diff --git "a/src/backend/gradio_cofoldinginput/templates/component/index.js" "b/src/backend/gradio_cofoldinginput/templates/component/index.js"
--- "a/src/backend/gradio_cofoldinginput/templates/component/index.js"
+++ "b/src/backend/gradio_cofoldinginput/templates/component/index.js"
@@ -1,3 +1,19 @@
+function _mergeNamespaces(n, e) {
+  for (var t = 0; t < e.length; t++) {
+    const r = e[t];
+    if (typeof r != "string" && !Array.isArray(r)) {
+      for (const a in r)
+        if (a !== "default" && !(a in n)) {
+          const s = Object.getOwnPropertyDescriptor(r, a);
+          s && Object.defineProperty(n, a, s.get ? s : {
+            enumerable: !0,
+            get: () => r[a]
+          });
+        }
+    }
+  }
+  return Object.freeze(Object.defineProperty(n, Symbol.toStringTag, { value: "Module" }));
+}
 const {
   SvelteComponent: SvelteComponent$i,
   assign: assign$1,
@@ -331,19 +347,19 @@ function create_fragment$i(n) {
   };
 }
 function instance$f(n, e, t) {
-  let { $$slots: r = {}, $$scope: a } = e, { height: s = void 0 } = e, { min_height: h = void 0 } = e, { max_height: o = void 0 } = e, { width: d = void 0 } = e, { elem_id: v = "" } = e, { elem_classes: f = [] } = e, { variant: y = "solid" } = e, { border_mode: A = "base" } = e, { padding: x = !0 } = e, { type: M = "normal" } = e, { test_id: m = void 0 } = e, { explicit_call: l = !1 } = e, { container: u = !0 } = e, { visible: g = !0 } = e, { allow_overflow: p = !0 } = e, { overflow_behavior: b = "auto" } = e, { scale: c = null } = e, { min_width: _ = 0 } = e, { flex: E = !1 } = e;
-  g || (E = !1);
+  let { $$slots: r = {}, $$scope: a } = e, { height: s = void 0 } = e, { min_height: h = void 0 } = e, { max_height: o = void 0 } = e, { width: d = void 0 } = e, { elem_id: v = "" } = e, { elem_classes: f = [] } = e, { variant: y = "solid" } = e, { border_mode: A = "base" } = e, { padding: x = !0 } = e, { type: M = "normal" } = e, { test_id: m = void 0 } = e, { explicit_call: l = !1 } = e, { container: u = !0 } = e, { visible: p = !0 } = e, { allow_overflow: g = !0 } = e, { overflow_behavior: b = "auto" } = e, { scale: c = null } = e, { min_width: _ = 0 } = e, { flex: E = !1 } = e;
+  p || (E = !1);
   let w = M === "fieldset" ? "fieldset" : "div";
-  const k = (L) => {
-    if (L !== void 0) {
-      if (typeof L == "number")
-        return L + "px";
-      if (typeof L == "string")
-        return L;
+  const k = ($) => {
+    if ($ !== void 0) {
+      if (typeof $ == "number")
+        return $ + "px";
+      if (typeof $ == "string")
+        return $;
     }
   };
-  return n.$$set = (L) => {
-    "height" in L && t(1, s = L.height), "min_height" in L && t(2, h = L.min_height), "max_height" in L && t(3, o = L.max_height), "width" in L && t(4, d = L.width), "elem_id" in L && t(5, v = L.elem_id), "elem_classes" in L && t(6, f = L.elem_classes), "variant" in L && t(7, y = L.variant), "border_mode" in L && t(8, A = L.border_mode), "padding" in L && t(9, x = L.padding), "type" in L && t(20, M = L.type), "test_id" in L && t(10, m = L.test_id), "explicit_call" in L && t(11, l = L.explicit_call), "container" in L && t(12, u = L.container), "visible" in L && t(13, g = L.visible), "allow_overflow" in L && t(14, p = L.allow_overflow), "overflow_behavior" in L && t(15, b = L.overflow_behavior), "scale" in L && t(16, c = L.scale), "min_width" in L && t(17, _ = L.min_width), "flex" in L && t(0, E = L.flex), "$$scope" in L && t(21, a = L.$$scope);
+  return n.$$set = ($) => {
+    "height" in $ && t(1, s = $.height), "min_height" in $ && t(2, h = $.min_height), "max_height" in $ && t(3, o = $.max_height), "width" in $ && t(4, d = $.width), "elem_id" in $ && t(5, v = $.elem_id), "elem_classes" in $ && t(6, f = $.elem_classes), "variant" in $ && t(7, y = $.variant), "border_mode" in $ && t(8, A = $.border_mode), "padding" in $ && t(9, x = $.padding), "type" in $ && t(20, M = $.type), "test_id" in $ && t(10, m = $.test_id), "explicit_call" in $ && t(11, l = $.explicit_call), "container" in $ && t(12, u = $.container), "visible" in $ && t(13, p = $.visible), "allow_overflow" in $ && t(14, g = $.allow_overflow), "overflow_behavior" in $ && t(15, b = $.overflow_behavior), "scale" in $ && t(16, c = $.scale), "min_width" in $ && t(17, _ = $.min_width), "flex" in $ && t(0, E = $.flex), "$$scope" in $ && t(21, a = $.$$scope);
   }, [
     E,
     s,
@@ -358,8 +374,8 @@ function instance$f(n, e, t) {
     m,
     l,
     u,
-    g,
     p,
+    g,
     b,
     c,
     _,
@@ -4759,11 +4775,11 @@ var wideLatinLetterData = [
       var u = retrieveTextFontName("amsrm", t.fontWeight, t.fontShape);
       return makeSymbol(s, u, a, t, h.concat("amsrm", t.fontWeight, t.fontShape));
     } else if (l === "main" || !l) {
-      var g = retrieveTextFontName("textrm", t.fontWeight, t.fontShape);
-      return makeSymbol(s, g, a, t, h.concat(t.fontWeight, t.fontShape));
+      var p = retrieveTextFontName("textrm", t.fontWeight, t.fontShape);
+      return makeSymbol(s, p, a, t, h.concat(t.fontWeight, t.fontShape));
     } else {
-      var p = retrieveTextFontName(l, t.fontWeight, t.fontShape);
-      return makeSymbol(s, p, a, t, h.concat(p, t.fontWeight, t.fontShape));
+      var g = retrieveTextFontName(l, t.fontWeight, t.fontShape);
+      return makeSymbol(s, g, a, t, h.concat(g, t.fontWeight, t.fontShape));
     }
   } else
     throw new Error("unexpected type: " + r + " in makeOrd");
@@ -4865,8 +4881,8 @@ var wideLatinLetterData = [
     if (m.type === "kern")
       x += m.size;
     else {
-      var l = m.elem, u = m.wrapperClasses || [], g = m.wrapperStyle || {}, p = makeSpan$2(u, [v, l], void 0, g);
-      p.style.top = makeEm(-s - x - l.depth), m.marginLeft && (p.style.marginLeft = m.marginLeft), m.marginRight && (p.style.marginRight = m.marginRight), f.push(p), x += l.height + l.depth;
+      var l = m.elem, u = m.wrapperClasses || [], p = m.wrapperStyle || {}, g = makeSpan$2(u, [v, l], void 0, p);
+      g.style.top = makeEm(-s - x - l.depth), m.marginLeft && (g.style.marginLeft = m.marginLeft), m.marginRight && (g.style.marginRight = m.marginRight), f.push(g), x += l.height + l.depth;
     }
     y = Math.min(y, x), A = Math.max(A, x);
   }
@@ -5152,9 +5168,9 @@ var normalizeArgument = function(e) {
   }, {
     node: y
   }, A, x), traverseNonSpaceNodes(s, (M, m) => {
-    var l = getTypeOfDomTree(m), u = getTypeOfDomTree(M), g = l && u ? M.hasClass("mtight") ? tightSpacings[l][u] : spacings[l][u] : null;
-    if (g)
-      return buildCommon.makeGlue(g, v);
+    var l = getTypeOfDomTree(m), u = getTypeOfDomTree(M), p = l && u ? M.hasClass("mtight") ? tightSpacings[l][u] : spacings[l][u] : null;
+    if (p)
+      return buildCommon.makeGlue(p, v);
   }, {
     node: y
   }, A, x), s;
@@ -5584,10 +5600,10 @@ var optionsFromSettings = function(e) {
         height: x
       };
     } else {
-      var u = [], g = katexImagesData[d], [p, b, c] = g, _ = c / 1e3, E = p.length, w, k;
+      var u = [], p = katexImagesData[d], [g, b, c] = p, _ = c / 1e3, E = g.length, w, k;
       if (E === 1) {
-        var L = g[3];
-        w = ["hide-tail"], k = [L];
+        var $ = p[3];
+        w = ["hide-tail"], k = [$];
       } else if (E === 2)
         w = ["halfarrow-left", "halfarrow-right"], k = ["xMinYMin", "xMaxYMin"];
       else if (E === 3)
@@ -5595,13 +5611,13 @@ var optionsFromSettings = function(e) {
       else
         throw new Error(`Correct katexImagesData or update code here to support
                     ` + E + " children.");
-      for (var $ = 0; $ < E; $++) {
-        var z = new PathNode(p[$]), O = new SvgNode([z], {
+      for (var L = 0; L < E; L++) {
+        var z = new PathNode(g[L]), F = new SvgNode([z], {
           width: "400em",
           height: makeEm(_),
           viewBox: "0 0 " + o + " " + c,
-          preserveAspectRatio: k[$] + " slice"
-        }), R = buildCommon.makeSvgSpan([w[$]], [O], t);
+          preserveAspectRatio: k[L] + " slice"
+        }), R = buildCommon.makeSvgSpan([w[L]], [F], t);
         if (E === 1)
           return {
             span: R,
@@ -6527,16 +6543,16 @@ var getMetrics = function(e, t, r) {
   o = v = f = e, d = null;
   var x = "Size1-Regular";
   e === "\\uparrow" ? v = f = "⏐" : e === "\\Uparrow" ? v = f = "‖" : e === "\\downarrow" ? o = v = "⏐" : e === "\\Downarrow" ? o = v = "‖" : e === "\\updownarrow" ? (o = "\\uparrow", v = "⏐", f = "\\downarrow") : e === "\\Updownarrow" ? (o = "\\Uparrow", v = "‖", f = "\\Downarrow") : utils.contains(verts, e) ? (v = "∣", y = "vert", A = 333) : utils.contains(doubleVerts, e) ? (v = "∥", y = "doublevert", A = 556) : e === "[" || e === "\\lbrack" ? (o = "⎡", v = "⎢", f = "⎣", x = "Size4-Regular", y = "lbrack", A = 667) : e === "]" || e === "\\rbrack" ? (o = "⎤", v = "⎥", f = "⎦", x = "Size4-Regular", y = "rbrack", A = 667) : e === "\\lfloor" || e === "⌊" ? (v = o = "⎢", f = "⎣", x = "Size4-Regular", y = "lfloor", A = 667) : e === "\\lceil" || e === "⌈" ? (o = "⎡", v = f = "⎢", x = "Size4-Regular", y = "lceil", A = 667) : e === "\\rfloor" || e === "⌋" ? (v = o = "⎥", f = "⎦", x = "Size4-Regular", y = "rfloor", A = 667) : e === "\\rceil" || e === "⌉" ? (o = "⎤", v = f = "⎥", x = "Size4-Regular", y = "rceil", A = 667) : e === "(" || e === "\\lparen" ? (o = "⎛", v = "⎜", f = "⎝", x = "Size4-Regular", y = "lparen", A = 875) : e === ")" || e === "\\rparen" ? (o = "⎞", v = "⎟", f = "⎠", x = "Size4-Regular", y = "rparen", A = 875) : e === "\\{" || e === "\\lbrace" ? (o = "⎧", d = "⎨", f = "⎩", v = "⎪", x = "Size4-Regular") : e === "\\}" || e === "\\rbrace" ? (o = "⎫", d = "⎬", f = "⎭", v = "⎪", x = "Size4-Regular") : e === "\\lgroup" || e === "⟮" ? (o = "⎧", f = "⎩", v = "⎪", x = "Size4-Regular") : e === "\\rgroup" || e === "⟯" ? (o = "⎫", f = "⎭", v = "⎪", x = "Size4-Regular") : e === "\\lmoustache" || e === "⎰" ? (o = "⎧", f = "⎭", v = "⎪", x = "Size4-Regular") : (e === "\\rmoustache" || e === "⎱") && (o = "⎫", f = "⎩", v = "⎪", x = "Size4-Regular");
-  var M = getMetrics(o, x, s), m = M.height + M.depth, l = getMetrics(v, x, s), u = l.height + l.depth, g = getMetrics(f, x, s), p = g.height + g.depth, b = 0, c = 1;
+  var M = getMetrics(o, x, s), m = M.height + M.depth, l = getMetrics(v, x, s), u = l.height + l.depth, p = getMetrics(f, x, s), g = p.height + p.depth, b = 0, c = 1;
   if (d !== null) {
     var _ = getMetrics(d, x, s);
     b = _.height + _.depth, c = 2;
   }
-  var E = m + p + b, w = Math.max(0, Math.ceil((t - E) / (c * u))), k = E + w * c * u, L = a.fontMetrics().axisHeight;
-  r && (L *= a.sizeMultiplier);
-  var $ = k / 2 - L, z = [];
+  var E = m + g + b, w = Math.max(0, Math.ceil((t - E) / (c * u))), k = E + w * c * u, $ = a.fontMetrics().axisHeight;
+  r && ($ *= a.sizeMultiplier);
+  var L = k / 2 - $, z = [];
   if (y.length > 0) {
-    var O = k - m - p, R = Math.round(k * 1e3), P = tallDelim(y, Math.round(O * 1e3)), U = new PathNode(y, P), N = (A / 1e3).toFixed(3) + "em", B = (R / 1e3).toFixed(3) + "em", W = new SvgNode([U], {
+    var F = k - m - g, R = Math.round(k * 1e3), P = tallDelim(y, Math.round(F * 1e3)), U = new PathNode(y, P), N = (A / 1e3).toFixed(3) + "em", B = (R / 1e3).toFixed(3) + "em", W = new SvgNode([U], {
       width: N,
       height: B,
       viewBox: "0 0 " + A + " " + R
@@ -6547,17 +6563,17 @@ var getMetrics = function(e, t, r) {
     });
   } else {
     if (z.push(makeGlyphSpan(f, x, s)), z.push(lap), d === null) {
-      var G = k - m - p + 2 * lapInEms;
+      var G = k - m - g + 2 * lapInEms;
       z.push(makeInner(v, G, a));
     } else {
-      var H = (k - m - p - b) / 2 + 2 * lapInEms;
+      var H = (k - m - g - b) / 2 + 2 * lapInEms;
       z.push(makeInner(v, H, a)), z.push(lap), z.push(makeGlyphSpan(d, x, s)), z.push(lap), z.push(makeInner(v, H, a));
     }
     z.push(lap), z.push(makeGlyphSpan(o, x, s));
   }
   var Q = a.havingBaseStyle(Style$1.TEXT), te = buildCommon.makeVList({
     positionType: "bottom",
-    positionData: $,
+    positionData: L,
     children: z
   }, Q);
   return styleWrap(buildCommon.makeSpan(["delimsizing", "mult"], [te], Q), Style$1.TEXT, a, h);
@@ -6935,9 +6951,9 @@ var htmlBuilder$7 = (n, e) => {
       // User override.
     ), m = e.fontMetrics().fboxsep + (r === "colorbox" ? 0 : u), l = m) : r === "angl" ? (u = Math.max(e.fontMetrics().defaultRuleThickness, e.minRuleThickness), m = 4 * u, l = Math.max(0, 0.25 - t.depth)) : (m = o ? 0.2 : 0, l = m), s = stretchy.encloseSpan(t, r, m, l, e), /fbox|boxed|fcolorbox/.test(r) ? (s.style.borderStyle = "solid", s.style.borderWidth = makeEm(u)) : r === "angl" && u !== 0.049 && (s.style.borderTopWidth = makeEm(u), s.style.borderRightWidth = makeEm(u)), h = t.depth + l, n.backgroundColor && (s.style.backgroundColor = n.backgroundColor, n.borderColor && (s.style.borderColor = n.borderColor));
   }
-  var g;
+  var p;
   if (n.backgroundColor)
-    g = buildCommon.makeVList({
+    p = buildCommon.makeVList({
       positionType: "individualShift",
       children: [
         // Put the color background behind inner;
@@ -6954,8 +6970,8 @@ var htmlBuilder$7 = (n, e) => {
       ]
     }, e);
   else {
-    var p = /cancel|phase/.test(r) ? ["svg-align"] : [];
-    g = buildCommon.makeVList({
+    var g = /cancel|phase/.test(r) ? ["svg-align"] : [];
+    p = buildCommon.makeVList({
       positionType: "individualShift",
       children: [
         // Write the \cancel stroke on top of inner.
@@ -6968,12 +6984,12 @@ var htmlBuilder$7 = (n, e) => {
           type: "elem",
           elem: s,
           shift: h,
-          wrapperClasses: p
+          wrapperClasses: g
         }
       ]
     }, e);
   }
-  return /cancel/.test(r) && (g.height = t.height, g.depth = t.depth), /cancel/.test(r) && !o ? buildCommon.makeSpan(["mord", "cancel-lap"], [g], e) : buildCommon.makeSpan(["mord"], [g], e);
+  return /cancel/.test(r) && (p.height = t.height, p.depth = t.depth), /cancel/.test(r) && !o ? buildCommon.makeSpan(["mord", "cancel-lap"], [p], e) : buildCommon.makeSpan(["mord"], [p], e);
 }, mathmlBuilder$6 = (n, e) => {
   var t = 0, r = new mathMLTree.MathNode(n.label.indexOf("colorbox") > -1 ? "mpadded" : "menclose", [buildGroup(n.body, e)]);
   switch (n.label) {
@@ -7184,14 +7200,14 @@ function parseArray(n, e, t) {
       throw new ParseError("Invalid \\arraystretch: " + x);
   }
   n.gullet.beginGroup();
-  var M = [], m = [M], l = [], u = [], g = d != null ? [] : void 0;
-  function p() {
+  var M = [], m = [M], l = [], u = [], p = d != null ? [] : void 0;
+  function g() {
     d && n.gullet.macros.set("\\@eqnsw", "1", !0);
   }
   function b() {
-    g && (n.gullet.macros.get("\\df@tag") ? (g.push(n.subparse([new Token("\\df@tag")])), n.gullet.macros.set("\\df@tag", void 0, !0)) : g.push(!!d && n.gullet.macros.get("\\@eqnsw") === "1"));
+    p && (n.gullet.macros.get("\\df@tag") ? (p.push(n.subparse([new Token("\\df@tag")])), n.gullet.macros.set("\\df@tag", void 0, !0)) : p.push(!!d && n.gullet.macros.get("\\@eqnsw") === "1"));
   }
-  for (p(), u.push(getHLines(n)); ; ) {
+  for (g(), u.push(getHLines(n)); ; ) {
     var c = n.parseExpression(!1, v ? "\\end" : "\\\\");
     n.gullet.endGroup(), n.gullet.beginGroup(), c = {
       type: "ordgroup",
@@ -7217,7 +7233,7 @@ function parseArray(n, e, t) {
     } else if (_ === "\\\\") {
       n.consume();
       var E = void 0;
-      n.gullet.future().text !== " " && (E = n.parseSizeGroup(!0)), l.push(E ? E.value : null), b(), u.push(getHLines(n)), M = [], m.push(M), p();
+      n.gullet.future().text !== " " && (E = n.parseSizeGroup(!0)), l.push(E ? E.value : null), b(), u.push(getHLines(n)), M = [], m.push(M), g();
     } else
       throw new ParseError("Expected & or \\\\ or \\cr or \\end", n.nextToken);
   }
@@ -7232,7 +7248,7 @@ function parseArray(n, e, t) {
     hskipBeforeAndAfter: r,
     hLinesBeforeRow: u,
     colSeparationType: o,
-    tags: g,
+    tags: p,
     leqno: A
   };
 }
@@ -7253,26 +7269,26 @@ var htmlBuilder$6 = function(e, t) {
   var M = e.colSeparationType === "CD" ? calculateSize({
     number: 3,
     unit: "ex"
-  }, t) : 12 * y, m = 3 * y, l = e.arraystretch * M, u = 0.7 * l, g = 0.3 * l, p = 0;
+  }, t) : 12 * y, m = 3 * y, l = e.arraystretch * M, u = 0.7 * l, p = 0.3 * l, g = 0;
   function b(Be) {
     for (var Ue = 0; Ue < Be.length; ++Ue)
-      Ue > 0 && (p += 0.25), v.push({
-        pos: p,
+      Ue > 0 && (g += 0.25), v.push({
+        pos: g,
         isDashed: Be[Ue]
       });
   }
   for (b(h[0]), r = 0; r < e.body.length; ++r) {
-    var c = e.body[r], _ = u, E = g;
+    var c = e.body[r], _ = u, E = p;
     o < c.length && (o = c.length);
     var w = new Array(c.length);
     for (a = 0; a < c.length; ++a) {
       var k = buildGroup$1(c[a], t);
       E < k.depth && (E = k.depth), _ < k.height && (_ = k.height), w[a] = k;
     }
-    var L = e.rowGaps[r], $ = 0;
-    L && ($ = calculateSize(L, t), $ > 0 && ($ += g, E < $ && (E = $), $ = 0)), e.addJot && (E += m), w.height = _, w.depth = E, p += _, w.pos = p, p += E + $, d[r] = w, b(h[r + 1]);
+    var $ = e.rowGaps[r], L = 0;
+    $ && (L = calculateSize($, t), L > 0 && (L += p, E < L && (E = L), L = 0)), e.addJot && (E += m), w.height = _, w.depth = E, g += _, w.pos = g, g += E + L, d[r] = w, b(h[r + 1]);
   }
-  var z = p / 2 + t.fontMetrics().axisHeight, O = e.cols || [], R = [], P, U, N = [];
+  var z = g / 2 + t.fontMetrics().axisHeight, F = e.cols || [], R = [], P, U, N = [];
   if (e.tags && e.tags.some((Be) => Be))
     for (r = 0; r < s; ++r) {
       var B = d[r], W = B.pos - z, V = e.tags[r], G = void 0;
@@ -7286,18 +7302,18 @@ var htmlBuilder$6 = function(e, t) {
     a = 0, U = 0;
     // Continue while either there are more columns or more column
     // descriptions, so trailing separators don't get lost.
-    a < o || U < O.length;
+    a < o || U < F.length;
     ++a, ++U
   ) {
-    for (var H = O[U] || {}, Q = !0; H.type === "separator"; ) {
+    for (var H = F[U] || {}, Q = !0; H.type === "separator"; ) {
       if (Q || (P = buildCommon.makeSpan(["arraycolsep"], []), P.style.width = makeEm(t.fontMetrics().doubleRuleSep), R.push(P)), H.separator === "|" || H.separator === ":") {
         var te = H.separator === "|" ? "solid" : "dashed", ee = buildCommon.makeSpan(["vertical-separator"], [], t);
-        ee.style.height = makeEm(p), ee.style.borderRightWidth = makeEm(f), ee.style.borderRightStyle = te, ee.style.margin = "0 " + makeEm(-f / 2);
-        var ce = p - z;
+        ee.style.height = makeEm(g), ee.style.borderRightWidth = makeEm(f), ee.style.borderRightStyle = te, ee.style.margin = "0 " + makeEm(-f / 2);
+        var ce = g - z;
         ce && (ee.style.verticalAlign = makeEm(-ce)), R.push(ee);
       } else
         throw new ParseError("Invalid separator type: " + H.separator);
-      U++, H = O[U] || {}, Q = !1;
+      U++, H = F[U] || {}, Q = !1;
     }
     if (!(a >= o)) {
       var fe = void 0;
@@ -7344,11 +7360,11 @@ var htmlBuilder$6 = function(e, t) {
   }
   if (N.length === 0)
     return buildCommon.makeSpan(["mord"], [d], t);
-  var Fe = buildCommon.makeVList({
+  var Oe = buildCommon.makeVList({
     positionType: "individualShift",
     children: N
   }, t);
-  return Fe = buildCommon.makeSpan(["tag"], [Fe], t), buildCommon.makeFragment([d, Fe]);
+  return Oe = buildCommon.makeSpan(["tag"], [Oe], t), buildCommon.makeFragment([d, Oe]);
 }, alignMap = {
   c: "center ",
   l: "left ",
@@ -7363,10 +7379,10 @@ var htmlBuilder$6 = function(e, t) {
   f.setAttribute("rowspacing", makeEm(y));
   var A = "", x = "";
   if (e.cols && e.cols.length > 0) {
-    var M = e.cols, m = "", l = !1, u = 0, g = M.length;
-    M[0].type === "separator" && (A += "top ", u = 1), M[M.length - 1].type === "separator" && (A += "bottom ", g -= 1);
-    for (var p = u; p < g; p++)
-      M[p].type === "align" ? (x += alignMap[M[p].align], l && (m += "none "), l = !0) : M[p].type === "separator" && l && (m += M[p].separator === "|" ? "solid " : "dashed ", l = !1);
+    var M = e.cols, m = "", l = !1, u = 0, p = M.length;
+    M[0].type === "separator" && (A += "top ", u = 1), M[M.length - 1].type === "separator" && (A += "bottom ", p -= 1);
+    for (var g = u; g < p; g++)
+      M[g].type === "align" ? (x += alignMap[M[g].align], l && (m += "none "), l = !0) : M[g].type === "separator" && l && (m += M[g].separator === "|" ? "solid " : "dashed ", l = !1);
     f.setAttribute("columnalign", x.trim()), /[sd]/.test(m) && f.setAttribute("columnlines", m.trim());
   }
   if (e.colSeparationType === "align") {
@@ -7403,8 +7419,8 @@ var htmlBuilder$6 = function(e, t) {
   }
   var x = !d;
   h.body.forEach(function(u) {
-    for (var g = 1; g < u.length; g += 2) {
-      var p = assertNodeType(u[g], "styling"), b = assertNodeType(p.body[0], "ordgroup");
+    for (var p = 1; p < u.length; p += 2) {
+      var g = assertNodeType(u[p], "styling"), b = assertNodeType(g.body[0], "ordgroup");
       b.body.unshift(v);
     }
     if (x)
@@ -7849,9 +7865,9 @@ var adjustStyle = (n, e) => {
   t.size === Style$1.DISPLAY.size || n.size === "display" ? (x = e.fontMetrics().num1, y > 0 ? M = 3 * A : M = 7 * A, m = e.fontMetrics().denom1) : (y > 0 ? (x = e.fontMetrics().num2, M = A) : (x = e.fontMetrics().num3, M = 3 * A), m = e.fontMetrics().denom2);
   var l;
   if (f) {
-    var g = e.fontMetrics().axisHeight;
-    x - h.depth - (g + 0.5 * y) < M && (x += M - (x - h.depth - (g + 0.5 * y))), g - 0.5 * y - (v.height - m) < M && (m += M - (g - 0.5 * y - (v.height - m)));
-    var p = -(g - 0.5 * y);
+    var p = e.fontMetrics().axisHeight;
+    x - h.depth - (p + 0.5 * y) < M && (x += M - (x - h.depth - (p + 0.5 * y))), p - 0.5 * y - (v.height - m) < M && (m += M - (p - 0.5 * y - (v.height - m)));
+    var g = -(p - 0.5 * y);
     l = buildCommon.makeVList({
       positionType: "individualShift",
       children: [{
@@ -7861,7 +7877,7 @@ var adjustStyle = (n, e) => {
       }, {
         type: "elem",
         elem: f,
-        shift: p
+        shift: g
       }, {
         type: "elem",
         elem: h,
@@ -9392,8 +9408,8 @@ defineFunction({
           type: "elem",
           elem: m
         }]
-      }, e), g = buildCommon.makeSpan(["root"], [u]);
-      return buildCommon.makeSpan(["mord", "sqrt"], [g, x], e);
+      }, e), p = buildCommon.makeSpan(["root"], [u]);
+      return buildCommon.makeSpan(["mord", "sqrt"], [p, x], e);
     } else
       return buildCommon.makeSpan(["mord", "sqrt"], [x], e);
   },
@@ -9489,10 +9505,10 @@ defineFunctionBuilders({
     }
     var m;
     e.style === Style$1.DISPLAY ? m = v.sup1 : e.style.cramped ? m = v.sup3 : m = v.sup2;
-    var l = e.sizeMultiplier, u = makeEm(0.5 / v.ptPerEm / l), g = null;
+    var l = e.sizeMultiplier, u = makeEm(0.5 / v.ptPerEm / l), p = null;
     if (d) {
-      var p = n.base && n.base.type === "op" && n.base.name && (n.base.name === "\\oiint" || n.base.name === "\\oiiint");
-      (h instanceof SymbolNode || p) && (g = makeEm(-h.italic));
+      var g = n.base && n.base.type === "op" && n.base.name && (n.base.name === "\\oiint" || n.base.name === "\\oiiint");
+      (h instanceof SymbolNode || g) && (p = makeEm(-h.italic));
     }
     var b;
     if (o && d) {
@@ -9508,7 +9524,7 @@ defineFunctionBuilders({
         elem: d,
         shift: y,
         marginRight: u,
-        marginLeft: g
+        marginLeft: p
       }, {
         type: "elem",
         elem: o,
@@ -9524,7 +9540,7 @@ defineFunctionBuilders({
       var k = [{
         type: "elem",
         elem: d,
-        marginLeft: g,
+        marginLeft: p,
         marginRight: u
       }];
       b = buildCommon.makeVList({
@@ -9544,8 +9560,8 @@ defineFunctionBuilders({
       }, e);
     else
       throw new Error("supsub must have either sup or sub.");
-    var L = getTypeOfDomTree(h, "right") || "mord";
-    return buildCommon.makeSpan([L], [h, buildCommon.makeSpan(["msupsub"], [b])], e);
+    var $ = getTypeOfDomTree(h, "right") || "mord";
+    return buildCommon.makeSpan([$], [h, buildCommon.makeSpan(["msupsub"], [b])], e);
   },
   mathmlBuilder(n, e) {
     var t = !1, r, a;
@@ -12406,17 +12422,17 @@ class _Tokenizer {
         let M = !1;
         if (!y && /^ *$/.test(A) && (o += A + `
 `, e = e.substring(A.length + 1), f = !0), !f) {
-          const u = new RegExp(`^ {0,${Math.min(3, x - 1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ 	][^\\n]*)?(?:\\n|$))`), g = new RegExp(`^ {0,${Math.min(3, x - 1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`), p = new RegExp(`^ {0,${Math.min(3, x - 1)}}(?:\`\`\`|~~~)`), b = new RegExp(`^ {0,${Math.min(3, x - 1)}}#`);
+          const u = new RegExp(`^ {0,${Math.min(3, x - 1)}}(?:[*+-]|\\d{1,9}[.)])((?:[ 	][^\\n]*)?(?:\\n|$))`), p = new RegExp(`^ {0,${Math.min(3, x - 1)}}((?:- *){3,}|(?:_ *){3,}|(?:\\* *){3,})(?:\\n+|$)`), g = new RegExp(`^ {0,${Math.min(3, x - 1)}}(?:\`\`\`|~~~)`), b = new RegExp(`^ {0,${Math.min(3, x - 1)}}#`);
           for (; e; ) {
             const c = e.split(`
 `, 1)[0];
-            if (A = c, this.options.pedantic && (A = A.replace(/^ {1,4}(?=( {4})*[^ ])/g, "  ")), p.test(A) || b.test(A) || u.test(A) || g.test(e))
+            if (A = c, this.options.pedantic && (A = A.replace(/^ {1,4}(?=( {4})*[^ ])/g, "  ")), g.test(A) || b.test(A) || u.test(A) || p.test(e))
               break;
             if (A.search(/[^ ]/) >= x || !A.trim())
               d += `
 ` + A.slice(x);
             else {
-              if (M || y.search(/[^ ]/) >= 4 || p.test(y) || b.test(y) || g.test(y))
+              if (M || y.search(/[^ ]/) >= 4 || g.test(y) || b.test(y) || p.test(y))
                 break;
               d += `
 ` + A;
@@ -13770,8 +13786,8 @@ var prism = { exports: {} };
        * @memberof Prism
        */
       util: {
-        encode: function g(p) {
-          return p instanceof d ? new d(p.type, g(p.content), p.alias) : Array.isArray(p) ? p.map(g) : p.replace(/&/g, "&amp;").replace(/</g, "&lt;").replace(/\u00a0/g, " ");
+        encode: function p(g) {
+          return g instanceof d ? new d(g.type, p(g.content), g.alias) : Array.isArray(g) ? g.map(p) : g.replace(/&/g, "&amp;").replace(/</g, "&lt;").replace(/\u00a0/g, " ");
         },
         /**
          * Returns the name of the type of the given value.
@@ -13789,8 +13805,8 @@ var prism = { exports: {} };
          * type(String)    === 'Function'
          * type(/abc+/)    === 'RegExp'
          */
-        type: function(g) {
-          return Object.prototype.toString.call(g).slice(8, -1);
+        type: function(p) {
+          return Object.prototype.toString.call(p).slice(8, -1);
         },
         /**
          * Returns a unique number for the given object. Later calls will still return the same number.
@@ -13798,8 +13814,8 @@ var prism = { exports: {} };
          * @param {Object} obj
          * @returns {number}
          */
-        objId: function(g) {
-          return g.__id || Object.defineProperty(g, "__id", { value: ++s }), g.__id;
+        objId: function(p) {
+          return p.__id || Object.defineProperty(p, "__id", { value: ++s }), p.__id;
         },
         /**
          * Creates a deep clone of the given object.
@@ -13811,30 +13827,30 @@ var prism = { exports: {} };
          * @returns {T}
          * @template T
          */
-        clone: function g(p, b) {
+        clone: function p(g, b) {
           b = b || {};
           var c, _;
-          switch (o.util.type(p)) {
+          switch (o.util.type(g)) {
             case "Object":
-              if (_ = o.util.objId(p), b[_])
+              if (_ = o.util.objId(g), b[_])
                 return b[_];
               c = /** @type {Record<string, any>} */
               {}, b[_] = c;
-              for (var E in p)
-                p.hasOwnProperty(E) && (c[E] = g(p[E], b));
+              for (var E in g)
+                g.hasOwnProperty(E) && (c[E] = p(g[E], b));
               return (
                 /** @type {any} */
                 c
               );
             case "Array":
-              return _ = o.util.objId(p), b[_] ? b[_] : (c = [], b[_] = c, /** @type {Array} */
+              return _ = o.util.objId(g), b[_] ? b[_] : (c = [], b[_] = c, /** @type {Array} */
               /** @type {any} */
-              p.forEach(function(w, k) {
-                c[k] = g(w, b);
+              g.forEach(function(w, k) {
+                c[k] = p(w, b);
               }), /** @type {any} */
               c);
             default:
-              return p;
+              return g;
           }
         },
         /**
@@ -13845,12 +13861,12 @@ var prism = { exports: {} };
          * @param {Element} element
          * @returns {string}
          */
-        getLanguage: function(g) {
-          for (; g; ) {
-            var p = a.exec(g.className);
-            if (p)
-              return p[1].toLowerCase();
-            g = g.parentElement;
+        getLanguage: function(p) {
+          for (; p; ) {
+            var g = a.exec(p.className);
+            if (g)
+              return g[1].toLowerCase();
+            p = p.parentElement;
           }
           return "none";
         },
@@ -13861,8 +13877,8 @@ var prism = { exports: {} };
          * @param {string} language
          * @returns {void}
          */
-        setLanguage: function(g, p) {
-          g.className = g.className.replace(RegExp(a, "gi"), ""), g.classList.add("language-" + p);
+        setLanguage: function(p, g) {
+          p.className = p.className.replace(RegExp(a, "gi"), ""), p.classList.add("language-" + g);
         },
         /**
          * Returns the script element that is currently executing.
@@ -13882,12 +13898,12 @@ var prism = { exports: {} };
           try {
             throw new Error();
           } catch (c) {
-            var g = (/at [^(\r\n]*\((.*):[^:]+:[^:]+\)$/i.exec(c.stack) || [])[1];
-            if (g) {
-              var p = document.getElementsByTagName("script");
-              for (var b in p)
-                if (p[b].src == g)
-                  return p[b];
+            var p = (/at [^(\r\n]*\((.*):[^:]+:[^:]+\)$/i.exec(c.stack) || [])[1];
+            if (p) {
+              var g = document.getElementsByTagName("script");
+              for (var b in g)
+                if (g[b].src == p)
+                  return g[b];
             }
             return null;
           }
@@ -13911,14 +13927,14 @@ var prism = { exports: {} };
          * @param {boolean} [defaultActivation=false]
          * @returns {boolean}
          */
-        isActive: function(g, p, b) {
-          for (var c = "no-" + p; g; ) {
-            var _ = g.classList;
-            if (_.contains(p))
+        isActive: function(p, g, b) {
+          for (var c = "no-" + g; p; ) {
+            var _ = p.classList;
+            if (_.contains(g))
               return !0;
             if (_.contains(c))
               return !1;
-            g = g.parentElement;
+            p = p.parentElement;
           }
           return !!b;
         }
@@ -13966,10 +13982,10 @@ var prism = { exports: {} };
          *     'color': /\b(?:red|green|blue)\b/
          * });
          */
-        extend: function(g, p) {
-          var b = o.util.clone(o.languages[g]);
-          for (var c in p)
-            b[c] = p[c];
+        extend: function(p, g) {
+          var b = o.util.clone(o.languages[p]);
+          for (var c in g)
+            b[c] = g[c];
           return b;
         },
         /**
@@ -14047,31 +14063,31 @@ var prism = { exports: {} };
          * @returns {Grammar} The new grammar object.
          * @public
          */
-        insertBefore: function(g, p, b, c) {
+        insertBefore: function(p, g, b, c) {
           c = c || /** @type {any} */
           o.languages;
-          var _ = c[g], E = {};
+          var _ = c[p], E = {};
           for (var w in _)
             if (_.hasOwnProperty(w)) {
-              if (w == p)
+              if (w == g)
                 for (var k in b)
                   b.hasOwnProperty(k) && (E[k] = b[k]);
               b.hasOwnProperty(w) || (E[w] = _[w]);
             }
-          var L = c[g];
-          return c[g] = E, o.languages.DFS(o.languages, function($, z) {
-            z === L && $ != g && (this[$] = E);
+          var $ = c[p];
+          return c[p] = E, o.languages.DFS(o.languages, function(L, z) {
+            z === $ && L != p && (this[L] = E);
           }), E;
         },
         // Traverse a language definition with Depth First Search
-        DFS: function g(p, b, c, _) {
+        DFS: function p(g, b, c, _) {
           _ = _ || {};
           var E = o.util.objId;
-          for (var w in p)
-            if (p.hasOwnProperty(w)) {
-              b.call(p, w, p[w], c || w);
-              var k = p[w], L = o.util.type(k);
-              L === "Object" && !_[E(k)] ? (_[E(k)] = !0, g(k, b, null, _)) : L === "Array" && !_[E(k)] && (_[E(k)] = !0, g(k, b, w, _));
+          for (var w in g)
+            if (g.hasOwnProperty(w)) {
+              b.call(g, w, g[w], c || w);
+              var k = g[w], $ = o.util.type(k);
+              $ === "Object" && !_[E(k)] ? (_[E(k)] = !0, p(k, b, null, _)) : $ === "Array" && !_[E(k)] && (_[E(k)] = !0, p(k, b, w, _));
             }
         }
       },
@@ -14088,8 +14104,8 @@ var prism = { exports: {} };
        * @memberof Prism
        * @public
        */
-      highlightAll: function(g, p) {
-        o.highlightAllUnder(document, g, p);
+      highlightAll: function(p, g) {
+        o.highlightAllUnder(document, p, g);
       },
       /**
        * Fetches all the descendants of `container` that have a `.language-xxxx` class and then calls
@@ -14106,15 +14122,15 @@ var prism = { exports: {} };
        * @memberof Prism
        * @public
        */
-      highlightAllUnder: function(g, p, b) {
+      highlightAllUnder: function(p, g, b) {
         var c = {
           callback: b,
-          container: g,
+          container: p,
           selector: 'code[class*="language-"], [class*="language-"] code, code[class*="lang-"], [class*="lang-"] code'
         };
         o.hooks.run("before-highlightall", c), c.elements = Array.prototype.slice.apply(c.container.querySelectorAll(c.selector)), o.hooks.run("before-all-elements-highlight", c);
         for (var _ = 0, E; E = c.elements[_++]; )
-          o.highlightElement(E, p === !0, c.callback);
+          o.highlightElement(E, g === !0, c.callback);
       },
       /**
        * Highlights the code inside a single element.
@@ -14144,18 +14160,18 @@ var prism = { exports: {} };
        * @memberof Prism
        * @public
        */
-      highlightElement: function(g, p, b) {
-        var c = o.util.getLanguage(g), _ = o.languages[c];
-        o.util.setLanguage(g, c);
-        var E = g.parentElement;
+      highlightElement: function(p, g, b) {
+        var c = o.util.getLanguage(p), _ = o.languages[c];
+        o.util.setLanguage(p, c);
+        var E = p.parentElement;
         E && E.nodeName.toLowerCase() === "pre" && o.util.setLanguage(E, c);
-        var w = g.textContent, k = {
-          element: g,
+        var w = p.textContent, k = {
+          element: p,
           language: c,
           grammar: _,
           code: w
         };
-        function L(z) {
+        function $(z) {
           k.highlightedCode = z, o.hooks.run("before-insert", k), k.element.innerHTML = k.highlightedCode, o.hooks.run("after-highlight", k), o.hooks.run("complete", k), b && b.call(k.element);
         }
         if (o.hooks.run("before-sanity-check", k), E = k.element.parentElement, E && E.nodeName.toLowerCase() === "pre" && !E.hasAttribute("tabindex") && E.setAttribute("tabindex", "0"), !k.code) {
@@ -14163,20 +14179,20 @@ var prism = { exports: {} };
           return;
         }
         if (o.hooks.run("before-highlight", k), !k.grammar) {
-          L(o.util.encode(k.code));
+          $(o.util.encode(k.code));
           return;
         }
-        if (p && r.Worker) {
-          var $ = new Worker(o.filename);
-          $.onmessage = function(z) {
-            L(z.data);
-          }, $.postMessage(JSON.stringify({
+        if (g && r.Worker) {
+          var L = new Worker(o.filename);
+          L.onmessage = function(z) {
+            $(z.data);
+          }, L.postMessage(JSON.stringify({
             language: k.language,
             code: k.code,
             immediateClose: !0
           }));
         } else
-          L(o.highlight(k.code, k.grammar, k.language));
+          $(o.highlight(k.code, k.grammar, k.language));
       },
       /**
        * Low-level function, only use if you know what you’re doing. It accepts a string of text as input
@@ -14198,10 +14214,10 @@ var prism = { exports: {} };
        * @example
        * Prism.highlight('var foo = true;', Prism.languages.javascript, 'javascript');
        */
-      highlight: function(g, p, b) {
+      highlight: function(p, g, b) {
         var c = {
-          code: g,
-          grammar: p,
+          code: p,
+          grammar: g,
           language: b
         };
         if (o.hooks.run("before-tokenize", c), !c.grammar)
@@ -14232,15 +14248,15 @@ var prism = { exports: {} };
        *     }
        * });
        */
-      tokenize: function(g, p) {
-        var b = p.rest;
+      tokenize: function(p, g) {
+        var b = g.rest;
         if (b) {
           for (var c in b)
-            p[c] = b[c];
-          delete p.rest;
+            g[c] = b[c];
+          delete g.rest;
         }
         var _ = new y();
-        return A(_, _.head, g), f(g, _, p, _.head, 0), M(_);
+        return A(_, _.head, p), f(p, _, g, _.head, 0), M(_);
       },
       /**
        * @namespace
@@ -14261,9 +14277,9 @@ var prism = { exports: {} };
          * @param {HookCallback} callback The callback function which is given environment variables.
