz$/, "");
try {
f = r(f);
- } catch (z) {
- console.log(z);
+ } catch ($) {
+ console.log($);
}
}
var t = { mdcrd: "", inpcrd: "", pdb: "", netcdf: "", array: "" };
@@ -5085,7 +5085,7 @@ TER` && (h = f.indexOf(`
ATOM`, h);
}
else if (c == "netcdf") {
- var M = new C.NetCDFReader(f);
+ var M = new L.NetCDFReader(f);
t = [].concat.apply([], M.getDataVariable("coordinates"));
} else {
if (c == "array" || Array.isArray(f))
@@ -5186,19 +5186,19 @@ ATOM`, h);
/* harmony export */
GLShape: () => (
/* binding */
- C
+ L
),
/* harmony export */
splitMesh: () => (
/* binding */
- L
+ C
)
/* harmony export */
});
var l = e(
/*! ./WebGL */
"./src/WebGL/index.ts"
- ), g = e(
+ ), p = e(
/*! ./WebGL/shapes */
"./src/WebGL/shapes/index.ts"
), _ = e(
@@ -5210,7 +5210,7 @@ ATOM`, h);
), o = e(
/*! ./ProteinSurface4 */
"./src/ProteinSurface4.ts"
- ), p = e(
+ ), g = e(
/*! ./VolumeData */
"./src/VolumeData.ts"
), E = e(
@@ -5223,7 +5223,7 @@ ATOM`, h);
/*! ./utilities */
"./src/utilities.ts"
);
- class C {
+ class L {
static finalizeGeo(r) {
var n = r.updateGeoGroup(0);
n.vertices > 0 && n.truncateArrayBuffers(!0, !0);
@@ -5263,38 +5263,38 @@ ATOM`, h);
return;
var w = n.updateGeoGroup(51), S = new _.Vector3(c.x, c.y, c.z).sub(f);
if (M) {
- let le = S.length();
- M > 0 ? h = M / le : h = (le + M) / le;
+ let ae = S.length();
+ M > 0 ? h = M / ae : h = (ae + M) / ae;
}
S.multiplyScalar(h);
var T = new _.Vector3(f.x, f.y, f.z).add(S), R = S.clone().negate();
- let z = new _.Vector3(f.x, f.y, f.z);
- r.intersectionShape.cylinder.push(new g.Cylinder(z, T.clone(), t)), r.intersectionShape.sphere.push(new g.Sphere(z, t));
+ let $ = new _.Vector3(f.x, f.y, f.z);
+ r.intersectionShape.cylinder.push(new p.Cylinder($, T.clone(), t)), r.intersectionShape.sphere.push(new p.Sphere($, t));
var P = [];
P[0] = S.clone(), Math.abs(P[0].x) > 1e-4 ? P[0].y += 1 : P[0].x += 1, P[0].cross(S), P[0].normalize(), P[4] = P[0].clone(), P[4].crossVectors(P[0], S), P[4].normalize(), P[8] = P[0].clone().negate(), P[12] = P[4].clone().negate(), P[2] = P[0].clone().add(P[4]).normalize(), P[6] = P[4].clone().add(P[8]).normalize(), P[10] = P[8].clone().add(P[12]).normalize(), P[14] = P[12].clone().add(P[0]).normalize(), P[1] = P[0].clone().add(P[2]).normalize(), P[3] = P[2].clone().add(P[4]).normalize(), P[5] = P[4].clone().add(P[6]).normalize(), P[7] = P[6].clone().add(P[8]).normalize(), P[9] = P[8].clone().add(P[10]).normalize(), P[11] = P[10].clone().add(P[12]).normalize(), P[13] = P[12].clone().add(P[14]).normalize(), P[15] = P[14].clone().add(P[0]).normalize();
- var B = w.vertices, U = w.vertexArray, F = w.faceArray, $ = w.normalArray, W = w.lineArray, N, G, k;
- for (G = 0, k = P.length; G < k; ++G) {
- N = 3 * (B + 3 * G);
- var j = P[G].clone().multiplyScalar(t).add(f), Q = P[G].clone().multiplyScalar(t).add(T), ie = P[G].clone().multiplyScalar(t * a).add(T);
- if (U[N] = j.x, U[N + 1] = j.y, U[N + 2] = j.z, U[N + 3] = Q.x, U[N + 4] = Q.y, U[N + 5] = Q.z, U[N + 6] = ie.x, U[N + 7] = ie.y, U[N + 8] = ie.z, G > 0) {
- var pe = U[N - 3], he = U[N - 2], ue = U[N - 1], se = new _.Vector3(pe, he, ue), ae = new _.Vector3(c.x, c.y, c.z), we = T.clone(), xe = new _.Vector3(ie.x, ie.y, ie.z);
- r.intersectionShape.triangle.push(new g.Triangle(xe, ae, se)), r.intersectionShape.triangle.push(new g.Triangle(se.clone(), we, xe.clone()));
+ var B = w.vertices, F = w.vertexArray, U = w.faceArray, z = w.normalArray, W = w.lineArray, V, N, k;
+ for (N = 0, k = P.length; N < k; ++N) {
+ V = 3 * (B + 3 * N);
+ var G = P[N].clone().multiplyScalar(t).add(f), Q = P[N].clone().multiplyScalar(t).add(T), ie = P[N].clone().multiplyScalar(t * a).add(T);
+ if (F[V] = G.x, F[V + 1] = G.y, F[V + 2] = G.z, F[V + 3] = Q.x, F[V + 4] = Q.y, F[V + 5] = Q.z, F[V + 6] = ie.x, F[V + 7] = ie.y, F[V + 8] = ie.z, N > 0) {
+ var ge = F[V - 3], le = F[V - 2], oe = F[V - 1], he = new _.Vector3(ge, le, oe), se = new _.Vector3(c.x, c.y, c.z), xe = T.clone(), ye = new _.Vector3(ie.x, ie.y, ie.z);
+ r.intersectionShape.triangle.push(new p.Triangle(ye, se, he)), r.intersectionShape.triangle.push(new p.Triangle(he.clone(), xe, ye.clone()));
}
}
- w.vertices += 48, N = w.vertices * 3, U[N] = f.x, U[N + 1] = f.y, U[N + 2] = f.z, U[N + 3] = T.x, U[N + 4] = T.y, U[N + 5] = T.z, U[N + 6] = c.x, U[N + 7] = c.y, U[N + 8] = c.z, w.vertices += 3;
- var Ie, oe, ve, re, Se, ze, Ge, $e, Re, Be, ke, We, Te, je, Fe, X, Z, q, fe, _e = w.vertices - 3, Me = w.vertices - 2, Ae = w.vertices - 1, H = _e * 3, ce = Me * 3, ye = Ae * 3;
- for (G = 0, k = P.length - 1; G < k; ++G) {
- var Pe = B + 3 * G;
- N = Pe * 3, oe = w.faceidx, ve = w.lineidx, re = Pe, Be = re * 3, Se = Pe + 1, ke = Se * 3, ze = Pe + 2, We = ze * 3, Ge = Pe + 4, Te = Ge * 3, $e = Pe + 5, je = $e * 3, Re = Pe + 3, Fe = Re * 3, X = Z = P[G], q = fe = P[G + 1], $[Be] = X.x, $[ke] = Z.x, $[Fe] = fe.x, $[Be + 1] = X.y, $[ke + 1] = Z.y, $[Fe + 1] = fe.y, $[Be + 2] = X.z, $[ke + 2] = Z.z, $[Fe + 2] = fe.z, $[ke] = Z.x, $[Te] = q.x, $[Fe] = fe.x, $[ke + 1] = Z.y, $[Te + 1] = q.y, $[Fe + 1] = fe.y, $[ke + 2] = Z.z, $[Te + 2] = q.z, $[Fe + 2] = fe.z, $[We] = Z.x, $[je] = q.x, $[We + 1] = Z.y, $[je + 1] = q.y, $[We + 2] = Z.z, $[je + 2] = q.z, F[oe] = re, F[oe + 1] = Se, F[oe + 2] = Re, F[oe + 3] = Se, F[oe + 4] = Ge, F[oe + 5] = Re, F[oe + 6] = re, F[oe + 7] = Re, F[oe + 8] = _e, F[oe + 9] = ze, F[oe + 10] = Me, F[oe + 11] = $e, F[oe + 12] = ze, F[oe + 13] = Ae, F[oe + 14] = $e, W[ve] = re, W[ve + 1] = Se, W[ve + 2] = re, W[ve + 3] = Re, W[ve + 4] = Ge, W[ve + 5] = Re, W[ve + 6] = re, W[ve + 7] = Re, W[ve + 8] = ze, W[ve + 9] = Se, W[ve + 10] = ze, W[ve + 11] = $e, W[ve + 12] = Ge, W[ve + 13] = $e, W[ve + 14] = ze, W[ve + 15] = Ae, W[ve + 16] = ze, W[ve + 17] = $e, W[ve + 18] = Ae, W[ve + 19] = $e, w.faceidx += 15, w.lineidx += 20;
+ w.vertices += 48, V = w.vertices * 3, F[V] = f.x, F[V + 1] = f.y, F[V + 2] = f.z, F[V + 3] = T.x, F[V + 4] = T.y, F[V + 5] = T.z, F[V + 6] = c.x, F[V + 7] = c.y, F[V + 8] = c.z, w.vertices += 3;
+ var Pe, de, pe, re, Se, ke, $e, ze, Re, Fe, Ie, We, Ue, Be, Ne, H, K, q, fe, _e = w.vertices - 3, Me = w.vertices - 2, Ae = w.vertices - 1, Z = _e * 3, ue = Me * 3, we = Ae * 3;
+ for (N = 0, k = P.length - 1; N < k; ++N) {
+ var Te = B + 3 * N;
+ V = Te * 3, de = w.faceidx, pe = w.lineidx, re = Te, Fe = re * 3, Se = Te + 1, Ie = Se * 3, ke = Te + 2, We = ke * 3, $e = Te + 4, Ue = $e * 3, ze = Te + 5, Be = ze * 3, Re = Te + 3, Ne = Re * 3, H = K = P[N], q = fe = P[N + 1], z[Fe] = H.x, z[Ie] = K.x, z[Ne] = fe.x, z[Fe + 1] = H.y, z[Ie + 1] = K.y, z[Ne + 1] = fe.y, z[Fe + 2] = H.z, z[Ie + 2] = K.z, z[Ne + 2] = fe.z, z[Ie] = K.x, z[Ue] = q.x, z[Ne] = fe.x, z[Ie + 1] = K.y, z[Ue + 1] = q.y, z[Ne + 1] = fe.y, z[Ie + 2] = K.z, z[Ue + 2] = q.z, z[Ne + 2] = fe.z, z[We] = K.x, z[Be] = q.x, z[We + 1] = K.y, z[Be + 1] = q.y, z[We + 2] = K.z, z[Be + 2] = q.z, U[de] = re, U[de + 1] = Se, U[de + 2] = Re, U[de + 3] = Se, U[de + 4] = $e, U[de + 5] = Re, U[de + 6] = re, U[de + 7] = Re, U[de + 8] = _e, U[de + 9] = ke, U[de + 10] = Me, U[de + 11] = ze, U[de + 12] = ke, U[de + 13] = Ae, U[de + 14] = ze, W[pe] = re, W[pe + 1] = Se, W[pe + 2] = re, W[pe + 3] = Re, W[pe + 4] = $e, W[pe + 5] = Re, W[pe + 6] = re, W[pe + 7] = Re, W[pe + 8] = ke, W[pe + 9] = Se, W[pe + 10] = ke, W[pe + 11] = ze, W[pe + 12] = $e, W[pe + 13] = ze, W[pe + 14] = ke, W[pe + 15] = Ae, W[pe + 16] = ke, W[pe + 17] = ze, W[pe + 18] = Ae, W[pe + 19] = ze, w.faceidx += 15, w.lineidx += 20;
}
- Ie = [
+ Pe = [
B + 45,
B + 46,
B + 1,
B,
B + 47,
B + 2
- ], oe = w.faceidx, ve = w.lineidx, re = Ie[0], Be = re * 3, Se = Ie[1], ke = Se * 3, ze = Ie[4], We = ze * 3, Ge = Ie[2], Te = Ge * 3, $e = Ie[5], je = $e * 3, Re = Ie[3], Fe = Re * 3, X = Z = P[15], q = fe = P[0], $[Be] = X.x, $[ke] = Z.x, $[Fe] = fe.x, $[Be + 1] = X.y, $[ke + 1] = Z.y, $[Fe + 1] = fe.y, $[Be + 2] = X.z, $[ke + 2] = Z.z, $[Fe + 2] = fe.z, $[ke] = Z.x, $[Te] = q.x, $[Fe] = fe.x, $[ke + 1] = Z.y, $[Te + 1] = q.y, $[Fe + 1] = fe.y, $[ke + 2] = Z.z, $[Te + 2] = q.z, $[Fe + 2] = fe.z, $[We] = Z.x, $[je] = q.x, $[We + 1] = Z.y, $[je + 1] = q.y, $[We + 2] = Z.z, $[je + 2] = q.z, S.normalize(), R.normalize(), $[H] = R.x, $[ce] = $[ye] = S.x, $[H + 1] = R.y, $[ce + 1] = $[ye + 1] = S.y, $[H + 2] = R.z, $[ce + 2] = $[ye + 2] = S.z, F[oe] = re, F[oe + 1] = Se, F[oe + 2] = Re, F[oe + 3] = Se, F[oe + 4] = Ge, F[oe + 5] = Re, F[oe + 6] = re, F[oe + 7] = Re, F[oe + 8] = _e, F[oe + 9] = ze, F[oe + 10] = Me, F[oe + 11] = $e, F[oe + 12] = ze, F[oe + 13] = Ae, F[oe + 14] = $e, W[ve] = re, W[ve + 1] = Se, W[ve + 2] = re, W[ve + 3] = Re, W[ve + 4] = Ge, W[ve + 5] = Re, W[ve + 6] = re, W[ve + 7] = Re, W[ve + 8] = ze, W[ve + 9] = Se, W[ve + 10] = ze, W[ve + 11] = $e, W[ve + 12] = Ge, W[ve + 13] = $e, W[ve + 14] = ze, W[ve + 15] = Ae, W[ve + 16] = ze, W[ve + 17] = $e, W[ve + 18] = Ae, W[ve + 19] = $e, w.faceidx += 15, w.lineidx += 20;
+ ], de = w.faceidx, pe = w.lineidx, re = Pe[0], Fe = re * 3, Se = Pe[1], Ie = Se * 3, ke = Pe[4], We = ke * 3, $e = Pe[2], Ue = $e * 3, ze = Pe[5], Be = ze * 3, Re = Pe[3], Ne = Re * 3, H = K = P[15], q = fe = P[0], z[Fe] = H.x, z[Ie] = K.x, z[Ne] = fe.x, z[Fe + 1] = H.y, z[Ie + 1] = K.y, z[Ne + 1] = fe.y, z[Fe + 2] = H.z, z[Ie + 2] = K.z, z[Ne + 2] = fe.z, z[Ie] = K.x, z[Ue] = q.x, z[Ne] = fe.x, z[Ie + 1] = K.y, z[Ue + 1] = q.y, z[Ne + 1] = fe.y, z[Ie + 2] = K.z, z[Ue + 2] = q.z, z[Ne + 2] = fe.z, z[We] = K.x, z[Be] = q.x, z[We + 1] = K.y, z[Be + 1] = q.y, z[We + 2] = K.z, z[Be + 2] = q.z, S.normalize(), R.normalize(), z[Z] = R.x, z[ue] = z[we] = S.x, z[Z + 1] = R.y, z[ue + 1] = z[we + 1] = S.y, z[Z + 2] = R.z, z[ue + 2] = z[we + 2] = S.z, U[de] = re, U[de + 1] = Se, U[de + 2] = Re, U[de + 3] = Se, U[de + 4] = $e, U[de + 5] = Re, U[de + 6] = re, U[de + 7] = Re, U[de + 8] = _e, U[de + 9] = ke, U[de + 10] = Me, U[de + 11] = ze, U[de + 12] = ke, U[de + 13] = Ae, U[de + 14] = ze, W[pe] = re, W[pe + 1] = Se, W[pe + 2] = re, W[pe + 3] = Re, W[pe + 4] = $e, W[pe + 5] = Re, W[pe + 6] = re, W[pe + 7] = Re, W[pe + 8] = ke, W[pe + 9] = Se, W[pe + 10] = ke, W[pe + 11] = ze, W[pe + 12] = $e, W[pe + 13] = ze, W[pe + 14] = ke, W[pe + 15] = Ae, W[pe + 16] = ke, W[pe + 17] = ze, W[pe + 18] = Ae, W[pe + 19] = ze, w.faceidx += 15, w.lineidx += 20;
}
// Update a bounding sphere's position and radius
// from list of centroids and new points
@@ -5311,8 +5311,8 @@ ATOM`, h);
r.center.set(0, 0, 0);
let c = 1 / 0, t = 1 / 0, a = 1 / 0, h = -1 / 0, M = -1 / 0, w = -1 / 0;
r.box && (c = r.box.min.x, h = r.box.max.x, t = r.box.min.y, M = r.box.max.y, a = r.box.min.z, w = r.box.max.z);
- for (let z = 0, P = f; z < P; z++) {
- var S = b[z * 3], T = b[z * 3 + 1], R = b[z * 3 + 2];
+ for (let $ = 0, P = f; $ < P; $++) {
+ var S = b[$ * 3], T = b[$ * 3 + 1], R = b[$ * 3 + 2];
S < c && (c = S), T < t && (t = T), R < a && (a = R), S > h && (h = S), T > M && (M = T), R > w && (w = R);
}
r.center.set((h + c) / 2, (M + t) / 2, (w + a) / 2), r.radius = r.center.distanceTo({ x: h, y: M, z: w }), r.box = { min: { x: c, y: t, z: a }, max: { x: h, y: M, z: w } };
@@ -5321,27 +5321,27 @@ ATOM`, h);
static addCustomGeo(r, n, b, f, c) {
var t = n.addGeoGroup(), a = b.vertexArr, h = b.normalArr, M = b.faceArr;
t.vertices = a.length, t.faceidx = M.length;
- var w, S, T, R, z, P, B, U, F, $ = t.vertexArray, W = t.colorArray;
- for (f.constructor !== Array && (U = f.r, F = f.g, R = f.b), P = 0, B = t.vertices; P < B; ++P)
- w = P * 3, S = a[P], $[w] = S.x, $[w + 1] = S.y, $[w + 2] = S.z, f.constructor === Array && (z = f[P], U = z.r, F = z.g, R = z.b), W[w] = U, W[w + 1] = F, W[w + 2] = R;
+ var w, S, T, R, $, P, B, F, U, z = t.vertexArray, W = t.colorArray;
+ for (f.constructor !== Array && (F = f.r, U = f.g, R = f.b), P = 0, B = t.vertices; P < B; ++P)
+ w = P * 3, S = a[P], z[w] = S.x, z[w + 1] = S.y, z[w + 2] = S.z, f.constructor === Array && ($ = f[P], F = $.r, U = $.g, R = $.b), W[w] = F, W[w + 1] = U, W[w + 2] = R;
if (c)
for (P = 0, B = t.faceidx / 3; P < B; ++P) {
- w = P * 3, T = M[w], R = M[w + 1], z = M[w + 2];
- var N = new _.Vector3(), G = new _.Vector3(), k = new _.Vector3();
- r.intersectionShape.triangle.push(new g.Triangle(N.copy(a[T]), G.copy(a[R]), k.copy(a[z])));
+ w = P * 3, T = M[w], R = M[w + 1], $ = M[w + 2];
+ var V = new _.Vector3(), N = new _.Vector3(), k = new _.Vector3();
+ r.intersectionShape.triangle.push(new p.Triangle(V.copy(a[T]), N.copy(a[R]), k.copy(a[$])));
}
if (c) {
- var j = new _.Vector3(0, 0, 0), Q = 0;
- for (let he = 0; he < n.geometryGroups.length; he++)
- j.add(n.geometryGroups[he].getCentroid()), Q++;
- j.divideScalar(Q), C.updateBoundingFromPoints(r.boundingSphere, { centroid: j }, $, t.vertices);
+ var G = new _.Vector3(0, 0, 0), Q = 0;
+ for (let le = 0; le < n.geometryGroups.length; le++)
+ G.add(n.geometryGroups[le].getCentroid()), Q++;
+ G.divideScalar(Q), L.updateBoundingFromPoints(r.boundingSphere, { centroid: G }, z, t.vertices);
}
if (t.faceArray = new Uint16Array(M), t.truncateArrayBuffers(!0, !0), h.length < t.vertices)
t.setNormals();
else {
- var ie = t.normalArray = new Float32Array(t.vertices * 3), pe;
+ var ie = t.normalArray = new Float32Array(t.vertices * 3), ge;
for (P = 0, B = t.vertices; P < B; ++P)
- w = P * 3, pe = h[P], ie[w] = pe.x, ie[w + 1] = pe.y, ie[w + 2] = pe.z;
+ w = P * 3, ge = h[P], ie[w] = ge.x, ie[w + 1] = ge.y, ie[w + 2] = ge.z;
}
t.setLineIndices(), t.lineidx = t.lineArray.length;
}
@@ -5364,12 +5364,12 @@ ATOM`, h);
* @param {ShapeSpec} stylespec
*/
constructor(r) {
- this.color = 16777215, this.hidden = !1, this.wireframe = !1, this.opacity = 1, this.linewidth = 1, this.clickable = !1, this.hoverable = !1, this.side = l.DoubleSide, this.stylespec = r || {}, this.boundingSphere = new g.Sphere(), this.intersectionShape = {
+ this.color = 16777215, this.hidden = !1, this.wireframe = !1, this.opacity = 1, this.linewidth = 1, this.clickable = !1, this.hoverable = !1, this.side = l.DoubleSide, this.stylespec = r || {}, this.boundingSphere = new p.Sphere(), this.intersectionShape = {
sphere: [],
cylinder: [],
line: [],
triangle: []
- }, C.updateFromStyle(this, this.stylespec), this.components = [], this.shapeObj = null, this.renderedShapeObj = null, this.geo = new l.Geometry(!0), this.linegeo = new l.Geometry(!0);
+ }, L.updateFromStyle(this, this.stylespec), this.components = [], this.shapeObj = null, this.renderedShapeObj = null, this.geo = new l.Geometry(!0), this.linegeo = new l.Geometry(!0);
}
/** Update shape with new style specification
* @param {ShapeSpec} newspec
@@ -5381,7 +5381,7 @@ ATOM`, h);
updateStyle(r) {
for (var n in r)
this.stylespec[n] = r[n];
- if (C.updateFromStyle(this, this.stylespec), r.voldata && r.volscheme) {
+ if (L.updateFromStyle(this, this.stylespec), r.voldata && r.volscheme) {
(0, A.adjustVolumeStyle)(r);
const b = r.volscheme, f = r.voldata, c = x.CC, t = b.range() || [-1, 1];
this.geo.setColors(function(a, h, M) {
@@ -5395,7 +5395,7 @@ ATOM`, h);
* @param {CustomShapeSpec} customSpec
*/
addCustom(r) {
- r.vertexArr = r.vertexArr || [], r.faceArr = r.faceArr || [], r.normalArr = r.normalArr || [], C.drawCustom(this, this.geo, r);
+ r.vertexArr = r.vertexArr || [], r.faceArr = r.faceArr || [], r.normalArr = r.normalArr || [], L.drawCustom(this, this.geo, r);
}
/**
* Creates a sphere shape
@@ -5406,11 +5406,11 @@ ATOM`, h);
viewer.render();
*/
addSphere(r) {
- r.center || (r.center = new _.Vector3(0, 0, 0)), r.radius = r.radius ? (0, _.clamp)(r.radius, 0, 1 / 0) : 1.5, r.color = x.CC.color(r.color), this.intersectionShape.sphere.push(new g.Sphere(r.center, r.radius)), E.GLDraw.drawSphere(this.geo, r.center, r.radius, r.color, r.quality), this.components.push({
+ r.center || (r.center = new _.Vector3(0, 0, 0)), r.radius = r.radius ? (0, _.clamp)(r.radius, 0, 1 / 0) : 1.5, r.color = x.CC.color(r.color), this.intersectionShape.sphere.push(new p.Sphere(r.center, r.radius)), E.GLDraw.drawSphere(this.geo, r.center, r.radius, r.color, r.quality), this.components.push({
centroid: new _.Vector3(r.center.x, r.center.y, r.center.z)
});
var n = this.geo.updateGeoGroup(0);
- C.updateBoundingFromPoints(this.boundingSphere, this.components, n.vertexArray, n.vertices);
+ L.updateBoundingFromPoints(this.boundingSphere, this.components, n.vertexArray, n.vertices);
}
/**
* Creates a box
@@ -5453,13 +5453,13 @@ ATOM`, h);
var w = 4;
h.splice(h.length, 0, a[2], a[3], a[6], a[7]), M.splice(M.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, h.splice(h.length, 0, a[4], a[5], a[0], a[1]), M.splice(M.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, h.splice(h.length, 0, a[6], a[7], a[4], a[5]), M.splice(M.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, h.splice(h.length, 0, a[3], a[1], a[7], a[5]), M.splice(M.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, h.splice(h.length, 0, a[2], a[6], a[0], a[4]), M.splice(M.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4;
var S = (0, A.extend)({}, r);
- S.vertexArr = h, S.faceArr = M, S.normalArr = [], C.drawCustom(this, this.geo, S);
+ S.vertexArr = h, S.faceArr = M, S.normalArr = [], L.drawCustom(this, this.geo, S);
var T = new _.Vector3();
this.components.push({
centroid: T.addVectors(a[0], a[7]).multiplyScalar(0.5)
});
var R = this.geo.updateGeoGroup(0);
- C.updateBoundingFromPoints(this.boundingSphere, this.components, R.vertexArray, R.vertices);
+ L.updateBoundingFromPoints(this.boundingSphere, this.components, R.vertexArray, R.vertices);
}
/**
* Creates a cylinder shape
@@ -5495,13 +5495,13 @@ ATOM`, h);
var n, b;
r.start ? n = new _.Vector3(r.start.x || 0, r.start.y || 0, r.start.z || 0) : n = new _.Vector3(0, 0, 0), r.end ? (b = new _.Vector3(r.end.x, r.end.y || 0, r.end.z || 0), typeof b.x > "u" && (b.x = 3)) : b = new _.Vector3(0, 0, 0);
var f = r.radius || 0.1, c = x.CC.color(r.color);
- this.intersectionShape.cylinder.push(new g.Cylinder(n, b, f)), E.GLDraw.drawCylinder(this.geo, n, b, f, c, r.fromCap, r.toCap);
+ this.intersectionShape.cylinder.push(new p.Cylinder(n, b, f)), E.GLDraw.drawCylinder(this.geo, n, b, f, c, r.fromCap, r.toCap);
var t = new _.Vector3();
this.components.push({
centroid: t.addVectors(n, b).multiplyScalar(0.5)
});
var a = this.geo.updateGeoGroup(0);
- C.updateBoundingFromPoints(this.boundingSphere, this.components, a.vertexArray, a.vertices);
+ L.updateBoundingFromPoints(this.boundingSphere, this.components, a.vertexArray, a.vertices);
}
/**
* Creates a dashed cylinder shape
@@ -5514,13 +5514,13 @@ ATOM`, h);
var b;
r.end ? (b = new _.Vector3(r.end.x, r.end.y || 0, r.end.z || 0), typeof b.x > "u" && (b.x = 3)) : b = new _.Vector3(3, 0, 0);
for (var f = r.radius || 0.1, c = x.CC.color(r.color), t = Math.sqrt(Math.pow(n.x - b.x, 2) + Math.pow(n.y - b.y, 2) + Math.pow(n.z - b.z, 2)), a = t / (r.gapLength + r.dashLength), h = new _.Vector3(r.start.x || 0, r.start.y || 0, r.start.z || 0), M = new _.Vector3(r.end.x, r.end.y || 0, r.end.z || 0), w = new _.Vector3((b.x - n.x) / (t / r.gapLength), (b.y - n.y) / (t / r.gapLength), (b.z - n.z) / (t / r.gapLength)), S = new _.Vector3((b.x - n.x) / (t / r.dashLength), (b.y - n.y) / (t / r.dashLength), (b.z - n.z) / (t / r.dashLength)), T = 0; T < a; T++)
- M = new _.Vector3(h.x + S.x, h.y + S.y, h.z + S.z), this.intersectionShape.cylinder.push(new g.Cylinder(h, M, f)), E.GLDraw.drawCylinder(this.geo, h, M, f, c, r.fromCap, r.toCap), h = new _.Vector3(M.x + w.x, M.y + w.y, M.z + w.z);
+ M = new _.Vector3(h.x + S.x, h.y + S.y, h.z + S.z), this.intersectionShape.cylinder.push(new p.Cylinder(h, M, f)), E.GLDraw.drawCylinder(this.geo, h, M, f, c, r.fromCap, r.toCap), h = new _.Vector3(M.x + w.x, M.y + w.y, M.z + w.z);
var R = new _.Vector3();
this.components.push({
centroid: R.addVectors(n, b).multiplyScalar(0.5)
});
- var z = this.geo.updateGeoGroup(0);
- C.updateBoundingFromPoints(this.boundingSphere, this.components, z.vertexArray, z.vertices);
+ var $ = this.geo.updateGeoGroup(0);
+ L.updateBoundingFromPoints(this.boundingSphere, this.components, $.vertexArray, $.vertices);
}
/**
* Creates a curved shape
@@ -5579,7 +5579,7 @@ ATOM`, h);
var w = new _.Vector3();
this.components.push({
centroid: w.addVectors(n, b).multiplyScalar(0.5)
- }), f = this.geo.updateGeoGroup(0), C.updateBoundingFromPoints(this.boundingSphere, this.components, f.vertexArray, f.vertices);
+ }), f = this.geo.updateGeoGroup(0), L.updateBoundingFromPoints(this.boundingSphere, this.components, f.vertexArray, f.vertices);
}
/**
* Creates an arrow shape
@@ -5608,20 +5608,20 @@ ATOM`, h);
r.end = n;
} else
r.end ? (r.end = new _.Vector3(r.end.x, r.end.y || 0, r.end.z || 0), typeof r.end.x > "u" && (r.end.x = 3)) : r.end = new _.Vector3(3, 0, 0);
- r.radius = r.radius || 0.1, r.radiusRatio = r.radiusRatio || 1.618034, r.mid = 0 < r.mid && r.mid < 1 ? r.mid : 0.618034, C.drawArrow(this, this.geo, r);
+ r.radius = r.radius || 0.1, r.radiusRatio = r.radiusRatio || 1.618034, r.mid = 0 < r.mid && r.mid < 1 ? r.mid : 0.618034, L.drawArrow(this, this.geo, r);
var b = new _.Vector3();
this.components.push({
centroid: b.addVectors(r.start, r.end).multiplyScalar(0.5)
});
var f = this.geo.updateGeoGroup(0);
- C.updateBoundingFromPoints(this.boundingSphere, this.components, f.vertexArray, f.vertices);
+ L.updateBoundingFromPoints(this.boundingSphere, this.components, f.vertexArray, f.vertices);
}
static distance_from(r, n) {
return Math.sqrt(Math.pow(r.x - n.x, 2) + Math.pow(r.y - n.y, 2) + Math.pow(r.z - n.z, 2));
}
static inSelectedRegion(r, n, b) {
for (var f = 0; f < n.length; f++)
- if (C.distance_from(n[f], r) <= b)
+ if (L.distance_from(n[f], r) <= b)
return !0;
return !1;
}
@@ -5656,13 +5656,13 @@ ATOM`, h);
var f = n.isoval !== void 0 && typeof n.isoval == "number" ? n.isoval : 0, c = !!n.voxel, t = n.smoothness === void 0 ? 1 : n.smoothness, a = r.size.x, h = r.size.y, M = r.size.z, w = new Int16Array(a * h * M), S = r.data, T, R;
for (T = 0, R = w.length; T < R; ++T)
w[T] = -1;
- var z = new Uint8Array(a * h * M);
+ var $ = new Uint8Array(a * h * M);
for (T = 0, R = S.length; T < R; ++T) {
var P = f >= 0 ? S[T] - f : f - S[T];
- P > 0 && (z[T] |= C.ISDONE);
+ P > 0 && ($[T] |= L.ISDONE);
}
- var B = [], U = [];
- o.MarchingCube.march(z, B, U, {
+ var B = [], F = [];
+ o.MarchingCube.march($, B, F, {
fulltable: !0,
voxel: c,
unitCube: r.unit,
@@ -5671,33 +5671,33 @@ ATOM`, h);
nX: a,
nY: h,
nZ: M
- }), !c && t > 0 && o.MarchingCube.laplacianSmooth(t, B, U);
- var F = [], $ = [], W = [];
+ }), !c && t > 0 && o.MarchingCube.laplacianSmooth(t, B, F);
+ var U = [], z = [], W = [];
if (n.selectedRegion && n.coords === void 0 && (n.coords = n.selectedRegion), n.coords !== void 0) {
- var N = n.coords[0].x, G = n.coords[0].y, k = n.coords[0].z, j = n.coords[0].x, Q = n.coords[0].y, ie = n.coords[0].z;
- for (let oe = 0; oe < n.coords.length; oe++)
- n.coords[oe].x > N ? N = n.coords[oe].x : n.coords[oe].x < j && (j = n.coords[oe].x), n.coords[oe].y > G ? G = n.coords[oe].y : n.coords[oe].y < Q && (Q = n.coords[oe].y), n.coords[oe].z > k ? k = n.coords[oe].z : n.coords[oe].z < ie && (ie = n.coords[oe].z);
- var pe = 2;
- n.radius !== void 0 && (pe = n.radius), n.selectedOffset !== void 0 && (pe = n.selectedOffset), n.seldist !== void 0 && (pe = n.seldist), j -= pe, N += pe, Q -= pe, G += pe, ie -= pe, k += pe;
- for (let oe = 0; oe < B.length; oe++)
- B[oe].x > j && B[oe].x < N && B[oe].y > Q && B[oe].y < G && B[oe].z > ie && B[oe].z < k && C.inSelectedRegion(B[oe], n.coords, pe) ? (F.push($.length), $.push(B[oe])) : F.push(-1);
- for (let oe = 0; oe + 2 < U.length; oe += 3)
- F[U[oe]] !== -1 && F[U[oe + 1]] !== -1 && F[U[oe + 2]] !== -1 && (W.push(U[oe] - (U[oe] - F[U[oe]])), W.push(U[oe + 1] - (U[oe + 1] - F[U[oe + 1]])), W.push(U[oe + 2] - (U[oe + 2] - F[U[oe + 2]])));
- B = $, U = W;
- }
- C.drawCustom(this, this.geo, {
+ var V = n.coords[0].x, N = n.coords[0].y, k = n.coords[0].z, G = n.coords[0].x, Q = n.coords[0].y, ie = n.coords[0].z;
+ for (let de = 0; de < n.coords.length; de++)
+ n.coords[de].x > V ? V = n.coords[de].x : n.coords[de].x < G && (G = n.coords[de].x), n.coords[de].y > N ? N = n.coords[de].y : n.coords[de].y < Q && (Q = n.coords[de].y), n.coords[de].z > k ? k = n.coords[de].z : n.coords[de].z < ie && (ie = n.coords[de].z);
+ var ge = 2;
+ n.radius !== void 0 && (ge = n.radius), n.selectedOffset !== void 0 && (ge = n.selectedOffset), n.seldist !== void 0 && (ge = n.seldist), G -= ge, V += ge, Q -= ge, N += ge, ie -= ge, k += ge;
+ for (let de = 0; de < B.length; de++)
+ B[de].x > G && B[de].x < V && B[de].y > Q && B[de].y < N && B[de].z > ie && B[de].z < k && L.inSelectedRegion(B[de], n.coords, ge) ? (U.push(z.length), z.push(B[de])) : U.push(-1);
+ for (let de = 0; de + 2 < F.length; de += 3)
+ U[F[de]] !== -1 && U[F[de + 1]] !== -1 && U[F[de + 2]] !== -1 && (W.push(F[de] - (F[de] - U[F[de]])), W.push(F[de + 1] - (F[de + 1] - U[F[de + 1]])), W.push(F[de + 2] - (F[de + 2] - U[F[de + 2]])));
+ B = z, F = W;
+ }
+ L.drawCustom(this, this.geo, {
vertexArr: B,
- faceArr: U,
+ faceArr: F,
normalArr: [],
clickable: n.clickable,
hoverable: n.hoverable
}), this.updateStyle(n);
- var he = new _.Vector3(r.origin.x, r.origin.y, r.origin.z), ue = new _.Vector3(r.size.x * r.unit.x, r.size.y * r.unit.y, r.size.z * r.unit.z), se = new _.Vector3(0, 0, 0), ae = he.clone(), we = he.clone().add(ue);
- for (let oe = 0; oe < B.length; oe++)
- se.add(B[oe]), ae.max(B[oe]), we.min(B[oe]);
- se.divideScalar(B.length);
- var xe = se.distanceTo(we), Ie = se.distanceTo(ae);
- this.boundingSphere.center = se, this.boundingSphere.radius = Math.max(xe, Ie), typeof b == "function" && b();
+ var le = new _.Vector3(r.origin.x, r.origin.y, r.origin.z), oe = new _.Vector3(r.size.x * r.unit.x, r.size.y * r.unit.y, r.size.z * r.unit.z), he = new _.Vector3(0, 0, 0), se = le.clone(), xe = le.clone().add(oe);
+ for (let de = 0; de < B.length; de++)
+ he.add(B[de]), se.max(B[de]), xe.min(B[de]);
+ he.divideScalar(B.length);
+ var ye = he.distanceTo(xe), Pe = he.distanceTo(se);
+ this.boundingSphere.center = he, this.boundingSphere.radius = Math.max(ye, Pe), typeof b == "function" && b();
}
/**
* @deprecated Use addIsosurface instead
@@ -5707,11 +5707,11 @@ ATOM`, h);
* @param {IsoSurfaceSpec} isoSpec - Volumetric data shape specification
*/
addVolumetricData(r, n, b) {
- r = new p.VolumeData(r, n), this.addIsosurface(r, b);
+ r = new g.VolumeData(r, n), this.addIsosurface(r, b);
}
//for internal use, truncate buffers to save memory
finalize() {
- return C.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.geo;
+ return L.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.geo;
}
/*
* Initialize webgl objects for rendering
@@ -5720,7 +5720,7 @@ ATOM`, h);
*/
globj(r) {
if (this.renderedShapeObj && (r.remove(this.renderedShapeObj), this.renderedShapeObj = null), !this.hidden) {
- C.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.wireframe && this.geo.setUpWireframe(), typeof this.color < "u" && C.updateColor(this.geo, this.color), this.shapeObj = new l.Object3D();
+ L.finalizeGeo(this.geo), this.geo.initTypedArrays(), this.wireframe && this.geo.setUpWireframe(), typeof this.color < "u" && L.updateColor(this.geo, this.color), this.shapeObj = new l.Object3D();
var n = null;
this.side == l.DoubleSide ? n = new l.MeshDoubleLambertMaterial({
wireframe: this.wireframe,
@@ -5762,15 +5762,15 @@ ATOM`, h);
return this.boundingSphere.center.z;
}
}
- C.ISDONE = 2, C.drawCustom = function(D, r, n) {
+ L.ISDONE = 2, L.drawCustom = function(D, r, n) {
var b = n, f = b.vertexArr, c = b.faceArr;
(f.length === 0 || c.length === 0) && console.warn("Error adding custom shape component: No vertices and/or face indices supplied!");
var t = n.color;
typeof t > "u" && (t = D.color), t = x.CC.color(t);
- for (var a = L(b), h = 0, M = a.length; h < M; h++)
- C.addCustomGeo(D, r, a[h], a[h].colorArr ? a[h].colorArr : t, n.clickable);
+ for (var a = C(b), h = 0, M = a.length; h < M; h++)
+ L.addCustomGeo(D, r, a[h], a[h].colorArr ? a[h].colorArr : t, n.clickable);
};
- function L(D) {
+ function C(D) {
var r = 64e3;
if (D.vertexArr.length < r)
return [D];
@@ -5822,7 +5822,7 @@ ATOM`, h);
var l = e(
/*! ./WebGL */
"./src/WebGL/index.ts"
- ), g = e(
+ ), p = e(
/*! ./WebGL/math */
"./src/WebGL/math/index.ts"
), _ = e(
@@ -5834,7 +5834,7 @@ ATOM`, h);
), o = e(
/*! ./Gradient */
"./src/Gradient.ts"
- ), p = e(
+ ), g = e(
/*! ./GLModel */
"./src/GLModel.ts"
), E = e(
@@ -5846,10 +5846,10 @@ ATOM`, h);
), A = e(
/*! ./VolumeData */
"./src/VolumeData.ts"
- ), C = e(
+ ), L = e(
/*! ./ProteinSurface4 */
"./src/ProteinSurface4.ts"
- ), L = e(
+ ), C = e(
/*! ./VolumetricRender */
"./src/VolumetricRender.ts"
), D = e(
@@ -5889,9 +5889,9 @@ ATOM`, h);
}), this.renderer.domElement.style.width = "100%", this.renderer.domElement.style.height = "100%", this.renderer.domElement.style.padding = "0", this.renderer.domElement.style.position = "absolute", this.renderer.domElement.style.top = "0px", this.renderer.domElement.style.left = "0px", this.renderer.domElement.style.zIndex = "0";
}
initializeScene() {
- this.scene = new l.Scene(), this.scene.fog = new l.Fog(this.bgColor, 100, 200), this.modelGroup = new l.Object3D(), this.rotationGroup = new l.Object3D(), this.rotationGroup.useQuaternion = !0, this.rotationGroup.quaternion = new g.Quaternion(0, 0, 0, 1), this.rotationGroup.add(this.modelGroup), this.scene.add(this.rotationGroup);
+ this.scene = new l.Scene(), this.scene.fog = new l.Fog(this.bgColor, 100, 200), this.modelGroup = new l.Object3D(), this.rotationGroup = new l.Object3D(), this.rotationGroup.useQuaternion = !0, this.rotationGroup.quaternion = new p.Quaternion(0, 0, 0, 1), this.rotationGroup.add(this.modelGroup), this.scene.add(this.rotationGroup);
var t = new l.Light(16777215);
- t.position = new g.Vector3(0.2, 0.2, 1).normalize(), t.intensity = 1, this.scene.add(t);
+ t.position = new p.Vector3(0.2, 0.2, 1).normalize(), t.intensity = 1, this.scene.add(t);
}
initContainer(t) {
this.container = t, this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.renderer.setSize(this.WIDTH, this.HEIGHT), this.container.append(this.renderer.domElement), this.glDOM = this.renderer.domElement, this.nomouse || (this.glDOM.addEventListener("mousedown", this._handleMouseDown.bind(this), { passive: !1 }), this.glDOM.addEventListener("touchstart", this._handleMouseDown.bind(this), { passive: !1 }), this.glDOM.addEventListener("wheel", this._handleMouseScroll.bind(this), { passive: !1 }), this.glDOM.addEventListener("mousemove", this._handleMouseMove.bind(this), { passive: !1 }), this.glDOM.addEventListener("touchmove", this._handleMouseMove.bind(this), { passive: !1 }), this.glDOM.addEventListener("contextmenu", this._handleContextMenu.bind(this), { passive: !1 }));
@@ -6015,8 +6015,8 @@ ATOM`, h);
//for grid viewers, return true if point is in this viewer
isInViewer(t, a) {
if (this.viewers != null) {
- var h = this.WIDTH / this.cols, M = this.HEIGHT / this.rows, w = this.canvasOffset(), S = t - w.left, T = a - w.top, R = this.rows - Math.floor(T / M) - 1, z = Math.floor(S / h);
- if (R != this.row || z != this.col)
+ var h = this.WIDTH / this.cols, M = this.HEIGHT / this.rows, w = this.canvasOffset(), S = t - w.left, T = a - w.top, R = this.rows - Math.floor(T / M) - 1, $ = Math.floor(S / h);
+ if (R != this.row || $ != this.col)
return !1;
}
return !0;
@@ -6043,20 +6043,20 @@ ATOM`, h);
return t.clone();
let M = t.x * a.x + t.y * a.y + t.z * a.z + t.w * a.w;
if (M > 0.9995) {
- let B = new g.Quaternion(t.x + h * (a.x - t.x), t.y + h * (a.y - t.y), t.z + h * (a.z - t.z), t.w + h * (a.w - t.w));
+ let B = new p.Quaternion(t.x + h * (a.x - t.x), t.y + h * (a.y - t.y), t.z + h * (a.z - t.z), t.w + h * (a.w - t.w));
return B.normalize(), B;
}
M < 0 && (a = a.clone().multiplyScalar(-1), M = -M), M > 1 ? M = 1 : M < -1 && (M = -1);
var w = Math.acos(M), S = w * h, T = a.clone();
T.sub(t.clone().multiplyScalar(M)), T.normalize();
- var R = Math.cos(S), z = Math.sin(S), P = new g.Quaternion(t.x * R + T.x * z, t.y * R + T.y * z, t.z * R + T.z * z, t.w * R + T.w * z);
+ var R = Math.cos(S), $ = Math.sin(S), P = new p.Quaternion(t.x * R + T.x * $, t.y * R + T.y * $, t.z * R + T.z * $, t.w * R + T.w * $);
return P.normalize(), P;
}
/* @param {Object} element HTML element within which to create viewer
* @param {ViewerSpec} config Object containing optional configuration for the viewer
*/
constructor(t, a = {}) {
- this.nomouse = !1, this.glDOM = null, this.models = [], this.surfaces = {}, this.shapes = [], this.labels = [], this.clickables = [], this.hoverables = [], this.contextMenuEnabledAtoms = [], this.current_hover = null, this.hoverDuration = 500, this.viewer_frame = 0, this.viewChangeCallback = null, this.stateChangeCallback = null, this.NEAR = 1, this.FAR = 800, this.CAMERA_Z = 150, this.fov = 20, this.linkedViewers = [], this.renderer = null, this.control_all = !1, this.scene = null, this.rotationGroup = null, this.modelGroup = null, this.fogStart = 0.4, this.slabNear = -50, this.slabFar = 50, this.cq = new g.Quaternion(0, 0, 0, 1), this.dq = new g.Quaternion(0, 0, 0, 1), this.animated = 0, this.animationTimers = /* @__PURE__ */ new Set(), this.isDragging = !1, this.mouseStartX = 0, this.mouseStartY = 0, this.touchDistanceStart = 0, this.touchHold = !1, this.currentModelPos = 0, this.cz = 0, this.cslabNear = 0, this.cslabFar = 0, this.userContextMenuHandler = null, this.config = a, this.callback = this.config.callback, this.defaultcolors = this.config.defaultcolors, this.defaultcolors || (this.defaultcolors = _.elementColors.defaultColors), this.nomouse = this.config.nomouse, this.bgColor = 0, this.config.backgroundColor = this.config.backgroundColor || "#ffffff", typeof this.config.backgroundColor < "u" && (this.bgColor = _.CC.color(this.config.backgroundColor).getHex()), this.config.backgroundAlpha = this.config.backgroundAlpha == null ? 1 : this.config.backgroundAlpha, this.camerax = 0, typeof this.config.camerax < "u" && (this.camerax = parseFloat(this.config.camerax)), this._viewer = this, this.container = t, this.config.hoverDuration != null && (this.hoverDuration = this.config.hoverDuration), this.config.antialias === void 0 && (this.config.antialias = !0), this.config.cartoonQuality === void 0 && (this.config.cartoonQuality = 10), this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.setupRenderer(), this.row = this.config.row == null ? 0 : this.config.row, this.col = this.config.col == null ? 0 : this.config.col, this.cols = this.config.cols, this.rows = this.config.rows, this.viewers = this.config.viewers, this.control_all = this.config.control_all, this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.camera = new l.Camera(this.fov, this.ASPECT, this.NEAR, this.FAR, this.config.orthographic), this.camera.position = new g.Vector3(this.camerax, 0, this.CAMERA_Z), this.lookingAt = new g.Vector3(), this.camera.lookAt(this.lookingAt), this.raycaster = new l.Raycaster(new g.Vector3(0, 0, 0), new g.Vector3(0, 0, 0)), this.projector = new l.Projector(), this.initializeScene(), this.renderer.setClearColorHex(this.bgColor, this.config.backgroundAlpha), this.scene.fog.color = _.CC.color(this.bgColor), document.body.addEventListener("mouseup", this._handleMouseUp.bind(this)), document.body.addEventListener("touchend", this._handleMouseUp.bind(this)), this.initContainer(this.container), this.config.style && this.setViewStyle(this.config), window.addEventListener("resize", this.resize.bind(this)), typeof window.ResizeObserver < "u" && (this.divwatcher = new window.ResizeObserver(this.resize.bind(this)), this.divwatcher.observe(this.container));
+ this.nomouse = !1, this.glDOM = null, this.models = [], this.surfaces = {}, this.shapes = [], this.labels = [], this.clickables = [], this.hoverables = [], this.contextMenuEnabledAtoms = [], this.current_hover = null, this.hoverDuration = 500, this.viewer_frame = 0, this.viewChangeCallback = null, this.stateChangeCallback = null, this.NEAR = 1, this.FAR = 800, this.CAMERA_Z = 150, this.fov = 20, this.linkedViewers = [], this.renderer = null, this.control_all = !1, this.scene = null, this.rotationGroup = null, this.modelGroup = null, this.fogStart = 0.4, this.slabNear = -50, this.slabFar = 50, this.cq = new p.Quaternion(0, 0, 0, 1), this.dq = new p.Quaternion(0, 0, 0, 1), this.animated = 0, this.animationTimers = /* @__PURE__ */ new Set(), this.isDragging = !1, this.mouseStartX = 0, this.mouseStartY = 0, this.touchDistanceStart = 0, this.touchHold = !1, this.currentModelPos = 0, this.cz = 0, this.cslabNear = 0, this.cslabFar = 0, this.userContextMenuHandler = null, this.config = a, this.callback = this.config.callback, this.defaultcolors = this.config.defaultcolors, this.defaultcolors || (this.defaultcolors = _.elementColors.defaultColors), this.nomouse = this.config.nomouse, this.bgColor = 0, this.config.backgroundColor = this.config.backgroundColor || "#ffffff", typeof this.config.backgroundColor < "u" && (this.bgColor = _.CC.color(this.config.backgroundColor).getHex()), this.config.backgroundAlpha = this.config.backgroundAlpha == null ? 1 : this.config.backgroundAlpha, this.camerax = 0, typeof this.config.camerax < "u" && (this.camerax = parseFloat(this.config.camerax)), this._viewer = this, this.container = t, this.config.hoverDuration != null && (this.hoverDuration = this.config.hoverDuration), this.config.antialias === void 0 && (this.config.antialias = !0), this.config.cartoonQuality === void 0 && (this.config.cartoonQuality = 10), this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.setupRenderer(), this.row = this.config.row == null ? 0 : this.config.row, this.col = this.config.col == null ? 0 : this.config.col, this.cols = this.config.cols, this.rows = this.config.rows, this.viewers = this.config.viewers, this.control_all = this.config.control_all, this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.camera = new l.Camera(this.fov, this.ASPECT, this.NEAR, this.FAR, this.config.orthographic), this.camera.position = new p.Vector3(this.camerax, 0, this.CAMERA_Z), this.lookingAt = new p.Vector3(), this.camera.lookAt(this.lookingAt), this.raycaster = new l.Raycaster(new p.Vector3(0, 0, 0), new p.Vector3(0, 0, 0)), this.projector = new l.Projector(), this.initializeScene(), this.renderer.setClearColorHex(this.bgColor, this.config.backgroundAlpha), this.scene.fog.color = _.CC.color(this.bgColor), document.body.addEventListener("mouseup", this._handleMouseUp.bind(this)), document.body.addEventListener("touchend", this._handleMouseUp.bind(this)), this.initContainer(this.container), this.config.style && this.setViewStyle(this.config), window.addEventListener("resize", this.resize.bind(this)), typeof window.ResizeObserver < "u" && (this.divwatcher = new window.ResizeObserver(this.resize.bind(this)), this.divwatcher.observe(this.container));
try {
typeof this.callback == "function" && this.callback(this);
} catch (h) {
@@ -6085,13 +6085,13 @@ ATOM`, h);
modelToScreen(t) {
let a = !1;
Array.isArray(t) || (t = [t], a = !0);
- let h = this.renderer.getXRatio(), M = this.renderer.getYRatio(), w = this.col, S = this.row, T = w * (this.WIDTH / h), R = (M - S - 1) * (this.HEIGHT / M), z = [], P = this.canvasOffset();
+ let h = this.renderer.getXRatio(), M = this.renderer.getYRatio(), w = this.col, S = this.row, T = w * (this.WIDTH / h), R = (M - S - 1) * (this.HEIGHT / M), $ = [], P = this.canvasOffset();
return t.forEach((B) => {
- let U = new g.Vector3(B.x, B.y, B.z);
- U.applyMatrix4(this.modelGroup.matrixWorld), this.projector.projectVector(U, this.camera);
- let F = this.WIDTH / h * (U.x + 1) / 2 + P.left + T, $ = -(this.HEIGHT / M) * (U.y - 1) / 2 + P.top + R;
- z.push({ x: F, y: $ });
- }), a && (z = z[0]), z;
+ let F = new p.Vector3(B.x, B.y, B.z);
+ F.applyMatrix4(this.modelGroup.matrixWorld), this.projector.projectVector(F, this.camera);
+ let U = this.WIDTH / h * (F.x + 1) / 2 + P.left + T, z = -(this.HEIGHT / M) * (F.y - 1) / 2 + P.top + R;
+ $.push({ x: U, y: z });
+ }), a && ($ = $[0]), $;
}
/**
* For a given screen (x,y) displacement return model displacement
@@ -6100,7 +6100,7 @@ ATOM`, h);
* @param{modelz} z coordinate in model coordinates to compute offset for, default is model axis
*/
screenOffsetToModel(t, a, h) {
- var M = t / this.WIDTH, w = a / this.HEIGHT, S = h === void 0 ? this.rotationGroup.position.z : h, T = this.rotationGroup.quaternion, R = new g.Vector3(0, 0, S);
+ var M = t / this.WIDTH, w = a / this.HEIGHT, S = h === void 0 ? this.rotationGroup.position.z : h, T = this.rotationGroup.quaternion, R = new p.Vector3(0, 0, S);
return this.projector.projectVector(R, this.camera), R.x += M * 2, R.y -= w * 2, this.projector.unprojectVector(R, this.camera), R.z = 0, R.applyQuaternion(T), R;
}
/**
@@ -6110,11 +6110,11 @@ ATOM`, h);
* @param{model} xyz model coordinate
*/
screenToModelDistance(t, a) {
- let h = this.canvasOffset(), M = new g.Vector3(a.x, a.y, a.z);
+ let h = this.canvasOffset(), M = new p.Vector3(a.x, a.y, a.z);
M.applyMatrix4(this.modelGroup.matrixWorld);
let w = M.clone();
this.projector.projectVector(M, this.camera);
- let S = new g.Vector3((t.x - h.left) * 2 / this.WIDTH - 1, (t.y - h.top) * 2 / -this.HEIGHT + 1, M.z);
+ let S = new p.Vector3((t.x - h.left) * 2 / this.WIDTH - 1, (t.y - h.top) * 2 / -this.HEIGHT + 1, M.z);
return this.projector.unprojectVector(S, this.camera), S.distanceTo(w);
}
/**
@@ -6164,7 +6164,7 @@ ATOM`, h);
this.clear();
var a = t.models;
for (let h = 0; h < a.length; h++)
- a[h] && (this.models[h] = new p.GLModel(h), this.models[h].setInternalState(a[h]));
+ a[h] && (this.models[h] = new g.GLModel(h), this.models[h].setInternalState(a[h]));
this.render();
}
/**
@@ -6257,20 +6257,20 @@ ATOM`, h);
return t = t || 1, new Promise(function(h) {
let M = 0, w = a.viewChangeCallback, S = [], T = [], R = Date.now();
a.viewChangeCallback = function() {
- T.push(Date.now() - R), R = Date.now(), S.push(new Promise((z) => {
+ T.push(Date.now() - R), R = Date.now(), S.push(new Promise(($) => {
a.getCanvas().toBlob(function(P) {
- P.arrayBuffer().then(z);
+ P.arrayBuffer().then($);
}, "image/png");
- })), M += 1, M == t && (a.viewChangeCallback = w, Promise.all(S).then((z) => {
+ })), M += 1, M == t && (a.viewChangeCallback = w, Promise.all(S).then(($) => {
let P = [];
- for (let N = 0; N < z.length; N++) {
- let G = (0, D.decode)(z[N]);
- P.push((0, D.toRGBA8)(G)[0]);
+ for (let V = 0; V < $.length; V++) {
+ let N = (0, D.decode)($[V]);
+ P.push((0, D.toRGBA8)(N)[0]);
}
- let B = a.getCanvas().width, U = a.getCanvas().height, F = (0, D.encode)(P, B, U, 0, T), $ = new Blob([F], { type: "image/png" }), W = new FileReader();
- W.onload = function(N) {
- h(N.target.result);
- }, W.readAsDataURL($);
+ let B = a.getCanvas().width, F = a.getCanvas().height, U = (0, D.encode)(P, B, F, 0, T), z = new Blob([U], { type: "image/png" }), W = new FileReader();
+ W.onload = function(V) {
+ h(V.target.result);
+ }, W.readAsDataURL(z);
}));
};
});
@@ -6299,7 +6299,7 @@ ATOM`, h);
this.hoverDuration = t;
}
mouseXY(t, a) {
- let h = this.canvasOffset(), M = this.renderer.getXRatio(), w = this.renderer.getYRatio(), S = this.col, T = this.row, R = S * (this.WIDTH / M), z = (w - T - 1) * (this.HEIGHT / w), P = (t - h.left - R) / (this.WIDTH / M) * 2 - 1, B = -((a - h.top - z) / (this.HEIGHT / w)) * 2 + 1;
+ let h = this.canvasOffset(), M = this.renderer.getXRatio(), w = this.renderer.getYRatio(), S = this.col, T = this.row, R = S * (this.WIDTH / M), $ = (w - T - 1) * (this.HEIGHT / w), P = (t - h.left - R) / (this.WIDTH / M) * 2 - 1, B = -((a - h.top - $) / (this.HEIGHT / w)) * 2 + 1;
return { x: P, y: B };
}
_handleMouseMove(t) {
@@ -6313,24 +6313,24 @@ ATOM`, h);
if (!(!this.control_all && !this.isInViewer(a, h)) && this.scene && (this.hoverables.length > 0 && (this.hoverTimeout = setTimeout(function() {
T.handleHoverSelection(S.x, S.y, t);
}, this.hoverDuration)), !!this.isDragging)) {
- var z = (a - this.mouseStartX) / this.WIDTH, P = (h - this.mouseStartY) / this.HEIGHT;
+ var $ = (a - this.mouseStartX) / this.WIDTH, P = (h - this.mouseStartY) / this.HEIGHT;
if (this.touchDistanceStart != 0 && t.targetTouches && t.targetTouches.length == 2) {
var B = this.calcTouchDistance(t);
R = 2, P = (B - this.touchDistanceStart) * 2 / (this.WIDTH + this.HEIGHT);
} else
t.targetTouches && t.targetTouches.length == 3 && (R = 1);
- z *= M, P *= w;
- var U = Math.hypot(z, P), F;
+ $ *= M, P *= w;
+ var F = Math.hypot($, P), U;
if (R == 3 || this.mouseButton == 3 && t.ctrlKey)
- this.slabNear = this.cslabNear + z * 100, this.slabFar = this.cslabFar - P * 100;
+ this.slabNear = this.cslabNear + $ * 100, this.slabFar = this.cslabFar - P * 100;
else if (R == 2 || this.mouseButton == 3 || t.shiftKey)
- F = (this.CAMERA_Z - this.rotationGroup.position.z) * 0.85, F < 80 && (F = 80), this.rotationGroup.position.z = this.cz + P * F, this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z);
+ U = (this.CAMERA_Z - this.rotationGroup.position.z) * 0.85, U < 80 && (U = 80), this.rotationGroup.position.z = this.cz + P * U, this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z);
else if (R == 1 || this.mouseButton == 2 || t.ctrlKey) {
- var $ = this.screenOffsetToModel(M * (a - this.mouseStartX), w * (h - this.mouseStartY));
- this.modelGroup.position.addVectors(this.currentModelPos, $);
- } else if ((R === 0 || this.mouseButton == 1) && U !== 0) {
- var W = Math.sin(U * Math.PI) / U;
- this.dq.x = Math.cos(U * Math.PI), this.dq.y = 0, this.dq.z = W * z, this.dq.w = -W * P, this.rotationGroup.quaternion.set(1, 0, 0, 0), this.rotationGroup.quaternion.multiply(this.dq), this.rotationGroup.quaternion.multiply(this.cq);
+ var z = this.screenOffsetToModel(M * (a - this.mouseStartX), w * (h - this.mouseStartY));
+ this.modelGroup.position.addVectors(this.currentModelPos, z);
+ } else if ((R === 0 || this.mouseButton == 1) && F !== 0) {
+ var W = Math.sin(F * Math.PI) / F;
+ this.dq.x = Math.cos(F * Math.PI), this.dq.y = 0, this.dq.z = W * $, this.dq.w = -W * P, this.rotationGroup.quaternion.set(1, 0, 0, 0), this.rotationGroup.quaternion.multiply(this.dq), this.rotationGroup.quaternion.multiply(this.cq);
}
this.show();
}
@@ -6340,7 +6340,7 @@ ATOM`, h);
var a = this.getX(t), h = this.getY(t);
if (!(a != this.mouseStartX || h != this.mouseStartY)) {
var S = this.mouseStartX, T = this.mouseStartY, w = this.canvasOffset();
- let R = this.mouseXY(S, T), z = R.x, P = R.y, B = this.targetedObjects(z, P, this.contextMenuEnabledAtoms);
+ let R = this.mouseXY(S, T), $ = R.x, P = R.y, B = this.targetedObjects($, P, this.contextMenuEnabledAtoms);
var M = null;
B.length && (M = B[0].clickable);
var w = this.canvasOffset(), S = this.mouseStartX - w.left, T = this.mouseStartY - w.top;
@@ -6486,7 +6486,7 @@ ATOM`, h);
});
*/
getModel(t) {
- return t === void 0 ? this.models.length == 0 ? null : this.models[this.models.length - 1] : t instanceof p.GLModel ? t : t in this.models ? this.models[t] : this.models.length == 0 ? null : this.models[this.models.length - 1];
+ return t === void 0 ? this.models.length == 0 ? null : this.models[this.models.length - 1] : t instanceof g.GLModel ? t : t in this.models ? this.models[t] : this.models.length == 0 ? null : this.models[this.models.length - 1];
}
/**
* Continuously rotate a scene around the specified axis.
@@ -6524,33 +6524,33 @@ ATOM`, h);
animateMotion(t, a, h, M, w, S) {
var T = 20, R = Math.ceil(t / T);
R < 1 && (R = 1), this.incAnim();
- var z = {
+ var $ = {
mpos: this.modelGroup.position.clone(),
rz: this.rotationGroup.position.z,
rot: this.rotationGroup.quaternion.clone(),
cam: this.lookingAt.clone()
};
if (a) {
- let U = new Array(R);
- for (let N = 0; N < R; N++) {
- let G = (N + 1) / R, k = { mpos: z.mpos, rz: z.rz, rot: z.rot };
- k.mpos = h.clone().sub(z.mpos).multiplyScalar(G).add(z.mpos), k.rz = z.rz + G * (M - z.rz), k.rot = r.slerp(z.rot, w, G), k.cam = S.clone().sub(z.cam).multiplyScalar(G).add(z.cam), U[N] = k;
+ let F = new Array(R);
+ for (let V = 0; V < R; V++) {
+ let N = (V + 1) / R, k = { mpos: $.mpos, rz: $.rz, rot: $.rot };
+ k.mpos = h.clone().sub($.mpos).multiplyScalar(N).add($.mpos), k.rz = $.rz + N * (M - $.rz), k.rot = r.slerp($.rot, w, N), k.cam = S.clone().sub($.cam).multiplyScalar(N).add($.cam), F[V] = k;
}
- let F = 0, $ = this, W = function() {
- var N = U[F];
- F += 1, $.modelGroup.position = N.mpos, $.rotationGroup.position.z = N.rz, $.rotationGroup.quaternion = N.rot, $.camera.lookAt(N.cam), F < U.length ? setTimeout(W, T) : $.decAnim(), $.show();
+ let U = 0, z = this, W = function() {
+ var V = F[U];
+ U += 1, z.modelGroup.position = V.mpos, z.rotationGroup.position.z = V.rz, z.rotationGroup.quaternion = V.rot, z.camera.lookAt(V.cam), U < F.length ? setTimeout(W, T) : z.decAnim(), z.show();
};
setTimeout(W, T);
} else {
var P = {};
- let U = 1 / R;
- if (h && (P.mpos = h.clone().sub(z.mpos).multiplyScalar(U)), typeof M < "u" && M != null && (P.rz = U * (M - z.rz)), w) {
- var B = r.slerp(z.rot, w, U);
- P.rot = z.rot.clone().inverse().multiply(B);
+ let F = 1 / R;
+ if (h && (P.mpos = h.clone().sub($.mpos).multiplyScalar(F)), typeof M < "u" && M != null && (P.rz = F * (M - $.rz)), w) {
+ var B = r.slerp($.rot, w, F);
+ P.rot = $.rot.clone().inverse().multiply(B);
}
- S && (P.cam = S.clone().sub(z.cam).multiplyScalar(U));
- let F = 0, $ = this, W = function() {
- F += 1, P.mpos && $.modelGroup.position.add(P.mpos), P.rz && ($.rotationGroup.position.z += P.rz), P.rot && $.rotationGroup.quaternion.multiply(P.rot), P.cam && ($.lookingAt.add(P.cam), $.camera.lookAt($.lookingAt)), F < R ? setTimeout(W, T) : $.decAnim(), $.show();
+ S && (P.cam = S.clone().sub($.cam).multiplyScalar(F));
+ let U = 0, z = this, W = function() {
+ U += 1, P.mpos && z.modelGroup.position.add(P.mpos), P.rz && (z.rotationGroup.position.z += P.rz), P.rot && z.rotationGroup.quaternion.multiply(P.rot), P.cam && (z.lookingAt.add(P.cam), z.camera.lookAt(z.lookingAt)), U < R ? setTimeout(W, T) : z.decAnim(), z.show();
};
setTimeout(W, T);
}
@@ -6580,16 +6580,16 @@ ATOM`, h);
*/
rotate(t, a = "y", h = 0, M = !1) {
if (a == "x" ? a = { x: 1, y: 0, z: 0 } : a == "y" ? a = { x: 0, y: 1, z: 0 } : a == "z" && (a = { x: 0, y: 0, z: 1 }), a == "vx" ? a = { vx: 1, vy: 0, vz: 0 } : a == "vy" ? a = { vx: 0, vy: 1, vz: 0 } : a == "vz" && (a = { vx: 0, vy: 0, vz: 1 }), typeof a.vx < "u") {
- var w = new g.Vector3(a.vx, a.vy, a.vz);
+ var w = new p.Vector3(a.vx, a.vy, a.vz);
w.applyQuaternion(this.rotationGroup.quaternion), a = { x: w.x, y: w.y, z: w.z };
}
var S = function(P) {
- var B = Math.sin(P / 2), U = Math.cos(P / 2), F = 0, $ = 0, W = 0;
- return F = a.x * B, $ = a.y * B, W = a.z * B, new g.Quaternion(F, $, W, U).normalize();
+ var B = Math.sin(P / 2), F = Math.cos(P / 2), U = 0, z = 0, W = 0;
+ return U = a.x * B, z = a.y * B, W = a.z * B, new p.Quaternion(U, z, W, F).normalize();
}, T = Math.PI * t / 180, R = S(T);
if (h) {
- var z = new g.Quaternion().copy(this.rotationGroup.quaternion).multiply(R);
- this.animateMotion(h, M, this.modelGroup.position, this.rotationGroup.position.z, z, this.lookingAt);
+ var $ = new p.Quaternion().copy(this.rotationGroup.quaternion).multiply(R);
+ this.animateMotion(h, M, this.modelGroup.position, this.rotationGroup.position.z, $, this.lookingAt);
} else
this.rotationGroup.quaternion.multiply(R), this.show();
return this;
@@ -6652,10 +6652,10 @@ ATOM`, h);
T.verticesNeedUpdate = !0, T.elementsNeedUpdate = !0, T.normalsNeedUpdate = !0, T.colorsNeedUpdate = !0, T.buffersNeedUpdate = !0, T.boundingSphere = null, S[w].mat.needsUpdate = !0, S[w].done && (S[w].finished = !0), S[w].lastGL && this.modelGroup.remove(S[w].lastGL);
var R = null;
if (S[w].mat instanceof l.LineBasicMaterial ? R = new l.Line(T, S[w].mat) : R = new l.Mesh(T, S[w].mat), S[w].mat.transparent && S[w].mat.opacity == 0 ? R.visible = !1 : R.visible = !0, S[w].symmetries.length > 1 || S[w].symmetries.length == 1 && !S[w].symmetries[w].isIdentity()) {
- var z, P = new l.Object3D();
- for (z = 0; z < S[w].symmetries.length; z++) {
+ var $, P = new l.Object3D();
+ for ($ = 0; $ < S[w].symmetries.length; $++) {
var B = R.clone();
- B.matrix = S[w].symmetries[z], B.matrixAutoUpdate = !1, P.add(B);
+ B.matrix = S[w].symmetries[$], B.matrixAutoUpdate = !1, P.add(B);
}
S[w].lastGL = P, this.modelGroup.add(P);
} else
@@ -6797,7 +6797,7 @@ ATOM`, h);
});
*/
translate(t, a, h = 0, M = !1) {
- var w = t / this.WIDTH, S = a / this.HEIGHT, T = new g.Vector3(0, 0, -this.CAMERA_Z);
+ var w = t / this.WIDTH, S = a / this.HEIGHT, T = new p.Vector3(0, 0, -this.CAMERA_Z);
this.projector.projectVector(T, this.camera), T.x -= w, T.y -= S, this.projector.unprojectVector(T, this.camera), T.z = 0;
var R = this.lookingAt.clone().add(T);
return h > 0 ? this.animateMotion(h, M, this.modelGroup.position, this.rotationGroup.position.z, this.rotationGroup.quaternion, R) : (this.lookingAt = R, this.camera.lookAt(this.lookingAt), this.show()), this;
@@ -6865,22 +6865,22 @@ ATOM`, h);
*/
center(t = {}, a = 0, h = !1) {
var M, w, S = this.getAtomsFromSel(t), T = (0, x.getExtent)(S);
- (0, x.isEmptyObject)(t) ? (this.shapes.forEach((G) => {
- if (G && G.boundingSphere && G.boundingSphere.center) {
- var k = G.boundingSphere.center, j = G.boundingSphere.radius;
- j > 0 ? (S.push(new g.Vector3(k.x + j, k.y, k.z)), S.push(new g.Vector3(k.x - j, k.y, k.z)), S.push(new g.Vector3(k.x, k.y + j, k.z)), S.push(new g.Vector3(k.x, k.y - j, k.z)), S.push(new g.Vector3(k.x, k.y, k.z + j)), S.push(new g.Vector3(k.x, k.y, k.z - j))) : S.push(k);
+ (0, x.isEmptyObject)(t) ? (this.shapes.forEach((N) => {
+ if (N && N.boundingSphere && N.boundingSphere.center) {
+ var k = N.boundingSphere.center, G = N.boundingSphere.radius;
+ G > 0 ? (S.push(new p.Vector3(k.x + G, k.y, k.z)), S.push(new p.Vector3(k.x - G, k.y, k.z)), S.push(new p.Vector3(k.x, k.y + G, k.z)), S.push(new p.Vector3(k.x, k.y - G, k.z)), S.push(new p.Vector3(k.x, k.y, k.z + G)), S.push(new p.Vector3(k.x, k.y, k.z - G))) : S.push(k);
}
}), T = (0, x.getExtent)(S), M = S, w = T) : (M = this.getAtomsFromSel({}), w = (0, x.getExtent)(M));
- var R = new g.Vector3(T[2][0], T[2][1], T[2][2]), z = w[1][0] - w[0][0], P = w[1][1] - w[0][1], B = w[1][2] - w[0][2], U = Math.hypot(z, P, B);
- U < 5 && (U = 5), this.slabNear = -U / 1.9, this.slabFar = U / 2, z = T[1][0] - T[0][0], P = T[1][1] - T[0][1], B = T[1][2] - T[0][2], U = Math.hypot(z, P, B), U < 5 && (U = 5);
- for (var F = 25, $ = 0; $ < S.length; $++)
- if (S[$]) {
- var W = R.distanceToSquared(S[$]);
- W > F && (F = W);
+ var R = new p.Vector3(T[2][0], T[2][1], T[2][2]), $ = w[1][0] - w[0][0], P = w[1][1] - w[0][1], B = w[1][2] - w[0][2], F = Math.hypot($, P, B);
+ F < 5 && (F = 5), this.slabNear = -F / 1.9, this.slabFar = F / 2, $ = T[1][0] - T[0][0], P = T[1][1] - T[0][1], B = T[1][2] - T[0][2], F = Math.hypot($, P, B), F < 5 && (F = 5);
+ for (var U = 25, z = 0; z < S.length; z++)
+ if (S[z]) {
+ var W = R.distanceToSquared(S[z]);
+ W > U && (U = W);
}
- U = Math.sqrt(F) * 2;
- var N = R.clone().multiplyScalar(-1);
- return a > 0 ? this.animateMotion(a, h, N, this.rotationGroup.position.z, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = N, this.show()), this;
+ F = Math.sqrt(U) * 2;
+ var V = R.clone().multiplyScalar(-1);
+ return a > 0 ? this.animateMotion(a, h, V, this.rotationGroup.position.z, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = V, this.show()), this;
}
/**
* Zoom to center of atom selection. The slab will be set appropriately for
@@ -6915,35 +6915,35 @@ ATOM`, h);
let M = this.getAtomsFromSel(t), w = (0, x.getExtent)(M), S = w;
if ((0, x.isEmptyObject)(t)) {
let k = M && M.length;
- if (this.shapes.forEach((j) => {
- if (j && j.boundingSphere) {
- if (j.boundingSphere.box) {
- let pe = j.boundingSphere.box;
- M.push(new g.Vector3(pe.min.x, pe.min.y, pe.min.z)), M.push(new g.Vector3(pe.max.x, pe.max.y, pe.max.z));
- } else if (j.boundingSphere.center) {
- var Q = j.boundingSphere.center, ie = j.boundingSphere.radius;
- ie > 0 ? (M.push(new g.Vector3(Q.x + ie, Q.y, Q.z)), M.push(new g.Vector3(Q.x - ie, Q.y, Q.z)), M.push(new g.Vector3(Q.x, Q.y + ie, Q.z)), M.push(new g.Vector3(Q.x, Q.y - ie, Q.z)), M.push(new g.Vector3(Q.x, Q.y, Q.z + ie)), M.push(new g.Vector3(Q.x, Q.y, Q.z - ie))) : M.push(Q);
+ if (this.shapes.forEach((G) => {
+ if (G && G.boundingSphere) {
+ if (G.boundingSphere.box) {
+ let ge = G.boundingSphere.box;
+ M.push(new p.Vector3(ge.min.x, ge.min.y, ge.min.z)), M.push(new p.Vector3(ge.max.x, ge.max.y, ge.max.z));
+ } else if (G.boundingSphere.center) {
+ var Q = G.boundingSphere.center, ie = G.boundingSphere.radius;
+ ie > 0 ? (M.push(new p.Vector3(Q.x + ie, Q.y, Q.z)), M.push(new p.Vector3(Q.x - ie, Q.y, Q.z)), M.push(new p.Vector3(Q.x, Q.y + ie, Q.z)), M.push(new p.Vector3(Q.x, Q.y - ie, Q.z)), M.push(new p.Vector3(Q.x, Q.y, Q.z + ie)), M.push(new p.Vector3(Q.x, Q.y, Q.z - ie))) : M.push(Q);
}
}
}), S = (0, x.getExtent)(M), !k)
- for (let j = 0; j < 3; j++)
- w[2][j] = (S[0][j] + S[1][j]) / 2;
+ for (let G = 0; G < 3; G++)
+ w[2][G] = (S[0][G] + S[1][G]) / 2;
} else {
let k = this.getAtomsFromSel({});
S = (0, x.getExtent)(k);
}
- var T = new g.Vector3(w[2][0], w[2][1], w[2][2]), R = S[1][0] - S[0][0], z = S[1][1] - S[0][1], P = S[1][2] - S[0][2], B = Math.hypot(R, z, P);
+ var T = new p.Vector3(w[2][0], w[2][1], w[2][2]), R = S[1][0] - S[0][0], $ = S[1][1] - S[0][1], P = S[1][2] - S[0][2], B = Math.hypot(R, $, P);
B < 5 && (B = 5), this.slabNear = -B / 1.9, this.slabFar = B / 2, Object.keys(t).length === 0 && (this.slabNear = Math.min(-B * 2, -50), this.slabFar = Math.max(B * 2, 50));
- var U = this.config.minimumZoomToDistance || 5;
- R = w[1][0] - w[0][0], z = w[1][1] - w[0][1], P = w[1][2] - w[0][2], B = Math.hypot(R, z, P), B < U && (B = U);
- for (var F = U * U, $ = 0; $ < M.length; $++)
- if (M[$]) {
- var W = T.distanceToSquared(M[$]);
- W > F && (F = W);
+ var F = this.config.minimumZoomToDistance || 5;
+ R = w[1][0] - w[0][0], $ = w[1][1] - w[0][1], P = w[1][2] - w[0][2], B = Math.hypot(R, $, P), B < F && (B = F);
+ for (var U = F * F, z = 0; z < M.length; z++)
+ if (M[z]) {
+ var W = T.distanceToSquared(M[z]);
+ W > U && (U = W);
}
- B = Math.sqrt(F) * 2;
- var N = T.clone().multiplyScalar(-1), G = -(B * 0.5 / Math.tan(Math.PI / 180 * this.camera.fov / 2) - this.CAMERA_Z);
- return G = this.adjustZoomToLimits(G), a > 0 ? this.animateMotion(a, h, N, G, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = N, this.rotationGroup.position.z = G, this.show()), this;
+ B = Math.sqrt(U) * 2;
+ var V = T.clone().multiplyScalar(-1), N = -(B * 0.5 / Math.tan(Math.PI / 180 * this.camera.fov / 2) - this.CAMERA_Z);
+ return N = this.adjustZoomToLimits(N), a > 0 ? this.animateMotion(a, h, V, N, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = V, this.rotationGroup.position.z = N, this.show()), this;
}
/**
* Set slab of view (contents outside of slab are clipped).
@@ -7341,61 +7341,61 @@ ATOM`, h);
if (h.matrix)
M = h.matrix;
else {
- var w = h.a, S = h.b, T = h.c, R = h.alpha, z = h.beta, P = h.gamma;
- R = R * Math.PI / 180, z = z * Math.PI / 180, P = P * Math.PI / 180;
- var B, U, F;
- B = Math.cos(z), U = (Math.cos(R) - Math.cos(z) * Math.cos(P)) / Math.sin(P), F = Math.sqrt(Math.max(0, 1 - B * B - U * U)), M = new g.Matrix3(w, S * Math.cos(P), T * B, 0, S * Math.sin(P), T * U, 0, 0, T * F);
+ var w = h.a, S = h.b, T = h.c, R = h.alpha, $ = h.beta, P = h.gamma;
+ R = R * Math.PI / 180, $ = $ * Math.PI / 180, P = P * Math.PI / 180;
+ var B, F, U;
+ B = Math.cos($), F = (Math.cos(R) - Math.cos($) * Math.cos(P)) / Math.sin(P), U = Math.sqrt(Math.max(0, 1 - B * B - F * F)), M = new p.Matrix3(w, S * Math.cos(P), T * B, 0, S * Math.sin(P), T * F, 0, 0, T * U);
}
- var $ = [
- new g.Vector3(0, 0, 0),
- new g.Vector3(1, 0, 0),
- new g.Vector3(0, 1, 0),
- new g.Vector3(0, 0, 1),
- new g.Vector3(1, 1, 0),
- new g.Vector3(0, 1, 1),
- new g.Vector3(1, 0, 1),
- new g.Vector3(1, 1, 1)
+ var z = [
+ new p.Vector3(0, 0, 0),
+ new p.Vector3(1, 0, 0),
+ new p.Vector3(0, 1, 0),
+ new p.Vector3(0, 0, 1),
+ new p.Vector3(1, 1, 0),
+ new p.Vector3(0, 1, 1),
+ new p.Vector3(1, 0, 1),
+ new p.Vector3(1, 1, 1)
];
if (h.matrix4)
- for (let N = 0; N < $.length; N++)
- h.size && $[N].multiplyVectors($[N], h.size), $[N] = $[N].applyMatrix4(h.matrix4);
+ for (let V = 0; V < z.length; V++)
+ h.size && z[V].multiplyVectors(z[V], h.size), z[V] = z[V].applyMatrix4(h.matrix4);
else
- for (let N = 0; N < $.length; N++)
- $[N] = $[N].applyMatrix3(M);
+ for (let V = 0; V < z.length; V++)
+ z[V] = z[V].applyMatrix3(M);
if (a.box && !a.box.hidden) {
a.box.wireframe = !0;
var W = new u.GLShape(a.box);
- W.shapePosition = this.shapes.length, W.addLine({ start: $[0], end: $[1] }), W.addLine({ start: $[0], end: $[2] }), W.addLine({ start: $[1], end: $[4] }), W.addLine({ start: $[2], end: $[4] }), W.addLine({ start: $[0], end: $[3] }), W.addLine({ start: $[3], end: $[5] }), W.addLine({ start: $[2], end: $[5] }), W.addLine({ start: $[1], end: $[6] }), W.addLine({ start: $[4], end: $[7] }), W.addLine({ start: $[6], end: $[7] }), W.addLine({ start: $[3], end: $[6] }), W.addLine({ start: $[5], end: $[7] }), this.shapes.push(W), t.unitCellObjects.shapes.push(W), W.finalize();
+ W.shapePosition = this.shapes.length, W.addLine({ start: z[0], end: z[1] }), W.addLine({ start: z[0], end: z[2] }), W.addLine({ start: z[1], end: z[4] }), W.addLine({ start: z[2], end: z[4] }), W.addLine({ start: z[0], end: z[3] }), W.addLine({ start: z[3], end: z[5] }), W.addLine({ start: z[2], end: z[5] }), W.addLine({ start: z[1], end: z[6] }), W.addLine({ start: z[4], end: z[7] }), W.addLine({ start: z[6], end: z[7] }), W.addLine({ start: z[3], end: z[6] }), W.addLine({ start: z[5], end: z[7] }), this.shapes.push(W), t.unitCellObjects.shapes.push(W), W.finalize();
}
if (!a.astyle.hidden) {
- a.astyle.start = $[0], a.astyle.end = $[1];
- let N = this.addArrow(a.astyle);
- t.unitCellObjects.shapes.push(N);
+ a.astyle.start = z[0], a.astyle.end = z[1];
+ let V = this.addArrow(a.astyle);
+ t.unitCellObjects.shapes.push(V);
}
if (!a.bstyle.hidden) {
- a.bstyle.start = $[0], a.bstyle.end = $[2];
- let N = this.addArrow(a.bstyle);
- t.unitCellObjects.shapes.push(N);
+ a.bstyle.start = z[0], a.bstyle.end = z[2];
+ let V = this.addArrow(a.bstyle);
+ t.unitCellObjects.shapes.push(V);
}
if (!a.cstyle.hidden) {
- a.cstyle.start = $[0], a.cstyle.end = $[3];
- let N = this.addArrow(a.cstyle);
- t.unitCellObjects.shapes.push(N);
+ a.cstyle.start = z[0], a.cstyle.end = z[3];
+ let V = this.addArrow(a.cstyle);
+ t.unitCellObjects.shapes.push(V);
}
if (a.alabel) {
- a.alabelstyle.position = $[1];
- let N = this.addLabel(a.alabel, a.alabelstyle);
- t.unitCellObjects.labels.push(N);
+ a.alabelstyle.position = z[1];
+ let V = this.addLabel(a.alabel, a.alabelstyle);
+ t.unitCellObjects.labels.push(V);
}
if (a.blabel) {
- a.blabelstyle.position = $[2];
- let N = this.addLabel(a.blabel, a.blabelstyle);
- t.unitCellObjects.labels.push(N);
+ a.blabelstyle.position = z[2];
+ let V = this.addLabel(a.blabel, a.blabelstyle);
+ t.unitCellObjects.labels.push(V);
}
if (a.clabel) {
- a.clabelstyle.position = $[3];
- let N = this.addLabel(a.clabel, a.clabelstyle);
- t.unitCellObjects.labels.push(N);
+ a.clabelstyle.position = z[3];
+ let V = this.addLabel(a.clabel, a.clabelstyle);
+ t.unitCellObjects.labels.push(V);
}
}
}
@@ -7448,39 +7448,39 @@ ATOM`, h);
M = this.getModel(M);
let T = M.getCrystData();
if (T) {
- const R = M.selectedAtoms({}), z = T.matrix;
- let P = function(U) {
- return U % 2 == 0 ? -U / 2 : Math.ceil(U / 2);
+ const R = M.selectedAtoms({}), $ = T.matrix;
+ let P = function(F) {
+ return F % 2 == 0 ? -F / 2 : Math.ceil(F / 2);
};
t <= 1 && a <= 1 && h <= 1 && (S = !0, t = a = h = 3);
- let B = function(U, F, $) {
+ let B = function(F, U, z) {
return !1;
};
if (S) {
- const U = new g.Matrix3().getInverse3(z);
- B = function(F, $, W) {
- let N = new g.Vector3(F, $, W).applyMatrix3(U);
- return !(N.x > -1e-4 && N.x < 1.0001 && N.y > -1e-4 && N.y < 1.0001 && N.z > -1e-4 && N.z < 1.0001);
+ const F = new p.Matrix3().getInverse3($);
+ B = function(U, z, W) {
+ let V = new p.Vector3(U, z, W).applyMatrix3(F);
+ return !(V.x > -1e-4 && V.x < 1.0001 && V.y > -1e-4 && V.y < 1.0001 && V.z > -1e-4 && V.z < 1.0001);
};
}
- for (let U = 0; U < t; U++)
- for (let F = 0; F < a; F++)
- for (let $ = 0; $ < h; $++) {
- if (U == 0 && F == 0 && $ == 0)
+ for (let F = 0; F < t; F++)
+ for (let U = 0; U < a; U++)
+ for (let z = 0; z < h; z++) {
+ if (F == 0 && U == 0 && z == 0)
continue;
- let W = new g.Vector3(P(U), P(F), P($));
- W.applyMatrix3(z);
- let N = [];
- for (let G = 0; G < R.length; G++) {
- let k = R[G].x + W.x, j = R[G].y + W.y, Q = R[G].z + W.z;
- if (B(k, j, Q))
+ let W = new p.Vector3(P(F), P(U), P(z));
+ W.applyMatrix3($);
+ let V = [];
+ for (let N = 0; N < R.length; N++) {
+ let k = R[N].x + W.x, G = R[N].y + W.y, Q = R[N].z + W.z;
+ if (B(k, G, Q))
continue;
let ie = {};
- for (let pe in R[G])
- ie[pe] = R[G][pe];
- ie.x = k, ie.y = j, ie.z = Q, N.push(ie);
+ for (let ge in R[N])
+ ie[ge] = R[N][ge];
+ ie.x = k, ie.y = G, ie.z = Q, V.push(ie);
}
- M.addAtoms(N);
+ M.addAtoms(V);
}
w && M.assignBonds();
}
@@ -7489,16 +7489,16 @@ ATOM`, h);
addLineDashed(t, a) {
t.dashLength = t.dashLength || 0.5, t.gapLength = t.gapLength || 0.5;
var h;
- t.start ? h = new g.Vector3(t.start.x || 0, t.start.y || 0, t.start.z || 0) : h = new g.Vector3(0, 0, 0);
+ t.start ? h = new p.Vector3(t.start.x || 0, t.start.y || 0, t.start.z || 0) : h = new p.Vector3(0, 0, 0);
var M;
- t.end ? M = new g.Vector3(t.end.x, t.end.y || 0, t.end.z || 0) : M = new g.Vector3(0, 0, 0);
- var w = new g.Vector3(), S = new g.Vector3(), T = new g.Vector3(), R, z, P, B = h.clone(), U = 0;
- for (w.subVectors(M, h), R = w.length(), w.normalize(), S = w.clone(), T = w.clone(), S.multiplyScalar(t.dashLength), T.multiplyScalar(t.gapLength), z = S.length(), P = T.length(); U < R; ) {
- if (U + z > R) {
+ t.end ? M = new p.Vector3(t.end.x, t.end.y || 0, t.end.z || 0) : M = new p.Vector3(0, 0, 0);
+ var w = new p.Vector3(), S = new p.Vector3(), T = new p.Vector3(), R, $, P, B = h.clone(), F = 0;
+ for (w.subVectors(M, h), R = w.length(), w.normalize(), S = w.clone(), T = w.clone(), S.multiplyScalar(t.dashLength), T.multiplyScalar(t.gapLength), $ = S.length(), P = T.length(); F < R; ) {
+ if (F + $ > R) {
t.start = h, t.end = M, a.addLine(t);
break;
}
- B.addVectors(h, S), t.start = h, t.end = B, a.addLine(t), h = B.clone(), U += z, B.addVectors(h, T), h = B.clone(), U += P;
+ B.addVectors(h, S), t.start = h, t.end = B, a.addLine(t), h = B.clone(), F += $, B.addVectors(h, T), h = B.clone(), F += P;
}
return a.finalize(), a;
}
@@ -7595,7 +7595,7 @@ ATOM`, h);
*/
addVolumetricRender(t, a) {
a = a || {};
- var h = new L.GLVolumetricRender(t, a);
+ var h = new C.GLVolumetricRender(t, a);
return h.shapePosition = this.shapes.length, this.shapes.push(h), h;
}
/**
@@ -7670,25 +7670,25 @@ ATOM`, h);
t.startFrame && (T = t.startFrame % w);
var R = 1;
t.step && (R = t.step, M /= R);
- var z = 0, P = w * M, B = /* @__PURE__ */ new Date(), U, F, $ = function(W) {
+ var $ = 0, P = w * M, B = /* @__PURE__ */ new Date(), F, U, z = function(W) {
B = /* @__PURE__ */ new Date(), W == "forward" ? S.setFrame(T).then(function() {
- T = (T + R) % w, U();
+ T = (T + R) % w, F();
}) : W == "backward" ? S.setFrame(w - 1 - T).then(function() {
- T = (T + R) % w, U();
+ T = (T + R) % w, F();
}) : S.setFrame(T).then(function() {
- T += R, R *= T % (w - 1) == 0 ? -1 : 1, U();
+ T += R, R *= T % (w - 1) == 0 ? -1 : 1, F();
});
};
- return U = function() {
+ return F = function() {
if (S.render(), !S.getCanvas().isConnected)
S.stopAnimate();
- else if (++z == P || !S.isAnimated())
- F.cancel(), S.animationTimers.delete(F), S.decAnim();
+ else if (++$ == P || !S.isAnimated())
+ U.cancel(), S.animationTimers.delete(U), S.decAnim();
else {
var W = a - ((/* @__PURE__ */ new Date()).getTime() - B.getTime());
- W = W > 0 ? W : 0, S.animationTimers.delete(F), F = new x.PausableTimer($, W, h), S.animationTimers.add(F);
+ W = W > 0 ? W : 0, S.animationTimers.delete(U), U = new x.PausableTimer(z, W, h), S.animationTimers.add(U);
}
- }, F = new x.PausableTimer($, 0, h), this.animationTimers.add(F), this;
+ }, U = new x.PausableTimer(z, 0, h), this.animationTimers.add(U), this;
}
/**
* Stop animation of all models in viewer
@@ -7749,7 +7749,7 @@ ATOM`, h);
*/
addModel(t, a = "", h) {
h = this.getModelOpt(h);
- var M = new p.GLModel(this.models.length, h);
+ var M = new g.GLModel(this.models.length, h);
return M.addMolData(t, a, h), this.models.push(M), M;
}
/**
@@ -7762,8 +7762,8 @@ ATOM`, h);
*/
addModels(t, a, h) {
h = this.getModelOpt(h), h.multimodel = !0, h.frames = !0;
- for (var M = p.GLModel.parseMolData(t, a, h), w = 0; w < M.length; w++) {
- var S = new p.GLModel(this.models.length, h);
+ for (var M = g.GLModel.parseMolData(t, a, h), w = 0; w < M.length; w++) {
+ var S = new g.GLModel(this.models.length, h);
S.setAtomDefaults(M[w]), S.addFrame(M[w]), S.setFrame(0), M.modelData && S.setModelData(M.modelData[w]), S.setDontDuplicateAtoms(!h.duplicateAssemblyAtoms), this.models.push(S);
}
return this.models;
@@ -7788,7 +7788,7 @@ ATOM`, h);
*/
addModelsAsFrames(t, a, h) {
h = this.getModelOpt(h), h.multimodel = !0, h.frames = !0;
- var M = new p.GLModel(this.models.length, h);
+ var M = new g.GLModel(this.models.length, h);
return M.addMolData(t, a, h), this.models.push(M), M;
}
/**
@@ -7809,7 +7809,7 @@ ATOM`, h);
*/
addAsOneMolecule(t, a, h) {
h = this.getModelOpt(h), h.multimodel = !0, h.onemol = !0;
- var M = new p.GLModel(this.models.length, h);
+ var M = new g.GLModel(this.models.length, h);
return M.addMolData(t, a, h), this.models.push(M), M;
}
/**
@@ -7866,7 +7866,7 @@ ATOM`, h);
* @return {GLModel}
*/
createModelFrom(t, a = !1) {
- for (var h = new p.GLModel(this.models.length, this.defaultcolors), M = 0; M < this.models.length; M++)
+ for (var h = new g.GLModel(this.models.length, this.defaultcolors), M = 0; M < this.models.length; M++)
if (this.models[M]) {
var w = this.models[M].selectedAtoms(t);
h.addAtoms(w), a && this.models[M].removeAtoms(w);
@@ -7874,8 +7874,8 @@ ATOM`, h);
return this.models.push(h), h;
}
applyToModels(t, a, h, M, w, S, T) {
- for (var R = this.getModelList(a), z = 0; z < R.length; z++)
- R[z][t](a, h, M, w, S, T);
+ for (var R = this.getModelList(a), $ = 0; $ < R.length; $++)
+ R[$][t](a, h, M, w, S, T);
}
setStyle(t, a) {
return typeof a > "u" && (a = t, t = {}), this.applyToModels("setStyle", t, a, !1), this;
@@ -8008,33 +8008,33 @@ ATOM`, h);
*/
carveUpExtent(t, a, h) {
let M = [], w = {};
- for (let B = 0, U = a.length; B < U; B++)
+ for (let B = 0, F = a.length; B < F; B++)
w[a[B].index] = B;
let S = function(B) {
- let U = [];
- for (let F = 0, $ = B.length; F < $; F++)
- B[F].index in w && U.push(w[B[F].index]);
- return U;
+ let F = [];
+ for (let U = 0, z = B.length; U < z; U++)
+ B[U].index in w && F.push(w[B[U].index]);
+ return F;
}, T = function(B) {
- let U = [];
- return U[0] = [B[0][0], B[0][1], B[0][2]], U[1] = [B[1][0], B[1][1], B[1][2]], U;
+ let F = [];
+ return F[0] = [B[0][0], B[0][1], B[0][2]], F[1] = [B[1][0], B[1][1], B[1][2]], F;
}, R = function(B) {
if (r.volume(B) < r.maxVolume)
return [B];
- var U = B[1][0] - B[0][0], F = B[1][1] - B[0][1], $ = B[1][2] - B[0][2], W;
- U > F && U > $ ? W = 0 : F > U && F > $ ? W = 1 : W = 2;
- var N = T(B), G = T(B), k = (B[1][W] - B[0][W]) / 2 + B[0][W];
- N[1][W] = k, G[0][W] = k;
- var j = R(N), Q = R(G);
- return j.concat(Q);
- }, z = R(t), P = 6;
- for (let B = 0, U = z.length; B < U; B++) {
- let F = T(z[B]);
- F[0][0] -= P, F[0][1] -= P, F[0][2] -= P, F[1][0] += P, F[1][1] += P, F[1][2] += P;
- let $ = r.getAtomsWithin(a, F), W = r.getAtomsWithin(h, z[B]);
+ var F = B[1][0] - B[0][0], U = B[1][1] - B[0][1], z = B[1][2] - B[0][2], W;
+ F > U && F > z ? W = 0 : U > F && U > z ? W = 1 : W = 2;
+ var V = T(B), N = T(B), k = (B[1][W] - B[0][W]) / 2 + B[0][W];
+ V[1][W] = k, N[0][W] = k;
+ var G = R(V), Q = R(N);
+ return G.concat(Q);
+ }, $ = R(t), P = 6;
+ for (let B = 0, F = $.length; B < F; B++) {
+ let U = T($[B]);
+ U[0][0] -= P, U[0][1] -= P, U[0][2] -= P, U[1][0] += P, U[1][1] += P, U[1][2] += P;
+ let z = r.getAtomsWithin(a, U), W = r.getAtomsWithin(h, $[B]);
M.push({
- extent: z[B],
- atoms: S($),
+ extent: $[B],
+ atoms: S(z),
toshow: S(W)
});
}
@@ -8053,37 +8053,37 @@ ATOM`, h);
*/
static generateSurfaceMesh(t, a, h) {
var M = new l.Geometry(!0), w = M.updateGeoGroup(0), S = [];
- for (let xe = 0, Ie = t.length; xe < Ie; xe++) {
- var T = t[xe];
- T && (typeof T.surfaceColor < "u" ? S[xe] = T.surfaceColor : T.color && (S[xe] = _.CC.color(T.color)));
+ for (let ye = 0, Pe = t.length; ye < Pe; ye++) {
+ var T = t[ye];
+ T && (typeof T.surfaceColor < "u" ? S[ye] = T.surfaceColor : T.color && (S[ye] = _.CC.color(T.color)));
}
- var R = w.vertexArray, z = a.vertices;
- for (let xe = 0, Ie = z.length; xe < Ie; xe++) {
- let oe = w.vertices * 3;
- R[oe] = z[xe].x, R[oe + 1] = z[xe].y, R[oe + 2] = z[xe].z, w.vertices++;
+ var R = w.vertexArray, $ = a.vertices;
+ for (let ye = 0, Pe = $.length; ye < Pe; ye++) {
+ let de = w.vertices * 3;
+ R[de] = $[ye].x, R[de + 1] = $[ye].y, R[de + 2] = $[ye].z, w.vertices++;
}
var P = w.colorArray;
if (h.voldata && h.volscheme) {
- var B = h.volscheme, U = h.voldata, F = B.range() || [-1, 1];
- for (let xe = 0, Ie = z.length; xe < Ie; xe++) {
- let oe = U.getVal(z[xe].x, z[xe].y, z[xe].z), ve = _.CC.color(B.valueToHex(oe, F)), re = xe * 3;
- P[re] = ve.r, P[re + 1] = ve.g, P[re + 2] = ve.b;
+ var B = h.volscheme, F = h.voldata, U = B.range() || [-1, 1];
+ for (let ye = 0, Pe = $.length; ye < Pe; ye++) {
+ let de = F.getVal($[ye].x, $[ye].y, $[ye].z), pe = _.CC.color(B.valueToHex(de, U)), re = ye * 3;
+ P[re] = pe.r, P[re + 1] = pe.g, P[re + 2] = pe.b;
}
} else if (S.length > 0)
- for (let xe = 0, Ie = z.length; xe < Ie; xe++) {
- let oe = z[xe].atomid, ve = xe * 3;
- P[ve] = S[oe].r, P[ve + 1] = S[oe].g, P[ve + 2] = S[oe].b;
+ for (let ye = 0, Pe = $.length; ye < Pe; ye++) {
+ let de = $[ye].atomid, pe = ye * 3;
+ P[pe] = S[de].r, P[pe + 1] = S[de].g, P[pe + 2] = S[de].b;
}
- var $ = a.faces;
- w.faceidx = $.length, M.initTypedArrays();
- var W = w.vertexArray, N = w.normalArray, G, k, j, Q;
- for (let xe = 0, Ie = $.length; xe < Ie; xe += 3) {
- var ie = $[xe], pe = $[xe + 1], he = $[xe + 2], ue = ie * 3, se = pe * 3, ae = he * 3;
- G = new g.Vector3(W[ue], W[ue + 1], W[ue + 2]), k = new g.Vector3(W[se], W[se + 1], W[se + 2]), j = new g.Vector3(W[ae], W[ae + 1], W[ae + 2]), j.subVectors(j, k), G.subVectors(G, k), j.cross(G), Q = j, Q.normalize(), N[ue] += Q.x, N[se] += Q.x, N[ae] += Q.x, N[ue + 1] += Q.y, N[se + 1] += Q.y, N[ae + 1] += Q.y, N[ue + 2] += Q.z, N[se + 2] += Q.z, N[ae + 2] += Q.z;
+ var z = a.faces;
+ w.faceidx = z.length, M.initTypedArrays();
+ var W = w.vertexArray, V = w.normalArray, N, k, G, Q;
+ for (let ye = 0, Pe = z.length; ye < Pe; ye += 3) {
+ var ie = z[ye], ge = z[ye + 1], le = z[ye + 2], oe = ie * 3, he = ge * 3, se = le * 3;
+ N = new p.Vector3(W[oe], W[oe + 1], W[oe + 2]), k = new p.Vector3(W[he], W[he + 1], W[he + 2]), G = new p.Vector3(W[se], W[se + 1], W[se + 2]), G.subVectors(G, k), N.subVectors(N, k), G.cross(N), Q = G, Q.normalize(), V[oe] += Q.x, V[he] += Q.x, V[se] += Q.x, V[oe + 1] += Q.y, V[he + 1] += Q.y, V[se + 1] += Q.y, V[oe + 2] += Q.z, V[he + 2] += Q.z, V[se + 2] += Q.z;
}
- w.faceArray = new Uint16Array($);
- var we = new l.Mesh(M, h);
- return we;
+ w.faceArray = new Uint16Array(z);
+ var xe = new l.Mesh(M, h);
+ return xe;
}
// do same thing as worker in main thread
/**
@@ -8102,8 +8102,8 @@ ATOM`, h);
* @return {Object}
*/
static generateMeshSyncHelper(t, a, h, M, w, S) {
- var T = new C.ProteinSurface();
- return T.initparm(a, t !== 1, S), T.fillvoxels(w, h), T.buildboundary(), (t == C.SurfaceType.SES || t == C.SurfaceType.MS) && (T.fastdistancemap(), T.boundingatom(!1), T.fillvoxelswaals(w, h)), T.marchingcube(t), T.getFacesAndVertices(M);
+ var T = new L.ProteinSurface();
+ return T.initparm(a, t !== 1, S), T.fillvoxels(w, h), T.buildboundary(), (t == L.SurfaceType.SES || t == L.SurfaceType.MS) && (T.fastdistancemap(), T.boundingatom(!1), T.fillvoxelswaals(w, h)), T.marchingcube(t), T.getFacesAndVertices(M);
}
/*
*
@@ -8157,111 +8157,111 @@ ATOM`, h);
* @return {Promise} promise - Returns a promise that ultimately resovles to the surfid. Returns surfid immediately if surfacecallback is specified. Returned promise has a [surfid, GLViewer, style, atomsel, allsel, focus] fields for immediate access.
*/
addSurface(t, a = {}, h = {}, M, w, S) {
- let T = this.nextSurfID(), R = null, z = this, P = C.SurfaceType.VDW;
+ let T = this.nextSurfID(), R = null, $ = this, P = L.SurfaceType.VDW;
typeof t == "string" ? r.surfaceTypeMap[t.toUpperCase()] !== void 0 ? P = r.surfaceTypeMap[t] : console.log("Surface type : " + t + " is not recognized") : typeof t == "number" && (P = t);
- var B = null, U = null, F = r.shallowCopy(this.getAtomsFromSel(h));
- M ? B = r.shallowCopy(this.getAtomsFromSel(M)) : B = F, (0, x.adjustVolumeStyle)(a);
- var $ = !1, W;
+ var B = null, F = null, U = r.shallowCopy(this.getAtomsFromSel(h));
+ M ? B = r.shallowCopy(this.getAtomsFromSel(M)) : B = U, (0, x.adjustVolumeStyle)(a);
+ var z = !1, W;
for (W = 0; W < this.models.length; W++)
if (this.models[W]) {
- var N = this.models[W].getSymmetries();
- if (N.length > 1 || N.length == 1 && !N[0].isIdentity()) {
- $ = !0;
+ var V = this.models[W].getSymmetries();
+ if (V.length > 1 || V.length == 1 && !V[0].isIdentity()) {
+ z = !0;
break;
}
}
- var G = function(ue, se, ae) {
- w ? U = r.shallowCopy(z.getAtomsFromSel(w)) : U = ae;
- var we, xe = (0, x.getExtent)(ae, !0);
+ var N = function(oe, he, se) {
+ w ? F = r.shallowCopy($.getAtomsFromSel(w)) : F = se;
+ var xe, ye = (0, x.getExtent)(se, !0);
if (a.map && a.map.prop) {
- var Ie = a.map.prop;
- let We = (0, o.getGradient)(a.map.scheme || a.map.gradient || new o.Gradient.RWB()), Te = We.range();
- Te || (Te = (0, x.getPropertyRange)(ae, Ie)), a.colorscheme = { prop: Ie, gradient: We };
+ var Pe = a.map.prop;
+ let We = (0, o.getGradient)(a.map.scheme || a.map.gradient || new o.Gradient.RWB()), Ue = We.range();
+ Ue || (Ue = (0, x.getPropertyRange)(se, Pe)), a.colorscheme = { prop: Pe, gradient: We };
}
- for (let We = 0, Te = se.length; We < Te; We++)
- we = se[We], we.surfaceColor = (0, x.getColorFromStyle)(we, a);
- var oe = r.volume(xe), ve = z.carveUpExtent(xe, se, ae);
- if (U && U.length && U.length > 0) {
- var re = (0, x.getExtent)(U, !0), Se = function(We, Te) {
- var je = function(Z, q) {
- var fe = Z.extent, _e = fe[1][0] - fe[0][0], Me = fe[1][1] - fe[0][1], Ae = fe[1][2] - fe[0][2], H = _e - q[2][0];
- H *= H;
- var ce = Me - q[2][1];
- ce *= ce;
- var ye = Ae - q[2][2];
- return ye *= ye, H + ce + ye;
- }, Fe = je(We, re), X = je(Te, re);
- return Fe - X;
+ for (let We = 0, Ue = he.length; We < Ue; We++)
+ xe = he[We], xe.surfaceColor = (0, x.getColorFromStyle)(xe, a);
+ var de = r.volume(ye), pe = $.carveUpExtent(ye, he, se);
+ if (F && F.length && F.length > 0) {
+ var re = (0, x.getExtent)(F, !0), Se = function(We, Ue) {
+ var Be = function(K, q) {
+ var fe = K.extent, _e = fe[1][0] - fe[0][0], Me = fe[1][1] - fe[0][1], Ae = fe[1][2] - fe[0][2], Z = _e - q[2][0];
+ Z *= Z;
+ var ue = Me - q[2][1];
+ ue *= ue;
+ var we = Ae - q[2][2];
+ return we *= we, Z + ue + we;
+ }, Ne = Be(We, re), H = Be(Ue, re);
+ return Ne - H;
};
- ve.sort(Se);
+ pe.sort(Se);
}
- var ze = [];
- for (let We = 0, Te = se.length; We < Te; We++)
- we = se[We], ze[We] = {
- x: we.x,
- y: we.y,
- z: we.z,
+ var ke = [];
+ for (let We = 0, Ue = he.length; We < Ue; We++)
+ xe = he[We], ke[We] = {
+ x: xe.x,
+ y: xe.y,
+ z: xe.z,
serial: We,
- elem: we.elem
+ elem: xe.elem
};
- var Ge = !!C.syncSurface;
- if (Ge) {
- var $e = function(Te) {
- return new Promise(function(je) {
- for (var Fe = r.generateMeshSyncHelper(P, ve[Te].extent, ve[Te].atoms, ve[Te].toshow, ze, oe), X = (0, u.splitMesh)({ vertexArr: Fe.vertices, faceArr: Fe.faces }), Z = 0, q = X.length; Z < q; Z++) {
- Fe = {
- vertices: X[Z].vertexArr,
- faces: X[Z].faceArr
+ var $e = !!L.syncSurface;
+ if ($e) {
+ var ze = function(Ue) {
+ return new Promise(function(Be) {
+ for (var Ne = r.generateMeshSyncHelper(P, pe[Ue].extent, pe[Ue].atoms, pe[Ue].toshow, ke, de), H = (0, u.splitMesh)({ vertexArr: Ne.vertices, faceArr: Ne.faces }), K = 0, q = H.length; K < q; K++) {
+ Ne = {
+ vertices: H[K].vertexArr,
+ faces: H[K].faceArr
};
- var fe = r.generateSurfaceMesh(se, Fe, R);
- (0, x.mergeGeos)(ue.geo, fe);
+ var fe = r.generateSurfaceMesh(he, Ne, R);
+ (0, x.mergeGeos)(oe.geo, fe);
}
- z.render(), je();
+ $.render(), Be();
});
}, Re = [];
- for (let We = 0; We < ve.length; We++)
- Re.push($e(We));
+ for (let We = 0; We < pe.length; We++)
+ Re.push(ze(We));
return Promise.all(Re).then(function() {
- return ue.done = !0, Promise.resolve(T);
+ return oe.done = !0, Promise.resolve(T);
});
} else {
- var Be = [];
+ var Fe = [];
P < 0 && (P = 0);
- for (let We = 0, Te = r.numWorkers; We < Te; We++) {
- var ke = new Worker($3Dmol.SurfaceWorker);
- Be.push(ke), ke.postMessage({
+ for (let We = 0, Ue = r.numWorkers; We < Ue; We++) {
+ var Ie = new Worker($3Dmol.SurfaceWorker);
+ Fe.push(Ie), Ie.postMessage({
type: -1,
- atoms: ze,
- volume: oe
+ atoms: ke,
+ volume: de
});
}
- return new Promise(function(We, Te) {
- var je = 0, Fe = function() {
- !Be || !Be.length || Be.forEach(function(fe) {
+ return new Promise(function(We, Ue) {
+ var Be = 0, Ne = function() {
+ !Fe || !Fe.length || Fe.forEach(function(fe) {
fe && fe.terminate && fe.terminate();
});
- }, X = function(fe) {
+ }, H = function(fe) {
for (var _e = (0, u.splitMesh)({
vertexArr: fe.data.vertices,
faceArr: fe.data.faces
}), Me = 0, Ae = _e.length; Me < Ae; Me++) {
- var H = {
+ var Z = {
vertices: _e[Me].vertexArr,
faces: _e[Me].faceArr
- }, ce = r.generateSurfaceMesh(se, H, R);
- (0, x.mergeGeos)(ue.geo, ce);
+ }, ue = r.generateSurfaceMesh(he, Z, R);
+ (0, x.mergeGeos)(oe.geo, ue);
}
- z.render(), je++, je == ve.length && (ue.done = !0, Fe(), We(T));
- }, Z = function(fe) {
- Fe(), console.log(fe.message + " (" + fe.filename + ":" + fe.lineno + ")"), Te(fe);
+ $.render(), Be++, Be == pe.length && (oe.done = !0, Ne(), We(T));
+ }, K = function(fe) {
+ Ne(), console.log(fe.message + " (" + fe.filename + ":" + fe.lineno + ")"), Ue(fe);
};
- for (let fe = 0; fe < ve.length; fe++) {
- var q = Be[fe % Be.length];
- q.onmessage = X, q.onerror = Z, q.postMessage({
+ for (let fe = 0; fe < pe.length; fe++) {
+ var q = Fe[fe % Fe.length];
+ q.onmessage = H, q.onerror = K, q.postMessage({
type: P,
- expandedExtent: ve[fe].extent,
- extendedAtoms: ve[fe].atoms,
- atomsToShow: ve[fe].toshow
+ expandedExtent: pe[fe].extent,
+ extendedAtoms: pe[fe].atoms,
+ atomsToShow: pe[fe].toshow
});
}
});
@@ -8270,16 +8270,16 @@ ATOM`, h);
a = a || {}, R = r.getMatWithStyle(a);
var k = [];
k.style = a, k.atomsel = h, k.allsel = M, k.focus = w;
- var j = null;
- if ($) {
+ var G = null;
+ if (z) {
var Q = {}, ie = {};
for (W = 0; W < this.models.length; W++)
Q[W] = [], ie[W] = [];
for (W = 0; W < B.length; W++)
Q[B[W].model].push(B[W]);
- for (W = 0; W < F.length; W++)
- ie[F[W].model].push(F[W]);
- var pe = [];
+ for (W = 0; W < U.length; W++)
+ ie[U[W].model].push(U[W]);
+ var ge = [];
for (W = 0; W < this.models.length; W++)
ie[W].length > 0 && (k.push({
geo: new l.Geometry(!0),
@@ -8288,19 +8288,19 @@ ATOM`, h);
finished: !1,
symmetries: this.models[W].getSymmetries()
// also webgl initialized
- }), pe.push(G(k[k.length - 1], Q[W], ie[W])));
- j = Promise.all(pe);
+ }), ge.push(N(k[k.length - 1], Q[W], ie[W])));
+ G = Promise.all(ge);
} else
k.push({
geo: new l.Geometry(!0),
mat: R,
done: !1,
finished: !1,
- symmetries: [new g.Matrix4()]
- }), j = G(k[k.length - 1], B, F);
- return this.surfaces[T] = k, j.surfid = T, S && typeof S == "function" ? (j.then(function(he) {
- S(he);
- }), T) : j;
+ symmetries: [new p.Matrix4()]
+ }), G = N(k[k.length - 1], B, U);
+ return this.surfaces[T] = k, G.surfid = T, S && typeof S == "function" ? (G.then(function(le) {
+ S(le);
+ }), T) : G;
}
/**
* Set the surface material to something else, must render change
@@ -8330,10 +8330,10 @@ ATOM`, h);
return S;
});
} else if (w.voldata && w.volscheme) {
- const S = w.volscheme, T = w.voldata, R = _.CC, z = S.range() || [-1, 1];
- h[M].geo.setColors(function(P, B, U) {
- let F = T.getVal(P, B, U);
- return R.color(S.valueToHex(F, z));
+ const S = w.volscheme, T = w.voldata, R = _.CC, $ = S.range() || [-1, 1];
+ h[M].geo.setColors(function(P, B, F) {
+ let U = T.getVal(P, B, F);
+ return R.color(S.valueToHex(U, $));
});
}
h[M].finished = !1;
@@ -8409,7 +8409,7 @@ ATOM`, h);
else
for (let S = 0, T = h.length; S < T; S++) {
var M = h[S];
- for (let R = 0, z = t.length; R < z; R++) {
+ for (let R = 0, $ = t.length; R < $; R++) {
let P = t[R];
if (P.props)
for (var w in P.props)
@@ -8447,7 +8447,7 @@ ATOM`, h);
*/
setAutoEyeSeparation(t, a) {
var h = this.getPerceivedDistance();
- return a || (a = 5), t || this.camera.position.x > 0 ? this.camera.position.x = h * Math.tan(Math.PI / 180 * a) : this.camera.position.x = -h * Math.tan(Math.PI / 180 * a), this.camera.lookAt(new g.Vector3(0, 0, this.rotationGroup.position.z)), this.camera.position.x;
+ return a || (a = 5), t || this.camera.position.x > 0 ? this.camera.position.x = h * Math.tan(Math.PI / 180 * a) : this.camera.position.x = -h * Math.tan(Math.PI / 180 * a), this.camera.lookAt(new p.Vector3(0, 0, this.rotationGroup.position.z)), this.camera.position.x;
}
/**
* Set the default cartoon quality for newly created models. Default is 5.