          * @public
          */
-        add: function(g, p) {
+        add: function(p, g) {
           var b = o.hooks.all;
-          b[g] = b[g] || [], b[g].push(p);
+          b[p] = b[p] || [], b[p].push(g);
         },
         /**
          * Runs a hook invoking all registered callbacks with the given environment variables.
@@ -14274,94 +14290,94 @@ var prism = { exports: {} };
          * @param {Object<string, any>} env The environment variables of the hook passed to all callbacks registered.
          * @public
          */
-        run: function(g, p) {
-          var b = o.hooks.all[g];
+        run: function(p, g) {
+          var b = o.hooks.all[p];
           if (!(!b || !b.length))
             for (var c = 0, _; _ = b[c++]; )
-              _(p);
+              _(g);
         }
       },
       Token: d
     };
     r.Prism = o;
-    function d(g, p, b, c) {
-      this.type = g, this.content = p, this.alias = b, this.length = (c || "").length | 0;
+    function d(p, g, b, c) {
+      this.type = p, this.content = g, this.alias = b, this.length = (c || "").length | 0;
     }
-    d.stringify = function g(p, b) {
-      if (typeof p == "string")
-        return p;
-      if (Array.isArray(p)) {
+    d.stringify = function p(g, b) {
+      if (typeof g == "string")
+        return g;
+      if (Array.isArray(g)) {
         var c = "";
-        return p.forEach(function(L) {
-          c += g(L, b);
+        return g.forEach(function($) {
+          c += p($, b);
         }), c;
       }
       var _ = {
-        type: p.type,
-        content: g(p.content, b),
+        type: g.type,
+        content: p(g.content, b),
         tag: "span",
-        classes: ["token", p.type],
+        classes: ["token", g.type],
         attributes: {},
         language: b
-      }, E = p.alias;
+      }, E = g.alias;
       E && (Array.isArray(E) ? Array.prototype.push.apply(_.classes, E) : _.classes.push(E)), o.hooks.run("wrap", _);
       var w = "";
       for (var k in _.attributes)
         w += " " + k + '="' + (_.attributes[k] || "").replace(/"/g, "&quot;") + '"';
       return "<" + _.tag + ' class="' + _.classes.join(" ") + '"' + w + ">" + _.content + "</" + _.tag + ">";
     };
-    function v(g, p, b, c) {
-      g.lastIndex = p;
-      var _ = g.exec(b);
+    function v(p, g, b, c) {
+      p.lastIndex = g;
+      var _ = p.exec(b);
       if (_ && c && _[1]) {
         var E = _[1].length;
         _.index += E, _[0] = _[0].slice(E);
       }
       return _;
     }
-    function f(g, p, b, c, _, E) {
+    function f(p, g, b, c, _, E) {
       for (var w in b)
         if (!(!b.hasOwnProperty(w) || !b[w])) {
           var k = b[w];
           k = Array.isArray(k) ? k : [k];
-          for (var L = 0; L < k.length; ++L) {
-            if (E && E.cause == w + "," + L)
+          for (var $ = 0; $ < k.length; ++$) {
+            if (E && E.cause == w + "," + $)
               return;
-            var $ = k[L], z = $.inside, O = !!$.lookbehind, R = !!$.greedy, P = $.alias;
-            if (R && !$.pattern.global) {
-              var U = $.pattern.toString().match(/[imsuy]*$/)[0];
-              $.pattern = RegExp($.pattern.source, U + "g");
+            var L = k[$], z = L.inside, F = !!L.lookbehind, R = !!L.greedy, P = L.alias;
+            if (R && !L.pattern.global) {
+              var U = L.pattern.toString().match(/[imsuy]*$/)[0];
+              L.pattern = RegExp(L.pattern.source, U + "g");
             }
-            for (var N = $.pattern || $, B = c.next, W = _; B !== p.tail && !(E && W >= E.reach); W += B.value.length, B = B.next) {
+            for (var N = L.pattern || L, B = c.next, W = _; B !== g.tail && !(E && W >= E.reach); W += B.value.length, B = B.next) {
               var V = B.value;
-              if (p.length > g.length)
+              if (g.length > p.length)
                 return;
               if (!(V instanceof d)) {
                 var G = 1, H;
                 if (R) {
-                  if (H = v(N, W, g, O), !H || H.index >= g.length)
+                  if (H = v(N, W, p, F), !H || H.index >= p.length)
                     break;
                   var ce = H.index, Q = H.index + H[0].length, te = W;
                   for (te += B.value.length; ce >= te; )
                     B = B.next, te += B.value.length;
                   if (te -= B.value.length, W = te, B.value instanceof d)
                     continue;
-                  for (var ee = B; ee !== p.tail && (te < Q || typeof ee.value == "string"); ee = ee.next)
+                  for (var ee = B; ee !== g.tail && (te < Q || typeof ee.value == "string"); ee = ee.next)
                     G++, te += ee.value.length;
-                  G--, V = g.slice(W, te), H.index -= W;
-                } else if (H = v(N, 0, V, O), !H)
+                  G--, V = p.slice(W, te), H.index -= W;
+                } else if (H = v(N, 0, V, F), !H)
                   continue;
                 var ce = H.index, fe = H[0], oe = V.slice(0, ce), he = V.slice(ce + fe.length), Ae = W + V.length;
                 E && Ae > E.reach && (E.reach = Ae);
                 var Se = B.prev;
-                oe && (Se = A(p, Se, oe), W += oe.length), x(p, Se, G);
+                oe && (Se = A(g, Se, oe), W += oe.length), x(g, Se, G);
                 var Ie = new d(w, z ? o.tokenize(fe, z) : fe, P, fe);
-                if (B = A(p, Se, Ie), he && A(p, B, he), G > 1) {
+                if (B = A(g, Se, Ie), he && A(g, B, he), G > 1) {
                   var pe = {
-                    cause: w + "," + L,
+                    cause: w + "," + $,
                     reach: Ae
                   };
-                  f(g, p, b, B.prev, W, pe), E && pe.reach > E.reach && (E.reach = pe.reach);
+                  f(p, g, b, B.prev, W, pe), E && pe.reach > E.reach && (E.reach = pe.reach);
                 }
               }
             }
@@ -14369,26 +14385,26 @@ var prism = { exports: {} };
         }
     }
     function y() {
-      var g = { value: null, prev: null, next: null }, p = { value: null, prev: g, next: null };
-      g.next = p, this.head = g, this.tail = p, this.length = 0;
+      var p = { value: null, prev: null, next: null }, g = { value: null, prev: p, next: null };
+      p.next = g, this.head = p, this.tail = g, this.length = 0;
     }
-    function A(g, p, b) {
-      var c = p.next, _ = { value: b, prev: p, next: c };
-      return p.next = _, c.prev = _, g.length++, _;
+    function A(p, g, b) {
+      var c = g.next, _ = { value: b, prev: g, next: c };
+      return g.next = _, c.prev = _, p.length++, _;
     }
-    function x(g, p, b) {
-      for (var c = p.next, _ = 0; _ < b && c !== g.tail; _++)
+    function x(p, g, b) {
+      for (var c = g.next, _ = 0; _ < b && c !== p.tail; _++)
         c = c.next;
-      p.next = c, c.prev = p, g.length -= _;
+      g.next = c, c.prev = g, p.length -= _;
     }
-    function M(g) {
-      for (var p = [], b = g.head.next; b !== g.tail; )
-        p.push(b.value), b = b.next;
-      return p;
+    function M(p) {
+      for (var g = [], b = p.head.next; b !== p.tail; )
+        g.push(b.value), b = b.next;
+      return g;
     }
     if (!r.document)
-      return r.addEventListener && (o.disableWorkerMessageHandler || r.addEventListener("message", function(g) {
-        var p = JSON.parse(g.data), b = p.language, c = p.code, _ = p.immediateClose;
+      return r.addEventListener && (o.disableWorkerMessageHandler || r.addEventListener("message", function(p) {
+        var g = JSON.parse(p.data), b = g.language, c = g.code, _ = g.immediateClose;
         r.postMessage(o.highlight(c, o.languages[b], b)), _ && r.close();
       }, !1)), o;
     var m = o.util.currentScript();
@@ -14794,16 +14810,16 @@ var prism = { exports: {} };
       tex: "latex"
     }, o = "data-src-status", d = "loading", v = "loaded", f = "failed", y = "pre[data-src]:not([" + o + '="' + v + '"]):not([' + o + '="' + d + '"])';
     function A(m, l, u) {
-      var g = new XMLHttpRequest();
-      g.open("GET", m, !0), g.onreadystatechange = function() {
-        g.readyState == 4 && (g.status < 400 && g.responseText ? l(g.responseText) : g.status >= 400 ? u(a(g.status, g.statusText)) : u(s));
-      }, g.send(null);
+      var p = new XMLHttpRequest();
+      p.open("GET", m, !0), p.onreadystatechange = function() {
+        p.readyState == 4 && (p.status < 400 && p.responseText ? l(p.responseText) : p.status >= 400 ? u(a(p.status, p.statusText)) : u(s));
+      }, p.send(null);
     }
     function x(m) {
       var l = /^\s*(\d+)\s*(?:(,)\s*(?:(\d+)\s*)?)?$/.exec(m || "");
       if (l) {
-        var u = Number(l[1]), g = l[2], p = l[3];
-        return g ? p ? [u, Number(p)] : [u, void 0] : [u, u];
+        var u = Number(l[1]), p = l[2], g = l[3];
+        return p ? g ? [u, Number(g)] : [u, void 0] : [u, u];
       }
     }
     t.hooks.add("before-highlightall", function(m) {
@@ -14817,21 +14833,21 @@ var prism = { exports: {} };
         m.code = "", l.setAttribute(o, d);
         var u = l.appendChild(document.createElement("CODE"));
         u.textContent = r;
-        var g = l.getAttribute("data-src"), p = m.language;
-        if (p === "none") {
-          var b = (/\.(\w+)$/.exec(g) || [, "none"])[1];
-          p = h[b] || b;
+        var p = l.getAttribute("data-src"), g = m.language;
+        if (g === "none") {
+          var b = (/\.(\w+)$/.exec(p) || [, "none"])[1];
+          g = h[b] || b;
         }
-        t.util.setLanguage(u, p), t.util.setLanguage(l, p);
+        t.util.setLanguage(u, g), t.util.setLanguage(l, g);
         var c = t.plugins.autoloader;
-        c && c.loadLanguages(p), A(
-          g,
+        c && c.loadLanguages(g), A(
+          p,
           function(_) {
             l.setAttribute(o, v);
             var E = x(l.getAttribute("data-range"));
             if (E) {
-              var w = _.split(/\r\n?|\n/g), k = E[0], L = E[1] == null ? w.length : E[1];
-              k < 0 && (k += w.length), k = Math.max(0, Math.min(k - 1, w.length)), L < 0 && (L += w.length), L = Math.max(0, Math.min(L, w.length)), _ = w.slice(k, L).join(`
+              var w = _.split(/\r\n?|\n/g), k = E[0], $ = E[1] == null ? w.length : E[1];
+              k < 0 && (k += w.length), k = Math.max(0, Math.min(k - 1, w.length)), $ < 0 && ($ += w.length), $ = Math.max(0, Math.min($, w.length)), _ = w.slice(k, $).join(`
 `), l.hasAttribute("data-start") || l.setAttribute("data-start", String(k + 1));
             }
             u.textContent = _, t.highlightElement(u);
@@ -14850,8 +14866,8 @@ var prism = { exports: {} };
        * @param {ParentNode} [container=document]
        */
       highlight: function(l) {
-        for (var u = (l || document).querySelectorAll(y), g = 0, p; p = u[g++]; )
-          t.highlightElement(p);
+        for (var u = (l || document).querySelectorAll(y), p = 0, g; g = u[p++]; )
+          t.highlightElement(g);
       }
     };
     var M = !1;
@@ -16113,20 +16129,20 @@ class Amuchina {
     _Amuchina_configuration.set(this, void 0), _Amuchina_allowElements.set(this, void 0), _Amuchina_allowAttributes.set(this, void 0), this.getConfiguration = () => cloneDeep(__classPrivateFieldGet(this, _Amuchina_configuration, "f")), this.sanitize = (f) => {
       const y = __classPrivateFieldGet(this, _Amuchina_allowElements, "f"), A = __classPrivateFieldGet(this, _Amuchina_allowAttributes, "f");
       return traverseElements(f, (x, M) => {
-        const m = x.namespaceURI || NAMESPACES.HTML, l = M.namespaceURI || NAMESPACES.HTML, u = NAMESPACES_ELEMENTS[m], g = NAMESPACES_ROOTS[m], p = NAMESPACES_PREFIXES[m], b = x.tagName.toLowerCase(), c = `${p}${b}`, E = `${p}*`;
-        if (!u.has(b) || !y.has(c) || m !== l && b !== g)
+        const m = x.namespaceURI || NAMESPACES.HTML, l = M.namespaceURI || NAMESPACES.HTML, u = NAMESPACES_ELEMENTS[m], p = NAMESPACES_ROOTS[m], g = NAMESPACES_PREFIXES[m], b = x.tagName.toLowerCase(), c = `${g}${b}`, E = `${g}*`;
+        if (!u.has(b) || !y.has(c) || m !== l && b !== p)
           M.removeChild(x);
         else {
           const w = x.getAttributeNames(), k = w.length;
           if (k) {
-            for (let L = 0; L < k; L++) {
-              const $ = w[L], z = A[$];
-              (!z || !z.has(E) && !z.has(c)) && x.removeAttribute($);
+            for (let $ = 0; $ < k; $++) {
+              const L = w[$], z = A[L];
+              (!z || !z.has(E) && !z.has(c)) && x.removeAttribute(L);
             }
             if (isElementFunky(x))
               if (isElementHyperlink(x)) {
-                const L = x.getAttribute("href");
-                L && isScriptOrDataUrlLoose(L) && isScriptOrDataUrl(x.protocol) && x.removeAttribute("href");
+                const $ = x.getAttribute("href");
+                $ && isScriptOrDataUrlLoose($) && isScriptOrDataUrl(x.protocol) && x.removeAttribute("href");
               } else isElementAction(x) ? isScriptOrDataUrl(x.action) && x.removeAttribute("action") : isElementFormAction(x) ? isScriptOrDataUrl(x.formAction) && x.removeAttribute("formaction") : isElementIframe(x) && (isScriptOrDataUrl(x.src) && x.removeAttribute("formaction"), x.setAttribute("sandbox", "allow-scripts"));
           }
         }
@@ -16257,18 +16273,18 @@ function instance$e(n, e, t) {
     latex_delimiters: h
   });
   function M(u) {
-    let g = u;
+    let p = u;
     if (o) {
-      const p = [];
+      const g = [];
       h.forEach((b, c) => {
         const _ = escapeRegExp(b.left), E = escapeRegExp(b.right), w = new RegExp(`${_}([\\s\\S]+?)${E}`, "g");
-        g = g.replace(w, (k, L) => (p.push(k), `%%%LATEX_BLOCK_${p.length - 1}%%%`));
-      }), g = x.parse(g), g = g.replace(/%%%LATEX_BLOCK_(\d+)%%%/g, (b, c) => p[parseInt(c, 10)]);
+        p = p.replace(w, (k, $) => (g.push(k), `%%%LATEX_BLOCK_${g.length - 1}%%%`));
+      }), p = x.parse(p), p = p.replace(/%%%LATEX_BLOCK_(\d+)%%%/g, (b, c) => g[parseInt(c, 10)]);
     }
-    return s && sanitize && (g = sanitize(g, f)), g;
+    return s && sanitize && (p = sanitize(p, f)), p;
   }
   async function m(u) {
-    h.length > 0 && u && h.some((p) => u.includes(p.left) && u.includes(p.right)) && renderMathInElement(y, {
+    h.length > 0 && u && h.some((g) => u.includes(g.left) && u.includes(g.right)) && renderMathInElement(y, {
       delimiters: h,
       throwOnError: !1
     });
@@ -16397,13 +16413,13 @@ const {
   children: children$d,
   claim_component: claim_component$6,
   claim_element: claim_element$b,
-  claim_space: claim_space$a,
+  claim_space: claim_space$b,
   create_component: create_component$6,
   create_slot: create_slot$2,
   destroy_component: destroy_component$6,
   detach: detach$f,
   element: element$b,
-  empty: empty$4,
+  empty: empty$5,
   get_all_dirty_from_scope: get_all_dirty_from_scope$2,
   get_slot_changes: get_slot_changes$2,
   group_outros: group_outros$6,
@@ -16411,13 +16427,13 @@ const {
   insert_hydration: insert_hydration$f,
   mount_component: mount_component$6,
   safe_not_equal: safe_not_equal$g,
-  space: space$a,
+  space: space$b,
   toggle_class: toggle_class$7,
   transition_in: transition_in$6,
   transition_out: transition_out$6,
   update_slot_base: update_slot_base$2
 } = window.__gradio__svelte__internal;
-function create_if_block$8(n) {
+function create_if_block$9(n) {
   let e, t;
   return e = new Info({
     props: {
@@ -16473,16 +16489,16 @@ function create_fragment$f(n) {
   );
   let o = (
     /*info*/
-    n[1] && create_if_block$8(n)
+    n[1] && create_if_block$9(n)
   );
   return {
     c() {
-      e = element$b("span"), h && h.c(), t = space$a(), o && o.c(), r = empty$4(), this.h();
+      e = element$b("span"), h && h.c(), t = space$b(), o && o.c(), r = empty$5(), this.h();
     },
     l(d) {
       e = claim_element$b(d, "SPAN", { "data-testid": !0, class: !0 });
       var v = children$d(e);
-      h && h.l(v), v.forEach(detach$f), t = claim_space$a(d), o && o.l(d), r = empty$4(), this.h();
+      h && h.l(v), v.forEach(detach$f), t = claim_space$b(d), o && o.l(d), r = empty$5(), this.h();
     },
     h() {
       attr$e(e, "data-testid", "block-info"), attr$e(e, "class", "svelte-22c38v"), toggle_class$7(e, "sr-only", !/*show_label*/
@@ -16528,7 +16544,7 @@ function create_fragment$f(n) {
         d[1] != null
       ), /*info*/
       d[1] ? o ? (o.p(d, v), v & /*info*/
-      2 && transition_in$6(o, 1)) : (o = create_if_block$8(d), o.c(), transition_in$6(o, 1), o.m(r.parentNode, r)) : o && (group_outros$6(), transition_out$6(o, 1, 1, () => {
+      2 && transition_in$6(o, 1)) : (o = create_if_block$9(d), o.c(), transition_in$6(o, 1), o.m(r.parentNode, r)) : o && (group_outros$6(), transition_out$6(o, 1, 1, () => {
         o = null;
       }), check_outros$6());
     },
@@ -16563,7 +16579,7 @@ const {
   children: children$c,
   claim_component: claim_component$5,
   claim_element: claim_element$a,
-  claim_space: claim_space$9,
+  claim_space: claim_space$a,
   claim_text: claim_text$8,
   construct_svelte_component,
   create_component: create_component$5,
@@ -16581,14 +16597,14 @@ const {
   safe_not_equal: safe_not_equal$f,
   set_data: set_data$6,
   set_style: set_style$4,
-  space: space$9,
+  space: space$a,
   text: text$9,
   toggle_class: toggle_class$6,
   transition_in: transition_in$5,
   transition_out: transition_out$5,
   update_slot_base: update_slot_base$1
 } = window.__gradio__svelte__internal;
-function create_if_block$7(n) {
+function create_if_block$8(n) {
   let e, t;
   return {
     c() {
@@ -16628,7 +16644,7 @@ function create_if_block$7(n) {
 function create_fragment$e(n) {
   let e, t, r, a, s, h, o, d, v = (
     /*show_label*/
-    n[2] && create_if_block$7(n)
+    n[2] && create_if_block$8(n)
   );
   var f = (
     /*Icon*/
@@ -16650,7 +16666,7 @@ function create_fragment$e(n) {
   );
   return {
     c() {
-      e = element$a("button"), v && v.c(), t = space$9(), r = element$a("div"), a && create_component$5(a.$$.fragment), s = space$9(), x && x.c(), this.h();
+      e = element$a("button"), v && v.c(), t = space$a(), r = element$a("div"), a && create_component$5(a.$$.fragment), s = space$a(), x && x.c(), this.h();
     },
     l(M) {
       e = claim_element$a(M, "BUTTON", {
@@ -16660,9 +16676,9 @@ function create_fragment$e(n) {
         class: !0
       });
       var m = children$c(e);
-      v && v.l(m), t = claim_space$9(m), r = claim_element$a(m, "DIV", { class: !0 });
+      v && v.l(m), t = claim_space$a(m), r = claim_element$a(m, "DIV", { class: !0 });
       var l = children$c(r);
-      a && claim_component$5(a.$$.fragment, l), s = claim_space$9(l), x && x.l(l), l.forEach(detach$e), m.forEach(detach$e), this.h();
+      a && claim_component$5(a.$$.fragment, l), s = claim_space$a(l), x && x.l(l), l.forEach(detach$e), m.forEach(detach$e), this.h();
     },
     h() {
       attr$d(r, "class", "svelte-vk34kx"), toggle_class$6(
@@ -16737,7 +16753,7 @@ function create_fragment$e(n) {
     },
     p(M, [m]) {
       if (/*show_label*/
-      M[2] ? v ? v.p(M, m) : (v = create_if_block$7(M), v.c(), v.m(e, t)) : v && (v.d(1), v = null), m & /*Icon*/
+      M[2] ? v ? v.p(M, m) : (v = create_if_block$8(M), v.c(), v.m(e, t)) : v && (v.d(1), v = null), m & /*Icon*/
       1 && f !== (f = /*Icon*/
       M[0])) {
         if (a) {
@@ -16855,11 +16871,11 @@ function create_fragment$e(n) {
 }
 function instance$b(n, e, t) {
   let r, { $$slots: a = {}, $$scope: s } = e, { Icon: h } = e, { label: o = "" } = e, { show_label: d = !1 } = e, { pending: v = !1 } = e, { size: f = "small" } = e, { padded: y = !0 } = e, { highlight: A = !1 } = e, { disabled: x = !1 } = e, { hasPopup: M = !1 } = e, { color: m = "var(--block-label-text-color)" } = e, { transparent: l = !1 } = e, { background: u = "var(--block-background-fill)" } = e;
-  function g(p) {
-    bubble$1.call(this, n, p);
+  function p(g) {
+    bubble$1.call(this, n, g);
   }
-  return n.$$set = (p) => {
-    "Icon" in p && t(0, h = p.Icon), "label" in p && t(1, o = p.label), "show_label" in p && t(2, d = p.show_label), "pending" in p && t(3, v = p.pending), "size" in p && t(4, f = p.size), "padded" in p && t(5, y = p.padded), "highlight" in p && t(6, A = p.highlight), "disabled" in p && t(7, x = p.disabled), "hasPopup" in p && t(8, M = p.hasPopup), "color" in p && t(12, m = p.color), "transparent" in p && t(9, l = p.transparent), "background" in p && t(10, u = p.background), "$$scope" in p && t(13, s = p.$$scope);
+  return n.$$set = (g) => {
+    "Icon" in g && t(0, h = g.Icon), "label" in g && t(1, o = g.label), "show_label" in g && t(2, d = g.show_label), "pending" in g && t(3, v = g.pending), "size" in g && t(4, f = g.size), "padded" in g && t(5, y = g.padded), "highlight" in g && t(6, A = g.highlight), "disabled" in g && t(7, x = g.disabled), "hasPopup" in g && t(8, M = g.hasPopup), "color" in g && t(12, m = g.color), "transparent" in g && t(9, l = g.transparent), "background" in g && t(10, u = g.background), "$$scope" in g && t(13, s = g.$$scope);
   }, n.$$.update = () => {
     n.$$.dirty & /*highlight, color*/
     4160 && t(11, r = A ? "var(--color-accent)" : m);
@@ -16879,7 +16895,7 @@ function instance$b(n, e, t) {
     m,
     s,
     a,
-    g
+    p
   ];
 }
 class IconButton extends SvelteComponent$e {
@@ -17380,26 +17396,26 @@ const {
   attr: attr$9,
   children: children$8,
   claim_element: claim_element$9,
-  claim_space: claim_space$8,
+  claim_space: claim_space$9,
   detach: detach$a,
   element: element$9,
-  get_svelte_dataset: get_svelte_dataset$4,
+  get_svelte_dataset: get_svelte_dataset$5,
   init: init$a,
   insert_hydration: insert_hydration$a,
   listen: listen$4,
   noop: noop$a,
   run_all: run_all$4,
   safe_not_equal: safe_not_equal$b,
-  space: space$8
+  space: space$9
 } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$6 } = window.__gradio__svelte__internal;
-function create_if_block$6(n) {
+function create_if_block$7(n) {
   let e, t = '<svg data-slot="icon" fill="none" stroke-width="1.5" stroke="currentColor" viewBox="0 0 24 24" xmlns="http://www.w3.org/2000/svg" aria-hidden="true" class="w-4 h-4 svelte-8wrmgx"><path stroke-linecap="round" stroke-linejoin="round" d="M12 9v6m3-3H9m12 0a9 9 0 1 1-18 0 9 9 0 0 1 18 0Z" class="svelte-8wrmgx"></path></svg> <span class="svelte-8wrmgx">Covalent modifcation</span>', r, a;
   return {
     c() {
       e = element$9("button"), e.innerHTML = t, this.h();
     },
     l(s) {
-      e = claim_element$9(s, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$4(e) !== "svelte-1ffedkh" && (e.innerHTML = t), this.h();
+      e = claim_element$9(s, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$5(e) !== "svelte-1ffedkh" && (e.innerHTML = t), this.h();
     },
     h() {
       attr$9(e, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx");
@@ -17421,18 +17437,18 @@ function create_if_block$6(n) {
 function create_fragment$a(n) {
   let e, t, r, a = '<svg data-slot="icon" fill="none" stroke-width="1.5" stroke="currentColor" viewBox="0 0 24 24" xmlns="http://www.w3.org/2000/svg" aria-hidden="true" class="w-4 h-4 svelte-8wrmgx"><path stroke-linecap="round" stroke-linejoin="round" d="M12 9v6m3-3H9m12 0a9 9 0 1 1-18 0 9 9 0 0 1 18 0Z" class="svelte-8wrmgx"></path></svg> <span class="svelte-8wrmgx">Protein</span>', s, h, o = '<svg data-slot="icon" fill="none" stroke-width="1.5" stroke="currentColor" viewBox="0 0 24 24" xmlns="http://www.w3.org/2000/svg" aria-hidden="true" class="w-4 h-4 svelte-8wrmgx"><path stroke-linecap="round" stroke-linejoin="round" d="M12 9v6m3-3H9m12 0a9 9 0 1 1-18 0 9 9 0 0 1 18 0Z" class="svelte-8wrmgx"></path></svg> <span class="svelte-8wrmgx">Nucleic acid</span>', d, v, f = '<svg data-slot="icon" fill="none" stroke-width="1.5" stroke="currentColor" viewBox="0 0 24 24" xmlns="http://www.w3.org/2000/svg" aria-hidden="true" class="w-4 h-4 svelte-8wrmgx"><path stroke-linecap="round" stroke-linejoin="round" d="M12 9v6m3-3H9m12 0a9 9 0 1 1-18 0 9 9 0 0 1 18 0Z" class="svelte-8wrmgx"></path></svg> <span class="svelte-8wrmgx">Small molecule</span>', y, A, x, M = (
     /*displayCovMod*/
-    n[0] && create_if_block$6(n)
+    n[0] && create_if_block$7(n)
   );
   return {
     c() {
-      e = element$9("div"), t = element$9("div"), r = element$9("button"), r.innerHTML = a, s = space$8(), h = element$9("button"), h.innerHTML = o, d = space$8(), v = element$9("button"), v.innerHTML = f, y = space$8(), M && M.c(), this.h();
+      e = element$9("div"), t = element$9("div"), r = element$9("button"), r.innerHTML = a, s = space$9(), h = element$9("button"), h.innerHTML = o, d = space$9(), v = element$9("button"), v.innerHTML = f, y = space$9(), M && M.c(), this.h();
     },
     l(m) {
       e = claim_element$9(m, "DIV", { class: !0 });
       var l = children$8(e);
       t = claim_element$9(l, "DIV", { class: !0 });
       var u = children$8(t);
-      r = claim_element$9(u, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$4(r) !== "svelte-1qxi4yp" && (r.innerHTML = a), s = claim_space$8(u), h = claim_element$9(u, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$4(h) !== "svelte-z7tz1a" && (h.innerHTML = o), d = claim_space$8(u), v = claim_element$9(u, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$4(v) !== "svelte-3ixhlr" && (v.innerHTML = f), y = claim_space$8(u), M && M.l(u), u.forEach(detach$a), l.forEach(detach$a), this.h();
+      r = claim_element$9(u, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$5(r) !== "svelte-1qxi4yp" && (r.innerHTML = a), s = claim_space$9(u), h = claim_element$9(u, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$5(h) !== "svelte-z7tz1a" && (h.innerHTML = o), d = claim_space$9(u), v = claim_element$9(u, "BUTTON", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$5(v) !== "svelte-3ixhlr" && (v.innerHTML = f), y = claim_space$9(u), M && M.l(u), u.forEach(detach$a), l.forEach(detach$a), this.h();
     },
     h() {
       attr$9(r, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(h, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(v, "class", "flex items-center space-x-2 block px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx"), attr$9(t, "class", "flex justify-center mt-2 svelte-8wrmgx"), attr$9(e, "class", "svelte-8wrmgx");
@@ -17461,7 +17477,7 @@ function create_fragment$a(n) {
     },
     p(m, [l]) {
       /*displayCovMod*/
-      m[0] ? M ? M.p(m, l) : (M = create_if_block$6(m), M.c(), M.m(t, null)) : M && (M.d(1), M = null);
+      m[0] ? M ? M.p(m, l) : (M = create_if_block$7(m), M.c(), M.m(t, null)) : M && (M.d(1), M = null);
     },
     i: noop$a,
     o: noop$a,
@@ -17516,11 +17532,11 @@ const {
   attr: attr$8,
   children: children$7,
   claim_element: claim_element$8,
-  claim_space: claim_space$7,
+  claim_space: claim_space$8,
   claim_text: claim_text$7,
   detach: detach$9,
   element: element$8,
-  get_svelte_dataset: get_svelte_dataset$3,
+  get_svelte_dataset: get_svelte_dataset$4,
   init: init$9,
   insert_hydration: insert_hydration$9,
   listen: listen$3,
@@ -17528,7 +17544,7 @@ const {
   prevent_default,
   run_all: run_all$3,
   safe_not_equal: safe_not_equal$a,
-  space: space$7,
+  space: space$8,
   text: text$8
 } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$5 } = window.__gradio__svelte__internal;
 function create_fragment$9(n) {
@@ -17538,10 +17554,10 @@ function create_fragment$9(n) {
       /*currentSel*/
       n[3]
     ] + ""
-  ), d, v, f, y = '<ul class="py-2 text-sm text-gray-700 dark:text-gray-200 svelte-8wrmgx" aria-labelledby="dropdown-button"><li class="svelte-8wrmgx"><button type="button" class="inline-flex w-full px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx">Pubchem</button></li> <li class="svelte-8wrmgx"><button type="button" class="inline-flex w-full px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx">RCSB 3 Letter code</button></li></ul>', A, x, M, m, l, u = '<svg class="w-4 h-4 svelte-8wrmgx" aria-hidden="true" xmlns="http://www.w3.org/2000/svg" fill="none" viewBox="0 0 20 20"><path stroke="currentColor" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="m19 19-4-4m0-7A7 7 0 1 1 1 8a7 7 0 0 1 14 0Z" class="svelte-8wrmgx"></path></svg> <span class="sr-only svelte-8wrmgx">Search</span>', g, p;
+  ), d, v, f, y = '<ul class="py-2 text-sm text-gray-700 dark:text-gray-200 svelte-8wrmgx" aria-labelledby="dropdown-button"><li class="svelte-8wrmgx"><button type="button" class="inline-flex w-full px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx">Pubchem</button></li> <li class="svelte-8wrmgx"><button type="button" class="inline-flex w-full px-4 py-2 hover:bg-gray-100 dark:hover:bg-gray-600 dark:hover:text-white svelte-8wrmgx">RCSB 3 Letter code</button></li></ul>', A, x, M, m, l, u = '<svg class="w-4 h-4 svelte-8wrmgx" aria-hidden="true" xmlns="http://www.w3.org/2000/svg" fill="none" viewBox="0 0 20 20"><path stroke="currentColor" stroke-linecap="round" stroke-linejoin="round" stroke-width="2" d="m19 19-4-4m0-7A7 7 0 1 1 1 8a7 7 0 0 1 14 0Z" class="svelte-8wrmgx"></path></svg> <span class="sr-only svelte-8wrmgx">Search</span>', p, g;
   return {
     c() {
-      e = element$8("form"), t = element$8("div"), r = element$8("label"), r.textContent = a, s = space$7(), h = element$8("button"), d = text$8(o), v = space$7(), f = element$8("div"), f.innerHTML = y, A = space$7(), x = element$8("div"), M = element$8("input"), m = space$7(), l = element$8("button"), l.innerHTML = u, this.h();
+      e = element$8("form"), t = element$8("div"), r = element$8("label"), r.textContent = a, s = space$8(), h = element$8("button"), d = text$8(o), v = space$8(), f = element$8("div"), f.innerHTML = y, A = space$8(), x = element$8("div"), M = element$8("input"), m = space$8(), l = element$8("button"), l.innerHTML = u, this.h();
     },
     l(b) {
       e = claim_element$8(b, "FORM", { class: !0 });
@@ -17552,29 +17568,29 @@ function create_fragment$9(n) {
         for: !0,
         class: !0,
         "data-svelte-h": !0
-      }), get_svelte_dataset$3(r) !== "svelte-1ryblwq" && (r.textContent = a), s = claim_space$7(_), h = claim_element$8(_, "BUTTON", {
+      }), get_svelte_dataset$4(r) !== "svelte-1ryblwq" && (r.textContent = a), s = claim_space$8(_), h = claim_element$8(_, "BUTTON", {
         id: !0,
         "data-dropdown-toggle": !0,
         class: !0,
         type: !0
       });
       var E = children$7(h);
-      d = claim_text$7(E, o), E.forEach(detach$9), v = claim_space$7(_), f = claim_element$8(_, "DIV", {
+      d = claim_text$7(E, o), E.forEach(detach$9), v = claim_space$8(_), f = claim_element$8(_, "DIV", {
         id: !0,
         class: !0,
         "data-svelte-h": !0
-      }), get_svelte_dataset$3(f) !== "svelte-1mzhtad" && (f.innerHTML = y), A = claim_space$7(_), x = claim_element$8(_, "DIV", { class: !0 });
+      }), get_svelte_dataset$4(f) !== "svelte-1mzhtad" && (f.innerHTML = y), A = claim_space$8(_), x = claim_element$8(_, "DIV", { class: !0 });
       var w = children$7(x);
       M = claim_element$8(w, "INPUT", {
         type: !0,
         id: !0,
         class: !0,
         placeholder: !0
-      }), m = claim_space$7(w), l = claim_element$8(w, "BUTTON", {
+      }), m = claim_space$8(w), l = claim_element$8(w, "BUTTON", {
         type: !0,
         class: !0,
         "data-svelte-h": !0
-      }), get_svelte_dataset$3(l) !== "svelte-12vvhvj" && (l.innerHTML = u), w.forEach(detach$9), _.forEach(detach$9), c.forEach(detach$9), this.h();
+      }), get_svelte_dataset$4(l) !== "svelte-12vvhvj" && (l.innerHTML = u), w.forEach(detach$9), _.forEach(detach$9), c.forEach(detach$9), this.h();
     },
     h() {
       attr$8(r, "for", "search-dropdown"), attr$8(r, "class", "mb-2 text-sm font-medium text-gray-900 sr-only dark:text-white svelte-8wrmgx"), attr$8(h, "id", "dropdown-button"), attr$8(h, "data-dropdown-toggle", "dropdown"), attr$8(h, "class", "flex-shrink-0 z-10 inline-flex items-center py-2.5 px-4 text-sm font-medium text-center text-gray-900 bg-gray-100 border border-gray-300 rounded-s-lg hover:bg-gray-200 focus:ring-4 focus:outline-none focus:ring-gray-100 dark:bg-gray-700 dark:hover:bg-gray-600 dark:focus:ring-gray-700 dark:text-white dark:border-gray-600 svelte-8wrmgx"), attr$8(h, "type", "button"), attr$8(f, "id", "dropdown"), attr$8(f, "class", "z-10 hidden bg-white divide-y divide-gray-100 rounded-lg shadow w-44 dark:bg-gray-700 svelte-8wrmgx"), attr$8(M, "type", "search"), attr$8(M, "id", "search-dropdown"), attr$8(M, "class", "block p-2.5 w-full z-20 text-sm text-gray-900 bg-gray-50 rounded-e-lg border-s-gray-50 border-s-2 border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-s-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:border-blue-500 svelte-8wrmgx"), attr$8(
@@ -17588,7 +17604,7 @@ function create_fragment$9(n) {
       ), attr$8(l, "type", "submit"), attr$8(l, "class", "absolute top-0 end-0 p-2.5 text-sm font-medium h-full text-white bg-blue-700 rounded-e-lg border border-blue-700 hover:bg-blue-800 focus:ring-4 focus:outline-none focus:ring-blue-300 dark:bg-blue-600 dark:hover:bg-blue-700 dark:focus:ring-blue-800 svelte-8wrmgx"), attr$8(x, "class", "relative w-full svelte-8wrmgx"), attr$8(t, "class", "flex svelte-8wrmgx"), attr$8(e, "class", "max-w-lg mx-auto mb-2 my-2 svelte-8wrmgx");
     },
     m(b, c) {
-      insert_hydration$9(b, e, c), append_hydration$7(e, t), append_hydration$7(t, r), append_hydration$7(t, s), append_hydration$7(t, h), append_hydration$7(h, d), append_hydration$7(t, v), append_hydration$7(t, f), append_hydration$7(t, A), append_hydration$7(t, x), append_hydration$7(x, M), append_hydration$7(x, m), append_hydration$7(x, l), g || (p = [
+      insert_hydration$9(b, e, c), append_hydration$7(e, t), append_hydration$7(t, r), append_hydration$7(t, s), append_hydration$7(t, h), append_hydration$7(h, d), append_hydration$7(t, v), append_hydration$7(t, f), append_hydration$7(t, A), append_hydration$7(t, x), append_hydration$7(x, M), append_hydration$7(x, m), append_hydration$7(x, l), p || (g = [
         listen$3(
           M,
           "input",
@@ -17599,13 +17615,13 @@ function create_fragment$9(n) {
           /*triggerFetch*/
           n[4]
         ))
-      ], g = !0);
+      ], p = !0);
     },
     p: noop$9,
     i: noop$9,
     o: noop$9,
     d(b) {
-      b && detach$9(e), g = !1, run_all$3(p);
+      b && detach$9(e), p = !1, run_all$3(g);
     }
   };
 }
@@ -17652,21 +17668,21 @@ const {
   attr: attr$7,
   children: children$6,
   claim_element: claim_element$7,
-  claim_space: claim_space$6,
+  claim_space: claim_space$7,
   claim_text: claim_text$6,
-  destroy_each: destroy_each$2,
+  destroy_each: destroy_each$3,
   detach: detach$8,
   element: element$7,
-  ensure_array_like: ensure_array_like$2,
+  ensure_array_like: ensure_array_like$3,
   init: init$8,
   insert_hydration: insert_hydration$8,
   noop: noop$8,
   safe_not_equal: safe_not_equal$9,
   set_style: set_style$2,
-  space: space$6,
+  space: space$7,
   text: text$7
 } = window.__gradio__svelte__internal;
-function get_each_context$2(n, e, t) {
+function get_each_context$3(n, e, t) {
   const r = n.slice();
   return r[3] = e[t], r[5] = t, r;
 }
@@ -17709,8 +17725,8 @@ function create_each_block_1$2(n) {
     }
   };
 }
-function create_each_block$2(n) {
-  let e, t, r = ensure_array_like$2(
+function create_each_block$3(n) {
+  let e, t, r = ensure_array_like$3(
     /*chunk*/
     n[3]
   ), a = [];
@@ -17721,14 +17737,14 @@ function create_each_block$2(n) {
       e = element$7("div");
       for (let s = 0; s < a.length; s += 1)
         a[s].c();
-      t = space$6(), this.h();
+      t = space$7(), this.h();
     },
     l(s) {
       e = claim_element$7(s, "DIV", { class: !0 });
       var h = children$6(e);
       for (let o = 0; o < a.length; o += 1)
         a[o].l(h);
-      t = claim_space$6(h), h.forEach(detach$8), this.h();
+      t = claim_space$7(h), h.forEach(detach$8), this.h();
     },
     h() {
       attr$7(e, "class", "sequence__chunk svelte-hhspdt");
@@ -17742,7 +17758,7 @@ function create_each_block$2(n) {
     p(s, h) {
       if (h & /*chunk_ids, chunked_seq*/
       3) {
-        r = ensure_array_like$2(
+        r = ensure_array_like$3(
           /*chunk*/
           s[3]
         );
@@ -17757,17 +17773,17 @@ function create_each_block$2(n) {
       }
     },
     d(s) {
-      s && detach$8(e), destroy_each$2(a, s);
+      s && detach$8(e), destroy_each$3(a, s);
     }
   };
 }
 function create_fragment$8(n) {
-  let e, t = ensure_array_like$2(
+  let e, t = ensure_array_like$3(
     /*chunked_seq*/
     n[0]
   ), r = [];
   for (let a = 0; a < t.length; a += 1)
-    r[a] = create_each_block$2(get_each_context$2(n, t, a));
+    r[a] = create_each_block$3(get_each_context$3(n, t, a));
   return {
     c() {
       e = element$7("div");
@@ -17793,14 +17809,14 @@ function create_fragment$8(n) {
     p(a, [s]) {
       if (s & /*chunked_seq, chunk_ids*/
       3) {
-        t = ensure_array_like$2(
+        t = ensure_array_like$3(
           /*chunked_seq*/
           a[0]
         );
         let h;
         for (h = 0; h < t.length; h += 1) {
-          const o = get_each_context$2(a, t, h);
-          r[h] ? r[h].p(o, s) : (r[h] = create_each_block$2(o), r[h].c(), r[h].m(e, null));
+          const o = get_each_context$3(a, t, h);
+          r[h] ? r[h].p(o, s) : (r[h] = create_each_block$3(o), r[h].c(), r[h].m(e, null));
         }
         for (; h < r.length; h += 1)
           r[h].d(1);
@@ -17810,7 +17826,7 @@ function create_fragment$8(n) {
     i: noop$8,
     o: noop$8,
     d(a) {
-      a && detach$8(e), destroy_each$2(r, a);
+      a && detach$8(e), destroy_each$3(r, a);
     }
   };
 }
@@ -17825,7 +17841,7 @@ class Sequence extends SvelteComponent$8 {
     super(), init$8(this, e, instance$8, create_fragment$8, safe_not_equal$9, { seq: 2 });
   }
 }
-var _3Dmol = { exports: {} };
+var _3Dmol$1 = { exports: {} };
 /*!