@@ -8459,10 +8459,10 @@ ATOM`, h);
}
}
r.numWorkers = 4, r.maxVolume = 64e3, r.surfaceTypeMap = {
- VDW: C.SurfaceType.VDW,
- MS: C.SurfaceType.MS,
- SAS: C.SurfaceType.SAS,
- SES: C.SurfaceType.SES
+ VDW: L.SurfaceType.VDW,
+ MS: L.SurfaceType.MS,
+ SAS: L.SurfaceType.SAS,
+ SES: L.SurfaceType.SES
};
function n(c, t) {
if (c = (0, x.getElement)(c), !!c) {
@@ -8488,8 +8488,8 @@ ATOM`, h);
}
h.unshift(S);
}
- } catch (z) {
- throw "error creating viewer grid: " + z;
+ } catch ($) {
+ throw "error creating viewer grid: " + $;
}
return h;
}
@@ -8540,17 +8540,17 @@ ATOM`, h);
/* harmony export */
Gradient: () => (
/* binding */
- C
+ L
),
/* harmony export */
GradientType: () => (
/* binding */
- g
+ p
),
/* harmony export */
ROYGB: () => (
/* binding */
- p
+ g
),
/* harmony export */
RWB: () => (
@@ -8583,21 +8583,21 @@ ATOM`, h);
/*! ./colors */
"./src/colors.ts"
);
- class g {
+ class p {
}
- function _(L, D, r) {
- return D >= L ? (r < L && (r = L), r > D && (r = D), { lo: L, hi: D, val: r }) : (r > L && (r = L), r < D && (r = D), r = L - r + D, { lo: D, hi: L, val: r });
+ function _(C, D, r) {
+ return D >= C ? (r < C && (r = C), r > D && (r = D), { lo: C, hi: D, val: r }) : (r > C && (r = C), r < D && (r = D), r = C - r + D, { lo: D, hi: C, val: r });
}
- function x(L) {
- if (L instanceof g)
- return L;
- if (L.gradient !== void 0 && A[L.gradient]) {
- let D = L.min === void 0 ? -1 : L.min, r = L.max === void 0 ? 1 : L.max;
- return L.mid === void 0 ? L.colors === void 0 ? new A[L.gradient](D, r) : new A[L.gradient](D, r, L.colors) : new A[L.gradient](D, r, L.mid);
+ function x(C) {
+ if (C instanceof p)
+ return C;
+ if (C.gradient !== void 0 && A[C.gradient]) {
+ let D = C.min === void 0 ? -1 : C.min, r = C.max === void 0 ? 1 : C.max;
+ return C.mid === void 0 ? C.colors === void 0 ? new A[C.gradient](D, r) : new A[C.gradient](D, r, C.colors) : new A[C.gradient](D, r, C.mid);
}
- return L;
+ return C;
}
- class o extends g {
+ class o extends p {
constructor(D, r, n) {
super(), this.gradient = "RWB", this.mult = 1, this.mid = n, this.min = D, this.max = r, typeof r > "u" && Array.isArray(D) && D.length >= 2 ? (this.max = D[1], this.min = D[0]) : D && r && !Array.isArray(D) && (this.min = D, this.max = r);
}
@@ -8618,7 +8618,7 @@ ATOM`, h);
return D < c ? (t = Math.floor(255 * Math.sqrt((D - n) / (c - n))), a = 16711680 + 256 * t + t, a) : D > c ? (t = Math.floor(255 * Math.sqrt(1 - (D - c) / (b - c))), a = 65536 * t + 256 * t + 255, a) : 16777215;
}
}
- class p extends g {
+ class g extends p {
constructor(D, r) {
super(), this.gradient = "ROYGB", this.mult = 1, this.min = D, this.max = r, typeof r > "u" && Array.isArray(D) && D.length >= 2 ? (this.max = D[1], this.min = D[0]) : D && r && !Array.isArray(D) && (this.min = D, this.max = r);
}
@@ -8637,7 +8637,7 @@ ATOM`, h);
return typeof this.min < "u" && typeof this.max < "u" ? [this.min, this.max] : null;
}
}
- class E extends g {
+ class E extends p {
constructor(D, r) {
super(), this.gradient = "Sinebow", this.mult = 1, this.min = D, this.max = r, typeof r > "u" && Array.isArray(D) && D.length >= 2 && (this.max = D[1], this.min = D[0]), r < D && (this.mult = -1, this.min *= -1, this.max *= -1);
}
@@ -8646,7 +8646,7 @@ ATOM`, h);
var n, b;
if (D = this.mult * D, r ? (n = r[0], b = r[1]) : (n = this.min, b = this.max), typeof D > "u")
return 16777215;
- var f = C.normalizeValue(n, b, D);
+ var f = L.normalizeValue(n, b, D);
n = f.lo, b = f.hi, D = f.val;
var c = (D - n) / (b - n), t = 5 * c / 6 + 0.5, a = Math.sin(Math.PI * t);
a *= a * 255;
@@ -8660,7 +8660,7 @@ ATOM`, h);
return typeof this.min < "u" && typeof this.max < "u" ? [this.min, this.max] : null;
}
}
- class u extends g {
+ class u extends p {
constructor(D, r, n) {
super(), this.gradient = "linear", this.colors = new Array();
var b;
@@ -8688,12 +8688,12 @@ ATOM`, h);
const A = {
rwb: o,
RWB: o,
- roygb: p,
- ROYGB: p,
+ roygb: g,
+ ROYGB: g,
sinebow: E,
linear: u
};
- class C extends g {
+ class L extends p {
valueToHex(D, r) {
return 0;
}
@@ -8701,7 +8701,7 @@ ATOM`, h);
return null;
}
}
- C.RWB = o, C.ROYGB = p, C.Sinebow = E, C.CustomLinear = u, C.builtinGradients = A, C.normalizeValue = _, C.getGradient = x;
+ L.RWB = o, L.ROYGB = g, L.Sinebow = E, L.CustomLinear = u, L.builtinGradients = A, L.normalizeValue = _, L.getGradient = x;
}
),
/***/
@@ -8727,7 +8727,7 @@ ATOM`, h);
var l = e(
/*! ./WebGL */
"./src/WebGL/index.ts"
- ), g = e(
+ ), p = e(
/*! ./Gradient */
"./src/Gradient.ts"
), _ = e(
@@ -8735,34 +8735,34 @@ ATOM`, h);
"./src/colors.ts"
);
let x = 0;
- function o(u, A, C, L, D, r, n) {
- u.beginPath(), u.moveTo(A + r, C), u.lineTo(A + L - r, C), u.quadraticCurveTo(A + L, C, A + L, C + r), u.lineTo(A + L, C + D - r), u.quadraticCurveTo(A + L, C + D, A + L - r, C + D), u.lineTo(A + r, C + D), u.quadraticCurveTo(A, C + D, A, C + D - r), u.lineTo(A, C + r), u.quadraticCurveTo(A, C, A + r, C), u.closePath(), u.fill(), n && u.stroke();
+ function o(u, A, L, C, D, r, n) {
+ u.beginPath(), u.moveTo(A + r, L), u.lineTo(A + C - r, L), u.quadraticCurveTo(A + C, L, A + C, L + r), u.lineTo(A + C, L + D - r), u.quadraticCurveTo(A + C, L + D, A + C - r, L + D), u.lineTo(A + r, L + D), u.quadraticCurveTo(A, L + D, A, L + D - r), u.lineTo(A, L + r), u.quadraticCurveTo(A, L, A + r, L), u.closePath(), u.fill(), n && u.stroke();
}
- function p(u, A, C) {
- var L = C;
- return typeof u < "u" && (u instanceof _.Color ? L = u.scaled() : (L = _.CC.color(u), typeof L.scaled < "u" && (L = L.scaled()))), typeof A < "u" && (L.a = parseFloat(A)), L;
+ function g(u, A, L) {
+ var C = L;
+ return typeof u < "u" && (u instanceof _.Color ? C = u.scaled() : (C = _.CC.color(u), typeof C.scaled < "u" && (C = C.scaled()))), typeof A < "u" && (C.a = parseFloat(A)), C;
}
class E {
- constructor(A, C) {
- this.id = x++, this.stylespec = C || {}, this.canvas = document.createElement("canvas"), this.canvas.width = 134, this.canvas.height = 35, this.context = this.canvas.getContext("2d"), this.sprite = new l.Sprite(), this.text = A, this.frame = this.stylespec.frame;
+ constructor(A, L) {
+ this.id = x++, this.stylespec = L || {}, this.canvas = document.createElement("canvas"), this.canvas.width = 134, this.canvas.height = 35, this.context = this.canvas.getContext("2d"), this.sprite = new l.Sprite(), this.text = A, this.frame = this.stylespec.frame;
}
getStyle() {
return this.stylespec;
}
setContext() {
- var A = this.stylespec, C = typeof A.useScreen > "u" ? !1 : A.useScreen, L = A.showBackground;
- (L === "0" || L === "false") && (L = !1), typeof L > "u" && (L = !0);
- var D = A.font ? A.font : "sans-serif", r = parseInt(A.fontSize) ? parseInt(A.fontSize) : 18, n = p(A.fontColor, A.fontOpacity, {
+ var A = this.stylespec, L = typeof A.useScreen > "u" ? !1 : A.useScreen, C = A.showBackground;
+ (C === "0" || C === "false") && (C = !1), typeof C > "u" && (C = !0);
+ var D = A.font ? A.font : "sans-serif", r = parseInt(A.fontSize) ? parseInt(A.fontSize) : 18, n = g(A.fontColor, A.fontOpacity, {
r: 255,
g: 255,
b: 255,
a: 1
- }), b = A.padding ? A.padding : 4, f = A.borderThickness ? A.borderThickness : 0, c = p(A.backgroundColor, A.backgroundOpacity, {
+ }), b = A.padding ? A.padding : 4, f = A.borderThickness ? A.borderThickness : 0, c = g(A.backgroundColor, A.backgroundOpacity, {
r: 0,
g: 0,
b: 0,
a: 1
- }), t = p(A.borderColor, A.borderOpacity, c), a = A.position ? A.position : {
+ }), t = g(A.borderColor, A.borderOpacity, c), a = A.position ? A.position : {
x: -10,
y: 1,
z: 1
@@ -8773,27 +8773,27 @@ ATOM`, h);
var w = "";
A.bold && (w = "bold "), this.context.font = w + r + "px " + D;
var S = this.context.measureText(this.text), T = S.width;
- L || (f = 0);
- var R = T + 2.5 * f + 2 * b, z = r * 1.25 + 2 * f + 2 * b;
+ C || (f = 0);
+ var R = T + 2.5 * f + 2 * b, $ = r * 1.25 + 2 * f + 2 * b;
if (A.backgroundImage) {
- var P = A.backgroundImage, B = A.backgroundWidth ? A.backgroundWidth : P.width, U = A.backgroundHeight ? A.backgroundHeight : P.height;
- B > R && (R = B), U > z && (z = U);
+ var P = A.backgroundImage, B = A.backgroundWidth ? A.backgroundWidth : P.width, F = A.backgroundHeight ? A.backgroundHeight : P.height;
+ B > R && (R = B), F > $ && ($ = F);
}
- if (this.canvas.width = R, this.canvas.height = z, this.context.clearRect(0, 0, this.canvas.width, this.canvas.height), w = "", A.bold && (w = "bold "), this.context.font = w + r + "px " + D, this.context.fillStyle = "rgba(" + c.r + "," + c.g + "," + c.b + "," + c.a + ")", this.context.strokeStyle = "rgba(" + t.r + "," + t.g + "," + t.b + "," + t.a + ")", A.backgroundGradient) {
- let $ = this.context.createLinearGradient(0, z / 2, R, z / 2), W = g.Gradient.getGradient(A.backgroundGradient), N = W.range(), G = -1, k = 1;
- N && (G = N[0], k = N[1]);
- let j = k - G;
+ if (this.canvas.width = R, this.canvas.height = $, this.context.clearRect(0, 0, this.canvas.width, this.canvas.height), w = "", A.bold && (w = "bold "), this.context.font = w + r + "px " + D, this.context.fillStyle = "rgba(" + c.r + "," + c.g + "," + c.b + "," + c.a + ")", this.context.strokeStyle = "rgba(" + t.r + "," + t.g + "," + t.b + "," + t.a + ")", A.backgroundGradient) {
+ let z = this.context.createLinearGradient(0, $ / 2, R, $ / 2), W = p.Gradient.getGradient(A.backgroundGradient), V = W.range(), N = -1, k = 1;
+ V && (N = V[0], k = V[1]);
+ let G = k - N;
for (let Q = 0; Q < 1.01; Q += 0.1) {
- let ie = p(W.valueToHex(G + j * Q)), pe = "rgba(" + ie.r + "," + ie.g + "," + ie.b + "," + ie.a + ")";
- $.addColorStop(Q, pe);
+ let ie = g(W.valueToHex(N + G * Q)), ge = "rgba(" + ie.r + "," + ie.g + "," + ie.b + "," + ie.a + ")";
+ z.addColorStop(Q, ge);
}
- this.context.fillStyle = $;
+ this.context.fillStyle = z;
}
- this.context.lineWidth = f, L && o(this.context, f, f, R - 2 * f, z - 2 * f, 6, f > 0), A.backgroundImage && this.context.drawImage(P, 0, 0, R, z), this.context.fillStyle = "rgba(" + n.r + "," + n.g + "," + n.b + "," + n.a + ")", this.context.fillText(this.text, f + b, r + f + b, T);
- var F = new l.Texture(this.canvas);
- F.needsUpdate = !0, this.sprite.material = new l.SpriteMaterial({
- map: F,
- useScreenCoordinates: C,
+ this.context.lineWidth = f, C && o(this.context, f, f, R - 2 * f, $ - 2 * f, 6, f > 0), A.backgroundImage && this.context.drawImage(P, 0, 0, R, $), this.context.fillStyle = "rgba(" + n.r + "," + n.g + "," + n.b + "," + n.a + ")", this.context.fillText(this.text, f + b, r + f + b, T);
+ var U = new l.Texture(this.canvas);
+ U.needsUpdate = !0, this.sprite.material = new l.SpriteMaterial({
+ map: U,
+ useScreenCoordinates: L,
alignment: M,
depthTest: !h,
screenOffset: A.screenOffset || null
@@ -8817,7 +8817,7 @@ ATOM`, h);
/* harmony export */
MarchingCube: () => (
/* binding */
- p
+ g
),
/* harmony export */
MarchingCubeInitializer: () => (
@@ -8837,7 +8837,7 @@ ATOM`, h);
/* harmony export */
SurfaceType: () => (
/* binding */
- g
+ p
),
/* harmony export */
setSyncSurface: () => (
@@ -8854,10 +8854,10 @@ ATOM`, h);
var l = e(
/*! ./WebGL/math */
"./src/WebGL/math/index.ts"
- ), g;
+ ), p;
(function(A) {
A[A.VDW = 1] = "VDW", A[A.MS = 2] = "MS", A[A.SAS = 3] = "SAS", A[A.SES = 4] = "SES";
- })(g || (g = {}));
+ })(p || (p = {}));
var _ = !1;
function x(A) {
_ = A;
@@ -9895,46 +9895,46 @@ ATOM`, h);
[]
];
}
- march(C, L, D, r) {
+ march(L, C, D, r) {
let n = !!r.fulltable, b = r.hasOwnProperty("origin") && r.origin.hasOwnProperty("x") ? r.origin : { x: 0, y: 0, z: 0 }, f = !!r.voxel, c = r.matrix, t = r.nX || 0, a = r.nY || 0, h = r.nZ || 0, M = r.scale || 1, w = null;
r.unitCube ? w = r.unitCube : w = { x: M, y: M, z: M };
let S = new Int32Array(t * a * h), T, R;
for (T = 0, R = S.length; T < R; ++T)
S[T] = -1;
- let z = function(F, $, W, N, G, k) {
- let j = { x: 0, y: 0, z: 0 }, Q = !!(N & 1 << G), ie = !!(N & 1 << k), pe = G;
- if (!Q && ie && (pe = k), pe & 1 && W++, pe & 2 && $++, pe & 4 && F++, c) {
- let ue = new l.Vector3(F, $, W);
- ue = ue.applyMatrix4(c), j = { x: ue.x, y: ue.y, z: ue.z };
+ let $ = function(U, z, W, V, N, k) {
+ let G = { x: 0, y: 0, z: 0 }, Q = !!(V & 1 << N), ie = !!(V & 1 << k), ge = N;
+ if (!Q && ie && (ge = k), ge & 1 && W++, ge & 2 && z++, ge & 4 && U++, c) {
+ let oe = new l.Vector3(U, z, W);
+ oe = oe.applyMatrix4(c), G = { x: oe.x, y: oe.y, z: oe.z };
} else
- j.x = b.x + w.x * F, j.y = b.y + w.y * $, j.z = b.z + w.z * W;
- let he = (a * F + $) * h + W;
- return f ? (L.push(j), L.length - 1) : (S[he] < 0 && (S[he] = L.length, L.push(j)), S[he]);
- }, P = new Int32Array(12), B = n ? this.edgeTable2 : this.edgeTable, U = n ? this.triTable2 : this.triTable;
+ G.x = b.x + w.x * U, G.y = b.y + w.y * z, G.z = b.z + w.z * W;
+ let le = (a * U + z) * h + W;
+ return f ? (C.push(G), C.length - 1) : (S[le] < 0 && (S[le] = C.length, C.push(G)), S[le]);
+ }, P = new Int32Array(12), B = n ? this.edgeTable2 : this.edgeTable, F = n ? this.triTable2 : this.triTable;
for (T = 0; T < t - 1; ++T)
- for (let F = 0; F < a - 1; ++F)
- for (let $ = 0; $ < h - 1; ++$) {
+ for (let U = 0; U < a - 1; ++U)
+ for (let z = 0; z < h - 1; ++z) {
let W = 0;
for (let k = 0; k < 8; ++k) {
- let j = (a * (T + ((k & 4) >> 2)) + F + ((k & 2) >> 1)) * h + $ + (k & 1), Q = !!(C[j] & this.ISDONE);
+ let G = (a * (T + ((k & 4) >> 2)) + U + ((k & 2) >> 1)) * h + z + (k & 1), Q = !!(L[G] & this.ISDONE);
W |= Q << k;
}
if (W === 0 || W === 255)
continue;
- let N = B[W];
- if (N === 0)
+ let V = B[W];
+ if (V === 0)
continue;
- let G = U[W];
- N & 1 && (P[0] = z(T, F, $, W, 0, 1)), N & 2 && (P[1] = z(T, F, $, W, 1, 3)), N & 4 && (P[2] = z(T, F, $, W, 3, 2)), N & 8 && (P[3] = z(T, F, $, W, 2, 0)), N & 16 && (P[4] = z(T, F, $, W, 4, 5)), N & 32 && (P[5] = z(T, F, $, W, 5, 7)), N & 64 && (P[6] = z(T, F, $, W, 7, 6)), N & 128 && (P[7] = z(T, F, $, W, 6, 4)), N & 256 && (P[8] = z(T, F, $, W, 0, 4)), N & 512 && (P[9] = z(T, F, $, W, 1, 5)), N & 1024 && (P[10] = z(T, F, $, W, 3, 7)), N & 2048 && (P[11] = z(T, F, $, W, 2, 6));
- for (let k = 0; k < G.length; k += 3) {
- let j = P[G[k]], Q = P[G[k + 1]], ie = P[G[k + 2]];
- f && k >= 3 && (L.push(L[j]), j = L.length - 1, L.push(L[Q]), Q = L.length - 1, L.push(L[ie]), ie = L.length - 1), D.push(j), D.push(Q), D.push(ie);
+ let N = F[W];
+ V & 1 && (P[0] = $(T, U, z, W, 0, 1)), V & 2 && (P[1] = $(T, U, z, W, 1, 3)), V & 4 && (P[2] = $(T, U, z, W, 3, 2)), V & 8 && (P[3] = $(T, U, z, W, 2, 0)), V & 16 && (P[4] = $(T, U, z, W, 4, 5)), V & 32 && (P[5] = $(T, U, z, W, 5, 7)), V & 64 && (P[6] = $(T, U, z, W, 7, 6)), V & 128 && (P[7] = $(T, U, z, W, 6, 4)), V & 256 && (P[8] = $(T, U, z, W, 0, 4)), V & 512 && (P[9] = $(T, U, z, W, 1, 5)), V & 1024 && (P[10] = $(T, U, z, W, 3, 7)), V & 2048 && (P[11] = $(T, U, z, W, 2, 6));
+ for (let k = 0; k < N.length; k += 3) {
+ let G = P[N[k]], Q = P[N[k + 1]], ie = P[N[k + 2]];
+ f && k >= 3 && (C.push(C[G]), G = C.length - 1, C.push(C[Q]), Q = C.length - 1, C.push(C[ie]), ie = C.length - 1), D.push(G), D.push(Q), D.push(ie);
}
}
}
- laplacianSmooth(C, L, D) {
- let r = new Array(L.length), n, b, f, c, t;
- for (n = 0, b = L.length; n < b; n++)
+ laplacianSmooth(L, C, D) {
+ let r = new Array(C.length), n, b, f, c, t;
+ for (n = 0, b = C.length; n < b; n++)
r[n] = {
x: 0,
y: 0,
@@ -9942,8 +9942,8 @@ ATOM`, h);
};
let a = new Array(20), h;
for (n = 0; n < 20; n++)
- a[n] = new Array(L.length);
- for (n = 0, b = L.length; n < b; n++)
+ a[n] = new Array(C.length);
+ for (n = 0, b = C.length; n < b; n++)
a[0][n] = 0;
for (n = 0, b = D.length / 3; n < b; n++) {
let S = n * 3, T = n * 3 + 1, R = n * 3 + 2;
@@ -9980,37 +9980,37 @@ ATOM`, h);
h && (a[0][D[R]]++, a[a[0][D[R]]][D[R]] = D[T]);
}
let M = 1, w = 0.5;
- for (t = 0; t < C; t++) {
- for (n = 0, b = L.length; n < b; n++)
+ for (t = 0; t < L; t++) {
+ for (n = 0, b = C.length; n < b; n++)
if (a[0][n] < 3)
- r[n].x = L[n].x, r[n].y = L[n].y, r[n].z = L[n].z;
+ r[n].x = C[n].x, r[n].y = C[n].y, r[n].z = C[n].z;
else if (a[0][n] == 3 || a[0][n] == 4) {
for (r[n].x = 0, r[n].y = 0, r[n].z = 0, f = 0, c = a[0][n]; f < c; f++)
- r[n].x += L[a[f + 1][n]].x, r[n].y += L[a[f + 1][n]].y, r[n].z += L[a[f + 1][n]].z;
- r[n].x += w * L[n].x, r[n].y += w * L[n].y, r[n].z += w * L[n].z, r[n].x /= w + a[0][n], r[n].y /= w + a[0][n], r[n].z /= w + a[0][n];
+ r[n].x += C[a[f + 1][n]].x, r[n].y += C[a[f + 1][n]].y, r[n].z += C[a[f + 1][n]].z;
+ r[n].x += w * C[n].x, r[n].y += w * C[n].y, r[n].z += w * C[n].z, r[n].x /= w + a[0][n], r[n].y /= w + a[0][n], r[n].z /= w + a[0][n];
} else {
for (r[n].x = 0, r[n].y = 0, r[n].z = 0, f = 0, c = a[0][n]; f < c; f++)
- r[n].x += L[a[f + 1][n]].x, r[n].y += L[a[f + 1][n]].y, r[n].z += L[a[f + 1][n]].z;
- r[n].x += M * L[n].x, r[n].y += M * L[n].y, r[n].z += M * L[n].z, r[n].x /= M + a[0][n], r[n].y /= M + a[0][n], r[n].z /= M + a[0][n];
+ r[n].x += C[a[f + 1][n]].x, r[n].y += C[a[f + 1][n]].y, r[n].z += C[a[f + 1][n]].z;
+ r[n].x += M * C[n].x, r[n].y += M * C[n].y, r[n].z += M * C[n].z, r[n].x /= M + a[0][n], r[n].y /= M + a[0][n], r[n].z /= M + a[0][n];
}
- for (n = 0, b = L.length; n < b; n++)
- L[n].x = r[n].x, L[n].y = r[n].y, L[n].z = r[n].z;
+ for (n = 0, b = C.length; n < b; n++)
+ C[n].x = r[n].x, C[n].y = r[n].y, C[n].z = r[n].z;
}
}
}
- let p = new o();
+ let g = new o();
class E {
- constructor(C, L, D) {
- this.data = new Int32Array(C * L * D * 3), this.width = L, this.height = D;
+ constructor(L, C, D) {
+ this.data = new Int32Array(L * C * D * 3), this.width = C, this.height = D;
}
// set position x,y,z to pt, which has ix,iy,and iz
- set(C, L, D, r) {
- let n = ((C * this.width + L) * this.height + D) * 3;
+ set(L, C, D, r) {
+ let n = ((L * this.width + C) * this.height + D) * 3;
this.data[n] = r.ix, this.data[n + 1] = r.iy, this.data[n + 2] = r.iz;
}
// return point at x,y,z
- get(C, L, D) {
- let r = ((C * this.width + L) * this.height + D) * 3;
+ get(L, C, D) {
+ let r = ((L * this.width + C) * this.height + D) * 3;
return {
ix: this.data[r],
iy: this.data[r + 1],
@@ -10067,38 +10067,38 @@ ATOM`, h);
new Int32Array([-1, -1, -1])
], u.MarchingCube || (u.MarchingCube = new o());
}
- getVDWIndex(C) {
- return !C.elem || typeof this.vdwRadii[C.elem] > "u" ? "X" : C.elem;
+ getVDWIndex(L) {
+ return !L.elem || typeof this.vdwRadii[L.elem] > "u" ? "X" : L.elem;
}
- getFacesAndVertices(C) {
- let L = {};
- for (let n = 0, b = C.length; n < b; n++)
- L[C[n]] = !0;
+ getFacesAndVertices(L) {
+ let C = {};
+ for (let n = 0, b = L.length; n < b; n++)
+ C[L[n]] = !0;
let D = this.verts;
for (let n = 0, b = D.length; n < b; n++)
D[n].x = D[n].x / this.scaleFactor - this.ptranx, D[n].y = D[n].y / this.scaleFactor - this.ptrany, D[n].z = D[n].z / this.scaleFactor - this.ptranz;
let r = [];
for (let n = 0, b = this.faces.length; n < b; n += 3) {
let f = this.faces[n], c = this.faces[n + 1], t = this.faces[n + 2], a = D[f].atomid, h = D[c].atomid, M = D[t].atomid, w = a;
- h < w && (w = h), M < w && (w = M), L[w] && f !== c && c !== t && f !== t && (r.push(f), r.push(c), r.push(t));
+ h < w && (w = h), M < w && (w = M), C[w] && f !== c && c !== t && f !== t && (r.push(f), r.push(c), r.push(t));
}
return this.vpBits = null, this.vpDistance = null, this.vpAtomID = null, {
vertices: D,
faces: r
};
}
- initparm(C, L, D) {
+ initparm(L, C, D) {
D > 1e6 && (this.scaleFactor = this.defaultScaleFactor / 2);
let r = 1 / this.scaleFactor * 5.5;
- this.pminx = C[0][0], this.pmaxx = C[1][0], this.pminy = C[0][1], this.pmaxy = C[1][1], this.pminz = C[0][2], this.pmaxz = C[1][2], L ? (this.pminx -= this.probeRadius + r, this.pminy -= this.probeRadius + r, this.pminz -= this.probeRadius + r, this.pmaxx += this.probeRadius + r, this.pmaxy += this.probeRadius + r, this.pmaxz += this.probeRadius + r) : (this.pminx -= r, this.pminy -= r, this.pminz -= r, this.pmaxx += r, this.pmaxy += r, this.pmaxz += r), this.pminx = Math.floor(this.pminx * this.scaleFactor) / this.scaleFactor, this.pminy = Math.floor(this.pminy * this.scaleFactor) / this.scaleFactor, this.pminz = Math.floor(this.pminz * this.scaleFactor) / this.scaleFactor, this.pmaxx = Math.ceil(this.pmaxx * this.scaleFactor) / this.scaleFactor, this.pmaxy = Math.ceil(this.pmaxy * this.scaleFactor) / this.scaleFactor, this.pmaxz = Math.ceil(this.pmaxz * this.scaleFactor) / this.scaleFactor, this.ptranx = -this.pminx, this.ptrany = -this.pminy, this.ptranz = -this.pminz, this.pLength = Math.ceil(this.scaleFactor * (this.pmaxx - this.pminx)) + 1, this.pWidth = Math.ceil(this.scaleFactor * (this.pmaxy - this.pminy)) + 1, this.pHeight = Math.ceil(this.scaleFactor * (this.pmaxz - this.pminz)) + 1, this.boundingatom(L), this.cutRadius = this.probeRadius * this.scaleFactor, this.vpBits = new Uint8Array(this.pLength * this.pWidth * this.pHeight), this.vpDistance = new Float64Array(this.pLength * this.pWidth * this.pHeight), this.vpAtomID = new Int32Array(this.pLength * this.pWidth * this.pHeight);
+ this.pminx = L[0][0], this.pmaxx = L[1][0], this.pminy = L[0][1], this.pmaxy = L[1][1], this.pminz = L[0][2], this.pmaxz = L[1][2], C ? (this.pminx -= this.probeRadius + r, this.pminy -= this.probeRadius + r, this.pminz -= this.probeRadius + r, this.pmaxx += this.probeRadius + r, this.pmaxy += this.probeRadius + r, this.pmaxz += this.probeRadius + r) : (this.pminx -= r, this.pminy -= r, this.pminz -= r, this.pmaxx += r, this.pmaxy += r, this.pmaxz += r), this.pminx = Math.floor(this.pminx * this.scaleFactor) / this.scaleFactor, this.pminy = Math.floor(this.pminy * this.scaleFactor) / this.scaleFactor, this.pminz = Math.floor(this.pminz * this.scaleFactor) / this.scaleFactor, this.pmaxx = Math.ceil(this.pmaxx * this.scaleFactor) / this.scaleFactor, this.pmaxy = Math.ceil(this.pmaxy * this.scaleFactor) / this.scaleFactor, this.pmaxz = Math.ceil(this.pmaxz * this.scaleFactor) / this.scaleFactor, this.ptranx = -this.pminx, this.ptrany = -this.pminy, this.ptranz = -this.pminz, this.pLength = Math.ceil(this.scaleFactor * (this.pmaxx - this.pminx)) + 1, this.pWidth = Math.ceil(this.scaleFactor * (this.pmaxy - this.pminy)) + 1, this.pHeight = Math.ceil(this.scaleFactor * (this.pmaxz - this.pminz)) + 1, this.boundingatom(C), this.cutRadius = this.probeRadius * this.scaleFactor, this.vpBits = new Uint8Array(this.pLength * this.pWidth * this.pHeight), this.vpDistance = new Float64Array(this.pLength * this.pWidth * this.pHeight), this.vpAtomID = new Int32Array(this.pLength * this.pWidth * this.pHeight);
}
- boundingatom(C) {
- let L = {};
+ boundingatom(L) {
+ let C = {};
for (const D in this.vdwRadii) {
let r = this.vdwRadii[D];
- C ? L[D] = (r + this.probeRadius) * this.scaleFactor + 0.5 : L[D] = r * this.scaleFactor + 0.5;
- let n = L[D] * L[D];
- this.widxz[D] = Math.floor(L[D]) + 1, this.depty[D] = new Int32Array(this.widxz[D] * this.widxz[D]);
+ L ? C[D] = (r + this.probeRadius) * this.scaleFactor + 0.5 : C[D] = r * this.scaleFactor + 0.5;
+ let n = C[D] * C[D];
+ this.widxz[D] = Math.floor(C[D]) + 1, this.depty[D] = new Int32Array(this.widxz[D] * this.widxz[D]);
let b = 0;
for (let f = 0; f < this.widxz[D]; f++)
for (let c = 0; c < this.widxz[D]; c++) {
@@ -10113,18 +10113,18 @@ ATOM`, h);
}
}
}
- fillvoxels(C, L) {
+ fillvoxels(L, C) {
for (let D = 0, r = this.vpBits.length; D < r; D++)
this.vpBits[D] = 0, this.vpDistance[D] = -1, this.vpAtomID[D] = -1;
- for (let D in L) {
- let r = C[L[D]];
- r !== void 0 && this.fillAtom(r, C);
+ for (let D in C) {
+ let r = L[C[D]];
+ r !== void 0 && this.fillAtom(r, L);
}
for (let D = 0, r = this.vpBits.length; D < r; D++)
this.vpBits[D] & this.INOUT && (this.vpBits[D] |= this.ISDONE);
}
- fillAtom(C, L) {
- let D = Math.floor(0.5 + this.scaleFactor * (C.x + this.ptranx)), r = Math.floor(0.5 + this.scaleFactor * (C.y + this.ptrany)), n = Math.floor(0.5 + this.scaleFactor * (C.z + this.ptranz)), b = this.getVDWIndex(C), f = 0, c = this.pWidth * this.pHeight;
+ fillAtom(L, C) {
+ let D = Math.floor(0.5 + this.scaleFactor * (L.x + this.ptranx)), r = Math.floor(0.5 + this.scaleFactor * (L.y + this.ptrany)), n = Math.floor(0.5 + this.scaleFactor * (L.z + this.ptranz)), b = this.getVDWIndex(L), f = 0, c = this.pWidth * this.pHeight;
for (let t = 0, a = this.widxz[b]; t < a; t++)
for (let h = 0; h < a; h++) {
if (this.depty[b][f] != -1) {
@@ -10133,18 +10133,18 @@ ATOM`, h);
for (let S = -1; S < 2; S++)
if (M !== 0 && w !== 0 && S !== 0) {
let T = M * t, R = S * h;
- for (let z = 0; z <= this.depty[b][f]; z++) {
- let P = z * w, B = D + T, U = r + P, F = n + R;
- if (B < 0 || U < 0 || F < 0 || B >= this.pLength || U >= this.pWidth || F >= this.pHeight)
+ for (let $ = 0; $ <= this.depty[b][f]; $++) {
+ let P = $ * w, B = D + T, F = r + P, U = n + R;
+ if (B < 0 || F < 0 || U < 0 || B >= this.pLength || F >= this.pWidth || U >= this.pHeight)
continue;
- let $ = B * c + U * this.pHeight + F;
- if (!(this.vpBits[$] & this.INOUT))
- this.vpBits[$] |= this.INOUT, this.vpAtomID[$] = C.serial;
+ let z = B * c + F * this.pHeight + U;
+ if (!(this.vpBits[z] & this.INOUT))
+ this.vpBits[z] |= this.INOUT, this.vpAtomID[z] = L.serial;
else {
- let W = L[this.vpAtomID[$]];
- if (W.serial != C.serial) {
- let N = D + T - Math.floor(0.5 + this.scaleFactor * (W.x + this.ptranx)), G = r + P - Math.floor(0.5 + this.scaleFactor * (W.y + this.ptrany)), k = n + R - Math.floor(0.5 + this.scaleFactor * (W.z + this.ptranz));
- T * T + P * P + R * R < N * N + G * G + k * k && (this.vpAtomID[$] = C.serial);
+ let W = C[this.vpAtomID[z]];
+ if (W.serial != L.serial) {
+ let V = D + T - Math.floor(0.5 + this.scaleFactor * (W.x + this.ptranx)), N = r + P - Math.floor(0.5 + this.scaleFactor * (W.y + this.ptrany)), k = n + R - Math.floor(0.5 + this.scaleFactor * (W.z + this.ptranz));
+ T * T + P * P + R * R < V * V + N * N + k * k && (this.vpAtomID[z] = L.serial);
}
}
}
@@ -10153,16 +10153,16 @@ ATOM`, h);
f++;
}
}
- fillvoxelswaals(C, L) {
+ fillvoxelswaals(L, C) {
for (let D = 0, r = this.vpBits.length; D < r; D++)
this.vpBits[D] &= ~this.ISDONE;
- for (let D in L) {
- let r = C[L[D]];
- r !== void 0 && this.fillAtomWaals(r, C);
+ for (let D in C) {
+ let r = L[C[D]];
+ r !== void 0 && this.fillAtomWaals(r, L);
}
}
- fillAtomWaals(C, L) {
- let D = 0, r = Math.floor(0.5 + this.scaleFactor * (C.x + this.ptranx)), n = Math.floor(0.5 + this.scaleFactor * (C.y + this.ptrany)), b = Math.floor(0.5 + this.scaleFactor * (C.z + this.ptranz)), f = this.getVDWIndex(C), c = this.pWidth * this.pHeight;
+ fillAtomWaals(L, C) {
+ let D = 0, r = Math.floor(0.5 + this.scaleFactor * (L.x + this.ptranx)), n = Math.floor(0.5 + this.scaleFactor * (L.y + this.ptrany)), b = Math.floor(0.5 + this.scaleFactor * (L.z + this.ptranz)), f = this.getVDWIndex(L), c = this.pWidth * this.pHeight;
for (let t = 0, a = this.widxz[f]; t < a; t++)
for (let h = 0; h < a; h++) {
if (this.depty[f][D] != -1) {
@@ -10171,18 +10171,18 @@ ATOM`, h);
for (let S = -1; S < 2; S++)
if (M !== 0 && w !== 0 && S !== 0) {
let T = M * t, R = S * h;
- for (let z = 0; z <= this.depty[f][D]; z++) {
- let P = z * w, B = r + T, U = n + P, F = b + R;
- if (B < 0 || U < 0 || F < 0 || B >= this.pLength || U >= this.pWidth || F >= this.pHeight)
+ for (let $ = 0; $ <= this.depty[f][D]; $++) {
+ let P = $ * w, B = r + T, F = n + P, U = b + R;
+ if (B < 0 || F < 0 || U < 0 || B >= this.pLength || F >= this.pWidth || U >= this.pHeight)
continue;
- let $ = B * c + U * this.pHeight + F;
- if (!(this.vpBits[$] & this.ISDONE))
- this.vpBits[$] |= this.ISDONE, this.vpAtomID[$] = C.serial;
+ let z = B * c + F * this.pHeight + U;
+ if (!(this.vpBits[z] & this.ISDONE))
+ this.vpBits[z] |= this.ISDONE, this.vpAtomID[z] = L.serial;
else {
- let W = L[this.vpAtomID[$]];
- if (W.serial != C.serial) {
- let N = r + T - Math.floor(0.5 + this.scaleFactor * (W.x + this.ptranx)), G = n + P - Math.floor(0.5 + this.scaleFactor * (W.y + this.ptrany)), k = b + R - Math.floor(0.5 + this.scaleFactor * (W.z + this.ptranz));
- T * T + P * P + R * R < N * N + G * G + k * k && (this.vpAtomID[$] = C.serial);
+ let W = C[this.vpAtomID[z]];
+ if (W.serial != L.serial) {
+ let V = r + T - Math.floor(0.5 + this.scaleFactor * (W.x + this.ptranx)), N = n + P - Math.floor(0.5 + this.scaleFactor * (W.y + this.ptrany)), k = b + R - Math.floor(0.5 + this.scaleFactor * (W.z + this.ptranz));
+ T * T + P * P + R * R < V * V + N * N + k * k && (this.vpAtomID[z] = L.serial);
}
}
}
@@ -10192,16 +10192,16 @@ ATOM`, h);
}
}
buildboundary() {
- let C = this.pWidth * this.pHeight;
- for (let L = 0; L < this.pLength; L++)
+ let L = this.pWidth * this.pHeight;
+ for (let C = 0; C < this.pLength; C++)
for (let D = 0; D < this.pHeight; D++)
for (let r = 0; r < this.pWidth; r++) {
- let n = L * C + r * this.pHeight + D;
+ let n = C * L + r * this.pHeight + D;
if (this.vpBits[n] & this.INOUT) {
let b = 0;
for (; b < 26; ) {
- let f = L + this.nb[b][0], c = D + this.nb[b][2], t = r + this.nb[b][1];
- if (f > -1 && f < this.pLength && t > -1 && t < this.pWidth && c > -1 && c < this.pHeight && !(this.vpBits[f * C + t * this.pHeight + c] & this.INOUT)) {
+ let f = C + this.nb[b][0], c = D + this.nb[b][2], t = r + this.nb[b][1];
+ if (f > -1 && f < this.pLength && t > -1 && t < this.pWidth && c > -1 && c < this.pHeight && !(this.vpBits[f * L + t * this.pHeight + c] & this.INOUT)) {
this.vpBits[n] |= this.ISBOUND;
break;
} else
@@ -10211,79 +10211,79 @@ ATOM`, h);
}
}
fastdistancemap() {
- let C = new E(this.pLength, this.pWidth, this.pHeight), L = this.pWidth * this.pHeight, D = this.cutRadius * this.cutRadius, r = [], n = [], b;
+ let L = new E(this.pLength, this.pWidth, this.pHeight), C = this.pWidth * this.pHeight, D = this.cutRadius * this.cutRadius, r = [], n = [], b;
for (let t = 0; t < this.pLength; t++)
for (let a = 0; a < this.pWidth; a++)
for (let h = 0; h < this.pHeight; h++)
- if (b = t * L + a * this.pHeight + h, this.vpBits[b] &= ~this.ISDONE, this.vpBits[b] & this.INOUT && this.vpBits[b] & this.ISBOUND) {
+ if (b = t * C + a * this.pHeight + h, this.vpBits[b] &= ~this.ISDONE, this.vpBits[b] & this.INOUT && this.vpBits[b] & this.ISBOUND) {
let M = {
ix: t,
iy: a,
iz: h
};
- C.set(t, a, h, M), r.push(M), this.vpDistance[b] = 0, this.vpBits[b] |= this.ISDONE, this.vpBits[b] &= ~this.ISBOUND;
+ L.set(t, a, h, M), r.push(M), this.vpDistance[b] = 0, this.vpBits[b] |= this.ISDONE, this.vpBits[b] &= ~this.ISBOUND;
}
do {
- n = this.fastoneshell(r, C), r = [];
+ n = this.fastoneshell(r, L), r = [];
for (let t = 0, a = n.length; t < a; t++)
- b = L * n[t].ix + this.pHeight * n[t].iy + n[t].iz, this.vpBits[b] &= ~this.ISBOUND, this.vpDistance[b] <= 1.0404 * D && r.push({
+ b = C * n[t].ix + this.pHeight * n[t].iy + n[t].iz, this.vpBits[b] &= ~this.ISBOUND, this.vpDistance[b] <= 1.0404 * D && r.push({
ix: n[t].ix,
iy: n[t].iy,
iz: n[t].iz
});
} while (r.length !== 0);
- r = [], n = [], C = null;
+ r = [], n = [], L = null;
let f = this.scaleFactor - 0.5;
f < 0 && (f = 0);
let c = D - 0.5 / (0.1 + f);
for (let t = 0; t < this.pLength; t++)
for (let a = 0; a < this.pWidth; a++)
for (let h = 0; h < this.pHeight; h++)
- b = t * L + a * this.pHeight + h, this.vpBits[b] &= ~this.ISBOUND, this.vpBits[b] & this.INOUT && (!(this.vpBits[b] & this.ISDONE) || this.vpBits[b] & this.ISDONE && this.vpDistance[b] >= c) && (this.vpBits[b] |= this.ISBOUND);
+ b = t * C + a * this.pHeight + h, this.vpBits[b] &= ~this.ISBOUND, this.vpBits[b] & this.INOUT && (!(this.vpBits[b] & this.ISDONE) || this.vpBits[b] & this.ISDONE && this.vpDistance[b] >= c) && (this.vpBits[b] |= this.ISBOUND);
}
- fastoneshell(C, L) {
+ fastoneshell(L, C) {
let D, r, n, b, f, c, t, a, h, M = [];
- if (C.length === 0)
+ if (L.length === 0)
return M;
let w = {
ix: -1,
iy: -1,
iz: -1
}, S = this.pWidth * this.pHeight;
- for (let T = 0, R = C.length; T < R; T++) {
- D = C[T].ix, r = C[T].iy, n = C[T].iz, a = L.get(D, r, n);
- for (let z = 0; z < 6; z++)
- w.ix = D + this.nb[z][0], w.iy = r + this.nb[z][1], w.iz = n + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (h = w.ix * S + this.pHeight * w.iy + w.iz, this.vpBits[h] & this.INOUT && !(this.vpBits[h] & this.ISDONE) ? (L.set(w.ix, w.iy, n + this.nb[z][2], a), b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, this.vpDistance[h] = t, this.vpBits[h] |= this.ISDONE, this.vpBits[h] |= this.ISBOUND, M.push({
+ for (let T = 0, R = L.length; T < R; T++) {
+ D = L[T].ix, r = L[T].iy, n = L[T].iz, a = C.get(D, r, n);
+ for (let $ = 0; $ < 6; $++)
+ w.ix = D + this.nb[$][0], w.iy = r + this.nb[$][1], w.iz = n + this.nb[$][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (h = w.ix * S + this.pHeight * w.iy + w.iz, this.vpBits[h] & this.INOUT && !(this.vpBits[h] & this.ISDONE) ? (C.set(w.ix, w.iy, n + this.nb[$][2], a), b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, this.vpDistance[h] = t, this.vpBits[h] |= this.ISDONE, this.vpBits[h] |= this.ISBOUND, M.push({
ix: w.ix,
iy: w.iy,
iz: w.iz
- })) : this.vpBits[h] & this.INOUT && this.vpBits[h] & this.ISDONE && (b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, t < this.vpDistance[h] && (L.set(w.ix, w.iy, w.iz, a), this.vpDistance[h] = t, this.vpBits[h] & this.ISBOUND || (this.vpBits[h] |= this.ISBOUND, M.push({
+ })) : this.vpBits[h] & this.INOUT && this.vpBits[h] & this.ISDONE && (b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, t < this.vpDistance[h] && (C.set(w.ix, w.iy, w.iz, a), this.vpDistance[h] = t, this.vpBits[h] & this.ISBOUND || (this.vpBits[h] |= this.ISBOUND, M.push({
ix: w.ix,
iy: w.iy,
iz: w.iz
})))));
}
- for (let T = 0, R = C.length; T < R; T++) {
- D = C[T].ix, r = C[T].iy, n = C[T].iz, a = L.get(D, r, n);
- for (let z = 6; z < 18; z++)
- w.ix = D + this.nb[z][0], w.iy = r + this.nb[z][1], w.iz = n + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (h = w.ix * S + this.pHeight * w.iy + w.iz, this.vpBits[h] & this.INOUT && !(this.vpBits[h] & this.ISDONE) ? (L.set(w.ix, w.iy, n + this.nb[z][2], a), b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, this.vpDistance[h] = t, this.vpBits[h] |= this.ISDONE, this.vpBits[h] |= this.ISBOUND, M.push({
+ for (let T = 0, R = L.length; T < R; T++) {
+ D = L[T].ix, r = L[T].iy, n = L[T].iz, a = C.get(D, r, n);
+ for (let $ = 6; $ < 18; $++)
+ w.ix = D + this.nb[$][0], w.iy = r + this.nb[$][1], w.iz = n + this.nb[$][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (h = w.ix * S + this.pHeight * w.iy + w.iz, this.vpBits[h] & this.INOUT && !(this.vpBits[h] & this.ISDONE) ? (C.set(w.ix, w.iy, n + this.nb[$][2], a), b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, this.vpDistance[h] = t, this.vpBits[h] |= this.ISDONE, this.vpBits[h] |= this.ISBOUND, M.push({
ix: w.ix,
iy: w.iy,
iz: w.iz
- })) : this.vpBits[h] & this.INOUT && this.vpBits[h] & this.ISDONE && (b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, t < this.vpDistance[h] && (L.set(w.ix, w.iy, w.iz, a), this.vpDistance[h] = t, this.vpBits[h] & this.ISBOUND || (this.vpBits[h] |= this.ISBOUND, M.push({
+ })) : this.vpBits[h] & this.INOUT && this.vpBits[h] & this.ISDONE && (b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, t < this.vpDistance[h] && (C.set(w.ix, w.iy, w.iz, a), this.vpDistance[h] = t, this.vpBits[h] & this.ISBOUND || (this.vpBits[h] |= this.ISBOUND, M.push({
ix: w.ix,
iy: w.iy,
iz: w.iz
})))));
}
- for (let T = 0, R = C.length; T < R; T++) {
- D = C[T].ix, r = C[T].iy, n = C[T].iz, a = L.get(D, r, n);
- for (let z = 18; z < 26; z++)
- w.ix = D + this.nb[z][0], w.iy = r + this.nb[z][1], w.iz = n + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (h = w.ix * S + this.pHeight * w.iy + w.iz, this.vpBits[h] & this.INOUT && !(this.vpBits[h] & this.ISDONE) ? (L.set(w.ix, w.iy, n + this.nb[z][2], a), b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, this.vpDistance[h] = t, this.vpBits[h] |= this.ISDONE, this.vpBits[h] |= this.ISBOUND, M.push({
+ for (let T = 0, R = L.length; T < R; T++) {
+ D = L[T].ix, r = L[T].iy, n = L[T].iz, a = C.get(D, r, n);
+ for (let $ = 18; $ < 26; $++)
+ w.ix = D + this.nb[$][0], w.iy = r + this.nb[$][1], w.iz = n + this.nb[$][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (h = w.ix * S + this.pHeight * w.iy + w.iz, this.vpBits[h] & this.INOUT && !(this.vpBits[h] & this.ISDONE) ? (C.set(w.ix, w.iy, n + this.nb[$][2], a), b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, this.vpDistance[h] = t, this.vpBits[h] |= this.ISDONE, this.vpBits[h] |= this.ISBOUND, M.push({
ix: w.ix,
iy: w.iy,
iz: w.iz
- })) : this.vpBits[h] & this.INOUT && this.vpBits[h] & this.ISDONE && (b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, t < this.vpDistance[h] && (L.set(w.ix, w.iy, w.iz, a), this.vpDistance[h] = t, this.vpBits[h] & this.ISBOUND || (this.vpBits[h] |= this.ISBOUND, M.push({
+ })) : this.vpBits[h] & this.INOUT && this.vpBits[h] & this.ISDONE && (b = w.ix - a.ix, f = w.iy - a.iy, c = w.iz - a.iz, t = b * b + f * f + c * c, t < this.vpDistance[h] && (C.set(w.ix, w.iy, w.iz, a), this.vpDistance[h] = t, this.vpBits[h] & this.ISBOUND || (this.vpBits[h] |= this.ISBOUND, M.push({
ix: w.ix,
iy: w.iy,
iz: w.iz
@@ -10291,20 +10291,20 @@ ATOM`, h);
}
return M;
}
- marchingcubeinit(C) {
- for (let L = 0, D = this.vpBits.length; L < D; L++)
- C == 1 ? this.vpBits[L] &= ~this.ISBOUND : C == 4 ? (this.vpBits[L] &= ~this.ISDONE, this.vpBits[L] & this.ISBOUND && (this.vpBits[L] |= this.ISDONE), this.vpBits[L] &= ~this.ISBOUND) : C == 2 ? this.vpBits[L] & this.ISBOUND && this.vpBits[L] & this.ISDONE ? this.vpBits[L] &= ~this.ISBOUND : this.vpBits[L] & this.ISBOUND && !(this.vpBits[L] & this.ISDONE) && (this.vpBits[L] |= this.ISDONE) : C == 3 && (this.vpBits[L] &= ~this.ISBOUND);
+ marchingcubeinit(L) {
+ for (let C = 0, D = this.vpBits.length; C < D; C++)
+ L == 1 ? this.vpBits[C] &= ~this.ISBOUND : L == 4 ? (this.vpBits[C] &= ~this.ISDONE, this.vpBits[C] & this.ISBOUND && (this.vpBits[C] |= this.ISDONE), this.vpBits[C] &= ~this.ISBOUND) : L == 2 ? this.vpBits[C] & this.ISBOUND && this.vpBits[C] & this.ISDONE ? this.vpBits[C] &= ~this.ISBOUND : this.vpBits[C] & this.ISBOUND && !(this.vpBits[C] & this.ISDONE) && (this.vpBits[C] |= this.ISDONE) : L == 3 && (this.vpBits[C] &= ~this.ISBOUND);
}
- marchingcube(C) {
- this.marchingcubeinit(C), this.verts = [], this.faces = [], u.MarchingCube.march(this.vpBits, this.verts, this.faces, {
+ marchingcube(L) {
+ this.marchingcubeinit(L), this.verts = [], this.faces = [], u.MarchingCube.march(this.vpBits, this.verts, this.faces, {
smooth: 1,
nX: this.pLength,
nY: this.pWidth,
nZ: this.pHeight
});
- let L = this.pWidth * this.pHeight;
+ let C = this.pWidth * this.pHeight;
for (let D = 0, r = this.verts.length; D < r; D++)
- this.verts[D].atomid = this.vpAtomID[this.verts[D].x * L + this.pHeight * this.verts[D].y + this.verts[D].z];
+ this.verts[D].atomid = this.vpAtomID[this.verts[D].x * C + this.pHeight * this.verts[D].y + this.verts[D].z];
u.MarchingCube.laplacianSmooth(1, this.verts, this.faces);
}
}
@@ -10322,14 +10322,14 @@ ATOM`, h);
/* harmony export */
VolumeData: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ./utilities */
"./src/utilities.ts"
- ), g = e(
+ ), p = e(
/*! ./WebGL/math */
"./src/WebGL/math/index.ts"
), _ = e(
@@ -10342,8 +10342,8 @@ ATOM`, h);
/*! pako */
"./node_modules/pako/dist/pako.esm.mjs"
);
- class p {
- constructor(u, A, C) {
+ class g {
+ constructor(u, A, L) {
if (this.unit = {
x: 1,
y: 1,
@@ -10367,30 +10367,30 @@ ATOM`, h);
}
var a = 1.889725992, h = 0.036749309, M = parseFloat(f[1]), w;
w = f[2].replace(/^\s+/, "").split(/\s+/);
- var S = new g.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(M * a);
+ var S = new p.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(M * a);
w = f[3].replace(/^\s+/, "").split(/\s+/);
- var T = new g.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(M * a);
+ var T = new p.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(M * a);
w = f[4].replace(/^\s+/, "").split(/\s+/);
- var R = new g.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(M * a), z = S.x * (T.y * R.z - R.y * T.z) - T.x * (S.y * R.z - R.y * S.z) + R.x * (S.y * T.z - T.y * S.z);
- z = Math.abs(z) / Math.pow(a, 3);
- var P = 1 / z;
+ var R = new p.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(M * a), $ = S.x * (T.y * R.z - R.y * T.z) - T.x * (S.y * R.z - R.y * S.z) + R.x * (S.y * T.z - T.y * S.z);
+ $ = Math.abs($) / Math.pow(a, 3);
+ var P = 1 / $;
f.splice(0, 8 + t + 1);
- var B = f[0].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), U = Math.abs(parseFloat(B[0])), F = Math.abs(parseFloat(B[1])), $ = Math.abs(parseFloat(B[2])), W = this.origin = new g.Vector3(0, 0, 0);
- this.size = { x: U, y: F, z: $ }, this.unit = new g.Vector3(S.x, T.y, R.z), S = S.multiplyScalar(1 / (a * U)), T = T.multiplyScalar(1 / (a * F)), R = R.multiplyScalar(1 / (a * $)), (S.y != 0 || S.z != 0 || T.x != 0 || T.z != 0 || R.x != 0 || R.y != 0) && (this.matrix = new g.Matrix4(S.x, T.x, R.x, 0, S.y, T.y, R.y, 0, S.z, T.z, R.z, 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new g.Matrix4().makeTranslation(W.x, W.y, W.z)), this.origin = new g.Vector3(0, 0, 0), this.unit = new g.Vector3(1, 1, 1)), f.splice(0, 1);
- var N = f.join(" ");
- N = N.replace(/^\s+/, "");
- var G = N.split(/[\s\r]+/);
- G.splice(U * F * $ + 1);
- for (var k = Float32Array.from(G, parseFloat), j = 0; j < k.length; j++)
- k[j] = k[j] * P * h;
+ var B = f[0].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), F = Math.abs(parseFloat(B[0])), U = Math.abs(parseFloat(B[1])), z = Math.abs(parseFloat(B[2])), W = this.origin = new p.Vector3(0, 0, 0);
+ this.size = { x: F, y: U, z }, this.unit = new p.Vector3(S.x, T.y, R.z), S = S.multiplyScalar(1 / (a * F)), T = T.multiplyScalar(1 / (a * U)), R = R.multiplyScalar(1 / (a * z)), (S.y != 0 || S.z != 0 || T.x != 0 || T.z != 0 || R.x != 0 || R.y != 0) && (this.matrix = new p.Matrix4(S.x, T.x, R.x, 0, S.y, T.y, R.y, 0, S.z, T.z, R.z, 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new p.Matrix4().makeTranslation(W.x, W.y, W.z)), this.origin = new p.Vector3(0, 0, 0), this.unit = new p.Vector3(1, 1, 1)), f.splice(0, 1);
+ var V = f.join(" ");
+ V = V.replace(/^\s+/, "");
+ var N = V.split(/[\s\r]+/);
+ N.splice(F * U * z + 1);
+ for (var k = Float32Array.from(N, parseFloat), G = 0; G < k.length; G++)
+ k[G] = k[G] * P * h;
this.data = k;
}, this.dx = function(b) {
var f = b.split(/[\n\r]+/), c, t = /gridpositions\s+counts\s+(\d+)\s+(\d+)\s+(\d+)/, a = /^origin\s+(\S+)\s+(\S+)\s+(\S+)/, h = /^delta\s+(\S+)\s+(\S+)\s+(\S+)/, M = /data follows/, w = 0;
for (w = 0; w < f.length; w++) {
var S = f[w];
if (c = t.exec(S)) {
- var T = parseInt(c[1]), R = parseInt(c[2]), z = parseInt(c[3]);
- this.size = { x: T, y: R, z };
+ var T = parseInt(c[1]), R = parseInt(c[2]), $ = parseInt(c[3]);
+ this.size = { x: T, y: R, z: $ };
} else if (c = h.exec(S)) {
var P = parseFloat(c[1]);
if ((parseFloat(c[2]) != 0 || parseFloat(c[3]) != 0) && console.log("Non-orthogonal delta matrix not currently supported in dx format"), w += 1, S = f[w], c = h.exec(S), c == null) {
@@ -10402,11 +10402,11 @@ ATOM`, h);
console.log("Parse error in dx delta matrix");
return;
}
- var U = parseFloat(c[3]);
- (parseFloat(c[1]) != 0 || parseFloat(c[2]) != 0) && console.log("Non-orthogonal delta matrix not currently supported in dx format"), this.unit = new g.Vector3(P, B, U);
+ var F = parseFloat(c[3]);
+ (parseFloat(c[1]) != 0 || parseFloat(c[2]) != 0) && console.log("Non-orthogonal delta matrix not currently supported in dx format"), this.unit = new p.Vector3(P, B, F);
} else if (c = a.exec(S)) {
- var F = parseFloat(c[1]), $ = parseFloat(c[2]), W = parseFloat(c[3]);
- this.origin = new g.Vector3(F, $, W);
+ var U = parseFloat(c[1]), z = parseFloat(c[2]), W = parseFloat(c[3]);
+ this.origin = new p.Vector3(U, z, W);
} else if (c = M.exec(S))
break;
}
@@ -10414,8 +10414,8 @@ ATOM`, h);
console.log("Error parsing dx format");
return;
}
- var N = f.splice(w).join(" "), G = N.split(/[\s\r]+/);
- this.data = Float32Array.from(G, parseFloat);
+ var V = f.splice(w).join(" "), N = V.split(/[\s\r]+/);
+ this.data = Float32Array.from(N, parseFloat);
}, A = A.toLowerCase(), /\.gz$/.test(A)) {
A = A.replace(/\.gz$/, "");
try {
@@ -10424,21 +10424,21 @@ ATOM`, h);
console.log(b);
}
}
- if (this[A] && (this.isbinary.has(A) && typeof u == "string" && (u = (0, l.base64ToArray)(u)), this[A](u)), C) {
- if (C.negate)
+ if (this[A] && (this.isbinary.has(A) && typeof u == "string" && (u = (0, l.base64ToArray)(u)), this[A](u)), L) {
+ if (L.negate)
for (let b = 0, f = this.data.length; b < f; b++)
this.data[b] = -this.data[b];
- if (C.normalize) {
- var L = 0;
+ if (L.normalize) {
+ var C = 0;
for (let b = 0, f = this.data.length; b < f; b++)
- L += this.data[b];
- var D = L / this.data.length;
- L = 0;
+ C += this.data[b];
+ var D = C / this.data.length;
+ C = 0;
for (let b = 0, f = this.data.length; b < f; b++) {
var r = this.data[b] - D;
- L += r * r;
+ C += r * r;
}
- var n = L / this.data.length;
+ var n = C / this.data.length;
for (let b = 0, f = this.data.length; b < f; b++)
this.data[b] = (this.data[b] - D) / n;
}
@@ -10449,30 +10449,30 @@ ATOM`, h);
* @param {number} x,y,z - the coordinates
* @returns - index into flat array closest to provided coordinate; -1 if invalid
*/
- getIndex(u, A, C) {
+ getIndex(u, A, L) {
if (this.matrix) {
- this.inversematrix == null && (this.inversematrix = new g.Matrix4().getInverse(this.matrix));
- var L = new g.Vector3(u, A, C);
- L = L.applyMatrix4(this.inversematrix), u = L.x, A = L.y, C = L.z;
+ this.inversematrix == null && (this.inversematrix = new p.Matrix4().getInverse(this.matrix));
+ var C = new p.Vector3(u, A, L);
+ C = C.applyMatrix4(this.inversematrix), u = C.x, A = C.y, L = C.z;
} else
- u -= this.origin.x, A -= this.origin.y, C -= this.origin.z, u /= this.unit.x, A /= this.unit.y, C /= this.unit.z;
- return u = Math.round(u), A = Math.round(A), C = Math.round(C), u < 0 || u >= this.size.x || A < 0 || A >= this.size.y || C < 0 || C >= this.size.z ? -1 : u * this.size.y * this.size.z + A * this.size.z + C;
+ u -= this.origin.x, A -= this.origin.y, L -= this.origin.z, u /= this.unit.x, A /= this.unit.y, L /= this.unit.z;
+ return u = Math.round(u), A = Math.round(A), L = Math.round(L), u < 0 || u >= this.size.x || A < 0 || A >= this.size.y || L < 0 || L >= this.size.z ? -1 : u * this.size.y * this.size.z + A * this.size.z + L;
}
/**
* @function $3Dmol.VolumeData.getVal
* @param {number} x,y,z - the coordinates
* @returns - value closest to provided coordinate; zero if coordinate invalid
*/
- getVal(u, A, C) {
- let L = this.getIndex(u, A, C);
- return L < 0 ? 0 : this.data[L];
+ getVal(u, A, L) {
+ let C = this.getIndex(u, A, L);
+ return C < 0 ? 0 : this.data[C];
}
// parse cube data
cube(u) {
var A = u.split(/\r?\n/);
if (!(A.length < 6)) {
- var C = (0, x.CUBE)(u, {}).modelData[0].cryst, L = A[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), D = parseFloat(L[0]), r = Math.abs(D);
- this.origin = C.origin, this.size = C.size, this.unit = C.unit, this.matrix = C.matrix4;
+ var L = (0, x.CUBE)(u, {}).modelData[0].cryst, C = A[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), D = parseFloat(C[0]), r = Math.abs(D);
+ this.origin = L.origin, this.size = L.size, this.unit = L.unit, this.matrix = L.matrix4;
var n = 6;
D < 0 && n++;
var b = A.splice(r + n).join(" ");
@@ -10485,11 +10485,11 @@ ATOM`, h);
ccp4(u) {
var A = {};
u = new Int8Array(u);
- var C = new Int32Array(u.buffer, 0, 56), L = new Float32Array(u.buffer, 0, 56), D = new DataView(u.buffer);
+ var L = new Int32Array(u.buffer, 0, 56), C = new Float32Array(u.buffer, 0, 56), D = new DataView(u.buffer);
if (A.MAP = String.fromCharCode(D.getUint8(208), D.getUint8(209), D.getUint8(210), D.getUint8(211)), A.MACHST = [D.getUint8(212), D.getUint8(213)], A.MACHST[0] === 17 && A.MACHST[1] === 17)
for (var r = u.byteLength, n = 0; n < r; n += 4)
D.setFloat32(n, D.getFloat32(n), !0);
- A.NX = C[0], A.NY = C[1], A.NZ = C[2], A.MODE = C[3], A.NXSTART = C[4], A.NYSTART = C[5], A.NZSTART = C[6], A.MX = C[7], A.MY = C[8], A.MZ = C[9], A.xlen = L[10], A.ylen = L[11], A.zlen = L[12], A.alpha = L[13], A.beta = L[14], A.gamma = L[15], A.MAPC = C[16], A.MAPR = C[17], A.MAPS = C[18], A.DMIN = L[19], A.DMAX = L[20], A.DMEAN = L[21], A.ISPG = C[22], A.NSYMBT = C[23], A.LSKFLG = C[24], A.originX = L[49], A.originY = L[50], A.originZ = L[51], A.ARMS = L[54];
+ A.NX = L[0], A.NY = L[1], A.NZ = L[2], A.MODE = L[3], A.NXSTART = L[4], A.NYSTART = L[5], A.NZSTART = L[6], A.MX = L[7], A.MY = L[8], A.MZ = L[9], A.xlen = C[10], A.ylen = C[11], A.zlen = C[12], A.alpha = C[13], A.beta = C[14], A.gamma = C[15], A.MAPC = L[16], A.MAPR = L[17], A.MAPS = L[18], A.DMIN = C[19], A.DMAX = C[20], A.DMEAN = C[21], A.ISPG = L[22], A.NSYMBT = L[23], A.LSKFLG = L[24], A.originX = C[49], A.originY = C[50], A.originZ = C[51], A.ARMS = C[54];
var b = A, f = [
b.xlen,
0,
@@ -10505,13 +10505,13 @@ ATOM`, h);
];
t[2] = Math.sqrt(b.zlen * b.zlen * Math.sin(Math.PI / 180 * b.beta) * Math.sin(Math.PI / 180 * b.beta) - t[1] * t[1]);
var a = [0, f, c, t], h = [0, b.MX, b.MY, b.MZ], M = [0, b.MAPC, b.MAPR, b.MAPS];
- this.matrix = new g.Matrix4(), this.matrix.set(a[M[1]][0] / h[M[1]], a[M[2]][0] / h[M[2]], a[M[3]][0] / h[M[3]], 0, a[M[1]][1] / h[M[1]], a[M[2]][1] / h[M[2]], a[M[3]][1] / h[M[3]], 0, a[M[1]][2] / h[M[1]], a[M[2]][2] / h[M[2]], a[M[3]][2] / h[M[3]], 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new g.Matrix4().makeTranslation(b.NXSTART + b.originX, b.NYSTART + b.originY, b.NZSTART + b.originZ)), this.origin = new g.Vector3(0, 0, 0), this.unit = new g.Vector3(1, 1, 1), this.size = { x: A.NX, y: A.NY, z: A.NZ }, this.dimensionorder = [A.MAPC, A.MAPR, A.MAPS];
+ this.matrix = new p.Matrix4(), this.matrix.set(a[M[1]][0] / h[M[1]], a[M[2]][0] / h[M[2]], a[M[3]][0] / h[M[3]], 0, a[M[1]][1] / h[M[1]], a[M[2]][1] / h[M[2]], a[M[3]][1] / h[M[3]], 0, a[M[1]][2] / h[M[1]], a[M[2]][2] / h[M[2]], a[M[3]][2] / h[M[3]], 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new p.Matrix4().makeTranslation(b.NXSTART + b.originX, b.NYSTART + b.originY, b.NZSTART + b.originZ)), this.origin = new p.Vector3(0, 0, 0), this.unit = new p.Vector3(1, 1, 1), this.size = { x: A.NX, y: A.NY, z: A.NZ }, this.dimensionorder = [A.MAPC, A.MAPR, A.MAPS];
var w = new Float32Array(u.buffer, 1024 + A.NSYMBT), S = A.NX, T = A.NY, R = A.NZ;
this.data = new Float32Array(S * T * R);
- for (let z = 0; z < S; z++)
+ for (let $ = 0; $ < S; $++)
for (let P = 0; P < T; P++)
for (let B = 0; B < R; B++)
- this.data[(z * T + P) * R + B] = w[(B * T + P) * S + z];
+ this.data[($ * T + P) * R + B] = w[(B * T + P) * S + $];
}
}
}
@@ -10527,14 +10527,14 @@ ATOM`, h);
/* harmony export */
GLVolumetricRender: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ./WebGL/shapes */
"./src/WebGL/shapes/index.ts"
- ), g = e(
+ ), p = e(
/*! ./WebGL/math */
"./src/WebGL/math/index.ts"
), _ = e(
@@ -10547,45 +10547,45 @@ ATOM`, h);
/*! ./GLShape */
"./src/GLShape.ts"
);
- class p {
+ class g {
static interpolateArray(u, A) {
- function C(t, a, h) {
+ function L(t, a, h) {
return t + (a - t) * h;
}
- var L = [], D = (u.length - 1) / (A - 1);
- L[0] = u[0];
+ var C = [], D = (u.length - 1) / (A - 1);
+ C[0] = u[0];
for (var r = 1; r < A - 1; r++) {
var n = r * D, b = Math.floor(n), f = Math.ceil(n), c = n - b;
- L[r] = C(u[b], u[f], c);
+ C[r] = L(u[b], u[f], c);
}
- return L[A - 1] = u[u.length - 1], L;
+ return C[A - 1] = u[u.length - 1], C;
}
constructor(u, A) {
this.hidden = !1, this.boundingSphere = new l.Sphere(), this.renderedShapeObj = null, this.shapeObj = null, this.subsamples = 5, this.data = null, this.transferfunctionbuffer = [], this.min = 0, this.max = 0, A = A || {};
- var C = Object.assign([], A.transferfn);
+ var L = Object.assign([], A.transferfn);
this.subsamples = A.subsamples || 5;
- let L = 256;
- C.forEach(function(S) {
+ let C = 256;
+ L.forEach(function(S) {
S.value = parseFloat(S.value);
- }), C.sort(function(S, T) {
+ }), L.sort(function(S, T) {
return S.value - T.value;
- }), this.min = C[0].value, C.length == 0 && C.push(C[0]), this.max = C[C.length - 1].value;
+ }), this.min = L[0].value, L.length == 0 && L.push(L[0]), this.max = L[L.length - 1].value;
var D, r, n, b, f, c, t, a, h, M;
- for (let S = 0; S < C.length - 1; S++)
- if (n = x.CC.color(C[S].color), b = x.CC.color(C[S + 1].color), h = C[S].opacity, M = C[S + 1].opacity, D = Math.floor((C[S].value - this.min) * L / (this.max - this.min)), r = Math.floor((C[S + 1].value - this.min) * L / (this.max - this.min)), D != r) {
- f = p.interpolateArray([n.r * 255, b.r * 255], r - D), c = p.interpolateArray([n.g * 255, b.g * 255], r - D), t = p.interpolateArray([n.b * 255, b.b * 255], r - D), a = p.interpolateArray([h * 255, M * 255], r - D);
+ for (let S = 0; S < L.length - 1; S++)
+ if (n = x.CC.color(L[S].color), b = x.CC.color(L[S + 1].color), h = L[S].opacity, M = L[S + 1].opacity, D = Math.floor((L[S].value - this.min) * C / (this.max - this.min)), r = Math.floor((L[S + 1].value - this.min) * C / (this.max - this.min)), D != r) {
+ f = g.interpolateArray([n.r * 255, b.r * 255], r - D), c = g.interpolateArray([n.g * 255, b.g * 255], r - D), t = g.interpolateArray([n.b * 255, b.b * 255], r - D), a = g.interpolateArray([h * 255, M * 255], r - D);
for (let T = 0; T < f.length; T++)
this.transferfunctionbuffer.push(f[T]), this.transferfunctionbuffer.push(c[T]), this.transferfunctionbuffer.push(t[T]), this.transferfunctionbuffer.push(a[T]);
}
if (this.transferfunctionbuffer = new Uint8ClampedArray(this.transferfunctionbuffer), u.matrix) {
- let S = new g.Vector3(0, 0, 0), T = new g.Vector3(u.size.x, u.size.y, u.size.z), R = new g.Vector3(1, 1, 1);
+ let S = new p.Vector3(0, 0, 0), T = new p.Vector3(u.size.x, u.size.y, u.size.z), R = new p.Vector3(1, 1, 1);
S.applyMatrix4(u.matrix), T.applyMatrix4(u.matrix), R.applyMatrix4(u.matrix).sub(S), this.extent = [[S.x, S.y, S.z], [T.x, T.y, T.z]];
- for (let U = 1; U < 7; U++)
- T.x = U & 1 ? u.size.x : 0, T.y = U & 2 ? u.size.y : 0, T.z = U & 4 ? u.size.z : 0, T.applyMatrix4(u.matrix), this.extent[0][0] = Math.min(this.extent[0][0], T.x), this.extent[0][1] = Math.min(this.extent[0][1], T.y), this.extent[0][2] = Math.min(this.extent[0][2], T.z), this.extent[1][0] = Math.max(this.extent[1][0], T.x), this.extent[1][1] = Math.max(this.extent[1][1], T.y), this.extent[1][2] = Math.max(this.extent[1][2], T.z);
- let z = T.x - S.x, P = T.y - S.y, B = T.z - S.z;
- this.maxdepth = Math.sqrt(z * z + P * P + B * B), this.minunit = Math.min(Math.min(R.x, R.y), R.z), this.texmatrix = new g.Matrix4().identity().scale({ x: u.size.x, y: u.size.y, z: u.size.z }), this.texmatrix = this.texmatrix.multiplyMatrices(u.matrix, this.texmatrix), this.texmatrix = this.texmatrix.getInverse(this.texmatrix);
+ for (let F = 1; F < 7; F++)
+ T.x = F & 1 ? u.size.x : 0, T.y = F & 2 ? u.size.y : 0, T.z = F & 4 ? u.size.z : 0, T.applyMatrix4(u.matrix), this.extent[0][0] = Math.min(this.extent[0][0], T.x), this.extent[0][1] = Math.min(this.extent[0][1], T.y), this.extent[0][2] = Math.min(this.extent[0][2], T.z), this.extent[1][0] = Math.max(this.extent[1][0], T.x), this.extent[1][1] = Math.max(this.extent[1][1], T.y), this.extent[1][2] = Math.max(this.extent[1][2], T.z);
+ let $ = T.x - S.x, P = T.y - S.y, B = T.z - S.z;
+ this.maxdepth = Math.sqrt($ * $ + P * P + B * B), this.minunit = Math.min(Math.min(R.x, R.y), R.z), this.texmatrix = new p.Matrix4().identity().scale({ x: u.size.x, y: u.size.y, z: u.size.z }), this.texmatrix = this.texmatrix.multiplyMatrices(u.matrix, this.texmatrix), this.texmatrix = this.texmatrix.getInverse(this.texmatrix);
} else {
- this.texmatrix = new g.Matrix4().identity();
+ this.texmatrix = new p.Matrix4().identity();
let S = u.unit.x * u.size.x, T = u.unit.y * u.size.y, R = u.unit.z * u.size.z;
this.texmatrix.makeTranslation(-u.origin.x / S, -u.origin.y / T, -u.origin.z / R), this.texmatrix.scale({ x: 1 / S, y: 1 / T, z: 1 / R }), this.minunit = Math.min(Math.min(u.unit.x, u.unit.y), u.unit.z), this.extent = [
[u.origin.x, u.origin.y, u.origin.z],
@@ -10600,20 +10600,20 @@ ATOM`, h);
h: this.extent[1][1] - this.extent[0][1],
d: this.extent[1][2] - this.extent[0][2]
}
- }), this.geo = w.finalize(), this.boundingSphere.center = new g.Vector3((this.extent[0][0] + this.extent[1][0]) / 2, (this.extent[0][1] + this.extent[1][1]) / 2, (this.extent[0][2] + this.extent[1][2]) / 2), this.boundingSphere.radius = this.maxdepth / 2, A.coords !== void 0 && A.seldist !== void 0) {
+ }), this.geo = w.finalize(), this.boundingSphere.center = new p.Vector3((this.extent[0][0] + this.extent[1][0]) / 2, (this.extent[0][1] + this.extent[1][1]) / 2, (this.extent[0][2] + this.extent[1][2]) / 2), this.boundingSphere.radius = this.maxdepth / 2, A.coords !== void 0 && A.seldist !== void 0) {
let S = new Uint8Array(u.data.length), T = A.seldist, R = T * T;
- for (let z = 0, P = A.coords.length; z < P; z++) {
- let B = A.coords[z], U = B.x - T, F = B.y - T, $ = B.z - T, W = B.x + T, N = B.y + T, G = B.z + T;
- if (u.getIndex(U, F, $) >= 0 || u.getIndex(W, N, G) >= 0)
- for (let k = U; k < W; k += this.minunit)
- for (let j = F; j < N; j += this.minunit)
- for (let Q = $; Q < G; Q += this.minunit) {
- let ie = u.getIndex(k, j, Q);
- ie >= 0 && !S[ie] && (k - B.x) * (k - B.x) + (j - B.y) * (j - B.y) + (Q - B.z) * (Q - B.z) < R && (S[ie] = 1);
+ for (let $ = 0, P = A.coords.length; $ < P; $++) {
+ let B = A.coords[$], F = B.x - T, U = B.y - T, z = B.z - T, W = B.x + T, V = B.y + T, N = B.z + T;
+ if (u.getIndex(F, U, z) >= 0 || u.getIndex(W, V, N) >= 0)
+ for (let k = F; k < W; k += this.minunit)
+ for (let G = U; G < V; G += this.minunit)
+ for (let Q = z; Q < N; Q += this.minunit) {
+ let ie = u.getIndex(k, G, Q);
+ ie >= 0 && !S[ie] && (k - B.x) * (k - B.x) + (G - B.y) * (G - B.y) + (Q - B.z) * (Q - B.z) < R && (S[ie] = 1);
}
}
- for (let z = 0, P = u.data.length; z < P; z++)
- S[z] == 0 && (u.data[z] = 1 / 0);
+ for (let $ = 0, P = u.data.length; $ < P; $++)
+ S[$] == 0 && (u.data[$] = 1 / 0);
}
this.data = u;
}
@@ -10625,12 +10625,12 @@ ATOM`, h);
globj(u) {
if (this.renderedShapeObj && (u.remove(this.renderedShapeObj), this.renderedShapeObj = null), !this.hidden) {
this.shapeObj = new _.Object3D();
- var A = null, C = new _.Texture(this.data, !0), L = new _.Texture(this.transferfunctionbuffer, !1);
- C.needsUpdate = !0, L.needsUpdate = !0, L.flipY = !1, A = new _.VolumetricMaterial({
- transferfn: L,
+ var A = null, L = new _.Texture(this.data, !0), C = new _.Texture(this.transferfunctionbuffer, !1);
+ L.needsUpdate = !0, C.needsUpdate = !0, C.flipY = !1, A = new _.VolumetricMaterial({
+ transferfn: C,
transfermin: this.min,
transfermax: this.max,
- map: C,
+ map: L,
extent: this.extent,
maxdepth: this.maxdepth,
texmatrix: this.texmatrix,
@@ -10677,18 +10677,18 @@ ATOM`, h);
var l = e(
/*! ./core */
"./src/WebGL/core/index.ts"
- ), g = e(
+ ), p = e(
/*! ./math */
"./src/WebGL/math/index.ts"
);
class _ extends l.Object3D {
- constructor(o = 50, p = 1, E = 0.1, u = 2e3, A = !1) {
- super(), this.projectionMatrix = new g.Matrix4(), this.projectionMatrixInverse = new g.Matrix4(), this.matrixWorldInverse = new g.Matrix4(), this.fov = o, this.aspect = p, this.near = E, this.far = u;
- var C = this.position.z;
- this.right = C * Math.tan(Math.PI / 180 * o), this.left = -this.right, this.top = this.right / this.aspect, this.bottom = -this.top, this.ortho = !!A, this.updateProjectionMatrix();
+ constructor(o = 50, g = 1, E = 0.1, u = 2e3, A = !1) {
+ super(), this.projectionMatrix = new p.Matrix4(), this.projectionMatrixInverse = new p.Matrix4(), this.matrixWorldInverse = new p.Matrix4(), this.fov = o, this.aspect = g, this.near = E, this.far = u;
+ var L = this.position.z;
+ this.right = L * Math.tan(Math.PI / 180 * o), this.left = -this.right, this.top = this.right / this.aspect, this.bottom = -this.top, this.ortho = !!A, this.updateProjectionMatrix();
}
lookAt(o) {
- this.matrix.lookAt(this.position, o, this.up), this.rotationAutoUpdate && (this.useQuaternion === !1 && this.rotation instanceof g.Vector3 ? this.rotation.setEulerFromRotationMatrix(this.matrix, this.eulerOrder) : console.error("Unimplemented math operation."));
+ this.matrix.lookAt(this.position, o, this.up), this.rotationAutoUpdate && (this.useQuaternion === !1 && this.rotation instanceof p.Vector3 ? this.rotation.setEulerFromRotationMatrix(this.matrix, this.eulerOrder) : console.error("Unimplemented math operation."));
}
updateProjectionMatrix() {
this.ortho ? this.projectionMatrix.makeOrthographic(this.left, this.right, this.top, this.bottom, this.near, this.far) : this.projectionMatrix.makePerspective(this.fov, this.aspect, this.near, this.far), this.projectionMatrixInverse.getInverse(this.projectionMatrix);
@@ -10707,7 +10707,7 @@ ATOM`, h);
/* harmony export */
Fog: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -10715,12 +10715,12 @@ ATOM`, h);
/*! ../colors */
"./src/colors.ts"
);
- class g {
- constructor(x, o = 1, p = 1e3) {
- this.name = "", this.color = new l.Color(x), this.near = o, this.far = p;
+ class p {
+ constructor(x, o = 1, g = 1e3) {
+ this.name = "", this.color = new l.Color(x), this.near = o, this.far = g;
}
clone() {
- return new g(this.color.getHex(), this.near, this.far);
+ return new p(this.color.getHex(), this.near, this.far);
}
}
}
@@ -10736,14 +10736,14 @@ ATOM`, h);
/* harmony export */
Renderer: () => (
/* binding */
- L
+ C
)
/* harmony export */
});
var l = e(
/*! ./Camera */
"./src/WebGL/Camera.ts"
- ), g = e(
+ ), p = e(
/*! ./constants/Sides */
"./src/WebGL/constants/Sides.ts"
), _ = e(
@@ -10755,7 +10755,7 @@ ATOM`, h);
), o = e(
/*! ../colors */
"./src/colors.ts"
- ), p = e(
+ ), g = e(
/*! ./materials */
"./src/WebGL/materials/index.ts"
), E = e(
@@ -10767,11 +10767,11 @@ ATOM`, h);
), A = e(
/*! ./shaders */
"./src/WebGL/shaders/index.ts"
- ), C = e(
+ ), L = e(
/*! ./SpritePlugin */
"./src/WebGL/SpritePlugin.ts"
);
- class L {
+ class C {
constructor(r) {
this.context = null, this.devicePixelRatio = 1, this.autoClear = !0, this.autoClearColor = !0, this.autoClearDepth = !0, this.autoClearStencil = !0, this.sortObjects = !0, this.autoUpdateObjects = !0, this.autoUpdateScene = !0, this.info = {
memory: {
@@ -10813,7 +10813,7 @@ ATOM`, h);
groundColors: [],
positions: []
}
- }, this.sprites = new C.SpritePlugin(), this._screenshader = null, this._vertexattribpos = null, this._screenQuadVBO = null, this._fb = null, this._targetTexture = null, this._depthTexture = null, r = r || {}, this.row = r.row, this.col = r.col, this.rows = r.rows, this.cols = r.cols, this._canvas = r.canvas !== void 0 ? r.canvas : document.createElement("canvas"), this._precision = r.precision !== void 0 ? r.precision : "highp", this._alpha = r.alpha !== void 0 ? r.alpha : !0, this._premultipliedAlpha = r.premultipliedAlpha !== void 0 ? r.premultipliedAlpha : !0, this._antialias = r.antialias !== void 0 ? r.antialias : !1, this._stencil = r.stencil !== void 0 ? r.stencil : !0, this._preserveDrawingBuffer = r.preserveDrawingBuffer !== void 0 ? r.preserveDrawingBuffer : !1, this._clearColor = r.clearColor !== void 0 ? new o.Color(r.clearColor) : new o.Color(0), this._clearAlpha = r.clearAlpha !== void 0 ? r.clearAlpha : 0, this._outlineMaterial = new p.MeshOutlineMaterial(r.outline), this._outlineSphereImposterMaterial = new p.SphereImposterOutlineMaterial(r.outline), this._outlineStickImposterMaterial = new p.StickImposterOutlineMaterial(r.outline), this._outlineEnabled = !!r.outline, this.domElement = this._canvas, this._canvas.id = r.id, this.initGL(), this.setDefaultGLState(), this.context = this._gl, this.isWebGL1() ? this._extInstanced = this._gl.getExtension("ANGLE_instanced_arrays") : this._extInstanced = {
+ }, this.sprites = new L.SpritePlugin(), this._screenshader = null, this._vertexattribpos = null, this._screenQuadVBO = null, this._fb = null, this._targetTexture = null, this._depthTexture = null, r = r || {}, this.row = r.row, this.col = r.col, this.rows = r.rows, this.cols = r.cols, this._canvas = r.canvas !== void 0 ? r.canvas : document.createElement("canvas"), this._precision = r.precision !== void 0 ? r.precision : "highp", this._alpha = r.alpha !== void 0 ? r.alpha : !0, this._premultipliedAlpha = r.premultipliedAlpha !== void 0 ? r.premultipliedAlpha : !0, this._antialias = r.antialias !== void 0 ? r.antialias : !1, this._stencil = r.stencil !== void 0 ? r.stencil : !0, this._preserveDrawingBuffer = r.preserveDrawingBuffer !== void 0 ? r.preserveDrawingBuffer : !1, this._clearColor = r.clearColor !== void 0 ? new o.Color(r.clearColor) : new o.Color(0), this._clearAlpha = r.clearAlpha !== void 0 ? r.clearAlpha : 0, this._outlineMaterial = new g.MeshOutlineMaterial(r.outline), this._outlineSphereImposterMaterial = new g.SphereImposterOutlineMaterial(r.outline), this._outlineStickImposterMaterial = new g.StickImposterOutlineMaterial(r.outline), this._outlineEnabled = !!r.outline, this.domElement = this._canvas, this._canvas.id = r.id, this.initGL(), this.setDefaultGLState(), this.context = this._gl, this.isWebGL1() ? this._extInstanced = this._gl.getExtension("ANGLE_instanced_arrays") : this._extInstanced = {
vertexAttribDivisorANGLE: this._gl.vertexAttribDivisor.bind(this._gl),
drawElementsInstancedANGLE: this._gl.drawElementsInstanced.bind(this._gl)
}, this._extFragDepth = this._gl.getExtension("EXT_frag_depth"), this._extFloatLinear = this._gl.getExtension("OES_texture_float_linear"), this._extColorBufferFloat = this._gl.getExtension("EXT_color_buffer_float"), this.sprites.init(this);
@@ -10842,7 +10842,7 @@ ATOM`, h);
this._clearColor.setHex(r), this._clearAlpha = n, this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha);
}
enableOutline(r) {
- this._outlineMaterial = new p.MeshOutlineMaterial(r), this._outlineSphereImposterMaterial = new p.SphereImposterOutlineMaterial(r), this._outlineStickImposterMaterial = new p.StickImposterOutlineMaterial(r), this._outlineEnabled = !0;
+ this._outlineMaterial = new g.MeshOutlineMaterial(r), this._outlineSphereImposterMaterial = new g.SphereImposterOutlineMaterial(r), this._outlineStickImposterMaterial = new g.StickImposterOutlineMaterial(r), this._outlineEnabled = !0;
}
disableOutline() {
this._outlineEnabled = !1;
@@ -10869,7 +10869,7 @@ ATOM`, h);
this.clear(r, n, b);
}
setMaterialFaces(r, n) {
- var b = r.side === g.DoubleSide, f = r.side === g.BackSide;
+ var b = r.side === p.DoubleSide, f = r.side === p.BackSide;
r.imposter || (f = n ? !f : f), this._oldDoubleSided !== b && (b ? this._gl.disable(this._gl.CULL_FACE) : this._gl.enable(this._gl.CULL_FACE), this._oldDoubleSided = b), this._oldFlipSided !== f && (f ? this._gl.frontFace(this._gl.CW) : this._gl.frontFace(this._gl.CCW), this._oldFlipSided = f), this._gl.cullFace(this._gl.BACK);
}
setDepthTest(r) {
@@ -10908,8 +10908,8 @@ ATOM`, h);
var T, R;
if (t instanceof u.Mesh) {
if (f.shaderID === "instanced") {
- var z = f.sphere.geometryGroups[0];
- M && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, z.vertexArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, z.normalArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, z.faceArray, this._gl.STATIC_DRAW)), T = z.faceidx, this._extInstanced.vertexAttribDivisorANGLE(h.offset, 1), this._extInstanced.vertexAttribDivisorANGLE(h.radius, 1), this._extInstanced.vertexAttribDivisorANGLE(h.color, 1), this._extInstanced.drawElementsInstancedANGLE(this._gl.TRIANGLES, T, this._gl.UNSIGNED_SHORT, 0, c.radiusArray.length), this._extInstanced.vertexAttribDivisorANGLE(h.offset, 0), this._extInstanced.vertexAttribDivisorANGLE(h.radius, 0), this._extInstanced.vertexAttribDivisorANGLE(h.color, 0);
+ var $ = f.sphere.geometryGroups[0];
+ M && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, $.vertexArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, $.normalArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, $.faceArray, this._gl.STATIC_DRAW)), T = $.faceidx, this._extInstanced.vertexAttribDivisorANGLE(h.offset, 1), this._extInstanced.vertexAttribDivisorANGLE(h.radius, 1), this._extInstanced.vertexAttribDivisorANGLE(h.color, 1), this._extInstanced.drawElementsInstancedANGLE(this._gl.TRIANGLES, T, this._gl.UNSIGNED_SHORT, 0, c.radiusArray.length), this._extInstanced.vertexAttribDivisorANGLE(h.offset, 0), this._extInstanced.vertexAttribDivisorANGLE(h.radius, 0), this._extInstanced.vertexAttribDivisorANGLE(h.color, 0);
} else
f.wireframe ? (R = c.lineidx, this.setLineWidth(f.wireframeLinewidth), M && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglLineBuffer), this._gl.drawElements(this._gl.LINES, R, this._gl.UNSIGNED_SHORT, 0)) : (T = c.faceidx, M && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.drawElements(this._gl.TRIANGLES, T, this._gl.UNSIGNED_SHORT, 0));
this.info.render.calls++, this.info.render.vertices += T, this.info.render.faces += T / 3;
@@ -11102,37 +11102,37 @@ ATOM`, h);
f.volumetric ? "#version 300 es" : "",
T
].join(`
-`), z = [
+`), $ = [
f.volumetric ? "#version 300 es" : "",
f.fragdepth && this.isWebGL1() ? "#extension GL_EXT_frag_depth: enable" : "",
f.wireframe ? "#define WIREFRAME 1" : "",
T
].join(`
-`), P = this.getShader("fragment", z + r), B = this.getShader("vertex", R + n);
+`), P = this.getShader("fragment", $ + r), B = this.getShader("vertex", R + n);
B != null && this._gl.attachShader(a, B), P != null && this._gl.attachShader(a, P), this._gl.linkProgram(a), this._gl.getProgramParameter(a, this._gl.LINK_STATUS) || console.error("Could not initialize shader"), a.uniforms = {}, a.attributes = {};
- var U, F, $;
- U = [
+ var F, U, z;
+ F = [
"viewMatrix",
"modelViewMatrix",
"projectionMatrix",
"normalMatrix"
];
- for (F in b)
- U.push(F);
- for ($ = 0; $ < U.length; $++) {
- var W = U[$];
+ for (U in b)
+ F.push(U);
+ for (z = 0; z < F.length; z++) {
+ var W = F[z];
a.uniforms[W] = this._gl.getUniformLocation(a, W);
}
- for (U = [
+ for (F = [
"position",
"normal",
"color",
"lineDistance",
"offset",
"radius"
- ], $ = 0; $ < U.length; $++) {
- var N = U[$];
- a.attributes[N] = this._gl.getAttribLocation(a, N);
+ ], z = 0; z < F.length; z++) {
+ var V = F[z];
+ a.attributes[V] = this._gl.getAttribLocation(a, V);
}
return a.id = this._programs_counter++, this._programs.push({
program: a,
@@ -11256,14 +11256,14 @@ ATOM`, h);
return r === _.UnsignedByteType ? this._gl.UNSIGNED_BYTE : r === _.RGBAFormat ? this._gl.RGBA : r === _.NearestFilter ? this._gl.NEAREST : 0;
}
setupLights(r, n) {
- var b, f, c, t = 0, a = 0, h = 0, M, w, S = this._lights, T = S.directional.colors, R = S.directional.positions, z = 0, P = 0;
+ var b, f, c, t = 0, a = 0, h = 0, M, w, S = this._lights, T = S.directional.colors, R = S.directional.positions, $ = 0, P = 0;
for (b = 0, f = n.length; b < f; b++)
if (c = n[b], M = c.color, w = c.intensity, c instanceof x.Light) {
if (this._direction.getPositionFromMatrix(c.matrixWorld), this._vector3.getPositionFromMatrix(c.target.matrixWorld), this._direction.sub(this._vector3), this._direction.normalize(), this._direction.x === 0 && this._direction.y === 0 && this._direction.z === 0)
continue;
- R[P] = this._direction.x, R[P + 1] = this._direction.y, R[P + 2] = this._direction.z, T[P] = M.r * w, T[P + 1] = M.g * w, T[P + 2] = M.b * w, P += 3, z++;
+ R[P] = this._direction.x, R[P + 1] = this._direction.y, R[P + 2] = this._direction.z, T[P] = M.r * w, T[P + 1] = M.g * w, T[P + 2] = M.b * w, P += 3, $++;
}
- S.ambient[0] = t, S.ambient[1] = a, S.ambient[2] = h, S.directional.length = z;
+ S.ambient[0] = t, S.ambient[1] = a, S.ambient[2] = h, S.directional.length = $;
}
initGL() {
try {
@@ -11301,15 +11301,15 @@ ATOM`, h);
}
// rendering
renderObjects(r, n, b, f, c, t, a, T) {
- var M, w, S, T, R, z, P;
- n ? (R = r.length - 1, z = -1, P = -1) : (R = 0, z = r.length, P = 1);
- for (var B = R; B !== z; B += P)
+ var M, w, S, T, R, $, P;
+ n ? (R = r.length - 1, $ = -1, P = -1) : (R = 0, $ = r.length, P = 1);
+ for (var B = R; B !== $; B += P)
if (M = r[B], M.render) {
if (w = M.object, S = M.buffer, T = M[b], !T)
continue;
a && this.setBlending(!0), this.setDepthTest(T.depthTest), this.setDepthWrite(T.depthWrite), this.setPolygonOffset(T.polygonOffset, T.polygonOffsetFactor, T.polygonOffsetUnits);
- var U = w._modelViewMatrix.isReflected();
- this.setMaterialFaces(T, U), this.renderBuffer(f, c, t, T, S, w), (this._outlineEnabled || T.outline) && (T.shaderID == "sphereimposter" ? this.renderBuffer(f, c, t, this._outlineSphereImposterMaterial, S, w) : T.shaderID == "stickimposter" ? this.renderBuffer(f, c, t, this._outlineStickImposterMaterial, S, w) : !T.wireframe && T.shaderID !== "basic" && T.opacity !== 0 && this.renderBuffer(f, c, t, this._outlineMaterial, S, w));
+ var F = w._modelViewMatrix.isReflected();
+ this.setMaterialFaces(T, F), this.renderBuffer(f, c, t, T, S, w), (this._outlineEnabled || T.outline) && (T.shaderID == "sphereimposter" ? this.renderBuffer(f, c, t, this._outlineSphereImposterMaterial, S, w) : T.shaderID == "stickimposter" ? this.renderBuffer(f, c, t, this._outlineStickImposterMaterial, S, w) : !T.wireframe && T.shaderID !== "basic" && T.opacity !== 0 && this.renderBuffer(f, c, t, this._outlineMaterial, S, w));
}
}
renderSprites(r, n, b) {
@@ -11329,7 +11329,7 @@ ATOM`, h);
/* harmony export */
SpritePlugin: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -11337,7 +11337,7 @@ ATOM`, h);
/*! ./shaders/index */
"./src/WebGL/shaders/index.ts"
);
- class g {
+ class p {
constructor() {
this.sprite = {
vertices: null,
@@ -11351,8 +11351,8 @@ ATOM`, h);
}
init(o) {
this.gl = o.context, this.renderer = o, this.precision = o.getPrecision(), this.sprite.vertices = new Float32Array(16), this.sprite.faces = new Uint16Array(6);
- var p = 0;
- this.sprite.vertices[p++] = -1, this.sprite.vertices[p++] = -1, this.sprite.vertices[p++] = 0, this.sprite.vertices[p++] = 0, this.sprite.vertices[p++] = 1, this.sprite.vertices[p++] = -1, this.sprite.vertices[p++] = 1, this.sprite.vertices[p++] = 0, this.sprite.vertices[p++] = 1, this.sprite.vertices[p++] = 1, this.sprite.vertices[p++] = 1, this.sprite.vertices[p++] = 1, this.sprite.vertices[p++] = -1, this.sprite.vertices[p++] = 1, this.sprite.vertices[p++] = 0, this.sprite.vertices[p++] = 1, p = 0, this.sprite.faces[p++] = 0, this.sprite.faces[p++] = 1, this.sprite.faces[p++] = 2, this.sprite.faces[p++] = 0, this.sprite.faces[p++] = 2, this.sprite.faces[p++] = 3, this.sprite.vertexBuffer = this.gl.createBuffer(), this.sprite.elementBuffer = this.gl.createBuffer(), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.bufferData(this.gl.ARRAY_BUFFER, this.sprite.vertices, this.gl.STATIC_DRAW), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.bufferData(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.faces, this.gl.STATIC_DRAW), this.sprite.program = this.createProgram(
+ var g = 0;
+ this.sprite.vertices[g++] = -1, this.sprite.vertices[g++] = -1, this.sprite.vertices[g++] = 0, this.sprite.vertices[g++] = 0, this.sprite.vertices[g++] = 1, this.sprite.vertices[g++] = -1, this.sprite.vertices[g++] = 1, this.sprite.vertices[g++] = 0, this.sprite.vertices[g++] = 1, this.sprite.vertices[g++] = 1, this.sprite.vertices[g++] = 1, this.sprite.vertices[g++] = 1, this.sprite.vertices[g++] = -1, this.sprite.vertices[g++] = 1, this.sprite.vertices[g++] = 0, this.sprite.vertices[g++] = 1, g = 0, this.sprite.faces[g++] = 0, this.sprite.faces[g++] = 1, this.sprite.faces[g++] = 2, this.sprite.faces[g++] = 0, this.sprite.faces[g++] = 2, this.sprite.faces[g++] = 3, this.sprite.vertexBuffer = this.gl.createBuffer(), this.sprite.elementBuffer = this.gl.createBuffer(), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.bufferData(this.gl.ARRAY_BUFFER, this.sprite.vertices, this.gl.STATIC_DRAW), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.bufferData(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.faces, this.gl.STATIC_DRAW), this.sprite.program = this.createProgram(
l.ShaderLib.sprite,
this.precision || 1
/** added default to single precision */
@@ -11360,12 +11360,12 @@ ATOM`, h);
const E = {};
this.sprite.attributes.position = this.gl.getAttribLocation(this.sprite.program, "position"), this.sprite.attributes.uv = this.gl.getAttribLocation(this.sprite.program, "uv"), E.uvOffset = this.gl.getUniformLocation(this.sprite.program, "uvOffset"), E.uvScale = this.gl.getUniformLocation(this.sprite.program, "uvScale"), E.rotation = this.gl.getUniformLocation(this.sprite.program, "rotation"), E.scale = this.gl.getUniformLocation(this.sprite.program, "scale"), E.alignment = this.gl.getUniformLocation(this.sprite.program, "alignment"), E.color = this.gl.getUniformLocation(this.sprite.program, "color"), E.map = this.gl.getUniformLocation(this.sprite.program, "map"), E.opacity = this.gl.getUniformLocation(this.sprite.program, "opacity"), E.useScreenCoordinates = this.gl.getUniformLocation(this.sprite.program, "useScreenCoordinates"), E.screenPosition = this.gl.getUniformLocation(this.sprite.program, "screenPosition"), E.modelViewMatrix = this.gl.getUniformLocation(this.sprite.program, "modelViewMatrix"), E.projectionMatrix = this.gl.getUniformLocation(this.sprite.program, "projectionMatrix"), E.fogType = this.gl.getUniformLocation(this.sprite.program, "fogType"), E.fogDensity = this.gl.getUniformLocation(this.sprite.program, "fogDensity"), E.fogNear = this.gl.getUniformLocation(this.sprite.program, "fogNear"), E.fogFar = this.gl.getUniformLocation(this.sprite.program, "fogFar"), E.fogColor = this.gl.getUniformLocation(this.sprite.program, "fogColor"), E.alphaTest = this.gl.getUniformLocation(this.sprite.program, "alphaTest"), this.sprite.uniforms = E;
}
- render(o, p, E, u, A) {
- var C, L, D, r, n, b, f, c, t, a;
+ render(o, g, E, u, A) {
+ var L, C, D, r, n, b, f, c, t, a;
if (!this.gl)
throw new Error("WebGLRenderer not initialized");
let h = [];
- (C = o == null ? void 0 : o.__webglSprites) === null || C === void 0 || C.forEach((Q) => {
+ (L = o == null ? void 0 : o.__webglSprites) === null || L === void 0 || L.forEach((Q) => {
(A && Q.material.depthTest == !1 || !A && Q.material.depthTest) && h.push(Q);
});
let M = h.length;
@@ -11375,24 +11375,24 @@ ATOM`, h);
if (!S)
throw new Error("Uniforms not defined");
var T = E * 0.5, R = u * 0.5;
- this.gl.useProgram(this.sprite.program), this.gl.enableVertexAttribArray(w.position), this.gl.enableVertexAttribArray(w.uv), this.gl.disable(this.gl.CULL_FACE), this.gl.enable(this.gl.BLEND), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.vertexAttribPointer(w.position, 2, this.gl.FLOAT, !1, 16, 0), this.gl.vertexAttribPointer(w.uv, 2, this.gl.FLOAT, !1, 16, 8), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.uniformMatrix4fv(S.projectionMatrix, !1, p.projectionMatrix.elements), this.gl.activeTexture(this.gl.TEXTURE0), this.gl.uniform1i(S.map, 0);
- var z = 0, P = 0, B = o.fog;
- B ? (this.gl.uniform3f(S.fogColor, B.color.r, B.color.g, B.color.b), this.gl.uniform1f(S.fogNear, B.near), this.gl.uniform1f(S.fogFar, B.far), this.gl.uniform1i(S.fogType, 1), z = 1, P = 1) : (this.gl.uniform1i(S.fogType, 0), z = 0, P = 0);
- var U;
- let F, $, W, N, G = [];
- for (U = 0; U < M; U++)
- F = h[U], $ = F.material, $ && ($.depthTest == !1 && !A || !F.visible || $.opacity === 0 || ($.useScreenCoordinates ? F.z = -F.position.z : (F._modelViewMatrix.multiplyMatrices(p.matrixWorldInverse, F.matrixWorld), F.z = -F._modelViewMatrix.elements[14])));
- for (h.sort(_), U = 0; U < M; U++)
- if (F = h[U], $ = F.material, !!$ && !(!F.visible || $.opacity === 0) && $.map && $.map.image && $.map.image.width) {
- this.gl.uniform1f((S == null ? void 0 : S.alphaTest) || null, $.alphaTest);
- var k = $.map.image.width, j = $.map.image.height;
- G[0] = k * this.renderer.devicePixelRatio / E, G[1] = j * this.renderer.devicePixelRatio / u, $.useScreenCoordinates === !0 ? (this.gl.uniform1i(S.useScreenCoordinates, 1), this.gl.uniform3f(S.screenPosition, (F.position.x * this.renderer.devicePixelRatio - T) / T, (R - F.position.y * this.renderer.devicePixelRatio) / R, Math.max(0, Math.min(1, F.position.z)))) : (this.gl.uniform1i(S.useScreenCoordinates, 0), this.gl.uniformMatrix4fv(S.modelViewMatrix, !1, F._modelViewMatrix.elements)), o.fog && $.fog ? N = P : N = 0, z !== N && (this.gl.uniform1i(S.fogType, N), z = N), W = 1 / ($.scaleByViewport ? u : 1), G[0] *= W * F.scale.x, G[1] *= W * F.scale.y;
- let Q = (L = $ == null ? void 0 : $.alignment) === null || L === void 0 ? void 0 : L.x, ie = (D = $ == null ? void 0 : $.alignment) === null || D === void 0 ? void 0 : D.y;
- $.screenOffset && (Q = (Q || 0) + 2 * $.screenOffset.x / k, ie = (ie || 0) + 2 * $.screenOffset.y / j), this.gl.uniform2f(S.uvScale, ((r = $ == null ? void 0 : $.uvScale) === null || r === void 0 ? void 0 : r.x) || 1, ((n = $ == null ? void 0 : $.uvScale) === null || n === void 0 ? void 0 : n.y) || 1), this.gl.uniform2f(S.uvOffset, ((b = $ == null ? void 0 : $.uvOffset) === null || b === void 0 ? void 0 : b.x) || 0, ((f = $ == null ? void 0 : $.uvOffset) === null || f === void 0 ? void 0 : f.y) || 0), this.gl.uniform2f(S.alignment, Q || 0, ie || 0), this.gl.uniform1f(S.opacity, $.opacity), this.gl.uniform3f(S.color, ((c = $ == null ? void 0 : $.color) === null || c === void 0 ? void 0 : c.r) || 0, ((t = $ == null ? void 0 : $.color) === null || t === void 0 ? void 0 : t.g) || 0, ((a = $ == null ? void 0 : $.color) === null || a === void 0 ? void 0 : a.b) || 0), this.gl.uniform1f(S.rotation, F.rotation), this.gl.uniform2fv(S.scale, G), this.renderer.setDepthTest($.depthTest), this.renderer.setDepthWrite($.depthWrite), this.renderer.setTexture($.map, 0), this.gl.drawElements(this.gl.TRIANGLES, 6, this.gl.UNSIGNED_SHORT, 0);
+ this.gl.useProgram(this.sprite.program), this.gl.enableVertexAttribArray(w.position), this.gl.enableVertexAttribArray(w.uv), this.gl.disable(this.gl.CULL_FACE), this.gl.enable(this.gl.BLEND), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.vertexAttribPointer(w.position, 2, this.gl.FLOAT, !1, 16, 0), this.gl.vertexAttribPointer(w.uv, 2, this.gl.FLOAT, !1, 16, 8), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.uniformMatrix4fv(S.projectionMatrix, !1, g.projectionMatrix.elements), this.gl.activeTexture(this.gl.TEXTURE0), this.gl.uniform1i(S.map, 0);
+ var $ = 0, P = 0, B = o.fog;
+ B ? (this.gl.uniform3f(S.fogColor, B.color.r, B.color.g, B.color.b), this.gl.uniform1f(S.fogNear, B.near), this.gl.uniform1f(S.fogFar, B.far), this.gl.uniform1i(S.fogType, 1), $ = 1, P = 1) : (this.gl.uniform1i(S.fogType, 0), $ = 0, P = 0);
+ var F;
+ let U, z, W, V, N = [];
+ for (F = 0; F < M; F++)
+ U = h[F], z = U.material, z && (z.depthTest == !1 && !A || !U.visible || z.opacity === 0 || (z.useScreenCoordinates ? U.z = -U.position.z : (U._modelViewMatrix.multiplyMatrices(g.matrixWorldInverse, U.matrixWorld), U.z = -U._modelViewMatrix.elements[14])));
+ for (h.sort(_), F = 0; F < M; F++)
+ if (U = h[F], z = U.material, !!z && !(!U.visible || z.opacity === 0) && z.map && z.map.image && z.map.image.width) {
+ this.gl.uniform1f((S == null ? void 0 : S.alphaTest) || null, z.alphaTest);
+ var k = z.map.image.width, G = z.map.image.height;
+ N[0] = k * this.renderer.devicePixelRatio / E, N[1] = G * this.renderer.devicePixelRatio / u, z.useScreenCoordinates === !0 ? (this.gl.uniform1i(S.useScreenCoordinates, 1), this.gl.uniform3f(S.screenPosition, (U.position.x * this.renderer.devicePixelRatio - T) / T, (R - U.position.y * this.renderer.devicePixelRatio) / R, Math.max(0, Math.min(1, U.position.z)))) : (this.gl.uniform1i(S.useScreenCoordinates, 0), this.gl.uniformMatrix4fv(S.modelViewMatrix, !1, U._modelViewMatrix.elements)), o.fog && z.fog ? V = P : V = 0, $ !== V && (this.gl.uniform1i(S.fogType, V), $ = V), W = 1 / (z.scaleByViewport ? u : 1), N[0] *= W * U.scale.x, N[1] *= W * U.scale.y;
+ let Q = (C = z == null ? void 0 : z.alignment) === null || C === void 0 ? void 0 : C.x, ie = (D = z == null ? void 0 : z.alignment) === null || D === void 0 ? void 0 : D.y;
+ z.screenOffset && (Q = (Q || 0) + 2 * z.screenOffset.x / k, ie = (ie || 0) + 2 * z.screenOffset.y / G), this.gl.uniform2f(S.uvScale, ((r = z == null ? void 0 : z.uvScale) === null || r === void 0 ? void 0 : r.x) || 1, ((n = z == null ? void 0 : z.uvScale) === null || n === void 0 ? void 0 : n.y) || 1), this.gl.uniform2f(S.uvOffset, ((b = z == null ? void 0 : z.uvOffset) === null || b === void 0 ? void 0 : b.x) || 0, ((f = z == null ? void 0 : z.uvOffset) === null || f === void 0 ? void 0 : f.y) || 0), this.gl.uniform2f(S.alignment, Q || 0, ie || 0), this.gl.uniform1f(S.opacity, z.opacity), this.gl.uniform3f(S.color, ((c = z == null ? void 0 : z.color) === null || c === void 0 ? void 0 : c.r) || 0, ((t = z == null ? void 0 : z.color) === null || t === void 0 ? void 0 : t.g) || 0, ((a = z == null ? void 0 : z.color) === null || a === void 0 ? void 0 : a.b) || 0), this.gl.uniform1f(S.rotation, U.rotation), this.gl.uniform2fv(S.scale, N), this.renderer.setDepthTest(z.depthTest), this.renderer.setDepthWrite(z.depthWrite), this.renderer.setTexture(z.map, 0), this.gl.drawElements(this.gl.TRIANGLES, 6, this.gl.UNSIGNED_SHORT, 0);
}
this.gl.enable(this.gl.CULL_FACE);
}
- createProgram(o, p) {
+ createProgram(o, g) {
if (!this.gl)
throw new Error("WebGL Rendering context not found");
var E = this.gl.createProgram();
@@ -11403,9 +11403,9 @@ ATOM`, h);
throw new Error("Unable to create fragment shader SpritePlugin.createProgram");
if (!A)
throw new Error("Unable to create vertex shader SpritePlugin.createProgram");
- var C = "precision " + p + ` float;
+ var L = "precision " + g + ` float;
`;
- if (this.gl.shaderSource(u, C + o.fragmentShader), this.gl.shaderSource(A, C + o.vertexShader), this.gl.compileShader(u), this.gl.compileShader(A), !this.gl.getShaderParameter(u, this.gl.COMPILE_STATUS) || !this.gl.getShaderParameter(A, this.gl.COMPILE_STATUS))
+ if (this.gl.shaderSource(u, L + o.fragmentShader), this.gl.shaderSource(A, L + o.vertexShader), this.gl.compileShader(u), this.gl.compileShader(A), !this.gl.getShaderParameter(u, this.gl.COMPILE_STATUS) || !this.gl.getShaderParameter(A, this.gl.COMPILE_STATUS))
throw new Error(`Error compiling shader:
${this.gl.getShaderInfoLog(u)}
${this.gl.getShaderInfoLog(A)}`);
@@ -11433,8 +11433,8 @@ ATOM`, h);
/* harmony export */
});
var l;
- (function(g) {
- g[g.NoColors = 0] = "NoColors", g[g.FaceColors = 1] = "FaceColors", g[g.VertexColors = 2] = "VertexColors";
+ (function(p) {
+ p[p.NoColors = 0] = "NoColors", p[p.FaceColors = 1] = "FaceColors", p[p.VertexColors = 2] = "VertexColors";
})(l || (l = {}));
}
),
@@ -11454,8 +11454,8 @@ ATOM`, h);
/* harmony export */
});
var l;
- (function(g) {
- g[g.NoShading = 0] = "NoShading", g[g.FlatShading = 1] = "FlatShading", g[g.SmoothShading = 2] = "SmoothShading";
+ (function(p) {
+ p[p.NoShading = 0] = "NoShading", p[p.FlatShading = 1] = "FlatShading", p[p.SmoothShading = 2] = "SmoothShading";
})(l || (l = {}));
}
),
@@ -11470,7 +11470,7 @@ ATOM`, h);
/* harmony export */
BackSide: () => (
/* binding */
- g
+ p
),
/* harmony export */
DoubleSide: () => (
@@ -11484,7 +11484,7 @@ ATOM`, h);
)
/* harmony export */
});
- const l = 0, g = 1, _ = 2;
+ const l = 0, p = 1, _ = 2;
}
),
/***/
@@ -11498,7 +11498,7 @@ ATOM`, h);
/* harmony export */
SpriteAlignment: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -11506,7 +11506,7 @@ ATOM`, h);
/*! ../math */
"./src/WebGL/math/index.ts"
);
- const g = {
+ const p = {
topLeft: new l.Vector2(1, -1),
topCenter: new l.Vector2(0, -1),
topRight: new l.Vector2(-1, -1),
@@ -11535,12 +11535,12 @@ ATOM`, h);
/* harmony export */
FloatType: () => (
/* binding */
- p
+ g
),
/* harmony export */
LinearFilter: () => (
/* binding */
- g
+ p
),
/* harmony export */
LinearMipMapLinearFilter: () => (
@@ -11574,7 +11574,7 @@ ATOM`, h);
)
/* harmony export */
});
- const l = 1001, g = 1006, _ = 1007, x = 1008, o = 1009, p = 1010, E = 1021, u = 1022, A = 1023;
+ const l = 1001, p = 1006, _ = 1007, x = 1008, o = 1009, g = 1010, E = 1021, u = 1022, A = 1023;
}
),
/***/
@@ -11593,8 +11593,8 @@ ATOM`, h);
/* harmony export */
});
var l;
- (function(g) {
- g[g.MultiplyOperation = 0] = "MultiplyOperation", g[g.MixOperation = 1] = "MixOperation", g[g.AddOperation = 2] = "AddOperation";
+ (function(p) {
+ p[p.MultiplyOperation = 0] = "MultiplyOperation", p[p.MixOperation = 1] = "MixOperation", p[p.AddOperation = 2] = "AddOperation";
})(l || (l = {}));
}
),
@@ -11609,7 +11609,7 @@ ATOM`, h);
/* harmony export */
BackSide: () => (
/* reexport safe */
- g.BackSide
+ p.BackSide
),
/* harmony export */
ClampToEdgeWrapping: () => (
@@ -11624,7 +11624,7 @@ ATOM`, h);
/* harmony export */
DoubleSide: () => (
/* reexport safe */
- g.DoubleSide
+ p.DoubleSide
),
/* harmony export */
FloatType: () => (
@@ -11634,7 +11634,7 @@ ATOM`, h);
/* harmony export */
FrontSide: () => (
/* reexport safe */
- g.FrontSide
+ p.FrontSide
),
/* harmony export */
LinearFilter: () => (
@@ -11679,7 +11679,7 @@ ATOM`, h);
/* harmony export */
TextureOperations: () => (
/* reexport safe */
- p.TextureOperations
+ g.TextureOperations
),
/* harmony export */
UnsignedByteType: () => (
@@ -11691,7 +11691,7 @@ ATOM`, h);
var l = e(
/*! ./Coloring */
"./src/WebGL/constants/Coloring.ts"
- ), g = e(
+ ), p = e(
/*! ./Sides */
"./src/WebGL/constants/Sides.ts"
), _ = e(
@@ -11703,7 +11703,7 @@ ATOM`, h);
), o = e(
/*! ./TextureConstants */
"./src/WebGL/constants/TextureConstants.ts"
- ), p = e(
+ ), g = e(
/*! ./TextureOperations */
"./src/WebGL/constants/TextureOperations.ts"
);
@@ -11732,7 +11732,7 @@ ATOM`, h);
var x = this.listeners[_.type];
if (x !== void 0) {
_.target = this;
- for (var o = 0, p = x.length; o < p; o++)
+ for (var o = 0, g = x.length; o < g; o++)
x[o].call(this, _);
}
}
@@ -11766,7 +11766,7 @@ ATOM`, h);
/* harmony export */
GeometryGroup: () => (
/* binding */
- p
+ g
),
/* harmony export */
GeometryIDCount: () => (
@@ -11778,7 +11778,7 @@ ATOM`, h);
var l = e(
/*! ../materials/LineBasicMaterial */
"./src/WebGL/materials/LineBasicMaterial.ts"
- ), g = e(
+ ), p = e(
/*! ./EventDispatcher */
"./src/WebGL/core/EventDispatcher.ts"
), _ = e(
@@ -11789,22 +11789,22 @@ ATOM`, h);
"./src/colors.ts"
);
const o = 65535;
- class p {
- constructor(C = 0) {
- this.vertexArray = null, this.colorArray = null, this.normalArray = null, this.radiusArray = null, this.faceArray = null, this.lineArray = null, this.vertices = 0, this.faceidx = 0, this.lineidx = 0, this.__inittedArrays = !1, this.id = C;
+ class g {
+ constructor(L = 0) {
+ this.vertexArray = null, this.colorArray = null, this.normalArray = null, this.radiusArray = null, this.faceArray = null, this.lineArray = null, this.vertices = 0, this.faceidx = 0, this.lineidx = 0, this.__inittedArrays = !1, this.id = L;
}
- setColors(C) {
- var L = this.vertexArray, D = this.colorArray;
- if (!L)
+ setColors(L) {
+ var C = this.vertexArray, D = this.colorArray;
+ if (!C)
throw new Error("vertex array not initialized");
if (!D)
throw new Error("color array not initialized");
- if (L.length != D.length) {
+ if (C.length != D.length) {
console.log("Cannot re-color geometry group due to mismatched lengths.");
return;
}
- for (var r = 0; r < L.length; r += 3) {
- var n = C(L[r], L[r + 1], L[r + 2]);
+ for (var r = 0; r < C.length; r += 3) {
+ var n = L(C[r], C[r + 1], C[r + 2]);
n instanceof x.Color || (n = x.CC.color(n)), D[r] = n.r, D[r + 1] = n.g, D[r + 2] = n.b;
}
}
@@ -11817,22 +11817,22 @@ ATOM`, h);
getCentroid() {
if (!this.vertexArray)
throw new Error("vertex array not initialized");
- for (var C = new _.Vector3(), L, D, r, n, b = 0; b < this.vertices; ++b)
- L = b * 3, D = this.vertexArray[L], r = this.vertexArray[L + 1], n = this.vertexArray[L + 2], C.x += D, C.y += r, C.z += n;
- return C.divideScalar(this.vertices), C;
+ for (var L = new _.Vector3(), C, D, r, n, b = 0; b < this.vertices; ++b)
+ C = b * 3, D = this.vertexArray[C], r = this.vertexArray[C + 1], n = this.vertexArray[C + 2], L.x += D, L.y += r, L.z += n;
+ return L.divideScalar(this.vertices), L;
}
//setup normals - vertex and face array must exist
setNormals() {
- var C = this.faceArray, L = this.vertexArray, D = this.normalArray;
+ var L = this.faceArray, C = this.vertexArray, D = this.normalArray;
if (!(!this.vertices || !this.faceidx)) {
- if (!C)
- throw new Error("face array not initialized");
if (!L)
+ throw new Error("face array not initialized");
+ if (!C)
throw new Error("vertex array not initialized");
if (!D)
throw new Error("normal array not initialized");
- for (var r, n, b, f, c, t, a, h = 0; h < C.length / 3; ++h)
- r = C[h * 3] * 3, n = C[h * 3 + 1] * 3, b = C[h * 3 + 2] * 3, f = new _.Vector3(L[r], L[r + 1], L[r + 2]), c = new _.Vector3(L[n], L[n + 1], L[n + 2]), t = new _.Vector3(L[b], L[b + 1], L[b + 2]), f.subVectors(f, c), t.subVectors(t, c), t.cross(f), a = t, a.normalize(), D[r] += a.x, D[n] += a.x, D[b] += a.x, D[r + 1] += a.y, D[n + 1] += a.y, D[b + 1] += a.y, D[r + 2] += a.z, D[n + 2] += a.z, D[b + 2] += a.z;
+ for (var r, n, b, f, c, t, a, h = 0; h < L.length / 3; ++h)
+ r = L[h * 3] * 3, n = L[h * 3 + 1] * 3, b = L[h * 3 + 2] * 3, f = new _.Vector3(C[r], C[r + 1], C[r + 2]), c = new _.Vector3(C[n], C[n + 1], C[n + 2]), t = new _.Vector3(C[b], C[b + 1], C[b + 2]), f.subVectors(f, c), t.subVectors(t, c), t.cross(f), a = t, a.normalize(), D[r] += a.x, D[n] += a.x, D[b] += a.x, D[r + 1] += a.y, D[n + 1] += a.y, D[b + 1] += a.y, D[r + 2] += a.z, D[n + 2] += a.z, D[b + 2] += a.z;
}
}
/* sets line index array from face arr
@@ -11842,181 +11842,181 @@ ATOM`, h);
as rectangles rather than two triangles) */
setLineIndices() {
if (this.faceidx && !(this.lineArray && this.lineArray.length == this.faceidx * 2 && this.lineidx == this.faceidx * 2)) {
- var C = this.faceArray, L = this.lineArray = new Uint16Array(this.faceidx * 2);
- if (this.lineidx = this.faceidx * 2, !C)
+ var L = this.faceArray, C = this.lineArray = new Uint16Array(this.faceidx * 2);
+ if (this.lineidx = this.faceidx * 2, !L)
throw new Error("face array not initialized");
for (var D = 0; D < this.faceidx / 3; ++D) {
- var r = D * 3, n = r * 2, b = C[r], f = C[r + 1], c = C[r + 2];
- L[n] = b, L[n + 1] = f, L[n + 2] = b, L[n + 3] = c, L[n + 4] = f, L[n + 5] = c;
+ var r = D * 3, n = r * 2, b = L[r], f = L[r + 1], c = L[r + 2];
+ C[n] = b, C[n + 1] = f, C[n + 2] = b, C[n + 3] = c, C[n + 4] = f, C[n + 5] = c;
}
}
}
- vrml(C, L) {
- var D, r, n, b, f, c, t, a, h, M, w, S, T, R, z, P, B, U, F = "";
- if (F += C + `Shape {
-` + C + ` appearance Appearance {
-` + C + ` material Material {
-` + C + " diffuseColor " + ((D = L == null ? void 0 : L.color) === null || D === void 0 ? void 0 : D.r) + " " + ((r = L == null ? void 0 : L.color) === null || r === void 0 ? void 0 : r.g) + " " + ((n = L == null ? void 0 : L.color) === null || n === void 0 ? void 0 : n.b) + `
-`, L.wireframe && this.colorArray) {
+ vrml(L, C) {
+ var D, r, n, b, f, c, t, a, h, M, w, S, T, R, $, P, B, F, U = "";
+ if (U += L + `Shape {
+` + L + ` appearance Appearance {
+` + L + ` material Material {
+` + L + " diffuseColor " + ((D = C == null ? void 0 : C.color) === null || D === void 0 ? void 0 : D.r) + " " + ((r = C == null ? void 0 : C.color) === null || r === void 0 ? void 0 : r.g) + " " + ((n = C == null ? void 0 : C.color) === null || n === void 0 ? void 0 : n.b) + `
+`, C.wireframe && this.colorArray) {
let W = this.colorArray;
- F += C + " emissiveColor " + W[0] + " " + W[1] + " " + W[2] + `
+ U += L + " emissiveColor " + W[0] + " " + W[1] + " " + W[2] + `
`;
}
- L != null && L.transparent && (F += C + " transparency " + (1 - L.opacity) + `
-`), F += C + ` }
-`, F += C + ` }
+ C != null && C.transparent && (U += L + " transparency " + (1 - C.opacity) + `
+`), U += L + ` }
+`, U += L + ` }
`;
- var $ = C;
- if (C += " ", L instanceof l.LineBasicMaterial || L.wireframe) {
- F += C + `geometry IndexedLineSet {
-` + C + ` colorPerVertex TRUE
-` + C + ` coord Coordinate {
-` + C + ` point [
+ var z = L;
+ if (L += " ", C instanceof l.LineBasicMaterial || C.wireframe) {
+ U += L + `geometry IndexedLineSet {
+` + L + ` colorPerVertex TRUE
+` + L + ` coord Coordinate {
+` + L + ` point [
`;
- let W, N, G;
+ let W, V, N;
for (let k = 0; k < this.vertices; ++k) {
- let j = k * 3;
- W = (b = this.vertexArray) === null || b === void 0 ? void 0 : b[j], N = (f = this.vertexArray) === null || f === void 0 ? void 0 : f[j + 1], G = (c = this.vertexArray) === null || c === void 0 ? void 0 : c[j + 2], F += C + " " + W + " " + N + " " + G + `,
+ let G = k * 3;
+ W = (b = this.vertexArray) === null || b === void 0 ? void 0 : b[G], V = (f = this.vertexArray) === null || f === void 0 ? void 0 : f[G + 1], N = (c = this.vertexArray) === null || c === void 0 ? void 0 : c[G + 2], U += L + " " + W + " " + V + " " + N + `,
`;
}
- if (F += C + ` ]
-`, F += C + ` }
-`, this.colorArray && !L.wireframe) {
- F += C + ` color Color {
-` + C + ` color [
+ if (U += L + ` ]
+`, U += L + ` }
+`, this.colorArray && !C.wireframe) {
+ U += L + ` color Color {
+` + L + ` color [
`;
for (let k = 0; k < this.vertices; ++k) {
- let j = k * 3;
- W = this.colorArray[j], N = this.colorArray[j + 1], G = this.colorArray[j + 2], F += C + " " + W + " " + N + " " + G + `,
+ let G = k * 3;
+ W = this.colorArray[G], V = this.colorArray[G + 1], N = this.colorArray[G + 2], U += L + " " + W + " " + V + " " + N + `,
`;
}
- F += C + ` ]
-`, F += C + ` }
+ U += L + ` ]
+`, U += L + ` }
`;
}
- if (F += C + ` coordIndex [
-`, L.wireframe && this.faceArray)
+ if (U += L + ` coordIndex [
+`, C.wireframe && this.faceArray)
for (let k = 0; k < this.faceidx; k += 3)
- W = (t = this.faceArray) === null || t === void 0 ? void 0 : t[k], N = (a = this.faceArray) === null || a === void 0 ? void 0 : a[k + 1], G = (h = this.faceArray) === null || h === void 0 ? void 0 : h[k + 2], F += C + " " + W + ", " + N + ", " + G + `, -1,
+ W = (t = this.faceArray) === null || t === void 0 ? void 0 : t[k], V = (a = this.faceArray) === null || a === void 0 ? void 0 : a[k + 1], N = (h = this.faceArray) === null || h === void 0 ? void 0 : h[k + 2], U += L + " " + W + ", " + V + ", " + N + `, -1,
`;
else
for (let k = 0; k < this.vertices - 1; k += 2)
- F += C + " " + k + ", " + (k + 1) + `, -1,
+ U += L + " " + k + ", " + (k + 1) + `, -1,
`;
- F += C + ` ]
-`, F += C + `}
+ U += L + ` ]
+`, U += L + `}
`;
} else {
- F += C + `geometry IndexedFaceSet {
-` + C + ` colorPerVertex TRUE
-` + C + ` normalPerVertex TRUE
-` + C + ` solid FALSE
-`, F += C + ` coord Coordinate {
-` + C + ` point [
+ U += L + `geometry IndexedFaceSet {
+` + L + ` colorPerVertex TRUE
+` + L + ` normalPerVertex TRUE
+` + L + ` solid FALSE
+`, U += L + ` coord Coordinate {
+` + L + ` point [
`;
- let W, N, G;
+ let W, V, N;
for (let k = 0; k < this.vertices; ++k) {
- let j = k * 3;
- W = (M = this.vertexArray) === null || M === void 0 ? void 0 : M[j], N = (w = this.vertexArray) === null || w === void 0 ? void 0 : w[j + 1], G = (S = this.vertexArray) === null || S === void 0 ? void 0 : S[j + 2], F += C + " " + W + " " + N + " " + G + `,
+ let G = k * 3;
+ W = (M = this.vertexArray) === null || M === void 0 ? void 0 : M[G], V = (w = this.vertexArray) === null || w === void 0 ? void 0 : w[G + 1], N = (S = this.vertexArray) === null || S === void 0 ? void 0 : S[G + 2], U += L + " " + W + " " + V + " " + N + `,
`;
}
- F += C + ` ]
-`, F += C + ` }
-`, F += C + ` normal Normal {
-` + C + ` vector [
+ U += L + ` ]
+`, U += L + ` }
+`, U += L + ` normal Normal {
+` + L + ` vector [
`;
for (let k = 0; k < this.vertices; ++k) {
- let j = k * 3;
- W = (T = this.normalArray) === null || T === void 0 ? void 0 : T[j], N = (R = this.normalArray) === null || R === void 0 ? void 0 : R[j + 1], G = (z = this.normalArray) === null || z === void 0 ? void 0 : z[j + 2], F += C + " " + W + " " + N + " " + G + `,
+ let G = k * 3;
+ W = (T = this.normalArray) === null || T === void 0 ? void 0 : T[G], V = (R = this.normalArray) === null || R === void 0 ? void 0 : R[G + 1], N = ($ = this.normalArray) === null || $ === void 0 ? void 0 : $[G + 2], U += L + " " + W + " " + V + " " + N + `,
`;
}
- if (F += C + ` ]
-`, F += C + ` }
+ if (U += L + ` ]
+`, U += L + ` }
`, this.colorArray) {
- F += C + ` color Color {
-` + C + ` color [
+ U += L + ` color Color {
+` + L + ` color [
`;
for (let k = 0; k < this.vertices; ++k) {
- let j = k * 3;
- W = this.colorArray[j], N = this.colorArray[j + 1], G = this.colorArray[j + 2], F += C + " " + W + " " + N + " " + G + `,
+ let G = k * 3;
+ W = this.colorArray[G], V = this.colorArray[G + 1], N = this.colorArray[G + 2], U += L + " " + W + " " + V + " " + N + `,
`;
}
- F += C + ` ]
-`, F += C + ` }
+ U += L + ` ]
+`, U += L + ` }
`;
}
- F += C + ` coordIndex [
+ U += L + ` coordIndex [
`;
for (let k = 0; k < this.faceidx; k += 3)
- W = (P = this.faceArray) === null || P === void 0 ? void 0 : P[k], N = (B = this.faceArray) === null || B === void 0 ? void 0 : B[k + 1], G = (U = this.faceArray) === null || U === void 0 ? void 0 : U[k + 2], F += C + " " + W + ", " + N + ", " + G + `, -1,
+ W = (P = this.faceArray) === null || P === void 0 ? void 0 : P[k], V = (B = this.faceArray) === null || B === void 0 ? void 0 : B[k + 1], N = (F = this.faceArray) === null || F === void 0 ? void 0 : F[k + 2], U += L + " " + W + ", " + V + ", " + N + `, -1,
`;
- F += C + ` ]
-`, F += C + `}
+ U += L + ` ]
+`, U += L + `}
`;
}
- return F += $ + "}", F;
+ return U += z + "}", U;
}
- truncateArrayBuffers(C = !0, L = !1) {
+ truncateArrayBuffers(L = !0, C = !1) {
var D = this.vertexArray, r = this.colorArray, n = this.normalArray, b = this.faceArray, f = this.lineArray, c = this.radiusArray;
- this.vertexArray = (D == null ? void 0 : D.subarray(0, this.vertices * 3)) || null, this.colorArray = (r == null ? void 0 : r.subarray(0, this.vertices * 3)) || null, C ? (this.normalArray = (n == null ? void 0 : n.subarray(0, this.vertices * 3)) || null, this.faceArray = (b == null ? void 0 : b.subarray(0, this.faceidx)) || null, this.lineidx > 0 ? this.lineArray = (f == null ? void 0 : f.subarray(0, this.lineidx)) || null : this.lineArray = new Uint16Array(0)) : (this.normalArray = new Float32Array(0), this.faceArray = new Uint16Array(0), this.lineArray = new Uint16Array(0)), c && (this.radiusArray = c.subarray(0, this.vertices)), L && (this.normalArray && (this.normalArray = new Float32Array(this.normalArray)), this.faceArray && (this.faceArray = new Uint16Array(this.faceArray)), this.lineArray && (this.lineArray = new Uint16Array(this.lineArray)), this.vertexArray && (this.vertexArray = new Float32Array(this.vertexArray)), this.colorArray && (this.colorArray = new Float32Array(this.colorArray)), this.radiusArray && (this.radiusArray = new Float32Array(this.radiusArray))), this.__inittedArrays = !0;
+ this.vertexArray = (D == null ? void 0 : D.subarray(0, this.vertices * 3)) || null, this.colorArray = (r == null ? void 0 : r.subarray(0, this.vertices * 3)) || null, L ? (this.normalArray = (n == null ? void 0 : n.subarray(0, this.vertices * 3)) || null, this.faceArray = (b == null ? void 0 : b.subarray(0, this.faceidx)) || null, this.lineidx > 0 ? this.lineArray = (f == null ? void 0 : f.subarray(0, this.lineidx)) || null : this.lineArray = new Uint16Array(0)) : (this.normalArray = new Float32Array(0), this.faceArray = new Uint16Array(0), this.lineArray = new Uint16Array(0)), c && (this.radiusArray = c.subarray(0, this.vertices)), C && (this.normalArray && (this.normalArray = new Float32Array(this.normalArray)), this.faceArray && (this.faceArray = new Uint16Array(this.faceArray)), this.lineArray && (this.lineArray = new Uint16Array(this.lineArray)), this.vertexArray && (this.vertexArray = new Float32Array(this.vertexArray)), this.colorArray && (this.colorArray = new Float32Array(this.colorArray)), this.radiusArray && (this.radiusArray = new Float32Array(this.radiusArray))), this.__inittedArrays = !0;
}
}
- class E extends g.EventDispatcher {
- constructor(C = !1, L = !1, D = !1) {
- super(), this.name = "", this.hasTangents = !1, this.dynamic = !0, this.verticesNeedUpdate = !1, this.elementsNeedUpdate = !1, this.normalsNeedUpdate = !1, this.colorsNeedUpdate = !1, this.buffersNeedUpdate = !1, this.imposter = !1, this.instanced = !1, this.geometryGroups = [], this.groups = 0, this.id = u++, this.mesh = C, this.radii = L, this.offset = D;
+ class E extends p.EventDispatcher {
+ constructor(L = !1, C = !1, D = !1) {
+ super(), this.name = "", this.hasTangents = !1, this.dynamic = !0, this.verticesNeedUpdate = !1, this.elementsNeedUpdate = !1, this.normalsNeedUpdate = !1, this.colorsNeedUpdate = !1, this.buffersNeedUpdate = !1, this.imposter = !1, this.instanced = !1, this.geometryGroups = [], this.groups = 0, this.id = u++, this.mesh = L, this.radii = C, this.offset = D;
}
//Get geometry group to accomodate addVertices new vertices - create
// new group if necessary
- updateGeoGroup(C = 0) {
- var L, D = this.groups > 0 ? this.geometryGroups[this.groups - 1] : null;
- return (!D || D.vertices + C > (((L = D == null ? void 0 : D.vertexArray) === null || L === void 0 ? void 0 : L.length) || 0) / 3) && (D = this.addGeoGroup()), D;
+ updateGeoGroup(L = 0) {
+ var C, D = this.groups > 0 ? this.geometryGroups[this.groups - 1] : null;
+ return (!D || D.vertices + L > (((C = D == null ? void 0 : D.vertexArray) === null || C === void 0 ? void 0 : C.length) || 0) / 3) && (D = this.addGeoGroup()), D;
}
//return comma separated list of IndexedFace (or Line) sets from geometry groups
- vrml(C, L) {
+ vrml(L, C) {
for (var D = "", r = this.geometryGroups.length, n = 0; n < r; n++) {
var b = this.geometryGroups[n];
- D += b.vrml(C, L) + `,
+ D += b.vrml(L, C) + `,
`;
}
return D;
}
addGeoGroup() {
- var C = new p(this.geometryGroups.length);
- return this.geometryGroups.push(C), this.groups = this.geometryGroups.length, C.vertexArray = new Float32Array(o * 3), C.colorArray = new Float32Array(o * 3), this.mesh && (C.normalArray = new Float32Array(o * 3), C.faceArray = new Uint16Array(o * 6), C.lineArray = new Uint16Array(o * 6)), this.radii && (C.radiusArray = new Float32Array(o)), C.useOffset = this.offset, C;
+ var L = new g(this.geometryGroups.length);
+ return this.geometryGroups.push(L), this.groups = this.geometryGroups.length, L.vertexArray = new Float32Array(o * 3), L.colorArray = new Float32Array(o * 3), this.mesh && (L.normalArray = new Float32Array(o * 3), L.faceArray = new Uint16Array(o * 6), L.lineArray = new Uint16Array(o * 6)), this.radii && (L.radiusArray = new Float32Array(o)), L.useOffset = this.offset, L;
}
- setUpNormals(...C) {
- for (var L = 0; L < this.groups; L++) {
- var D = this.geometryGroups[L];
- D.setNormals(...C);
+ setUpNormals(...L) {
+ for (var C = 0; C < this.groups; C++) {
+ var D = this.geometryGroups[C];
+ D.setNormals(...L);
}
}
- setColors(...C) {
- for (var L = this.geometryGroups.length, D = 0; D < L; D++) {
+ setColors(...L) {
+ for (var C = this.geometryGroups.length, D = 0; D < C; D++) {
var r = this.geometryGroups[D];
- r.setColors(...C);
+ r.setColors(...L);
}
}
- setUpWireframe(...C) {
- for (var L = 0; L < this.groups; L++) {
- var D = this.geometryGroups[L];
- D.setLineIndices(...C);
+ setUpWireframe(...L) {
+ for (var C = 0; C < this.groups; C++) {
+ var D = this.geometryGroups[C];
+ D.setLineIndices(...L);
}
}
//After vertices, colors, etc are collected in regular or typed arrays,
// create typed arrays from regular arrays if they don't already exist,
initTypedArrays() {
- for (var C = 0; C < this.groups; C++) {
- var L = this.geometryGroups[C];
- L.__inittedArrays !== !0 && L.truncateArrayBuffers(this.mesh, !1);
+ for (var L = 0; L < this.groups; L++) {
+ var C = this.geometryGroups[L];
+ C.__inittedArrays !== !0 && C.truncateArrayBuffers(this.mesh, !1);
}
}
dispose() {
this.dispatchEvent({ type: "dispose" });
}
get vertices() {
- for (var C = 0, L = 0; L < this.groups; L++)
- C += this.geometryGroups[L].vertices;
- return C;
+ for (var L = 0, C = 0; C < this.groups; C++)
+ L += this.geometryGroups[C].vertices;
+ return L;
}
}
let u = 0;
@@ -12033,7 +12033,7 @@ ATOM`, h);
/* harmony export */
Light: () => (
/* binding */
- p
+ g
),
/* harmony export */
Object3D: () => (
@@ -12055,7 +12055,7 @@ ATOM`, h);
var l = e(
/*! ../math */
"./src/WebGL/math/index.ts"
- ), g = e(
+ ), p = e(
/*! ../../colors */
"./src/colors.ts"
);
@@ -12082,22 +12082,22 @@ ATOM`, h);
var A = this.children.indexOf(u);
if (A !== -1) {
u.parent = void 0, this.children.splice(A, 1);
- for (var C = this; C.parent !== void 0; )
- C = C.parent;
- C !== void 0 && C instanceof o && C.__removeObject(u);
+ for (var L = this; L.parent !== void 0; )
+ L = L.parent;
+ L !== void 0 && L instanceof o && L.__removeObject(u);
}
}
//convert to vrml
vrml(u) {
u || (u = " ");
- var A = 2 * Math.atan2(this.quaternion.lengthxyz(), this.quaternion.w), C = 0, L = 0, D = 0;
+ var A = 2 * Math.atan2(this.quaternion.lengthxyz(), this.quaternion.w), L = 0, C = 0, D = 0;
if (A != 0) {
let b = Math.sin(A / 2);
- C = this.quaternion.x / b, L = this.quaternion.y / b, D = this.quaternion.z / b;
+ L = this.quaternion.x / b, C = this.quaternion.y / b, D = this.quaternion.z / b;
}
var r = u + `Transform {
` + u + " center " + this.position.x + " " + this.position.y + " " + this.position.z + `
-` + u + " rotation " + C + " " + L + " " + D + " " + A + `
+` + u + " rotation " + L + " " + C + " " + D + " " + A + `
` + u + ` children [
`;
this.geometry && (r += this.geometry.vrml(u, this.material));
@@ -12118,16 +12118,16 @@ ATOM`, h);
clone(u) {
u === void 0 && (u = new x()), u.name = this.name, u.up.copy(this.up), u.position.copy(this.position), u.rotation instanceof l.Vector3 && this.rotation instanceof l.Vector3 ? u.rotation.copy(this.rotation) : u.rotation = this.rotation, u.eulerOrder = this.eulerOrder, u.scale.copy(this.scale), u.rotationAutoUpdate = this.rotationAutoUpdate, u.matrix.copy(this.matrix), u.matrixWorld.copy(this.matrixWorld), u.quaternion.copy(this.quaternion), u.matrixAutoUpdate = this.matrixAutoUpdate, u.matrixWorldNeedsUpdate = this.matrixWorldNeedsUpdate, u.useQuaternion = this.useQuaternion, u.visible = this.visible;
for (var A = 0; A < this.children.length; A++) {
- var C = this.children[A];
- u.add(C.clone());
+ var L = this.children[A];
+ u.add(L.clone());
}
return u;
}
setVisible(u) {
this.visible = u;
for (var A = 0; A < this.children.length; A++) {
- var C = this.children[A];
- C.setVisible(u);
+ var L = this.children[A];
+ L.setVisible(u);
}
}
}
@@ -12136,32 +12136,32 @@ ATOM`, h);
super(...arguments), this.fog = null, this.overrideMaterial = null, this.matrixAutoUpdate = !1, this.__objects = [], this.__lights = [], this.__objectsAdded = [], this.__objectsRemoved = [];
}
__addObject(u) {
- if (u instanceof p)
+ if (u instanceof g)
this.__lights.indexOf(u) === -1 && this.__lights.push(u), u.target && u.target.parent === void 0 && this.add(u.target);
else if (this.__objects.indexOf(u) === -1) {
this.__objects.push(u), this.__objectsAdded.push(u);
var A = this.__objectsRemoved.indexOf(u);
A !== -1 && this.__objectsRemoved.splice(A, 1);
}
- for (var C = 0; C < u.children.length; C++)
- this.__addObject(u.children[C]);
+ for (var L = 0; L < u.children.length; L++)
+ this.__addObject(u.children[L]);
}
__removeObject(u) {
var A;
- if (u instanceof p)
+ if (u instanceof g)
A = this.__lights.indexOf(u), A !== -1 && this.__lights.splice(A, 1);
else if (A = this.__objects.indexOf(u), A !== -1) {
this.__objects.splice(A, 1), this.__objectsRemoved.push(u);
- var C = this.__objectsAdded.indexOf(u);
- C !== -1 && this.__objectsAdded.splice(A, 1);
+ var L = this.__objectsAdded.indexOf(u);
+ L !== -1 && this.__objectsAdded.splice(A, 1);
}
- for (var L = 0; L < u.children.length; L++)
- this.__removeObject(u.children[L]);
+ for (var C = 0; C < u.children.length; C++)
+ this.__removeObject(u.children[C]);
}
}
- class p extends x {
+ class g extends x {
constructor(u, A = 1) {
- super(), this.position = new l.Vector3(0, 1, 0), this.target = new x(), this.castShadow = !1, this.onlyShadow = !1, this.color = new g.Color(u), this.intensity = A;
+ super(), this.position = new l.Vector3(0, 1, 0), this.target = new x(), this.castShadow = !1, this.onlyShadow = !1, this.color = new p.Color(u), this.intensity = A;
}
}
}
@@ -12185,19 +12185,19 @@ ATOM`, h);
/*! ../math */
"./src/WebGL/math/index.ts"
);
- const g = new l.Matrix4();
+ const p = new l.Matrix4();
class _ {
- static unprojectVector(o, p) {
- return p.projectionMatrixInverse.getInverse(p.projectionMatrix), g.multiplyMatrices(p.matrixWorld, p.projectionMatrixInverse), o.applyProjection(g);
+ static unprojectVector(o, g) {
+ return g.projectionMatrixInverse.getInverse(g.projectionMatrix), p.multiplyMatrices(g.matrixWorld, g.projectionMatrixInverse), o.applyProjection(p);
}
- static projectVector(o, p) {
- return p.matrixWorldInverse.getInverse(p.matrixWorld), g.multiplyMatrices(p.projectionMatrix, p.matrixWorldInverse), o.applyProjection(g);
+ static projectVector(o, g) {
+ return g.matrixWorldInverse.getInverse(g.matrixWorld), p.multiplyMatrices(g.projectionMatrix, g.matrixWorldInverse), o.applyProjection(p);
}
- projectVector(o, p) {
- return _.projectVector(o, p);
+ projectVector(o, g) {
+ return _.projectVector(o, g);
}
- unprojectVector(o, p) {
- return _.unprojectVector(o, p);
+ unprojectVector(o, g) {
+ return _.unprojectVector(o, g);
}
}
}
@@ -12225,7 +12225,7 @@ ATOM`, h);
var l = e(
/*! ../math */
"./src/WebGL/math/index.ts"
- ), g = e(
+ ), p = e(
/*! ../shapes */
"./src/WebGL/shapes/index.ts"
);
@@ -12246,53 +12246,53 @@ ATOM`, h);
return a.sort(_), a;
}
}
- const p = (f) => Math.min(Math.max(f, -1), 1);
- var E = new g.Sphere(), u = new g.Cylinder(), A = new g.Triangle(), C = new l.Vector3(), L = new l.Vector3(), D = new l.Vector3(), r = new l.Vector3(), n = new l.Vector3();
+ const g = (f) => Math.min(Math.max(f, -1), 1);
+ var E = new p.Sphere(), u = new p.Cylinder(), A = new p.Triangle(), L = new l.Vector3(), C = new l.Vector3(), D = new l.Vector3(), r = new l.Vector3(), n = new l.Vector3();
function b(f, c, t, a) {
if (n.getPositionFromMatrix(f.matrixWorld), c.intersectionShape === void 0)
return a;
var h = c.intersectionShape, M = t.linePrecision;
M *= f.matrixWorld.getMaxScaleOnAxis();
var w = M * M;
- if (c.boundingSphere !== void 0 && c.boundingSphere instanceof g.Sphere && (E.copy(c.boundingSphere), E.applyMatrix4(f.matrixWorld), !t.ray.isIntersectionSphere(E)))
+ if (c.boundingSphere !== void 0 && c.boundingSphere instanceof p.Sphere && (E.copy(c.boundingSphere), E.applyMatrix4(f.matrixWorld), !t.ray.isIntersectionSphere(E)))
return a;
- var S, T, R, z, P, B, U, F, $, W, N, G, k, j;
+ var S, T, R, $, P, B, F, U, z, W, V, N, k, G;
for (S = 0, T = h.triangle.length; S < T; S++)
- if (h.triangle[S] instanceof g.Triangle) {
- if (A.copy(h.triangle[S]), A.applyMatrix4(f.matrixWorld), R = A.getNormal(), z = t.ray.direction.dot(R), z >= 0 || (C.subVectors(A.a, t.ray.origin), U = R.dot(C) / z, U < 0))
+ if (h.triangle[S] instanceof p.Triangle) {
+ if (A.copy(h.triangle[S]), A.applyMatrix4(f.matrixWorld), R = A.getNormal(), $ = t.ray.direction.dot(R), $ >= 0 || (L.subVectors(A.a, t.ray.origin), F = R.dot(L) / $, F < 0))
continue;
- L.copy(t.ray.direction).multiplyScalar(U).add(t.ray.origin), L.sub(A.a), D.copy(A.b).sub(A.a), r.copy(A.c).sub(A.a);
- var Q = D.dot(r), ie = D.lengthSq(), pe = r.lengthSq();
- if (G = (ie * L.dot(r) - Q * L.dot(D)) / (ie * pe - Q * Q), G < 0 || G > 1 || (N = (L.dot(D) - G * Q) / ie, N < 0 || N > 1 || N + G > 1))
+ C.copy(t.ray.direction).multiplyScalar(F).add(t.ray.origin), C.sub(A.a), D.copy(A.b).sub(A.a), r.copy(A.c).sub(A.a);
+ var Q = D.dot(r), ie = D.lengthSq(), ge = r.lengthSq();
+ if (N = (ie * C.dot(r) - Q * C.dot(D)) / (ie * ge - Q * Q), N < 0 || N > 1 || (V = (C.dot(D) - N * Q) / ie, V < 0 || V > 1 || V + N > 1))
continue;
- a.push({ clickable: c, distance: U });
+ a.push({ clickable: c, distance: F });
}
for (S = 0, T = h.cylinder.length; S < T; S++)
- if (h.cylinder[S] instanceof g.Cylinder) {
- if (u.copy(h.cylinder[S]), u.applyMatrix4(f.matrixWorld), C.subVectors(u.c1, t.ray.origin), P = C.dot(u.direction), B = C.dot(t.ray.direction), z = p(t.ray.direction.dot(u.direction)), $ = 1 - z * z, $ === 0)
+ if (h.cylinder[S] instanceof p.Cylinder) {
+ if (u.copy(h.cylinder[S]), u.applyMatrix4(f.matrixWorld), L.subVectors(u.c1, t.ray.origin), P = L.dot(u.direction), B = L.dot(t.ray.direction), $ = g(t.ray.direction.dot(u.direction)), z = 1 - $ * $, z === 0)
continue;
- k = (z * B - P) / $, j = (B - z * P) / $, L.copy(u.direction).multiplyScalar(k).add(u.c1), D.copy(t.ray.direction).multiplyScalar(j).add(t.ray.origin), F = r.subVectors(L, D).lengthSq();
- var he = u.radius * u.radius;
- if (F <= he) {
- if (W = (z * P - B) * (z * P - B) - $ * (C.lengthSq() - P * P - he), W <= 0 ? G = U = Math.sqrt(F) : G = U = (B - z * P - Math.sqrt(W)) / $, N = z * G - P, N < 0 || N * N > u.lengthSq() || G < 0)
+ k = ($ * B - P) / z, G = (B - $ * P) / z, C.copy(u.direction).multiplyScalar(k).add(u.c1), D.copy(t.ray.direction).multiplyScalar(G).add(t.ray.origin), U = r.subVectors(C, D).lengthSq();
+ var le = u.radius * u.radius;
+ if (U <= le) {
+ if (W = ($ * P - B) * ($ * P - B) - z * (L.lengthSq() - P * P - le), W <= 0 ? N = F = Math.sqrt(U) : N = F = (B - $ * P - Math.sqrt(W)) / z, V = $ * N - P, V < 0 || V * V > u.lengthSq() || N < 0)
continue;
- a.push({ clickable: c, distance: U });
+ a.push({ clickable: c, distance: F });
}
}
for (S = 0, T = h.line.length; S < T; S += 2) {
- L.copy(h.line[S]), L.applyMatrix4(f.matrixWorld), D.copy(h.line[S + 1]), D.applyMatrix4(f.matrixWorld), r.subVectors(D, L);
- var ue = r.lengthSq();
- r.normalize(), C.subVectors(L, t.ray.origin);
- var se = C.dot(r);
- B = C.dot(t.ray.direction), z = p(t.ray.direction.dot(r)), $ = 1 - z * z, $ !== 0 && (k = (z * B - se) / $, j = (B - z * se) / $, L.add(r.multiplyScalar(k)), D.copy(t.ray.direction).multiplyScalar(j).add(t.ray.origin), F = r.subVectors(D, L).lengthSq(), F < w && k * k < ue && a.push({ clickable: c, distance: j }));
+ C.copy(h.line[S]), C.applyMatrix4(f.matrixWorld), D.copy(h.line[S + 1]), D.applyMatrix4(f.matrixWorld), r.subVectors(D, C);
+ var oe = r.lengthSq();
+ r.normalize(), L.subVectors(C, t.ray.origin);
+ var he = L.dot(r);
+ B = L.dot(t.ray.direction), $ = g(t.ray.direction.dot(r)), z = 1 - $ * $, z !== 0 && (k = ($ * B - he) / z, G = (B - $ * he) / z, C.add(r.multiplyScalar(k)), D.copy(t.ray.direction).multiplyScalar(G).add(t.ray.origin), U = r.subVectors(D, C).lengthSq(), U < w && k * k < oe && a.push({ clickable: c, distance: G }));
}
for (S = 0, T = h.sphere.length; S < T; S++)
- if (h.sphere[S] instanceof g.Sphere && (E.copy(h.sphere[S]), E.applyMatrix4(f.matrixWorld), t.ray.isIntersectionSphere(E))) {
- L.subVectors(E.center, t.ray.origin);
- var ae = L.dot(t.ray.direction);
- if (W = ae * ae - (L.lengthSq() - E.radius * E.radius), ae < 0)
+ if (h.sphere[S] instanceof p.Sphere && (E.copy(h.sphere[S]), E.applyMatrix4(f.matrixWorld), t.ray.isIntersectionSphere(E))) {
+ C.subVectors(E.center, t.ray.origin);
+ var se = C.dot(t.ray.direction);
+ if (W = se * se - (C.lengthSq() - E.radius * E.radius), se < 0)
return a;
- W <= 0 ? U = ae : U = ae - Math.sqrt(W), a.push({ clickable: c, distance: U });
+ W <= 0 ? F = se : F = se - Math.sqrt(W), a.push({ clickable: c, distance: F });
}
return a;
}
@@ -12314,14 +12314,14 @@ ATOM`, h);
/* harmony export */
TextureIdCount: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ../constants/TextureConstants */
"./src/WebGL/constants/TextureConstants.ts"
- ), g = e(
+ ), p = e(
/*! ../math */
"./src/WebGL/math/index.ts"
), _ = e(
@@ -12333,7 +12333,7 @@ ATOM`, h);
);
class o extends _.EventDispatcher {
constructor(u, A) {
- super(), this.id = p++, this.name = "", this.image = u, this.mapping = new x.UVMapping(), this.wrapS = l.ClampToEdgeWrapping, this.wrapT = l.ClampToEdgeWrapping, this.anisotropy = 1, A ? (this.format = l.RFormat, this.type = l.FloatType, this.premultiplyAlpha = !1, this.flipY = !1, this.unpackAlignment = 1, this.magFilter = l.NearestFilter, this.minFilter = l.NearestFilter) : (this.format = l.RGBAFormat, this.type = l.UnsignedByteType, this.offset = new g.Vector2(0, 0), this.repeat = new g.Vector2(1, 1), this.premultiplyAlpha = !1, this.flipY = !0, this.unpackAlignment = 4, this.magFilter = l.LinearFilter, this.minFilter = l.LinearMipMapLinearFilter), this.needsUpdate = !1, this.onUpdate = null;
+ super(), this.id = g++, this.name = "", this.image = u, this.mapping = new x.UVMapping(), this.wrapS = l.ClampToEdgeWrapping, this.wrapT = l.ClampToEdgeWrapping, this.anisotropy = 1, A ? (this.format = l.RFormat, this.type = l.FloatType, this.premultiplyAlpha = !1, this.flipY = !1, this.unpackAlignment = 1, this.magFilter = l.NearestFilter, this.minFilter = l.NearestFilter) : (this.format = l.RGBAFormat, this.type = l.UnsignedByteType, this.offset = new p.Vector2(0, 0), this.repeat = new p.Vector2(1, 1), this.premultiplyAlpha = !1, this.flipY = !0, this.unpackAlignment = 4, this.magFilter = l.LinearFilter, this.minFilter = l.LinearMipMapLinearFilter), this.needsUpdate = !1, this.onUpdate = null;
}
clone(u = new o()) {
return u.image = this.image, u.mapping = this.mapping, u.wrapS = this.wrapS, u.wrapT = this.wrapT, u.magFilter = this.magFilter, u.minFilter = this.minFilter, u.anisotropy = this.anisotropy, u.format = this.format, u.type = this.type, u.offset.copy(this.offset), u.repeat.copy(this.repeat), u.premultiplyAlpha = this.premultiplyAlpha, u.flipY = this.flipY, u.unpackAlignment = this.unpackAlignment, u;
@@ -12342,7 +12342,7 @@ ATOM`, h);
this.dispatchEvent({ type: "dispose" });
}
}
- let p = 0;
+ let g = 0;
}
),
/***/
@@ -12380,17 +12380,17 @@ ATOM`, h);
/* harmony export */
Geometry: () => (
/* reexport safe */
- g.Geometry
+ p.Geometry
),
/* harmony export */
GeometryGroup: () => (
/* reexport safe */
- g.GeometryGroup
+ p.GeometryGroup
),
/* harmony export */
GeometryIDCount: () => (
/* reexport safe */
- g.GeometryIDCount
+ p.GeometryIDCount
),
/* harmony export */
Light: () => (
@@ -12425,12 +12425,12 @@ ATOM`, h);
/* harmony export */
Texture: () => (
/* reexport safe */
- p.Texture
+ g.Texture
),
/* harmony export */
TextureIdCount: () => (
/* reexport safe */
- p.TextureIdCount
+ g.TextureIdCount
),
/* harmony export */
UVMapping: () => (
@@ -12447,7 +12447,7 @@ ATOM`, h);
var l = e(
/*! ./EventDispatcher */
"./src/WebGL/core/EventDispatcher.ts"
- ), g = e(
+ ), p = e(
/*! ./Geometry */
"./src/WebGL/core/Geometry.ts"
), _ = e(
@@ -12459,7 +12459,7 @@ ATOM`, h);
), o = e(
/*! ./Raycaster */
"./src/WebGL/core/Raycaster.ts"
- ), p = e(
+ ), g = e(
/*! ./Texture */
"./src/WebGL/core/Texture.ts"
), E = e(
@@ -12509,7 +12509,7 @@ ATOM`, h);
/* harmony export */
EventDispatcher: () => (
/* reexport safe */
- g.EventDispatcher
+ p.EventDispatcher
),
/* harmony export */
FloatType: () => (
@@ -12529,17 +12529,17 @@ ATOM`, h);
/* harmony export */
Geometry: () => (
/* reexport safe */
- g.Geometry
+ p.Geometry
),
/* harmony export */
GeometryGroup: () => (
/* reexport safe */
- g.GeometryGroup
+ p.GeometryGroup
),
/* harmony export */
GeometryIDCount: () => (
/* reexport safe */
- g.GeometryIDCount
+ p.GeometryIDCount
),
/* harmony export */
ImposterMaterial: () => (
@@ -12554,7 +12554,7 @@ ATOM`, h);
/* harmony export */
Light: () => (
/* reexport safe */
- g.Light
+ p.Light
),
/* harmony export */
Line: () => (
@@ -12629,17 +12629,17 @@ ATOM`, h);
/* harmony export */
Object3D: () => (
/* reexport safe */
- g.Object3D
+ p.Object3D
),
/* harmony export */
Object3DIDCount: () => (
/* reexport safe */
- g.Object3DIDCount
+ p.Object3DIDCount
),
/* harmony export */
Projector: () => (
/* reexport safe */
- g.Projector
+ p.Projector
),
/* harmony export */
Quaternion: () => (
@@ -12669,27 +12669,27 @@ ATOM`, h);
/* harmony export */
Raycaster: () => (
/* reexport safe */
- g.Raycaster
+ p.Raycaster
),
/* harmony export */
Renderer: () => (
/* reexport safe */
- C.Renderer
+ L.Renderer
),
/* harmony export */
Scene: () => (
/* reexport safe */
- g.Scene
+ p.Scene
),
/* harmony export */
ShaderLib: () => (
/* reexport safe */
- p.ShaderLib
+ g.ShaderLib
),
/* harmony export */
ShaderUtils: () => (
/* reexport safe */
- p.ShaderUtils
+ g.ShaderUtils
),
/* harmony export */
Shading: () => (
@@ -12729,7 +12729,7 @@ ATOM`, h);
/* harmony export */
SpritePlugin: () => (
/* reexport safe */
- L.SpritePlugin
+ C.SpritePlugin
),
/* harmony export */
StickImposterMaterial: () => (
@@ -12744,12 +12744,12 @@ ATOM`, h);
/* harmony export */
Texture: () => (
/* reexport safe */
- g.Texture
+ p.Texture
),
/* harmony export */
TextureIdCount: () => (
/* reexport safe */
- g.TextureIdCount
+ p.TextureIdCount
),
/* harmony export */
TextureOperations: () => (
@@ -12764,7 +12764,7 @@ ATOM`, h);
/* harmony export */
UVMapping: () => (
/* reexport safe */
- g.UVMapping
+ p.UVMapping
),
/* harmony export */
UnsignedByteType: () => (
@@ -12789,7 +12789,7 @@ ATOM`, h);
/* harmony export */
basic: () => (
/* reexport safe */
- p.basic
+ g.basic
),
/* harmony export */
clamp: () => (
@@ -12799,7 +12799,7 @@ ATOM`, h);
/* harmony export */
clone: () => (
/* reexport safe */
- p.clone
+ g.clone
),
/* harmony export */
conversionMatrix3: () => (
@@ -12814,74 +12814,74 @@ ATOM`, h);
/* harmony export */
instanced: () => (
/* reexport safe */
- p.instanced
+ g.instanced
),
/* harmony export */
intersectObject: () => (
/* reexport safe */
- g.intersectObject
+ p.intersectObject
),
/* harmony export */
lambert: () => (
/* reexport safe */
- p.lambert
+ g.lambert
),
/* harmony export */
lambertdouble: () => (
/* reexport safe */
- p.lambertdouble
+ g.lambertdouble
),
/* harmony export */
outline: () => (
/* reexport safe */
- p.outline
+ g.outline
),
/* harmony export */
screen: () => (
/* reexport safe */
- p.screen
+ g.screen
),
/* harmony export */
screenaa: () => (
/* reexport safe */
- p.screenaa
+ g.screenaa
),
/* harmony export */
sphereimposter: () => (
/* reexport safe */
- p.sphereimposter
+ g.sphereimposter
),
/* harmony export */
sphereimposteroutline: () => (
/* reexport safe */
- p.sphereimposteroutline
+ g.sphereimposteroutline
),
/* harmony export */
sprite: () => (
/* reexport safe */
- p.sprite
+ g.sprite
),
/* harmony export */
stickimposter: () => (
/* reexport safe */
- p.stickimposter
+ g.stickimposter
),
/* harmony export */
stickimposteroutline: () => (
/* reexport safe */
- p.stickimposteroutline
+ g.stickimposteroutline
),
/* harmony export */
volumetric: () => (
/* reexport safe */
- p.volumetric
+ g.volumetric
)
/* harmony export */
});
var l = e(
/*! ./constants */
"./src/WebGL/constants/index.ts"
- ), g = e(
+ ), p = e(
/*! ./core */
"./src/WebGL/core/index.ts"
), _ = e(
@@ -12893,7 +12893,7 @@ ATOM`, h);
), o = e(
/*! ./objects */
"./src/WebGL/objects/index.ts"
- ), p = e(
+ ), g = e(
/*! ./shaders */
"./src/WebGL/shaders/index.ts"
), E = e(
@@ -12905,10 +12905,10 @@ ATOM`, h);
), A = e(
/*! ./Fog */
"./src/WebGL/Fog.ts"
- ), C = e(
+ ), L = e(
/*! ./Renderer */
"./src/WebGL/Renderer.ts"
- ), L = e(
+ ), C = e(
/*! ./SpritePlugin */
"./src/WebGL/SpritePlugin.ts"
);
@@ -12925,14 +12925,14 @@ ATOM`, h);
/* harmony export */
ImposterMaterial: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ./../constants/Coloring */
"./src/WebGL/constants/Coloring.ts"
- ), g = e(
+ ), p = e(
/*! ./../constants/Shading */
"./src/WebGL/constants/Shading.ts"
), _ = e(
@@ -12945,11 +12945,11 @@ ATOM`, h);
/*! ./Material */
"./src/WebGL/materials/Material.ts"
);
- class p extends o.Material {
+ class g extends o.Material {
constructor(u) {
- super(), this.color = new _.Color(16777215), this.ambient = new _.Color(1048575), this.emissive = new _.Color(0), this.imposter = !0, this.wrapAround = !1, this.wrapRGB = new x.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = g.Shading.SmoothShading, this.shaderID = null, this.vertexColors = l.Coloring.NoColors, this.skinning = !1, this.setValues(u);
+ super(), this.color = new _.Color(16777215), this.ambient = new _.Color(1048575), this.emissive = new _.Color(0), this.imposter = !0, this.wrapAround = !1, this.wrapRGB = new x.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = p.Shading.SmoothShading, this.shaderID = null, this.vertexColors = l.Coloring.NoColors, this.skinning = !1, this.setValues(u);
}
- clone(u = new p()) {
+ clone(u = new g()) {
return super.clone.call(this, u), u.color.copy(this.color), u.ambient.copy(this.ambient), u.emissive.copy(this.emissive), u.wrapAround = this.wrapAround, u.wrapRGB.copy(this.wrapRGB), u.map = this.map, u.lightMap = this.lightMap, u.specularMap = this.specularMap, u.envMap = this.envMap, u.combine = this.combine, u.reflectivity = this.reflectivity, u.refractionRatio = this.refractionRatio, u.fog = this.fog, u.shading = this.shading, u.shaderID = this.shaderID, u.vertexColors = this.vertexColors, u.skinning = this.skinning, u.morphTargets = this.morphTargets, u.morphNormals = this.morphNormals, u;
}
}
@@ -12966,14 +12966,14 @@ ATOM`, h);
/* harmony export */
InstancedMaterial: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ../constants/Coloring */
"./src/WebGL/constants/Coloring.ts"
- ), g = e(
+ ), p = e(
/*! ../constants/Shading */
"./src/WebGL/constants/Shading.ts"
), _ = e(
@@ -12986,11 +12986,11 @@ ATOM`, h);
/*! ./Material */
"./src/WebGL/materials/Material.ts"
);
- class p extends o.Material {
+ class g extends o.Material {
constructor(u) {
- super(), this.color = new _.Color(16777215), this.ambient = new _.Color(1048575), this.emissive = new _.Color(0), this.wrapAround = !1, this.wrapRGB = new x.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = g.Shading.SmoothShading, this.shaderID = "instanced", this.vertexColors = l.Coloring.NoColors, this.skinning = !1, this.sphere = null, this.setValues(u);
+ super(), this.color = new _.Color(16777215), this.ambient = new _.Color(1048575), this.emissive = new _.Color(0), this.wrapAround = !1, this.wrapRGB = new x.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = p.Shading.SmoothShading, this.shaderID = "instanced", this.vertexColors = l.Coloring.NoColors, this.skinning = !1, this.sphere = null, this.setValues(u);
}
- clone(u = new p()) {
+ clone(u = new g()) {
return super.clone.call(this, u), u.color.copy(this.color), u.ambient.copy(this.ambient), u.emissive.copy(this.emissive), u.wrapAround = this.wrapAround, u.wrapRGB.copy(this.wrapRGB), u.map = this.map, u.lightMap = this.lightMap, u.specularMap = this.specularMap, u.envMap = this.envMap, u.combine = this.combine, u.reflectivity = this.reflectivity, u.refractionRatio = this.refractionRatio, u.fog = this.fog, u.shading = this.shading, u.shaderID = this.shaderID, u.vertexColors = this.vertexColors, u.skinning = this.skinning, u.morphTargets = this.morphTargets, u.morphNormals = this.morphNormals, u.sphere = this.sphere, u;
}
}
@@ -13014,11 +13014,11 @@ ATOM`, h);
var l = e(
/*! ../../colors */
"./src/colors.ts"
- ), g = e(
+ ), p = e(
/*! ./Material */
"./src/WebGL/materials/Material.ts"
);
- class _ extends g.Material {
+ class _ extends p.Material {
constructor(o) {
super(), this.color = new l.Color(16777215), this.linewidth = 1, this.linecap = "round", this.linejoin = "round", this.vertexColors = !1, this.fog = !0, this.shaderID = "basic", this.setValues(o);
}
@@ -13044,14 +13044,14 @@ ATOM`, h);
/* harmony export */
MaterialIdCount: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ../constants/Sides */
"./src/WebGL/constants/Sides.ts"
- ), g = e(
+ ), p = e(
/*! ../core */
"./src/WebGL/core/index.ts"
), _ = e(
@@ -13061,21 +13061,21 @@ ATOM`, h);
/*! ../../colors */
"./src/colors.ts"
);
- class o extends g.EventDispatcher {
+ class o extends p.EventDispatcher {
constructor() {
- super(...arguments), this.id = p++, this.name = "", this.side = l.FrontSide, this.opacity = 1, this.transparent = !1, this.depthTest = !0, this.depthWrite = !0, this.stencilTest = !0, this.polygonOffset = !1, this.polygonOffsetFactor = 0, this.polygonOffsetUnits = 0, this.alphaTest = 0, this.visible = !0, this.needsUpdate = !0, this.outline = !1, this.wireframe = !1;
+ super(...arguments), this.id = g++, this.name = "", this.side = l.FrontSide, this.opacity = 1, this.transparent = !1, this.depthTest = !0, this.depthWrite = !0, this.stencilTest = !0, this.polygonOffset = !1, this.polygonOffsetFactor = 0, this.polygonOffsetUnits = 0, this.alphaTest = 0, this.visible = !0, this.needsUpdate = !0, this.outline = !1, this.wireframe = !1;
}
setValues(u = {}) {
if (u !== void 0)
for (var A in u) {
- var C = u[A];
- if (C === void 0) {
+ var L = u[A];
+ if (L === void 0) {
console.warn("$3Dmol.Material: '" + A + "' parameter is undefined.");
continue;
}
if (A in this) {
- var L = this[A];
- L instanceof x.Color && C instanceof x.Color ? L.copy(C) : L instanceof x.Color ? L.set(C) : L instanceof _.Vector3 && C instanceof _.Vector3 ? L.copy(C) : this[A] = C;
+ var C = this[A];
+ C instanceof x.Color && L instanceof x.Color ? C.copy(L) : C instanceof x.Color ? C.set(L) : C instanceof _.Vector3 && L instanceof _.Vector3 ? C.copy(L) : this[A] = L;
}
}
}
@@ -13087,7 +13087,7 @@ ATOM`, h);
this.dispatchEvent({ type: "dispose" });
}
}
- let p = 0;
+ let g = 0;
}
),
/***/
@@ -13108,11 +13108,11 @@ ATOM`, h);
var l = e(
/*! ./../constants/Sides */
"./src/WebGL/constants/Sides.ts"
- ), g = e(
+ ), p = e(
/*! ./MeshLambertMaterial */
"./src/WebGL/materials/MeshLambertMaterial.ts"
);
- class _ extends g.MeshLambertMaterial {
+ class _ extends p.MeshLambertMaterial {
constructor(o) {
super(o), this.shaderID = "lambertdouble", this.side = l.DoubleSide, this.outline = !1;
}
@@ -13133,14 +13133,14 @@ ATOM`, h);
/* harmony export */
MeshLambertMaterial: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ./../constants/Coloring */
"./src/WebGL/constants/Coloring.ts"
- ), g = e(
+ ), p = e(
/*! ./../constants/Shading */
"./src/WebGL/constants/Shading.ts"
), _ = e(
@@ -13153,11 +13153,11 @@ ATOM`, h);
/*! ../math */
"./src/WebGL/math/index.ts"
);
- class p extends _.Material {
+ class g extends _.Material {
constructor(u) {
- super(), this.color = new x.Color(16777215), this.ambient = new x.Color(1048575), this.emissive = new x.Color(0), this.wrapAround = !1, this.wrapRGB = new o.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = g.Shading.SmoothShading, this.shaderID = "lambert", this.vertexColors = l.Coloring.NoColors, this.skinning = !1, this.setValues(u);
+ super(), this.color = new x.Color(16777215), this.ambient = new x.Color(1048575), this.emissive = new x.Color(0), this.wrapAround = !1, this.wrapRGB = new o.Vector3(1, 1, 1), this.map = void 0, this.lightMap = null, this.specularMap = null, this.envMap = null, this.reflectivity = 1, this.refractionRatio = 0.98, this.fog = !0, this.wireframe = !1, this.wireframeLinewidth = 1, this.wireframeLinecap = "round", this.wireframeLinejoin = "round", this.shading = p.Shading.SmoothShading, this.shaderID = "lambert", this.vertexColors = l.Coloring.NoColors, this.skinning = !1, this.setValues(u);
}
- clone(u = new p()) {
+ clone(u = new g()) {
return super.clone.call(this, u), u.color.copy(this.color), u.ambient.copy(this.ambient), u.emissive.copy(this.emissive), u.wrapAround = this.wrapAround, u.wrapRGB.copy(this.wrapRGB), u.map = this.map, u.lightMap = this.lightMap, u.specularMap = this.specularMap, u.envMap = this.envMap, u.combine = this.combine, u.reflectivity = this.reflectivity, u.refractionRatio = this.refractionRatio, u.fog = this.fog, u.shading = this.shading, u.shaderID = this.shaderID, u.vertexColors = this.vertexColors, u.skinning = this.skinning, u.morphTargets = this.morphTargets, u.morphNormals = this.morphNormals, u;
}
}
@@ -13181,11 +13181,11 @@ ATOM`, h);
var l = e(
/*! ../../colors */
"./src/colors.ts"
- ), g = e(
+ ), p = e(
/*! ./Material */
"./src/WebGL/materials/Material.ts"
);
- class _ extends g.Material {
+ class _ extends p.Material {
constructor(o) {
super(), o = o || {}, this.fog = !0, this.shaderID = "outline", this.wireframe = !1, this.outlineColor = o.color || new l.Color(0, 0, 0), this.outlineWidth = o.width || 0.1, this.outlinePushback = o.pushback || 1;
}
@@ -13206,7 +13206,7 @@ ATOM`, h);
/* harmony export */
SphereImposterMaterial: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -13214,11 +13214,11 @@ ATOM`, h);
/*! ./ImposterMaterial */
"./src/WebGL/materials/ImposterMaterial.ts"
);
- class g extends l.ImposterMaterial {
+ class p extends l.ImposterMaterial {
constructor(x) {
super(x), this.shaderID = "sphereimposter", this.setValues(x);
}
- clone(x = new g()) {
+ clone(x = new p()) {
return super.clone.call(this, x), x;
}
}
@@ -13242,11 +13242,11 @@ ATOM`, h);
var l = e(
/*! ../../colors */
"./src/colors.ts"
- ), g = e(
+ ), p = e(
/*! ./ImposterMaterial */
"./src/WebGL/materials/ImposterMaterial.ts"
);
- class _ extends g.ImposterMaterial {
+ class _ extends p.ImposterMaterial {
constructor(o) {
super(o), o = o || {}, this.shaderID = "sphereimposteroutline", this.outlineColor = o.color || new l.Color(0, 0, 0), this.outlineWidth = o.width || 0.1, this.outlinePushback = o.pushback || 1, this.setValues(o);
}
@@ -13267,14 +13267,14 @@ ATOM`, h);
/* harmony export */
SpriteMaterial: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ../constants/SpriteAlignment */
"./src/WebGL/constants/SpriteAlignment.ts"
- ), g = e(
+ ), p = e(
/*! ../core/Texture */
"./src/WebGL/core/Texture.ts"
), _ = e(
@@ -13287,11 +13287,11 @@ ATOM`, h);
/*! ./Material */
"./src/WebGL/materials/Material.ts"
);
- class p extends o.Material {
+ class g extends o.Material {
constructor(u) {
- super(), this.color = new _.Color(16777215), this.map = new g.Texture(), this.useScreenCoordinates = !0, this.fog = !1, this.uvOffset = new x.Vector2(0, 0), this.uvScale = new x.Vector2(1, 1), this.depthTest = !this.useScreenCoordinates, this.sizeAttenuation = !this.useScreenCoordinates, this.screenOffset = this.screenOffset, this.scaleByViewPort = !this.sizeAttenuation, this.alignment = l.SpriteAlignment.center.clone(), this.setValues(u), u = u || {}, u.depthTest === void 0 && (this.depthTest = !this.useScreenCoordinates), u.sizeAttenuation === void 0 && (this.sizeAttenuation = !this.useScreenCoordinates), u.scaleByViewPort === void 0 && (this.scaleByViewPort = !this.sizeAttenuation);
+ super(), this.color = new _.Color(16777215), this.map = new p.Texture(), this.useScreenCoordinates = !0, this.fog = !1, this.uvOffset = new x.Vector2(0, 0), this.uvScale = new x.Vector2(1, 1), this.depthTest = !this.useScreenCoordinates, this.sizeAttenuation = !this.useScreenCoordinates, this.screenOffset = this.screenOffset, this.scaleByViewPort = !this.sizeAttenuation, this.alignment = l.SpriteAlignment.center.clone(), this.setValues(u), u = u || {}, u.depthTest === void 0 && (this.depthTest = !this.useScreenCoordinates), u.sizeAttenuation === void 0 && (this.sizeAttenuation = !this.useScreenCoordinates), u.scaleByViewPort === void 0 && (this.scaleByViewPort = !this.sizeAttenuation);
}
- clone(u = new p()) {
+ clone(u = new g()) {
return super.clone.call(this, u), u.color.copy(this.color), u.map = this.map, u.useScreenCoordinates = this.useScreenCoordinates, u.screenOffset = this.screenOffset, u.sizeAttenuation = this.sizeAttenuation, u.scaleByViewport = this.scaleByViewPort, u.alignment.copy(this.alignment), u.uvOffset.copy(this.uvOffset), u;
}
}
@@ -13308,7 +13308,7 @@ ATOM`, h);
/* harmony export */
StickImposterMaterial: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -13316,11 +13316,11 @@ ATOM`, h);
/*! ./ImposterMaterial */
"./src/WebGL/materials/ImposterMaterial.ts"
);
- class g extends l.ImposterMaterial {
+ class p extends l.ImposterMaterial {
constructor(x) {
super(x), this.shaderID = "stickimposter", this.setValues(x);
}
- clone(x = new g()) {
+ clone(x = new p()) {
return super.clone.call(this, x), x;
}
}
@@ -13344,11 +13344,11 @@ ATOM`, h);
var l = e(
/*! ../../colors */
"./src/colors.ts"
- ), g = e(
+ ), p = e(
/*! ./ImposterMaterial */
"./src/WebGL/materials/ImposterMaterial.ts"
);
- class _ extends g.ImposterMaterial {
+ class _ extends p.ImposterMaterial {
constructor(o = {}) {
super(o), this.shaderID = "stickimposteroutline", this.outlineColor = new l.Color(0, 0, 0), this.outlineWidth = 0.1, this.outlinePushback = 1, o.color && (this.outlineColor = o.color), o.width && (this.outlineWidth = o.width), o.pushback && (this.outlinePushback = o.pushback), this.setValues(o);
}
@@ -13376,7 +13376,7 @@ ATOM`, h);
var l = e(
/*! ../constants/Sides */
"./src/WebGL/constants/Sides.ts"
- ), g = e(
+ ), p = e(
/*! ../../colors */
"./src/colors.ts"
), _ = e(
@@ -13384,11 +13384,11 @@ ATOM`, h);
"./src/WebGL/materials/Material.ts"
);
class x extends _.Material {
- constructor(p) {
- super(), this.transparent = !1, this.volumetric = !0, this.color = new g.Color(16777215), this.transferfn = null, this.map = void 0, this.extent = [], this.maxdepth = 100, this.unit = 0, this.texmatrix = null, this.transfermin = -1, this.transfermax = 1, this.subsamples = 5, this.shaderID = "volumetric", this.side = l.FrontSide, this.setValues(p);
+ constructor(g) {
+ super(), this.transparent = !1, this.volumetric = !0, this.color = new p.Color(16777215), this.transferfn = null, this.map = void 0, this.extent = [], this.maxdepth = 100, this.unit = 0, this.texmatrix = null, this.transfermin = -1, this.transfermax = 1, this.subsamples = 5, this.shaderID = "volumetric", this.side = l.FrontSide, this.setValues(g);
}
- clone(p = new x()) {
- return super.clone.call(this, p), p.transparent = this.transparent, p.volumetric = this.volumetric, p.color = this.color, p.transferfn = this.transferfn, p.map = this.map, p.extent = this.extent, p.maxdepth = this.maxdepth, p.unit = this.unit, p.texmatrix = this.texmatrix, p.transfermin = this.transfermin, p.transfermax = this.transfermax, p.subsamples = this.subsamples, p.shaderID = this.shaderID, p.side = this.side, p;
+ clone(g = new x()) {
+ return super.clone.call(this, g), g.transparent = this.transparent, g.volumetric = this.volumetric, g.color = this.color, g.transferfn = this.transferfn, g.map = this.map, g.extent = this.extent, g.maxdepth = this.maxdepth, g.unit = this.unit, g.texmatrix = this.texmatrix, g.transfermin = this.transfermin, g.transfermax = this.transfermax, g.subsamples = this.subsamples, g.shaderID = this.shaderID, g.side = this.side, g;
}
}
}
@@ -13409,7 +13409,7 @@ ATOM`, h);
/* harmony export */
InstancedMaterial: () => (
/* reexport safe */
- g.InstancedMaterial
+ p.InstancedMaterial
),
/* harmony export */
LineBasicMaterial: () => (
@@ -13434,7 +13434,7 @@ ATOM`, h);
/* harmony export */
MeshLambertMaterial: () => (
/* reexport safe */
- p.MeshLambertMaterial
+ g.MeshLambertMaterial
),
/* harmony export */
MeshOutlineMaterial: () => (
@@ -13454,12 +13454,12 @@ ATOM`, h);
/* harmony export */
SpriteMaterial: () => (
/* reexport safe */
- C.SpriteMaterial
+ L.SpriteMaterial
),
/* harmony export */
StickImposterMaterial: () => (
/* reexport safe */
- L.StickImposterMaterial
+ C.StickImposterMaterial
),
/* harmony export */
StickImposterOutlineMaterial: () => (
@@ -13476,7 +13476,7 @@ ATOM`, h);
var l = e(
/*! ./ImposterMaterial */
"./src/WebGL/materials/ImposterMaterial.ts"
- ), g = e(
+ ), p = e(
/*! ./InstancedMaterial */
"./src/WebGL/materials/InstancedMaterial.ts"
), _ = e(
@@ -13488,7 +13488,7 @@ ATOM`, h);
), o = e(
/*! ./MeshDoubleLambertMaterial */
"./src/WebGL/materials/MeshDoubleLambertMaterial.ts"
- ), p = e(
+ ), g = e(
/*! ./MeshLambertMaterial */
"./src/WebGL/materials/MeshLambertMaterial.ts"
), E = e(
@@ -13500,10 +13500,10 @@ ATOM`, h);
), A = e(
/*! ./SphereImposterOutlineMaterial */
"./src/WebGL/materials/SphereImposterOutlineMaterial.ts"
- ), C = e(
+ ), L = e(
/*! ./SpriteMaterial */
"./src/WebGL/materials/SpriteMaterial.ts"
- ), L = e(
+ ), C = e(
/*! ./StickImposterMaterial */
"./src/WebGL/materials/StickImposterMaterial.ts"
), D = e(
@@ -13531,11 +13531,11 @@ ATOM`, h);
/* harmony export */
});
class l {
- constructor(_, x, o, p) {
- this.x = _ || 0, this.y = x || 0, this.z = o || 0, this.w = p !== void 0 ? p : 1;
+ constructor(_, x, o, g) {
+ this.x = _ || 0, this.y = x || 0, this.z = o || 0, this.w = g !== void 0 ? g : 1;
}
- set(_, x, o, p) {
- return this.x = _, this.y = x, this.z = o, this.w = p, this;
+ set(_, x, o, g) {
+ return this.x = _, this.y = x, this.z = o, this.w = g, this;
}
copy(_) {
return this.x = _.x, this.y = _.y, this.z = _.z, this.w = _.w, this;
@@ -13563,8 +13563,8 @@ ATOM`, h);
return this.x *= _, this.y *= _, this.z *= _, this.w *= _, this;
}
multiplyQuaternions(_, x) {
- const o = _.x, p = _.y, E = _.z, u = _.w, A = x.x, C = x.y, L = x.z, D = x.w;
- return this.x = o * D + u * A + p * L - E * C, this.y = p * D + u * C + E * A - o * L, this.z = E * D + u * L + o * C - p * A, this.w = u * D - o * A - p * C - E * L, this;
+ const o = _.x, g = _.y, E = _.z, u = _.w, A = x.x, L = x.y, C = x.z, D = x.w;
+ return this.x = o * D + u * A + g * C - E * L, this.y = g * D + u * L + E * A - o * C, this.z = E * D + u * C + o * L - g * A, this.w = u * D - o * A - g * L - E * C, this;
}
sub(_) {
return this.x -= _.x, this.y -= _.y, this.z -= _.z, this.w -= _.w, this;
@@ -13573,8 +13573,8 @@ ATOM`, h);
return new l(this.x, this.y, this.z, this.w);
}
setFromEuler(_) {
- const x = Math.cos(_.x / 2), o = Math.cos(_.y / 2), p = Math.cos(_.z / 2), E = Math.sin(_.x / 2), u = Math.sin(_.y / 2), A = Math.sin(_.z / 2);
- return this.x = E * o * p + x * u * A, this.y = x * u * p - E * o * A, this.z = x * o * A + E * u * p, this.w = x * o * p - E * u * A, this;
+ const x = Math.cos(_.x / 2), o = Math.cos(_.y / 2), g = Math.cos(_.z / 2), E = Math.sin(_.x / 2), u = Math.sin(_.y / 2), A = Math.sin(_.z / 2);
+ return this.x = E * o * g + x * u * A, this.y = x * u * g - E * o * A, this.z = x * o * A + E * u * g, this.w = x * o * g - E * u * A, this;
}
}
}
@@ -13624,12 +13624,12 @@ ATOM`, h);
/* harmony export */
Matrix3: () => (
/* reexport safe */
- p.Matrix3
+ g.Matrix3
),
/* harmony export */
Matrix4: () => (
/* reexport safe */
- p.Matrix4
+ g.Matrix4
),
/* harmony export */
Quaternion: () => (
@@ -13639,17 +13639,17 @@ ATOM`, h);
/* harmony export */
Ray: () => (
/* reexport safe */
- p.Ray
+ g.Ray
),
/* harmony export */
Vector2: () => (
/* reexport safe */
- g.Vector2
+ p.Vector2
),
/* harmony export */
Vector3: () => (
/* reexport safe */
- p.Vector3
+ g.Vector3
),
/* harmony export */
clamp: () => (
@@ -13671,7 +13671,7 @@ ATOM`, h);
var l = e(
/*! ./Quaternion */
"./src/WebGL/math/Quaternion.ts"
- ), g = e(
+ ), p = e(
/*! ./Vector2 */
"./src/WebGL/math/Vector2.ts"
), _ = e(
@@ -13683,7 +13683,7 @@ ATOM`, h);
), o = e(
/*! ./utils/degToRad */
"./src/WebGL/math/utils/degToRad.ts"
- ), p = e(
+ ), g = e(
/*! ./math */
"./src/WebGL/math/math.ts"
);
@@ -13700,7 +13700,7 @@ ATOM`, h);
/* harmony export */
Matrix3: () => (
/* binding */
- C
+ L
),
/* harmony export */
Matrix4: () => (
@@ -13710,7 +13710,7 @@ ATOM`, h);
/* harmony export */
Ray: () => (
/* binding */
- L
+ C
),
/* harmony export */
Vector3: () => (
@@ -13722,21 +13722,21 @@ ATOM`, h);
var l = e(
/*! ./utils/degToRad */
"./src/WebGL/math/utils/degToRad.ts"
- ), g = e(
+ ), p = e(
/*! ./utils/clamp */
"./src/WebGL/math/utils/clamp.ts"
- ), _, x, o, p, E;
+ ), _, x, o, g, E;
class u {
- constructor(r = 1, n = 0, b = 0, f = 0, c = 0, t = 1, a = 0, h = 0, M = 0, w = 0, S = 1, T = 0, R = 0, z = 0, P = 0, B = 1) {
- typeof r < "u" && typeof r != "number" ? this.elements = new Float32Array(r) : (this.elements = new Float32Array(16), this.elements[0] = r, this.elements[4] = n, this.elements[8] = b, this.elements[12] = f, this.elements[1] = c, this.elements[5] = t, this.elements[9] = a, this.elements[13] = h, this.elements[2] = M, this.elements[6] = w, this.elements[10] = S, this.elements[14] = T, this.elements[3] = R, this.elements[7] = z, this.elements[11] = P, this.elements[15] = B);
+ constructor(r = 1, n = 0, b = 0, f = 0, c = 0, t = 1, a = 0, h = 0, M = 0, w = 0, S = 1, T = 0, R = 0, $ = 0, P = 0, B = 1) {
+ typeof r < "u" && typeof r != "number" ? this.elements = new Float32Array(r) : (this.elements = new Float32Array(16), this.elements[0] = r, this.elements[4] = n, this.elements[8] = b, this.elements[12] = f, this.elements[1] = c, this.elements[5] = t, this.elements[9] = a, this.elements[13] = h, this.elements[2] = M, this.elements[6] = w, this.elements[10] = S, this.elements[14] = T, this.elements[3] = R, this.elements[7] = $, this.elements[11] = P, this.elements[15] = B);
}
// eslint-disable-next-line no-unused-vars, class-methods-use-this
makeScale(r, n, b) {
throw new Error("Method not implemented.");
}
- set(r, n, b, f, c, t, a, h, M, w, S, T, R, z, P, B) {
- const U = this.elements;
- return U[0] = r, U[4] = n, U[8] = b, U[12] = f, U[1] = c, U[5] = t, U[9] = a, U[13] = h, U[2] = M, U[6] = w, U[10] = S, U[14] = T, U[3] = R, U[7] = z, U[11] = P, U[15] = B, this;
+ set(r, n, b, f, c, t, a, h, M, w, S, T, R, $, P, B) {
+ const F = this.elements;
+ return F[0] = r, F[4] = n, F[8] = b, F[12] = f, F[1] = c, F[5] = t, F[9] = a, F[13] = h, F[2] = M, F[6] = w, F[10] = S, F[14] = T, F[3] = R, F[7] = $, F[11] = P, F[15] = B, this;
}
identity() {
return this.set(1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1), this;
@@ -13747,24 +13747,24 @@ ATOM`, h);
}
matrix3FromTopLeft() {
const r = this.elements;
- return new C(r[0], r[4], r[8], r[1], r[5], r[9], r[2], r[6], r[10]);
+ return new L(r[0], r[4], r[8], r[1], r[5], r[9], r[2], r[6], r[10]);
}
setRotationFromEuler(r, n) {
const b = this.elements, { x: f, y: c, z: t } = r, a = Math.cos(f), h = Math.sin(f), M = Math.cos(c), w = Math.sin(c), S = Math.cos(t), T = Math.sin(t);
if (n === void 0 || n === "XYZ") {
- const R = a * S, z = a * T, P = h * S, B = h * T;
- b[0] = M * S, b[4] = -M * T, b[8] = w, b[1] = z + P * w, b[5] = R - B * w, b[9] = -h * M, b[2] = B - R * w, b[6] = P + z * w, b[10] = a * M;
+ const R = a * S, $ = a * T, P = h * S, B = h * T;
+ b[0] = M * S, b[4] = -M * T, b[8] = w, b[1] = $ + P * w, b[5] = R - B * w, b[9] = -h * M, b[2] = B - R * w, b[6] = P + $ * w, b[10] = a * M;
} else
console.error(`Error with matrix4 setRotationFromEuler. Order: ${n}`);
return this;
}
setRotationFromQuaternion(r) {
- const n = this.elements, { x: b, y: f, z: c, w: t } = r, a = b + b, h = f + f, M = c + c, w = b * a, S = b * h, T = b * M, R = f * h, z = f * M, P = c * M, B = t * a, U = t * h, F = t * M;
- return n[0] = 1 - (R + P), n[4] = S - F, n[8] = T + U, n[1] = S + F, n[5] = 1 - (w + P), n[9] = z - B, n[2] = T - U, n[6] = z + B, n[10] = 1 - (w + R), this;
+ const n = this.elements, { x: b, y: f, z: c, w: t } = r, a = b + b, h = f + f, M = c + c, w = b * a, S = b * h, T = b * M, R = f * h, $ = f * M, P = c * M, B = t * a, F = t * h, U = t * M;
+ return n[0] = 1 - (R + P), n[4] = S - U, n[8] = T + F, n[1] = S + U, n[5] = 1 - (w + P), n[9] = $ - B, n[2] = T - F, n[6] = $ + B, n[10] = 1 - (w + R), this;
}
multiplyMatrices(r, n) {
- const b = r.elements, f = n.elements, c = this.elements, t = b[0], a = b[4], h = b[8], M = b[12], w = b[1], S = b[5], T = b[9], R = b[13], z = b[2], P = b[6], B = b[10], U = b[14], F = b[3], $ = b[7], W = b[11], N = b[15], G = f[0], k = f[4], j = f[8], Q = f[12], ie = f[1], pe = f[5], he = f[9], ue = f[13], se = f[2], ae = f[6], we = f[10], xe = f[14], Ie = f[3], oe = f[7], ve = f[11], re = f[15];
- return c[0] = t * G + a * ie + h * se + M * Ie, c[4] = t * k + a * pe + h * ae + M * oe, c[8] = t * j + a * he + h * we + M * ve, c[12] = t * Q + a * ue + h * xe + M * re, c[1] = w * G + S * ie + T * se + R * Ie, c[5] = w * k + S * pe + T * ae + R * oe, c[9] = w * j + S * he + T * we + R * ve, c[13] = w * Q + S * ue + T * xe + R * re, c[2] = z * G + P * ie + B * se + U * Ie, c[6] = z * k + P * pe + B * ae + U * oe, c[10] = z * j + P * he + B * we + U * ve, c[14] = z * Q + P * ue + B * xe + U * re, c[3] = F * G + $ * ie + W * se + N * Ie, c[7] = F * k + $ * pe + W * ae + N * oe, c[11] = F * j + $ * he + W * we + N * ve, c[15] = F * Q + $ * ue + W * xe + N * re, this;
+ const b = r.elements, f = n.elements, c = this.elements, t = b[0], a = b[4], h = b[8], M = b[12], w = b[1], S = b[5], T = b[9], R = b[13], $ = b[2], P = b[6], B = b[10], F = b[14], U = b[3], z = b[7], W = b[11], V = b[15], N = f[0], k = f[4], G = f[8], Q = f[12], ie = f[1], ge = f[5], le = f[9], oe = f[13], he = f[2], se = f[6], xe = f[10], ye = f[14], Pe = f[3], de = f[7], pe = f[11], re = f[15];
+ return c[0] = t * N + a * ie + h * he + M * Pe, c[4] = t * k + a * ge + h * se + M * de, c[8] = t * G + a * le + h * xe + M * pe, c[12] = t * Q + a * oe + h * ye + M * re, c[1] = w * N + S * ie + T * he + R * Pe, c[5] = w * k + S * ge + T * se + R * de, c[9] = w * G + S * le + T * xe + R * pe, c[13] = w * Q + S * oe + T * ye + R * re, c[2] = $ * N + P * ie + B * he + F * Pe, c[6] = $ * k + P * ge + B * se + F * de, c[10] = $ * G + P * le + B * xe + F * pe, c[14] = $ * Q + P * oe + B * ye + F * re, c[3] = U * N + z * ie + W * he + V * Pe, c[7] = U * k + z * ge + W * se + V * de, c[11] = U * G + z * le + W * xe + V * pe, c[15] = U * Q + z * oe + W * ye + V * re, this;
}
multiplyScalar(r) {
const n = this.elements;
@@ -13797,16 +13797,16 @@ ATOM`, h);
return n[12] += r.x, n[13] += r.y, n[14] += r.z, this;
}
getInverse(r, n) {
- const b = this.elements, f = r.elements, c = f[0], t = f[4], a = f[8], h = f[12], M = f[1], w = f[5], S = f[9], T = f[13], R = f[2], z = f[6], P = f[10], B = f[14], U = f[3], F = f[7], $ = f[11], W = f[15];
- b[0] = S * B * F - T * P * F + T * z * $ - w * B * $ - S * z * W + w * P * W, b[4] = h * P * F - a * B * F - h * z * $ + t * B * $ + a * z * W - t * P * W, b[8] = a * T * F - h * S * F + h * w * $ - t * T * $ - a * w * W + t * S * W, b[12] = h * S * z - a * T * z - h * w * P + t * T * P + a * w * B - t * S * B, b[1] = T * P * U - S * B * U - T * R * $ + M * B * $ + S * R * W - M * P * W, b[5] = a * B * U - h * P * U + h * R * $ - c * B * $ - a * R * W + c * P * W, b[9] = h * S * U - a * T * U - h * M * $ + c * T * $ + a * M * W - c * S * W, b[13] = a * T * R - h * S * R + h * M * P - c * T * P - a * M * B + c * S * B, b[2] = w * B * U - T * z * U + T * R * F - M * B * F - w * R * W + M * z * W, b[6] = h * z * U - t * B * U - h * R * F + c * B * F + t * R * W - c * z * W, b[10] = t * T * U - h * w * U + h * M * F - c * T * F - t * M * W + c * w * W, b[14] = h * w * R - t * T * R - h * M * z + c * T * z + t * M * B - c * w * B, b[3] = S * z * U - w * P * U - S * R * F + M * P * F + w * R * $ - M * z * $, b[7] = t * P * U - a * z * U + a * R * F - c * P * F - t * R * $ + c * z * $, b[11] = a * w * U - t * S * U - a * M * F + c * S * F + t * M * $ - c * w * $, b[15] = t * S * R - a * w * R + a * M * z - c * S * z - t * M * P + c * w * P;
- const N = c * b[0] + M * b[4] + R * b[8] + U * b[12];
- if (N === 0) {
- const G = "Matrix4.getInverse(): can't invert matrix, determinant is 0";
+ const b = this.elements, f = r.elements, c = f[0], t = f[4], a = f[8], h = f[12], M = f[1], w = f[5], S = f[9], T = f[13], R = f[2], $ = f[6], P = f[10], B = f[14], F = f[3], U = f[7], z = f[11], W = f[15];
+ b[0] = S * B * U - T * P * U + T * $ * z - w * B * z - S * $ * W + w * P * W, b[4] = h * P * U - a * B * U - h * $ * z + t * B * z + a * $ * W - t * P * W, b[8] = a * T * U - h * S * U + h * w * z - t * T * z - a * w * W + t * S * W, b[12] = h * S * $ - a * T * $ - h * w * P + t * T * P + a * w * B - t * S * B, b[1] = T * P * F - S * B * F - T * R * z + M * B * z + S * R * W - M * P * W, b[5] = a * B * F - h * P * F + h * R * z - c * B * z - a * R * W + c * P * W, b[9] = h * S * F - a * T * F - h * M * z + c * T * z + a * M * W - c * S * W, b[13] = a * T * R - h * S * R + h * M * P - c * T * P - a * M * B + c * S * B, b[2] = w * B * F - T * $ * F + T * R * U - M * B * U - w * R * W + M * $ * W, b[6] = h * $ * F - t * B * F - h * R * U + c * B * U + t * R * W - c * $ * W, b[10] = t * T * F - h * w * F + h * M * U - c * T * U - t * M * W + c * w * W, b[14] = h * w * R - t * T * R - h * M * $ + c * T * $ + t * M * B - c * w * B, b[3] = S * $ * F - w * P * F - S * R * U + M * P * U + w * R * z - M * $ * z, b[7] = t * P * F - a * $ * F + a * R * U - c * P * U - t * R * z + c * $ * z, b[11] = a * w * F - t * S * F - a * M * U + c * S * U + t * M * z - c * w * z, b[15] = t * S * R - a * w * R + a * M * $ - c * S * $ - t * M * P + c * w * P;
+ const V = c * b[0] + M * b[4] + R * b[8] + F * b[12];
+ if (V === 0) {
+ const N = "Matrix4.getInverse(): can't invert matrix, determinant is 0";
if (n)
- throw new Error(G);
- return console.warn(G), this.identity(), this;
+ throw new Error(N);
+ return console.warn(N), this.identity(), this;
}
- return this.multiplyScalar(1 / N), this;
+ return this.multiplyScalar(1 / V), this;
}
isReflected() {
const r = this.elements, n = r[0], b = r[4], f = r[8], c = r[1], t = r[5], a = r[9], h = r[2], M = r[6], w = r[10];
@@ -13855,11 +13855,11 @@ ATOM`, h);
}
getScale(r) {
const n = this.elements;
- return r = r || new A(), o.set(n[0], n[1], n[2]), p.set(n[4], n[5], n[6]), E.set(n[8], n[9], n[10]), r.x = o.length(), r.y = p.length(), r.z = E.length(), r;
+ return r = r || new A(), o.set(n[0], n[1], n[2]), g.set(n[4], n[5], n[6]), E.set(n[8], n[9], n[10]), r.x = o.length(), r.y = g.length(), r.z = E.length(), r;
}
lookAt(r, n, b) {
const f = this.elements;
- return E.subVectors(r, n).normalize(), E.length() === 0 && (E.z = 1), o.crossVectors(b, E).normalize(), o.length() === 0 && (E.x += 1e-4, o.crossVectors(b, E).normalize()), p.crossVectors(E, o), f[0] = o.x, f[4] = p.x, f[8] = E.x, f[1] = o.y, f[5] = p.y, f[9] = E.y, f[2] = o.z, f[6] = p.z, f[10] = E.z, this;
+ return E.subVectors(r, n).normalize(), E.length() === 0 && (E.z = 1), o.crossVectors(b, E).normalize(), o.length() === 0 && (E.x += 1e-4, o.crossVectors(b, E).normalize()), g.crossVectors(E, o), f[0] = o.x, f[4] = g.x, f[8] = E.x, f[1] = o.y, f[5] = g.y, f[9] = E.y, f[2] = o.z, f[6] = g.z, f[10] = E.z, this;
}
compose(r, n, b) {
const f = this.elements;
@@ -13961,7 +13961,7 @@ ATOM`, h);
}
setEulerFromRotationMatrix(r, n) {
const b = r.elements, f = b[0], c = b[4], t = b[8], a = b[5], h = b[9], M = b[6], w = b[10];
- return n === void 0 || n === "XYZ" ? (this.y = Math.asin((0, g.clamp)(t, -1, 1)), Math.abs(t) < 0.99999 ? (this.x = Math.atan2(-h, w), this.z = Math.atan2(-c, f)) : (this.x = Math.atan2(M, a), this.z = 0)) : console.error(`Error with vector's setEulerFromRotationMatrix: Unknown order: ${n}`), this;
+ return n === void 0 || n === "XYZ" ? (this.y = Math.asin((0, p.clamp)(t, -1, 1)), Math.abs(t) < 0.99999 ? (this.x = Math.atan2(-h, w), this.z = Math.atan2(-c, f)) : (this.x = Math.atan2(M, a), this.z = 0)) : console.error(`Error with vector's setEulerFromRotationMatrix: Unknown order: ${n}`), this;
}
rotateAboutVector(r, n) {
r.normalize();
@@ -13985,8 +13985,8 @@ ATOM`, h);
return n.multiplyMatrices(r.matrixWorld, n.getInverse(r.projectionMatrix)), this.applyMatrix4(n);
}
}
- o = new A(), p = new A(), E = new A();
- class C {
+ o = new A(), g = new A(), E = new A();
+ class L {
constructor(r = 1, n = 0, b = 0, f = 0, c = 1, t = 0, a = 0, h = 0, M = 1) {
this.elements = new Float32Array(9), this.set(r, n, b, f, c, t, a, h, M);
}
@@ -14040,14 +14040,14 @@ ATOM`, h);
}
clone() {
const r = this.elements;
- return new C(r[0], r[3], r[6], r[1], r[4], r[7], r[2], r[5], r[8]);
+ return new L(r[0], r[3], r[6], r[1], r[4], r[7], r[2], r[5], r[8]);
}
getMatrix4() {
const r = this.elements;
return new u(r[0], r[3], r[6], 0, r[1], r[4], r[7], 0, r[2], r[5], r[8], 0);
}
}
- class L {
+ class C {
constructor(r, n) {
this.origin = r !== void 0 ? r : new A(), this.direction = n !== void 0 ? n : new A();
}
@@ -14096,7 +14096,7 @@ ATOM`, h);
return this.direction.add(this.origin).applyMatrix4(r), this.origin.applyMatrix4(r), this.direction.sub(this.origin), this;
}
clone() {
- return new L().copy(this);
+ return new C().copy(this);
}
}
}
@@ -14116,8 +14116,8 @@ ATOM`, h);
)
/* harmony export */
});
- function l(g, _, x) {
- return Math.min(Math.max(g, _), x);
+ function l(p, _, x) {
+ return Math.min(Math.max(p, _), x);
}
}
),
@@ -14132,7 +14132,7 @@ ATOM`, h);
/* harmony export */
conversionMatrix3: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -14140,10 +14140,10 @@ ATOM`, h);
/*! ../math */
"./src/WebGL/math/math.ts"
);
- function g(_, x, o, p, E, u) {
- p = p * Math.PI / 180, E = E * Math.PI / 180, u = u * Math.PI / 180;
- const A = (b) => b * b, C = Math.cos(p), L = Math.cos(E), D = Math.cos(u), r = Math.sin(u);
- return new l.Matrix3(_, x * D, o * L, 0, x * r, o * (C - L * D) / r, 0, 0, o * Math.sqrt(1 - A(C) - A(L) - A(D) + 2 * C * L * D) / r);
+ function p(_, x, o, g, E, u) {
+ g = g * Math.PI / 180, E = E * Math.PI / 180, u = u * Math.PI / 180;
+ const A = (b) => b * b, L = Math.cos(g), C = Math.cos(E), D = Math.cos(u), r = Math.sin(u);
+ return new l.Matrix3(_, x * D, o * C, 0, x * r, o * (L - C * D) / r, 0, 0, o * Math.sqrt(1 - A(L) - A(C) - A(D) + 2 * L * C * D) / r);
}
}
),
@@ -14158,12 +14158,12 @@ ATOM`, h);
/* harmony export */
degToRad: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
const l = Math.PI / 180;
- function g(_) {
+ function p(_) {
return _ * l;
}
}
@@ -14191,21 +14191,21 @@ ATOM`, h);
var l = e(
/*! ../materials */
"./src/WebGL/materials/index.ts"
- ), g = e(
+ ), p = e(
/*! ../core */
"./src/WebGL/core/index.ts"
), _;
(function(o) {
o[o.LineStrip = 0] = "LineStrip", o[o.LinePieces = 1] = "LinePieces";
})(_ || (_ = {}));
- class x extends g.Object3D {
- constructor(p, E = new l.LineBasicMaterial({
+ class x extends p.Object3D {
+ constructor(g, E = new l.LineBasicMaterial({
color: Math.random() * 16777215
}), u = _.LineStrip) {
- super(), this.geometry = p, this.material = E, this.type = u;
+ super(), this.geometry = g, this.material = E, this.type = u;
}
- clone(p = new x(this.geometry, this.material, this.type)) {
- return super.clone.call(this, p), p;
+ clone(g = new x(this.geometry, this.material, this.type)) {
+ return super.clone.call(this, g), g;
}
}
}
@@ -14221,7 +14221,7 @@ ATOM`, h);
/* harmony export */
Mesh: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -14229,12 +14229,12 @@ ATOM`, h);
/*! ../core */
"./src/WebGL/core/index.ts"
);
- class g extends l.Object3D {
+ class p extends l.Object3D {
constructor(x, o) {
super(), this.geometry = x, this.material = o;
}
clone(x) {
- return x === void 0 && (x = new g(this.geometry, this.material)), super.clone.call(this, x), x;
+ return x === void 0 && (x = new p(this.geometry, this.material)), super.clone.call(this, x), x;
}
}
}
@@ -14257,11 +14257,11 @@ ATOM`, h);
var l = e(
/*! ../materials */
"./src/WebGL/materials/index.ts"
- ), g = e(
+ ), p = e(
/*! ../core */
"./src/WebGL/core/index.ts"
);
- class _ extends g.Object3D {
+ class _ extends p.Object3D {
constructor(o = new l.SpriteMaterial()) {
super(), this.material = o, this.rotation3d = this.rotation, this.rotation = 0;
}
@@ -14269,7 +14269,7 @@ ATOM`, h);
this.matrix.setPosition(this.position), this.rotation3d.set(0, 0, this.rotation), this.matrix.setRotationFromEuler(this.rotation3d), (this.scale.x !== 1 || this.scale.y !== 1) && this.matrix.scale(this.scale), this.matrixWorldNeedsUpdate = !0;
}
clone(o = new _(this.material)) {
- return g.Object3D.prototype.clone.call(this, o), o;
+ return p.Object3D.prototype.clone.call(this, o), o;
}
}
}
@@ -14295,7 +14295,7 @@ ATOM`, h);
/* harmony export */
Mesh: () => (
/* reexport safe */
- g.Mesh
+ p.Mesh
),
/* harmony export */
Sprite: () => (
@@ -14307,7 +14307,7 @@ ATOM`, h);
var l = e(
/*! ./Line */
"./src/WebGL/objects/Line.ts"
- ), g = e(
+ ), p = e(
/*! ./Mesh */
"./src/WebGL/objects/Mesh.ts"
), _ = e(
@@ -14342,7 +14342,7 @@ ATOM`, h);
/* harmony export */
ShaderUtils: () => (
/* reexport safe */
- g.ShaderUtils
+ p.ShaderUtils
),
/* harmony export */
basic: () => (
@@ -14352,7 +14352,7 @@ ATOM`, h);
/* harmony export */
clone: () => (
/* reexport safe */
- g.clone
+ p.clone
),
/* harmony export */
instanced: () => (
@@ -14419,7 +14419,7 @@ ATOM`, h);
var l = e(
/*! ./lib */
"./src/WebGL/shaders/lib/index.ts"
- ), g = e(
+ ), p = e(
/*! ./utils */
"./src/WebGL/shaders/utils/index.ts"
);
@@ -14447,7 +14447,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/basic/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./basic.frag */
"./src/WebGL/shaders/lib/basic/basic.frag"
), _ = e(
@@ -14456,7 +14456,7 @@ ATOM`, h);
);
const x = {
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
}
@@ -14472,7 +14472,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -14480,7 +14480,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -14509,7 +14509,7 @@ ATOM`, h);
/* harmony export */
instanced: () => (
/* reexport safe */
- g.instanced
+ p.instanced
),
/* harmony export */
lambert: () => (
@@ -14529,7 +14529,7 @@ ATOM`, h);
/* harmony export */
screen: () => (
/* reexport safe */
- p.screen
+ g.screen
),
/* harmony export */
screenaa: () => (
@@ -14549,12 +14549,12 @@ ATOM`, h);
/* harmony export */
sprite: () => (
/* reexport safe */
- C.sprite
+ L.sprite
),
/* harmony export */
stickimposter: () => (
/* reexport safe */
- L.stickimposter
+ C.stickimposter
),
/* harmony export */
stickimposteroutline: () => (
@@ -14571,7 +14571,7 @@ ATOM`, h);
var l = e(
/*! ./basic */
"./src/WebGL/shaders/lib/basic/index.ts"
- ), g = e(
+ ), p = e(
/*! ./instanced */
"./src/WebGL/shaders/lib/instanced/index.ts"
), _ = e(
@@ -14583,7 +14583,7 @@ ATOM`, h);
), o = e(
/*! ./outline */
"./src/WebGL/shaders/lib/outline/index.ts"
- ), p = e(
+ ), g = e(
/*! ./screen */
"./src/WebGL/shaders/lib/screen/index.ts"
), E = e(
@@ -14595,10 +14595,10 @@ ATOM`, h);
), A = e(
/*! ./sphereimposteroutline */
"./src/WebGL/shaders/lib/sphereimposteroutline/index.ts"
- ), C = e(
+ ), L = e(
/*! ./sprite */
"./src/WebGL/shaders/lib/sprite/index.ts"
- ), L = e(
+ ), C = e(
/*! ./stickimposter */
"./src/WebGL/shaders/lib/stickimposter/index.ts"
), D = e(
@@ -14610,16 +14610,16 @@ ATOM`, h);
);
const n = {
basic: l.basic,
- instanced: g.instanced,
+ instanced: p.instanced,
lambert: _.lambert,
lambertdouble: x.lambertdouble,
outline: o.outline,
- screen: p.screen,
+ screen: g.screen,
screenaa: E.screenaa,
sphereimposter: u.sphereimposter,
sphereimposteroutline: A.sphereimposteroutline,
- sprite: C.sprite,
- stickimposter: L.stickimposter,
+ sprite: L.sprite,
+ stickimposter: C.stickimposter,
stickimposteroutline: D.stickimposteroutline,
volumetric: r.volumetric
};
@@ -14643,7 +14643,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/instanced/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./instanced.frag */
"./src/WebGL/shaders/lib/instanced/instanced.frag"
), _ = e(
@@ -14651,7 +14651,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/instanced/instanced.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -14668,7 +14668,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -14676,7 +14676,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -14704,7 +14704,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/lambert/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./lambert.frag */
"./src/WebGL/shaders/lib/lambert/lambert.frag"
), _ = e(
@@ -14712,7 +14712,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/lambert/lambert.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -14729,7 +14729,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -14737,7 +14737,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -14765,7 +14765,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/lambertdouble/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./lambertdouble.frag */
"./src/WebGL/shaders/lib/lambertdouble/lambertdouble.frag"
), _ = e(
@@ -14773,7 +14773,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/lambertdouble/lambertdouble.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -14790,7 +14790,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -14798,7 +14798,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -14826,7 +14826,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/outline/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./outline.frag */
"./src/WebGL/shaders/lib/outline/outline.frag"
), _ = e(
@@ -14834,7 +14834,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/outline/outline.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -14851,7 +14851,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -14859,7 +14859,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
outlineColor: { type: "c", value: new l.Color(0, 0, 0) },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
@@ -14888,7 +14888,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/screen/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./screen.frag */
"./src/WebGL/shaders/lib/screen/screen.frag"
), _ = e(
@@ -14896,7 +14896,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/screen/screen.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -14938,7 +14938,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/screenaa/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./screenaa.frag */
"./src/WebGL/shaders/lib/screenaa/screenaa.frag"
), _ = e(
@@ -14946,7 +14946,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/screenaa/screenaa.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -14988,7 +14988,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/sphereimposter/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./sphereimposter.frag */
"./src/WebGL/shaders/lib/sphereimposter/sphereimposter.frag"
), _ = e(
@@ -14997,7 +14997,7 @@ ATOM`, h);
);
const x = {
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
}
@@ -15013,7 +15013,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -15021,7 +15021,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -15049,7 +15049,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/sphereimposteroutline/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./sphereimposteroutline.frag */
"./src/WebGL/shaders/lib/sphereimposteroutline/sphereimposteroutline.frag"
), _ = e(
@@ -15057,7 +15057,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/sphereimposteroutline/sphereimposteroutline.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -15074,7 +15074,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -15082,7 +15082,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
outlineColor: { type: "c", value: new l.Color(0, 0, 0) },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
@@ -15111,7 +15111,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/sprite/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./sprite.frag */
"./src/WebGL/shaders/lib/sprite/sprite.frag"
), _ = e(
@@ -15119,7 +15119,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/sprite/sprite.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -15154,14 +15154,14 @@ ATOM`, h);
/* harmony export */
stickimposter: () => (
/* binding */
- p
+ g
)
/* harmony export */
});
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/stickimposter/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ../../utils/stickimposterFragmentShader.partial.frag */
"./src/WebGL/shaders/utils/stickimposterFragmentShader.partial.frag"
), _ = e(
@@ -15171,8 +15171,8 @@ ATOM`, h);
/*! ./stickimposter.vert */
"./src/WebGL/shaders/lib/stickimposter/stickimposter.vert"
);
- const p = {
- fragmentShader: [g.default, _.default].join(`
+ const g = {
+ fragmentShader: [p.default, _.default].join(`
`).replace("#define GLSLIFY 1", ""),
vertexShader: x.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
@@ -15190,7 +15190,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -15198,7 +15198,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -15226,7 +15226,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/stickimposteroutline/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ../../utils/stickimposterFragmentShader.partial.frag */
"./src/WebGL/shaders/utils/stickimposterFragmentShader.partial.frag"
), _ = e(
@@ -15234,7 +15234,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/stickimposteroutline/stickimposteroutline.vert"
);
const o = {
- fragmentShader: (g.default + "gl_FragColor = vec4(color,1.0);}").replace("#define GLSLIFY 1", ""),
+ fragmentShader: (p.default + "gl_FragColor = vec4(color,1.0);}").replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -15251,7 +15251,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -15259,7 +15259,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -15288,7 +15288,7 @@ ATOM`, h);
var l = e(
/*! ./uniforms */
"./src/WebGL/shaders/lib/volumetric/uniforms.ts"
- ), g = e(
+ ), p = e(
/*! ./volumetric.frag */
"./src/WebGL/shaders/lib/volumetric/volumetric.frag"
), _ = e(
@@ -15296,7 +15296,7 @@ ATOM`, h);
"./src/WebGL/shaders/lib/volumetric/volumetric.vert"
);
const x = {
- fragmentShader: g.default.replace("#define GLSLIFY 1", ""),
+ fragmentShader: p.default.replace("#define GLSLIFY 1", ""),
vertexShader: _.default.replace("#define GLSLIFY 1", ""),
uniforms: l.uniforms
};
@@ -15313,7 +15313,7 @@ ATOM`, h);
/* harmony export */
uniforms: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -15321,7 +15321,7 @@ ATOM`, h);
/*! ../../../../colors */
"./src/colors.ts"
);
- const g = {
+ const p = {
opacity: { type: "f", value: 1 },
fogColor: { type: "c", value: new l.Color(1, 1, 1) },
fogNear: { type: "f", value: 1 },
@@ -15350,7 +15350,7 @@ ATOM`, h);
/* harmony export */
clone: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -15358,12 +15358,12 @@ ATOM`, h);
/*! ../../../colors */
"./src/colors.ts"
);
- function g(_) {
+ function p(_) {
let x = {};
- for (const p in _) {
- x[p] = {}, x[p].type = _[p].type;
- var o = _[p].value;
- o instanceof l.Color ? x[p].value = o.clone() : typeof o == "number" ? x[p].value = o : o instanceof Array ? x[p].value = [] : console.error("Error copying shader uniforms from ShaderLib: unknown type for uniform");
+ for (const g in _) {
+ x[g] = {}, x[g].type = _[g].type;
+ var o = _[g].value;
+ o instanceof l.Color ? x[g].value = o.clone() : typeof o == "number" ? x[g].value = o : o instanceof Array ? x[g].value = [] : console.error("Error copying shader uniforms from ShaderLib: unknown type for uniform");
}
return x;
}
@@ -15392,13 +15392,13 @@ ATOM`, h);
var l = e(
/*! ./clone */
"./src/WebGL/shaders/utils/clone.ts"
- ), g = e(
+ ), p = e(
/*! ./stickimposterFragmentShader.partial.frag */
"./src/WebGL/shaders/utils/stickimposterFragmentShader.partial.frag"
);
const _ = {
clone: l.clone,
- stickimposterFragmentShader: g.default
+ stickimposterFragmentShader: p.default
};
}
),
@@ -15421,16 +15421,16 @@ ATOM`, h);
/*! ../math */
"./src/WebGL/math/index.ts"
);
- let g = new l.Vector3();
+ let p = new l.Vector3();
class _ {
- constructor(o = new l.Vector3(), p = new l.Vector3(), E = 0) {
- this.c1 = o, this.c2 = p, this.radius = E, this.direction = new l.Vector3().subVectors(this.c2, this.c1).normalize();
+ constructor(o = new l.Vector3(), g = new l.Vector3(), E = 0) {
+ this.c1 = o, this.c2 = g, this.radius = E, this.direction = new l.Vector3().subVectors(this.c2, this.c1).normalize();
}
copy(o) {
return this.c1.copy(o.c1), this.c2.copy(o.c2), this.direction.copy(o.direction), this.radius = o.radius, this;
}
lengthSq() {
- return g.subVectors(this.c2, this.c1).lengthSq();
+ return p.subVectors(this.c2, this.c1).lengthSq();
}
applyMatrix4(o) {
return this.direction.add(this.c1).applyMatrix4(o), this.c1.applyMatrix4(o), this.c2.applyMatrix4(o), this.direction.sub(this.c1).normalize(), this.radius = this.radius * o.getMaxScaleOnAxis(), this;
@@ -15449,7 +15449,7 @@ ATOM`, h);
/* harmony export */
Sphere: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -15457,7 +15457,7 @@ ATOM`, h);
/*! ../math */
"./src/WebGL/math/index.ts"
);
- class g {
+ class p {
constructor(x = { x: 0, y: 0, z: 0 }, o = 0) {
this.center = new l.Vector3(x.x, x.y, x.z), this.radius = o;
}
@@ -15477,7 +15477,7 @@ ATOM`, h);
return x.center.equals(this.center) && x.radius === this.radius;
}
clone() {
- return new g().copy(this);
+ return new p().copy(this);
}
}
}
@@ -15501,10 +15501,10 @@ ATOM`, h);
/*! ../math */
"./src/WebGL/math/index.ts"
);
- const g = new l.Vector3();
+ const p = new l.Vector3();
class _ {
- constructor(o = new l.Vector3(), p = new l.Vector3(), E = new l.Vector3()) {
- this.a = o, this.b = p, this.c = E;
+ constructor(o = new l.Vector3(), g = new l.Vector3(), E = new l.Vector3()) {
+ this.a = o, this.b = g, this.c = E;
}
copy(o) {
return this.a.copy(o.a), this.b.copy(o.b), this.c.copy(o.c), this;
@@ -15514,7 +15514,7 @@ ATOM`, h);
}
getNormal() {
var o = this.a.clone();
- return o.sub(this.b), g.subVectors(this.c, this.b), o.cross(g), o.normalize(), o;
+ return o.sub(this.b), p.subVectors(this.c, this.b), o.cross(p), o.normalize(), o;
}
}
}
@@ -15530,7 +15530,7 @@ ATOM`, h);
/* harmony export */
Cylinder: () => (
/* reexport safe */
- g.Cylinder
+ p.Cylinder
),
/* harmony export */
Sphere: () => (
@@ -15547,7 +15547,7 @@ ATOM`, h);
var l = e(
/*! ./Sphere */
"./src/WebGL/shapes/Sphere.ts"
- ), g = e(
+ ), p = e(
/*! ./Cylinder */
"./src/WebGL/shapes/Cylinder.ts"
), _ = e(
@@ -15643,8 +15643,8 @@ ATOM`, h);
}
for (i = 0; i < surfaces.length; i++) {
let s = surfaces[i][0] || {}, e = surfaces[i][1] || {};
- UI ? y.addSurface(_ProteinSurface4__WEBPACK_IMPORTED_MODULE_1__.SurfaceType.VDW, e, s, s).then((g) => {
- UI.loadSurface("VDW", s, e, g);
+ UI ? y.addSurface(_ProteinSurface4__WEBPACK_IMPORTED_MODULE_1__.SurfaceType.VDW, e, s, s).then((p) => {
+ UI.loadSurface("VDW", s, e, p);
}) : y.addSurface(_ProteinSurface4__WEBPACK_IMPORTED_MODULE_1__.SurfaceType.VDW, e, s, s);
}
for (i = 0; i < labels.length; i++) {
@@ -15709,7 +15709,7 @@ ATOM`, h);
/* harmony export */
CC: () => (
/* binding */
- g
+ p
),
/* harmony export */
Color: () => (
@@ -15729,7 +15729,7 @@ ATOM`, h);
/* harmony export */
elementColors: () => (
/* binding */
- p
+ g
),
/* harmony export */
htmlColors: () => (
@@ -15749,55 +15749,55 @@ ATOM`, h);
/* harmony export */
});
class l {
- constructor(L, D, r) {
- return this.r = 0, this.g = 0, this.b = 0, arguments.length > 1 && typeof L == "number" ? (this.r = L || 0, this.g = D || 0, this.b = r || 0, this) : this.set(L || 0);
+ constructor(C, D, r) {
+ return this.r = 0, this.g = 0, this.b = 0, arguments.length > 1 && typeof C == "number" ? (this.r = C || 0, this.g = D || 0, this.b = r || 0, this) : this.set(C || 0);
}
- set(L) {
- return L instanceof l ? L.clone() : (typeof L == "number" ? this.setHex(L) : typeof L == "object" && (this.r = (L == null ? void 0 : L.r) || 0, this.g = (L == null ? void 0 : L.g) || 0, this.b = (L == null ? void 0 : L.b) || 0), this);
+ set(C) {
+ return C instanceof l ? C.clone() : (typeof C == "number" ? this.setHex(C) : typeof C == "object" && (this.r = (C == null ? void 0 : C.r) || 0, this.g = (C == null ? void 0 : C.g) || 0, this.b = (C == null ? void 0 : C.b) || 0), this);
}
- setHex(L) {
- return L = Math.floor(L), this.r = (L >> 16 & 255) / 255, this.g = (L >> 8 & 255) / 255, this.b = (L & 255) / 255, this;
+ setHex(C) {
+ return C = Math.floor(C), this.r = (C >> 16 & 255) / 255, this.g = (C >> 8 & 255) / 255, this.b = (C & 255) / 255, this;
}
getHex() {
- var L = Math.round(this.r * 255), D = Math.round(this.g * 255), r = Math.round(this.b * 255);
- return L << 16 | D << 8 | r;
+ var C = Math.round(this.r * 255), D = Math.round(this.g * 255), r = Math.round(this.b * 255);
+ return C << 16 | D << 8 | r;
}
clone() {
return new l(this.r, this.g, this.b);
}
- copy(L) {
- return this.r = L.r, this.g = L.g, this.b = L.b, this;
+ copy(C) {
+ return this.r = C.r, this.g = C.g, this.b = C.b, this;
}
//return object that represents color components from 0 to 255
scaled() {
- var L = {};
- return L.r = Math.round(this.r * 255), L.g = Math.round(this.g * 255), L.b = Math.round(this.b * 255), L.a = 1, L;
+ var C = {};
+ return C.r = Math.round(this.r * 255), C.g = Math.round(this.g * 255), C.b = Math.round(this.b * 255), C.a = 1, C;
}
}
- class g {
- static color(L) {
- if (!L)
- return g.cache[0];
- if (L instanceof l)
- return L;
- if (typeof L == "number" && typeof g.cache[L] < "u")
- return g.cache[L];
- if (L && Array.isArray(L))
- return L.map(g.color);
- let D = g.getHex(L), r = new l(D);
- return g.cache[D] = r, r;
- }
- static getHex(L) {
+ class p {
+ static color(C) {
+ if (!C)
+ return p.cache[0];
+ if (C instanceof l)
+ return C;
+ if (typeof C == "number" && typeof p.cache[C] < "u")
+ return p.cache[C];
+ if (C && Array.isArray(C))
+ return C.map(p.color);
+ let D = p.getHex(C), r = new l(D);
+ return p.cache[D] = r, r;
+ }
+ static getHex(C) {
var D;
- if (Array.isArray(L))
- return L.map(g.getHex);
- if (typeof L == "string") {
- let r = L;
+ if (Array.isArray(C))
+ return C.map(p.getHex);
+ if (typeof C == "string") {
+ let r = C;
if (!isNaN(parseInt(r)))
return parseInt(r);
if (r = r.trim(), r.length == 4 && r[0] == "#" && (r = "#" + r[1] + r[1] + r[2] + r[2] + r[3] + r[3]), r.length == 7 && r[0] == "#")
return parseInt(r.substring(1), 16);
- let n = g.rgbRegEx.exec(r);
+ let n = p.rgbRegEx.exec(r);
if (n) {
n[1] != "" && console.log("WARNING: Opacity value in rgba ignored. Specify separately as opacity attribute.");
let b = 0;
@@ -15808,12 +15808,12 @@ ATOM`, h);
}
return b;
}
- return ((D = window == null ? void 0 : window.$3Dmol) === null || D === void 0 ? void 0 : D.htmlColors[L.toLowerCase()]) || 0;
+ return ((D = window == null ? void 0 : window.$3Dmol) === null || D === void 0 ? void 0 : D.htmlColors[C.toLowerCase()]) || 0;
}
- return L;
+ return C;
}
}
- g.rgbRegEx = /rgb(a?)\(\s*([^ ,\)\t]+)\s*,\s*([^ ,\)\t]+)\s*,\s*([^ ,\)\t]+)/i, g.cache = { 0: new l(0) };
+ p.rgbRegEx = /rgb(a?)\(\s*([^ ,\)\t]+)\s*,\s*([^ ,\)\t]+)\s*,\s*([^ ,\)\t]+)/i, p.cache = { 0: new l(0) };
const _ = {
aliceblue: 15792383,
antiquewhite: 16444375,
@@ -16015,7 +16015,7 @@ ATOM`, h);
BA: 16753920,
Au: 14329120,
AU: 14329120
- }, p = {
+ }, g = {
defaultColor: 16716947,
/** Jmol-like element colors*/
Jmol: {
@@ -16358,22 +16358,22 @@ ATOM`, h);
/** secondary structure pymol */
ssPyMol: { prop: "ss", map: x.pyMol },
ssJmol: { prop: "ss", map: x.Jmol },
- Jmol: { prop: "elem", map: p.Jmol },
+ Jmol: { prop: "elem", map: g.Jmol },
amino: { prop: "resn", map: E.amino },
shapely: { prop: "resn", map: E.shapely },
nucleic: { prop: "resn", map: E.nucleic },
chain: { prop: "chain", map: u.atom },
- rasmol: { prop: "elem", map: p.rasmol },
- default: { prop: "elem", map: p.defaultColors },
- greenCarbon: { prop: "elem", map: p.greenCarbon },
+ rasmol: { prop: "elem", map: g.rasmol },
+ default: { prop: "elem", map: g.defaultColors },
+ greenCarbon: { prop: "elem", map: g.greenCarbon },
chainHetatm: { prop: "chain", map: u.hetatm },
- cyanCarbon: { prop: "elem", map: p.cyanCarbon },
- magentaCarbon: { prop: "elem", map: p.magentaCarbon },
- purpleCarbon: { prop: "elem", map: p.purpleCarbon },
- whiteCarbon: { prop: "elem", map: p.whiteCarbon },
- orangeCarbon: { prop: "elem", map: p.orangeCarbon },
- yellowCarbon: { prop: "elem", map: p.yellowCarbon },
- blueCarbon: { prop: "elem", map: p.blueCarbon }
+ cyanCarbon: { prop: "elem", map: g.cyanCarbon },
+ magentaCarbon: { prop: "elem", map: g.magentaCarbon },
+ purpleCarbon: { prop: "elem", map: g.purpleCarbon },
+ whiteCarbon: { prop: "elem", map: g.whiteCarbon },
+ orangeCarbon: { prop: "elem", map: g.orangeCarbon },
+ yellowCarbon: { prop: "elem", map: g.yellowCarbon },
+ blueCarbon: { prop: "elem", map: g.blueCarbon }
};
}
),
@@ -16388,7 +16388,7 @@ ATOM`, h);
/* harmony export */
drawCartoon: () => (
/* binding */
- z
+ $
),
/* harmony export */
subdivide_spline: () => (
@@ -16400,7 +16400,7 @@ ATOM`, h);
var l = e(
/*! ./WebGL/math */
"./src/WebGL/math/index.ts"
- ), g = e(
+ ), p = e(
/*! ./WebGL/shapes */
"./src/WebGL/shapes/index.ts"
), _ = e(
@@ -16412,7 +16412,7 @@ ATOM`, h);
), o = e(
/*! ./colors */
"./src/colors.ts"
- ), p = e(
+ ), g = e(
/*! ./GLDraw */
"./src/GLDraw.ts"
), E = e(
@@ -16420,153 +16420,153 @@ ATOM`, h);
"./src/utilities.ts"
);
function u(P, B) {
- var U = [], F = P;
- F = [], F.push(P[0]);
- var $, W, N, G, k, j, Q, ie, pe;
- for ($ = 1, W = P.length - 1; $ < W; $++)
- if (k = P[$], j = P[$ + 1], k.smoothen) {
- var he = new l.Vector3((k.x + j.x) / 2, (k.y + j.y) / 2, (k.z + j.z) / 2);
- he.atom = k.atom, F.push(he);
+ var F = [], U = P;
+ U = [], U.push(P[0]);
+ var z, W, V, N, k, G, Q, ie, ge;
+ for (z = 1, W = P.length - 1; z < W; z++)
+ if (k = P[z], G = P[z + 1], k.smoothen) {
+ var le = new l.Vector3((k.x + G.x) / 2, (k.y + G.y) / 2, (k.z + G.z) / 2);
+ le.atom = k.atom, U.push(le);
} else
- F.push(k);
- for (F.push(P[P.length - 1]), $ = -1, N = F.length; $ <= N - 3; $++)
- if (G = F[$ === -1 ? 0 : $], k = F[$ + 1], j = F[$ + 2], Q = F[$ === N - 3 ? N - 1 : $ + 3], ie = new l.Vector3().subVectors(j, G).multiplyScalar(0.5), pe = new l.Vector3().subVectors(Q, k).multiplyScalar(0.5), !j.skip)
- for (var ue = 0; ue < B; ue++) {
- var se = 1 / B * ue, ae = k.x + se * ie.x + se * se * (-3 * k.x + 3 * j.x - 2 * ie.x - pe.x) + se * se * se * (2 * k.x - 2 * j.x + ie.x + pe.x), we = k.y + se * ie.y + se * se * (-3 * k.y + 3 * j.y - 2 * ie.y - pe.y) + se * se * se * (2 * k.y - 2 * j.y + ie.y + pe.y), xe = k.z + se * ie.z + se * se * (-3 * k.z + 3 * j.z - 2 * ie.z - pe.z) + se * se * se * (2 * k.z - 2 * j.z + ie.z + pe.z), Ie = new l.Vector3(ae, we, xe);
- ue < B / 2 ? Ie.atom = k.atom : Ie.atom = j.atom, U.push(Ie);
+ U.push(k);
+ for (U.push(P[P.length - 1]), z = -1, V = U.length; z <= V - 3; z++)
+ if (N = U[z === -1 ? 0 : z], k = U[z + 1], G = U[z + 2], Q = U[z === V - 3 ? V - 1 : z + 3], ie = new l.Vector3().subVectors(G, N).multiplyScalar(0.5), ge = new l.Vector3().subVectors(Q, k).multiplyScalar(0.5), !G.skip)
+ for (var oe = 0; oe < B; oe++) {
+ var he = 1 / B * oe, se = k.x + he * ie.x + he * he * (-3 * k.x + 3 * G.x - 2 * ie.x - ge.x) + he * he * he * (2 * k.x - 2 * G.x + ie.x + ge.x), xe = k.y + he * ie.y + he * he * (-3 * k.y + 3 * G.y - 2 * ie.y - ge.y) + he * he * he * (2 * k.y - 2 * G.y + ie.y + ge.y), ye = k.z + he * ie.z + he * he * (-3 * k.z + 3 * G.z - 2 * ie.z - ge.z) + he * he * he * (2 * k.z - 2 * G.z + ie.z + ge.z), Pe = new l.Vector3(se, xe, ye);
+ oe < B / 2 ? Pe.atom = k.atom : Pe.atom = G.atom, F.push(Pe);
}
- return U.push(F[F.length - 1]), U;
+ return F.push(U[U.length - 1]), F;
}
- const A = 0.5, C = 1.3, L = 0.8, D = 0.4, r = 0.4;
- function n(P, B, U, F) {
- for (var $, W, N, G, k = 0, j = B.length; k < j; k++) {
- G = Math.round(k * (F.length - 1) / j), N = o.CC.color(F[G]);
- var Q = P.updateGeoGroup(2), ie = Q.vertexArray, pe = Q.colorArray, he = Q.faceArray;
- $ = Q.vertices, W = $ * 3, ie[W] = B[k].x, ie[W + 1] = B[k].y, ie[W + 2] = B[k].z, ie[W + 3] = U[k].x, ie[W + 4] = U[k].y, ie[W + 5] = U[k].z;
- for (var ue = 0; ue < 6; ++ue)
- pe[W + 3 * ue] = N.r, pe[W + 1 + 3 * ue] = N.g, pe[W + 2 + 3 * ue] = N.b;
+ const A = 0.5, L = 1.3, C = 0.8, D = 0.4, r = 0.4;
+ function n(P, B, F, U) {
+ for (var z, W, V, N, k = 0, G = B.length; k < G; k++) {
+ N = Math.round(k * (U.length - 1) / G), V = o.CC.color(U[N]);
+ var Q = P.updateGeoGroup(2), ie = Q.vertexArray, ge = Q.colorArray, le = Q.faceArray;
+ z = Q.vertices, W = z * 3, ie[W] = B[k].x, ie[W + 1] = B[k].y, ie[W + 2] = B[k].z, ie[W + 3] = F[k].x, ie[W + 4] = F[k].y, ie[W + 5] = F[k].z;
+ for (var oe = 0; oe < 6; ++oe)
+ ge[W + 3 * oe] = V.r, ge[W + 1 + 3 * oe] = V.g, ge[W + 2 + 3 * oe] = V.b;
if (k > 0) {
- var se = [$, $ + 1, $ - 1, $ - 2], ae = Q.faceidx;
- he[ae] = se[0], he[ae + 1] = se[1], he[ae + 2] = se[3], he[ae + 3] = se[1], he[ae + 4] = se[2], he[ae + 5] = se[3], Q.faceidx += 6;
+ var he = [z, z + 1, z - 1, z - 2], se = Q.faceidx;
+ le[se] = he[0], le[se + 1] = he[1], le[se + 2] = he[3], le[se + 3] = he[1], le[se + 4] = he[2], le[se + 5] = he[3], Q.faceidx += 6;
}
Q.vertices += 2;
}
}
- function b(P, B, U, F, $, W, N) {
- var G, k, j, Q;
- if (j = B.length, j < 2 || B[0].length < 2)
+ function b(P, B, F, U, z, W, V) {
+ var N, k, G, Q;
+ if (G = B.length, G < 2 || B[0].length < 2)
return;
- for (G = 0; G < j; G++)
- B[G] = u(B[G], F);
- if (Q = B[0].length, !$)
- return n(P, B[0], B[j - 1], U);
- var ie, pe, he, ue, se, ae, we = [], xe = [], Ie = [];
- for (k = 0; k < j; k++)
- we.push(0.25 + 1.5 * Math.sqrt((j - 1) * k - Math.pow(k, 2)) / (j - 1)), xe.push(0.5), Ie.push(2 * (Math.pow(k / j, 2) - k / j) + 0.6);
- var oe = [];
- for (k = 0; k < j * 2 - 1; k++)
- oe[k] = [k, k + 1, k + 1 - 2 * j, k - 2 * j];
- oe[j * 2 - 1] = [
+ for (N = 0; N < G; N++)
+ B[N] = u(B[N], U);
+ if (Q = B[0].length, !z)
+ return n(P, B[0], B[G - 1], F);
+ var ie, ge, le, oe, he, se, xe = [], ye = [], Pe = [];
+ for (k = 0; k < G; k++)
+ xe.push(0.25 + 1.5 * Math.sqrt((G - 1) * k - Math.pow(k, 2)) / (G - 1)), ye.push(0.5), Pe.push(2 * (Math.pow(k / G, 2) - k / G) + 0.6);
+ var de = [];
+ for (k = 0; k < G * 2 - 1; k++)
+ de[k] = [k, k + 1, k + 1 - 2 * G, k - 2 * G];
+ de[G * 2 - 1] = [
k,
- k + 1 - 2 * j,
- k + 1 - 4 * j,
- k - 2 * j
+ k + 1 - 2 * G,
+ k + 1 - 4 * G,
+ k - 2 * G
];
- var ve, re, Se, ze, Ge, $e, Re, Be, ke, We;
- let Te = P.updateGeoGroup();
- for (G = 0; G < Q; G++) {
- let Z = P.groups, q = !1;
- Te = P.updateGeoGroup(2 * j), Z != P.groups && G > 0 && (G = G - 1, q = !0), $e = Math.round(G * (U.length - 1) / Q), Ge = o.CC.color(U[$e]), se = he, ae = ue, he = [], ue = [], ie = [], B[0][G].atom !== void 0 && (ze = B[0][G].atom, N === "oval" ? pe = we : N === "rectangle" ? pe = xe : N === "parabola" && (pe = Ie)), pe || (pe = xe);
- var je, Fe;
- for (k = 0; k < j; k++)
- G < Q - 1 ? je = B[k][G + 1].clone().sub(B[k][G]) : je = B[k][G - 1].clone().sub(B[k][G]).negate(), k < j - 1 ? Fe = B[k + 1][G].clone().sub(B[k][G]) : Fe = B[k - 1][G].clone().sub(B[k][G]).negate(), ie[k] = Fe.cross(je).normalize().multiplyScalar($ * pe[k]);
- for (k = 0; k < j; k++)
- he[k] = B[k][G].clone().add(ie[k].clone().negate());
- for (k = 0; k < j; k++)
- ue[k] = B[k][G].clone().add(ie[k]);
- for (Re = Te.vertexArray, Be = Te.colorArray, ke = Te.faceArray, ve = Te.vertices, re = ve * 3, k = 0; k < j; k++)
- Re[re + 3 * k + 0] = he[k].x, Re[re + 3 * k + 1] = he[k].y, Re[re + 3 * k + 2] = he[k].z;
- for (k = 0; k < j; k++)
- Re[re + 3 * k + 0 + 3 * j] = ue[j - 1 - k].x, Re[re + 3 * k + 1 + 3 * j] = ue[j - 1 - k].y, Re[re + 3 * k + 2 + 3 * j] = ue[j - 1 - k].z;
- for (k = 0; k < 2 * j; ++k)
- Be[re + 3 * k + 0] = Ge.r, Be[re + 3 * k + 1] = Ge.g, Be[re + 3 * k + 2] = Ge.b;
- if (G > 0 && !q) {
- for (k = 0; k < j * 2; k++)
+ var pe, re, Se, ke, $e, ze, Re, Fe, Ie, We;
+ let Ue = P.updateGeoGroup();
+ for (N = 0; N < Q; N++) {
+ let K = P.groups, q = !1;
+ Ue = P.updateGeoGroup(2 * G), K != P.groups && N > 0 && (N = N - 1, q = !0), ze = Math.round(N * (F.length - 1) / Q), $e = o.CC.color(F[ze]), he = le, se = oe, le = [], oe = [], ie = [], B[0][N].atom !== void 0 && (ke = B[0][N].atom, V === "oval" ? ge = xe : V === "rectangle" ? ge = ye : V === "parabola" && (ge = Pe)), ge || (ge = ye);
+ var Be, Ne;
+ for (k = 0; k < G; k++)
+ N < Q - 1 ? Be = B[k][N + 1].clone().sub(B[k][N]) : Be = B[k][N - 1].clone().sub(B[k][N]).negate(), k < G - 1 ? Ne = B[k + 1][N].clone().sub(B[k][N]) : Ne = B[k - 1][N].clone().sub(B[k][N]).negate(), ie[k] = Ne.cross(Be).normalize().multiplyScalar(z * ge[k]);
+ for (k = 0; k < G; k++)
+ le[k] = B[k][N].clone().add(ie[k].clone().negate());
+ for (k = 0; k < G; k++)
+ oe[k] = B[k][N].clone().add(ie[k]);
+ for (Re = Ue.vertexArray, Fe = Ue.colorArray, Ie = Ue.faceArray, pe = Ue.vertices, re = pe * 3, k = 0; k < G; k++)
+ Re[re + 3 * k + 0] = le[k].x, Re[re + 3 * k + 1] = le[k].y, Re[re + 3 * k + 2] = le[k].z;
+ for (k = 0; k < G; k++)
+ Re[re + 3 * k + 0 + 3 * G] = oe[G - 1 - k].x, Re[re + 3 * k + 1 + 3 * G] = oe[G - 1 - k].y, Re[re + 3 * k + 2 + 3 * G] = oe[G - 1 - k].z;
+ for (k = 0; k < 2 * G; ++k)
+ Fe[re + 3 * k + 0] = $e.r, Fe[re + 3 * k + 1] = $e.g, Fe[re + 3 * k + 2] = $e.b;
+ if (N > 0 && !q) {
+ for (k = 0; k < G * 2; k++)
We = [
- ve + oe[k][0],
- ve + oe[k][1],
- ve + oe[k][2],
- ve + oe[k][3]
- ], Se = Te.faceidx, ke[Se] = We[0], ke[Se + 1] = We[1], ke[Se + 2] = We[3], ke[Se + 3] = We[1], ke[Se + 4] = We[2], ke[Se + 5] = We[3], Te.faceidx += 6;
- if (ze.clickable || ze.hoverable) {
- var X = [];
- X.push(new g.Triangle(se[0], he[0], he[j - 1])), X.push(new g.Triangle(se[0], he[j - 1], se[j - 1])), X.push(new g.Triangle(se[j - 1], he[j - 1], ue[j - 1])), X.push(new g.Triangle(se[j - 1], ue[j - 1], ae[j - 1])), X.push(new g.Triangle(ue[0], ae[0], ae[j - 1])), X.push(new g.Triangle(ue[j - 1], ue[0], ae[j - 1])), X.push(new g.Triangle(he[0], se[0], ae[0])), X.push(new g.Triangle(ue[0], he[0], ae[0]));
- for (k in X)
- ze.intersectionShape.triangle.push(X[k]);
+ pe + de[k][0],
+ pe + de[k][1],
+ pe + de[k][2],
+ pe + de[k][3]
+ ], Se = Ue.faceidx, Ie[Se] = We[0], Ie[Se + 1] = We[1], Ie[Se + 2] = We[3], Ie[Se + 3] = We[1], Ie[Se + 4] = We[2], Ie[Se + 5] = We[3], Ue.faceidx += 6;
+ if (ke.clickable || ke.hoverable) {
+ var H = [];
+ H.push(new p.Triangle(he[0], le[0], le[G - 1])), H.push(new p.Triangle(he[0], le[G - 1], he[G - 1])), H.push(new p.Triangle(he[G - 1], le[G - 1], oe[G - 1])), H.push(new p.Triangle(he[G - 1], oe[G - 1], se[G - 1])), H.push(new p.Triangle(oe[0], se[0], se[G - 1])), H.push(new p.Triangle(oe[G - 1], oe[0], se[G - 1])), H.push(new p.Triangle(le[0], he[0], se[0])), H.push(new p.Triangle(oe[0], le[0], se[0]));
+ for (k in H)
+ ke.intersectionShape.triangle.push(H[k]);
}
}
- Te.vertices += 2 * j;
+ Ue.vertices += 2 * G;
}
- for (Re = Te.vertexArray, Be = Te.colorArray, ke = Te.faceArray, ve = Te.vertices, re = ve * 3, Se = Te.faceidx, G = 0; G < j - 1; G++)
- We = [G, G + 1, 2 * j - 2 - G, 2 * j - 1 - G], Se = Te.faceidx, ke[Se] = We[0], ke[Se + 1] = We[1], ke[Se + 2] = We[3], ke[Se + 3] = We[1], ke[Se + 4] = We[2], ke[Se + 5] = We[3], Te.faceidx += 6;
- for (G = 0; G < j - 1; G++)
+ for (Re = Ue.vertexArray, Fe = Ue.colorArray, Ie = Ue.faceArray, pe = Ue.vertices, re = pe * 3, Se = Ue.faceidx, N = 0; N < G - 1; N++)
+ We = [N, N + 1, 2 * G - 2 - N, 2 * G - 1 - N], Se = Ue.faceidx, Ie[Se] = We[0], Ie[Se + 1] = We[1], Ie[Se + 2] = We[3], Ie[Se + 3] = We[1], Ie[Se + 4] = We[2], Ie[Se + 5] = We[3], Ue.faceidx += 6;
+ for (N = 0; N < G - 1; N++)
We = [
- ve - 1 - G,
- ve - 2 - G,
- ve - 2 * j + G + 1,
- ve - 2 * j + G
- ], Se = Te.faceidx, ke[Se] = We[0], ke[Se + 1] = We[1], ke[Se + 2] = We[3], ke[Se + 3] = We[1], ke[Se + 4] = We[2], ke[Se + 5] = We[3], Te.faceidx += 6;
+ pe - 1 - N,
+ pe - 2 - N,
+ pe - 2 * G + N + 1,
+ pe - 2 * G + N
+ ], Se = Ue.faceidx, Ie[Se] = We[0], Ie[Se + 1] = We[1], Ie[Se + 2] = We[3], Ie[Se + 3] = We[1], Ie[Se + 4] = We[2], Ie[Se + 5] = We[3], Ue.faceidx += 6;
}
- function f(P, B, U, F, $, W) {
+ function f(P, B, F, U, z, W) {
if (!(B.length < 2)) {
- var N, G;
- if (N = B[0], G = B[B.length - 1], N = u(N, F), G = u(G, F), !$)
- return n(P, N, G, U);
- var k = [], j, Q, ie, pe, he, ue = [
+ var V, N;
+ if (V = B[0], N = B[B.length - 1], V = u(V, U), N = u(N, U), !z)
+ return n(P, V, N, F);
+ var k = [], G, Q, ie, ge, le, oe = [
[0, 2, -6, -8],
[-4, -2, 6, 4],
[7, -1, -5, 3],
[-3, 5, 1, -7]
- ], se, ae, we, xe, Ie, oe, ve, re, Se, ze, Ge, $e, Re, Be, ke, We, Te;
- for (re = 0, Se = N.length; re < Se; re++) {
- if (Ie = Math.round(re * (U.length - 1) / Se), xe = o.CC.color(U[Ie]), k.push(Q = N[re]), k.push(Q), k.push(ie = G[re]), k.push(ie), re < Se - 1) {
- var je = N[re + 1].clone().sub(N[re]), Fe = G[re].clone().sub(N[re]);
- j = Fe.cross(je).normalize().multiplyScalar($);
+ ], he, se, xe, ye, Pe, de, pe, re, Se, ke, $e, ze, Re, Fe, Ie, We, Ue;
+ for (re = 0, Se = V.length; re < Se; re++) {
+ if (Pe = Math.round(re * (F.length - 1) / Se), ye = o.CC.color(F[Pe]), k.push(Q = V[re]), k.push(Q), k.push(ie = N[re]), k.push(ie), re < Se - 1) {
+ var Be = V[re + 1].clone().sub(V[re]), Ne = N[re].clone().sub(V[re]);
+ G = Ne.cross(Be).normalize().multiplyScalar(z);
}
- for (k.push(pe = N[re].clone().add(j)), k.push(pe), k.push(he = G[re].clone().add(j)), k.push(he), Q.atom !== void 0 && (oe = Q.atom), Be = P.updateGeoGroup(8), ke = Be.vertexArray, We = Be.colorArray, Te = Be.faceArray, se = Be.vertices, ae = se * 3, ke[ae] = Q.x, ke[ae + 1] = Q.y, ke[ae + 2] = Q.z, ke[ae + 3] = Q.x, ke[ae + 4] = Q.y, ke[ae + 5] = Q.z, ke[ae + 6] = ie.x, ke[ae + 7] = ie.y, ke[ae + 8] = ie.z, ke[ae + 9] = ie.x, ke[ae + 10] = ie.y, ke[ae + 11] = ie.z, ke[ae + 12] = pe.x, ke[ae + 13] = pe.y, ke[ae + 14] = pe.z, ke[ae + 15] = pe.x, ke[ae + 16] = pe.y, ke[ae + 17] = pe.z, ke[ae + 18] = he.x, ke[ae + 19] = he.y, ke[ae + 20] = he.z, ke[ae + 21] = he.x, ke[ae + 22] = he.y, ke[ae + 23] = he.z, ze = 0; ze < 8; ++ze)
- We[ae + 3 * ze] = xe.r, We[ae + 1 + 3 * ze] = xe.g, We[ae + 2 + 3 * ze] = xe.b;
+ for (k.push(ge = V[re].clone().add(G)), k.push(ge), k.push(le = N[re].clone().add(G)), k.push(le), Q.atom !== void 0 && (de = Q.atom), Fe = P.updateGeoGroup(8), Ie = Fe.vertexArray, We = Fe.colorArray, Ue = Fe.faceArray, he = Fe.vertices, se = he * 3, Ie[se] = Q.x, Ie[se + 1] = Q.y, Ie[se + 2] = Q.z, Ie[se + 3] = Q.x, Ie[se + 4] = Q.y, Ie[se + 5] = Q.z, Ie[se + 6] = ie.x, Ie[se + 7] = ie.y, Ie[se + 8] = ie.z, Ie[se + 9] = ie.x, Ie[se + 10] = ie.y, Ie[se + 11] = ie.z, Ie[se + 12] = ge.x, Ie[se + 13] = ge.y, Ie[se + 14] = ge.z, Ie[se + 15] = ge.x, Ie[se + 16] = ge.y, Ie[se + 17] = ge.z, Ie[se + 18] = le.x, Ie[se + 19] = le.y, Ie[se + 20] = le.z, Ie[se + 21] = le.x, Ie[se + 22] = le.y, Ie[se + 23] = le.z, ke = 0; ke < 8; ++ke)
+ We[se + 3 * ke] = ye.r, We[se + 1 + 3 * ke] = ye.g, We[se + 2 + 3 * ke] = ye.b;
if (re > 0) {
- var X = ve !== void 0 && oe !== void 0 && ve.serial !== oe.serial;
- for (ze = 0; ze < 4; ze++) {
- var Z = [
- se + ue[ze][0],
- se + ue[ze][1],
- se + ue[ze][2],
- se + ue[ze][3]
+ var H = pe !== void 0 && de !== void 0 && pe.serial !== de.serial;
+ for (ke = 0; ke < 4; ke++) {
+ var K = [
+ he + oe[ke][0],
+ he + oe[ke][1],
+ he + oe[ke][2],
+ he + oe[ke][3]
];
- if (we = Be.faceidx, Te[we] = Z[0], Te[we + 1] = Z[1], Te[we + 2] = Z[3], Te[we + 3] = Z[1], Te[we + 4] = Z[2], Te[we + 5] = Z[3], Be.faceidx += 6, oe.clickable || ve.clickable || oe.hoverable || ve.hoverable) {
- var q = k[Z[3]].clone(), fe = k[Z[0]].clone(), _e = k[Z[2]].clone(), Me = k[Z[1]].clone();
- if (q.atom = k[Z[3]].atom || null, _e.atom = k[Z[2]].atom || null, fe.atom = k[Z[0]].atom || null, Me.atom = k[Z[1]].atom || null, X) {
- var Ae = q.clone().add(fe).multiplyScalar(0.5), H = _e.clone().add(Me).multiplyScalar(0.5), ce = q.clone().add(Me).multiplyScalar(0.5);
- ze % 2 === 0 ? ((ve.clickable || ve.hoverable) && (Ge = new g.Triangle(Ae, ce, q), $e = new g.Triangle(H, _e, ce), Re = new g.Triangle(ce, _e, q), ve.intersectionShape.triangle.push(Ge), ve.intersectionShape.triangle.push($e), ve.intersectionShape.triangle.push(Re)), (oe.clickable || oe.hoverable) && (Ge = new g.Triangle(fe, Me, ce), $e = new g.Triangle(Me, H, ce), Re = new g.Triangle(fe, ce, Ae), oe.intersectionShape.triangle.push(Ge), oe.intersectionShape.triangle.push($e), oe.intersectionShape.triangle.push(Re))) : ((oe.clickable || oe.hoverable) && (Ge = new g.Triangle(Ae, ce, q), $e = new g.Triangle(H, _e, ce), Re = new g.Triangle(ce, _e, q), oe.intersectionShape.triangle.push(Ge), oe.intersectionShape.triangle.push($e), oe.intersectionShape.triangle.push(Re)), (ve.clickable || ve.hoverable) && (Ge = new g.Triangle(fe, Me, ce), $e = new g.Triangle(Me, H, ce), Re = new g.Triangle(fe, ce, Ae), ve.intersectionShape.triangle.push(Ge), ve.intersectionShape.triangle.push($e), ve.intersectionShape.triangle.push(Re)));
+ if (xe = Fe.faceidx, Ue[xe] = K[0], Ue[xe + 1] = K[1], Ue[xe + 2] = K[3], Ue[xe + 3] = K[1], Ue[xe + 4] = K[2], Ue[xe + 5] = K[3], Fe.faceidx += 6, de.clickable || pe.clickable || de.hoverable || pe.hoverable) {
+ var q = k[K[3]].clone(), fe = k[K[0]].clone(), _e = k[K[2]].clone(), Me = k[K[1]].clone();
+ if (q.atom = k[K[3]].atom || null, _e.atom = k[K[2]].atom || null, fe.atom = k[K[0]].atom || null, Me.atom = k[K[1]].atom || null, H) {
+ var Ae = q.clone().add(fe).multiplyScalar(0.5), Z = _e.clone().add(Me).multiplyScalar(0.5), ue = q.clone().add(Me).multiplyScalar(0.5);
+ ke % 2 === 0 ? ((pe.clickable || pe.hoverable) && ($e = new p.Triangle(Ae, ue, q), ze = new p.Triangle(Z, _e, ue), Re = new p.Triangle(ue, _e, q), pe.intersectionShape.triangle.push($e), pe.intersectionShape.triangle.push(ze), pe.intersectionShape.triangle.push(Re)), (de.clickable || de.hoverable) && ($e = new p.Triangle(fe, Me, ue), ze = new p.Triangle(Me, Z, ue), Re = new p.Triangle(fe, ue, Ae), de.intersectionShape.triangle.push($e), de.intersectionShape.triangle.push(ze), de.intersectionShape.triangle.push(Re))) : ((de.clickable || de.hoverable) && ($e = new p.Triangle(Ae, ue, q), ze = new p.Triangle(Z, _e, ue), Re = new p.Triangle(ue, _e, q), de.intersectionShape.triangle.push($e), de.intersectionShape.triangle.push(ze), de.intersectionShape.triangle.push(Re)), (pe.clickable || pe.hoverable) && ($e = new p.Triangle(fe, Me, ue), ze = new p.Triangle(Me, Z, ue), Re = new p.Triangle(fe, ue, Ae), pe.intersectionShape.triangle.push($e), pe.intersectionShape.triangle.push(ze), pe.intersectionShape.triangle.push(Re)));
} else
- (oe.clickable || oe.hoverable) && (Ge = new g.Triangle(fe, Me, q), $e = new g.Triangle(Me, _e, q), oe.intersectionShape.triangle.push(Ge), oe.intersectionShape.triangle.push($e));
+ (de.clickable || de.hoverable) && ($e = new p.Triangle(fe, Me, q), ze = new p.Triangle(Me, _e, q), de.intersectionShape.triangle.push($e), de.intersectionShape.triangle.push(ze));
}
}
}
- Be.vertices += 8, ve = oe;
+ Fe.vertices += 8, pe = de;
}
- var ye = k.length - 8;
- for (Be = P.updateGeoGroup(8), ke = Be.vertexArray, We = Be.colorArray, Te = Be.faceArray, se = Be.vertices, ae = se * 3, we = Be.faceidx, re = 0; re < 4; re++) {
- k.push(k[re * 2]), k.push(k[ye + re * 2]);
- var Pe = k[re * 2], le = k[ye + re * 2];
- ke[ae + 6 * re] = Pe.x, ke[ae + 1 + 6 * re] = Pe.y, ke[ae + 2 + 6 * re] = Pe.z, ke[ae + 3 + 6 * re] = le.x, ke[ae + 4 + 6 * re] = le.y, ke[ae + 5 + 6 * re] = le.z, We[ae + 6 * re] = xe.r, We[ae + 1 + 6 * re] = xe.g, We[ae + 2 + 6 * re] = xe.b, We[ae + 3 + 6 * re] = xe.r, We[ae + 4 + 6 * re] = xe.g, We[ae + 5 + 6 * re] = xe.b;
+ var we = k.length - 8;
+ for (Fe = P.updateGeoGroup(8), Ie = Fe.vertexArray, We = Fe.colorArray, Ue = Fe.faceArray, he = Fe.vertices, se = he * 3, xe = Fe.faceidx, re = 0; re < 4; re++) {
+ k.push(k[re * 2]), k.push(k[we + re * 2]);
+ var Te = k[re * 2], ae = k[we + re * 2];
+ Ie[se + 6 * re] = Te.x, Ie[se + 1 + 6 * re] = Te.y, Ie[se + 2 + 6 * re] = Te.z, Ie[se + 3 + 6 * re] = ae.x, Ie[se + 4 + 6 * re] = ae.y, Ie[se + 5 + 6 * re] = ae.z, We[se + 6 * re] = ye.r, We[se + 1 + 6 * re] = ye.g, We[se + 2 + 6 * re] = ye.b, We[se + 3 + 6 * re] = ye.r, We[se + 4 + 6 * re] = ye.g, We[se + 5 + 6 * re] = ye.b;
}
- ye += 8, Ge = [se, se + 2, se + 6, se + 4], $e = [se + 1, se + 5, se + 7, se + 3], Te[we] = Ge[0], Te[we + 1] = Ge[1], Te[we + 2] = Ge[3], Te[we + 3] = Ge[1], Te[we + 4] = Ge[2], Te[we + 5] = Ge[3], Te[we + 6] = $e[0], Te[we + 7] = $e[1], Te[we + 8] = $e[3], Te[we + 9] = $e[1], Te[we + 10] = $e[2], Te[we + 11] = $e[3], Be.faceidx += 12, Be.vertices += 8;
+ we += 8, $e = [he, he + 2, he + 6, he + 4], ze = [he + 1, he + 5, he + 7, he + 3], Ue[xe] = $e[0], Ue[xe + 1] = $e[1], Ue[xe + 2] = $e[3], Ue[xe + 3] = $e[1], Ue[xe + 4] = $e[2], Ue[xe + 5] = $e[3], Ue[xe + 6] = ze[0], Ue[xe + 7] = ze[1], Ue[xe + 8] = ze[3], Ue[xe + 9] = ze[1], Ue[xe + 10] = ze[2], Ue[xe + 11] = ze[3], Fe.faceidx += 12, Fe.vertices += 8;
}
}
- function c(P, B, U, F, $, W, N) {
- (!N || N === "default") && (N = "rectangle"), N === "edged" ? f(P, B, U, F, $) : (N === "rectangle" || N === "oval" || N === "parabola") && b(P, B, U, F, $, W, N);
+ function c(P, B, F, U, z, W, V) {
+ (!V || V === "default") && (V = "rectangle"), V === "edged" ? f(P, B, F, U, z) : (V === "rectangle" || V === "oval" || V === "parabola") && b(P, B, F, U, z, W, V);
}
function t(P) {
return P && P.elem === "C" && P.atom === "CA";
@@ -16576,7 +16576,7 @@ ATOM`, h);
if (!P.hetflag && !B.hetflag && P.reschain === B.reschain && (P.resi === B.resi || P.resi === B.resi - 1))
return !0;
if (P.resi < B.resi) {
- var U = P.x - B.x, F = P.y - B.y, $ = P.z - B.z, W = U * U + F * F + $ * $;
+ var F = P.x - B.x, U = P.y - B.y, z = P.z - B.z, W = F * F + U * U + z * z;
if (P.atom == "CA" && B.atom == "CA" && W < 16)
return !0;
if ((P.atom == "P" || B.atom == "P") && W < 64)
@@ -16585,35 +16585,35 @@ ATOM`, h);
}
return !1;
}
- function h(P, B, U, F, $) {
+ function h(P, B, F, U, z) {
if (!(B == null || B.vertices == 0)) {
- $ && (B.initTypedArrays(), B.setUpNormals());
+ z && (B.initTypedArrays(), B.setUpNormals());
var W = new _.MeshDoubleLambertMaterial();
- W.vertexColors = _.Coloring.FaceColors, typeof U == "number" && U >= 0 && U < 1 && (W.transparent = !0, W.opacity = U), W.outline = F;
- var N = new _.Mesh(B, W);
- P.add(N);
+ W.vertexColors = _.Coloring.FaceColors, typeof F == "number" && F >= 0 && F < 1 && (W.transparent = !0, W.opacity = F), W.outline = U;
+ var V = new _.Mesh(B, W);
+ P.add(V);
}
}
- function M(P, B, U, F, $, W, N, G, k) {
- var j, Q, ie, pe, he, ue;
- if (!(!F || !$ || !N)) {
- var se = $.sub(F);
- se.normalize();
- var ae = G[k];
- for (Q = k + 1; Q < G.length && (ae = G[Q], ae.atom != N.atom); Q++)
+ function M(P, B, F, U, z, W, V, N, k) {
+ var G, Q, ie, ge, le, oe;
+ if (!(!U || !z || !V)) {
+ var he = z.sub(U);
+ he.normalize();
+ var se = N[k];
+ for (Q = k + 1; Q < N.length && (se = N[Q], se.atom != V.atom); Q++)
;
- if (ae = ae ? new l.Vector3(ae.x, ae.y, ae.z) : new l.Vector3(0, 0, 0), ae.sub(F), N.ss === "arrow start") {
- var we = ae.clone().multiplyScalar(0.3).cross($);
- F.add(we);
- var xe = ae.clone().cross(se).normalize();
- se.rotateAboutVector(xe, 0.43);
- }
- for (N.style.cartoon.ribbon ? j = N.style.cartoon.thickness || D : N.style.cartoon.width ? j = N.style.cartoon.width : N.ss === "c" ? N.atom === "P" ? j = L : j = A : N.ss === "arrow start" ? (j = C, he = !0) : N.ss === "arrow end" || N.ss === "h" && N.style.cartoon.tubes || N.ss === "tube start" ? j = A : j = C, W != null && se.dot(W) < 0 && se.negate(), se.multiplyScalar(j), Q = 0; Q < B; Q++)
- ie = -1 + Q * 2 / (B - 1), pe = new l.Vector3(F.x + ie * se.x, F.y + ie * se.y, F.z + ie * se.z), pe.atom = N, U && N.ss === "s" && (pe.smoothen = !0), P[Q].push(pe);
- if (he)
- for (se.multiplyScalar(2), Q = 0; Q < B; Q++)
- ie = -1 + Q * 2 / (B - 1), pe = new l.Vector3(F.x + ie * se.x, F.y + ie * se.y, F.z + ie * se.z), pe.atom = N, pe.smoothen = !1, pe.skip = !0, P[Q].push(pe);