  * 3dmol v2.4.0
  * JavaScript/TypeScript molecular visualization library
@@ -18458,31 +18474,31 @@ var _3Dmol = { exports: {} };
             function f(M, m) {
               const l = { version: m }, u = {
                 length: M.readUint32()
-              }, g = y(M);
-              Array.isArray(g) || (u.id = g.recordId, u.name = g.recordName, l.dimensions = g.dimensions), l.globalAttributes = A(M);
-              const p = x(M, u?.id, m);
-              return Array.isArray(p) || (l.variables = p.variables, u.recordStep = p.recordStep), l.recordDimension = u, l;
+              }, p = y(M);
+              Array.isArray(p) || (u.id = p.recordId, u.name = p.recordName, l.dimensions = p.dimensions), l.globalAttributes = A(M);
+              const g = x(M, u?.id, m);
+              return Array.isArray(g) || (l.variables = g.variables, u.recordStep = g.recordStep), l.recordDimension = u, l;
             }
             function y(M) {
               const m = {};
               let l, u;
-              const g = M.readUint32();
-              let p;
-              if (g === s)
+              const p = M.readUint32();
+              let g;
+              if (p === s)
                 return (0, a.notNetcdf)(M.readUint32() !== s, "wrong empty tag for list of dimensions"), [];
               {
-                (0, a.notNetcdf)(g !== h, "wrong tag for list of dimensions");
+                (0, a.notNetcdf)(p !== h, "wrong tag for list of dimensions");
                 const b = M.readUint32();
-                p = new Array(b);
+                g = new Array(b);
                 for (let c = 0; c < b; c++) {
                   const _ = (0, a.readName)(M), E = M.readUint32();
-                  E === v && (l = c, u = _), p[c] = {
+                  E === v && (l = c, u = _), g[c] = {
                     name: _,
                     size: E
                   };
                 }
               }
-              return l !== void 0 && (m.recordId = l), u !== void 0 && (m.recordName = u), m.dimensions = p, m;
+              return l !== void 0 && (m.recordId = l), u !== void 0 && (m.recordName = u), m.dimensions = g, m;
             }
             function A(M) {
               const m = M.readUint32();
@@ -18493,12 +18509,12 @@ var _3Dmol = { exports: {} };
                 (0, a.notNetcdf)(m !== d, "wrong tag for list of attributes");
                 const u = M.readUint32();
                 l = new Array(u);
-                for (let g = 0; g < u; g++) {
-                  const p = (0, a.readName)(M), b = M.readUint32();
+                for (let p = 0; p < u; p++) {
+                  const g = (0, a.readName)(M), b = M.readUint32();
                   (0, a.notNetcdf)(b < 1 || b > 6, `non valid type ${b}`);
                   const c = M.readUint32(), _ = (0, r.readType)(M, b, c);
-                  (0, a.padding)(M), l[g] = {
-                    name: p,
+                  (0, a.padding)(M), l[p] = {
+                    name: g,
                     type: (0, r.num2str)(b),
                     value: _
                   };
@@ -18508,37 +18524,37 @@ var _3Dmol = { exports: {} };
             }
             function x(M, m, l) {
               const u = M.readUint32();
-              let g = 0, p;
+              let p = 0, g;
               if (u === s)
                 return (0, a.notNetcdf)(M.readUint32() !== s, "wrong empty tag for list of variables"), [];
               {
                 (0, a.notNetcdf)(u !== o, "wrong tag for list of variables");
                 const b = M.readUint32();
-                p = new Array(b);
+                g = new Array(b);
                 for (let c = 0; c < b; c++) {
                   const _ = (0, a.readName)(M), E = M.readUint32(), w = new Array(E);
                   for (let R = 0; R < E; R++)
                     w[R] = M.readUint32();
-                  const k = A(M), L = M.readUint32();
-                  (0, a.notNetcdf)(L < 1 && L > 6, `non valid type ${L}`);
-                  const $ = M.readUint32();
+                  const k = A(M), $ = M.readUint32();
+                  (0, a.notNetcdf)($ < 1 && $ > 6, `non valid type ${$}`);
+                  const L = M.readUint32();
                   let z = M.readUint32();
                   l === 2 && ((0, a.notNetcdf)(z > 0, "offsets larger than 4GB not supported"), z = M.readUint32());
-                  let O = !1;
-                  typeof m < "u" && w[0] === m && (g += $, O = !0), p[c] = {
+                  let F = !1;
+                  typeof m < "u" && w[0] === m && (p += L, F = !0), g[c] = {
                     name: _,
                     dimensions: w,
                     attributes: k,
-                    type: (0, r.num2str)(L),
-                    size: $,
+                    type: (0, r.num2str)($),
+                    size: L,
                     offset: z,
-                    record: O
+                    record: F
                   };
                 }
               }
               return {
-                variables: p,
-                recordStep: g
+                variables: g,
+                recordStep: p
               };
             }
           }
@@ -20564,44 +20580,44 @@ void main() {
             var s;
             (function(h) {
               function o(m, l, u) {
-                var g = Math.hypot(m, l), p, b, c, _, E;
-                g < 1e-4 ? (b = 0, c = 1) : (b = -m / g, c = l / g), l = -b * m + c * l, p = Math.hypot(l, u), p < 1e-4 ? (_ = 0, E = 1) : (_ = u / p, E = l / p);
+                var p = Math.hypot(m, l), g, b, c, _, E;
+                p < 1e-4 ? (b = 0, c = 1) : (b = -m / p, c = l / p), l = -b * m + c * l, g = Math.hypot(l, u), g < 1e-4 ? (_ = 0, E = 1) : (_ = u / g, E = l / g);
                 var w = new Float32Array(9);
                 return w[0] = c, w[1] = b, w[2] = 0, w[3] = -b * E, w[4] = c * E, w[5] = _, w[6] = b * _, w[7] = -c * _, w[8] = E, w;
               }
               class d {
                 constructor() {
                   this.cache = {};
-                  let l = [], u = 4, g = Math.pow(2, u), p = 2, b = Math.pow(2, p), c = g / b, _;
-                  for (l[0] = new r.Vector3(-1, 0, 0), l[c] = new r.Vector3(0, 0, 1), l[c * 2] = new r.Vector3(1, 0, 0), l[c * 3] = new r.Vector3(0, 0, -1), p = 3; p <= u; p++) {
-                    for (b = Math.pow(2, p - 1), c = g / b, _ = 0; _ < b - 1; _++)
+                  let l = [], u = 4, p = Math.pow(2, u), g = 2, b = Math.pow(2, g), c = p / b, _;
+                  for (l[0] = new r.Vector3(-1, 0, 0), l[c] = new r.Vector3(0, 0, 1), l[c * 2] = new r.Vector3(1, 0, 0), l[c * 3] = new r.Vector3(0, 0, -1), g = 3; g <= u; g++) {
+                    for (b = Math.pow(2, g - 1), c = p / b, _ = 0; _ < b - 1; _++)
                       l[c / 2 + _ * c] = l[_ * c].clone().add(l[(_ + 1) * c]).normalize();
                     _ = b - 1, l[c / 2 + _ * c] = l[_ * c].clone().add(l[0]).normalize();
                   }
                   this.basisVectors = l;
                 }
-                getVerticesForRadius(l, u, g) {
-                  if (typeof this.cache < "u" && this.cache[l] !== void 0 && this.cache[l][u + g] !== void 0)
-                    return this.cache[l][u + g];
-                  for (var p = this.basisVectors.length, b = [], c = [], _, E = 0; E < p; E++)
+                getVerticesForRadius(l, u, p) {
+                  if (typeof this.cache < "u" && this.cache[l] !== void 0 && this.cache[l][u + p] !== void 0)
+                    return this.cache[l][u + p];
+                  for (var g = this.basisVectors.length, b = [], c = [], _, E = 0; E < g; E++)
                     b.push(this.basisVectors[E].clone().multiplyScalar(l)), b.push(this.basisVectors[E].clone().multiplyScalar(l)), _ = this.basisVectors[E].clone().normalize(), c.push(_), c.push(_);
-                  var w = [], k = 10, L = p, $ = 0, z = Math.PI * 2, O = 0, R = Math.PI, P, U, N = !1, B = !1;
+                  var w = [], k = 10, $ = g, L = 0, z = Math.PI * 2, F = 0, R = Math.PI, P, U, N = !1, B = !1;
                   for (U = 0; U <= k; U++) {
                     N = U === 0 || U === k, B = U === k / 2;
                     var W = [], V = [];
-                    for (P = 0; P <= L; P++) {
+                    for (P = 0; P <= $; P++) {
                       if (B) {
-                        var G = P < L ? 2 * P : 0;
+                        var G = P < $ ? 2 * P : 0;
                         V.push(G + 1), W.push(G);
                         continue;
                       }
-                      var H = P / L, Q = U / k;
+                      var H = P / $, Q = U / k;
                       if (!N || P === 0)
-                        if (P < L) {
+                        if (P < $) {
                           var te = new r.Vector3();
-                          te.x = -l * Math.cos($ + H * z) * Math.sin(O + Q * R), u == 1 ? te.y = 0 : te.y = l * Math.cos(O + Q * R), te.z = l * Math.sin($ + H * z) * Math.sin(O + Q * R), Math.abs(te.x) < 1e-5 && (te.x = 0), Math.abs(te.y) < 1e-5 && (te.y = 0), Math.abs(te.z) < 1e-5 && (te.z = 0), u == a.FLAT ? (_ = new r.Vector3(0, Math.cos(O + Q * R), 0), _.normalize()) : (_ = new r.Vector3(te.x, te.y, te.z), _.normalize()), b.push(te), c.push(_), W.push(b.length - 1);
+                          te.x = -l * Math.cos(L + H * z) * Math.sin(F + Q * R), u == 1 ? te.y = 0 : te.y = l * Math.cos(F + Q * R), te.z = l * Math.sin(L + H * z) * Math.sin(F + Q * R), Math.abs(te.x) < 1e-5 && (te.x = 0), Math.abs(te.y) < 1e-5 && (te.y = 0), Math.abs(te.z) < 1e-5 && (te.z = 0), u == a.FLAT ? (_ = new r.Vector3(0, Math.cos(F + Q * R), 0), _.normalize()) : (_ = new r.Vector3(te.x, te.y, te.z), _.normalize()), b.push(te), c.push(_), W.push(b.length - 1);
                         } else
-                          W.push(b.length - L);
+                          W.push(b.length - $);
                       else N && W.push(b.length - 1);
                     }
                     B && w.push(V), w.push(W);
@@ -20610,14 +20626,14 @@ void main() {
                     vertices: b,
                     normals: c,
                     verticesRows: w,
-                    w: L,
+                    w: $,
                     h: k
                   };
-                  return l in this.cache || (this.cache[l] = {}), this.cache[l][u + g] = ee, ee;
+                  return l in this.cache || (this.cache[l] = {}), this.cache[l][u + p] = ee, ee;
                 }
               }
               var v = new d();
-              function f(m, l, u, g, p, b = 0, c = 0) {
+              function f(m, l, u, p, g, b = 0, c = 0) {
                 if (!l || !u)
                   return;
                 let _ = function(Me) {
@@ -20629,39 +20645,39 @@ void main() {
                 };
                 b = _(b), c = _(c);
                 var E = c || b;
-                p = p || { r: 0, g: 0, b: 0 };
-                var w = o(u.x - l.x, u.y - l.y, u.z - l.z), k = v.getVerticesForRadius(g, c, "to"), L = k.w, $ = k.h, z = E ? $ * L + 2 : 2 * L, O = m.updateGeoGroup(z), R = k.vertices, P = k.normals, U = k.verticesRows, N = U[$ / 2], B = U[$ / 2 + 1], W = O.vertices, V, G, H, Q, te, ee, ce = O.vertexArray, fe = O.normalArray, oe = O.colorArray, he = O.faceArray;
-                for (H = 0; H < L; ++H) {
+                g = g || { r: 0, g: 0, b: 0 };
+                var w = o(u.x - l.x, u.y - l.y, u.z - l.z), k = v.getVerticesForRadius(p, c, "to"), $ = k.w, L = k.h, z = E ? L * $ + 2 : 2 * $, F = m.updateGeoGroup(z), R = k.vertices, P = k.normals, U = k.verticesRows, N = U[L / 2], B = U[L / 2 + 1], W = F.vertices, V, G, H, Q, te, ee, ce = F.vertexArray, fe = F.normalArray, oe = F.colorArray, he = F.faceArray;
+                for (H = 0; H < $; ++H) {
                   var Ae = 2 * H;
-                  Q = w[0] * R[Ae].x + w[3] * R[Ae].y + w[6] * R[Ae].z, te = w[1] * R[Ae].x + w[4] * R[Ae].y + w[7] * R[Ae].z, ee = w[5] * R[Ae].y + w[8] * R[Ae].z, V = 3 * (W + Ae), G = O.faceidx, ce[V] = Q + l.x, ce[V + 1] = te + l.y, ce[V + 2] = ee + l.z, ce[V + 3] = Q + u.x, ce[V + 4] = te + u.y, ce[V + 5] = ee + u.z, fe[V] = Q, fe[V + 3] = Q, fe[V + 1] = te, fe[V + 4] = te, fe[V + 2] = ee, fe[V + 5] = ee, oe[V] = p.r, oe[V + 3] = p.r, oe[V + 1] = p.g, oe[V + 4] = p.g, oe[V + 2] = p.b, oe[V + 5] = p.b, he[G] = B[H] + W, he[G + 1] = B[H + 1] + W, he[G + 2] = N[H] + W, he[G + 3] = N[H] + W, he[G + 4] = B[H + 1] + W, he[G + 5] = N[H + 1] + W, O.faceidx += 6;
+                  Q = w[0] * R[Ae].x + w[3] * R[Ae].y + w[6] * R[Ae].z, te = w[1] * R[Ae].x + w[4] * R[Ae].y + w[7] * R[Ae].z, ee = w[5] * R[Ae].y + w[8] * R[Ae].z, V = 3 * (W + Ae), G = F.faceidx, ce[V] = Q + l.x, ce[V + 1] = te + l.y, ce[V + 2] = ee + l.z, ce[V + 3] = Q + u.x, ce[V + 4] = te + u.y, ce[V + 5] = ee + u.z, fe[V] = Q, fe[V + 3] = Q, fe[V + 1] = te, fe[V + 4] = te, fe[V + 2] = ee, fe[V + 5] = ee, oe[V] = g.r, oe[V + 3] = g.r, oe[V + 1] = g.g, oe[V + 4] = g.g, oe[V + 2] = g.b, oe[V + 5] = g.b, he[G] = B[H] + W, he[G + 1] = B[H + 1] + W, he[G + 2] = N[H] + W, he[G + 3] = N[H] + W, he[G + 4] = B[H + 1] + W, he[G + 5] = N[H + 1] + W, F.faceidx += 6;
                 }
                 if (E) {
-                  var Se = c ? 0 : $ / 2, Ie = b ? $ + 1 : $ / 2 + 1, pe, le, ne, Te, Fe, Be, Ue, Pe, Ge, Ne, Re, De, je, Xe, X, q, re, ye, me, ze, ke, K, ae, ge, xe, ue, Ce, Z, Oe, We, I, we;
+                  var Se = c ? 0 : L / 2, Ie = b ? L + 1 : L / 2 + 1, pe, le, ne, Te, Oe, Be, Ue, Pe, Ge, Ne, Re, De, je, Xe, X, q, re, ye, me, ze, ke, K, ae, ge, xe, ue, Ce, Z, Fe, We, I, we;
                   for (te = Se; te < Ie; te++)
-                    if (te !== $ / 2) {
-                      var ve = te <= $ / 2 ? u : l, Y = v.getVerticesForRadius(g, c, "to"), de = v.getVerticesForRadius(g, b, "from");
-                      for (ve === u ? (R = Y.vertices, P = Y.normals, U = Y.verticesRows) : ve == l && (R = de.vertices, P = de.normals, U = de.verticesRows), Q = 0; Q < L; Q++)
-                        G = O.faceidx, pe = U[te][Q + 1], Oe = (pe + W) * 3, le = U[te][Q], We = (le + W) * 3, ne = U[te + 1][Q], I = (ne + W) * 3, Te = U[te + 1][Q + 1], we = (Te + W) * 3, Fe = w[0] * R[pe].x + w[3] * R[pe].y + w[6] * R[pe].z, Be = w[0] * R[le].x + w[3] * R[le].y + w[6] * R[le].z, Ue = w[0] * R[ne].x + w[3] * R[ne].y + w[6] * R[ne].z, Pe = w[0] * R[Te].x + w[3] * R[Te].y + w[6] * R[Te].z, Ge = w[1] * R[pe].x + w[4] * R[pe].y + w[7] * R[pe].z, Ne = w[1] * R[le].x + w[4] * R[le].y + w[7] * R[le].z, Re = w[1] * R[ne].x + w[4] * R[ne].y + w[7] * R[ne].z, De = w[1] * R[Te].x + w[4] * R[Te].y + w[7] * R[Te].z, je = w[5] * R[pe].y + w[8] * R[pe].z, Xe = w[5] * R[le].y + w[8] * R[le].z, X = w[5] * R[ne].y + w[8] * R[ne].z, q = w[5] * R[Te].y + w[8] * R[Te].z, ce[Oe] = Fe + ve.x, ce[We] = Be + ve.x, ce[I] = Ue + ve.x, ce[we] = Pe + ve.x, ce[Oe + 1] = Ge + ve.y, ce[We + 1] = Ne + ve.y, ce[I + 1] = Re + ve.y, ce[we + 1] = De + ve.y, ce[Oe + 2] = je + ve.z, ce[We + 2] = Xe + ve.z, ce[I + 2] = X + ve.z, ce[we + 2] = q + ve.z, oe[Oe] = p.r, oe[We] = p.r, oe[I] = p.r, oe[we] = p.r, oe[Oe + 1] = p.g, oe[We + 1] = p.g, oe[I + 1] = p.g, oe[we + 1] = p.g, oe[Oe + 2] = p.b, oe[We + 2] = p.b, oe[I + 2] = p.b, oe[we + 2] = p.b, re = w[0] * P[pe].x + w[3] * P[pe].y + w[6] * P[pe].z, ye = w[0] * P[le].x + w[3] * P[le].y + w[6] * P[le].z, me = w[0] * P[ne].x + w[3] * P[ne].y + w[6] * P[ne].z, ze = w[0] * P[Te].x + w[3] * P[Te].y + w[6] * P[Te].z, ke = w[1] * P[pe].x + w[4] * P[pe].y + w[7] * P[pe].z, K = w[1] * P[le].x + w[4] * P[le].y + w[7] * P[le].z, ae = w[1] * P[ne].x + w[4] * P[ne].y + w[7] * P[ne].z, ge = w[1] * P[Te].x + w[4] * P[Te].y + w[7] * P[Te].z, xe = w[5] * P[pe].y + w[8] * P[pe].z, ue = w[5] * P[le].y + w[8] * P[le].z, Ce = w[5] * P[ne].y + w[8] * P[ne].z, Z = w[5] * P[Te].y + w[8] * P[Te].z, te === 0 ? (fe[Oe] = re, fe[I] = me, fe[we] = ze, fe[Oe + 1] = ke, fe[I + 1] = ae, fe[we + 1] = ge, fe[Oe + 2] = xe, fe[I + 2] = Ce, fe[we + 2] = Z, he[G] = pe + W, he[G + 1] = ne + W, he[G + 2] = Te + W, O.faceidx += 3) : te === Ie - 1 ? (fe[Oe] = re, fe[We] = ye, fe[I] = me, fe[Oe + 1] = ke, fe[We + 1] = K, fe[I + 1] = ae, fe[Oe + 2] = xe, fe[We + 2] = ue, fe[I + 2] = Ce, he[G] = pe + W, he[G + 1] = le + W, he[G + 2] = ne + W, O.faceidx += 3) : (fe[Oe] = re, fe[We] = ye, fe[we] = ze, fe[Oe + 1] = ke, fe[We + 1] = K, fe[we + 1] = ge, fe[Oe + 2] = xe, fe[We + 2] = ue, fe[we + 2] = Z, fe[We] = ye, fe[I] = me, fe[we] = ze, fe[We + 1] = K, fe[I + 1] = ae, fe[we + 1] = ge, fe[We + 2] = ue, fe[I + 2] = Ce, fe[we + 2] = Z, he[G] = pe + W, he[G + 1] = le + W, he[G + 2] = Te + W, he[G + 3] = le + W, he[G + 4] = ne + W, he[G + 5] = Te + W, O.faceidx += 6);
+                    if (te !== L / 2) {
+                      var ve = te <= L / 2 ? u : l, Y = v.getVerticesForRadius(p, c, "to"), de = v.getVerticesForRadius(p, b, "from");
+                      for (ve === u ? (R = Y.vertices, P = Y.normals, U = Y.verticesRows) : ve == l && (R = de.vertices, P = de.normals, U = de.verticesRows), Q = 0; Q < $; Q++)
+                        G = F.faceidx, pe = U[te][Q + 1], Fe = (pe + W) * 3, le = U[te][Q], We = (le + W) * 3, ne = U[te + 1][Q], I = (ne + W) * 3, Te = U[te + 1][Q + 1], we = (Te + W) * 3, Oe = w[0] * R[pe].x + w[3] * R[pe].y + w[6] * R[pe].z, Be = w[0] * R[le].x + w[3] * R[le].y + w[6] * R[le].z, Ue = w[0] * R[ne].x + w[3] * R[ne].y + w[6] * R[ne].z, Pe = w[0] * R[Te].x + w[3] * R[Te].y + w[6] * R[Te].z, Ge = w[1] * R[pe].x + w[4] * R[pe].y + w[7] * R[pe].z, Ne = w[1] * R[le].x + w[4] * R[le].y + w[7] * R[le].z, Re = w[1] * R[ne].x + w[4] * R[ne].y + w[7] * R[ne].z, De = w[1] * R[Te].x + w[4] * R[Te].y + w[7] * R[Te].z, je = w[5] * R[pe].y + w[8] * R[pe].z, Xe = w[5] * R[le].y + w[8] * R[le].z, X = w[5] * R[ne].y + w[8] * R[ne].z, q = w[5] * R[Te].y + w[8] * R[Te].z, ce[Fe] = Oe + ve.x, ce[We] = Be + ve.x, ce[I] = Ue + ve.x, ce[we] = Pe + ve.x, ce[Fe + 1] = Ge + ve.y, ce[We + 1] = Ne + ve.y, ce[I + 1] = Re + ve.y, ce[we + 1] = De + ve.y, ce[Fe + 2] = je + ve.z, ce[We + 2] = Xe + ve.z, ce[I + 2] = X + ve.z, ce[we + 2] = q + ve.z, oe[Fe] = g.r, oe[We] = g.r, oe[I] = g.r, oe[we] = g.r, oe[Fe + 1] = g.g, oe[We + 1] = g.g, oe[I + 1] = g.g, oe[we + 1] = g.g, oe[Fe + 2] = g.b, oe[We + 2] = g.b, oe[I + 2] = g.b, oe[we + 2] = g.b, re = w[0] * P[pe].x + w[3] * P[pe].y + w[6] * P[pe].z, ye = w[0] * P[le].x + w[3] * P[le].y + w[6] * P[le].z, me = w[0] * P[ne].x + w[3] * P[ne].y + w[6] * P[ne].z, ze = w[0] * P[Te].x + w[3] * P[Te].y + w[6] * P[Te].z, ke = w[1] * P[pe].x + w[4] * P[pe].y + w[7] * P[pe].z, K = w[1] * P[le].x + w[4] * P[le].y + w[7] * P[le].z, ae = w[1] * P[ne].x + w[4] * P[ne].y + w[7] * P[ne].z, ge = w[1] * P[Te].x + w[4] * P[Te].y + w[7] * P[Te].z, xe = w[5] * P[pe].y + w[8] * P[pe].z, ue = w[5] * P[le].y + w[8] * P[le].z, Ce = w[5] * P[ne].y + w[8] * P[ne].z, Z = w[5] * P[Te].y + w[8] * P[Te].z, te === 0 ? (fe[Fe] = re, fe[I] = me, fe[we] = ze, fe[Fe + 1] = ke, fe[I + 1] = ae, fe[we + 1] = ge, fe[Fe + 2] = xe, fe[I + 2] = Ce, fe[we + 2] = Z, he[G] = pe + W, he[G + 1] = ne + W, he[G + 2] = Te + W, F.faceidx += 3) : te === Ie - 1 ? (fe[Fe] = re, fe[We] = ye, fe[I] = me, fe[Fe + 1] = ke, fe[We + 1] = K, fe[I + 1] = ae, fe[Fe + 2] = xe, fe[We + 2] = ue, fe[I + 2] = Ce, he[G] = pe + W, he[G + 1] = le + W, he[G + 2] = ne + W, F.faceidx += 3) : (fe[Fe] = re, fe[We] = ye, fe[we] = ze, fe[Fe + 1] = ke, fe[We + 1] = K, fe[we + 1] = ge, fe[Fe + 2] = xe, fe[We + 2] = ue, fe[we + 2] = Z, fe[We] = ye, fe[I] = me, fe[we] = ze, fe[We + 1] = K, fe[I + 1] = ae, fe[we + 1] = ge, fe[We + 2] = ue, fe[I + 2] = Ce, fe[we + 2] = Z, he[G] = pe + W, he[G + 1] = le + W, he[G + 2] = Te + W, he[G + 3] = le + W, he[G + 4] = ne + W, he[G + 5] = Te + W, F.faceidx += 6);
                     }
                 }
-                O.vertices += z;
+                F.vertices += z;
               }
               h.drawCylinder = f;
-              function y(m, l, u, g, p) {
+              function y(m, l, u, p, g) {
                 if (!l || !u)
                   return;
-                p = p || { r: 0, g: 0, b: 0 };
+                g = g || { r: 0, g: 0, b: 0 };
                 let b = new r.Vector3(u.x - l.x, u.y - l.y, u.z - l.z);
                 var c = o(b.x, b.y, b.z);
                 b = b.normalize();
-                var _ = v.basisVectors.length, E = v.basisVectors, w = _ + 2, k = m.updateGeoGroup(w), L = k.vertices, $, z, O, R, P, U, N = k.vertexArray, B = k.normalArray, W = k.colorArray, V = k.faceArray;
-                for ($ = L * 3, N[$] = l.x, N[$ + 1] = l.y, N[$ + 2] = l.z, B[$] = -b.x, B[$ + 1] = -b.y, B[$ + 2] = -b.z, W[$] = p.r, W[$ + 1] = p.g, W[$ + 2] = p.b, N[$ + 3] = u.x, N[$ + 4] = u.y, N[$ + 5] = u.z, B[$ + 3] = b.x, B[$ + 4] = b.y, B[$ + 5] = b.z, W[$ + 3] = p.r, W[$ + 4] = p.g, W[$ + 5] = p.b, $ += 6, O = 0; O < _; ++O) {
-                  var G = E[O].clone();
-                  G.multiplyScalar(g), R = c[0] * G.x + c[3] * G.y + c[6] * G.z, P = c[1] * G.x + c[4] * G.y + c[7] * G.z, U = c[5] * G.y + c[8] * G.z, N[$] = R + l.x, N[$ + 1] = P + l.y, N[$ + 2] = U + l.z, B[$] = R, B[$ + 1] = P, B[$ + 2] = U, W[$] = p.r, W[$ + 1] = p.g, W[$ + 2] = p.b, $ += 3;
+                var _ = v.basisVectors.length, E = v.basisVectors, w = _ + 2, k = m.updateGeoGroup(w), $ = k.vertices, L, z, F, R, P, U, N = k.vertexArray, B = k.normalArray, W = k.colorArray, V = k.faceArray;
+                for (L = $ * 3, N[L] = l.x, N[L + 1] = l.y, N[L + 2] = l.z, B[L] = -b.x, B[L + 1] = -b.y, B[L + 2] = -b.z, W[L] = g.r, W[L + 1] = g.g, W[L + 2] = g.b, N[L + 3] = u.x, N[L + 4] = u.y, N[L + 5] = u.z, B[L + 3] = b.x, B[L + 4] = b.y, B[L + 5] = b.z, W[L + 3] = g.r, W[L + 4] = g.g, W[L + 5] = g.b, L += 6, F = 0; F < _; ++F) {
+                  var G = E[F].clone();
+                  G.multiplyScalar(p), R = c[0] * G.x + c[3] * G.y + c[6] * G.z, P = c[1] * G.x + c[4] * G.y + c[7] * G.z, U = c[5] * G.y + c[8] * G.z, N[L] = R + l.x, N[L + 1] = P + l.y, N[L + 2] = U + l.z, B[L] = R, B[L + 1] = P, B[L + 2] = U, W[L] = g.r, W[L + 1] = g.g, W[L + 2] = g.b, L += 3;
                 }
-                for (k.vertices += _ + 2, z = k.faceidx, O = 0; O < _; O++) {
-                  var H = L + 2 + O, Q = L + 2 + (O + 1) % _;
-                  V[z] = H, V[z + 1] = Q, V[z + 2] = L, z += 3, V[z] = H, V[z + 1] = Q, V[z + 2] = L + 1, z += 3;
+                for (k.vertices += _ + 2, z = k.faceidx, F = 0; F < _; F++) {
+                  var H = $ + 2 + F, Q = $ + 2 + (F + 1) % _;
+                  V[z] = H, V[z + 1] = Q, V[z + 2] = $, z += 3, V[z] = H, V[z + 1] = Q, V[z + 2] = $ + 1, z += 3;
                 }
                 k.faceidx += 6 * _;
               }
@@ -20672,34 +20688,34 @@ void main() {
                 }
                 getVerticesForRadius(l, u) {
                   u = u || 2, this.cache.has(u) || this.cache.set(u, /* @__PURE__ */ new Map());
-                  let g = this.cache.get(u);
-                  if (g.has(l))
-                    return g.get(l);
-                  var p = {
+                  let p = this.cache.get(u);
+                  if (p.has(l))
+                    return p.get(l);
+                  var g = {
                     vertices: [],
                     verticesRows: [],
                     normals: []
                   }, b = 16 * u, c = 10 * u;
                   l < 1 && (b = 10 * u, c = 8 * u);
-                  var _ = 0, E = Math.PI * 2, w = 0, k = Math.PI, L, $;
-                  for ($ = 0; $ <= c; $++) {
-                    let O = [];
-                    for (L = 0; L <= b; L++) {
-                      let R = L / b, P = $ / c, U = -l * Math.cos(_ + R * E) * Math.sin(w + P * k), N = l * Math.cos(w + P * k), B = l * Math.sin(_ + R * E) * Math.sin(w + P * k);
+                  var _ = 0, E = Math.PI * 2, w = 0, k = Math.PI, $, L;
+                  for (L = 0; L <= c; L++) {
+                    let F = [];
+                    for ($ = 0; $ <= b; $++) {
+                      let R = $ / b, P = L / c, U = -l * Math.cos(_ + R * E) * Math.sin(w + P * k), N = l * Math.cos(w + P * k), B = l * Math.sin(_ + R * E) * Math.sin(w + P * k);
                       var z = new r.Vector3(U, N, B);
-                      z.normalize(), p.vertices.push({ x: U, y: N, z: B }), p.normals.push(z), O.push(p.vertices.length - 1);
+                      z.normalize(), g.vertices.push({ x: U, y: N, z: B }), g.normals.push(z), F.push(g.vertices.length - 1);
                     }
-                    p.verticesRows.push(O);
+                    g.verticesRows.push(F);
                   }
-                  return g.set(l, p), p;
+                  return p.set(l, g), g;
                 }
               }
               var x = new A();
-              function M(m, l, u, g, p) {
-                var b = x.getVerticesForRadius(u, p), c = b.vertices, _ = b.normals, E = m.updateGeoGroup(c.length), w = E.vertices, k = E.vertexArray, L = E.colorArray, $ = E.faceArray, z = E.lineArray, O = E.normalArray;
+              function M(m, l, u, p, g) {
+                var b = x.getVerticesForRadius(u, g), c = b.vertices, _ = b.normals, E = m.updateGeoGroup(c.length), w = E.vertices, k = E.vertexArray, $ = E.colorArray, L = E.faceArray, z = E.lineArray, F = E.normalArray;
                 for (let U = 0, N = c.length; U < N; ++U) {
                   let B = 3 * (w + U), W = c[U];
-                  k[B] = W.x + l.x, k[B + 1] = W.y + l.y, k[B + 2] = W.z + l.z, L[B] = g.r, L[B + 1] = g.g, L[B + 2] = g.b;
+                  k[B] = W.x + l.x, k[B + 1] = W.y + l.y, k[B + 2] = W.z + l.z, $[B] = p.r, $[B + 1] = p.g, $[B + 2] = p.b;
                 }
                 E.vertices += c.length;
                 let R = b.verticesRows, P = R.length - 1;
@@ -20707,7 +20723,7 @@ void main() {
                   let N = R[U].length - 1;
                   for (let B = 0; B < N; B++) {
                     let W = E.faceidx, V = E.lineidx, G = R[U][B + 1] + w, H = G * 3, Q = R[U][B] + w, te = Q * 3, ee = R[U + 1][B] + w, ce = ee * 3, fe = R[U + 1][B + 1] + w, oe = fe * 3, he = _[G - w], Ae = _[Q - w], Se = _[ee - w], Ie = _[fe - w];
-                    Math.abs(c[G - w].y) === u ? (O[H] = he.x, O[ce] = Se.x, O[oe] = Ie.x, O[H + 1] = he.y, O[ce + 1] = Se.y, O[oe + 1] = Ie.y, O[H + 2] = he.z, O[ce + 2] = Se.z, O[oe + 2] = Ie.z, $[W] = G, $[W + 1] = ee, $[W + 2] = fe, z[V] = G, z[V + 1] = ee, z[V + 2] = G, z[V + 3] = fe, z[V + 4] = ee, z[V + 5] = fe, E.faceidx += 3, E.lineidx += 6) : Math.abs(c[ee - w].y) === u ? (O[H] = he.x, O[te] = Ae.x, O[ce] = Se.x, O[H + 1] = he.y, O[te + 1] = Ae.y, O[ce + 1] = Se.y, O[H + 2] = he.z, O[te + 2] = Ae.z, O[ce + 2] = Se.z, $[W] = G, $[W + 1] = Q, $[W + 2] = ee, z[V] = G, z[V + 1] = Q, z[V + 2] = G, z[V + 3] = ee, z[V + 4] = Q, z[V + 5] = ee, E.faceidx += 3, E.lineidx += 6) : (O[H] = he.x, O[te] = Ae.x, O[oe] = Ie.x, O[H + 1] = he.y, O[te + 1] = Ae.y, O[oe + 1] = Ie.y, O[H + 2] = he.z, O[te + 2] = Ae.z, O[oe + 2] = Ie.z, O[te] = Ae.x, O[ce] = Se.x, O[oe] = Ie.x, O[te + 1] = Ae.y, O[ce + 1] = Se.y, O[oe + 1] = Ie.y, O[te + 2] = Ae.z, O[ce + 2] = Se.z, O[oe + 2] = Ie.z, $[W] = G, $[W + 1] = Q, $[W + 2] = fe, $[W + 3] = Q, $[W + 4] = ee, $[W + 5] = fe, z[V] = G, z[V + 1] = Q, z[V + 2] = G, z[V + 3] = fe, z[V + 4] = Q, z[V + 5] = ee, z[V + 6] = ee, z[V + 7] = fe, E.faceidx += 6, E.lineidx += 8);
+                    Math.abs(c[G - w].y) === u ? (F[H] = he.x, F[ce] = Se.x, F[oe] = Ie.x, F[H + 1] = he.y, F[ce + 1] = Se.y, F[oe + 1] = Ie.y, F[H + 2] = he.z, F[ce + 2] = Se.z, F[oe + 2] = Ie.z, L[W] = G, L[W + 1] = ee, L[W + 2] = fe, z[V] = G, z[V + 1] = ee, z[V + 2] = G, z[V + 3] = fe, z[V + 4] = ee, z[V + 5] = fe, E.faceidx += 3, E.lineidx += 6) : Math.abs(c[ee - w].y) === u ? (F[H] = he.x, F[te] = Ae.x, F[ce] = Se.x, F[H + 1] = he.y, F[te + 1] = Ae.y, F[ce + 1] = Se.y, F[H + 2] = he.z, F[te + 2] = Ae.z, F[ce + 2] = Se.z, L[W] = G, L[W + 1] = Q, L[W + 2] = ee, z[V] = G, z[V + 1] = Q, z[V + 2] = G, z[V + 3] = ee, z[V + 4] = Q, z[V + 5] = ee, E.faceidx += 3, E.lineidx += 6) : (F[H] = he.x, F[te] = Ae.x, F[oe] = Ie.x, F[H + 1] = he.y, F[te + 1] = Ae.y, F[oe + 1] = Ie.y, F[H + 2] = he.z, F[te + 2] = Ae.z, F[oe + 2] = Ie.z, F[te] = Ae.x, F[ce] = Se.x, F[oe] = Ie.x, F[te + 1] = Ae.y, F[ce + 1] = Se.y, F[oe + 1] = Ie.y, F[te + 2] = Ae.z, F[ce + 2] = Se.z, F[oe + 2] = Ie.z, L[W] = G, L[W + 1] = Q, L[W + 2] = fe, L[W + 3] = Q, L[W + 4] = ee, L[W + 5] = fe, z[V] = G, z[V + 1] = Q, z[V + 2] = G, z[V + 3] = fe, z[V + 4] = Q, z[V + 5] = ee, z[V + 6] = ee, z[V + 7] = fe, E.faceidx += 6, E.lineidx += 8);
                   }
                 }
               }
@@ -20782,16 +20798,16 @@ void main() {
                *
                */
               getRadiusFromStyle(l, u) {
-                var g = this.defaultSphereRadius;
+                var p = this.defaultSphereRadius;
                 if (typeof u.radius < "u")
-                  g = u.radius;
+                  p = u.radius;
                 else if (M.vdwRadii[l.elem])
-                  g = M.vdwRadii[l.elem];
+                  p = M.vdwRadii[l.elem];
                 else if (l.elem.length > 1) {
-                  let p = l.elem;
-                  p = p[0].toUpperCase() + p[1].toLowerCase(), M.vdwRadii[p] && (g = M.vdwRadii[p]);
+                  let g = l.elem;
+                  g = g[0].toUpperCase() + g[1].toLowerCase(), M.vdwRadii[g] && (p = M.vdwRadii[g]);
                 }
-                return typeof u.scale < "u" && (g *= u.scale), g;
+                return typeof u.scale < "u" && (p *= u.scale), p;
               }
               // cross drawing
               /**
@@ -20801,11 +20817,11 @@ void main() {
                */
               drawAtomCross(l, u) {
                 if (l.style.cross) {
-                  var g = l.style.cross;
-                  if (!g.hidden) {
-                    var p = g.linewidth || M.defaultlineWidth;
-                    u[p] || (u[p] = new r.Geometry());
-                    var b = u[p].updateGeoGroup(6), c = this.getRadiusFromStyle(l, g), _ = [
+                  var p = l.style.cross;
+                  if (!p.hidden) {
+                    var g = p.linewidth || M.defaultlineWidth;
+                    u[g] || (u[g] = new r.Geometry());
+                    var b = u[g].updateGeoGroup(6), c = this.getRadiusFromStyle(l, p), _ = [
                       [c, 0, 0],
                       [-c, 0, 0],
                       [0, c, 0],
@@ -20814,43 +20830,43 @@ void main() {
                       [0, 0, -c]
                     ], E = l.clickable || l.hoverable;
                     E && l.intersectionShape === void 0 && (l.intersectionShape = { sphere: [], cylinder: [], line: [] });
-                    for (var w = (0, v.getColorFromStyle)(l, g), k = b.vertexArray, L = b.colorArray, $ = 0; $ < 6; $++) {
+                    for (var w = (0, v.getColorFromStyle)(l, p), k = b.vertexArray, $ = b.colorArray, L = 0; L < 6; L++) {
                       var z = b.vertices * 3;
-                      if (b.vertices++, k[z] = l.x + _[$][0], k[z + 1] = l.y + _[$][1], k[z + 2] = l.z + _[$][2], L[z] = w.r, L[z + 1] = w.g, L[z + 2] = w.b, E) {
-                        var O = new s.Vector3(_[$][0], _[$][1], _[$][2]);
-                        O.multiplyScalar(0.1), O.set(O.x + l.x, O.y + l.y, O.z + l.z), l.intersectionShape.line.push(O);
+                      if (b.vertices++, k[z] = l.x + _[L][0], k[z + 1] = l.y + _[L][1], k[z + 2] = l.z + _[L][2], $[z] = w.r, $[z + 1] = w.g, $[z + 2] = w.b, E) {
+                        var F = new s.Vector3(_[L][0], _[L][1], _[L][2]);
+                        F.multiplyScalar(0.1), F.set(F.x + l.x, F.y + l.y, F.z + l.z), l.intersectionShape.line.push(F);
                       }
                     }
                   }
                 }
               }
-              getGoodCross(l, u, g, p) {
+              getGoodCross(l, u, p, g) {
                 for (var b = null, c = -1, _ = 0, E = l.bonds.length; _ < E; _++)
                   if (l.bonds[_] != u.index) {
-                    let k = l.bonds[_], L = this.atoms[k], z = new s.Vector3(L.x, L.y, L.z).clone();
-                    z.sub(g);
-                    let O = z.clone();
-                    O.cross(p);
-                    var w = O.lengthSq();
-                    if (w > c && (c = w, b = O, c > 0.1))
+                    let k = l.bonds[_], $ = this.atoms[k], z = new s.Vector3($.x, $.y, $.z).clone();
+                    z.sub(p);
+                    let F = z.clone();
+                    F.cross(g);
+                    var w = F.lengthSq();
+                    if (w > c && (c = w, b = F, c > 0.1))
                       return b;
                   }
                 return b;
               }
               //from atom, return a normalized vector v that is orthogonal and along which
               //it is appropraite to draw multiple bonds
-              getSideBondV(l, u, g) {
-                var p, b, c, _, E, w = new s.Vector3(l.x, l.y, l.z), k = new s.Vector3(u.x, u.y, u.z), L = k.clone(), $ = null;
-                if (L.sub(w), l.bonds.length === 1)
-                  u.bonds.length === 1 ? ($ = L.clone(), Math.abs($.x) > 1e-4 ? $.y += 1 : $.x += 1) : (p = (g + 1) % u.bonds.length, b = u.bonds[p], c = this.atoms[b], c.index == l.index && (p = (p + 1) % u.bonds.length, b = u.bonds[p], c = this.atoms[b]), _ = new s.Vector3(c.x, c.y, c.z), E = _.clone(), E.sub(w), $ = E.clone(), $.cross(L));
-                else if ($ = this.getGoodCross(l, u, w, L), $.lengthSq() < 0.01) {
-                  var z = this.getGoodCross(u, l, w, L);
-                  z != null && ($ = z);
+              getSideBondV(l, u, p) {
+                var g, b, c, _, E, w = new s.Vector3(l.x, l.y, l.z), k = new s.Vector3(u.x, u.y, u.z), $ = k.clone(), L = null;
+                if ($.sub(w), l.bonds.length === 1)
+                  u.bonds.length === 1 ? (L = $.clone(), Math.abs(L.x) > 1e-4 ? L.y += 1 : L.x += 1) : (g = (p + 1) % u.bonds.length, b = u.bonds[g], c = this.atoms[b], c.index == l.index && (g = (g + 1) % u.bonds.length, b = u.bonds[g], c = this.atoms[b]), _ = new s.Vector3(c.x, c.y, c.z), E = _.clone(), E.sub(w), L = E.clone(), L.cross($));
+                else if (L = this.getGoodCross(l, u, w, $), L.lengthSq() < 0.01) {
+                  var z = this.getGoodCross(u, l, w, $);
+                  z != null && (L = z);
                 }
-                return $.lengthSq() < 0.01 && ($ = L.clone(), Math.abs($.x) > 1e-4 ? $.y += 1 : $.x += 1), $.cross(L), $.normalize(), $;
+                return L.lengthSq() < 0.01 && (L = $.clone(), Math.abs(L.x) > 1e-4 ? L.y += 1 : L.x += 1), L.cross($), L.normalize(), L;
               }
-              addLine(l, u, g, p, b, c) {
-                l[g] = p.x, l[g + 1] = p.y, l[g + 2] = p.z, u[g] = c.r, u[g + 1] = c.g, u[g + 2] = c.b, l[g + 3] = b.x, l[g + 4] = b.y, l[g + 5] = b.z, u[g + 3] = c.r, u[g + 4] = c.g, u[g + 5] = c.b;
+              addLine(l, u, p, g, b, c) {
+                l[p] = g.x, l[p + 1] = g.y, l[p + 2] = g.z, u[p] = c.r, u[p + 1] = c.g, u[p + 2] = c.b, l[p + 3] = b.x, l[p + 4] = b.y, l[p + 5] = b.z, u[p + 3] = c.r, u[p + 4] = c.g, u[p + 5] = c.b;
               }
               // bonds - both atoms must match bond style
               // standardize on only drawing for lowest to highest
@@ -20861,14 +20877,14 @@ void main() {
                * @param {AtomSpec[]} atoms
                * @param {Record<number,Geometry>} geos
                */
-              drawBondLines(l, u, g) {
+              drawBondLines(l, u, p) {
                 if (l.style.line) {
-                  var p = l.style.line;
-                  if (!p.hidden) {
-                    var b, c, _, E, w = p.linewidth || M.defaultlineWidth;
-                    g[w] || (g[w] = new r.Geometry());
-                    for (var k = g[w].updateGeoGroup(6 * l.bonds.length), L = k.vertexArray, $ = k.colorArray, z = 0; z < l.bonds.length; z++) {
-                      var O = l.bonds[z], R = u[O];
+                  var g = l.style.line;
+                  if (!g.hidden) {
+                    var b, c, _, E, w = g.linewidth || M.defaultlineWidth;
+                    p[w] || (p[w] = new r.Geometry());
+                    for (var k = p[w].updateGeoGroup(6 * l.bonds.length), $ = k.vertexArray, L = k.colorArray, z = 0; z < l.bonds.length; z++) {
+                      var F = l.bonds[z], R = u[F];
                       if (R.style.line && !(l.index >= R.index)) {
                         var P = new s.Vector3(l.x, l.y, l.z), U = new s.Vector3(R.x, R.y, R.z), N = P.clone().add(U).multiplyScalar(0.5), B = !1, W = l.clickable || l.hoverable, V = R.clickable || R.hoverable;
                         (W || V) && (W && (l.intersectionShape === void 0 && (l.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), l.intersectionShape.line.push(P), l.intersectionShape.line.push(N)), V && (R.intersectionShape === void 0 && (R.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), R.intersectionShape.line.push(N), R.intersectionShape.line.push(U)));
@@ -20882,9 +20898,9 @@ void main() {
                         var te = k.vertices * 3, ee, ce;
                         if (l.bondOrder[z] > 1 && l.bondOrder[z] < 4 && !B) {
                           var fe = this.getSideBondV(l, R, z), oe = U.clone();