- return ue = N.style.cartoon.style || "default", P.style ? P.style != ue && (console.log("Warning: a cartoon chain's strand-style is ambiguous"), P.style = "default") : P.style = ue, (N.ss === "arrow start" || N.ss === "arrow end") && (N.ss = "s"), he;
+ if (se = se ? new l.Vector3(se.x, se.y, se.z) : new l.Vector3(0, 0, 0), se.sub(U), V.ss === "arrow start") {
+ var xe = se.clone().multiplyScalar(0.3).cross(z);
+ U.add(xe);
+ var ye = se.clone().cross(he).normalize();
+ he.rotateAboutVector(ye, 0.43);
+ }
+ for (V.style.cartoon.ribbon ? G = V.style.cartoon.thickness || D : V.style.cartoon.width ? G = V.style.cartoon.width : V.ss === "c" ? V.atom === "P" ? G = C : G = A : V.ss === "arrow start" ? (G = L, le = !0) : V.ss === "arrow end" || V.ss === "h" && V.style.cartoon.tubes || V.ss === "tube start" ? G = A : G = L, W != null && he.dot(W) < 0 && he.negate(), he.multiplyScalar(G), Q = 0; Q < B; Q++)
+ ie = -1 + Q * 2 / (B - 1), ge = new l.Vector3(U.x + ie * he.x, U.y + ie * he.y, U.z + ie * he.z), ge.atom = V, F && V.ss === "s" && (ge.smoothen = !0), P[Q].push(ge);
+ if (le)
+ for (he.multiplyScalar(2), Q = 0; Q < B; Q++)
+ ie = -1 + Q * 2 / (B - 1), ge = new l.Vector3(U.x + ie * he.x, U.y + ie * he.y, U.z + ie * he.z), ge.atom = V, ge.smoothen = !1, ge.skip = !0, P[Q].push(ge);
+ return oe = V.style.cartoon.style || "default", P.style ? P.style != oe && (console.log("Warning: a cartoon chain's strand-style is ambiguous"), P.style = "default") : P.style = oe, (V.ss === "arrow start" || V.ss === "arrow end") && (V.ss = "s"), le;
}
}
const w = {
@@ -16634,98 +16634,98 @@ ATOM`, h);
N1: !0,
N3: !0
}, S = { DA: !0, DG: !0, A: !0, G: !0 }, T = { DT: !0, DC: !0, U: !0, C: !0, T: !0 }, R = { DA: !0, DG: !0, A: !0, G: !0, DT: !0, DC: !0, U: !0, C: !0, T: !0 };
- function z(P, B, U, F = 10) {
- let $ = F, W = F;
- var N, G, k, j, Q, ie, pe, he, ue, se, ae, we, xe, Ie, oe, ve, re, Se, ze = new _.Geometry(!0), Ge = new _.Geometry(!0), $e = [], Re = [], Be = 1, ke = !1, We = {};
- for (var Te in x.Gradient.builtinGradients)
- x.Gradient.builtinGradients.hasOwnProperty(Te) && (We[Te] = new x.Gradient.builtinGradients[Te](U[1], U[0]));
- var je = function(K, Oe) {
- return U && Oe.color === "spectrum" ? Oe.colorscheme in We ? We[Oe.colorscheme].valueToHex(K.resi) : We.sinebow.valueToHex(K.resi) : (0, E.getColorFromStyle)(K, Oe).getHex();
+ function $(P, B, F, U = 10) {
+ let z = U, W = U;
+ var V, N, k, G, Q, ie, ge, le, oe, he, se, xe, ye, Pe, de, pe, re, Se, ke = new _.Geometry(!0), $e = new _.Geometry(!0), ze = [], Re = [], Fe = 1, Ie = !1, We = {};
+ for (var Ue in x.Gradient.builtinGradients)
+ x.Gradient.builtinGradients.hasOwnProperty(Ue) && (We[Ue] = new x.Gradient.builtinGradients[Ue](F[1], F[0]));
+ var Be = function(Y, Oe) {
+ return F && Oe.color === "spectrum" ? Oe.colorscheme in We ? We[Oe.colorscheme].valueToHex(Y.resi) : We.sinebow.valueToHex(Y.resi) : (0, E.getColorFromStyle)(Y, Oe).getHex();
};
- for (he = 0; he < $; he++)
- Re[he] = [];
- var Fe = !1, X = !1, Z = [];
- for (he in B) {
- if (j = B[he], j.elem === "C" && j.atom === "CA") {
- var q = a(k, j);
- q && j.ss === "s" ? Fe = !0 : Fe && (k && G && k.style.cartoon.arrows && G.style.cartoon.arrows && (k.ss = "arrow end", G.ss = "arrow start"), Fe = !1), q && (k.ss === "h" || k.ss == "tube start") && k.style.cartoon.tubes ? !X && k.ss != "tube start" && j.style.cartoon.tubes && (j.ss = "tube start", X = !0) : X && (k.ss === "tube start" ? k.ss = "tube end" : G && G.style.cartoon.tubes && (G.ss = "tube end"), X = !1), G = k, k = j;
- }
- j && j.atom in w && Z.push(j);
- }
- X && k.style.cartoon.tubes && (k.ss = "tube end", X = !1);
- var fe = function(K) {
- Re[0].length > 0 && c(Ge, Re, $e, W, pe, Be, Re.style);
- var Oe = [], Ne = null;
- if (K) {
- for (he = 0; he < $; he++)
- Oe[he] = Re[he][Re[he].length - 1];
- Ne = $e[$e.length - 1];
- }
- for (Re = [], he = 0; he < $; he++)
- Re[he] = [];
- if ($e = [], K) {
- for (he = 0; he < $; he++)
- Re[he].push(Oe[he]);
- $e.push(Ne);
- }
- h(P, Ge, Be, ke, !0), h(P, ze, Be, ke, !1), Ge = new _.Geometry(!0), ze = new _.Geometry(!0);
+ for (le = 0; le < z; le++)
+ Re[le] = [];
+ var Ne = !1, H = !1, K = [];
+ for (le in B) {
+ if (G = B[le], G.elem === "C" && G.atom === "CA") {
+ var q = a(k, G);
+ q && G.ss === "s" ? Ne = !0 : Ne && (k && N && k.style.cartoon.arrows && N.style.cartoon.arrows && (k.ss = "arrow end", N.ss = "arrow start"), Ne = !1), q && (k.ss === "h" || k.ss == "tube start") && k.style.cartoon.tubes ? !H && k.ss != "tube start" && G.style.cartoon.tubes && (G.ss = "tube start", H = !0) : H && (k.ss === "tube start" ? k.ss = "tube end" : N && N.style.cartoon.tubes && (N.ss = "tube end"), H = !1), N = k, k = G;
+ }
+ G && G.atom in w && K.push(G);
+ }
+ H && k.style.cartoon.tubes && (k.ss = "tube end", H = !1);
+ var fe = function(Y) {
+ Re[0].length > 0 && c($e, Re, ze, W, ge, Fe, Re.style);
+ var Oe = [], Ve = null;
+ if (Y) {
+ for (le = 0; le < z; le++)
+ Oe[le] = Re[le][Re[le].length - 1];
+ Ve = ze[ze.length - 1];
+ }
+ for (Re = [], le = 0; le < z; le++)
+ Re[le] = [];
+ if (ze = [], Y) {
+ for (le = 0; le < z; le++)
+ Re[le].push(Oe[le]);
+ ze.push(Ve);
+ }
+ h(P, $e, Fe, Ie, !0), h(P, ke, Fe, Ie, !1), $e = new _.Geometry(!0), ke = new _.Geometry(!0);
};
k = void 0;
- for (var _e = 0; _e < Z.length; _e++) {
- j = Z[_e];
- var Me = j.resn.trim(), Ae = Me in R;
- if (Be = 1, N = j.style.cartoon, k && k.style.cartoon && (Be = k.style.cartoon.opacity), k && k.style.cartoon && k.style.cartoon.outline && (ke = k.style.cartoon.outline), k && k.style.cartoon && (!j.style.cartoon || k.style.cartoon.opacity != j.style.cartoon.opacity) && fe(k.chain == j.chain), N.style === "trace") {
- if (!j.hetflag) {
- if (j.elem === "C" && j.atom === "CA" || Ae && j.atom === "P" || j.atom === "BB") {
- if (ie = je(j, N), (0, E.isNumeric)(N.thickness) ? pe = N.thickness : pe = D, a(k, j))
+ for (var _e = 0; _e < K.length; _e++) {
+ G = K[_e];
+ var Me = G.resn.trim(), Ae = Me in R;
+ if (Fe = 1, V = G.style.cartoon, k && k.style.cartoon && (Fe = k.style.cartoon.opacity), k && k.style.cartoon && k.style.cartoon.outline && (Ie = k.style.cartoon.outline), k && k.style.cartoon && (!G.style.cartoon || k.style.cartoon.opacity != G.style.cartoon.opacity) && fe(k.chain == G.chain), V.style === "trace") {
+ if (!G.hetflag) {
+ if (G.elem === "C" && G.atom === "CA" || Ae && G.atom === "P" || G.atom === "BB") {
+ if (ie = Be(G, V), (0, E.isNumeric)(V.thickness) ? ge = V.thickness : ge = D, a(k, G))
if (ie == Q) {
- var H = o.CC.color(ie);
- p.GLDraw.drawCylinder(ze, k, j, pe, H, 2, 2);
+ var Z = o.CC.color(ie);
+ g.GLDraw.drawCylinder(ke, k, G, ge, Z, 2, 2);
} else {
- var ce = new l.Vector3().addVectors(k, j).multiplyScalar(0.5), ye = o.CC.color(Q), Pe = o.CC.color(ie);
- p.GLDraw.drawCylinder(ze, k, ce, pe, ye, 2, 0), p.GLDraw.drawCylinder(ze, ce, j, pe, Pe, 0, 2);
+ var ue = new l.Vector3().addVectors(k, G).multiplyScalar(0.5), we = o.CC.color(Q), Te = o.CC.color(ie);
+ g.GLDraw.drawCylinder(ke, k, ue, ge, we, 2, 0), g.GLDraw.drawCylinder(ke, ue, G, ge, Te, 0, 2);
}
- if ((j.clickable === !0 || j.hoverable) && j.intersectionShape !== void 0) {
- var le = new l.Vector3(j.x, j.y, j.z);
- j.intersectionShape.sphere.push(new g.Sphere(le, pe));
+ if ((G.clickable === !0 || G.hoverable) && G.intersectionShape !== void 0) {
+ var ae = new l.Vector3(G.x, G.y, G.z);
+ G.intersectionShape.sphere.push(new p.Sphere(ae, ge));
}
- k = j, Q = ie;
+ k = G, Q = ie;
}
}
} else {
- if (t(j) || Ae && (j.atom === "P" || j.atom.indexOf("O5") == 0)) {
+ if (t(G) || Ae && (G.atom === "P" || G.atom.indexOf("O5") == 0)) {
if (Se)
- if (j.ss === "tube end")
- Se = !1, re = new l.Vector3(j.x, j.y, j.z), p.GLDraw.drawCylinder(ze, ve, re, 2, o.CC.color(Q), 1, 1), j.ss = "h";
- else if (k.chain != j.chain || k.ss === "tube end")
- Se = !1, k.ss = "h", re = new l.Vector3(k.x, k.y, k.z), p.GLDraw.drawCylinder(ze, ve, re, 2, o.CC.color(Q), 1, 1);
+ if (G.ss === "tube end")
+ Se = !1, re = new l.Vector3(G.x, G.y, G.z), g.GLDraw.drawCylinder(ke, pe, re, 2, o.CC.color(Q), 1, 1), G.ss = "h";
+ else if (k.chain != G.chain || k.ss === "tube end")
+ Se = !1, k.ss = "h", re = new l.Vector3(k.x, k.y, k.z), g.GLDraw.drawCylinder(ke, pe, re, 2, o.CC.color(Q), 1, 1);
else
continue;
- if (k && (!a(k, j) || k.ss === "tube start")) {
- for (k.ss === "tube start" && (Se = !0, ve = new l.Vector3(k.x, k.y, k.z), k.ss = "h"), oe && (we ? Ie = new l.Vector3().addVectors(k, we).multiplyScalar(0.5) : Ie = new l.Vector3(k.x, k.y, k.z), p.GLDraw.drawCylinder(ze, Ie, oe, r, o.CC.color(oe.color), 0, 2), M(Re, $, !0, we, xe, ae, k, Z, _e), $e.push(ie), Ie = null, oe = null), Re[0].length > 0 && c(Ge, Re, $e, W, pe, Be, Re.style), Re = [], he = 0; he < $; he++)
- Re[he] = [];
- $e = [];
+ if (k && (!a(k, G) || k.ss === "tube start")) {
+ for (k.ss === "tube start" && (Se = !0, pe = new l.Vector3(k.x, k.y, k.z), k.ss = "h"), de && (xe ? Pe = new l.Vector3().addVectors(k, xe).multiplyScalar(0.5) : Pe = new l.Vector3(k.x, k.y, k.z), g.GLDraw.drawCylinder(ke, Pe, de, r, o.CC.color(de.color), 0, 2), M(Re, z, !0, xe, ye, se, k, K, _e), ze.push(ie), Pe = null, de = null), Re[0].length > 0 && c($e, Re, ze, W, ge, Fe, Re.style), Re = [], le = 0; le < z; le++)
+ Re[le] = [];
+ ze = [];
}
- if (k === void 0 || k.rescode != j.rescode || k.resi != j.resi) {
- if (oe && k != null) {
- Ie = new l.Vector3().addVectors(k, j).multiplyScalar(0.5);
- var De = Ie.clone().sub(oe).multiplyScalar(0.02);
- Ie.add(De), p.GLDraw.drawCylinder(ze, Ie, oe, r, o.CC.color(oe.color), 0, 2), Ie = null, oe = null;
+ if (k === void 0 || k.rescode != G.rescode || k.resi != G.resi) {
+ if (de && k != null) {
+ Pe = new l.Vector3().addVectors(k, G).multiplyScalar(0.5);
+ var De = Pe.clone().sub(de).multiplyScalar(0.02);
+ Pe.add(De), g.GLDraw.drawCylinder(ke, Pe, de, r, o.CC.color(de.color), 0, 2), Pe = null, de = null;
}
- ie = je(j, N), $e.push(ie), (0, E.isNumeric)(N.thickness) ? pe = N.thickness : pe = D, k = j, ue = new l.Vector3(k.x, k.y, k.z), ue.resi = k.resi, Q = ie;
+ ie = Be(G, V), ze.push(ie), (0, E.isNumeric)(V.thickness) ? ge = V.thickness : ge = D, k = G, oe = new l.Vector3(k.x, k.y, k.z), oe.resi = k.resi, Q = ie;
}
- (j.clickable === !0 || j.hoverable === !0) && (j.intersectionShape === void 0 || j.intersectionShape.triangle === void 0) && (j.intersectionShape = {
+ (G.clickable === !0 || G.hoverable === !0) && (G.intersectionShape === void 0 || G.intersectionShape.triangle === void 0) && (G.intersectionShape = {
sphere: null,
cylinder: [],
line: [],
triangle: []
});
} else
- k != null && (t(k) && j.atom === "O" || Ae && k.atom === "P" && (j.atom === "OP2" || j.atom === "O2P") || Ae && k.atom.indexOf("O5") == 0 && j.atom.indexOf("C5") == 0) ? (se = new l.Vector3(j.x, j.y, j.z), se.resi = j.resi, (j.atom === "OP2" || j.atom === "O2P") && (xe = new l.Vector3(j.x, j.y, j.z))) : Ae && j.atom.indexOf("O3") == 0 ? we = new l.Vector3(j.x, j.y, j.z) : (j.atom === "N1" && Me in S || j.atom === "N3" && Me in T) && (oe = new l.Vector3(j.x, j.y, j.z), oe.color = (0, E.getColorFromStyle)(j, N).getHex());
- se && ue && se.resi === ue.resi && (M(Re, $, !0, ue, se, ae, k, Z, _e), ae = se, ue = null, se = null, $e.push(ie));
+ k != null && (t(k) && G.atom === "O" || Ae && k.atom === "P" && (G.atom === "OP2" || G.atom === "O2P") || Ae && k.atom.indexOf("O5") == 0 && G.atom.indexOf("C5") == 0) ? (he = new l.Vector3(G.x, G.y, G.z), he.resi = G.resi, (G.atom === "OP2" || G.atom === "O2P") && (ye = new l.Vector3(G.x, G.y, G.z))) : Ae && G.atom.indexOf("O3") == 0 ? xe = new l.Vector3(G.x, G.y, G.z) : (G.atom === "N1" && Me in S || G.atom === "N3" && Me in T) && (de = new l.Vector3(G.x, G.y, G.z), de.color = (0, E.getColorFromStyle)(G, V).getHex());
+ he && oe && he.resi === oe.resi && (M(Re, z, !0, oe, he, se, k, K, _e), se = he, oe = null, he = null, ze.push(ie));
}
}
- oe && (we ? Ie = new l.Vector3().addVectors(k, we).multiplyScalar(0.5) : Ie = new l.Vector3(k.x, k.y, k.z), p.GLDraw.drawCylinder(ze, Ie, oe, r, o.CC.color(oe.color), 0, 2), M(Re, $, !0, we, xe, ae, k, Z, _e), $e.push(ie)), fe(!1);
+ de && (xe ? Pe = new l.Vector3().addVectors(k, xe).multiplyScalar(0.5) : Pe = new l.Vector3(k.x, k.y, k.z), g.GLDraw.drawCylinder(ke, Pe, de, r, o.CC.color(de.color), 0, 2), M(Re, z, !0, xe, ye, se, k, K, _e), ze.push(ie)), fe(!1);
}
}
),
@@ -16745,12 +16745,12 @@ ATOM`, h);
/* harmony export */
CC: () => (
/* reexport safe */
- g.CC
+ p.CC
),
/* harmony export */
Color: () => (
/* reexport safe */
- g.Color
+ p.Color
),
/* harmony export */
CustomLinear: () => (
@@ -16785,7 +16785,7 @@ ATOM`, h);
/* harmony export */
GLVolumetricRender: () => (
/* reexport safe */
- L.GLVolumetricRender
+ C.GLVolumetricRender
),
/* harmony export */
Gradient: () => (
@@ -16820,12 +16820,12 @@ ATOM`, h);
/* harmony export */
Matrix3: () => (
/* reexport safe */
- p.Matrix3
+ g.Matrix3
),
/* harmony export */
Matrix4: () => (
/* reexport safe */
- p.Matrix4
+ g.Matrix4
),
/* harmony export */
Parsers: () => (
@@ -16850,7 +16850,7 @@ ATOM`, h);
/* harmony export */
Quaternion: () => (
/* reexport safe */
- p.Quaternion
+ g.Quaternion
),
/* harmony export */
ROYGB: () => (
@@ -16865,7 +16865,7 @@ ATOM`, h);
/* harmony export */
Ray: () => (
/* reexport safe */
- p.Ray
+ g.Ray
),
/* harmony export */
Sinebow: () => (
@@ -16890,17 +16890,17 @@ ATOM`, h);
/* harmony export */
Vector2: () => (
/* reexport safe */
- p.Vector2
+ g.Vector2
),
/* harmony export */
Vector3: () => (
/* reexport safe */
- p.Vector3
+ g.Vector3
),
/* harmony export */
VolumeData: () => (
/* reexport safe */
- C.VolumeData
+ L.VolumeData
),
/* harmony export */
adjustVolumeStyle: () => (
@@ -16935,7 +16935,7 @@ ATOM`, h);
/* harmony export */
builtinColorSchemes: () => (
/* reexport safe */
- g.builtinColorSchemes
+ p.builtinColorSchemes
),
/* harmony export */
builtinGradients: () => (
@@ -16945,17 +16945,17 @@ ATOM`, h);
/* harmony export */
chains: () => (
/* reexport safe */
- g.chains
+ p.chains
),
/* harmony export */
clamp: () => (
/* reexport safe */
- p.clamp
+ g.clamp
),
/* harmony export */
conversionMatrix3: () => (
/* reexport safe */
- p.conversionMatrix3
+ g.conversionMatrix3
),
/* harmony export */
createStereoViewer: () => (
@@ -16980,7 +16980,7 @@ ATOM`, h);
/* harmony export */
degToRad: () => (
/* reexport safe */
- p.degToRad
+ g.degToRad
),
/* harmony export */
download: () => (
@@ -16995,7 +16995,7 @@ ATOM`, h);
/* harmony export */
elementColors: () => (
/* reexport safe */
- g.elementColors
+ p.elementColors
),
/* harmony export */
extend: () => (
@@ -17045,7 +17045,7 @@ ATOM`, h);
/* harmony export */
htmlColors: () => (
/* reexport safe */
- g.htmlColors
+ p.htmlColors
),
/* harmony export */
isEmptyObject: () => (
@@ -17085,7 +17085,7 @@ ATOM`, h);
/* harmony export */
residues: () => (
/* reexport safe */
- g.residues
+ p.residues
),
/* harmony export */
setBondLength: () => (
@@ -17110,7 +17110,7 @@ ATOM`, h);
/* harmony export */
ssColors: () => (
/* reexport safe */
- g.ssColors
+ p.ssColors
),
/* harmony export */
subdivide_spline: () => (
@@ -17132,7 +17132,7 @@ ATOM`, h);
var l = e(
/*! ./Gradient */
"./src/Gradient.ts"
- ), g = e(
+ ), p = e(
/*! ./colors */
"./src/colors.ts"
), _ = e(
@@ -17144,7 +17144,7 @@ ATOM`, h);
), o = e(
/*! ./parsers */
"./src/parsers/index.ts"
- ), p = e(
+ ), g = e(
/*! ./WebGL/math */
"./src/WebGL/math/index.ts"
), E = e(
@@ -17156,10 +17156,10 @@ ATOM`, h);
), A = e(
/*! ./ProteinSurface4 */
"./src/ProteinSurface4.ts"
- ), C = e(
+ ), L = e(
/*! ./VolumeData */
"./src/VolumeData.ts"
- ), L = e(
+ ), C = e(
/*! ./VolumetricRender */
"./src/VolumetricRender.ts"
), D = e(
@@ -17202,17 +17202,17 @@ ATOM`, h);
)
/* harmony export */
});
- function l(g, _) {
+ function l(p, _) {
var x = [[]];
- typeof g == "string" && (g = JSON.parse(g));
- for (var o = g.m, p = o[0].a, E = o[0].b, u = o[0].s, A = _ !== void 0 && _.parseStyle !== void 0 ? _.parseStyle : u !== void 0, C = x[x.length - 1].length, L = 0; L < p.length; L++) {
- var D = p[L], r = {};
+ typeof p == "string" && (p = JSON.parse(p));
+ for (var o = p.m, g = o[0].a, E = o[0].b, u = o[0].s, A = _ !== void 0 && _.parseStyle !== void 0 ? _.parseStyle : u !== void 0, L = x[x.length - 1].length, C = 0; C < g.length; C++) {
+ var D = g[C], r = {};
r.id = D.i, r.x = D.x, r.y = D.y, r.z = D.z || 0, r.bonds = [], r.bondOrder = [];
var n = D.l || "C";
r.elem = n[0].toUpperCase() + n.substring(1).toLowerCase(), r.serial = x[x.length - 1].length, A && (r.style = u[D.s || 0]), x[x.length - 1].push(r);
}
for (let b = 0; b < E.length; b++) {
- let f = E[b], c = f.b + C, t = f.e + C, a = f.o || 1, h = x[x.length - 1][c], M = x[x.length - 1][t];
+ let f = E[b], c = f.b + L, t = f.e + L, a = f.o || 1, h = x[x.length - 1][c], M = x[x.length - 1][t];
h.bonds.push(t), h.bondOrder.push(a), M.bonds.push(c), M.bondOrder.push(a);
}
return x;
@@ -17237,7 +17237,7 @@ ATOM`, h);
var l = e(
/*! ./utils/computeSecondaryStructure */
"./src/parsers/utils/computeSecondaryStructure.ts"
- ), g = e(
+ ), p = e(
/*! ./utils/processSymmetries */
"./src/parsers/utils/processSymmetries.ts"
), _ = e(
@@ -17247,31 +17247,31 @@ ATOM`, h);
/*! ./utils/assignPDBBonds */
"./src/parsers/utils/assignPDBBonds.ts"
);
- function o(p, E = {}) {
- var u = [], A = !E.doAssembly, C = u.modelData = [], L = E.assignBonds === void 0 ? !0 : E.assignBonds, D = function(Z, q, fe, _e) {
- return new _.Vector3(q, fe, _e).applyMatrix3(Z);
+ function o(g, E = {}) {
+ var u = [], A = !E.doAssembly, L = u.modelData = [], C = E.assignBonds === void 0 ? !0 : E.assignBonds, D = function(K, q, fe, _e) {
+ return new _.Vector3(q, fe, _e).applyMatrix3(K);
};
- function r(Z, q) {
- for (var fe = [], _e = 0, Me = 0; Me < Z.length; ) {
- for (; Z.substring(Me, Me + q.length) !== q && Me < Z.length; )
- if (Z[Me] === "'") {
- for (Me++; Me < Z.length && Z[Me] !== "'"; )
+ function r(K, q) {
+ for (var fe = [], _e = 0, Me = 0; Me < K.length; ) {
+ for (; K.substring(Me, Me + q.length) !== q && Me < K.length; )
+ if (K[Me] === "'") {
+ for (Me++; Me < K.length && K[Me] !== "'"; )
Me++;
- for (; Z.substring(Me, Me + q.length) !== q && Me < Z.length; )
+ for (; K.substring(Me, Me + q.length) !== q && Me < K.length; )
Me++;
- } else if (Z[Me] === '"') {
- for (Me++; Me < Z.length && Z[Me] !== '"'; )
+ } else if (K[Me] === '"') {
+ for (Me++; Me < K.length && K[Me] !== '"'; )
Me++;
Me++;
} else
Me++;
- fe.push(Z.substring(_e, Me)), _e = Me = Me + q.length;
+ fe.push(K.substring(_e, Me)), _e = Me = Me + q.length;
}
return fe;
}
- var n = p.split(/\r?\n|\r/), b = [], f = !1;
- for (let Z = 0; Z < n.length; Z++) {
- var c = n[Z].split("#")[0];
+ var n = g.split(/\r?\n|\r/), b = [], f = !1;
+ for (let K = 0; K < n.length; K++) {
+ var c = n[K].split("#")[0];
if (f ? c[0] === ";" && (f = !1) : c[0] === ";" && (f = !0), f || c !== "") {
if (!f && (c = c.trim(), c[0] === "_")) {
var t = c.split(/\s/)[0].indexOf(".");
@@ -17308,78 +17308,78 @@ ATOM`, h);
a++;
for (var R = []; b[a] === "" || b[a][0] === "_"; ) {
if (b[a] !== "") {
- let Z = b[a].split(/\s/)[0].toLowerCase(), q = h[Z] = h[Z] || [];
+ let K = b[a].split(/\s/)[0].toLowerCase(), q = h[K] = h[K] || [];
R.push(q);
}
a++;
}
- for (var z = 0; a < b.length && b[a][0] !== "_" && !b[a].startsWith("loop_") && !b[a].startsWith("data_"); ) {
- let Z = r(b[a], " ");
- for (var P = 0; P < Z.length; P++)
- Z[P] !== "" && (R[z].push(Z[P]), z = (z + 1) % R.length);
+ for (var $ = 0; a < b.length && b[a][0] !== "_" && !b[a].startsWith("loop_") && !b[a].startsWith("data_"); ) {
+ let K = r(b[a], " ");
+ for (var P = 0; P < K.length; P++)
+ K[P] !== "" && (R[$].push(K[P]), $ = ($ + 1) % R.length);
a++;
}
} else
a++;
- C.push({ symmetries: [] }), u.push([]);
- var B = h._atom_site_id !== void 0 ? h._atom_site_id.length : h._atom_site_label.length, U;
+ L.push({ symmetries: [] }), u.push([]);
+ var B = h._atom_site_id !== void 0 ? h._atom_site_id.length : h._atom_site_label.length, F;
if (h._cell_length_a !== void 0) {
- var F = parseFloat(h._cell_length_a), $ = parseFloat(h._cell_length_b), W = parseFloat(h._cell_length_c), N = parseFloat(h._cell_angle_alpha) || 90, G = parseFloat(h._cell_angle_beta) || 90, k = parseFloat(h._cell_angle_gamma) || 90;
- U = (0, _.conversionMatrix3)(F, $, W, N, G, k), C[C.length - 1].cryst = {
- a: F,
- b: $,
+ var U = parseFloat(h._cell_length_a), z = parseFloat(h._cell_length_b), W = parseFloat(h._cell_length_c), V = parseFloat(h._cell_angle_alpha) || 90, N = parseFloat(h._cell_angle_beta) || 90, k = parseFloat(h._cell_angle_gamma) || 90;
+ F = (0, _.conversionMatrix3)(U, z, W, V, N, k), L[L.length - 1].cryst = {
+ a: U,
+ b: z,
c: W,
- alpha: N,
- beta: G,
+ alpha: V,
+ beta: N,
gamma: k
};
}
- for (var j = 0; j < B; j++)
- if (!(h._atom_site_group_pdb !== void 0 && h._atom_site_group_pdb[j] === "TER")) {
+ for (var G = 0; G < B; G++)
+ if (!(h._atom_site_group_pdb !== void 0 && h._atom_site_group_pdb[G] === "TER")) {
var Q = {};
if (h._atom_site_cartn_x !== void 0)
- Q.x = parseFloat(h._atom_site_cartn_x[j]), Q.y = parseFloat(h._atom_site_cartn_y[j]), Q.z = parseFloat(h._atom_site_cartn_z[j]);
+ Q.x = parseFloat(h._atom_site_cartn_x[G]), Q.y = parseFloat(h._atom_site_cartn_y[G]), Q.z = parseFloat(h._atom_site_cartn_z[G]);
else {
- var ie = D(U, parseFloat(h._atom_site_fract_x[j]), parseFloat(h._atom_site_fract_y[j]), parseFloat(h._atom_site_fract_z[j]));
+ var ie = D(F, parseFloat(h._atom_site_fract_x[G]), parseFloat(h._atom_site_fract_y[G]), parseFloat(h._atom_site_fract_z[G]));
Q.x = ie.x, Q.y = ie.y, Q.z = ie.z;
}
- Q.chain = h._atom_site_auth_asym_id ? h._atom_site_auth_asym_id[j] : h._atom_site_label_asym_id ? h._atom_site_label_asym_id[j] : void 0, Q.resi = h._atom_site_auth_seq_id ? parseInt(h._atom_site_auth_seq_id[j]) : h._atom_site_label_seq_id ? h._atom_site_label_seq_id[j] : void 0, Q.resn = h._atom_site_auth_comp_id ? h._atom_site_auth_comp_id[j].trim() : h._atom_site_label_comp_id ? h._atom_site_label_comp_id[j].trim() : void 0, Q.atom = h._atom_site_auth_atom_id ? h._atom_site_auth_atom_id[j].replace(/"/gm, "") : h._atom_site_label_atom_id ? h._atom_site_label_atom_id[j].replace(/"/gm, "") : void 0, Q.hetflag = !h._atom_site_group_pdb || h._atom_site_group_pdb[j] === "HETA" || h._atom_site_group_pdb[j] === "HETATM";
- var pe = "X";
- h._atom_site_type_symbol ? pe = h._atom_site_type_symbol[j].replace(/\(?\+?\d+.*/, "") : h._atom_site_label && (pe = h._atom_site_label[j].split("_")[0].replace(/\(?\d+.*/, "")), Q.elem = pe[0].toUpperCase() + pe.substring(1, 2).toLowerCase(), Q.bonds = [], Q.ss = "c", Q.serial = j, Q.bondOrder = [], Q.properties = {}, u[u.length - 1].push(Q);
+ Q.chain = h._atom_site_auth_asym_id ? h._atom_site_auth_asym_id[G] : h._atom_site_label_asym_id ? h._atom_site_label_asym_id[G] : void 0, Q.resi = h._atom_site_auth_seq_id ? parseInt(h._atom_site_auth_seq_id[G]) : h._atom_site_label_seq_id ? h._atom_site_label_seq_id[G] : void 0, Q.resn = h._atom_site_auth_comp_id ? h._atom_site_auth_comp_id[G].trim() : h._atom_site_label_comp_id ? h._atom_site_label_comp_id[G].trim() : void 0, Q.atom = h._atom_site_auth_atom_id ? h._atom_site_auth_atom_id[G].replace(/"/gm, "") : h._atom_site_label_atom_id ? h._atom_site_label_atom_id[G].replace(/"/gm, "") : void 0, Q.hetflag = !h._atom_site_group_pdb || h._atom_site_group_pdb[G] === "HETA" || h._atom_site_group_pdb[G] === "HETATM";
+ var ge = "X";
+ h._atom_site_type_symbol ? ge = h._atom_site_type_symbol[G].replace(/\(?\+?\d+.*/, "") : h._atom_site_label && (ge = h._atom_site_label[G].split("_")[0].replace(/\(?\d+.*/, "")), Q.elem = ge[0].toUpperCase() + ge.substring(1, 2).toLowerCase(), Q.bonds = [], Q.ss = "c", Q.serial = G, Q.bondOrder = [], Q.properties = {}, u[u.length - 1].push(Q);
}
if (h._pdbx_struct_oper_list_id !== void 0 && !A)
- for (let Z = 0; Z < h._pdbx_struct_oper_list_id.length; Z++) {
- var he = parseFloat(h["_pdbx_struct_oper_list_matrix[1][1]"][Z]), ue = parseFloat(h["_pdbx_struct_oper_list_matrix[1][2]"][Z]), se = parseFloat(h["_pdbx_struct_oper_list_matrix[1][3]"][Z]), ae = parseFloat(h["_pdbx_struct_oper_list_vector[1]"][Z]), we = parseFloat(h["_pdbx_struct_oper_list_matrix[2][1]"][Z]), xe = parseFloat(h["_pdbx_struct_oper_list_matrix[2][2]"][Z]), Ie = parseFloat(h["_pdbx_struct_oper_list_matrix[2][3]"][Z]), oe = parseFloat(h["_pdbx_struct_oper_list_vector[2]"][Z]), ve = parseFloat(h["_pdbx_struct_oper_list_matrix[3][1]"][Z]), re = parseFloat(h["_pdbx_struct_oper_list_matrix[3][2]"][Z]), Se = parseFloat(h["_pdbx_struct_oper_list_matrix[3][3]"][Z]), ze = parseFloat(h["_pdbx_struct_oper_list_vector[3]"][Z]), Ge = new _.Matrix4(he, ue, se, ae, we, xe, Ie, oe, ve, re, Se, ze);
- C[C.length - 1].symmetries.push(Ge);
+ for (let K = 0; K < h._pdbx_struct_oper_list_id.length; K++) {
+ var le = parseFloat(h["_pdbx_struct_oper_list_matrix[1][1]"][K]), oe = parseFloat(h["_pdbx_struct_oper_list_matrix[1][2]"][K]), he = parseFloat(h["_pdbx_struct_oper_list_matrix[1][3]"][K]), se = parseFloat(h["_pdbx_struct_oper_list_vector[1]"][K]), xe = parseFloat(h["_pdbx_struct_oper_list_matrix[2][1]"][K]), ye = parseFloat(h["_pdbx_struct_oper_list_matrix[2][2]"][K]), Pe = parseFloat(h["_pdbx_struct_oper_list_matrix[2][3]"][K]), de = parseFloat(h["_pdbx_struct_oper_list_vector[2]"][K]), pe = parseFloat(h["_pdbx_struct_oper_list_matrix[3][1]"][K]), re = parseFloat(h["_pdbx_struct_oper_list_matrix[3][2]"][K]), Se = parseFloat(h["_pdbx_struct_oper_list_matrix[3][3]"][K]), ke = parseFloat(h["_pdbx_struct_oper_list_vector[3]"][K]), $e = new _.Matrix4(le, oe, he, se, xe, ye, Pe, de, pe, re, Se, ke);
+ L[L.length - 1].symmetries.push($e);
}
- var $e = function(Z) {
- var q = Z.match("-");
- Z = Z.replace(/[-xyz]/g, "");
- var fe = Z.split("/"), _e, Me;
+ var ze = function(K) {
+ var q = K.match("-");
+ K = K.replace(/[-xyz]/g, "");
+ var fe = K.split("/"), _e, Me;
return fe[1] === void 0 ? Me = 1 : Me = parseInt(fe[1]), fe[0] === "" ? _e = 1 : _e = parseInt(fe[0]), _e / Me * (q ? -1 : 1);
};
if (h._symmetry_equiv_pos_as_xyz !== void 0 && !A)
for (var Re = 0; Re < h._symmetry_equiv_pos_as_xyz.length; Re++) {
- var Be = h._symmetry_equiv_pos_as_xyz[Re].replace(/["' ]/g, ""), ke = Be.split(",").map(function(q) {
+ var Fe = h._symmetry_equiv_pos_as_xyz[Re].replace(/["' ]/g, ""), Ie = Fe.split(",").map(function(q) {
return q.replace(/-/g, "+-");
});
- let Z = new _.Matrix4(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1);
+ let K = new _.Matrix4(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1);
for (let q = 0; q < 3; q++) {
- var We = ke[q].split("+");
+ var We = Ie[q].split("+");
for (let fe = 0; fe < We.length; fe++) {
- var Te = We[fe];
- if (Te !== "") {
- var je = $e(Te);
- Te.match("x") ? Z.elements[q + 0] = je : Te.match("y") ? Z.elements[q + 4] = je : Te.match("z") ? Z.elements[q + 8] = je : Z.elements[q + 12] = je;
+ var Ue = We[fe];
+ if (Ue !== "") {
+ var Be = ze(Ue);
+ Ue.match("x") ? K.elements[q + 0] = Be : Ue.match("y") ? K.elements[q + 4] = Be : Ue.match("z") ? K.elements[q + 8] = Be : K.elements[q + 12] = Be;
}
}
}
- var Fe = U.getMatrix4(), X = new _.Matrix4().getInverse(Fe, !0);
- Z = new _.Matrix4().multiplyMatrices(Z, X), Z = new _.Matrix4().multiplyMatrices(Fe, Z), C[C.length - 1].symmetries.push(Z);
+ var Ne = F.getMatrix4(), H = new _.Matrix4().getInverse(Ne, !0);
+ K = new _.Matrix4().multiplyMatrices(K, H), K = new _.Matrix4().multiplyMatrices(Ne, K), L[L.length - 1].symmetries.push(K);
}
}
- for (let Z = 0; Z < u.length; Z++)
- L && !(E.duplicateAssemblyAtoms && !E.dontConnectDuplicatedAtoms) && (0, x.assignPDBBonds)(u[Z], E), (0, l.computeSecondaryStructure)(u[Z], E.hbondCutoff), (0, g.processSymmetries)(C[Z].symmetries, u[Z], E, C[Z].cryst), E.duplicateAssemblyAtoms && !E.dontConnectDuplicatedAtoms && L && (0, x.assignPDBBonds)(u[Z], E);
+ for (let K = 0; K < u.length; K++)
+ C && !(E.duplicateAssemblyAtoms && !E.dontConnectDuplicatedAtoms) && (0, x.assignPDBBonds)(u[K], E), (0, l.computeSecondaryStructure)(u[K], E.hbondCutoff), (0, p.processSymmetries)(L[K].symmetries, u[K], E, L[K].cryst), E.duplicateAssemblyAtoms && !E.dontConnectDuplicatedAtoms && C && (0, x.assignPDBBonds)(u[K], E);
return u;
}
}
@@ -17402,44 +17402,44 @@ ATOM`, h);
var l = e(
/*! ../WebGL */
"./src/WebGL/index.ts"
- ), g = e(
+ ), p = e(
/*! ./utils/assignBonds */
"./src/parsers/utils/assignBonds.ts"
), _ = e(
/*! ./utils/anumToSymbol */
"./src/parsers/utils/anumToSymbol.ts"
);
- function x(o, p) {
- p = p || {};
- var E = [[]], u = o.split(/\r?\n/), A = p.assignBonds === void 0 ? !0 : p.assignBonds;
+ function x(o, g) {
+ g = g || {};
+ var E = [[]], u = o.split(/\r?\n/), A = g.assignBonds === void 0 ? !0 : g.assignBonds;
if (u.length < 6)
return E;
- var C = u[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), L = Math.abs(parseFloat(C[0]));
+ var L = u[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), C = Math.abs(parseFloat(L[0]));
let D = {};
- var r = D.origin = new l.Vector3(parseFloat(C[1]), parseFloat(C[2]), parseFloat(C[3]));
- C = u[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), C = u[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
- var n = C[0] > 0 ? 0.529177 : 1;
+ var r = D.origin = new l.Vector3(parseFloat(L[1]), parseFloat(L[2]), parseFloat(L[3]));
+ L = u[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), L = u[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
+ var n = L[0] > 0 ? 0.529177 : 1;
r.multiplyScalar(n);
- var b = Math.abs(C[0]), f = new l.Vector3(parseFloat(C[1]), parseFloat(C[2]), parseFloat(C[3])).multiplyScalar(n);
- C = u[4].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
- var c = Math.abs(C[0]), t = new l.Vector3(parseFloat(C[1]), parseFloat(C[2]), parseFloat(C[3])).multiplyScalar(n);
- C = u[5].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
- var a = Math.abs(C[0]), h = new l.Vector3(parseFloat(C[1]), parseFloat(C[2]), parseFloat(C[3])).multiplyScalar(n);
+ var b = Math.abs(L[0]), f = new l.Vector3(parseFloat(L[1]), parseFloat(L[2]), parseFloat(L[3])).multiplyScalar(n);
+ L = u[4].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
+ var c = Math.abs(L[0]), t = new l.Vector3(parseFloat(L[1]), parseFloat(L[2]), parseFloat(L[3])).multiplyScalar(n);
+ L = u[5].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
+ var a = Math.abs(L[0]), h = new l.Vector3(parseFloat(L[1]), parseFloat(L[2]), parseFloat(L[3])).multiplyScalar(n);
if (D.size = { x: b, y: c, z: a }, D.unit = new l.Vector3(f.x, t.y, h.z), f.y != 0 || f.z != 0 || t.x != 0 || t.z != 0 || h.x != 0 || h.y != 0) {
D.matrix4 = new l.Matrix4(f.x, t.x, h.x, 0, f.y, t.y, h.y, 0, f.z, t.z, h.z, 0, 0, 0, 0, 1);
let P = new l.Matrix4().makeTranslation(r.x, r.y, r.z);
D.matrix4 = D.matrix4.multiplyMatrices(P, D.matrix4), D.matrix = D.matrix4.matrix3FromTopLeft(), D.origin = new l.Vector3(0, 0, 0), D.unit = new l.Vector3(1, 1, 1);
}
- E.modelData = [{ cryst: D }], u = u.splice(6, L);
+ E.modelData = [{ cryst: D }], u = u.splice(6, C);
for (var M = E[E.length - 1].length, w = M + u.length, S = M; S < w; ++S) {
var T = {};
T.serial = S;
- var R = u[S - M], z = R.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
- T.elem = _.anumToSymbol[z[0]], T.x = parseFloat(z[2]) * n, T.y = parseFloat(z[3]) * n, T.z = parseFloat(z[4]) * n, T.hetflag = !0, T.bonds = [], T.bondOrder = [], T.properties = {}, E[E.length - 1].push(T);
+ var R = u[S - M], $ = R.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
+ T.elem = _.anumToSymbol[$[0]], T.x = parseFloat($[2]) * n, T.y = parseFloat($[3]) * n, T.z = parseFloat($[4]) * n, T.hetflag = !0, T.bonds = [], T.bondOrder = [], T.properties = {}, E[E.length - 1].push(T);
}
if (A)
for (let P = 0; P < E.length; P++)
- (0, g.assignBonds)(E[P], p);
+ (0, p.assignBonds)(E[P], g);
return E;
}
}
@@ -17462,34 +17462,34 @@ ATOM`, h);
var l = e(
/*! ./utils/assignPDBBonds */
"./src/parsers/utils/assignPDBBonds.ts"
- ), g = e(
+ ), p = e(
/*! ./utils/atomNameToElem */
"./src/parsers/utils/atomNameToElem.ts"
);
function _(x, o) {
- for (var p = [], E = x.split(/\r?\n|\r/); E.length > 0 && !(E.length < 3); ) {
+ for (var g = [], E = x.split(/\r?\n|\r/); E.length > 0 && !(E.length < 3); ) {
var u = parseInt(E[1]);
if (isNaN(u) || u <= 0 || E.length < u + 3)
break;
var A = [];
- p.push(A);
- for (var C = 2, L = A.length, D = L + u, r = L; r < D; r++) {
- var n = E[C++], b = {};
- b.serial = r, b.atom = n.slice(10, 15).trim(), b.elem = (0, g.atomNameToElem)(b.atom, !0), b.x = 10 * parseFloat(n.slice(20, 28)), b.y = 10 * parseFloat(n.slice(28, 36)), b.z = 10 * parseFloat(n.slice(36, 44)), b.resi = parseInt(n.slice(0, 5)), b.resn = n.slice(5, 10).trim(), b.bonds = [], b.bondOrder = [], b.properties = {}, n.length > 44 && (b.dx = 10 * parseFloat(n.slice(44, 52)), b.dy = 10 * parseFloat(n.slice(52, 60)), b.dz = 10 * parseFloat(n.slice(60, 68))), A[r] = b;
+ g.push(A);
+ for (var L = 2, C = A.length, D = C + u, r = C; r < D; r++) {
+ var n = E[L++], b = {};
+ b.serial = r, b.atom = n.slice(10, 15).trim(), b.elem = (0, p.atomNameToElem)(b.atom, !0), b.x = 10 * parseFloat(n.slice(20, 28)), b.y = 10 * parseFloat(n.slice(28, 36)), b.z = 10 * parseFloat(n.slice(36, 44)), b.resi = parseInt(n.slice(0, 5)), b.resn = n.slice(5, 10).trim(), b.bonds = [], b.bondOrder = [], b.properties = {}, n.length > 44 && (b.dx = 10 * parseFloat(n.slice(44, 52)), b.dy = 10 * parseFloat(n.slice(52, 60)), b.dz = 10 * parseFloat(n.slice(60, 68))), A[r] = b;
}
- if (E.length <= C + 3) {
- var f = E[C++], c = f.trim().split(/\s+/);
+ if (E.length <= L + 3) {
+ var f = E[L++], c = f.trim().split(/\s+/);
if (c.length == 3) {
for (var t = 0; t < 3; t++)
c[t] = parseFloat(c[t]) * 10;
- p.box = c;
+ g.box = c;
}
}
- E.splice(0, ++C);
+ E.splice(0, ++L);
}
- for (let a = 0; a < p.length; a++)
- (0, l.assignPDBBonds)(p[a], o);
- return p;
+ for (let a = 0; a < g.length; a++)
+ (0, l.assignPDBBonds)(g[a], o);
+ return g;
}
}
),
@@ -17504,7 +17504,7 @@ ATOM`, h);
/* harmony export */
LAMMPSTRJ: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -17512,8 +17512,8 @@ ATOM`, h);
/*! ./utils/assignBonds */
"./src/parsers/utils/assignBonds.ts"
);
- function g(_, x) {
- for (var o = [], p = {
+ function p(_, x) {
+ for (var o = [], g = {
id: "serial",
type: "atom",
element: "elem",
@@ -17531,22 +17531,22 @@ ATOM`, h);
zu: "z",
zs: "z",
zsu: "z"
- }, E = _.split(/\r?\n|\r/), u = 0, A = 0, C = 0; C < E.length - 9; ) {
- for (var L = C; L < E.length; L++)
- if (E[L].match(/ITEM: NUMBER OF ATOMS/) && (A = parseInt(E[L + 1])), E[L].match(/ITEM: ATOMS/)) {
- u = L + 1;
+ }, E = _.split(/\r?\n|\r/), u = 0, A = 0, L = 0; L < E.length - 9; ) {
+ for (var C = L; C < E.length; C++)
+ if (E[C].match(/ITEM: NUMBER OF ATOMS/) && (A = parseInt(E[C + 1])), E[C].match(/ITEM: ATOMS/)) {
+ u = C + 1;
break;
}
var D = E[u - 1].replace("ITEM: ATOMS ", "").split(" ");
o.push([]);
for (let a = u; a < u + A; a++) {
for (var r = {}, n = {}, b = E[a].split(" "), f = 0; f < b.length; f++) {
- var c = p[D[f]];
+ var c = g[D[f]];
c != null && (c == "serial" ? r[c] = parseInt(b[f]) : c == "x" || c == "y" || c === "z" ? r[c] = parseFloat(b[f]) : c == "charge" || c == "radius" ? n[c] = parseFloat(b[f]) : r[c] = b[f]), r.properties = n, r.bonds = [], r.bondOrder = [];
}
o[o.length - 1][a - u] = r;
}
- C = u + A - 1;
+ L = u + A - 1;
}
if (x.assignBonds)
for (var t = 0; t < o.length; t++)
@@ -17573,7 +17573,7 @@ ATOM`, h);
var l = e(
/*! ../utilities */
"./src/utilities.ts"
- ), g = e(
+ ), p = e(
/*! ../WebGL */
"./src/WebGL/index.ts"
), _ = e(
@@ -17585,10 +17585,10 @@ ATOM`, h);
), o = e(
/*! ./src/vendor/mmtf.js */
"./src/vendor/mmtf.js"
- ), p = function(C) {
- return String.fromCharCode.apply(null, C).replace(/\0/g, "");
- }, E = function(C) {
- return C == 0 || C == 2 || C == 4 ? "h" : C == 3 ? "s" : "c";
+ ), g = function(L) {
+ return String.fromCharCode.apply(null, L).replace(/\0/g, "");
+ }, E = function(L) {
+ return L == 0 || L == 2 || L == 4 ? "h" : L == 3 ? "s" : "c";
};
let u = /* @__PURE__ */ new Set([
"D-SACCHARIDE",
@@ -17602,81 +17602,81 @@ ATOM`, h);
"PEPTIDE-LIKE",
"SACCHARIDE"
]);
- function A(C, L) {
- var D = !L.keepH, r = L.altLoc ? L.altLoc : "A", n = !!L.noSecondaryStructure, b = !L.noComputeSecondaryStructure, f = !L.doAssembly, c = L.assemblyIndex ? L.assemblyIndex : 0;
- typeof C == "string" ? C = (0, l.base64ToArray)(C) : C = new Uint8Array(C);
- var t = o.decode(C), a = [[]], h = a.modelData = [], M = 0, w = 0, S = 0, T = t.secStructList, R = t.bFactorList, z = t.altLocList, P = t.occupancyList, B = t.bondAtomList, U = t.bondOrderList, F = t.numModels;
- if (F == 0)
+ function A(L, C) {
+ var D = !C.keepH, r = C.altLoc ? C.altLoc : "A", n = !!C.noSecondaryStructure, b = !C.noComputeSecondaryStructure, f = !C.doAssembly, c = C.assemblyIndex ? C.assemblyIndex : 0;
+ typeof L == "string" ? L = (0, l.base64ToArray)(L) : L = new Uint8Array(L);
+ var t = o.decode(L), a = [[]], h = a.modelData = [], M = 0, w = 0, S = 0, T = t.secStructList, R = t.bFactorList, $ = t.altLocList, P = t.occupancyList, B = t.bondAtomList, F = t.bondOrderList, U = t.numModels;
+ if (U == 0)
return a;
- L.multimodel || (F = 1);
- var $, W, N, G, k, j, Q = [];
+ C.multimodel || (U = 1);
+ var z, W, V, N, k, G, Q = [];
if (!f && t.bioAssemblyList && t.bioAssemblyList.length > 0) {
var ie = t.bioAssemblyList[c].transformList;
- for ($ = 0, j = ie.length; $ < j; $++) {
- var pe = new g.Matrix4(ie[$].matrix);
- pe.transpose(), Q.push(pe);
+ for (z = 0, G = ie.length; z < G; z++) {
+ var ge = new p.Matrix4(ie[z].matrix);
+ ge.transpose(), Q.push(ge);
}
}
- var he = null;
+ var le = null;
if (t.unitCell) {
- var ue = t.unitCell;
- he = { a: ue[0], b: ue[1], c: ue[2], alpha: ue[3], beta: ue[4], gamma: ue[5] };
+ var oe = t.unitCell;
+ le = { a: oe[0], b: oe[1], c: oe[2], alpha: oe[3], beta: oe[4], gamma: oe[5] };
}
- let se = [];
- t.entityList.forEach((ge) => {
- ge.chainIndexList.forEach((Y) => {
- se[Y] = ge.type == "polymer";
+ let he = [];
+ t.entityList.forEach((ve) => {
+ ve.chainIndexList.forEach((X) => {
+ he[X] = ve.type == "polymer";
});
});
- var ae = 0;
- for (k = 0; k < F; k++) {
- var we = t.chainsPerModel[k], xe = a[a.length - 1], Ie = [];
- for (h.push({ symmetries: Q, cryst: he }), $ = 0; $ < we; ++$) {
- var oe = t.groupsPerChain[M], ve = p(t.chainIdList.subarray(M * 4, M * 4 + 4));
- t.chainNameList && (ve = p(t.chainNameList.subarray(M * 4, M * 4 + 4)));
+ var se = 0;
+ for (k = 0; k < U; k++) {
+ var xe = t.chainsPerModel[k], ye = a[a.length - 1], Pe = [];
+ for (h.push({ symmetries: Q, cryst: le }), z = 0; z < xe; ++z) {
+ var de = t.groupsPerChain[M], pe = g(t.chainIdList.subarray(M * 4, M * 4 + 4));
+ t.chainNameList && (pe = g(t.chainNameList.subarray(M * 4, M * 4 + 4)));
var re = w, Se = "";
- for (W = 0; W < oe; ++W) {
- var ze = t.groupList[t.groupTypeList[w]], Ge = ze.atomNameList.length, $e = 0, Re = !1, Be = !1;
+ for (W = 0; W < de; ++W) {
+ var ke = t.groupList[t.groupTypeList[w]], $e = ke.atomNameList.length, ze = 0, Re = !1, Fe = !1;
if (T) {
- $e = T[w];
- var ke = E($e);
- (w == 0 || ke != Se) && (Re = !0), Se = ke;
+ ze = T[w];
+ var Ie = E(ze);
+ (w == 0 || Ie != Se) && (Re = !0), Se = Ie;
var We = w + 1;
- (We >= T.length || E(T[We] != ke)) && (Be = !0);
+ (We >= T.length || E(T[We] != Ie)) && (Fe = !0);
}
- var Te = t.groupIdList[w], je = ze.groupName;
- let ge = ze.chemCompType;
- var Fe = S;
- let Y = u.has(ge) || !se[M];
- for (N = 0; N < Ge; ++N) {
- var X = ze.elementList[N];
- if (D && X == "H") {
+ var Ue = t.groupIdList[w], Be = ke.groupName;
+ let ve = ke.chemCompType;
+ var Ne = S;
+ let X = u.has(ve) || !he[M];
+ for (V = 0; V < $e; ++V) {
+ var H = ke.elementList[V];
+ if (D && H == "H") {
S += 1;
continue;
}
- var Z = "";
- R && (Z = R[S]);
+ var K = "";
+ R && (K = R[S]);
var q = "";
- z && z[S] && (q = String.fromCharCode(z[S]));
+ $ && $[S] && (q = String.fromCharCode($[S]));
var fe = "";
if (P && (fe = P[S]), q != "" && q != r && r != "*") {
S += 1;
continue;
}
- var _e = t.atomIdList[S], Me = ze.atomNameList[N], Ae = 0;
- ze.atomChargeList && (Ae = ze.atomChargeList[N]);
- var H = t.xCoordList[S], ce = t.yCoordList[S], ye = t.zCoordList[S];
- Ie[S] = xe.length, xe.push({
- resn: je,
- x: H,
- y: ce,
- z: ye,
- elem: X,
- hetflag: Y,
- chain: ve,
- resi: Te,
+ var _e = t.atomIdList[S], Me = ke.atomNameList[V], Ae = 0;
+ ke.atomChargeList && (Ae = ke.atomChargeList[V]);
+ var Z = t.xCoordList[S], ue = t.yCoordList[S], we = t.zCoordList[S];
+ Pe[S] = ye.length, ye.push({
+ resn: Be,
+ x: Z,
+ y: ue,
+ z: we,
+ elem: H,
+ hetflag: X,
+ chain: pe,
+ resi: Ue,
icode: q,
- rescode: Te + (q != " " ? "^" + q : ""),
+ rescode: Ue + (q != " " ? "^" + q : ""),
// resi
// and
// icode
@@ -17685,41 +17685,41 @@ ATOM`, h);
index: S,
atom: Me,
bonds: [],
- ss: E($e),
+ ss: E(ze),
ssbegin: Re,
- ssend: Be,
+ ssend: Fe,
bondOrder: [],
properties: { charge: Ae, occupancy: fe },
- b: Z
+ b: K
}), S += 1;
}
- var Pe = ze.bondAtomList;
- for (N = 0, G = ze.bondOrderList.length; N < G; ++N) {
- var le = Fe + Pe[N * 2], De = Fe + Pe[N * 2 + 1], K = ze.bondOrderList[N], Oe = Ie[le], Ne = Ie[De], I = xe[Oe], me = xe[Ne];
- I && me && (I.bonds.push(Ne), I.bondOrder.push(K), me.bonds.push(Oe), me.bondOrder.push(K));
+ var Te = ke.bondAtomList;
+ for (V = 0, N = ke.bondOrderList.length; V < N; ++V) {
+ var ae = Ne + Te[V * 2], De = Ne + Te[V * 2 + 1], Y = ke.bondOrderList[V], Oe = Pe[ae], Ve = Pe[De], I = ye[Oe], me = ye[Ve];
+ I && me && (I.bonds.push(Ve), I.bondOrder.push(Y), me.bonds.push(Oe), me.bondOrder.push(Y));
}
w += 1;
}
- for (w = re, W = 0; W < oe; ++W)
+ for (w = re, W = 0; W < de; ++W)
w += 1;
M += 1;
}
if (B)
- for (let ge = ae, Y = B.length; ge < Y; ge += 2) {
- let ne = B[ge], Ee = B[ge + 1], He = U ? U[ge / 2] : 1;
+ for (let ve = se, X = B.length; ve < X; ve += 2) {
+ let ne = B[ve], Ee = B[ve + 1], He = F ? F[ve / 2] : 1;
if (ne >= S) {
- ae = ge;
+ se = ve;
break;
}
- let Ke = Ie[ne], Ve = Ie[Ee], qe = xe[Ke], wt = xe[Ve];
- qe && wt && (qe.bonds.push(Ve), qe.bondOrder.push(He), wt.bonds.push(Ke), wt.bondOrder.push(He));
+ let Ke = Pe[ne], je = Pe[Ee], qe = ye[Ke], wt = ye[je];
+ qe && wt && (qe.bonds.push(je), qe.bondOrder.push(He), wt.bonds.push(Ke), wt.bondOrder.push(He));
}
- L.multimodel && (L.onemol || a.push([]));
+ C.multimodel && (C.onemol || a.push([]));
}
if (!f)
- for (let ge = 0; ge < a.length; ge++)
- (0, x.processSymmetries)(h[ge].symmetries, a[ge], L, h[ge].cryst);
- return b && !n && (0, _.computeSecondaryStructure)(a, L.hbondCutoff), a;
+ for (let ve = 0; ve < a.length; ve++)
+ (0, x.processSymmetries)(h[ve].symmetries, a[ve], C, h[ve].cryst);
+ return b && !n && (0, _.computeSecondaryStructure)(a, C.hbondCutoff), a;
}
}
),
@@ -17734,7 +17734,7 @@ ATOM`, h);
/* harmony export */
MOL2: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -17788,15 +17788,15 @@ ATOM`, h);
"S.o2": "S",
So2: "S"
};
- function g(_, x) {
- var o = [[]], p = !1;
- typeof x.keepH < "u" && (p = !x.keepH);
+ function p(_, x) {
+ var o = [[]], g = !1;
+ typeof x.keepH < "u" && (g = !x.keepH);
var E = _.search(/@MOLECULE/), u = _.search(/@ATOM/);
if (E == -1 || u == -1)
return o;
for (var A = _.substring(E).split(/\r?\n|\r/); A.length > 0; ) {
- var C = [], L = A[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), D = parseInt(L[0]), r = 0;
- L.length > 1 && (r = parseInt(L[1]));
+ var L = [], C = A[2].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), D = parseInt(C[0]), r = 0;
+ C.length > 1 && (r = parseInt(C[1]));
var n = 4, b;
for (b = 3; b < A.length; b++)
if (A[b] == "@ATOM") {
@@ -17805,16 +17805,16 @@ ATOM`, h);
}
var f = o[o.length - 1].length, c = f + D, t;
for (b = f; b < c; b++) {
- t = A[n++], L = t.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
- var a = {}, h = L[5];
- if (l[h] !== void 0 ? h = l[h] : (h = h.split(".")[0], h = h[0].toUpperCase() + h.substring(1).toLowerCase()), a.atom = L[1], a.elem = h, !(a.elem == "H" && p)) {
- var M = o[o.length - 1].length, w = parseInt(L[0]);
- a.serial = w, a.x = parseFloat(L[2]), a.y = parseFloat(L[3]), a.z = parseFloat(L[4]), a.atom = L[5];
- var S = parseFloat(L[8]);
+ t = A[n++], C = t.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
+ var a = {}, h = C[5];
+ if (l[h] !== void 0 ? h = l[h] : (h = h.split(".")[0], h = h[0].toUpperCase() + h.substring(1).toLowerCase()), a.atom = C[1], a.elem = h, !(a.elem == "H" && g)) {
+ var M = o[o.length - 1].length, w = parseInt(C[0]);
+ a.serial = w, a.x = parseFloat(C[2]), a.y = parseFloat(C[3]), a.z = parseFloat(C[4]), a.atom = C[5];
+ var S = parseFloat(C[8]);
a.index = M, a.bonds = [], a.bondOrder = [], a.properties = {
charge: S,
partialCharge: S
- }, C[w] = M, o[o.length - 1].push(a);
+ }, L[w] = M, o[o.length - 1].push(a);
}
}
for (var T = !1; n < A.length; )
@@ -17824,9 +17824,9 @@ ATOM`, h);
}
if (T && r)
for (b = 0; b < r; b++) {
- t = A[n++], L = t.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
- var R = parseInt(L[1]), z = o[o.length - 1][C[R]], P = parseInt(L[2]), B = o[o.length - 1][C[P]], U = parseInt(L[3]);
- isNaN(U) && (U = 1), z !== void 0 && B !== void 0 && (z.bonds.push(C[P]), z.bondOrder.push(U), B.bonds.push(C[R]), B.bondOrder.push(U));
+ t = A[n++], C = t.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
+ var R = parseInt(C[1]), $ = o[o.length - 1][L[R]], P = parseInt(C[2]), B = o[o.length - 1][L[P]], F = parseInt(C[3]);
+ isNaN(F) && (F = 1), $ !== void 0 && B !== void 0 && ($.bonds.push(L[P]), $.bondOrder.push(F), B.bonds.push(L[R]), B.bondOrder.push(F));
}
if (x.multimodel) {
x.onemol || o.push([]), A.splice(0, n), _ = A.join(`
@@ -17850,7 +17850,7 @@ ATOM`, h);
/* harmony export */
PDB: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -17858,23 +17858,23 @@ ATOM`, h);
/*! ./utils/getSinglePDB */
"./src/parsers/utils/getSinglePDB.ts"
);
- function g(_, x) {
+ function p(_, x) {
x = x || {};
- var o = [], p = {};
+ var o = [], g = {};
o.modelData = [];
for (var E = _.split(/\r?\n|\r/); E.length > 0; ) {
- var u = (0, l.getSinglePDB)(E, x, p), A = u[0], C = u[1];
+ var u = (0, l.getSinglePDB)(E, x, g), A = u[0], L = u[1];
if (E = u[2], A.length != 0) {
if (x.multimodel && x.onemol && o.length > 0)
- for (var L = o[0].length, D = 0; D < A.length; D++) {
+ for (var C = o[0].length, D = 0; D < A.length; D++) {
var r = A[D];
r.index = D;
for (var n = 0; n < r.bonds.length; n++)
- r.bonds[n] += L;
+ r.bonds[n] += C;
o[0].push(r);
}
else
- o.modelData.push(C), o.push(A);
+ o.modelData.push(L), o.push(A);
if (!x.multimodel)
break;
}
@@ -17901,28 +17901,28 @@ ATOM`, h);
var l = e(
/*! ./utils/assignPDBBonds */
"./src/parsers/utils/assignPDBBonds.ts"
- ), g = e(
+ ), p = e(
/*! ./utils/computeSecondaryStructure */
"./src/parsers/utils/computeSecondaryStructure.ts"
);
function _(x, o) {
- var p = [[]], E = !o.noSecondaryStructure;
- p.modelData = [{ symmetries: [] }];
- var u = [], A = x.split(/\r?\n|\r/), C;
+ var g = [[]], E = !o.noSecondaryStructure;
+ g.modelData = [{ symmetries: [] }];
+ var u = [], A = x.split(/\r?\n|\r/), L;
for (let T = 0; T < A.length; T++) {
- C = A[T].replace(/^\s*/, "");
- var L = C.substring(0, 6);
- if (L.indexOf("END") == 0)
+ L = A[T].replace(/^\s*/, "");
+ var C = L.substring(0, 6);
+ if (C.indexOf("END") == 0)
if (o.multimodel) {
- o.onemol || p.push([]);
+ o.onemol || g.push([]);
continue;
} else
break;
- else if (L == "ATOM " || L == "HETATM") {
+ else if (C == "ATOM " || C == "HETATM") {
var D;
- let R = parseInt(C.substring(6, 11)), z = C.substring(12, 16).replace(/ /g, ""), P = C.substring(17, 20).trim(), B = C.substring(21, 22), U = parseInt(C.substring(22, 26));
- var r = C.substring(30).trim().split(/\s+/), n = parseFloat(r[0]), b = parseFloat(r[1]), f = parseFloat(r[2]), c = parseFloat(r[3]), t = parseFloat(r[4]), a = z[0];
- z.length > 1 && z[1].toUpperCase() != z[1] && (a = z.substring(0, 2)), C[0] == "H" ? D = !0 : D = !1, u[R] = p[p.length - 1].length, p[p.length - 1].push({
+ let R = parseInt(L.substring(6, 11)), $ = L.substring(12, 16).replace(/ /g, ""), P = L.substring(17, 20).trim(), B = L.substring(21, 22), F = parseInt(L.substring(22, 26));
+ var r = L.substring(30).trim().split(/\s+/), n = parseFloat(r[0]), b = parseFloat(r[1]), f = parseFloat(r[2]), c = parseFloat(r[3]), t = parseFloat(r[4]), a = $[0];
+ $.length > 1 && $[1].toUpperCase() != $[1] && (a = $.substring(0, 2)), L[0] == "H" ? D = !0 : D = !1, u[R] = g[g.length - 1].length, g[g.length - 1].push({
resn: P,
x: n,
y: b,
@@ -17930,9 +17930,9 @@ ATOM`, h);
elem: a,
hetflag: D,
chain: B,
- resi: U,
+ resi: F,
serial: R,
- atom: z,
+ atom: $,
bonds: [],
ss: "c",
bondOrder: [],
@@ -17941,19 +17941,19 @@ ATOM`, h);
partialCharge: c,
radius: t
},
- pdbline: C
+ pdbline: L
});
- } else if (L == "CONECT") {
- var h = parseInt(C.substring(6, 11)), M = p[p.length - 1][u[h]];
+ } else if (C == "CONECT") {
+ var h = parseInt(L.substring(6, 11)), M = g[g.length - 1][u[h]];
for (let R = 0; R < 4; R++) {
- var w = parseInt(C.substring([11, 16, 21, 26][R], [11, 16, 21, 26][R] + 5)), S = p[p.length - 1][u[w]];
+ var w = parseInt(L.substring([11, 16, 21, 26][R], [11, 16, 21, 26][R] + 5)), S = g[g.length - 1][u[w]];
M !== void 0 && S !== void 0 && (M.bonds.push(u[w]), M.bondOrder.push(1));
}
}
}
- for (let T = 0; T < p.length; T++)
- (0, l.assignPDBBonds)(p[T], o), E && (0, g.computeSecondaryStructure)(p[T], o.hbondCutoff);
- return p;
+ for (let T = 0; T < g.length; T++)
+ (0, l.assignPDBBonds)(g[T], o), E && (0, p.computeSecondaryStructure)(g[T], o.hbondCutoff);
+ return g;
}
}
),
@@ -17972,77 +17972,77 @@ ATOM`, h);
)
/* harmony export */
});
- function l(g) {
- var _ = [], x, o = 0, p = g.split(/\r?\n|\r/);
- if (p.length > 0 && p[0].includes("VERSION")) {
- var E = p.filter(function(n) {
+ function l(p) {
+ var _ = [], x, o = 0, g = p.split(/\r?\n|\r/);
+ if (g.length > 0 && g[0].includes("VERSION")) {
+ var E = g.filter(function(n) {
return n.includes("POINTERS") || n.includes("ATOM_NAME") || n.includes("CHARGE") || n.includes("RADII") || n.includes("BONDS_INC_HYDROGEN") || n.includes("BONDS_WITHOUT_HYDROGEN");
}), u = D("POINTERS");
if (u == -1)
return [];
- var A = r(u), C = parseInt(p[u + 1].slice(0, A[1]));
- if (isNaN(C) || C <= 0)
+ var A = r(u), L = parseInt(g[u + 1].slice(0, A[1]));
+ if (isNaN(L) || L <= 0)
return [];
if (u = D("ATOM_NAME"), u == -1)
return [];
A = r(u);
- var L = A[0];
- for (let n = 0; n < C / A[0]; n++) {
- n == parseInt(C / A[0]) && (L = C % A[0]);
- for (let b = 0; b < L; b++) {
+ var C = A[0];
+ for (let n = 0; n < L / A[0]; n++) {
+ n == parseInt(L / A[0]) && (C = L % A[0]);
+ for (let b = 0; b < C; b++) {
let f = {}, c = { charge: "", radii: "" };
- f.serial = o, f.x = 0, f.y = 0, f.z = 0, f.atom = p[u + 1].slice(A[1] * b, A[1] * (b + 1)), f.elem = p[u + 1].slice(A[1] * b, A[1] * b + 1), f.properties = c, f.bonds = [], f.bondOrder = [], _.push(f), o++;
+ f.serial = o, f.x = 0, f.y = 0, f.z = 0, f.atom = g[u + 1].slice(A[1] * b, A[1] * (b + 1)), f.elem = g[u + 1].slice(A[1] * b, A[1] * b + 1), f.properties = c, f.bonds = [], f.bondOrder = [], _.push(f), o++;
}
u++;
}
if (u = D("CHARGE"), u != -1) {
- A = r(u), o = 0, L = A[0];
- for (let n = 0; n < C / A[0]; n++) {
- n == parseInt(C / A[0]) && (L = C % A[0]);
- for (let b = 0; b < L; b++)
- _[o].properties.charge = parseFloat(p[u + 1].slice(A[1] * b, A[1] * (b + 1))), o++;
+ A = r(u), o = 0, C = A[0];
+ for (let n = 0; n < L / A[0]; n++) {
+ n == parseInt(L / A[0]) && (C = L % A[0]);
+ for (let b = 0; b < C; b++)
+ _[o].properties.charge = parseFloat(g[u + 1].slice(A[1] * b, A[1] * (b + 1))), o++;
u++;
}
}
if (u = D("RADII"), u != -1) {
- A = r(u), o = 0, L = A[0];
- for (let n = 0; n < C / A[0]; n++) {
- n == parseInt(C / A[0]) && (L = C % A[0]);
- for (let b = 0; b < L; b++)
- _[o].properties.radii = parseFloat(p[u + 1].slice(A[1] * b, A[1] * (b + 1))), o++;
+ A = r(u), o = 0, C = A[0];
+ for (let n = 0; n < L / A[0]; n++) {
+ n == parseInt(L / A[0]) && (C = L % A[0]);
+ for (let b = 0; b < C; b++)
+ _[o].properties.radii = parseFloat(g[u + 1].slice(A[1] * b, A[1] * (b + 1))), o++;
u++;
}
}
if (u = D("BONDS_WITHOUT_HYDROGEN"), u != -1)
- for (A = r(u), o = 0, L = A[0], u = u + 1; !p[u].match(/^%FLAG/); ) {
- p[u + 1].match(/^%FLAG/) && (L = C % A[0]);
- for (let n = 0; n < L; n++)
- o % 3 == 0 ? x = parseInt(p[u].slice(A[1] * n, A[1] * (n + 1)) / 3) : o % 3 == 1 && _[x].bonds.push(parseInt(p[u].slice(A[1] * n, A[1] * (n + 1)) / 3)), o++;
+ for (A = r(u), o = 0, C = A[0], u = u + 1; !g[u].match(/^%FLAG/); ) {
+ g[u + 1].match(/^%FLAG/) && (C = L % A[0]);
+ for (let n = 0; n < C; n++)
+ o % 3 == 0 ? x = parseInt(g[u].slice(A[1] * n, A[1] * (n + 1)) / 3) : o % 3 == 1 && _[x].bonds.push(parseInt(g[u].slice(A[1] * n, A[1] * (n + 1)) / 3)), o++;
u++;
}
if (u = D("BONDS_INC_HYDROGEN"), u != -1)
- for (A = r(u), o = 0, L = A[0], u = u + 1; !p[u].match(/^%FLAG/); ) {
- p[u + 1].match(/^%FLAG/) && (L = C % A[0]);
- for (let n = 0; n < L; n++)
- o % 3 == 0 ? x = parseInt(p[u].slice(A[1] * n, A[1] * (n + 1)) / 3) : o % 3 == 1 && _[x].bonds.push(parseInt(p[u].slice(A[1] * n, A[1] * (n + 1)) / 3)), o++;
+ for (A = r(u), o = 0, C = A[0], u = u + 1; !g[u].match(/^%FLAG/); ) {
+ g[u + 1].match(/^%FLAG/) && (C = L % A[0]);
+ for (let n = 0; n < C; n++)
+ o % 3 == 0 ? x = parseInt(g[u].slice(A[1] * n, A[1] * (n + 1)) / 3) : o % 3 == 1 && _[x].bonds.push(parseInt(g[u].slice(A[1] * n, A[1] * (n + 1)) / 3)), o++;
u++;
}
} else
return [];
function D(n) {
- var b = p.indexOf(E.filter(function(f) {
+ var b = g.indexOf(E.filter(function(f) {
return f.includes(n);
})[0]);
if (Number.isInteger(b) && b > 0) {
- for (; !p[b].includes("FORMAT"); )
+ for (; !g[b].includes("FORMAT"); )
b++;
return b;
} else
return -1;
}
function r(n) {
- var b = p[n].match(/\((\d*)\S*/), f = p[n].match(/[a-zA-Z](\d*)\)\s*/);
- return f == null && (f = p[n].match(/[a-zA-Z](\d*)\.\d*\)\s*/)), [b[1], f[1]];
+ var b = g[n].match(/\((\d*)\S*/), f = g[n].match(/[a-zA-Z](\d*)\)\s*/);
+ return f == null && (f = g[n].match(/[a-zA-Z](\d*)\.\d*\)\s*/)), [b[1], f[1]];
}
return [_];
}
@@ -18064,35 +18064,35 @@ ATOM`, h);
/* harmony export */
});
var l = function(x, o) {
- var p = [[]], E = !1;
+ var g = [[]], E = !1;
for (typeof o.keepH < "u" && (E = !o.keepH); x.length > 0 && !(x.length < 4); ) {
var u = parseInt(x[3].substring(0, 3));
if (isNaN(u) || u <= 0)
break;
- var A = parseInt(x[3].substring(3, 6)), C = 4;
+ var A = parseInt(x[3].substring(3, 6)), L = 4;
if (x.length < 4 + u + A)
break;
- var L = [], D = p[p.length - 1].length, r = D + u, n, b;
- for (n = D; n < r; n++, C++) {
- b = x[C];
+ var C = [], D = g[g.length - 1].length, r = D + u, n, b;
+ for (n = D; n < r; n++, L++) {
+ b = x[L];
var f = {}, c = b.substring(31, 34).replace(/ /g, "");
- f.atom = f.elem = c[0].toUpperCase() + c.substring(1).toLowerCase(), (f.elem !== "H" || !E) && (f.serial = n, L[n] = p[p.length - 1].length, f.x = parseFloat(b.substring(0, 10)), f.y = parseFloat(b.substring(10, 20)), f.z = parseFloat(b.substring(20, 30)), f.hetflag = !0, f.bonds = [], f.bondOrder = [], f.properties = {}, f.index = p[p.length - 1].length, p[p.length - 1].push(f));
+ f.atom = f.elem = c[0].toUpperCase() + c.substring(1).toLowerCase(), (f.elem !== "H" || !E) && (f.serial = n, C[n] = g[g.length - 1].length, f.x = parseFloat(b.substring(0, 10)), f.y = parseFloat(b.substring(10, 20)), f.z = parseFloat(b.substring(20, 30)), f.hetflag = !0, f.bonds = [], f.bondOrder = [], f.properties = {}, f.index = g[g.length - 1].length, g[g.length - 1].push(f));
}
- for (n = 0; n < A; n++, C++) {
- b = x[C];
- var t = L[parseInt(b.substring(0, 3)) - 1 + D], a = L[parseInt(b.substring(3, 6)) - 1 + D], h = parseFloat(b.substring(6));
- typeof t < "u" && typeof a < "u" && (p[p.length - 1][t].bonds.push(a), p[p.length - 1][t].bondOrder.push(h), p[p.length - 1][a].bonds.push(t), p[p.length - 1][a].bondOrder.push(h));
+ for (n = 0; n < A; n++, L++) {
+ b = x[L];
+ var t = C[parseInt(b.substring(0, 3)) - 1 + D], a = C[parseInt(b.substring(3, 6)) - 1 + D], h = parseFloat(b.substring(6));
+ typeof t < "u" && typeof a < "u" && (g[g.length - 1][t].bonds.push(a), g[g.length - 1][t].bondOrder.push(h), g[g.length - 1][a].bonds.push(t), g[g.length - 1][a].bondOrder.push(h));
}
if (o.multimodel) {
- for (o.onemol || p.push([]); x[C] !== "$$$$" && C < x.length; )
- C++;
- x.splice(0, ++C);
+ for (o.onemol || g.push([]); x[L] !== "$$$$" && L < x.length; )
+ L++;
+ x.splice(0, ++L);
} else
break;
}
- return p;
- }, g = function(x, o) {
- var p = [[]], E = !1;
+ return g;
+ }, p = function(x, o) {
+ var g = [[]], E = !1;
for (typeof o.keepH < "u" && (E = !o.keepH); x.length > 0 && !(x.length < 8 || !x[4].startsWith("M V30 BEGIN CTAB") || !x[5].startsWith("M V30 COUNTS") || x[5].length < 14); ) {
var u = x[5].substring(13).match(/\S+/g);
if (u.length < 2)
@@ -18100,46 +18100,46 @@ ATOM`, h);
var A = parseInt(u[0]);
if (isNaN(A) || A <= 0)
break;
- var C = parseInt(u[1]), L = 7;
- if (x.length < 8 + A + C)
+ var L = parseInt(u[1]), C = 7;
+ if (x.length < 8 + A + L)
break;
- var D = [], r = p[p.length - 1].length, n = r + A, b, f;
- for (b = r; b < n; b++, L++) {
- f = x[L];
+ var D = [], r = g[g.length - 1].length, n = r + A, b, f;
+ for (b = r; b < n; b++, C++) {
+ f = x[C];
var c = f.substring(6).match(/\S+/g);
if (c.length > 4) {
var t = {}, a = c[1].replace(/ /g, "");
- t.atom = t.elem = a[0].toUpperCase() + a.substring(1).toLowerCase(), (t.elem !== "H" || !E) && (t.serial = b, D[b] = p[p.length - 1].length, t.x = parseFloat(c[2]), t.y = parseFloat(c[3]), t.z = parseFloat(c[4]), t.hetflag = !0, t.bonds = [], t.bondOrder = [], t.properties = {}, t.index = p[p.length - 1].length, p[p.length - 1].push(t));
+ t.atom = t.elem = a[0].toUpperCase() + a.substring(1).toLowerCase(), (t.elem !== "H" || !E) && (t.serial = b, D[b] = g[g.length - 1].length, t.x = parseFloat(c[2]), t.y = parseFloat(c[3]), t.z = parseFloat(c[4]), t.hetflag = !0, t.bonds = [], t.bondOrder = [], t.properties = {}, t.index = g[g.length - 1].length, g[g.length - 1].push(t));
}
}
- if (x[L] === "M V30 END ATOM")
- L++;
+ if (x[C] === "M V30 END ATOM")
+ C++;
else
break;
- if (C !== 0 && x[L] === "M V30 BEGIN BOND")
- L++;
+ if (L !== 0 && x[C] === "M V30 BEGIN BOND")
+ C++;
else
break;
- for (b = 0; b < C; b++, L++) {
- f = x[L];
+ for (b = 0; b < L; b++, C++) {
+ f = x[C];
var h = f.substring(6).match(/\S+/g);
if (h.length > 3) {
var M = D[parseInt(h[2]) - 1 + r], w = D[parseInt(h[3]) - 1 + r], S = parseFloat(h[1]);
- typeof M < "u" && typeof w < "u" && (p[p.length - 1][M].bonds.push(w), p[p.length - 1][M].bondOrder.push(S), p[p.length - 1][w].bonds.push(M), p[p.length - 1][w].bondOrder.push(S));
+ typeof M < "u" && typeof w < "u" && (g[g.length - 1][M].bonds.push(w), g[g.length - 1][M].bondOrder.push(S), g[g.length - 1][w].bonds.push(M), g[g.length - 1][w].bondOrder.push(S));
}
}
if (o.multimodel) {
- for (o.onemol || p.push([]); x[L] !== "$$$$" && L < x.length; )
- L++;
- x.splice(0, ++L);
+ for (o.onemol || g.push([]); x[C] !== "$$$$" && C < x.length; )
+ C++;
+ x.splice(0, ++C);
} else
break;
}
- return p;
+ return g;
};
function _(x, o) {
- var p = "V2000", E = x.split(/\r?\n|\r/);
- return E.length > 3 && E[3].length > 38 && (p = E[3].substring(34, 39)), p === "V2000" ? l(E, o) : p === "V3000" ? g(E, o) : [[""]];
+ var g = "V2000", E = x.split(/\r?\n|\r/);
+ return E.length > 3 && E[3].length > 38 && (g = E[3].substring(34, 39)), g === "V2000" ? l(E, o) : g === "V3000" ? p(E, o) : [[""]];
}
}
),
@@ -18154,7 +18154,7 @@ ATOM`, h);
/* harmony export */
VASP: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -18162,35 +18162,35 @@ ATOM`, h);
/*! ../WebGL */
"./src/WebGL/index.ts"
);
- function g(_) {
- var x = [[]], o = {}, p = _.replace(/^\s+/, "").split(/\r?\n/);
- if (p.length < 3)
+ function p(_) {
+ var x = [[]], o = {}, g = _.replace(/^\s+/, "").split(/\r?\n/);
+ if (g.length < 3)
return x;
- if (p[1].match(/\d+/))
- o.length = parseFloat(p[1]);
+ if (g[1].match(/\d+/))
+ o.length = parseFloat(g[1]);
else
return console.log("Warning: second line of the vasp structure file must be a number"), x;
if (o.length < 0)
return console.log("Warning: Vasp implementation for negative lattice lengths is not yet available"), x;
- o.xVec = new Float32Array(p[2].replace(/^\s+/, "").split(/\s+/)), o.yVec = new Float32Array(p[3].replace(/^\s+/, "").split(/\s+/)), o.zVec = new Float32Array(p[4].replace(/^\s+/, "").split(/\s+/));
+ o.xVec = new Float32Array(g[2].replace(/^\s+/, "").split(/\s+/)), o.yVec = new Float32Array(g[3].replace(/^\s+/, "").split(/\s+/)), o.zVec = new Float32Array(g[4].replace(/^\s+/, "").split(/\s+/));
var E = new l.Matrix3(o.xVec[0], o.xVec[1], o.xVec[2], o.yVec[0], o.yVec[1], o.yVec[2], o.zVec[0], o.zVec[1], o.zVec[2]);
E.multiplyScalar(o.length), x.modelData = [{ symmetries: [], cryst: { matrix: E } }];
- var u = p[5].replace(/\s+/, "").replace(/\s+$/, "").split(/\s+/), A = new Int16Array(p[6].replace(/^\s+/, "").split(/\s+/)), C = p[7].replace(/\s+/, "");
- if (C.match(/C/))
- C = "cartesian";
- else if (C.match(/D/))
- C = "direct";
+ var u = g[5].replace(/\s+/, "").replace(/\s+$/, "").split(/\s+/), A = new Int16Array(g[6].replace(/^\s+/, "").split(/\s+/)), L = g[7].replace(/\s+/, "");
+ if (L.match(/C/))
+ L = "cartesian";
+ else if (L.match(/D/))
+ L = "direct";
else
return console.log("Warning: Unknown vasp mode in POSCAR file: mode must be either C(artesian) or D(irect)"), x;
if (u.length != A.length)
return console.log("Warning: declaration of atomary species wrong:"), console.log(u), console.log(A), x;
- p.splice(0, 8);
- for (var L = 0, D = 0, r = u.length; D < r; D++) {
+ g.splice(0, 8);
+ for (var C = 0, D = 0, r = u.length; D < r; D++) {
for (var n = u[D], b = 0, f = A[D]; b < f; b++) {
- var c = new Float32Array(p[L + b].replace(/^\s+/, "").split(/\s+/)), t = {};
- t.elem = n, C == "cartesian" ? (t.x = o.length * c[0], t.y = o.length * c[1], t.z = o.length * c[2]) : (t.x = o.length * (c[0] * o.xVec[0] + c[1] * o.yVec[0] + c[2] * o.zVec[0]), t.y = o.length * (c[0] * o.xVec[1] + c[1] * o.yVec[1] + c[2] * o.zVec[1]), t.z = o.length * (c[0] * o.xVec[2] + c[1] * o.yVec[2] + c[2] * o.zVec[2])), t.bonds = [], x[0].push(t);
+ var c = new Float32Array(g[C + b].replace(/^\s+/, "").split(/\s+/)), t = {};
+ t.elem = n, L == "cartesian" ? (t.x = o.length * c[0], t.y = o.length * c[1], t.z = o.length * c[2]) : (t.x = o.length * (c[0] * o.xVec[0] + c[1] * o.yVec[0] + c[2] * o.zVec[0]), t.y = o.length * (c[0] * o.xVec[1] + c[1] * o.yVec[1] + c[2] * o.zVec[1]), t.z = o.length * (c[0] * o.xVec[2] + c[1] * o.yVec[2] + c[2] * o.zVec[2])), t.bonds = [], x[0].push(t);
}
- L += A[D];
+ C += A[D];
}
return x;
}
@@ -18214,49 +18214,49 @@ ATOM`, h);
var l = e(
/*! ../WebGL */
"./src/WebGL/index.ts"
- ), g = e(
+ ), p = e(
/*! ./utils/assignBonds */
"./src/parsers/utils/assignBonds.ts"
);
function _(x, o) {
o = o || {};
- for (var p = [[]], E = o.assignBonds === void 0 ? !0 : o.assignBonds, u = x.split(/\r?\n|\r/); u.length > 0 && !(u.length < 3); ) {
+ for (var g = [[]], E = o.assignBonds === void 0 ? !0 : o.assignBonds, u = x.split(/\r?\n|\r/); u.length > 0 && !(u.length < 3); ) {
var A = parseInt(u[0]);
if (isNaN(A) || A <= 0 || u.length < A + 2)
break;
- var C = /Lattice\s*=\s*["\{\}]([^"\{\}]+)["\{\}]\s*/gi, L = C.exec(u[1]);
- if (L != null && L.length > 1) {
- var D = new Float32Array(L[1].split(/\s+/)), r = new l.Matrix3(D[0], D[3], D[6], D[1], D[4], D[7], D[2], D[5], D[8]);
- p.modelData = [{ cryst: { matrix: r } }];
+ var L = /Lattice\s*=\s*["\{\}]([^"\{\}]+)["\{\}]\s*/gi, C = L.exec(u[1]);
+ if (C != null && C.length > 1) {
+ var D = new Float32Array(C[1].split(/\s+/)), r = new l.Matrix3(D[0], D[3], D[6], D[1], D[4], D[7], D[2], D[5], D[8]);
+ g.modelData = [{ cryst: { matrix: r } }];
}
- for (var n = 2, b = p[p.length - 1].length, f = b + A, c = b; c < f; c++) {
+ for (var n = 2, b = g[g.length - 1].length, f = b + A, c = b; c < f; c++) {
var t = u[n++], a = t.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), h = {};
h.serial = c;
var M = a[0];
- h.atom = h.elem = M[0].toUpperCase() + M.substring(1, 2).toLowerCase(), h.x = parseFloat(a[1]), h.y = parseFloat(a[2]), h.z = parseFloat(a[3]), h.hetflag = !0, h.bonds = [], h.bondOrder = [], h.properties = {}, p[p.length - 1][c] = h, a.length >= 7 && (h.dx = parseFloat(a[4]), h.dy = parseFloat(a[5]), h.dz = parseFloat(a[6]));
+ h.atom = h.elem = M[0].toUpperCase() + M.substring(1, 2).toLowerCase(), h.x = parseFloat(a[1]), h.y = parseFloat(a[2]), h.z = parseFloat(a[3]), h.hetflag = !0, h.bonds = [], h.bondOrder = [], h.properties = {}, g[g.length - 1][c] = h, a.length >= 7 && (h.dx = parseFloat(a[4]), h.dy = parseFloat(a[5]), h.dz = parseFloat(a[6]));
}
if (o.multimodel)
- p.push([]), u.splice(0, n);
+ g.push([]), u.splice(0, n);
else
break;
}
if (E)
- for (let S = 0; S < p.length; S++)
- (0, g.assignBonds)(p[S], o);
+ for (let S = 0; S < g.length; S++)
+ (0, p.assignBonds)(g[S], o);
if (o.onemol) {
- var w = p;
- p = [], p.push(w[0]);
+ var w = g;
+ g = [], g.push(w[0]);
for (let S = 1; S < w.length; S++) {
- let T = p[0].length;
+ let T = g[0].length;
for (let R = 0; R < w[S].length; R++) {
- let z = w[S][R];
- for (let P = 0; P < z.bonds.length; P++)
- z.bonds[P] = z.bonds[P] + T;
- z.index = p[0].length, z.serial = p[0].length, p[0].push(z);
+ let $ = w[S][R];
+ for (let P = 0; P < $.bonds.length; P++)
+ $.bonds[P] = $.bonds[P] + T;
+ $.index = g[0].length, $.serial = g[0].length, g[0].push($);
}
}
}
- return p;
+ return g;
}
}
),
@@ -18288,7 +18288,7 @@ ATOM`, h);
var l = e(
/*! ./VASP */
"./src/parsers/VASP.ts"
- ), g = e(
+ ), p = e(
/*! ./CUBE */
"./src/parsers/CUBE.ts"
), _ = e(
@@ -18300,7 +18300,7 @@ ATOM`, h);
), o = e(
/*! ./CDJSON */
"./src/parsers/CDJSON.ts"
- ), p = e(
+ ), g = e(
/*! ./CIF */
"./src/parsers/CIF.ts"
), E = e(
@@ -18312,10 +18312,10 @@ ATOM`, h);
), A = e(
/*! ./PQR */
"./src/parsers/PQR.ts"
- ), C = e(
+ ), L = e(
/*! ./MMTF */
"./src/parsers/MMTF.ts"
- ), L = e(
+ ), C = e(
/*! ./PRMTOP */
"./src/parsers/PRMTOP.ts"
), D = e(
@@ -18331,8 +18331,8 @@ ATOM`, h);
const b = {
vasp: l.VASP,
VASP: l.VASP,
- cube: g.CUBE,
- CUBE: g.CUBE,
+ cube: p.CUBE,
+ CUBE: p.CUBE,
xyz: _.XYZ,
XYZ: _.XYZ,
sdf: x.SDF,
@@ -18340,9 +18340,9 @@ ATOM`, h);
json: o.CDJSON,
cdjson: o.CDJSON,
CDJSON: o.CDJSON,
- mcif: p.CIF,
- cif: p.CIF,
- CIF: p.CIF,
+ mcif: g.CIF,
+ cif: g.CIF,
+ CIF: g.CIF,
mol2: E.MOL2,
MOL2: E.MOL2,
pdb: u.PDB,
@@ -18351,10 +18351,10 @@ ATOM`, h);
PDBQT: u.PDB,
pqr: A.PQR,
PQR: A.PQR,
- mmtf: C.MMTFparser,
- MMTF: C.MMTFparser,
- prmtop: L.PRMTOP,
- PRMTOP: L.PRMTOP,
+ mmtf: L.MMTFparser,
+ MMTF: L.MMTFparser,
+ prmtop: C.PRMTOP,
+ PRMTOP: C.PRMTOP,
gro: D.GRO,
GRO: D.GRO,
lammpstrj: r.LAMMPSTRJ,
@@ -18517,9 +18517,9 @@ ATOM`, h);
/*! ./bondLength */
"./src/parsers/utils/bondLength.ts"
);
- const g = /* @__PURE__ */ new Set(["Na", "K", "Ca", "Mg", "Mn", "Sr"]);
- function _(x, o, p) {
- if (p && p.unboundCations && (g.has(x.elem) || g.has(o.elem)))
+ const p = /* @__PURE__ */ new Set(["Na", "K", "Ca", "Mg", "Mn", "Sr"]);
+ function _(x, o, g) {
+ if (g && g.unboundCations && (p.has(x.elem) || p.has(o.elem)))
return !1;
let E = (0, l.bondLength)(x.elem) + (0, l.bondLength)(o.elem);
E += 0.25, E *= E;
@@ -18529,11 +18529,11 @@ ATOM`, h);
let A = x.y - o.y;
if (A *= A, A > E)
return !1;
- let C = x.z - o.z;
- if (C *= C, C > E)
+ let L = x.z - o.z;
+ if (L *= L, L > E)
return !1;
- const L = u + A + C;
- return !(isNaN(L) || L < 0.5 || L > E || x.altLoc !== o.altLoc && x.altLoc !== " " && o.altLoc !== " ");
+ const C = u + A + L;
+ return !(isNaN(C) || C < 0.5 || C > E || x.altLoc !== o.altLoc && x.altLoc !== " " && o.altLoc !== " ");
}
}
),
@@ -18552,32 +18552,32 @@ ATOM`, h);
)
/* harmony export */
});
- function l(g, _) {
- const x = _ || 3.2, o = x * x, p = [];
- for (let E = 0, u = g.length; E < u; E++) {
- g[E].index = E;
- const A = g[E];
- !A.hetflag && (A.atom === "N" || A.atom === "O") && (p.push(A), A.hbondOther = null, A.hbondDistanceSq = Number.POSITIVE_INFINITY);
+ function l(p, _) {
+ const x = _ || 3.2, o = x * x, g = [];
+ for (let E = 0, u = p.length; E < u; E++) {
+ p[E].index = E;
+ const A = p[E];
+ !A.hetflag && (A.atom === "N" || A.atom === "O") && (g.push(A), A.hbondOther = null, A.hbondDistanceSq = Number.POSITIVE_INFINITY);
}
- p.sort(function(E, u) {
+ g.sort(function(E, u) {
return E.z - u.z;
});
- for (let E = 0, u = p.length; E < u; E++) {
- const A = p[E];
- for (let C = E + 1; C < u; C++) {
- const L = p[C], D = L.z - A.z;
+ for (let E = 0, u = g.length; E < u; E++) {
+ const A = g[E];
+ for (let L = E + 1; L < u; L++) {
+ const C = g[L], D = C.z - A.z;
if (D > x)
break;
- if (L.atom == A.atom)
+ if (C.atom == A.atom)
continue;
- const r = Math.abs(L.y - A.y);
+ const r = Math.abs(C.y - A.y);
if (r > x)
continue;
- const n = Math.abs(L.x - A.x);
+ const n = Math.abs(C.x - A.x);
if (n > x)
continue;
const b = n * n + r * r + D * D;
- b > o || L.chain == A.chain && Math.abs(L.resi - A.resi) < 4 || (b < A.hbondDistanceSq && (A.hbondOther = L, A.hbondDistanceSq = b), b < L.hbondDistanceSq && (L.hbondOther = A, L.hbondDistanceSq = b));
+ b > o || C.chain == A.chain && Math.abs(C.resi - A.resi) < 4 || (b < A.hbondDistanceSq && (A.hbondOther = C, A.hbondDistanceSq = b), b < C.hbondDistanceSq && (C.hbondOther = A, C.hbondDistanceSq = b));
}
}
}
@@ -18602,7 +18602,7 @@ ATOM`, h);
/*! ./areConnected */
"./src/parsers/utils/areConnected.ts"
);
- const g = [
+ const p = [
{ x: 0, y: 0, z: 1 },
{ x: 0, y: 1, z: -1 },
{ x: 0, y: 1, z: 0 },
@@ -18617,8 +18617,8 @@ ATOM`, h);
{ x: 1, y: 1, z: 0 },
{ x: 1, y: 1, z: 1 }
], _ = 4.95;
- function x(o, p) {
- for (let A = 0, C = o.length; A < C; A++)
+ function x(o, g) {
+ for (let A = 0, L = o.length; A < L; A++)
o[A].index || (o[A].index = A);
const E = {
x: {
@@ -18628,15 +18628,15 @@ ATOM`, h);
}
};
for (let A = 0; A < o.length; A++) {
- const C = o[A], L = Math.floor(C.x / _), D = Math.floor(C.y / _), r = Math.floor(C.z / _);
- E[L] || (E[L] = {}), E[L][D] || (E[L][D] = {}), E[L][D][r] || (E[L][D][r] = []), E[L][D][r].push(C);
- }
- function u(A, C) {
- for (let L = 0; L < A.length; L++) {
- const D = A[L];
- for (let r = 0; r < C.length; r++) {
- const n = C[r];
- if ((0, l.areConnected)(D, n, p)) {
+ const L = o[A], C = Math.floor(L.x / _), D = Math.floor(L.y / _), r = Math.floor(L.z / _);
+ E[C] || (E[C] = {}), E[C][D] || (E[C][D] = {}), E[C][D][r] || (E[C][D][r] = []), E[C][D][r].push(L);
+ }
+ function u(A, L) {
+ for (let C = 0; C < A.length; C++) {
+ const D = A[C];
+ for (let r = 0; r < L.length; r++) {
+ const n = L[r];
+ if ((0, l.areConnected)(D, n, g)) {
const b = D.bonds.indexOf(n.index), f = n.bonds.indexOf(D.index);
b === -1 && f === -1 ? (D.bonds.push(n.index), D.bondOrder.push(1), n.bonds.push(D.index), n.bondOrder.push(1)) : b === -1 ? (D.bonds.push(n.index), D.bondOrder.push(n.bondOrder[f])) : f === -1 && (n.bonds.push(D.index), n.bondOrder.push(D.bondOrder[b]));
}
@@ -18644,23 +18644,23 @@ ATOM`, h);
}
}
for (let A in E) {
- const C = parseInt(A);
- for (let L in E[C]) {
- const D = parseInt(L);
- for (let r in E[C][D]) {
- const n = parseInt(r), b = E[C][D][n];
+ const L = parseInt(A);
+ for (let C in E[L]) {
+ const D = parseInt(C);
+ for (let r in E[L][D]) {
+ const n = parseInt(r), b = E[L][D][n];
for (let f = 0; f < b.length; f++) {
const c = b[f];
for (let t = f + 1; t < b.length; t++) {
const a = b[t];
- (0, l.areConnected)(c, a, p) && c.bonds.indexOf(a.index) == -1 && (c.bonds.push(a.index), c.bondOrder.push(1), a.bonds.push(c.index), a.bondOrder.push(1));
+ (0, l.areConnected)(c, a, g) && c.bonds.indexOf(a.index) == -1 && (c.bonds.push(a.index), c.bondOrder.push(1), a.bonds.push(c.index), a.bondOrder.push(1));
}
}
- for (let f = 0; f < g.length; f++) {
- const c = g[f];
- if (!E[C + c.x] || !E[C + c.x][D + c.y] || !E[C + c.x][D + c.y][n + c.z])
+ for (let f = 0; f < p.length; f++) {
+ const c = p[f];
+ if (!E[L + c.x] || !E[L + c.x][D + c.y] || !E[L + c.x][D + c.y][n + c.z])
continue;
- const t = E[C + c.x][D + c.y][n + c.z];
+ const t = E[L + c.x][D + c.y][n + c.z];
u(b, t);
}
}
@@ -18687,31 +18687,31 @@ ATOM`, h);
var l = e(
/*! ./areConnected */
"./src/parsers/utils/areConnected.ts"
- ), g = e(
+ ), p = e(
/*! ./assignBonds */
"./src/parsers/utils/assignBonds.ts"
), _ = e(
/*! ./standardResidues */
"./src/parsers/utils/standardResidues.ts"
);
- function x(o, p) {
+ function x(o, g) {
const E = [], u = [];
for (let D = 0, r = o.length; D < r; D++) {
const n = o[D];
n.index = D, n.hetflag || !_.standardResidues.has(n.resn) ? u.push(n) : E.push(n);
}
- (0, g.assignBonds)(u, p), E.sort(function(D, r) {
+ (0, p.assignBonds)(u, g), E.sort(function(D, r) {
return D.chain !== r.chain ? D.chain < r.chain ? -1 : 1 : D.resi - r.resi;
});
- let A = -1, C = -1, L;
+ let A = -1, L = -1, C;
for (let D = 0, r = E.length; D < r; D++) {
const n = E[D];
- n.resi !== A && (A = n.resi, L || C++, L = !1), n.reschain = C;
+ n.resi !== A && (A = n.resi, C || L++, C = !1), n.reschain = L;
for (let b = D + 1; b < E.length; b++) {
const f = E[b];
if (f.chain !== n.chain || f.resi - n.resi > 1)
break;
- (0, l.areConnected)(n, f, p) && (n.bonds.indexOf(f.index) === -1 && (n.bonds.push(f.index), n.bondOrder.push(1), f.bonds.push(n.index), f.bondOrder.push(1)), n.resi !== f.resi && (L = !0));
+ (0, l.areConnected)(n, f, g) && (n.bonds.indexOf(f.index) === -1 && (n.bonds.push(f.index), n.bondOrder.push(1), f.bonds.push(n.index), f.bondOrder.push(1)), n.resi !== f.resi && (C = !0));
}
}
}
@@ -18728,7 +18728,7 @@ ATOM`, h);
/* harmony export */
atomNameToElem: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -18736,7 +18736,7 @@ ATOM`, h);
/*! ./bondLength */
"./src/parsers/utils/bondLength.ts"
);
- function g(_, x) {
+ function p(_, x) {
let o = _.replace(/ /g, "");
return o.length > 0 && o[0] === "H" && o !== "Hg" && o !== "He" && o !== "Hf" && o !== "Hs" && o !== "Ho" && (o = "H"), o.length > 1 && (o = o[0].toUpperCase() + o.substring(1).toLowerCase(), l.bondTable[o] === void 0 ? o = o[0] : x && (o === "Ca" || o === "Cd") && (o = "C")), o;
}
@@ -18753,7 +18753,7 @@ ATOM`, h);
/* harmony export */
bondLength: () => (
/* binding */
- g
+ p
),
/* harmony export */
bondTable: () => (
@@ -18842,7 +18842,7 @@ ATOM`, h);
Rn: 1.45
// None of the bottom row or any of the Lanthanides have bond lengths
};
- function g(x) {
+ function p(x) {
return l[x] || 1.6;
}
function _(x, o) {
@@ -18861,7 +18861,7 @@ ATOM`, h);
/* harmony export */
computeSecondaryStructure: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -18869,39 +18869,39 @@ ATOM`, h);
/*! ./assignBackboneHBonds */
"./src/parsers/utils/assignBackboneHBonds.ts"
);
- function g(_, x) {
+ function p(_, x) {
(0, l.assignBackboneHBonds)(_, x);
const o = {};
- let p, E, u, A, C, L;
- for (p = 0, E = _.length; p < E; p++)
- if (C = _[p], o[C.chain] === void 0 && (o[C.chain] = []), isFinite(C.hbondDistanceSq)) {
- const D = C.hbondOther;
- o[D.chain] === void 0 && (o[D.chain] = []), Math.abs(D.resi - C.resi) === 4 && (o[C.chain][C.resi] = "h");
+ let g, E, u, A, L, C;
+ for (g = 0, E = _.length; g < E; g++)
+ if (L = _[g], o[L.chain] === void 0 && (o[L.chain] = []), isFinite(L.hbondDistanceSq)) {
+ const D = L.hbondOther;
+ o[D.chain] === void 0 && (o[D.chain] = []), Math.abs(D.resi - L.resi) === 4 && (o[L.chain][L.resi] = "h");
}
for (u in o)
for (A = 1; A < o[u].length - 1; A++) {
const D = o[u][A - 1], r = o[u][A + 1];
- L = o[u][A], D == "h" && D == r && L != D && (o[u][A] = D);
+ C = o[u][A], D == "h" && D == r && C != D && (o[u][A] = D);
}
- for (p = 0, E = _.length; p < E; p++)
- C = _[p], isFinite(C.hbondDistanceSq) && o[C.chain][C.resi] != "h" && C.ss !== "h" && (o[C.chain][C.resi] = "maybesheet");
+ for (g = 0, E = _.length; g < E; g++)
+ L = _[g], isFinite(L.hbondDistanceSq) && o[L.chain][L.resi] != "h" && L.ss !== "h" && (o[L.chain][L.resi] = "maybesheet");
for (let D = 0, r = _.length; D < r; D++)
- if (C = _[D], isFinite(C.hbondDistanceSq) && o[C.chain][C.resi] == "maybesheet") {
- let n = C.hbondOther, b = o[n.chain][n.resi];
- (b == "maybesheet" || b == "s") && (o[C.chain][C.resi] = "s", o[n.chain][n.resi] = "s");
+ if (L = _[D], isFinite(L.hbondDistanceSq) && o[L.chain][L.resi] == "maybesheet") {
+ let n = L.hbondOther, b = o[n.chain][n.resi];
+ (b == "maybesheet" || b == "s") && (o[L.chain][L.resi] = "s", o[n.chain][n.resi] = "s");
}
for (let D in o) {
for (let r = 1; r < o[D].length - 1; r++) {
const n = o[D][r - 1], b = o[D][r + 1];
- L = o[D][r], n == "s" && n == b && L != n && (o[D][r] = n);
+ C = o[D][r], n == "s" && n == b && C != n && (o[D][r] = n);
}
for (let r = 0; r < o[D].length; r++) {
const n = o[D][r];
(n == "h" || n == "s") && o[D][r - 1] != n && o[D][r + 1] != n && delete o[D][r];
}
}
- for (p = 0, E = _.length; p < E; p++)
- C = _[p], L = o[C.chain][C.resi], delete C.hbondOther, delete C.hbondDistanceSq, !(L === void 0 || L === "maybesheet") && (C.ss = L, o[C.chain][C.resi - 1] != L && (C.ssbegin = !0), o[C.chain][C.resi + 1] != L && (C.ssend = !0));
+ for (g = 0, E = _.length; g < E; g++)
+ L = _[g], C = o[L.chain][L.resi], delete L.hbondOther, delete L.hbondDistanceSq, !(C === void 0 || C === "maybesheet") && (L.ss = C, o[L.chain][L.resi - 1] != C && (L.ssbegin = !0), o[L.chain][L.resi + 1] != C && (L.ssend = !0));
}
}
),
@@ -18923,7 +18923,7 @@ ATOM`, h);
var l = e(
/*! ../../WebGL */
"./src/WebGL/index.ts"
- ), g = e(
+ ), p = e(
/*! ./atomNameToElem */
"./src/parsers/utils/atomNameToElem.ts"
), _ = e(
@@ -18935,7 +18935,7 @@ ATOM`, h);
), o = e(
/*! ./isEmpty */
"./src/parsers/utils/isEmpty.ts"
- ), p = e(
+ ), g = e(
/*! ./processSymmetries */
"./src/parsers/utils/processSymmetries.ts"
), E = e(
@@ -18945,114 +18945,114 @@ ATOM`, h);
/*! ./validateBonds */
"./src/parsers/utils/validateBonds.ts"
);
- function A(C, L, D) {
- const r = [], n = L.assignBonds === void 0 ? !0 : L.assignBonds, b = !L.keepH, f = !!L.noSecondaryStructure, c = !L.noComputeSecondaryStructure, t = !L.doAssembly, a = L.altLoc ? L.altLoc : "A", h = { symmetries: [], cryst: void 0 };
+ function A(L, C, D) {
+ const r = [], n = C.assignBonds === void 0 ? !0 : C.assignBonds, b = !C.keepH, f = !!C.noSecondaryStructure, c = !C.noComputeSecondaryStructure, t = !C.doAssembly, a = C.altLoc ? C.altLoc : "A", h = { symmetries: [], cryst: void 0 };
let M, w = [];
const S = [];
let T;
const R = {};
- for (let z = 0; z < C.length; z++) {
- T = C[z].replace(/^\s*/, "");
+ for (let $ = 0; $ < L.length; $++) {
+ T = L[$].replace(/^\s*/, "");
const P = T.substring(0, 6);
- let B, U, F;
+ let B, F, U;
if (P.indexOf("END") === 0) {
- if (w = C.slice(z + 1), P === "END")
- for (const $ in D)
- D.hasOwnProperty($) && delete D[$];
+ if (w = L.slice($ + 1), P === "END")
+ for (const z in D)
+ D.hasOwnProperty(z) && delete D[z];
break;
} else if (P === "ATOM " || P === "HETATM") {
- let $, W, N, G, k, j, Q, ie, pe, he, ue, se;
- if (ue = T.substring(16, 17), ue !== " " && ue !== a && a !== "*" || (he = parseInt(T.substring(6, 11)), M = T.substring(12, 16).replace(/ /g, ""), $ = T.substring(17, 20).replace(/ /g, ""), W = T.substring(21, 22), N = parseInt(T.substring(22, 26)), G = T.substring(26, 27), k = parseFloat(T.substring(30, 38)), j = parseFloat(T.substring(38, 46)), Q = parseFloat(T.substring(46, 54)), se = parseFloat(T.substring(60, 68)), pe = T.substring(76, 78).replace(/ /g, ""), pe === "" || _.bondTable[pe] === void 0 ? pe = (0, g.atomNameToElem)(T.substring(12, 14), T[0] == "A") : pe = pe[0].toUpperCase() + pe.substring(1).toLowerCase(), pe === "H" && b))
+ let z, W, V, N, k, G, Q, ie, ge, le, oe, he;
+ if (oe = T.substring(16, 17), oe !== " " && oe !== a && a !== "*" || (le = parseInt(T.substring(6, 11)), M = T.substring(12, 16).replace(/ /g, ""), z = T.substring(17, 20).replace(/ /g, ""), W = T.substring(21, 22), V = parseInt(T.substring(22, 26)), N = T.substring(26, 27), k = parseFloat(T.substring(30, 38)), G = parseFloat(T.substring(38, 46)), Q = parseFloat(T.substring(46, 54)), he = parseFloat(T.substring(60, 68)), ge = T.substring(76, 78).replace(/ /g, ""), ge === "" || _.bondTable[ge] === void 0 ? ge = (0, p.atomNameToElem)(T.substring(12, 14), T[0] == "A") : ge = ge[0].toUpperCase() + ge.substring(1).toLowerCase(), ge === "H" && b))
continue;
- P[0] == "H" ? ie = !0 : ie = !1, S[he] = r.length, r.push({
- resn: $,
+ P[0] == "H" ? ie = !0 : ie = !1, S[le] = r.length, r.push({
+ resn: z,
x: k,
- y: j,
+ y: G,
z: Q,
- elem: pe,
+ elem: ge,
hetflag: ie,
- altLoc: ue,
+ altLoc: oe,
chain: W,
- resi: N,
- icode: G,
- rescode: N + (G !== " " ? "^" + G : ""),
+ resi: V,
+ icode: N,
+ rescode: V + (N !== " " ? "^" + N : ""),
// resi
// and
// icode
- serial: he,
+ serial: le,
atom: M,
bonds: [],
ss: "c",
bondOrder: [],
properties: {},
- b: se,
+ b: he,
pdbline: T
});
} else if (P === "SHEET ") {
- B = T.substring(21, 22), U = parseInt(T.substring(22, 26)), F = parseInt(T.substring(33, 37)), B in D || (D[B] = {}), D[B][U] = "s1";
- for (let $ = U + 1; $ < F; $++)
- D[B][$] = "s";
- D[B][F] = "s2";
+ B = T.substring(21, 22), F = parseInt(T.substring(22, 26)), U = parseInt(T.substring(33, 37)), B in D || (D[B] = {}), D[B][F] = "s1";
+ for (let z = F + 1; z < U; z++)
+ D[B][z] = "s";
+ D[B][U] = "s2";
} else if (P === "CONECT") {
- const $ = parseInt(T.substring(6, 11)), W = S[$], N = r[W], G = [11, 16, 21, 26];
+ const z = parseInt(T.substring(6, 11)), W = S[z], V = r[W], N = [11, 16, 21, 26];
for (let k = 0; k < 4; k++) {
- const j = parseInt(T.substring(G[k], G[k] + 5)), Q = S[j];
+ const G = parseInt(T.substring(N[k], N[k] + 5)), Q = S[G];
let ie = W + ":" + Q;
- const pe = r[Q];
- if (N !== void 0 && pe !== void 0)
+ const ge = r[Q];
+ if (V !== void 0 && ge !== void 0)
if (!R[ie])
- R[ie] = 1, (N.bonds.length == 0 || N.bonds[N.bonds.length - 1] !== Q) && (N.bonds.push(Q), N.bondOrder.push(1));
+ R[ie] = 1, (V.bonds.length == 0 || V.bonds[V.bonds.length - 1] !== Q) && (V.bonds.push(Q), V.bondOrder.push(1));
else {
R[ie] += 1;
- for (let he = 0; he < N.bonds.length; he++)
- if (N.bonds[he] == Q) {
- const ue = R[ie];
- ue >= 4 ? N.bondOrder[he] = 1 : N.bondOrder[he] = ue;
+ for (let le = 0; le < V.bonds.length; le++)
+ if (V.bonds[le] == Q) {
+ const oe = R[ie];
+ oe >= 4 ? V.bondOrder[le] = 1 : V.bondOrder[le] = oe;
}
}
}
} else if (P === "HELIX ") {
- B = T.substring(19, 20), U = parseInt(T.substring(21, 25)), F = parseInt(T.substring(33, 37)), B in D || (D[B] = {}), D[B][U] = "h1";
- for (let $ = U + 1; $ < F; $++)
- D[B][$] = "h";
- D[B][F] = "h2";
+ B = T.substring(19, 20), F = parseInt(T.substring(21, 25)), U = parseInt(T.substring(33, 37)), B in D || (D[B] = {}), D[B][F] = "h1";
+ for (let z = F + 1; z < U; z++)
+ D[B][z] = "h";
+ D[B][U] = "h2";
} else if (!t && P === "REMARK" && T.substring(13, 18) === "BIOMT") {
- let $, W = new l.Matrix4();
- for ($ = 1; $ <= 3; $++)
- if (T = C[z].replace(/^\s*/, ""), parseInt(T.substring(18, 19)) == $)
- W.elements[$ - 1] = parseFloat(T.substring(23, 33)), W.elements[$ - 1 + 4] = parseFloat(T.substring(33, 43)), W.elements[$ - 1 + 8] = parseFloat(T.substring(43, 53)), W.elements[$ - 1 + 12] = parseFloat(T.substring(53)), z++;
+ let z, W = new l.Matrix4();
+ for (z = 1; z <= 3; z++)
+ if (T = L[$].replace(/^\s*/, ""), parseInt(T.substring(18, 19)) == z)
+ W.elements[z - 1] = parseFloat(T.substring(23, 33)), W.elements[z - 1 + 4] = parseFloat(T.substring(33, 43)), W.elements[z - 1 + 8] = parseFloat(T.substring(43, 53)), W.elements[z - 1 + 12] = parseFloat(T.substring(53)), $++;
else
for (; T.substring(13, 18) === "BIOMT"; )
- z++, T = C[z].replace(/^\s*/, "");
- W.elements[3] = 0, W.elements[7] = 0, W.elements[11] = 0, W.elements[15] = 1, h.symmetries.push(W), z--;
+ $++, T = L[$].replace(/^\s*/, "");
+ W.elements[3] = 0, W.elements[7] = 0, W.elements[11] = 0, W.elements[15] = 1, h.symmetries.push(W), $--;
} else if (P === "CRYST1") {
- let $, W, N, G, k, j;
- $ = parseFloat(T.substring(7, 15)), W = parseFloat(T.substring(16, 24)), N = parseFloat(T.substring(25, 33)), G = parseFloat(T.substring(34, 40)), k = parseFloat(T.substring(41, 47)), j = parseFloat(T.substring(48, 54)), h.cryst = {
- a: $,
+ let z, W, V, N, k, G;
+ z = parseFloat(T.substring(7, 15)), W = parseFloat(T.substring(16, 24)), V = parseFloat(T.substring(25, 33)), N = parseFloat(T.substring(34, 40)), k = parseFloat(T.substring(41, 47)), G = parseFloat(T.substring(48, 54)), h.cryst = {
+ a: z,
b: W,
- c: N,
- alpha: G,
+ c: V,
+ alpha: N,
beta: k,
- gamma: j
+ gamma: G
};
} else if (P === "ANISOU") {
- const $ = parseInt(T.substring(6, 11)), W = S[$], N = r[W];
- if (N) {
- const G = T.substring(30).trim().split(/\s+/), k = {
- u11: parseInt(G[0]),
- u22: parseInt(G[1]),
- u33: parseInt(G[2]),
- u12: parseInt(G[3]),
- u13: parseInt(G[4]),
- u23: parseInt(G[5])
+ const z = parseInt(T.substring(6, 11)), W = S[z], V = r[W];
+ if (V) {
+ const N = T.substring(30).trim().split(/\s+/), k = {
+ u11: parseInt(N[0]),
+ u22: parseInt(N[1]),
+ u33: parseInt(N[2]),
+ u12: parseInt(N[3]),
+ u13: parseInt(N[4]),
+ u23: parseInt(N[5])
};
- N.uMat = k;
+ V.uMat = k;
}
}
}
- if ((0, u.validateBonds)(r, S), n && (0, E.assignPDBBonds)(r, L), t || (0, p.processSymmetries)(h.symmetries, r, L, h.cryst), c && !f && (0, x.computeSecondaryStructure)(r, L.hbondCutoff), !(0, o.isEmpty)(D))
- for (let z = 0; z < r.length; z++) {
- const P = r[z];
+ if ((0, u.validateBonds)(r, S), n && (0, E.assignPDBBonds)(r, C), t || (0, g.processSymmetries)(h.symmetries, r, C, h.cryst), c && !f && (0, x.computeSecondaryStructure)(r, C.hbondCutoff), !(0, o.isEmpty)(D))
+ for (let $ = 0; $ < r.length; $++) {
+ const P = r[$];
if (P !== void 0 && P.chain in D && P.resi in D[P.chain]) {
const B = D[P.chain][P.resi];
P.ss = B[0], B.length > 1 && (B[1] == "1" ? P.ssbegin = !0 : B[1] == "2" && (P.ssend = !0));
@@ -19077,8 +19077,8 @@ ATOM`, h);
)
/* harmony export */
});
- function l(g) {
- for (const _ in g)
+ function l(p) {
+ for (const _ in p)
return !1;
return !0;
}
@@ -19095,7 +19095,7 @@ ATOM`, h);
/* harmony export */
processSymmetries: () => (
/* binding */
- g
+ p
)
/* harmony export */
});
@@ -19103,10 +19103,10 @@ ATOM`, h);
/*! ../../WebGL */
"./src/WebGL/index.ts"
);
- function g(_, x, o, p) {
+ function p(_, x, o, g) {
const E = !o.duplicateAssemblyAtoms, u = x.length;
- let A = u, C = -1, L = null, D = null;
- (o.normalizeAssembly || o.wrapAtoms) && p && (L = (0, l.conversionMatrix3)(p.a, p.b, p.c, p.alpha, p.beta, p.gamma), D = new l.Matrix3(), D.getInverse3(L));
+ let A = u, L = -1, C = null, D = null;
+ (o.normalizeAssembly || o.wrapAtoms) && g && (C = (0, l.conversionMatrix3)(g.a, g.b, g.c, g.alpha, g.beta, g.gamma), D = new l.Matrix3(), D.getInverse3(C));
let r = function(f) {
let c = f.clone().applyMatrix3(D);
const t = [c.x, c.y, c.z], a = [0, 0, 0];
@@ -19117,9 +19117,9 @@ ATOM`, h);
t[M] -= 1, a[M] -= 1;
}
const h = new l.Vector3(a[0], a[1], a[2]);
- return h.applyMatrix3(L), h;
+ return h.applyMatrix3(C), h;
};
- if (o.normalizeAssembly && p)
+ if (o.normalizeAssembly && g)
for (let f = 0; f < _.length; f++) {
const c = new l.Vector3(0, 0, 0);
for (let a = 0; a < u; a++) {
@@ -19128,7 +19128,7 @@ ATOM`, h);
}
c.divideScalar(u);
const t = r(c);
- _[f].isNearlyIdentity() && t.lengthSq() > 1e-3 && (C = f), _[f].translate(t);
+ _[f].isNearlyIdentity() && t.lengthSq() > 1e-3 && (L = f), _[f].translate(t);
}
if (E) {
if (_.length > 1)
@@ -19145,13 +19145,13 @@ ATOM`, h);
for (let f = 0; f < u; f++)
x[f].sym = -1;
for (let f = 0; f < _.length; f++)
- if (!_[f].isNearlyIdentity() && C != f) {
+ if (!_[f].isNearlyIdentity() && L != f) {
let c = new l.Vector3();
for (let t = 0; t < u; t++) {
const a = [];
for (let M = 0; M < x[t].bonds.length; M++)
a.push(x[t].bonds[M] + A);
- if (c.set(x[t].x, x[t].y, x[t].z), c.applyMatrix4(_[f]), o.wrapAtoms && p) {
+ if (c.set(x[t].x, x[t].y, x[t].z), c.applyMatrix4(_[f]), o.wrapAtoms && g) {
let M = r(c);
c.add(M);
}
@@ -19164,7 +19164,7 @@ ATOM`, h);
} else
for (let c = 0; c < u; c++)
x[c].sym = f;
- if (o.wrapAtoms && p) {
+ if (o.wrapAtoms && g) {
let f = new l.Vector3();
for (let c = 0; c < u; c++) {
f.set(x[c].x, x[c].y, x[c].z);
@@ -19172,10 +19172,10 @@ ATOM`, h);
f.add(t), x[c].x = f.x, x[c].y = f.y, x[c].z = f.z;
}
}
- if (C >= 0) {
+ if (L >= 0) {
const f = new l.Vector3();
for (let c = 0; c < u; c++)
- f.set(x[c].x, x[c].y, x[c].z), f.applyMatrix4(_[C]), x[c].x = f.x, x[c].y = f.y, x[c].z = f.z;
+ f.set(x[c].x, x[c].y, x[c].z), f.applyMatrix4(_[L]), x[c].x = f.x, x[c].y = f.y, x[c].z = f.z;
}
_.length = 0;
}
@@ -19281,12 +19281,12 @@ ATOM`, h);
)
/* harmony export */
});
- function l(g, _) {
- for (let x = 0, o = g.length; x < o; x++) {
- const p = g[x];
- for (let E = 0; E < p.bonds.length; E++) {
- const u = p.bonds[E], A = g[u], C = _[p.serial];
- A && C && A.bonds.indexOf(C) < 0 && (A.bonds.push(C), A.bondOrder.push(p.bondOrder[E]));
+ function l(p, _) {
+ for (let x = 0, o = p.length; x < o; x++) {
+ const g = p[x];
+ for (let E = 0; E < g.bonds.length; E++) {
+ const u = g.bonds[E], A = p[u], L = _[g.serial];
+ A && L && A.bonds.indexOf(L) < 0 && (A.bonds.push(L), A.bondOrder.push(g.bondOrder[E]));
}
}
}
@@ -19303,7 +19303,7 @@ ATOM`, h);
/* harmony export */
applyPartialCharges: () => (
/* binding */
- g
+ p
),
/* harmony export */
partialCharges: () => (
@@ -19481,7 +19481,7 @@ ATOM`, h);
"VAL:C": 0.6,
"VAL:O": -0.55
};
- function g(_, x) {
+ function p(_, x) {
if ((!x || typeof _.partialCharge > "u") && _.resn && _.atom) {
var o = _.resn + ":" + _.atom;
_.properties.partialCharge = l[o];
@@ -19642,24 +19642,24 @@ ATOM`, h);
y && (y.volformat && !(y.voldata instanceof _VolumeData__WEBPACK_IMPORTED_MODULE_1__.VolumeData) && (y.voldata = new _VolumeData__WEBPACK_IMPORTED_MODULE_1__.VolumeData(y.voldata, y.volformat)), y.volscheme && (y.volscheme = _Gradient__WEBPACK_IMPORTED_MODULE_0__.Gradient.getGradient(y.volscheme)));
}
function getExtent(y, s) {
- var e, l, g, _, x, o, p, E, u, A, C = !s;
- if (e = l = g = 9999, _ = x = o = -9999, p = E = u = A = 0, y.length === 0)
+ var e, l, p, _, x, o, g, E, u, A, L = !s;
+ if (e = l = p = 9999, _ = x = o = -9999, g = E = u = A = 0, y.length === 0)
return [[0, 0, 0], [0, 0, 0], [0, 0, 0]];
- for (var L = 0; L < y.length; L++) {
- var D = y[L];
- if (!(typeof D > "u" || !isFinite(D.x) || !isFinite(D.y) || !isFinite(D.z)) && (A++, p += D.x, E += D.y, u += D.z, e = e < D.x ? e : D.x, l = l < D.y ? l : D.y, g = g < D.z ? g : D.z, _ = _ > D.x ? _ : D.x, x = x > D.y ? x : D.y, o = o > D.z ? o : D.z, D.symmetries && C))
+ for (var C = 0; C < y.length; C++) {
+ var D = y[C];
+ if (!(typeof D > "u" || !isFinite(D.x) || !isFinite(D.y) || !isFinite(D.z)) && (A++, g += D.x, E += D.y, u += D.z, e = e < D.x ? e : D.x, l = l < D.y ? l : D.y, p = p < D.z ? p : D.z, _ = _ > D.x ? _ : D.x, x = x > D.y ? x : D.y, o = o > D.z ? o : D.z, D.symmetries && L))
for (var r = 0; r < D.symmetries.length; r++)
- A++, p += D.symmetries[r].x, E += D.symmetries[r].y, u += D.symmetries[r].z, e = e < D.symmetries[r].x ? e : D.symmetries[r].x, l = l < D.symmetries[r].y ? l : D.symmetries[r].y, g = g < D.symmetries[r].z ? g : D.symmetries[r].z, _ = _ > D.symmetries[r].x ? _ : D.symmetries[r].x, x = x > D.symmetries[r].y ? x : D.symmetries[r].y, o = o > D.symmetries[r].z ? o : D.symmetries[r].z;
+ A++, g += D.symmetries[r].x, E += D.symmetries[r].y, u += D.symmetries[r].z, e = e < D.symmetries[r].x ? e : D.symmetries[r].x, l = l < D.symmetries[r].y ? l : D.symmetries[r].y, p = p < D.symmetries[r].z ? p : D.symmetries[r].z, _ = _ > D.symmetries[r].x ? _ : D.symmetries[r].x, x = x > D.symmetries[r].y ? x : D.symmetries[r].y, o = o > D.symmetries[r].z ? o : D.symmetries[r].z;
}
return [
- [e, l, g],
+ [e, l, p],
[_, x, o],
- [p / A, E / A, u / A]
+ [g / A, E / A, u / A]
];
}
function getPropertyRange(y, s) {
- for (var e = Number.POSITIVE_INFINITY, l = Number.NEGATIVE_INFINITY, g = 0, _ = y.length; g < _; g++) {
- var x = y[g], o = getAtomProperty(x, s);
+ for (var e = Number.POSITIVE_INFINITY, l = Number.NEGATIVE_INFINITY, p = 0, _ = y.length; p < _; p++) {
+ var x = y[p], o = getAtomProperty(x, s);
o != null && (o < e && (e = o), o > l && (l = o));
}
return !isFinite(e) && !isFinite(l) ? e = l = 0 : isFinite(e) ? isFinite(l) || (l = e) : e = l, [e, l];
@@ -19679,8 +19679,8 @@ ATOM`, h);
}
}
function base64ToArray(y) {
- for (var s = window.atob(y), e = s.length, l = new Uint8Array(e), g = 0; g < e; g++)
- l[g] = s.charCodeAt(g);
+ for (var s = window.atob(y), e = s.length, l = new Uint8Array(e), p = 0; p < e; p++)
+ l[p] = s.charCodeAt(p);
return l;
}
function getAtomProperty(y, s) {
@@ -19701,21 +19701,21 @@ ATOM`, h);
} catch {
}
y = y.replace(/%7E/g, "~");
- var s = function(C) {
- return isNumeric(C) ? Math.floor(parseFloat(C)) == parseInt(C) || C.indexOf(".") >= 0 ? parseFloat(C) : parseInt(C) : C === "true" ? !0 : C === "false" ? !1 : C;
+ var s = function(L) {
+ return isNumeric(L) ? Math.floor(parseFloat(L)) == parseInt(L) || L.indexOf(".") >= 0 ? parseFloat(L) : parseInt(L) : L === "true" ? !0 : L === "false" ? !1 : L;
}, e = {};
if (y === "all")
return e;
- for (var l = y.split(";"), g = 0; g < l.length; g++) {
- var _ = l[g].split(":"), x = _[0], o = {}, p = _[1];
- if (p)
- if (p = p.replace(/~/g, "="), p.indexOf("=") !== -1)
- for (var E = p.split(","), u = 0; u < E.length; u++) {
+ for (var l = y.split(";"), p = 0; p < l.length; p++) {
+ var _ = l[p].split(":"), x = _[0], o = {}, g = _[1];
+ if (g)
+ if (g = g.replace(/~/g, "="), g.indexOf("=") !== -1)
+ for (var E = g.split(","), u = 0; u < E.length; u++) {
var A = E[u].split("=", 2);
o[A[0]] = s(A[1]);
}
else
- p.indexOf(",") !== -1 ? o = p.split(",") : o = s(p);
+ g.indexOf(",") !== -1 ? o = g.split(",") : o = s(g);
e[x] = o;
}
return e;
@@ -19730,56 +19730,56 @@ ATOM`, h);
return s ? e.then(s) : e;
}
function getbin(y, s, e, l) {
- var g;
- return e == "POST" ? g = fetch(y, { method: "POST", body: l }).then((_) => checkStatus(_)).then((_) => _.arrayBuffer()) : g = fetch(y).then((_) => checkStatus(_)).then((_) => _.arrayBuffer()), s ? g.then(s) : g;
+ var p;
+ return e == "POST" ? p = fetch(y, { method: "POST", body: l }).then((_) => checkStatus(_)).then((_) => _.arrayBuffer()) : p = fetch(y).then((_) => checkStatus(_)).then((_) => _.arrayBuffer()), s ? p.then(s) : p;
}
function download(y, s, e, l) {
- var g = "", _ = "", x = "", o = "", p = null, E = s.addModel();
+ var p = "", _ = "", x = "", o = "", g = null, E = s.addModel();
if (y.indexOf(":") < 0 && (y.length == 4 ? y = "pdb:" + y : isNaN(y) ? y = "url:" + y : y = "cid:" + y), y.substring(0, 5) === "mmtf:")
- _ = e && e.pdbUri ? e.pdbUri : "https://mmtf.rcsb.org/v1.0/full/", y = y.substring(5).toUpperCase(), o = _ + y, e && typeof e.noComputeSecondaryStructure > "u" && (e.noComputeSecondaryStructure = !0), p = new Promise(function(A) {
- getbin(o).then(function(C) {
- E.addMolData(C, "mmtf", e), s.zoomTo(), s.render(), A(E);
+ _ = e && e.pdbUri ? e.pdbUri : "https://mmtf.rcsb.org/v1.0/full/", y = y.substring(5).toUpperCase(), o = _ + y, e && typeof e.noComputeSecondaryStructure > "u" && (e.noComputeSecondaryStructure = !0), g = new Promise(function(A) {
+ getbin(o).then(function(L) {
+ E.addMolData(L, "mmtf", e), s.zoomTo(), s.render(), A(E);
}, function() {
console.log("fetch of " + o + " failed.");
});
});
else {
if (y.substring(0, 4) === "pdb:") {
- if (g = "mmtf", e && e.format && (g = e.format), e && typeof e.noComputeSecondaryStructure > "u" && (e.noComputeSecondaryStructure = !0), y = y.substring(4).toUpperCase(), !y.match(/^[1-9][A-Za-z0-9]{3}$/)) {
+ if (p = "mmtf", e && e.format && (p = e.format), e && typeof e.noComputeSecondaryStructure > "u" && (e.noComputeSecondaryStructure = !0), y = y.substring(4).toUpperCase(), !y.match(/^[1-9][A-Za-z0-9]{3}$/)) {
alert("Wrong PDB ID");
return;
}
- g == "mmtf" ? (x = e && e.mmtfUri ? e.mmtfUri : "https://mmtf.rcsb.org/v1.0/full/", o = x + y.toUpperCase()) : (_ = e && e.pdbUri ? e.pdbUri : "https://files.rcsb.org/view/", o = _ + y + "." + g);
+ p == "mmtf" ? (x = e && e.mmtfUri ? e.mmtfUri : "https://mmtf.rcsb.org/v1.0/full/", o = x + y.toUpperCase()) : (_ = e && e.pdbUri ? e.pdbUri : "https://files.rcsb.org/view/", o = _ + y + "." + p);
} else if (y.substring(0, 4) == "cid:") {
- if (g = "sdf", y = y.substring(4), !y.match(/^[0-9]+$/)) {
+ if (p = "sdf", y = y.substring(4), !y.match(/^[0-9]+$/)) {
alert("Wrong Compound ID");
return;
}
o = "https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + y + "/SDF?record_type=3d";
} else
- y.substring(0, 4) == "url:" && (o = y.substring(4), g = o);
+ y.substring(0, 4) == "url:" && (o = y.substring(4), p = o);
var u = function(A) {
- E.addMolData(A, g, e), s.zoomTo(), s.render();
+ E.addMolData(A, p, e), s.zoomTo(), s.render();
};
- p = new Promise(function(A) {
- g == "mmtf" ? getbin(o).then(function(C) {
- u(C), A(E);
+ g = new Promise(function(A) {
+ p == "mmtf" ? getbin(o).then(function(L) {
+ u(L), A(E);
}).catch(function() {
- _ = e && e.pdbUri ? e.pdbUri : "https://files.rcsb.org/view/", o = _ + y + ".pdb", g = "pdb", console.log("falling back to pdb format"), get(o).then(function(C) {
- u(C), A(E);
- }).catch(function(C) {
- u(""), A(E), console.log("fetch of " + o + " failed: " + C.statusText);
+ _ = e && e.pdbUri ? e.pdbUri : "https://files.rcsb.org/view/", o = _ + y + ".pdb", p = "pdb", console.log("falling back to pdb format"), get(o).then(function(L) {
+ u(L), A(E);
+ }).catch(function(L) {
+ u(""), A(E), console.log("fetch of " + o + " failed: " + L.statusText);
});
- }) : get(o).then(function(C) {
- u(C), A(E);
- }).catch(function(C) {
- u(""), A(E), console.log("fetch of " + o + " failed: " + C.statusText);
+ }) : get(o).then(function(L) {
+ u(L), A(E);
+ }).catch(function(L) {
+ u(""), A(E), console.log("fetch of " + o + " failed: " + L.statusText);
});
});
}
- return l ? (p.then(function(A) {
+ return l ? (g.then(function(A) {
l(A);
- }), E) : p;
+ }), E) : g;
}
function getColorFromStyle(y, s) {
let e = s.colorscheme;
@@ -19801,10 +19801,10 @@ ATOM`, h);
l = e.map[y[e.prop]];
else if (typeof e.prop < "u" && typeof e.gradient < "u") {
x = e.prop;
- var g = e.gradient;
- typeof _Gradient__WEBPACK_IMPORTED_MODULE_0__.builtinGradients[g] < "u" && (g = new _Gradient__WEBPACK_IMPORTED_MODULE_0__.builtinGradients[g](e.min, e.max, e.mid ? e.mid : e.colors));
- let p = g.range() || [-1, 1];
- o = getAtomProperty(y, x), o != null && (l = g.valueToHex(o, p));
+ var p = e.gradient;
+ typeof _Gradient__WEBPACK_IMPORTED_MODULE_0__.builtinGradients[p] < "u" && (p = new _Gradient__WEBPACK_IMPORTED_MODULE_0__.builtinGradients[p](e.min, e.max, e.mid ? e.mid : e.colors));
+ let g = p.range() || [-1, 1];
+ o = getAtomProperty(y, x), o != null && (l = p.valueToHex(o, g));
} else
typeof e.prop < "u" && typeof e.map < "u" ? (x = e.prop, o = getAtomProperty(y, x), typeof e.map[o] < "u" && (l = e.map[o])) : typeof s.colorscheme[y.elem] < "u" ? l = s.colorscheme[y.elem] : console.log("Could not interpret colorscheme " + e);
} else
@@ -19825,32 +19825,32 @@ ATOM`, h);
/***/
(y, s, e) => {
(function() {
- var l = {}, g;
- y.exports = l, g = e(
+ var l = {}, p;
+ y.exports = l, p = e(
/*! pako */
"./node_modules/upng-js/node_modules/pako/index.js"
), function(_, x) {
_.toRGBA8 = function(o) {
- var p = o.width, E = o.height;
+ var g = o.width, E = o.height;
if (o.tabs.acTL == null)
- return [_.toRGBA8.decodeImage(o.data, p, E, o).buffer];
+ return [_.toRGBA8.decodeImage(o.data, g, E, o).buffer];
var u = [];
o.frames[0].data == null && (o.frames[0].data = o.data);
- for (var A, C = new Uint8Array(p * E * 4), L = 0; L < o.frames.length; L++) {
- var D = o.frames[L], r = D.rect.x, n = D.rect.y, b = D.rect.width, f = D.rect.height, c = _.toRGBA8.decodeImage(D.data, b, f, o);
- if (L == 0 ? A = c : D.blend == 0 ? _._copyTile(c, b, f, A, p, E, r, n, 0) : D.blend == 1 && _._copyTile(c, b, f, A, p, E, r, n, 1), u.push(A.buffer), A = A.slice(0), D.dispose != 0) {
+ for (var A, L = new Uint8Array(g * E * 4), C = 0; C < o.frames.length; C++) {
+ var D = o.frames[C], r = D.rect.x, n = D.rect.y, b = D.rect.width, f = D.rect.height, c = _.toRGBA8.decodeImage(D.data, b, f, o);
+ if (C == 0 ? A = c : D.blend == 0 ? _._copyTile(c, b, f, A, g, E, r, n, 0) : D.blend == 1 && _._copyTile(c, b, f, A, g, E, r, n, 1), u.push(A.buffer), A = A.slice(0), D.dispose != 0) {
if (D.dispose == 1)
- _._copyTile(C, b, f, A, p, E, r, n, 0);
+ _._copyTile(L, b, f, A, g, E, r, n, 0);
else if (D.dispose == 2) {
- for (var t = L - 1; o.frames[t].dispose == 2; )
+ for (var t = C - 1; o.frames[t].dispose == 2; )
t--;
A = new Uint8Array(u[t]).slice(0);
}
}
}
return u;
- }, _.toRGBA8.decodeImage = function(o, p, E, u) {
- var A = p * E, C = _.decode._getBPP(u), L = Math.ceil(p * C / 8), D = new Uint8Array(A * 4), r = new Uint32Array(D.buffer), n = u.ctype, b = u.depth, f = _._bin.readUshort;
+ }, _.toRGBA8.decodeImage = function(o, g, E, u) {
+ var A = g * E, L = _.decode._getBPP(u), C = Math.ceil(g * L / 8), D = new Uint8Array(A * 4), r = new Uint32Array(D.buffer), n = u.ctype, b = u.depth, f = _._bin.readUshort;
if (n == 6) {
var c = A << 2;
if (b == 8)
@@ -19872,340 +19872,340 @@ ATOM`, h);
D[S] = o[T], D[S + 1] = o[T + 2], D[S + 2] = o[T + 4], D[S + 3] = 255, h != -1 && f(o, T) == h && f(o, T + 2) == M && f(o, T + 4) == w && (D[S + 3] = 0);
}
} else if (n == 3) {
- var R = u.tabs.PLTE, z = u.tabs.tRNS, P = z ? z.length : 0;
+ var R = u.tabs.PLTE, $ = u.tabs.tRNS, P = $ ? $.length : 0;
if (b == 1)
for (var B = 0; B < E; B++)
- for (var U = B * L, F = B * p, t = 0; t < p; t++) {
- var S = F + t << 2, $ = o[U + (t >> 3)] >> 7 - ((t & 7) << 0) & 1, W = 3 * $;
- D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = $ < P ? z[$] : 255;
+ for (var F = B * C, U = B * g, t = 0; t < g; t++) {
+ var S = U + t << 2, z = o[F + (t >> 3)] >> 7 - ((t & 7) << 0) & 1, W = 3 * z;
+ D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = z < P ? $[z] : 255;
}
if (b == 2)
for (var B = 0; B < E; B++)
- for (var U = B * L, F = B * p, t = 0; t < p; t++) {
- var S = F + t << 2, $ = o[U + (t >> 2)] >> 6 - ((t & 3) << 1) & 3, W = 3 * $;
- D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = $ < P ? z[$] : 255;
+ for (var F = B * C, U = B * g, t = 0; t < g; t++) {
+ var S = U + t << 2, z = o[F + (t >> 2)] >> 6 - ((t & 3) << 1) & 3, W = 3 * z;
+ D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = z < P ? $[z] : 255;
}
if (b == 4)
for (var B = 0; B < E; B++)
- for (var U = B * L, F = B * p, t = 0; t < p; t++) {
- var S = F + t << 2, $ = o[U + (t >> 1)] >> 4 - ((t & 1) << 2) & 15, W = 3 * $;
- D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = $ < P ? z[$] : 255;
+ for (var F = B * C, U = B * g, t = 0; t < g; t++) {
+ var S = U + t << 2, z = o[F + (t >> 1)] >> 4 - ((t & 1) << 2) & 15, W = 3 * z;
+ D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = z < P ? $[z] : 255;
}
if (b == 8)
for (var t = 0; t < A; t++) {
- var S = t << 2, $ = o[t], W = 3 * $;
- D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = $ < P ? z[$] : 255;
+ var S = t << 2, z = o[t], W = 3 * z;
+ D[S] = R[W], D[S + 1] = R[W + 1], D[S + 2] = R[W + 2], D[S + 3] = z < P ? $[z] : 255;
}
} else if (n == 4) {
if (b == 8)
for (var t = 0; t < A; t++) {
- var S = t << 2, N = t << 1, G = o[N];
- D[S] = G, D[S + 1] = G, D[S + 2] = G, D[S + 3] = o[N + 1];
+ var S = t << 2, V = t << 1, N = o[V];
+ D[S] = N, D[S + 1] = N, D[S + 2] = N, D[S + 3] = o[V + 1];
}
if (b == 16)
for (var t = 0; t < A; t++) {
- var S = t << 2, N = t << 2, G = o[N];
- D[S] = G, D[S + 1] = G, D[S + 2] = G, D[S + 3] = o[N + 2];
+ var S = t << 2, V = t << 2, N = o[V];
+ D[S] = N, D[S + 1] = N, D[S + 2] = N, D[S + 3] = o[V + 2];
}
} else if (n == 0) {
var h = u.tabs.tRNS ? u.tabs.tRNS : -1;
if (b == 1)
for (var t = 0; t < A; t++) {
- var G = 255 * (o[t >> 3] >> 7 - (t & 7) & 1), k = G == h * 255 ? 0 : 255;
- r[t] = k << 24 | G << 16 | G << 8 | G;
+ var N = 255 * (o[t >> 3] >> 7 - (t & 7) & 1), k = N == h * 255 ? 0 : 255;
+ r[t] = k << 24 | N << 16 | N << 8 | N;
}
if (b == 2)
for (var t = 0; t < A; t++) {
- var G = 85 * (o[t >> 2] >> 6 - ((t & 3) << 1) & 3), k = G == h * 85 ? 0 : 255;
- r[t] = k << 24 | G << 16 | G << 8 | G;
+ var N = 85 * (o[t >> 2] >> 6 - ((t & 3) << 1) & 3), k = N == h * 85 ? 0 : 255;
+ r[t] = k << 24 | N << 16 | N << 8 | N;
}
if (b == 4)
for (var t = 0; t < A; t++) {
- var G = 17 * (o[t >> 1] >> 4 - ((t & 1) << 2) & 15), k = G == h * 17 ? 0 : 255;
- r[t] = k << 24 | G << 16 | G << 8 | G;
+ var N = 17 * (o[t >> 1] >> 4 - ((t & 1) << 2) & 15), k = N == h * 17 ? 0 : 255;
+ r[t] = k << 24 | N << 16 | N << 8 | N;
}
if (b == 8)
for (var t = 0; t < A; t++) {
- var G = o[t], k = G == h ? 0 : 255;
- r[t] = k << 24 | G << 16 | G << 8 | G;
+ var N = o[t], k = N == h ? 0 : 255;
+ r[t] = k << 24 | N << 16 | N << 8 | N;
}
if (b == 16)
for (var t = 0; t < A; t++) {
- var G = o[t << 1], k = f(o, t << 1) == h ? 0 : 255;
- r[t] = k << 24 | G << 16 | G << 8 | G;
+ var N = o[t << 1], k = f(o, t << 1) == h ? 0 : 255;
+ r[t] = k << 24 | N << 16 | N << 8 | N;
}
}
return D;
}, _.decode = function(o) {
- for (var p = new Uint8Array(o), E = 8, u = _._bin, A = u.readUshort, C = u.readUint, L = { tabs: {}, frames: [] }, D = new Uint8Array(p.length), r = 0, n, b = 0, f = [137, 80, 78, 71, 13, 10, 26, 10], c = 0; c < 8; c++)
- if (p[c] != f[c])
+ for (var g = new Uint8Array(o), E = 8, u = _._bin, A = u.readUshort, L = u.readUint, C = { tabs: {}, frames: [] }, D = new Uint8Array(g.length), r = 0, n, b = 0, f = [137, 80, 78, 71, 13, 10, 26, 10], c = 0; c < 8; c++)
+ if (g[c] != f[c])
throw "The input is not a PNG file!";
- for (; E < p.length; ) {
- var t = u.readUint(p, E);
+ for (; E < g.length; ) {
+ var t = u.readUint(g, E);
E += 4;
- var a = u.readASCII(p, E, 4);
+ var a = u.readASCII(g, E, 4);
if (E += 4, a == "IHDR")
- _.decode._IHDR(p, E, L);
+ _.decode._IHDR(g, E, C);
else if (a == "IDAT") {
for (var c = 0; c < t; c++)
- D[r + c] = p[E + c];
+ D[r + c] = g[E + c];
r += t;
} else if (a == "acTL")
- L.tabs[a] = { num_frames: C(p, E), num_plays: C(p, E + 4) }, n = new Uint8Array(p.length);
+ C.tabs[a] = { num_frames: L(g, E), num_plays: L(g, E + 4) }, n = new Uint8Array(g.length);
else if (a == "fcTL") {
if (b != 0) {
- var h = L.frames[L.frames.length - 1];
- h.data = _.decode._decompress(L, n.slice(0, b), h.rect.width, h.rect.height), b = 0;
+ var h = C.frames[C.frames.length - 1];
+ h.data = _.decode._decompress(C, n.slice(0, b), h.rect.width, h.rect.height), b = 0;
}
- var M = { x: C(p, E + 12), y: C(p, E + 16), width: C(p, E + 4), height: C(p, E + 8) }, w = A(p, E + 22);
- w = A(p, E + 20) / (w == 0 ? 100 : w);
- var S = { rect: M, delay: Math.round(w * 1e3), dispose: p[E + 24], blend: p[E + 25] };
- L.frames.push(S);
+ var M = { x: L(g, E + 12), y: L(g, E + 16), width: L(g, E + 4), height: L(g, E + 8) }, w = A(g, E + 22);
+ w = A(g, E + 20) / (w == 0 ? 100 : w);
+ var S = { rect: M, delay: Math.round(w * 1e3), dispose: g[E + 24], blend: g[E + 25] };
+ C.frames.push(S);
} else if (a == "fdAT") {
for (var c = 0; c < t - 4; c++)
- n[b + c] = p[E + c + 4];
+ n[b + c] = g[E + c + 4];
b += t - 4;
} else if (a == "pHYs")
- L.tabs[a] = [u.readUint(p, E), u.readUint(p, E + 4), p[E + 8]];
+ C.tabs[a] = [u.readUint(g, E), u.readUint(g, E + 4), g[E + 8]];
else if (a == "cHRM") {
- L.tabs[a] = [];
+ C.tabs[a] = [];
for (var c = 0; c < 8; c++)
- L.tabs[a].push(u.readUint(p, E + c * 4));
+ C.tabs[a].push(u.readUint(g, E + c * 4));
} else if (a == "tEXt") {
- L.tabs[a] == null && (L.tabs[a] = {});
- var T = u.nextZero(p, E), R = u.readASCII(p, E, T - E), z = u.readASCII(p, T + 1, E + t - T - 1);
- L.tabs[a][R] = z;
+ C.tabs[a] == null && (C.tabs[a] = {});
+ var T = u.nextZero(g, E), R = u.readASCII(g, E, T - E), $ = u.readASCII(g, T + 1, E + t - T - 1);
+ C.tabs[a][R] = $;
} else if (a == "iTXt") {
- L.tabs[a] == null && (L.tabs[a] = {});
+ C.tabs[a] == null && (C.tabs[a] = {});
var T = 0, P = E;
- T = u.nextZero(p, P);
- var R = u.readASCII(p, P, T - P);
- P = T + 1, p[P], p[P + 1], P += 2, T = u.nextZero(p, P), u.readASCII(p, P, T - P), P = T + 1, T = u.nextZero(p, P), u.readUTF8(p, P, T - P), P = T + 1;
- var z = u.readUTF8(p, P, t - (P - E));
- L.tabs[a][R] = z;
+ T = u.nextZero(g, P);
+ var R = u.readASCII(g, P, T - P);
+ P = T + 1, g[P], g[P + 1], P += 2, T = u.nextZero(g, P), u.readASCII(g, P, T - P), P = T + 1, T = u.nextZero(g, P), u.readUTF8(g, P, T - P), P = T + 1;
+ var $ = u.readUTF8(g, P, t - (P - E));
+ C.tabs[a][R] = $;
} else if (a == "PLTE")
- L.tabs[a] = u.readBytes(p, E, t);
+ C.tabs[a] = u.readBytes(g, E, t);
else if (a == "hIST") {
- var B = L.tabs.PLTE.length / 3;
- L.tabs[a] = [];
+ var B = C.tabs.PLTE.length / 3;
+ C.tabs[a] = [];
for (var c = 0; c < B; c++)
- L.tabs[a].push(A(p, E + c * 2));
+ C.tabs[a].push(A(g, E + c * 2));
} else if (a == "tRNS")
- L.ctype == 3 ? L.tabs[a] = u.readBytes(p, E, t) : L.ctype == 0 ? L.tabs[a] = A(p, E) : L.ctype == 2 && (L.tabs[a] = [A(p, E), A(p, E + 2), A(p, E + 4)]);
+ C.ctype == 3 ? C.tabs[a] = u.readBytes(g, E, t) : C.ctype == 0 ? C.tabs[a] = A(g, E) : C.ctype == 2 && (C.tabs[a] = [A(g, E), A(g, E + 2), A(g, E + 4)]);
else if (a == "gAMA")
- L.tabs[a] = u.readUint(p, E) / 1e5;
+ C.tabs[a] = u.readUint(g, E) / 1e5;
else if (a == "sRGB")
- L.tabs[a] = p[E];
+ C.tabs[a] = g[E];
else if (a == "bKGD")
- L.ctype == 0 || L.ctype == 4 ? L.tabs[a] = [A(p, E)] : L.ctype == 2 || L.ctype == 6 ? L.tabs[a] = [A(p, E), A(p, E + 2), A(p, E + 4)] : L.ctype == 3 && (L.tabs[a] = p[E]);
+ C.ctype == 0 || C.ctype == 4 ? C.tabs[a] = [A(g, E)] : C.ctype == 2 || C.ctype == 6 ? C.tabs[a] = [A(g, E), A(g, E + 2), A(g, E + 4)] : C.ctype == 3 && (C.tabs[a] = g[E]);
else if (a == "IEND") {
if (b != 0) {
- var h = L.frames[L.frames.length - 1];
- h.data = _.decode._decompress(L, n.slice(0, b), h.rect.width, h.rect.height), b = 0;
+ var h = C.frames[C.frames.length - 1];
+ h.data = _.decode._decompress(C, n.slice(0, b), h.rect.width, h.rect.height), b = 0;
}
- L.data = _.decode._decompress(L, D, L.width, L.height);
+ C.data = _.decode._decompress(C, D, C.width, C.height);
break;
}
- E += t, u.readUint(p, E), E += 4;
+ E += t, u.readUint(g, E), E += 4;
}
- return delete L.compress, delete L.interlace, delete L.filter, L;
- }, _.decode._decompress = function(o, p, E, u) {
- return o.compress == 0 && (p = _.decode._inflate(p)), o.interlace == 0 ? p = _.decode._filterZero(p, o, 0, E, u) : o.interlace == 1 && (p = _.decode._readInterlace(p, o)), p;
+ return delete C.compress, delete C.interlace, delete C.filter, C;
+ }, _.decode._decompress = function(o, g, E, u) {
+ return o.compress == 0 && (g = _.decode._inflate(g)), o.interlace == 0 ? g = _.decode._filterZero(g, o, 0, E, u) : o.interlace == 1 && (g = _.decode._readInterlace(g, o)), g;
}, _.decode._inflate = function(o) {
return x.inflate(o);
- }, _.decode._readInterlace = function(o, p) {
- for (var E = p.width, u = p.height, A = _.decode._getBPP(p), C = A >> 3, L = Math.ceil(E * A / 8), D = new Uint8Array(u * L), r = 0, n = [0, 0, 4, 0, 2, 0, 1], b = [0, 4, 0, 2, 0, 1, 0], f = [8, 8, 8, 4, 4, 2, 2], c = [8, 8, 4, 4, 2, 2, 1], t = 0; t < 7; ) {
+ }, _.decode._readInterlace = function(o, g) {
+ for (var E = g.width, u = g.height, A = _.decode._getBPP(g), L = A >> 3, C = Math.ceil(E * A / 8), D = new Uint8Array(u * C), r = 0, n = [0, 0, 4, 0, 2, 0, 1], b = [0, 4, 0, 2, 0, 1, 0], f = [8, 8, 8, 4, 4, 2, 2], c = [8, 8, 4, 4, 2, 2, 1], t = 0; t < 7; ) {
for (var a = f[t], h = c[t], M = 0, w = 0, S = n[t]; S < u; )
S += a, w++;
for (var T = b[t]; T < E; )
T += h, M++;
var R = Math.ceil(M * A / 8);
- _.decode._filterZero(o, p, r, M, w);
- for (var z = 0, P = n[t]; P < u; ) {
- for (var B = b[t], U = r + z * R << 3; B < E; ) {
+ _.decode._filterZero(o, g, r, M, w);
+ for (var $ = 0, P = n[t]; P < u; ) {
+ for (var B = b[t], F = r + $ * R << 3; B < E; ) {
if (A == 1) {
- var F = o[U >> 3];
- F = F >> 7 - (U & 7) & 1, D[P * L + (B >> 3)] |= F << 7 - ((B & 3) << 0);
+ var U = o[F >> 3];
+ U = U >> 7 - (F & 7) & 1, D[P * C + (B >> 3)] |= U << 7 - ((B & 3) << 0);
}
if (A == 2) {
- var F = o[U >> 3];
- F = F >> 6 - (U & 7) & 3, D[P * L + (B >> 2)] |= F << 6 - ((B & 3) << 1);
+ var U = o[F >> 3];
+ U = U >> 6 - (F & 7) & 3, D[P * C + (B >> 2)] |= U << 6 - ((B & 3) << 1);
}
if (A == 4) {
- var F = o[U >> 3];
- F = F >> 4 - (U & 7) & 15, D[P * L + (B >> 1)] |= F << 4 - ((B & 1) << 2);
+ var U = o[F >> 3];
+ U = U >> 4 - (F & 7) & 15, D[P * C + (B >> 1)] |= U << 4 - ((B & 1) << 2);
}
if (A >= 8)
- for (var $ = P * L + B * C, W = 0; W < C; W++)
- D[$ + W] = o[(U >> 3) + W];
- U += A, B += h;
+ for (var z = P * C + B * L, W = 0; W < L; W++)
+ D[z + W] = o[(F >> 3) + W];
+ F += A, B += h;
}
- z++, P += a;
+ $++, P += a;
}
M * w != 0 && (r += w * (1 + R)), t = t + 1;
}
return D;
}, _.decode._getBPP = function(o) {
- var p = [1, null, 3, 1, 2, null, 4][o.ctype];
- return p * o.depth;
- }, _.decode._filterZero = function(o, p, E, u, A) {
- var C = _.decode._getBPP(p), L = Math.ceil(u * C / 8), D = _.decode._paeth;
- C = Math.ceil(C / 8);
+ var g = [1, null, 3, 1, 2, null, 4][o.ctype];
+ return g * o.depth;
+ }, _.decode._filterZero = function(o, g, E, u, A) {
+ var L = _.decode._getBPP(g), C = Math.ceil(u * L / 8), D = _.decode._paeth;
+ L = Math.ceil(L / 8);
for (var r = 0; r < A; r++) {
- var n = E + r * L, b = n + r + 1, f = o[b - 1];
+ var n = E + r * C, b = n + r + 1, f = o[b - 1];
if (f == 0)
- for (var c = 0; c < L; c++)
+ for (var c = 0; c < C; c++)
o[n + c] = o[b + c];
else if (f == 1) {
- for (var c = 0; c < C; c++)
+ for (var c = 0; c < L; c++)
o[n + c] = o[b + c];
- for (var c = C; c < L; c++)
- o[n + c] = o[b + c] + o[n + c - C] & 255;
+ for (var c = L; c < C; c++)
+ o[n + c] = o[b + c] + o[n + c - L] & 255;
} else if (r == 0) {
- for (var c = 0; c < C; c++)
+ for (var c = 0; c < L; c++)
o[n + c] = o[b + c];
if (f == 2)
- for (var c = C; c < L; c++)
+ for (var c = L; c < C; c++)
o[n + c] = o[b + c] & 255;
if (f == 3)
- for (var c = C; c < L; c++)
- o[n + c] = o[b + c] + (o[n + c - C] >> 1) & 255;
+ for (var c = L; c < C; c++)
+ o[n + c] = o[b + c] + (o[n + c - L] >> 1) & 255;
if (f == 4)
- for (var c = C; c < L; c++)
- o[n + c] = o[b + c] + D(o[n + c - C], 0, 0) & 255;
+ for (var c = L; c < C; c++)
+ o[n + c] = o[b + c] + D(o[n + c - L], 0, 0) & 255;
} else {
if (f == 2)
- for (var c = 0; c < L; c++)
- o[n + c] = o[b + c] + o[n + c - L] & 255;
- if (f == 3) {
for (var c = 0; c < C; c++)
- o[n + c] = o[b + c] + (o[n + c - L] >> 1) & 255;
- for (var c = C; c < L; c++)
- o[n + c] = o[b + c] + (o[n + c - L] + o[n + c - C] >> 1) & 255;
+ o[n + c] = o[b + c] + o[n + c - C] & 255;
+ if (f == 3) {
+ for (var c = 0; c < L; c++)
+ o[n + c] = o[b + c] + (o[n + c - C] >> 1) & 255;
+ for (var c = L; c < C; c++)
+ o[n + c] = o[b + c] + (o[n + c - C] + o[n + c - L] >> 1) & 255;
}
if (f == 4) {
- for (var c = 0; c < C; c++)
- o[n + c] = o[b + c] + D(0, o[n + c - L], 0) & 255;
- for (var c = C; c < L; c++)
- o[n + c] = o[b + c] + D(o[n + c - C], o[n + c - L], o[n + c - C - L]) & 255;
+ for (var c = 0; c < L; c++)
+ o[n + c] = o[b + c] + D(0, o[n + c - C], 0) & 255;
+ for (var c = L; c < C; c++)
+ o[n + c] = o[b + c] + D(o[n + c - L], o[n + c - C], o[n + c - L - C]) & 255;
}
}
}
return o;
- }, _.decode._paeth = function(o, p, E) {
- var u = o + p - E, A = Math.abs(u - o), C = Math.abs(u - p), L = Math.abs(u - E);
- return A <= C && A <= L ? o : C <= L ? p : E;
- }, _.decode._IHDR = function(o, p, E) {
+ }, _.decode._paeth = function(o, g, E) {
+ var u = o + g - E, A = Math.abs(u - o), L = Math.abs(u - g), C = Math.abs(u - E);
+ return A <= L && A <= C ? o : L <= C ? g : E;
+ }, _.decode._IHDR = function(o, g, E) {
var u = _._bin;
- E.width = u.readUint(o, p), p += 4, E.height = u.readUint(o, p), p += 4, E.depth = o[p], p++, E.ctype = o[p], p++, E.compress = o[p], p++, E.filter = o[p], p++, E.interlace = o[p], p++;
+ E.width = u.readUint(o, g), g += 4, E.height = u.readUint(o, g), g += 4, E.depth = o[g], g++, E.ctype = o[g], g++, E.compress = o[g], g++, E.filter = o[g], g++, E.interlace = o[g], g++;
}, _._bin = {
- nextZero: function(o, p) {
- for (; o[p] != 0; )
- p++;
- return p;
+ nextZero: function(o, g) {
+ for (; o[g] != 0; )
+ g++;
+ return g;
},
- readUshort: function(o, p) {
- return o[p] << 8 | o[p + 1];
+ readUshort: function(o, g) {
+ return o[g] << 8 | o[g + 1];
},
- writeUshort: function(o, p, E) {
- o[p] = E >> 8 & 255, o[p + 1] = E & 255;
+ writeUshort: function(o, g, E) {
+ o[g] = E >> 8 & 255, o[g + 1] = E & 255;
},
- readUint: function(o, p) {
- return o[p] * 16777216 + (o[p + 1] << 16 | o[p + 2] << 8 | o[p + 3]);
+ readUint: function(o, g) {
+ return o[g] * 16777216 + (o[g + 1] << 16 | o[g + 2] << 8 | o[g + 3]);
},
- writeUint: function(o, p, E) {
- o[p] = E >> 24 & 255, o[p + 1] = E >> 16 & 255, o[p + 2] = E >> 8 & 255, o[p + 3] = E & 255;
+ writeUint: function(o, g, E) {
+ o[g] = E >> 24 & 255, o[g + 1] = E >> 16 & 255, o[g + 2] = E >> 8 & 255, o[g + 3] = E & 255;
},
- readASCII: function(o, p, E) {
+ readASCII: function(o, g, E) {
for (var u = "", A = 0; A < E; A++)
- u += String.fromCharCode(o[p + A]);
+ u += String.fromCharCode(o[g + A]);
return u;
},
- writeASCII: function(o, p, E) {
+ writeASCII: function(o, g, E) {
for (var u = 0; u < E.length; u++)
- o[p + u] = E.charCodeAt(u);
+ o[g + u] = E.charCodeAt(u);
},
- readBytes: function(o, p, E) {
+ readBytes: function(o, g, E) {
for (var u = [], A = 0; A < E; A++)
- u.push(o[p + A]);
+ u.push(o[g + A]);
return u;
},
pad: function(o) {
return o.length < 2 ? "0" + o : o;
},
- readUTF8: function(o, p, E) {
- for (var u = "", A, C = 0; C < E; C++)
- u += "%" + _._bin.pad(o[p + C].toString(16));
+ readUTF8: function(o, g, E) {
+ for (var u = "", A, L = 0; L < E; L++)
+ u += "%" + _._bin.pad(o[g + L].toString(16));
try {
A = decodeURIComponent(u);
} catch {
- return _._bin.readASCII(o, p, E);
+ return _._bin.readASCII(o, g, E);
}
return A;
}
- }, _._copyTile = function(o, p, E, u, A, C, L, D, r) {
- for (var n = Math.min(p, A), b = Math.min(E, C), f = 0, c = 0, t = 0; t < b; t++)
+ }, _._copyTile = function(o, g, E, u, A, L, C, D, r) {
+ for (var n = Math.min(g, A), b = Math.min(E, L), f = 0, c = 0, t = 0; t < b; t++)
for (var a = 0; a < n; a++)
- if (L >= 0 && D >= 0 ? (f = t * p + a << 2, c = (D + t) * A + L + a << 2) : (f = (-D + t) * p - L + a << 2, c = t * A + a << 2), r == 0)
+ if (C >= 0 && D >= 0 ? (f = t * g + a << 2, c = (D + t) * A + C + a << 2) : (f = (-D + t) * g - C + a << 2, c = t * A + a << 2), r == 0)
u[c] = o[f], u[c + 1] = o[f + 1], u[c + 2] = o[f + 2], u[c + 3] = o[f + 3];
else if (r == 1) {
- var h = o[f + 3] * 0.00392156862745098, M = o[f] * h, w = o[f + 1] * h, S = o[f + 2] * h, T = u[c + 3] * (1 / 255), R = u[c] * T, z = u[c + 1] * T, P = u[c + 2] * T, B = 1 - h, U = h + T * B, F = U == 0 ? 0 : 1 / U;
- u[c + 3] = 255 * U, u[c + 0] = (M + R * B) * F, u[c + 1] = (w + z * B) * F, u[c + 2] = (S + P * B) * F;
+ var h = o[f + 3] * 0.00392156862745098, M = o[f] * h, w = o[f + 1] * h, S = o[f + 2] * h, T = u[c + 3] * (1 / 255), R = u[c] * T, $ = u[c + 1] * T, P = u[c + 2] * T, B = 1 - h, F = h + T * B, U = F == 0 ? 0 : 1 / F;
+ u[c + 3] = 255 * F, u[c + 0] = (M + R * B) * U, u[c + 1] = (w + $ * B) * U, u[c + 2] = (S + P * B) * U;
} else if (r == 2) {
- var h = o[f + 3], M = o[f], w = o[f + 1], S = o[f + 2], T = u[c + 3], R = u[c], z = u[c + 1], P = u[c + 2];
- h == T && M == R && w == z && S == P ? (u[c] = 0, u[c + 1] = 0, u[c + 2] = 0, u[c + 3] = 0) : (u[c] = M, u[c + 1] = w, u[c + 2] = S, u[c + 3] = h);
+ var h = o[f + 3], M = o[f], w = o[f + 1], S = o[f + 2], T = u[c + 3], R = u[c], $ = u[c + 1], P = u[c + 2];
+ h == T && M == R && w == $ && S == P ? (u[c] = 0, u[c + 1] = 0, u[c + 2] = 0, u[c + 3] = 0) : (u[c] = M, u[c + 1] = w, u[c + 2] = S, u[c + 3] = h);
} else if (r == 3) {
- var h = o[f + 3], M = o[f], w = o[f + 1], S = o[f + 2], T = u[c + 3], R = u[c], z = u[c + 1], P = u[c + 2];
- if (h == T && M == R && w == z && S == P)
+ var h = o[f + 3], M = o[f], w = o[f + 1], S = o[f + 2], T = u[c + 3], R = u[c], $ = u[c + 1], P = u[c + 2];
+ if (h == T && M == R && w == $ && S == P)
continue;
if (h < 220 && T > 20)
return !1;
}
return !0;
- }, _.encode = function(o, p, E, u, A, C) {
- u == null && (u = 0), C == null && (C = !1);
- for (var L = new Uint8Array(o[0].byteLength * o.length + 100), D = [137, 80, 78, 71, 13, 10, 26, 10], r = 0; r < 8; r++)
- L[r] = D[r];
- var n = 8, b = _._bin, f = _.crc.crc, c = b.writeUint, t = b.writeUshort, a = b.writeASCII, h = _.encode.compressPNG(o, p, E, u, C);
- c(L, n, 13), n += 4, a(L, n, "IHDR"), n += 4, c(L, n, p), n += 4, c(L, n, E), n += 4, L[n] = h.depth, n++, L[n] = h.ctype, n++, L[n] = 0, n++, L[n] = 0, n++, L[n] = 0, n++, c(L, n, f(L, n - 17, 17)), n += 4, c(L, n, 1), n += 4, a(L, n, "sRGB"), n += 4, L[n] = 1, n++, c(L, n, f(L, n - 5, 5)), n += 4;
+ }, _.encode = function(o, g, E, u, A, L) {
+ u == null && (u = 0), L == null && (L = !1);
+ for (var C = new Uint8Array(o[0].byteLength * o.length + 100), D = [137, 80, 78, 71, 13, 10, 26, 10], r = 0; r < 8; r++)
+ C[r] = D[r];
+ var n = 8, b = _._bin, f = _.crc.crc, c = b.writeUint, t = b.writeUshort, a = b.writeASCII, h = _.encode.compressPNG(o, g, E, u, L);
+ c(C, n, 13), n += 4, a(C, n, "IHDR"), n += 4, c(C, n, g), n += 4, c(C, n, E), n += 4, C[n] = h.depth, n++, C[n] = h.ctype, n++, C[n] = 0, n++, C[n] = 0, n++, C[n] = 0, n++, c(C, n, f(C, n - 17, 17)), n += 4, c(C, n, 1), n += 4, a(C, n, "sRGB"), n += 4, C[n] = 1, n++, c(C, n, f(C, n - 5, 5)), n += 4;
var M = o.length > 1;
- if (M && (c(L, n, 8), n += 4, a(L, n, "acTL"), n += 4, c(L, n, o.length), n += 4, c(L, n, 0), n += 4, c(L, n, f(L, n - 12, 12)), n += 4), h.ctype == 3) {
+ if (M && (c(C, n, 8), n += 4, a(C, n, "acTL"), n += 4, c(C, n, o.length), n += 4, c(C, n, 0), n += 4, c(C, n, f(C, n - 12, 12)), n += 4), h.ctype == 3) {
var w = h.plte.length;
- c(L, n, w * 3), n += 4, a(L, n, "PLTE"), n += 4;
+ c(C, n, w * 3), n += 4, a(C, n, "PLTE"), n += 4;
for (var r = 0; r < w; r++) {
- var S = r * 3, T = h.plte[r], R = T & 255, z = T >> 8 & 255, P = T >> 16 & 255;
- L[n + S + 0] = R, L[n + S + 1] = z, L[n + S + 2] = P;
+ var S = r * 3, T = h.plte[r], R = T & 255, $ = T >> 8 & 255, P = T >> 16 & 255;
+ C[n + S + 0] = R, C[n + S + 1] = $, C[n + S + 2] = P;
}
- if (n += w * 3, c(L, n, f(L, n - w * 3 - 4, w * 3 + 4)), n += 4, h.gotAlpha) {
- c(L, n, w), n += 4, a(L, n, "tRNS"), n += 4;
+ if (n += w * 3, c(C, n, f(C, n - w * 3 - 4, w * 3 + 4)), n += 4, h.gotAlpha) {
+ c(C, n, w), n += 4, a(C, n, "tRNS"), n += 4;
for (var r = 0; r < w; r++)
- L[n + r] = h.plte[r] >> 24 & 255;
- n += w, c(L, n, f(L, n - w - 4, w + 4)), n += 4;
+ C[n + r] = h.plte[r] >> 24 & 255;
+ n += w, c(C, n, f(C, n - w - 4, w + 4)), n += 4;
}
}
- for (var B = 0, U = 0; U < h.frames.length; U++) {
- var F = h.frames[U];
- M && (c(L, n, 26), n += 4, a(L, n, "fcTL"), n += 4, c(L, n, B++), n += 4, c(L, n, F.rect.width), n += 4, c(L, n, F.rect.height), n += 4, c(L, n, F.rect.x), n += 4, c(L, n, F.rect.y), n += 4, t(L, n, A[U]), n += 2, t(L, n, 1e3), n += 2, L[n] = F.dispose, n++, L[n] = F.blend, n++, c(L, n, f(L, n - 30, 30)), n += 4);
- var $ = F.cimg, w = $.length;
- c(L, n, w + (U == 0 ? 0 : 4)), n += 4;
+ for (var B = 0, F = 0; F < h.frames.length; F++) {
+ var U = h.frames[F];
+ M && (c(C, n, 26), n += 4, a(C, n, "fcTL"), n += 4, c(C, n, B++), n += 4, c(C, n, U.rect.width), n += 4, c(C, n, U.rect.height), n += 4, c(C, n, U.rect.x), n += 4, c(C, n, U.rect.y), n += 4, t(C, n, A[F]), n += 2, t(C, n, 1e3), n += 2, C[n] = U.dispose, n++, C[n] = U.blend, n++, c(C, n, f(C, n - 30, 30)), n += 4);
+ var z = U.cimg, w = z.length;
+ c(C, n, w + (F == 0 ? 0 : 4)), n += 4;
var W = n;
- a(L, n, U == 0 ? "IDAT" : "fdAT"), n += 4, U != 0 && (c(L, n, B++), n += 4);
+ a(C, n, F == 0 ? "IDAT" : "fdAT"), n += 4, F != 0 && (c(C, n, B++), n += 4);
for (var r = 0; r < w; r++)
- L[n + r] = $[r];
- n += w, c(L, n, f(L, W, n - W)), n += 4;
+ C[n + r] = z[r];
+ n += w, c(C, n, f(C, W, n - W)), n += 4;
}
- return c(L, n, 0), n += 4, a(L, n, "IEND"), n += 4, c(L, n, f(L, n - 4, 4)), n += 4, L.buffer.slice(0, n);
- }, _.encode.compressPNG = function(o, p, E, u, A) {
- for (var C = _.encode.compress(o, p, E, u, !1, A), L = 0; L < o.length; L++) {
- var D = C.frames[L];
+ return c(C, n, 0), n += 4, a(C, n, "IEND"), n += 4, c(C, n, f(C, n - 4, 4)), n += 4, C.buffer.slice(0, n);
+ }, _.encode.compressPNG = function(o, g, E, u, A) {
+ for (var L = _.encode.compress(o, g, E, u, !1, A), C = 0; C < o.length; C++) {
+ var D = L.frames[C];
D.rect.width;
var r = D.rect.height, n = D.bpl, b = D.bpp, f = new Uint8Array(r * n + r);
D.cimg = _.encode._filterZero(D.img, r, b, n, f);
}
- return C;
- }, _.encode.compress = function(o, p, E, u, A, C) {
- C == null && (C = !1);
- for (var L = 6, D = 8, r = 4, n = 255, b = 0; b < o.length; b++)
+ return L;
+ }, _.encode.compress = function(o, g, E, u, A, L) {
+ L == null && (L = !1);
+ for (var C = 6, D = 8, r = 4, n = 255, b = 0; b < o.length; b++)
for (var f = new Uint8Array(o[b]), c = f.length, t = 0; t < c; t += 4)
n &= f[t + 3];
var a = n != 255, h = {}, M = [];
@@ -20220,223 +20220,223 @@ ATOM`, h);
for (var b = 0; b < o.length; b++)
for (var T = new Uint32Array(o[b]), c = T.length, t = 0; t < c; t++) {
var S = T[t];
- if ((t < p || S != T[t - 1] && S != T[t - p]) && h[S] == null && (h[S] = M.length, M.push(S), M.length >= 300))
+ if ((t < g || S != T[t - 1] && S != T[t - g]) && h[S] == null && (h[S] = M.length, M.push(S), M.length >= 300))
break;
}
- var R = a ? A : !1, z = M.length;
- z <= 256 && C == !1 && (z <= 2 ? D = 1 : z <= 4 ? D = 2 : z <= 16 ? D = 4 : D = 8, A && (D = 8), a = !0);
+ var R = a ? A : !1, $ = M.length;
+ $ <= 256 && L == !1 && ($ <= 2 ? D = 1 : $ <= 4 ? D = 2 : $ <= 16 ? D = 4 : D = 8, A && (D = 8), a = !0);
for (var P = [], b = 0; b < o.length; b++) {
- var B = new Uint8Array(o[b]), U = new Uint32Array(B.buffer), F = 0, $ = 0, W = p, N = E, G = 0;
+ var B = new Uint8Array(o[b]), F = new Uint32Array(B.buffer), U = 0, z = 0, W = g, V = E, N = 0;
if (b != 0 && !R) {
- for (var k = A || b == 1 || P[P.length - 2].dispose == 2 ? 1 : 2, j = 0, Q = 1e9, ie = 0; ie < k; ie++) {
- for (var oe = new Uint8Array(o[b - 1 - ie]), pe = new Uint32Array(o[b - 1 - ie]), he = p, ue = E, se = -1, ae = -1, we = 0; we < E; we++)
- for (var xe = 0; xe < p; xe++) {
- var t = we * p + xe;
- U[t] != pe[t] && (xe < he && (he = xe), xe > se && (se = xe), we < ue && (ue = we), we > ae && (ae = we));
+ for (var k = A || b == 1 || P[P.length - 2].dispose == 2 ? 1 : 2, G = 0, Q = 1e9, ie = 0; ie < k; ie++) {
+ for (var de = new Uint8Array(o[b - 1 - ie]), ge = new Uint32Array(o[b - 1 - ie]), le = g, oe = E, he = -1, se = -1, xe = 0; xe < E; xe++)
+ for (var ye = 0; ye < g; ye++) {
+ var t = xe * g + ye;
+ F[t] != ge[t] && (ye < le && (le = ye), ye > he && (he = ye), xe < oe && (oe = xe), xe > se && (se = xe));
}
- var Ie = se == -1 ? 1 : (se - he + 1) * (ae - ue + 1);
- Ie < Q && (Q = Ie, j = ie, se == -1 ? (F = $ = 0, W = N = 1) : (F = he, $ = ue, W = se - he + 1, N = ae - ue + 1));
+ var Pe = he == -1 ? 1 : (he - le + 1) * (se - oe + 1);
+ Pe < Q && (Q = Pe, G = ie, he == -1 ? (U = z = 0, W = V = 1) : (U = le, z = oe, W = he - le + 1, V = se - oe + 1));
}
- var oe = new Uint8Array(o[b - 1 - j]);
- j == 1 && (P[P.length - 1].dispose = 2);
- var ve = new Uint8Array(W * N * 4);
- new Uint32Array(ve.buffer), _._copyTile(oe, p, E, ve, W, N, -F, -$, 0), _._copyTile(B, p, E, ve, W, N, -F, -$, 3) ? (_._copyTile(B, p, E, ve, W, N, -F, -$, 2), G = 1) : (_._copyTile(B, p, E, ve, W, N, -F, -$, 0), G = 0), B = ve, U = new Uint32Array(B.buffer);
+ var de = new Uint8Array(o[b - 1 - G]);
+ G == 1 && (P[P.length - 1].dispose = 2);
+ var pe = new Uint8Array(W * V * 4);
+ new Uint32Array(pe.buffer), _._copyTile(de, g, E, pe, W, V, -U, -z, 0), _._copyTile(B, g, E, pe, W, V, -U, -z, 3) ? (_._copyTile(B, g, E, pe, W, V, -U, -z, 2), N = 1) : (_._copyTile(B, g, E, pe, W, V, -U, -z, 0), N = 0), B = pe, F = new Uint32Array(B.buffer);
}
var re = 4 * W;
- if (z <= 256 && C == !1) {
+ if ($ <= 256 && L == !1) {
re = Math.ceil(D * W / 8);
- for (var ve = new Uint8Array(re * N), we = 0; we < N; we++) {
- var t = we * re, Se = we * W;
+ for (var pe = new Uint8Array(re * V), xe = 0; xe < V; xe++) {
+ var t = xe * re, Se = xe * W;
if (D == 8)
- for (var xe = 0; xe < W; xe++)
- ve[t + xe] = h[U[Se + xe]];
+ for (var ye = 0; ye < W; ye++)
+ pe[t + ye] = h[F[Se + ye]];
else if (D == 4)
- for (var xe = 0; xe < W; xe++)
- ve[t + (xe >> 1)] |= h[U[Se + xe]] << 4 - (xe & 1) * 4;
+ for (var ye = 0; ye < W; ye++)
+ pe[t + (ye >> 1)] |= h[F[Se + ye]] << 4 - (ye & 1) * 4;
else if (D == 2)
- for (var xe = 0; xe < W; xe++)
- ve[t + (xe >> 2)] |= h[U[Se + xe]] << 6 - (xe & 3) * 2;
+ for (var ye = 0; ye < W; ye++)
+ pe[t + (ye >> 2)] |= h[F[Se + ye]] << 6 - (ye & 3) * 2;
else if (D == 1)
- for (var xe = 0; xe < W; xe++)
- ve[t + (xe >> 3)] |= h[U[Se + xe]] << 7 - (xe & 7) * 1;
+ for (var ye = 0; ye < W; ye++)
+ pe[t + (ye >> 3)] |= h[F[Se + ye]] << 7 - (ye & 7) * 1;
}
- B = ve, L = 3, r = 1;
+ B = pe, C = 3, r = 1;
} else if (a == !1 && o.length == 1) {
- for (var ve = new Uint8Array(W * N * 3), ze = W * N, t = 0; t < ze; t++) {
- var Ge = t * 3, $e = t * 4;
- ve[Ge] = B[$e], ve[Ge + 1] = B[$e + 1], ve[Ge + 2] = B[$e + 2];
+ for (var pe = new Uint8Array(W * V * 3), ke = W * V, t = 0; t < ke; t++) {
+ var $e = t * 3, ze = t * 4;
+ pe[$e] = B[ze], pe[$e + 1] = B[ze + 1], pe[$e + 2] = B[ze + 2];
}
- B = ve, L = 2, r = 3, re = 3 * W;
+ B = pe, C = 2, r = 3, re = 3 * W;
}
- P.push({ rect: { x: F, y: $, width: W, height: N }, img: B, bpl: re, bpp: r, blend: G, dispose: R ? 1 : 0 });
+ P.push({ rect: { x: U, y: z, width: W, height: V }, img: B, bpl: re, bpp: r, blend: N, dispose: R ? 1 : 0 });
}
- return { ctype: L, depth: D, plte: M, gotAlpha: a, frames: P };
- }, _.encode._filterZero = function(o, p, E, u, A) {
- for (var C = [], L = 0; L < 5; L++)
- if (!(p * u > 5e5 && (L == 2 || L == 3 || L == 4))) {
- for (var D = 0; D < p; D++)
- _.encode._filterLine(A, o, D, u, E, L);
- if (C.push(x.deflate(A)), E == 1)
+ return { ctype: C, depth: D, plte: M, gotAlpha: a, frames: P };
+ }, _.encode._filterZero = function(o, g, E, u, A) {
+ for (var L = [], C = 0; C < 5; C++)
+ if (!(g * u > 5e5 && (C == 2 || C == 3 || C == 4))) {
+ for (var D = 0; D < g; D++)
+ _.encode._filterLine(A, o, D, u, E, C);
+ if (L.push(x.deflate(A)), E == 1)
break;
}
- for (var r, n = 1e9, b = 0; b < C.length; b++)
- C[b].length < n && (r = b, n = C[b].length);
- return C[r];
- }, _.encode._filterLine = function(o, p, E, u, A, C) {
- var L = E * u, D = L + E, r = _.decode._paeth;
- if (o[D] = C, D++, C == 0)
+ for (var r, n = 1e9, b = 0; b < L.length; b++)
+ L[b].length < n && (r = b, n = L[b].length);
+ return L[r];
+ }, _.encode._filterLine = function(o, g, E, u, A, L) {
+ var C = E * u, D = C + E, r = _.decode._paeth;
+ if (o[D] = L, D++, L == 0)
for (var n = 0; n < u; n++)
- o[D + n] = p[L + n];
- else if (C == 1) {
+ o[D + n] = g[C + n];
+ else if (L == 1) {
for (var n = 0; n < A; n++)
- o[D + n] = p[L + n];
+ o[D + n] = g[C + n];
for (var n = A; n < u; n++)
- o[D + n] = p[L + n] - p[L + n - A] + 256 & 255;
+ o[D + n] = g[C + n] - g[C + n - A] + 256 & 255;
} else if (E == 0) {
for (var n = 0; n < A; n++)
- o[D + n] = p[L + n];
- if (C == 2)
+ o[D + n] = g[C + n];
+ if (L == 2)
for (var n = A; n < u; n++)
- o[D + n] = p[L + n];
- if (C == 3)
+ o[D + n] = g[C + n];
+ if (L == 3)
for (var n = A; n < u; n++)
- o[D + n] = p[L + n] - (p[L + n - A] >> 1) + 256 & 255;
- if (C == 4)
+ o[D + n] = g[C + n] - (g[C + n - A] >> 1) + 256 & 255;
+ if (L == 4)
for (var n = A; n < u; n++)
- o[D + n] = p[L + n] - r(p[L + n - A], 0, 0) + 256 & 255;
+ o[D + n] = g[C + n] - r(g[C + n - A], 0, 0) + 256 & 255;
} else {
- if (C == 2)
+ if (L == 2)
for (var n = 0; n < u; n++)
- o[D + n] = p[L + n] + 256 - p[L + n - u] & 255;
- if (C == 3) {
+ o[D + n] = g[C + n] + 256 - g[C + n - u] & 255;
+ if (L == 3) {
for (var n = 0; n < A; n++)
- o[D + n] = p[L + n] + 256 - (p[L + n - u] >> 1) & 255;
+ o[D + n] = g[C + n] + 256 - (g[C + n - u] >> 1) & 255;
for (var n = A; n < u; n++)
- o[D + n] = p[L + n] + 256 - (p[L + n - u] + p[L + n - A] >> 1) & 255;
+ o[D + n] = g[C + n] + 256 - (g[C + n - u] + g[C + n - A] >> 1) & 255;
}
- if (C == 4) {
+ if (L == 4) {
for (var n = 0; n < A; n++)
- o[D + n] = p[L + n] + 256 - r(0, p[L + n - u], 0) & 255;
+ o[D + n] = g[C + n] + 256 - r(0, g[C + n - u], 0) & 255;
for (var n = A; n < u; n++)
- o[D + n] = p[L + n] + 256 - r(p[L + n - A], p[L + n - u], p[L + n - A - u]) & 255;
+ o[D + n] = g[C + n] + 256 - r(g[C + n - A], g[C + n - u], g[C + n - A - u]) & 255;
}
}
}, _.crc = {
table: function() {
- for (var o = new Uint32Array(256), p = 0; p < 256; p++) {
- for (var E = p, u = 0; u < 8; u++)
+ for (var o = new Uint32Array(256), g = 0; g < 256; g++) {
+ for (var E = g, u = 0; u < 8; u++)
E & 1 ? E = 3988292384 ^ E >>> 1 : E = E >>> 1;
- o[p] = E;
+ o[g] = E;
}
return o;
}(),
- update: function(o, p, E, u) {
+ update: function(o, g, E, u) {
for (var A = 0; A < u; A++)
- o = _.crc.table[(o ^ p[E + A]) & 255] ^ o >>> 8;
+ o = _.crc.table[(o ^ g[E + A]) & 255] ^ o >>> 8;
return o;
},
- crc: function(o, p, E) {
- return _.crc.update(4294967295, o, p, E) ^ 4294967295;
+ crc: function(o, g, E) {
+ return _.crc.update(4294967295, o, g, E) ^ 4294967295;
}
- }, _.quantize = function(o, p, E) {
- for (var u = [], A = 0, C = 0; C < o.length; C++)
- u.push(_.encode.alphaMul(new Uint8Array(o[C]), E)), A += o[C].byteLength;
- for (var L = new Uint8Array(A), D = new Uint32Array(L.buffer), r = 0, C = 0; C < u.length; C++) {
- for (var n = u[C], b = n.length, f = 0; f < b; f++)
- L[r + f] = n[f];
+ }, _.quantize = function(o, g, E) {
+ for (var u = [], A = 0, L = 0; L < o.length; L++)
+ u.push(_.encode.alphaMul(new Uint8Array(o[L]), E)), A += o[L].byteLength;
+ for (var C = new Uint8Array(A), D = new Uint32Array(C.buffer), r = 0, L = 0; L < u.length; L++) {
+ for (var n = u[L], b = n.length, f = 0; f < b; f++)
+ C[r + f] = n[f];
r += b;
}
- var c = { i0: 0, i1: L.length, bst: null, est: null, tdst: 0, left: null, right: null };
- c.bst = _.quantize.stats(L, c.i0, c.i1), c.est = _.quantize.estats(c.bst);
- for (var t = [c]; t.length < p; ) {
- for (var a = 0, h = 0, C = 0; C < t.length; C++)
- t[C].est.L > a && (a = t[C].est.L, h = C);
+ var c = { i0: 0, i1: C.length, bst: null, est: null, tdst: 0, left: null, right: null };
+ c.bst = _.quantize.stats(C, c.i0, c.i1), c.est = _.quantize.estats(c.bst);
+ for (var t = [c]; t.length < g; ) {
+ for (var a = 0, h = 0, L = 0; L < t.length; L++)
+ t[L].est.L > a && (a = t[L].est.L, h = L);
if (a < 1e-3)
break;
- var M = t[h], w = _.quantize.splitPixels(L, D, M.i0, M.i1, M.est.e, M.est.eMq255), S = { i0: M.i0, i1: w, bst: null, est: null, tdst: 0, left: null, right: null };
- S.bst = _.quantize.stats(L, S.i0, S.i1), S.est = _.quantize.estats(S.bst);
+ var M = t[h], w = _.quantize.splitPixels(C, D, M.i0, M.i1, M.est.e, M.est.eMq255), S = { i0: M.i0, i1: w, bst: null, est: null, tdst: 0, left: null, right: null };
+ S.bst = _.quantize.stats(C, S.i0, S.i1), S.est = _.quantize.estats(S.bst);
var T = { i0: w, i1: M.i1, bst: null, est: null, tdst: 0, left: null, right: null };
T.bst = { R: [], m: [], N: M.bst.N - S.bst.N };
- for (var C = 0; C < 16; C++)
- T.bst.R[C] = M.bst.R[C] - S.bst.R[C];
- for (var C = 0; C < 4; C++)
- T.bst.m[C] = M.bst.m[C] - S.bst.m[C];
+ for (var L = 0; L < 16; L++)
+ T.bst.R[L] = M.bst.R[L] - S.bst.R[L];
+ for (var L = 0; L < 4; L++)
+ T.bst.m[L] = M.bst.m[L] - S.bst.m[L];
T.est = _.quantize.estats(T.bst), M.left = S, M.right = T, t[h] = S, t.push(T);
}
- t.sort(function(k, j) {
- return j.bst.N - k.bst.N;
+ t.sort(function(k, G) {
+ return G.bst.N - k.bst.N;
});
for (var R = 0; R < u.length; R++) {
- for (var z = _.quantize.planeDst, P = new Uint8Array(u[R].buffer), B = new Uint32Array(u[R].buffer), U = P.length, C = 0; C < U; C += 4) {
- for (var F = P[C] * 0.00392156862745098, $ = P[C + 1] * (1 / 255), W = P[C + 2] * (1 / 255), N = P[C + 3] * (1 / 255), G = c; G.left; )
- G = z(G.est, F, $, W, N) <= 0 ? G.left : G.right;
- B[C >> 2] = G.est.rgba;
+ for (var $ = _.quantize.planeDst, P = new Uint8Array(u[R].buffer), B = new Uint32Array(u[R].buffer), F = P.length, L = 0; L < F; L += 4) {
+ for (var U = P[L] * 0.00392156862745098, z = P[L + 1] * (1 / 255), W = P[L + 2] * (1 / 255), V = P[L + 3] * (1 / 255), N = c; N.left; )
+ N = $(N.est, U, z, W, V) <= 0 ? N.left : N.right;
+ B[L >> 2] = N.est.rgba;
}
u[R] = B.buffer;
}
return { bufs: u, plte: t };
- }, _.quantize.getNearest = function(o, p, E, u, A) {
+ }, _.quantize.getNearest = function(o, g, E, u, A) {
if (o.left == null)
- return o.tdst = _.quantize.dist(o.est.q, p, E, u, A), o;
- var C = _.quantize.planeDst(o.est, p, E, u, A), L = o.left, D = o.right;
- C > 0 && (L = o.right, D = o.left);
- var r = _.quantize.getNearest(L, p, E, u, A);
- if (r.tdst <= C * C)
+ return o.tdst = _.quantize.dist(o.est.q, g, E, u, A), o;
+ var L = _.quantize.planeDst(o.est, g, E, u, A), C = o.left, D = o.right;
+ L > 0 && (C = o.right, D = o.left);
+ var r = _.quantize.getNearest(C, g, E, u, A);
+ if (r.tdst <= L * L)
return r;
- var n = _.quantize.getNearest(D, p, E, u, A);
+ var n = _.quantize.getNearest(D, g, E, u, A);
return n.tdst < r.tdst ? n : r;
- }, _.quantize.planeDst = function(o, p, E, u, A) {
- var C = o.e;
- return C[0] * p + C[1] * E + C[2] * u + C[3] * A - o.eMq;
- }, _.quantize.dist = function(o, p, E, u, A) {
- var C = p - o[0], L = E - o[1], D = u - o[2], r = A - o[3];
- return C * C + L * L + D * D + r * r;
- }, _.quantize.splitPixels = function(o, p, E, u, A, C) {
- var L = _.quantize.vecDot;
+ }, _.quantize.planeDst = function(o, g, E, u, A) {
+ var L = o.e;
+ return L[0] * g + L[1] * E + L[2] * u + L[3] * A - o.eMq;
+ }, _.quantize.dist = function(o, g, E, u, A) {
+ var L = g - o[0], C = E - o[1], D = u - o[2], r = A - o[3];
+ return L * L + C * C + D * D + r * r;
+ }, _.quantize.splitPixels = function(o, g, E, u, A, L) {
+ var C = _.quantize.vecDot;
for (u -= 4; E < u; ) {
- for (; L(o, E, A) <= C; )
+ for (; C(o, E, A) <= L; )
E += 4;
- for (; L(o, u, A) > C; )
+ for (; C(o, u, A) > L; )
u -= 4;
if (E >= u)
break;
- var D = p[E >> 2];
- p[E >> 2] = p[u >> 2], p[u >> 2] = D, E += 4, u -= 4;
+ var D = g[E >> 2];
+ g[E >> 2] = g[u >> 2], g[u >> 2] = D, E += 4, u -= 4;
}
- for (; L(o, E, A) > C; )
+ for (; C(o, E, A) > L; )
E -= 4;
return E + 4;
- }, _.quantize.vecDot = function(o, p, E) {
- return o[p] * E[0] + o[p + 1] * E[1] + o[p + 2] * E[2] + o[p + 3] * E[3];
- }, _.quantize.stats = function(o, p, E) {
- for (var u = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], A = [0, 0, 0, 0], C = E - p >> 2, L = p; L < E; L += 4) {
- var D = o[L] * 0.00392156862745098, r = o[L + 1] * (1 / 255), n = o[L + 2] * (1 / 255), b = o[L + 3] * (1 / 255);
+ }, _.quantize.vecDot = function(o, g, E) {
+ return o[g] * E[0] + o[g + 1] * E[1] + o[g + 2] * E[2] + o[g + 3] * E[3];
+ }, _.quantize.stats = function(o, g, E) {
+ for (var u = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0], A = [0, 0, 0, 0], L = E - g >> 2, C = g; C < E; C += 4) {
+ var D = o[C] * 0.00392156862745098, r = o[C + 1] * (1 / 255), n = o[C + 2] * (1 / 255), b = o[C + 3] * (1 / 255);
A[0] += D, A[1] += r, A[2] += n, A[3] += b, u[0] += D * D, u[1] += D * r, u[2] += D * n, u[3] += D * b, u[5] += r * r, u[6] += r * n, u[7] += r * b, u[10] += n * n, u[11] += n * b, u[15] += b * b;
}
- return u[4] = u[1], u[8] = u[2], u[12] = u[3], u[9] = u[6], u[13] = u[7], u[14] = u[11], { R: u, m: A, N: C };
+ return u[4] = u[1], u[8] = u[2], u[12] = u[3], u[9] = u[6], u[13] = u[7], u[14] = u[11], { R: u, m: A, N: L };
}, _.quantize.estats = function(o) {
- var p = o.R, E = o.m, u = o.N, A = E[0], C = E[1], L = E[2], D = E[3], r = u == 0 ? 0 : 1 / u, n = [
- p[0] - A * A * r,
- p[1] - A * C * r,
- p[2] - A * L * r,
- p[3] - A * D * r,
- p[4] - C * A * r,
- p[5] - C * C * r,
- p[6] - C * L * r,
- p[7] - C * D * r,
- p[8] - L * A * r,
- p[9] - L * C * r,
- p[10] - L * L * r,
- p[11] - L * D * r,
- p[12] - D * A * r,
- p[13] - D * C * r,
- p[14] - D * L * r,
- p[15] - D * D * r
+ var g = o.R, E = o.m, u = o.N, A = E[0], L = E[1], C = E[2], D = E[3], r = u == 0 ? 0 : 1 / u, n = [
+ g[0] - A * A * r,
+ g[1] - A * L * r,
+ g[2] - A * C * r,
+ g[3] - A * D * r,
+ g[4] - L * A * r,
+ g[5] - L * L * r,
+ g[6] - L * C * r,
+ g[7] - L * D * r,
+ g[8] - C * A * r,
+ g[9] - C * L * r,
+ g[10] - C * C * r,
+ g[11] - C * D * r,
+ g[12] - D * A * r,
+ g[13] - D * L * r,
+ g[14] - D * C * r,
+ g[15] - D * D * r
], b = n, f = _.M4, c = [0.5, 0.5, 0.5, 0.5], t = 0, a = 0;
if (u != 0)
for (var h = 0; h < 10 && (c = f.multVec(b, c), a = Math.sqrt(f.dot(c, c)), c = f.sml(1 / a, c), !(Math.abs(a - t) < 1e-9)); h++)
t = a;
- var M = [A * r, C * r, L * r, D * r], w = f.dot(f.sml(255, M), c), S = M[3] < 1e-3 ? 0 : 1 / M[3];
+ var M = [A * r, L * r, C * r, D * r], w = f.dot(f.sml(255, M), c), S = M[3] < 1e-3 ? 0 : 1 / M[3];
return {
Cov: n,
q: M,
@@ -20447,30 +20447,30 @@ ATOM`, h);
rgba: (Math.round(255 * M[3]) << 24 | Math.round(255 * M[2] * S) << 16 | Math.round(255 * M[1] * S) << 8 | Math.round(255 * M[0] * S) << 0) >>> 0
};
}, _.M4 = {
- multVec: function(o, p) {
+ multVec: function(o, g) {
return [
- o[0] * p[0] + o[1] * p[1] + o[2] * p[2] + o[3] * p[3],
- o[4] * p[0] + o[5] * p[1] + o[6] * p[2] + o[7] * p[3],
- o[8] * p[0] + o[9] * p[1] + o[10] * p[2] + o[11] * p[3],
- o[12] * p[0] + o[13] * p[1] + o[14] * p[2] + o[15] * p[3]
+ o[0] * g[0] + o[1] * g[1] + o[2] * g[2] + o[3] * g[3],
+ o[4] * g[0] + o[5] * g[1] + o[6] * g[2] + o[7] * g[3],
+ o[8] * g[0] + o[9] * g[1] + o[10] * g[2] + o[11] * g[3],
+ o[12] * g[0] + o[13] * g[1] + o[14] * g[2] + o[15] * g[3]
];
},
- dot: function(o, p) {
- return o[0] * p[0] + o[1] * p[1] + o[2] * p[2] + o[3] * p[3];
+ dot: function(o, g) {
+ return o[0] * g[0] + o[1] * g[1] + o[2] * g[2] + o[3] * g[3];
},
- sml: function(o, p) {
- return [o * p[0], o * p[1], o * p[2], o * p[3]];
+ sml: function(o, g) {
+ return [o * g[0], o * g[1], o * g[2], o * g[3]];
}
- }, _.encode.alphaMul = function(o, p) {
+ }, _.encode.alphaMul = function(o, g) {
for (var E = new Uint8Array(o.length), u = o.length >> 2, A = 0; A < u; A++) {
- var C = A << 2, L = o[C + 3];
- p && (L = L < 128 ? 0 : 255);
- var D = L * (1 / 255);
- E[C + 0] = o[C + 0] * D, E[C + 1] = o[C + 1] * D, E[C + 2] = o[C + 2] * D, E[C + 3] = L;
+ var L = A << 2, C = o[L + 3];
+ g && (C = C < 128 ? 0 : 255);
+ var D = C * (1 / 255);
+ E[L + 0] = o[L + 0] * D, E[L + 1] = o[L + 1] * D, E[L + 2] = o[L + 2] * D, E[L + 3] = C;
}
return E;
};
- }(l, g);
+ }(l, p);
})();
}
),
@@ -20484,7 +20484,7 @@ ATOM`, h);
var l = e(
/*! ./lib/utils/common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
- ).assign, g = e(
+ ).assign, p = e(
/*! ./lib/deflate */
"./node_modules/upng-js/node_modules/pako/lib/deflate.js"
), _ = e(
@@ -20494,7 +20494,7 @@ ATOM`, h);
/*! ./lib/zlib/constants */
"./node_modules/upng-js/node_modules/pako/lib/zlib/constants.js"
), o = {};
- l(o, g, _, x), y.exports = o;
+ l(o, p, _, x), y.exports = o;
}
),
/***/
@@ -20507,7 +20507,7 @@ ATOM`, h);
var l = e(
/*! ./zlib/deflate */
"./node_modules/upng-js/node_modules/pako/lib/zlib/deflate.js"
- ), g = e(
+ ), p = e(
/*! ./utils/common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
), _ = e(
@@ -20519,11 +20519,11 @@ ATOM`, h);
), o = e(
/*! ./zlib/zstream */
"./node_modules/upng-js/node_modules/pako/lib/zlib/zstream.js"
- ), p = Object.prototype.toString, E = 0, u = 4, A = 0, C = 1, L = 2, D = -1, r = 0, n = 8;
+ ), g = Object.prototype.toString, E = 0, u = 4, A = 0, L = 1, C = 2, D = -1, r = 0, n = 8;
function b(a) {
if (!(this instanceof b))
return new b(a);
- this.options = g.assign({
+ this.options = p.assign({
level: D,
method: n,
chunkSize: 16384,
@@ -20546,7 +20546,7 @@ ATOM`, h);
throw new Error(x[M]);
if (h.header && l.deflateSetHeader(this.strm, h.header), h.dictionary) {
var w;
- if (typeof h.dictionary == "string" ? w = _.string2buf(h.dictionary) : p.call(h.dictionary) === "[object ArrayBuffer]" ? w = new Uint8Array(h.dictionary) : w = h.dictionary, M = l.deflateSetDictionary(this.strm, w), M !== A)
+ if (typeof h.dictionary == "string" ? w = _.string2buf(h.dictionary) : g.call(h.dictionary) === "[object ArrayBuffer]" ? w = new Uint8Array(h.dictionary) : w = h.dictionary, M = l.deflateSetDictionary(this.strm, w), M !== A)
throw new Error(x[M]);
this._dict_set = !0;
}
@@ -20555,17 +20555,17 @@ ATOM`, h);
var M = this.strm, w = this.options.chunkSize, S, T;
if (this.ended)
return !1;
- T = h === ~~h ? h : h === !0 ? u : E, typeof a == "string" ? M.input = _.string2buf(a) : p.call(a) === "[object ArrayBuffer]" ? M.input = new Uint8Array(a) : M.input = a, M.next_in = 0, M.avail_in = M.input.length;
+ T = h === ~~h ? h : h === !0 ? u : E, typeof a == "string" ? M.input = _.string2buf(a) : g.call(a) === "[object ArrayBuffer]" ? M.input = new Uint8Array(a) : M.input = a, M.next_in = 0, M.avail_in = M.input.length;
do {
- if (M.avail_out === 0 && (M.output = new g.Buf8(w), M.next_out = 0, M.avail_out = w), S = l.deflate(M, T), S !== C && S !== A)
+ if (M.avail_out === 0 && (M.output = new p.Buf8(w), M.next_out = 0, M.avail_out = w), S = l.deflate(M, T), S !== L && S !== A)
return this.onEnd(S), this.ended = !0, !1;
- (M.avail_out === 0 || M.avail_in === 0 && (T === u || T === L)) && (this.options.to === "string" ? this.onData(_.buf2binstring(g.shrinkBuf(M.output, M.next_out))) : this.onData(g.shrinkBuf(M.output, M.next_out)));
- } while ((M.avail_in > 0 || M.avail_out === 0) && S !== C);
- return T === u ? (S = l.deflateEnd(this.strm), this.onEnd(S), this.ended = !0, S === A) : (T === L && (this.onEnd(A), M.avail_out = 0), !0);
+ (M.avail_out === 0 || M.avail_in === 0 && (T === u || T === C)) && (this.options.to === "string" ? this.onData(_.buf2binstring(p.shrinkBuf(M.output, M.next_out))) : this.onData(p.shrinkBuf(M.output, M.next_out)));
+ } while ((M.avail_in > 0 || M.avail_out === 0) && S !== L);
+ return T === u ? (S = l.deflateEnd(this.strm), this.onEnd(S), this.ended = !0, S === A) : (T === C && (this.onEnd(A), M.avail_out = 0), !0);
}, b.prototype.onData = function(a) {
this.chunks.push(a);
}, b.prototype.onEnd = function(a) {
- a === A && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = g.flattenChunks(this.chunks)), this.chunks = [], this.err = a, this.msg = this.strm.msg;
+ a === A && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = p.flattenChunks(this.chunks)), this.chunks = [], this.err = a, this.msg = this.strm.msg;
};
function f(a, h) {
var M = new b(h);
@@ -20592,7 +20592,7 @@ ATOM`, h);
var l = e(
/*! ./zlib/inflate */
"./node_modules/upng-js/node_modules/pako/lib/zlib/inflate.js"
- ), g = e(
+ ), p = e(
/*! ./utils/common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
), _ = e(
@@ -20604,7 +20604,7 @@ ATOM`, h);
), o = e(
/*! ./zlib/messages */
"./node_modules/upng-js/node_modules/pako/lib/zlib/messages.js"
- ), p = e(
+ ), g = e(
/*! ./zlib/zstream */
"./node_modules/upng-js/node_modules/pako/lib/zlib/zstream.js"
), E = e(
@@ -20614,13 +20614,13 @@ ATOM`, h);
function A(D) {
if (!(this instanceof A))
return new A(D);
- this.options = g.assign({
+ this.options = p.assign({
chunkSize: 16384,
windowBits: 0,
to: ""
}, D || {});
var r = this.options;
- r.raw && r.windowBits >= 0 && r.windowBits < 16 && (r.windowBits = -r.windowBits, r.windowBits === 0 && (r.windowBits = -15)), r.windowBits >= 0 && r.windowBits < 16 && !(D && D.windowBits) && (r.windowBits += 32), r.windowBits > 15 && r.windowBits < 48 && (r.windowBits & 15 || (r.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new p(), this.strm.avail_out = 0;
+ r.raw && r.windowBits >= 0 && r.windowBits < 16 && (r.windowBits = -r.windowBits, r.windowBits === 0 && (r.windowBits = -15)), r.windowBits >= 0 && r.windowBits < 16 && !(D && D.windowBits) && (r.windowBits += 32), r.windowBits > 15 && r.windowBits < 48 && (r.windowBits & 15 || (r.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new g(), this.strm.avail_out = 0;
var n = l.inflateInit2(
this.strm,
r.windowBits
@@ -20636,26 +20636,26 @@ ATOM`, h);
return !1;
t = r === ~~r ? r : r === !0 ? x.Z_FINISH : x.Z_NO_FLUSH, typeof D == "string" ? n.input = _.binstring2buf(D) : u.call(D) === "[object ArrayBuffer]" ? n.input = new Uint8Array(D) : n.input = D, n.next_in = 0, n.avail_in = n.input.length;
do {
- if (n.avail_out === 0 && (n.output = new g.Buf8(b), n.next_out = 0, n.avail_out = b), c = l.inflate(n, x.Z_NO_FLUSH), c === x.Z_NEED_DICT && f && (c = l.inflateSetDictionary(this.strm, f)), c === x.Z_BUF_ERROR && w === !0 && (c = x.Z_OK, w = !1), c !== x.Z_STREAM_END && c !== x.Z_OK)
+ if (n.avail_out === 0 && (n.output = new p.Buf8(b), n.next_out = 0, n.avail_out = b), c = l.inflate(n, x.Z_NO_FLUSH), c === x.Z_NEED_DICT && f && (c = l.inflateSetDictionary(this.strm, f)), c === x.Z_BUF_ERROR && w === !0 && (c = x.Z_OK, w = !1), c !== x.Z_STREAM_END && c !== x.Z_OK)
return this.onEnd(c), this.ended = !0, !1;
- n.next_out && (n.avail_out === 0 || c === x.Z_STREAM_END || n.avail_in === 0 && (t === x.Z_FINISH || t === x.Z_SYNC_FLUSH)) && (this.options.to === "string" ? (a = _.utf8border(n.output, n.next_out), h = n.next_out - a, M = _.buf2string(n.output, a), n.next_out = h, n.avail_out = b - h, h && g.arraySet(n.output, n.output, a, h, 0), this.onData(M)) : this.onData(g.shrinkBuf(n.output, n.next_out))), n.avail_in === 0 && n.avail_out === 0 && (w = !0);
+ n.next_out && (n.avail_out === 0 || c === x.Z_STREAM_END || n.avail_in === 0 && (t === x.Z_FINISH || t === x.Z_SYNC_FLUSH)) && (this.options.to === "string" ? (a = _.utf8border(n.output, n.next_out), h = n.next_out - a, M = _.buf2string(n.output, a), n.next_out = h, n.avail_out = b - h, h && p.arraySet(n.output, n.output, a, h, 0), this.onData(M)) : this.onData(p.shrinkBuf(n.output, n.next_out))), n.avail_in === 0 && n.avail_out === 0 && (w = !0);
} while ((n.avail_in > 0 || n.avail_out === 0) && c !== x.Z_STREAM_END);
return c === x.Z_STREAM_END && (t = x.Z_FINISH), t === x.Z_FINISH ? (c = l.inflateEnd(this.strm), this.onEnd(c), this.ended = !0, c === x.Z_OK) : (t === x.Z_SYNC_FLUSH && (this.onEnd(x.Z_OK), n.avail_out = 0), !0);
}, A.prototype.onData = function(D) {
this.chunks.push(D);
}, A.prototype.onEnd = function(D) {
- D === x.Z_OK && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = g.flattenChunks(this.chunks)), this.chunks = [], this.err = D, this.msg = this.strm.msg;
+ D === x.Z_OK && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = p.flattenChunks(this.chunks)), this.chunks = [], this.err = D, this.msg = this.strm.msg;
};
- function C(D, r) {
+ function L(D, r) {
var n = new A(r);
if (n.push(D, !0), n.err)
throw n.msg || o[n.err];
return n.result;
}
- function L(D, r) {
- return r = r || {}, r.raw = !0, C(D, r);
+ function C(D, r) {
+ return r = r || {}, r.raw = !0, L(D, r);
}
- s.Inflate = A, s.inflate = C, s.inflateRaw = L, s.ungzip = C;
+ s.Inflate = A, s.inflate = L, s.inflateRaw = C, s.ungzip = L;
}
),
/***/
@@ -20671,40 +20671,40 @@ ATOM`, h);
}
s.assign = function(x) {
for (var o = Array.prototype.slice.call(arguments, 1); o.length; ) {
- var p = o.shift();
- if (p) {
- if (typeof p != "object")
- throw new TypeError(p + "must be non-object");
- for (var E in p)
- l(p, E) && (x[E] = p[E]);
+ var g = o.shift();
+ if (g) {
+ if (typeof g != "object")
+ throw new TypeError(g + "must be non-object");
+ for (var E in g)
+ l(g, E) && (x[E] = g[E]);
}
}
return x;
}, s.shrinkBuf = function(x, o) {
return x.length === o ? x : x.subarray ? x.subarray(0, o) : (x.length = o, x);
};
- var g = {
- arraySet: function(x, o, p, E, u) {
+ var p = {
+ arraySet: function(x, o, g, E, u) {
if (o.subarray && x.subarray) {
- x.set(o.subarray(p, p + E), u);
+ x.set(o.subarray(g, g + E), u);
return;
}
for (var A = 0; A < E; A++)
- x[u + A] = o[p + A];
+ x[u + A] = o[g + A];
},
// Join array of chunks to single array.
flattenChunks: function(x) {
- var o, p, E, u, A, C;
- for (E = 0, o = 0, p = x.length; o < p; o++)
+ var o, g, E, u, A, L;
+ for (E = 0, o = 0, g = x.length; o < g; o++)
E += x[o].length;
- for (C = new Uint8Array(E), u = 0, o = 0, p = x.length; o < p; o++)
- A = x[o], C.set(A, u), u += A.length;
- return C;
+ for (L = new Uint8Array(E), u = 0, o = 0, g = x.length; o < g; o++)
+ A = x[o], L.set(A, u), u += A.length;
+ return L;
}
}, _ = {
- arraySet: function(x, o, p, E, u) {
+ arraySet: function(x, o, g, E, u) {
for (var A = 0; A < E; A++)
- x[u + A] = o[p + A];
+ x[u + A] = o[g + A];
},
// Join array of chunks to single array.
flattenChunks: function(x) {
@@ -20712,7 +20712,7 @@ ATOM`, h);
}
};
s.setTyped = function(x) {
- x ? (s.Buf8 = Uint8Array, s.Buf16 = Uint16Array, s.Buf32 = Int32Array, s.assign(s, g)) : (s.Buf8 = Array, s.Buf16 = Array, s.Buf32 = Array, s.assign(s, _));
+ x ? (s.Buf8 = Uint8Array, s.Buf16 = Uint16Array, s.Buf32 = Int32Array, s.assign(s, p)) : (s.Buf8 = Array, s.Buf16 = Array, s.Buf32 = Array, s.assign(s, _));
}, s.setTyped(e);
}
),
@@ -20726,11 +20726,11 @@ ATOM`, h);
var l = e(
/*! ./common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
- ), g = !0, _ = !0;
+ ), p = !0, _ = !0;
try {
String.fromCharCode.apply(null, [0]);
} catch {
- g = !1;
+ p = !1;
}
try {
String.fromCharCode.apply(null, new Uint8Array(1));
@@ -20740,46 +20740,46 @@ ATOM`, h);
for (var x = new l.Buf8(256), o = 0; o < 256; o++)
x[o] = o >= 252 ? 6 : o >= 248 ? 5 : o >= 240 ? 4 : o >= 224 ? 3 : o >= 192 ? 2 : 1;
x[254] = x[254] = 1, s.string2buf = function(E) {
- var u, A, C, L, D, r = E.length, n = 0;
- for (L = 0; L < r; L++)
- A = E.charCodeAt(L), (A & 64512) === 55296 && L + 1 < r && (C = E.charCodeAt(L + 1), (C & 64512) === 56320 && (A = 65536 + (A - 55296 << 10) + (C - 56320), L++)), n += A < 128 ? 1 : A < 2048 ? 2 : A < 65536 ? 3 : 4;
- for (u = new l.Buf8(n), D = 0, L = 0; D < n; L++)
- A = E.charCodeAt(L), (A & 64512) === 55296 && L + 1 < r && (C = E.charCodeAt(L + 1), (C & 64512) === 56320 && (A = 65536 + (A - 55296 << 10) + (C - 56320), L++)), A < 128 ? u[D++] = A : A < 2048 ? (u[D++] = 192 | A >>> 6, u[D++] = 128 | A & 63) : A < 65536 ? (u[D++] = 224 | A >>> 12, u[D++] = 128 | A >>> 6 & 63, u[D++] = 128 | A & 63) : (u[D++] = 240 | A >>> 18, u[D++] = 128 | A >>> 12 & 63, u[D++] = 128 | A >>> 6 & 63, u[D++] = 128 | A & 63);
+ var u, A, L, C, D, r = E.length, n = 0;
+ for (C = 0; C < r; C++)
+ A = E.charCodeAt(C), (A & 64512) === 55296 && C + 1 < r && (L = E.charCodeAt(C + 1), (L & 64512) === 56320 && (A = 65536 + (A - 55296 << 10) + (L - 56320), C++)), n += A < 128 ? 1 : A < 2048 ? 2 : A < 65536 ? 3 : 4;
+ for (u = new l.Buf8(n), D = 0, C = 0; D < n; C++)
+ A = E.charCodeAt(C), (A & 64512) === 55296 && C + 1 < r && (L = E.charCodeAt(C + 1), (L & 64512) === 56320 && (A = 65536 + (A - 55296 << 10) + (L - 56320), C++)), A < 128 ? u[D++] = A : A < 2048 ? (u[D++] = 192 | A >>> 6, u[D++] = 128 | A & 63) : A < 65536 ? (u[D++] = 224 | A >>> 12, u[D++] = 128 | A >>> 6 & 63, u[D++] = 128 | A & 63) : (u[D++] = 240 | A >>> 18, u[D++] = 128 | A >>> 12 & 63, u[D++] = 128 | A >>> 6 & 63, u[D++] = 128 | A & 63);
return u;
};
- function p(E, u) {
- if (u < 65534 && (E.subarray && _ || !E.subarray && g))
+ function g(E, u) {
+ if (u < 65534 && (E.subarray && _ || !E.subarray && p))
return String.fromCharCode.apply(null, l.shrinkBuf(E, u));
- for (var A = "", C = 0; C < u; C++)
- A += String.fromCharCode(E[C]);
+ for (var A = "", L = 0; L < u; L++)
+ A += String.fromCharCode(E[L]);
return A;
}
s.buf2binstring = function(E) {
- return p(E, E.length);
+ return g(E, E.length);
}, s.binstring2buf = function(E) {
- for (var u = new l.Buf8(E.length), A = 0, C = u.length; A < C; A++)
+ for (var u = new l.Buf8(E.length), A = 0, L = u.length; A < L; A++)
u[A] = E.charCodeAt(A);
return u;
}, s.buf2string = function(E, u) {
- var A, C, L, D, r = u || E.length, n = new Array(r * 2);
- for (C = 0, A = 0; A < r; ) {
- if (L = E[A++], L < 128) {
- n[C++] = L;
+ var A, L, C, D, r = u || E.length, n = new Array(r * 2);
+ for (L = 0, A = 0; A < r; ) {
+ if (C = E[A++], C < 128) {
+ n[L++] = C;
continue;
}
- if (D = x[L], D > 4) {
- n[C++] = 65533, A += D - 1;
+ if (D = x[C], D > 4) {
+ n[L++] = 65533, A += D - 1;
continue;
}
- for (L &= D === 2 ? 31 : D === 3 ? 15 : 7; D > 1 && A < r; )
- L = L << 6 | E[A++] & 63, D--;
+ for (C &= D === 2 ? 31 : D === 3 ? 15 : 7; D > 1 && A < r; )
+ C = C << 6 | E[A++] & 63, D--;
if (D > 1) {
- n[C++] = 65533;
+ n[L++] = 65533;
continue;
}
- L < 65536 ? n[C++] = L : (L -= 65536, n[C++] = 55296 | L >> 10 & 1023, n[C++] = 56320 | L & 1023);
+ C < 65536 ? n[L++] = C : (C -= 65536, n[L++] = 55296 | C >> 10 & 1023, n[L++] = 56320 | C & 1023);
}
- return p(n, C);
+ return g(n, L);
}, s.utf8border = function(E, u) {
var A;
for (u = u || E.length, u > E.length && (u = E.length), A = u - 1; A >= 0 && (E[A] & 192) === 128; )
@@ -20795,12 +20795,12 @@ ATOM`, h);
\********************************************************************/
/***/
(y) => {
- function s(e, l, g, _) {
- for (var x = e & 65535 | 0, o = e >>> 16 & 65535 | 0, p = 0; g !== 0; ) {
- p = g > 2e3 ? 2e3 : g, g -= p;
+ function s(e, l, p, _) {
+ for (var x = e & 65535 | 0, o = e >>> 16 & 65535 | 0, g = 0; p !== 0; ) {
+ g = p > 2e3 ? 2e3 : p, p -= g;
do
x = x + l[_++] | 0, o = o + x | 0;
- while (--p);
+ while (--g);
x %= 65521, o %= 65521;
}
return x | o << 16 | 0;
@@ -20865,21 +20865,21 @@ ATOM`, h);
/***/
(y) => {
function s() {
- for (var g, _ = [], x = 0; x < 256; x++) {
- g = x;
+ for (var p, _ = [], x = 0; x < 256; x++) {
+ p = x;
for (var o = 0; o < 8; o++)
- g = g & 1 ? 3988292384 ^ g >>> 1 : g >>> 1;
- _[x] = g;
+ p = p & 1 ? 3988292384 ^ p >>> 1 : p >>> 1;
+ _[x] = p;
}
return _;
}
var e = s();
- function l(g, _, x, o) {
- var p = e, E = o + x;
- g ^= -1;
+ function l(p, _, x, o) {
+ var g = e, E = o + x;
+ p ^= -1;
for (var u = o; u < E; u++)
- g = g >>> 8 ^ p[(g ^ _[u]) & 255];
- return g ^ -1;
+ p = p >>> 8 ^ g[(p ^ _[u]) & 255];
+ return p ^ -1;
}
y.exports = l;
}
@@ -20894,7 +20894,7 @@ ATOM`, h);
var l = e(
/*! ../utils/common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
- ), g = e(
+ ), p = e(
/*! ./trees */
"./node_modules/upng-js/node_modules/pako/lib/zlib/trees.js"
), _ = e(
@@ -20906,308 +20906,308 @@ ATOM`, h);
), o = e(
/*! ./messages */
"./node_modules/upng-js/node_modules/pako/lib/zlib/messages.js"
- ), p = 0, E = 1, u = 3, A = 4, C = 5, L = 0, D = 1, r = -2, n = -3, b = -5, f = -1, c = 1, t = 2, a = 3, h = 4, M = 0, w = 2, S = 8, T = 9, R = 15, z = 8, P = 29, B = 256, U = B + 1 + P, F = 30, $ = 19, W = 2 * U + 1, N = 15, G = 3, k = 258, j = k + G + 1, Q = 32, ie = 42, pe = 69, he = 73, ue = 91, se = 103, ae = 113, we = 666, xe = 1, Ie = 2, oe = 3, ve = 4, re = 3;
+ ), g = 0, E = 1, u = 3, A = 4, L = 5, C = 0, D = 1, r = -2, n = -3, b = -5, f = -1, c = 1, t = 2, a = 3, h = 4, M = 0, w = 2, S = 8, T = 9, R = 15, $ = 8, P = 29, B = 256, F = B + 1 + P, U = 30, z = 19, W = 2 * F + 1, V = 15, N = 3, k = 258, G = k + N + 1, Q = 32, ie = 42, ge = 69, le = 73, oe = 91, he = 103, se = 113, xe = 666, ye = 1, Pe = 2, de = 3, pe = 4, re = 3;
function Se(I, me) {
return I.msg = o[me], me;
}
- function ze(I) {
+ function ke(I) {
return (I << 1) - (I > 4 ? 9 : 0);
}
- function Ge(I) {
+ function $e(I) {
for (var me = I.length; --me >= 0; )
I[me] = 0;
}
- function $e(I) {
- var me = I.state, ge = me.pending;
- ge > I.avail_out && (ge = I.avail_out), ge !== 0 && (l.arraySet(I.output, me.pending_buf, me.pending_out, ge, I.next_out), I.next_out += ge, me.pending_out += ge, I.total_out += ge, I.avail_out -= ge, me.pending -= ge, me.pending === 0 && (me.pending_out = 0));
+ function ze(I) {
+ var me = I.state, ve = me.pending;
+ ve > I.avail_out && (ve = I.avail_out), ve !== 0 && (l.arraySet(I.output, me.pending_buf, me.pending_out, ve, I.next_out), I.next_out += ve, me.pending_out += ve, I.total_out += ve, I.avail_out -= ve, me.pending -= ve, me.pending === 0 && (me.pending_out = 0));
}
function Re(I, me) {
- g._tr_flush_block(I, I.block_start >= 0 ? I.block_start : -1, I.strstart - I.block_start, me), I.block_start = I.strstart, $e(I.strm);
+ p._tr_flush_block(I, I.block_start >= 0 ? I.block_start : -1, I.strstart - I.block_start, me), I.block_start = I.strstart, ze(I.strm);
}
- function Be(I, me) {
+ function Fe(I, me) {
I.pending_buf[I.pending++] = me;
}
- function ke(I, me) {
+ function Ie(I, me) {
I.pending_buf[I.pending++] = me >>> 8 & 255, I.pending_buf[I.pending++] = me & 255;
}
- function We(I, me, ge, Y) {
+ function We(I, me, ve, X) {
var ne = I.avail_in;
- return ne > Y && (ne = Y), ne === 0 ? 0 : (I.avail_in -= ne, l.arraySet(me, I.input, I.next_in, ne, ge), I.state.wrap === 1 ? I.adler = _(I.adler, me, ne, ge) : I.state.wrap === 2 && (I.adler = x(I.adler, me, ne, ge)), I.next_in += ne, I.total_in += ne, ne);
+ return ne > X && (ne = X), ne === 0 ? 0 : (I.avail_in -= ne, l.arraySet(me, I.input, I.next_in, ne, ve), I.state.wrap === 1 ? I.adler = _(I.adler, me, ne, ve) : I.state.wrap === 2 && (I.adler = x(I.adler, me, ne, ve)), I.next_in += ne, I.total_in += ne, ne);
}
- function Te(I, me) {
- var ge = I.max_chain_length, Y = I.strstart, ne, Ee, He = I.prev_length, Ke = I.nice_match, Ve = I.strstart > I.w_size - j ? I.strstart - (I.w_size - j) : 0, qe = I.window, wt = I.w_mask, nt = I.prev, rt = I.strstart + k, tt = qe[Y + He - 1], yt = qe[Y + He];
- I.prev_length >= I.good_match && (ge >>= 2), Ke > I.lookahead && (Ke = I.lookahead);
+ function Ue(I, me) {
+ var ve = I.max_chain_length, X = I.strstart, ne, Ee, He = I.prev_length, Ke = I.nice_match, je = I.strstart > I.w_size - G ? I.strstart - (I.w_size - G) : 0, qe = I.window, wt = I.w_mask, nt = I.prev, rt = I.strstart + k, tt = qe[X + He - 1], yt = qe[X + He];
+ I.prev_length >= I.good_match && (ve >>= 2), Ke > I.lookahead && (Ke = I.lookahead);
do
- if (ne = me, !(qe[ne + He] !== yt || qe[ne + He - 1] !== tt || qe[ne] !== qe[Y] || qe[++ne] !== qe[Y + 1])) {
- Y += 2, ne++;
+ if (ne = me, !(qe[ne + He] !== yt || qe[ne + He - 1] !== tt || qe[ne] !== qe[X] || qe[++ne] !== qe[X + 1])) {
+ X += 2, ne++;
do
;
- while (qe[++Y] === qe[++ne] && qe[++Y] === qe[++ne] && qe[++Y] === qe[++ne] && qe[++Y] === qe[++ne] && qe[++Y] === qe[++ne] && qe[++Y] === qe[++ne] && qe[++Y] === qe[++ne] && qe[++Y] === qe[++ne] && Y < rt);
- if (Ee = k - (rt - Y), Y = rt - k, Ee > He) {
+ while (qe[++X] === qe[++ne] && qe[++X] === qe[++ne] && qe[++X] === qe[++ne] && qe[++X] === qe[++ne] && qe[++X] === qe[++ne] && qe[++X] === qe[++ne] && qe[++X] === qe[++ne] && qe[++X] === qe[++ne] && X < rt);
+ if (Ee = k - (rt - X), X = rt - k, Ee > He) {
if (I.match_start = me, He = Ee, Ee >= Ke)
break;
- tt = qe[Y + He - 1], yt = qe[Y + He];
+ tt = qe[X + He - 1], yt = qe[X + He];
}
}
- while ((me = nt[me & wt]) > Ve && --ge !== 0);
+ while ((me = nt[me & wt]) > je && --ve !== 0);
return He <= I.lookahead ? He : I.lookahead;
}
- function je(I) {
- var me = I.w_size, ge, Y, ne, Ee, He;
+ function Be(I) {
+ var me = I.w_size, ve, X, ne, Ee, He;
do {
- if (Ee = I.window_size - I.lookahead - I.strstart, I.strstart >= me + (me - j)) {
- l.arraySet(I.window, I.window, me, me, 0), I.match_start -= me, I.strstart -= me, I.block_start -= me, Y = I.hash_size, ge = Y;
+ if (Ee = I.window_size - I.lookahead - I.strstart, I.strstart >= me + (me - G)) {
+ l.arraySet(I.window, I.window, me, me, 0), I.match_start -= me, I.strstart -= me, I.block_start -= me, X = I.hash_size, ve = X;
do
- ne = I.head[--ge], I.head[ge] = ne >= me ? ne - me : 0;
- while (--Y);
- Y = me, ge = Y;
+ ne = I.head[--ve], I.head[ve] = ne >= me ? ne - me : 0;
+ while (--X);
+ X = me, ve = X;
do
- ne = I.prev[--ge], I.prev[ge] = ne >= me ? ne - me : 0;
- while (--Y);
+ ne = I.prev[--ve], I.prev[ve] = ne >= me ? ne - me : 0;
+ while (--X);
Ee += me;
}
if (I.strm.avail_in === 0)
break;
- if (Y = We(I.strm, I.window, I.strstart + I.lookahead, Ee), I.lookahead += Y, I.lookahead + I.insert >= G)
- for (He = I.strstart - I.insert, I.ins_h = I.window[He], I.ins_h = (I.ins_h << I.hash_shift ^ I.window[He + 1]) & I.hash_mask; I.insert && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[He + G - 1]) & I.hash_mask, I.prev[He & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = He, He++, I.insert--, !(I.lookahead + I.insert < G)); )
+ if (X = We(I.strm, I.window, I.strstart + I.lookahead, Ee), I.lookahead += X, I.lookahead + I.insert >= N)
+ for (He = I.strstart - I.insert, I.ins_h = I.window[He], I.ins_h = (I.ins_h << I.hash_shift ^ I.window[He + 1]) & I.hash_mask; I.insert && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[He + N - 1]) & I.hash_mask, I.prev[He & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = He, He++, I.insert--, !(I.lookahead + I.insert < N)); )
;
- } while (I.lookahead < j && I.strm.avail_in !== 0);
+ } while (I.lookahead < G && I.strm.avail_in !== 0);
}
- function Fe(I, me) {
- var ge = 65535;
- for (ge > I.pending_buf_size - 5 && (ge = I.pending_buf_size - 5); ; ) {
+ function Ne(I, me) {
+ var ve = 65535;
+ for (ve > I.pending_buf_size - 5 && (ve = I.pending_buf_size - 5); ; ) {
if (I.lookahead <= 1) {
- if (je(I), I.lookahead === 0 && me === p)
- return xe;
+ if (Be(I), I.lookahead === 0 && me === g)
+ return ye;
if (I.lookahead === 0)
break;
}
I.strstart += I.lookahead, I.lookahead = 0;
- var Y = I.block_start + ge;
- if ((I.strstart === 0 || I.strstart >= Y) && (I.lookahead = I.strstart - Y, I.strstart = Y, Re(I, !1), I.strm.avail_out === 0) || I.strstart - I.block_start >= I.w_size - j && (Re(I, !1), I.strm.avail_out === 0))
- return xe;
+ var X = I.block_start + ve;
+ if ((I.strstart === 0 || I.strstart >= X) && (I.lookahead = I.strstart - X, I.strstart = X, Re(I, !1), I.strm.avail_out === 0) || I.strstart - I.block_start >= I.w_size - G && (Re(I, !1), I.strm.avail_out === 0))
+ return ye;
}
- return I.insert = 0, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? oe : ve) : (I.strstart > I.block_start && (Re(I, !1), I.strm.avail_out === 0), xe);
+ return I.insert = 0, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? de : pe) : (I.strstart > I.block_start && (Re(I, !1), I.strm.avail_out === 0), ye);
}
- function X(I, me) {
- for (var ge, Y; ; ) {
- if (I.lookahead < j) {
- if (je(I), I.lookahead < j && me === p)
- return xe;
+ function H(I, me) {
+ for (var ve, X; ; ) {
+ if (I.lookahead < G) {
+ if (Be(I), I.lookahead < G && me === g)
+ return ye;
if (I.lookahead === 0)
break;
}
- if (ge = 0, I.lookahead >= G && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + G - 1]) & I.hash_mask, ge = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), ge !== 0 && I.strstart - ge <= I.w_size - j && (I.match_length = Te(I, ge)), I.match_length >= G)
- if (Y = g._tr_tally(I, I.strstart - I.match_start, I.match_length - G), I.lookahead -= I.match_length, I.match_length <= I.max_lazy_match && I.lookahead >= G) {
+ if (ve = 0, I.lookahead >= N && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + N - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), ve !== 0 && I.strstart - ve <= I.w_size - G && (I.match_length = Ue(I, ve)), I.match_length >= N)
+ if (X = p._tr_tally(I, I.strstart - I.match_start, I.match_length - N), I.lookahead -= I.match_length, I.match_length <= I.max_lazy_match && I.lookahead >= N) {
I.match_length--;
do
- I.strstart++, I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + G - 1]) & I.hash_mask, ge = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart;
+ I.strstart++, I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + N - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart;
while (--I.match_length !== 0);
I.strstart++;
} else
I.strstart += I.match_length, I.match_length = 0, I.ins_h = I.window[I.strstart], I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + 1]) & I.hash_mask;
else
- Y = g._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++;
- if (Y && (Re(I, !1), I.strm.avail_out === 0))
- return xe;
+ X = p._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++;
+ if (X && (Re(I, !1), I.strm.avail_out === 0))
+ return ye;
}
- return I.insert = I.strstart < G - 1 ? I.strstart : G - 1, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? oe : ve) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? xe : Ie;
+ return I.insert = I.strstart < N - 1 ? I.strstart : N - 1, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? de : pe) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? ye : Pe;
}
- function Z(I, me) {
- for (var ge, Y, ne; ; ) {
- if (I.lookahead < j) {
- if (je(I), I.lookahead < j && me === p)
- return xe;
+ function K(I, me) {
+ for (var ve, X, ne; ; ) {
+ if (I.lookahead < G) {
+ if (Be(I), I.lookahead < G && me === g)
+ return ye;
if (I.lookahead === 0)
break;
}
- if (ge = 0, I.lookahead >= G && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + G - 1]) & I.hash_mask, ge = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), I.prev_length = I.match_length, I.prev_match = I.match_start, I.match_length = G - 1, ge !== 0 && I.prev_length < I.max_lazy_match && I.strstart - ge <= I.w_size - j && (I.match_length = Te(I, ge), I.match_length <= 5 && (I.strategy === c || I.match_length === G && I.strstart - I.match_start > 4096) && (I.match_length = G - 1)), I.prev_length >= G && I.match_length <= I.prev_length) {
- ne = I.strstart + I.lookahead - G, Y = g._tr_tally(I, I.strstart - 1 - I.prev_match, I.prev_length - G), I.lookahead -= I.prev_length - 1, I.prev_length -= 2;
+ if (ve = 0, I.lookahead >= N && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + N - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), I.prev_length = I.match_length, I.prev_match = I.match_start, I.match_length = N - 1, ve !== 0 && I.prev_length < I.max_lazy_match && I.strstart - ve <= I.w_size - G && (I.match_length = Ue(I, ve), I.match_length <= 5 && (I.strategy === c || I.match_length === N && I.strstart - I.match_start > 4096) && (I.match_length = N - 1)), I.prev_length >= N && I.match_length <= I.prev_length) {
+ ne = I.strstart + I.lookahead - N, X = p._tr_tally(I, I.strstart - 1 - I.prev_match, I.prev_length - N), I.lookahead -= I.prev_length - 1, I.prev_length -= 2;
do
- ++I.strstart <= ne && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + G - 1]) & I.hash_mask, ge = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart);
+ ++I.strstart <= ne && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + N - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart);
while (--I.prev_length !== 0);
- if (I.match_available = 0, I.match_length = G - 1, I.strstart++, Y && (Re(I, !1), I.strm.avail_out === 0))
- return xe;
+ if (I.match_available = 0, I.match_length = N - 1, I.strstart++, X && (Re(I, !1), I.strm.avail_out === 0))
+ return ye;
} else if (I.match_available) {
- if (Y = g._tr_tally(I, 0, I.window[I.strstart - 1]), Y && Re(I, !1), I.strstart++, I.lookahead--, I.strm.avail_out === 0)
- return xe;
+ if (X = p._tr_tally(I, 0, I.window[I.strstart - 1]), X && Re(I, !1), I.strstart++, I.lookahead--, I.strm.avail_out === 0)
+ return ye;
} else
I.match_available = 1, I.strstart++, I.lookahead--;
}
- return I.match_available && (Y = g._tr_tally(I, 0, I.window[I.strstart - 1]), I.match_available = 0), I.insert = I.strstart < G - 1 ? I.strstart : G - 1, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? oe : ve) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? xe : Ie;
+ return I.match_available && (X = p._tr_tally(I, 0, I.window[I.strstart - 1]), I.match_available = 0), I.insert = I.strstart < N - 1 ? I.strstart : N - 1, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? de : pe) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? ye : Pe;
}
function q(I, me) {
- for (var ge, Y, ne, Ee, He = I.window; ; ) {
+ for (var ve, X, ne, Ee, He = I.window; ; ) {
if (I.lookahead <= k) {
- if (je(I), I.lookahead <= k && me === p)
- return xe;
+ if (Be(I), I.lookahead <= k && me === g)
+ return ye;
if (I.lookahead === 0)
break;
}
- if (I.match_length = 0, I.lookahead >= G && I.strstart > 0 && (ne = I.strstart - 1, Y = He[ne], Y === He[++ne] && Y === He[++ne] && Y === He[++ne])) {
+ if (I.match_length = 0, I.lookahead >= N && I.strstart > 0 && (ne = I.strstart - 1, X = He[ne], X === He[++ne] && X === He[++ne] && X === He[++ne])) {
Ee = I.strstart + k;
do
;
- while (Y === He[++ne] && Y === He[++ne] && Y === He[++ne] && Y === He[++ne] && Y === He[++ne] && Y === He[++ne] && Y === He[++ne] && Y === He[++ne] && ne < Ee);
+ while (X === He[++ne] && X === He[++ne] && X === He[++ne] && X === He[++ne] && X === He[++ne] && X === He[++ne] && X === He[++ne] && X === He[++ne] && ne < Ee);
I.match_length = k - (Ee - ne), I.match_length > I.lookahead && (I.match_length = I.lookahead);
}
- if (I.match_length >= G ? (ge = g._tr_tally(I, 1, I.match_length - G), I.lookahead -= I.match_length, I.strstart += I.match_length, I.match_length = 0) : (ge = g._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++), ge && (Re(I, !1), I.strm.avail_out === 0))
- return xe;
+ if (I.match_length >= N ? (ve = p._tr_tally(I, 1, I.match_length - N), I.lookahead -= I.match_length, I.strstart += I.match_length, I.match_length = 0) : (ve = p._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++), ve && (Re(I, !1), I.strm.avail_out === 0))
+ return ye;
}
- return I.insert = 0, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? oe : ve) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? xe : Ie;
+ return I.insert = 0, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? de : pe) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? ye : Pe;
}
function fe(I, me) {
- for (var ge; ; ) {
- if (I.lookahead === 0 && (je(I), I.lookahead === 0)) {
- if (me === p)
- return xe;
+ for (var ve; ; ) {
+ if (I.lookahead === 0 && (Be(I), I.lookahead === 0)) {
+ if (me === g)
+ return ye;
break;
}
- if (I.match_length = 0, ge = g._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++, ge && (Re(I, !1), I.strm.avail_out === 0))
- return xe;
+ if (I.match_length = 0, ve = p._tr_tally(I, 0, I.window[I.strstart]), I.lookahead--, I.strstart++, ve && (Re(I, !1), I.strm.avail_out === 0))
+ return ye;
}
- return I.insert = 0, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? oe : ve) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? xe : Ie;
+ return I.insert = 0, me === A ? (Re(I, !0), I.strm.avail_out === 0 ? de : pe) : I.last_lit && (Re(I, !1), I.strm.avail_out === 0) ? ye : Pe;
}
- function _e(I, me, ge, Y, ne) {
- this.good_length = I, this.max_lazy = me, this.nice_length = ge, this.max_chain = Y, this.func = ne;
+ function _e(I, me, ve, X, ne) {
+ this.good_length = I, this.max_lazy = me, this.nice_length = ve, this.max_chain = X, this.func = ne;
}
var Me;
Me = [
/* good lazy nice chain */
- new _e(0, 0, 0, 0, Fe),
+ new _e(0, 0, 0, 0, Ne),
/* 0 store only */
- new _e(4, 4, 8, 4, X),
+ new _e(4, 4, 8, 4, H),
/* 1 max speed, no lazy matches */
- new _e(4, 5, 16, 8, X),
+ new _e(4, 5, 16, 8, H),
/* 2 */
- new _e(4, 6, 32, 32, X),
+ new _e(4, 6, 32, 32, H),
/* 3 */
- new _e(4, 4, 16, 16, Z),
+ new _e(4, 4, 16, 16, K),
/* 4 lazy matches */
- new _e(8, 16, 32, 32, Z),
+ new _e(8, 16, 32, 32, K),
/* 5 */
- new _e(8, 16, 128, 128, Z),
+ new _e(8, 16, 128, 128, K),
/* 6 */
- new _e(8, 32, 128, 256, Z),
+ new _e(8, 32, 128, 256, K),
/* 7 */
- new _e(32, 128, 258, 1024, Z),
+ new _e(32, 128, 258, 1024, K),
/* 8 */
- new _e(32, 258, 258, 4096, Z)
+ new _e(32, 258, 258, 4096, K)
/* 9 max compression */
];
function Ae(I) {
- I.window_size = 2 * I.w_size, Ge(I.head), I.max_lazy_match = Me[I.level].max_lazy, I.good_match = Me[I.level].good_length, I.nice_match = Me[I.level].nice_length, I.max_chain_length = Me[I.level].max_chain, I.strstart = 0, I.block_start = 0, I.lookahead = 0, I.insert = 0, I.match_length = I.prev_length = G - 1, I.match_available = 0, I.ins_h = 0;
+ I.window_size = 2 * I.w_size, $e(I.head), I.max_lazy_match = Me[I.level].max_lazy, I.good_match = Me[I.level].good_length, I.nice_match = Me[I.level].nice_length, I.max_chain_length = Me[I.level].max_chain, I.strstart = 0, I.block_start = 0, I.lookahead = 0, I.insert = 0, I.match_length = I.prev_length = N - 1, I.match_available = 0, I.ins_h = 0;
}
- function H() {
- this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = S, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new l.Buf16(W * 2), this.dyn_dtree = new l.Buf16((2 * F + 1) * 2), this.bl_tree = new l.Buf16((2 * $ + 1) * 2), Ge(this.dyn_ltree), Ge(this.dyn_dtree), Ge(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new l.Buf16(N + 1), this.heap = new l.Buf16(2 * U + 1), Ge(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new l.Buf16(2 * U + 1), Ge(this.depth), this.l_buf = 0, this.lit_bufsize = 0, this.last_lit = 0, this.d_buf = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0;
+ function Z() {
+ this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = S, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new l.Buf16(W * 2), this.dyn_dtree = new l.Buf16((2 * U + 1) * 2), this.bl_tree = new l.Buf16((2 * z + 1) * 2), $e(this.dyn_ltree), $e(this.dyn_dtree), $e(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new l.Buf16(V + 1), this.heap = new l.Buf16(2 * F + 1), $e(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new l.Buf16(2 * F + 1), $e(this.depth), this.l_buf = 0, this.lit_bufsize = 0, this.last_lit = 0, this.d_buf = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0;
}
- function ce(I) {
+ function ue(I) {
var me;
- return !I || !I.state ? Se(I, r) : (I.total_in = I.total_out = 0, I.data_type = w, me = I.state, me.pending = 0, me.pending_out = 0, me.wrap < 0 && (me.wrap = -me.wrap), me.status = me.wrap ? ie : ae, I.adler = me.wrap === 2 ? 0 : 1, me.last_flush = p, g._tr_init(me), L);
+ return !I || !I.state ? Se(I, r) : (I.total_in = I.total_out = 0, I.data_type = w, me = I.state, me.pending = 0, me.pending_out = 0, me.wrap < 0 && (me.wrap = -me.wrap), me.status = me.wrap ? ie : se, I.adler = me.wrap === 2 ? 0 : 1, me.last_flush = g, p._tr_init(me), C);
}
- function ye(I) {
- var me = ce(I);
- return me === L && Ae(I.state), me;
+ function we(I) {
+ var me = ue(I);
+ return me === C && Ae(I.state), me;
}
- function Pe(I, me) {
- return !I || !I.state || I.state.wrap !== 2 ? r : (I.state.gzhead = me, L);
+ function Te(I, me) {
+ return !I || !I.state || I.state.wrap !== 2 ? r : (I.state.gzhead = me, C);
}
- function le(I, me, ge, Y, ne, Ee) {
+ function ae(I, me, ve, X, ne, Ee) {
if (!I)
return r;
var He = 1;
- if (me === f && (me = 6), Y < 0 ? (He = 0, Y = -Y) : Y > 15 && (He = 2, Y -= 16), ne < 1 || ne > T || ge !== S || Y < 8 || Y > 15 || me < 0 || me > 9 || Ee < 0 || Ee > h)
+ if (me === f && (me = 6), X < 0 ? (He = 0, X = -X) : X > 15 && (He = 2, X -= 16), ne < 1 || ne > T || ve !== S || X < 8 || X > 15 || me < 0 || me > 9 || Ee < 0 || Ee > h)
return Se(I, r);
- Y === 8 && (Y = 9);
- var Ke = new H();
- return I.state = Ke, Ke.strm = I, Ke.wrap = He, Ke.gzhead = null, Ke.w_bits = Y, Ke.w_size = 1 << Ke.w_bits, Ke.w_mask = Ke.w_size - 1, Ke.hash_bits = ne + 7, Ke.hash_size = 1 << Ke.hash_bits, Ke.hash_mask = Ke.hash_size - 1, Ke.hash_shift = ~~((Ke.hash_bits + G - 1) / G), Ke.window = new l.Buf8(Ke.w_size * 2), Ke.head = new l.Buf16(Ke.hash_size), Ke.prev = new l.Buf16(Ke.w_size), Ke.lit_bufsize = 1 << ne + 6, Ke.pending_buf_size = Ke.lit_bufsize * 4, Ke.pending_buf = new l.Buf8(Ke.pending_buf_size), Ke.d_buf = 1 * Ke.lit_bufsize, Ke.l_buf = 3 * Ke.lit_bufsize, Ke.level = me, Ke.strategy = Ee, Ke.method = ge, ye(I);
+ X === 8 && (X = 9);
+ var Ke = new Z();
+ return I.state = Ke, Ke.strm = I, Ke.wrap = He, Ke.gzhead = null, Ke.w_bits = X, Ke.w_size = 1 << Ke.w_bits, Ke.w_mask = Ke.w_size - 1, Ke.hash_bits = ne + 7, Ke.hash_size = 1 << Ke.hash_bits, Ke.hash_mask = Ke.hash_size - 1, Ke.hash_shift = ~~((Ke.hash_bits + N - 1) / N), Ke.window = new l.Buf8(Ke.w_size * 2), Ke.head = new l.Buf16(Ke.hash_size), Ke.prev = new l.Buf16(Ke.w_size), Ke.lit_bufsize = 1 << ne + 6, Ke.pending_buf_size = Ke.lit_bufsize * 4, Ke.pending_buf = new l.Buf8(Ke.pending_buf_size), Ke.d_buf = 1 * Ke.lit_bufsize, Ke.l_buf = 3 * Ke.lit_bufsize, Ke.level = me, Ke.strategy = Ee, Ke.method = ve, we(I);
}
function De(I, me) {
- return le(I, me, S, R, z, M);
+ return ae(I, me, S, R, $, M);
}
- function K(I, me) {
- var ge, Y, ne, Ee;
- if (!I || !I.state || me > C || me < 0)
+ function Y(I, me) {
+ var ve, X, ne, Ee;
+ if (!I || !I.state || me > L || me < 0)
return I ? Se(I, r) : r;
- if (Y = I.state, !I.output || !I.input && I.avail_in !== 0 || Y.status === we && me !== A)
+ if (X = I.state, !I.output || !I.input && I.avail_in !== 0 || X.status === xe && me !== A)
return Se(I, I.avail_out === 0 ? b : r);
- if (Y.strm = I, ge = Y.last_flush, Y.last_flush = me, Y.status === ie)
- if (Y.wrap === 2)
- I.adler = 0, Be(Y, 31), Be(Y, 139), Be(Y, 8), Y.gzhead ? (Be(
- Y,
- (Y.gzhead.text ? 1 : 0) + (Y.gzhead.hcrc ? 2 : 0) + (Y.gzhead.extra ? 4 : 0) + (Y.gzhead.name ? 8 : 0) + (Y.gzhead.comment ? 16 : 0)
- ), Be(Y, Y.gzhead.time & 255), Be(Y, Y.gzhead.time >> 8 & 255), Be(Y, Y.gzhead.time >> 16 & 255), Be(Y, Y.gzhead.time >> 24 & 255), Be(Y, Y.level === 9 ? 2 : Y.strategy >= t || Y.level < 2 ? 4 : 0), Be(Y, Y.gzhead.os & 255), Y.gzhead.extra && Y.gzhead.extra.length && (Be(Y, Y.gzhead.extra.length & 255), Be(Y, Y.gzhead.extra.length >> 8 & 255)), Y.gzhead.hcrc && (I.adler = x(I.adler, Y.pending_buf, Y.pending, 0)), Y.gzindex = 0, Y.status = pe) : (Be(Y, 0), Be(Y, 0), Be(Y, 0), Be(Y, 0), Be(Y, 0), Be(Y, Y.level === 9 ? 2 : Y.strategy >= t || Y.level < 2 ? 4 : 0), Be(Y, re), Y.status = ae);
+ if (X.strm = I, ve = X.last_flush, X.last_flush = me, X.status === ie)
+ if (X.wrap === 2)
+ I.adler = 0, Fe(X, 31), Fe(X, 139), Fe(X, 8), X.gzhead ? (Fe(
+ X,
+ (X.gzhead.text ? 1 : 0) + (X.gzhead.hcrc ? 2 : 0) + (X.gzhead.extra ? 4 : 0) + (X.gzhead.name ? 8 : 0) + (X.gzhead.comment ? 16 : 0)
+ ), Fe(X, X.gzhead.time & 255), Fe(X, X.gzhead.time >> 8 & 255), Fe(X, X.gzhead.time >> 16 & 255), Fe(X, X.gzhead.time >> 24 & 255), Fe(X, X.level === 9 ? 2 : X.strategy >= t || X.level < 2 ? 4 : 0), Fe(X, X.gzhead.os & 255), X.gzhead.extra && X.gzhead.extra.length && (Fe(X, X.gzhead.extra.length & 255), Fe(X, X.gzhead.extra.length >> 8 & 255)), X.gzhead.hcrc && (I.adler = x(I.adler, X.pending_buf, X.pending, 0)), X.gzindex = 0, X.status = ge) : (Fe(X, 0), Fe(X, 0), Fe(X, 0), Fe(X, 0), Fe(X, 0), Fe(X, X.level === 9 ? 2 : X.strategy >= t || X.level < 2 ? 4 : 0), Fe(X, re), X.status = se);
else {
- var He = S + (Y.w_bits - 8 << 4) << 8, Ke = -1;
- Y.strategy >= t || Y.level < 2 ? Ke = 0 : Y.level < 6 ? Ke = 1 : Y.level === 6 ? Ke = 2 : Ke = 3, He |= Ke << 6, Y.strstart !== 0 && (He |= Q), He += 31 - He % 31, Y.status = ae, ke(Y, He), Y.strstart !== 0 && (ke(Y, I.adler >>> 16), ke(Y, I.adler & 65535)), I.adler = 1;
- }
- if (Y.status === pe)
- if (Y.gzhead.extra) {
- for (ne = Y.pending; Y.gzindex < (Y.gzhead.extra.length & 65535) && !(Y.pending === Y.pending_buf_size && (Y.gzhead.hcrc && Y.pending > ne && (I.adler = x(I.adler, Y.pending_buf, Y.pending - ne, ne)), $e(I), ne = Y.pending, Y.pending === Y.pending_buf_size)); )
- Be(Y, Y.gzhead.extra[Y.gzindex] & 255), Y.gzindex++;
- Y.gzhead.hcrc && Y.pending > ne && (I.adler = x(I.adler, Y.pending_buf, Y.pending - ne, ne)), Y.gzindex === Y.gzhead.extra.length && (Y.gzindex = 0, Y.status = he);
+ var He = S + (X.w_bits - 8 << 4) << 8, Ke = -1;
+ X.strategy >= t || X.level < 2 ? Ke = 0 : X.level < 6 ? Ke = 1 : X.level === 6 ? Ke = 2 : Ke = 3, He |= Ke << 6, X.strstart !== 0 && (He |= Q), He += 31 - He % 31, X.status = se, Ie(X, He), X.strstart !== 0 && (Ie(X, I.adler >>> 16), Ie(X, I.adler & 65535)), I.adler = 1;
+ }
+ if (X.status === ge)
+ if (X.gzhead.extra) {
+ for (ne = X.pending; X.gzindex < (X.gzhead.extra.length & 65535) && !(X.pending === X.pending_buf_size && (X.gzhead.hcrc && X.pending > ne && (I.adler = x(I.adler, X.pending_buf, X.pending - ne, ne)), ze(I), ne = X.pending, X.pending === X.pending_buf_size)); )
+ Fe(X, X.gzhead.extra[X.gzindex] & 255), X.gzindex++;
+ X.gzhead.hcrc && X.pending > ne && (I.adler = x(I.adler, X.pending_buf, X.pending - ne, ne)), X.gzindex === X.gzhead.extra.length && (X.gzindex = 0, X.status = le);
} else
- Y.status = he;
- if (Y.status === he)
- if (Y.gzhead.name) {
- ne = Y.pending;
+ X.status = le;
+ if (X.status === le)
+ if (X.gzhead.name) {
+ ne = X.pending;
do {
- if (Y.pending === Y.pending_buf_size && (Y.gzhead.hcrc && Y.pending > ne && (I.adler = x(I.adler, Y.pending_buf, Y.pending - ne, ne)), $e(I), ne = Y.pending, Y.pending === Y.pending_buf_size)) {
+ if (X.pending === X.pending_buf_size && (X.gzhead.hcrc && X.pending > ne && (I.adler = x(I.adler, X.pending_buf, X.pending - ne, ne)), ze(I), ne = X.pending, X.pending === X.pending_buf_size)) {
Ee = 1;
break;
}
- Y.gzindex < Y.gzhead.name.length ? Ee = Y.gzhead.name.charCodeAt(Y.gzindex++) & 255 : Ee = 0, Be(Y, Ee);
+ X.gzindex < X.gzhead.name.length ? Ee = X.gzhead.name.charCodeAt(X.gzindex++) & 255 : Ee = 0, Fe(X, Ee);
} while (Ee !== 0);
- Y.gzhead.hcrc && Y.pending > ne && (I.adler = x(I.adler, Y.pending_buf, Y.pending - ne, ne)), Ee === 0 && (Y.gzindex = 0, Y.status = ue);
+ X.gzhead.hcrc && X.pending > ne && (I.adler = x(I.adler, X.pending_buf, X.pending - ne, ne)), Ee === 0 && (X.gzindex = 0, X.status = oe);
} else
- Y.status = ue;
- if (Y.status === ue)
- if (Y.gzhead.comment) {
- ne = Y.pending;
+ X.status = oe;
+ if (X.status === oe)
+ if (X.gzhead.comment) {
+ ne = X.pending;
do {
- if (Y.pending === Y.pending_buf_size && (Y.gzhead.hcrc && Y.pending > ne && (I.adler = x(I.adler, Y.pending_buf, Y.pending - ne, ne)), $e(I), ne = Y.pending, Y.pending === Y.pending_buf_size)) {
+ if (X.pending === X.pending_buf_size && (X.gzhead.hcrc && X.pending > ne && (I.adler = x(I.adler, X.pending_buf, X.pending - ne, ne)), ze(I), ne = X.pending, X.pending === X.pending_buf_size)) {
Ee = 1;
break;
}
- Y.gzindex < Y.gzhead.comment.length ? Ee = Y.gzhead.comment.charCodeAt(Y.gzindex++) & 255 : Ee = 0, Be(Y, Ee);
+ X.gzindex < X.gzhead.comment.length ? Ee = X.gzhead.comment.charCodeAt(X.gzindex++) & 255 : Ee = 0, Fe(X, Ee);
} while (Ee !== 0);
- Y.gzhead.hcrc && Y.pending > ne && (I.adler = x(I.adler, Y.pending_buf, Y.pending - ne, ne)), Ee === 0 && (Y.status = se);
+ X.gzhead.hcrc && X.pending > ne && (I.adler = x(I.adler, X.pending_buf, X.pending - ne, ne)), Ee === 0 && (X.status = he);
} else
- Y.status = se;
- if (Y.status === se && (Y.gzhead.hcrc ? (Y.pending + 2 > Y.pending_buf_size && $e(I), Y.pending + 2 <= Y.pending_buf_size && (Be(Y, I.adler & 255), Be(Y, I.adler >> 8 & 255), I.adler = 0, Y.status = ae)) : Y.status = ae), Y.pending !== 0) {
- if ($e(I), I.avail_out === 0)
- return Y.last_flush = -1, L;
- } else if (I.avail_in === 0 && ze(me) <= ze(ge) && me !== A)
+ X.status = he;
+ if (X.status === he && (X.gzhead.hcrc ? (X.pending + 2 > X.pending_buf_size && ze(I), X.pending + 2 <= X.pending_buf_size && (Fe(X, I.adler & 255), Fe(X, I.adler >> 8 & 255), I.adler = 0, X.status = se)) : X.status = se), X.pending !== 0) {
+ if (ze(I), I.avail_out === 0)
+ return X.last_flush = -1, C;
+ } else if (I.avail_in === 0 && ke(me) <= ke(ve) && me !== A)
return Se(I, b);
- if (Y.status === we && I.avail_in !== 0)
+ if (X.status === xe && I.avail_in !== 0)
return Se(I, b);
- if (I.avail_in !== 0 || Y.lookahead !== 0 || me !== p && Y.status !== we) {
- var Ve = Y.strategy === t ? fe(Y, me) : Y.strategy === a ? q(Y, me) : Me[Y.level].func(Y, me);
- if ((Ve === oe || Ve === ve) && (Y.status = we), Ve === xe || Ve === oe)
- return I.avail_out === 0 && (Y.last_flush = -1), L;
- if (Ve === Ie && (me === E ? g._tr_align(Y) : me !== C && (g._tr_stored_block(Y, 0, 0, !1), me === u && (Ge(Y.head), Y.lookahead === 0 && (Y.strstart = 0, Y.block_start = 0, Y.insert = 0))), $e(I), I.avail_out === 0))
- return Y.last_flush = -1, L;
- }
- return me !== A ? L : Y.wrap <= 0 ? D : (Y.wrap === 2 ? (Be(Y, I.adler & 255), Be(Y, I.adler >> 8 & 255), Be(Y, I.adler >> 16 & 255), Be(Y, I.adler >> 24 & 255), Be(Y, I.total_in & 255), Be(Y, I.total_in >> 8 & 255), Be(Y, I.total_in >> 16 & 255), Be(Y, I.total_in >> 24 & 255)) : (ke(Y, I.adler >>> 16), ke(Y, I.adler & 65535)), $e(I), Y.wrap > 0 && (Y.wrap = -Y.wrap), Y.pending !== 0 ? L : D);
+ if (I.avail_in !== 0 || X.lookahead !== 0 || me !== g && X.status !== xe) {
+ var je = X.strategy === t ? fe(X, me) : X.strategy === a ? q(X, me) : Me[X.level].func(X, me);
+ if ((je === de || je === pe) && (X.status = xe), je === ye || je === de)
+ return I.avail_out === 0 && (X.last_flush = -1), C;
+ if (je === Pe && (me === E ? p._tr_align(X) : me !== L && (p._tr_stored_block(X, 0, 0, !1), me === u && ($e(X.head), X.lookahead === 0 && (X.strstart = 0, X.block_start = 0, X.insert = 0))), ze(I), I.avail_out === 0))
+ return X.last_flush = -1, C;
+ }
+ return me !== A ? C : X.wrap <= 0 ? D : (X.wrap === 2 ? (Fe(X, I.adler & 255), Fe(X, I.adler >> 8 & 255), Fe(X, I.adler >> 16 & 255), Fe(X, I.adler >> 24 & 255), Fe(X, I.total_in & 255), Fe(X, I.total_in >> 8 & 255), Fe(X, I.total_in >> 16 & 255), Fe(X, I.total_in >> 24 & 255)) : (Ie(X, I.adler >>> 16), Ie(X, I.adler & 65535)), ze(I), X.wrap > 0 && (X.wrap = -X.wrap), X.pending !== 0 ? C : D);
}
function Oe(I) {
var me;
- return !I || !I.state ? r : (me = I.state.status, me !== ie && me !== pe && me !== he && me !== ue && me !== se && me !== ae && me !== we ? Se(I, r) : (I.state = null, me === ae ? Se(I, n) : L));
+ return !I || !I.state ? r : (me = I.state.status, me !== ie && me !== ge && me !== le && me !== oe && me !== he && me !== se && me !== xe ? Se(I, r) : (I.state = null, me === se ? Se(I, n) : C));
}
- function Ne(I, me) {
- var ge = me.length, Y, ne, Ee, He, Ke, Ve, qe, wt;
- if (!I || !I.state || (Y = I.state, He = Y.wrap, He === 2 || He === 1 && Y.status !== ie || Y.lookahead))
+ function Ve(I, me) {
+ var ve = me.length, X, ne, Ee, He, Ke, je, qe, wt;
+ if (!I || !I.state || (X = I.state, He = X.wrap, He === 2 || He === 1 && X.status !== ie || X.lookahead))
return r;
- for (He === 1 && (I.adler = _(I.adler, me, ge, 0)), Y.wrap = 0, ge >= Y.w_size && (He === 0 && (Ge(Y.head), Y.strstart = 0, Y.block_start = 0, Y.insert = 0), wt = new l.Buf8(Y.w_size), l.arraySet(wt, me, ge - Y.w_size, Y.w_size, 0), me = wt, ge = Y.w_size), Ke = I.avail_in, Ve = I.next_in, qe = I.input, I.avail_in = ge, I.next_in = 0, I.input = me, je(Y); Y.lookahead >= G; ) {
- ne = Y.strstart, Ee = Y.lookahead - (G - 1);
+ for (He === 1 && (I.adler = _(I.adler, me, ve, 0)), X.wrap = 0, ve >= X.w_size && (He === 0 && ($e(X.head), X.strstart = 0, X.block_start = 0, X.insert = 0), wt = new l.Buf8(X.w_size), l.arraySet(wt, me, ve - X.w_size, X.w_size, 0), me = wt, ve = X.w_size), Ke = I.avail_in, je = I.next_in, qe = I.input, I.avail_in = ve, I.next_in = 0, I.input = me, Be(X); X.lookahead >= N; ) {
+ ne = X.strstart, Ee = X.lookahead - (N - 1);
do
- Y.ins_h = (Y.ins_h << Y.hash_shift ^ Y.window[ne + G - 1]) & Y.hash_mask, Y.prev[ne & Y.w_mask] = Y.head[Y.ins_h], Y.head[Y.ins_h] = ne, ne++;
+ X.ins_h = (X.ins_h << X.hash_shift ^ X.window[ne + N - 1]) & X.hash_mask, X.prev[ne & X.w_mask] = X.head[X.ins_h], X.head[X.ins_h] = ne, ne++;
while (--Ee);
- Y.strstart = ne, Y.lookahead = G - 1, je(Y);
+ X.strstart = ne, X.lookahead = N - 1, Be(X);
}
- return Y.strstart += Y.lookahead, Y.block_start = Y.strstart, Y.insert = Y.lookahead, Y.lookahead = 0, Y.match_length = Y.prev_length = G - 1, Y.match_available = 0, I.next_in = Ve, I.input = qe, I.avail_in = Ke, Y.wrap = He, L;
+ return X.strstart += X.lookahead, X.block_start = X.strstart, X.insert = X.lookahead, X.lookahead = 0, X.match_length = X.prev_length = N - 1, X.match_available = 0, I.next_in = je, I.input = qe, I.avail_in = Ke, X.wrap = He, C;
}
- s.deflateInit = De, s.deflateInit2 = le, s.deflateReset = ye, s.deflateResetKeep = ce, s.deflateSetHeader = Pe, s.deflate = K, s.deflateEnd = Oe, s.deflateSetDictionary = Ne, s.deflateInfo = "pako deflate (from Nodeca project)";
+ s.deflateInit = De, s.deflateInit2 = ae, s.deflateReset = we, s.deflateResetKeep = ue, s.deflateSetHeader = Te, s.deflate = Y, s.deflateEnd = Oe, s.deflateSetDictionary = Ve, s.deflateInfo = "pako deflate (from Nodeca project)";
}
),
/***/
@@ -21231,9 +21231,9 @@ ATOM`, h);
/***/
(y) => {
var s = 30, e = 12;
- y.exports = function(g, _) {
- var x, o, p, E, u, A, C, L, D, r, n, b, f, c, t, a, h, M, w, S, T, R, z, P, B;
- x = g.state, o = g.next_in, P = g.input, p = o + (g.avail_in - 5), E = g.next_out, B = g.output, u = E - (_ - g.avail_out), A = E + (g.avail_out - 257), C = x.dmax, L = x.wsize, D = x.whave, r = x.wnext, n = x.window, b = x.hold, f = x.bits, c = x.lencode, t = x.distcode, a = (1 << x.lenbits) - 1, h = (1 << x.distbits) - 1;
+ y.exports = function(p, _) {
+ var x, o, g, E, u, A, L, C, D, r, n, b, f, c, t, a, h, M, w, S, T, R, $, P, B;
+ x = p.state, o = p.next_in, P = p.input, g = o + (p.avail_in - 5), E = p.next_out, B = p.output, u = E - (_ - p.avail_out), A = E + (p.avail_out - 257), L = x.dmax, C = x.wsize, D = x.whave, r = x.wnext, n = x.window, b = x.hold, f = x.bits, c = x.lencode, t = x.distcode, a = (1 << x.lenbits) - 1, h = (1 << x.distbits) - 1;
e:
do {
f < 15 && (b += P[o++] << f, f += 8, b += P[o++] << f, f += 8), M = c[b & a];
@@ -21246,25 +21246,25 @@ ATOM`, h);
i:
for (; ; ) {
if (w = M >>> 24, b >>>= w, f -= w, w = M >>> 16 & 255, w & 16) {
- if (T = M & 65535, w &= 15, f < w && (b += P[o++] << f, f += 8, f < w && (b += P[o++] << f, f += 8)), T += b & (1 << w) - 1, T > C) {
- g.msg = "invalid distance too far back", x.mode = s;
+ if (T = M & 65535, w &= 15, f < w && (b += P[o++] << f, f += 8, f < w && (b += P[o++] << f, f += 8)), T += b & (1 << w) - 1, T > L) {
+ p.msg = "invalid distance too far back", x.mode = s;
break e;
}
if (b >>>= w, f -= w, w = E - u, T > w) {
if (w = T - w, w > D && x.sane) {
- g.msg = "invalid distance too far back", x.mode = s;
+ p.msg = "invalid distance too far back", x.mode = s;
break e;
}
- if (R = 0, z = n, r === 0) {
- if (R += L - w, w < S) {
+ if (R = 0, $ = n, r === 0) {
+ if (R += C - w, w < S) {
S -= w;
do
B[E++] = n[R++];
while (--w);
- R = E - T, z = B;
+ R = E - T, $ = B;
}
} else if (r < w) {
- if (R += L + r - w, w -= r, w < S) {
+ if (R += C + r - w, w -= r, w < S) {
S -= w;
do
B[E++] = n[R++];
@@ -21274,7 +21274,7 @@ ATOM`, h);
do
B[E++] = n[R++];
while (--w);
- R = E - T, z = B;
+ R = E - T, $ = B;
}
}
} else if (R += r - w, w < S) {
@@ -21282,11 +21282,11 @@ ATOM`, h);
do
B[E++] = n[R++];
while (--w);
- R = E - T, z = B;
+ R = E - T, $ = B;
}
for (; S > 2; )
- B[E++] = z[R++], B[E++] = z[R++], B[E++] = z[R++], S -= 3;
- S && (B[E++] = z[R++], S > 1 && (B[E++] = z[R++]));
+ B[E++] = $[R++], B[E++] = $[R++], B[E++] = $[R++], S -= 3;
+ S && (B[E++] = $[R++], S > 1 && (B[E++] = $[R++]));
} else {
R = E - T;
do
@@ -21295,7 +21295,7 @@ ATOM`, h);
S && (B[E++] = B[R++], S > 1 && (B[E++] = B[R++]));
}
} else if (w & 64) {
- g.msg = "invalid distance code", x.mode = s;
+ p.msg = "invalid distance code", x.mode = s;
break e;
} else {
M = t[(M & 65535) + (b & (1 << w) - 1)];
@@ -21308,7 +21308,7 @@ ATOM`, h);
x.mode = e;
break e;
} else {
- g.msg = "invalid literal/length code", x.mode = s;
+ p.msg = "invalid literal/length code", x.mode = s;
break e;
}
else {
@@ -21317,8 +21317,8 @@ ATOM`, h);
}
break;
}
- } while (o < p && E < A);
- S = f >> 3, o -= S, f -= S << 3, b &= (1 << f) - 1, g.next_in = o, g.next_out = E, g.avail_in = o < p ? 5 + (p - o) : 5 - (o - p), g.avail_out = E < A ? 257 + (A - E) : 257 - (E - A), x.hold = b, x.bits = f;
+ } while (o < g && E < A);
+ S = f >> 3, o -= S, f -= S << 3, b &= (1 << f) - 1, p.next_in = o, p.next_out = E, p.avail_in = o < g ? 5 + (g - o) : 5 - (o - g), p.avail_out = E < A ? 257 + (A - E) : 257 - (E - A), x.hold = b, x.bits = f;
};
}
),
@@ -21332,7 +21332,7 @@ ATOM`, h);
var l = e(
/*! ../utils/common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
- ), g = e(
+ ), p = e(
/*! ./adler32 */
"./node_modules/upng-js/node_modules/pako/lib/zlib/adler32.js"
), _ = e(
@@ -21344,470 +21344,470 @@ ATOM`, h);
), o = e(
/*! ./inftrees */
"./node_modules/upng-js/node_modules/pako/lib/zlib/inftrees.js"
- ), p = 0, E = 1, u = 2, A = 4, C = 5, L = 6, D = 0, r = 1, n = 2, b = -2, f = -3, c = -4, t = -5, a = 8, h = 1, M = 2, w = 3, S = 4, T = 5, R = 6, z = 7, P = 8, B = 9, U = 10, F = 11, $ = 12, W = 13, N = 14, G = 15, k = 16, j = 17, Q = 18, ie = 19, pe = 20, he = 21, ue = 22, se = 23, ae = 24, we = 25, xe = 26, Ie = 27, oe = 28, ve = 29, re = 30, Se = 31, ze = 32, Ge = 852, $e = 592, Re = 15, Be = Re;
- function ke(le) {
- return (le >>> 24 & 255) + (le >>> 8 & 65280) + ((le & 65280) << 8) + ((le & 255) << 24);
+ ), g = 0, E = 1, u = 2, A = 4, L = 5, C = 6, D = 0, r = 1, n = 2, b = -2, f = -3, c = -4, t = -5, a = 8, h = 1, M = 2, w = 3, S = 4, T = 5, R = 6, $ = 7, P = 8, B = 9, F = 10, U = 11, z = 12, W = 13, V = 14, N = 15, k = 16, G = 17, Q = 18, ie = 19, ge = 20, le = 21, oe = 22, he = 23, se = 24, xe = 25, ye = 26, Pe = 27, de = 28, pe = 29, re = 30, Se = 31, ke = 32, $e = 852, ze = 592, Re = 15, Fe = Re;
+ function Ie(ae) {
+ return (ae >>> 24 & 255) + (ae >>> 8 & 65280) + ((ae & 65280) << 8) + ((ae & 255) << 24);
}
function We() {
this.mode = 0, this.last = !1, this.wrap = 0, this.havedict = !1, this.flags = 0, this.dmax = 0, this.check = 0, this.total = 0, this.head = null, this.wbits = 0, this.wsize = 0, this.whave = 0, this.wnext = 0, this.window = null, this.hold = 0, this.bits = 0, this.length = 0, this.offset = 0, this.extra = 0, this.lencode = null, this.distcode = null, this.lenbits = 0, this.distbits = 0, this.ncode = 0, this.nlen = 0, this.ndist = 0, this.have = 0, this.next = null, this.lens = new l.Buf16(320), this.work = new l.Buf16(288), this.lendyn = null, this.distdyn = null, this.sane = 0, this.back = 0, this.was = 0;
}
- function Te(le) {
+ function Ue(ae) {
var De;
- return !le || !le.state ? b : (De = le.state, le.total_in = le.total_out = De.total = 0, le.msg = "", De.wrap && (le.adler = De.wrap & 1), De.mode = h, De.last = 0, De.havedict = 0, De.dmax = 32768, De.head = null, De.hold = 0, De.bits = 0, De.lencode = De.lendyn = new l.Buf32(Ge), De.distcode = De.distdyn = new l.Buf32($e), De.sane = 1, De.back = -1, D);
+ return !ae || !ae.state ? b : (De = ae.state, ae.total_in = ae.total_out = De.total = 0, ae.msg = "", De.wrap && (ae.adler = De.wrap & 1), De.mode = h, De.last = 0, De.havedict = 0, De.dmax = 32768, De.head = null, De.hold = 0, De.bits = 0, De.lencode = De.lendyn = new l.Buf32($e), De.distcode = De.distdyn = new l.Buf32(ze), De.sane = 1, De.back = -1, D);
}
- function je(le) {
+ function Be(ae) {
var De;
- return !le || !le.state ? b : (De = le.state, De.wsize = 0, De.whave = 0, De.wnext = 0, Te(le));
+ return !ae || !ae.state ? b : (De = ae.state, De.wsize = 0, De.whave = 0, De.wnext = 0, Ue(ae));
}
- function Fe(le, De) {
- var K, Oe;
- return !le || !le.state || (Oe = le.state, De < 0 ? (K = 0, De = -De) : (K = (De >> 4) + 1, De < 48 && (De &= 15)), De && (De < 8 || De > 15)) ? b : (Oe.window !== null && Oe.wbits !== De && (Oe.window = null), Oe.wrap = K, Oe.wbits = De, je(le));
+ function Ne(ae, De) {
+ var Y, Oe;
+ return !ae || !ae.state || (Oe = ae.state, De < 0 ? (Y = 0, De = -De) : (Y = (De >> 4) + 1, De < 48 && (De &= 15)), De && (De < 8 || De > 15)) ? b : (Oe.window !== null && Oe.wbits !== De && (Oe.window = null), Oe.wrap = Y, Oe.wbits = De, Be(ae));
}
- function X(le, De) {
- var K, Oe;
- return le ? (Oe = new We(), le.state = Oe, Oe.window = null, K = Fe(le, De), K !== D && (le.state = null), K) : b;
+ function H(ae, De) {
+ var Y, Oe;
+ return ae ? (Oe = new We(), ae.state = Oe, Oe.window = null, Y = Ne(ae, De), Y !== D && (ae.state = null), Y) : b;
}
- function Z(le) {
- return X(le, Be);
+ function K(ae) {
+ return H(ae, Fe);
}
var q = !0, fe, _e;
- function Me(le) {
+ function Me(ae) {
if (q) {
var De;
for (fe = new l.Buf32(512), _e = new l.Buf32(32), De = 0; De < 144; )
- le.lens[De++] = 8;
+ ae.lens[De++] = 8;
for (; De < 256; )
- le.lens[De++] = 9;
+ ae.lens[De++] = 9;
for (; De < 280; )
- le.lens[De++] = 7;
+ ae.lens[De++] = 7;
for (; De < 288; )
- le.lens[De++] = 8;
- for (o(E, le.lens, 0, 288, fe, 0, le.work, { bits: 9 }), De = 0; De < 32; )
- le.lens[De++] = 5;
- o(u, le.lens, 0, 32, _e, 0, le.work, { bits: 5 }), q = !1;
+ ae.lens[De++] = 8;
+ for (o(E, ae.lens, 0, 288, fe, 0, ae.work, { bits: 9 }), De = 0; De < 32; )
+ ae.lens[De++] = 5;
+ o(u, ae.lens, 0, 32, _e, 0, ae.work, { bits: 5 }), q = !1;
}
- le.lencode = fe, le.lenbits = 9, le.distcode = _e, le.distbits = 5;
+ ae.lencode = fe, ae.lenbits = 9, ae.distcode = _e, ae.distbits = 5;
}
- function Ae(le, De, K, Oe) {
- var Ne, I = le.state;
- return I.window === null && (I.wsize = 1 << I.wbits, I.wnext = 0, I.whave = 0, I.window = new l.Buf8(I.wsize)), Oe >= I.wsize ? (l.arraySet(I.window, De, K - I.wsize, I.wsize, 0), I.wnext = 0, I.whave = I.wsize) : (Ne = I.wsize - I.wnext, Ne > Oe && (Ne = Oe), l.arraySet(I.window, De, K - Oe, Ne, I.wnext), Oe -= Ne, Oe ? (l.arraySet(I.window, De, K - Oe, Oe, 0), I.wnext = Oe, I.whave = I.wsize) : (I.wnext += Ne, I.wnext === I.wsize && (I.wnext = 0), I.whave < I.wsize && (I.whave += Ne))), 0;
+ function Ae(ae, De, Y, Oe) {
+ var Ve, I = ae.state;
+ return I.window === null && (I.wsize = 1 << I.wbits, I.wnext = 0, I.whave = 0, I.window = new l.Buf8(I.wsize)), Oe >= I.wsize ? (l.arraySet(I.window, De, Y - I.wsize, I.wsize, 0), I.wnext = 0, I.whave = I.wsize) : (Ve = I.wsize - I.wnext, Ve > Oe && (Ve = Oe), l.arraySet(I.window, De, Y - Oe, Ve, I.wnext), Oe -= Ve, Oe ? (l.arraySet(I.window, De, Y - Oe, Oe, 0), I.wnext = Oe, I.whave = I.wsize) : (I.wnext += Ve, I.wnext === I.wsize && (I.wnext = 0), I.whave < I.wsize && (I.whave += Ve))), 0;
}
- function H(le, De) {
- var K, Oe, Ne, I, me, ge, Y, ne, Ee, He, Ke, Ve, qe, wt, nt = 0, rt, tt, yt, _t, It, Ot, vt, mt, gt = new l.Buf8(4), Ct, Mt, Ft = (
+ function Z(ae, De) {
+ var Y, Oe, Ve, I, me, ve, X, ne, Ee, He, Ke, je, qe, wt, nt = 0, rt, tt, yt, _t, It, Ot, vt, mt, pt = new l.Buf8(4), Ct, Mt, Ft = (
/* permutation of code lengths */
[16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]
);
- if (!le || !le.state || !le.output || !le.input && le.avail_in !== 0)
+ if (!ae || !ae.state || !ae.output || !ae.input && ae.avail_in !== 0)
return b;
- K = le.state, K.mode === $ && (K.mode = W), me = le.next_out, Ne = le.output, Y = le.avail_out, I = le.next_in, Oe = le.input, ge = le.avail_in, ne = K.hold, Ee = K.bits, He = ge, Ke = Y, mt = D;
+ Y = ae.state, Y.mode === z && (Y.mode = W), me = ae.next_out, Ve = ae.output, X = ae.avail_out, I = ae.next_in, Oe = ae.input, ve = ae.avail_in, ne = Y.hold, Ee = Y.bits, He = ve, Ke = X, mt = D;
e:
for (; ; )
- switch (K.mode) {
+ switch (Y.mode) {
case h:
- if (K.wrap === 0) {
- K.mode = W;
+ if (Y.wrap === 0) {
+ Y.mode = W;
break;
}
for (; Ee < 16; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- if (K.wrap & 2 && ne === 35615) {
- K.check = 0, gt[0] = ne & 255, gt[1] = ne >>> 8 & 255, K.check = _(K.check, gt, 2, 0), ne = 0, Ee = 0, K.mode = M;
+ if (Y.wrap & 2 && ne === 35615) {
+ Y.check = 0, pt[0] = ne & 255, pt[1] = ne >>> 8 & 255, Y.check = _(Y.check, pt, 2, 0), ne = 0, Ee = 0, Y.mode = M;
break;
}
- if (K.flags = 0, K.head && (K.head.done = !1), !(K.wrap & 1) || /* check if zlib header allowed */
+ if (Y.flags = 0, Y.head && (Y.head.done = !1), !(Y.wrap & 1) || /* check if zlib header allowed */
(((ne & 255) << 8) + (ne >> 8)) % 31) {
- le.msg = "incorrect header check", K.mode = re;
+ ae.msg = "incorrect header check", Y.mode = re;
break;
}
if ((ne & 15) !== a) {
- le.msg = "unknown compression method", K.mode = re;
+ ae.msg = "unknown compression method", Y.mode = re;
break;
}
- if (ne >>>= 4, Ee -= 4, vt = (ne & 15) + 8, K.wbits === 0)
- K.wbits = vt;
- else if (vt > K.wbits) {
- le.msg = "invalid window size", K.mode = re;
+ if (ne >>>= 4, Ee -= 4, vt = (ne & 15) + 8, Y.wbits === 0)
+ Y.wbits = vt;
+ else if (vt > Y.wbits) {
+ ae.msg = "invalid window size", Y.mode = re;
break;
}
- K.dmax = 1 << vt, le.adler = K.check = 1, K.mode = ne & 512 ? U : $, ne = 0, Ee = 0;
+ Y.dmax = 1 << vt, ae.adler = Y.check = 1, Y.mode = ne & 512 ? F : z, ne = 0, Ee = 0;
break;
case M:
for (; Ee < 16; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- if (K.flags = ne, (K.flags & 255) !== a) {
- le.msg = "unknown compression method", K.mode = re;
+ if (Y.flags = ne, (Y.flags & 255) !== a) {
+ ae.msg = "unknown compression method", Y.mode = re;
break;
}
- if (K.flags & 57344) {
- le.msg = "unknown header flags set", K.mode = re;
+ if (Y.flags & 57344) {
+ ae.msg = "unknown header flags set", Y.mode = re;
break;
}
- K.head && (K.head.text = ne >> 8 & 1), K.flags & 512 && (gt[0] = ne & 255, gt[1] = ne >>> 8 & 255, K.check = _(K.check, gt, 2, 0)), ne = 0, Ee = 0, K.mode = w;
+ Y.head && (Y.head.text = ne >> 8 & 1), Y.flags & 512 && (pt[0] = ne & 255, pt[1] = ne >>> 8 & 255, Y.check = _(Y.check, pt, 2, 0)), ne = 0, Ee = 0, Y.mode = w;
case w:
for (; Ee < 32; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- K.head && (K.head.time = ne), K.flags & 512 && (gt[0] = ne & 255, gt[1] = ne >>> 8 & 255, gt[2] = ne >>> 16 & 255, gt[3] = ne >>> 24 & 255, K.check = _(K.check, gt, 4, 0)), ne = 0, Ee = 0, K.mode = S;
+ Y.head && (Y.head.time = ne), Y.flags & 512 && (pt[0] = ne & 255, pt[1] = ne >>> 8 & 255, pt[2] = ne >>> 16 & 255, pt[3] = ne >>> 24 & 255, Y.check = _(Y.check, pt, 4, 0)), ne = 0, Ee = 0, Y.mode = S;
case S:
for (; Ee < 16; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- K.head && (K.head.xflags = ne & 255, K.head.os = ne >> 8), K.flags & 512 && (gt[0] = ne & 255, gt[1] = ne >>> 8 & 255, K.check = _(K.check, gt, 2, 0)), ne = 0, Ee = 0, K.mode = T;
+ Y.head && (Y.head.xflags = ne & 255, Y.head.os = ne >> 8), Y.flags & 512 && (pt[0] = ne & 255, pt[1] = ne >>> 8 & 255, Y.check = _(Y.check, pt, 2, 0)), ne = 0, Ee = 0, Y.mode = T;
case T:
- if (K.flags & 1024) {
+ if (Y.flags & 1024) {
for (; Ee < 16; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- K.length = ne, K.head && (K.head.extra_len = ne), K.flags & 512 && (gt[0] = ne & 255, gt[1] = ne >>> 8 & 255, K.check = _(K.check, gt, 2, 0)), ne = 0, Ee = 0;
+ Y.length = ne, Y.head && (Y.head.extra_len = ne), Y.flags & 512 && (pt[0] = ne & 255, pt[1] = ne >>> 8 & 255, Y.check = _(Y.check, pt, 2, 0)), ne = 0, Ee = 0;
} else