-                          oe.sub(P), l.bondOrder[z] == 2 ? (fe.multiplyScalar(0.1), b = P.clone(), b.add(fe), c = P.clone(), c.sub(fe), _ = b.clone(), _.add(oe), E = c.clone(), E.add(oe), G == H ? (k.vertices += 4, this.addLine(L, $, te, b, _, G), this.addLine(L, $, te + 6, c, E, G)) : (k.vertices += 8, oe.multiplyScalar(0.5), ee = b.clone(), ee.add(oe), ce = c.clone(), ce.add(oe), this.addLine(L, $, te, b, ee, G), this.addLine(L, $, te + 6, ee, _, H), this.addLine(L, $, te + 12, c, ce, G), this.addLine(L, $, te + 18, ce, E, H))) : l.bondOrder[z] == 3 && (fe.multiplyScalar(0.1), b = P.clone(), b.add(fe), c = P.clone(), c.sub(fe), _ = b.clone(), _.add(oe), E = c.clone(), E.add(oe), G == H ? (k.vertices += 6, this.addLine(L, $, te, P, U, G), this.addLine(L, $, te + 6, b, _, G), this.addLine(L, $, te + 12, c, E, G)) : (k.vertices += 12, oe.multiplyScalar(0.5), ee = b.clone(), ee.add(oe), ce = c.clone(), ce.add(oe), this.addLine(L, $, te, P, N, G), this.addLine(L, $, te + 6, N, U, H), this.addLine(L, $, te + 12, b, ee, G), this.addLine(L, $, te + 18, ee, _, H), this.addLine(L, $, te + 24, c, ce, G), this.addLine(L, $, te + 30, ce, E, H)));
+                          oe.sub(P), l.bondOrder[z] == 2 ? (fe.multiplyScalar(0.1), b = P.clone(), b.add(fe), c = P.clone(), c.sub(fe), _ = b.clone(), _.add(oe), E = c.clone(), E.add(oe), G == H ? (k.vertices += 4, this.addLine($, L, te, b, _, G), this.addLine($, L, te + 6, c, E, G)) : (k.vertices += 8, oe.multiplyScalar(0.5), ee = b.clone(), ee.add(oe), ce = c.clone(), ce.add(oe), this.addLine($, L, te, b, ee, G), this.addLine($, L, te + 6, ee, _, H), this.addLine($, L, te + 12, c, ce, G), this.addLine($, L, te + 18, ce, E, H))) : l.bondOrder[z] == 3 && (fe.multiplyScalar(0.1), b = P.clone(), b.add(fe), c = P.clone(), c.sub(fe), _ = b.clone(), _.add(oe), E = c.clone(), E.add(oe), G == H ? (k.vertices += 6, this.addLine($, L, te, P, U, G), this.addLine($, L, te + 6, b, _, G), this.addLine($, L, te + 12, c, E, G)) : (k.vertices += 12, oe.multiplyScalar(0.5), ee = b.clone(), ee.add(oe), ce = c.clone(), ce.add(oe), this.addLine($, L, te, P, N, G), this.addLine($, L, te + 6, N, U, H), this.addLine($, L, te + 12, b, ee, G), this.addLine($, L, te + 18, ee, _, H), this.addLine($, L, te + 24, c, ce, G), this.addLine($, L, te + 30, ce, E, H)));
                         } else
-                          G == H ? (k.vertices += 2, this.addLine(L, $, te, P, U, G)) : (k.vertices += 4, this.addLine(L, $, te, P, N, G), this.addLine(L, $, te + 6, N, U, H));
+                          G == H ? (k.vertices += 2, this.addLine($, L, te, P, U, G)) : (k.vertices += 4, this.addLine($, L, te, P, N, G), this.addLine($, L, te + 6, N, U, H));
                       }
                     }
                   }
@@ -20899,14 +20915,14 @@ void main() {
                */
               drawAtomSphere(l, u) {
                 if (l.style.sphere) {
-                  var g = l.style.sphere;
-                  if (!g.hidden) {
-                    var p = (0, v.getColorFromStyle)(l, g), b = this.getRadiusFromStyle(l, g);
+                  var p = l.style.sphere;
+                  if (!p.hidden) {
+                    var g = (0, v.getColorFromStyle)(l, p), b = this.getRadiusFromStyle(l, p);
                     if ((l.clickable === !0 || l.hoverable) && l.intersectionShape !== void 0) {
                       var c = new s.Vector3(l.x, l.y, l.z);
                       l.intersectionShape.sphere.push(new a.Sphere(c, b));
                     }
-                    o.GLDraw.drawSphere(u, l, b, p);
+                    o.GLDraw.drawSphere(u, l, b, g);
                   }
                 }
               }
@@ -20915,85 +20931,85 @@ void main() {
                 if (l.style.clicksphere) {
                   var u = l.style.clicksphere;
                   if (!u.hidden) {
-                    var g = this.getRadiusFromStyle(l, u);
+                    var p = this.getRadiusFromStyle(l, u);
                     if ((l.clickable === !0 || l.hoverable) && l.intersectionShape !== void 0) {
-                      var p = new s.Vector3(l.x, l.y, l.z);
-                      l.intersectionShape.sphere.push(new a.Sphere(p, g));
+                      var g = new s.Vector3(l.x, l.y, l.z);
+                      l.intersectionShape.sphere.push(new a.Sphere(g, p));
                     }
                   }
                 }
               }
               drawAtomInstanced(l, u) {
                 if (l.style.sphere) {
-                  var g = l.style.sphere;
-                  if (!g.hidden) {
-                    var p = this.getRadiusFromStyle(l, g), b = (0, v.getColorFromStyle)(l, g), c = u.updateGeoGroup(1), _ = c.vertices, E = _ * 3, w = c.vertexArray, k = c.colorArray, L = c.radiusArray;
-                    if (w[E] = l.x, w[E + 1] = l.y, w[E + 2] = l.z, k[E] = b.r, k[E + 1] = b.g, k[E + 2] = b.b, L[_] = p, (l.clickable === !0 || l.hoverable) && l.intersectionShape !== void 0) {
-                      var $ = new s.Vector3(l.x, l.y, l.z);
-                      l.intersectionShape.sphere.push(new a.Sphere($, p));
+                  var p = l.style.sphere;
+                  if (!p.hidden) {
+                    var g = this.getRadiusFromStyle(l, p), b = (0, v.getColorFromStyle)(l, p), c = u.updateGeoGroup(1), _ = c.vertices, E = _ * 3, w = c.vertexArray, k = c.colorArray, $ = c.radiusArray;
+                    if (w[E] = l.x, w[E + 1] = l.y, w[E + 2] = l.z, k[E] = b.r, k[E + 1] = b.g, k[E + 2] = b.b, $[_] = g, (l.clickable === !0 || l.hoverable) && l.intersectionShape !== void 0) {
+                      var L = new s.Vector3(l.x, l.y, l.z);
+                      l.intersectionShape.sphere.push(new a.Sphere(L, g));
                     }
                     c.vertices += 1;
                   }
                 }
               }
-              drawSphereImposter(l, u, g, p) {
+              drawSphereImposter(l, u, p, g) {
                 var b = l.updateGeoGroup(4), c, _ = b.vertices, E = _ * 3, w = b.vertexArray, k = b.colorArray;
                 for (c = 0; c < 4; c++)
                   w[E + 3 * c] = u.x, w[E + 3 * c + 1] = u.y, w[E + 3 * c + 2] = u.z;
-                var L = b.normalArray;
+                var $ = b.normalArray;
                 for (c = 0; c < 4; c++)
-                  k[E + 3 * c] = p.r, k[E + 3 * c + 1] = p.g, k[E + 3 * c + 2] = p.b;
-                L[E + 0] = -g, L[E + 1] = g, L[E + 2] = 0, L[E + 3] = -g, L[E + 4] = -g, L[E + 5] = 0, L[E + 6] = g, L[E + 7] = -g, L[E + 8] = 0, L[E + 9] = g, L[E + 10] = g, L[E + 11] = 0, b.vertices += 4;
-                var $ = b.faceArray, z = b.faceidx;
-                $[z + 0] = _, $[z + 1] = _ + 1, $[z + 2] = _ + 2, $[z + 3] = _ + 2, $[z + 4] = _ + 3, $[z + 5] = _, b.faceidx += 6;
+                  k[E + 3 * c] = g.r, k[E + 3 * c + 1] = g.g, k[E + 3 * c + 2] = g.b;
+                $[E + 0] = -p, $[E + 1] = p, $[E + 2] = 0, $[E + 3] = -p, $[E + 4] = -p, $[E + 5] = 0, $[E + 6] = p, $[E + 7] = -p, $[E + 8] = 0, $[E + 9] = p, $[E + 10] = p, $[E + 11] = 0, b.vertices += 4;
+                var L = b.faceArray, z = b.faceidx;
+                L[z + 0] = _, L[z + 1] = _ + 1, L[z + 2] = _ + 2, L[z + 3] = _ + 2, L[z + 4] = _ + 3, L[z + 5] = _, b.faceidx += 6;
               }
               //dkoes -  code for sphere imposters
               drawAtomImposter(l, u) {
                 if (l.style.sphere) {
-                  var g = l.style.sphere;
-                  if (!g.hidden) {
-                    var p = this.getRadiusFromStyle(l, g), b = (0, v.getColorFromStyle)(l, g);
+                  var p = l.style.sphere;
+                  if (!p.hidden) {
+                    var g = this.getRadiusFromStyle(l, p), b = (0, v.getColorFromStyle)(l, p);
                     if ((l.clickable === !0 || l.hoverable) && l.intersectionShape !== void 0) {
                       var c = new s.Vector3(l.x, l.y, l.z);
-                      l.intersectionShape.sphere.push(new a.Sphere(c, p));
+                      l.intersectionShape.sphere.push(new a.Sphere(c, g));
                     }
-                    this.drawSphereImposter(u, l, p, b);
+                    this.drawSphereImposter(u, l, g, b);
                   }
                 }
               }
-              calculateDashes(l, u, g, p, b) {
+              calculateDashes(l, u, p, g, b) {
                 var c = Math.sqrt(Math.pow(l.x - u.x, 2) + Math.pow(l.y - u.y, 2) + Math.pow(l.z - u.z, 2));
-                g = Math.max(g, 0), b = Math.max(b, 0) + 2 * g, p = Math.max(p, 1e-3), p + b > c && (p = c, b = 0);
-                var _ = Math.floor((c - p) / (p + b)) + 1, E = _ * p;
+                p = Math.max(p, 0), b = Math.max(b, 0) + 2 * p, g = Math.max(g, 1e-3), g + b > c && (g = c, b = 0);
+                var _ = Math.floor((c - g) / (g + b)) + 1, E = _ * g;
                 b = (c - E) / _;
-                for (var w, k = new s.Vector3(l.x, l.y, l.z), L = new s.Vector3((u.x - l.x) / (c / b), (u.y - l.y) / (c / b), (u.z - l.z) / (c / b)), $ = new s.Vector3((u.x - l.x) / (c / p), (u.y - l.y) / (c / p), (u.z - l.z) / (c / p)), z = [], O = 0; O < _; O++)
-                  w = new s.Vector3(k.x + $.x, k.y + $.y, k.z + $.z), z.push({ from: k, to: w }), k = new s.Vector3(w.x + L.x, w.y + L.y, w.z + L.z);
+                for (var w, k = new s.Vector3(l.x, l.y, l.z), $ = new s.Vector3((u.x - l.x) / (c / b), (u.y - l.y) / (c / b), (u.z - l.z) / (c / b)), L = new s.Vector3((u.x - l.x) / (c / g), (u.y - l.y) / (c / g), (u.z - l.z) / (c / g)), z = [], F = 0; F < _; F++)
+                  w = new s.Vector3(k.x + L.x, k.y + L.y, k.z + L.z), z.push({ from: k, to: w }), k = new s.Vector3(w.x + $.x, w.y + $.y, w.z + $.z);
                 return z;
               }
-              static drawStickImposter(l, u, g, p, b, c = 0, _ = 0) {
-                for (var E = l.updateGeoGroup(4), w = E.vertices, k = w * 3, L = E.vertexArray, $ = E.colorArray, z = E.radiusArray, O = E.normalArray, R = b.r, P = b.g, U = b.b, N = function(H) {
+              static drawStickImposter(l, u, p, g, b, c = 0, _ = 0) {
+                for (var E = l.updateGeoGroup(4), w = E.vertices, k = w * 3, $ = E.vertexArray, L = E.colorArray, z = E.radiusArray, F = E.normalArray, R = b.r, P = b.g, U = b.b, N = function(H) {
                   var Q = -H;
                   return Q == 0 && (Q = -1e-4), Q;
                 }, B = k, W = 0; W < 4; W++)
-                  L[B] = u.x, O[B] = g.x, $[B] = R, B++, L[B] = u.y, O[B] = g.y, $[B] = P, B++, L[B] = u.z, O[B] = g.z, W < 2 ? $[B] = U : $[B] = N(U), B++;
-                E.vertices += 4, z[w] = -p, z[w + 1] = p, z[w + 2] = -p, z[w + 3] = p;
+                  $[B] = u.x, F[B] = p.x, L[B] = R, B++, $[B] = u.y, F[B] = p.y, L[B] = P, B++, $[B] = u.z, F[B] = p.z, W < 2 ? L[B] = U : L[B] = N(U), B++;
+                E.vertices += 4, z[w] = -g, z[w + 1] = g, z[w + 2] = -g, z[w + 3] = g;
                 var V = E.faceArray, G = E.faceidx;
                 V[G + 0] = w, V[G + 1] = w + 1, V[G + 2] = w + 2, V[G + 3] = w + 2, V[G + 4] = w + 3, V[G + 5] = w, E.faceidx += 6;
               }
               // draws cylinders and small spheres (at bond radius)
-              drawBondSticks(l, u, g) {
-                var p, b;
+              drawBondSticks(l, u, p) {
+                var g, b;
                 if (l.style.stick) {
                   var c = l.style.stick;
                   if (!c.hidden) {
-                    var _ = c.radius || this.defaultStickRadius, E = c.doubleBondScaling || 0.4, w = c.tripleBondScaling || 0.25, k = ((p = c.dashedBondConfig) === null || p === void 0 ? void 0 : p.dashLength) || 0.1, L = ((b = c.dashedBondConfig) === null || b === void 0 ? void 0 : b.gapLength) || 0.25, $ = _, z = c.singleBonds || !1, O = c.dashedBonds || !1, R = 0, P = 0, U, N, B, W, V, G, H, Q, te, ee, ce, fe = (0, v.getColorFromStyle)(l, c), oe, he, Ae;
+                    var _ = c.radius || this.defaultStickRadius, E = c.doubleBondScaling || 0.4, w = c.tripleBondScaling || 0.25, k = ((g = c.dashedBondConfig) === null || g === void 0 ? void 0 : g.dashLength) || 0.1, $ = ((b = c.dashedBondConfig) === null || b === void 0 ? void 0 : b.gapLength) || 0.25, L = _, z = c.singleBonds || !1, F = c.dashedBonds || !1, R = 0, P = 0, U, N, B, W, V, G, H, Q, te, ee, ce, fe = (0, v.getColorFromStyle)(l, c), oe, he, Ae;
                     !l.capDrawn && l.bonds.length < 4 && (R = 2);
                     var Se = (ae) => {
-                      var ge = g.imposter ? M.drawStickImposter : o.GLDraw.drawCylinder;
-                      return !O && ae >= 1 ? ge : (xe, ue, Ce, Z, Oe, We = 0, I = 0, we = 0.1, ve = 0.25) => {
+                      var ge = p.imposter ? M.drawStickImposter : o.GLDraw.drawCylinder;
+                      return !F && ae >= 1 ? ge : (xe, ue, Ce, Z, Fe, We = 0, I = 0, we = 0.1, ve = 0.25) => {
                         var Y = this.calculateDashes(ue, Ce, Z, we, ve);
                         Y.forEach((de) => {
-                          ge(xe, de.from, de.to, Z, Oe, We, I);
+                          ge(xe, de.from, de.to, Z, Fe, We, I);
                         });
                       };
                     };
@@ -21004,37 +21020,37 @@ void main() {
                         if (!ne.stick || ne.stick.hidden)
                           continue;
                         var Te = (0, v.getColorFromStyle)(le, ne.stick);
-                        if ($ = _, W = z, l.bondStyles && l.bondStyles[B]) {
+                        if (L = _, W = z, l.bondStyles && l.bondStyles[B]) {
                           if (V = l.bondStyles[B], V.iswire)
                             continue;
-                          V.radius && ($ = V.radius), V.singleBond && (W = !0), typeof V.color1 < "u" && (fe = h.CC.color(V.color1)), typeof V.color2 < "u" && (Te = h.CC.color(V.color2));
+                          V.radius && (L = V.radius), V.singleBond && (W = !0), typeof V.color1 < "u" && (fe = h.CC.color(V.color1)), typeof V.color2 < "u" && (Te = h.CC.color(V.color2));
                         }
-                        var Fe = new s.Vector3(l.x, l.y, l.z), Be = new s.Vector3(le.x, le.y, le.z);
+                        var Oe = new s.Vector3(l.x, l.y, l.z), Be = new s.Vector3(le.x, le.y, le.z);
                         if (l.bondOrder[B] <= 1 || W || l.bondOrder[B] > 3) {
-                          if (l.bondOrder[B] < 1 && ($ *= l.bondOrder[B]), !le.capDrawn && le.bonds.length < 4 && (P = 2), fe != Te ? (oe = new s.Vector3().addVectors(Fe, Be).multiplyScalar(0.5), Ie(g, Fe, oe, $, fe, R, 0, k, L), Ie(g, oe, Be, $, Te, 0, P, k, L)) : Ie(g, Fe, Be, $, fe, R, P, k, L), U = l.clickable || l.hoverable, N = le.clickable || le.hoverable, U || N) {
-                            if (oe || (oe = new s.Vector3().addVectors(Fe, Be).multiplyScalar(0.5)), U) {
-                              var Ue = new a.Cylinder(Fe, oe, $), Pe = new a.Sphere(Fe, $);
+                          if (l.bondOrder[B] < 1 && (L *= l.bondOrder[B]), !le.capDrawn && le.bonds.length < 4 && (P = 2), fe != Te ? (oe = new s.Vector3().addVectors(Oe, Be).multiplyScalar(0.5), Ie(p, Oe, oe, L, fe, R, 0, k, $), Ie(p, oe, Be, L, Te, 0, P, k, $)) : Ie(p, Oe, Be, L, fe, R, P, k, $), U = l.clickable || l.hoverable, N = le.clickable || le.hoverable, U || N) {
+                            if (oe || (oe = new s.Vector3().addVectors(Oe, Be).multiplyScalar(0.5)), U) {
+                              var Ue = new a.Cylinder(Oe, oe, L), Pe = new a.Sphere(Oe, L);
                               l.intersectionShape.cylinder.push(Ue), l.intersectionShape.sphere.push(Pe);
                             }
                             if (N) {
-                              var Ge = new a.Cylinder(Be, oe, $), Ne = new a.Sphere(Be, $);
+                              var Ge = new a.Cylinder(Be, oe, L), Ne = new a.Sphere(Be, L);
                               le.intersectionShape.cylinder.push(Ge), le.intersectionShape.sphere.push(Ne);
                             }
                           }
                         } else if (l.bondOrder[B] > 1) {
                           var Re = 0, De = 0;
-                          $ != _ && (Re = 2, De = 2);
+                          L != _ && (Re = 2, De = 2);
                           var je = Be.clone(), Xe = null;
-                          je.sub(Fe);
+                          je.sub(Oe);
                           var X, q, re, ye, me;
-                          Xe = this.getSideBondV(l, le, B), l.bondOrder[B] == 2 ? (X = $ * E, Xe.multiplyScalar(X * 1.5), q = Fe.clone(), q.add(Xe), re = Fe.clone(), re.sub(Xe), ye = q.clone(), ye.add(je), me = re.clone(), me.add(je), fe != Te ? (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5), he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5), Ie(g, q, oe, X, fe, Re, 0), Ie(g, oe, ye, X, Te, 0, De), Ie(g, re, he, X, fe, Re, 0), Ie(g, he, me, X, Te, 0, De)) : (Ie(g, q, ye, X, fe, Re, De), Ie(g, re, me, X, fe, Re, De)), U = l.clickable || l.hoverable, N = le.clickable || le.hoverable, (U || N) && (oe || (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5)), he || (he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5)), U && (G = new a.Cylinder(q, oe, X), H = new a.Cylinder(re, he, X), l.intersectionShape.cylinder.push(G), l.intersectionShape.cylinder.push(H)), N && (te = new a.Cylinder(ye, oe, X), ee = new a.Cylinder(me, he, X), le.intersectionShape.cylinder.push(te), le.intersectionShape.cylinder.push(ee)))) : l.bondOrder[B] == 3 && (X = $ * w, Xe.cross(je), Xe.normalize(), Xe.multiplyScalar(X * 3), q = Fe.clone(), q.add(Xe), re = Fe.clone(), re.sub(Xe), ye = q.clone(), ye.add(je), me = re.clone(), me.add(je), fe != Te ? (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5), he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5), Ae = new s.Vector3().addVectors(Fe, Be).multiplyScalar(0.5), Ie(g, q, oe, X, fe, Re, 0), Ie(g, oe, ye, X, Te, 0, De), Ie(g, Fe, Ae, X, fe, R, 0), Ie(g, Ae, Be, X, Te, 0, P), Ie(g, re, he, X, fe, Re, 0), Ie(g, he, me, X, Te, 0, De)) : (Ie(g, q, ye, X, fe, Re, De), Ie(g, Fe, Be, X, fe, R, P), Ie(g, re, me, X, fe, Re, De)), U = l.clickable || l.hoverable, N = le.clickable || le.hoverable, (U || N) && (oe || (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5)), he || (he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5)), Ae || (Ae = new s.Vector3().addVectors(Fe, Be).multiplyScalar(0.5)), U && (G = new a.Cylinder(q.clone(), oe.clone(), X), H = new a.Cylinder(re.clone(), he.clone(), X), Q = new a.Cylinder(Fe.clone(), Ae.clone(), X), l.intersectionShape.cylinder.push(G), l.intersectionShape.cylinder.push(H), l.intersectionShape.cylinder.push(Q)), N && (te = new a.Cylinder(ye.clone(), oe.clone(), X), ee = new a.Cylinder(me.clone(), he.clone(), X), ce = new a.Cylinder(Be.clone(), Ae.clone(), X), le.intersectionShape.cylinder.push(te), le.intersectionShape.cylinder.push(ee), le.intersectionShape.cylinder.push(ce))));
+                          Xe = this.getSideBondV(l, le, B), l.bondOrder[B] == 2 ? (X = L * E, Xe.multiplyScalar(X * 1.5), q = Oe.clone(), q.add(Xe), re = Oe.clone(), re.sub(Xe), ye = q.clone(), ye.add(je), me = re.clone(), me.add(je), fe != Te ? (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5), he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5), Ie(p, q, oe, X, fe, Re, 0), Ie(p, oe, ye, X, Te, 0, De), Ie(p, re, he, X, fe, Re, 0), Ie(p, he, me, X, Te, 0, De)) : (Ie(p, q, ye, X, fe, Re, De), Ie(p, re, me, X, fe, Re, De)), U = l.clickable || l.hoverable, N = le.clickable || le.hoverable, (U || N) && (oe || (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5)), he || (he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5)), U && (G = new a.Cylinder(q, oe, X), H = new a.Cylinder(re, he, X), l.intersectionShape.cylinder.push(G), l.intersectionShape.cylinder.push(H)), N && (te = new a.Cylinder(ye, oe, X), ee = new a.Cylinder(me, he, X), le.intersectionShape.cylinder.push(te), le.intersectionShape.cylinder.push(ee)))) : l.bondOrder[B] == 3 && (X = L * w, Xe.cross(je), Xe.normalize(), Xe.multiplyScalar(X * 3), q = Oe.clone(), q.add(Xe), re = Oe.clone(), re.sub(Xe), ye = q.clone(), ye.add(je), me = re.clone(), me.add(je), fe != Te ? (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5), he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5), Ae = new s.Vector3().addVectors(Oe, Be).multiplyScalar(0.5), Ie(p, q, oe, X, fe, Re, 0), Ie(p, oe, ye, X, Te, 0, De), Ie(p, Oe, Ae, X, fe, R, 0), Ie(p, Ae, Be, X, Te, 0, P), Ie(p, re, he, X, fe, Re, 0), Ie(p, he, me, X, Te, 0, De)) : (Ie(p, q, ye, X, fe, Re, De), Ie(p, Oe, Be, X, fe, R, P), Ie(p, re, me, X, fe, Re, De)), U = l.clickable || l.hoverable, N = le.clickable || le.hoverable, (U || N) && (oe || (oe = new s.Vector3().addVectors(q, ye).multiplyScalar(0.5)), he || (he = new s.Vector3().addVectors(re, me).multiplyScalar(0.5)), Ae || (Ae = new s.Vector3().addVectors(Oe, Be).multiplyScalar(0.5)), U && (G = new a.Cylinder(q.clone(), oe.clone(), X), H = new a.Cylinder(re.clone(), he.clone(), X), Q = new a.Cylinder(Oe.clone(), Ae.clone(), X), l.intersectionShape.cylinder.push(G), l.intersectionShape.cylinder.push(H), l.intersectionShape.cylinder.push(Q)), N && (te = new a.Cylinder(ye.clone(), oe.clone(), X), ee = new a.Cylinder(me.clone(), he.clone(), X), ce = new a.Cylinder(Be.clone(), Ae.clone(), X), le.intersectionShape.cylinder.push(te), le.intersectionShape.cylinder.push(ee), le.intersectionShape.cylinder.push(ce))));
                         }
                       }
                     }
                     var ze = !1, ke = 0, K = !1;
                     for (B = 0; B < l.bonds.length; B++)
                       W = z, l.bondStyles && l.bondStyles[B] && (V = l.bondStyles[B], V.singleBond && (W = !0), V.radius && V.radius != _ && (K = !0)), (W || l.bondOrder[B] == 1) && ke++;
-                    K ? ke > 0 && (ze = !0) : ke == 0 && (l.bonds.length > 0 || c.showNonBonded) && (ze = !0), ze && ($ = _, g.imposter ? this.drawSphereImposter(g.sphereGeometry, l, $, fe) : o.GLDraw.drawSphere(g, l, $, fe));
+                    K ? ke > 0 && (ze = !0) : ke == 0 && (l.bonds.length > 0 || c.showNonBonded) && (ze = !0), ze && (L = _, p.imposter ? this.drawSphereImposter(p.sphereGeometry, l, L, fe) : o.GLDraw.drawSphere(p, l, L, fe));
                   }
                 }
               }
@@ -21046,19 +21062,19 @@ void main() {
               /** param {AtomSpec[]} atoms */
               createMolObj(l, u) {
                 u = u || {};
-                var g = new r.Object3D(), p = [], b = {}, c = {}, _ = this.drawAtomSphere, E = null, w = null;
+                var p = new r.Object3D(), g = [], b = {}, c = {}, _ = this.drawAtomSphere, E = null, w = null;
                 u.supportsImposters ? (_ = this.drawAtomImposter, E = new r.Geometry(!0), E.imposter = !0, w = new r.Geometry(!0, !0), w.imposter = !0, w.sphereGeometry = new r.Geometry(!0), w.sphereGeometry.imposter = !0, w.drawnCaps = {}) : u.supportsAIA ? (_ = this.drawAtomInstanced, E = new r.Geometry(!1, !0, !0), E.instanced = !0, w = new r.Geometry(!0)) : (E = new r.Geometry(!0), w = new r.Geometry(!0));
-                var k, L, $, z, O = {}, R = [Number.POSITIVE_INFINITY, Number.NEGATIVE_INFINITY];
-                for (k = 0, $ = l.length; k < $; k++) {
+                var k, $, L, z, F = {}, R = [Number.POSITIVE_INFINITY, Number.NEGATIVE_INFINITY];
+                for (k = 0, L = l.length; k < L; k++) {
                   var P = l[k];
                   if (P && P.style) {
                     (P.clickable || P.hoverable) && P.intersectionShape === void 0 && (P.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), z = { line: void 0, cross: void 0, stick: void 0, sphere: void 0 };
-                    for (L in z)
-                      P.style[L] ? P.style[L].opacity ? z[L] = parseFloat(P.style[L].opacity) : z[L] = 1 : z[L] = void 0, O[L] ? z[L] != null && O[L] != z[L] && (console.log("Warning: " + L + " opacity is ambiguous"), O[L] = 1) : O[L] = z[L];
-                    _.call(this, P, E), this.drawAtomClickSphere(P), this.drawAtomCross(P, c), this.drawBondLines(P, l, b), this.drawBondSticks(P, l, w), typeof P.style.cartoon < "u" && !P.style.cartoon.hidden && (P.style.cartoon.color === "spectrum" && typeof P.resi == "number" && !P.hetflag && (P.resi < R[0] && (R[0] = P.resi), P.resi > R[1] && (R[1] = P.resi)), p.push(P));
+                    for ($ in z)
+                      P.style[$] ? P.style[$].opacity ? z[$] = parseFloat(P.style[$].opacity) : z[$] = 1 : z[$] = void 0, F[$] ? z[$] != null && F[$] != z[$] && (console.log("Warning: " + $ + " opacity is ambiguous"), F[$] = 1) : F[$] = z[$];
+                    _.call(this, P, E), this.drawAtomClickSphere(P), this.drawAtomCross(P, c), this.drawBondLines(P, l, b), this.drawBondSticks(P, l, w), typeof P.style.cartoon < "u" && !P.style.cartoon.hidden && (P.style.cartoon.color === "spectrum" && typeof P.resi == "number" && !P.hetflag && (P.resi < R[0] && (R[0] = P.resi), P.resi > R[1] && (R[1] = P.resi)), g.push(P));
                   }
                 }
-                if (p.length > 0 && (0, d.drawCartoon)(g, p, R, this.defaultCartoonQuality), E && E.vertices > 0) {
+                if (g.length > 0 && (0, d.drawCartoon)(p, g, R, this.defaultCartoonQuality), E && E.vertices > 0) {
                   E.initTypedArrays();
                   var U = null, N = null;
                   E.imposter ? U = new r.SphereImposterMaterial({
@@ -21076,17 +21092,17 @@ void main() {
                     ambient: 0,
                     vertexColors: !0,
                     reflectivity: 0
-                  }), O.sphere < 1 && O.sphere >= 0 && (U.transparent = !0, U.opacity = O.sphere), N = new r.Mesh(E, U), g.add(N);
+                  }), F.sphere < 1 && F.sphere >= 0 && (U.transparent = !0, U.opacity = F.sphere), N = new r.Mesh(E, U), p.add(N);
                 }
                 if (w.vertices > 0) {
                   var B = null, W = null, V = w.sphereGeometry;
                   (!V || typeof V.vertices > "u" || V.vertices == 0) && (V = null), w.initTypedArrays(), V && V.initTypedArrays();
                   var G = { ambient: 0, vertexColors: !0, reflectivity: 0 };
-                  w.imposter ? (B = new r.StickImposterMaterial(G), W = new r.SphereImposterMaterial(G)) : (B = new r.MeshLambertMaterial(G), W = new r.MeshLambertMaterial(G), B.wireframe && (w.setUpWireframe(), V && V.setUpWireframe())), O.stick < 1 && O.stick >= 0 && (B.transparent = !0, B.opacity = O.stick, W.transparent = !0, W.opacity = O.stick);
+                  w.imposter ? (B = new r.StickImposterMaterial(G), W = new r.SphereImposterMaterial(G)) : (B = new r.MeshLambertMaterial(G), W = new r.MeshLambertMaterial(G), B.wireframe && (w.setUpWireframe(), V && V.setUpWireframe())), F.stick < 1 && F.stick >= 0 && (B.transparent = !0, B.opacity = F.stick, W.transparent = !0, W.opacity = F.stick);
                   var H = new r.Mesh(w, B);
-                  if (g.add(H), V) {
+                  if (p.add(H), V) {
                     var Q = new r.Mesh(V, W);
-                    g.add(Q);
+                    p.add(Q);
                   }
                 }
                 var te;
@@ -21097,9 +21113,9 @@ void main() {
                       linewidth: te,
                       vertexColors: !0
                     });
-                    O.line < 1 && O.line >= 0 && (ee.transparent = !0, ee.opacity = O.line), b[k].initTypedArrays();
+                    F.line < 1 && F.line >= 0 && (ee.transparent = !0, ee.opacity = F.line), b[k].initTypedArrays();
                     var ce = new r.Line(b[k], ee, r.LineStyle.LinePieces);
-                    g.add(ce);
+                    p.add(ce);
                   }
                 for (k in c)
                   if (c.hasOwnProperty(k)) {
@@ -21108,19 +21124,19 @@ void main() {
                       linewidth: te,
                       vertexColors: !0
                     });
-                    O.cross < 1 && O.cross >= 0 && (fe.transparent = !0, fe.opacity = O.cross), c[k].initTypedArrays();
+                    F.cross < 1 && F.cross >= 0 && (fe.transparent = !0, fe.opacity = F.cross), c[k].initTypedArrays();
                     var oe = new r.Line(c[k], fe, r.LineStyle.LinePieces);
-                    g.add(oe);
+                    p.add(oe);
                   }
                 if (this.dontDuplicateAtoms && this.modelData.symmetries && this.modelData.symmetries.length > 0) {
                   var he = new r.Object3D(), Ae;
                   for (Ae = 0; Ae < this.modelData.symmetries.length; Ae++) {
                     var Se = new r.Object3D();
-                    Se = g.clone(), Se.matrix.copy(this.modelData.symmetries[Ae]), Se.matrixAutoUpdate = !1, he.add(Se);
+                    Se = p.clone(), Se.matrix.copy(this.modelData.symmetries[Ae]), Se.matrixAutoUpdate = !1, he.add(Se);
                   }
                   return he;
                 }
-                return g;
+                return p;
               }
               /**
                * Return object representing internal state of
@@ -21166,14 +21182,14 @@ void main() {
               	     * @param {number} gamma - unit cell angle in degrees (default 90)
               
               	     */
-              setCrystData(l, u, g, p, b, c) {
-                l = l || 1, u = u || 1, g = g || 1, p = p || 90, b = b || 90, c = c || 90;
-                const _ = (0, s.conversionMatrix3)(l, u, g, p, b, c);
+              setCrystData(l, u, p, g, b, c) {
+                l = l || 1, u = u || 1, p = p || 1, g = g || 90, b = b || 90, c = c || 90;
+                const _ = (0, s.conversionMatrix3)(l, u, p, g, b, c);
                 this.modelData.cryst = {
                   a: l,
                   b: u,
-                  c: g,
-                  alpha: p,
+                  c: p,
+                  alpha: g,
                   beta: b,
                   gamma: c,
                   matrix: _
@@ -21227,18 +21243,18 @@ void main() {
               getNumFrames() {
                 return this.frames.numFrames != null ? this.frames.numFrames : this.frames.length;
               }
-              adjustCoord(l, u, g, p) {
+              adjustCoord(l, u, p, g) {
                 var b = u - l;
-                return b < -g ? u + p : b > g ? u - p : u;
+                return b < -p ? u + g : b > p ? u - g : u;
               }
               //go over current atoms in depth first order and ensure that connected
               //attoms aren't split across the box
               adjustCoordinatesToBox() {
                 if (this.box && this.atomdfs)
-                  for (var l = this.box[0], u = this.box[1], g = this.box[2], p = l * 0.9, b = u * 0.9, c = g * 0.9, _ = 0; _ < this.atomdfs.length; _++)
+                  for (var l = this.box[0], u = this.box[1], p = this.box[2], g = l * 0.9, b = u * 0.9, c = p * 0.9, _ = 0; _ < this.atomdfs.length; _++)
                     for (var E = this.atomdfs[_], w = 1; w < E.length; w++) {
-                      var k = this.atoms[E[w][0]], L = this.atoms[E[w][1]];
-                      k.x = this.adjustCoord(L.x, k.x, p, l), k.y = this.adjustCoord(L.y, k.y, b, u), k.z = this.adjustCoord(L.z, k.z, c, g);
+                      var k = this.atoms[E[w][0]], $ = this.atoms[E[w][1]];
+                      k.x = this.adjustCoord($.x, k.x, g, l), k.y = this.adjustCoord($.y, k.y, b, u), k.z = this.adjustCoord($.z, k.z, c, p);
                     }
               }
               /**
@@ -21249,19 +21265,19 @@ void main() {
                * @return {Promise}
                */
               setFrame(l, u) {
-                var g = this.getNumFrames();
-                let p = this;
+                var p = this.getNumFrames();
+                let g = this;
                 return new Promise(function(b, c) {
-                  if (g == 0 && b(), (l < 0 || l >= g) && (l = g - 1), p.frames.url != null) {
-                    var _ = p.frames.url;
-                    (0, v.getbin)(_ + "/traj/frame/" + l + "/" + p.frames.path, void 0, "POST", void 0).then(function(E) {
-                      for (var w = new Float32Array(E, 44), k = 0, L = 0; L < p.atoms.length; L++)
-                        p.atoms[L].x = w[k++], p.atoms[L].y = w[k++], p.atoms[L].z = w[k++];
-                      p.box && p.atomdfs && p.adjustCoordinatesToBox(), b();
+                  if (p == 0 && b(), (l < 0 || l >= p) && (l = p - 1), g.frames.url != null) {
+                    var _ = g.frames.url;
+                    (0, v.getbin)(_ + "/traj/frame/" + l + "/" + g.frames.path, void 0, "POST", void 0).then(function(E) {
+                      for (var w = new Float32Array(E, 44), k = 0, $ = 0; $ < g.atoms.length; $++)
+                        g.atoms[$].x = w[k++], g.atoms[$].y = w[k++], g.atoms[$].z = w[k++];
+                      g.box && g.atomdfs && g.adjustCoordinatesToBox(), b();
                     }).catch(c);
                   } else
-                    p.atoms = p.frames[l], b();
-                  p.molObj = null, p.modelDatas && l < p.modelDatas.length && (p.modelData = p.modelDatas[l], p.unitCellObjects && u && (u.removeUnitCell(p), u.addUnitCell(p)));
+                    g.atoms = g.frames[l], b();
+                  g.molObj = null, g.modelDatas && l < g.modelDatas.length && (g.modelData = g.modelDatas[l], g.unitCellObjects && u && (u.removeUnitCell(g), u.addUnitCell(g)));
                 });
               }
               /**
@@ -21292,28 +21308,28 @@ void main() {
               	              viewer.render();
               	          });
               	     */
-              vibrate(l = 10, u = 1, g = !1, p, b) {
+              vibrate(l = 10, u = 1, p = !1, g, b) {
                 var c = 0, _ = l;
-                g && (c = -l, _ = l), this.frames !== void 0 && this.frames.origIndex !== void 0 ? this.setFrame(this.frames.origIndex) : this.setFrame(0), c < _ && (this.frames = []), g && (this.frames.origIndex = l);
+                p && (c = -l, _ = l), this.frames !== void 0 && this.frames.origIndex !== void 0 ? this.setFrame(this.frames.origIndex) : this.setFrame(0), c < _ && (this.frames = []), p && (this.frames.origIndex = l);
                 for (var E = c; E < _; E++) {
                   var w = [], k = this.frames.length;
                   if (E == 0 && !b) {
                     this.frames.push(this.atoms);
                     continue;
                   }
-                  for (var L = 0; L < this.atoms.length; L++) {
-                    var $ = (0, v.getAtomProperty)(this.atoms[L], "dx"), z = (0, v.getAtomProperty)(this.atoms[L], "dy"), O = (0, v.getAtomProperty)(this.atoms[L], "dz"), R = new s.Vector3($, z, O), P = new s.Vector3(this.atoms[L].x, this.atoms[L].y, this.atoms[L].z), U = E * u / l;
+                  for (var $ = 0; $ < this.atoms.length; $++) {
+                    var L = (0, v.getAtomProperty)(this.atoms[$], "dx"), z = (0, v.getAtomProperty)(this.atoms[$], "dy"), F = (0, v.getAtomProperty)(this.atoms[$], "dz"), R = new s.Vector3(L, z, F), P = new s.Vector3(this.atoms[$].x, this.atoms[$].y, this.atoms[$].z), U = E * u / l;
                     R.multiplyScalar(U), P.add(R);
                     var N = {};
-                    for (var B in this.atoms[L])
-                      N[B] = this.atoms[L][B];
-                    if (N.x = P.x, N.y = P.y, N.z = P.z, w.push(N), p && b) {
-                      var W = (0, v.extend)({}, b), V = new s.Vector3($, z, O);
+                    for (var B in this.atoms[$])
+                      N[B] = this.atoms[$][B];
+                    if (N.x = P.x, N.y = P.y, N.z = P.z, w.push(N), g && b) {
+                      var W = (0, v.extend)({}, b), V = new s.Vector3(L, z, F);
                       if (V.multiplyScalar(u), V.add(P), W.start = P, W.end = V, W.frame = k, !W.color) {
                         var G = N.style.sphere;
                         G || (G = N.style.stick), G || (G = N.style.line), W.color = (0, v.getColorFromStyle)(N, G);
                       }
-                      p.addArrow(W);
+                      g.addArrow(W);
                     }
                   }
                   this.frames.push(w);
@@ -21322,8 +21338,8 @@ void main() {
               // set default style and colors for atoms
               setAtomDefaults(l) {
                 for (let u = 0; u < l.length; u++) {
-                  let g = l[u];
-                  g && (g.style = g.style || (0, v.deepCopy)(M.defaultAtomStyle), g.color = g.color || this.ElementColors[g.elem] || this.defaultColor, g.model = this.id, (g.clickable || g.hoverable) && (g.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }));
+                  let p = l[u];
+                  p && (p.style = p.style || (0, v.deepCopy)(M.defaultAtomStyle), p.color = p.color || this.ElementColors[p.elem] || this.defaultColor, p.model = this.id, (p.clickable || p.hoverable) && (p.intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }));
                 }
               }
               /** add atoms to this model from molecular data string
@@ -21332,23 +21348,23 @@ void main() {
                * @param {string} format - input file string format (e.g 'pdb', 'sdf', 'sdf.gz', etc.)