- K.head && (K.head.extra = null);
- K.mode = R;
+ Y.head && (Y.head.extra = null);
+ Y.mode = R;
case R:
- if (K.flags & 1024 && (Ve = K.length, Ve > ge && (Ve = ge), Ve && (K.head && (vt = K.head.extra_len - K.length, K.head.extra || (K.head.extra = new Array(K.head.extra_len)), l.arraySet(
- K.head.extra,
+ if (Y.flags & 1024 && (je = Y.length, je > ve && (je = ve), je && (Y.head && (vt = Y.head.extra_len - Y.length, Y.head.extra || (Y.head.extra = new Array(Y.head.extra_len)), l.arraySet(
+ Y.head.extra,
Oe,
I,
// extra field is limited to 65536 bytes
// - no need for additional size check
- Ve,
+ je,
/*len + copy > state.head.extra_max - len ? state.head.extra_max : copy,*/
vt
- )), K.flags & 512 && (K.check = _(K.check, Oe, Ve, I)), ge -= Ve, I += Ve, K.length -= Ve), K.length))
+ )), Y.flags & 512 && (Y.check = _(Y.check, Oe, je, I)), ve -= je, I += je, Y.length -= je), Y.length))
break e;
- K.length = 0, K.mode = z;
- case z:
- if (K.flags & 2048) {
- if (ge === 0)
+ Y.length = 0, Y.mode = $;
+ case $:
+ if (Y.flags & 2048) {
+ if (ve === 0)
break e;
- Ve = 0;
+ je = 0;
do
- vt = Oe[I + Ve++], K.head && vt && K.length < 65536 && (K.head.name += String.fromCharCode(vt));
- while (vt && Ve < ge);
- if (K.flags & 512 && (K.check = _(K.check, Oe, Ve, I)), ge -= Ve, I += Ve, vt)
+ vt = Oe[I + je++], Y.head && vt && Y.length < 65536 && (Y.head.name += String.fromCharCode(vt));
+ while (vt && je < ve);
+ if (Y.flags & 512 && (Y.check = _(Y.check, Oe, je, I)), ve -= je, I += je, vt)
break e;
} else
- K.head && (K.head.name = null);
- K.length = 0, K.mode = P;
+ Y.head && (Y.head.name = null);
+ Y.length = 0, Y.mode = P;
case P:
- if (K.flags & 4096) {
- if (ge === 0)
+ if (Y.flags & 4096) {
+ if (ve === 0)
break e;
- Ve = 0;
+ je = 0;
do
- vt = Oe[I + Ve++], K.head && vt && K.length < 65536 && (K.head.comment += String.fromCharCode(vt));
- while (vt && Ve < ge);
- if (K.flags & 512 && (K.check = _(K.check, Oe, Ve, I)), ge -= Ve, I += Ve, vt)
+ vt = Oe[I + je++], Y.head && vt && Y.length < 65536 && (Y.head.comment += String.fromCharCode(vt));
+ while (vt && je < ve);
+ if (Y.flags & 512 && (Y.check = _(Y.check, Oe, je, I)), ve -= je, I += je, vt)
break e;
} else
- K.head && (K.head.comment = null);
- K.mode = B;
+ Y.head && (Y.head.comment = null);
+ Y.mode = B;
case B:
- if (K.flags & 512) {
+ if (Y.flags & 512) {
for (; Ee < 16; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- if (ne !== (K.check & 65535)) {
- le.msg = "header crc mismatch", K.mode = re;
+ if (ne !== (Y.check & 65535)) {
+ ae.msg = "header crc mismatch", Y.mode = re;
break;
}
ne = 0, Ee = 0;
}
- K.head && (K.head.hcrc = K.flags >> 9 & 1, K.head.done = !0), le.adler = K.check = 0, K.mode = $;
+ Y.head && (Y.head.hcrc = Y.flags >> 9 & 1, Y.head.done = !0), ae.adler = Y.check = 0, Y.mode = z;
break;
- case U:
+ case F:
for (; Ee < 32; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- le.adler = K.check = ke(ne), ne = 0, Ee = 0, K.mode = F;
- case F:
- if (K.havedict === 0)
- return le.next_out = me, le.avail_out = Y, le.next_in = I, le.avail_in = ge, K.hold = ne, K.bits = Ee, n;
- le.adler = K.check = 1, K.mode = $;
- case $:
- if (De === C || De === L)
+ ae.adler = Y.check = Ie(ne), ne = 0, Ee = 0, Y.mode = U;
+ case U:
+ if (Y.havedict === 0)
+ return ae.next_out = me, ae.avail_out = X, ae.next_in = I, ae.avail_in = ve, Y.hold = ne, Y.bits = Ee, n;
+ ae.adler = Y.check = 1, Y.mode = z;
+ case z:
+ if (De === L || De === C)
break e;
case W:
- if (K.last) {
- ne >>>= Ee & 7, Ee -= Ee & 7, K.mode = Ie;
+ if (Y.last) {
+ ne >>>= Ee & 7, Ee -= Ee & 7, Y.mode = Pe;
break;
}
for (; Ee < 3; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- switch (K.last = ne & 1, ne >>>= 1, Ee -= 1, ne & 3) {
+ switch (Y.last = ne & 1, ne >>>= 1, Ee -= 1, ne & 3) {
case 0:
- K.mode = N;
+ Y.mode = V;
break;
case 1:
- if (Me(K), K.mode = pe, De === L) {
+ if (Me(Y), Y.mode = ge, De === C) {
ne >>>= 2, Ee -= 2;
break e;
}
break;
case 2:
- K.mode = j;
+ Y.mode = G;
break;
case 3:
- le.msg = "invalid block type", K.mode = re;
+ ae.msg = "invalid block type", Y.mode = re;
}
ne >>>= 2, Ee -= 2;
break;
- case N:
+ case V:
for (ne >>>= Ee & 7, Ee -= Ee & 7; Ee < 32; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
if ((ne & 65535) !== (ne >>> 16 ^ 65535)) {
- le.msg = "invalid stored block lengths", K.mode = re;
+ ae.msg = "invalid stored block lengths", Y.mode = re;
break;
}
- if (K.length = ne & 65535, ne = 0, Ee = 0, K.mode = G, De === L)
+ if (Y.length = ne & 65535, ne = 0, Ee = 0, Y.mode = N, De === C)
break e;
- case G:
- K.mode = k;
+ case N:
+ Y.mode = k;
case k:
- if (Ve = K.length, Ve) {
- if (Ve > ge && (Ve = ge), Ve > Y && (Ve = Y), Ve === 0)
+ if (je = Y.length, je) {
+ if (je > ve && (je = ve), je > X && (je = X), je === 0)
break e;
- l.arraySet(Ne, Oe, I, Ve, me), ge -= Ve, I += Ve, Y -= Ve, me += Ve, K.length -= Ve;
+ l.arraySet(Ve, Oe, I, je, me), ve -= je, I += je, X -= je, me += je, Y.length -= je;
break;
}
- K.mode = $;
+ Y.mode = z;
break;
- case j:
+ case G:
for (; Ee < 14; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- if (K.nlen = (ne & 31) + 257, ne >>>= 5, Ee -= 5, K.ndist = (ne & 31) + 1, ne >>>= 5, Ee -= 5, K.ncode = (ne & 15) + 4, ne >>>= 4, Ee -= 4, K.nlen > 286 || K.ndist > 30) {
- le.msg = "too many length or distance symbols", K.mode = re;
+ if (Y.nlen = (ne & 31) + 257, ne >>>= 5, Ee -= 5, Y.ndist = (ne & 31) + 1, ne >>>= 5, Ee -= 5, Y.ncode = (ne & 15) + 4, ne >>>= 4, Ee -= 4, Y.nlen > 286 || Y.ndist > 30) {
+ ae.msg = "too many length or distance symbols", Y.mode = re;
break;
}
- K.have = 0, K.mode = Q;
+ Y.have = 0, Y.mode = Q;
case Q:
- for (; K.have < K.ncode; ) {
+ for (; Y.have < Y.ncode; ) {
for (; Ee < 3; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- K.lens[Ft[K.have++]] = ne & 7, ne >>>= 3, Ee -= 3;
+ Y.lens[Ft[Y.have++]] = ne & 7, ne >>>= 3, Ee -= 3;
}
- for (; K.have < 19; )
- K.lens[Ft[K.have++]] = 0;
- if (K.lencode = K.lendyn, K.lenbits = 7, Ct = { bits: K.lenbits }, mt = o(p, K.lens, 0, 19, K.lencode, 0, K.work, Ct), K.lenbits = Ct.bits, mt) {
- le.msg = "invalid code lengths set", K.mode = re;
+ for (; Y.have < 19; )
+ Y.lens[Ft[Y.have++]] = 0;
+ if (Y.lencode = Y.lendyn, Y.lenbits = 7, Ct = { bits: Y.lenbits }, mt = o(g, Y.lens, 0, 19, Y.lencode, 0, Y.work, Ct), Y.lenbits = Ct.bits, mt) {
+ ae.msg = "invalid code lengths set", Y.mode = re;
break;
}
- K.have = 0, K.mode = ie;
+ Y.have = 0, Y.mode = ie;
case ie:
- for (; K.have < K.nlen + K.ndist; ) {
- for (; nt = K.lencode[ne & (1 << K.lenbits) - 1], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(rt <= Ee); ) {
- if (ge === 0)
+ for (; Y.have < Y.nlen + Y.ndist; ) {
+ for (; nt = Y.lencode[ne & (1 << Y.lenbits) - 1], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(rt <= Ee); ) {
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
if (yt < 16)
- ne >>>= rt, Ee -= rt, K.lens[K.have++] = yt;
+ ne >>>= rt, Ee -= rt, Y.lens[Y.have++] = yt;
else {
if (yt === 16) {
for (Mt = rt + 2; Ee < Mt; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- if (ne >>>= rt, Ee -= rt, K.have === 0) {
- le.msg = "invalid bit length repeat", K.mode = re;
+ if (ne >>>= rt, Ee -= rt, Y.have === 0) {
+ ae.msg = "invalid bit length repeat", Y.mode = re;
break;
}
- vt = K.lens[K.have - 1], Ve = 3 + (ne & 3), ne >>>= 2, Ee -= 2;
+ vt = Y.lens[Y.have - 1], je = 3 + (ne & 3), ne >>>= 2, Ee -= 2;
} else if (yt === 17) {
for (Mt = rt + 3; Ee < Mt; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- ne >>>= rt, Ee -= rt, vt = 0, Ve = 3 + (ne & 7), ne >>>= 3, Ee -= 3;
+ ne >>>= rt, Ee -= rt, vt = 0, je = 3 + (ne & 7), ne >>>= 3, Ee -= 3;
} else {
for (Mt = rt + 7; Ee < Mt; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- ne >>>= rt, Ee -= rt, vt = 0, Ve = 11 + (ne & 127), ne >>>= 7, Ee -= 7;
+ ne >>>= rt, Ee -= rt, vt = 0, je = 11 + (ne & 127), ne >>>= 7, Ee -= 7;
}
- if (K.have + Ve > K.nlen + K.ndist) {
- le.msg = "invalid bit length repeat", K.mode = re;
+ if (Y.have + je > Y.nlen + Y.ndist) {
+ ae.msg = "invalid bit length repeat", Y.mode = re;
break;
}
- for (; Ve--; )
- K.lens[K.have++] = vt;
+ for (; je--; )
+ Y.lens[Y.have++] = vt;
}
}
- if (K.mode === re)
+ if (Y.mode === re)
break;
- if (K.lens[256] === 0) {
- le.msg = "invalid code -- missing end-of-block", K.mode = re;
+ if (Y.lens[256] === 0) {
+ ae.msg = "invalid code -- missing end-of-block", Y.mode = re;
break;
}
- if (K.lenbits = 9, Ct = { bits: K.lenbits }, mt = o(E, K.lens, 0, K.nlen, K.lencode, 0, K.work, Ct), K.lenbits = Ct.bits, mt) {
- le.msg = "invalid literal/lengths set", K.mode = re;
+ if (Y.lenbits = 9, Ct = { bits: Y.lenbits }, mt = o(E, Y.lens, 0, Y.nlen, Y.lencode, 0, Y.work, Ct), Y.lenbits = Ct.bits, mt) {
+ ae.msg = "invalid literal/lengths set", Y.mode = re;
break;
}
- if (K.distbits = 6, K.distcode = K.distdyn, Ct = { bits: K.distbits }, mt = o(u, K.lens, K.nlen, K.ndist, K.distcode, 0, K.work, Ct), K.distbits = Ct.bits, mt) {
- le.msg = "invalid distances set", K.mode = re;
+ if (Y.distbits = 6, Y.distcode = Y.distdyn, Ct = { bits: Y.distbits }, mt = o(u, Y.lens, Y.nlen, Y.ndist, Y.distcode, 0, Y.work, Ct), Y.distbits = Ct.bits, mt) {
+ ae.msg = "invalid distances set", Y.mode = re;
break;
}
- if (K.mode = pe, De === L)
+ if (Y.mode = ge, De === C)
break e;
- case pe:
- K.mode = he;
- case he:
- if (ge >= 6 && Y >= 258) {
- le.next_out = me, le.avail_out = Y, le.next_in = I, le.avail_in = ge, K.hold = ne, K.bits = Ee, x(le, Ke), me = le.next_out, Ne = le.output, Y = le.avail_out, I = le.next_in, Oe = le.input, ge = le.avail_in, ne = K.hold, Ee = K.bits, K.mode === $ && (K.back = -1);
+ case ge:
+ Y.mode = le;
+ case le:
+ if (ve >= 6 && X >= 258) {
+ ae.next_out = me, ae.avail_out = X, ae.next_in = I, ae.avail_in = ve, Y.hold = ne, Y.bits = Ee, x(ae, Ke), me = ae.next_out, Ve = ae.output, X = ae.avail_out, I = ae.next_in, Oe = ae.input, ve = ae.avail_in, ne = Y.hold, Ee = Y.bits, Y.mode === z && (Y.back = -1);
break;
}
- for (K.back = 0; nt = K.lencode[ne & (1 << K.lenbits) - 1], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(rt <= Ee); ) {
- if (ge === 0)
+ for (Y.back = 0; nt = Y.lencode[ne & (1 << Y.lenbits) - 1], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(rt <= Ee); ) {
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
if (tt && !(tt & 240)) {
- for (_t = rt, It = tt, Ot = yt; nt = K.lencode[Ot + ((ne & (1 << _t + It) - 1) >> _t)], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(_t + rt <= Ee); ) {
- if (ge === 0)
+ for (_t = rt, It = tt, Ot = yt; nt = Y.lencode[Ot + ((ne & (1 << _t + It) - 1) >> _t)], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(_t + rt <= Ee); ) {
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- ne >>>= _t, Ee -= _t, K.back += _t;
+ ne >>>= _t, Ee -= _t, Y.back += _t;
}
- if (ne >>>= rt, Ee -= rt, K.back += rt, K.length = yt, tt === 0) {
- K.mode = xe;
+ if (ne >>>= rt, Ee -= rt, Y.back += rt, Y.length = yt, tt === 0) {
+ Y.mode = ye;
break;
}
if (tt & 32) {
- K.back = -1, K.mode = $;
+ Y.back = -1, Y.mode = z;
break;
}
if (tt & 64) {
- le.msg = "invalid literal/length code", K.mode = re;
+ ae.msg = "invalid literal/length code", Y.mode = re;
break;
}
- K.extra = tt & 15, K.mode = ue;
- case ue:
- if (K.extra) {
- for (Mt = K.extra; Ee < Mt; ) {
- if (ge === 0)
+ Y.extra = tt & 15, Y.mode = oe;
+ case oe:
+ if (Y.extra) {
+ for (Mt = Y.extra; Ee < Mt; ) {
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- K.length += ne & (1 << K.extra) - 1, ne >>>= K.extra, Ee -= K.extra, K.back += K.extra;
+ Y.length += ne & (1 << Y.extra) - 1, ne >>>= Y.extra, Ee -= Y.extra, Y.back += Y.extra;
}
- K.was = K.length, K.mode = se;
- case se:
- for (; nt = K.distcode[ne & (1 << K.distbits) - 1], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(rt <= Ee); ) {
- if (ge === 0)
+ Y.was = Y.length, Y.mode = he;
+ case he:
+ for (; nt = Y.distcode[ne & (1 << Y.distbits) - 1], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(rt <= Ee); ) {
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
if (!(tt & 240)) {
- for (_t = rt, It = tt, Ot = yt; nt = K.distcode[Ot + ((ne & (1 << _t + It) - 1) >> _t)], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(_t + rt <= Ee); ) {
- if (ge === 0)
+ for (_t = rt, It = tt, Ot = yt; nt = Y.distcode[Ot + ((ne & (1 << _t + It) - 1) >> _t)], rt = nt >>> 24, tt = nt >>> 16 & 255, yt = nt & 65535, !(_t + rt <= Ee); ) {
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- ne >>>= _t, Ee -= _t, K.back += _t;
+ ne >>>= _t, Ee -= _t, Y.back += _t;
}
- if (ne >>>= rt, Ee -= rt, K.back += rt, tt & 64) {
- le.msg = "invalid distance code", K.mode = re;
+ if (ne >>>= rt, Ee -= rt, Y.back += rt, tt & 64) {
+ ae.msg = "invalid distance code", Y.mode = re;
break;
}
- K.offset = yt, K.extra = tt & 15, K.mode = ae;
- case ae:
- if (K.extra) {
- for (Mt = K.extra; Ee < Mt; ) {
- if (ge === 0)
+ Y.offset = yt, Y.extra = tt & 15, Y.mode = se;
+ case se:
+ if (Y.extra) {
+ for (Mt = Y.extra; Ee < Mt; ) {
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- K.offset += ne & (1 << K.extra) - 1, ne >>>= K.extra, Ee -= K.extra, K.back += K.extra;
+ Y.offset += ne & (1 << Y.extra) - 1, ne >>>= Y.extra, Ee -= Y.extra, Y.back += Y.extra;
}
- if (K.offset > K.dmax) {
- le.msg = "invalid distance too far back", K.mode = re;
+ if (Y.offset > Y.dmax) {
+ ae.msg = "invalid distance too far back", Y.mode = re;
break;
}
- K.mode = we;
- case we:
- if (Y === 0)
+ Y.mode = xe;
+ case xe:
+ if (X === 0)
break e;
- if (Ve = Ke - Y, K.offset > Ve) {
- if (Ve = K.offset - Ve, Ve > K.whave && K.sane) {
- le.msg = "invalid distance too far back", K.mode = re;
+ if (je = Ke - X, Y.offset > je) {
+ if (je = Y.offset - je, je > Y.whave && Y.sane) {
+ ae.msg = "invalid distance too far back", Y.mode = re;
break;
}
- Ve > K.wnext ? (Ve -= K.wnext, qe = K.wsize - Ve) : qe = K.wnext - Ve, Ve > K.length && (Ve = K.length), wt = K.window;
+ je > Y.wnext ? (je -= Y.wnext, qe = Y.wsize - je) : qe = Y.wnext - je, je > Y.length && (je = Y.length), wt = Y.window;
} else
- wt = Ne, qe = me - K.offset, Ve = K.length;
- Ve > Y && (Ve = Y), Y -= Ve, K.length -= Ve;
+ wt = Ve, qe = me - Y.offset, je = Y.length;
+ je > X && (je = X), X -= je, Y.length -= je;
do
- Ne[me++] = wt[qe++];
- while (--Ve);
- K.length === 0 && (K.mode = he);
+ Ve[me++] = wt[qe++];
+ while (--je);
+ Y.length === 0 && (Y.mode = le);
break;
- case xe:
- if (Y === 0)
+ case ye:
+ if (X === 0)
break e;
- Ne[me++] = K.length, Y--, K.mode = he;
+ Ve[me++] = Y.length, X--, Y.mode = le;
break;
- case Ie:
- if (K.wrap) {
+ case Pe:
+ if (Y.wrap) {
for (; Ee < 32; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne |= Oe[I++] << Ee, Ee += 8;
+ ve--, ne |= Oe[I++] << Ee, Ee += 8;
}
- if (Ke -= Y, le.total_out += Ke, K.total += Ke, Ke && (le.adler = K.check = /*UPDATE(state.check, put - _out, _out);*/
- K.flags ? _(K.check, Ne, Ke, me - Ke) : g(K.check, Ne, Ke, me - Ke)), Ke = Y, (K.flags ? ne : ke(ne)) !== K.check) {
- le.msg = "incorrect data check", K.mode = re;
+ if (Ke -= X, ae.total_out += Ke, Y.total += Ke, Ke && (ae.adler = Y.check = /*UPDATE(state.check, put - _out, _out);*/
+ Y.flags ? _(Y.check, Ve, Ke, me - Ke) : p(Y.check, Ve, Ke, me - Ke)), Ke = X, (Y.flags ? ne : Ie(ne)) !== Y.check) {
+ ae.msg = "incorrect data check", Y.mode = re;
break;
}
ne = 0, Ee = 0;
}
- K.mode = oe;
- case oe:
- if (K.wrap && K.flags) {
+ Y.mode = de;
+ case de:
+ if (Y.wrap && Y.flags) {
for (; Ee < 32; ) {
- if (ge === 0)
+ if (ve === 0)
break e;
- ge--, ne += Oe[I++] << Ee, Ee += 8;
+ ve--, ne += Oe[I++] << Ee, Ee += 8;
}
- if (ne !== (K.total & 4294967295)) {
- le.msg = "incorrect length check", K.mode = re;
+ if (ne !== (Y.total & 4294967295)) {
+ ae.msg = "incorrect length check", Y.mode = re;
break;
}
ne = 0, Ee = 0;
}
- K.mode = ve;
- case ve:
+ Y.mode = pe;
+ case pe:
mt = r;
break e;
case re:
@@ -21815,28 +21815,28 @@ ATOM`, h);
break e;
case Se:
return c;
- case ze:
+ case ke:
default:
return b;
}
- return le.next_out = me, le.avail_out = Y, le.next_in = I, le.avail_in = ge, K.hold = ne, K.bits = Ee, (K.wsize || Ke !== le.avail_out && K.mode < re && (K.mode < Ie || De !== A)) && Ae(le, le.output, le.next_out, Ke - le.avail_out), He -= le.avail_in, Ke -= le.avail_out, le.total_in += He, le.total_out += Ke, K.total += Ke, K.wrap && Ke && (le.adler = K.check = /*UPDATE(state.check, strm.next_out - _out, _out);*/
- K.flags ? _(K.check, Ne, Ke, le.next_out - Ke) : g(K.check, Ne, Ke, le.next_out - Ke)), le.data_type = K.bits + (K.last ? 64 : 0) + (K.mode === $ ? 128 : 0) + (K.mode === pe || K.mode === G ? 256 : 0), (He === 0 && Ke === 0 || De === A) && mt === D && (mt = t), mt;
+ return ae.next_out = me, ae.avail_out = X, ae.next_in = I, ae.avail_in = ve, Y.hold = ne, Y.bits = Ee, (Y.wsize || Ke !== ae.avail_out && Y.mode < re && (Y.mode < Pe || De !== A)) && Ae(ae, ae.output, ae.next_out, Ke - ae.avail_out), He -= ae.avail_in, Ke -= ae.avail_out, ae.total_in += He, ae.total_out += Ke, Y.total += Ke, Y.wrap && Ke && (ae.adler = Y.check = /*UPDATE(state.check, strm.next_out - _out, _out);*/
+ Y.flags ? _(Y.check, Ve, Ke, ae.next_out - Ke) : p(Y.check, Ve, Ke, ae.next_out - Ke)), ae.data_type = Y.bits + (Y.last ? 64 : 0) + (Y.mode === z ? 128 : 0) + (Y.mode === ge || Y.mode === N ? 256 : 0), (He === 0 && Ke === 0 || De === A) && mt === D && (mt = t), mt;
}
- function ce(le) {
- if (!le || !le.state)
+ function ue(ae) {
+ if (!ae || !ae.state)
return b;
- var De = le.state;
- return De.window && (De.window = null), le.state = null, D;
+ var De = ae.state;
+ return De.window && (De.window = null), ae.state = null, D;
}
- function ye(le, De) {
- var K;
- return !le || !le.state || (K = le.state, !(K.wrap & 2)) ? b : (K.head = De, De.done = !1, D);
+ function we(ae, De) {
+ var Y;
+ return !ae || !ae.state || (Y = ae.state, !(Y.wrap & 2)) ? b : (Y.head = De, De.done = !1, D);
}
- function Pe(le, De) {
- var K = De.length, Oe, Ne, I;
- return !le || !le.state || (Oe = le.state, Oe.wrap !== 0 && Oe.mode !== F) ? b : Oe.mode === F && (Ne = 1, Ne = g(Ne, De, K, 0), Ne !== Oe.check) ? f : (I = Ae(le, De, K, K), I ? (Oe.mode = Se, c) : (Oe.havedict = 1, D));
+ function Te(ae, De) {
+ var Y = De.length, Oe, Ve, I;
+ return !ae || !ae.state || (Oe = ae.state, Oe.wrap !== 0 && Oe.mode !== U) ? b : Oe.mode === U && (Ve = 1, Ve = p(Ve, De, Y, 0), Ve !== Oe.check) ? f : (I = Ae(ae, De, Y, Y), I ? (Oe.mode = Se, c) : (Oe.havedict = 1, D));
}
- s.inflateReset = je, s.inflateReset2 = Fe, s.inflateResetKeep = Te, s.inflateInit = Z, s.inflateInit2 = X, s.inflate = H, s.inflateEnd = ce, s.inflateGetHeader = ye, s.inflateSetDictionary = Pe, s.inflateInfo = "pako inflate (from Nodeca project)";
+ s.inflateReset = Be, s.inflateReset2 = Ne, s.inflateResetKeep = Ue, s.inflateInit = K, s.inflateInit2 = H, s.inflate = Z, s.inflateEnd = ue, s.inflateGetHeader = we, s.inflateSetDictionary = Te, s.inflateInfo = "pako inflate (from Nodeca project)";
}
),
/***/
@@ -21849,7 +21849,7 @@ ATOM`, h);
var l = e(
/*! ../utils/common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
- ), g = 15, _ = 852, x = 592, o = 0, p = 1, E = 2, u = [
+ ), p = 15, _ = 852, x = 592, o = 0, g = 1, E = 2, u = [
/* Length codes 257..285 base */
3,
4,
@@ -21915,7 +21915,7 @@ ATOM`, h);
16,
72,
78
- ], C = [
+ ], L = [
/* Distance codes 0..29 base */
1,
2,
@@ -21949,7 +21949,7 @@ ATOM`, h);
24577,
0,
0
- ], L = [
+ ], C = [
/* Distance codes 0..29 extra */
16,
16,
@@ -21985,49 +21985,49 @@ ATOM`, h);
64
];
y.exports = function(r, n, b, f, c, t, a, h) {
- var M = h.bits, w = 0, S = 0, T = 0, R = 0, z = 0, P = 0, B = 0, U = 0, F = 0, $ = 0, W, N, G, k, j, Q = null, ie = 0, pe, he = new l.Buf16(g + 1), ue = new l.Buf16(g + 1), se = null, ae = 0, we, xe, Ie;
- for (w = 0; w <= g; w++)
- he[w] = 0;
+ var M = h.bits, w = 0, S = 0, T = 0, R = 0, $ = 0, P = 0, B = 0, F = 0, U = 0, z = 0, W, V, N, k, G, Q = null, ie = 0, ge, le = new l.Buf16(p + 1), oe = new l.Buf16(p + 1), he = null, se = 0, xe, ye, Pe;
+ for (w = 0; w <= p; w++)
+ le[w] = 0;
for (S = 0; S < f; S++)
- he[n[b + S]]++;
- for (z = M, R = g; R >= 1 && he[R] === 0; R--)
+ le[n[b + S]]++;
+ for ($ = M, R = p; R >= 1 && le[R] === 0; R--)
;
- if (z > R && (z = R), R === 0)
+ if ($ > R && ($ = R), R === 0)
return c[t++] = 20971520, c[t++] = 20971520, h.bits = 1, 0;
- for (T = 1; T < R && he[T] === 0; T++)
+ for (T = 1; T < R && le[T] === 0; T++)
;
- for (z < T && (z = T), U = 1, w = 1; w <= g; w++)
- if (U <<= 1, U -= he[w], U < 0)
+ for ($ < T && ($ = T), F = 1, w = 1; w <= p; w++)
+ if (F <<= 1, F -= le[w], F < 0)
return -1;
- if (U > 0 && (r === o || R !== 1))
+ if (F > 0 && (r === o || R !== 1))
return -1;
- for (ue[1] = 0, w = 1; w < g; w++)
- ue[w + 1] = ue[w] + he[w];
+ for (oe[1] = 0, w = 1; w < p; w++)
+ oe[w + 1] = oe[w] + le[w];
for (S = 0; S < f; S++)
- n[b + S] !== 0 && (a[ue[n[b + S]]++] = S);
- if (r === o ? (Q = se = a, pe = 19) : r === p ? (Q = u, ie -= 257, se = A, ae -= 257, pe = 256) : (Q = C, se = L, pe = -1), $ = 0, S = 0, w = T, j = t, P = z, B = 0, G = -1, F = 1 << z, k = F - 1, r === p && F > _ || r === E && F > x)
+ n[b + S] !== 0 && (a[oe[n[b + S]]++] = S);
+ if (r === o ? (Q = he = a, ge = 19) : r === g ? (Q = u, ie -= 257, he = A, se -= 257, ge = 256) : (Q = L, he = C, ge = -1), z = 0, S = 0, w = T, G = t, P = $, B = 0, N = -1, U = 1 << $, k = U - 1, r === g && U > _ || r === E && U > x)
return 1;
for (; ; ) {
- we = w - B, a[S] < pe ? (xe = 0, Ie = a[S]) : a[S] > pe ? (xe = se[ae + a[S]], Ie = Q[ie + a[S]]) : (xe = 96, Ie = 0), W = 1 << w - B, N = 1 << P, T = N;
+ xe = w - B, a[S] < ge ? (ye = 0, Pe = a[S]) : a[S] > ge ? (ye = he[se + a[S]], Pe = Q[ie + a[S]]) : (ye = 96, Pe = 0), W = 1 << w - B, V = 1 << P, T = V;
do
- N -= W, c[j + ($ >> B) + N] = we << 24 | xe << 16 | Ie | 0;
- while (N !== 0);
- for (W = 1 << w - 1; $ & W; )
+ V -= W, c[G + (z >> B) + V] = xe << 24 | ye << 16 | Pe | 0;
+ while (V !== 0);
+ for (W = 1 << w - 1; z & W; )
W >>= 1;
- if (W !== 0 ? ($ &= W - 1, $ += W) : $ = 0, S++, --he[w] === 0) {
+ if (W !== 0 ? (z &= W - 1, z += W) : z = 0, S++, --le[w] === 0) {
if (w === R)
break;
w = n[b + a[S]];
}
- if (w > z && ($ & k) !== G) {
- for (B === 0 && (B = z), j += T, P = w - B, U = 1 << P; P + B < R && (U -= he[P + B], !(U <= 0)); )
- P++, U <<= 1;
- if (F += 1 << P, r === p && F > _ || r === E && F > x)
+ if (w > $ && (z & k) !== N) {
+ for (B === 0 && (B = $), G += T, P = w - B, F = 1 << P; P + B < R && (F -= le[P + B], !(F <= 0)); )
+ P++, F <<= 1;
+ if (U += 1 << P, r === g && U > _ || r === E && U > x)
return 1;
- G = $ & k, c[G] = z << 24 | P << 16 | j - t | 0;
+ N = z & k, c[N] = $ << 24 | P << 16 | G - t | 0;
}
}
- return $ !== 0 && (c[j + $] = w - B << 24 | 4194304 | 0), h.bits = z, 0;
+ return z !== 0 && (c[G + z] = w - B << 24 | 4194304 | 0), h.bits = $, 0;
};
}
),
@@ -22070,247 +22070,247 @@ ATOM`, h);
var l = e(
/*! ../utils/common */
"./node_modules/upng-js/node_modules/pako/lib/utils/common.js"
- ), g = 4, _ = 0, x = 1, o = 2;
- function p(H) {
- for (var ce = H.length; --ce >= 0; )
- H[ce] = 0;
+ ), p = 4, _ = 0, x = 1, o = 2;
+ function g(Z) {
+ for (var ue = Z.length; --ue >= 0; )
+ Z[ue] = 0;
}
- var E = 0, u = 1, A = 2, C = 3, L = 258, D = 29, r = 256, n = r + 1 + D, b = 30, f = 19, c = 2 * n + 1, t = 15, a = 16, h = 7, M = 256, w = 16, S = 17, T = 18, R = (
+ var E = 0, u = 1, A = 2, L = 3, C = 258, D = 29, r = 256, n = r + 1 + D, b = 30, f = 19, c = 2 * n + 1, t = 15, a = 16, h = 7, M = 256, w = 16, S = 17, T = 18, R = (
/* extra bits for each length code */
[0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0]
- ), z = (
+ ), $ = (
/* extra bits for each distance code */
[0, 0, 0, 0, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13]
), P = (
/* extra bits for each bit length code */
[0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 3, 7]
- ), B = [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15], U = 512, F = new Array((n + 2) * 2);
- p(F);
- var $ = new Array(b * 2);
- p($);
- var W = new Array(U);
- p(W);
- var N = new Array(L - C + 1);
- p(N);
- var G = new Array(D);
- p(G);
+ ), B = [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15], F = 512, U = new Array((n + 2) * 2);
+ g(U);
+ var z = new Array(b * 2);
+ g(z);
+ var W = new Array(F);
+ g(W);
+ var V = new Array(C - L + 1);
+ g(V);
+ var N = new Array(D);
+ g(N);
var k = new Array(b);
- p(k);
- function j(H, ce, ye, Pe, le) {
- this.static_tree = H, this.extra_bits = ce, this.extra_base = ye, this.elems = Pe, this.max_length = le, this.has_stree = H && H.length;
+ g(k);
+ function G(Z, ue, we, Te, ae) {
+ this.static_tree = Z, this.extra_bits = ue, this.extra_base = we, this.elems = Te, this.max_length = ae, this.has_stree = Z && Z.length;
}
- var Q, ie, pe;
- function he(H, ce) {
- this.dyn_tree = H, this.max_code = 0, this.stat_desc = ce;
+ var Q, ie, ge;
+ function le(Z, ue) {
+ this.dyn_tree = Z, this.max_code = 0, this.stat_desc = ue;
}
- function ue(H) {
- return H < 256 ? W[H] : W[256 + (H >>> 7)];
+ function oe(Z) {
+ return Z < 256 ? W[Z] : W[256 + (Z >>> 7)];
}
- function se(H, ce) {
- H.pending_buf[H.pending++] = ce & 255, H.pending_buf[H.pending++] = ce >>> 8 & 255;
+ function he(Z, ue) {
+ Z.pending_buf[Z.pending++] = ue & 255, Z.pending_buf[Z.pending++] = ue >>> 8 & 255;
}
- function ae(H, ce, ye) {
- H.bi_valid > a - ye ? (H.bi_buf |= ce << H.bi_valid & 65535, se(H, H.bi_buf), H.bi_buf = ce >> a - H.bi_valid, H.bi_valid += ye - a) : (H.bi_buf |= ce << H.bi_valid & 65535, H.bi_valid += ye);
+ function se(Z, ue, we) {
+ Z.bi_valid > a - we ? (Z.bi_buf |= ue << Z.bi_valid & 65535, he(Z, Z.bi_buf), Z.bi_buf = ue >> a - Z.bi_valid, Z.bi_valid += we - a) : (Z.bi_buf |= ue << Z.bi_valid & 65535, Z.bi_valid += we);
}
- function we(H, ce, ye) {
- ae(
- H,
- ye[ce * 2],
- ye[ce * 2 + 1]
+ function xe(Z, ue, we) {
+ se(
+ Z,
+ we[ue * 2],
+ we[ue * 2 + 1]
/*.Len*/
);
}
- function xe(H, ce) {
- var ye = 0;
+ function ye(Z, ue) {
+ var we = 0;
do
- ye |= H & 1, H >>>= 1, ye <<= 1;
- while (--ce > 0);
- return ye >>> 1;
+ we |= Z & 1, Z >>>= 1, we <<= 1;
+ while (--ue > 0);
+ return we >>> 1;
}
- function Ie(H) {
- H.bi_valid === 16 ? (se(H, H.bi_buf), H.bi_buf = 0, H.bi_valid = 0) : H.bi_valid >= 8 && (H.pending_buf[H.pending++] = H.bi_buf & 255, H.bi_buf >>= 8, H.bi_valid -= 8);
+ function Pe(Z) {
+ Z.bi_valid === 16 ? (he(Z, Z.bi_buf), Z.bi_buf = 0, Z.bi_valid = 0) : Z.bi_valid >= 8 && (Z.pending_buf[Z.pending++] = Z.bi_buf & 255, Z.bi_buf >>= 8, Z.bi_valid -= 8);
}
- function oe(H, ce) {
- var ye = ce.dyn_tree, Pe = ce.max_code, le = ce.stat_desc.static_tree, De = ce.stat_desc.has_stree, K = ce.stat_desc.extra_bits, Oe = ce.stat_desc.extra_base, Ne = ce.stat_desc.max_length, I, me, ge, Y, ne, Ee, He = 0;
- for (Y = 0; Y <= t; Y++)
- H.bl_count[Y] = 0;
- for (ye[H.heap[H.heap_max] * 2 + 1] = 0, I = H.heap_max + 1; I < c; I++)
- me = H.heap[I], Y = ye[ye[me * 2 + 1] * 2 + 1] + 1, Y > Ne && (Y = Ne, He++), ye[me * 2 + 1] = Y, !(me > Pe) && (H.bl_count[Y]++, ne = 0, me >= Oe && (ne = K[me - Oe]), Ee = ye[me * 2], H.opt_len += Ee * (Y + ne), De && (H.static_len += Ee * (le[me * 2 + 1] + ne)));
+ function de(Z, ue) {
+ var we = ue.dyn_tree, Te = ue.max_code, ae = ue.stat_desc.static_tree, De = ue.stat_desc.has_stree, Y = ue.stat_desc.extra_bits, Oe = ue.stat_desc.extra_base, Ve = ue.stat_desc.max_length, I, me, ve, X, ne, Ee, He = 0;
+ for (X = 0; X <= t; X++)
+ Z.bl_count[X] = 0;
+ for (we[Z.heap[Z.heap_max] * 2 + 1] = 0, I = Z.heap_max + 1; I < c; I++)
+ me = Z.heap[I], X = we[we[me * 2 + 1] * 2 + 1] + 1, X > Ve && (X = Ve, He++), we[me * 2 + 1] = X, !(me > Te) && (Z.bl_count[X]++, ne = 0, me >= Oe && (ne = Y[me - Oe]), Ee = we[me * 2], Z.opt_len += Ee * (X + ne), De && (Z.static_len += Ee * (ae[me * 2 + 1] + ne)));
if (He !== 0) {
do {
- for (Y = Ne - 1; H.bl_count[Y] === 0; )
- Y--;
- H.bl_count[Y]--, H.bl_count[Y + 1] += 2, H.bl_count[Ne]--, He -= 2;
+ for (X = Ve - 1; Z.bl_count[X] === 0; )
+ X--;
+ Z.bl_count[X]--, Z.bl_count[X + 1] += 2, Z.bl_count[Ve]--, He -= 2;
} while (He > 0);
- for (Y = Ne; Y !== 0; Y--)
- for (me = H.bl_count[Y]; me !== 0; )
- ge = H.heap[--I], !(ge > Pe) && (ye[ge * 2 + 1] !== Y && (H.opt_len += (Y - ye[ge * 2 + 1]) * ye[ge * 2], ye[ge * 2 + 1] = Y), me--);
+ for (X = Ve; X !== 0; X--)
+ for (me = Z.bl_count[X]; me !== 0; )
+ ve = Z.heap[--I], !(ve > Te) && (we[ve * 2 + 1] !== X && (Z.opt_len += (X - we[ve * 2 + 1]) * we[ve * 2], we[ve * 2 + 1] = X), me--);
}
}
- function ve(H, ce, ye) {
- var Pe = new Array(t + 1), le = 0, De, K;
+ function pe(Z, ue, we) {
+ var Te = new Array(t + 1), ae = 0, De, Y;
for (De = 1; De <= t; De++)
- Pe[De] = le = le + ye[De - 1] << 1;
- for (K = 0; K <= ce; K++) {
- var Oe = H[K * 2 + 1];
- Oe !== 0 && (H[K * 2] = xe(Pe[Oe]++, Oe));
+ Te[De] = ae = ae + we[De - 1] << 1;
+ for (Y = 0; Y <= ue; Y++) {
+ var Oe = Z[Y * 2 + 1];
+ Oe !== 0 && (Z[Y * 2] = ye(Te[Oe]++, Oe));
}
}
function re() {
- var H, ce, ye, Pe, le, De = new Array(t + 1);
- for (ye = 0, Pe = 0; Pe < D - 1; Pe++)
- for (G[Pe] = ye, H = 0; H < 1 << R[Pe]; H++)
- N[ye++] = Pe;
- for (N[ye - 1] = Pe, le = 0, Pe = 0; Pe < 16; Pe++)
- for (k[Pe] = le, H = 0; H < 1 << z[Pe]; H++)
- W[le++] = Pe;
- for (le >>= 7; Pe < b; Pe++)
- for (k[Pe] = le << 7, H = 0; H < 1 << z[Pe] - 7; H++)
- W[256 + le++] = Pe;
- for (ce = 0; ce <= t; ce++)
- De[ce] = 0;
- for (H = 0; H <= 143; )
- F[H * 2 + 1] = 8, H++, De[8]++;
- for (; H <= 255; )
- F[H * 2 + 1] = 9, H++, De[9]++;
- for (; H <= 279; )
- F[H * 2 + 1] = 7, H++, De[7]++;
- for (; H <= 287; )
- F[H * 2 + 1] = 8, H++, De[8]++;
- for (ve(F, n + 1, De), H = 0; H < b; H++)
- $[H * 2 + 1] = 5, $[H * 2] = xe(H, 5);
- Q = new j(F, R, r + 1, n, t), ie = new j($, z, 0, b, t), pe = new j(new Array(0), P, 0, f, h);
+ var Z, ue, we, Te, ae, De = new Array(t + 1);
+ for (we = 0, Te = 0; Te < D - 1; Te++)
+ for (N[Te] = we, Z = 0; Z < 1 << R[Te]; Z++)
+ V[we++] = Te;
+ for (V[we - 1] = Te, ae = 0, Te = 0; Te < 16; Te++)
+ for (k[Te] = ae, Z = 0; Z < 1 << $[Te]; Z++)
+ W[ae++] = Te;
+ for (ae >>= 7; Te < b; Te++)
+ for (k[Te] = ae << 7, Z = 0; Z < 1 << $[Te] - 7; Z++)
+ W[256 + ae++] = Te;
+ for (ue = 0; ue <= t; ue++)
+ De[ue] = 0;
+ for (Z = 0; Z <= 143; )
+ U[Z * 2 + 1] = 8, Z++, De[8]++;
+ for (; Z <= 255; )
+ U[Z * 2 + 1] = 9, Z++, De[9]++;
+ for (; Z <= 279; )
+ U[Z * 2 + 1] = 7, Z++, De[7]++;
+ for (; Z <= 287; )
+ U[Z * 2 + 1] = 8, Z++, De[8]++;
+ for (pe(U, n + 1, De), Z = 0; Z < b; Z++)
+ z[Z * 2 + 1] = 5, z[Z * 2] = ye(Z, 5);
+ Q = new G(U, R, r + 1, n, t), ie = new G(z, $, 0, b, t), ge = new G(new Array(0), P, 0, f, h);
}
- function Se(H) {
- var ce;
- for (ce = 0; ce < n; ce++)
- H.dyn_ltree[ce * 2] = 0;
- for (ce = 0; ce < b; ce++)
- H.dyn_dtree[ce * 2] = 0;
- for (ce = 0; ce < f; ce++)
- H.bl_tree[ce * 2] = 0;
- H.dyn_ltree[M * 2] = 1, H.opt_len = H.static_len = 0, H.last_lit = H.matches = 0;
+ function Se(Z) {
+ var ue;
+ for (ue = 0; ue < n; ue++)
+ Z.dyn_ltree[ue * 2] = 0;
+ for (ue = 0; ue < b; ue++)
+ Z.dyn_dtree[ue * 2] = 0;
+ for (ue = 0; ue < f; ue++)
+ Z.bl_tree[ue * 2] = 0;
+ Z.dyn_ltree[M * 2] = 1, Z.opt_len = Z.static_len = 0, Z.last_lit = Z.matches = 0;
}
- function ze(H) {
- H.bi_valid > 8 ? se(H, H.bi_buf) : H.bi_valid > 0 && (H.pending_buf[H.pending++] = H.bi_buf), H.bi_buf = 0, H.bi_valid = 0;
+ function ke(Z) {
+ Z.bi_valid > 8 ? he(Z, Z.bi_buf) : Z.bi_valid > 0 && (Z.pending_buf[Z.pending++] = Z.bi_buf), Z.bi_buf = 0, Z.bi_valid = 0;
}
- function Ge(H, ce, ye, Pe) {
- ze(H), Pe && (se(H, ye), se(H, ~ye)), l.arraySet(H.pending_buf, H.window, ce, ye, H.pending), H.pending += ye;
+ function $e(Z, ue, we, Te) {
+ ke(Z), Te && (he(Z, we), he(Z, ~we)), l.arraySet(Z.pending_buf, Z.window, ue, we, Z.pending), Z.pending += we;
}
- function $e(H, ce, ye, Pe) {
- var le = ce * 2, De = ye * 2;
- return H[le] < H[De] || H[le] === H[De] && Pe[ce] <= Pe[ye];
+ function ze(Z, ue, we, Te) {
+ var ae = ue * 2, De = we * 2;
+ return Z[ae] < Z[De] || Z[ae] === Z[De] && Te[ue] <= Te[we];
}
- function Re(H, ce, ye) {
- for (var Pe = H.heap[ye], le = ye << 1; le <= H.heap_len && (le < H.heap_len && $e(ce, H.heap[le + 1], H.heap[le], H.depth) && le++, !$e(ce, Pe, H.heap[le], H.depth)); )
- H.heap[ye] = H.heap[le], ye = le, le <<= 1;
- H.heap[ye] = Pe;
+ function Re(Z, ue, we) {
+ for (var Te = Z.heap[we], ae = we << 1; ae <= Z.heap_len && (ae < Z.heap_len && ze(ue, Z.heap[ae + 1], Z.heap[ae], Z.depth) && ae++, !ze(ue, Te, Z.heap[ae], Z.depth)); )
+ Z.heap[we] = Z.heap[ae], we = ae, ae <<= 1;
+ Z.heap[we] = Te;
}
- function Be(H, ce, ye) {
- var Pe, le, De = 0, K, Oe;
- if (H.last_lit !== 0)
+ function Fe(Z, ue, we) {
+ var Te, ae, De = 0, Y, Oe;
+ if (Z.last_lit !== 0)
do
- Pe = H.pending_buf[H.d_buf + De * 2] << 8 | H.pending_buf[H.d_buf + De * 2 + 1], le = H.pending_buf[H.l_buf + De], De++, Pe === 0 ? we(H, le, ce) : (K = N[le], we(H, K + r + 1, ce), Oe = R[K], Oe !== 0 && (le -= G[K], ae(H, le, Oe)), Pe--, K = ue(Pe), we(H, K, ye), Oe = z[K], Oe !== 0 && (Pe -= k[K], ae(H, Pe, Oe)));
- while (De < H.last_lit);
- we(H, M, ce);
+ Te = Z.pending_buf[Z.d_buf + De * 2] << 8 | Z.pending_buf[Z.d_buf + De * 2 + 1], ae = Z.pending_buf[Z.l_buf + De], De++, Te === 0 ? xe(Z, ae, ue) : (Y = V[ae], xe(Z, Y + r + 1, ue), Oe = R[Y], Oe !== 0 && (ae -= N[Y], se(Z, ae, Oe)), Te--, Y = oe(Te), xe(Z, Y, we), Oe = $[Y], Oe !== 0 && (Te -= k[Y], se(Z, Te, Oe)));
+ while (De < Z.last_lit);
+ xe(Z, M, ue);
}
- function ke(H, ce) {
- var ye = ce.dyn_tree, Pe = ce.stat_desc.static_tree, le = ce.stat_desc.has_stree, De = ce.stat_desc.elems, K, Oe, Ne = -1, I;
- for (H.heap_len = 0, H.heap_max = c, K = 0; K < De; K++)
- ye[K * 2] !== 0 ? (H.heap[++H.heap_len] = Ne = K, H.depth[K] = 0) : ye[K * 2 + 1] = 0;
- for (; H.heap_len < 2; )
- I = H.heap[++H.heap_len] = Ne < 2 ? ++Ne : 0, ye[I * 2] = 1, H.depth[I] = 0, H.opt_len--, le && (H.static_len -= Pe[I * 2 + 1]);
- for (ce.max_code = Ne, K = H.heap_len >> 1; K >= 1; K--)
- Re(H, ye, K);
+ function Ie(Z, ue) {
+ var we = ue.dyn_tree, Te = ue.stat_desc.static_tree, ae = ue.stat_desc.has_stree, De = ue.stat_desc.elems, Y, Oe, Ve = -1, I;
+ for (Z.heap_len = 0, Z.heap_max = c, Y = 0; Y < De; Y++)
+ we[Y * 2] !== 0 ? (Z.heap[++Z.heap_len] = Ve = Y, Z.depth[Y] = 0) : we[Y * 2 + 1] = 0;
+ for (; Z.heap_len < 2; )
+ I = Z.heap[++Z.heap_len] = Ve < 2 ? ++Ve : 0, we[I * 2] = 1, Z.depth[I] = 0, Z.opt_len--, ae && (Z.static_len -= Te[I * 2 + 1]);
+ for (ue.max_code = Ve, Y = Z.heap_len >> 1; Y >= 1; Y--)
+ Re(Z, we, Y);
I = De;
do
- K = H.heap[
+ Y = Z.heap[
1
/*SMALLEST*/
- ], H.heap[
+ ], Z.heap[
1
/*SMALLEST*/
- ] = H.heap[H.heap_len--], Re(
- H,
- ye,
+ ] = Z.heap[Z.heap_len--], Re(
+ Z,
+ we,
1
/*SMALLEST*/
- ), Oe = H.heap[
+ ), Oe = Z.heap[
1
/*SMALLEST*/
- ], H.heap[--H.heap_max] = K, H.heap[--H.heap_max] = Oe, ye[I * 2] = ye[K * 2] + ye[Oe * 2], H.depth[I] = (H.depth[K] >= H.depth[Oe] ? H.depth[K] : H.depth[Oe]) + 1, ye[K * 2 + 1] = ye[Oe * 2 + 1] = I, H.heap[
+ ], Z.heap[--Z.heap_max] = Y, Z.heap[--Z.heap_max] = Oe, we[I * 2] = we[Y * 2] + we[Oe * 2], Z.depth[I] = (Z.depth[Y] >= Z.depth[Oe] ? Z.depth[Y] : Z.depth[Oe]) + 1, we[Y * 2 + 1] = we[Oe * 2 + 1] = I, Z.heap[
1
/*SMALLEST*/
] = I++, Re(
- H,
- ye,
+ Z,
+ we,
1
/*SMALLEST*/
);
- while (H.heap_len >= 2);
- H.heap[--H.heap_max] = H.heap[
+ while (Z.heap_len >= 2);
+ Z.heap[--Z.heap_max] = Z.heap[
1
/*SMALLEST*/
- ], oe(H, ce), ve(ye, Ne, H.bl_count);
+ ], de(Z, ue), pe(we, Ve, Z.bl_count);
}
- function We(H, ce, ye) {
- var Pe, le = -1, De, K = ce[0 * 2 + 1], Oe = 0, Ne = 7, I = 4;
- for (K === 0 && (Ne = 138, I = 3), ce[(ye + 1) * 2 + 1] = 65535, Pe = 0; Pe <= ye; Pe++)
- De = K, K = ce[(Pe + 1) * 2 + 1], !(++Oe < Ne && De === K) && (Oe < I ? H.bl_tree[De * 2] += Oe : De !== 0 ? (De !== le && H.bl_tree[De * 2]++, H.bl_tree[w * 2]++) : Oe <= 10 ? H.bl_tree[S * 2]++ : H.bl_tree[T * 2]++, Oe = 0, le = De, K === 0 ? (Ne = 138, I = 3) : De === K ? (Ne = 6, I = 3) : (Ne = 7, I = 4));
+ function We(Z, ue, we) {
+ var Te, ae = -1, De, Y = ue[0 * 2 + 1], Oe = 0, Ve = 7, I = 4;
+ for (Y === 0 && (Ve = 138, I = 3), ue[(we + 1) * 2 + 1] = 65535, Te = 0; Te <= we; Te++)
+ De = Y, Y = ue[(Te + 1) * 2 + 1], !(++Oe < Ve && De === Y) && (Oe < I ? Z.bl_tree[De * 2] += Oe : De !== 0 ? (De !== ae && Z.bl_tree[De * 2]++, Z.bl_tree[w * 2]++) : Oe <= 10 ? Z.bl_tree[S * 2]++ : Z.bl_tree[T * 2]++, Oe = 0, ae = De, Y === 0 ? (Ve = 138, I = 3) : De === Y ? (Ve = 6, I = 3) : (Ve = 7, I = 4));
}
- function Te(H, ce, ye) {
- var Pe, le = -1, De, K = ce[0 * 2 + 1], Oe = 0, Ne = 7, I = 4;
- for (K === 0 && (Ne = 138, I = 3), Pe = 0; Pe <= ye; Pe++)
- if (De = K, K = ce[(Pe + 1) * 2 + 1], !(++Oe < Ne && De === K)) {
+ function Ue(Z, ue, we) {
+ var Te, ae = -1, De, Y = ue[0 * 2 + 1], Oe = 0, Ve = 7, I = 4;
+ for (Y === 0 && (Ve = 138, I = 3), Te = 0; Te <= we; Te++)
+ if (De = Y, Y = ue[(Te + 1) * 2 + 1], !(++Oe < Ve && De === Y)) {
if (Oe < I)
do
- we(H, De, H.bl_tree);
+ xe(Z, De, Z.bl_tree);
while (--Oe !== 0);
else
- De !== 0 ? (De !== le && (we(H, De, H.bl_tree), Oe--), we(H, w, H.bl_tree), ae(H, Oe - 3, 2)) : Oe <= 10 ? (we(H, S, H.bl_tree), ae(H, Oe - 3, 3)) : (we(H, T, H.bl_tree), ae(H, Oe - 11, 7));
- Oe = 0, le = De, K === 0 ? (Ne = 138, I = 3) : De === K ? (Ne = 6, I = 3) : (Ne = 7, I = 4);
+ De !== 0 ? (De !== ae && (xe(Z, De, Z.bl_tree), Oe--), xe(Z, w, Z.bl_tree), se(Z, Oe - 3, 2)) : Oe <= 10 ? (xe(Z, S, Z.bl_tree), se(Z, Oe - 3, 3)) : (xe(Z, T, Z.bl_tree), se(Z, Oe - 11, 7));
+ Oe = 0, ae = De, Y === 0 ? (Ve = 138, I = 3) : De === Y ? (Ve = 6, I = 3) : (Ve = 7, I = 4);
}
}
- function je(H) {
- var ce;
- for (We(H, H.dyn_ltree, H.l_desc.max_code), We(H, H.dyn_dtree, H.d_desc.max_code), ke(H, H.bl_desc), ce = f - 1; ce >= 3 && H.bl_tree[B[ce] * 2 + 1] === 0; ce--)
+ function Be(Z) {
+ var ue;
+ for (We(Z, Z.dyn_ltree, Z.l_desc.max_code), We(Z, Z.dyn_dtree, Z.d_desc.max_code), Ie(Z, Z.bl_desc), ue = f - 1; ue >= 3 && Z.bl_tree[B[ue] * 2 + 1] === 0; ue--)
;
- return H.opt_len += 3 * (ce + 1) + 5 + 5 + 4, ce;
+ return Z.opt_len += 3 * (ue + 1) + 5 + 5 + 4, ue;
}
- function Fe(H, ce, ye, Pe) {
- var le;
- for (ae(H, ce - 257, 5), ae(H, ye - 1, 5), ae(H, Pe - 4, 4), le = 0; le < Pe; le++)
- ae(H, H.bl_tree[B[le] * 2 + 1], 3);
- Te(H, H.dyn_ltree, ce - 1), Te(H, H.dyn_dtree, ye - 1);
+ function Ne(Z, ue, we, Te) {
+ var ae;
+ for (se(Z, ue - 257, 5), se(Z, we - 1, 5), se(Z, Te - 4, 4), ae = 0; ae < Te; ae++)
+ se(Z, Z.bl_tree[B[ae] * 2 + 1], 3);
+ Ue(Z, Z.dyn_ltree, ue - 1), Ue(Z, Z.dyn_dtree, we - 1);
}
- function X(H) {
- var ce = 4093624447, ye;
- for (ye = 0; ye <= 31; ye++, ce >>>= 1)
- if (ce & 1 && H.dyn_ltree[ye * 2] !== 0)
+ function H(Z) {
+ var ue = 4093624447, we;
+ for (we = 0; we <= 31; we++, ue >>>= 1)
+ if (ue & 1 && Z.dyn_ltree[we * 2] !== 0)
return _;
- if (H.dyn_ltree[18] !== 0 || H.dyn_ltree[20] !== 0 || H.dyn_ltree[26] !== 0)
+ if (Z.dyn_ltree[18] !== 0 || Z.dyn_ltree[20] !== 0 || Z.dyn_ltree[26] !== 0)
return x;
- for (ye = 32; ye < r; ye++)
- if (H.dyn_ltree[ye * 2] !== 0)
+ for (we = 32; we < r; we++)
+ if (Z.dyn_ltree[we * 2] !== 0)
return x;
return _;
}
- var Z = !1;
- function q(H) {
- Z || (re(), Z = !0), H.l_desc = new he(H.dyn_ltree, Q), H.d_desc = new he(H.dyn_dtree, ie), H.bl_desc = new he(H.bl_tree, pe), H.bi_buf = 0, H.bi_valid = 0, Se(H);
+ var K = !1;
+ function q(Z) {
+ K || (re(), K = !0), Z.l_desc = new le(Z.dyn_ltree, Q), Z.d_desc = new le(Z.dyn_dtree, ie), Z.bl_desc = new le(Z.bl_tree, ge), Z.bi_buf = 0, Z.bi_valid = 0, Se(Z);
}
- function fe(H, ce, ye, Pe) {
- ae(H, (E << 1) + (Pe ? 1 : 0), 3), Ge(H, ce, ye, !0);
+ function fe(Z, ue, we, Te) {
+ se(Z, (E << 1) + (Te ? 1 : 0), 3), $e(Z, ue, we, !0);
}
- function _e(H) {
- ae(H, u << 1, 3), we(H, M, F), Ie(H);
+ function _e(Z) {
+ se(Z, u << 1, 3), xe(Z, M, U), Pe(Z);
}
- function Me(H, ce, ye, Pe) {
- var le, De, K = 0;
- H.level > 0 ? (H.strm.data_type === o && (H.strm.data_type = X(H)), ke(H, H.l_desc), ke(H, H.d_desc), K = je(H), le = H.opt_len + 3 + 7 >>> 3, De = H.static_len + 3 + 7 >>> 3, De <= le && (le = De)) : le = De = ye + 5, ye + 4 <= le && ce !== -1 ? fe(H, ce, ye, Pe) : H.strategy === g || De === le ? (ae(H, (u << 1) + (Pe ? 1 : 0), 3), Be(H, F, $)) : (ae(H, (A << 1) + (Pe ? 1 : 0), 3), Fe(H, H.l_desc.max_code + 1, H.d_desc.max_code + 1, K + 1), Be(H, H.dyn_ltree, H.dyn_dtree)), Se(H), Pe && ze(H);
+ function Me(Z, ue, we, Te) {
+ var ae, De, Y = 0;
+ Z.level > 0 ? (Z.strm.data_type === o && (Z.strm.data_type = H(Z)), Ie(Z, Z.l_desc), Ie(Z, Z.d_desc), Y = Be(Z), ae = Z.opt_len + 3 + 7 >>> 3, De = Z.static_len + 3 + 7 >>> 3, De <= ae && (ae = De)) : ae = De = we + 5, we + 4 <= ae && ue !== -1 ? fe(Z, ue, we, Te) : Z.strategy === p || De === ae ? (se(Z, (u << 1) + (Te ? 1 : 0), 3), Fe(Z, U, z)) : (se(Z, (A << 1) + (Te ? 1 : 0), 3), Ne(Z, Z.l_desc.max_code + 1, Z.d_desc.max_code + 1, Y + 1), Fe(Z, Z.dyn_ltree, Z.dyn_dtree)), Se(Z), Te && ke(Z);
}
- function Ae(H, ce, ye) {
- return H.pending_buf[H.d_buf + H.last_lit * 2] = ce >>> 8 & 255, H.pending_buf[H.d_buf + H.last_lit * 2 + 1] = ce & 255, H.pending_buf[H.l_buf + H.last_lit] = ye & 255, H.last_lit++, ce === 0 ? H.dyn_ltree[ye * 2]++ : (H.matches++, ce--, H.dyn_ltree[(N[ye] + r + 1) * 2]++, H.dyn_dtree[ue(ce) * 2]++), H.last_lit === H.lit_bufsize - 1;
+ function Ae(Z, ue, we) {
+ return Z.pending_buf[Z.d_buf + Z.last_lit * 2] = ue >>> 8 & 255, Z.pending_buf[Z.d_buf + Z.last_lit * 2 + 1] = ue & 255, Z.pending_buf[Z.l_buf + Z.last_lit] = we & 255, Z.last_lit++, ue === 0 ? Z.dyn_ltree[we * 2]++ : (Z.matches++, ue--, Z.dyn_ltree[(V[we] + r + 1) * 2]++, Z.dyn_dtree[oe(ue) * 2]++), Z.last_lit === Z.lit_bufsize - 1;
}
s._tr_init = q, s._tr_stored_block = fe, s._tr_flush_block = Me, s._tr_tally = Ae, s._tr_align = _e;
}
@@ -22343,8 +22343,8 @@ ATOM`, h);
else {
var l = self.ps;
l.initparm(s.expandedExtent, e != 1, self.volume), l.fillvoxels(self.atomData, s.extendedAtoms), l.buildboundary(), (e === 4 || e === 2) && (l.fastdistancemap(), l.boundingatom(!1), l.fillvoxelswaals(self.atomData, s.extendedAtoms)), l.marchingcube(e);
- var g = l.getFacesAndVertices(s.atomsToShow);
- self.postMessage(g);
+ var p = l.getFacesAndVertices(s.atomsToShow);
+ self.postMessage(p);
}
};
}).toString().replace(/(^.*?\{|\}$)/g, ""), $3Dmol.workerString += `;
@@ -22379,116 +22379,116 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
(function(e, l) {
l(s);
})(this, function(e) {
- function l(X, Z, q) {
- for (var fe = (X.byteLength, 0), _e = q.length; _e > fe; fe++) {
+ function l(H, K, q) {
+ for (var fe = (H.byteLength, 0), _e = q.length; _e > fe; fe++) {
var Me = q.charCodeAt(fe);
if (128 > Me)
- X.setUint8(Z++, Me >>> 0 & 127 | 0);
+ H.setUint8(K++, Me >>> 0 & 127 | 0);
else if (2048 > Me)
- X.setUint8(Z++, Me >>> 6 & 31 | 192), X.setUint8(Z++, Me >>> 0 & 63 | 128);
+ H.setUint8(K++, Me >>> 6 & 31 | 192), H.setUint8(K++, Me >>> 0 & 63 | 128);
else if (65536 > Me)
- X.setUint8(Z++, Me >>> 12 & 15 | 224), X.setUint8(Z++, Me >>> 6 & 63 | 128), X.setUint8(Z++, Me >>> 0 & 63 | 128);
+ H.setUint8(K++, Me >>> 12 & 15 | 224), H.setUint8(K++, Me >>> 6 & 63 | 128), H.setUint8(K++, Me >>> 0 & 63 | 128);
else {
if (!(1114112 > Me))
throw new Error("bad codepoint " + Me);
- X.setUint8(Z++, Me >>> 18 & 7 | 240), X.setUint8(Z++, Me >>> 12 & 63 | 128), X.setUint8(Z++, Me >>> 6 & 63 | 128), X.setUint8(Z++, Me >>> 0 & 63 | 128);
+ H.setUint8(K++, Me >>> 18 & 7 | 240), H.setUint8(K++, Me >>> 12 & 63 | 128), H.setUint8(K++, Me >>> 6 & 63 | 128), H.setUint8(K++, Me >>> 0 & 63 | 128);
}
}
}
- function g(X) {
- for (var Z = 0, q = 0, fe = X.length; fe > q; q++) {
- var _e = X.charCodeAt(q);
+ function p(H) {
+ for (var K = 0, q = 0, fe = H.length; fe > q; q++) {
+ var _e = H.charCodeAt(q);
if (128 > _e)
- Z += 1;
+ K += 1;
else if (2048 > _e)
- Z += 2;
+ K += 2;
else if (65536 > _e)
- Z += 3;
+ K += 3;
else {
if (!(1114112 > _e))
throw new Error("bad codepoint " + _e);
- Z += 4;
+ K += 4;
}
}
- return Z;
+ return K;
}
- function _(X, Z, q) {
- var fe = typeof X;
+ function _(H, K, q) {
+ var fe = typeof H;
if (fe === "string") {
- var _e = g(X);
+ var _e = p(H);
if (32 > _e)
- return Z.setUint8(q, 160 | _e), l(Z, q + 1, X), 1 + _e;
+ return K.setUint8(q, 160 | _e), l(K, q + 1, H), 1 + _e;
if (256 > _e)
- return Z.setUint8(q, 217), Z.setUint8(q + 1, _e), l(Z, q + 2, X), 2 + _e;
+ return K.setUint8(q, 217), K.setUint8(q + 1, _e), l(K, q + 2, H), 2 + _e;
if (65536 > _e)
- return Z.setUint8(q, 218), Z.setUint16(q + 1, _e), l(Z, q + 3, X), 3 + _e;
+ return K.setUint8(q, 218), K.setUint16(q + 1, _e), l(K, q + 3, H), 3 + _e;
if (4294967296 > _e)
- return Z.setUint8(q, 219), Z.setUint32(q + 1, _e), l(Z, q + 5, X), 5 + _e;
+ return K.setUint8(q, 219), K.setUint32(q + 1, _e), l(K, q + 5, H), 5 + _e;
}
- if (X instanceof Uint8Array) {
- var _e = X.byteLength, Me = new Uint8Array(Z.buffer);
+ if (H instanceof Uint8Array) {
+ var _e = H.byteLength, Me = new Uint8Array(K.buffer);
if (256 > _e)
- return Z.setUint8(q, 196), Z.setUint8(q + 1, _e), Me.set(X, q + 2), 2 + _e;
+ return K.setUint8(q, 196), K.setUint8(q + 1, _e), Me.set(H, q + 2), 2 + _e;
if (65536 > _e)
- return Z.setUint8(q, 197), Z.setUint16(q + 1, _e), Me.set(X, q + 3), 3 + _e;
+ return K.setUint8(q, 197), K.setUint16(q + 1, _e), Me.set(H, q + 3), 3 + _e;
if (4294967296 > _e)
- return Z.setUint8(q, 198), Z.setUint32(q + 1, _e), Me.set(X, q + 5), 5 + _e;
+ return K.setUint8(q, 198), K.setUint32(q + 1, _e), Me.set(H, q + 5), 5 + _e;
}
if (fe === "number") {
- if (!isFinite(X))
- throw new Error("Number not finite: " + X);
- if (Math.floor(X) !== X)
- return Z.setUint8(q, 203), Z.setFloat64(q + 1, X), 9;
- if (X >= 0) {
- if (128 > X)
- return Z.setUint8(q, X), 1;
- if (256 > X)
- return Z.setUint8(q, 204), Z.setUint8(q + 1, X), 2;
- if (65536 > X)
- return Z.setUint8(q, 205), Z.setUint16(q + 1, X), 3;
- if (4294967296 > X)
- return Z.setUint8(q, 206), Z.setUint32(q + 1, X), 5;
- throw new Error("Number too big 0x" + X.toString(16));
+ if (!isFinite(H))
+ throw new Error("Number not finite: " + H);
+ if (Math.floor(H) !== H)
+ return K.setUint8(q, 203), K.setFloat64(q + 1, H), 9;
+ if (H >= 0) {
+ if (128 > H)
+ return K.setUint8(q, H), 1;
+ if (256 > H)
+ return K.setUint8(q, 204), K.setUint8(q + 1, H), 2;
+ if (65536 > H)
+ return K.setUint8(q, 205), K.setUint16(q + 1, H), 3;
+ if (4294967296 > H)
+ return K.setUint8(q, 206), K.setUint32(q + 1, H), 5;
+ throw new Error("Number too big 0x" + H.toString(16));
}
- if (X >= -32)
- return Z.setInt8(q, X), 1;
- if (X >= -128)
- return Z.setUint8(q, 208), Z.setInt8(q + 1, X), 2;
- if (X >= -32768)
- return Z.setUint8(q, 209), Z.setInt16(q + 1, X), 3;
- if (X >= -2147483648)
- return Z.setUint8(q, 210), Z.setInt32(q + 1, X), 5;
- throw new Error("Number too small -0x" + (-X).toString(16).substr(1));
- }
- if (X === null)
- return Z.setUint8(q, 192), 1;
+ if (H >= -32)
+ return K.setInt8(q, H), 1;
+ if (H >= -128)
+ return K.setUint8(q, 208), K.setInt8(q + 1, H), 2;
+ if (H >= -32768)
+ return K.setUint8(q, 209), K.setInt16(q + 1, H), 3;
+ if (H >= -2147483648)
+ return K.setUint8(q, 210), K.setInt32(q + 1, H), 5;
+ throw new Error("Number too small -0x" + (-H).toString(16).substr(1));
+ }
+ if (H === null)
+ return K.setUint8(q, 192), 1;
if (fe === "boolean")
- return Z.setUint8(q, X ? 195 : 194), 1;
+ return K.setUint8(q, H ? 195 : 194), 1;
if (fe === "object") {
- var _e, ce = 0, Ae = Array.isArray(X);
+ var _e, ue = 0, Ae = Array.isArray(H);
if (Ae)
- _e = X.length;
- else {
- var H = Object.keys(X);
_e = H.length;
+ else {
+ var Z = Object.keys(H);
+ _e = Z.length;
}
- var ce;
- if (16 > _e ? (Z.setUint8(q, _e | (Ae ? 144 : 128)), ce = 1) : 65536 > _e ? (Z.setUint8(q, Ae ? 220 : 222), Z.setUint16(q + 1, _e), ce = 3) : 4294967296 > _e && (Z.setUint8(q, Ae ? 221 : 223), Z.setUint32(q + 1, _e), ce = 5), Ae)
- for (var ye = 0; _e > ye; ye++)
- ce += _(X[ye], Z, q + ce);
+ var ue;
+ if (16 > _e ? (K.setUint8(q, _e | (Ae ? 144 : 128)), ue = 1) : 65536 > _e ? (K.setUint8(q, Ae ? 220 : 222), K.setUint16(q + 1, _e), ue = 3) : 4294967296 > _e && (K.setUint8(q, Ae ? 221 : 223), K.setUint32(q + 1, _e), ue = 5), Ae)
+ for (var we = 0; _e > we; we++)
+ ue += _(H[we], K, q + ue);
else
- for (var ye = 0; _e > ye; ye++) {
- var Pe = H[ye];
- ce += _(Pe, Z, q + ce), ce += _(X[Pe], Z, q + ce);
+ for (var we = 0; _e > we; we++) {
+ var Te = Z[we];
+ ue += _(Te, K, q + ue), ue += _(H[Te], K, q + ue);
}
- return ce;
+ return ue;
}
throw new Error("Unknown type " + fe);
}
- function x(X) {
- var Z = typeof X;
- if (Z === "string") {
- var q = g(X);
+ function x(H) {
+ var K = typeof H;
+ if (K === "string") {
+ var q = p(H);
if (32 > q)
return 1 + q;
if (256 > q)
@@ -22498,8 +22498,8 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
if (4294967296 > q)
return 5 + q;
}
- if (X instanceof Uint8Array) {
- var q = X.byteLength;
+ if (H instanceof Uint8Array) {
+ var q = H.byteLength;
if (256 > q)
return 2 + q;
if (65536 > q)
@@ -22507,44 +22507,44 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
if (4294967296 > q)
return 5 + q;
}
- if (Z === "number") {
- if (Math.floor(X) !== X)
+ if (K === "number") {
+ if (Math.floor(H) !== H)
return 9;
- if (X >= 0) {
- if (128 > X)
+ if (H >= 0) {
+ if (128 > H)
return 1;
- if (256 > X)
+ if (256 > H)
return 2;
- if (65536 > X)
+ if (65536 > H)
return 3;
- if (4294967296 > X)
+ if (4294967296 > H)
return 5;
- throw new Error("Number too big 0x" + X.toString(16));
+ throw new Error("Number too big 0x" + H.toString(16));
}
- if (X >= -32)
+ if (H >= -32)
return 1;
- if (X >= -128)
+ if (H >= -128)
return 2;
- if (X >= -32768)
+ if (H >= -32768)
return 3;
- if (X >= -2147483648)
+ if (H >= -2147483648)
return 5;
- throw new Error("Number too small -0x" + X.toString(16).substr(1));
+ throw new Error("Number too small -0x" + H.toString(16).substr(1));
}
- if (Z === "boolean" || X === null)
+ if (K === "boolean" || H === null)
return 1;
- if (Z === "object") {
+ if (K === "object") {
var q, fe = 0;
- if (Array.isArray(X)) {
- q = X.length;
+ if (Array.isArray(H)) {
+ q = H.length;
for (var _e = 0; q > _e; _e++)
- fe += x(X[_e]);
+ fe += x(H[_e]);
} else {
- var Me = Object.keys(X);
+ var Me = Object.keys(H);
q = Me.length;
for (var _e = 0; q > _e; _e++) {
var Ae = Me[_e];
- fe += x(Ae) + x(X[Ae]);
+ fe += x(Ae) + x(H[Ae]);
}
}
if (16 > q)
@@ -22555,263 +22555,263 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
return 5 + fe;
throw new Error("Array or object too long 0x" + q.toString(16));
}
- throw new Error("Unknown type " + Z);
+ throw new Error("Unknown type " + K);
}
- function o(X) {
- var Z = new ArrayBuffer(x(X)), q = new DataView(Z);
- return _(X, q, 0), new Uint8Array(Z);
+ function o(H) {
+ var K = new ArrayBuffer(x(H)), q = new DataView(K);
+ return _(H, q, 0), new Uint8Array(K);
}
- function p(X, Z, q) {
- return Z ? new X(Z.buffer, Z.byteOffset, Z.byteLength / (q || 1)) : void 0;
+ function g(H, K, q) {
+ return K ? new H(K.buffer, K.byteOffset, K.byteLength / (q || 1)) : void 0;
}
- function E(X) {
- return p(DataView, X);
+ function E(H) {
+ return g(DataView, H);
}
- function u(X) {
- return p(Uint8Array, X);
+ function u(H) {
+ return g(Uint8Array, H);
}
- function A(X) {
- return p(Int8Array, X);
+ function A(H) {
+ return g(Int8Array, H);
}
- function C(X) {
- return p(Int32Array, X, 4);
+ function L(H) {
+ return g(Int32Array, H, 4);
}
- function L(X) {
- return p(Float32Array, X, 4);
+ function C(H) {
+ return g(Float32Array, H, 4);
}
- function D(X, Z) {
- var q = X.length / 2;
- Z || (Z = new Int16Array(q));
+ function D(H, K) {
+ var q = H.length / 2;
+ K || (K = new Int16Array(q));
for (var fe = 0, _e = 0; q > fe; ++fe, _e += 2)
- Z[fe] = X[_e] << 8 ^ X[_e + 1] << 0;
- return Z;
- }
- function r(X, Z) {
- var q = X.length;
- Z || (Z = new Uint8Array(2 * q));
- for (var fe = E(Z), _e = 0; q > _e; ++_e)
- fe.setInt16(2 * _e, X[_e]);
- return u(Z);
- }
- function n(X, Z) {
- var q = X.length / 4;
- Z || (Z = new Int32Array(q));
+ K[fe] = H[_e] << 8 ^ H[_e + 1] << 0;
+ return K;
+ }
+ function r(H, K) {
+ var q = H.length;
+ K || (K = new Uint8Array(2 * q));
+ for (var fe = E(K), _e = 0; q > _e; ++_e)
+ fe.setInt16(2 * _e, H[_e]);
+ return u(K);
+ }
+ function n(H, K) {
+ var q = H.length / 4;
+ K || (K = new Int32Array(q));
for (var fe = 0, _e = 0; q > fe; ++fe, _e += 4)
- Z[fe] = X[_e] << 24 ^ X[_e + 1] << 16 ^ X[_e + 2] << 8 ^ X[_e + 3] << 0;
- return Z;
- }
- function b(X, Z) {
- var q = X.length;
- Z || (Z = new Uint8Array(4 * q));
- for (var fe = E(Z), _e = 0; q > _e; ++_e)
- fe.setInt32(4 * _e, X[_e]);
- return u(Z);
- }
- function f(X, Z) {
- var q = X.length;
- Z || (Z = new Float32Array(q / 4));
- for (var fe = E(Z), _e = E(X), Me = 0, Ae = 0, H = q / 4; H > Me; ++Me, Ae += 4)
+ K[fe] = H[_e] << 24 ^ H[_e + 1] << 16 ^ H[_e + 2] << 8 ^ H[_e + 3] << 0;
+ return K;
+ }
+ function b(H, K) {
+ var q = H.length;
+ K || (K = new Uint8Array(4 * q));
+ for (var fe = E(K), _e = 0; q > _e; ++_e)
+ fe.setInt32(4 * _e, H[_e]);
+ return u(K);
+ }
+ function f(H, K) {
+ var q = H.length;
+ K || (K = new Float32Array(q / 4));
+ for (var fe = E(K), _e = E(H), Me = 0, Ae = 0, Z = q / 4; Z > Me; ++Me, Ae += 4)
fe.setFloat32(Ae, _e.getFloat32(Ae), !0);
- return Z;
+ return K;
}
- function c(X, Z, q) {
- var fe = X.length, _e = 1 / Z;
+ function c(H, K, q) {
+ var fe = H.length, _e = 1 / K;
q || (q = new Float32Array(fe));
for (var Me = 0; fe > Me; ++Me)
- q[Me] = X[Me] * _e;
+ q[Me] = H[Me] * _e;
return q;
}
- function t(X, Z, q) {
- var fe = X.length;
+ function t(H, K, q) {
+ var fe = H.length;
q || (q = new Int32Array(fe));
for (var _e = 0; fe > _e; ++_e)
- q[_e] = Math.round(X[_e] * Z);
+ q[_e] = Math.round(H[_e] * K);
return q;
}
- function a(X, Z) {
+ function a(H, K) {
var q, fe;
- if (!Z) {
+ if (!K) {
var _e = 0;
- for (q = 0, fe = X.length; fe > q; q += 2)
- _e += X[q + 1];
- Z = new X.constructor(_e);
+ for (q = 0, fe = H.length; fe > q; q += 2)
+ _e += H[q + 1];
+ K = new H.constructor(_e);
}
var Me = 0;
- for (q = 0, fe = X.length; fe > q; q += 2)
- for (var Ae = X[q], H = X[q + 1], ce = 0; H > ce; ++ce)
- Z[Me] = Ae, ++Me;
- return Z;
+ for (q = 0, fe = H.length; fe > q; q += 2)
+ for (var Ae = H[q], Z = H[q + 1], ue = 0; Z > ue; ++ue)
+ K[Me] = Ae, ++Me;
+ return K;
}
- function h(X) {
- if (X.length === 0)
+ function h(H) {
+ if (H.length === 0)
return new Int32Array();
- var Z, q, fe = 2;
- for (Z = 1, q = X.length; q > Z; ++Z)
- X[Z - 1] !== X[Z] && (fe += 2);
+ var K, q, fe = 2;
+ for (K = 1, q = H.length; q > K; ++K)
+ H[K - 1] !== H[K] && (fe += 2);
var _e = new Int32Array(fe), Me = 0, Ae = 1;
- for (Z = 1, q = X.length; q > Z; ++Z)
- X[Z - 1] !== X[Z] ? (_e[Me] = X[Z - 1], _e[Me + 1] = Ae, Ae = 1, Me += 2) : ++Ae;
- return _e[Me] = X[X.length - 1], _e[Me + 1] = Ae, _e;
+ for (K = 1, q = H.length; q > K; ++K)
+ H[K - 1] !== H[K] ? (_e[Me] = H[K - 1], _e[Me + 1] = Ae, Ae = 1, Me += 2) : ++Ae;
+ return _e[Me] = H[H.length - 1], _e[Me + 1] = Ae, _e;
}
- function M(X, Z) {
- var q = X.length;
- Z || (Z = new X.constructor(q)), q && (Z[0] = X[0]);
+ function M(H, K) {
+ var q = H.length;
+ K || (K = new H.constructor(q)), q && (K[0] = H[0]);
for (var fe = 1; q > fe; ++fe)
- Z[fe] = X[fe] + Z[fe - 1];
- return Z;
+ K[fe] = H[fe] + K[fe - 1];
+ return K;
}
- function w(X, Z) {
- var q = X.length;
- Z || (Z = new X.constructor(q)), Z[0] = X[0];
+ function w(H, K) {
+ var q = H.length;
+ K || (K = new H.constructor(q)), K[0] = H[0];
for (var fe = 1; q > fe; ++fe)
- Z[fe] = X[fe] - X[fe - 1];
- return Z;
+ K[fe] = H[fe] - H[fe - 1];
+ return K;
}
- function S(X, Z) {
- var q, fe, _e = X instanceof Int8Array ? 127 : 32767, Me = -_e - 1, Ae = X.length;
- if (!Z) {
- var H = 0;
+ function S(H, K) {
+ var q, fe, _e = H instanceof Int8Array ? 127 : 32767, Me = -_e - 1, Ae = H.length;
+ if (!K) {
+ var Z = 0;
for (q = 0; Ae > q; ++q)
- X[q] < _e && X[q] > Me && ++H;
- Z = new Int32Array(H);
+ H[q] < _e && H[q] > Me && ++Z;
+ K = new Int32Array(Z);
}
for (q = 0, fe = 0; Ae > q; ) {
- for (var ce = 0; X[q] === _e || X[q] === Me; )
- ce += X[q], ++q;
- ce += X[q], ++q, Z[fe] = ce, ++fe;
+ for (var ue = 0; H[q] === _e || H[q] === Me; )
+ ue += H[q], ++q;
+ ue += H[q], ++q, K[fe] = ue, ++fe;
}
- return Z;
+ return K;
}
- function T(X, Z) {
- var q, fe = Z ? 127 : 32767, _e = -fe - 1, Me = X.length, Ae = 0;
+ function T(H, K) {
+ var q, fe = K ? 127 : 32767, _e = -fe - 1, Me = H.length, Ae = 0;
for (q = 0; Me > q; ++q) {
- var H = X[q];
- H === 0 ? ++Ae : H > 0 ? (Ae += Math.ceil(H / fe), H % fe === 0 && (Ae += 1)) : (Ae += Math.ceil(H / _e), H % _e === 0 && (Ae += 1));
+ var Z = H[q];
+ Z === 0 ? ++Ae : Z > 0 ? (Ae += Math.ceil(Z / fe), Z % fe === 0 && (Ae += 1)) : (Ae += Math.ceil(Z / _e), Z % _e === 0 && (Ae += 1));
}
- var ce = Z ? new Int8Array(Ae) : new Int16Array(Ae), ye = 0;
+ var ue = K ? new Int8Array(Ae) : new Int16Array(Ae), we = 0;
for (q = 0; Me > q; ++q) {
- var H = X[q];
- if (H >= 0)
- for (; H >= fe; )
- ce[ye] = fe, ++ye, H -= fe;
+ var Z = H[q];
+ if (Z >= 0)
+ for (; Z >= fe; )
+ ue[we] = fe, ++we, Z -= fe;
else
- for (; _e >= H; )
- ce[ye] = _e, ++ye, H -= _e;
- ce[ye] = H, ++ye;
+ for (; _e >= Z; )
+ ue[we] = _e, ++we, Z -= _e;
+ ue[we] = Z, ++we;
}
- return ce;
+ return ue;
}
- function R(X, Z) {
- return M(a(X), Z);
+ function R(H, K) {
+ return M(a(H), K);
}
- function z(X) {
- return h(w(X));
+ function $(H) {
+ return h(w(H));
}
- function P(X, Z, q) {
- return c(a(X, C(q)), Z, q);
+ function P(H, K, q) {
+ return c(a(H, L(q)), K, q);
}
- function B(X, Z) {
- return h(t(X, Z));
+ function B(H, K) {
+ return h(t(H, K));
}
- function U(X, Z, q) {
- return c(M(X, C(q)), Z, q);
+ function F(H, K, q) {
+ return c(M(H, L(q)), K, q);
}
- function F(X, Z, q) {
- return w(t(X, Z), q);
+ function U(H, K, q) {
+ return w(t(H, K), q);
}
- function $(X, Z, q) {
- return c(S(X, C(q)), Z, q);
+ function z(H, K, q) {
+ return c(S(H, L(q)), K, q);
}
- function W(X, Z, q) {
- var fe = S(X, C(q));
- return U(fe, Z, L(fe));
+ function W(H, K, q) {
+ var fe = S(H, L(q));
+ return F(fe, K, C(fe));
}
- function N(X, Z, q) {
- return T(F(X, Z), q);
+ function V(H, K, q) {
+ return T(U(H, K), q);
}
- function G(Me) {
- var Z = E(Me), q = Z.getInt32(0), fe = Z.getInt32(4), _e = Me.subarray(8, 12), Me = Me.subarray(12);
+ function N(Me) {
+ var K = E(Me), q = K.getInt32(0), fe = K.getInt32(4), _e = Me.subarray(8, 12), Me = Me.subarray(12);
return [q, Me, fe, _e];
}
- function k(X, Z, q, fe) {
+ function k(H, K, q, fe) {
var _e = new ArrayBuffer(12 + fe.byteLength), Me = new Uint8Array(_e), Ae = new DataView(_e);
- return Ae.setInt32(0, X), Ae.setInt32(4, Z), q && Me.set(q, 8), Me.set(fe, 12), Me;
+ return Ae.setInt32(0, H), Ae.setInt32(4, K), q && Me.set(q, 8), Me.set(fe, 12), Me;
}
- function j(X) {
- var Z = X.length, q = u(X);
- return k(2, Z, void 0, q);
+ function G(H) {
+ var K = H.length, q = u(H);
+ return k(2, K, void 0, q);
}
- function Q(X) {
- var Z = X.length, q = b(X);
- return k(4, Z, void 0, q);
+ function Q(H) {
+ var K = H.length, q = b(H);
+ return k(4, K, void 0, q);
}
- function ie(X, Z) {
- var q = X.length / Z, fe = b([Z]), _e = u(X);
+ function ie(H, K) {
+ var q = H.length / K, fe = b([K]), _e = u(H);
return k(5, q, fe, _e);
}
- function pe(X) {
- var Z = X.length, q = b(h(X));
- return k(6, Z, void 0, q);
+ function ge(H) {
+ var K = H.length, q = b(h(H));
+ return k(6, K, void 0, q);
}
- function he(X) {
- var Z = X.length, q = b(z(X));
- return k(8, Z, void 0, q);
+ function le(H) {
+ var K = H.length, q = b($(H));
+ return k(8, K, void 0, q);
}
- function ue(X, Z) {
- var q = X.length, fe = b([Z]), _e = b(B(X, Z));
+ function oe(H, K) {
+ var q = H.length, fe = b([K]), _e = b(B(H, K));
return k(9, q, fe, _e);
}
- function se(X, Z) {
- var q = X.length, fe = b([Z]), _e = r(N(X, Z));
+ function he(H, K) {
+ var q = H.length, fe = b([K]), _e = r(V(H, K));
return k(10, q, fe, _e);
}
- function ae(X) {
- var Z = {};
+ function se(H) {
+ var K = {};
return Re.forEach(function(q) {
- X[q] !== void 0 && (Z[q] = X[q]);
- }), X.bondAtomList && (Z.bondAtomList = Q(X.bondAtomList)), X.bondOrderList && (Z.bondOrderList = j(X.bondOrderList)), Z.xCoordList = se(X.xCoordList, 1e3), Z.yCoordList = se(X.yCoordList, 1e3), Z.zCoordList = se(X.zCoordList, 1e3), X.bFactorList && (Z.bFactorList = se(X.bFactorList, 100)), X.atomIdList && (Z.atomIdList = he(X.atomIdList)), X.altLocList && (Z.altLocList = pe(X.altLocList)), X.occupancyList && (Z.occupancyList = ue(X.occupancyList, 100)), Z.groupIdList = he(X.groupIdList), Z.groupTypeList = Q(X.groupTypeList), X.secStructList && (Z.secStructList = j(X.secStructList)), X.insCodeList && (Z.insCodeList = pe(X.insCodeList)), X.sequenceIndexList && (Z.sequenceIndexList = he(X.sequenceIndexList)), Z.chainIdList = ie(X.chainIdList, 4), X.chainNameList && (Z.chainNameList = ie(X.chainNameList, 4)), Z;
- }
- function we(X) {
- function Z(ce) {
- for (var ye = {}, Pe = 0; ce > Pe; Pe++) {
- var le = Me();
- ye[le] = Me();
+ H[q] !== void 0 && (K[q] = H[q]);
+ }), H.bondAtomList && (K.bondAtomList = Q(H.bondAtomList)), H.bondOrderList && (K.bondOrderList = G(H.bondOrderList)), K.xCoordList = he(H.xCoordList, 1e3), K.yCoordList = he(H.yCoordList, 1e3), K.zCoordList = he(H.zCoordList, 1e3), H.bFactorList && (K.bFactorList = he(H.bFactorList, 100)), H.atomIdList && (K.atomIdList = le(H.atomIdList)), H.altLocList && (K.altLocList = ge(H.altLocList)), H.occupancyList && (K.occupancyList = oe(H.occupancyList, 100)), K.groupIdList = le(H.groupIdList), K.groupTypeList = Q(H.groupTypeList), H.secStructList && (K.secStructList = G(H.secStructList)), H.insCodeList && (K.insCodeList = ge(H.insCodeList)), H.sequenceIndexList && (K.sequenceIndexList = le(H.sequenceIndexList)), K.chainIdList = ie(H.chainIdList, 4), H.chainNameList && (K.chainNameList = ie(H.chainNameList, 4)), K;
+ }
+ function xe(H) {
+ function K(ue) {
+ for (var we = {}, Te = 0; ue > Te; Te++) {
+ var ae = Me();
+ we[ae] = Me();
}
- return ye;
- }
- function q(ce) {
- var ye = X.subarray(Ae, Ae + ce);
- return Ae += ce, ye;
- }
- function fe(ce) {
- var ye = X.subarray(Ae, Ae + ce);
- Ae += ce;
- var Pe = 65535;
- if (ce > Pe) {
- for (var le = [], De = 0; De < ye.length; De += Pe)
- le.push(String.fromCharCode.apply(null, ye.subarray(De, De + Pe)));
- return le.join("");
+ return we;
+ }
+ function q(ue) {
+ var we = H.subarray(Ae, Ae + ue);
+ return Ae += ue, we;
+ }
+ function fe(ue) {
+ var we = H.subarray(Ae, Ae + ue);
+ Ae += ue;
+ var Te = 65535;
+ if (ue > Te) {
+ for (var ae = [], De = 0; De < we.length; De += Te)
+ ae.push(String.fromCharCode.apply(null, we.subarray(De, De + Te)));
+ return ae.join("");
}
- return String.fromCharCode.apply(null, ye);
+ return String.fromCharCode.apply(null, we);
}
- function _e(ce) {
- for (var ye = new Array(ce), Pe = 0; ce > Pe; Pe++)
- ye[Pe] = Me();
- return ye;
+ function _e(ue) {
+ for (var we = new Array(ue), Te = 0; ue > Te; Te++)
+ we[Te] = Me();
+ return we;
}
function Me() {
- var ce, ye, Pe = X[Ae];
- if (!(128 & Pe))
- return Ae++, Pe;
- if ((240 & Pe) === 128)
- return ye = 15 & Pe, Ae++, Z(ye);
- if ((240 & Pe) === 144)
- return ye = 15 & Pe, Ae++, _e(ye);
- if ((224 & Pe) === 160)
- return ye = 31 & Pe, Ae++, fe(ye);
- if ((224 & Pe) === 224)
- return ce = H.getInt8(Ae), Ae++, ce;
- switch (Pe) {
+ var ue, we, Te = H[Ae];
+ if (!(128 & Te))
+ return Ae++, Te;
+ if ((240 & Te) === 128)
+ return we = 15 & Te, Ae++, K(we);
+ if ((240 & Te) === 144)
+ return we = 15 & Te, Ae++, _e(we);
+ if ((224 & Te) === 160)
+ return we = 31 & Te, Ae++, fe(we);
+ if ((224 & Te) === 224)
+ return ue = Z.getInt8(Ae), Ae++, ue;
+ switch (Te) {
case 192:
return Ae++, null;
case 194:
@@ -22819,171 +22819,171 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
case 195:
return Ae++, !0;
case 196:
- return ye = H.getUint8(Ae + 1), Ae += 2, q(ye);
+ return we = Z.getUint8(Ae + 1), Ae += 2, q(we);
case 197:
- return ye = H.getUint16(Ae + 1), Ae += 3, q(ye);
+ return we = Z.getUint16(Ae + 1), Ae += 3, q(we);
case 198:
- return ye = H.getUint32(Ae + 1), Ae += 5, q(ye);
+ return we = Z.getUint32(Ae + 1), Ae += 5, q(we);
case 202:
- return ce = H.getFloat32(Ae + 1), Ae += 5, ce;
+ return ue = Z.getFloat32(Ae + 1), Ae += 5, ue;
case 203:
- return ce = H.getFloat64(Ae + 1), Ae += 9, ce;
+ return ue = Z.getFloat64(Ae + 1), Ae += 9, ue;
case 204:
- return ce = X[Ae + 1], Ae += 2, ce;
+ return ue = H[Ae + 1], Ae += 2, ue;
case 205:
- return ce = H.getUint16(Ae + 1), Ae += 3, ce;
+ return ue = Z.getUint16(Ae + 1), Ae += 3, ue;
case 206:
- return ce = H.getUint32(Ae + 1), Ae += 5, ce;
+ return ue = Z.getUint32(Ae + 1), Ae += 5, ue;
case 208:
- return ce = H.getInt8(Ae + 1), Ae += 2, ce;
+ return ue = Z.getInt8(Ae + 1), Ae += 2, ue;
case 209:
- return ce = H.getInt16(Ae + 1), Ae += 3, ce;
+ return ue = Z.getInt16(Ae + 1), Ae += 3, ue;
case 210:
- return ce = H.getInt32(Ae + 1), Ae += 5, ce;
+ return ue = Z.getInt32(Ae + 1), Ae += 5, ue;
case 217:
- return ye = H.getUint8(Ae + 1), Ae += 2, fe(ye);
+ return we = Z.getUint8(Ae + 1), Ae += 2, fe(we);
case 218:
- return ye = H.getUint16(Ae + 1), Ae += 3, fe(ye);
+ return we = Z.getUint16(Ae + 1), Ae += 3, fe(we);
case 219:
- return ye = H.getUint32(Ae + 1), Ae += 5, fe(ye);
+ return we = Z.getUint32(Ae + 1), Ae += 5, fe(we);
case 220:
- return ye = H.getUint16(Ae + 1), Ae += 3, _e(ye);
+ return we = Z.getUint16(Ae + 1), Ae += 3, _e(we);
case 221:
- return ye = H.getUint32(Ae + 1), Ae += 5, _e(ye);
+ return we = Z.getUint32(Ae + 1), Ae += 5, _e(we);
case 222:
- return ye = H.getUint16(Ae + 1), Ae += 3, Z(ye);
+ return we = Z.getUint16(Ae + 1), Ae += 3, K(we);
case 223:
- return ye = H.getUint32(Ae + 1), Ae += 5, Z(ye);
+ return we = Z.getUint32(Ae + 1), Ae += 5, K(we);
}
- throw new Error("Unknown type 0x" + Pe.toString(16));
+ throw new Error("Unknown type 0x" + Te.toString(16));
}
- var Ae = 0, H = new DataView(X.buffer);
+ var Ae = 0, Z = new DataView(H.buffer);
return Me();
}
- function xe(X, Z, q, fe) {
- switch (X) {
+ function ye(H, K, q, fe) {
+ switch (H) {
case 1:
- return f(Z);
+ return f(K);
case 2:
- return A(Z);
+ return A(K);
case 3:
- return D(Z);
+ return D(K);
case 4:
- return n(Z);
+ return n(K);
case 5:
- return u(Z);
+ return u(K);
case 6:
- return a(n(Z), new Uint8Array(q));
+ return a(n(K), new Uint8Array(q));
case 7:
- return a(n(Z));
+ return a(n(K));
case 8:
- return R(n(Z));
+ return R(n(K));
case 9:
- return P(n(Z), n(fe)[0]);
+ return P(n(K), n(fe)[0]);
case 10:
- return W(D(Z), n(fe)[0]);
+ return W(D(K), n(fe)[0]);
case 11:
- return c(D(Z), n(fe)[0]);
+ return c(D(K), n(fe)[0]);
case 12:
- return $(D(Z), n(fe)[0]);
+ return z(D(K), n(fe)[0]);
case 13:
- return $(A(Z), n(fe)[0]);
+ return z(A(K), n(fe)[0]);
case 14:
- return S(D(Z));
+ return S(D(K));
case 15:
- return S(A(Z));
+ return S(A(K));
}
}
- function Ie(X, Z) {
- Z = Z || {};
- var q = Z.ignoreFields, fe = {};
- return ke.forEach(function(_e) {
- var Me = q ? q.indexOf(_e) !== -1 : !1, Ae = X[_e];
- Me || Ae === void 0 || (Ae instanceof Uint8Array ? fe[_e] = xe.apply(null, G(Ae)) : fe[_e] = Ae);
+ function Pe(H, K) {
+ K = K || {};
+ var q = K.ignoreFields, fe = {};
+ return Ie.forEach(function(_e) {
+ var Me = q ? q.indexOf(_e) !== -1 : !1, Ae = H[_e];
+ Me || Ae === void 0 || (Ae instanceof Uint8Array ? fe[_e] = ye.apply(null, N(Ae)) : fe[_e] = Ae);
}), fe;
}
- function oe(X) {
- return String.fromCharCode.apply(null, X).replace(/\0/g, "");
+ function de(H) {
+ return String.fromCharCode.apply(null, H).replace(/\0/g, "");
}
- function ve(X, Z, q) {
+ function pe(H, K, q) {
q = q || {};
- var fe, _e, Me, Ae, H, ce, ye = q.firstModelOnly, Pe = Z.onModel, le = Z.onChain, De = Z.onGroup, K = Z.onAtom, Oe = Z.onBond, Ne = 0, I = 0, me = 0, ge = 0, Y = 0, ne = -1, Ee = X.chainNameList, He = X.secStructList, Ke = X.insCodeList, Ve = X.sequenceIndexList, qe = X.atomIdList, wt = X.bFactorList, nt = X.altLocList, rt = X.occupancyList, tt = X.bondAtomList, yt = X.bondOrderList;
- for (fe = 0, _e = X.chainsPerModel.length; _e > fe && !(ye && Ne > 0); ++fe) {
- var _t = X.chainsPerModel[Ne];
- for (Pe && Pe({ chainCount: _t, modelIndex: Ne }), Me = 0; _t > Me; ++Me) {
- var It = X.groupsPerChain[I];
- if (le) {
- var Ot = oe(X.chainIdList.subarray(4 * I, 4 * I + 4)), vt = null;
- Ee && (vt = oe(Ee.subarray(4 * I, 4 * I + 4))), le({ groupCount: It, chainIndex: I, modelIndex: Ne, chainId: Ot, chainName: vt });
+ var fe, _e, Me, Ae, Z, ue, we = q.firstModelOnly, Te = K.onModel, ae = K.onChain, De = K.onGroup, Y = K.onAtom, Oe = K.onBond, Ve = 0, I = 0, me = 0, ve = 0, X = 0, ne = -1, Ee = H.chainNameList, He = H.secStructList, Ke = H.insCodeList, je = H.sequenceIndexList, qe = H.atomIdList, wt = H.bFactorList, nt = H.altLocList, rt = H.occupancyList, tt = H.bondAtomList, yt = H.bondOrderList;
+ for (fe = 0, _e = H.chainsPerModel.length; _e > fe && !(we && Ve > 0); ++fe) {
+ var _t = H.chainsPerModel[Ve];
+ for (Te && Te({ chainCount: _t, modelIndex: Ve }), Me = 0; _t > Me; ++Me) {
+ var It = H.groupsPerChain[I];
+ if (ae) {
+ var Ot = de(H.chainIdList.subarray(4 * I, 4 * I + 4)), vt = null;
+ Ee && (vt = de(Ee.subarray(4 * I, 4 * I + 4))), ae({ groupCount: It, chainIndex: I, modelIndex: Ve, chainId: Ot, chainName: vt });
}
for (Ae = 0; It > Ae; ++Ae) {
- var mt = X.groupList[X.groupTypeList[me]], gt = mt.atomNameList.length;
+ var mt = H.groupList[H.groupTypeList[me]], pt = mt.atomNameList.length;
if (De) {
var Ct = null;
He && (Ct = He[me]);
var Mt = null;
- X.insCodeList && (Mt = String.fromCharCode(Ke[me]));
+ H.insCodeList && (Mt = String.fromCharCode(Ke[me]));
var Ft = null;
- Ve && (Ft = Ve[me]), De({ atomCount: gt, groupIndex: me, chainIndex: I, modelIndex: Ne, groupId: X.groupIdList[me], groupType: X.groupTypeList[me], groupName: mt.groupName, singleLetterCode: mt.singleLetterCode, chemCompType: mt.chemCompType, secStruct: Ct, insCode: Mt, sequenceIndex: Ft });
+ je && (Ft = je[me]), De({ atomCount: pt, groupIndex: me, chainIndex: I, modelIndex: Ve, groupId: H.groupIdList[me], groupType: H.groupTypeList[me], groupName: mt.groupName, singleLetterCode: mt.singleLetterCode, chemCompType: mt.chemCompType, secStruct: Ct, insCode: Mt, sequenceIndex: Ft });
}
- for (H = 0; gt > H; ++H) {
- if (K) {
+ for (Z = 0; pt > Z; ++Z) {
+ if (Y) {
var hi = null;
- qe && (hi = qe[ge]);
+ qe && (hi = qe[ve]);
var Ut = null;
- wt && (Ut = wt[ge]);
+ wt && (Ut = wt[ve]);
var di = null;
- nt && (di = String.fromCharCode(nt[ge]));
+ nt && (di = String.fromCharCode(nt[ve]));
var ci = null;
- rt && (ci = rt[ge]), K({ atomIndex: ge, groupIndex: me, chainIndex: I, modelIndex: Ne, atomId: hi, element: mt.elementList[H], atomName: mt.atomNameList[H], formalCharge: mt.formalChargeList[H], xCoord: X.xCoordList[ge], yCoord: X.yCoordList[ge], zCoord: X.zCoordList[ge], bFactor: Ut, altLoc: di, occupancy: ci });
+ rt && (ci = rt[ve]), Y({ atomIndex: ve, groupIndex: me, chainIndex: I, modelIndex: Ve, atomId: hi, element: mt.elementList[Z], atomName: mt.atomNameList[Z], formalCharge: mt.formalChargeList[Z], xCoord: H.xCoordList[ve], yCoord: H.yCoordList[ve], zCoord: H.zCoordList[ve], bFactor: Ut, altLoc: di, occupancy: ci });
}
- ge += 1;
+ ve += 1;
}
if (Oe) {
var ui = mt.bondAtomList;
- for (H = 0, ce = mt.bondOrderList.length; ce > H; ++H)
- Oe({ atomIndex1: ge - gt + ui[2 * H], atomIndex2: ge - gt + ui[2 * H + 1], bondOrder: mt.bondOrderList[H] });
+ for (Z = 0, ue = mt.bondOrderList.length; ue > Z; ++Z)
+ Oe({ atomIndex1: ve - pt + ui[2 * Z], atomIndex2: ve - pt + ui[2 * Z + 1], bondOrder: mt.bondOrderList[Z] });
}
me += 1;
}
I += 1;
}
- if (Y = ne + 1, ne = ge - 1, Oe && tt)
- for (H = 0, ce = tt.length; ce > H; H += 2) {
- var _i = tt[H], gi = tt[H + 1];
- (_i >= Y && ne >= _i || gi >= Y && ne >= gi) && Oe({ atomIndex1: _i, atomIndex2: gi, bondOrder: yt ? yt[H / 2] : null });
+ if (X = ne + 1, ne = ve - 1, Oe && tt)
+ for (Z = 0, ue = tt.length; ue > Z; Z += 2) {
+ var _i = tt[Z], pi = tt[Z + 1];
+ (_i >= X && ne >= _i || pi >= X && ne >= pi) && Oe({ atomIndex1: _i, atomIndex2: pi, bondOrder: yt ? yt[Z / 2] : null });
}
- Ne += 1;
+ Ve += 1;
}
}
- function re(X) {
- return o(ae(X));
+ function re(H) {
+ return o(se(H));
}
- function Se(X, Z) {
- X instanceof ArrayBuffer && (X = new Uint8Array(X));
+ function Se(H, K) {
+ H instanceof ArrayBuffer && (H = new Uint8Array(H));
var q;
- return q = X instanceof Uint8Array ? we(X) : X, Ie(q, Z);
+ return q = H instanceof Uint8Array ? xe(H) : H, Pe(q, K);
}
- function ze(X, Z, q, fe) {
+ function ke(H, K, q, fe) {
function _e() {
try {
var Ae = Se(Me.response);
q(Ae);
- } catch (H) {
- fe(H);
+ } catch (Z) {
+ fe(Z);
}
}
var Me = new XMLHttpRequest();
- Me.addEventListener("load", _e, !0), Me.addEventListener("error", fe, !0), Me.responseType = "arraybuffer", Me.open("GET", Z + X.toUpperCase()), Me.send();
+ Me.addEventListener("load", _e, !0), Me.addEventListener("error", fe, !0), Me.responseType = "arraybuffer", Me.open("GET", K + H.toUpperCase()), Me.send();
}
- function Ge(X, Z, q) {
- ze(X, je, Z, q);
+ function $e(H, K, q) {
+ ke(H, Be, K, q);
}
- function $e(X, Z, q) {
- ze(X, Fe, Z, q);
+ function ze(H, K, q) {
+ ke(H, Ne, K, q);
}
- var Re = ["mmtfVersion", "mmtfProducer", "unitCell", "spaceGroup", "structureId", "title", "depositionDate", "releaseDate", "experimentalMethods", "resolution", "rFree", "rWork", "bioAssemblyList", "ncsOperatorList", "entityList", "groupList", "numBonds", "numAtoms", "numGroups", "numChains", "numModels", "groupsPerChain", "chainsPerModel"], Be = ["xCoordList", "yCoordList", "zCoordList", "groupIdList", "groupTypeList", "chainIdList", "bFactorList", "atomIdList", "altLocList", "occupancyList", "secStructList", "insCodeList", "sequenceIndexList", "chainNameList", "bondAtomList", "bondOrderList"], ke = Re.concat(Be), We = "v1.0.1", Te = "//mmtf.rcsb.org/v1.0/", je = Te + "full/", Fe = Te + "reduced/";
- e.encode = re, e.decode = Se, e.traverse = ve, e.fetch = Ge, e.fetchReduced = $e, e.version = We, e.fetchUrl = je, e.fetchReducedUrl = Fe, e.encodeMsgpack = o, e.encodeMmtf = ae, e.decodeMsgpack = we, e.decodeMmtf = Ie;
+ var Re = ["mmtfVersion", "mmtfProducer", "unitCell", "spaceGroup", "structureId", "title", "depositionDate", "releaseDate", "experimentalMethods", "resolution", "rFree", "rWork", "bioAssemblyList", "ncsOperatorList", "entityList", "groupList", "numBonds", "numAtoms", "numGroups", "numChains", "numModels", "groupsPerChain", "chainsPerModel"], Fe = ["xCoordList", "yCoordList", "zCoordList", "groupIdList", "groupTypeList", "chainIdList", "bFactorList", "atomIdList", "altLocList", "occupancyList", "secStructList", "insCodeList", "sequenceIndexList", "chainNameList", "bondAtomList", "bondOrderList"], Ie = Re.concat(Fe), We = "v1.0.1", Ue = "//mmtf.rcsb.org/v1.0/", Be = Ue + "full/", Ne = Ue + "reduced/";
+ e.encode = re, e.decode = Se, e.traverse = pe, e.fetch = $e, e.fetchReduced = ze, e.version = We, e.fetchUrl = Be, e.fetchReducedUrl = Ne, e.encodeMsgpack = o, e.encodeMmtf = se, e.decodeMsgpack = xe, e.decodeMmtf = Pe;
});
}
),
@@ -23048,66 +23048,66 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
/* harmony export */
});
/*! pako 2.1.0 https://github.com/nodeca/pako @license (MIT AND Zlib) */
- const l = 4, g = 0, _ = 1, x = 2;
+ const l = 4, p = 0, _ = 1, x = 2;
function o(v) {
- let V = v.length;
- for (; --V >= 0; )
- v[V] = 0;
+ let j = v.length;
+ for (; --j >= 0; )
+ v[j] = 0;
}
- const p = 0, E = 1, u = 2, A = 3, C = 258, L = 29, D = 256, r = D + 1 + L, n = 30, b = 19, f = 2 * r + 1, c = 15, t = 16, a = 7, h = 256, M = 16, w = 17, S = 18, T = (
+ const g = 0, E = 1, u = 2, A = 3, L = 258, C = 29, D = 256, r = D + 1 + C, n = 30, b = 19, f = 2 * r + 1, c = 15, t = 16, a = 7, h = 256, M = 16, w = 17, S = 18, T = (
/* extra bits for each length code */
new Uint8Array([0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0])
), R = (
/* extra bits for each distance code */
new Uint8Array([0, 0, 0, 0, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13])
- ), z = (
+ ), $ = (
/* extra bits for each bit length code */
new Uint8Array([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 3, 7])
- ), P = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]), B = 512, U = new Array((r + 2) * 2);
- o(U);
- const F = new Array(n * 2);
+ ), P = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]), B = 512, F = new Array((r + 2) * 2);
o(F);
- const $ = new Array(B);
- o($);
- const W = new Array(C - A + 1);
+ const U = new Array(n * 2);
+ o(U);
+ const z = new Array(B);
+ o(z);
+ const W = new Array(L - A + 1);
o(W);
- const N = new Array(L);
+ const V = new Array(C);
+ o(V);
+ const N = new Array(n);
o(N);
- const G = new Array(n);
- o(G);
- function k(v, V, O, J, te) {
- this.static_tree = v, this.extra_bits = V, this.extra_base = O, this.elems = J, this.max_length = te, this.has_stree = v && v.length;
+ function k(v, j, O, J, te) {
+ this.static_tree = v, this.extra_bits = j, this.extra_base = O, this.elems = J, this.max_length = te, this.has_stree = v && v.length;
}
- let j, Q, ie;
- function pe(v, V) {
- this.dyn_tree = v, this.max_code = 0, this.stat_desc = V;
+ let G, Q, ie;
+ function ge(v, j) {
+ this.dyn_tree = v, this.max_code = 0, this.stat_desc = j;
}
- const he = (v) => v < 256 ? $[v] : $[256 + (v >>> 7)], ue = (v, V) => {
- v.pending_buf[v.pending++] = V & 255, v.pending_buf[v.pending++] = V >>> 8 & 255;
- }, se = (v, V, O) => {
- v.bi_valid > t - O ? (v.bi_buf |= V << v.bi_valid & 65535, ue(v, v.bi_buf), v.bi_buf = V >> t - v.bi_valid, v.bi_valid += O - t) : (v.bi_buf |= V << v.bi_valid & 65535, v.bi_valid += O);
- }, ae = (v, V, O) => {
- se(
+ const le = (v) => v < 256 ? z[v] : z[256 + (v >>> 7)], oe = (v, j) => {
+ v.pending_buf[v.pending++] = j & 255, v.pending_buf[v.pending++] = j >>> 8 & 255;
+ }, he = (v, j, O) => {
+ v.bi_valid > t - O ? (v.bi_buf |= j << v.bi_valid & 65535, oe(v, v.bi_buf), v.bi_buf = j >> t - v.bi_valid, v.bi_valid += O - t) : (v.bi_buf |= j << v.bi_valid & 65535, v.bi_valid += O);
+ }, se = (v, j, O) => {
+ he(
v,
- O[V * 2],
- O[V * 2 + 1]
+ O[j * 2],
+ O[j * 2 + 1]
/*.Len*/
);
- }, we = (v, V) => {
+ }, xe = (v, j) => {
let O = 0;
do
O |= v & 1, v >>>= 1, O <<= 1;
- while (--V > 0);
+ while (--j > 0);
return O >>> 1;
- }, xe = (v) => {
- v.bi_valid === 16 ? (ue(v, v.bi_buf), v.bi_buf = 0, v.bi_valid = 0) : v.bi_valid >= 8 && (v.pending_buf[v.pending++] = v.bi_buf & 255, v.bi_buf >>= 8, v.bi_valid -= 8);
- }, Ie = (v, V) => {
- const O = V.dyn_tree, J = V.max_code, te = V.stat_desc.static_tree, ee = V.stat_desc.has_stree, Ce = V.stat_desc.extra_bits, be = V.stat_desc.extra_base, Xe = V.stat_desc.max_length;
- let de, Le, ht, Ye, Ue, Qe, xt = 0;
+ }, ye = (v) => {
+ v.bi_valid === 16 ? (oe(v, v.bi_buf), v.bi_buf = 0, v.bi_valid = 0) : v.bi_valid >= 8 && (v.pending_buf[v.pending++] = v.bi_buf & 255, v.bi_buf >>= 8, v.bi_valid -= 8);
+ }, Pe = (v, j) => {
+ const O = j.dyn_tree, J = j.max_code, te = j.stat_desc.static_tree, ee = j.stat_desc.has_stree, Ce = j.stat_desc.extra_bits, be = j.stat_desc.extra_base, Xe = j.stat_desc.max_length;
+ let ce, Le, ht, Ye, Ge, Qe, xt = 0;
for (Ye = 0; Ye <= c; Ye++)
v.bl_count[Ye] = 0;
- for (O[v.heap[v.heap_max] * 2 + 1] = 0, de = v.heap_max + 1; de < f; de++)
- Le = v.heap[de], Ye = O[O[Le * 2 + 1] * 2 + 1] + 1, Ye > Xe && (Ye = Xe, xt++), O[Le * 2 + 1] = Ye, !(Le > J) && (v.bl_count[Ye]++, Ue = 0, Le >= be && (Ue = Ce[Le - be]), Qe = O[Le * 2], v.opt_len += Qe * (Ye + Ue), ee && (v.static_len += Qe * (te[Le * 2 + 1] + Ue)));
+ for (O[v.heap[v.heap_max] * 2 + 1] = 0, ce = v.heap_max + 1; ce < f; ce++)
+ Le = v.heap[ce], Ye = O[O[Le * 2 + 1] * 2 + 1] + 1, Ye > Xe && (Ye = Xe, xt++), O[Le * 2 + 1] = Ye, !(Le > J) && (v.bl_count[Ye]++, Ge = 0, Le >= be && (Ge = Ce[Le - be]), Qe = O[Le * 2], v.opt_len += Qe * (Ye + Ge), ee && (v.static_len += Qe * (te[Le * 2 + 1] + Ge)));
if (xt !== 0) {
do {
for (Ye = Xe - 1; v.bl_count[Ye] === 0; )
@@ -23116,79 +23116,79 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
} while (xt > 0);
for (Ye = Xe; Ye !== 0; Ye--)
for (Le = v.bl_count[Ye]; Le !== 0; )
- ht = v.heap[--de], !(ht > J) && (O[ht * 2 + 1] !== Ye && (v.opt_len += (Ye - O[ht * 2 + 1]) * O[ht * 2], O[ht * 2 + 1] = Ye), Le--);
+ ht = v.heap[--ce], !(ht > J) && (O[ht * 2 + 1] !== Ye && (v.opt_len += (Ye - O[ht * 2 + 1]) * O[ht * 2], O[ht * 2 + 1] = Ye), Le--);
}
- }, oe = (v, V, O) => {
+ }, de = (v, j, O) => {
const J = new Array(c + 1);
let te = 0, ee, Ce;
for (ee = 1; ee <= c; ee++)
te = te + O[ee - 1] << 1, J[ee] = te;
- for (Ce = 0; Ce <= V; Ce++) {
+ for (Ce = 0; Ce <= j; Ce++) {
let be = v[Ce * 2 + 1];
- be !== 0 && (v[Ce * 2] = we(J[be]++, be));
+ be !== 0 && (v[Ce * 2] = xe(J[be]++, be));
}
- }, ve = () => {
- let v, V, O, J, te;
+ }, pe = () => {
+ let v, j, O, J, te;
const ee = new Array(c + 1);
- for (O = 0, J = 0; J < L - 1; J++)
- for (N[J] = O, v = 0; v < 1 << T[J]; v++)
+ for (O = 0, J = 0; J < C - 1; J++)
+ for (V[J] = O, v = 0; v < 1 << T[J]; v++)
W[O++] = J;
for (W[O - 1] = J, te = 0, J = 0; J < 16; J++)
- for (G[J] = te, v = 0; v < 1 << R[J]; v++)
- $[te++] = J;
+ for (N[J] = te, v = 0; v < 1 << R[J]; v++)
+ z[te++] = J;
for (te >>= 7; J < n; J++)
- for (G[J] = te << 7, v = 0; v < 1 << R[J] - 7; v++)
- $[256 + te++] = J;
- for (V = 0; V <= c; V++)
- ee[V] = 0;
+ for (N[J] = te << 7, v = 0; v < 1 << R[J] - 7; v++)
+ z[256 + te++] = J;
+ for (j = 0; j <= c; j++)
+ ee[j] = 0;
for (v = 0; v <= 143; )
- U[v * 2 + 1] = 8, v++, ee[8]++;
+ F[v * 2 + 1] = 8, v++, ee[8]++;
for (; v <= 255; )
- U[v * 2 + 1] = 9, v++, ee[9]++;
+ F[v * 2 + 1] = 9, v++, ee[9]++;
for (; v <= 279; )
- U[v * 2 + 1] = 7, v++, ee[7]++;
+ F[v * 2 + 1] = 7, v++, ee[7]++;
for (; v <= 287; )
- U[v * 2 + 1] = 8, v++, ee[8]++;
- for (oe(U, r + 1, ee), v = 0; v < n; v++)
- F[v * 2 + 1] = 5, F[v * 2] = we(v, 5);
- j = new k(U, T, D + 1, r, c), Q = new k(F, R, 0, n, c), ie = new k(new Array(0), z, 0, b, a);
+ F[v * 2 + 1] = 8, v++, ee[8]++;
+ for (de(F, r + 1, ee), v = 0; v < n; v++)
+ U[v * 2 + 1] = 5, U[v * 2] = xe(v, 5);
+ G = new k(F, T, D + 1, r, c), Q = new k(U, R, 0, n, c), ie = new k(new Array(0), $, 0, b, a);
}, re = (v) => {
- let V;
- for (V = 0; V < r; V++)
- v.dyn_ltree[V * 2] = 0;
- for (V = 0; V < n; V++)
- v.dyn_dtree[V * 2] = 0;
- for (V = 0; V < b; V++)
- v.bl_tree[V * 2] = 0;
+ let j;
+ for (j = 0; j < r; j++)
+ v.dyn_ltree[j * 2] = 0;
+ for (j = 0; j < n; j++)
+ v.dyn_dtree[j * 2] = 0;
+ for (j = 0; j < b; j++)
+ v.bl_tree[j * 2] = 0;
v.dyn_ltree[h * 2] = 1, v.opt_len = v.static_len = 0, v.sym_next = v.matches = 0;
}, Se = (v) => {
- v.bi_valid > 8 ? ue(v, v.bi_buf) : v.bi_valid > 0 && (v.pending_buf[v.pending++] = v.bi_buf), v.bi_buf = 0, v.bi_valid = 0;
- }, ze = (v, V, O, J) => {
- const te = V * 2, ee = O * 2;
- return v[te] < v[ee] || v[te] === v[ee] && J[V] <= J[O];
- }, Ge = (v, V, O) => {
+ v.bi_valid > 8 ? oe(v, v.bi_buf) : v.bi_valid > 0 && (v.pending_buf[v.pending++] = v.bi_buf), v.bi_buf = 0, v.bi_valid = 0;
+ }, ke = (v, j, O, J) => {
+ const te = j * 2, ee = O * 2;
+ return v[te] < v[ee] || v[te] === v[ee] && J[j] <= J[O];
+ }, $e = (v, j, O) => {
const J = v.heap[O];
let te = O << 1;
- for (; te <= v.heap_len && (te < v.heap_len && ze(V, v.heap[te + 1], v.heap[te], v.depth) && te++, !ze(V, J, v.heap[te], v.depth)); )
+ for (; te <= v.heap_len && (te < v.heap_len && ke(j, v.heap[te + 1], v.heap[te], v.depth) && te++, !ke(j, J, v.heap[te], v.depth)); )
v.heap[O] = v.heap[te], O = te, te <<= 1;
v.heap[O] = J;
- }, $e = (v, V, O) => {
+ }, ze = (v, j, O) => {
let J, te, ee = 0, Ce, be;
if (v.sym_next !== 0)
do
- J = v.pending_buf[v.sym_buf + ee++] & 255, J += (v.pending_buf[v.sym_buf + ee++] & 255) << 8, te = v.pending_buf[v.sym_buf + ee++], J === 0 ? ae(v, te, V) : (Ce = W[te], ae(v, Ce + D + 1, V), be = T[Ce], be !== 0 && (te -= N[Ce], se(v, te, be)), J--, Ce = he(J), ae(v, Ce, O), be = R[Ce], be !== 0 && (J -= G[Ce], se(v, J, be)));
+ J = v.pending_buf[v.sym_buf + ee++] & 255, J += (v.pending_buf[v.sym_buf + ee++] & 255) << 8, te = v.pending_buf[v.sym_buf + ee++], J === 0 ? se(v, te, j) : (Ce = W[te], se(v, Ce + D + 1, j), be = T[Ce], be !== 0 && (te -= V[Ce], he(v, te, be)), J--, Ce = le(J), se(v, Ce, O), be = R[Ce], be !== 0 && (J -= N[Ce], he(v, J, be)));
while (ee < v.sym_next);
- ae(v, h, V);
- }, Re = (v, V) => {
- const O = V.dyn_tree, J = V.stat_desc.static_tree, te = V.stat_desc.has_stree, ee = V.stat_desc.elems;
- let Ce, be, Xe = -1, de;
+ se(v, h, j);
+ }, Re = (v, j) => {
+ const O = j.dyn_tree, J = j.stat_desc.static_tree, te = j.stat_desc.has_stree, ee = j.stat_desc.elems;
+ let Ce, be, Xe = -1, ce;
for (v.heap_len = 0, v.heap_max = f, Ce = 0; Ce < ee; Ce++)
O[Ce * 2] !== 0 ? (v.heap[++v.heap_len] = Xe = Ce, v.depth[Ce] = 0) : O[Ce * 2 + 1] = 0;
for (; v.heap_len < 2; )
- de = v.heap[++v.heap_len] = Xe < 2 ? ++Xe : 0, O[de * 2] = 1, v.depth[de] = 0, v.opt_len--, te && (v.static_len -= J[de * 2 + 1]);
- for (V.max_code = Xe, Ce = v.heap_len >> 1; Ce >= 1; Ce--)
- Ge(v, O, Ce);
- de = ee;
+ ce = v.heap[++v.heap_len] = Xe < 2 ? ++Xe : 0, O[ce * 2] = 1, v.depth[ce] = 0, v.opt_len--, te && (v.static_len -= J[ce * 2 + 1]);
+ for (j.max_code = Xe, Ce = v.heap_len >> 1; Ce >= 1; Ce--)
+ $e(v, O, Ce);
+ ce = ee;
do
Ce = v.heap[
1
@@ -23196,7 +23196,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
], v.heap[
1
/*SMALLEST*/
- ] = v.heap[v.heap_len--], Ge(
+ ] = v.heap[v.heap_len--], $e(
v,
O,
1
@@ -23204,10 +23204,10 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
), be = v.heap[
1
/*SMALLEST*/
- ], v.heap[--v.heap_max] = Ce, v.heap[--v.heap_max] = be, O[de * 2] = O[Ce * 2] + O[be * 2], v.depth[de] = (v.depth[Ce] >= v.depth[be] ? v.depth[Ce] : v.depth[be]) + 1, O[Ce * 2 + 1] = O[be * 2 + 1] = de, v.heap[
+ ], v.heap[--v.heap_max] = Ce, v.heap[--v.heap_max] = be, O[ce * 2] = O[Ce * 2] + O[be * 2], v.depth[ce] = (v.depth[Ce] >= v.depth[be] ? v.depth[Ce] : v.depth[be]) + 1, O[Ce * 2 + 1] = O[be * 2 + 1] = ce, v.heap[
1
/*SMALLEST*/
- ] = de++, Ge(
+ ] = ce++, $e(
v,
O,
1
@@ -23217,88 +23217,88 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
v.heap[--v.heap_max] = v.heap[
1
/*SMALLEST*/
- ], Ie(v, V), oe(O, Xe, v.bl_count);
- }, Be = (v, V, O) => {
- let J, te = -1, ee, Ce = V[0 * 2 + 1], be = 0, Xe = 7, de = 4;
- for (Ce === 0 && (Xe = 138, de = 3), V[(O + 1) * 2 + 1] = 65535, J = 0; J <= O; J++)
- ee = Ce, Ce = V[(J + 1) * 2 + 1], !(++be < Xe && ee === Ce) && (be < de ? v.bl_tree[ee * 2] += be : ee !== 0 ? (ee !== te && v.bl_tree[ee * 2]++, v.bl_tree[M * 2]++) : be <= 10 ? v.bl_tree[w * 2]++ : v.bl_tree[S * 2]++, be = 0, te = ee, Ce === 0 ? (Xe = 138, de = 3) : ee === Ce ? (Xe = 6, de = 3) : (Xe = 7, de = 4));
- }, ke = (v, V, O) => {
- let J, te = -1, ee, Ce = V[0 * 2 + 1], be = 0, Xe = 7, de = 4;
- for (Ce === 0 && (Xe = 138, de = 3), J = 0; J <= O; J++)
- if (ee = Ce, Ce = V[(J + 1) * 2 + 1], !(++be < Xe && ee === Ce)) {
- if (be < de)
+ ], Pe(v, j), de(O, Xe, v.bl_count);
+ }, Fe = (v, j, O) => {
+ let J, te = -1, ee, Ce = j[0 * 2 + 1], be = 0, Xe = 7, ce = 4;
+ for (Ce === 0 && (Xe = 138, ce = 3), j[(O + 1) * 2 + 1] = 65535, J = 0; J <= O; J++)
+ ee = Ce, Ce = j[(J + 1) * 2 + 1], !(++be < Xe && ee === Ce) && (be < ce ? v.bl_tree[ee * 2] += be : ee !== 0 ? (ee !== te && v.bl_tree[ee * 2]++, v.bl_tree[M * 2]++) : be <= 10 ? v.bl_tree[w * 2]++ : v.bl_tree[S * 2]++, be = 0, te = ee, Ce === 0 ? (Xe = 138, ce = 3) : ee === Ce ? (Xe = 6, ce = 3) : (Xe = 7, ce = 4));
+ }, Ie = (v, j, O) => {
+ let J, te = -1, ee, Ce = j[0 * 2 + 1], be = 0, Xe = 7, ce = 4;
+ for (Ce === 0 && (Xe = 138, ce = 3), J = 0; J <= O; J++)
+ if (ee = Ce, Ce = j[(J + 1) * 2 + 1], !(++be < Xe && ee === Ce)) {
+ if (be < ce)
do
- ae(v, ee, v.bl_tree);
+ se(v, ee, v.bl_tree);
while (--be !== 0);
else
- ee !== 0 ? (ee !== te && (ae(v, ee, v.bl_tree), be--), ae(v, M, v.bl_tree), se(v, be - 3, 2)) : be <= 10 ? (ae(v, w, v.bl_tree), se(v, be - 3, 3)) : (ae(v, S, v.bl_tree), se(v, be - 11, 7));
- be = 0, te = ee, Ce === 0 ? (Xe = 138, de = 3) : ee === Ce ? (Xe = 6, de = 3) : (Xe = 7, de = 4);
+ ee !== 0 ? (ee !== te && (se(v, ee, v.bl_tree), be--), se(v, M, v.bl_tree), he(v, be - 3, 2)) : be <= 10 ? (se(v, w, v.bl_tree), he(v, be - 3, 3)) : (se(v, S, v.bl_tree), he(v, be - 11, 7));
+ be = 0, te = ee, Ce === 0 ? (Xe = 138, ce = 3) : ee === Ce ? (Xe = 6, ce = 3) : (Xe = 7, ce = 4);
}
}, We = (v) => {
- let V;
- for (Be(v, v.dyn_ltree, v.l_desc.max_code), Be(v, v.dyn_dtree, v.d_desc.max_code), Re(v, v.bl_desc), V = b - 1; V >= 3 && v.bl_tree[P[V] * 2 + 1] === 0; V--)
+ let j;
+ for (Fe(v, v.dyn_ltree, v.l_desc.max_code), Fe(v, v.dyn_dtree, v.d_desc.max_code), Re(v, v.bl_desc), j = b - 1; j >= 3 && v.bl_tree[P[j] * 2 + 1] === 0; j--)
;
- return v.opt_len += 3 * (V + 1) + 5 + 5 + 4, V;
- }, Te = (v, V, O, J) => {
+ return v.opt_len += 3 * (j + 1) + 5 + 5 + 4, j;
+ }, Ue = (v, j, O, J) => {
let te;
- for (se(v, V - 257, 5), se(v, O - 1, 5), se(v, J - 4, 4), te = 0; te < J; te++)
- se(v, v.bl_tree[P[te] * 2 + 1], 3);
- ke(v, v.dyn_ltree, V - 1), ke(v, v.dyn_dtree, O - 1);
- }, je = (v) => {
- let V = 4093624447, O;
- for (O = 0; O <= 31; O++, V >>>= 1)
- if (V & 1 && v.dyn_ltree[O * 2] !== 0)
- return g;
+ for (he(v, j - 257, 5), he(v, O - 1, 5), he(v, J - 4, 4), te = 0; te < J; te++)
+ he(v, v.bl_tree[P[te] * 2 + 1], 3);
+ Ie(v, v.dyn_ltree, j - 1), Ie(v, v.dyn_dtree, O - 1);
+ }, Be = (v) => {
+ let j = 4093624447, O;
+ for (O = 0; O <= 31; O++, j >>>= 1)
+ if (j & 1 && v.dyn_ltree[O * 2] !== 0)
+ return p;
if (v.dyn_ltree[9 * 2] !== 0 || v.dyn_ltree[10 * 2] !== 0 || v.dyn_ltree[13 * 2] !== 0)
return _;
for (O = 32; O < D; O++)
if (v.dyn_ltree[O * 2] !== 0)
return _;
- return g;
+ return p;
};
- let Fe = !1;
- const X = (v) => {
- Fe || (ve(), Fe = !0), v.l_desc = new pe(v.dyn_ltree, j), v.d_desc = new pe(v.dyn_dtree, Q), v.bl_desc = new pe(v.bl_tree, ie), v.bi_buf = 0, v.bi_valid = 0, re(v);
- }, Z = (v, V, O, J) => {
- se(v, (p << 1) + (J ? 1 : 0), 3), Se(v), ue(v, O), ue(v, ~O), O && v.pending_buf.set(v.window.subarray(V, V + O), v.pending), v.pending += O;
+ let Ne = !1;
+ const H = (v) => {
+ Ne || (pe(), Ne = !0), v.l_desc = new ge(v.dyn_ltree, G), v.d_desc = new ge(v.dyn_dtree, Q), v.bl_desc = new ge(v.bl_tree, ie), v.bi_buf = 0, v.bi_valid = 0, re(v);
+ }, K = (v, j, O, J) => {
+ he(v, (g << 1) + (J ? 1 : 0), 3), Se(v), oe(v, O), oe(v, ~O), O && v.pending_buf.set(v.window.subarray(j, j + O), v.pending), v.pending += O;
}, q = (v) => {
- se(v, E << 1, 3), ae(v, h, U), xe(v);
- }, fe = (v, V, O, J) => {
+ he(v, E << 1, 3), se(v, h, F), ye(v);
+ }, fe = (v, j, O, J) => {
let te, ee, Ce = 0;
- v.level > 0 ? (v.strm.data_type === x && (v.strm.data_type = je(v)), Re(v, v.l_desc), Re(v, v.d_desc), Ce = We(v), te = v.opt_len + 3 + 7 >>> 3, ee = v.static_len + 3 + 7 >>> 3, ee <= te && (te = ee)) : te = ee = O + 5, O + 4 <= te && V !== -1 ? Z(v, V, O, J) : v.strategy === l || ee === te ? (se(v, (E << 1) + (J ? 1 : 0), 3), $e(v, U, F)) : (se(v, (u << 1) + (J ? 1 : 0), 3), Te(v, v.l_desc.max_code + 1, v.d_desc.max_code + 1, Ce + 1), $e(v, v.dyn_ltree, v.dyn_dtree)), re(v), J && Se(v);
- }, _e = (v, V, O) => (v.pending_buf[v.sym_buf + v.sym_next++] = V, v.pending_buf[v.sym_buf + v.sym_next++] = V >> 8, v.pending_buf[v.sym_buf + v.sym_next++] = O, V === 0 ? v.dyn_ltree[O * 2]++ : (v.matches++, V--, v.dyn_ltree[(W[O] + D + 1) * 2]++, v.dyn_dtree[he(V) * 2]++), v.sym_next === v.sym_end);
- var Me = X, Ae = Z, H = fe, ce = _e, ye = q, Pe = {
+ v.level > 0 ? (v.strm.data_type === x && (v.strm.data_type = Be(v)), Re(v, v.l_desc), Re(v, v.d_desc), Ce = We(v), te = v.opt_len + 3 + 7 >>> 3, ee = v.static_len + 3 + 7 >>> 3, ee <= te && (te = ee)) : te = ee = O + 5, O + 4 <= te && j !== -1 ? K(v, j, O, J) : v.strategy === l || ee === te ? (he(v, (E << 1) + (J ? 1 : 0), 3), ze(v, F, U)) : (he(v, (u << 1) + (J ? 1 : 0), 3), Ue(v, v.l_desc.max_code + 1, v.d_desc.max_code + 1, Ce + 1), ze(v, v.dyn_ltree, v.dyn_dtree)), re(v), J && Se(v);
+ }, _e = (v, j, O) => (v.pending_buf[v.sym_buf + v.sym_next++] = j, v.pending_buf[v.sym_buf + v.sym_next++] = j >> 8, v.pending_buf[v.sym_buf + v.sym_next++] = O, j === 0 ? v.dyn_ltree[O * 2]++ : (v.matches++, j--, v.dyn_ltree[(W[O] + D + 1) * 2]++, v.dyn_dtree[le(j) * 2]++), v.sym_next === v.sym_end);
+ var Me = H, Ae = K, Z = fe, ue = _e, we = q, Te = {
_tr_init: Me,
_tr_stored_block: Ae,
- _tr_flush_block: H,
- _tr_tally: ce,
- _tr_align: ye
- }, De = (v, V, O, J) => {
+ _tr_flush_block: Z,
+ _tr_tally: ue,
+ _tr_align: we
+ }, De = (v, j, O, J) => {
let te = v & 65535 | 0, ee = v >>> 16 & 65535 | 0, Ce = 0;
for (; O !== 0; ) {
Ce = O > 2e3 ? 2e3 : O, O -= Ce;
do
- te = te + V[J++] | 0, ee = ee + te | 0;
+ te = te + j[J++] | 0, ee = ee + te | 0;
while (--Ce);
te %= 65521, ee %= 65521;
}
return te | ee << 16 | 0;
};
- const K = () => {
- let v, V = [];
+ const Y = () => {
+ let v, j = [];
for (var O = 0; O < 256; O++) {
v = O;
for (var J = 0; J < 8; J++)
v = v & 1 ? 3988292384 ^ v >>> 1 : v >>> 1;
- V[O] = v;
+ j[O] = v;
}
- return V;
- }, Oe = new Uint32Array(K());
- var I = (v, V, O, J) => {
+ return j;
+ }, Oe = new Uint32Array(Y());
+ var I = (v, j, O, J) => {
const te = Oe, ee = J + O;
v ^= -1;
for (let Ce = J; Ce < ee; Ce++)
- v = v >>> 8 ^ te[(v ^ V[Ce]) & 255];
+ v = v >>> 8 ^ te[(v ^ j[Ce]) & 255];
return v ^ -1;
}, me = {
2: "need dictionary",
@@ -23319,7 +23319,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
/* Z_BUF_ERROR (-5) */
"-6": "incompatible version"
/* Z_VERSION_ERROR (-6) */
- }, ge = {
+ }, ve = {
/* Allowed flush values; see deflate() and inflate() below for details */
Z_NO_FLUSH: 0,
Z_PARTIAL_FLUSH: 1,
@@ -23359,8 +23359,8 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
Z_DEFLATED: 8
//Z_NULL: null // Use -1 or null inline, depending on var type
};
- const { _tr_init: Y, _tr_stored_block: ne, _tr_flush_block: Ee, _tr_tally: He, _tr_align: Ke } = Pe, {
- Z_NO_FLUSH: Ve,
+ const { _tr_init: X, _tr_stored_block: ne, _tr_flush_block: Ee, _tr_tally: He, _tr_align: Ke } = Te, {
+ Z_NO_FLUSH: je,
Z_PARTIAL_FLUSH: qe,
Z_FULL_FLUSH: wt,
Z_FINISH: nt,
@@ -23372,83 +23372,83 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
Z_BUF_ERROR: Ot,
Z_DEFAULT_COMPRESSION: vt,
Z_FILTERED: mt,
- Z_HUFFMAN_ONLY: gt,
+ Z_HUFFMAN_ONLY: pt,
Z_RLE: Ct,
Z_FIXED: Mt,
Z_DEFAULT_STRATEGY: Ft,
Z_UNKNOWN: hi,
Z_DEFLATED: Ut
- } = ge, di = 9, ci = 15, ui = 8, Ci = 256 + 1 + 29, Qr = 30, Jr = 19, qr = 2 * Ci + 1, en = 15, at = 3, $t = 258, Tt = $t + at + 1, tn = 32, Kt = 42, Li = 57, Di = 69, Si = 73, Oi = 91, Ti = 103, Wt = 113, qt = 666, At = 1, Zt = 2, Gt = 3, Yt = 4, rn = 3, Nt = (v, V) => (v.msg = me[V], V), Vi = (v) => v * 2 - (v > 4 ? 9 : 0), Bt = (v) => {
- let V = v.length;
- for (; --V >= 0; )
- v[V] = 0;
+ } = ve, di = 9, ci = 15, ui = 8, Ci = 256 + 1 + 29, Qr = 30, Jr = 19, qr = 2 * Ci + 1, en = 15, at = 3, $t = 258, Tt = $t + at + 1, tn = 32, Kt = 42, Li = 57, Di = 69, Si = 73, Oi = 91, Ti = 103, Wt = 113, qt = 666, At = 1, Zt = 2, Gt = 3, Yt = 4, rn = 3, Nt = (v, j) => (v.msg = me[j], j), Vi = (v) => v * 2 - (v > 4 ? 9 : 0), Bt = (v) => {
+ let j = v.length;
+ for (; --j >= 0; )
+ v[j] = 0;
}, nn = (v) => {
- let V, O, J, te = v.w_size;
- V = v.hash_size, J = V;
+ let j, O, J, te = v.w_size;
+ j = v.hash_size, J = j;
do
O = v.head[--J], v.head[J] = O >= te ? O - te : 0;
- while (--V);
- V = te, J = V;
+ while (--j);
+ j = te, J = j;
do
O = v.prev[--J], v.prev[J] = O >= te ? O - te : 0;
- while (--V);
+ while (--j);
};
- let kt = (v, V, O) => (V << v.hash_shift ^ O) & v.hash_mask;
+ let kt = (v, j, O) => (j << v.hash_shift ^ O) & v.hash_mask;
const Lt = (v) => {
- const V = v.state;
- let O = V.pending;
- O > v.avail_out && (O = v.avail_out), O !== 0 && (v.output.set(V.pending_buf.subarray(V.pending_out, V.pending_out + O), v.next_out), v.next_out += O, V.pending_out += O, v.total_out += O, v.avail_out -= O, V.pending -= O, V.pending === 0 && (V.pending_out = 0));
- }, Dt = (v, V) => {
- Ee(v, v.block_start >= 0 ? v.block_start : -1, v.strstart - v.block_start, V), v.block_start = v.strstart, Lt(v.strm);
- }, dt = (v, V) => {
- v.pending_buf[v.pending++] = V;
- }, ei = (v, V) => {
- v.pending_buf[v.pending++] = V >>> 8 & 255, v.pending_buf[v.pending++] = V & 255;
- }, Pi = (v, V, O, J) => {
+ const j = v.state;
+ let O = j.pending;
+ O > v.avail_out && (O = v.avail_out), O !== 0 && (v.output.set(j.pending_buf.subarray(j.pending_out, j.pending_out + O), v.next_out), v.next_out += O, j.pending_out += O, v.total_out += O, v.avail_out -= O, j.pending -= O, j.pending === 0 && (j.pending_out = 0));
+ }, Dt = (v, j) => {
+ Ee(v, v.block_start >= 0 ? v.block_start : -1, v.strstart - v.block_start, j), v.block_start = v.strstart, Lt(v.strm);
+ }, dt = (v, j) => {
+ v.pending_buf[v.pending++] = j;
+ }, ei = (v, j) => {
+ v.pending_buf[v.pending++] = j >>> 8 & 255, v.pending_buf[v.pending++] = j & 255;
+ }, Pi = (v, j, O, J) => {
let te = v.avail_in;
- return te > J && (te = J), te === 0 ? 0 : (v.avail_in -= te, V.set(v.input.subarray(v.next_in, v.next_in + te), O), v.state.wrap === 1 ? v.adler = De(v.adler, V, te, O) : v.state.wrap === 2 && (v.adler = I(v.adler, V, te, O)), v.next_in += te, v.total_in += te, te);
- }, ji = (v, V) => {
+ return te > J && (te = J), te === 0 ? 0 : (v.avail_in -= te, j.set(v.input.subarray(v.next_in, v.next_in + te), O), v.state.wrap === 1 ? v.adler = De(v.adler, j, te, O) : v.state.wrap === 2 && (v.adler = I(v.adler, j, te, O)), v.next_in += te, v.total_in += te, te);
+ }, ji = (v, j) => {
let O = v.max_chain_length, J = v.strstart, te, ee, Ce = v.prev_length, be = v.nice_match;
- const Xe = v.strstart > v.w_size - Tt ? v.strstart - (v.w_size - Tt) : 0, de = v.window, Le = v.w_mask, ht = v.prev, Ye = v.strstart + $t;
- let Ue = de[J + Ce - 1], Qe = de[J + Ce];
+ const Xe = v.strstart > v.w_size - Tt ? v.strstart - (v.w_size - Tt) : 0, ce = v.window, Le = v.w_mask, ht = v.prev, Ye = v.strstart + $t;
+ let Ge = ce[J + Ce - 1], Qe = ce[J + Ce];
v.prev_length >= v.good_match && (O >>= 2), be > v.lookahead && (be = v.lookahead);
do
- if (te = V, !(de[te + Ce] !== Qe || de[te + Ce - 1] !== Ue || de[te] !== de[J] || de[++te] !== de[J + 1])) {
+ if (te = j, !(ce[te + Ce] !== Qe || ce[te + Ce - 1] !== Ge || ce[te] !== ce[J] || ce[++te] !== ce[J + 1])) {
J += 2, te++;
do
;
- while (de[++J] === de[++te] && de[++J] === de[++te] && de[++J] === de[++te] && de[++J] === de[++te] && de[++J] === de[++te] && de[++J] === de[++te] && de[++J] === de[++te] && de[++J] === de[++te] && J < Ye);
+ while (ce[++J] === ce[++te] && ce[++J] === ce[++te] && ce[++J] === ce[++te] && ce[++J] === ce[++te] && ce[++J] === ce[++te] && ce[++J] === ce[++te] && ce[++J] === ce[++te] && ce[++J] === ce[++te] && J < Ye);
if (ee = $t - (Ye - J), J = Ye - $t, ee > Ce) {
- if (v.match_start = V, Ce = ee, ee >= be)
+ if (v.match_start = j, Ce = ee, ee >= be)
break;
- Ue = de[J + Ce - 1], Qe = de[J + Ce];
+ Ge = ce[J + Ce - 1], Qe = ce[J + Ce];
}
}
- while ((V = ht[V & Le]) > Xe && --O !== 0);
+ while ((j = ht[j & Le]) > Xe && --O !== 0);
return Ce <= v.lookahead ? Ce : v.lookahead;
}, Xt = (v) => {
- const V = v.w_size;
+ const j = v.w_size;
let O, J, te;
do {
- if (J = v.window_size - v.lookahead - v.strstart, v.strstart >= V + (V - Tt) && (v.window.set(v.window.subarray(V, V + V - J), 0), v.match_start -= V, v.strstart -= V, v.block_start -= V, v.insert > v.strstart && (v.insert = v.strstart), nn(v), J += V), v.strm.avail_in === 0)
+ if (J = v.window_size - v.lookahead - v.strstart, v.strstart >= j + (j - Tt) && (v.window.set(v.window.subarray(j, j + j - J), 0), v.match_start -= j, v.strstart -= j, v.block_start -= j, v.insert > v.strstart && (v.insert = v.strstart), nn(v), J += j), v.strm.avail_in === 0)
break;
if (O = Pi(v.strm, v.window, v.strstart + v.lookahead, J), v.lookahead += O, v.lookahead + v.insert >= at)
for (te = v.strstart - v.insert, v.ins_h = v.window[te], v.ins_h = kt(v, v.ins_h, v.window[te + 1]); v.insert && (v.ins_h = kt(v, v.ins_h, v.window[te + at - 1]), v.prev[te & v.w_mask] = v.head[v.ins_h], v.head[v.ins_h] = te, te++, v.insert--, !(v.lookahead + v.insert < at)); )
;
} while (v.lookahead < Tt && v.strm.avail_in !== 0);
- }, Hi = (v, V) => {
+ }, Hi = (v, j) => {
let O = v.pending_buf_size - 5 > v.w_size ? v.w_size : v.pending_buf_size - 5, J, te, ee, Ce = 0, be = v.strm.avail_in;
do {
- if (J = 65535, ee = v.bi_valid + 42 >> 3, v.strm.avail_out < ee || (ee = v.strm.avail_out - ee, te = v.strstart - v.block_start, J > te + v.strm.avail_in && (J = te + v.strm.avail_in), J > ee && (J = ee), J < O && (J === 0 && V !== nt || V === Ve || J !== te + v.strm.avail_in)))
+ if (J = 65535, ee = v.bi_valid + 42 >> 3, v.strm.avail_out < ee || (ee = v.strm.avail_out - ee, te = v.strstart - v.block_start, J > te + v.strm.avail_in && (J = te + v.strm.avail_in), J > ee && (J = ee), J < O && (J === 0 && j !== nt || j === je || J !== te + v.strm.avail_in)))
break;
- Ce = V === nt && J === te + v.strm.avail_in ? 1 : 0, ne(v, 0, 0, Ce), v.pending_buf[v.pending - 4] = J, v.pending_buf[v.pending - 3] = J >> 8, v.pending_buf[v.pending - 2] = ~J, v.pending_buf[v.pending - 1] = ~J >> 8, Lt(v.strm), te && (te > J && (te = J), v.strm.output.set(v.window.subarray(v.block_start, v.block_start + te), v.strm.next_out), v.strm.next_out += te, v.strm.avail_out -= te, v.strm.total_out += te, v.block_start += te, J -= te), J && (Pi(v.strm, v.strm.output, v.strm.next_out, J), v.strm.next_out += J, v.strm.avail_out -= J, v.strm.total_out += J);
+ Ce = j === nt && J === te + v.strm.avail_in ? 1 : 0, ne(v, 0, 0, Ce), v.pending_buf[v.pending - 4] = J, v.pending_buf[v.pending - 3] = J >> 8, v.pending_buf[v.pending - 2] = ~J, v.pending_buf[v.pending - 1] = ~J >> 8, Lt(v.strm), te && (te > J && (te = J), v.strm.output.set(v.window.subarray(v.block_start, v.block_start + te), v.strm.next_out), v.strm.next_out += te, v.strm.avail_out -= te, v.strm.total_out += te, v.block_start += te, J -= te), J && (Pi(v.strm, v.strm.output, v.strm.next_out, J), v.strm.next_out += J, v.strm.avail_out -= J, v.strm.total_out += J);
} while (Ce === 0);
- return be -= v.strm.avail_in, be && (be >= v.w_size ? (v.matches = 2, v.window.set(v.strm.input.subarray(v.strm.next_in - v.w_size, v.strm.next_in), 0), v.strstart = v.w_size, v.insert = v.strstart) : (v.window_size - v.strstart <= be && (v.strstart -= v.w_size, v.window.set(v.window.subarray(v.w_size, v.w_size + v.strstart), 0), v.matches < 2 && v.matches++, v.insert > v.strstart && (v.insert = v.strstart)), v.window.set(v.strm.input.subarray(v.strm.next_in - be, v.strm.next_in), v.strstart), v.strstart += be, v.insert += be > v.w_size - v.insert ? v.w_size - v.insert : be), v.block_start = v.strstart), v.high_water < v.strstart && (v.high_water = v.strstart), Ce ? Yt : V !== Ve && V !== nt && v.strm.avail_in === 0 && v.strstart === v.block_start ? Zt : (ee = v.window_size - v.strstart, v.strm.avail_in > ee && v.block_start >= v.w_size && (v.block_start -= v.w_size, v.strstart -= v.w_size, v.window.set(v.window.subarray(v.w_size, v.w_size + v.strstart), 0), v.matches < 2 && v.matches++, ee += v.w_size, v.insert > v.strstart && (v.insert = v.strstart)), ee > v.strm.avail_in && (ee = v.strm.avail_in), ee && (Pi(v.strm, v.window, v.strstart, ee), v.strstart += ee, v.insert += ee > v.w_size - v.insert ? v.w_size - v.insert : ee), v.high_water < v.strstart && (v.high_water = v.strstart), ee = v.bi_valid + 42 >> 3, ee = v.pending_buf_size - ee > 65535 ? 65535 : v.pending_buf_size - ee, O = ee > v.w_size ? v.w_size : ee, te = v.strstart - v.block_start, (te >= O || (te || V === nt) && V !== Ve && v.strm.avail_in === 0 && te <= ee) && (J = te > ee ? ee : te, Ce = V === nt && v.strm.avail_in === 0 && J === te ? 1 : 0, ne(v, v.block_start, J, Ce), v.block_start += J, Lt(v.strm)), Ce ? Gt : At);
- }, Ii = (v, V) => {
+ return be -= v.strm.avail_in, be && (be >= v.w_size ? (v.matches = 2, v.window.set(v.strm.input.subarray(v.strm.next_in - v.w_size, v.strm.next_in), 0), v.strstart = v.w_size, v.insert = v.strstart) : (v.window_size - v.strstart <= be && (v.strstart -= v.w_size, v.window.set(v.window.subarray(v.w_size, v.w_size + v.strstart), 0), v.matches < 2 && v.matches++, v.insert > v.strstart && (v.insert = v.strstart)), v.window.set(v.strm.input.subarray(v.strm.next_in - be, v.strm.next_in), v.strstart), v.strstart += be, v.insert += be > v.w_size - v.insert ? v.w_size - v.insert : be), v.block_start = v.strstart), v.high_water < v.strstart && (v.high_water = v.strstart), Ce ? Yt : j !== je && j !== nt && v.strm.avail_in === 0 && v.strstart === v.block_start ? Zt : (ee = v.window_size - v.strstart, v.strm.avail_in > ee && v.block_start >= v.w_size && (v.block_start -= v.w_size, v.strstart -= v.w_size, v.window.set(v.window.subarray(v.w_size, v.w_size + v.strstart), 0), v.matches < 2 && v.matches++, ee += v.w_size, v.insert > v.strstart && (v.insert = v.strstart)), ee > v.strm.avail_in && (ee = v.strm.avail_in), ee && (Pi(v.strm, v.window, v.strstart, ee), v.strstart += ee, v.insert += ee > v.w_size - v.insert ? v.w_size - v.insert : ee), v.high_water < v.strstart && (v.high_water = v.strstart), ee = v.bi_valid + 42 >> 3, ee = v.pending_buf_size - ee > 65535 ? 65535 : v.pending_buf_size - ee, O = ee > v.w_size ? v.w_size : ee, te = v.strstart - v.block_start, (te >= O || (te || j === nt) && j !== je && v.strm.avail_in === 0 && te <= ee) && (J = te > ee ? ee : te, Ce = j === nt && v.strm.avail_in === 0 && J === te ? 1 : 0, ne(v, v.block_start, J, Ce), v.block_start += J, Lt(v.strm)), Ce ? Gt : At);
+ }, Ii = (v, j) => {
let O, J;
for (; ; ) {
if (v.lookahead < Tt) {
- if (Xt(v), v.lookahead < Tt && V === Ve)
+ if (Xt(v), v.lookahead < Tt && j === je)
return At;
if (v.lookahead === 0)
break;
@@ -23467,12 +23467,12 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
if (J && (Dt(v, !1), v.strm.avail_out === 0))
return At;
}
- return v.insert = v.strstart < at - 1 ? v.strstart : at - 1, V === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
- }, Qt = (v, V) => {
+ return v.insert = v.strstart < at - 1 ? v.strstart : at - 1, j === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
+ }, Qt = (v, j) => {
let O, J, te;
for (; ; ) {
if (v.lookahead < Tt) {
- if (Xt(v), v.lookahead < Tt && V === Ve)
+ if (Xt(v), v.lookahead < Tt && j === je)
return At;
if (v.lookahead === 0)
break;
@@ -23490,13 +23490,13 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
} else
v.match_available = 1, v.strstart++, v.lookahead--;
}
- return v.match_available && (J = He(v, 0, v.window[v.strstart - 1]), v.match_available = 0), v.insert = v.strstart < at - 1 ? v.strstart : at - 1, V === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
- }, sn = (v, V) => {
+ return v.match_available && (J = He(v, 0, v.window[v.strstart - 1]), v.match_available = 0), v.insert = v.strstart < at - 1 ? v.strstart : at - 1, j === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
+ }, sn = (v, j) => {
let O, J, te, ee;
const Ce = v.window;
for (; ; ) {
if (v.lookahead <= $t) {
- if (Xt(v), v.lookahead <= $t && V === Ve)
+ if (Xt(v), v.lookahead <= $t && j === je)
return At;
if (v.lookahead === 0)
break;
@@ -23511,22 +23511,22 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
if (v.match_length >= at ? (O = He(v, 1, v.match_length - at), v.lookahead -= v.match_length, v.strstart += v.match_length, v.match_length = 0) : (O = He(v, 0, v.window[v.strstart]), v.lookahead--, v.strstart++), O && (Dt(v, !1), v.strm.avail_out === 0))
return At;
}
- return v.insert = 0, V === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
- }, an = (v, V) => {
+ return v.insert = 0, j === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
+ }, an = (v, j) => {
let O;
for (; ; ) {
if (v.lookahead === 0 && (Xt(v), v.lookahead === 0)) {
- if (V === Ve)
+ if (j === je)
return At;
break;
}
if (v.match_length = 0, O = He(v, 0, v.window[v.strstart]), v.lookahead--, v.strstart++, O && (Dt(v, !1), v.strm.avail_out === 0))
return At;
}
- return v.insert = 0, V === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
+ return v.insert = 0, j === nt ? (Dt(v, !0), v.strm.avail_out === 0 ? Gt : Yt) : v.sym_next && (Dt(v, !1), v.strm.avail_out === 0) ? At : Zt;
};
- function Pt(v, V, O, J, te) {
- this.good_length = v, this.max_lazy = V, this.nice_length = O, this.max_chain = J, this.func = te;
+ function Pt(v, j, O, J, te) {
+ this.good_length = v, this.max_lazy = j, this.nice_length = O, this.max_chain = J, this.func = te;
}
const ti = [
/* good lazy nice chain */
@@ -23559,49 +23559,49 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
const ii = (v) => {
if (!v)
return 1;
- const V = v.state;
- return !V || V.strm !== v || V.status !== Kt && //#ifdef GZIP
- V.status !== Li && //#endif
- V.status !== Di && V.status !== Si && V.status !== Oi && V.status !== Ti && V.status !== Wt && V.status !== qt ? 1 : 0;
+ const j = v.state;
+ return !j || j.strm !== v || j.status !== Kt && //#ifdef GZIP
+ j.status !== Li && //#endif
+ j.status !== Di && j.status !== Si && j.status !== Oi && j.status !== Ti && j.status !== Wt && j.status !== qt ? 1 : 0;
}, Ki = (v) => {
if (ii(v))
return Nt(v, _t);
v.total_in = v.total_out = 0, v.data_type = hi;
- const V = v.state;
- return V.pending = 0, V.pending_out = 0, V.wrap < 0 && (V.wrap = -V.wrap), V.status = //#ifdef GZIP
- V.wrap === 2 ? Li : (
+ const j = v.state;
+ return j.pending = 0, j.pending_out = 0, j.wrap < 0 && (j.wrap = -j.wrap), j.status = //#ifdef GZIP
+ j.wrap === 2 ? Li : (
//#endif
- V.wrap ? Kt : Wt
- ), v.adler = V.wrap === 2 ? 0 : 1, V.last_flush = -2, Y(V), tt;
+ j.wrap ? Kt : Wt
+ ), v.adler = j.wrap === 2 ? 0 : 1, j.last_flush = -2, X(j), tt;
}, Zi = (v) => {
- const V = Ki(v);
- return V === tt && ln(v.state), V;
- }, fn = (v, V) => ii(v) || v.state.wrap !== 2 ? _t : (v.state.gzhead = V, tt), Yi = (v, V, O, J, te, ee) => {
+ const j = Ki(v);
+ return j === tt && ln(v.state), j;
+ }, fn = (v, j) => ii(v) || v.state.wrap !== 2 ? _t : (v.state.gzhead = j, tt), Yi = (v, j, O, J, te, ee) => {
if (!v)
return _t;
let Ce = 1;
- if (V === vt && (V = 6), J < 0 ? (Ce = 0, J = -J) : J > 15 && (Ce = 2, J -= 16), te < 1 || te > di || O !== Ut || J < 8 || J > 15 || V < 0 || V > 9 || ee < 0 || ee > Mt || J === 8 && Ce !== 1)
+ if (j === vt && (j = 6), J < 0 ? (Ce = 0, J = -J) : J > 15 && (Ce = 2, J -= 16), te < 1 || te > di || O !== Ut || J < 8 || J > 15 || j < 0 || j > 9 || ee < 0 || ee > Mt || J === 8 && Ce !== 1)
return Nt(v, _t);
J === 8 && (J = 9);
const be = new on();
- return v.state = be, be.strm = v, be.status = Kt, be.wrap = Ce, be.gzhead = null, be.w_bits = J, be.w_size = 1 << be.w_bits, be.w_mask = be.w_size - 1, be.hash_bits = te + 7, be.hash_size = 1 << be.hash_bits, be.hash_mask = be.hash_size - 1, be.hash_shift = ~~((be.hash_bits + at - 1) / at), be.window = new Uint8Array(be.w_size * 2), be.head = new Uint16Array(be.hash_size), be.prev = new Uint16Array(be.w_size), be.lit_bufsize = 1 << te + 6, be.pending_buf_size = be.lit_bufsize * 4, be.pending_buf = new Uint8Array(be.pending_buf_size), be.sym_buf = be.lit_bufsize, be.sym_end = (be.lit_bufsize - 1) * 3, be.level = V, be.strategy = ee, be.method = O, Zi(v);
- }, hn = (v, V) => Yi(v, V, Ut, ci, ui, Ft), dn = (v, V) => {
- if (ii(v) || V > rt || V < 0)
+ return v.state = be, be.strm = v, be.status = Kt, be.wrap = Ce, be.gzhead = null, be.w_bits = J, be.w_size = 1 << be.w_bits, be.w_mask = be.w_size - 1, be.hash_bits = te + 7, be.hash_size = 1 << be.hash_bits, be.hash_mask = be.hash_size - 1, be.hash_shift = ~~((be.hash_bits + at - 1) / at), be.window = new Uint8Array(be.w_size * 2), be.head = new Uint16Array(be.hash_size), be.prev = new Uint16Array(be.w_size), be.lit_bufsize = 1 << te + 6, be.pending_buf_size = be.lit_bufsize * 4, be.pending_buf = new Uint8Array(be.pending_buf_size), be.sym_buf = be.lit_bufsize, be.sym_end = (be.lit_bufsize - 1) * 3, be.level = j, be.strategy = ee, be.method = O, Zi(v);
+ }, hn = (v, j) => Yi(v, j, Ut, ci, ui, Ft), dn = (v, j) => {
+ if (ii(v) || j > rt || j < 0)
return v ? Nt(v, _t) : _t;
const O = v.state;
- if (!v.output || v.avail_in !== 0 && !v.input || O.status === qt && V !== nt)
+ if (!v.output || v.avail_in !== 0 && !v.input || O.status === qt && j !== nt)
return Nt(v, v.avail_out === 0 ? Ot : _t);
const J = O.last_flush;
- if (O.last_flush = V, O.pending !== 0) {
+ if (O.last_flush = j, O.pending !== 0) {
if (Lt(v), v.avail_out === 0)
return O.last_flush = -1, tt;
- } else if (v.avail_in === 0 && Vi(V) <= Vi(J) && V !== nt)
+ } else if (v.avail_in === 0 && Vi(j) <= Vi(J) && j !== nt)
return Nt(v, Ot);
if (O.status === qt && v.avail_in !== 0)
return Nt(v, Ot);
if (O.status === Kt && O.wrap === 0 && (O.status = Wt), O.status === Kt) {
let te = Ut + (O.w_bits - 8 << 4) << 8, ee = -1;
- if (O.strategy >= gt || O.level < 2 ? ee = 0 : O.level < 6 ? ee = 1 : O.level === 6 ? ee = 2 : ee = 3, te |= ee << 6, O.strstart !== 0 && (te |= tn), te += 31 - te % 31, ei(O, te), O.strstart !== 0 && (ei(O, v.adler >>> 16), ei(O, v.adler & 65535)), v.adler = 1, O.status = Wt, Lt(v), O.pending !== 0)
+ if (O.strategy >= pt || O.level < 2 ? ee = 0 : O.level < 6 ? ee = 1 : O.level === 6 ? ee = 2 : ee = 3, te |= ee << 6, O.strstart !== 0 && (te |= tn), te += 31 - te % 31, ei(O, te), O.strstart !== 0 && (ei(O, v.adler >>> 16), ei(O, v.adler & 65535)), v.adler = 1, O.status = Wt, Lt(v), O.pending !== 0)
return O.last_flush = -1, tt;
}
if (O.status === Li) {
@@ -23609,8 +23609,8 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
dt(
O,
(O.gzhead.text ? 1 : 0) + (O.gzhead.hcrc ? 2 : 0) + (O.gzhead.extra ? 4 : 0) + (O.gzhead.name ? 8 : 0) + (O.gzhead.comment ? 16 : 0)
- ), dt(O, O.gzhead.time & 255), dt(O, O.gzhead.time >> 8 & 255), dt(O, O.gzhead.time >> 16 & 255), dt(O, O.gzhead.time >> 24 & 255), dt(O, O.level === 9 ? 2 : O.strategy >= gt || O.level < 2 ? 4 : 0), dt(O, O.gzhead.os & 255), O.gzhead.extra && O.gzhead.extra.length && (dt(O, O.gzhead.extra.length & 255), dt(O, O.gzhead.extra.length >> 8 & 255)), O.gzhead.hcrc && (v.adler = I(v.adler, O.pending_buf, O.pending, 0)), O.gzindex = 0, O.status = Di;
- else if (dt(O, 0), dt(O, 0), dt(O, 0), dt(O, 0), dt(O, 0), dt(O, O.level === 9 ? 2 : O.strategy >= gt || O.level < 2 ? 4 : 0), dt(O, rn), O.status = Wt, Lt(v), O.pending !== 0)
+ ), dt(O, O.gzhead.time & 255), dt(O, O.gzhead.time >> 8 & 255), dt(O, O.gzhead.time >> 16 & 255), dt(O, O.gzhead.time >> 24 & 255), dt(O, O.level === 9 ? 2 : O.strategy >= pt || O.level < 2 ? 4 : 0), dt(O, O.gzhead.os & 255), O.gzhead.extra && O.gzhead.extra.length && (dt(O, O.gzhead.extra.length & 255), dt(O, O.gzhead.extra.length >> 8 & 255)), O.gzhead.hcrc && (v.adler = I(v.adler, O.pending_buf, O.pending, 0)), O.gzindex = 0, O.status = Di;
+ else if (dt(O, 0), dt(O, 0), dt(O, 0), dt(O, 0), dt(O, 0), dt(O, O.level === 9 ? 2 : O.strategy >= pt || O.level < 2 ? 4 : 0), dt(O, rn), O.status = Wt, Lt(v), O.pending !== 0)
return O.last_flush = -1, tt;
}
if (O.status === Di) {
@@ -23666,45 +23666,45 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
if (O.status = Wt, Lt(v), O.pending !== 0)
return O.last_flush = -1, tt;
}
- if (v.avail_in !== 0 || O.lookahead !== 0 || V !== Ve && O.status !== qt) {
- let te = O.level === 0 ? Hi(O, V) : O.strategy === gt ? an(O, V) : O.strategy === Ct ? sn(O, V) : ti[O.level].func(O, V);
+ if (v.avail_in !== 0 || O.lookahead !== 0 || j !== je && O.status !== qt) {
+ let te = O.level === 0 ? Hi(O, j) : O.strategy === pt ? an(O, j) : O.strategy === Ct ? sn(O, j) : ti[O.level].func(O, j);
if ((te === Gt || te === Yt) && (O.status = qt), te === At || te === Gt)
return v.avail_out === 0 && (O.last_flush = -1), tt;
- if (te === Zt && (V === qe ? Ke(O) : V !== rt && (ne(O, 0, 0, !1), V === wt && (Bt(O.head), O.lookahead === 0 && (O.strstart = 0, O.block_start = 0, O.insert = 0))), Lt(v), v.avail_out === 0))
+ if (te === Zt && (j === qe ? Ke(O) : j !== rt && (ne(O, 0, 0, !1), j === wt && (Bt(O.head), O.lookahead === 0 && (O.strstart = 0, O.block_start = 0, O.insert = 0))), Lt(v), v.avail_out === 0))
return O.last_flush = -1, tt;
}
- return V !== nt ? tt : O.wrap <= 0 ? yt : (O.wrap === 2 ? (dt(O, v.adler & 255), dt(O, v.adler >> 8 & 255), dt(O, v.adler >> 16 & 255), dt(O, v.adler >> 24 & 255), dt(O, v.total_in & 255), dt(O, v.total_in >> 8 & 255), dt(O, v.total_in >> 16 & 255), dt(O, v.total_in >> 24 & 255)) : (ei(O, v.adler >>> 16), ei(O, v.adler & 65535)), Lt(v), O.wrap > 0 && (O.wrap = -O.wrap), O.pending !== 0 ? tt : yt);
+ return j !== nt ? tt : O.wrap <= 0 ? yt : (O.wrap === 2 ? (dt(O, v.adler & 255), dt(O, v.adler >> 8 & 255), dt(O, v.adler >> 16 & 255), dt(O, v.adler >> 24 & 255), dt(O, v.total_in & 255), dt(O, v.total_in >> 8 & 255), dt(O, v.total_in >> 16 & 255), dt(O, v.total_in >> 24 & 255)) : (ei(O, v.adler >>> 16), ei(O, v.adler & 65535)), Lt(v), O.wrap > 0 && (O.wrap = -O.wrap), O.pending !== 0 ? tt : yt);
}, cn = (v) => {
if (ii(v))
return _t;
- const V = v.state.status;
- return v.state = null, V === Wt ? Nt(v, It) : tt;
- }, un = (v, V) => {
- let O = V.length;
+ const j = v.state.status;
+ return v.state = null, j === Wt ? Nt(v, It) : tt;
+ }, un = (v, j) => {
+ let O = j.length;
if (ii(v))
return _t;
const J = v.state, te = J.wrap;
if (te === 2 || te === 1 && J.status !== Kt || J.lookahead)
return _t;
- if (te === 1 && (v.adler = De(v.adler, V, O, 0)), J.wrap = 0, O >= J.w_size) {
+ if (te === 1 && (v.adler = De(v.adler, j, O, 0)), J.wrap = 0, O >= J.w_size) {
te === 0 && (Bt(J.head), J.strstart = 0, J.block_start = 0, J.insert = 0);
let Xe = new Uint8Array(J.w_size);
- Xe.set(V.subarray(O - J.w_size, O), 0), V = Xe, O = J.w_size;
+ Xe.set(j.subarray(O - J.w_size, O), 0), j = Xe, O = J.w_size;
}
const ee = v.avail_in, Ce = v.next_in, be = v.input;
- for (v.avail_in = O, v.next_in = 0, v.input = V, Xt(J); J.lookahead >= at; ) {
- let Xe = J.strstart, de = J.lookahead - (at - 1);
+ for (v.avail_in = O, v.next_in = 0, v.input = j, Xt(J); J.lookahead >= at; ) {
+ let Xe = J.strstart, ce = J.lookahead - (at - 1);
do
J.ins_h = kt(J, J.ins_h, J.window[Xe + at - 1]), J.prev[Xe & J.w_mask] = J.head[J.ins_h], J.head[J.ins_h] = Xe, Xe++;
- while (--de);
+ while (--ce);
J.strstart = Xe, J.lookahead = at - 1, Xt(J);
}
return J.strstart += J.lookahead, J.block_start = J.strstart, J.insert = J.lookahead, J.lookahead = 0, J.match_length = J.prev_length = at - 1, J.match_available = 0, v.next_in = Ce, v.input = be, v.avail_in = ee, J.wrap = te, tt;
};
- var _n = hn, gn = Yi, pn = Zi, vn = Ki, mn = fn, bn = dn, xn = cn, yn = un, wn = "pako deflate (from Nodeca project)", ri = {
+ var _n = hn, pn = Yi, gn = Zi, vn = Ki, mn = fn, bn = dn, xn = cn, yn = un, wn = "pako deflate (from Nodeca project)", ri = {
deflateInit: _n,
- deflateInit2: gn,
- deflateReset: pn,
+ deflateInit2: pn,
+ deflateReset: gn,
deflateResetKeep: vn,
deflateSetHeader: mn,
deflate: bn,
@@ -23712,11 +23712,11 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
deflateSetDictionary: yn,
deflateInfo: wn
};
- const En = (v, V) => Object.prototype.hasOwnProperty.call(v, V);
+ const En = (v, j) => Object.prototype.hasOwnProperty.call(v, j);
var Mn = function(v) {
- const V = Array.prototype.slice.call(arguments, 1);
- for (; V.length; ) {
- const O = V.shift();
+ const j = Array.prototype.slice.call(arguments, 1);
+ for (; j.length; ) {
+ const O = j.shift();
if (O) {
if (typeof O != "object")
throw new TypeError(O + "must be non-object");
@@ -23726,16 +23726,16 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
}
return v;
}, An = (v) => {
- let V = 0;
+ let j = 0;
for (let J = 0, te = v.length; J < te; J++)
- V += v[J].length;
- const O = new Uint8Array(V);
+ j += v[J].length;
+ const O = new Uint8Array(j);
for (let J = 0, te = 0, ee = v.length; J < ee; J++) {
let Ce = v[J];
O.set(Ce, te), te += Ce.length;
}
return O;
- }, pi = {
+ }, gi = {
assign: Mn,
flattenChunks: An
};
@@ -23752,25 +23752,25 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
var Cn = (v) => {
if (typeof TextEncoder == "function" && TextEncoder.prototype.encode)
return new TextEncoder().encode(v);
- let V, O, J, te, ee, Ce = v.length, be = 0;
+ let j, O, J, te, ee, Ce = v.length, be = 0;
for (te = 0; te < Ce; te++)
O = v.charCodeAt(te), (O & 64512) === 55296 && te + 1 < Ce && (J = v.charCodeAt(te + 1), (J & 64512) === 56320 && (O = 65536 + (O - 55296 << 10) + (J - 56320), te++)), be += O < 128 ? 1 : O < 2048 ? 2 : O < 65536 ? 3 : 4;
- for (V = new Uint8Array(be), ee = 0, te = 0; ee < be; te++)
- O = v.charCodeAt(te), (O & 64512) === 55296 && te + 1 < Ce && (J = v.charCodeAt(te + 1), (J & 64512) === 56320 && (O = 65536 + (O - 55296 << 10) + (J - 56320), te++)), O < 128 ? V[ee++] = O : O < 2048 ? (V[ee++] = 192 | O >>> 6, V[ee++] = 128 | O & 63) : O < 65536 ? (V[ee++] = 224 | O >>> 12, V[ee++] = 128 | O >>> 6 & 63, V[ee++] = 128 | O & 63) : (V[ee++] = 240 | O >>> 18, V[ee++] = 128 | O >>> 12 & 63, V[ee++] = 128 | O >>> 6 & 63, V[ee++] = 128 | O & 63);
- return V;
+ for (j = new Uint8Array(be), ee = 0, te = 0; ee < be; te++)
+ O = v.charCodeAt(te), (O & 64512) === 55296 && te + 1 < Ce && (J = v.charCodeAt(te + 1), (J & 64512) === 56320 && (O = 65536 + (O - 55296 << 10) + (J - 56320), te++)), O < 128 ? j[ee++] = O : O < 2048 ? (j[ee++] = 192 | O >>> 6, j[ee++] = 128 | O & 63) : O < 65536 ? (j[ee++] = 224 | O >>> 12, j[ee++] = 128 | O >>> 6 & 63, j[ee++] = 128 | O & 63) : (j[ee++] = 240 | O >>> 18, j[ee++] = 128 | O >>> 12 & 63, j[ee++] = 128 | O >>> 6 & 63, j[ee++] = 128 | O & 63);
+ return j;
};
- const Ln = (v, V) => {
- if (V < 65534 && v.subarray && Xi)
- return String.fromCharCode.apply(null, v.length === V ? v : v.subarray(0, V));
+ const Ln = (v, j) => {
+ if (j < 65534 && v.subarray && Xi)
+ return String.fromCharCode.apply(null, v.length === j ? v : v.subarray(0, j));
let O = "";
- for (let J = 0; J < V; J++)
+ for (let J = 0; J < j; J++)
O += String.fromCharCode(v[J]);
return O;
};
- var Dn = (v, V) => {
- const O = V || v.length;
+ var Dn = (v, j) => {
+ const O = j || v.length;
if (typeof TextDecoder == "function" && TextDecoder.prototype.decode)
- return new TextDecoder().decode(v.subarray(0, V));
+ return new TextDecoder().decode(v.subarray(0, j));
let J, te;
const ee = new Array(O * 2);
for (te = 0, J = 0; J < O; ) {
@@ -23793,12 +23793,12 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
Ce < 65536 ? ee[te++] = Ce : (Ce -= 65536, ee[te++] = 55296 | Ce >> 10 & 1023, ee[te++] = 56320 | Ce & 1023);
}
return Ln(ee, te);
- }, Sn = (v, V) => {
- V = V || v.length, V > v.length && (V = v.length);
- let O = V - 1;
+ }, Sn = (v, j) => {
+ j = j || v.length, j > v.length && (j = v.length);
+ let O = j - 1;
for (; O >= 0 && (v[O] & 192) === 128; )
O--;
- return O < 0 || O === 0 ? V : O + ni[v[O]] > V ? O : V;
+ return O < 0 || O === 0 ? j : O + ni[v[O]] > j ? O : j;
}, si = {
string2buf: Cn,
buf2string: Dn,
@@ -23818,9 +23818,9 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
Z_DEFAULT_COMPRESSION: $n,
Z_DEFAULT_STRATEGY: Bn,
Z_DEFLATED: kn
- } = ge;
+ } = ve;
function ai(v) {
- this.options = pi.assign({
+ this.options = gi.assign({
level: $n,
method: kn,
chunkSize: 16384,
@@ -23828,31 +23828,31 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
memLevel: 8,
strategy: Bn
}, v || {});
- let V = this.options;
- V.raw && V.windowBits > 0 ? V.windowBits = -V.windowBits : V.gzip && V.windowBits > 0 && V.windowBits < 16 && (V.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new Qi(), this.strm.avail_out = 0;
+ let j = this.options;
+ j.raw && j.windowBits > 0 ? j.windowBits = -j.windowBits : j.gzip && j.windowBits > 0 && j.windowBits < 16 && (j.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new Qi(), this.strm.avail_out = 0;
let O = ri.deflateInit2(
this.strm,
- V.level,
- V.method,
- V.windowBits,
- V.memLevel,
- V.strategy
+ j.level,
+ j.method,
+ j.windowBits,
+ j.memLevel,
+ j.strategy
);
if (O !== vi)
throw new Error(me[O]);
- if (V.header && ri.deflateSetHeader(this.strm, V.header), V.dictionary) {
+ if (j.header && ri.deflateSetHeader(this.strm, j.header), j.dictionary) {
let J;
- if (typeof V.dictionary == "string" ? J = si.string2buf(V.dictionary) : Ji.call(V.dictionary) === "[object ArrayBuffer]" ? J = new Uint8Array(V.dictionary) : J = V.dictionary, O = ri.deflateSetDictionary(this.strm, J), O !== vi)
+ if (typeof j.dictionary == "string" ? J = si.string2buf(j.dictionary) : Ji.call(j.dictionary) === "[object ArrayBuffer]" ? J = new Uint8Array(j.dictionary) : J = j.dictionary, O = ri.deflateSetDictionary(this.strm, J), O !== vi)
throw new Error(me[O]);
this._dict_set = !0;
}
}
- ai.prototype.push = function(v, V) {
+ ai.prototype.push = function(v, j) {
const O = this.strm, J = this.options.chunkSize;
let te, ee;
if (this.ended)
return !1;
- for (V === ~~V ? ee = V : ee = V === !0 ? Rn : Tn, typeof v == "string" ? O.input = si.string2buf(v) : Ji.call(v) === "[object ArrayBuffer]" ? O.input = new Uint8Array(v) : O.input = v, O.next_in = 0, O.avail_in = O.input.length; ; ) {
+ for (j === ~~j ? ee = j : ee = j === !0 ? Rn : Tn, typeof v == "string" ? O.input = si.string2buf(v) : Ji.call(v) === "[object ArrayBuffer]" ? O.input = new Uint8Array(v) : O.input = v, O.next_in = 0, O.avail_in = O.input.length; ; ) {
if (O.avail_out === 0 && (O.output = new Uint8Array(J), O.next_out = 0, O.avail_out = J), (ee === Pn || ee === In) && O.avail_out <= 6) {
this.onData(O.output.subarray(0, O.next_out)), O.avail_out = 0;
continue;
@@ -23874,21 +23874,21 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
}, ai.prototype.onData = function(v) {
this.chunks.push(v);
}, ai.prototype.onEnd = function(v) {
- v === vi && (this.result = pi.flattenChunks(this.chunks)), this.chunks = [], this.err = v, this.msg = this.strm.msg;
+ v === vi && (this.result = gi.flattenChunks(this.chunks)), this.chunks = [], this.err = v, this.msg = this.strm.msg;
};
- function Ri(v, V) {
- const O = new ai(V);
+ function Ri(v, j) {
+ const O = new ai(j);
if (O.push(v, !0), O.err)
throw O.msg || me[O.err];
return O.result;
}
- function Fn(v, V) {
- return V = V || {}, V.raw = !0, Ri(v, V);
+ function Fn(v, j) {
+ return j = j || {}, j.raw = !0, Ri(v, j);
}
- function Un(v, V) {
- return V = V || {}, V.gzip = !0, Ri(v, V);
+ function Un(v, j) {
+ return j = j || {}, j.gzip = !0, Ri(v, j);
}
- var Wn = ai, Gn = Ri, Nn = Fn, Vn = Un, jn = ge, Hn = {
+ var Wn = ai, Gn = Ri, Nn = Fn, Vn = Un, jn = ve, Hn = {
Deflate: Wn,
deflate: Gn,
deflateRaw: Nn,
@@ -23896,41 +23896,41 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
constants: jn
};
const mi = 16209, Kn = 16191;
- var Zn = function(V, O) {
- let J, te, ee, Ce, be, Xe, de, Le, ht, Ye, Ue, Qe, xt, ot, it, ut, st, Ze, ct, Et, Je, pt, ft, et;
- const lt = V.state;
- J = V.next_in, ft = V.input, te = J + (V.avail_in - 5), ee = V.next_out, et = V.output, Ce = ee - (O - V.avail_out), be = ee + (V.avail_out - 257), Xe = lt.dmax, de = lt.wsize, Le = lt.whave, ht = lt.wnext, Ye = lt.window, Ue = lt.hold, Qe = lt.bits, xt = lt.lencode, ot = lt.distcode, it = (1 << lt.lenbits) - 1, ut = (1 << lt.distbits) - 1;
+ var Zn = function(j, O) {
+ let J, te, ee, Ce, be, Xe, ce, Le, ht, Ye, Ge, Qe, xt, ot, it, ut, st, Ze, ct, Et, Je, gt, ft, et;
+ const lt = j.state;
+ J = j.next_in, ft = j.input, te = J + (j.avail_in - 5), ee = j.next_out, et = j.output, Ce = ee - (O - j.avail_out), be = ee + (j.avail_out - 257), Xe = lt.dmax, ce = lt.wsize, Le = lt.whave, ht = lt.wnext, Ye = lt.window, Ge = lt.hold, Qe = lt.bits, xt = lt.lencode, ot = lt.distcode, it = (1 << lt.lenbits) - 1, ut = (1 << lt.distbits) - 1;
e:
do {
- Qe < 15 && (Ue += ft[J++] << Qe, Qe += 8, Ue += ft[J++] << Qe, Qe += 8), st = xt[Ue & it];
+ Qe < 15 && (Ge += ft[J++] << Qe, Qe += 8, Ge += ft[J++] << Qe, Qe += 8), st = xt[Ge & it];
t:
for (; ; ) {
- if (Ze = st >>> 24, Ue >>>= Ze, Qe -= Ze, Ze = st >>> 16 & 255, Ze === 0)
+ if (Ze = st >>> 24, Ge >>>= Ze, Qe -= Ze, Ze = st >>> 16 & 255, Ze === 0)
et[ee++] = st & 65535;
else if (Ze & 16) {
- ct = st & 65535, Ze &= 15, Ze && (Qe < Ze && (Ue += ft[J++] << Qe, Qe += 8), ct += Ue & (1 << Ze) - 1, Ue >>>= Ze, Qe -= Ze), Qe < 15 && (Ue += ft[J++] << Qe, Qe += 8, Ue += ft[J++] << Qe, Qe += 8), st = ot[Ue & ut];
+ ct = st & 65535, Ze &= 15, Ze && (Qe < Ze && (Ge += ft[J++] << Qe, Qe += 8), ct += Ge & (1 << Ze) - 1, Ge >>>= Ze, Qe -= Ze), Qe < 15 && (Ge += ft[J++] << Qe, Qe += 8, Ge += ft[J++] << Qe, Qe += 8), st = ot[Ge & ut];
i:
for (; ; ) {
- if (Ze = st >>> 24, Ue >>>= Ze, Qe -= Ze, Ze = st >>> 16 & 255, Ze & 16) {
- if (Et = st & 65535, Ze &= 15, Qe < Ze && (Ue += ft[J++] << Qe, Qe += 8, Qe < Ze && (Ue += ft[J++] << Qe, Qe += 8)), Et += Ue & (1 << Ze) - 1, Et > Xe) {
- V.msg = "invalid distance too far back", lt.mode = mi;
+ if (Ze = st >>> 24, Ge >>>= Ze, Qe -= Ze, Ze = st >>> 16 & 255, Ze & 16) {
+ if (Et = st & 65535, Ze &= 15, Qe < Ze && (Ge += ft[J++] << Qe, Qe += 8, Qe < Ze && (Ge += ft[J++] << Qe, Qe += 8)), Et += Ge & (1 << Ze) - 1, Et > Xe) {
+ j.msg = "invalid distance too far back", lt.mode = mi;
break e;
}
- if (Ue >>>= Ze, Qe -= Ze, Ze = ee - Ce, Et > Ze) {
+ if (Ge >>>= Ze, Qe -= Ze, Ze = ee - Ce, Et > Ze) {
if (Ze = Et - Ze, Ze > Le && lt.sane) {
- V.msg = "invalid distance too far back", lt.mode = mi;
+ j.msg = "invalid distance too far back", lt.mode = mi;
break e;
}
- if (Je = 0, pt = Ye, ht === 0) {
- if (Je += de - Ze, Ze < ct) {
+ if (Je = 0, gt = Ye, ht === 0) {
+ if (Je += ce - Ze, Ze < ct) {
ct -= Ze;
do
et[ee++] = Ye[Je++];
while (--Ze);
- Je = ee - Et, pt = et;
+ Je = ee - Et, gt = et;
}
} else if (ht < Ze) {
- if (Je += de + ht - Ze, Ze -= ht, Ze < ct) {
+ if (Je += ce + ht - Ze, Ze -= ht, Ze < ct) {
ct -= Ze;
do
et[ee++] = Ye[Je++];
@@ -23940,7 +23940,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
do
et[ee++] = Ye[Je++];
while (--Ze);
- Je = ee - Et, pt = et;
+ Je = ee - Et, gt = et;
}
}
} else if (Je += ht - Ze, Ze < ct) {
@@ -23948,11 +23948,11 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
do
et[ee++] = Ye[Je++];
while (--Ze);
- Je = ee - Et, pt = et;
+ Je = ee - Et, gt = et;
}
for (; ct > 2; )
- et[ee++] = pt[Je++], et[ee++] = pt[Je++], et[ee++] = pt[Je++], ct -= 3;
- ct && (et[ee++] = pt[Je++], ct > 1 && (et[ee++] = pt[Je++]));
+ et[ee++] = gt[Je++], et[ee++] = gt[Je++], et[ee++] = gt[Je++], ct -= 3;
+ ct && (et[ee++] = gt[Je++], ct > 1 && (et[ee++] = gt[Je++]));
} else {
Je = ee - Et;
do
@@ -23961,10 +23961,10 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
ct && (et[ee++] = et[Je++], ct > 1 && (et[ee++] = et[Je++]));
}
} else if (Ze & 64) {
- V.msg = "invalid distance code", lt.mode = mi;
+ j.msg = "invalid distance code", lt.mode = mi;
break e;
} else {
- st = ot[(st & 65535) + (Ue & (1 << Ze) - 1)];
+ st = ot[(st & 65535) + (Ge & (1 << Ze) - 1)];
continue i;
}
break;
@@ -23974,17 +23974,17 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
lt.mode = Kn;
break e;
} else {
- V.msg = "invalid literal/length code", lt.mode = mi;
+ j.msg = "invalid literal/length code", lt.mode = mi;
break e;
}
else {
- st = xt[(st & 65535) + (Ue & (1 << Ze) - 1)];
+ st = xt[(st & 65535) + (Ge & (1 << Ze) - 1)];
continue t;
}
break;
}
} while (J < te && ee < be);
- ct = Qe >> 3, J -= ct, Qe -= ct << 3, Ue &= (1 << Qe) - 1, V.next_in = J, V.next_out = ee, V.avail_in = J < te ? 5 + (te - J) : 5 - (J - te), V.avail_out = ee < be ? 257 + (be - ee) : 257 - (ee - be), lt.hold = Ue, lt.bits = Qe;
+ ct = Qe >> 3, J -= ct, Qe -= ct << 3, Ge &= (1 << Qe) - 1, j.next_in = J, j.next_out = ee, j.avail_in = J < te ? 5 + (te - J) : 5 - (J - te), j.avail_out = ee < be ? 257 + (be - ee) : 257 - (ee - be), lt.hold = Ge, lt.bits = Qe;
};
const Jt = 15, qi = 852, er = 592, tr = 0, zi = 1, ir = 2, Yn = new Uint16Array([
/* Length codes 257..285 base */
@@ -24121,53 +24121,53 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
64,
64
]);
- var li = (v, V, O, J, te, ee, Ce, be) => {
+ var li = (v, j, O, J, te, ee, Ce, be) => {
const Xe = be.bits;
- let de = 0, Le = 0, ht = 0, Ye = 0, Ue = 0, Qe = 0, xt = 0, ot = 0, it = 0, ut = 0, st, Ze, ct, Et, Je, pt = null, ft;
+ let ce = 0, Le = 0, ht = 0, Ye = 0, Ge = 0, Qe = 0, xt = 0, ot = 0, it = 0, ut = 0, st, Ze, ct, Et, Je, gt = null, ft;
const et = new Uint16Array(Jt + 1), lt = new Uint16Array(Jt + 1);
let Ht = null, Xr, Mi, Ai;
- for (de = 0; de <= Jt; de++)
- et[de] = 0;
+ for (ce = 0; ce <= Jt; ce++)
+ et[ce] = 0;
for (Le = 0; Le < J; Le++)
- et[V[O + Le]]++;
- for (Ue = Xe, Ye = Jt; Ye >= 1 && et[Ye] === 0; Ye--)
+ et[j[O + Le]]++;
+ for (Ge = Xe, Ye = Jt; Ye >= 1 && et[Ye] === 0; Ye--)
;
- if (Ue > Ye && (Ue = Ye), Ye === 0)
+ if (Ge > Ye && (Ge = Ye), Ye === 0)
return te[ee++] = 1 << 24 | 64 << 16 | 0, te[ee++] = 1 << 24 | 64 << 16 | 0, be.bits = 1, 0;
for (ht = 1; ht < Ye && et[ht] === 0; ht++)
;
- for (Ue < ht && (Ue = ht), ot = 1, de = 1; de <= Jt; de++)
- if (ot <<= 1, ot -= et[de], ot < 0)
+ for (Ge < ht && (Ge = ht), ot = 1, ce = 1; ce <= Jt; ce++)
+ if (ot <<= 1, ot -= et[ce], ot < 0)
return -1;
if (ot > 0 && (v === tr || Ye !== 1))
return -1;
- for (lt[1] = 0, de = 1; de < Jt; de++)
- lt[de + 1] = lt[de] + et[de];
+ for (lt[1] = 0, ce = 1; ce < Jt; ce++)
+ lt[ce + 1] = lt[ce] + et[ce];
for (Le = 0; Le < J; Le++)
- V[O + Le] !== 0 && (Ce[lt[V[O + Le]]++] = Le);
- if (v === tr ? (pt = Ht = Ce, ft = 20) : v === zi ? (pt = Yn, Ht = Xn, ft = 257) : (pt = Qn, Ht = Jn, ft = 0), ut = 0, Le = 0, de = ht, Je = ee, Qe = Ue, xt = 0, ct = -1, it = 1 << Ue, Et = it - 1, v === zi && it > qi || v === ir && it > er)
+ j[O + Le] !== 0 && (Ce[lt[j[O + Le]]++] = Le);
+ if (v === tr ? (gt = Ht = Ce, ft = 20) : v === zi ? (gt = Yn, Ht = Xn, ft = 257) : (gt = Qn, Ht = Jn, ft = 0), ut = 0, Le = 0, ce = ht, Je = ee, Qe = Ge, xt = 0, ct = -1, it = 1 << Ge, Et = it - 1, v === zi && it > qi || v === ir && it > er)
return 1;
for (; ; ) {
- Xr = de - xt, Ce[Le] + 1 < ft ? (Mi = 0, Ai = Ce[Le]) : Ce[Le] >= ft ? (Mi = Ht[Ce[Le] - ft], Ai = pt[Ce[Le] - ft]) : (Mi = 96, Ai = 0), st = 1 << de - xt, Ze = 1 << Qe, ht = Ze;
+ Xr = ce - xt, Ce[Le] + 1 < ft ? (Mi = 0, Ai = Ce[Le]) : Ce[Le] >= ft ? (Mi = Ht[Ce[Le] - ft], Ai = gt[Ce[Le] - ft]) : (Mi = 96, Ai = 0), st = 1 << ce - xt, Ze = 1 << Qe, ht = Ze;
do
Ze -= st, te[Je + (ut >> xt) + Ze] = Xr << 24 | Mi << 16 | Ai | 0;
while (Ze !== 0);
- for (st = 1 << de - 1; ut & st; )
+ for (st = 1 << ce - 1; ut & st; )
st >>= 1;
- if (st !== 0 ? (ut &= st - 1, ut += st) : ut = 0, Le++, --et[de] === 0) {
- if (de === Ye)
+ if (st !== 0 ? (ut &= st - 1, ut += st) : ut = 0, Le++, --et[ce] === 0) {
+ if (ce === Ye)
break;
- de = V[O + Ce[Le]];
+ ce = j[O + Ce[Le]];
}
- if (de > Ue && (ut & Et) !== ct) {
- for (xt === 0 && (xt = Ue), Je += ht, Qe = de - xt, ot = 1 << Qe; Qe + xt < Ye && (ot -= et[Qe + xt], !(ot <= 0)); )
+ if (ce > Ge && (ut & Et) !== ct) {
+ for (xt === 0 && (xt = Ge), Je += ht, Qe = ce - xt, ot = 1 << Qe; Qe + xt < Ye && (ot -= et[Qe + xt], !(ot <= 0)); )
Qe++, ot <<= 1;
if (it += 1 << Qe, v === zi && it > qi || v === ir && it > er)
return 1;
- ct = ut & Et, te[ct] = Ue << 24 | Qe << 16 | Je - ee | 0;
+ ct = ut & Et, te[ct] = Ge << 24 | Qe << 16 | Je - ee | 0;
}
}
- return ut !== 0 && (te[Je + ut] = de - xt << 24 | 64 << 16 | 0), be.bits = Ue, 0;
+ return ut !== 0 && (te[Je + ut] = ce - xt << 24 | 64 << 16 | 0), be.bits = Ge, 0;
};
const qn = 0, rr = 1, nr = 2, {
Z_FINISH: sr,
@@ -24181,63 +24181,63 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
Z_MEM_ERROR: lr,
Z_BUF_ERROR: rs,
Z_DEFLATED: or
- } = ge, xi = 16180, fr = 16181, hr = 16182, dr = 16183, cr = 16184, ur = 16185, _r = 16186, gr = 16187, pr = 16188, vr = 16189, yi = 16190, Rt = 16191, $i = 16192, mr = 16193, Bi = 16194, br = 16195, xr = 16196, yr = 16197, wr = 16198, wi = 16199, Ei = 16200, Er = 16201, Mr = 16202, Ar = 16203, Cr = 16204, Lr = 16205, ki = 16206, Dr = 16207, Sr = 16208, bt = 16209, Or = 16210, Tr = 16211, ns = 852, ss = 592, as = 15, Pr = (v) => (v >>> 24 & 255) + (v >>> 8 & 65280) + ((v & 65280) << 8) + ((v & 255) << 24);
+ } = ve, xi = 16180, fr = 16181, hr = 16182, dr = 16183, cr = 16184, ur = 16185, _r = 16186, pr = 16187, gr = 16188, vr = 16189, yi = 16190, Rt = 16191, $i = 16192, mr = 16193, Bi = 16194, br = 16195, xr = 16196, yr = 16197, wr = 16198, wi = 16199, Ei = 16200, Er = 16201, Mr = 16202, Ar = 16203, Cr = 16204, Lr = 16205, ki = 16206, Dr = 16207, Sr = 16208, bt = 16209, Or = 16210, Tr = 16211, ns = 852, ss = 592, as = 15, Pr = (v) => (v >>> 24 & 255) + (v >>> 8 & 65280) + ((v & 65280) << 8) + ((v & 255) << 24);
function ls() {
this.strm = null, this.mode = 0, this.last = !1, this.wrap = 0, this.havedict = !1, this.flags = 0, this.dmax = 0, this.check = 0, this.total = 0, this.head = null, this.wbits = 0, this.wsize = 0, this.whave = 0, this.wnext = 0, this.window = null, this.hold = 0, this.bits = 0, this.length = 0, this.offset = 0, this.extra = 0, this.lencode = null, this.distcode = null, this.lenbits = 0, this.distbits = 0, this.ncode = 0, this.nlen = 0, this.ndist = 0, this.have = 0, this.next = null, this.lens = new Uint16Array(320), this.work = new Uint16Array(288), this.lendyn = null, this.distdyn = null, this.sane = 0, this.back = 0, this.was = 0;
}
const jt = (v) => {
if (!v)
return 1;
- const V = v.state;
- return !V || V.strm !== v || V.mode < xi || V.mode > Tr ? 1 : 0;
+ const j = v.state;
+ return !j || j.strm !== v || j.mode < xi || j.mode > Tr ? 1 : 0;
}, Ir = (v) => {
if (jt(v))
return St;
- const V = v.state;
- return v.total_in = v.total_out = V.total = 0, v.msg = "", V.wrap && (v.adler = V.wrap & 1), V.mode = xi, V.last = 0, V.havedict = 0, V.flags = -1, V.dmax = 32768, V.head = null, V.hold = 0, V.bits = 0, V.lencode = V.lendyn = new Int32Array(ns), V.distcode = V.distdyn = new Int32Array(ss), V.sane = 1, V.back = -1, Vt;
+ const j = v.state;
+ return v.total_in = v.total_out = j.total = 0, v.msg = "", j.wrap && (v.adler = j.wrap & 1), j.mode = xi, j.last = 0, j.havedict = 0, j.flags = -1, j.dmax = 32768, j.head = null, j.hold = 0, j.bits = 0, j.lencode = j.lendyn = new Int32Array(ns), j.distcode = j.distdyn = new Int32Array(ss), j.sane = 1, j.back = -1, Vt;
}, Rr = (v) => {
if (jt(v))
return St;
- const V = v.state;
- return V.wsize = 0, V.whave = 0, V.wnext = 0, Ir(v);
- }, zr = (v, V) => {
+ const j = v.state;
+ return j.wsize = 0, j.whave = 0, j.wnext = 0, Ir(v);
+ }, zr = (v, j) => {
let O;
if (jt(v))
return St;
const J = v.state;
- return V < 0 ? (O = 0, V = -V) : (O = (V >> 4) + 5, V < 48 && (V &= 15)), V && (V < 8 || V > 15) ? St : (J.window !== null && J.wbits !== V && (J.window = null), J.wrap = O, J.wbits = V, Rr(v));
- }, $r = (v, V) => {
+ return j < 0 ? (O = 0, j = -j) : (O = (j >> 4) + 5, j < 48 && (j &= 15)), j && (j < 8 || j > 15) ? St : (J.window !== null && J.wbits !== j && (J.window = null), J.wrap = O, J.wbits = j, Rr(v));
+ }, $r = (v, j) => {
if (!v)
return St;
const O = new ls();
v.state = O, O.strm = v, O.window = null, O.mode = xi;
- const J = zr(v, V);
+ const J = zr(v, j);
return J !== Vt && (v.state = null), J;
}, os = (v) => $r(v, as);
let Br = !0, Fi, Ui;
const fs = (v) => {
if (Br) {
Fi = new Int32Array(512), Ui = new Int32Array(32);
- let V = 0;
- for (; V < 144; )
- v.lens[V++] = 8;
- for (; V < 256; )
- v.lens[V++] = 9;
- for (; V < 280; )
- v.lens[V++] = 7;
- for (; V < 288; )
- v.lens[V++] = 8;
- for (li(rr, v.lens, 0, 288, Fi, 0, v.work, { bits: 9 }), V = 0; V < 32; )
- v.lens[V++] = 5;
+ let j = 0;
+ for (; j < 144; )
+ v.lens[j++] = 8;
+ for (; j < 256; )
+ v.lens[j++] = 9;
+ for (; j < 280; )
+ v.lens[j++] = 7;
+ for (; j < 288; )
+ v.lens[j++] = 8;
+ for (li(rr, v.lens, 0, 288, Fi, 0, v.work, { bits: 9 }), j = 0; j < 32; )
+ v.lens[j++] = 5;
li(nr, v.lens, 0, 32, Ui, 0, v.work, { bits: 5 }), Br = !1;
}
v.lencode = Fi, v.lenbits = 9, v.distcode = Ui, v.distbits = 5;
- }, kr = (v, V, O, J) => {
+ }, kr = (v, j, O, J) => {
let te;
const ee = v.state;
- return ee.window === null && (ee.wsize = 1 << ee.wbits, ee.wnext = 0, ee.whave = 0, ee.window = new Uint8Array(ee.wsize)), J >= ee.wsize ? (ee.window.set(V.subarray(O - ee.wsize, O), 0), ee.wnext = 0, ee.whave = ee.wsize) : (te = ee.wsize - ee.wnext, te > J && (te = J), ee.window.set(V.subarray(O - J, O - J + te), ee.wnext), J -= te, J ? (ee.window.set(V.subarray(O - J, O), 0), ee.wnext = J, ee.whave = ee.wsize) : (ee.wnext += te, ee.wnext === ee.wsize && (ee.wnext = 0), ee.whave < ee.wsize && (ee.whave += te))), 0;
- }, hs = (v, V) => {
- let O, J, te, ee, Ce, be, Xe, de, Le, ht, Ye, Ue, Qe, xt, ot = 0, it, ut, st, Ze, ct, Et, Je, pt;
+ return ee.window === null && (ee.wsize = 1 << ee.wbits, ee.wnext = 0, ee.whave = 0, ee.window = new Uint8Array(ee.wsize)), J >= ee.wsize ? (ee.window.set(j.subarray(O - ee.wsize, O), 0), ee.wnext = 0, ee.whave = ee.wsize) : (te = ee.wsize - ee.wnext, te > J && (te = J), ee.window.set(j.subarray(O - J, O - J + te), ee.wnext), J -= te, J ? (ee.window.set(j.subarray(O - J, O), 0), ee.wnext = J, ee.whave = ee.wsize) : (ee.wnext += te, ee.wnext === ee.wsize && (ee.wnext = 0), ee.whave < ee.wsize && (ee.whave += te))), 0;
+ }, hs = (v, j) => {
+ let O, J, te, ee, Ce, be, Xe, ce, Le, ht, Ye, Ge, Qe, xt, ot = 0, it, ut, st, Ze, ct, Et, Je, gt;
const ft = new Uint8Array(4);
let et, lt;
const Ht = (
@@ -24246,7 +24246,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
);
if (jt(v) || !v.output || !v.input && v.avail_in !== 0)
return St;
- O = v.state, O.mode === Rt && (O.mode = $i), Ce = v.next_out, te = v.output, Xe = v.avail_out, ee = v.next_in, J = v.input, be = v.avail_in, de = O.hold, Le = O.bits, ht = be, Ye = Xe, pt = Vt;
+ O = v.state, O.mode === Rt && (O.mode = $i), Ce = v.next_out, te = v.output, Xe = v.avail_out, ee = v.next_in, J = v.input, be = v.avail_in, ce = O.hold, Le = O.bits, ht = be, Ye = Xe, gt = Vt;
e:
for (; ; )
switch (O.mode) {
@@ -24258,34 +24258,34 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (; Le < 16; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- if (O.wrap & 2 && de === 35615) {
- O.wbits === 0 && (O.wbits = 15), O.check = 0, ft[0] = de & 255, ft[1] = de >>> 8 & 255, O.check = I(O.check, ft, 2, 0), de = 0, Le = 0, O.mode = fr;
+ if (O.wrap & 2 && ce === 35615) {
+ O.wbits === 0 && (O.wbits = 15), O.check = 0, ft[0] = ce & 255, ft[1] = ce >>> 8 & 255, O.check = I(O.check, ft, 2, 0), ce = 0, Le = 0, O.mode = fr;
break;
}
if (O.head && (O.head.done = !1), !(O.wrap & 1) || /* check if zlib header allowed */
- (((de & 255) << 8) + (de >> 8)) % 31) {
+ (((ce & 255) << 8) + (ce >> 8)) % 31) {
v.msg = "incorrect header check", O.mode = bt;
break;
}
- if ((de & 15) !== or) {
+ if ((ce & 15) !== or) {
v.msg = "unknown compression method", O.mode = bt;
break;
}
- if (de >>>= 4, Le -= 4, Je = (de & 15) + 8, O.wbits === 0 && (O.wbits = Je), Je > 15 || Je > O.wbits) {
+ if (ce >>>= 4, Le -= 4, Je = (ce & 15) + 8, O.wbits === 0 && (O.wbits = Je), Je > 15 || Je > O.wbits) {
v.msg = "invalid window size", O.mode = bt;
break;
}
- O.dmax = 1 << O.wbits, O.flags = 0, v.adler = O.check = 1, O.mode = de & 512 ? vr : Rt, de = 0, Le = 0;
+ O.dmax = 1 << O.wbits, O.flags = 0, v.adler = O.check = 1, O.mode = ce & 512 ? vr : Rt, ce = 0, Le = 0;
break;
case fr:
for (; Le < 16; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- if (O.flags = de, (O.flags & 255) !== or) {
+ if (O.flags = ce, (O.flags & 255) !== or) {
v.msg = "unknown compression method", O.mode = bt;
break;
}
@@ -24293,83 +24293,83 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
v.msg = "unknown header flags set", O.mode = bt;
break;
}
- O.head && (O.head.text = de >> 8 & 1), O.flags & 512 && O.wrap & 4 && (ft[0] = de & 255, ft[1] = de >>> 8 & 255, O.check = I(O.check, ft, 2, 0)), de = 0, Le = 0, O.mode = hr;
+ O.head && (O.head.text = ce >> 8 & 1), O.flags & 512 && O.wrap & 4 && (ft[0] = ce & 255, ft[1] = ce >>> 8 & 255, O.check = I(O.check, ft, 2, 0)), ce = 0, Le = 0, O.mode = hr;
case hr:
for (; Le < 32; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- O.head && (O.head.time = de), O.flags & 512 && O.wrap & 4 && (ft[0] = de & 255, ft[1] = de >>> 8 & 255, ft[2] = de >>> 16 & 255, ft[3] = de >>> 24 & 255, O.check = I(O.check, ft, 4, 0)), de = 0, Le = 0, O.mode = dr;
+ O.head && (O.head.time = ce), O.flags & 512 && O.wrap & 4 && (ft[0] = ce & 255, ft[1] = ce >>> 8 & 255, ft[2] = ce >>> 16 & 255, ft[3] = ce >>> 24 & 255, O.check = I(O.check, ft, 4, 0)), ce = 0, Le = 0, O.mode = dr;
case dr:
for (; Le < 16; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- O.head && (O.head.xflags = de & 255, O.head.os = de >> 8), O.flags & 512 && O.wrap & 4 && (ft[0] = de & 255, ft[1] = de >>> 8 & 255, O.check = I(O.check, ft, 2, 0)), de = 0, Le = 0, O.mode = cr;
+ O.head && (O.head.xflags = ce & 255, O.head.os = ce >> 8), O.flags & 512 && O.wrap & 4 && (ft[0] = ce & 255, ft[1] = ce >>> 8 & 255, O.check = I(O.check, ft, 2, 0)), ce = 0, Le = 0, O.mode = cr;
case cr:
if (O.flags & 1024) {
for (; Le < 16; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- O.length = de, O.head && (O.head.extra_len = de), O.flags & 512 && O.wrap & 4 && (ft[0] = de & 255, ft[1] = de >>> 8 & 255, O.check = I(O.check, ft, 2, 0)), de = 0, Le = 0;
+ O.length = ce, O.head && (O.head.extra_len = ce), O.flags & 512 && O.wrap & 4 && (ft[0] = ce & 255, ft[1] = ce >>> 8 & 255, O.check = I(O.check, ft, 2, 0)), ce = 0, Le = 0;
} else
O.head && (O.head.extra = null);
O.mode = ur;
case ur:
- if (O.flags & 1024 && (Ue = O.length, Ue > be && (Ue = be), Ue && (O.head && (Je = O.head.extra_len - O.length, O.head.extra || (O.head.extra = new Uint8Array(O.head.extra_len)), O.head.extra.set(
+ if (O.flags & 1024 && (Ge = O.length, Ge > be && (Ge = be), Ge && (O.head && (Je = O.head.extra_len - O.length, O.head.extra || (O.head.extra = new Uint8Array(O.head.extra_len)), O.head.extra.set(
J.subarray(
ee,
// extra field is limited to 65536 bytes
// - no need for additional size check
- ee + Ue
+ ee + Ge
),
/*len + copy > state.head.extra_max - len ? state.head.extra_max : copy,*/
Je
- )), O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, Ue, ee)), be -= Ue, ee += Ue, O.length -= Ue), O.length))
+ )), O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, Ge, ee)), be -= Ge, ee += Ge, O.length -= Ge), O.length))
break e;
O.length = 0, O.mode = _r;
case _r:
if (O.flags & 2048) {
if (be === 0)
break e;
- Ue = 0;
+ Ge = 0;
do
- Je = J[ee + Ue++], O.head && Je && O.length < 65536 && (O.head.name += String.fromCharCode(Je));
- while (Je && Ue < be);
- if (O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, Ue, ee)), be -= Ue, ee += Ue, Je)
+ Je = J[ee + Ge++], O.head && Je && O.length < 65536 && (O.head.name += String.fromCharCode(Je));
+ while (Je && Ge < be);
+ if (O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, Ge, ee)), be -= Ge, ee += Ge, Je)
break e;
} else
O.head && (O.head.name = null);
- O.length = 0, O.mode = gr;
- case gr:
+ O.length = 0, O.mode = pr;
+ case pr:
if (O.flags & 4096) {
if (be === 0)
break e;
- Ue = 0;
+ Ge = 0;
do
- Je = J[ee + Ue++], O.head && Je && O.length < 65536 && (O.head.comment += String.fromCharCode(Je));
- while (Je && Ue < be);
- if (O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, Ue, ee)), be -= Ue, ee += Ue, Je)
+ Je = J[ee + Ge++], O.head && Je && O.length < 65536 && (O.head.comment += String.fromCharCode(Je));
+ while (Je && Ge < be);
+ if (O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, Ge, ee)), be -= Ge, ee += Ge, Je)
break e;
} else
O.head && (O.head.comment = null);
- O.mode = pr;
- case pr:
+ O.mode = gr;
+ case gr:
if (O.flags & 512) {
for (; Le < 16; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- if (O.wrap & 4 && de !== (O.check & 65535)) {
+ if (O.wrap & 4 && ce !== (O.check & 65535)) {
v.msg = "header crc mismatch", O.mode = bt;
break;
}
- de = 0, Le = 0;
+ ce = 0, Le = 0;
}
O.head && (O.head.hcrc = O.flags >> 9 & 1, O.head.done = !0), v.adler = O.check = 0, O.mode = Rt;
break;
@@ -24377,33 +24377,33 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (; Le < 32; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- v.adler = O.check = Pr(de), de = 0, Le = 0, O.mode = yi;
+ v.adler = O.check = Pr(ce), ce = 0, Le = 0, O.mode = yi;
case yi:
if (O.havedict === 0)
- return v.next_out = Ce, v.avail_out = Xe, v.next_in = ee, v.avail_in = be, O.hold = de, O.bits = Le, is;
+ return v.next_out = Ce, v.avail_out = Xe, v.next_in = ee, v.avail_in = be, O.hold = ce, O.bits = Le, is;
v.adler = O.check = 1, O.mode = Rt;
case Rt:
- if (V === es || V === bi)
+ if (j === es || j === bi)
break e;
case $i:
if (O.last) {
- de >>>= Le & 7, Le -= Le & 7, O.mode = ki;
+ ce >>>= Le & 7, Le -= Le & 7, O.mode = ki;
break;
}
for (; Le < 3; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- switch (O.last = de & 1, de >>>= 1, Le -= 1, de & 3) {
+ switch (O.last = ce & 1, ce >>>= 1, Le -= 1, ce & 3) {
case 0:
O.mode = mr;
break;
case 1:
- if (fs(O), O.mode = wi, V === bi) {
- de >>>= 2, Le -= 2;
+ if (fs(O), O.mode = wi, j === bi) {
+ ce >>>= 2, Le -= 2;
break e;
}
break;
@@ -24413,27 +24413,27 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
case 3:
v.msg = "invalid block type", O.mode = bt;
}
- de >>>= 2, Le -= 2;
+ ce >>>= 2, Le -= 2;
break;
case mr:
- for (de >>>= Le & 7, Le -= Le & 7; Le < 32; ) {
+ for (ce >>>= Le & 7, Le -= Le & 7; Le < 32; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- if ((de & 65535) !== (de >>> 16 ^ 65535)) {
+ if ((ce & 65535) !== (ce >>> 16 ^ 65535)) {
v.msg = "invalid stored block lengths", O.mode = bt;
break;
}
- if (O.length = de & 65535, de = 0, Le = 0, O.mode = Bi, V === bi)
+ if (O.length = ce & 65535, ce = 0, Le = 0, O.mode = Bi, j === bi)
break e;
case Bi:
O.mode = br;
case br:
- if (Ue = O.length, Ue) {
- if (Ue > be && (Ue = be), Ue > Xe && (Ue = Xe), Ue === 0)
+ if (Ge = O.length, Ge) {
+ if (Ge > be && (Ge = be), Ge > Xe && (Ge = Xe), Ge === 0)
break e;
- te.set(J.subarray(ee, ee + Ue), Ce), be -= Ue, ee += Ue, Xe -= Ue, Ce += Ue, O.length -= Ue;
+ te.set(J.subarray(ee, ee + Ge), Ce), be -= Ge, ee += Ge, Xe -= Ge, Ce += Ge, O.length -= Ge;
break;
}
O.mode = Rt;
@@ -24442,9 +24442,9 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (; Le < 14; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- if (O.nlen = (de & 31) + 257, de >>>= 5, Le -= 5, O.ndist = (de & 31) + 1, de >>>= 5, Le -= 5, O.ncode = (de & 15) + 4, de >>>= 4, Le -= 4, O.nlen > 286 || O.ndist > 30) {
+ if (O.nlen = (ce & 31) + 257, ce >>>= 5, Le -= 5, O.ndist = (ce & 31) + 1, ce >>>= 5, Le -= 5, O.ncode = (ce & 15) + 4, ce >>>= 4, Le -= 4, O.nlen > 286 || O.ndist > 30) {
v.msg = "too many length or distance symbols", O.mode = bt;
break;
}
@@ -24454,58 +24454,58 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (; Le < 3; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- O.lens[Ht[O.have++]] = de & 7, de >>>= 3, Le -= 3;
+ O.lens[Ht[O.have++]] = ce & 7, ce >>>= 3, Le -= 3;
}
for (; O.have < 19; )
O.lens[Ht[O.have++]] = 0;
- if (O.lencode = O.lendyn, O.lenbits = 7, et = { bits: O.lenbits }, pt = li(qn, O.lens, 0, 19, O.lencode, 0, O.work, et), O.lenbits = et.bits, pt) {
+ if (O.lencode = O.lendyn, O.lenbits = 7, et = { bits: O.lenbits }, gt = li(qn, O.lens, 0, 19, O.lencode, 0, O.work, et), O.lenbits = et.bits, gt) {
v.msg = "invalid code lengths set", O.mode = bt;
break;
}
O.have = 0, O.mode = wr;
case wr:
for (; O.have < O.nlen + O.ndist; ) {
- for (; ot = O.lencode[de & (1 << O.lenbits) - 1], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(it <= Le); ) {
+ for (; ot = O.lencode[ce & (1 << O.lenbits) - 1], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(it <= Le); ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
if (st < 16)
- de >>>= it, Le -= it, O.lens[O.have++] = st;
+ ce >>>= it, Le -= it, O.lens[O.have++] = st;
else {
if (st === 16) {
for (lt = it + 2; Le < lt; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- if (de >>>= it, Le -= it, O.have === 0) {
+ if (ce >>>= it, Le -= it, O.have === 0) {
v.msg = "invalid bit length repeat", O.mode = bt;
break;
}
- Je = O.lens[O.have - 1], Ue = 3 + (de & 3), de >>>= 2, Le -= 2;
+ Je = O.lens[O.have - 1], Ge = 3 + (ce & 3), ce >>>= 2, Le -= 2;
} else if (st === 17) {
for (lt = it + 3; Le < lt; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- de >>>= it, Le -= it, Je = 0, Ue = 3 + (de & 7), de >>>= 3, Le -= 3;
+ ce >>>= it, Le -= it, Je = 0, Ge = 3 + (ce & 7), ce >>>= 3, Le -= 3;
} else {
for (lt = it + 7; Le < lt; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- de >>>= it, Le -= it, Je = 0, Ue = 11 + (de & 127), de >>>= 7, Le -= 7;
+ ce >>>= it, Le -= it, Je = 0, Ge = 11 + (ce & 127), ce >>>= 7, Le -= 7;
}
- if (O.have + Ue > O.nlen + O.ndist) {
+ if (O.have + Ge > O.nlen + O.ndist) {
v.msg = "invalid bit length repeat", O.mode = bt;
break;
}
- for (; Ue--; )
+ for (; Ge--; )
O.lens[O.have++] = Je;
}
}
@@ -24515,37 +24515,37 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
v.msg = "invalid code -- missing end-of-block", O.mode = bt;
break;
}
- if (O.lenbits = 9, et = { bits: O.lenbits }, pt = li(rr, O.lens, 0, O.nlen, O.lencode, 0, O.work, et), O.lenbits = et.bits, pt) {
+ if (O.lenbits = 9, et = { bits: O.lenbits }, gt = li(rr, O.lens, 0, O.nlen, O.lencode, 0, O.work, et), O.lenbits = et.bits, gt) {
v.msg = "invalid literal/lengths set", O.mode = bt;
break;
}
- if (O.distbits = 6, O.distcode = O.distdyn, et = { bits: O.distbits }, pt = li(nr, O.lens, O.nlen, O.ndist, O.distcode, 0, O.work, et), O.distbits = et.bits, pt) {
+ if (O.distbits = 6, O.distcode = O.distdyn, et = { bits: O.distbits }, gt = li(nr, O.lens, O.nlen, O.ndist, O.distcode, 0, O.work, et), O.distbits = et.bits, gt) {
v.msg = "invalid distances set", O.mode = bt;
break;
}
- if (O.mode = wi, V === bi)
+ if (O.mode = wi, j === bi)
break e;
case wi:
O.mode = Ei;
case Ei:
if (be >= 6 && Xe >= 258) {
- v.next_out = Ce, v.avail_out = Xe, v.next_in = ee, v.avail_in = be, O.hold = de, O.bits = Le, Zn(v, Ye), Ce = v.next_out, te = v.output, Xe = v.avail_out, ee = v.next_in, J = v.input, be = v.avail_in, de = O.hold, Le = O.bits, O.mode === Rt && (O.back = -1);
+ v.next_out = Ce, v.avail_out = Xe, v.next_in = ee, v.avail_in = be, O.hold = ce, O.bits = Le, Zn(v, Ye), Ce = v.next_out, te = v.output, Xe = v.avail_out, ee = v.next_in, J = v.input, be = v.avail_in, ce = O.hold, Le = O.bits, O.mode === Rt && (O.back = -1);
break;
}
- for (O.back = 0; ot = O.lencode[de & (1 << O.lenbits) - 1], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(it <= Le); ) {
+ for (O.back = 0; ot = O.lencode[ce & (1 << O.lenbits) - 1], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(it <= Le); ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
if (ut && !(ut & 240)) {
- for (Ze = it, ct = ut, Et = st; ot = O.lencode[Et + ((de & (1 << Ze + ct) - 1) >> Ze)], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(Ze + it <= Le); ) {
+ for (Ze = it, ct = ut, Et = st; ot = O.lencode[Et + ((ce & (1 << Ze + ct) - 1) >> Ze)], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(Ze + it <= Le); ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- de >>>= Ze, Le -= Ze, O.back += Ze;
+ ce >>>= Ze, Le -= Ze, O.back += Ze;
}
- if (de >>>= it, Le -= it, O.back += it, O.length = st, ut === 0) {
+ if (ce >>>= it, Le -= it, O.back += it, O.length = st, ut === 0) {
O.mode = Lr;
break;
}
@@ -24563,26 +24563,26 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (lt = O.extra; Le < lt; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- O.length += de & (1 << O.extra) - 1, de >>>= O.extra, Le -= O.extra, O.back += O.extra;
+ O.length += ce & (1 << O.extra) - 1, ce >>>= O.extra, Le -= O.extra, O.back += O.extra;
}
O.was = O.length, O.mode = Mr;
case Mr:
- for (; ot = O.distcode[de & (1 << O.distbits) - 1], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(it <= Le); ) {
+ for (; ot = O.distcode[ce & (1 << O.distbits) - 1], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(it <= Le); ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
if (!(ut & 240)) {
- for (Ze = it, ct = ut, Et = st; ot = O.distcode[Et + ((de & (1 << Ze + ct) - 1) >> Ze)], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(Ze + it <= Le); ) {
+ for (Ze = it, ct = ut, Et = st; ot = O.distcode[Et + ((ce & (1 << Ze + ct) - 1) >> Ze)], it = ot >>> 24, ut = ot >>> 16 & 255, st = ot & 65535, !(Ze + it <= Le); ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- de >>>= Ze, Le -= Ze, O.back += Ze;
+ ce >>>= Ze, Le -= Ze, O.back += Ze;
}
- if (de >>>= it, Le -= it, O.back += it, ut & 64) {
+ if (ce >>>= it, Le -= it, O.back += it, ut & 64) {
v.msg = "invalid distance code", O.mode = bt;
break;
}
@@ -24592,9 +24592,9 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (lt = O.extra; Le < lt; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- O.offset += de & (1 << O.extra) - 1, de >>>= O.extra, Le -= O.extra, O.back += O.extra;
+ O.offset += ce & (1 << O.extra) - 1, ce >>>= O.extra, Le -= O.extra, O.back += O.extra;
}
if (O.offset > O.dmax) {
v.msg = "invalid distance too far back", O.mode = bt;
@@ -24604,18 +24604,18 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
case Cr:
if (Xe === 0)
break e;
- if (Ue = Ye - Xe, O.offset > Ue) {
- if (Ue = O.offset - Ue, Ue > O.whave && O.sane) {
+ if (Ge = Ye - Xe, O.offset > Ge) {
+ if (Ge = O.offset - Ge, Ge > O.whave && O.sane) {
v.msg = "invalid distance too far back", O.mode = bt;
break;
}
- Ue > O.wnext ? (Ue -= O.wnext, Qe = O.wsize - Ue) : Qe = O.wnext - Ue, Ue > O.length && (Ue = O.length), xt = O.window;
+ Ge > O.wnext ? (Ge -= O.wnext, Qe = O.wsize - Ge) : Qe = O.wnext - Ge, Ge > O.length && (Ge = O.length), xt = O.window;
} else
- xt = te, Qe = Ce - O.offset, Ue = O.length;
- Ue > Xe && (Ue = Xe), Xe -= Ue, O.length -= Ue;
+ xt = te, Qe = Ce - O.offset, Ge = O.length;
+ Ge > Xe && (Ge = Xe), Xe -= Ge, O.length -= Ge;
do
te[Ce++] = xt[Qe++];
- while (--Ue);
+ while (--Ge);
O.length === 0 && (O.mode = Ei);
break;
case Lr:
@@ -24628,14 +24628,14 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (; Le < 32; ) {
if (be === 0)
break e;
- be--, de |= J[ee++] << Le, Le += 8;
+ be--, ce |= J[ee++] << Le, Le += 8;
}
if (Ye -= Xe, v.total_out += Ye, O.total += Ye, O.wrap & 4 && Ye && (v.adler = O.check = /*UPDATE_CHECK(state.check, put - _out, _out);*/
- O.flags ? I(O.check, te, Ye, Ce - Ye) : De(O.check, te, Ye, Ce - Ye)), Ye = Xe, O.wrap & 4 && (O.flags ? de : Pr(de)) !== O.check) {
+ O.flags ? I(O.check, te, Ye, Ce - Ye) : De(O.check, te, Ye, Ce - Ye)), Ye = Xe, O.wrap & 4 && (O.flags ? ce : Pr(ce)) !== O.check) {
v.msg = "incorrect data check", O.mode = bt;
break;
}
- de = 0, Le = 0;
+ ce = 0, Le = 0;
}
O.mode = Dr;
case Dr:
@@ -24643,20 +24643,20 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
for (; Le < 32; ) {
if (be === 0)
break e;
- be--, de += J[ee++] << Le, Le += 8;
+ be--, ce += J[ee++] << Le, Le += 8;
}
- if (O.wrap & 4 && de !== (O.total & 4294967295)) {
+ if (O.wrap & 4 && ce !== (O.total & 4294967295)) {
v.msg = "incorrect length check", O.mode = bt;
break;
}
- de = 0, Le = 0;
+ ce = 0, Le = 0;
}
O.mode = Sr;
case Sr:
- pt = ts;
+ gt = ts;
break e;
case bt:
- pt = ar;
+ gt = ar;
break e;
case Or:
return lr;
@@ -24664,27 +24664,27 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
default:
return St;
}
- return v.next_out = Ce, v.avail_out = Xe, v.next_in = ee, v.avail_in = be, O.hold = de, O.bits = Le, (O.wsize || Ye !== v.avail_out && O.mode < bt && (O.mode < ki || V !== sr)) && kr(v, v.output, v.next_out, Ye - v.avail_out), ht -= v.avail_in, Ye -= v.avail_out, v.total_in += ht, v.total_out += Ye, O.total += Ye, O.wrap & 4 && Ye && (v.adler = O.check = /*UPDATE_CHECK(state.check, strm.next_out - _out, _out);*/
- O.flags ? I(O.check, te, Ye, v.next_out - Ye) : De(O.check, te, Ye, v.next_out - Ye)), v.data_type = O.bits + (O.last ? 64 : 0) + (O.mode === Rt ? 128 : 0) + (O.mode === wi || O.mode === Bi ? 256 : 0), (ht === 0 && Ye === 0 || V === sr) && pt === Vt && (pt = rs), pt;
+ return v.next_out = Ce, v.avail_out = Xe, v.next_in = ee, v.avail_in = be, O.hold = ce, O.bits = Le, (O.wsize || Ye !== v.avail_out && O.mode < bt && (O.mode < ki || j !== sr)) && kr(v, v.output, v.next_out, Ye - v.avail_out), ht -= v.avail_in, Ye -= v.avail_out, v.total_in += ht, v.total_out += Ye, O.total += Ye, O.wrap & 4 && Ye && (v.adler = O.check = /*UPDATE_CHECK(state.check, strm.next_out - _out, _out);*/
+ O.flags ? I(O.check, te, Ye, v.next_out - Ye) : De(O.check, te, Ye, v.next_out - Ye)), v.data_type = O.bits + (O.last ? 64 : 0) + (O.mode === Rt ? 128 : 0) + (O.mode === wi || O.mode === Bi ? 256 : 0), (ht === 0 && Ye === 0 || j === sr) && gt === Vt && (gt = rs), gt;
}, ds = (v) => {
if (jt(v))
return St;
- let V = v.state;
- return V.window && (V.window = null), v.state = null, Vt;
- }, cs = (v, V) => {
+ let j = v.state;
+ return j.window && (j.window = null), v.state = null, Vt;
+ }, cs = (v, j) => {
if (jt(v))
return St;
const O = v.state;
- return O.wrap & 2 ? (O.head = V, V.done = !1, Vt) : St;
- }, us = (v, V) => {
- const O = V.length;
+ return O.wrap & 2 ? (O.head = j, j.done = !1, Vt) : St;
+ }, us = (v, j) => {
+ const O = j.length;
let J, te, ee;
- return jt(v) || (J = v.state, J.wrap !== 0 && J.mode !== yi) ? St : J.mode === yi && (te = 1, te = De(te, V, O, 0), te !== J.check) ? ar : (ee = kr(v, V, O, O), ee ? (J.mode = Or, lr) : (J.havedict = 1, Vt));
+ return jt(v) || (J = v.state, J.wrap !== 0 && J.mode !== yi) ? St : J.mode === yi && (te = 1, te = De(te, j, O, 0), te !== J.check) ? ar : (ee = kr(v, j, O, O), ee ? (J.mode = Or, lr) : (J.havedict = 1, Vt));
};
- var _s = Rr, gs = zr, ps = Ir, vs = os, ms = $r, bs = hs, xs = ds, ys = cs, ws = us, Es = "pako inflate (from Nodeca project)", zt = {
+ var _s = Rr, ps = zr, gs = Ir, vs = os, ms = $r, bs = hs, xs = ds, ys = cs, ws = us, Es = "pako inflate (from Nodeca project)", zt = {
inflateReset: _s,
- inflateReset2: gs,
- inflateResetKeep: ps,
+ inflateReset2: ps,
+ inflateResetKeep: gs,
inflateInit: vs,
inflateInit2: ms,
inflate: bs,
@@ -24706,30 +24706,30 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
Z_STREAM_ERROR: Ds,
Z_DATA_ERROR: Ur,
Z_MEM_ERROR: Ss
- } = ge;
+ } = ve;
function fi(v) {
- this.options = pi.assign({
+ this.options = gi.assign({
chunkSize: 65536,
windowBits: 15,
to: ""
}, v || {});
- const V = this.options;
- V.raw && V.windowBits >= 0 && V.windowBits < 16 && (V.windowBits = -V.windowBits, V.windowBits === 0 && (V.windowBits = -15)), V.windowBits >= 0 && V.windowBits < 16 && !(v && v.windowBits) && (V.windowBits += 32), V.windowBits > 15 && V.windowBits < 48 && (V.windowBits & 15 || (V.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new Qi(), this.strm.avail_out = 0;
+ const j = this.options;
+ j.raw && j.windowBits >= 0 && j.windowBits < 16 && (j.windowBits = -j.windowBits, j.windowBits === 0 && (j.windowBits = -15)), j.windowBits >= 0 && j.windowBits < 16 && !(v && v.windowBits) && (j.windowBits += 32), j.windowBits > 15 && j.windowBits < 48 && (j.windowBits & 15 || (j.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new Qi(), this.strm.avail_out = 0;
let O = zt.inflateInit2(
this.strm,
- V.windowBits
+ j.windowBits
);
if (O !== oi)
throw new Error(me[O]);
- if (this.header = new As(), zt.inflateGetHeader(this.strm, this.header), V.dictionary && (typeof V.dictionary == "string" ? V.dictionary = si.string2buf(V.dictionary) : Fr.call(V.dictionary) === "[object ArrayBuffer]" && (V.dictionary = new Uint8Array(V.dictionary)), V.raw && (O = zt.inflateSetDictionary(this.strm, V.dictionary), O !== oi)))
+ if (this.header = new As(), zt.inflateGetHeader(this.strm, this.header), j.dictionary && (typeof j.dictionary == "string" ? j.dictionary = si.string2buf(j.dictionary) : Fr.call(j.dictionary) === "[object ArrayBuffer]" && (j.dictionary = new Uint8Array(j.dictionary)), j.raw && (O = zt.inflateSetDictionary(this.strm, j.dictionary), O !== oi)))
throw new Error(me[O]);
}
- fi.prototype.push = function(v, V) {
+ fi.prototype.push = function(v, j) {
const O = this.strm, J = this.options.chunkSize, te = this.options.dictionary;
let ee, Ce, be;
if (this.ended)
return !1;
- for (V === ~~V ? Ce = V : Ce = V === !0 ? Ls : Cs, Fr.call(v) === "[object ArrayBuffer]" ? O.input = new Uint8Array(v) : O.input = v, O.next_in = 0, O.avail_in = O.input.length; ; ) {
+ for (j === ~~j ? Ce = j : Ce = j === !0 ? Ls : Cs, Fr.call(v) === "[object ArrayBuffer]" ? O.input = new Uint8Array(v) : O.input = v, O.next_in = 0, O.avail_in = O.input.length; ; ) {
for (O.avail_out === 0 && (O.output = new Uint8Array(J), O.next_out = 0, O.avail_out = J), ee = zt.inflate(O, Ce), ee === Gi && te && (ee = zt.inflateSetDictionary(O, te), ee === oi ? ee = zt.inflate(O, Ce) : ee === Ur && (ee = Gi)); O.avail_in > 0 && ee === Wi && O.state.wrap > 0 && v[O.next_in] !== 0; )
zt.inflateReset(O), ee = zt.inflate(O, Ce);
switch (ee) {
@@ -24741,8 +24741,8 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
}
if (be = O.avail_out, O.next_out && (O.avail_out === 0 || ee === Wi))
if (this.options.to === "string") {
- let Xe = si.utf8border(O.output, O.next_out), de = O.next_out - Xe, Le = si.buf2string(O.output, Xe);
- O.next_out = de, O.avail_out = J - de, de && O.output.set(O.output.subarray(Xe, Xe + de), 0), this.onData(Le);
+ let Xe = si.utf8border(O.output, O.next_out), ce = O.next_out - Xe, Le = si.buf2string(O.output, Xe);
+ O.next_out = ce, O.avail_out = J - ce, ce && O.output.set(O.output.subarray(Xe, Xe + ce), 0), this.onData(Le);
} else
this.onData(O.output.length === O.next_out ? O.output : O.output.subarray(0, O.next_out));
if (!(ee === oi && be === 0)) {
@@ -24756,18 +24756,18 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
}, fi.prototype.onData = function(v) {
this.chunks.push(v);
}, fi.prototype.onEnd = function(v) {
- v === oi && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = pi.flattenChunks(this.chunks)), this.chunks = [], this.err = v, this.msg = this.strm.msg;
+ v === oi && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = gi.flattenChunks(this.chunks)), this.chunks = [], this.err = v, this.msg = this.strm.msg;
};
- function Ni(v, V) {
- const O = new fi(V);
+ function Ni(v, j) {
+ const O = new fi(j);
if (O.push(v), O.err)
throw O.msg || me[O.err];
return O.result;
}
- function Os(v, V) {
- return V = V || {}, V.raw = !0, Ni(v, V);
+ function Os(v, j) {
+ return j = j || {}, j.raw = !0, Ni(v, j);
}
- var Ts = fi, Ps = Ni, Is = Os, Rs = Ni, zs = ge, $s = {
+ var Ts = fi, Ps = Ni, Is = Os, Rs = Ni, zs = ve, $s = {
Inflate: Ts,
inflate: Ps,
inflateRaw: Is,
@@ -24775,7 +24775,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
constants: zs
};
const { Deflate: Bs, deflate: ks, deflateRaw: Fs, gzip: Us } = Hn, { Inflate: Ws, inflate: Gs, inflateRaw: Ns, ungzip: Vs } = $s;
- var Wr = Bs, Gr = ks, Nr = Fs, Vr = Us, jr = Ws, Hr = Gs, Kr = Ns, Zr = Vs, Yr = ge, js = {
+ var Wr = Bs, Gr = ks, Nr = Fs, Vr = Us, jr = Ws, Hr = Gs, Kr = Ns, Zr = Vs, Yr = ve, js = {
Deflate: Wr,
deflate: Gr,
deflateRaw: Nr,
@@ -24845,37 +24845,37 @@ const Dmol = /* @__PURE__ */ getDefaultExportFromCjs(_3DmolExports), Molecule_sv
toggle_class: toggle_class$5
} = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$3, afterUpdate: afterUpdate$2 } = window.__gradio__svelte__internal;
function create_if_block$5(y) {
- let s, e, l, g, _, x, o, p, E, u, A, C, L, D, r, n, b, f, c, t, a, h, M, w, S;
- function T(F, $) {
+ let s, e, l, p, _, x, o, g, E, u, A, L, C, D, r, n, b, f, c, t, a, h, M, w, S;
+ function T(U, z) {
return (
/*attachmentIndex*/
- F[1] !== null ? create_if_block_2$3 : create_else_block_1$2
+ U[1] !== null ? create_if_block_2$3 : create_else_block_1$2
);
}
- let R = T(y), z = R(y);
- function P(F, $) {
+ let R = T(y), $ = R(y);
+ function P(U, z) {
return (
/*deleteIndexes*/
- F[2].length > 0 ? create_if_block_1$4 : create_else_block$4
+ U[2].length > 0 ? create_if_block_1$4 : create_else_block$4
);
}
- let B = P(y), U = B(y);
+ let B = P(y), F = B(y);
return {
c() {
- s = element$6("div"), s.textContent = "Covalent Modification", e = space$5(), l = element$6("div"), l.innerHTML = ' click on atoms in viewer to select them', g = space$5(), _ = element$6("div"), x = element$6("button"), x.innerHTML = ' Attachment atom', o = space$5(), p = element$6("button"), p.innerHTML = ' Atoms to delete', E = space$5(), u = element$6("div"), A = element$6("table"), C = element$6("thead"), C.innerHTML = ' | index |
|---|
', L = space$5(), D = element$6("tbody"), r = element$6("tr"), n = element$6("th"), n.textContent = "Attachment atom", b = space$5(), f = element$6("td"), z.c(), c = space$5(), t = element$6("tr"), a = element$6("th"), a.textContent = "Deleted atoms", h = space$5(), M = element$6("td"), U.c(), attr$6(s, "class", "w-full text-center text-lg mb-2 svelte-1jhdl43"), attr$6(l, "class", "flex items-center space-x-2 justify-center mb-2 text-xs svelte-1jhdl43"), attr$6(x, "class", "w-1/2 flex items-center rounded-l-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-1jhdl43"), attr$6(x, "id", "attach"), toggle_class$5(
+ s = element$6("div"), s.textContent = "Covalent Modification", e = space$5(), l = element$6("div"), l.innerHTML = ' click on atoms in viewer to select them', p = space$5(), _ = element$6("div"), x = element$6("button"), x.innerHTML = ' Attachment atom', o = space$5(), g = element$6("button"), g.innerHTML = ' Atoms to delete', E = space$5(), u = element$6("div"), A = element$6("table"), L = element$6("thead"), L.innerHTML = ' | index |
|---|
', C = space$5(), D = element$6("tbody"), r = element$6("tr"), n = element$6("th"), n.textContent = "Attachment atom", b = space$5(), f = element$6("td"), $.c(), c = space$5(), t = element$6("tr"), a = element$6("th"), a.textContent = "Deleted atoms", h = space$5(), M = element$6("td"), F.c(), attr$6(s, "class", "w-full text-center text-lg mb-2 svelte-1jhdl43"), attr$6(l, "class", "flex items-center space-x-2 justify-center mb-2 text-xs svelte-1jhdl43"), attr$6(x, "class", "w-1/2 flex items-center rounded-l-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-1jhdl43"), attr$6(x, "id", "attach"), toggle_class$5(
x,
"active",
/*mode*/
y[3] === "attach"
- ), attr$6(p, "class", "w-1/2 flex items-center rounded-r-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-1jhdl43"), attr$6(p, "id", "delete"), toggle_class$5(
- p,
+ ), attr$6(g, "class", "w-1/2 flex items-center rounded-r-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-1jhdl43"), attr$6(g, "id", "delete"), toggle_class$5(
+ g,
"active",
/*mode*/
y[3] === "delete"
- ), attr$6(_, "class", "flex rounded-full border-2 border-gray-200 bg-gray-200 text-sm leading-none text-gray-500 svelte-1jhdl43"), attr$6(C, "class", "text-xs text-gray-700 uppercase bg-gray-50 dark:bg-gray-700 dark:text-gray-400 svelte-1jhdl43"), attr$6(n, "scope", "row"), attr$6(n, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-1jhdl43"), attr$6(f, "class", "px-6 py-4 font-mono svelte-1jhdl43"), attr$6(r, "class", "bg-white border-b dark:bg-gray-800 dark:border-gray-700 svelte-1jhdl43"), attr$6(a, "scope", "row"), attr$6(a, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-1jhdl43"), attr$6(M, "class", "px-6 py-4 font-mono svelte-1jhdl43"), attr$6(t, "class", "bg-white dark:bg-gray-800 svelte-1jhdl43"), attr$6(D, "class", "svelte-1jhdl43"), attr$6(A, "class", "w-full text-sm text-left rtl:text-right text-gray-500 dark:text-gray-400 svelte-1jhdl43"), attr$6(u, "class", "relative overflow-x-auto mt-3 svelte-1jhdl43");
+ ), attr$6(_, "class", "flex rounded-full border-2 border-gray-200 bg-gray-200 text-sm leading-none text-gray-500 svelte-1jhdl43"), attr$6(L, "class", "text-xs text-gray-700 uppercase bg-gray-50 dark:bg-gray-700 dark:text-gray-400 svelte-1jhdl43"), attr$6(n, "scope", "row"), attr$6(n, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-1jhdl43"), attr$6(f, "class", "px-6 py-4 font-mono svelte-1jhdl43"), attr$6(r, "class", "bg-white border-b dark:bg-gray-800 dark:border-gray-700 svelte-1jhdl43"), attr$6(a, "scope", "row"), attr$6(a, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-1jhdl43"), attr$6(M, "class", "px-6 py-4 font-mono svelte-1jhdl43"), attr$6(t, "class", "bg-white dark:bg-gray-800 svelte-1jhdl43"), attr$6(D, "class", "svelte-1jhdl43"), attr$6(A, "class", "w-full text-sm text-left rtl:text-right text-gray-500 dark:text-gray-400 svelte-1jhdl43"), attr$6(u, "class", "relative overflow-x-auto mt-3 svelte-1jhdl43");
},
- m(F, $) {
- insert$7(F, s, $), insert$7(F, e, $), insert$7(F, l, $), insert$7(F, g, $), insert$7(F, _, $), append$5(_, x), append$5(_, o), append$5(_, p), insert$7(F, E, $), insert$7(F, u, $), append$5(u, A), append$5(A, C), append$5(A, L), append$5(A, D), append$5(D, r), append$5(r, n), append$5(r, b), append$5(r, f), z.m(f, null), append$5(D, c), append$5(D, t), append$5(t, a), append$5(t, h), append$5(t, M), U.m(M, null), w || (S = [
+ m(U, z) {
+ insert$7(U, s, z), insert$7(U, e, z), insert$7(U, l, z), insert$7(U, p, z), insert$7(U, _, z), append$5(_, x), append$5(_, o), append$5(_, g), insert$7(U, E, z), insert$7(U, u, z), append$5(u, A), append$5(A, L), append$5(A, C), append$5(A, D), append$5(D, r), append$5(r, n), append$5(r, b), append$5(r, f), $.m(f, null), append$5(D, c), append$5(D, t), append$5(t, a), append$5(t, h), append$5(t, M), F.m(M, null), w || (S = [
listen$2(
x,
"click",
@@ -24883,30 +24883,30 @@ function create_if_block$5(y) {
y[7]
),
listen$2(
- p,
+ g,
"click",
/*click_handler_1*/
y[8]
)
], w = !0);
},
- p(F, $) {
- $ & /*mode*/
+ p(U, z) {
+ z & /*mode*/
8 && toggle_class$5(
x,
"active",
/*mode*/
- F[3] === "attach"
- ), $ & /*mode*/
+ U[3] === "attach"
+ ), z & /*mode*/
8 && toggle_class$5(
- p,
+ g,
"active",
/*mode*/
- F[3] === "delete"
- ), R === (R = T(F)) && z ? z.p(F, $) : (z.d(1), z = R(F), z && (z.c(), z.m(f, null))), B === (B = P(F)) && U ? U.p(F, $) : (U.d(1), U = B(F), U && (U.c(), U.m(M, null)));
+ U[3] === "delete"
+ ), R === (R = T(U)) && $ ? $.p(U, z) : ($.d(1), $ = R(U), $ && ($.c(), $.m(f, null))), B === (B = P(U)) && F ? F.p(U, z) : (F.d(1), F = B(U), F && (F.c(), F.m(M, null)));
},
- d(F) {
- F && (detach$7(s), detach$7(e), detach$7(l), detach$7(g), detach$7(_), detach$7(E), detach$7(u)), z.d(), U.d(), w = !1, run_all$2(S);
+ d(U) {
+ U && (detach$7(s), detach$7(e), detach$7(l), detach$7(p), detach$7(_), detach$7(E), detach$7(u)), $.d(), F.d(), w = !1, run_all$2(S);
}
};
}
@@ -24974,11 +24974,11 @@ function create_if_block_1$4(y) {
c() {
e = text$5(s);
},
- m(l, g) {
- insert$7(l, e, g);
+ m(l, p) {
+ insert$7(l, e, p);
},
- p(l, g) {
- g & /*deleteIndexes*/
+ p(l, p) {
+ p & /*deleteIndexes*/
4 && s !== (s = /*deleteIndexes*/
l[2].join(", ") + "") && set_data$5(e, s);
},
@@ -24988,20 +24988,20 @@ function create_if_block_1$4(y) {
};
}
function create_fragment$7(y) {
- let s, e, l, g, _, x = (
+ let s, e, l, p, _, x = (
/*showCovMod*/
y[0] > -1 && create_if_block$5(y)
);
return {
c() {
- s = element$6("div"), e = element$6("div"), l = element$6("div"), g = space$5(), _ = element$6("div"), x && x.c(), attr$6(l, "class", "mol-canvas svelte-1jhdl43"), attr$6(e, "class", "relative svelte-1jhdl43"), attr$6(_, "class", "flex flex-col justify-center svelte-1jhdl43"), attr$6(s, "class", "mol-wrapper svelte-1jhdl43");
+ s = element$6("div"), e = element$6("div"), l = element$6("div"), p = space$5(), _ = element$6("div"), x && x.c(), attr$6(l, "class", "mol-canvas svelte-1jhdl43"), attr$6(e, "class", "relative svelte-1jhdl43"), attr$6(_, "class", "flex flex-col justify-center svelte-1jhdl43"), attr$6(s, "class", "mol-wrapper svelte-1jhdl43");
},
- m(o, p) {
- insert$7(o, s, p), append$5(s, e), append$5(e, l), y[6](l), append$5(s, g), append$5(s, _), x && x.m(_, null);
+ m(o, g) {
+ insert$7(o, s, g), append$5(s, e), append$5(e, l), y[6](l), append$5(s, p), append$5(s, _), x && x.m(_, null);
},
- p(o, [p]) {
+ p(o, [g]) {
/*showCovMod*/
- o[0] > -1 ? x ? x.p(o, p) : (x = create_if_block$5(o), x.c(), x.m(_, null)) : x && (x.d(1), x = null);
+ o[0] > -1 ? x ? x.p(o, g) : (x = create_if_block$5(o), x.c(), x.m(_, null)) : x && (x.d(1), x = null);
},
i: noop$7,
o: noop$7,
@@ -25012,42 +25012,42 @@ function create_fragment$7(y) {
}
function instance$7(y, s, e) {
const l = createEventDispatcher$3();
- let g = null, _ = [], x = "attach";
+ let p = null, _ = [], x = "attach";
function o(r) {
- r.setStyle({ stick: {} }), u > -1 && (g !== null && r.addStyle({ index: g }, { sphere: { color: "blue", scale: 0.5 } }), r.addStyle({ index: _ }, { sphere: { color: "red", scale: 0.5 } }), l("updateMol", {
- attachmentIndex: g,
+ r.setStyle({ stick: {} }), u > -1 && (p !== null && r.addStyle({ index: p }, { sphere: { color: "blue", scale: 0.5 } }), r.addStyle({ index: _ }, { sphere: { color: "red", scale: 0.5 } }), l("updateMol", {
+ attachmentIndex: p,
deleteIndexes: _,
index: u,
mol: r.exportJSON()
}));
}
- function p(r, n) {
+ function g(r, n) {
let b = Dmol.createViewer(n, {});
return b.addModel(r, "sdf"), o(b), b.setBackgroundColor("white"), b.zoomTo(), b.getModel(0).setClickable({}, !0, function(f, c, t, a) {
- u > -1 && (x === "attach" ? e(1, g = f.serial) : (_.includes(f.serial) ? e(2, _ = _.filter((h) => h !== f.serial)) : _.push(f.serial), e(2, _), o(c)));
+ u > -1 && (x === "attach" ? e(1, p = f.serial) : (_.includes(f.serial) ? e(2, _ = _.filter((h) => h !== f.serial)) : _.push(f.serial), e(2, _), o(c)));
}), b.render(), b;
}
let { molvalue: E = "" } = s, { showCovMod: u = -1 } = s, A = null;
afterUpdate$2(() => {
- p(E, A);
+ g(E, A);
});
- function C(r) {
+ function L(r) {
binding_callbacks$4[r ? "unshift" : "push"](() => {
A = r, e(4, A);
});
}
- const L = () => e(3, x = "attach"), D = () => e(3, x = "delete");
+ const C = () => e(3, x = "attach"), D = () => e(3, x = "delete");
return y.$$set = (r) => {
"molvalue" in r && e(5, E = r.molvalue), "showCovMod" in r && e(0, u = r.showCovMod);
}, [
u,
- g,
+ p,
_,
x,
A,
E,
- C,
L,
+ C,
D
];
}
@@ -25090,27 +25090,31 @@ const Accordion_svelte_svelte_type_style_lang = "", {
} = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$2 } = window.__gradio__svelte__internal;
function get_each_context$1(y, s, e) {
const l = y.slice();
- return l[33] = s[e], l[34] = s, l[35] = e, l;
+ return l[35] = s[e], l[36] = s, l[37] = e, l;
}
function get_each_context_1$1(y, s, e) {
const l = y.slice();
- return l[36] = s[e], l;
+ return l[38] = s[e], l;
}
function get_each_context_2(y, s, e) {
const l = y.slice();
- return l[39] = s[e], l;
+ return l[41] = s[e], l;
}
function get_each_context_3(y, s, e) {
const l = y.slice();
- return l[36] = s[e], l;
+ return l[44] = s[e], l[37] = e, l;
}
function get_each_context_4(y, s, e) {
const l = y.slice();
- return l[44] = s[e], l[45] = s, l[35] = e, l;
+ return l[38] = s[e], l;
}
function get_each_context_5(y, s, e) {
const l = y.slice();
- return l[46] = s[e], l;
+ return l[48] = s[e], l[49] = s, l[37] = e, l;
+}
+function get_each_context_6(y, s, e) {
+ const l = y.slice();
+ return l[50] = s[e], l;
}
function create_if_block_11$1(y) {
let s, e;
@@ -25119,10 +25123,10 @@ function create_if_block_11$1(y) {
1 && (s = null), s == null && (s = !!/*metals*/
x[8].includes(
/*item*/
- x[44].name
+ x[48].name
)), s ? create_if_block_12$1 : create_else_block_2;
}
- let g = l(y, [-1, -1]), _ = g(y);
+ let p = l(y, [-1, -1]), _ = p(y);
return {
c() {
_.c(), e = empty$3();
@@ -25131,7 +25135,7 @@ function create_if_block_11$1(y) {
_.m(x, o), insert$6(x, e, o);
},
p(x, o) {
- g === (g = l(x, o)) && _ ? _.p(x, o) : (_.d(1), _ = g(x), _ && (_.c(), _.m(e.parentNode, e)));
+ p === (p = l(x, o)) && _ ? _.p(x, o) : (_.d(1), _ = p(x), _ && (_.c(), _.m(e.parentNode, e)));
},
d(x) {
x && detach$6(e), _.d(x);
@@ -25141,19 +25145,19 @@ function create_if_block_11$1(y) {
function create_else_block_2(y) {
let s = (
/*item*/
- y[44].smiles + ""
+ y[48].smiles + ""
), e;
return {
c() {
e = text$4(s);
},
- m(l, g) {
- insert$6(l, e, g);
+ m(l, p) {
+ insert$6(l, e, p);
},
- p(l, g) {
- g[0] & /*vals*/
+ p(l, p) {
+ p[0] & /*vals*/
1 && s !== (s = /*item*/
- l[44].smiles + "") && set_data$4(e, s);
+ l[48].smiles + "") && set_data$4(e, s);
},
d(l) {
l && detach$6(e);
@@ -25163,19 +25167,19 @@ function create_else_block_2(y) {
function create_if_block_12$1(y) {
let s = (
/*item*/
- y[44].name + ""
+ y[48].name + ""
), e;
return {
c() {
e = text$4(s);
},
- m(l, g) {
- insert$6(l, e, g);
+ m(l, p) {
+ insert$6(l, e, p);
},
- p(l, g) {
- g[0] & /*vals*/
+ p(l, p) {
+ p[0] & /*vals*/
1 && s !== (s = /*item*/
- l[44].name + "") && set_data$4(e, s);
+ l[48].name + "") && set_data$4(e, s);
},
d(l) {
l && detach$6(e);
@@ -25183,32 +25187,32 @@ function create_if_block_12$1(y) {
};
}
function create_if_block_8$1(y) {
- let s, e, l, g, _, x;
- const o = [create_if_block_9$1, create_if_block_10$1], p = [];
+ let s, e, l, p, _, x;
+ const o = [create_if_block_9$1, create_if_block_10$1], g = [];
function E(u, A) {
return A[0] & /*vals*/
1 && (l = null), l == null && (l = !!["DNA", "RNA", "protein"].includes(
/*item*/
- u[44].class
+ u[48].class
)), l ? 0 : (
/*item*/
- u[44].class === "ligand" ? 1 : -1
+ u[48].class === "ligand" ? 1 : -1
);
}
- return ~(g = E(y, [-1, -1])) && (_ = p[g] = o[g](y)), {
+ return ~(p = E(y, [-1, -1])) && (_ = g[p] = o[p](y)), {
c() {
- s = element$5("div"), e = element$5("div"), _ && _.c(), attr$5(e, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 dark:bg-gray-900 svelte-fryf3t"), attr$5(s, "id", `accordion-collapse-body-${/*i*/
- y[35]}`), attr$5(s, "aria-labelledby", `accordion-collapse-heading-${/*i*/
- y[35]}`), attr$5(s, "class", "svelte-fryf3t");
+ s = element$5("div"), e = element$5("div"), _ && _.c(), attr$5(e, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 dark:bg-gray-900 svelte-bt9x4p"), attr$5(s, "id", `accordion-collapse-body-${/*i*/
+ y[37]}`), attr$5(s, "aria-labelledby", `accordion-collapse-heading-${/*i*/
+ y[37]}`), attr$5(s, "class", "svelte-bt9x4p");
},
m(u, A) {
- insert$6(u, s, A), append$4(s, e), ~g && p[g].m(e, null), x = !0;
+ insert$6(u, s, A), append$4(s, e), ~p && g[p].m(e, null), x = !0;
},
p(u, A) {
- let C = g;
- g = E(u, A), g === C ? ~g && p[g].p(u, A) : (_ && (group_outros$4(), transition_out$4(p[C], 1, 1, () => {
- p[C] = null;
- }), check_outros$4()), ~g ? (_ = p[g], _ ? _.p(u, A) : (_ = p[g] = o[g](u), _.c()), transition_in$4(_, 1), _.m(e, null)) : _ = null);
+ let L = p;
+ p = E(u, A), p === L ? ~p && g[p].p(u, A) : (_ && (group_outros$4(), transition_out$4(g[L], 1, 1, () => {
+ g[L] = null;
+ }), check_outros$4()), ~p ? (_ = g[p], _ ? _.p(u, A) : (_ = g[p] = o[p](u), _.c()), transition_in$4(_, 1), _.m(e, null)) : _ = null);
},
i(u) {
x || (transition_in$4(_), x = !0);
@@ -25217,18 +25221,18 @@ function create_if_block_8$1(y) {
transition_out$4(_), x = !1;
},
d(u) {
- u && detach$6(s), ~g && p[g].d();
+ u && detach$6(s), ~p && g[p].d();
}
};
}
function create_if_block_10$1(y) {
- let s, e, l, g, _, x, o, p, E, u, A, C, L, D, r, n, b, f, c, t;
+ let s, e, l, p, _, x, o, g, E, u, A, L, C, D, r, n, b, f, c, t;
function a(...S) {
return (
/*input_handler_1*/
- y[16](
+ y[17](
/*i*/
- y[35],
+ y[37],
...S
)
);
@@ -25238,20 +25242,20 @@ function create_if_block_10$1(y) {
database: "rcsb-3ligand",
index: (
/*i*/
- y[35]
+ y[37]
)
}
}), x.$on(
"triggerFetch",
/*handleMessage*/
- y[12]
+ y[13]
);
function h(...S) {
return (
/*input_handler_2*/
- y[17](
+ y[18](
/*i*/
- y[35],
+ y[37],
...S
)
);
@@ -25261,18 +25265,18 @@ function create_if_block_10$1(y) {
y[8]
), w = [];
for (let S = 0; S < M.length; S += 1)
- w[S] = create_each_block_5(get_each_context_5(y, M, S));
+ w[S] = create_each_block_6(get_each_context_6(y, M, S));
return {
c() {
- s = element$5("textarea"), l = space$4(), g = element$5("div"), g.textContent = "- or -", _ = space$4(), create_component$4(x.$$.fragment), o = space$4(), p = element$5("div"), p.textContent = "- or -", E = space$4(), u = element$5("textarea"), C = space$4(), L = element$5("div"), L.textContent = "- or -", D = space$4(), r = element$5("div"), r.textContent = "Metal ion", n = space$4(), b = element$5("div");
+ s = element$5("textarea"), l = space$4(), p = element$5("div"), p.textContent = "- or -", _ = space$4(), create_component$4(x.$$.fragment), o = space$4(), g = element$5("div"), g.textContent = "- or -", E = space$4(), u = element$5("textarea"), L = space$4(), C = element$5("div"), C.textContent = "- or -", D = space$4(), r = element$5("div"), r.textContent = "Metal ion", n = space$4(), b = element$5("div");
for (let S = 0; S < w.length; S += 1)
w[S].c();
- attr$5(s, "rows", "1"), attr$5(s, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-fryf3t"), attr$5(s, "placeholder", "SMILES like CCC ..."), s.value = e = /*item*/
- y[44].smiles, attr$5(g, "class", "text-center text-gray-400 w-full my-2 svelte-fryf3t"), attr$5(p, "class", "text-center text-gray-400 w-full my-2 svelte-fryf3t"), attr$5(u, "rows", "3"), attr$5(u, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-fryf3t"), attr$5(u, "placeholder", "SDF format 3D molecule ..."), u.value = A = /*item*/
- y[44].sdf, attr$5(L, "class", "text-center text-gray-400 w-full my-2 svelte-fryf3t"), attr$5(r, "class", "text-center text-gray-600 font-bold mb-2 svelte-fryf3t"), attr$5(b, "class", "flex justify-center space-x-2 svelte-fryf3t");
+ attr$5(s, "rows", "1"), attr$5(s, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-bt9x4p"), attr$5(s, "placeholder", "SMILES like CCC ..."), s.value = e = /*item*/
+ y[48].smiles, attr$5(p, "class", "text-center text-gray-400 w-full my-2 svelte-bt9x4p"), attr$5(g, "class", "text-center text-gray-400 w-full my-2 svelte-bt9x4p"), attr$5(u, "rows", "3"), attr$5(u, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-bt9x4p"), attr$5(u, "placeholder", "SDF format 3D molecule ..."), u.value = A = /*item*/
+ y[48].sdf, attr$5(C, "class", "text-center text-gray-400 w-full my-2 svelte-bt9x4p"), attr$5(r, "class", "text-center text-gray-600 font-bold mb-2 svelte-bt9x4p"), attr$5(b, "class", "flex justify-center space-x-2 svelte-bt9x4p");
},
m(S, T) {
- insert$6(S, s, T), insert$6(S, l, T), insert$6(S, g, T), insert$6(S, _, T), mount_component$4(x, S, T), insert$6(S, o, T), insert$6(S, p, T), insert$6(S, E, T), insert$6(S, u, T), insert$6(S, C, T), insert$6(S, L, T), insert$6(S, D, T), insert$6(S, r, T), insert$6(S, n, T), insert$6(S, b, T);
+ insert$6(S, s, T), insert$6(S, l, T), insert$6(S, p, T), insert$6(S, _, T), mount_component$4(x, S, T), insert$6(S, o, T), insert$6(S, g, T), insert$6(S, E, T), insert$6(S, u, T), insert$6(S, L, T), insert$6(S, C, T), insert$6(S, D, T), insert$6(S, r, T), insert$6(S, n, T), insert$6(S, b, T);
for (let R = 0; R < w.length; R += 1)
w[R] && w[R].m(b, null);
f = !0, c || (t = [
@@ -25283,9 +25287,9 @@ function create_if_block_10$1(y) {
p(S, T) {
if (y = S, (!f || T[0] & /*vals*/
1 && e !== (e = /*item*/
- y[44].smiles)) && (s.value = e), (!f || T[0] & /*vals*/
+ y[48].smiles)) && (s.value = e), (!f || T[0] & /*vals*/
1 && A !== (A = /*item*/
- y[44].sdf)) && (u.value = A), T[0] & /*vals, metals, dispatch*/
+ y[48].sdf)) && (u.value = A), T[0] & /*vals, metals, dispatch*/
289) {
M = ensure_array_like$1(
/*metals*/
@@ -25293,8 +25297,8 @@ function create_if_block_10$1(y) {
);
let R;
for (R = 0; R < M.length; R += 1) {
- const z = get_each_context_5(y, M, R);
- w[R] ? w[R].p(z, T) : (w[R] = create_each_block_5(z), w[R].c(), w[R].m(b, null));
+ const $ = get_each_context_6(y, M, R);
+ w[R] ? w[R].p($, T) : (w[R] = create_each_block_6($), w[R].c(), w[R].m(b, null));
}
for (; R < w.length; R += 1)
w[R].d(1);
@@ -25308,122 +25312,122 @@ function create_if_block_10$1(y) {
transition_out$4(x.$$.fragment, S), f = !1;
},
d(S) {
- S && (detach$6(s), detach$6(l), detach$6(g), detach$6(_), detach$6(o), detach$6(p), detach$6(E), detach$6(u), detach$6(C), detach$6(L), detach$6(D), detach$6(r), detach$6(n), detach$6(b)), destroy_component$4(x, S), destroy_each$1(w, S), c = !1, run_all$1(t);
+ S && (detach$6(s), detach$6(l), detach$6(p), detach$6(_), detach$6(o), detach$6(g), detach$6(E), detach$6(u), detach$6(L), detach$6(C), detach$6(D), detach$6(r), detach$6(n), detach$6(b)), destroy_component$4(x, S), destroy_each$1(w, S), c = !1, run_all$1(t);
}
};
}
function create_if_block_9$1(y) {
- let s, e, l, g;
+ let s, e, l, p;
function _(...x) {
return (
/*input_handler*/
- y[15](
+ y[16](
/*i*/
- y[35],
+ y[37],
...x
)
);
}
return {
c() {
- s = element$5("textarea"), attr$5(s, "id", "message"), attr$5(s, "rows", "4"), attr$5(s, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-fryf3t"), attr$5(s, "placeholder", "MSAVGH..."), s.value = e = /*item*/
- y[44].sequence;
+ s = element$5("textarea"), attr$5(s, "id", "message"), attr$5(s, "rows", "4"), attr$5(s, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-bt9x4p"), attr$5(s, "placeholder", "MSAVGH..."), s.value = e = /*item*/
+ y[48].sequence;
},
m(x, o) {
- insert$6(x, s, o), l || (g = listen$1(s, "input", _), l = !0);
+ insert$6(x, s, o), l || (p = listen$1(s, "input", _), l = !0);
},
p(x, o) {
y = x, o[0] & /*vals*/
1 && e !== (e = /*item*/
- y[44].sequence) && (s.value = e);
+ y[48].sequence) && (s.value = e);
},
i: noop$6,
o: noop$6,
d(x) {
- x && detach$6(s), l = !1, g();
+ x && detach$6(s), l = !1, p();
}
};
}
-function create_each_block_5(y) {
- let s, e, l, g, _;
+function create_each_block_6(y) {
+ let s, e, l, p, _;
function x() {
return (
/*click_handler_2*/
- y[18](
+ y[19](
/*metal*/
- y[46],
+ y[50],
/*i*/
- y[35]
+ y[37]
)
);
}
return {
c() {
s = element$5("button"), e = element$5("span"), e.textContent = `${/*metal*/
- y[46]}`, l = space$4(), attr$5(e, "class", "font-medium text-gray-600 dark:text-gray-300 svelte-fryf3t"), attr$5(s, "class", "relative inline-flex items-center justify-center w-10 h-10 overflow-hidden rounded-full dark:bg-gray-600 svelte-fryf3t"), toggle_class$4(
+ y[50]}`, l = space$4(), attr$5(e, "class", "font-medium text-gray-600 dark:text-gray-300 svelte-bt9x4p"), attr$5(s, "class", "relative inline-flex items-center justify-center w-10 h-10 overflow-hidden rounded-full dark:bg-gray-600 svelte-bt9x4p"), toggle_class$4(
s,
"bg-blue-200",
/*item*/
- y[44].name === /*metal*/
- y[46]
+ y[48].name === /*metal*/
+ y[50]
), toggle_class$4(
s,
"bg-violet-100",
/*item*/
- y[44].name !== /*metal*/
- y[46]
+ y[48].name !== /*metal*/
+ y[50]
);
},
- m(o, p) {
- insert$6(o, s, p), append$4(s, e), append$4(s, l), g || (_ = listen$1(s, "click", x), g = !0);
+ m(o, g) {
+ insert$6(o, s, g), append$4(s, e), append$4(s, l), p || (_ = listen$1(s, "click", x), p = !0);
},
- p(o, p) {
- y = o, p[0] & /*vals, metals*/
+ p(o, g) {
+ y = o, g[0] & /*vals, metals*/
257 && toggle_class$4(
s,
"bg-blue-200",
/*item*/
- y[44].name === /*metal*/
- y[46]
- ), p[0] & /*vals, metals*/
+ y[48].name === /*metal*/
+ y[50]
+ ), g[0] & /*vals, metals*/
257 && toggle_class$4(
s,
"bg-violet-100",
/*item*/
- y[44].name !== /*metal*/
- y[46]
+ y[48].name !== /*metal*/
+ y[50]
);
},
d(o) {
- o && detach$6(s), g = !1, _();
+ o && detach$6(s), p = !1, _();
}
};
}
function create_if_block_3$2(y) {
- let s, e, l, g, _;
+ let s, e, l, p, _;
const x = [create_if_block_4$2, create_if_block_6$1], o = [];
- function p(E, u) {
+ function g(E, u) {
return u[0] & /*vals*/
1 && (s = null), s == null && (s = !!["DNA", "RNA", "protein"].includes(
/*item*/
- E[44].class
+ E[48].class
)), s ? 0 : (
/*item*/
- E[44].class === "ligand" ? 1 : -1
+ E[48].class === "ligand" ? 1 : -1
);
}
- return ~(e = p(y, [-1, -1])) && (l = o[e] = x[e](y)), {
+ return ~(e = g(y, [-1, -1])) && (l = o[e] = x[e](y)), {
c() {
- l && l.c(), g = empty$3();
+ l && l.c(), p = empty$3();
},
m(E, u) {
- ~e && o[e].m(E, u), insert$6(E, g, u), _ = !0;
+ ~e && o[e].m(E, u), insert$6(E, p, u), _ = !0;
},
p(E, u) {
let A = e;
- e = p(E, u), e === A ? ~e && o[e].p(E, u) : (l && (group_outros$4(), transition_out$4(o[A], 1, 1, () => {
+ e = g(E, u), e === A ? ~e && o[e].p(E, u) : (l && (group_outros$4(), transition_out$4(o[A], 1, 1, () => {
o[A] = null;
- }), check_outros$4()), ~e ? (l = o[e], l ? l.p(E, u) : (l = o[e] = x[e](E), l.c()), transition_in$4(l, 1), l.m(g.parentNode, g)) : l = null);
+ }), check_outros$4()), ~e ? (l = o[e], l ? l.p(E, u) : (l = o[e] = x[e](E), l.c()), transition_in$4(l, 1), l.m(p.parentNode, p)) : l = null);
},
i(E) {
_ || (transition_in$4(l), _ = !0);
@@ -25432,141 +25436,141 @@ function create_if_block_3$2(y) {
transition_out$4(l), _ = !1;
},
d(E) {
- E && detach$6(g), ~e && o[e].d(E);
+ E && detach$6(p), ~e && o[e].d(E);
}
};
}
function create_if_block_6$1(y) {
let s, e, l = (
/*item*/
- y[44].sdf !== "" && create_if_block_7$1(y)
+ y[48].sdf !== "" && create_if_block_7$1(y)
);
return {
c() {
l && l.c(), s = empty$3();
},
- m(g, _) {
- l && l.m(g, _), insert$6(g, s, _), e = !0;
+ m(p, _) {
+ l && l.m(p, _), insert$6(p, s, _), e = !0;
},
- p(g, _) {
+ p(p, _) {
/*item*/
- g[44].sdf !== "" ? l ? (l.p(g, _), _[0] & /*vals*/
- 1 && transition_in$4(l, 1)) : (l = create_if_block_7$1(g), l.c(), transition_in$4(l, 1), l.m(s.parentNode, s)) : l && (group_outros$4(), transition_out$4(l, 1, 1, () => {
+ p[48].sdf !== "" ? l ? (l.p(p, _), _[0] & /*vals*/
+ 1 && transition_in$4(l, 1)) : (l = create_if_block_7$1(p), l.c(), transition_in$4(l, 1), l.m(s.parentNode, s)) : l && (group_outros$4(), transition_out$4(l, 1, 1, () => {
l = null;
}), check_outros$4());
},
- i(g) {
+ i(p) {
e || (transition_in$4(l), e = !0);
},
- o(g) {
+ o(p) {
transition_out$4(l), e = !1;
},
- d(g) {
- g && detach$6(s), l && l.d(g);
+ d(p) {
+ p && detach$6(s), l && l.d(p);
}
};
}
function create_if_block_4$2(y) {
- let s, e, l, g = (
+ let s, e, l, p = (
/*item*/
- y[44].sequence !== "" && create_if_block_5$2(y)
+ y[48].sequence !== "" && create_if_block_5$2(y)
);
return {
c() {
- s = element$5("div"), e = element$5("div"), g && g.c(), attr$5(e, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 svelte-fryf3t"), toggle_class$4(
+ s = element$5("div"), e = element$5("div"), p && p.c(), attr$5(e, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 svelte-bt9x4p"), toggle_class$4(
e,
"border-b-0",
/*i*/
- y[35] != /*vals*/
+ y[37] != /*vals*/
y[0].length - 1
), attr$5(s, "id", `accordion-collapse-body-${/*i*/
- y[35]}`), attr$5(s, "aria-labelledby", `accordion-collapse-heading-${/*i*/
- y[35]}`), attr$5(s, "class", "svelte-fryf3t");
+ y[37]}`), attr$5(s, "aria-labelledby", `accordion-collapse-heading-${/*i*/
+ y[37]}`), attr$5(s, "class", "svelte-bt9x4p");
},
m(_, x) {
- insert$6(_, s, x), append$4(s, e), g && g.m(e, null), l = !0;
+ insert$6(_, s, x), append$4(s, e), p && p.m(e, null), l = !0;
},
p(_, x) {
/*item*/
- _[44].sequence !== "" ? g ? (g.p(_, x), x[0] & /*vals*/
- 1 && transition_in$4(g, 1)) : (g = create_if_block_5$2(_), g.c(), transition_in$4(g, 1), g.m(e, null)) : g && (group_outros$4(), transition_out$4(g, 1, 1, () => {
- g = null;
+ _[48].sequence !== "" ? p ? (p.p(_, x), x[0] & /*vals*/
+ 1 && transition_in$4(p, 1)) : (p = create_if_block_5$2(_), p.c(), transition_in$4(p, 1), p.m(e, null)) : p && (group_outros$4(), transition_out$4(p, 1, 1, () => {
+ p = null;
}), check_outros$4()), (!l || x[0] & /*vals*/
1) && toggle_class$4(
e,
"border-b-0",
/*i*/
- _[35] != /*vals*/
+ _[37] != /*vals*/
_[0].length - 1
);
},
i(_) {
- l || (transition_in$4(g), l = !0);
+ l || (transition_in$4(p), l = !0);
},
o(_) {
- transition_out$4(g), l = !1;
+ transition_out$4(p), l = !1;
},
d(_) {
- _ && detach$6(s), g && g.d();
+ _ && detach$6(s), p && p.d();
}
};
}
function create_if_block_7$1(y) {
- let s, e, l, g;
+ let s, e, l, p;
return l = new Molecule({
props: {
molvalue: (
/*item*/
- y[44].sdf
+ y[48].sdf
),
showCovMod: (
/*showCovModVals*/
y[2][
/*i*/
- y[35]
+ y[37]
]
)
}
}), l.$on(
"updateMol",
/*updateMol*/
- y[11]
+ y[12]
), {
c() {
- s = element$5("div"), e = element$5("div"), create_component$4(l.$$.fragment), attr$5(e, "class", "relative svelte-fryf3t"), attr$5(s, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 svelte-fryf3t"), toggle_class$4(
+ s = element$5("div"), e = element$5("div"), create_component$4(l.$$.fragment), attr$5(e, "class", "relative svelte-bt9x4p"), attr$5(s, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 svelte-bt9x4p"), toggle_class$4(
s,
"border-b-0",
/*i*/
- y[35] != /*vals*/
+ y[37] != /*vals*/
y[0].length - 1
);
},
m(_, x) {
- insert$6(_, s, x), append$4(s, e), mount_component$4(l, e, null), g = !0;
+ insert$6(_, s, x), append$4(s, e), mount_component$4(l, e, null), p = !0;
},
p(_, x) {
const o = {};
x[0] & /*vals*/
1 && (o.molvalue = /*item*/
- _[44].sdf), x[0] & /*showCovModVals*/
+ _[48].sdf), x[0] & /*showCovModVals*/
4 && (o.showCovMod = /*showCovModVals*/
_[2][
/*i*/
- _[35]
- ]), l.$set(o), (!g || x[0] & /*vals*/
+ _[37]
+ ]), l.$set(o), (!p || x[0] & /*vals*/
1) && toggle_class$4(
s,
"border-b-0",
/*i*/
- _[35] != /*vals*/
+ _[37] != /*vals*/
_[0].length - 1
);
},
i(_) {
- g || (transition_in$4(l.$$.fragment, _), g = !0);
+ p || (transition_in$4(l.$$.fragment, _), p = !0);
},
o(_) {
- transition_out$4(l.$$.fragment, _), g = !1;
+ transition_out$4(l.$$.fragment, _), p = !1;
},
d(_) {
_ && detach$6(s), destroy_component$4(l);
@@ -25578,20 +25582,20 @@ function create_if_block_5$2(y) {
return s = new Sequence({
props: { seq: (
/*item*/
- y[44].sequence
+ y[48].sequence
) }
}), {
c() {
create_component$4(s.$$.fragment);
},
- m(l, g) {
- mount_component$4(s, l, g), e = !0;
+ m(l, p) {
+ mount_component$4(s, l, p), e = !0;
},
- p(l, g) {
+ p(l, p) {
const _ = {};
- g[0] & /*vals*/
+ p[0] & /*vals*/
1 && (_.seq = /*item*/
- l[44].sequence), s.$set(_);
+ l[48].sequence), s.$set(_);
},
i(l) {
e || (transition_in$4(s.$$.fragment, l), e = !0);
@@ -25604,183 +25608,183 @@ function create_if_block_5$2(y) {
}
};
}
-function create_each_block_4(y) {
- let s, e, l, g, _ = (
+function create_each_block_5(y) {
+ let s, e, l, p, _ = (
/*item*/
- y[44].chain + ""
- ), x, o, p, E, u = (
+ y[48].chain + ""
+ ), x, o, g, E, u = (
/*labels*/
y[6][
/*item*/
- y[44].class
+ y[48].class
] + ""
- ), A, C, L, D, r, n, b, f, c, t, a, h, M, w, S, T, R, z = !/*item*/
- y[44].open && /*item*/
- y[44].class === "ligand" && create_if_block_11$1(y);
- function P(...$) {
+ ), A, L, C, D, r, n, b, f, c, t, a, h, M, w, S, T, R, $ = !/*item*/
+ y[48].open && /*item*/
+ y[48].class === "ligand" && create_if_block_11$1(y);
+ function P(...z) {
return (
/*click_handler*/
- y[13](
+ y[14](
/*i*/
- y[35],
- ...$
+ y[37],
+ ...z
)
);
}
function B() {
return (
/*click_handler_1*/
- y[14](
+ y[15](
/*item*/
- y[44],
- /*each_value_4*/
- y[45],
+ y[48],
+ /*each_value_5*/
+ y[49],
/*i*/
- y[35]
+ y[37]
)
);
}
- let U = (
+ let F = (
/*item*/
- y[44].open && create_if_block_8$1(y)
- ), F = !/*item*/
- y[44].open && create_if_block_3$2(y);
+ y[48].open && create_if_block_8$1(y)
+ ), U = !/*item*/
+ y[48].open && create_if_block_3$2(y);
return {
c() {
- s = element$5("h2"), e = element$5("button"), l = element$5("div"), g = element$5("span"), x = text$4(_), p = space$4(), E = element$5("span"), A = text$4(u), C = space$4(), L = element$5("span"), z && z.c(), D = space$4(), r = element$5("div"), n = svg_element$1("svg"), b = svg_element$1("path"), f = space$4(), c = svg_element$1("svg"), t = svg_element$1("path"), h = space$4(), U && U.c(), M = space$4(), F && F.c(), w = empty$3(), attr$5(g, "class", o = "inline-flex items-center justify-center p-1 px-2 text-xs font-semibold rounded-full " + /*colorCode*/
+ s = element$5("h2"), e = element$5("button"), l = element$5("div"), p = element$5("span"), x = text$4(_), g = space$4(), E = element$5("span"), A = text$4(u), L = space$4(), C = element$5("span"), $ && $.c(), D = space$4(), r = element$5("div"), n = svg_element$1("svg"), b = svg_element$1("path"), f = space$4(), c = svg_element$1("svg"), t = svg_element$1("path"), h = space$4(), F && F.c(), M = space$4(), U && U.c(), w = empty$3(), attr$5(p, "class", o = "inline-flex items-center justify-center p-1 px-2 text-xs font-semibold rounded-full " + /*colorCode*/
y[7][
/*item*/
- y[44].class
- ] + " svelte-fryf3t"), attr$5(E, "class", "svelte-fryf3t"), attr$5(L, "class", "px-2 text-gray-800 font-bold svelte-fryf3t"), attr$5(l, "class", "svelte-fryf3t"), attr$5(b, "stroke-linecap", "round"), attr$5(b, "stroke-linejoin", "round"), attr$5(b, "d", "M6 18 18 6M6 6l12 12"), attr$5(b, "class", "svelte-fryf3t"), attr$5(n, "data-slot", "icon"), attr$5(n, "fill", "none"), attr$5(n, "stroke-width", "3"), attr$5(n, "stroke", "currentColor"), attr$5(n, "viewBox", "0 0 24 24"), attr$5(n, "xmlns", "http://www.w3.org/2000/svg"), attr$5(n, "aria-hidden", "true"), attr$5(n, "class", "w-4 h-4 text-red-800 svelte-fryf3t"), attr$5(t, "stroke", "currentColor"), attr$5(t, "stroke-linecap", "round"), attr$5(t, "stroke-linejoin", "round"), attr$5(t, "stroke-width", "2"), attr$5(t, "d", "M9 5 5 1 1 5"), attr$5(t, "class", "svelte-fryf3t"), attr$5(c, "data-accordion-icon", ""), attr$5(c, "class", "w-3 h-3 shrink-0 svelte-fryf3t"), attr$5(c, "aria-hidden", "true"), attr$5(c, "xmlns", "http://www.w3.org/2000/svg"), attr$5(c, "fill", "none"), attr$5(c, "viewBox", "0 0 10 6"), toggle_class$4(
+ y[48].class
+ ] + " svelte-bt9x4p"), attr$5(E, "class", "svelte-bt9x4p"), attr$5(C, "class", "px-2 text-gray-800 font-bold svelte-bt9x4p"), attr$5(l, "class", "svelte-bt9x4p"), attr$5(b, "stroke-linecap", "round"), attr$5(b, "stroke-linejoin", "round"), attr$5(b, "d", "M6 18 18 6M6 6l12 12"), attr$5(b, "class", "svelte-bt9x4p"), attr$5(n, "data-slot", "icon"), attr$5(n, "fill", "none"), attr$5(n, "stroke-width", "3"), attr$5(n, "stroke", "currentColor"), attr$5(n, "viewBox", "0 0 24 24"), attr$5(n, "xmlns", "http://www.w3.org/2000/svg"), attr$5(n, "aria-hidden", "true"), attr$5(n, "class", "w-4 h-4 text-red-800 svelte-bt9x4p"), attr$5(t, "stroke", "currentColor"), attr$5(t, "stroke-linecap", "round"), attr$5(t, "stroke-linejoin", "round"), attr$5(t, "stroke-width", "2"), attr$5(t, "d", "M9 5 5 1 1 5"), attr$5(t, "class", "svelte-bt9x4p"), attr$5(c, "data-accordion-icon", ""), attr$5(c, "class", "w-3 h-3 shrink-0 svelte-bt9x4p"), attr$5(c, "aria-hidden", "true"), attr$5(c, "xmlns", "http://www.w3.org/2000/svg"), attr$5(c, "fill", "none"), attr$5(c, "viewBox", "0 0 10 6"), toggle_class$4(
c,
"rotate-180",
/*item*/
- y[44].open
+ y[48].open
), toggle_class$4(c, "-rotate-90", !/*item*/
- y[44].open), attr$5(r, "class", "flex items-center space-x-2 svelte-fryf3t"), attr$5(e, "type", "button"), attr$5(e, "class", "flex items-center justify-between w-full p-5 font-medium rtl:text-right text-gray-500 border border-gray-200 dark:border-gray-700 dark:text-gray-400 hover:bg-gray-100 dark:hover:bg-gray-800 gap-3 svelte-fryf3t"), attr$5(e, "data-accordion-target", `#accordion-collapse-body-${/*i*/
- y[35]}`), attr$5(e, "aria-expanded", a = /*item*/
- y[44].open), attr$5(e, "aria-controls", `accordion-collapse-body-${/*i*/
- y[35]}`), toggle_class$4(
+ y[48].open), attr$5(r, "class", "flex items-center space-x-2 svelte-bt9x4p"), attr$5(e, "type", "button"), attr$5(e, "class", "flex items-center justify-between w-full p-5 font-medium rtl:text-right text-gray-500 border border-gray-200 dark:border-gray-700 dark:text-gray-400 hover:bg-gray-100 dark:hover:bg-gray-800 gap-3 svelte-bt9x4p"), attr$5(e, "data-accordion-target", `#accordion-collapse-body-${/*i*/
+ y[37]}`), attr$5(e, "aria-expanded", a = /*item*/
+ y[48].open), attr$5(e, "aria-controls", `accordion-collapse-body-${/*i*/
+ y[37]}`), toggle_class$4(
e,
"rounded-t-xl",
/*i*/
- y[35] === 0
+ y[37] === 0
), toggle_class$4(
e,
"rounded-b-xl",
/*i*/
- y[35] == /*vals*/
+ y[37] == /*vals*/
y[0].length - 1
), toggle_class$4(
e,
"border-b-0",
/*i*/
- y[35] != /*vals*/
+ y[37] != /*vals*/
y[0].length - 1
), attr$5(s, "id", `accordion-collapse-heading-${/*i*/
- y[35]}`), attr$5(s, "class", "svelte-fryf3t");
+ y[37]}`), attr$5(s, "class", "svelte-bt9x4p");
},
- m($, W) {
- insert$6($, s, W), append$4(s, e), append$4(e, l), append$4(l, g), append$4(g, x), append$4(l, p), append$4(l, E), append$4(E, A), append$4(l, C), append$4(l, L), z && z.m(L, null), append$4(e, D), append$4(e, r), append$4(r, n), append$4(n, b), append$4(r, f), append$4(r, c), append$4(c, t), insert$6($, h, W), U && U.m($, W), insert$6($, M, W), F && F.m($, W), insert$6($, w, W), S = !0, T || (R = [
+ m(z, W) {
+ insert$6(z, s, W), append$4(s, e), append$4(e, l), append$4(l, p), append$4(p, x), append$4(l, g), append$4(l, E), append$4(E, A), append$4(l, L), append$4(l, C), $ && $.m(C, null), append$4(e, D), append$4(e, r), append$4(r, n), append$4(n, b), append$4(r, f), append$4(r, c), append$4(c, t), insert$6(z, h, W), F && F.m(z, W), insert$6(z, M, W), U && U.m(z, W), insert$6(z, w, W), S = !0, T || (R = [
listen$1(n, "click", P),
listen$1(e, "click", B)
], T = !0);
},
- p($, W) {
- y = $, (!S || W[0] & /*vals*/
+ p(z, W) {
+ y = z, (!S || W[0] & /*vals*/
1) && _ !== (_ = /*item*/
- y[44].chain + "") && set_data$4(x, _), (!S || W[0] & /*vals*/
+ y[48].chain + "") && set_data$4(x, _), (!S || W[0] & /*vals*/
1 && o !== (o = "inline-flex items-center justify-center p-1 px-2 text-xs font-semibold rounded-full " + /*colorCode*/
y[7][
/*item*/
- y[44].class
- ] + " svelte-fryf3t")) && attr$5(g, "class", o), (!S || W[0] & /*vals*/
+ y[48].class
+ ] + " svelte-bt9x4p")) && attr$5(p, "class", o), (!S || W[0] & /*vals*/
1) && u !== (u = /*labels*/
y[6][
/*item*/
- y[44].class
+ y[48].class
] + "") && set_data$4(A, u), !/*item*/
- y[44].open && /*item*/
- y[44].class === "ligand" ? z ? z.p(y, W) : (z = create_if_block_11$1(y), z.c(), z.m(L, null)) : z && (z.d(1), z = null), (!S || W[0] & /*vals*/
+ y[48].open && /*item*/
+ y[48].class === "ligand" ? $ ? $.p(y, W) : ($ = create_if_block_11$1(y), $.c(), $.m(C, null)) : $ && ($.d(1), $ = null), (!S || W[0] & /*vals*/
1) && toggle_class$4(
c,
"rotate-180",
/*item*/
- y[44].open
+ y[48].open
), (!S || W[0] & /*vals*/
1) && toggle_class$4(c, "-rotate-90", !/*item*/
- y[44].open), (!S || W[0] & /*vals*/
+ y[48].open), (!S || W[0] & /*vals*/
1 && a !== (a = /*item*/
- y[44].open)) && attr$5(e, "aria-expanded", a), (!S || W[0] & /*vals*/
+ y[48].open)) && attr$5(e, "aria-expanded", a), (!S || W[0] & /*vals*/
1) && toggle_class$4(
e,
"rounded-b-xl",
/*i*/
- y[35] == /*vals*/
+ y[37] == /*vals*/
y[0].length - 1
), (!S || W[0] & /*vals*/
1) && toggle_class$4(
e,
"border-b-0",
/*i*/
- y[35] != /*vals*/
+ y[37] != /*vals*/
y[0].length - 1
), /*item*/
- y[44].open ? U ? (U.p(y, W), W[0] & /*vals*/
- 1 && transition_in$4(U, 1)) : (U = create_if_block_8$1(y), U.c(), transition_in$4(U, 1), U.m(M.parentNode, M)) : U && (group_outros$4(), transition_out$4(U, 1, 1, () => {
- U = null;
- }), check_outros$4()), /*item*/
- y[44].open ? F && (group_outros$4(), transition_out$4(F, 1, 1, () => {