                * @param {ParserOptionsSpec} options - format dependent options. Attributes depend on the input format
                */
-              addMolData(l, u, g = {}) {
-                var p = M.parseMolData(l, u, g);
-                this.dontDuplicateAtoms = !g.duplicateAssemblyAtoms;
-                var b = p.modelData;
-                if (b && (Array.isArray(b) ? (this.modelData = b[0], g.frames && (this.modelDatas = b)) : this.modelData = b), p.box ? this.box = p.box : this.box = null, this.frames.length == 0) {
-                  for (let _ = 0; _ < p.length; _++)
-                    p[_].length != 0 && this.frames.push(p[_]);
+              addMolData(l, u, p = {}) {
+                var g = M.parseMolData(l, u, p);
+                this.dontDuplicateAtoms = !p.duplicateAssemblyAtoms;
+                var b = g.modelData;
+                if (b && (Array.isArray(b) ? (this.modelData = b[0], p.frames && (this.modelDatas = b)) : this.modelData = b), g.box ? this.box = g.box : this.box = null, this.frames.length == 0) {
+                  for (let _ = 0; _ < g.length; _++)
+                    g[_].length != 0 && this.frames.push(g[_]);
                   this.frames[0] && (this.atoms = this.frames[0]);
-                } else if (g.frames)
-                  for (let _ = 0; _ < p.length; _++)
-                    this.frames.push(p[_]);
+                } else if (p.frames)
+                  for (let _ = 0; _ < g.length; _++)
+                    this.frames.push(g[_]);
                 else
-                  for (var c = 0; c < p.length; c++)
-                    this.addAtoms(p[c]);
+                  for (var c = 0; c < g.length; c++)
+                    this.addAtoms(g[c]);
                 for (let _ = 0; _ < this.frames.length; _++)
                   this.setAtomDefaults(this.frames[_]);
-                g.vibrate && g.vibrate.frames && g.vibrate.amplitude && this.vibrate(g.vibrate.frames, g.vibrate.amplitude), g.style && this.setStyle({}, g.style);
+                p.vibrate && p.vibrate.frames && p.vibrate.amplitude && this.vibrate(p.vibrate.frames, p.vibrate.amplitude), p.style && this.setStyle({}, p.style);
               }
               setDontDuplicateAtoms(l) {
                 this.dontDuplicateAtoms = l;
@@ -21361,10 +21377,10 @@ void main() {
                 if (l == u)
                   return !0;
                 if (typeof u == "string" && typeof l == "number") {
-                  var g = u.match(/(-?\d+)\s*-\s*(-?\d+)/);
-                  if (g) {
-                    var p = parseInt(g[1]), b = parseInt(g[2]);
-                    if (g && l >= p && l <= b)
+                  var p = u.match(/(-?\d+)\s*-\s*(-?\d+)/);
+                  if (p) {
+                    var g = parseInt(p[1]), b = parseInt(p[2]);
+                    if (p && l >= g && l <= b)
                       return !0;
                   }
                 }
@@ -21381,43 +21397,43 @@ void main() {
               static deepCopyAndCache(l, u) {
                 if (typeof l != "object" || l == null || l.__cache_created)
                   return l;
-                const g = {};
-                for (const p in l) {
-                  const b = l[p];
+                const p = {};
+                for (const g in l) {
+                  const b = l[g];
                   if (Array.isArray(b)) {
-                    g[p] = [];
+                    p[g] = [];
                     for (let c = 0; c < b.length; c++)
-                      g[p].push(M.deepCopyAndCache(b[c], u));
-                  } else typeof b == "object" && p != "properties" && p != "model" ? g[p] = M.deepCopyAndCache(b, u) : g[p] = b;
-                  if (p == "and" || p == "or") {
+                      p[g].push(M.deepCopyAndCache(b[c], u));
+                  } else typeof b == "object" && g != "properties" && g != "model" ? p[g] = M.deepCopyAndCache(b, u) : p[g] = b;
+                  if (g == "and" || g == "or") {
                     const c = [];
-                    for (const _ of g[p]) {
+                    for (const _ of p[g]) {
                       const E = /* @__PURE__ */ new Set();
                       for (const w of u.selectedAtoms(_))
                         E.add(w.index);
                       c.push(E);
                     }
-                    if (p == "and") {
+                    if (g == "and") {
                       const _ = function(w, k) {
-                        const L = /* @__PURE__ */ new Set();
-                        for (const $ of k)
-                          w.has($) && L.add($);
-                        return L;
+                        const $ = /* @__PURE__ */ new Set();
+                        for (const L of k)
+                          w.has(L) && $.add(L);
+                        return $;
                       };
                       let E = new Set(c[0]);
                       for (const w of c.splice(1))
                         E = _(E, w);
-                      g[p].__cached_results = E;
-                    } else if (p == "or") {
+                      p[g].__cached_results = E;
+                    } else if (g == "or") {
                       const _ = /* @__PURE__ */ new Set();
                       for (const E of c)
                         for (const w of E)
                           _.add(w);
-                      g[p].__cached_results = _;
+                      p[g].__cached_results = _;
                     }
                   }
                 }
-                return g.__cache_created = !0, g;
+                return p.__cache_created = !0, p;
               }
               /** given a selection specification, return true if atom is selected.
                * Does not support context-aware selectors like expand/within/byres.
@@ -21429,69 +21445,69 @@ void main() {
               atomIsSelected(l, u) {
                 if (typeof u > "u")
                   return !0;
-                var g = !!u.invert, p = !0;
+                var p = !!u.invert, g = !0;
                 for (var b in u)
                   if (b == "and" || b == "or" || b == "not") {
                     if (b == "not") {
                       if (this.atomIsSelected(l, u[b])) {
-                        p = !1;
+                        g = !1;
                         break;
                       }
-                    } else if (u[b].__cached_results === void 0 && (u = M.deepCopyAndCache(u, this)), p = u[b].__cached_results.has(l.index), !p)
+                    } else if (u[b].__cached_results === void 0 && (u = M.deepCopyAndCache(u, this)), g = u[b].__cached_results.has(l.index), !g)
                       break;
                   } else if (b === "predicate") {
                     if (!u.predicate(l)) {
-                      p = !1;
+                      g = !1;
                       break;
                     }
                   } else if (b == "properties" && l[b]) {
                     for (var c in u.properties)
                       if (!c.startsWith("__cache")) {
                         if (typeof l.properties[c] > "u") {
-                          p = !1;
+                          g = !1;
                           break;
                         }
                         if (l.properties[c] != u.properties[c]) {
-                          p = !1;
+                          g = !1;
                           break;
                         }
                       }
                   } else if (u.hasOwnProperty(b) && !M.ignoredKeys.has(b) && !b.startsWith("__cache")) {
                     if (typeof l[b] > "u") {
-                      p = !1;
+                      g = !1;
                       break;
                     }
                     var _ = !1;
                     if (b === "bonds") {
                       var E = u[b];
                       if (E != l.bonds.length) {
-                        p = !1;
+                        g = !1;
                         break;
                       }
                     } else if (Array.isArray(u[b])) {
                       var w = u[b], k = l[b];
-                      for (let L = 0; L < w.length; L++)
-                        if (this.propertyMatches(k, w[L])) {
+                      for (let $ = 0; $ < w.length; $++)
+                        if (this.propertyMatches(k, w[$])) {
                           _ = !0;
                           break;
                         }
                       if (!_) {
-                        p = !1;
+                        g = !1;
                         break;
                       }
                     } else {
-                      let L = u[b];
-                      if (!this.propertyMatches(l[b], L)) {
-                        p = !1;
+                      let $ = u[b];
+                      if (!this.propertyMatches(l[b], $)) {
+                        g = !1;
                         break;
                       }
                     }
                   }
-                return g ? !p : p;
+                return p ? !g : g;
               }
               static squaredDistance(l, u) {
-                var g = u.x - l.x, p = u.y - l.y, b = u.z - l.z;
-                return g * g + p * p + b * b;
+                var p = u.x - l.x, g = u.y - l.y, b = u.z - l.z;
+                return p * p + g * g + b * b;
               }
               /** returns a list of atoms in the expanded bounding box, but not in the current one
                *
@@ -21505,12 +21521,12 @@ void main() {
               expandAtomList(l, u) {
                 if (u <= 0)
                   return l;
-                for (var g = (0, v.getExtent)(l, void 0), p = [[], [], []], b = 0; b < 3; b++)
-                  p[0][b] = g[0][b] - u, p[1][b] = g[1][b] + u, p[2][b] = g[2][b];
+                for (var p = (0, v.getExtent)(l, void 0), g = [[], [], []], b = 0; b < 3; b++)
+                  g[0][b] = p[0][b] - u, g[1][b] = p[1][b] + u, g[2][b] = p[2][b];
                 var c = [];
                 for (let k = 0; k < this.atoms.length; k++) {
                   var _ = this.atoms[k].x, E = this.atoms[k].y, w = this.atoms[k].z;
-                  _ >= p[0][0] && _ <= p[1][0] && E >= p[0][1] && E <= p[1][1] && w >= p[0][2] && w <= p[1][2] && (_ >= g[0][0] && _ <= g[1][0] && E >= g[0][1] && E <= g[1][1] && w >= g[0][2] && w <= g[1][2] || c.push(this.atoms[k]));
+                  _ >= g[0][0] && _ <= g[1][0] && E >= g[0][1] && E <= g[1][1] && w >= g[0][2] && w <= g[1][2] && (_ >= p[0][0] && _ <= p[1][0] && E >= p[0][1] && E <= p[1][1] && w >= p[0][2] && w <= p[1][2] || c.push(this.atoms[k]));
                 }
                 return c;
               }
@@ -21532,57 +21548,57 @@ void main() {
                     });
                */
               selectedAtoms(l, u) {
-                var g = [];
+                var p = [];
                 l = M.deepCopyAndCache(l || {}, this), u || (u = this.atoms);
-                for (var p = u.length, b = 0; b < p; b++) {
+                for (var g = u.length, b = 0; b < g; b++) {
                   var c = u[b];
-                  c && this.atomIsSelected(c, l) && g.push(c);
+                  c && this.atomIsSelected(c, l) && p.push(c);
                 }
                 if (l.hasOwnProperty("expand")) {
                   const N = M.getFloat(l.expand);
-                  let B = this.expandAtomList(g, N), W = g.length;
+                  let B = this.expandAtomList(p, N), W = p.length;
                   const V = N * N;
                   for (let G = 0; G < B.length; G++)
                     for (let H = 0; H < W; H++) {
-                      var _ = M.squaredDistance(B[G], g[H]);
-                      _ < V && _ > 0 && g.push(B[G]);
+                      var _ = M.squaredDistance(B[G], p[H]);
+                      _ < V && _ > 0 && p.push(B[G]);
                     }
                 }
                 if (l.hasOwnProperty("within") && l.within.hasOwnProperty("sel") && l.within.hasOwnProperty("distance")) {
                   var E = this.selectedAtoms(l.within.sel, this.atoms), w = {};
                   const N = M.getFloat(l.within.distance), B = N * N;
                   for (let W = 0; W < E.length; W++)
-                    for (let V = 0; V < g.length; V++) {
-                      let G = M.squaredDistance(E[W], g[V]);
+                    for (let V = 0; V < p.length; V++) {
+                      let G = M.squaredDistance(E[W], p[V]);
                       G < B && G > 0 && (w[V] = 1);
                     }
                   var k = [];
                   if (l.within.invert)
-                    for (let W = 0; W < g.length; W++)
-                      w[W] || k.push(g[W]);
+                    for (let W = 0; W < p.length; W++)
+                      w[W] || k.push(p[W]);
                   else
                     for (let W in w)
-                      k.push(g[W]);
-                  g = k;
+                      k.push(p[W]);
+                  p = k;
                 }
                 if (l.hasOwnProperty("byres")) {
-                  var L = {}, $ = [], z = [];
-                  for (let N = 0; N < g.length; N++) {
-                    let B = g[N];
-                    var O = B.chain, R = B.resi;
-                    if (L[O] === void 0 && (L[O] = {}), B.hasOwnProperty("resi") && L[O][R] === void 0) {
-                      for (L[O][R] = !0, z.push(B); z.length > 0; )
-                        if (B = z.pop(), O = B.chain, R = B.resi, $[B.index] === void 0) {
-                          $[B.index] = !0;
+                  var $ = {}, L = [], z = [];
+                  for (let N = 0; N < p.length; N++) {
+                    let B = p[N];
+                    var F = B.chain, R = B.resi;
+                    if ($[F] === void 0 && ($[F] = {}), B.hasOwnProperty("resi") && $[F][R] === void 0) {
+                      for ($[F][R] = !0, z.push(B); z.length > 0; )
+                        if (B = z.pop(), F = B.chain, R = B.resi, L[B.index] === void 0) {
+                          L[B.index] = !0;
                           for (var P = 0; P < B.bonds.length; P++) {
                             var U = this.atoms[B.bonds[P]];
-                            $[U.index] === void 0 && U.hasOwnProperty("resi") && U.chain == O && U.resi == R && (z.push(U), g.push(U));
+                            L[U.index] === void 0 && U.hasOwnProperty("resi") && U.chain == F && U.resi == R && (z.push(U), p.push(U));
                           }
                         }
                     }
                   }
                 }
-                return g;
+                return p;
               }
               /** Add list of new atoms to model.  Adjusts bonds appropriately.
               	     *
@@ -21599,14 +21615,14 @@ void main() {
               	     */
               addAtoms(l) {
                 this.molObj = null;
-                var u = this.atoms.length, g = [], p;
-                for (p = 0; p < l.length; p++)
-                  typeof l[p].index > "u" && (l[p].index = p), typeof l[p].serial > "u" && (l[p].serial = p), g[l[p].index] = u + p;
-                for (p = 0; p < l.length; p++) {
-                  var b = l[p], c = g[b.index], _ = (0, v.extend)({}, b);
+                var u = this.atoms.length, p = [], g;
+                for (g = 0; g < l.length; g++)
+                  typeof l[g].index > "u" && (l[g].index = g), typeof l[g].serial > "u" && (l[g].serial = g), p[l[g].index] = u + g;
+                for (g = 0; g < l.length; g++) {
+                  var b = l[g], c = p[b.index], _ = (0, v.extend)({}, b);
                   _.index = c, _.bonds = [], _.bondOrder = [], _.model = this.id, _.style = _.style || (0, v.deepCopy)(M.defaultAtomStyle), typeof _.color > "u" && (_.color = this.ElementColors[_.elem] || this.defaultColor);
                   for (var E = b.bonds ? b.bonds.length : 0, w = 0; w < E; w++) {
-                    var k = g[b.bonds[w]];
+                    var k = p[b.bonds[w]];
                     typeof k < "u" && (_.bonds.push(k), _.bondOrder.push(b.bondOrder ? b.bondOrder[w] : 1));
                   }
                   this.atoms.push(_);
@@ -21625,15 +21641,15 @@ void main() {
                */
               removeAtoms(l) {
                 this.molObj = null;
-                var u = [], g;
-                for (g = 0; g < l.length; g++)
-                  u[l[g].index] = !0;
-                var p = [];
-                for (g = 0; g < this.atoms.length; g++) {
-                  var b = this.atoms[g];
-                  u[b.index] || p.push(b);
+                var u = [], p;
+                for (p = 0; p < l.length; p++)
+                  u[l[p].index] = !0;
+                var g = [];
+                for (p = 0; p < this.atoms.length; p++) {
+                  var b = this.atoms[p];
+                  u[b.index] || g.push(b);
                 }
-                this.atoms = [], this.addAtoms(p);
+                this.atoms = [], this.addAtoms(g);
               }
               /** Set atom style of selected atoms
               	     *
@@ -21655,16 +21671,16 @@ void main() {
               	              viewer.render();
               	          });
               	     */
-              setStyle(l, u, g) {
-                typeof u > "u" && typeof g > "u" && (u = l, l = {}), l = l, typeof u == "string" && (u = (0, v.specStringToObject)(u));
-                var p = !1, b = this, c = function(E) {
+              setStyle(l, u, p) {
+                typeof u > "u" && typeof p > "u" && (u = l, l = {}), l = l, typeof u == "string" && (u = (0, v.specStringToObject)(u));
+                var g = !1, b = this, c = function(E) {
                   var w = b.selectedAtoms(l, E);
                   for (let k = 0; k < E.length; k++)
                     E[k] && (E[k].capDrawn = !1);
                   for (let k = 0; k < w.length; k++) {
-                    p = !0, (w[k].clickable || w[k].hoverable) && (w[k].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), g || (w[k].style = {});
-                    for (let L in u)
-                      u.hasOwnProperty(L) && (w[k].style[L] = w[k].style[L] || {}, Object.assign(w[k].style[L], u[L]));
+                    g = !0, (w[k].clickable || w[k].hoverable) && (w[k].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }), p || (w[k].style = {});
+                    for (let $ in u)
+                      u.hasOwnProperty($) && (w[k].style[$] = w[k].style[$] || {}, Object.assign(w[k].style[$], u[$]));
                   }
                 };
                 if (l.frame !== void 0 && l.frame < this.frames.length) {
@@ -21675,7 +21691,7 @@ void main() {
                   for (var _ = 0; _ < this.frames.length; _++)
                     this.frames[_] !== this.atoms && c(this.frames[_]);
                 }
-                p && (this.molObj = null);
+                g && (this.molObj = null);
               }
               /** Set clickable and callback of selected atoms
               	     *
@@ -21684,14 +21700,14 @@ void main() {
               	     * @param {function} callback - function called when an atom in the selection is clicked
               
               	     */
-              setClickable(l, u, g) {
-                if (u = !!u, g = (0, v.makeFunction)(g), g === null) {
+              setClickable(l, u, p) {
+                if (u = !!u, p = (0, v.makeFunction)(p), p === null) {
                   console.log("Callback is not a function");
                   return;
                 }
-                var p = this.selectedAtoms(l, this.atoms), b = p.length;
+                var g = this.selectedAtoms(l, this.atoms), b = g.length;
                 for (let c = 0; c < b; c++)
-                  p[c].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, p[c].clickable = u, g && (p[c].callback = g);
+                  g[c].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, g[c].clickable = u, p && (g[c].callback = p);
                 b > 0 && (this.molObj = null);
               }
               /** Set hoverable and callback of selected atoms
@@ -21701,18 +21717,18 @@ void main() {
               * @param {function} hover_callback - function called when an atom in the selection is hovered over
               * @param {function} unhover_callback - function called when the mouse moves out of the hover area
               */
-              setHoverable(l, u, g, p) {
-                if (u = !!u, g = (0, v.makeFunction)(g), p = (0, v.makeFunction)(p), g === null) {
+              setHoverable(l, u, p, g) {
+                if (u = !!u, p = (0, v.makeFunction)(p), g = (0, v.makeFunction)(g), p === null) {
                   console.log("Hover_callback is not a function");
                   return;
                 }
-                if (p === null) {
+                if (g === null) {
                   console.log("Unhover_callback is not a function");
                   return;
                 }
                 var b = this.selectedAtoms(l, this.atoms), c = b.length;
                 for (let _ = 0; _ < c; _++)
-                  b[_].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, b[_].hoverable = u, g && (b[_].hover_callback = g), p && (b[_].unhover_callback = p);
+                  b[_].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, b[_].hoverable = u, p && (b[_].hover_callback = p), g && (b[_].unhover_callback = g);
                 c > 0 && (this.molObj = null);
               }
               /** enable context menu of selected atoms
@@ -21722,9 +21738,9 @@ void main() {
                */
               enableContextMenu(l, u) {
                 u = !!u;
-                var g, p = this.selectedAtoms(l, this.atoms), b = p.length;
-                for (g = 0; g < b; g++)
-                  p[g].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, p[g].contextMenuEnabled = u;
+                var p, g = this.selectedAtoms(l, this.atoms), b = g.length;
+                for (p = 0; p < b; p++)
+                  g[p].intersectionShape = { sphere: [], cylinder: [], line: [], triangle: [] }, g[p].contextMenuEnabled = u;
                 b > 0 && (this.molObj = null);
               }
               /** given a mapping from element to color, set atom colors
@@ -21735,10 +21751,10 @@ void main() {
               setColorByElement(l, u) {
                 if (!(this.molObj !== null && M.sameObj(u, this.lastColors))) {
                   this.lastColors = u;
-                  var g = this.selectedAtoms(l, g);
-                  g.length > 0 && (this.molObj = null);
-                  for (var p = 0; p < g.length; p++) {
-                    var b = g[p];
+                  var p = this.selectedAtoms(l, p);
+                  p.length > 0 && (this.molObj = null);
+                  for (var g = 0; g < p.length; g++) {
+                    var b = p[g];
                     typeof u[b.elem] < "u" && (b.color = u[b.elem]);
                   }
                 }
@@ -21748,12 +21764,12 @@ void main() {
                * @param {string} prop
                * @param {Gradient|string} scheme
                */
-              setColorByProperty(l, u, g, p) {
+              setColorByProperty(l, u, p, g) {
                 var b, c, _ = this.selectedAtoms(l, _);
-                for (this.lastColors = null, _.length > 0 && (this.molObj = null), typeof g == "string" && typeof f.Gradient.builtinGradients[g] < "u" && (g = new f.Gradient.builtinGradients[g]()), g = g, p || (p = g.range()), p || (p = (0, v.getPropertyRange)(_, u)), b = 0; b < _.length; b++) {
+                for (this.lastColors = null, _.length > 0 && (this.molObj = null), typeof p == "string" && typeof f.Gradient.builtinGradients[p] < "u" && (p = new f.Gradient.builtinGradients[p]()), p = p, g || (g = p.range()), g || (g = (0, v.getPropertyRange)(_, u)), b = 0; b < _.length; b++) {
                   c = _[b];
                   var E = (0, v.getAtomProperty)(c, u);
-                  E != null && (c.color = g.valueToHex(parseFloat(c.properties[u]), p));
+                  E != null && (c.color = p.valueToHex(parseFloat(c.properties[u]), g));
                 }
               }
               /**
@@ -21774,11 +21790,11 @@ void main() {
               
               	     */
               setColorByFunction(l, u) {
-                var g = this.selectedAtoms(l, g);
+                var p = this.selectedAtoms(l, p);
                 if (typeof u == "function") {
-                  this.lastColors = null, g.length > 0 && (this.molObj = null);
-                  for (let p = 0; p < g.length; p++) {
-                    let b = g[p];
+                  this.lastColors = null, p.length > 0 && (this.molObj = null);
+                  for (let g = 0; g < p.length; g++) {
+                    let b = p[g];
                     b.color = u(b);
                   }
                 }
@@ -21791,23 +21807,23 @@ void main() {
               toCDObject(l = !1) {
                 var u = { a: [], b: [] };
                 l && (u.s = []);
-                for (let p = 0; p < this.atoms.length; p++) {
-                  let b = {}, c = this.atoms[p];
+                for (let g = 0; g < this.atoms.length; g++) {
+                  let b = {}, c = this.atoms[g];
                   if (b.x = c.x, b.y = c.y, b.z = c.z, c.elem != "C" && (b.l = c.elem), l) {
-                    for (var g = 0; g < u.s.length && JSON.stringify(c.style) !== JSON.stringify(u.s[g]); )
-                      g++;
-                    g === u.s.length && u.s.push(c.style), g !== 0 && (b.s = g);
+                    for (var p = 0; p < u.s.length && JSON.stringify(c.style) !== JSON.stringify(u.s[p]); )
+                      p++;
+                    p === u.s.length && u.s.push(c.style), p !== 0 && (b.s = p);
                   }
                   u.a.push(b);
                   for (let _ = 0; _ < c.bonds.length; _++) {
-                    let E = p, w = c.bonds[_];
+                    let E = g, w = c.bonds[_];
                     if (E >= w)
                       continue;
                     let k = {
                       b: E,
                       e: w
-                    }, L = c.bondOrder[_];
-                    L != 1 && (k.o = L), u.b.push(k);
+                    }, $ = c.bondOrder[_];
+                    $ != 1 && (k.o = $), u.b.push(k);
                   }
                 }
                 return u;
@@ -21872,10 +21888,10 @@ void main() {
                * @param {GLViewer} viewer
                * @param {LabelSpec} options
                */
-              addPropertyLabels(l, u, g, p) {
-                for (var b = this.selectedAtoms(u, b), c = (0, v.deepCopy)(p), _ = 0; _ < b.length; _++) {
+              addPropertyLabels(l, u, p, g) {
+                for (var b = this.selectedAtoms(u, b), c = (0, v.deepCopy)(g), _ = 0; _ < b.length; _++) {
                   var E = b[_], w = null;
-                  typeof E[l] < "u" ? w = String(E[l]) : typeof E.properties[l] < "u" && (w = String(E.properties[l])), w != null && (c.position = E, g.addLabel(w, c));
+                  typeof E[l] < "u" ? w = String(E[l]) : typeof E.properties[l] < "u" && (w = String(E.properties[l])), w != null && (c.position = E, p.addLabel(w, c));
                 }
               }
               /** Create labels for residues of selected atoms.
@@ -21887,16 +21903,16 @@ void main() {
                * @param {LabelSpec} options
                * @param {boolean} byframe - if true, create labels for every individual frame, not just current; frames must be loaded already
                */
-              addResLabels(l, u, g, p = !1) {
+              addResLabels(l, u, p, g = !1) {
                 var b = [], c = function(E, w) {
-                  for (var k = E.selectedAtoms(l, k), L = {}, $ = 0; $ < k.length; $++) {
-                    var z = k[$], O = z.chain, R = z.resn, P = z.resi, U = R + "" + P;
-                    L[O] || (L[O] = {}), L[O][U] || (L[O][U] = []), L[O][U].push(z);
+                  for (var k = E.selectedAtoms(l, k), $ = {}, L = 0; L < k.length; L++) {
+                    var z = k[L], F = z.chain, R = z.resn, P = z.resi, U = R + "" + P;
+                    $[F] || ($[F] = {}), $[F][U] || ($[F][U] = []), $[F][U].push(z);
                   }
-                  var N = (0, v.deepCopy)(g);
-                  for (let W in L)
-                    if (L.hasOwnProperty(W)) {
-                      var B = L[W];
+                  var N = (0, v.deepCopy)(p);
+                  for (let W in $)
+                    if ($.hasOwnProperty(W)) {
+                      var B = $[W];
                       for (let V in B)
                         if (B.hasOwnProperty(V)) {
                           let G = B[V], H = new s.Vector3(0, 0, 0);
@@ -21910,7 +21926,7 @@ void main() {
                         }
                     }
                 };
-                if (p) {
+                if (g) {
                   var _ = this.getNumFrames();
                   let E = this.atoms;
                   for (let w = 0; w < _; w++)
@@ -21925,19 +21941,19 @@ void main() {
                 this.atomdfs = [];
                 var l = this, u = new Int8Array(this.atoms.length);
                 u.fill(0);
-                for (var g = function(_, E, w) {
+                for (var p = function(_, E, w) {
                   w.push([_, E]);
                   var k = l.atoms[_];
                   u[_] = 1;
-                  for (var L = 0; L < k.bonds.length; L++) {
-                    var $ = k.bonds[L];
-                    l.atoms[$] && !u[$] && g($, _, w);
+                  for (var $ = 0; $ < k.bonds.length; $++) {
+                    var L = k.bonds[$];
+                    l.atoms[L] && !u[L] && p(L, _, w);
                   }
-                }, p = 0; p < this.atoms.length; p++) {
-                  var b = this.atoms[p];
-                  if (b && !u[p]) {
+                }, g = 0; g < this.atoms.length; g++) {
+                  var b = this.atoms[g];
+                  if (b && !u[g]) {
                     var c = [];
-                    g(p, -1, c), this.atomdfs.push(c);
+                    p(g, -1, c), this.atomdfs.push(c);
                   }
                 }
               }
@@ -21949,10 +21965,10 @@ void main() {
               */
               setCoordinatesFromURL(l, u) {
                 this.frames = [];
-                var g = this;
-                return this.box && this.setupDFS(), l.startsWith("http") || (l = "http://" + l), (0, v.get)(l + "/traj/numframes/" + u, function(p) {
-                  if (!isNaN(parseInt(p)))
-                    return g.frames.push(g.atoms), g.frames.numFrames = p, g.frames.url = l, g.frames.path = u, g.setFrame(0);
+                var p = this;
+                return this.box && this.setupDFS(), l.startsWith("http") || (l = "http://" + l), (0, v.get)(l + "/traj/numframes/" + u, function(g) {
+                  if (!isNaN(parseInt(g)))
+                    return p.frames.push(p.atoms), p.frames.numFrames = g, p.frames.url = l, p.frames.path = u, p.setFrame(0);
                 });
               }
               /**
@@ -21976,15 +21992,15 @@ void main() {
                   u = u.replace(/\.gz$/, "");
                   try {
                     l = (0, v.inflateString)(l);
-                  } catch (L) {
-                    console.log(L);
+                  } catch ($) {
+                    console.log($);
                   }
                 }
-                var g = { mdcrd: "", inpcrd: "", pdb: "", netcdf: "", array: "" };
-                if (g.hasOwnProperty(u)) {
+                var p = { mdcrd: "", inpcrd: "", pdb: "", netcdf: "", array: "" };
+                if (p.hasOwnProperty(u)) {
                   this.frames = [];
-                  for (var p = this.atoms.length, b = M.parseCrd(l, u), c = 0; c < b.length; ) {
-                    for (var _ = [], E = 0; E < p; E++) {
+                  for (var g = this.atoms.length, b = M.parseCrd(l, u), c = 0; c < b.length; ) {
+                    for (var _ = [], E = 0; E < g; E++) {
                       var w = {};
                       for (var k in this.atoms[E])
                         w[k] = this.atoms[E][k];
@@ -22010,14 +22026,14 @@ void main() {
               addAtomSpecs(l) {
               }
               static parseCrd(l, u) {
-                var g = [], p = 0;
+                var p = [], g = 0;
                 if (u == "pdb")
                   for (var b = l.indexOf(`
 ATOM`); b != -1; ) {
                     for (; l.slice(b, b + 5) == `
 ATOM` || l.slice(b, b + 7) == `
 HETATM`; )
-                      g[p++] = parseFloat(l.slice(b + 31, b + 39)), g[p++] = parseFloat(l.slice(b + 39, b + 47)), g[p++] = parseFloat(l.slice(b + 47, b + 55)), b = l.indexOf(`
+                      p[g++] = parseFloat(l.slice(b + 31, b + 39)), p[g++] = parseFloat(l.slice(b + 39, b + 47)), p[g++] = parseFloat(l.slice(b + 47, b + 55)), b = l.indexOf(`
 `, b + 54), l.slice(b, b + 4) == `
 TER` && (b = l.indexOf(`
 `, b + 5));
@@ -22026,7 +22042,7 @@ ATOM`, b);
                   }
                 else if (u == "netcdf") {
                   var c = new A.NetCDFReader(l);
-                  g = [].concat.apply([], c.getDataVariable("coordinates"));
+                  p = [].concat.apply([], c.getDataVariable("coordinates"));
                 } else {
                   if (u == "array" || Array.isArray(l))
                     return l.flat(2);
@@ -22034,12 +22050,12 @@ ATOM`, b);
                     let _ = l.indexOf(`
 `);
                     u == "inpcrd" && (_ = l.indexOf(`
-`, _ + 1)), l = l.slice(_ + 1), g = l.match(/\S+/g).map(parseFloat);
+`, _ + 1)), l = l.slice(_ + 1), p = l.match(/\S+/g).map(parseFloat);
                   }
                 }
-                return g;
+                return p;
               }
-              static parseMolData(l, u = "", g) {
+              static parseMolData(l, u = "", p) {
                 if (!l)
                   return [];
                 if (/\.gz$/.test(u)) {
@@ -22051,7 +22067,7 @@ ATOM`, b);
                   }
                 }
                 typeof y.Parsers[u] > "u" && (u = u.split(".").pop(), typeof y.Parsers[u] > "u" && (console.log("Unknown format: " + u), l instanceof Uint8Array ? u = "bcif" : l.match(/^@<TRIPOS>MOLECULE/gm) ? u = "mol2" : l.match(/^data_/gm) && l.match(/^loop_/gm) ? u = "cif" : l.match(/^HETATM/gm) || l.match(/^ATOM/gm) ? u = "pdb" : l.match(/ITEM: TIMESTEP/gm) ? u = "lammpstrj" : l.match(/^.*\n.*\n.\s*(\d+)\s+(\d+)/gm) ? u = "sdf" : l.match(/^%VERSION\s+VERSION_STAMP/gm) ? u = "prmtop" : u = "xyz", console.log("Best guess: " + u)));
-                var p = y.Parsers[u], b = p(l, g);
+                var g = y.Parsers[u], b = g(l, p);
                 return b;
               }
             }
@@ -22176,16 +22192,16 @@ ATOM`, b);
                */
               static updateColor(m, l) {
                 l = l || h.CC.color(l), m.colorsNeedUpdate = !0;
-                var u, g, p;
-                l.constructor !== Array && (u = l.r, g = l.g, p = l.b);
+                var u, p, g;
+                l.constructor !== Array && (u = l.r, p = l.g, g = l.b);
                 for (let b in m.geometryGroups) {
                   let c = m.geometryGroups[b], _ = c.colorArray;
                   for (let E = 0, w = c.vertices; E < w; ++E) {
                     if (l.constructor === Array) {
                       let k = l[E];
-                      u = k.r, g = k.g, p = k.b;
+                      u = k.r, p = k.g, g = k.b;
                     }
-                    _[E * 3] = u, _[E * 3 + 1] = g, _[E * 3 + 2] = p;
+                    _[E * 3] = u, _[E * 3 + 1] = p, _[E * 3 + 2] = g;
                   }
                 }
               }
@@ -22198,34 +22214,34 @@ ATOM`, b);
                *            spec
                */
               static drawArrow(m, l, u) {
-                var g = u.start, p = u.end, b = u.radius, c = u.radiusRatio, _ = u.mid, E = u.midpos;
-                if (!(g && p))
+                var p = u.start, g = u.end, b = u.radius, c = u.radiusRatio, _ = u.mid, E = u.midpos;
+                if (!(p && g))
                   return;
-                var w = l.updateGeoGroup(51), k = new s.Vector3(p.x, p.y, p.z).sub(g);
+                var w = l.updateGeoGroup(51), k = new s.Vector3(g.x, g.y, g.z).sub(p);
                 if (E) {
                   let ue = k.length();
                   E > 0 ? _ = E / ue : _ = (ue + E) / ue;
                 }
                 k.multiplyScalar(_);
-                var L = new s.Vector3(g.x, g.y, g.z).add(k), $ = k.clone().negate();
-                let z = new s.Vector3(g.x, g.y, g.z);
-                m.intersectionShape.cylinder.push(new a.Cylinder(z, L.clone(), b)), m.intersectionShape.sphere.push(new a.Sphere(z, b));
-                var O = [];
-                O[0] = k.clone(), Math.abs(O[0].x) > 1e-4 ? O[0].y += 1 : O[0].x += 1, O[0].cross(k), O[0].normalize(), O[4] = O[0].clone(), O[4].crossVectors(O[0], k), O[4].normalize(), O[8] = O[0].clone().negate(), O[12] = O[4].clone().negate(), O[2] = O[0].clone().add(O[4]).normalize(), O[6] = O[4].clone().add(O[8]).normalize(), O[10] = O[8].clone().add(O[12]).normalize(), O[14] = O[12].clone().add(O[0]).normalize(), O[1] = O[0].clone().add(O[2]).normalize(), O[3] = O[2].clone().add(O[4]).normalize(), O[5] = O[4].clone().add(O[6]).normalize(), O[7] = O[6].clone().add(O[8]).normalize(), O[9] = O[8].clone().add(O[10]).normalize(), O[11] = O[10].clone().add(O[12]).normalize(), O[13] = O[12].clone().add(O[14]).normalize(), O[15] = O[14].clone().add(O[0]).normalize();
+                var $ = new s.Vector3(p.x, p.y, p.z).add(k), L = k.clone().negate();
+                let z = new s.Vector3(p.x, p.y, p.z);
+                m.intersectionShape.cylinder.push(new a.Cylinder(z, $.clone(), b)), m.intersectionShape.sphere.push(new a.Sphere(z, b));
+                var F = [];
+                F[0] = k.clone(), Math.abs(F[0].x) > 1e-4 ? F[0].y += 1 : F[0].x += 1, F[0].cross(k), F[0].normalize(), F[4] = F[0].clone(), F[4].crossVectors(F[0], k), F[4].normalize(), F[8] = F[0].clone().negate(), F[12] = F[4].clone().negate(), F[2] = F[0].clone().add(F[4]).normalize(), F[6] = F[4].clone().add(F[8]).normalize(), F[10] = F[8].clone().add(F[12]).normalize(), F[14] = F[12].clone().add(F[0]).normalize(), F[1] = F[0].clone().add(F[2]).normalize(), F[3] = F[2].clone().add(F[4]).normalize(), F[5] = F[4].clone().add(F[6]).normalize(), F[7] = F[6].clone().add(F[8]).normalize(), F[9] = F[8].clone().add(F[10]).normalize(), F[11] = F[10].clone().add(F[12]).normalize(), F[13] = F[12].clone().add(F[14]).normalize(), F[15] = F[14].clone().add(F[0]).normalize();
                 var R = w.vertices, P = w.vertexArray, U = w.faceArray, N = w.normalArray, B = w.lineArray, W, V, G;
-                for (V = 0, G = O.length; V < G; ++V) {
+                for (V = 0, G = F.length; V < G; ++V) {
                   W = 3 * (R + 3 * V);
-                  var H = O[V].clone().multiplyScalar(b).add(g), Q = O[V].clone().multiplyScalar(b).add(L), te = O[V].clone().multiplyScalar(b * c).add(L);
+                  var H = F[V].clone().multiplyScalar(b).add(p), Q = F[V].clone().multiplyScalar(b).add($), te = F[V].clone().multiplyScalar(b * c).add($);
                   if (P[W] = H.x, P[W + 1] = H.y, P[W + 2] = H.z, P[W + 3] = Q.x, P[W + 4] = Q.y, P[W + 5] = Q.z, P[W + 6] = te.x, P[W + 7] = te.y, P[W + 8] = te.z, V > 0) {
-                    var ee = P[W - 3], ce = P[W - 2], fe = P[W - 1], oe = new s.Vector3(ee, ce, fe), he = new s.Vector3(p.x, p.y, p.z), Ae = L.clone(), Se = new s.Vector3(te.x, te.y, te.z);
+                    var ee = P[W - 3], ce = P[W - 2], fe = P[W - 1], oe = new s.Vector3(ee, ce, fe), he = new s.Vector3(g.x, g.y, g.z), Ae = $.clone(), Se = new s.Vector3(te.x, te.y, te.z);
                     m.intersectionShape.triangle.push(new a.Triangle(Se, he, oe)), m.intersectionShape.triangle.push(new a.Triangle(oe.clone(), Ae, Se.clone()));
                   }
                 }
-                w.vertices += 48, W = w.vertices * 3, P[W] = g.x, P[W + 1] = g.y, P[W + 2] = g.z, P[W + 3] = L.x, P[W + 4] = L.y, P[W + 5] = L.z, P[W + 6] = p.x, P[W + 7] = p.y, P[W + 8] = p.z, w.vertices += 3;
-                var Ie, pe, le, ne, Te, Fe, Be, Ue, Pe, Ge, Ne, Re, De, je, Xe, X, q, re, ye, me = w.vertices - 3, ze = w.vertices - 2, ke = w.vertices - 1, K = me * 3, ae = ze * 3, ge = ke * 3;
-                for (V = 0, G = O.length - 1; V < G; ++V) {
+                w.vertices += 48, W = w.vertices * 3, P[W] = p.x, P[W + 1] = p.y, P[W + 2] = p.z, P[W + 3] = $.x, P[W + 4] = $.y, P[W + 5] = $.z, P[W + 6] = g.x, P[W + 7] = g.y, P[W + 8] = g.z, w.vertices += 3;
+                var Ie, pe, le, ne, Te, Oe, Be, Ue, Pe, Ge, Ne, Re, De, je, Xe, X, q, re, ye, me = w.vertices - 3, ze = w.vertices - 2, ke = w.vertices - 1, K = me * 3, ae = ze * 3, ge = ke * 3;
+                for (V = 0, G = F.length - 1; V < G; ++V) {
                   var xe = R + 3 * V;
-                  W = xe * 3, pe = w.faceidx, le = w.lineidx, ne = xe, Ge = ne * 3, Te = xe + 1, Ne = Te * 3, Fe = xe + 2, Re = Fe * 3, Be = xe + 4, De = Be * 3, Ue = xe + 5, je = Ue * 3, Pe = xe + 3, Xe = Pe * 3, X = q = O[V], re = ye = O[V + 1], N[Ge] = X.x, N[Ne] = q.x, N[Xe] = ye.x, N[Ge + 1] = X.y, N[Ne + 1] = q.y, N[Xe + 1] = ye.y, N[Ge + 2] = X.z, N[Ne + 2] = q.z, N[Xe + 2] = ye.z, N[Ne] = q.x, N[De] = re.x, N[Xe] = ye.x, N[Ne + 1] = q.y, N[De + 1] = re.y, N[Xe + 1] = ye.y, N[Ne + 2] = q.z, N[De + 2] = re.z, N[Xe + 2] = ye.z, N[Re] = q.x, N[je] = re.x, N[Re + 1] = q.y, N[je + 1] = re.y, N[Re + 2] = q.z, N[je + 2] = re.z, U[pe] = ne, U[pe + 1] = Te, U[pe + 2] = Pe, U[pe + 3] = Te, U[pe + 4] = Be, U[pe + 5] = Pe, U[pe + 6] = ne, U[pe + 7] = Pe, U[pe + 8] = me, U[pe + 9] = Fe, U[pe + 10] = ze, U[pe + 11] = Ue, U[pe + 12] = Fe, U[pe + 13] = ke, U[pe + 14] = Ue, B[le] = ne, B[le + 1] = Te, B[le + 2] = ne, B[le + 3] = Pe, B[le + 4] = Be, B[le + 5] = Pe, B[le + 6] = ne, B[le + 7] = Pe, B[le + 8] = Fe, B[le + 9] = Te, B[le + 10] = Fe, B[le + 11] = Ue, B[le + 12] = Be, B[le + 13] = Ue, B[le + 14] = Fe, B[le + 15] = ke, B[le + 16] = Fe, B[le + 17] = Ue, B[le + 18] = ke, B[le + 19] = Ue, w.faceidx += 15, w.lineidx += 20;
+                  W = xe * 3, pe = w.faceidx, le = w.lineidx, ne = xe, Ge = ne * 3, Te = xe + 1, Ne = Te * 3, Oe = xe + 2, Re = Oe * 3, Be = xe + 4, De = Be * 3, Ue = xe + 5, je = Ue * 3, Pe = xe + 3, Xe = Pe * 3, X = q = F[V], re = ye = F[V + 1], N[Ge] = X.x, N[Ne] = q.x, N[Xe] = ye.x, N[Ge + 1] = X.y, N[Ne + 1] = q.y, N[Xe + 1] = ye.y, N[Ge + 2] = X.z, N[Ne + 2] = q.z, N[Xe + 2] = ye.z, N[Ne] = q.x, N[De] = re.x, N[Xe] = ye.x, N[Ne + 1] = q.y, N[De + 1] = re.y, N[Xe + 1] = ye.y, N[Ne + 2] = q.z, N[De + 2] = re.z, N[Xe + 2] = ye.z, N[Re] = q.x, N[je] = re.x, N[Re + 1] = q.y, N[je + 1] = re.y, N[Re + 2] = q.z, N[je + 2] = re.z, U[pe] = ne, U[pe + 1] = Te, U[pe + 2] = Pe, U[pe + 3] = Te, U[pe + 4] = Be, U[pe + 5] = Pe, U[pe + 6] = ne, U[pe + 7] = Pe, U[pe + 8] = me, U[pe + 9] = Oe, U[pe + 10] = ze, U[pe + 11] = Ue, U[pe + 12] = Oe, U[pe + 13] = ke, U[pe + 14] = Ue, B[le] = ne, B[le + 1] = Te, B[le + 2] = ne, B[le + 3] = Pe, B[le + 4] = Be, B[le + 5] = Pe, B[le + 6] = ne, B[le + 7] = Pe, B[le + 8] = Oe, B[le + 9] = Te, B[le + 10] = Oe, B[le + 11] = Ue, B[le + 12] = Be, B[le + 13] = Ue, B[le + 14] = Oe, B[le + 15] = ke, B[le + 16] = Oe, B[le + 17] = Ue, B[le + 18] = ke, B[le + 19] = Ue, w.faceidx += 15, w.lineidx += 20;
                 }
                 Ie = [
                   R + 45,
@@ -22234,7 +22250,7 @@ ATOM`, b);
                   R,
                   R + 47,
                   R + 2
-                ], pe = w.faceidx, le = w.lineidx, ne = Ie[0], Ge = ne * 3, Te = Ie[1], Ne = Te * 3, Fe = Ie[4], Re = Fe * 3, Be = Ie[2], De = Be * 3, Ue = Ie[5], je = Ue * 3, Pe = Ie[3], Xe = Pe * 3, X = q = O[15], re = ye = O[0], N[Ge] = X.x, N[Ne] = q.x, N[Xe] = ye.x, N[Ge + 1] = X.y, N[Ne + 1] = q.y, N[Xe + 1] = ye.y, N[Ge + 2] = X.z, N[Ne + 2] = q.z, N[Xe + 2] = ye.z, N[Ne] = q.x, N[De] = re.x, N[Xe] = ye.x, N[Ne + 1] = q.y, N[De + 1] = re.y, N[Xe + 1] = ye.y, N[Ne + 2] = q.z, N[De + 2] = re.z, N[Xe + 2] = ye.z, N[Re] = q.x, N[je] = re.x, N[Re + 1] = q.y, N[je + 1] = re.y, N[Re + 2] = q.z, N[je + 2] = re.z, k.normalize(), $.normalize(), N[K] = $.x, N[ae] = N[ge] = k.x, N[K + 1] = $.y, N[ae + 1] = N[ge + 1] = k.y, N[K + 2] = $.z, N[ae + 2] = N[ge + 2] = k.z, U[pe] = ne, U[pe + 1] = Te, U[pe + 2] = Pe, U[pe + 3] = Te, U[pe + 4] = Be, U[pe + 5] = Pe, U[pe + 6] = ne, U[pe + 7] = Pe, U[pe + 8] = me, U[pe + 9] = Fe, U[pe + 10] = ze, U[pe + 11] = Ue, U[pe + 12] = Fe, U[pe + 13] = ke, U[pe + 14] = Ue, B[le] = ne, B[le + 1] = Te, B[le + 2] = ne, B[le + 3] = Pe, B[le + 4] = Be, B[le + 5] = Pe, B[le + 6] = ne, B[le + 7] = Pe, B[le + 8] = Fe, B[le + 9] = Te, B[le + 10] = Fe, B[le + 11] = Ue, B[le + 12] = Be, B[le + 13] = Ue, B[le + 14] = Fe, B[le + 15] = ke, B[le + 16] = Fe, B[le + 17] = Ue, B[le + 18] = ke, B[le + 19] = Ue, w.faceidx += 15, w.lineidx += 20;
+                ], pe = w.faceidx, le = w.lineidx, ne = Ie[0], Ge = ne * 3, Te = Ie[1], Ne = Te * 3, Oe = Ie[4], Re = Oe * 3, Be = Ie[2], De = Be * 3, Ue = Ie[5], je = Ue * 3, Pe = Ie[3], Xe = Pe * 3, X = q = F[15], re = ye = F[0], N[Ge] = X.x, N[Ne] = q.x, N[Xe] = ye.x, N[Ge + 1] = X.y, N[Ne + 1] = q.y, N[Xe + 1] = ye.y, N[Ge + 2] = X.z, N[Ne + 2] = q.z, N[Xe + 2] = ye.z, N[Ne] = q.x, N[De] = re.x, N[Xe] = ye.x, N[Ne + 1] = q.y, N[De + 1] = re.y, N[Xe + 1] = ye.y, N[Ne + 2] = q.z, N[De + 2] = re.z, N[Xe + 2] = ye.z, N[Re] = q.x, N[je] = re.x, N[Re + 1] = q.y, N[je + 1] = re.y, N[Re + 2] = q.z, N[je + 2] = re.z, k.normalize(), L.normalize(), N[K] = L.x, N[ae] = N[ge] = k.x, N[K + 1] = L.y, N[ae + 1] = N[ge + 1] = k.y, N[K + 2] = L.z, N[ae + 2] = N[ge + 2] = k.z, U[pe] = ne, U[pe + 1] = Te, U[pe + 2] = Pe, U[pe + 3] = Te, U[pe + 4] = Be, U[pe + 5] = Pe, U[pe + 6] = ne, U[pe + 7] = Pe, U[pe + 8] = me, U[pe + 9] = Oe, U[pe + 10] = ze, U[pe + 11] = Ue, U[pe + 12] = Oe, U[pe + 13] = ke, U[pe + 14] = Ue, B[le] = ne, B[le + 1] = Te, B[le + 2] = ne, B[le + 3] = Pe, B[le + 4] = Be, B[le + 5] = Pe, B[le + 6] = ne, B[le + 7] = Pe, B[le + 8] = Oe, B[le + 9] = Te, B[le + 10] = Oe, B[le + 11] = Ue, B[le + 12] = Be, B[le + 13] = Ue, B[le + 14] = Oe, B[le + 15] = ke, B[le + 16] = Oe, B[le + 17] = Ue, B[le + 18] = ke, B[le + 19] = Ue, w.faceidx += 15, w.lineidx += 20;
               }
               // Update a bounding sphere's position and radius
               // from list of centroids and new points
@@ -22247,30 +22263,30 @@ ATOM`, b);
                *            points, flat array of all points in shape
                * @param {int} numPoints, number of valid poitns in points
                */
-              static updateBoundingFromPoints(m, l, u, g) {
+              static updateBoundingFromPoints(m, l, u, p) {
                 m.center.set(0, 0, 0);
-                let p = 1 / 0, b = 1 / 0, c = 1 / 0, _ = -1 / 0, E = -1 / 0, w = -1 / 0;
-                m.box && (p = m.box.min.x, _ = m.box.max.x, b = m.box.min.y, E = m.box.max.y, c = m.box.min.z, w = m.box.max.z);
-                for (let z = 0, O = g; z < O; z++) {
-                  var k = u[z * 3], L = u[z * 3 + 1], $ = u[z * 3 + 2];
-                  k < p && (p = k), L < b && (b = L), $ < c && (c = $), k > _ && (_ = k), L > E && (E = L), $ > w && (w = $);
+                let g = 1 / 0, b = 1 / 0, c = 1 / 0, _ = -1 / 0, E = -1 / 0, w = -1 / 0;
+                m.box && (g = m.box.min.x, _ = m.box.max.x, b = m.box.min.y, E = m.box.max.y, c = m.box.min.z, w = m.box.max.z);
+                for (let z = 0, F = p; z < F; z++) {
+                  var k = u[z * 3], $ = u[z * 3 + 1], L = u[z * 3 + 2];
+                  k < g && (g = k), $ < b && (b = $), L < c && (c = L), k > _ && (_ = k), $ > E && (E = $), L > w && (w = L);
                 }
-                m.center.set((_ + p) / 2, (E + b) / 2, (w + c) / 2), m.radius = m.center.distanceTo({ x: _, y: E, z: w }), m.box = { min: { x: p, y: b, z: c }, max: { x: _, y: E, z: w } };
+                m.center.set((_ + g) / 2, (E + b) / 2, (w + c) / 2), m.radius = m.center.distanceTo({ x: _, y: E, z: w }), m.box = { min: { x: g, y: b, z: c }, max: { x: _, y: E, z: w } };
               }
               //helper function for adding an appropriately sized mesh
-              static addCustomGeo(m, l, u, g, p) {
+              static addCustomGeo(m, l, u, p, g) {
                 var b = l.addGeoGroup(), c = u.vertexArr, _ = u.normalArr, E = u.faceArr;
                 b.vertices = c.length, b.faceidx = E.length;
-                var w, k, L, $, z, O, R, P, U, N = b.vertexArray, B = b.colorArray;
-                for (g.constructor !== Array && (P = g.r, U = g.g, $ = g.b), O = 0, R = b.vertices; O < R; ++O)
-                  w = O * 3, k = c[O], N[w] = k.x, N[w + 1] = k.y, N[w + 2] = k.z, g.constructor === Array && (z = g[O], P = z.r, U = z.g, $ = z.b), B[w] = P, B[w + 1] = U, B[w + 2] = $;
-                if (p)
-                  for (O = 0, R = b.faceidx / 3; O < R; ++O) {
-                    w = O * 3, L = E[w], $ = E[w + 1], z = E[w + 2];
+                var w, k, $, L, z, F, R, P, U, N = b.vertexArray, B = b.colorArray;
+                for (p.constructor !== Array && (P = p.r, U = p.g, L = p.b), F = 0, R = b.vertices; F < R; ++F)
+                  w = F * 3, k = c[F], N[w] = k.x, N[w + 1] = k.y, N[w + 2] = k.z, p.constructor === Array && (z = p[F], P = z.r, U = z.g, L = z.b), B[w] = P, B[w + 1] = U, B[w + 2] = L;
+                if (g)
+                  for (F = 0, R = b.faceidx / 3; F < R; ++F) {
+                    w = F * 3, $ = E[w], L = E[w + 1], z = E[w + 2];
                     var W = new s.Vector3(), V = new s.Vector3(), G = new s.Vector3();
-                    m.intersectionShape.triangle.push(new a.Triangle(W.copy(c[L]), V.copy(c[$]), G.copy(c[z])));
+                    m.intersectionShape.triangle.push(new a.Triangle(W.copy(c[$]), V.copy(c[L]), G.copy(c[z])));
                   }
-                if (p) {
+                if (g) {
                   var H = new s.Vector3(0, 0, 0), Q = 0;
                   for (let ce = 0; ce < l.geometryGroups.length; ce++)
                     H.add(l.geometryGroups[ce].getCentroid()), Q++;
@@ -22280,8 +22296,8 @@ ATOM`, b);
                   b.setNormals();
                 else {
                   var te = b.normalArray = new Float32Array(b.vertices * 3), ee;
-                  for (O = 0, R = b.vertices; O < R; ++O)
-                    w = O * 3, ee = _[O], te[w] = ee.x, te[w + 1] = ee.y, te[w + 2] = ee.z;
+                  for (F = 0, R = b.vertices; F < R; ++F)
+                    w = F * 3, ee = _[F], te[w] = ee.x, te[w + 1] = ee.y, te[w + 2] = ee.z;
                 }
                 b.setLineIndices(), b.lineidx = b.lineArray.length;
               }
@@ -22323,10 +22339,10 @@ ATOM`, b);
                   this.stylespec[l] = m[l];
                 if (A.updateFromStyle(this, this.stylespec), m.voldata && m.volscheme) {
                   (0, y.adjustVolumeStyle)(m);
-                  const u = m.volscheme, g = m.voldata, p = h.CC, b = u.range() || [-1, 1];
+                  const u = m.volscheme, p = m.voldata, g = h.CC, b = u.range() || [-1, 1];
                   this.geo.setColors(function(c, _, E) {
-                    let w = g.getVal(c, _, E);
-                    return p.color(u.valueToHex(w, b));
+                    let w = p.getVal(c, _, E);
+                    return g.color(u.valueToHex(w, b));
                   }), delete this.color;
                 }
               }
@@ -22369,37 +22385,37 @@ ATOM`, b);
               addBox(m) {
                 var l = m.dimensions || { w: 1, h: 1, d: 1 }, u;
                 typeof l.w == "number" ? u = { x: l.w, y: 0, z: 0 } : u = l.w;
-                var g;
-                typeof l.h == "number" ? g = { x: 0, y: l.h, z: 0 } : g = l.h;
                 var p;
-                typeof l.d == "number" ? p = { x: 0, y: 0, z: l.d } : p = l.d;
+                typeof l.h == "number" ? p = { x: 0, y: l.h, z: 0 } : p = l.h;
+                var g;
+                typeof l.d == "number" ? g = { x: 0, y: 0, z: l.d } : g = l.d;
                 var b = m.corner;
                 b == null && (m.center !== void 0 ? b = {
-                  x: m.center.x - 0.5 * (u.x + g.x + p.x),
-                  y: m.center.y - 0.5 * (u.y + g.y + p.y),
-                  z: m.center.z - 0.5 * (u.z + g.z + p.z)
+                  x: m.center.x - 0.5 * (u.x + p.x + g.x),
+                  y: m.center.y - 0.5 * (u.y + p.y + g.y),
+                  z: m.center.z - 0.5 * (u.z + p.z + g.z)
                 } : b = { x: 0, y: 0, z: 0 });
                 var c = [
                   { x: b.x, y: b.y, z: b.z },
                   { x: b.x + u.x, y: b.y + u.y, z: b.z + u.z },
-                  { x: b.x + g.x, y: b.y + g.y, z: b.z + g.z },
-                  { x: b.x + u.x + g.x, y: b.y + u.y + g.y, z: b.z + u.z + g.z },
                   { x: b.x + p.x, y: b.y + p.y, z: b.z + p.z },
                   { x: b.x + u.x + p.x, y: b.y + u.y + p.y, z: b.z + u.z + p.z },
-                  { x: b.x + g.x + p.x, y: b.y + g.y + p.y, z: b.z + g.z + p.z },
-                  { x: b.x + u.x + g.x + p.x, y: b.y + u.y + g.y + p.y, z: b.z + u.z + g.z + p.z }
+                  { x: b.x + g.x, y: b.y + g.y, z: b.z + g.z },
+                  { x: b.x + u.x + g.x, y: b.y + u.y + g.y, z: b.z + u.z + g.z },
+                  { x: b.x + p.x + g.x, y: b.y + p.y + g.y, z: b.z + p.z + g.z },
+                  { x: b.x + u.x + p.x + g.x, y: b.y + u.y + p.y + g.y, z: b.z + u.z + p.z + g.z }
                 ], _ = [], E = [];
                 _.splice(_.length, 0, c[0], c[1], c[2], c[3]), E.splice(E.length, 0, 0, 2, 1, 1, 2, 3);
                 var w = 4;
                 _.splice(_.length, 0, c[2], c[3], c[6], c[7]), E.splice(E.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, _.splice(_.length, 0, c[4], c[5], c[0], c[1]), E.splice(E.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, _.splice(_.length, 0, c[6], c[7], c[4], c[5]), E.splice(E.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, _.splice(_.length, 0, c[3], c[1], c[7], c[5]), E.splice(E.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4, _.splice(_.length, 0, c[2], c[6], c[0], c[4]), E.splice(E.length, 0, w + 0, w + 2, w + 1, w + 1, w + 2, w + 3), w += 4;
                 var k = (0, y.extend)({}, m);
                 k.vertexArr = _, k.faceArr = E, k.normalArr = [], A.drawCustom(this, this.geo, k);
-                var L = new s.Vector3();
+                var $ = new s.Vector3();
                 this.components.push({
-                  centroid: L.addVectors(c[0], c[7]).multiplyScalar(0.5)
+                  centroid: $.addVectors(c[0], c[7]).multiplyScalar(0.5)
                 });
-                var $ = this.geo.updateGeoGroup(0);
-                A.updateBoundingFromPoints(this.boundingSphere, this.components, $.vertexArray, $.vertices);
+                var L = this.geo.updateGeoGroup(0);
+                A.updateBoundingFromPoints(this.boundingSphere, this.components, L.vertexArray, L.vertices);
               }
               /**
                * Creates a cylinder shape
@@ -22434,8 +22450,8 @@ ATOM`, b);
               addCylinder(m) {
                 var l, u;
                 m.start ? l = new s.Vector3(m.start.x || 0, m.start.y || 0, m.start.z || 0) : l = new s.Vector3(0, 0, 0), m.end ? (u = new s.Vector3(m.end.x, m.end.y || 0, m.end.z || 0), typeof u.x > "u" && (u.x = 3)) : u = new s.Vector3(0, 0, 0);
-                var g = m.radius || 0.1, p = h.CC.color(m.color);
-                this.intersectionShape.cylinder.push(new a.Cylinder(l, u, g)), v.GLDraw.drawCylinder(this.geo, l, u, g, p, m.fromCap, m.toCap);
+                var p = m.radius || 0.1, g = h.CC.color(m.color);
+                this.intersectionShape.cylinder.push(new a.Cylinder(l, u, p)), v.GLDraw.drawCylinder(this.geo, l, u, p, g, m.fromCap, m.toCap);
                 var b = new s.Vector3();
                 this.components.push({
                   centroid: b.addVectors(l, u).multiplyScalar(0.5)
@@ -22453,11 +22469,11 @@ ATOM`, b);
                 m.start ? l = new s.Vector3(m.start.x || 0, m.start.y || 0, m.start.z || 0) : l = new s.Vector3(0, 0, 0);
                 var u;
                 m.end ? (u = new s.Vector3(m.end.x, m.end.y || 0, m.end.z || 0), typeof u.x > "u" && (u.x = 3)) : u = new s.Vector3(3, 0, 0);
-                for (var g = m.radius || 0.1, p = h.CC.color(m.color), b = Math.sqrt(Math.pow(l.x - u.x, 2) + Math.pow(l.y - u.y, 2) + Math.pow(l.z - u.z, 2)), c = b / (m.gapLength + m.dashLength), _ = new s.Vector3(m.start.x || 0, m.start.y || 0, m.start.z || 0), E = new s.Vector3(m.end.x, m.end.y || 0, m.end.z || 0), w = new s.Vector3((u.x - l.x) / (b / m.gapLength), (u.y - l.y) / (b / m.gapLength), (u.z - l.z) / (b / m.gapLength)), k = new s.Vector3((u.x - l.x) / (b / m.dashLength), (u.y - l.y) / (b / m.dashLength), (u.z - l.z) / (b / m.dashLength)), L = 0; L < c; L++)
-                  E = new s.Vector3(_.x + k.x, _.y + k.y, _.z + k.z), this.intersectionShape.cylinder.push(new a.Cylinder(_, E, g)), v.GLDraw.drawCylinder(this.geo, _, E, g, p, m.fromCap, m.toCap), _ = new s.Vector3(E.x + w.x, E.y + w.y, E.z + w.z);
-                var $ = new s.Vector3();
+                for (var p = m.radius || 0.1, g = h.CC.color(m.color), b = Math.sqrt(Math.pow(l.x - u.x, 2) + Math.pow(l.y - u.y, 2) + Math.pow(l.z - u.z, 2)), c = b / (m.gapLength + m.dashLength), _ = new s.Vector3(m.start.x || 0, m.start.y || 0, m.start.z || 0), E = new s.Vector3(m.end.x, m.end.y || 0, m.end.z || 0), w = new s.Vector3((u.x - l.x) / (b / m.gapLength), (u.y - l.y) / (b / m.gapLength), (u.z - l.z) / (b / m.gapLength)), k = new s.Vector3((u.x - l.x) / (b / m.dashLength), (u.y - l.y) / (b / m.dashLength), (u.z - l.z) / (b / m.dashLength)), $ = 0; $ < c; $++)
+                  E = new s.Vector3(_.x + k.x, _.y + k.y, _.z + k.z), this.intersectionShape.cylinder.push(new a.Cylinder(_, E, p)), v.GLDraw.drawCylinder(this.geo, _, E, p, g, m.fromCap, m.toCap), _ = new s.Vector3(E.x + w.x, E.y + w.y, E.z + w.z);
+                var L = new s.Vector3();
                 this.components.push({
-                  centroid: $.addVectors(l, u).multiplyScalar(0.5)
+                  centroid: L.addVectors(l, u).multiplyScalar(0.5)
                 });
                 var z = this.geo.updateGeoGroup(0);
                 A.updateBoundingFromPoints(this.boundingSphere, this.components, z.vertexArray, z.vertices);
@@ -22473,30 +22489,30 @@ ATOM`, b);
                   console.log("Too few points in addCurve");
                   return;
                 }
-                var u = m.radius || 0.1, g = h.CC.color(m.color), p = 0, b = l.length - 1, c = l[0].distanceTo(l[1]), _ = Math.ceil(2 * u / c);
+                var u = m.radius || 0.1, p = h.CC.color(m.color), g = 0, b = l.length - 1, c = l[0].distanceTo(l[1]), _ = Math.ceil(2 * u / c);
                 if (m.toArrow) {
                   b -= _;
-                  let L = {
+                  let $ = {
                     start: l[b],
                     end: l[l.length - 1],
                     radius: u,
-                    color: g,
+                    color: p,
                     mid: 1e-4
                   };
-                  this.addArrow(L);
+                  this.addArrow($);
                 }
                 if (m.fromArrow) {
-                  p += _;
-                  let L = {
-                    start: l[p],
+                  g += _;
+                  let $ = {
+                    start: l[g],
                     end: l[0],
                     radius: u,
-                    color: g,
+                    color: p,
                     mid: 1e-4
                   };
-                  this.addArrow(L);
+                  this.addArrow($);
                 }
-                for (var E = Math.ceil(l.length / 2), w = { radius: u, color: g, fromCap: 2, toCap: 2 }, k = p; k < b; k++)
+                for (var E = Math.ceil(l.length / 2), w = { radius: u, color: p, fromCap: 2, toCap: 2 }, k = g; k < b; k++)
                   w.start = l[k], w.end = l[k + 1], w.fromCap = 2, w.toCap = 2, k < E ? (w.fromCap = 2, w.toCap = 0) : k > E ? (w.fromCap = 0, w.toCap = 2) : (w.fromCap = 2, w.toCap = 2), this.addCylinder(w);
               }
               /**
@@ -22512,14 +22528,14 @@ ATOM`, b);
               addLine(m) {
                 var l, u;
                 m.start ? l = new s.Vector3(m.start.x || 0, m.start.y || 0, m.start.z || 0) : l = new s.Vector3(0, 0, 0), m.end ? (u = new s.Vector3(m.end.x, m.end.y || 0, m.end.z || 0), typeof u.x > "u" && (u.x = 3)) : u = new s.Vector3(3, 0, 0);
-                var g = this.geo.updateGeoGroup(2), p = g.vertices, b = p * 3, c = g.vertexArray;
-                c[b] = l.x, c[b + 1] = l.y, c[b + 2] = l.z, c[b + 3] = u.x, c[b + 4] = u.y, c[b + 5] = u.z, g.vertices += 2;
-                var _ = g.lineArray, E = g.lineidx;
-                _[E] = p, _[E + 1] = p + 1, g.lineidx += 2;
+                var p = this.geo.updateGeoGroup(2), g = p.vertices, b = g * 3, c = p.vertexArray;
+                c[b] = l.x, c[b + 1] = l.y, c[b + 2] = l.z, c[b + 3] = u.x, c[b + 4] = u.y, c[b + 5] = u.z, p.vertices += 2;
+                var _ = p.lineArray, E = p.lineidx;
+                _[E] = g, _[E + 1] = g + 1, p.lineidx += 2;
                 var w = new s.Vector3();
                 this.components.push({
                   centroid: w.addVectors(l, u).multiplyScalar(0.5)
-                }), g = this.geo.updateGeoGroup(0), A.updateBoundingFromPoints(this.boundingSphere, this.components, g.vertexArray, g.vertices);
+                }), p = this.geo.updateGeoGroup(0), A.updateBoundingFromPoints(this.boundingSphere, this.components, p.vertexArray, p.vertices);
               }
               /**
                * Creates an arrow shape
@@ -22552,15 +22568,15 @@ ATOM`, b);
                 this.components.push({
                   centroid: u.addVectors(m.start, m.end).multiplyScalar(0.5)
                 });
-                var g = this.geo.updateGeoGroup(0);
-                A.updateBoundingFromPoints(this.boundingSphere, this.components, g.vertexArray, g.vertices);
+                var p = this.geo.updateGeoGroup(0);
+                A.updateBoundingFromPoints(this.boundingSphere, this.components, p.vertexArray, p.vertices);
               }
               static distance_from(m, l) {
                 return Math.sqrt(Math.pow(m.x - l.x, 2) + Math.pow(m.y - l.y, 2) + Math.pow(m.z - l.z, 2));
               }
               static inSelectedRegion(m, l, u) {
-                for (var g = 0; g < l.length; g++)
-                  if (A.distance_from(l[g], m) <= u)
+                for (var p = 0; p < l.length; p++)
+                  if (A.distance_from(l[p], m) <= u)
                     return !0;
                 return !1;
               }
@@ -22591,17 +22607,17 @@ ATOM`, b);
                         viewer.render();
                       });
                */
-              addIsosurface(m, l, u, g) {
-                var p = l.isoval !== void 0 && typeof l.isoval == "number" ? l.isoval : 0, b = !!l.voxel, c = l.smoothness === void 0 ? 1 : l.smoothness, _ = m.size.x, E = m.size.y, w = m.size.z, k = new Int16Array(_ * E * w), L = m.data, $, z;
-                for ($ = 0, z = k.length; $ < z; ++$)
-                  k[$] = -1;
-                var O = new Uint8Array(_ * E * w);
-                for ($ = 0, z = L.length; $ < z; ++$) {
-                  var R = p >= 0 ? L[$] - p : p - L[$];
-                  R > 0 && (O[$] |= A.ISDONE);
+              addIsosurface(m, l, u, p) {
+                var g = l.isoval !== void 0 && typeof l.isoval == "number" ? l.isoval : 0, b = !!l.voxel, c = l.smoothness === void 0 ? 1 : l.smoothness, _ = m.size.x, E = m.size.y, w = m.size.z, k = new Int16Array(_ * E * w), $ = m.data, L, z;
+                for (L = 0, z = k.length; L < z; ++L)
+                  k[L] = -1;
+                var F = new Uint8Array(_ * E * w);
+                for (L = 0, z = $.length; L < z; ++L) {
+                  var R = g >= 0 ? $[L] - g : g - $[L];
+                  R > 0 && (F[L] |= A.ISDONE);
                 }
                 var P = [], U = [];
-                o.MarchingCube.march(O, P, U, {
+                o.MarchingCube.march(F, P, U, {
                   fulltable: !0,
                   voxel: b,
                   unitCube: m.unit,
@@ -22612,7 +22628,7 @@ ATOM`, b);
                   nZ: w
                 }), !b && c > 0 && o.MarchingCube.laplacianSmooth(c, P, U);
                 var N = [], B = [], W = [];
-                if (l.selectedRegion && l.coords === void 0 && (l.coords = l.selectedRegion), l.coords === void 0 && l.selection !== void 0 && (g ? l.coords = g.selectedAtoms(l.selection) : console.log("addIsosurface needs viewer is selection provided.")), l.coords !== void 0) {
+                if (l.selectedRegion && l.coords === void 0 && (l.coords = l.selectedRegion), l.coords === void 0 && l.selection !== void 0 && (p ? l.coords = p.selectedAtoms(l.selection) : console.log("addIsosurface needs viewer is selection provided.")), l.coords !== void 0) {
                   var V = l.coords[0].x, G = l.coords[0].y, H = l.coords[0].z, Q = l.coords[0].x, te = l.coords[0].y, ee = l.coords[0].z;
                   for (let le = 0; le < l.coords.length; le++)
                     l.coords[le].x > V ? V = l.coords[le].x : l.coords[le].x < Q && (Q = l.coords[le].x), l.coords[le].y > G ? G = l.coords[le].y : l.coords[le].y < te && (te = l.coords[le].y), l.coords[le].z > H ? H = l.coords[le].z : l.coords[le].z < ee && (ee = l.coords[le].z);
@@ -22678,11 +22694,11 @@ ATOM`, b);
                   });
                   var u = new r.Mesh(this.geo, l);
                   if (this.shapeObj.add(u), this.linegeo && this.linegeo.vertices > 0) {
-                    var g = new r.LineBasicMaterial({
+                    var p = new r.LineBasicMaterial({
                       linewidth: this.linewidth,
                       color: this.color
-                    }), p = new r.Line(this.linegeo, g, r.LineStyle.LinePieces);
-                    this.shapeObj.add(p);
+                    }), g = new r.Line(this.linegeo, p, r.LineStyle.LinePieces);
+                    this.shapeObj.add(g);
                   }
                   this.renderedShapeObj = this.shapeObj.clone(), m.add(this.renderedShapeObj);
                 }
@@ -22704,8 +22720,8 @@ ATOM`, b);
               }
             }
             A.ISDONE = 2, A.drawCustom = function(M, m, l) {
-              var u = l, g = u.vertexArr, p = u.faceArr;
-              (g.length === 0 || p.length === 0) && console.warn("Error adding custom shape component: No vertices and/or face indices supplied!");
+              var u = l, p = u.vertexArr, g = u.faceArr;
+              (p.length === 0 || g.length === 0) && console.warn("Error adding custom shape component: No vertices and/or face indices supplied!");
               var b = l.color;
               typeof b > "u" && (b = M.color), b = h.CC.color(b);
               for (var c = x(u), _ = 0, E = c.length; _ < E; _++)
@@ -22717,14 +22733,14 @@ ATOM`, b);
                 return [M];
               var l = [{ vertexArr: [], normalArr: [], faceArr: [] }];
               M.colorArr && (l.colorArr = []);
-              var u = [], g = [], p = 0, b = M.faceArr;
+              var u = [], p = [], g = 0, b = M.faceArr;
               for (let _ = 0, E = b.length; _ < E; _ += 3) {
-                let w = l[p];
+                let w = l[g];
                 for (let k = 0; k < 3; k++) {
                   var c = b[_ + k];
-                  u[c] !== p && (u[c] = p, g[c] = w.vertexArr.length, w.vertexArr.push(M.vertexArr[c]), M.normalArr && M.normalArr[c] && w.normalArr.push(M.normalArr[c]), M.colorArr && M.colorArr[c] && w.colorArr.push(M.colorArr[c])), w.faceArr.push(g[c]);
+                  u[c] !== g && (u[c] = g, p[c] = w.vertexArr.length, w.vertexArr.push(M.vertexArr[c]), M.normalArr && M.normalArr[c] && w.normalArr.push(M.normalArr[c]), M.colorArr && M.colorArr[c] && w.colorArr.push(M.colorArr[c])), w.faceArr.push(p[c]);
                 }
-                w.vertexArr.length >= m && (l.push({ vertexArr: [], normalArr: [], faceArr: [] }), M.colorArr && (l.colorArr = []), p++);
+                w.vertexArr.length >= m && (l.push({ vertexArr: [], normalArr: [], faceArr: [] }), M.colorArr && (l.colorArr = []), g++);
               }
               return l;
             }
@@ -22751,7 +22767,7 @@ ATOM`, b);
               /* harmony export */
               createStereoViewer: () => (
                 /* binding */
-                p
+                g
               ),
               /* harmony export */
               createViewer: () => (
@@ -22761,7 +22777,7 @@ ATOM`, b);
               /* harmony export */
               createViewerGrid: () => (
                 /* binding */
-                g
+                p
               )
               /* harmony export */
             });
@@ -22897,13 +22913,13 @@ ATOM`, b);
                       clickable: !0
                     }), k = E.selectedAtoms({
                       hoverable: !0
-                    }), L = E.selectedAtoms({ contextMenuEnabled: !0 });
-                    for (let $ = 0; $ < k.length; $++)
-                      this.hoverables.push(k[$]);
-                    for (let $ = 0; $ < w.length; $++)
-                      this.clickables.push(w[$]);
-                    for (let $ = 0; $ < L.length; $++)
-                      this.contextMenuEnabledObjects.push(L[$]);
+                    }), $ = E.selectedAtoms({ contextMenuEnabled: !0 });
+                    for (let L = 0; L < k.length; L++)
+                      this.hoverables.push(k[L]);
+                    for (let L = 0; L < w.length; L++)
+                      this.clickables.push(w[L]);
+                    for (let L = 0; L < $.length; L++)
+                      this.contextMenuEnabledObjects.push($[L]);
                   }
                 }
                 for (let c = 0, _ = this.shapes.length; c < _; c++) {
@@ -22956,8 +22972,8 @@ ATOM`, b);
               closeEnoughForClick(c, { allowTolerance: _ = c.targetTouches, tolerance: E = 5 } = {}) {
                 const w = this.getX(c), k = this.getY(c);
                 if (_) {
-                  const L = Math.abs(w - this.mouseStartX), $ = Math.abs(k - this.mouseStartY);
-                  return L <= E && $ <= E;
+                  const $ = Math.abs(w - this.mouseStartX), L = Math.abs(k - this.mouseStartY);
+                  return $ <= E && L <= E;
                 } else
                   return w === this.mouseStartX && k === this.mouseStartY;
               }
@@ -22977,8 +22993,8 @@ ATOM`, b);
               //for grid viewers, return true if point is in this viewer
               isInViewer(c, _) {
                 if (this.viewers != null) {
-                  var E = this.WIDTH / this.cols, w = this.HEIGHT / this.rows, k = this.canvasOffset(), L = c - k.left, $ = _ - k.top, z = this.rows - Math.floor($ / w) - 1, O = Math.floor(L / E);
-                  if (z != this.row || O != this.col)
+                  var E = this.WIDTH / this.cols, w = this.HEIGHT / this.rows, k = this.canvasOffset(), $ = c - k.left, L = _ - k.top, z = this.rows - Math.floor(L / w) - 1, F = Math.floor($ / E);
+                  if (z != this.row || F != this.col)
                     return !1;
                 }
                 return !0;
@@ -23009,9 +23025,9 @@ ATOM`, b);
                   return P.normalize(), P;
                 }
                 w < 0 && (_ = _.clone().multiplyScalar(-1), w = -w), w > 1 ? w = 1 : w < -1 && (w = -1);
-                var k = Math.acos(w), L = k * E, $ = _.clone();
-                $.sub(c.clone().multiplyScalar(w)), $.normalize();
-                var z = Math.cos(L), O = Math.sin(L), R = new a.Quaternion(c.x * z + $.x * O, c.y * z + $.y * O, c.z * z + $.z * O, c.w * z + $.w * O);
+                var k = Math.acos(w), $ = k * E, L = _.clone();
+                L.sub(c.clone().multiplyScalar(w)), L.normalize();
+                var z = Math.cos($), F = Math.sin($), R = new a.Quaternion(c.x * z + L.x * F, c.y * z + L.y * F, c.z * z + L.z * F, c.w * z + L.w * F);
                 return R.normalize(), R;
               }
               /* @param {Object} element HTML element within which to create viewer
@@ -23020,8 +23036,8 @@ ATOM`, b);
               constructor(c, _ = {}) {
                 if (this.nomouse = !1, this.glDOM = null, this.models = [], this.surfaces = {}, this.shapes = [], this.labels = [], this.clickables = [], this.hoverables = [], this.contextMenuEnabledObjects = [], this.current_hover = null, this.hoverDuration = 500, this.longTouchDuration = 1e3, this.viewer_frame = 0, this.viewChangeCallback = null, this.stateChangeCallback = null, this.NEAR = 1, this.FAR = 800, this.CAMERA_Z = 150, this.fov = 20, this.linkedViewers = [], this.renderer = null, this.control_all = !1, this.scene = null, this.rotationGroup = null, this.modelGroup = null, this.fogStart = 0.4, this.slabNear = -50, this.slabFar = 50, this.cq = new a.Quaternion(0, 0, 0, 1), this.dq = new a.Quaternion(0, 0, 0, 1), this.animated = 0, this.animationTimers = /* @__PURE__ */ new Set(), this.isDragging = !1, this.mouseStartX = 0, this.mouseStartY = 0, this.touchDistanceStart = 0, this.touchHold = !1, this.currentModelPos = 0, this.cz = 0, this.cslabNear = 0, this.cslabFar = 0, this.userContextMenuHandler = null, this.config = _, this.callback = this.config.callback, this.defaultcolors = this.config.defaultcolors, this.defaultcolors || (this.defaultcolors = s.elementColors.defaultColors), this.nomouse = !!this.config.nomouse, this.bgColor = 0, this.config.backgroundColor = this.config.backgroundColor || "#ffffff", typeof this.config.backgroundColor < "u" && (this.bgColor = s.CC.color(this.config.backgroundColor).getHex()), this.config.backgroundAlpha = this.config.backgroundAlpha == null ? 1 : this.config.backgroundAlpha, this.camerax = 0, typeof this.config.camerax < "u" && (this.camerax = typeof this.config.camerax == "string" ? parseFloat(this.config.camerax) : this.config.camerax), this._viewer = this, this.container = c, this.config.hoverDuration != null && (this.hoverDuration = this.config.hoverDuration), this.config.antialias === void 0 && (this.config.antialias = !0), this.config.cartoonQuality === void 0 && (this.config.cartoonQuality = 10), this.WIDTH = this.getWidth(), this.HEIGHT = this.getHeight(), this.setupRenderer(), this.row = this.config.row == null ? 0 : this.config.row, this.col = this.config.col == null ? 0 : this.config.col, this.cols = this.config.cols, this.rows = this.config.rows, this.viewers = this.config.viewers, this.control_all = this.config.control_all, this.ASPECT = this.renderer.getAspect(this.WIDTH, this.HEIGHT), this.camera = new r.Camera(this.fov, this.ASPECT, this.NEAR, this.FAR, this.config.orthographic), this.camera.position = new a.Vector3(this.camerax, 0, this.CAMERA_Z), this.lookingAt = new a.Vector3(), this.camera.lookAt(this.lookingAt), this.raycaster = new r.Raycaster(new a.Vector3(0, 0, 0), new a.Vector3(0, 0, 0)), this.projector = new r.Projector(), this.initializeScene(), this.renderer.setClearColorHex(this.bgColor, this.config.backgroundAlpha), this.scene.fog.color = s.CC.color(this.bgColor), document.body.addEventListener("mouseup", this._handleMouseUp.bind(this)), document.body.addEventListener("touchend", this._handleMouseUp.bind(this)), this.initContainer(this.container), this.config.style && this.setViewStyle(this.config), window.addEventListener("resize", this.resize.bind(this)), typeof window.ResizeObserver < "u" && (this.divwatcher = new window.ResizeObserver(this.resize.bind(this)), this.divwatcher.observe(this.container)), typeof window.IntersectionObserver < "u") {
                   let E = (w, k) => {
-                    w.forEach((L) => {
-                      L.isIntersecting && this.resize();
+                    w.forEach(($) => {
+                      $.isIntersecting && this.resize();
                     });
                   };
                   this.intwatcher = new window.IntersectionObserver(E), this.intwatcher.observe(this.container);
@@ -23054,13 +23070,13 @@ ATOM`, b);
               modelToScreen(c) {
                 let _ = !1;
                 Array.isArray(c) || (c = [c], _ = !0);
-                let E = this.renderer.getXRatio(), w = this.renderer.getYRatio(), k = this.col, L = this.row, $ = k * (this.WIDTH / E), z = (w - L - 1) * (this.HEIGHT / w), O = [], R = this.canvasOffset();
+                let E = this.renderer.getXRatio(), w = this.renderer.getYRatio(), k = this.col, $ = this.row, L = k * (this.WIDTH / E), z = (w - $ - 1) * (this.HEIGHT / w), F = [], R = this.canvasOffset();
                 return c.forEach((P) => {
                   let U = new a.Vector3(P.x, P.y, P.z);
                   U.applyMatrix4(this.modelGroup.matrixWorld), this.projector.projectVector(U, this.camera);
-                  let N = this.WIDTH / E * (U.x + 1) / 2 + R.left + $, B = -(this.HEIGHT / w) * (U.y - 1) / 2 + R.top + z;
-                  O.push({ x: N, y: B });
-                }), _ && (O = O[0]), O;
+                  let N = this.WIDTH / E * (U.x + 1) / 2 + R.left + L, B = -(this.HEIGHT / w) * (U.y - 1) / 2 + R.top + z;
+                  F.push({ x: N, y: B });
+                }), _ && (F = F[0]), F;
               }
               /**
                * For a given screen (x,y) displacement return model displacement
@@ -23069,8 +23085,8 @@ ATOM`, b);
                * @param{modelz} z coordinate in model coordinates to compute offset for, default is model axis
               */
               screenOffsetToModel(c, _, E) {
-                var w = c / this.WIDTH, k = _ / this.HEIGHT, L = E === void 0 ? this.rotationGroup.position.z : E, $ = this.rotationGroup.quaternion, z = new a.Vector3(0, 0, L);
-                return this.projector.projectVector(z, this.camera), z.x += w * 2, z.y -= k * 2, this.projector.unprojectVector(z, this.camera), z.z = 0, z.applyQuaternion($), z;
+                var w = c / this.WIDTH, k = _ / this.HEIGHT, $ = E === void 0 ? this.rotationGroup.position.z : E, L = this.rotationGroup.quaternion, z = new a.Vector3(0, 0, $);
+                return this.projector.projectVector(z, this.camera), z.x += w * 2, z.y -= k * 2, this.projector.unprojectVector(z, this.camera), z.z = 0, z.applyQuaternion(L), z;
               }
               /**
                * Distance from screen coordinate to model coordinate assuming screen point
@@ -23083,8 +23099,8 @@ ATOM`, b);
                 w.applyMatrix4(this.modelGroup.matrixWorld);
                 let k = w.clone();
                 this.projector.projectVector(w, this.camera);
-                let L = new a.Vector3((c.x - E.left) * 2 / this.WIDTH - 1, (c.y - E.top) * 2 / -this.HEIGHT + 1, w.z);
-                return this.projector.unprojectVector(L, this.camera), L.distanceTo(k);
+                let $ = new a.Vector3((c.x - E.left) * 2 / this.WIDTH - 1, (c.y - E.top) * 2 / -this.HEIGHT + 1, w.z);
+                return this.projector.unprojectVector($, this.camera), $.distanceTo(k);
               }
               /**
                * Set a callback to call when the view has potentially changed.