+ y[48].open ? F ? (F.p(y, W), W[0] & /*vals*/
+ 1 && transition_in$4(F, 1)) : (F = create_if_block_8$1(y), F.c(), transition_in$4(F, 1), F.m(M.parentNode, M)) : F && (group_outros$4(), transition_out$4(F, 1, 1, () => {
F = null;
- }), check_outros$4()) : F ? (F.p(y, W), W[0] & /*vals*/
- 1 && transition_in$4(F, 1)) : (F = create_if_block_3$2(y), F.c(), transition_in$4(F, 1), F.m(w.parentNode, w));
+ }), check_outros$4()), /*item*/
+ y[48].open ? U && (group_outros$4(), transition_out$4(U, 1, 1, () => {
+ U = null;
+ }), check_outros$4()) : U ? (U.p(y, W), W[0] & /*vals*/
+ 1 && transition_in$4(U, 1)) : (U = create_if_block_3$2(y), U.c(), transition_in$4(U, 1), U.m(w.parentNode, w));
},
- i($) {
- S || (transition_in$4(U), transition_in$4(F), S = !0);
+ i(z) {
+ S || (transition_in$4(F), transition_in$4(U), S = !0);
},
- o($) {
- transition_out$4(U), transition_out$4(F), S = !1;
+ o(z) {
+ transition_out$4(F), transition_out$4(U), S = !1;
},
- d($) {
- $ && (detach$6(s), detach$6(h), detach$6(M), detach$6(w)), z && z.d(), U && U.d($), F && F.d($), T = !1, run_all$1(R);
+ d(z) {
+ z && (detach$6(s), detach$6(h), detach$6(M), detach$6(w)), $ && $.d(), F && F.d(z), U && U.d(z), T = !1, run_all$1(R);
}
};
}
function create_if_block$4(y) {
- let s, e, l, g = ensure_array_like$1(
+ let s, e, l, p = ensure_array_like$1(
/*covMods*/
y[1]
), _ = [];
- for (let x = 0; x < g.length; x += 1)
- _[x] = create_each_block$1(get_each_context$1(y, g, x));
+ for (let x = 0; x < p.length; x += 1)
+ _[x] = create_each_block$1(get_each_context$1(y, p, x));
return {
c() {
s = element$5("h4"), s.textContent = "Covalent Modification", e = space$4();
for (let x = 0; x < _.length; x += 1)
_[x].c();
- l = empty$3(), attr$5(s, "class", "text-center font-bold text-xl svelte-fryf3t");
+ l = empty$3(), attr$5(s, "class", "text-center font-bold text-xl svelte-bt9x4p");
},
m(x, o) {
insert$6(x, s, o), insert$6(x, e, o);
- for (let p = 0; p < _.length; p += 1)
- _[p] && _[p].m(x, o);
+ for (let g = 0; g < _.length; g += 1)
+ _[g] && _[g].m(x, o);
insert$6(x, l, o);
},
p(x, o) {
- if (o[0] & /*dispatch, covMods, ligandChains, getResAtoms, getResname, proteinChains*/
- 1594) {
- g = ensure_array_like$1(
+ if (o[0] & /*dispatch, covMods, ligandChains, getResAtoms, getResname, getResidues, proteinChains*/
+ 3642) {
+ p = ensure_array_like$1(
/*covMods*/
x[1]
);
- let p;
- for (p = 0; p < g.length; p += 1) {
- const E = get_each_context$1(x, g, p);
- _[p] ? _[p].p(E, o) : (_[p] = create_each_block$1(E), _[p].c(), _[p].m(l.parentNode, l));
+ let g;
+ for (g = 0; g < p.length; g += 1) {
+ const E = get_each_context$1(x, p, g);
+ _[g] ? _[g].p(E, o) : (_[g] = create_each_block$1(E), _[g].c(), _[g].m(l.parentNode, l));
}
- for (; p < _.length; p += 1)
- _[p].d(1);
- _.length = g.length;
+ for (; g < _.length; g += 1)
+ _[g].d(1);
+ _.length = p.length;
}
},
d(x) {
@@ -25788,15 +25792,15 @@ function create_if_block$4(y) {
}
};
}
-function create_each_block_3(y) {
+function create_each_block_4(y) {
let s, e = (
/*chain*/
- y[36] + ""
- ), l, g;
+ y[38] + ""
+ ), l, p;
return {
c() {
- s = element$5("option"), l = text$4(e), s.__value = g = /*chain*/
- y[36], set_input_value$1(s, s.__value), attr$5(s, "class", "svelte-fryf3t");
+ s = element$5("option"), l = text$4(e), s.__value = p = /*chain*/
+ y[38], set_input_value$1(s, s.__value), attr$5(s, "class", "svelte-bt9x4p");
},
m(_, x) {
insert$6(_, s, x), append$4(s, l);
@@ -25804,20 +25808,46 @@ function create_each_block_3(y) {
p(_, x) {
x[0] & /*proteinChains*/
8 && e !== (e = /*chain*/
- _[36] + "") && set_data$4(l, e), x[0] & /*proteinChains*/
- 8 && g !== (g = /*chain*/
- _[36]) && (s.__value = g, set_input_value$1(s, s.__value));
+ _[38] + "") && set_data$4(l, e), x[0] & /*proteinChains*/
+ 8 && p !== (p = /*chain*/
+ _[38]) && (s.__value = p, set_input_value$1(s, s.__value));
},
d(_) {
_ && detach$6(s);
}
};
}
+function create_each_block_3(y) {
+ let s, e = (
+ /*i*/
+ y[37] + 1 + ""
+ ), l, p, _ = (
+ /*resi*/
+ y[44] + ""
+ ), x;
+ return {
+ c() {
+ s = element$5("option"), l = text$4(e), p = space$4(), x = text$4(_), s.__value = /*i*/
+ y[37] + 1, set_input_value$1(s, s.__value), attr$5(s, "class", "svelte-bt9x4p");
+ },
+ m(o, g) {
+ insert$6(o, s, g), append$4(s, l), append$4(s, p), append$4(s, x);
+ },
+ p(o, g) {
+ g[0] & /*covMods*/
+ 2 && _ !== (_ = /*resi*/
+ o[44] + "") && set_data$4(x, _);
+ },
+ d(o) {
+ o && detach$6(s);
+ }
+ };
+}
function create_else_block_1$1(y) {
let s;
return {
c() {
- s = element$5("option"), s.disabled = !0, s.__value = "", set_input_value$1(s, s.__value), attr$5(s, "class", "svelte-fryf3t");
+ s = element$5("option"), s.disabled = !0, s.__value = "", set_input_value$1(s, s.__value), attr$5(s, "class", "svelte-bt9x4p");
},
m(e, l) {
insert$6(e, s, l);
@@ -25833,35 +25863,35 @@ function create_if_block_2$2(y) {
/*getResAtoms*/
y[9](
/*covMod*/
- y[33]
+ y[35]
)
), l = [];
- for (let g = 0; g < e.length; g += 1)
- l[g] = create_each_block_2(get_each_context_2(y, e, g));
+ for (let p = 0; p < e.length; p += 1)
+ l[p] = create_each_block_2(get_each_context_2(y, e, p));
return {
c() {
- for (let g = 0; g < l.length; g += 1)
- l[g].c();
+ for (let p = 0; p < l.length; p += 1)
+ l[p].c();
s = empty$3();
},
- m(g, _) {
+ m(p, _) {
for (let x = 0; x < l.length; x += 1)
- l[x] && l[x].m(g, _);
- insert$6(g, s, _);
+ l[x] && l[x].m(p, _);
+ insert$6(p, s, _);
},
- p(g, _) {
+ p(p, _) {
if (_[0] & /*getResAtoms, covMods, getResname*/
- 1538) {
+ 2562) {
e = ensure_array_like$1(
/*getResAtoms*/
- g[9](
+ p[9](
/*covMod*/
- g[33]
+ p[35]
)
);
let x;
for (x = 0; x < e.length; x += 1) {
- const o = get_each_context_2(g, e, x);
+ const o = get_each_context_2(p, e, x);
l[x] ? l[x].p(o, _) : (l[x] = create_each_block_2(o), l[x].c(), l[x].m(s.parentNode, s));
}
for (; x < l.length; x += 1)
@@ -25869,42 +25899,42 @@ function create_if_block_2$2(y) {
l.length = e.length;
}
},
- d(g) {
- g && detach$6(s), destroy_each$1(l, g);
+ d(p) {
+ p && detach$6(s), destroy_each$1(l, p);
}
};
}
function create_each_block_2(y) {
let s, e, l = (
/*getResname*/
- y[10](
+ y[11](
/*covMod*/
- y[33]
+ y[35]
) + ""
- ), g, _, x = (
+ ), p, _, x = (
/*atom*/
- y[39] + ""
- ), o, p;
+ y[41] + ""
+ ), o, g;
return {
c() {
s = text$4(`}
- `), e = element$5("option"), g = text$4(l), _ = text$4(":"), o = text$4(x), e.__value = p = /*atom*/
- y[39], set_input_value$1(e, e.__value), attr$5(e, "class", "svelte-fryf3t");
+ `), e = element$5("option"), p = text$4(l), _ = text$4(":"), o = text$4(x), e.__value = g = /*atom*/
+ y[41], set_input_value$1(e, e.__value), attr$5(e, "class", "svelte-bt9x4p");
},
m(E, u) {
- insert$6(E, s, u), insert$6(E, e, u), append$4(e, g), append$4(e, _), append$4(e, o);
+ insert$6(E, s, u), insert$6(E, e, u), append$4(e, p), append$4(e, _), append$4(e, o);
},
p(E, u) {
u[0] & /*covMods*/
2 && l !== (l = /*getResname*/
- E[10](
+ E[11](
/*covMod*/
- E[33]
- ) + "") && set_data$4(g, l), u[0] & /*covMods*/
+ E[35]
+ ) + "") && set_data$4(p, l), u[0] & /*covMods*/
2 && x !== (x = /*atom*/
- E[39] + "") && set_data$4(o, x), u[0] & /*covMods, proteinChains*/
- 10 && p !== (p = /*atom*/
- E[39]) && (e.__value = p, set_input_value$1(e, e.__value));
+ E[41] + "") && set_data$4(o, x), u[0] & /*covMods, proteinChains*/
+ 10 && g !== (g = /*atom*/
+ E[41]) && (e.__value = g, set_input_value$1(e, e.__value));
},
d(E) {
E && (detach$6(s), detach$6(e));
@@ -25914,14 +25944,14 @@ function create_each_block_2(y) {
function create_each_block_1$1(y) {
let s, e = (
/*chain*/
- y[36] + ""
- ), l, g, _;
+ y[38] + ""
+ ), l, p, _;
return {
c() {
- s = element$5("option"), l = text$4(e), s.__value = g = /*chain*/
- y[36], set_input_value$1(s, s.__value), s.selected = _ = /*chain*/
- y[36] === /*covMod*/
- y[33].ligand, attr$5(s, "class", "svelte-fryf3t");
+ s = element$5("option"), l = text$4(e), s.__value = p = /*chain*/
+ y[38], set_input_value$1(s, s.__value), s.selected = _ = /*chain*/
+ y[38] === /*covMod*/
+ y[35].ligand, attr$5(s, "class", "svelte-bt9x4p");
},
m(x, o) {
insert$6(x, s, o), append$4(s, l);
@@ -25929,12 +25959,12 @@ function create_each_block_1$1(y) {
p(x, o) {
o[0] & /*ligandChains*/
16 && e !== (e = /*chain*/
- x[36] + "") && set_data$4(l, e), o[0] & /*ligandChains*/
- 16 && g !== (g = /*chain*/
- x[36]) && (s.__value = g, set_input_value$1(s, s.__value)), o[0] & /*ligandChains, covMods, proteinChains*/
+ x[38] + "") && set_data$4(l, e), o[0] & /*ligandChains*/
+ 16 && p !== (p = /*chain*/
+ x[38]) && (s.__value = p, set_input_value$1(s, s.__value)), o[0] & /*ligandChains, covMods, proteinChains*/
26 && _ !== (_ = /*chain*/
- x[36] === /*covMod*/
- x[33].ligand) && (s.selected = _);
+ x[38] === /*covMod*/
+ x[35].ligand) && (s.selected = _);
},
d(x) {
x && detach$6(s);
@@ -25945,7 +25975,7 @@ function create_else_block$3(y) {
let s;
return {
c() {
- s = element$5("p"), s.textContent = "click on atom", attr$5(s, "class", "font-mono svelte-fryf3t");
+ s = element$5("p"), s.textContent = "click on atom", attr$5(s, "class", "font-mono svelte-bt9x4p");
},
m(e, l) {
insert$6(e, s, l);
@@ -25959,19 +25989,19 @@ function create_else_block$3(y) {
function create_if_block_1$3(y) {
let s, e, l = (
/*covMod*/
- y[33].attachmentIndex + ""
- ), g;
+ y[35].attachmentIndex + ""
+ ), p;
return {
c() {
- s = element$5("p"), e = text$4("index "), g = text$4(l), attr$5(s, "class", "font-mono svelte-fryf3t");
+ s = element$5("p"), e = text$4("index "), p = text$4(l), attr$5(s, "class", "font-mono svelte-bt9x4p");
},
m(_, x) {
- insert$6(_, s, x), append$4(s, e), append$4(s, g);
+ insert$6(_, s, x), append$4(s, e), append$4(s, p);
},
p(_, x) {
x[0] & /*covMods*/
2 && l !== (l = /*covMod*/
- _[33].attachmentIndex + "") && set_data$4(g, l);
+ _[35].attachmentIndex + "") && set_data$4(p, l);
},
d(_) {
_ && detach$6(s);
@@ -25979,296 +26009,349 @@ function create_if_block_1$3(y) {
};
}
function create_each_block$1(y) {
- let s, e, l, g, _, x, o, p, E, u, A, C, L, D, r, n, b, f, c, t, a, h, M, w, S, T, R, z, P, B, U, F, $, W, N, G, k, j, Q, ie, pe, he, ue = ensure_array_like$1(
+ let s, e, l, p, _, x, o, g, E, u, A, L, C, D, r, n, b, f, c, t, a, h, M, w, S, T, R, $, P, B, F, U, z, W, V, N, k, G, Q, ie, ge, le = ensure_array_like$1(
/*proteinChains*/
y[3]
- ), se = [];
- for (let Te = 0; Te < ue.length; Te += 1)
- se[Te] = create_each_block_3(get_each_context_3(y, ue, Te));
- function ae() {
- y[19].call(
+ ), oe = [];
+ for (let Be = 0; Be < le.length; Be += 1)
+ oe[Be] = create_each_block_4(get_each_context_4(y, le, Be));
+ function he() {
+ y[20].call(
E,
/*i*/
- y[35]
+ y[37]
);
}
- function we(...Te) {
- return (
- /*input_handler_3*/
- y[21](
- /*i*/
- y[35],
- ...Te
- )
+ let se = ensure_array_like$1(
+ /*getResidues*/
+ y[10](
+ /*covMod*/
+ y[35]
+ )
+ ), xe = [];
+ for (let Be = 0; Be < se.length; Be += 1)
+ xe[Be] = create_each_block_3(get_each_context_3(y, se, Be));
+ function ye() {
+ y[22].call(
+ A,
+ /*i*/
+ y[37]
);
}
- function xe(Te, je) {
+ function Pe(Be, Ne) {
return (
/*covMod*/
- Te[33].residue != "" ? create_if_block_2$2 : create_else_block_1$1
+ Be[35].residue != "" ? create_if_block_2$2 : create_else_block_1$1
);
}
- let Ie = xe(y), oe = Ie(y);
- function ve() {
- y[22].call(
- D,
+ let de = Pe(y), pe = de(y);
+ function re() {
+ y[24].call(
+ C,
/*i*/
- y[35]
+ y[37]
);
}
- function re() {
- y[24].call(
- n,
+ function Se() {
+ y[26].call(
+ r,
/*i*/
- y[35]
+ y[37]
);
}
- let Se = ensure_array_like$1(
+ let ke = ensure_array_like$1(
/*ligandChains*/
y[4]
- ), ze = [];
- for (let Te = 0; Te < Se.length; Te += 1)
- ze[Te] = create_each_block_1$1(get_each_context_1$1(y, Se, Te));
- function Ge() {
- y[26].call(
- z,
+ ), $e = [];
+ for (let Be = 0; Be < ke.length; Be += 1)
+ $e[Be] = create_each_block_1$1(get_each_context_1$1(y, ke, Be));
+ function ze() {
+ y[28].call(
+ R,
/*i*/
- y[35]
+ y[37]
);
}
- function $e(Te, je) {
+ function Re(Be, Ne) {
return (
/*covMod*/
- Te[33].attachmentIndex ? create_if_block_1$3 : create_else_block$3
+ Be[35].attachmentIndex ? create_if_block_1$3 : create_else_block$3
);
}
- let Re = $e(y), Be = Re(y);
- function ke() {
- y[28].call(
+ let Fe = Re(y), Ie = Fe(y);
+ function We() {
+ y[30].call(
F,
/*i*/
- y[35]
+ y[37]
);
}
- function We(...Te) {
+ function Ue(...Be) {
return (
/*click_handler_3*/
- y[30](
+ y[32](
/*i*/
- y[35],
- ...Te
+ y[37],
+ ...Be
)
);
}
return {
c() {
- s = element$5("div"), e = element$5("div"), l = element$5("div"), g = element$5("div"), g.innerHTML = 'Protein', _ = space$4(), x = element$5("div"), x.innerHTML = 'Chain Residue Atom Chirality', o = space$4(), p = element$5("div"), E = element$5("select");
- for (let Te = 0; Te < se.length; Te += 1)
- se[Te].c();
- u = space$4(), A = element$5("input"), L = space$4(), D = element$5("select"), oe.c(), r = space$4(), n = element$5("select"), b = element$5("option"), b.textContent = "no chirality defined", f = element$5("option"), f.textContent = "CW", c = element$5("option"), c.textContent = "CCW", t = space$4(), a = element$5("div"), h = element$5("div"), M = element$5("div"), M.innerHTML = 'Small molecule', w = space$4(), S = element$5("div"), S.innerHTML = 'Chain Atom index Chirality', T = space$4(), R = element$5("div"), z = element$5("select");
- for (let Te = 0; Te < ze.length; Te += 1)
- ze[Te].c();
- P = space$4(), B = element$5("div"), Be.c(), U = space$4(), F = element$5("select"), $ = element$5("option"), $.textContent = "no chirality defined", W = element$5("option"), W.textContent = "CW", N = element$5("option"), N.textContent = "CCW", G = space$4(), k = element$5("div"), j = svg_element$1("svg"), Q = svg_element$1("path"), ie = space$4(), attr$5(g, "class", "flex justify-center svelte-fryf3t"), attr$5(x, "class", "grid grid-cols-4 font-bold svelte-fryf3t"), attr$5(E, "name", ""), attr$5(E, "id", ""), attr$5(E, "class", "svelte-fryf3t"), /*covMods*/
+ s = element$5("div"), e = element$5("div"), l = element$5("div"), p = element$5("div"), p.innerHTML = 'Protein', _ = space$4(), x = element$5("div"), x.innerHTML = 'Chain Residue Atom Chirality', o = space$4(), g = element$5("div"), E = element$5("select");
+ for (let Be = 0; Be < oe.length; Be += 1)
+ oe[Be].c();
+ u = space$4(), A = element$5("select");
+ for (let Be = 0; Be < xe.length; Be += 1)
+ xe[Be].c();
+ L = space$4(), C = element$5("select"), pe.c(), D = space$4(), r = element$5("select"), n = element$5("option"), n.textContent = "no chirality defined", b = element$5("option"), b.textContent = "CW", f = element$5("option"), f.textContent = "CCW", c = space$4(), t = element$5("div"), a = element$5("div"), h = element$5("div"), h.innerHTML = 'Small molecule', M = space$4(), w = element$5("div"), w.innerHTML = 'Chain Atom index Chirality', S = space$4(), T = element$5("div"), R = element$5("select");
+ for (let Be = 0; Be < $e.length; Be += 1)
+ $e[Be].c();
+ $ = space$4(), P = element$5("div"), Ie.c(), B = space$4(), F = element$5("select"), U = element$5("option"), U.textContent = "no chirality defined", z = element$5("option"), z.textContent = "CW", W = element$5("option"), W.textContent = "CCW", V = space$4(), N = element$5("div"), k = svg_element$1("svg"), G = svg_element$1("path"), Q = space$4(), attr$5(p, "class", "flex justify-center svelte-bt9x4p"), attr$5(x, "class", "grid grid-cols-4 font-bold svelte-bt9x4p"), attr$5(E, "name", ""), attr$5(E, "id", ""), attr$5(E, "class", "svelte-bt9x4p"), /*covMods*/
y[1][
/*i*/
- y[35]
- ].protein === void 0 && add_render_callback$2(ae), attr$5(A, "type", "text"), attr$5(A, "placeholder", "residue "), attr$5(A, "class", "px-3 svelte-fryf3t"), A.value = C = /*covMod*/
- y[33].residue, attr$5(D, "name", ""), attr$5(D, "id", ""), attr$5(D, "class", "svelte-fryf3t"), /*covMods*/
+ y[37]
+ ].protein === void 0 && add_render_callback$2(he), attr$5(A, "name", ""), attr$5(A, "id", ""), attr$5(A, "class", "svelte-bt9x4p"), /*covMods*/
y[1][
/*i*/
- y[35]
- ].atom === void 0 && add_render_callback$2(ve), b.__value = "", set_input_value$1(b, b.__value), attr$5(b, "class", "svelte-fryf3t"), f.__value = "CW", set_input_value$1(f, f.__value), attr$5(f, "class", "svelte-fryf3t"), c.__value = "CCW", set_input_value$1(c, c.__value), attr$5(c, "class", "svelte-fryf3t"), attr$5(n, "name", ""), attr$5(n, "id", ""), attr$5(n, "class", "svelte-fryf3t"), /*covMods*/
+ y[37]
+ ].residue === void 0 && add_render_callback$2(ye), attr$5(C, "name", ""), attr$5(C, "id", ""), attr$5(C, "class", "svelte-bt9x4p"), /*covMods*/
y[1][
/*i*/
- y[35]
- ].protein_symmetry === void 0 && add_render_callback$2(re), attr$5(p, "class", "grid grid-cols-4 svelte-fryf3t"), attr$5(l, "class", "w-3/5 flex-col px-2 svelte-fryf3t"), attr$5(M, "class", "flex justify-center svelte-fryf3t"), attr$5(S, "class", "grid grid-cols-3 font-bold svelte-fryf3t"), attr$5(z, "name", ""), attr$5(z, "id", ""), attr$5(z, "title", "click on atom in structure"), attr$5(z, "class", "svelte-fryf3t"), /*covMods*/
+ y[37]
+ ].atom === void 0 && add_render_callback$2(re), n.__value = "", set_input_value$1(n, n.__value), attr$5(n, "class", "svelte-bt9x4p"), b.__value = "CW", set_input_value$1(b, b.__value), attr$5(b, "class", "svelte-bt9x4p"), f.__value = "CCW", set_input_value$1(f, f.__value), attr$5(f, "class", "svelte-bt9x4p"), attr$5(r, "name", ""), attr$5(r, "id", ""), attr$5(r, "class", "svelte-bt9x4p"), /*covMods*/
y[1][
/*i*/
- y[35]
- ].ligand === void 0 && add_render_callback$2(Ge), attr$5(B, "class", "svelte-fryf3t"), $.__value = "", set_input_value$1($, $.__value), attr$5($, "class", "svelte-fryf3t"), W.__value = "CW", set_input_value$1(W, W.__value), attr$5(W, "class", "svelte-fryf3t"), N.__value = "CCW", set_input_value$1(N, N.__value), attr$5(N, "class", "svelte-fryf3t"), attr$5(F, "name", ""), attr$5(F, "id", ""), attr$5(F, "class", "svelte-fryf3t"), /*covMods*/
+ y[37]
+ ].protein_symmetry === void 0 && add_render_callback$2(Se), attr$5(g, "class", "grid grid-cols-4 svelte-bt9x4p"), attr$5(l, "class", "w-3/5 flex-col px-2 svelte-bt9x4p"), attr$5(h, "class", "flex justify-center svelte-bt9x4p"), attr$5(w, "class", "grid grid-cols-3 font-bold svelte-bt9x4p"), attr$5(R, "name", ""), attr$5(R, "id", ""), attr$5(R, "title", "click on atom in structure"), attr$5(R, "class", "svelte-bt9x4p"), /*covMods*/
y[1][
/*i*/
- y[35]
- ].ligand_symmetry === void 0 && add_render_callback$2(ke), attr$5(R, "class", "grid grid-cols-3 svelte-fryf3t"), attr$5(h, "class", "flex-col p-1 svelte-fryf3t"), attr$5(a, "class", "w-2/5 px-2 svelte-fryf3t"), attr$5(e, "class", "flex divide-x rounded border p-1 svelte-fryf3t"), attr$5(Q, "stroke-linecap", "round"), attr$5(Q, "stroke-linejoin", "round"), attr$5(Q, "d", "M6 18 18 6M6 6l12 12"), attr$5(Q, "class", "svelte-fryf3t"), attr$5(j, "data-slot", "icon"), attr$5(j, "fill", "none"), attr$5(j, "stroke-width", "2"), attr$5(j, "stroke", "currentColor"), attr$5(j, "viewBox", "0 0 24 24"), attr$5(j, "xmlns", "http://www.w3.org/2000/svg"), attr$5(j, "aria-hidden", "true"), attr$5(j, "class", "w-8 h-8 text-red-800 cursor-pointer svelte-fryf3t"), attr$5(k, "class", "flex items-center p-2 svelte-fryf3t"), attr$5(s, "class", "flex p-10 svelte-fryf3t");
+ y[37]
+ ].ligand === void 0 && add_render_callback$2(ze), attr$5(P, "class", "svelte-bt9x4p"), U.__value = "", set_input_value$1(U, U.__value), attr$5(U, "class", "svelte-bt9x4p"), z.__value = "CW", set_input_value$1(z, z.__value), attr$5(z, "class", "svelte-bt9x4p"), W.__value = "CCW", set_input_value$1(W, W.__value), attr$5(W, "class", "svelte-bt9x4p"), attr$5(F, "name", ""), attr$5(F, "id", ""), attr$5(F, "class", "svelte-bt9x4p"), /*covMods*/
+ y[1][
+ /*i*/
+ y[37]
+ ].ligand_symmetry === void 0 && add_render_callback$2(We), attr$5(T, "class", "grid grid-cols-3 svelte-bt9x4p"), attr$5(a, "class", "flex-col p-1 svelte-bt9x4p"), attr$5(t, "class", "w-2/5 px-2 svelte-bt9x4p"), attr$5(e, "class", "flex divide-x rounded border p-1 w-full svelte-bt9x4p"), attr$5(G, "stroke-linecap", "round"), attr$5(G, "stroke-linejoin", "round"), attr$5(G, "d", "M6 18 18 6M6 6l12 12"), attr$5(G, "class", "svelte-bt9x4p"), attr$5(k, "data-slot", "icon"), attr$5(k, "fill", "none"), attr$5(k, "stroke-width", "2"), attr$5(k, "stroke", "currentColor"), attr$5(k, "viewBox", "0 0 24 24"), attr$5(k, "xmlns", "http://www.w3.org/2000/svg"), attr$5(k, "aria-hidden", "true"), attr$5(k, "class", "w-8 h-8 text-red-800 cursor-pointer svelte-bt9x4p"), attr$5(N, "class", "flex items-center p-2 svelte-bt9x4p"), attr$5(s, "class", "flex p-10 svelte-bt9x4p");
},
- m(Te, je) {
- insert$6(Te, s, je), append$4(s, e), append$4(e, l), append$4(l, g), append$4(l, _), append$4(l, x), append$4(l, o), append$4(l, p), append$4(p, E);
- for (let Fe = 0; Fe < se.length; Fe += 1)
- se[Fe] && se[Fe].m(E, null);
+ m(Be, Ne) {
+ insert$6(Be, s, Ne), append$4(s, e), append$4(e, l), append$4(l, p), append$4(l, _), append$4(l, x), append$4(l, o), append$4(l, g), append$4(g, E);
+ for (let H = 0; H < oe.length; H += 1)
+ oe[H] && oe[H].m(E, null);
select_option(
E,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].protein,
!0
- ), append$4(p, u), append$4(p, A), append$4(p, L), append$4(p, D), oe.m(D, null), select_option(
- D,
+ ), append$4(g, u), append$4(g, A);
+ for (let H = 0; H < xe.length; H += 1)
+ xe[H] && xe[H].m(A, null);
+ select_option(
+ A,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
+ ].residue,
+ !0
+ ), append$4(g, L), append$4(g, C), pe.m(C, null), select_option(
+ C,
+ /*covMods*/
+ y[1][
+ /*i*/
+ y[37]
].atom,
!0
- ), append$4(p, r), append$4(p, n), append$4(n, b), append$4(n, f), append$4(n, c), select_option(
- n,
+ ), append$4(g, D), append$4(g, r), append$4(r, n), append$4(r, b), append$4(r, f), select_option(
+ r,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].protein_symmetry,
!0
- ), append$4(e, t), append$4(e, a), append$4(a, h), append$4(h, M), append$4(h, w), append$4(h, S), append$4(h, T), append$4(h, R), append$4(R, z);
- for (let Fe = 0; Fe < ze.length; Fe += 1)
- ze[Fe] && ze[Fe].m(z, null);
+ ), append$4(e, c), append$4(e, t), append$4(t, a), append$4(a, h), append$4(a, M), append$4(a, w), append$4(a, S), append$4(a, T), append$4(T, R);
+ for (let H = 0; H < $e.length; H += 1)
+ $e[H] && $e[H].m(R, null);
select_option(
- z,
+ R,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].ligand,
!0
- ), append$4(R, P), append$4(R, B), Be.m(B, null), append$4(R, U), append$4(R, F), append$4(F, $), append$4(F, W), append$4(F, N), select_option(
+ ), append$4(T, $), append$4(T, P), Ie.m(P, null), append$4(T, B), append$4(T, F), append$4(F, U), append$4(F, z), append$4(F, W), select_option(
F,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].ligand_symmetry,
!0
- ), append$4(s, G), append$4(s, k), append$4(k, j), append$4(j, Q), append$4(s, ie), pe || (he = [
- listen$1(E, "change", ae),
+ ), append$4(s, V), append$4(s, N), append$4(N, k), append$4(k, G), append$4(s, Q), ie || (ge = [
+ listen$1(E, "change", he),
listen$1(
E,
"change",
/*change_handler*/
- y[20]
+ y[21]
),
- listen$1(A, "input", we),
- listen$1(D, "change", ve),
+ listen$1(A, "change", ye),
listen$1(
- D,
+ A,
"change",
/*change_handler_1*/
y[23]
),
- listen$1(n, "change", re),
+ listen$1(C, "change", re),
listen$1(
- n,
+ C,
"change",
/*change_handler_2*/
y[25]
),
- listen$1(z, "change", Ge),
+ listen$1(r, "change", Se),
listen$1(
- z,
+ r,
"change",
/*change_handler_3*/
y[27]
),
- listen$1(F, "change", ke),
+ listen$1(R, "change", ze),
listen$1(
- F,
+ R,
"change",
/*change_handler_4*/
y[29]
),
- listen$1(j, "click", We)
- ], pe = !0);
+ listen$1(F, "change", We),
+ listen$1(
+ F,
+ "change",
+ /*change_handler_5*/
+ y[31]
+ ),
+ listen$1(k, "click", Ue)
+ ], ie = !0);
},
- p(Te, je) {
- if (y = Te, je[0] & /*proteinChains*/
+ p(Be, Ne) {
+ if (y = Be, Ne[0] & /*proteinChains*/
8) {
- ue = ensure_array_like$1(
+ le = ensure_array_like$1(
/*proteinChains*/
y[3]
);
- let Fe;
- for (Fe = 0; Fe < ue.length; Fe += 1) {
- const X = get_each_context_3(y, ue, Fe);
- se[Fe] ? se[Fe].p(X, je) : (se[Fe] = create_each_block_3(X), se[Fe].c(), se[Fe].m(E, null));
+ let H;
+ for (H = 0; H < le.length; H += 1) {
+ const K = get_each_context_4(y, le, H);
+ oe[H] ? oe[H].p(K, Ne) : (oe[H] = create_each_block_4(K), oe[H].c(), oe[H].m(E, null));
}
- for (; Fe < se.length; Fe += 1)
- se[Fe].d(1);
- se.length = ue.length;
+ for (; H < oe.length; H += 1)
+ oe[H].d(1);
+ oe.length = le.length;
}
- if (je[0] & /*covMods, proteinChains*/
+ if (Ne[0] & /*covMods, proteinChains*/
10 && select_option(
E,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].protein
- ), je[0] & /*covMods, proteinChains*/
- 10 && C !== (C = /*covMod*/
- y[33].residue) && A.value !== C && (A.value = C), Ie === (Ie = xe(y)) && oe ? oe.p(y, je) : (oe.d(1), oe = Ie(y), oe && (oe.c(), oe.m(D, null))), je[0] & /*covMods, proteinChains*/
+ ), Ne[0] & /*getResidues, covMods*/
+ 1026) {
+ se = ensure_array_like$1(
+ /*getResidues*/
+ y[10](
+ /*covMod*/
+ y[35]
+ )
+ );
+ let H;
+ for (H = 0; H < se.length; H += 1) {
+ const K = get_each_context_3(y, se, H);
+ xe[H] ? xe[H].p(K, Ne) : (xe[H] = create_each_block_3(K), xe[H].c(), xe[H].m(A, null));
+ }
+ for (; H < xe.length; H += 1)
+ xe[H].d(1);
+ xe.length = se.length;
+ }
+ if (Ne[0] & /*covMods, proteinChains*/
10 && select_option(
- D,
+ A,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
+ ].residue
+ ), de === (de = Pe(y)) && pe ? pe.p(y, Ne) : (pe.d(1), pe = de(y), pe && (pe.c(), pe.m(C, null))), Ne[0] & /*covMods, proteinChains*/
+ 10 && select_option(
+ C,
+ /*covMods*/
+ y[1][
+ /*i*/
+ y[37]
].atom
- ), je[0] & /*covMods, proteinChains*/
+ ), Ne[0] & /*covMods, proteinChains*/
10 && select_option(
- n,
+ r,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].protein_symmetry
- ), je[0] & /*ligandChains, covMods*/
+ ), Ne[0] & /*ligandChains, covMods*/
18) {
- Se = ensure_array_like$1(
+ ke = ensure_array_like$1(
/*ligandChains*/
y[4]
);
- let Fe;
- for (Fe = 0; Fe < Se.length; Fe += 1) {
- const X = get_each_context_1$1(y, Se, Fe);
- ze[Fe] ? ze[Fe].p(X, je) : (ze[Fe] = create_each_block_1$1(X), ze[Fe].c(), ze[Fe].m(z, null));
+ let H;
+ for (H = 0; H < ke.length; H += 1) {
+ const K = get_each_context_1$1(y, ke, H);
+ $e[H] ? $e[H].p(K, Ne) : ($e[H] = create_each_block_1$1(K), $e[H].c(), $e[H].m(R, null));
}
- for (; Fe < ze.length; Fe += 1)
- ze[Fe].d(1);
- ze.length = Se.length;
+ for (; H < $e.length; H += 1)
+ $e[H].d(1);
+ $e.length = ke.length;
}
- je[0] & /*covMods, proteinChains*/
+ Ne[0] & /*covMods, proteinChains*/
10 && select_option(
- z,
+ R,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].ligand
- ), Re === (Re = $e(y)) && Be ? Be.p(y, je) : (Be.d(1), Be = Re(y), Be && (Be.c(), Be.m(B, null))), je[0] & /*covMods, proteinChains*/
+ ), Fe === (Fe = Re(y)) && Ie ? Ie.p(y, Ne) : (Ie.d(1), Ie = Fe(y), Ie && (Ie.c(), Ie.m(P, null))), Ne[0] & /*covMods, proteinChains*/
10 && select_option(
F,
/*covMods*/
y[1][
/*i*/
- y[35]
+ y[37]
].ligand_symmetry
);
},
- d(Te) {
- Te && detach$6(s), destroy_each$1(se, Te), oe.d(), destroy_each$1(ze, Te), Be.d(), pe = !1, run_all$1(he);
+ d(Be) {
+ Be && detach$6(s), destroy_each$1(oe, Be), destroy_each$1(xe, Be), pe.d(), destroy_each$1($e, Be), Ie.d(), ie = !1, run_all$1(ge);
}
};
}
function create_fragment$6(y) {
- let s, e, l, g, _ = ensure_array_like$1(
+ let s, e, l, p, _ = ensure_array_like$1(
/*vals*/
y[0]
), x = [];
for (let E = 0; E < _.length; E += 1)
- x[E] = create_each_block_4(get_each_context_4(y, _, E));
+ x[E] = create_each_block_5(get_each_context_5(y, _, E));
const o = (E) => transition_out$4(x[E], 1, 1, () => {
x[E] = null;
});
- let p = (
+ let g = (
/*covMods*/
y[1].length > 0 && create_if_block$4(y)
);
@@ -26277,64 +26360,64 @@ function create_fragment$6(y) {
s = element$5("div");
for (let E = 0; E < x.length; E += 1)
x[E].c();
- e = space$4(), l = element$5("div"), p && p.c(), attr$5(l, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 svelte-fryf3t"), attr$5(s, "id", "accordion-collapse"), attr$5(s, "data-accordion", "collapse"), attr$5(s, "class", "svelte-fryf3t");
+ e = space$4(), l = element$5("div"), g && g.c(), attr$5(l, "class", "p-5 border border-t-0 border-gray-200 dark:border-gray-700 w-full svelte-bt9x4p"), attr$5(s, "id", "accordion-collapse"), attr$5(s, "data-accordion", "collapse"), attr$5(s, "class", "svelte-bt9x4p");
},
m(E, u) {
insert$6(E, s, u);
for (let A = 0; A < x.length; A += 1)
x[A] && x[A].m(s, null);
- append$4(s, e), append$4(s, l), p && p.m(l, null), g = !0;
+ append$4(s, e), append$4(s, l), g && g.m(l, null), p = !0;
},
p(E, u) {
if (u[0] & /*vals, showCovModVals, updateMol, dispatch, metals, handleMessage, labels, colorCode*/
- 6629) {
+ 12773) {
_ = ensure_array_like$1(
/*vals*/
E[0]
);
let A;
for (A = 0; A < _.length; A += 1) {
- const C = get_each_context_4(E, _, A);
- x[A] ? (x[A].p(C, u), transition_in$4(x[A], 1)) : (x[A] = create_each_block_4(C), x[A].c(), transition_in$4(x[A], 1), x[A].m(s, e));
+ const L = get_each_context_5(E, _, A);
+ x[A] ? (x[A].p(L, u), transition_in$4(x[A], 1)) : (x[A] = create_each_block_5(L), x[A].c(), transition_in$4(x[A], 1), x[A].m(s, e));
}
for (group_outros$4(), A = _.length; A < x.length; A += 1)
o(A);
check_outros$4();
}
/*covMods*/
- E[1].length > 0 ? p ? p.p(E, u) : (p = create_if_block$4(E), p.c(), p.m(l, null)) : p && (p.d(1), p = null);
+ E[1].length > 0 ? g ? g.p(E, u) : (g = create_if_block$4(E), g.c(), g.m(l, null)) : g && (g.d(1), g = null);
},
i(E) {
- if (!g) {
+ if (!p) {
for (let u = 0; u < _.length; u += 1)
transition_in$4(x[u]);
- g = !0;
+ p = !0;
}
},
o(E) {
x = x.filter(Boolean);
for (let u = 0; u < x.length; u += 1)
transition_out$4(x[u]);
- g = !1;
+ p = !1;
},
d(E) {
- E && detach$6(s), destroy_each$1(x, E), p && p.d();
+ E && detach$6(s), destroy_each$1(x, E), g && g.d();
}
};
}
function instance$6(y, s, e) {
const l = createEventDispatcher$2();
- let { vals: g = [] } = s, { covMods: _ = [] } = s, x = [], o = {
+ let { vals: p = [] } = s, { covMods: _ = [] } = s, x = [], o = {
DNA: "NA sequence",
RNA: "NA sequence",
protein: "Protein sequence",
ligand: "Small molecule"
- }, p = {
+ }, g = {
DNA: "bg-green-200 text-blue-800",
RNA: "bg-green-200 text-blue-800",
protein: "bg-blue-200 text-blue-800",
ligand: "bg-orange-200 text-blue-800"
- }, E = ["ZN", "MG", "CA", "FE", "NA", "K", "CL", "CU", "MN", "CO", "NI"], u = [], A = [], C = {
+ }, E = ["ZN", "MG", "CA", "FE", "NA", "K", "CL", "CU", "MN", "CO", "NI"], u = [], A = [], L = {
A: ["C", "CA", "CB", "N", "O"],
R: ["C", "CA", "CB", "CG", "CD", "CZ", "N", "NE", "O", "NH1", "NH2"],
D: ["C", "CA", "CB", "CG", "N", "O", "OD1", "OD2"],
@@ -26370,7 +26453,7 @@ function instance$6(y, s, e) {
],
Y: ["C", "CA", "CB", "CG", "CD1", "CD2", "CE1", "CE2", "CZ", "N", "O", "OH"],
V: ["C", "CA", "CB", "CG1", "CG2", "N", "O"]
- }, L = {
+ }, C = {
H: "HIS",
A: "ALA",
R: "ARG",
@@ -26394,84 +26477,90 @@ function instance$6(y, s, e) {
V: "VAL"
};
function D(G) {
- let k = g.find((Q) => Q.chain === G.protein).sequence;
- if (k.length < G.residue)
+ let Q = p.find((ge) => ge.chain === G.protein).sequence;
+ if (Q.length < G.residue)
return alert("Residue number is too high"), [];
- let j = k[G.residue - 1];
- return C[j];
+ let ie = Q[G.residue - 1];
+ return L[ie];
}
function r(G) {
- let j = g.find((Q) => Q.chain === G.protein).sequence[G.residue - 1];
- return L[j];
+ let Q = p.find((ie) => ie.chain === G.protein).sequence;
+ return Array.from(Q).map((ie) => C[ie]);
}
function n(G) {
- let k = G.detail.index;
- e(1, _[k].mol = G.detail.mol, _), e(1, _[k].attachmentIndex = G.detail.attachmentIndex, _), e(1, _[k].deleteIndexes = G.detail.deleteIndexes, _), l("updateCovMod", _);
+ let ie = p.find((ge) => ge.chain === G.protein).sequence[G.residue - 1];
+ return C[ie];
}
function b(G) {
- fetch(`https://files.rcsb.org/ligands/download/${G.detail.text}_ideal.sdf`).then((k) => {
- if (!k.ok)
+ let Q = G.detail.index;
+ e(1, _[Q].mol = G.detail.mol, _), e(1, _[Q].attachmentIndex = G.detail.attachmentIndex, _), e(1, _[Q].deleteIndexes = G.detail.deleteIndexes, _), l("updateCovMod", _);
+ }
+ function f(G) {
+ fetch(`https://files.rcsb.org/ligands/download/${G.detail.text}_ideal.sdf`).then((Q) => {
+ if (!Q.ok)
throw new Error("Network response was not ok");
- return k.text();
- }).then((k) => {
+ return Q.text();
+ }).then((Q) => {
l("updateVals", {
- sdf: k,
+ sdf: Q,
index: G.detail.index,
close: !0
});
- }).catch((k) => {
+ }).catch((Q) => {
alert("Error fetching sdf file");
});
}
- const f = (G, k) => {
+ const c = (G, Q) => {
l("removeVal", G);
- }, c = (G, k, j) => e(0, k[j].open = !G.open, g), t = (G, k) => {
- l("updateVals", { sequence: k.target.value, index: G });
- }, a = (G, k) => {
- l("updateVals", { smiles: k.target.value, index: G });
- }, h = (G, k) => {
- l("updateVals", { sdf: k.target.value, index: G });
- }, M = (G, k) => l("updateVals", { name: G, index: k });
- function w(G) {
- _[G].protein = select_value(this), e(1, _), e(3, u), e(0, g);
+ }, t = (G, Q, ie) => e(0, Q[ie].open = !G.open, p), a = (G, Q) => {
+ l("updateVals", { sequence: Q.target.value, index: G });
+ }, h = (G, Q) => {
+ l("updateVals", { smiles: Q.target.value, index: G });
+ }, M = (G, Q) => {
+ l("updateVals", { sdf: Q.target.value, index: G });
+ }, w = (G, Q) => l("updateVals", { name: G, index: Q });
+ function S(G) {
+ _[G].protein = select_value(this), e(1, _), e(3, u), e(0, p);
}
- const S = () => l("updateCovMod", _), T = (G, k) => {
- e(1, _[G].residue = k.target.value, _), l("updateCovMod", _);
- };
+ const T = () => l("updateCovMod", _);
function R(G) {
- _[G].atom = select_value(this), e(1, _), e(3, u), e(0, g);
+ _[G].residue = select_value(this), e(1, _), e(3, u), e(0, p);
}
- const z = () => l("updateCovMod", _);
+ const $ = () => l("updateCovMod", _);
function P(G) {
- _[G].protein_symmetry = select_value(this), e(1, _), e(3, u), e(0, g);
+ _[G].atom = select_value(this), e(1, _), e(3, u), e(0, p);
}
const B = () => l("updateCovMod", _);
- function U(G) {
- _[G].ligand = select_value(this), e(1, _), e(3, u), e(0, g);
+ function F(G) {
+ _[G].protein_symmetry = select_value(this), e(1, _), e(3, u), e(0, p);
+ }
+ const U = () => l("updateCovMod", _);
+ function z(G) {
+ _[G].ligand = select_value(this), e(1, _), e(3, u), e(0, p);
}
- const F = () => l("updateCovMod", _);
- function $(G) {
- _[G].ligand_symmetry = select_value(this), e(1, _), e(3, u), e(0, g);
+ const W = () => l("updateCovMod", _);
+ function V(G) {
+ _[G].ligand_symmetry = select_value(this), e(1, _), e(3, u), e(0, p);
}
- const W = () => l("updateCovMod", _), N = (G, k) => {
+ const N = () => l("updateCovMod", _), k = (G, Q) => {
l("removeCovMod", G);
};
return y.$$set = (G) => {
- "vals" in G && e(0, g = G.vals), "covMods" in G && e(1, _ = G.covMods);
+ "vals" in G && e(0, p = G.vals), "covMods" in G && e(1, _ = G.covMods);
}, y.$$.update = () => {
y.$$.dirty[0] & /*covMods, vals*/
- 3 && _ && e(2, x = g.map((G) => _.findIndex((k) => k.ligand === G.chain))), y.$$.dirty[0] & /*vals*/
- 1 && e(3, u = g.filter((G) => G.class === "protein").map((G) => G.chain)), y.$$.dirty[0] & /*vals*/
- 1 && e(4, A = g.filter((G) => G.class === "ligand").map((G) => G.chain));
+ 3 && _ && e(2, x = p.map((G) => _.findIndex((Q) => Q.ligand === G.chain))), y.$$.dirty[0] & /*vals*/
+ 1 && e(3, u = p.filter((G) => G.class === "protein").map((G) => G.chain)), y.$$.dirty[0] & /*vals*/
+ 1 && e(4, A = p.filter((G) => G.class === "ligand").map((G) => G.chain));
}, [
- g,
+ p,
_,
x,
u,
A,
l,
o,
- p,
+ g,
E,
D,
r,
@@ -26487,14 +26576,16 @@ function instance$6(y, s, e) {
S,
T,
R,
- z,
+ $,
P,
B,
- U,
F,
- $,
+ U,
+ z,
W,
- N
+ V,
+ N,
+ k
];
}
class Accordion extends SvelteComponent$6 {
@@ -26523,60 +26614,60 @@ const SequenceInput_svelte_svelte_type_style_lang = "", {
transition_out: transition_out$3
} = window.__gradio__svelte__internal, { tick: tick$2 } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$1, onMount: onMount$3, afterUpdate: afterUpdate$1 } = window.__gradio__svelte__internal;
function create_if_block$3(y) {
- let s, e, l, g;
+ let s, e, l, p;
const _ = [create_if_block_1$2, create_else_block$2], x = [];
- function o(p, E) {
+ function o(g, E) {
return (
/*vals*/
- p[0].length > 0 ? 0 : 1
+ g[0].length > 0 ? 0 : 1
);
}
return s = o(y), e = x[s] = _[s](y), {
c() {
e.c(), l = empty$2();
},
- m(p, E) {
- x[s].m(p, E), insert$5(p, l, E), g = !0;
+ m(g, E) {
+ x[s].m(g, E), insert$5(g, l, E), p = !0;
},
- p(p, E) {
+ p(g, E) {
let u = s;
- s = o(p), s === u ? x[s].p(p, E) : (group_outros$3(), transition_out$3(x[u], 1, 1, () => {
+ s = o(g), s === u ? x[s].p(g, E) : (group_outros$3(), transition_out$3(x[u], 1, 1, () => {
x[u] = null;
- }), check_outros$3(), e = x[s], e ? e.p(p, E) : (e = x[s] = _[s](p), e.c()), transition_in$3(e, 1), e.m(l.parentNode, l));
+ }), check_outros$3(), e = x[s], e ? e.p(g, E) : (e = x[s] = _[s](g), e.c()), transition_in$3(e, 1), e.m(l.parentNode, l));
},
- i(p) {
- g || (transition_in$3(e), g = !0);
+ i(g) {
+ p || (transition_in$3(e), p = !0);
},
- o(p) {
- transition_out$3(e), g = !1;
+ o(g) {
+ transition_out$3(e), p = !1;
},
- d(p) {
- p && detach$5(l), x[s].d(p);
+ d(g) {
+ g && detach$5(l), x[s].d(g);
}
};
}
function create_else_block$2(y) {
- let s, e, l, g, _, x, o, p;
+ let s, e, l, p, _, x, o, g;
return _ = new SearchInput({ props: { database: "rcsb-bioass" } }), _.$on(
"triggerFetch",
/*handleMessage*/
y[2]
), {
c() {
- s = element$4("div"), s.textContent = "Empty input", e = space$3(), l = element$4("div"), l.textContent = "You can import a protein from the PDB", g = space$3(), create_component$3(_.$$.fragment), x = space$3(), o = element$4("div"), o.textContent = "- or create the input from scratch -", attr$4(s, "class", "my-8 text-center text-gray-600 svelte-13zuw1o"), attr$4(l, "class", "text-center text-gray-400 svelte-13zuw1o"), attr$4(o, "class", "text-center text-gray-400 w-full my-2 svelte-13zuw1o");
+ s = element$4("div"), s.textContent = "Empty input", e = space$3(), l = element$4("div"), l.textContent = "You can import a protein from the PDB", p = space$3(), create_component$3(_.$$.fragment), x = space$3(), o = element$4("div"), o.textContent = "- or create the input from scratch -", attr$4(s, "class", "my-8 text-center text-gray-600 svelte-13zuw1o"), attr$4(l, "class", "text-center text-gray-400 svelte-13zuw1o"), attr$4(o, "class", "text-center text-gray-400 w-full my-2 svelte-13zuw1o");
},
m(E, u) {
- insert$5(E, s, u), insert$5(E, e, u), insert$5(E, l, u), insert$5(E, g, u), mount_component$3(_, E, u), insert$5(E, x, u), insert$5(E, o, u), p = !0;
+ insert$5(E, s, u), insert$5(E, e, u), insert$5(E, l, u), insert$5(E, p, u), mount_component$3(_, E, u), insert$5(E, x, u), insert$5(E, o, u), g = !0;
},
p: noop$5,
i(E) {
- p || (transition_in$3(_.$$.fragment, E), p = !0);
+ g || (transition_in$3(_.$$.fragment, E), g = !0);
},
o(E) {
- transition_out$3(_.$$.fragment, E), p = !1;
+ transition_out$3(_.$$.fragment, E), g = !1;
},
d(E) {
- E && (detach$5(s), detach$5(e), detach$5(l), detach$5(g), detach$5(x), detach$5(o)), destroy_component$3(_, E);
+ E && (detach$5(s), detach$5(e), detach$5(l), detach$5(p), detach$5(x), detach$5(o)), destroy_component$3(_, E);
}
};
}
@@ -26613,14 +26704,14 @@ function create_if_block_1$2(y) {
c() {
create_component$3(s.$$.fragment);
},
- m(l, g) {
- mount_component$3(s, l, g), e = !0;
+ m(l, p) {
+ mount_component$3(s, l, p), e = !0;
},
- p(l, g) {
+ p(l, p) {
const _ = {};
- g & /*vals*/
+ p & /*vals*/
1 && (_.vals = /*vals*/
- l[0]), g & /*covMods*/
+ l[0]), p & /*covMods*/
2 && (_.covMods = /*covMods*/
l[1]), s.$set(_);
},
@@ -26636,7 +26727,7 @@ function create_if_block_1$2(y) {
};
}
function create_fragment$5(y) {
- let s, e, l, g = (
+ let s, e, l, p = (
/*vals*/
y[0] != null && create_if_block$3(y)
);
@@ -26653,16 +26744,16 @@ function create_fragment$5(y) {
y[6]
), {
c() {
- g && g.c(), s = space$3(), create_component$3(e.$$.fragment);
+ p && p.c(), s = space$3(), create_component$3(e.$$.fragment);
},
m(_, x) {
- g && g.m(_, x), insert$5(_, s, x), mount_component$3(e, _, x), l = !0;
+ p && p.m(_, x), insert$5(_, s, x), mount_component$3(e, _, x), l = !0;
},
p(_, [x]) {
/*vals*/
- _[0] != null ? g ? (g.p(_, x), x & /*vals*/
- 1 && transition_in$3(g, 1)) : (g = create_if_block$3(_), g.c(), transition_in$3(g, 1), g.m(s.parentNode, s)) : g && (group_outros$3(), transition_out$3(g, 1, 1, () => {
- g = null;
+ _[0] != null ? p ? (p.p(_, x), x & /*vals*/
+ 1 && transition_in$3(p, 1)) : (p = create_if_block$3(_), p.c(), transition_in$3(p, 1), p.m(s.parentNode, s)) : p && (group_outros$3(), transition_out$3(p, 1, 1, () => {
+ p = null;
}), check_outros$3());
const o = {};
x & /*vals*/
@@ -26670,13 +26761,13 @@ function create_fragment$5(y) {
_[0]), e.$set(o);
},
i(_) {
- l || (transition_in$3(g), transition_in$3(e.$$.fragment, _), l = !0);
+ l || (transition_in$3(p), transition_in$3(e.$$.fragment, _), l = !0);
},
o(_) {
- transition_out$3(g), transition_out$3(e.$$.fragment, _), l = !1;
+ transition_out$3(p), transition_out$3(e.$$.fragment, _), l = !1;
},
d(_) {
- _ && detach$5(s), g && g.d(_), destroy_component$3(e, _);
+ _ && detach$5(s), p && p.d(_), destroy_component$3(e, _);
}
};
}
@@ -26767,7 +26858,7 @@ function importBioAssembly(y) {
}
function instance$5(y, s, e) {
let { value: l = { chains: [], covMods: [] } } = s;
- const g = createEventDispatcher$1();
+ const p = createEventDispatcher$1();
let _ = ["ZN", "MG", "CA", "FE", "NA", "K", "CL", "CU", "MN", "CO", "NI"];
async function x(n) {
let b = n.detail.text;
@@ -26800,11 +26891,11 @@ function instance$5(y, s, e) {
});
await tick$2();
}
- })), e(0, o = c), g("updateVals", o);
+ })), e(0, o = c), p("updateVals", o);
}
- let o = [], p = [];
+ let o = [], g = [];
function E(n) {
- n.detail.sequence !== void 0 && e(0, o[n.detail.index].sequence = n.detail.sequence, o), n.detail.name !== void 0 && (e(0, o[n.detail.index].name = n.detail.name, o), e(0, o[n.detail.index].open = n.detail.open, o), e(0, o[n.detail.index].sdf = "", o), e(0, o[n.detail.index].smiles = "", o)), n.detail.smiles !== void 0 && (e(0, o[n.detail.index].smiles = n.detail.smiles, o), e(0, o[n.detail.index].sdf = "", o), e(0, o[n.detail.index].name = "", o)), n.detail.sdf !== void 0 && (n.detail.close == !0 && e(0, o[n.detail.index].open = !1, o), e(0, o[n.detail.index].sdf = n.detail.sdf, o), e(0, o[n.detail.index].name = "", o), e(0, o[n.detail.index].smiles = "", o)), g("updateVals", o);
+ n.detail.sequence !== void 0 && e(0, o[n.detail.index].sequence = n.detail.sequence, o), n.detail.name !== void 0 && (e(0, o[n.detail.index].name = n.detail.name, o), e(0, o[n.detail.index].open = n.detail.open, o), e(0, o[n.detail.index].sdf = "", o), e(0, o[n.detail.index].smiles = "", o)), n.detail.smiles !== void 0 && (e(0, o[n.detail.index].smiles = n.detail.smiles, o), e(0, o[n.detail.index].sdf = "", o), e(0, o[n.detail.index].name = "", o)), n.detail.sdf !== void 0 && (n.detail.close == !0 && e(0, o[n.detail.index].open = !1, o), e(0, o[n.detail.index].sdf = n.detail.sdf, o), e(0, o[n.detail.index].name = "", o), e(0, o[n.detail.index].smiles = "", o)), p("updateVals", o);
}
function u() {
let n = "A";
@@ -26831,10 +26922,10 @@ function instance$5(y, s, e) {
chain: b
}), e(0, o);
}
- function C(n) {
- o.splice(n.detail, 1), e(0, o), g("updateVals", o);
- }
function L(n) {
+ o.splice(n.detail, 1), e(0, o), p("updateVals", o);
+ }
+ function C(n) {
let b = o.find((t) => t.class === "protein").chain;
if (b === void 0) {
alert("Please add a protein chain first");
@@ -26855,26 +26946,26 @@ function instance$5(y, s, e) {
deleteIndexes: [],
ligand_symmetry: "CW"
};
- p.push(c), e(1, p), e(0, o), g("updateCovMod", p);
+ g.push(c), e(1, g), e(0, o), p("updateCovMod", g);
}
function D(n) {
- p.splice(n.detail, 1), e(1, p);
+ g.splice(n.detail, 1), e(1, g);
}
function r(n) {
- e(1, p = n.detail), g("updateCovMod", p);
+ e(1, g = n.detail), p("updateCovMod", g);
}
return onMount$3(async () => {
- e(0, o = l.chains), e(1, p = l.covMods);
+ e(0, o = l.chains), e(1, g = l.covMods);
}), y.$$set = (n) => {
"value" in n && e(9, l = n.value);
}, [
o,
- p,
+ g,
x,
E,
A,
- C,
L,
+ C,
D,
r,
l
@@ -26924,24 +27015,24 @@ function loop(y) {
};
}
function fade(y, { delay: s = 0, duration: e = 400, easing: l = identity } = {}) {
- const g = +getComputedStyle(y).opacity;
+ const p = +getComputedStyle(y).opacity;
return {
delay: s,
duration: e,
easing: l,
- css: (_) => `opacity: ${_ * g}`
+ css: (_) => `opacity: ${_ * p}`
};
}
const subscriber_queue = [];
function writable(y, s = noop$4) {
let e;
const l = /* @__PURE__ */ new Set();
- function g(o) {
+ function p(o) {
if (safe_not_equal$5(y, o) && (y = o, e)) {
- const p = !subscriber_queue.length;
+ const g = !subscriber_queue.length;
for (const E of l)
E[1](), subscriber_queue.push(E, y);
- if (p) {
+ if (g) {
for (let E = 0; E < subscriber_queue.length; E += 2)
subscriber_queue[E][0](subscriber_queue[E + 1]);
subscriber_queue.length = 0;
@@ -26949,47 +27040,47 @@ function writable(y, s = noop$4) {
}
}
function _(o) {
- g(o(y));
+ p(o(y));
}
- function x(o, p = noop$4) {
- const E = [o, p];
- return l.add(E), l.size === 1 && (e = s(g, _) || noop$4), o(y), () => {
+ function x(o, g = noop$4) {
+ const E = [o, g];
+ return l.add(E), l.size === 1 && (e = s(p, _) || noop$4), o(y), () => {
l.delete(E), l.size === 0 && e && (e(), e = null);
};
}
- return { set: g, update: _, subscribe: x };
+ return { set: p, update: _, subscribe: x };
}
function is_date(y) {
return Object.prototype.toString.call(y) === "[object Date]";
}
function tick_spring(y, s, e, l) {
if (typeof e == "number" || is_date(e)) {
- const g = l - e, _ = (e - s) / (y.dt || 1 / 60), x = y.opts.stiffness * g, o = y.opts.damping * _, p = (x - o) * y.inv_mass, E = (_ + p) * y.dt;
- return Math.abs(E) < y.opts.precision && Math.abs(g) < y.opts.precision ? l : (y.settled = !1, is_date(e) ? new Date(e.getTime() + E) : e + E);
+ const p = l - e, _ = (e - s) / (y.dt || 1 / 60), x = y.opts.stiffness * p, o = y.opts.damping * _, g = (x - o) * y.inv_mass, E = (_ + g) * y.dt;
+ return Math.abs(E) < y.opts.precision && Math.abs(p) < y.opts.precision ? l : (y.settled = !1, is_date(e) ? new Date(e.getTime() + E) : e + E);
} else {
if (Array.isArray(e))
return e.map(
- (g, _) => tick_spring(y, s[_], e[_], l[_])
+ (p, _) => tick_spring(y, s[_], e[_], l[_])
);
if (typeof e == "object") {
- const g = {};
+ const p = {};
for (const _ in e)
- g[_] = tick_spring(y, s[_], e[_], l[_]);
- return g;
+ p[_] = tick_spring(y, s[_], e[_], l[_]);
+ return p;
} else
throw new Error(`Cannot spring ${typeof e} values`);
}
}
function spring(y, s = {}) {
- const e = writable(y), { stiffness: l = 0.15, damping: g = 0.8, precision: _ = 0.01 } = s;
- let x, o, p, E = y, u = y, A = 1, C = 0, L = !1;
+ const e = writable(y), { stiffness: l = 0.15, damping: p = 0.8, precision: _ = 0.01 } = s;
+ let x, o, g, E = y, u = y, A = 1, L = 0, C = !1;
function D(n, b = {}) {
u = n;
- const f = p = {};
- return y == null || b.hard || r.stiffness >= 1 && r.damping >= 1 ? (L = !0, x = now(), E = n, e.set(y = u), Promise.resolve()) : (b.soft && (C = 1 / ((b.soft === !0 ? 0.5 : +b.soft) * 60), A = 0), o || (x = now(), L = !1, o = loop((c) => {
- if (L)
- return L = !1, o = null, !1;
- A = Math.min(A + C, 1);
+ const f = g = {};
+ return y == null || b.hard || r.stiffness >= 1 && r.damping >= 1 ? (C = !0, x = now(), E = n, e.set(y = u), Promise.resolve()) : (b.soft && (L = 1 / ((b.soft === !0 ? 0.5 : +b.soft) * 60), A = 0), o || (x = now(), C = !1, o = loop((c) => {
+ if (C)
+ return C = !1, o = null, !1;
+ A = Math.min(A + L, 1);
const t = {
inv_mass: A,
opts: r,
@@ -26999,7 +27090,7 @@ function spring(y, s = {}) {
return x = c, E = y, e.set(y = a), t.settled && (o = null), !t.settled;
})), new Promise((c) => {
o.promise.then(() => {
- f === p && c();
+ f === g && c();
});
}));
}
@@ -27008,7 +27099,7 @@ function spring(y, s = {}) {
update: (n, b) => D(n(u, y), b),
subscribe: e.subscribe,
stiffness: l,
- damping: g,
+ damping: p,
precision: _
};
return r;
@@ -27029,12 +27120,12 @@ const Loader_svelte_svelte_type_style_lang = "", {
toggle_class: toggle_class$3
} = window.__gradio__svelte__internal, { onMount: onMount$2 } = window.__gradio__svelte__internal;
function create_fragment$4(y) {
- let s, e, l, g, _, x, o, p, E, u, A, C;
+ let s, e, l, p, _, x, o, g, E, u, A, L;
return {
c() {
- s = element$3("div"), e = svg_element("svg"), l = svg_element("g"), g = svg_element("path"), _ = svg_element("path"), x = svg_element("path"), o = svg_element("path"), p = svg_element("g"), E = svg_element("path"), u = svg_element("path"), A = svg_element("path"), C = svg_element("path"), attr$3(g, "d", "M255.926 0.754768L509.702 139.936V221.027L255.926 81.8465V0.754768Z"), attr$3(g, "fill", "#FF7C00"), attr$3(g, "fill-opacity", "0.4"), attr$3(g, "class", "svelte-43sxxs"), attr$3(_, "d", "M509.69 139.936L254.981 279.641V361.255L509.69 221.55V139.936Z"), attr$3(_, "fill", "#FF7C00"), attr$3(_, "class", "svelte-43sxxs"), attr$3(x, "d", "M0.250138 139.937L254.981 279.641V361.255L0.250138 221.55V139.937Z"), attr$3(x, "fill", "#FF7C00"), attr$3(x, "fill-opacity", "0.4"), attr$3(x, "class", "svelte-43sxxs"), attr$3(o, "d", "M255.923 0.232622L0.236328 139.936V221.55L255.923 81.8469V0.232622Z"), attr$3(o, "fill", "#FF7C00"), attr$3(o, "class", "svelte-43sxxs"), set_style$1(l, "transform", "translate(" + /*$top*/
+ s = element$3("div"), e = svg_element("svg"), l = svg_element("g"), p = svg_element("path"), _ = svg_element("path"), x = svg_element("path"), o = svg_element("path"), g = svg_element("g"), E = svg_element("path"), u = svg_element("path"), A = svg_element("path"), L = svg_element("path"), attr$3(p, "d", "M255.926 0.754768L509.702 139.936V221.027L255.926 81.8465V0.754768Z"), attr$3(p, "fill", "#FF7C00"), attr$3(p, "fill-opacity", "0.4"), attr$3(p, "class", "svelte-43sxxs"), attr$3(_, "d", "M509.69 139.936L254.981 279.641V361.255L509.69 221.55V139.936Z"), attr$3(_, "fill", "#FF7C00"), attr$3(_, "class", "svelte-43sxxs"), attr$3(x, "d", "M0.250138 139.937L254.981 279.641V361.255L0.250138 221.55V139.937Z"), attr$3(x, "fill", "#FF7C00"), attr$3(x, "fill-opacity", "0.4"), attr$3(x, "class", "svelte-43sxxs"), attr$3(o, "d", "M255.923 0.232622L0.236328 139.936V221.55L255.923 81.8469V0.232622Z"), attr$3(o, "fill", "#FF7C00"), attr$3(o, "class", "svelte-43sxxs"), set_style$1(l, "transform", "translate(" + /*$top*/
y[1][0] + "px, " + /*$top*/
- y[1][1] + "px)"), attr$3(E, "d", "M255.926 141.5L509.702 280.681V361.773L255.926 222.592V141.5Z"), attr$3(E, "fill", "#FF7C00"), attr$3(E, "fill-opacity", "0.4"), attr$3(E, "class", "svelte-43sxxs"), attr$3(u, "d", "M509.69 280.679L254.981 420.384V501.998L509.69 362.293V280.679Z"), attr$3(u, "fill", "#FF7C00"), attr$3(u, "class", "svelte-43sxxs"), attr$3(A, "d", "M0.250138 280.681L254.981 420.386V502L0.250138 362.295V280.681Z"), attr$3(A, "fill", "#FF7C00"), attr$3(A, "fill-opacity", "0.4"), attr$3(A, "class", "svelte-43sxxs"), attr$3(C, "d", "M255.923 140.977L0.236328 280.68V362.294L255.923 222.591V140.977Z"), attr$3(C, "fill", "#FF7C00"), attr$3(C, "class", "svelte-43sxxs"), set_style$1(p, "transform", "translate(" + /*$bottom*/
+ y[1][1] + "px)"), attr$3(E, "d", "M255.926 141.5L509.702 280.681V361.773L255.926 222.592V141.5Z"), attr$3(E, "fill", "#FF7C00"), attr$3(E, "fill-opacity", "0.4"), attr$3(E, "class", "svelte-43sxxs"), attr$3(u, "d", "M509.69 280.679L254.981 420.384V501.998L509.69 362.293V280.679Z"), attr$3(u, "fill", "#FF7C00"), attr$3(u, "class", "svelte-43sxxs"), attr$3(A, "d", "M0.250138 280.681L254.981 420.386V502L0.250138 362.295V280.681Z"), attr$3(A, "fill", "#FF7C00"), attr$3(A, "fill-opacity", "0.4"), attr$3(A, "class", "svelte-43sxxs"), attr$3(L, "d", "M255.923 140.977L0.236328 280.68V362.294L255.923 222.591V140.977Z"), attr$3(L, "fill", "#FF7C00"), attr$3(L, "class", "svelte-43sxxs"), set_style$1(g, "transform", "translate(" + /*$bottom*/
y[2][0] + "px, " + /*$bottom*/
y[2][1] + "px)"), attr$3(e, "viewBox", "-1200 -1200 3000 3000"), attr$3(e, "fill", "none"), attr$3(e, "xmlns", "http://www.w3.org/2000/svg"), attr$3(e, "class", "svelte-43sxxs"), attr$3(s, "class", "svelte-43sxxs"), toggle_class$3(
s,
@@ -27043,50 +27134,50 @@ function create_fragment$4(y) {
y[0]
);
},
- m(L, D) {
- insert$4(L, s, D), append$3(s, e), append$3(e, l), append$3(l, g), append$3(l, _), append$3(l, x), append$3(l, o), append$3(e, p), append$3(p, E), append$3(p, u), append$3(p, A), append$3(p, C);
+ m(C, D) {
+ insert$4(C, s, D), append$3(s, e), append$3(e, l), append$3(l, p), append$3(l, _), append$3(l, x), append$3(l, o), append$3(e, g), append$3(g, E), append$3(g, u), append$3(g, A), append$3(g, L);
},
- p(L, [D]) {
+ p(C, [D]) {
D & /*$top*/
2 && set_style$1(l, "transform", "translate(" + /*$top*/
- L[1][0] + "px, " + /*$top*/
- L[1][1] + "px)"), D & /*$bottom*/
- 4 && set_style$1(p, "transform", "translate(" + /*$bottom*/
- L[2][0] + "px, " + /*$bottom*/
- L[2][1] + "px)"), D & /*margin*/
+ C[1][0] + "px, " + /*$top*/
+ C[1][1] + "px)"), D & /*$bottom*/
+ 4 && set_style$1(g, "transform", "translate(" + /*$bottom*/
+ C[2][0] + "px, " + /*$bottom*/
+ C[2][1] + "px)"), D & /*margin*/
1 && toggle_class$3(
s,
"margin",
/*margin*/
- L[0]
+ C[0]
);
},
i: noop$3,
o: noop$3,
- d(L) {
- L && detach$4(s);
+ d(C) {
+ C && detach$4(s);
}
};
}
function instance$4(y, s, e) {
- let l, g, { margin: _ = !0 } = s;
+ let l, p, { margin: _ = !0 } = s;
const x = spring([0, 0]);
- component_subscribe(y, x, (C) => e(1, l = C));
+ component_subscribe(y, x, (L) => e(1, l = L));
const o = spring([0, 0]);
- component_subscribe(y, o, (C) => e(2, g = C));
- let p;
+ component_subscribe(y, o, (L) => e(2, p = L));
+ let g;
async function E() {
await Promise.all([x.set([125, 140]), o.set([-125, -140])]), await Promise.all([x.set([-125, 140]), o.set([125, -140])]), await Promise.all([x.set([-125, 0]), o.set([125, -0])]), await Promise.all([x.set([125, 0]), o.set([-125, 0])]);
}
async function u() {
- await E(), p || u();
+ await E(), g || u();
}
async function A() {
await Promise.all([x.set([125, 0]), o.set([-125, 0])]), u();
}
- return onMount$2(() => (A(), () => p = !0)), y.$$set = (C) => {
- "margin" in C && e(0, _ = C.margin);
- }, [_, l, g, x, o];
+ return onMount$2(() => (A(), () => g = !0)), y.$$set = (L) => {
+ "margin" in L && e(0, _ = L.margin);
+ }, [_, l, p, x, o];
}
class Loader extends SvelteComponent$4 {
constructor(s) {
@@ -27136,7 +27227,7 @@ function create_if_block_17(y) {
let s, e = (
/*i18n*/
y[1]("common.error") + ""
- ), l, g, _;
+ ), l, p, _;
const x = (
/*#slots*/
y[29].error
@@ -27149,47 +27240,47 @@ function create_if_block_17(y) {
);
return {
c() {
- s = element$2("span"), l = text$3(e), g = space$2(), o && o.c(), attr$2(s, "class", "error svelte-1yserjw");
+ s = element$2("span"), l = text$3(e), p = space$2(), o && o.c(), attr$2(s, "class", "error svelte-1yserjw");
},
- m(p, E) {
- insert$3(p, s, E), append$2(s, l), insert$3(p, g, E), o && o.m(p, E), _ = !0;
+ m(g, E) {
+ insert$3(g, s, E), append$2(s, l), insert$3(g, p, E), o && o.m(g, E), _ = !0;
},
- p(p, E) {
+ p(g, E) {
(!_ || E[0] & /*i18n*/
2) && e !== (e = /*i18n*/
- p[1]("common.error") + "") && set_data$3(l, e), o && o.p && (!_ || E[0] & /*$$scope*/
+ g[1]("common.error") + "") && set_data$3(l, e), o && o.p && (!_ || E[0] & /*$$scope*/
268435456) && update_slot_base(
o,
x,
- p,
+ g,
/*$$scope*/
- p[28],
+ g[28],
_ ? get_slot_changes(
x,
/*$$scope*/
- p[28],
+ g[28],
E,
get_error_slot_changes
) : get_all_dirty_from_scope(
/*$$scope*/
- p[28]
+ g[28]
),
get_error_slot_context
);
},
- i(p) {
- _ || (transition_in$2(o, p), _ = !0);
+ i(g) {
+ _ || (transition_in$2(o, g), _ = !0);
},
- o(p) {
- transition_out$2(o, p), _ = !1;
+ o(g) {
+ transition_out$2(o, g), _ = !1;
},
- d(p) {
- p && (detach$3(s), detach$3(g)), o && o.d(p);
+ d(g) {
+ g && (detach$3(s), detach$3(p)), o && o.d(g);
}
};
}
function create_if_block$2(y) {
- let s, e, l, g, _, x, o, p, E, u = (
+ let s, e, l, p, _, x, o, g, E, u = (
/*variant*/
y[8] === "default" && /*show_eta_bar*/
y[18] && /*show_progress*/
@@ -27214,7 +27305,7 @@ function create_if_block$2(y) {
)
return create_if_block_15;
}
- let C = A(y), L = C && C(y), D = (
+ let L = A(y), C = L && L(y), D = (
/*timer*/
y[5] && create_if_block_10(y)
);
@@ -27233,7 +27324,7 @@ function create_if_block$2(y) {
y[5] && create_if_block_1$1(y);
return {
c() {
- u && u.c(), s = space$2(), e = element$2("div"), L && L.c(), l = space$2(), D && D.c(), g = space$2(), x && x.c(), o = space$2(), f && f.c(), p = empty$1(), attr$2(e, "class", "progress-text svelte-1yserjw"), toggle_class$2(
+ u && u.c(), s = space$2(), e = element$2("div"), C && C.c(), l = space$2(), D && D.c(), p = space$2(), x && x.c(), o = space$2(), f && f.c(), g = empty$1(), attr$2(e, "class", "progress-text svelte-1yserjw"), toggle_class$2(
e,
"meta-text-center",
/*variant*/
@@ -27246,13 +27337,13 @@ function create_if_block$2(y) {
);
},
m(c, t) {
- u && u.m(c, t), insert$3(c, s, t), insert$3(c, e, t), L && L.m(e, null), append$2(e, l), D && D.m(e, null), insert$3(c, g, t), ~_ && n[_].m(c, t), insert$3(c, o, t), f && f.m(c, t), insert$3(c, p, t), E = !0;
+ u && u.m(c, t), insert$3(c, s, t), insert$3(c, e, t), C && C.m(e, null), append$2(e, l), D && D.m(e, null), insert$3(c, p, t), ~_ && n[_].m(c, t), insert$3(c, o, t), f && f.m(c, t), insert$3(c, g, t), E = !0;
},
p(c, t) {
/*variant*/
c[8] === "default" && /*show_eta_bar*/
c[18] && /*show_progress*/
- c[6] === "full" ? u ? u.p(c, t) : (u = create_if_block_16(c), u.c(), u.m(s.parentNode, s)) : u && (u.d(1), u = null), C === (C = A(c)) && L ? L.p(c, t) : (L && L.d(1), L = C && C(c), L && (L.c(), L.m(e, l))), /*timer*/
+ c[6] === "full" ? u ? u.p(c, t) : (u = create_if_block_16(c), u.c(), u.m(s.parentNode, s)) : u && (u.d(1), u = null), L === (L = A(c)) && C ? C.p(c, t) : (C && C.d(1), C = L && L(c), C && (C.c(), C.m(e, l))), /*timer*/
c[5] ? D ? D.p(c, t) : (D = create_if_block_10(c), D.c(), D.m(e, null)) : D && (D.d(1), D = null), (!E || t[0] & /*variant*/
256) && toggle_class$2(
e,
@@ -27270,7 +27361,7 @@ function create_if_block$2(y) {
_ = b(c), _ === a ? ~_ && n[_].p(c, t) : (x && (group_outros$2(), transition_out$2(n[a], 1, 1, () => {
n[a] = null;
}), check_outros$2()), ~_ ? (x = n[_], x ? x.p(c, t) : (x = n[_] = r[_](c), x.c()), transition_in$2(x, 1), x.m(o.parentNode, o)) : x = null), /*timer*/
- c[5] ? f && (f.d(1), f = null) : f ? f.p(c, t) : (f = create_if_block_1$1(c), f.c(), f.m(p.parentNode, p));
+ c[5] ? f && (f.d(1), f = null) : f ? f.p(c, t) : (f = create_if_block_1$1(c), f.c(), f.m(g.parentNode, g));
},
i(c) {
E || (transition_in$2(x), E = !0);
@@ -27279,7 +27370,7 @@ function create_if_block$2(y) {
transition_out$2(x), E = !1;
},
d(c) {
- c && (detach$3(s), detach$3(e), detach$3(g), detach$3(o), detach$3(p)), u && u.d(c), L && L.d(), D && D.d(), ~_ && n[_].d(c), f && f.d(c);
+ c && (detach$3(s), detach$3(e), detach$3(p), detach$3(o), detach$3(g)), u && u.d(c), C && C.d(), D && D.d(), ~_ && n[_].d(c), f && f.d(c);
}
};
}
@@ -27290,11 +27381,11 @@ function create_if_block_16(y) {
c() {
s = element$2("div"), attr$2(s, "class", "eta-bar svelte-1yserjw"), set_style(s, "transform", e);
},
- m(l, g) {
- insert$3(l, s, g);
+ m(l, p) {
+ insert$3(l, s, p);
},
- p(l, g) {
- g[0] & /*eta_level*/
+ p(l, p) {
+ p[0] & /*eta_level*/
131072 && e !== (e = `translateX(${/*eta_level*/
(l[17] || 0) * 100 - 100}%)`) && set_style(s, "transform", e);
},
@@ -27322,21 +27413,21 @@ function create_if_block_14(y) {
let s, e = (
/*queue_position*/
y[2] + 1 + ""
- ), l, g, _, x;
+ ), l, p, _, x;
return {
c() {
- s = text$3("queue: "), l = text$3(e), g = text$3("/"), _ = text$3(
+ s = text$3("queue: "), l = text$3(e), p = text$3("/"), _ = text$3(
/*queue_size*/
y[3]
), x = text$3(" |");
},
- m(o, p) {
- insert$3(o, s, p), insert$3(o, l, p), insert$3(o, g, p), insert$3(o, _, p), insert$3(o, x, p);
+ m(o, g) {
+ insert$3(o, s, g), insert$3(o, l, g), insert$3(o, p, g), insert$3(o, _, g), insert$3(o, x, g);
},
- p(o, p) {
- p[0] & /*queue_position*/
+ p(o, g) {
+ g[0] & /*queue_position*/
4 && e !== (e = /*queue_position*/
- o[2] + 1 + "") && set_data$3(l, e), p[0] & /*queue_size*/
+ o[2] + 1 + "") && set_data$3(l, e), g[0] & /*queue_size*/
8 && set_data$3(
_,
/*queue_size*/
@@ -27344,7 +27435,7 @@ function create_if_block_14(y) {
);
},
d(o) {
- o && (detach$3(s), detach$3(l), detach$3(g), detach$3(_), detach$3(x));
+ o && (detach$3(s), detach$3(l), detach$3(p), detach$3(_), detach$3(x));
}
};
}
@@ -27353,29 +27444,29 @@ function create_if_block_11(y) {
/*progress*/
y[7]
), l = [];
- for (let g = 0; g < e.length; g += 1)
- l[g] = create_each_block_1(get_each_context_1(y, e, g));
+ for (let p = 0; p < e.length; p += 1)
+ l[p] = create_each_block_1(get_each_context_1(y, e, p));
return {
c() {
- for (let g = 0; g < l.length; g += 1)
- l[g].c();
+ for (let p = 0; p < l.length; p += 1)
+ l[p].c();
s = empty$1();
},
- m(g, _) {
+ m(p, _) {
for (let x = 0; x < l.length; x += 1)
- l[x] && l[x].m(g, _);
- insert$3(g, s, _);
+ l[x] && l[x].m(p, _);
+ insert$3(p, s, _);
},
- p(g, _) {
+ p(p, _) {
if (_[0] & /*progress*/
128) {
e = ensure_array_like(
/*progress*/
- g[7]
+ p[7]
);
let x;
for (x = 0; x < e.length; x += 1) {
- const o = get_each_context_1(g, e, x);
+ const o = get_each_context_1(p, e, x);
l[x] ? l[x].p(o, _) : (l[x] = create_each_block_1(o), l[x].c(), l[x].m(s.parentNode, s));
}
for (; x < l.length; x += 1)
@@ -27383,8 +27474,8 @@ function create_if_block_11(y) {
l.length = e.length;
}
},
- d(g) {
- g && detach$3(s), destroy_each(l, g);
+ d(p) {
+ p && detach$3(s), destroy_each(l, p);
}
};
}
@@ -27392,28 +27483,28 @@ function create_if_block_12(y) {
let s, e = (
/*p*/
y[38].unit + ""
- ), l, g, _ = " ", x;
+ ), l, p, _ = " ", x;
function o(u, A) {
return (
/*p*/
u[38].length != null ? create_if_block_13 : create_else_block$1
);
}
- let p = o(y), E = p(y);
+ let g = o(y), E = g(y);
return {
c() {
- E.c(), s = space$2(), l = text$3(e), g = text$3(" | "), x = text$3(_);
+ E.c(), s = space$2(), l = text$3(e), p = text$3(" | "), x = text$3(_);
},
m(u, A) {
- E.m(u, A), insert$3(u, s, A), insert$3(u, l, A), insert$3(u, g, A), insert$3(u, x, A);
+ E.m(u, A), insert$3(u, s, A), insert$3(u, l, A), insert$3(u, p, A), insert$3(u, x, A);
},
p(u, A) {
- p === (p = o(u)) && E ? E.p(u, A) : (E.d(1), E = p(u), E && (E.c(), E.m(s.parentNode, s))), A[0] & /*progress*/
+ g === (g = o(u)) && E ? E.p(u, A) : (E.d(1), E = g(u), E && (E.c(), E.m(s.parentNode, s))), A[0] & /*progress*/
128 && e !== (e = /*p*/
u[38].unit + "") && set_data$3(l, e);
},
d(u) {
- u && (detach$3(s), detach$3(l), detach$3(g), detach$3(x)), E.d(u);
+ u && (detach$3(s), detach$3(l), detach$3(p), detach$3(x)), E.d(u);
}
};
}
@@ -27426,11 +27517,11 @@ function create_else_block$1(y) {
c() {
e = text$3(s);
},
- m(l, g) {
- insert$3(l, e, g);
+ m(l, p) {
+ insert$3(l, e, p);
},
- p(l, g) {
- g[0] & /*progress*/
+ p(l, p) {
+ p[0] & /*progress*/
128 && s !== (s = pretty_si(
/*p*/
l[38].index || 0
@@ -27445,13 +27536,13 @@ function create_if_block_13(y) {
let s = pretty_si(
/*p*/
y[38].index || 0
- ) + "", e, l, g = pretty_si(
+ ) + "", e, l, p = pretty_si(
/*p*/
y[38].length
) + "", _;
return {
c() {
- e = text$3(s), l = text$3("/"), _ = text$3(g);
+ e = text$3(s), l = text$3("/"), _ = text$3(p);
},
m(x, o) {
insert$3(x, e, o), insert$3(x, l, o), insert$3(x, _, o);
@@ -27462,10 +27553,10 @@ function create_if_block_13(y) {
/*p*/
x[38].index || 0
) + "") && set_data$3(e, s), o[0] & /*progress*/
- 128 && g !== (g = pretty_si(
+ 128 && p !== (p = pretty_si(
/*p*/
x[38].length
- ) + "") && set_data$3(_, g);
+ ) + "") && set_data$3(_, p);
},
d(x) {
x && (detach$3(e), detach$3(l), detach$3(_));
@@ -27481,12 +27572,12 @@ function create_each_block_1(y) {
c() {
e && e.c(), s = empty$1();
},
- m(l, g) {
- e && e.m(l, g), insert$3(l, s, g);
+ m(l, p) {
+ e && e.m(l, p), insert$3(l, s, p);
},
- p(l, g) {
+ p(l, p) {
/*p*/
- l[38].index != null ? e ? e.p(l, g) : (e = create_if_block_12(l), e.c(), e.m(s.parentNode, s)) : e && (e.d(1), e = null);
+ l[38].index != null ? e ? e.p(l, p) : (e = create_if_block_12(l), e.c(), e.m(s.parentNode, s)) : e && (e.d(1), e = null);
},
d(l) {
l && detach$3(s), e && e.d(l);
@@ -27498,16 +27589,16 @@ function create_if_block_10(y) {
/*eta*/
y[0] ? `/${/*formatted_eta*/
y[19]}` : ""
- ), l, g;
+ ), l, p;
return {
c() {
s = text$3(
/*formatted_timer*/
y[20]
- ), l = text$3(e), g = text$3("s");
+ ), l = text$3(e), p = text$3("s");
},
m(_, x) {
- insert$3(_, s, x), insert$3(_, l, x), insert$3(_, g, x);
+ insert$3(_, s, x), insert$3(_, l, x), insert$3(_, p, x);
},
p(_, x) {
x[0] & /*formatted_timer*/
@@ -27521,7 +27612,7 @@ function create_if_block_10(y) {
_[19]}` : "") && set_data$3(l, e);
},
d(_) {
- _ && (detach$3(s), detach$3(l), detach$3(g));
+ _ && (detach$3(s), detach$3(l), detach$3(p));
}
};
}
@@ -27536,12 +27627,12 @@ function create_if_block_9(y) {
c() {
create_component$2(s.$$.fragment);
},
- m(l, g) {
- mount_component$2(s, l, g), e = !0;
+ m(l, p) {
+ mount_component$2(s, l, p), e = !0;
},
- p(l, g) {
+ p(l, p) {
const _ = {};
- g[0] & /*variant*/
+ p[0] & /*variant*/
256 && (_.margin = /*variant*/
l[8] === "default"), s.$set(_);
},
@@ -27557,28 +27648,28 @@ function create_if_block_9(y) {
};
}
function create_if_block_2$1(y) {
- let s, e, l, g, _, x = `${/*last_progress_level*/
+ let s, e, l, p, _, x = `${/*last_progress_level*/
y[15] * 100}%`, o = (
/*progress*/
y[7] != null && create_if_block_3$1(y)
);
return {
c() {
- s = element$2("div"), e = element$2("div"), o && o.c(), l = space$2(), g = element$2("div"), _ = element$2("div"), attr$2(e, "class", "progress-level-inner svelte-1yserjw"), attr$2(_, "class", "progress-bar svelte-1yserjw"), set_style(_, "width", x), attr$2(g, "class", "progress-bar-wrap svelte-1yserjw"), attr$2(s, "class", "progress-level svelte-1yserjw");
+ s = element$2("div"), e = element$2("div"), o && o.c(), l = space$2(), p = element$2("div"), _ = element$2("div"), attr$2(e, "class", "progress-level-inner svelte-1yserjw"), attr$2(_, "class", "progress-bar svelte-1yserjw"), set_style(_, "width", x), attr$2(p, "class", "progress-bar-wrap svelte-1yserjw"), attr$2(s, "class", "progress-level svelte-1yserjw");
},
- m(p, E) {
- insert$3(p, s, E), append$2(s, e), o && o.m(e, null), append$2(s, l), append$2(s, g), append$2(g, _), y[30](_);
+ m(g, E) {
+ insert$3(g, s, E), append$2(s, e), o && o.m(e, null), append$2(s, l), append$2(s, p), append$2(p, _), y[30](_);
},
- p(p, E) {
+ p(g, E) {
/*progress*/
- p[7] != null ? o ? o.p(p, E) : (o = create_if_block_3$1(p), o.c(), o.m(e, null)) : o && (o.d(1), o = null), E[0] & /*last_progress_level*/
+ g[7] != null ? o ? o.p(g, E) : (o = create_if_block_3$1(g), o.c(), o.m(e, null)) : o && (o.d(1), o = null), E[0] & /*last_progress_level*/
32768 && x !== (x = `${/*last_progress_level*/
- p[15] * 100}%`) && set_style(_, "width", x);
+ g[15] * 100}%`) && set_style(_, "width", x);
},
i: noop$2,
o: noop$2,
- d(p) {
- p && detach$3(s), o && o.d(), y[30](null);
+ d(g) {
+ g && detach$3(s), o && o.d(), y[30](null);
}
};
}
@@ -27587,29 +27678,29 @@ function create_if_block_3$1(y) {
/*progress*/
y[7]
), l = [];
- for (let g = 0; g < e.length; g += 1)
- l[g] = create_each_block(get_each_context(y, e, g));
+ for (let p = 0; p < e.length; p += 1)
+ l[p] = create_each_block(get_each_context(y, e, p));
return {
c() {
- for (let g = 0; g < l.length; g += 1)
- l[g].c();
+ for (let p = 0; p < l.length; p += 1)
+ l[p].c();
s = empty$1();
},
- m(g, _) {
+ m(p, _) {
for (let x = 0; x < l.length; x += 1)
- l[x] && l[x].m(g, _);
- insert$3(g, s, _);
+ l[x] && l[x].m(p, _);
+ insert$3(p, s, _);
},
- p(g, _) {
+ p(p, _) {
if (_[0] & /*progress_level, progress*/
16512) {
e = ensure_array_like(
/*progress*/
- g[7]
+ p[7]
);
let x;
for (x = 0; x < e.length; x += 1) {
- const o = get_each_context(g, e, x);
+ const o = get_each_context(p, e, x);
l[x] ? l[x].p(o, _) : (l[x] = create_each_block(o), l[x].c(), l[x].m(s.parentNode, s));
}
for (; x < l.length; x += 1)
@@ -27617,13 +27708,13 @@ function create_if_block_3$1(y) {
l.length = e.length;
}
},
- d(g) {
- g && detach$3(s), destroy_each(l, g);
+ d(p) {
+ p && detach$3(s), destroy_each(l, p);
}
};
}
function create_if_block_4$1(y) {
- let s, e, l, g, _ = (
+ let s, e, l, p, _ = (
/*i*/
y[40] !== 0 && create_if_block_8()
), x = (
@@ -27637,16 +27728,16 @@ function create_if_block_4$1(y) {
/*i*/
y[40]
] != null && create_if_block_6()
- ), p = (
+ ), g = (
/*progress_level*/
y[14] != null && create_if_block_5$1(y)
);
return {
c() {
- _ && _.c(), s = space$2(), x && x.c(), e = space$2(), o && o.c(), l = space$2(), p && p.c(), g = empty$1();
+ _ && _.c(), s = space$2(), x && x.c(), e = space$2(), o && o.c(), l = space$2(), g && g.c(), p = empty$1();
},
m(E, u) {
- _ && _.m(E, u), insert$3(E, s, u), x && x.m(E, u), insert$3(E, e, u), o && o.m(E, u), insert$3(E, l, u), p && p.m(E, u), insert$3(E, g, u);
+ _ && _.m(E, u), insert$3(E, s, u), x && x.m(E, u), insert$3(E, e, u), o && o.m(E, u), insert$3(E, l, u), g && g.m(E, u), insert$3(E, p, u);
},
p(E, u) {
/*p*/
@@ -27657,10 +27748,10 @@ function create_if_block_4$1(y) {
/*i*/
E[40]
] != null ? o || (o = create_if_block_6(), o.c(), o.m(l.parentNode, l)) : o && (o.d(1), o = null), /*progress_level*/
- E[14] != null ? p ? p.p(E, u) : (p = create_if_block_5$1(E), p.c(), p.m(g.parentNode, g)) : p && (p.d(1), p = null);
+ E[14] != null ? g ? g.p(E, u) : (g = create_if_block_5$1(E), g.c(), g.m(p.parentNode, p)) : g && (g.d(1), g = null);
},
d(E) {
- E && (detach$3(s), detach$3(e), detach$3(l), detach$3(g)), _ && _.d(E), x && x.d(E), o && o.d(E), p && p.d(E);
+ E && (detach$3(s), detach$3(e), detach$3(l), detach$3(p)), _ && _.d(E), x && x.d(E), o && o.d(E), g && g.d(E);
}
};
}
@@ -27687,11 +27778,11 @@ function create_if_block_7(y) {
c() {
e = text$3(s);
},
- m(l, g) {
- insert$3(l, e, g);
+ m(l, p) {
+ insert$3(l, e, p);
},
- p(l, g) {
- g[0] & /*progress*/
+ p(l, p) {
+ p[0] & /*progress*/
128 && s !== (s = /*p*/
l[38].desc + "") && set_data$3(e, s);
},
@@ -27724,19 +27815,19 @@ function create_if_block_5$1(y) {
c() {
e = text$3(s), l = text$3("%");
},
- m(g, _) {
- insert$3(g, e, _), insert$3(g, l, _);
+ m(p, _) {
+ insert$3(p, e, _), insert$3(p, l, _);
},
- p(g, _) {
+ p(p, _) {
_[0] & /*progress_level*/
16384 && s !== (s = (100 * /*progress_level*/
- (g[14][
+ (p[14][
/*i*/
- g[40]
+ p[40]
] || 0)).toFixed(1) + "") && set_data$3(e, s);
},
- d(g) {
- g && (detach$3(e), detach$3(l));
+ d(p) {
+ p && (detach$3(e), detach$3(l));
}
};
}
@@ -27754,17 +27845,17 @@ function create_each_block(y) {
c() {
e && e.c(), s = empty$1();
},
- m(l, g) {
- e && e.m(l, g), insert$3(l, s, g);
+ m(l, p) {
+ e && e.m(l, p), insert$3(l, s, p);
},
- p(l, g) {
+ p(l, p) {
/*p*/
l[38].desc != null || /*progress_level*/
l[14] && /*progress_level*/
l[14][
/*i*/
l[40]
- ] != null ? e ? e.p(l, g) : (e = create_if_block_4$1(l), e.c(), e.m(s.parentNode, s)) : e && (e.d(1), e = null);
+ ] != null ? e ? e.p(l, p) : (e = create_if_block_4$1(l), e.c(), e.m(s.parentNode, s)) : e && (e.d(1), e = null);
},
d(l) {
l && detach$3(s), e && e.d(l);
@@ -27780,11 +27871,11 @@ function create_if_block_1$1(y) {
y[9]
), attr$2(s, "class", "loading svelte-1yserjw");
},
- m(l, g) {
- insert$3(l, s, g), append$2(s, e);
+ m(l, p) {
+ insert$3(l, s, p), append$2(s, e);
},
- p(l, g) {
- g[0] & /*loading_text*/
+ p(l, p) {
+ p[0] & /*loading_text*/
512 && set_data$3(
e,
/*loading_text*/
@@ -27797,9 +27888,9 @@ function create_if_block_1$1(y) {
};
}
function create_fragment$3(y) {
- let s, e, l, g, _;
+ let s, e, l, p, _;
const x = [create_if_block$2, create_if_block_17], o = [];
- function p(E, u) {
+ function g(E, u) {
return (
/*status*/
E[4] === "pending" ? 0 : (
@@ -27808,9 +27899,9 @@ function create_fragment$3(y) {
)
);
}
- return ~(e = p(y)) && (l = o[e] = x[e](y)), {
+ return ~(e = g(y)) && (l = o[e] = x[e](y)), {
c() {
- s = element$2("div"), l && l.c(), attr$2(s, "class", g = "wrap " + /*variant*/
+ s = element$2("div"), l && l.c(), attr$2(s, "class", p = "wrap " + /*variant*/
y[8] + " " + /*show_progress*/
y[6] + " svelte-1yserjw"), toggle_class$2(s, "hide", !/*status*/
y[4] || /*status*/
@@ -27851,12 +27942,12 @@ function create_fragment$3(y) {
},
p(E, u) {
let A = e;
- e = p(E), e === A ? ~e && o[e].p(E, u) : (l && (group_outros$2(), transition_out$2(o[A], 1, 1, () => {
+ e = g(E), e === A ? ~e && o[e].p(E, u) : (l && (group_outros$2(), transition_out$2(o[A], 1, 1, () => {
o[A] = null;
}), check_outros$2()), ~e ? (l = o[e], l ? l.p(E, u) : (l = o[e] = x[e](E), l.c()), transition_in$2(l, 1), l.m(s, null)) : l = null), (!_ || u[0] & /*variant, show_progress*/
- 320 && g !== (g = "wrap " + /*variant*/
+ 320 && p !== (p = "wrap " + /*variant*/
E[8] + " " + /*show_progress*/
- E[6] + " svelte-1yserjw")) && attr$2(s, "class", g), (!_ || u[0] & /*variant, show_progress, status, show_progress*/
+ E[6] + " svelte-1yserjw")) && attr$2(s, "class", p), (!_ || u[0] & /*variant, show_progress, status, show_progress*/
336) && toggle_class$2(s, "hide", !/*status*/
E[4] || /*status*/
E[4] === "complete" || /*show_progress*/
@@ -27925,57 +28016,57 @@ async function scroll_into_view(y, s = !0) {
}
}
function instance$3(y, s, e) {
- let l, { $$slots: g = {}, $$scope: _ } = s, { i18n: x } = s, { eta: o = null } = s, { queue_position: p } = s, { queue_size: E } = s, { status: u } = s, { scroll_to_output: A = !1 } = s, { timer: C = !0 } = s, { show_progress: L = "full" } = s, { message: D = null } = s, { progress: r = null } = s, { variant: n = "default" } = s, { loading_text: b = "Loading..." } = s, { absolute: f = !0 } = s, { translucent: c = !1 } = s, { border: t = !1 } = s, { autoscroll: a } = s, h, M = !1, w = 0, S = 0, T = null, R = null, z = 0, P = null, B, U = null, F = !0;
- const $ = () => {
- e(0, o = e(26, T = e(19, G = null))), e(24, w = performance.now()), e(25, S = 0), M = !0, W();
+ let l, { $$slots: p = {}, $$scope: _ } = s, { i18n: x } = s, { eta: o = null } = s, { queue_position: g } = s, { queue_size: E } = s, { status: u } = s, { scroll_to_output: A = !1 } = s, { timer: L = !0 } = s, { show_progress: C = "full" } = s, { message: D = null } = s, { progress: r = null } = s, { variant: n = "default" } = s, { loading_text: b = "Loading..." } = s, { absolute: f = !0 } = s, { translucent: c = !1 } = s, { border: t = !1 } = s, { autoscroll: a } = s, h, M = !1, w = 0, S = 0, T = null, R = null, $ = 0, P = null, B, F = null, U = !0;
+ const z = () => {
+ e(0, o = e(26, T = e(19, N = null))), e(24, w = performance.now()), e(25, S = 0), M = !0, W();
};
function W() {
requestAnimationFrame(() => {
e(25, S = (performance.now() - w) / 1e3), M && W();
});
}
- function N() {
- e(25, S = 0), e(0, o = e(26, T = e(19, G = null))), M && (M = !1);
+ function V() {
+ e(25, S = 0), e(0, o = e(26, T = e(19, N = null))), M && (M = !1);
}
onDestroy(() => {
- M && N();
+ M && V();
});
- let G = null;
+ let N = null;
function k(Q) {
binding_callbacks$3[Q ? "unshift" : "push"](() => {
- U = Q, e(16, U), e(7, r), e(14, P), e(15, B);
+ F = Q, e(16, F), e(7, r), e(14, P), e(15, B);
});
}
- function j(Q) {
+ function G(Q) {
binding_callbacks$3[Q ? "unshift" : "push"](() => {
h = Q, e(13, h);
});
}
return y.$$set = (Q) => {
- "i18n" in Q && e(1, x = Q.i18n), "eta" in Q && e(0, o = Q.eta), "queue_position" in Q && e(2, p = Q.queue_position), "queue_size" in Q && e(3, E = Q.queue_size), "status" in Q && e(4, u = Q.status), "scroll_to_output" in Q && e(21, A = Q.scroll_to_output), "timer" in Q && e(5, C = Q.timer), "show_progress" in Q && e(6, L = Q.show_progress), "message" in Q && e(22, D = Q.message), "progress" in Q && e(7, r = Q.progress), "variant" in Q && e(8, n = Q.variant), "loading_text" in Q && e(9, b = Q.loading_text), "absolute" in Q && e(10, f = Q.absolute), "translucent" in Q && e(11, c = Q.translucent), "border" in Q && e(12, t = Q.border), "autoscroll" in Q && e(23, a = Q.autoscroll), "$$scope" in Q && e(28, _ = Q.$$scope);
+ "i18n" in Q && e(1, x = Q.i18n), "eta" in Q && e(0, o = Q.eta), "queue_position" in Q && e(2, g = Q.queue_position), "queue_size" in Q && e(3, E = Q.queue_size), "status" in Q && e(4, u = Q.status), "scroll_to_output" in Q && e(21, A = Q.scroll_to_output), "timer" in Q && e(5, L = Q.timer), "show_progress" in Q && e(6, C = Q.show_progress), "message" in Q && e(22, D = Q.message), "progress" in Q && e(7, r = Q.progress), "variant" in Q && e(8, n = Q.variant), "loading_text" in Q && e(9, b = Q.loading_text), "absolute" in Q && e(10, f = Q.absolute), "translucent" in Q && e(11, c = Q.translucent), "border" in Q && e(12, t = Q.border), "autoscroll" in Q && e(23, a = Q.autoscroll), "$$scope" in Q && e(28, _ = Q.$$scope);
}, y.$$.update = () => {
y.$$.dirty[0] & /*eta, old_eta, timer_start, eta_from_start*/
- 218103809 && (o === null && e(0, o = T), o != null && T !== o && (e(27, R = (performance.now() - w) / 1e3 + o), e(19, G = R.toFixed(1)), e(26, T = o))), y.$$.dirty[0] & /*eta_from_start, timer_diff*/
- 167772160 && e(17, z = R === null || R <= 0 || !S ? null : Math.min(S / R, 1)), y.$$.dirty[0] & /*progress*/
- 128 && r != null && e(18, F = !1), y.$$.dirty[0] & /*progress, progress_level, progress_bar, last_progress_level*/
+ 218103809 && (o === null && e(0, o = T), o != null && T !== o && (e(27, R = (performance.now() - w) / 1e3 + o), e(19, N = R.toFixed(1)), e(26, T = o))), y.$$.dirty[0] & /*eta_from_start, timer_diff*/
+ 167772160 && e(17, $ = R === null || R <= 0 || !S ? null : Math.min(S / R, 1)), y.$$.dirty[0] & /*progress*/
+ 128 && r != null && e(18, U = !1), y.$$.dirty[0] & /*progress, progress_level, progress_bar, last_progress_level*/
114816 && (r != null ? e(14, P = r.map((Q) => {
if (Q.index != null && Q.length != null)
return Q.index / Q.length;
if (Q.progress != null)
return Q.progress;
- })) : e(14, P = null), P ? (e(15, B = P[P.length - 1]), U && (B === 0 ? e(16, U.style.transition = "0", U) : e(16, U.style.transition = "150ms", U))) : e(15, B = void 0)), y.$$.dirty[0] & /*status*/
- 16 && (u === "pending" ? $() : N()), y.$$.dirty[0] & /*el, scroll_to_output, status, autoscroll*/
+ })) : e(14, P = null), P ? (e(15, B = P[P.length - 1]), F && (B === 0 ? e(16, F.style.transition = "0", F) : e(16, F.style.transition = "150ms", F))) : e(15, B = void 0)), y.$$.dirty[0] & /*status*/
+ 16 && (u === "pending" ? z() : V()), y.$$.dirty[0] & /*el, scroll_to_output, status, autoscroll*/
10493968 && h && A && (u === "pending" || u === "complete") && scroll_into_view(h, a), y.$$.dirty[0] & /*status, message*/
4194320, y.$$.dirty[0] & /*timer_diff*/
33554432 && e(20, l = S.toFixed(1));
}, [
o,
x,
- p,
+ g,
E,
u,
- C,
L,
+ C,
r,
n,
b,
@@ -27985,10 +28076,10 @@ function instance$3(y, s, e) {
h,
P,
B,
- U,
- z,
F,
- G,
+ $,
+ U,
+ N,
l,
A,
D,
@@ -27998,9 +28089,9 @@ function instance$3(y, s, e) {
T,
R,
_,
- g,
+ p,
k,
- j
+ G
];
}
class Static extends SvelteComponent$3 {
@@ -28058,7 +28149,7 @@ function create_fragment$2(y) {
/*value*/
y[0]
) : "") + ""
- ), l, g;
+ ), l, p;
return {
c() {
s = element$1("div"), l = text$2(e), attr$1(s, "class", "svelte-84cxb8"), add_render_callback$1(() => (
@@ -28082,7 +28173,7 @@ function create_fragment$2(y) {
);
},
m(_, x) {
- insert$2(_, s, x), append$1(s, l), g = add_iframe_resize_listener(
+ insert$2(_, s, x), append$1(s, l), p = add_iframe_resize_listener(
s,
/*div_elementresize_handler*/
y[5].bind(s)
@@ -28117,17 +28208,17 @@ function create_fragment$2(y) {
i: noop$1,
o: noop$1,
d(_) {
- _ && detach$2(s), g(), y[6](null);
+ _ && detach$2(s), p(), y[6](null);
}
};
}
function instance$2(y, s, e) {
- let { value: l } = s, { type: g } = s, { selected: _ = !1 } = s, x, o;
- function p(A, C) {
- !A || !C || (o.style.setProperty("--local-text-width", `${C < 150 ? C : 200}px`), e(4, o.style.whiteSpace = "unset", o));
+ let { value: l } = s, { type: p } = s, { selected: _ = !1 } = s, x, o;
+ function g(A, L) {
+ !A || !L || (o.style.setProperty("--local-text-width", `${L < 150 ? L : 200}px`), e(4, o.style.whiteSpace = "unset", o));
}
onMount$1(() => {
- p(o, x);
+ g(o, x);
});
function E() {
x = this.clientWidth, e(3, x);
@@ -28138,8 +28229,8 @@ function instance$2(y, s, e) {
});
}
return y.$$set = (A) => {
- "value" in A && e(0, l = A.value), "type" in A && e(1, g = A.type), "selected" in A && e(2, _ = A.selected);
- }, [l, g, _, x, o, E, u];
+ "value" in A && e(0, l = A.value), "type" in A && e(1, p = A.type), "selected" in A && e(2, _ = A.selected);
+ }, [l, p, _, x, o, E, u];
}
class Example extends SvelteComponent$2 {
constructor(s) {
@@ -28204,7 +28295,7 @@ function create_default_slot$1(y) {
};
}
function create_else_block(y) {
- let s, e, l, g, _, x, o, p, E = (
+ let s, e, l, p, _, x, o, g, E = (
/*show_label*/
y[6] && /*show_copy_button*/
y[10] && create_if_block_4(y)
@@ -28224,7 +28315,7 @@ function create_else_block(y) {
y[1]
), e.disabled = /*disabled*/
y[5], e.autofocus = /*autofocus*/
- y[12], attr(e, "style", g = /*text_align*/
+ y[12], attr(e, "style", p = /*text_align*/
y[13] ? "text-align: " + /*text_align*/
y[13] : "");
},
@@ -28234,7 +28325,7 @@ function create_else_block(y) {
/*value*/
y[0]
), y[38](e), x = !0, /*autofocus*/
- y[12] && e.focus(), o || (p = [
+ y[12] && e.focus(), o || (g = [
action_destroyer(_ = /*text_area_resize*/
y[20].call(
null,
@@ -28305,9 +28396,9 @@ function create_else_block(y) {
u[5]), (!x || A[0] & /*autofocus*/
4096) && (e.autofocus = /*autofocus*/
u[12]), (!x || A[0] & /*text_align*/
- 8192 && g !== (g = /*text_align*/
+ 8192 && p !== (p = /*text_align*/
u[13] ? "text-align: " + /*text_align*/
- u[13] : "")) && attr(e, "style", g), _ && is_function(_.update) && A[0] & /*value*/
+ u[13] : "")) && attr(e, "style", p), _ && is_function(_.update) && A[0] & /*value*/
1 && _.update.call(
null,
/*value*/
@@ -28326,7 +28417,7 @@ function create_else_block(y) {
transition_out$1(E), x = !1;
},
d(u) {
- u && (detach$1(s), detach$1(e)), E && E.d(u), y[38](null), o = !1, run_all(p);
+ u && (detach$1(s), detach$1(e)), E && E.d(u), y[38](null), o = !1, run_all(g);
}
};
}
@@ -28349,70 +28440,70 @@ function create_if_block$1(y) {
)
return create_if_block_3;
}
- let l = e(y), g = l && l(y);
+ let l = e(y), p = l && l(y);
return {
c() {
- g && g.c(), s = empty();
+ p && p.c(), s = empty();
},
m(_, x) {
- g && g.m(_, x), insert$1(_, s, x);
+ p && p.m(_, x), insert$1(_, s, x);
},
p(_, x) {
- l === (l = e(_)) && g ? g.p(_, x) : (g && g.d(1), g = l && l(_), g && (g.c(), g.m(s.parentNode, s)));
+ l === (l = e(_)) && p ? p.p(_, x) : (p && p.d(1), p = l && l(_), p && (p.c(), p.m(s.parentNode, s)));
},
i: noop,
o: noop,
d(_) {
- _ && detach$1(s), g && g.d(_);
+ _ && detach$1(s), p && p.d(_);
}
};
}
function create_if_block_4(y) {
- let s, e, l, g;
+ let s, e, l, p;
const _ = [create_if_block_5, create_else_block_1], x = [];
- function o(p, E) {
+ function o(g, E) {
return (
/*copied*/
- p[15] ? 0 : 1
+ g[15] ? 0 : 1
);
}
return s = o(y), e = x[s] = _[s](y), {
c() {
e.c(), l = empty();
},
- m(p, E) {
- x[s].m(p, E), insert$1(p, l, E), g = !0;
+ m(g, E) {
+ x[s].m(g, E), insert$1(g, l, E), p = !0;
},
- p(p, E) {
+ p(g, E) {
let u = s;
- s = o(p), s === u ? x[s].p(p, E) : (group_outros$1(), transition_out$1(x[u], 1, 1, () => {
+ s = o(g), s === u ? x[s].p(g, E) : (group_outros$1(), transition_out$1(x[u], 1, 1, () => {
x[u] = null;
- }), check_outros$1(), e = x[s], e ? e.p(p, E) : (e = x[s] = _[s](p), e.c()), transition_in$1(e, 1), e.m(l.parentNode, l));
+ }), check_outros$1(), e = x[s], e ? e.p(g, E) : (e = x[s] = _[s](g), e.c()), transition_in$1(e, 1), e.m(l.parentNode, l));
},
- i(p) {
- g || (transition_in$1(e), g = !0);
+ i(g) {
+ p || (transition_in$1(e), p = !0);
},
- o(p) {
- transition_out$1(e), g = !1;
+ o(g) {
+ transition_out$1(e), p = !1;
},
- d(p) {
- p && detach$1(l), x[s].d(p);
+ d(g) {
+ g && detach$1(l), x[s].d(g);
}
};
}
function create_else_block_1(y) {
- let s, e, l, g, _;
+ let s, e, l, p, _;
return e = new Copy({}), {
c() {
s = element("button"), create_component$1(e.$$.fragment), attr(s, "aria-label", "Copy"), attr(s, "aria-roledescription", "Copy text"), attr(s, "class", "svelte-18tqgac");
},
m(x, o) {
- insert$1(x, s, o), mount_component$1(e, s, null), l = !0, g || (_ = listen(
+ insert$1(x, s, o), mount_component$1(e, s, null), l = !0, p || (_ = listen(
s,
"click",
/*handle_copy*/
y[16]
- ), g = !0);
+ ), p = !0);
},
p: noop,
i(x) {
@@ -28422,27 +28513,27 @@ function create_else_block_1(y) {
transition_out$1(e.$$.fragment, x), l = !1;
},
d(x) {
- x && detach$1(s), destroy_component$1(e), g = !1, _();
+ x && detach$1(s), destroy_component$1(e), p = !1, _();
}
};
}
function create_if_block_5(y) {
- let s, e, l, g;
+ let s, e, l, p;
return e = new Check({}), {
c() {
s = element("button"), create_component$1(e.$$.fragment), attr(s, "aria-label", "Copied"), attr(s, "aria-roledescription", "Text copied"), attr(s, "class", "svelte-18tqgac");
},
m(_, x) {
- insert$1(_, s, x), mount_component$1(e, s, null), g = !0;
+ insert$1(_, s, x), mount_component$1(e, s, null), p = !0;
},
p: noop,
i(_) {
- g || (transition_in$1(e.$$.fragment, _), _ && (l || add_render_callback(() => {
+ p || (transition_in$1(e.$$.fragment, _), _ && (l || add_render_callback(() => {
l = create_in_transition(s, fade, { duration: 300 }), l.start();
- })), g = !0);
+ })), p = !0);
},
o(_) {
- transition_out$1(e.$$.fragment, _), g = !1;
+ transition_out$1(e.$$.fragment, _), p = !1;
},
d(_) {
_ && detach$1(s), destroy_component$1(e);
@@ -28462,8 +28553,8 @@ function create_if_block_3(y) {
y[5], s.autofocus = /*autofocus*/
y[12], attr(s, "autocomplete", "email");
},
- m(g, _) {
- insert$1(g, s, _), set_input_value(
+ m(p, _) {
+ insert$1(p, s, _), set_input_value(
s,
/*value*/
y[0]
@@ -28501,27 +28592,27 @@ function create_if_block_3(y) {
)
], e = !0);
},
- p(g, _) {
+ p(p, _) {
_[0] & /*placeholder*/
4 && attr(
s,
"placeholder",
/*placeholder*/
- g[2]
+ p[2]
), _[0] & /*disabled*/
32 && (s.disabled = /*disabled*/
- g[5]), _[0] & /*autofocus*/
+ p[5]), _[0] & /*autofocus*/
4096 && (s.autofocus = /*autofocus*/
- g[12]), _[0] & /*value*/
+ p[12]), _[0] & /*value*/
1 && s.value !== /*value*/
- g[0] && set_input_value(
+ p[0] && set_input_value(
s,
/*value*/
- g[0]
+ p[0]
);
},
- d(g) {
- g && detach$1(s), y[36](null), e = !1, run_all(l);
+ d(p) {
+ p && detach$1(s), y[36](null), e = !1, run_all(l);
}
};
}
@@ -28538,8 +28629,8 @@ function create_if_block_2(y) {
y[5], s.autofocus = /*autofocus*/
y[12], attr(s, "autocomplete", "");
},
- m(g, _) {
- insert$1(g, s, _), set_input_value(
+ m(p, _) {
+ insert$1(p, s, _), set_input_value(
s,
/*value*/
y[0]
@@ -28577,32 +28668,32 @@ function create_if_block_2(y) {
)
], e = !0);
},
- p(g, _) {
+ p(p, _) {
_[0] & /*placeholder*/
4 && attr(
s,
"placeholder",
/*placeholder*/
- g[2]
+ p[2]
), _[0] & /*disabled*/
32 && (s.disabled = /*disabled*/
- g[5]), _[0] & /*autofocus*/
+ p[5]), _[0] & /*autofocus*/
4096 && (s.autofocus = /*autofocus*/
- g[12]), _[0] & /*value*/
+ p[12]), _[0] & /*value*/
1 && s.value !== /*value*/
- g[0] && set_input_value(
+ p[0] && set_input_value(
s,
/*value*/
- g[0]
+ p[0]
);
},
- d(g) {
- g && detach$1(s), y[34](null), e = !1, run_all(l);
+ d(p) {
+ p && detach$1(s), y[34](null), e = !1, run_all(l);
}
};
}
function create_if_block_1(y) {
- let s, e, l, g, _;
+ let s, e, l, p, _;
return {
c() {
s = element("input"), attr(s, "data-testid", "textbox"), attr(s, "type", "text"), attr(s, "class", "scroll-hide svelte-18tqgac"), attr(s, "dir", e = /*rtl*/
@@ -28623,7 +28714,7 @@ function create_if_block_1(y) {
/*value*/
y[0]
), y[32](s), /*autofocus*/
- y[12] && s.focus(), g || (_ = [
+ y[12] && s.focus(), p || (_ = [
listen(
s,
"input",
@@ -28654,7 +28745,7 @@ function create_if_block_1(y) {
/*focus_handler*/
y[24]
)
- ], g = !0);
+ ], p = !0);
},
p(x, o) {
o[0] & /*rtl*/
@@ -28681,12 +28772,12 @@ function create_if_block_1(y) {
);
},
d(x) {
- x && detach$1(s), y[32](null), g = !1, run_all(_);
+ x && detach$1(s), y[32](null), p = !1, run_all(_);
}
};
}
function create_fragment$1(y) {
- let s, e, l, g, _, x;
+ let s, e, l, p, _, x;
e = new BlockTitle({
props: {
show_label: (
@@ -28701,7 +28792,7 @@ function create_fragment$1(y) {
$$scope: { ctx: y }
}
});
- const o = [create_if_block$1, create_else_block], p = [];
+ const o = [create_if_block$1, create_else_block], g = [];
function E(u, A) {
return (
/*lines*/
@@ -28709,7 +28800,7 @@ function create_fragment$1(y) {
u[8] === 1 ? 0 : 1
);
}
- return g = E(y), _ = p[g] = o[g](y), {
+ return p = E(y), _ = g[p] = o[p](y), {
c() {
s = element("label"), create_component$1(e.$$.fragment), l = space$1(), _.c(), attr(s, "class", "svelte-18tqgac"), toggle_class(
s,
@@ -28719,21 +28810,21 @@ function create_fragment$1(y) {
);
},
m(u, A) {
- insert$1(u, s, A), mount_component$1(e, s, null), append(s, l), p[g].m(s, null), x = !0;
+ insert$1(u, s, A), mount_component$1(e, s, null), append(s, l), g[p].m(s, null), x = !0;
},
p(u, A) {
- const C = {};
+ const L = {};
A[0] & /*show_label*/
- 64 && (C.show_label = /*show_label*/
+ 64 && (L.show_label = /*show_label*/
u[6]), A[0] & /*info*/
- 16 && (C.info = /*info*/
+ 16 && (L.info = /*info*/
u[4]), A[0] & /*label*/
8 | A[1] & /*$$scope*/
- 131072 && (C.$$scope = { dirty: A, ctx: u }), e.$set(C);
- let L = g;
- g = E(u), g === L ? p[g].p(u, A) : (group_outros$1(), transition_out$1(p[L], 1, 1, () => {
- p[L] = null;
- }), check_outros$1(), _ = p[g], _ ? _.p(u, A) : (_ = p[g] = o[g](u), _.c()), transition_in$1(_, 1), _.m(s, null)), (!x || A[0] & /*container*/
+ 131072 && (L.$$scope = { dirty: A, ctx: u }), e.$set(L);
+ let C = p;
+ p = E(u), p === C ? g[p].p(u, A) : (group_outros$1(), transition_out$1(g[C], 1, 1, () => {
+ g[C] = null;
+ }), check_outros$1(), _ = g[p], _ ? _.p(u, A) : (_ = g[p] = o[p](u), _.c()), transition_in$1(_, 1), _.m(s, null)), (!x || A[0] & /*container*/
128) && toggle_class(
s,
"container",
@@ -28748,12 +28839,12 @@ function create_fragment$1(y) {
transition_out$1(e.$$.fragment, u), transition_out$1(_), x = !1;
},
d(u) {
- u && detach$1(s), destroy_component$1(e), p[g].d();
+ u && detach$1(s), destroy_component$1(e), g[p].d();
}
};
}
function instance$1(y, s, e) {
- let { value: l = "" } = s, { value_is_output: g = !1 } = s, { lines: _ = 1 } = s, { placeholder: x = "Type here..." } = s, { label: o } = s, { info: p = void 0 } = s, { disabled: E = !1 } = s, { show_label: u = !0 } = s, { container: A = !0 } = s, { max_lines: C } = s, { type: L = "text" } = s, { show_copy_button: D = !1 } = s, { rtl: r = !1 } = s, { autofocus: n = !1 } = s, { text_align: b = void 0 } = s, { autoscroll: f = !0 } = s, c, t = !1, a, h, M = 0, w = !1;
+ let { value: l = "" } = s, { value_is_output: p = !1 } = s, { lines: _ = 1 } = s, { placeholder: x = "Type here..." } = s, { label: o } = s, { info: g = void 0 } = s, { disabled: E = !1 } = s, { show_label: u = !0 } = s, { container: A = !0 } = s, { max_lines: L } = s, { type: C = "text" } = s, { show_copy_button: D = !1 } = s, { rtl: r = !1 } = s, { autofocus: n = !1 } = s, { text_align: b = void 0 } = s, { autoscroll: f = !0 } = s, c, t = !1, a, h, M = 0, w = !1;
const S = createEventDispatcher();
beforeUpdate(() => {
h = c && c.offsetHeight + c.scrollTop > c.scrollHeight - 100;
@@ -28762,12 +28853,12 @@ function instance$1(y, s, e) {
h && f && !w && c.scrollTo(0, c.scrollHeight);
};
function R() {
- S("change", l), g || S("input");
+ S("change", l), p || S("input");
}
afterUpdate(() => {
- n && c.focus(), h && f && T(), e(21, g = !1);
+ n && c.focus(), h && f && T(), e(21, p = !1);
});
- async function z() {
+ async function $() {
"clipboard" in navigator && (await navigator.clipboard.writeText(l), P());
}
function P() {
@@ -28779,43 +28870,43 @@ function instance$1(y, s, e) {
);
}
function B(re) {
- const Se = re.target, ze = Se.value, Ge = [Se.selectionStart, Se.selectionEnd];
- S("select", { value: ze.substring(...Ge), index: Ge });
+ const Se = re.target, ke = Se.value, $e = [Se.selectionStart, Se.selectionEnd];
+ S("select", { value: ke.substring(...$e), index: $e });
}
- async function U(re) {
- await tick(), (re.key === "Enter" && re.shiftKey && _ > 1 || re.key === "Enter" && !re.shiftKey && _ === 1 && C >= 1) && (re.preventDefault(), S("submit"));
+ async function F(re) {
+ await tick(), (re.key === "Enter" && re.shiftKey && _ > 1 || re.key === "Enter" && !re.shiftKey && _ === 1 && L >= 1) && (re.preventDefault(), S("submit"));
}
- function F(re) {
- const Se = re.target, ze = Se.scrollTop;
- ze < M && (w = !0), M = ze;
- const Ge = Se.scrollHeight - Se.clientHeight;
- ze >= Ge && (w = !1);
+ function U(re) {
+ const Se = re.target, ke = Se.scrollTop;
+ ke < M && (w = !0), M = ke;
+ const $e = Se.scrollHeight - Se.clientHeight;
+ ke >= $e && (w = !1);
}
- async function $(re) {
- if (await tick(), _ === C)
+ async function z(re) {
+ if (await tick(), _ === L)
return;
- let Se = C === void 0 ? !1 : C === void 0 ? 21 * 11 : 21 * (C + 1), ze = 21 * (_ + 1);
- const Ge = re.target;
- Ge.style.height = "1px";
- let $e;
- Se && Ge.scrollHeight > Se ? $e = Se : Ge.scrollHeight < ze ? $e = ze : $e = Ge.scrollHeight, Ge.style.height = `${$e}px`;
+ let Se = L === void 0 ? !1 : L === void 0 ? 21 * 11 : 21 * (L + 1), ke = 21 * (_ + 1);
+ const $e = re.target;
+ $e.style.height = "1px";
+ let ze;
+ Se && $e.scrollHeight > Se ? ze = Se : $e.scrollHeight < ke ? ze = ke : ze = $e.scrollHeight, $e.style.height = `${ze}px`;
}
function W(re, Se) {
- if (_ !== C && (re.style.overflowY = "scroll", re.addEventListener("input", $), !!Se.trim()))
- return $({ target: re }), {
- destroy: () => re.removeEventListener("input", $)
+ if (_ !== L && (re.style.overflowY = "scroll", re.addEventListener("input", z), !!Se.trim()))
+ return z({ target: re }), {
+ destroy: () => re.removeEventListener("input", z)
};
}
- function N(re) {
+ function V(re) {
bubble.call(this, y, re);
}
- function G(re) {
+ function N(re) {
bubble.call(this, y, re);
}
function k(re) {
bubble.call(this, y, re);
}
- function j(re) {
+ function G(re) {
bubble.call(this, y, re);
}
function Q(re) {
@@ -28824,91 +28915,91 @@ function instance$1(y, s, e) {
function ie(re) {
bubble.call(this, y, re);
}
- function pe(re) {
+ function ge(re) {
bubble.call(this, y, re);
}
- function he(re) {
+ function le(re) {
bubble.call(this, y, re);
}
- function ue() {
+ function oe() {
l = this.value, e(0, l);
}
- function se(re) {
+ function he(re) {
binding_callbacks$1[re ? "unshift" : "push"](() => {
c = re, e(14, c);
});
}
- function ae() {
+ function se() {
l = this.value, e(0, l);
}
- function we(re) {
+ function xe(re) {
binding_callbacks$1[re ? "unshift" : "push"](() => {
c = re, e(14, c);
});
}
- function xe() {
+ function ye() {
l = this.value, e(0, l);
}
- function Ie(re) {
+ function Pe(re) {
binding_callbacks$1[re ? "unshift" : "push"](() => {
c = re, e(14, c);
});
}
- function oe() {
+ function de() {
l = this.value, e(0, l);
}
- function ve(re) {
+ function pe(re) {
binding_callbacks$1[re ? "unshift" : "push"](() => {
c = re, e(14, c);
});
}
return y.$$set = (re) => {
- "value" in re && e(0, l = re.value), "value_is_output" in re && e(21, g = re.value_is_output), "lines" in re && e(1, _ = re.lines), "placeholder" in re && e(2, x = re.placeholder), "label" in re && e(3, o = re.label), "info" in re && e(4, p = re.info), "disabled" in re && e(5, E = re.disabled), "show_label" in re && e(6, u = re.show_label), "container" in re && e(7, A = re.container), "max_lines" in re && e(8, C = re.max_lines), "type" in re && e(9, L = re.type), "show_copy_button" in re && e(10, D = re.show_copy_button), "rtl" in re && e(11, r = re.rtl), "autofocus" in re && e(12, n = re.autofocus), "text_align" in re && e(13, b = re.text_align), "autoscroll" in re && e(22, f = re.autoscroll);
+ "value" in re && e(0, l = re.value), "value_is_output" in re && e(21, p = re.value_is_output), "lines" in re && e(1, _ = re.lines), "placeholder" in re && e(2, x = re.placeholder), "label" in re && e(3, o = re.label), "info" in re && e(4, g = re.info), "disabled" in re && e(5, E = re.disabled), "show_label" in re && e(6, u = re.show_label), "container" in re && e(7, A = re.container), "max_lines" in re && e(8, L = re.max_lines), "type" in re && e(9, C = re.type), "show_copy_button" in re && e(10, D = re.show_copy_button), "rtl" in re && e(11, r = re.rtl), "autofocus" in re && e(12, n = re.autofocus), "text_align" in re && e(13, b = re.text_align), "autoscroll" in re && e(22, f = re.autoscroll);
}, y.$$.update = () => {
y.$$.dirty[0] & /*value*/
1 && l === null && e(0, l = ""), y.$$.dirty[0] & /*value, el, lines, max_lines*/
- 16643 && c && _ !== C && $({ target: c }), y.$$.dirty[0] & /*value*/
+ 16643 && c && _ !== L && z({ target: c }), y.$$.dirty[0] & /*value*/
1 && R();
}, [
l,
_,
x,
o,
- p,
+ g,
E,
u,
A,
- C,
L,
+ C,
D,
r,
n,
b,
c,
t,
- z,
+ $,
B,
- U,
F,
+ U,
W,
- g,
+ p,
f,
+ V,
N,
- G,
k,
- j,
+ G,
Q,
ie,
- pe,
+ ge,
+ le,
+ oe,
he,
- ue,
se,
- ae,
- we,
xe,
- Ie,
- oe,
- ve
+ ye,
+ Pe,
+ de,
+ pe
];
}
class Textbox extends SvelteComponent$1 {
@@ -28980,10 +29071,10 @@ function create_if_block(y) {
/*loading_status*/
y[11]
];
- let g = {};
+ let p = {};
for (let _ = 0; _ < l.length; _ += 1)
- g = assign(g, l[_]);
- return s = new Static({ props: g }), {
+ p = assign(p, l[_]);
+ return s = new Static({ props: p }), {
c() {
create_component(s.$$.fragment);
},
@@ -29048,7 +29139,7 @@ function create_default_slot_1(y) {
};
}
function create_default_slot(y) {
- let s, e, l, g, _, x, o = (
+ let s, e, l, p, _, x, o = (
/*loading_status*/
y[11] && create_if_block(y)
);
@@ -29066,27 +29157,27 @@ function create_default_slot(y) {
$$scope: { ctx: y }
}
});
- function p(u) {
+ function g(u) {
y[14](u);
}
let E = {};
return (
/*value*/
y[0] !== void 0 && (E.value = /*value*/
- y[0]), g = new SequenceInput({ props: E }), binding_callbacks.push(() => bind(g, "value", p)), g.$on(
+ y[0]), p = new SequenceInput({ props: E }), binding_callbacks.push(() => bind(p, "value", g)), p.$on(
"updateVals",
/*syncValue*/
y[12]
- ), g.$on(
+ ), p.$on(
"updateCovMod",
/*syncCovMod*/
y[13]
), {
c() {
- o && o.c(), s = space(), create_component(e.$$.fragment), l = space(), create_component(g.$$.fragment);
+ o && o.c(), s = space(), create_component(e.$$.fragment), l = space(), create_component(p.$$.fragment);
},
m(u, A) {
- o && o.m(u, A), insert(u, s, A), mount_component(e, u, A), insert(u, l, A), mount_component(g, u, A), x = !0;
+ o && o.m(u, A), insert(u, s, A), mount_component(e, u, A), insert(u, l, A), mount_component(p, u, A), x = !0;
},
p(u, A) {
/*loading_status*/
@@ -29094,26 +29185,26 @@ function create_default_slot(y) {
2048 && transition_in(o, 1)) : (o = create_if_block(u), o.c(), transition_in(o, 1), o.m(s.parentNode, s)) : o && (group_outros(), transition_out(o, 1, 1, () => {
o = null;
}), check_outros());
- const C = {};
+ const L = {};
A & /*show_label*/
- 128 && (C.show_label = /*show_label*/
+ 128 && (L.show_label = /*show_label*/
u[7]), A & /*info*/
- 8 && (C.info = /*info*/
+ 8 && (L.info = /*info*/
u[3]), A & /*$$scope, label*/
- 32772 && (C.$$scope = { dirty: A, ctx: u }), e.$set(C);
- const L = {};
+ 32772 && (L.$$scope = { dirty: A, ctx: u }), e.$set(L);
+ const C = {};
!_ && A & /*value*/
- 1 && (_ = !0, L.value = /*value*/
- u[0], add_flush_callback(() => _ = !1)), g.$set(L);
+ 1 && (_ = !0, C.value = /*value*/
+ u[0], add_flush_callback(() => _ = !1)), p.$set(C);
},
i(u) {
- x || (transition_in(o), transition_in(e.$$.fragment, u), transition_in(g.$$.fragment, u), x = !0);
+ x || (transition_in(o), transition_in(e.$$.fragment, u), transition_in(p.$$.fragment, u), x = !0);
},
o(u) {
- transition_out(o), transition_out(e.$$.fragment, u), transition_out(g.$$.fragment, u), x = !1;
+ transition_out(o), transition_out(e.$$.fragment, u), transition_out(p.$$.fragment, u), x = !1;
},
d(u) {
- u && (detach(s), detach(l)), o && o.d(u), destroy_component(e, u), destroy_component(g, u);
+ u && (detach(s), detach(l)), o && o.d(u), destroy_component(e, u), destroy_component(p, u);
}
}
);
@@ -29154,25 +29245,25 @@ function create_fragment(y) {
c() {
create_component(s.$$.fragment);
},
- m(l, g) {
- mount_component(s, l, g), e = !0;
+ m(l, p) {
+ mount_component(s, l, p), e = !0;
},
- p(l, [g]) {
+ p(l, [p]) {
const _ = {};
- g & /*visible*/
+ p & /*visible*/
64 && (_.visible = /*visible*/
- l[6]), g & /*elem_id*/
+ l[6]), p & /*elem_id*/
16 && (_.elem_id = /*elem_id*/
- l[4]), g & /*elem_classes*/
+ l[4]), p & /*elem_classes*/
32 && (_.elem_classes = /*elem_classes*/
- l[5]), g & /*scale*/
+ l[5]), p & /*scale*/
512 && (_.scale = /*scale*/
- l[9]), g & /*min_width*/
+ l[9]), p & /*min_width*/
1024 && (_.min_width = /*min_width*/
- l[10]), g & /*container*/
+ l[10]), p & /*container*/
256 && (_.padding = /*container*/
- l[8]), g & /*$$scope, value, show_label, info, label, gradio, loading_status*/
- 34959 && (_.$$scope = { dirty: g, ctx: l }), s.$set(_);
+ l[8]), p & /*$$scope, value, show_label, info, label, gradio, loading_status*/
+ 34959 && (_.$$scope = { dirty: p, ctx: l }), s.$set(_);
},
i(l) {
e || (transition_in(s.$$.fragment, l), e = !0);
@@ -29186,7 +29277,7 @@ function create_fragment(y) {
};
}
function instance(y, s, e) {
- let { gradio: l } = s, { label: g = "CofoldingInput" } = s, { info: _ = void 0 } = s, { elem_id: x = "" } = s, { elem_classes: o = [] } = s, { visible: p = !0 } = s, { value: E = { chains: [], covMods: [] } } = s, { show_label: u } = s, { container: A = !0 } = s, { scale: C = null } = s, { min_width: L = void 0 } = s, { loading_status: D = void 0 } = s;
+ let { gradio: l } = s, { label: p = "CofoldingInput" } = s, { info: _ = void 0 } = s, { elem_id: x = "" } = s, { elem_classes: o = [] } = s, { visible: g = !0 } = s, { value: E = { chains: [], covMods: [] } } = s, { show_label: u } = s, { container: A = !0 } = s, { scale: L = null } = s, { min_width: C = void 0 } = s, { loading_status: D = void 0 } = s;
function r(f) {
let c = f.detail.map((t) => Object.fromEntries(Object.entries(t).filter(([a, h]) => a !== "open" && h !== "")));
e(0, E.chains = c, E);
@@ -29200,19 +29291,19 @@ function instance(y, s, e) {
E = f, e(0, E);
}
return y.$$set = (f) => {
- "gradio" in f && e(1, l = f.gradio), "label" in f && e(2, g = f.label), "info" in f && e(3, _ = f.info), "elem_id" in f && e(4, x = f.elem_id), "elem_classes" in f && e(5, o = f.elem_classes), "visible" in f && e(6, p = f.visible), "value" in f && e(0, E = f.value), "show_label" in f && e(7, u = f.show_label), "container" in f && e(8, A = f.container), "scale" in f && e(9, C = f.scale), "min_width" in f && e(10, L = f.min_width), "loading_status" in f && e(11, D = f.loading_status);
+ "gradio" in f && e(1, l = f.gradio), "label" in f && e(2, p = f.label), "info" in f && e(3, _ = f.info), "elem_id" in f && e(4, x = f.elem_id), "elem_classes" in f && e(5, o = f.elem_classes), "visible" in f && e(6, g = f.visible), "value" in f && e(0, E = f.value), "show_label" in f && e(7, u = f.show_label), "container" in f && e(8, A = f.container), "scale" in f && e(9, L = f.scale), "min_width" in f && e(10, C = f.min_width), "loading_status" in f && e(11, D = f.loading_status);
}, [
E,
l,
- g,
+ p,
_,
x,
o,
- p,
+ g,
u,
A,
- C,
L,
+ C,
D,
r,
n,