@@ -23184,8 +23200,8 @@ ATOM`, b);
                 c.targetTouches && c.targetTouches.length === 1 && (this.longTouchTimeout = setTimeout(function() {
                   if (w.touchHold == !0) {
                     w.glDOM = w.renderer.domElement;
-                    const k = c.targetTouches[0], L = new PointerEvent("contextmenu", Object.assign(Object.assign({}, c), { pageX: k.pageX, pageY: k.pageY, screenX: k.screenX, screenY: k.screenY, clientX: k.clientX, clientY: k.clientY }));
-                    w.glDOM.dispatchEvent(L);
+                    const k = c.targetTouches[0], $ = new PointerEvent("contextmenu", Object.assign(Object.assign({}, c), { pageX: k.pageX, pageY: k.pageY, screenX: k.screenX, screenY: k.screenY, clientX: k.clientX, clientY: k.clientY }));
+                    w.glDOM.dispatchEvent($);
                   }
                 }, this.longTouchDuration));
               }
@@ -23207,8 +23223,8 @@ ATOM`, b);
                     if (c.ctrlKey && (k = -1), c.detail)
                       this.rotationGroup.position.z += k * w * c.detail / 10;
                     else if (c.wheelDelta) {
-                      let L = c.wheelDelta * 600 / (c.wheelDelta + 600);
-                      this.rotationGroup.position.z -= k * w * L / 400;
+                      let $ = c.wheelDelta * 600 / (c.wheelDelta + 600);
+                      this.rotationGroup.position.z -= k * w * $ / 400;
                     }
                     this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z), this.show();
                   }
@@ -23228,19 +23244,19 @@ ATOM`, b);
               apngURI(c) {
                 let _ = this;
                 return c = c || 1, new Promise(function(E) {
-                  let w = 0, k = _.viewChangeCallback, L = [], $ = [], z = Date.now();
+                  let w = 0, k = _.viewChangeCallback, $ = [], L = [], z = Date.now();
                   _.viewChangeCallback = function() {
-                    $.push(Date.now() - z), z = Date.now(), L.push(new Promise((O) => {
+                    L.push(Date.now() - z), z = Date.now(), $.push(new Promise((F) => {
                       _.getCanvas().toBlob(function(R) {
-                        R.arrayBuffer().then(O);
+                        R.arrayBuffer().then(F);
                       }, "image/png");
-                    })), w += 1, w == c && (_.viewChangeCallback = k, Promise.all(L).then((O) => {
+                    })), w += 1, w == c && (_.viewChangeCallback = k, Promise.all($).then((F) => {
                       let R = [];
-                      for (let V = 0; V < O.length; V++) {
-                        let G = (0, M.decode)(O[V]);
+                      for (let V = 0; V < F.length; V++) {
+                        let G = (0, M.decode)(F[V]);
                         R.push((0, M.toRGBA8)(G)[0]);
                       }
-                      let P = _.getCanvas().width, U = _.getCanvas().height, N = (0, M.encode)(R, P, U, 0, $), B = new Blob([N], { type: "image/png" }), W = new FileReader();
+                      let P = _.getCanvas().width, U = _.getCanvas().height, N = (0, M.encode)(R, P, U, 0, L), B = new Blob([N], { type: "image/png" }), W = new FileReader();
                       W.onload = function(V) {
                         E(V.target.result);
                       }, W.readAsDataURL(B);
@@ -23272,7 +23288,7 @@ ATOM`, b);
                 this.hoverDuration = c;
               }
               mouseXY(c, _) {
-                let E = this.canvasOffset(), w = this.renderer.getXRatio(), k = this.renderer.getYRatio(), L = this.col, $ = this.row, z = L * (this.WIDTH / w), O = (k - $ - 1) * (this.HEIGHT / k), R = (c - E.left - z) / (this.WIDTH / w) * 2 - 1, P = -((_ - E.top - O) / (this.HEIGHT / k)) * 2 + 1;
+                let E = this.canvasOffset(), w = this.renderer.getXRatio(), k = this.renderer.getYRatio(), $ = this.col, L = this.row, z = $ * (this.WIDTH / w), F = (k - L - 1) * (this.HEIGHT / k), R = (c - E.left - z) / (this.WIDTH / w) * 2 - 1, P = -((_ - E.top - F) / (this.HEIGHT / k)) * 2 + 1;
                 return { x: R, y: P };
               }
               _handleMouseMove(c) {
@@ -23280,22 +23296,22 @@ ATOM`, b);
                 let _ = this.getX(c), E = this.getY(c);
                 if (_ === void 0)
                   return;
-                let w = this.renderer.getXRatio(), k = this.renderer.getYRatio(), L = this.mouseXY(_, E), $ = this;
-                this.current_hover !== null && this.handleHoverContinue(L.x, L.y);
+                let w = this.renderer.getXRatio(), k = this.renderer.getYRatio(), $ = this.mouseXY(_, E), L = this;
+                this.current_hover !== null && this.handleHoverContinue($.x, $.y);
                 var z = 0;
                 if (!(!this.control_all && !this.isInViewer(_, E)) && this.scene && (this.hoverables.length > 0 && (this.hoverTimeout = setTimeout(function() {
-                  $.handleHoverSelection(L.x, L.y, c);
+                  L.handleHoverSelection($.x, $.y, c);
                 }, this.hoverDuration)), !!this.isDragging)) {
                   c.targetTouches && (c.targetTouches.length > 1 || c.targetTouches.length === 1 && !this.closeEnoughForClick(c)) && clearTimeout(this.longTouchTimeout);
-                  var O = (_ - this.mouseStartX) / this.WIDTH, R = (E - this.mouseStartY) / this.HEIGHT;
+                  var F = (_ - this.mouseStartX) / this.WIDTH, R = (E - this.mouseStartY) / this.HEIGHT;
                   if (this.touchDistanceStart != 0 && c.targetTouches && c.targetTouches.length == 2) {
                     var P = this.calcTouchDistance(c);
                     z = 2, R = (P - this.touchDistanceStart) * 2 / (this.WIDTH + this.HEIGHT);
                   } else c.targetTouches && c.targetTouches.length == 3 && (z = 1);
-                  O *= w, R *= k;
-                  var U = Math.hypot(O, R), N;
+                  F *= w, R *= k;
+                  var U = Math.hypot(F, R), N;
                   if (z == 3 || this.mouseButton == 3 && c.ctrlKey)
-                    this.slabNear = this.cslabNear + O * 100, this.slabFar = this.cslabFar - R * 100;
+                    this.slabNear = this.cslabNear + F * 100, this.slabFar = this.cslabFar - R * 100;
                   else if (z == 2 || this.mouseButton == 3 || c.shiftKey)
                     N = (this.CAMERA_Z - this.rotationGroup.position.z) * 0.85, N < 80 && (N = 80), this.rotationGroup.position.z = this.cz + R * N, this.rotationGroup.position.z = this.adjustZoomToLimits(this.rotationGroup.position.z);
                   else if (z == 1 || this.mouseButton == 2 || c.ctrlKey) {
@@ -23303,7 +23319,7 @@ ATOM`, b);
                     this.modelGroup.position.addVectors(this.currentModelPos, B);
                   } else if ((z === 0 || this.mouseButton == 1) && U !== 0) {
                     var W = Math.sin(U * Math.PI) / U;
-                    this.dq.x = Math.cos(U * Math.PI), this.dq.y = 0, this.dq.z = W * O, this.dq.w = -W * R, this.rotationGroup.quaternion.set(1, 0, 0, 0), this.rotationGroup.quaternion.multiply(this.dq), this.rotationGroup.quaternion.multiply(this.cq);
+                    this.dq.x = Math.cos(U * Math.PI), this.dq.y = 0, this.dq.z = W * F, this.dq.w = -W * R, this.rotationGroup.quaternion.set(1, 0, 0, 0), this.rotationGroup.quaternion.multiply(this.dq), this.rotationGroup.quaternion.multiply(this.cq);
                   }
                   this.show();
                 }
@@ -23311,11 +23327,11 @@ ATOM`, b);
               _handleContextMenu(c) {
                 if (c.preventDefault(), this.closeEnoughForClick(c)) {
                   var w = this.mouseStartX, k = this.mouseStartY, E = this.canvasOffset();
-                  let L = this.mouseXY(w, k), $ = L.x, z = L.y, O = this.targetedObjects($, z, this.contextMenuEnabledObjects);
+                  let $ = this.mouseXY(w, k), L = $.x, z = $.y, F = this.targetedObjects(L, z, this.contextMenuEnabledObjects);
                   var _ = null;
-                  O.length && (_ = O[0].clickable);
+                  F.length && (_ = F[0].clickable);
                   var E = this.canvasOffset(), w = this.mouseStartX - E.left, k = this.mouseStartY - E.top;
-                  this.userContextMenuHandler && (this.userContextMenuHandler(_, w, k, O, c), this.isDragging = !1);
+                  this.userContextMenuHandler && (this.userContextMenuHandler(_, w, k, F, c), this.isDragging = !1);
                 }
               }
               /**
@@ -23430,7 +23446,7 @@ ATOM`, b);
                   let _ = this.renderer.supportedExtensions();
                   if (_.regen = !0, this.viewers)
                     for (let E = 0, w = this.viewers.length; E < w; E++)
-                      for (let k = 0, L = this.viewers[E].length; k < L; k++)
+                      for (let k = 0, $ = this.viewers[E].length; k < $; k++)
                         this.viewers[E][k].render(null, _);
                   this._viewer.render(null, _);
                 } else
@@ -23492,10 +23508,10 @@ ATOM`, b);
               //and rotationgroup quaternion
               //return array includes final position, but not current
               //the returned array includes an animate method
-              animateMotion(c, _, E, w, k, L) {
-                var $ = 20, z = Math.ceil(c / $);
+              animateMotion(c, _, E, w, k, $) {
+                var L = 20, z = Math.ceil(c / L);
                 z < 1 && (z = 1), this.incAnim();
-                var O = {
+                var F = {
                   mpos: this.modelGroup.position.clone(),
                   rz: this.rotationGroup.position.z,
                   rot: this.rotationGroup.quaternion.clone(),
@@ -23504,26 +23520,26 @@ ATOM`, b);
                 if (_) {
                   let U = new Array(z);
                   for (let V = 0; V < z; V++) {
-                    let G = (V + 1) / z, H = { mpos: O.mpos, rz: O.rz, rot: O.rot };
-                    H.mpos = E.clone().sub(O.mpos).multiplyScalar(G).add(O.mpos), H.rz = O.rz + G * (w - O.rz), H.rot = l.slerp(O.rot, k, G), H.cam = L.clone().sub(O.cam).multiplyScalar(G).add(O.cam), U[V] = H;
+                    let G = (V + 1) / z, H = { mpos: F.mpos, rz: F.rz, rot: F.rot };
+                    H.mpos = E.clone().sub(F.mpos).multiplyScalar(G).add(F.mpos), H.rz = F.rz + G * (w - F.rz), H.rot = l.slerp(F.rot, k, G), H.cam = $.clone().sub(F.cam).multiplyScalar(G).add(F.cam), U[V] = H;
                   }
                   let N = 0, B = this, W = function() {
                     var V = U[N];
-                    N += 1, B.modelGroup.position = V.mpos, B.rotationGroup.position.z = V.rz, B.rotationGroup.quaternion = V.rot, B.camera.lookAt(V.cam), N < U.length ? setTimeout(W, $) : B.decAnim(), B.show();
+                    N += 1, B.modelGroup.position = V.mpos, B.rotationGroup.position.z = V.rz, B.rotationGroup.quaternion = V.rot, B.camera.lookAt(V.cam), N < U.length ? setTimeout(W, L) : B.decAnim(), B.show();
                   };
-                  setTimeout(W, $);
+                  setTimeout(W, L);
                 } else {
                   var R = {};
                   let U = 1 / z;
-                  if (E && (R.mpos = E.clone().sub(O.mpos).multiplyScalar(U)), typeof w < "u" && w != null && (R.rz = U * (w - O.rz)), k) {
-                    var P = l.slerp(O.rot, k, U);
-                    R.rot = O.rot.clone().inverse().multiply(P);
+                  if (E && (R.mpos = E.clone().sub(F.mpos).multiplyScalar(U)), typeof w < "u" && w != null && (R.rz = U * (w - F.rz)), k) {
+                    var P = l.slerp(F.rot, k, U);
+                    R.rot = F.rot.clone().inverse().multiply(P);
                   }
-                  L && (R.cam = L.clone().sub(O.cam).multiplyScalar(U));
+                  $ && (R.cam = $.clone().sub(F.cam).multiplyScalar(U));
                   let N = 0, B = this, W = function() {
-                    N += 1, R.mpos && B.modelGroup.position.add(R.mpos), R.rz && (B.rotationGroup.position.z += R.rz), R.rot && B.rotationGroup.quaternion.multiply(R.rot), R.cam && (B.lookingAt.add(R.cam), B.camera.lookAt(B.lookingAt)), N < z ? setTimeout(W, $) : B.decAnim(), B.show();
+                    N += 1, R.mpos && B.modelGroup.position.add(R.mpos), R.rz && (B.rotationGroup.position.z += R.rz), R.rot && B.rotationGroup.quaternion.multiply(R.rot), R.cam && (B.lookingAt.add(R.cam), B.camera.lookAt(B.lookingAt)), N < z ? setTimeout(W, L) : B.decAnim(), B.show();
                   };
-                  setTimeout(W, $);
+                  setTimeout(W, L);
                 }
               }
               /**
@@ -23554,13 +23570,13 @@ ATOM`, b);
                   var k = new a.Vector3(_.vx, _.vy, _.vz);
                   k.applyQuaternion(this.rotationGroup.quaternion), _ = { x: k.x, y: k.y, z: k.z };
                 }
-                var L = function(R) {
+                var $ = function(R) {
                   var P = Math.sin(R / 2), U = Math.cos(R / 2), N = 0, B = 0, W = 0;
                   return N = _.x * P, B = _.y * P, W = _.z * P, new a.Quaternion(N, B, W, U).normalize();
-                }, $ = Math.PI * c / 180, z = L($);
+                }, L = Math.PI * c / 180, z = $(L);
                 if (E) {
-                  var O = new a.Quaternion().copy(this.rotationGroup.quaternion).multiply(z);
-                  this.animateMotion(E, w, this.modelGroup.position, this.rotationGroup.position.z, O, this.lookingAt);
+                  var F = new a.Quaternion().copy(this.rotationGroup.quaternion).multiply(z);
+                  this.animateMotion(E, w, this.modelGroup.position, this.rotationGroup.position.z, F, this.lookingAt);
                 } else
                   this.rotationGroup.quaternion.multiply(z), this.show();
                 return this;
@@ -23615,22 +23631,22 @@ ATOM`, b);
                   _.regen && (this.labels[w].dispose(), this.modelGroup.remove(this.labels[w].sprite), this.labels[w].setContext(), this.modelGroup.add(this.labels[w].sprite)), this.labels[w] && typeof this.labels[w].frame < "u" && this.labels[w].frame >= 0 && (this.modelGroup.remove(this.labels[w].sprite), (this.viewer_frame < 0 || this.labels[w].frame == this.viewer_frame) && this.modelGroup.add(this.labels[w].sprite));
                 for (w in this.surfaces)
                   if (this.surfaces.hasOwnProperty(w)) {
-                    var L = this.surfaces[w];
-                    for (k = 0; k < L.length; k++)
-                      if (L.hasOwnProperty(k)) {
-                        var $ = L[k].geo;
-                        if (!L[k].finished || _.regen) {
-                          $.verticesNeedUpdate = !0, $.elementsNeedUpdate = !0, $.normalsNeedUpdate = !0, $.colorsNeedUpdate = !0, $.buffersNeedUpdate = !0, L[k].mat.needsUpdate = !0, L[k].done && (L[k].finished = !0), L[k].lastGL && this.modelGroup.remove(L[k].lastGL);
+                    var $ = this.surfaces[w];
+                    for (k = 0; k < $.length; k++)
+                      if ($.hasOwnProperty(k)) {
+                        var L = $[k].geo;
+                        if (!$[k].finished || _.regen) {
+                          L.verticesNeedUpdate = !0, L.elementsNeedUpdate = !0, L.normalsNeedUpdate = !0, L.colorsNeedUpdate = !0, L.buffersNeedUpdate = !0, $[k].mat.needsUpdate = !0, $[k].done && ($[k].finished = !0), $[k].lastGL && this.modelGroup.remove($[k].lastGL);
                           var z = null;
-                          if (L[k].mat instanceof r.LineBasicMaterial ? z = new r.Line($, L[k].mat) : z = new r.Mesh($, L[k].mat), L[k].mat.transparent && L[k].mat.opacity == 0 ? z.visible = !1 : z.visible = !0, L[k].symmetries.length > 1 || L[k].symmetries.length == 1 && !L[k].symmetries[k].isIdentity()) {
-                            var O, R = new r.Object3D();
-                            for (O = 0; O < L[k].symmetries.length; O++) {
+                          if ($[k].mat instanceof r.LineBasicMaterial ? z = new r.Line(L, $[k].mat) : z = new r.Mesh(L, $[k].mat), $[k].mat.transparent && $[k].mat.opacity == 0 ? z.visible = !1 : z.visible = !0, $[k].symmetries.length > 1 || $[k].symmetries.length == 1 && !$[k].symmetries[k].isIdentity()) {
+                            var F, R = new r.Object3D();
+                            for (F = 0; F < $[k].symmetries.length; F++) {
                               var P = z.clone();
-                              P.matrix = L[k].symmetries[O], P.matrixAutoUpdate = !1, R.add(P);
+                              P.matrix = $[k].symmetries[F], P.matrixAutoUpdate = !1, R.add(P);
                             }
-                            L[k].lastGL = R, this.modelGroup.add(R);
+                            $[k].lastGL = R, this.modelGroup.add(R);
                           } else
-                            L[k].lastGL = z, this.modelGroup.add(z);
+                            $[k].lastGL = z, this.modelGroup.add(z);
                         }
                       }
                   }
@@ -23705,8 +23721,8 @@ ATOM`, b);
                 var E = this.getAtomsFromSel(_), w = {};
                 for (var k in E)
                   if (E[k].hasOwnProperty(c)) {
-                    var L = E[k][c];
-                    w[L] = !0;
+                    var $ = E[k][c];
+                    w[$] = !0;
                   }
                 return Object.keys(w);
               }
@@ -23768,9 +23784,9 @@ ATOM`, b);
               });
                */
               translate(c, _, E = 0, w = !1) {
-                var k = c / this.WIDTH, L = _ / this.HEIGHT, $ = new a.Vector3(0, 0, -this.CAMERA_Z);
-                this.projector.projectVector($, this.camera), $.x -= k, $.y -= L, this.projector.unprojectVector($, this.camera), $.z = 0;
-                var z = this.lookingAt.clone().add($);
+                var k = c / this.WIDTH, $ = _ / this.HEIGHT, L = new a.Vector3(0, 0, -this.CAMERA_Z);
+                this.projector.projectVector(L, this.camera), L.x -= k, L.y -= $, this.projector.unprojectVector(L, this.camera), L.z = 0;
+                var z = this.lookingAt.clone().add(L);
                 return E > 0 ? this.animateMotion(E, w, this.modelGroup.position, this.rotationGroup.position.z, this.rotationGroup.quaternion, z) : (this.lookingAt = z, this.camera.lookAt(this.lookingAt), this.show()), this;
               }
               /**
@@ -23795,8 +23811,8 @@ ATOM`, b);
               });
                */
               translateScene(c, _, E = 0, w = !1) {
-                var k = this.screenOffsetToModel(c, _), L = this.modelGroup.position.clone().add(k);
-                return E > 0 ? this.animateMotion(E, w, this.modelGroup.position, this.rotationGroup.position.z, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = L, this.show()), this;
+                var k = this.screenOffsetToModel(c, _), $ = this.modelGroup.position.clone().add(k);
+                return E > 0 ? this.animateMotion(E, w, this.modelGroup.position, this.rotationGroup.position.z, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = $, this.show()), this;
               }
               /**
                * Adjust slab to fully enclose selection (default everything).
@@ -23807,8 +23823,8 @@ ATOM`, b);
                */
               fitSlab(c) {
                 c = c || {};
-                var _ = this.getAtomsFromSel(c), E = (0, h.getExtent)(_), w = E[1][0] - E[0][0], k = E[1][1] - E[0][1], L = E[1][2] - E[0][2], $ = Math.hypot(w, k, L);
-                return $ < 5 && ($ = 5), this.slabNear = -$ / 1.9, this.slabFar = $ / 2, this;
+                var _ = this.getAtomsFromSel(c), E = (0, h.getExtent)(_), w = E[1][0] - E[0][0], k = E[1][1] - E[0][1], $ = E[1][2] - E[0][2], L = Math.hypot(w, k, $);
+                return L < 5 && (L = 5), this.slabNear = -L / 1.9, this.slabFar = L / 2, this;
               }
               /**
                * Re-center the viewer around the provided selection (unlike zoomTo, does not zoom).
@@ -23835,18 +23851,18 @@ ATOM`, b);
               });
                */
               center(c = {}, _ = 0, E = !1) {
-                var w, k, L = this.getAtomsFromSel(c), $ = (0, h.getExtent)(L);
+                var w, k, $ = this.getAtomsFromSel(c), L = (0, h.getExtent)($);
                 (0, h.isEmptyObject)(c) ? (this.shapes.forEach((G) => {
                   if (G && G.boundingSphere && G.boundingSphere.center) {
                     var H = G.boundingSphere.center, Q = G.boundingSphere.radius;
-                    Q > 0 ? (L.push(new a.Vector3(H.x + Q, H.y, H.z)), L.push(new a.Vector3(H.x - Q, H.y, H.z)), L.push(new a.Vector3(H.x, H.y + Q, H.z)), L.push(new a.Vector3(H.x, H.y - Q, H.z)), L.push(new a.Vector3(H.x, H.y, H.z + Q)), L.push(new a.Vector3(H.x, H.y, H.z - Q))) : L.push(H);
+                    Q > 0 ? ($.push(new a.Vector3(H.x + Q, H.y, H.z)), $.push(new a.Vector3(H.x - Q, H.y, H.z)), $.push(new a.Vector3(H.x, H.y + Q, H.z)), $.push(new a.Vector3(H.x, H.y - Q, H.z)), $.push(new a.Vector3(H.x, H.y, H.z + Q)), $.push(new a.Vector3(H.x, H.y, H.z - Q))) : $.push(H);
                   }
-                }), $ = (0, h.getExtent)(L), w = L, k = $) : (w = this.getAtomsFromSel({}), k = (0, h.getExtent)(w));
-                var z = new a.Vector3($[2][0], $[2][1], $[2][2]), O = k[1][0] - k[0][0], R = k[1][1] - k[0][1], P = k[1][2] - k[0][2], U = Math.hypot(O, R, P);
-                U < 5 && (U = 5), this.slabNear = -U / 1.9, this.slabFar = U / 2, O = $[1][0] - $[0][0], R = $[1][1] - $[0][1], P = $[1][2] - $[0][2], U = Math.hypot(O, R, P), U < 5 && (U = 5);
-                for (var N = 25, B = 0; B < L.length; B++)
-                  if (L[B]) {
-                    var W = z.distanceToSquared(L[B]);
+                }), L = (0, h.getExtent)($), w = $, k = L) : (w = this.getAtomsFromSel({}), k = (0, h.getExtent)(w));
+                var z = new a.Vector3(L[2][0], L[2][1], L[2][2]), F = k[1][0] - k[0][0], R = k[1][1] - k[0][1], P = k[1][2] - k[0][2], U = Math.hypot(F, R, P);
+                U < 5 && (U = 5), this.slabNear = -U / 1.9, this.slabFar = U / 2, F = L[1][0] - L[0][0], R = L[1][1] - L[0][1], P = L[1][2] - L[0][2], U = Math.hypot(F, R, P), U < 5 && (U = 5);
+                for (var N = 25, B = 0; B < $.length; B++)
+                  if ($[B]) {
+                    var W = z.distanceToSquared($[B]);
                     W > N && (N = W);
                   }
                 U = Math.sqrt(N) * 2;
@@ -23883,7 +23899,7 @@ ATOM`, b);
               	            });
               	     */
               zoomTo(c = {}, _ = 0, E = !1) {
-                let w = this.getAtomsFromSel(c), k = (0, h.getExtent)(w), L = k;
+                let w = this.getAtomsFromSel(c), k = (0, h.getExtent)(w), $ = k;
                 if ((0, h.isEmptyObject)(c)) {
                   let H = w && w.length;
                   if (this.shapes.forEach((Q) => {
@@ -23896,24 +23912,24 @@ ATOM`, b);
                         ee > 0 ? (w.push(new a.Vector3(te.x + ee, te.y, te.z)), w.push(new a.Vector3(te.x - ee, te.y, te.z)), w.push(new a.Vector3(te.x, te.y + ee, te.z)), w.push(new a.Vector3(te.x, te.y - ee, te.z)), w.push(new a.Vector3(te.x, te.y, te.z + ee)), w.push(new a.Vector3(te.x, te.y, te.z - ee))) : w.push(te);
                       }
                     }
-                  }), L = (0, h.getExtent)(w), !H)
+                  }), $ = (0, h.getExtent)(w), !H)
                     for (let Q = 0; Q < 3; Q++)
-                      k[2][Q] = (L[0][Q] + L[1][Q]) / 2;
+                      k[2][Q] = ($[0][Q] + $[1][Q]) / 2;
                 } else {
                   let H = this.getAtomsFromSel({});
-                  L = (0, h.getExtent)(H);
+                  $ = (0, h.getExtent)(H);
                 }
-                var $ = new a.Vector3(k[2][0], k[2][1], k[2][2]), z = L[1][0] - L[0][0], O = L[1][1] - L[0][1], R = L[1][2] - L[0][2], P = Math.hypot(z, O, R);
+                var L = new a.Vector3(k[2][0], k[2][1], k[2][2]), z = $[1][0] - $[0][0], F = $[1][1] - $[0][1], R = $[1][2] - $[0][2], P = Math.hypot(z, F, R);
                 P < 5 && (P = 5), this.slabNear = -P / 1.9, this.slabFar = P / 2, Object.keys(c).length === 0 && (this.slabNear = Math.min(-P * 2, -50), this.slabFar = Math.max(P * 2, 50));
                 var U = this.config.minimumZoomToDistance || 5;
-                z = k[1][0] - k[0][0], O = k[1][1] - k[0][1], R = k[1][2] - k[0][2], P = Math.hypot(z, O, R), P < U && (P = U);
+                z = k[1][0] - k[0][0], F = k[1][1] - k[0][1], R = k[1][2] - k[0][2], P = Math.hypot(z, F, R), P < U && (P = U);
                 for (var N = U * U, B = 0; B < w.length; B++)
                   if (w[B]) {
-                    var W = $.distanceToSquared(w[B]);
+                    var W = L.distanceToSquared(w[B]);
                     W > N && (N = W);
                   }
                 P = Math.sqrt(N) * 2;
-                var V = $.clone().multiplyScalar(-1), G = -(P * 0.5 / Math.tan(Math.PI / 180 * this.camera.fov / 2) - this.CAMERA_Z);
+                var V = L.clone().multiplyScalar(-1), G = -(P * 0.5 / Math.tan(Math.PI / 180 * this.camera.fov / 2) - this.CAMERA_Z);
                 return G = this.adjustZoomToLimits(G), _ > 0 ? this.animateMotion(_, E, V, G, this.rotationGroup.quaternion, this.lookingAt) : (this.modelGroup.position = V, this.rotationGroup.position.z = G, this.show()), this;
               }
               /**
@@ -23979,8 +23995,8 @@ ATOM`, b);
                   var k = (0, h.getExtent)(this.getAtomsFromSel(E));
                   _.position = { x: k[2][0], y: k[2][1], z: k[2][2] };
                 }
-                var L = new v.Label(c, _);
-                return L.setContext(), this.modelGroup.add(L.sprite), this.labels.push(L), w || this.show(), L;
+                var $ = new v.Label(c, _);
+                return $.setContext(), this.modelGroup.add($.sprite), this.labels.push($), w || this.show(), $;
               }
               /** Add residue labels.  This will generate one label per a
                * residue within the selected atoms.  The label will be at the
@@ -24312,10 +24328,10 @@ ATOM`, b);
                   if (E.matrix)
                     w = E.matrix;
                   else {
-                    var k = E.a, L = E.b, $ = E.c, z = E.alpha, O = E.beta, R = E.gamma;
-                    z = z * Math.PI / 180, O = O * Math.PI / 180, R = R * Math.PI / 180;
+                    var k = E.a, $ = E.b, L = E.c, z = E.alpha, F = E.beta, R = E.gamma;
+                    z = z * Math.PI / 180, F = F * Math.PI / 180, R = R * Math.PI / 180;
                     var P, U, N;
-                    P = Math.cos(O), U = (Math.cos(z) - Math.cos(O) * Math.cos(R)) / Math.sin(R), N = Math.sqrt(Math.max(0, 1 - P * P - U * U)), w = new a.Matrix3(k, L * Math.cos(R), $ * P, 0, L * Math.sin(R), $ * U, 0, 0, $ * N);
+                    P = Math.cos(F), U = (Math.cos(z) - Math.cos(F) * Math.cos(R)) / Math.sin(R), N = Math.sqrt(Math.max(0, 1 - P * P - U * U)), w = new a.Matrix3(k, $ * Math.cos(R), L * P, 0, $ * Math.sin(R), L * U, 0, 0, L * N);
                   }
                   var B = [
                     new a.Vector3(0, 0, 0),
@@ -24415,20 +24431,20 @@ ATOM`, b);
                        viewer.render();
                  });
               */
-              replicateUnitCell(c = 3, _ = c, E = _, w, k, L) {
+              replicateUnitCell(c = 3, _ = c, E = _, w, k, $) {
                 w = this.getModel(w);
-                let $ = w.getCrystData();
-                if ($) {
-                  const z = w.selectedAtoms({}), O = $.matrix;
+                let L = w.getCrystData();
+                if (L) {
+                  const z = w.selectedAtoms({}), F = L.matrix;
                   let R = function(U) {
                     return U % 2 == 0 ? -U / 2 : Math.ceil(U / 2);
                   };
-                  c <= 1 && _ <= 1 && E <= 1 && (L = !0, c = _ = E = 3);
+                  c <= 1 && _ <= 1 && E <= 1 && ($ = !0, c = _ = E = 3);
                   let P = function(U, N, B) {
                     return !1;
                   };
-                  if (L) {
-                    const U = new a.Matrix3().getInverse3(O);
+                  if ($) {
+                    const U = new a.Matrix3().getInverse3(F);
                     P = function(N, B, W) {
                       let V = new a.Vector3(N, B, W).applyMatrix3(U);
                       return !(V.x > -1e-4 && V.x < 1.0001 && V.y > -1e-4 && V.y < 1.0001 && V.z > -1e-4 && V.z < 1.0001);
@@ -24440,7 +24456,7 @@ ATOM`, b);
                         if (U == 0 && N == 0 && B == 0)
                           continue;
                         let W = new a.Vector3(R(U), R(N), R(B));
-                        W.applyMatrix3(O);
+                        W.applyMatrix3(F);
                         let V = [];
                         for (let G = 0; G < z.length; G++) {
                           let H = z[G].x + W.x, Q = z[G].y + W.y, te = z[G].z + W.z;
@@ -24463,13 +24479,13 @@ ATOM`, b);
                 c.start ? E = new a.Vector3(c.start.x || 0, c.start.y || 0, c.start.z || 0) : E = new a.Vector3(0, 0, 0);
                 var w;
                 c.end ? w = new a.Vector3(c.end.x, c.end.y || 0, c.end.z || 0) : w = new a.Vector3(0, 0, 0);
-                var k = new a.Vector3(), L = new a.Vector3(), $ = new a.Vector3(), z, O, R, P = E.clone(), U = 0;
-                for (k.subVectors(w, E), z = k.length(), k.normalize(), L = k.clone(), $ = k.clone(), L.multiplyScalar(c.dashLength), $.multiplyScalar(c.gapLength), O = L.length(), R = $.length(); U < z; ) {
-                  if (U + O > z) {
+                var k = new a.Vector3(), $ = new a.Vector3(), L = new a.Vector3(), z, F, R, P = E.clone(), U = 0;
+                for (k.subVectors(w, E), z = k.length(), k.normalize(), $ = k.clone(), L = k.clone(), $.multiplyScalar(c.dashLength), L.multiplyScalar(c.gapLength), F = $.length(), R = L.length(); U < z; ) {
+                  if (U + F > z) {
                     c.start = E, c.end = w, _.addLine(c);
                     break;
                   }
-                  P.addVectors(E, L), c.start = E, c.end = P, _.addLine(c), E = P.clone(), U += O, P.addVectors(E, $), E = P.clone(), U += R;
+                  P.addVectors(E, $), c.start = E, c.end = P, _.addLine(c), E = P.clone(), U += F, P.addVectors(E, L), E = P.clone(), U += R;
                 }
                 return _.finalize(), _;
               }
@@ -24637,27 +24653,27 @@ ATOM`, b);
                 this.incAnim();
                 var _ = 100, E = "forward", w = 1 / 0;
                 c = c || {}, c.interval && (_ = c.interval), c.loop && (E = c.loop), c.reps && (w = c.reps);
-                var k = this.getNumFrames(), L = this, $ = 0;
-                c.startFrame && ($ = c.startFrame % k);
+                var k = this.getNumFrames(), $ = this, L = 0;
+                c.startFrame && (L = c.startFrame % k);
                 var z = 1;
                 c.step && (z = c.step, w /= z);
-                var O = 0, R = k * w, P = /* @__PURE__ */ new Date(), U, N, B = function(W) {
-                  P = /* @__PURE__ */ new Date(), W == "forward" ? L.setFrame($).then(function() {
-                    $ = ($ + z) % k, U();
-                  }) : W == "backward" ? L.setFrame(k - 1 - $).then(function() {
-                    $ = ($ + z) % k, U();
-                  }) : L.setFrame($).then(function() {
-                    $ += z, z *= $ % (k - 1) == 0 ? -1 : 1, U();
+                var F = 0, R = k * w, P = /* @__PURE__ */ new Date(), U, N, B = function(W) {
+                  P = /* @__PURE__ */ new Date(), W == "forward" ? $.setFrame(L).then(function() {
+                    L = (L + z) % k, U();
+                  }) : W == "backward" ? $.setFrame(k - 1 - L).then(function() {
+                    L = (L + z) % k, U();
+                  }) : $.setFrame(L).then(function() {
+                    L += z, z *= L % (k - 1) == 0 ? -1 : 1, U();
                   });
                 };
                 return U = function() {
-                  if (L.render(), !L.getCanvas().isConnected)
-                    L.stopAnimate();
-                  else if (++O >= R || !L.isAnimated())
-                    N.cancel(), L.animationTimers.delete(N), L.decAnim();
+                  if ($.render(), !$.getCanvas().isConnected)
+                    $.stopAnimate();
+                  else if (++F >= R || !$.isAnimated())
+                    N.cancel(), $.animationTimers.delete(N), $.decAnim();
                   else {
                     var W = _ - ((/* @__PURE__ */ new Date()).getTime() - P.getTime());
-                    W = W > 0 ? W : 0, L.animationTimers.delete(N), N = new h.PausableTimer(B, W, E), L.animationTimers.add(N);
+                    W = W > 0 ? W : 0, $.animationTimers.delete(N), N = new h.PausableTimer(B, W, E), $.animationTimers.add(N);
                   }
                 }, N = new h.PausableTimer(B, 0, E), this.animationTimers.add(N), this;
               }
@@ -24734,8 +24750,8 @@ ATOM`, b);
               addModels(c, _, E) {
                 E = this.getModelOpt(E), E.multimodel = !0, E.frames = !0;
                 for (var w = d.GLModel.parseMolData(c, _, E), k = 0; k < w.length; k++) {
-                  var L = new d.GLModel(this.models.length, E);
-                  L.setAtomDefaults(w[k]), L.addFrame(w[k]), L.setFrame(0), w.modelData && L.setModelData(w.modelData[k]), L.setDontDuplicateAtoms(!E.duplicateAssemblyAtoms), this.models.push(L);
+                  var $ = new d.GLModel(this.models.length, E);
+                  $.setAtomDefaults(w[k]), $.addFrame(w[k]), $.setFrame(0), w.modelData && $.setModelData(w.modelData[k]), $.setDontDuplicateAtoms(!E.duplicateAssemblyAtoms), this.models.push($);
                 }
                 return this.models;
               }
@@ -24844,9 +24860,9 @@ ATOM`, b);
                   }
                 return this.models.push(E), E;
               }
-              applyToModels(c, _, E, w, k, L, $) {
-                for (var z = this.getModelList(_), O = 0; O < z.length; O++)
-                  z[O][c](_, E, w, k, L, $);
+              applyToModels(c, _, E, w, k, $, L) {
+                for (var z = this.getModelList(_), F = 0; F < z.length; F++)
+                  z[F][c](_, E, w, k, $, L);
               }
               setStyle(c, _) {
                 return typeof _ > "u" && (_ = c, c = {}), this.applyToModels("setStyle", c, _, !1), this;
@@ -24981,12 +24997,12 @@ ATOM`, b);
                 let w = [], k = {};
                 for (let P = 0, U = _.length; P < U; P++)
                   k[_[P].index] = P;
-                let L = function(P) {
+                let $ = function(P) {
                   let U = [];
                   for (let N = 0, B = P.length; N < B; N++)
                     P[N].index in k && U.push(k[P[N].index]);
                   return U;
-                }, $ = function(P) {
+                }, L = function(P) {
                   let U = [];
                   return U[0] = [P[0][0], P[0][1], P[0][2]], U[1] = [P[1][0], P[1][1], P[1][2]], U;
                 }, z = function(P) {
@@ -24994,19 +25010,19 @@ ATOM`, b);
                     return [P];
                   var U = P[1][0] - P[0][0], N = P[1][1] - P[0][1], B = P[1][2] - P[0][2], W;
                   U > N && U > B ? W = 0 : N > U && N > B ? W = 1 : W = 2;
-                  var V = $(P), G = $(P), H = (P[1][W] - P[0][W]) / 2 + P[0][W];
+                  var V = L(P), G = L(P), H = (P[1][W] - P[0][W]) / 2 + P[0][W];
                   V[1][W] = H, G[0][W] = H;
                   var Q = z(V), te = z(G);
                   return Q.concat(te);
-                }, O = z(c), R = 6;
-                for (let P = 0, U = O.length; P < U; P++) {
-                  let N = $(O[P]);
+                }, F = z(c), R = 6;
+                for (let P = 0, U = F.length; P < U; P++) {
+                  let N = L(F[P]);
                   N[0][0] -= R, N[0][1] -= R, N[0][2] -= R, N[1][0] += R, N[1][1] += R, N[1][2] += R;
-                  let B = l.getAtomsWithin(_, N), W = l.getAtomsWithin(E, O[P]);
+                  let B = l.getAtomsWithin(_, N), W = l.getAtomsWithin(E, F[P]);
                   w.push({
-                    extent: O[P],
-                    atoms: L(B),
-                    toshow: L(W)
+                    extent: F[P],
+                    atoms: $(B),
+                    toshow: $(W)
                   });
                 }
                 return w;
@@ -25023,28 +25039,28 @@ ATOM`, b);
                * @return {Mesh}
                */
               static generateSurfaceMesh(c, _, E) {
-                var w = new r.Geometry(!0), k = w.updateGeoGroup(0), L = [];
+                var w = new r.Geometry(!0), k = w.updateGeoGroup(0), $ = [];
                 for (let pe = 0, le = c.length; pe < le; pe++) {
-                  var $ = c[pe];
-                  $ && (typeof $.surfaceColor < "u" ? L[pe] = $.surfaceColor : $.color && (L[pe] = s.CC.color($.color)));
+                  var L = c[pe];
+                  L && (typeof L.surfaceColor < "u" ? $[pe] = L.surfaceColor : L.color && ($[pe] = s.CC.color(L.color)));
                 }
-                var z = k.vertexArray, O = _.vertices;
-                for (let pe = 0, le = O.length; pe < le; pe++) {
+                var z = k.vertexArray, F = _.vertices;
+                for (let pe = 0, le = F.length; pe < le; pe++) {
                   let ne = k.vertices * 3;
-                  z[ne] = O[pe].x, z[ne + 1] = O[pe].y, z[ne + 2] = O[pe].z, k.vertices++;
+                  z[ne] = F[pe].x, z[ne + 1] = F[pe].y, z[ne + 2] = F[pe].z, k.vertices++;
                 }
                 var R = k.colorArray;
                 let P = k.atomArray;
                 if (E.voldata && E.volscheme) {
                   var U = E.volscheme, N = E.voldata, B = U.range() || [-1, 1];
-                  for (let pe = 0, le = O.length; pe < le; pe++) {
-                    let ne = O[pe].atomid, Te = N.getVal(O[pe].x, O[pe].y, O[pe].z), Fe = s.CC.color(U.valueToHex(Te, B)), Be = pe * 3;
-                    R[Be] = Fe.r, R[Be + 1] = Fe.g, R[Be + 2] = Fe.b, P[pe] = c[ne];
+                  for (let pe = 0, le = F.length; pe < le; pe++) {
+                    let ne = F[pe].atomid, Te = N.getVal(F[pe].x, F[pe].y, F[pe].z), Oe = s.CC.color(U.valueToHex(Te, B)), Be = pe * 3;
+                    R[Be] = Oe.r, R[Be + 1] = Oe.g, R[Be + 2] = Oe.b, P[pe] = c[ne];
                   }
-                } else if (L.length > 0)
-                  for (let pe = 0, le = O.length; pe < le; pe++) {
-                    let ne = O[pe].atomid, Te = pe * 3;
-                    R[Te] = L[ne].r, R[Te + 1] = L[ne].g, R[Te + 2] = L[ne].b, P[pe] = c[ne];
+                } else if ($.length > 0)
+                  for (let pe = 0, le = F.length; pe < le; pe++) {
+                    let ne = F[pe].atomid, Te = pe * 3;
+                    R[Te] = $[ne].r, R[Te + 1] = $[ne].g, R[Te + 2] = $[ne].b, P[pe] = c[ne];
                   }
                 var W = _.faces;
                 k.faceidx = W.length, w.initTypedArrays();
@@ -25073,9 +25089,9 @@ ATOM`, b);
                *            vol
                * @return {Object}
                */
-              static generateMeshSyncHelper(c, _, E, w, k, L) {
-                var $ = new A.ProteinSurface();
-                return $.initparm(_, c !== 1, L), $.fillvoxels(k, E), $.buildboundary(), (c == A.SurfaceType.SES || c == A.SurfaceType.MS) && ($.fastdistancemap(), $.boundingatom(!1), $.fillvoxelswaals(k, E)), $.marchingcube(c), $.getFacesAndVertices(w);
+              static generateMeshSyncHelper(c, _, E, w, k, $) {
+                var L = new A.ProteinSurface();
+                return L.initparm(_, c !== 1, $), L.fillvoxels(k, E), L.buildboundary(), (c == A.SurfaceType.SES || c == A.SurfaceType.MS) && (L.fastdistancemap(), L.boundingatom(!1), L.fillvoxelswaals(k, E)), L.marchingcube(c), L.getFacesAndVertices(w);
               }
               /*
                *
@@ -25128,8 +25144,8 @@ ATOM`, b);
                * @param {function} surfacecallback - function to be called after setting the surface
                * @return {Promise} promise - Returns a promise that ultimately resovles to the surfid.  Returns surfid immediately if surfacecallback is specified.  Returned promise has a [surfid, GLViewer, style, atomsel, allsel, focus] fields for immediate access.
                */
-              addSurface(c, _ = {}, E = {}, w, k, L) {
-                let $ = this.nextSurfID(), z = null, O = this, R = A.SurfaceType.VDW;
+              addSurface(c, _ = {}, E = {}, w, k, $) {
+                let L = this.nextSurfID(), z = null, F = this, R = A.SurfaceType.VDW;
                 typeof c == "string" ? l.surfaceTypeMap[c.toUpperCase()] !== void 0 ? R = l.surfaceTypeMap[c] : console.log("Surface type : " + c + " is not recognized") : typeof c == "number" && (R = c);
                 var P = null, U = null, N = l.shallowCopy(this.getAtomsFromSel(E));
                 w ? P = l.shallowCopy(this.getAtomsFromSel(w)) : P = N, (0, h.adjustVolumeStyle)(_);
@@ -25143,7 +25159,7 @@ ATOM`, b);
                     }
                   }
                 var G = function(oe, he, Ae) {
-                  k ? U = l.shallowCopy(O.getAtomsFromSel(k)) : U = Ae;
+                  k ? U = l.shallowCopy(F.getAtomsFromSel(k)) : U = Ae;
                   var Se, Ie = (0, h.getExtent)(Ae, !0);
                   if (_.map && _.map.prop) {
                     var pe = _.map.prop;
@@ -25152,9 +25168,9 @@ ATOM`, b);
                   }
                   for (let De = 0, je = he.length; De < je; De++)
                     Se = he[De], Se.surfaceColor = (0, h.getColorFromStyle)(Se, _);
-                  var le = l.volume(Ie), ne = O.carveUpExtent(Ie, he, Ae);
+                  var le = l.volume(Ie), ne = F.carveUpExtent(Ie, he, Ae);
                   if (U && U.length && U.length > 0) {
-                    var Te = (0, h.getExtent)(U, !0), Fe = function(De, je) {
+                    var Te = (0, h.getExtent)(U, !0), Oe = function(De, je) {
                       var Xe = function(re, ye) {
                         var me = re.extent, ze = me[1][0] - me[0][0], ke = me[1][1] - me[0][1], K = me[1][2] - me[0][2], ae = ze - ye[2][0];
                         ae *= ae;
@@ -25165,7 +25181,7 @@ ATOM`, b);
                       }, X = Xe(De, Te), q = Xe(je, Te);
                       return X - q;
                     };
-                    ne.sort(Fe);
+                    ne.sort(Oe);
                   }
                   var Be = [];
                   for (let De = 0, je = he.length; De < je; De++)
@@ -25188,13 +25204,13 @@ ATOM`, b);
                           var me = l.generateSurfaceMesh(he, X, z);
                           (0, h.mergeGeos)(oe.geo, me);
                         }
-                        O.render(), Xe();
+                        F.render(), Xe();
                       });
                     }, Ge = [];
                     for (let De = 0; De < ne.length; De++)
                       Ge.push(Pe(De));
                     return Promise.all(Ge).then(function() {
-                      return oe.done = !0, Promise.resolve($);
+                      return oe.done = !0, Promise.resolve(L);
                     });
                   } else {
                     var Ne = [];
@@ -25223,7 +25239,7 @@ ATOM`, b);
                           }, ge = l.generateSurfaceMesh(he, ae, z);
                           (0, h.mergeGeos)(oe.geo, ge);
                         }
-                        O.render(), Xe++, Xe == ne.length && (oe.done = !0, X(), De($));
+                        F.render(), Xe++, Xe == ne.length && (oe.done = !0, X(), De(L));
                       }, re = function(me) {
                         X(), console.log(me.message + " (" + me.filename + ":" + me.lineno + ")"), je(me);
                       };
@@ -25270,9 +25286,9 @@ ATOM`, b);
                     finished: !1,
                     symmetries: [new a.Matrix4()]
                   }), Q = G(H[H.length - 1], P, N);
-                return this.surfaces[$] = H, Q.surfid = $, L && typeof L == "function" ? (Q.then(function(fe) {
-                  L(fe);
-                }), $) : Q;
+                return this.surfaces[L] = H, Q.surfid = L, $ && typeof $ == "function" ? (Q.then(function(fe) {
+                  $(fe);
+                }), L) : Q;
               }
               /**
                * Set the surface material to something else, must render change
@@ -25296,20 +25312,20 @@ ATOM`, b);
                     var w = E[k].mat = l.getMatWithStyle(_);
                     if (E[k].mat.side = r.FrontSide, _.color) {
                       E[k].mat.color = s.CC.color(_.color), E[k].geo.colorsNeedUpdate = !0;
-                      const L = s.CC.color(_.color);
-                      E[k].geo.setColor(L);
+                      const $ = s.CC.color(_.color);
+                      E[k].geo.setColor($);
                     } else if (w.voldata && w.volscheme) {
-                      const L = w.volscheme, $ = w.voldata, z = s.CC, O = L.range() || [-1, 1];
+                      const $ = w.volscheme, L = w.voldata, z = s.CC, F = $.range() || [-1, 1];
                       E[k].geo.setColors(function(R, P, U) {
-                        let N = $.getVal(R, P, U);
-                        return z.color(L.valueToHex(N, O));
+                        let N = L.getVal(R, P, U);
+                        return z.color($.valueToHex(N, F));
                       });
                     } else {
                       E[k].geo.colorsNeedUpdate = !0;
-                      for (let L of E[k].geo.geometryGroups)
-                        for (let $ = 0; $ < L.vertices; $++) {
-                          let z = (0, h.getColorFromStyle)(L.atomArray[$], _), O = 3 * $;
-                          L.colorArray[O] = z.r, L.colorArray[O + 1] = z.g, L.colorArray[O + 2] = z.b;
+                      for (let $ of E[k].geo.geometryGroups)
+                        for (let L = 0; L < $.vertices; L++) {
+                          let z = (0, h.getColorFromStyle)($.atomArray[L], _), F = 3 * L;
+                          $.colorArray[F] = z.r, $.colorArray[F + 1] = z.g, $.colorArray[F + 2] = z.b;
                         }
                     }
                     E[k].finished = !1;
@@ -25378,14 +25394,14 @@ ATOM`, b);
                 _ = _ || {};
                 var E = this.getAtomsFromSel(_);
                 if (typeof c == "function")
-                  for (let L = 0, $ = E.length; L < $; L++) {
-                    let z = E[L];
+                  for (let $ = 0, L = E.length; $ < L; $++) {
+                    let z = E[$];
                     c(z);
                   }
                 else
-                  for (let L = 0, $ = E.length; L < $; L++) {
-                    var w = E[L];
-                    for (let z = 0, O = c.length; z < O; z++) {
+                  for (let $ = 0, L = E.length; $ < L; $++) {
+                    var w = E[$];
+                    for (let z = 0, F = c.length; z < F; z++) {
                       let R = c[z];
                       if (R.props)
                         for (var k in R.props)
@@ -25451,42 +25467,42 @@ ATOM`, b);
                 }
               }
             }
-            function g(b, c = {}, _ = {}) {
+            function p(b, c = {}, _ = {}) {
               if (b = (0, h.getElement)(b), !!b) {
                 var E = [], w = document.createElement("canvas");
                 _.rows = c.rows, _.cols = c.cols, _.control_all = c.control_all != null ? c.control_all : !1, b.appendChild(w);
                 try {
                   for (var k = 0; k < c.rows; k++) {
-                    for (var L = [], $ = 0; $ < c.cols; $++) {
-                      _.row = k, _.col = $, _.canvas = w, _.viewers = E, _.control_all = c.control_all;
+                    for (var $ = [], L = 0; L < c.cols; L++) {
+                      _.row = k, _.col = L, _.canvas = w, _.viewers = E, _.control_all = c.control_all;
                       var z = u(b, (0, h.extend)({}, _));
-                      L.push(z);
+                      $.push(z);
                     }
-                    E.unshift(L);
+                    E.unshift($);
                   }
-                } catch (O) {
-                  throw "error creating viewer grid: " + O;
+                } catch (F) {
+                  throw "error creating viewer grid: " + F;
                 }
                 return E;
               }
             }
-            function p(b) {
+            function g(b) {
               var c = this;
               if (b = (0, h.getElement)(b), !!b) {
-                var _ = g(b, { rows: 1, cols: 2, control_all: !0 });
+                var _ = p(b, { rows: 1, cols: 2, control_all: !0 });
                 this.glviewer1 = _[0][0], this.glviewer2 = _[0][1], this.glviewer1.setAutoEyeSeparation(!1), this.glviewer2.setAutoEyeSeparation(!0), this.glviewer1.linkViewer(this.glviewer2), this.glviewer2.linkViewer(this.glviewer1);
                 for (var E = Object.getOwnPropertyNames(this.glviewer1.__proto__).filter(function(k) {
                   return typeof c.glviewer1[k] == "function";
                 }), w = 0; w < E.length; w++)
                   this[E[w]] = /* @__PURE__ */ function(k) {
                     return function() {
-                      var L = this.glviewer1[k].apply(this.glviewer1, arguments), $ = this.glviewer2[k].apply(this.glviewer2, arguments);
-                      return [L, $];
+                      var $ = this.glviewer1[k].apply(this.glviewer1, arguments), L = this.glviewer2[k].apply(this.glviewer2, arguments);
+                      return [$, L];
                     };
                   }(E[w]);
-                this.setCoordinates = function(k, L, $) {
+                this.setCoordinates = function(k, $, L) {
                   for (var z = 0; z < k.length; z++)
-                    k[z].setCoordinates(L, $);
+                    k[z].setCoordinates($, L);
                 }, this.surfacesFinished = function() {
                   return this.glviewer1.surfacesFinished() && this.glviewer2.surfacesFinished();
                 }, this.isAnimated = function() {
@@ -25591,12 +25607,12 @@ ATOM`, b);
                 var l, u;
                 if (M = this.mult * M, m ? (l = m[0], u = m[1]) : (l = this.min, u = this.max), M === void 0)
                   return 16777215;
-                var g = s(l, u, M);
-                l = g.lo, u = g.hi, M = g.val;
-                var p = (u + l) / 2;
-                m && typeof m[2] < "u" ? p = m[2] : typeof this.mid < "u" ? p = this.mid : p = (l + u) / 2;
+                var p = s(l, u, M);
+                l = p.lo, u = p.hi, M = p.val;
+                var g = (u + l) / 2;
+                m && typeof m[2] < "u" ? g = m[2] : typeof this.mid < "u" ? g = this.mid : g = (l + u) / 2;
                 var b, c;
-                return M < p ? (b = Math.floor(255 * Math.sqrt((M - l) / (p - l))), c = 16711680 + 256 * b + b, c) : M > p ? (b = Math.floor(255 * Math.sqrt(1 - (M - p) / (u - p))), c = 65536 * b + 256 * b + 255, c) : 16777215;
+                return M < g ? (b = Math.floor(255 * Math.sqrt((M - l) / (g - l))), c = 16711680 + 256 * b + b, c) : M > g ? (b = Math.floor(255 * Math.sqrt(1 - (M - g) / (u - g))), c = 65536 * b + 256 * b + 255, c) : 16777215;
               }
             }
             class d extends a {
@@ -25608,10 +25624,10 @@ ATOM`, b);
                 var l, u;
                 if (M = this.mult * M, m ? (l = m[0], u = m[1]) : (l = this.min, u = this.max), typeof M > "u")
                   return 16777215;
-                var g = s(l, u, M);
-                l = g.lo, u = g.hi, M = g.val;
-                var p = (l + u) / 2, b = (l + p) / 2, c = (p + u) / 2, _, E;
-                return M < b ? (_ = Math.floor(255 * Math.sqrt((M - l) / (b - l))), E = 16711680 + 256 * _ + 0, E) : M < p ? (_ = Math.floor(255 * Math.sqrt(1 - (M - b) / (p - b))), E = 65536 * _ + 65280 + 0, E) : M < c ? (_ = Math.floor(255 * Math.sqrt((M - p) / (c - p))), E = 65280 + 1 * _, E) : (_ = Math.floor(255 * Math.sqrt(1 - (M - c) / (u - c))), E = 0 + 256 * _ + 255, E);
+                var p = s(l, u, M);
+                l = p.lo, u = p.hi, M = p.val;
+                var g = (l + u) / 2, b = (l + g) / 2, c = (g + u) / 2, _, E;
+                return M < b ? (_ = Math.floor(255 * Math.sqrt((M - l) / (b - l))), E = 16711680 + 256 * _ + 0, E) : M < g ? (_ = Math.floor(255 * Math.sqrt(1 - (M - b) / (g - b))), E = 65536 * _ + 65280 + 0, E) : M < c ? (_ = Math.floor(255 * Math.sqrt((M - g) / (c - g))), E = 65280 + 1 * _, E) : (_ = Math.floor(255 * Math.sqrt(1 - (M - c) / (u - c))), E = 0 + 256 * _ + 255, E);
               }
               //return range used for color mapping, null if none set
               range() {
@@ -25627,9 +25643,9 @@ ATOM`, b);
                 var l, u;
                 if (M = this.mult * M, m ? (l = m[0], u = m[1]) : (l = this.min, u = this.max), typeof M > "u")
                   return 16777215;
-                var g = A.normalizeValue(l, u, M);
-                l = g.lo, u = g.hi, M = g.val;
-                var p = (M - l) / (u - l), b = 5 * p / 6 + 0.5, c = Math.sin(Math.PI * b);
+                var p = A.normalizeValue(l, u, M);
+                l = p.lo, u = p.hi, M = p.val;
+                var g = (M - l) / (u - l), b = 5 * g / 6 + 0.5, c = Math.sin(Math.PI * b);
                 c *= c * 255;
                 var _ = Math.sin(Math.PI * (b + 1 / 3));
                 _ *= _ * 255;
@@ -25646,8 +25662,8 @@ ATOM`, b);
                 super(), this.gradient = "linear", this.colors = new Array();
                 var u;
                 if (Array.isArray(M) && M.length >= 2 ? (this.max = M[1], this.min = M[0], u = m) : (this.min = M, this.max = m, u = l), u)
-                  for (let g of u)
-                    this.colors.push(r.CC.color(g));
+                  for (let p of u)
+                    this.colors.push(r.CC.color(p));
                 else
                   this.colors.push(r.CC.color(0));
               }
@@ -25660,9 +25676,9 @@ ATOM`, b);
                 var l, u;
                 if (m ? (l = m[0], u = m[1]) : (l = this.min, u = this.max), M === void 0)
                   return 16777215;
-                var g = s(l, u, M);
-                l = g.lo, u = g.hi, M = g.val;
-                let p = this.colors.length, b = (u - l) / p, c = Math.min(Math.floor((M - l) / b), p - 1), _ = Math.min(c + 1, p - 1), E = (M - l - c * b) / b, w = this.colors[c], k = this.colors[_];
+                var p = s(l, u, M);
+                l = p.lo, u = p.hi, M = p.val;
+                let g = this.colors.length, b = (u - l) / g, c = Math.min(Math.floor((M - l) / b), g - 1), _ = Math.min(c + 1, g - 1), E = (M - l - c * b) / b, w = this.colors[c], k = this.colors[_];
                 return new r.Color(w.r + E * (k.r - w.r), w.g + E * (k.g - w.g), w.b + E * (k.b - w.b)).getHex();
               }
             }
@@ -25746,12 +25762,12 @@ ATOM`, b);
                   g: 255,
                   b: 255,
                   a: 1
-                }), u = y.padding ? y.padding : 4, g = y.borderThickness ? y.borderThickness : 0, p = d(y.backgroundColor, y.backgroundOpacity, {
+                }), u = y.padding ? y.padding : 4, p = y.borderThickness ? y.borderThickness : 0, g = d(y.backgroundColor, y.backgroundOpacity, {
                   r: 0,
                   g: 0,
                   b: 0,
                   a: 1
-                }), b = d(y.borderColor, y.borderOpacity, p), c = y.position ? y.position : {
+                }), b = d(y.borderColor, y.borderOpacity, g), c = y.position ? y.position : {
                   x: -10,
                   y: 1,
                   z: 1
@@ -25761,15 +25777,15 @@ ATOM`, b);
                 typeof E == "string" && E in r.SpriteAlignment && (E = r.SpriteAlignment[E]);
                 var w = "";
                 y.bold && (w = "bold "), this.context.font = w + m + "px  " + M;
-                var k = this.context.measureText(this.text), L = k.width;
-                x || (g = 0);
-                var $ = L + 2.5 * g + 2 * u, z = m * 1.25 + 2 * g + 2 * u;
+                var k = this.context.measureText(this.text), $ = k.width;
+                x || (p = 0);
+                var L = $ + 2.5 * p + 2 * u, z = m * 1.25 + 2 * p + 2 * u;
                 if (y.backgroundImage) {
-                  var O = y.backgroundImage, R = y.backgroundWidth ? y.backgroundWidth : O.width, P = y.backgroundHeight ? y.backgroundHeight : O.height;
-                  R > $ && ($ = R), P > z && (z = P);
+                  var F = y.backgroundImage, R = y.backgroundWidth ? y.backgroundWidth : F.width, P = y.backgroundHeight ? y.backgroundHeight : F.height;
+                  R > L && (L = R), P > z && (z = P);
                 }
-                if (this.canvas.width = $, this.canvas.height = z, this.context.clearRect(0, 0, this.canvas.width, this.canvas.height), w = "", y.bold && (w = "bold "), this.context.font = w + m + "px  " + M, this.context.fillStyle = "rgba(" + p.r + "," + p.g + "," + p.b + "," + p.a + ")", this.context.strokeStyle = "rgba(" + b.r + "," + b.g + "," + b.b + "," + b.a + ")", y.backgroundGradient) {
-                  let N = this.context.createLinearGradient(0, z / 2, $, z / 2), B = a.Gradient.getGradient(y.backgroundGradient), W = B.range(), V = -1, G = 1;
+                if (this.canvas.width = L, this.canvas.height = z, this.context.clearRect(0, 0, this.canvas.width, this.canvas.height), w = "", y.bold && (w = "bold "), this.context.font = w + m + "px  " + M, this.context.fillStyle = "rgba(" + g.r + "," + g.g + "," + g.b + "," + g.a + ")", this.context.strokeStyle = "rgba(" + b.r + "," + b.g + "," + b.b + "," + b.a + ")", y.backgroundGradient) {
+                  let N = this.context.createLinearGradient(0, z / 2, L, z / 2), B = a.Gradient.getGradient(y.backgroundGradient), W = B.range(), V = -1, G = 1;
                   W && (V = W[0], G = W[1]);
                   let H = G - V;
                   for (let Q = 0; Q < 1.01; Q += 0.1) {
@@ -25778,7 +25794,7 @@ ATOM`, b);
                   }
                   this.context.fillStyle = N;
                 }
-                this.context.lineWidth = g, x && o(this.context, g, g, $ - 2 * g, z - 2 * g, 6, g > 0), y.backgroundImage && this.context.drawImage(O, 0, 0, $, z), this.context.fillStyle = "rgba(" + l.r + "," + l.g + "," + l.b + "," + l.a + ")", this.context.fillText(this.text, g + u, m + g + u, L);
+                this.context.lineWidth = p, x && o(this.context, p, p, L - 2 * p, z - 2 * p, 6, p > 0), y.backgroundImage && this.context.drawImage(F, 0, 0, L, z), this.context.fillStyle = "rgba(" + l.r + "," + l.g + "," + l.b + "," + l.a + ")", this.context.fillText(this.text, p + u, m + p + u, $);
                 var U = new r.Texture(this.canvas);
                 U.needsUpdate = !0, this.sprite.material = new r.SpriteMaterial({
                   map: U,
@@ -26885,27 +26901,27 @@ ATOM`, b);
                 ];
               }
               march(A, x, M, m) {
-                let l = !!m.fulltable, u = m.hasOwnProperty("origin") && m.origin.hasOwnProperty("x") ? m.origin : { x: 0, y: 0, z: 0 }, g = !!m.voxel, p = m.matrix, b = m.nX || 0, c = m.nY || 0, _ = m.nZ || 0, E = m.scale || 1, w = null;
+                let l = !!m.fulltable, u = m.hasOwnProperty("origin") && m.origin.hasOwnProperty("x") ? m.origin : { x: 0, y: 0, z: 0 }, p = !!m.voxel, g = m.matrix, b = m.nX || 0, c = m.nY || 0, _ = m.nZ || 0, E = m.scale || 1, w = null;
                 m.unitCube ? w = m.unitCube : w = { x: E, y: E, z: E };
-                let k = new Int32Array(b * c * _), L, $;
-                for (L = 0, $ = k.length; L < $; ++L)
-                  k[L] = -1;
+                let k = new Int32Array(b * c * _), $, L;
+                for ($ = 0, L = k.length; $ < L; ++$)
+                  k[$] = -1;
                 let z = function(U, N, B, W, V, G) {
                   let H = { x: 0, y: 0, z: 0 }, Q = !!(W & 1 << V), te = !!(W & 1 << G), ee = V;
-                  if (!Q && te && (ee = G), ee & 1 && B++, ee & 2 && N++, ee & 4 && U++, p) {
+                  if (!Q && te && (ee = G), ee & 1 && B++, ee & 2 && N++, ee & 4 && U++, g) {
                     let fe = new r.Vector3(U, N, B);
-                    fe = fe.applyMatrix4(p), H = { x: fe.x, y: fe.y, z: fe.z };
+                    fe = fe.applyMatrix4(g), H = { x: fe.x, y: fe.y, z: fe.z };
                   } else
                     H.x = u.x + w.x * U, H.y = u.y + w.y * N, H.z = u.z + w.z * B;
                   let ce = (c * U + N) * _ + B;
-                  return g ? (x.push(H), x.length - 1) : (k[ce] < 0 && (k[ce] = x.length, x.push(H)), k[ce]);
-                }, O = new Int32Array(12), R = l ? this.edgeTable2 : this.edgeTable, P = l ? this.triTable2 : this.triTable;
-                for (L = 0; L < b - 1; ++L)
+                  return p ? (x.push(H), x.length - 1) : (k[ce] < 0 && (k[ce] = x.length, x.push(H)), k[ce]);
+                }, F = new Int32Array(12), R = l ? this.edgeTable2 : this.edgeTable, P = l ? this.triTable2 : this.triTable;
+                for ($ = 0; $ < b - 1; ++$)
                   for (let U = 0; U < c - 1; ++U)
                     for (let N = 0; N < _ - 1; ++N) {
                       let B = 0;
                       for (let G = 0; G < 8; ++G) {
-                        let H = (c * (L + ((G & 4) >> 2)) + U + ((G & 2) >> 1)) * _ + N + (G & 1), Q = !!(A[H] & this.ISDONE);
+                        let H = (c * ($ + ((G & 4) >> 2)) + U + ((G & 2) >> 1)) * _ + N + (G & 1), Q = !!(A[H] & this.ISDONE);
                         B |= Q << G;
                       }
                       if (B === 0 || B === 255)
@@ -26914,15 +26930,15 @@ ATOM`, b);
                       if (W === 0)
                         continue;
                       let V = P[B];
-                      W & 1 && (O[0] = z(L, U, N, B, 0, 1)), W & 2 && (O[1] = z(L, U, N, B, 1, 3)), W & 4 && (O[2] = z(L, U, N, B, 3, 2)), W & 8 && (O[3] = z(L, U, N, B, 2, 0)), W & 16 && (O[4] = z(L, U, N, B, 4, 5)), W & 32 && (O[5] = z(L, U, N, B, 5, 7)), W & 64 && (O[6] = z(L, U, N, B, 7, 6)), W & 128 && (O[7] = z(L, U, N, B, 6, 4)), W & 256 && (O[8] = z(L, U, N, B, 0, 4)), W & 512 && (O[9] = z(L, U, N, B, 1, 5)), W & 1024 && (O[10] = z(L, U, N, B, 3, 7)), W & 2048 && (O[11] = z(L, U, N, B, 2, 6));
+                      W & 1 && (F[0] = z($, U, N, B, 0, 1)), W & 2 && (F[1] = z($, U, N, B, 1, 3)), W & 4 && (F[2] = z($, U, N, B, 3, 2)), W & 8 && (F[3] = z($, U, N, B, 2, 0)), W & 16 && (F[4] = z($, U, N, B, 4, 5)), W & 32 && (F[5] = z($, U, N, B, 5, 7)), W & 64 && (F[6] = z($, U, N, B, 7, 6)), W & 128 && (F[7] = z($, U, N, B, 6, 4)), W & 256 && (F[8] = z($, U, N, B, 0, 4)), W & 512 && (F[9] = z($, U, N, B, 1, 5)), W & 1024 && (F[10] = z($, U, N, B, 3, 7)), W & 2048 && (F[11] = z($, U, N, B, 2, 6));
                       for (let G = 0; G < V.length; G += 3) {
-                        let H = O[V[G]], Q = O[V[G + 1]], te = O[V[G + 2]];
-                        g && G >= 3 && (x.push(x[H]), H = x.length - 1, x.push(x[Q]), Q = x.length - 1, x.push(x[te]), te = x.length - 1), M.push(H), M.push(Q), M.push(te);
+                        let H = F[V[G]], Q = F[V[G + 1]], te = F[V[G + 2]];
+                        p && G >= 3 && (x.push(x[H]), H = x.length - 1, x.push(x[Q]), Q = x.length - 1, x.push(x[te]), te = x.length - 1), M.push(H), M.push(Q), M.push(te);
                       }
                     }
               }
               laplacianSmooth(A, x, M) {
-                let m = new Array(x.length), l, u, g, p, b;
+                let m = new Array(x.length), l, u, p, g, b;
                 for (l = 0, u = x.length; l < u; l++)
                   m[l] = {
                     x: 0,
@@ -26935,38 +26951,38 @@ ATOM`, b);
                 for (l = 0, u = x.length; l < u; l++)
                   c[0][l] = 0;
                 for (l = 0, u = M.length / 3; l < u; l++) {
-                  let k = l * 3, L = l * 3 + 1, $ = l * 3 + 2;
-                  for (_ = !0, g = 0, p = c[0][M[k]]; g < p; g++)
-                    if (M[L] == c[g + 1][M[k]]) {
+                  let k = l * 3, $ = l * 3 + 1, L = l * 3 + 2;
+                  for (_ = !0, p = 0, g = c[0][M[k]]; p < g; p++)
+                    if (M[$] == c[p + 1][M[k]]) {
                       _ = !1;
                       break;
                     }
-                  for (_ && (c[0][M[k]]++, c[c[0][M[k]]][M[k]] = M[L]), _ = !0, g = 0, p = c[0][M[k]]; g < p; g++)
-                    if (M[$] == c[g + 1][M[k]]) {
+                  for (_ && (c[0][M[k]]++, c[c[0][M[k]]][M[k]] = M[$]), _ = !0, p = 0, g = c[0][M[k]]; p < g; p++)
+                    if (M[L] == c[p + 1][M[k]]) {
                       _ = !1;
                       break;
                     }
-                  for (_ && (c[0][M[k]]++, c[c[0][M[k]]][M[k]] = M[$]), _ = !0, g = 0, p = c[0][M[L]]; g < p; g++)
-                    if (M[k] == c[g + 1][M[L]]) {
+                  for (_ && (c[0][M[k]]++, c[c[0][M[k]]][M[k]] = M[L]), _ = !0, p = 0, g = c[0][M[$]]; p < g; p++)
+                    if (M[k] == c[p + 1][M[$]]) {
                       _ = !1;
                       break;
                     }
-                  for (_ && (c[0][M[L]]++, c[c[0][M[L]]][M[L]] = M[k]), _ = !0, g = 0, p = c[0][M[L]]; g < p; g++)
-                    if (M[$] == c[g + 1][M[L]]) {
+                  for (_ && (c[0][M[$]]++, c[c[0][M[$]]][M[$]] = M[k]), _ = !0, p = 0, g = c[0][M[$]]; p < g; p++)
+                    if (M[L] == c[p + 1][M[$]]) {
                       _ = !1;
                       break;
                     }
-                  for (_ && (c[0][M[L]]++, c[c[0][M[L]]][M[L]] = M[$]), _ = !0, g = 0; g < c[0][M[$]]; g++)
-                    if (M[k] == c[g + 1][M[$]]) {
+                  for (_ && (c[0][M[$]]++, c[c[0][M[$]]][M[$]] = M[L]), _ = !0, p = 0; p < c[0][M[L]]; p++)
+                    if (M[k] == c[p + 1][M[L]]) {
                       _ = !1;
                       break;
                     }
-                  for (_ && (c[0][M[$]]++, c[c[0][M[$]]][M[$]] = M[k]), _ = !0, g = 0, p = c[0][M[$]]; g < p; g++)
-                    if (M[L] == c[g + 1][M[$]]) {
+                  for (_ && (c[0][M[L]]++, c[c[0][M[L]]][M[L]] = M[k]), _ = !0, p = 0, g = c[0][M[L]]; p < g; p++)
+                    if (M[$] == c[p + 1][M[L]]) {
                       _ = !1;
                       break;
                     }
-                  _ && (c[0][M[$]]++, c[c[0][M[$]]][M[$]] = M[L]);
+                  _ && (c[0][M[L]]++, c[c[0][M[L]]][M[L]] = M[$]);
                 }
                 let E = 1, w = 0.5;
                 for (b = 0; b < A; b++) {
@@ -26974,12 +26990,12 @@ ATOM`, b);
                     if (c[0][l] < 3)
                       m[l].x = x[l].x, m[l].y = x[l].y, m[l].z = x[l].z;
                     else if (c[0][l] == 3 || c[0][l] == 4) {
-                      for (m[l].x = 0, m[l].y = 0, m[l].z = 0, g = 0, p = c[0][l]; g < p; g++)
-                        m[l].x += x[c[g + 1][l]].x, m[l].y += x[c[g + 1][l]].y, m[l].z += x[c[g + 1][l]].z;
+                      for (m[l].x = 0, m[l].y = 0, m[l].z = 0, p = 0, g = c[0][l]; p < g; p++)
+                        m[l].x += x[c[p + 1][l]].x, m[l].y += x[c[p + 1][l]].y, m[l].z += x[c[p + 1][l]].z;
                       m[l].x += w * x[l].x, m[l].y += w * x[l].y, m[l].z += w * x[l].z, m[l].x /= w + c[0][l], m[l].y /= w + c[0][l], m[l].z /= w + c[0][l];
                     } else {
-                      for (m[l].x = 0, m[l].y = 0, m[l].z = 0, g = 0, p = c[0][l]; g < p; g++)
-                        m[l].x += x[c[g + 1][l]].x, m[l].y += x[c[g + 1][l]].y, m[l].z += x[c[g + 1][l]].z;
+                      for (m[l].x = 0, m[l].y = 0, m[l].z = 0, p = 0, g = c[0][l]; p < g; p++)
+                        m[l].x += x[c[p + 1][l]].x, m[l].y += x[c[p + 1][l]].y, m[l].z += x[c[p + 1][l]].z;
                       m[l].x += E * x[l].x, m[l].y += E * x[l].y, m[l].z += E * x[l].z, m[l].x /= E + c[0][l], m[l].y /= E + c[0][l], m[l].z /= E + c[0][l];
                     }
                   for (l = 0, u = x.length; l < u; l++)
@@ -27068,8 +27084,8 @@ ATOM`, b);
                   M[l].x = M[l].x / this.scaleFactor - this.ptranx, M[l].y = M[l].y / this.scaleFactor - this.ptrany, M[l].z = M[l].z / this.scaleFactor - this.ptranz;
                 let m = [];
                 for (let l = 0, u = this.faces.length; l < u; l += 3) {
-                  let g = this.faces[l], p = this.faces[l + 1], b = this.faces[l + 2], c = M[g].atomid, _ = M[p].atomid, E = M[b].atomid, w = c;
-                  _ < w && (w = _), E < w && (w = E), x[w] && g !== p && p !== b && g !== b && (m.push(g), m.push(p), m.push(b));
+                  let p = this.faces[l], g = this.faces[l + 1], b = this.faces[l + 2], c = M[p].atomid, _ = M[g].atomid, E = M[b].atomid, w = c;
+                  _ < w && (w = _), E < w && (w = E), x[w] && p !== g && g !== b && p !== b && (m.push(p), m.push(g), m.push(b));
                 }
                 return this.vpBits = null, this.vpDistance = null, this.vpAtomID = null, {
                   vertices: M,
@@ -27089,9 +27105,9 @@ ATOM`, b);
                   let l = x[M] * x[M];
                   this.widxz[M] = Math.floor(x[M]) + 1, this.depty[M] = new Int32Array(this.widxz[M] * this.widxz[M]);
                   let u = 0;
-                  for (let g = 0; g < this.widxz[M]; g++)
-                    for (let p = 0; p < this.widxz[M]; p++) {
-                      let b = g * g + p * p;
+                  for (let p = 0; p < this.widxz[M]; p++)
+                    for (let g = 0; g < this.widxz[M]; g++) {
+                      let b = p * p + g * g;
                       if (b > l)
                         this.depty[M][u] = -1;
                       else {
@@ -27113,33 +27129,33 @@ ATOM`, b);
                   this.vpBits[M] & this.INOUT && (this.vpBits[M] |= this.ISDONE);
               }
               fillAtom(A, x) {
-                let M = Math.floor(0.5 + this.scaleFactor * (A.x + this.ptranx)), m = Math.floor(0.5 + this.scaleFactor * (A.y + this.ptrany)), l = Math.floor(0.5 + this.scaleFactor * (A.z + this.ptranz)), u = this.getVDWIndex(A), g = 0, p = this.pWidth * this.pHeight;
+                let M = Math.floor(0.5 + this.scaleFactor * (A.x + this.ptranx)), m = Math.floor(0.5 + this.scaleFactor * (A.y + this.ptrany)), l = Math.floor(0.5 + this.scaleFactor * (A.z + this.ptranz)), u = this.getVDWIndex(A), p = 0, g = this.pWidth * this.pHeight;
                 for (let b = 0, c = this.widxz[u]; b < c; b++)
                   for (let _ = 0; _ < c; _++) {
-                    if (this.depty[u][g] != -1) {
+                    if (this.depty[u][p] != -1) {
                       for (let E = -1; E < 2; E++)
                         for (let w = -1; w < 2; w++)
                           for (let k = -1; k < 2; k++)
                             if (E !== 0 && w !== 0 && k !== 0) {
-                              let L = E * b, $ = k * _;
-                              for (let z = 0; z <= this.depty[u][g]; z++) {
-                                let O = z * w, R = M + L, P = m + O, U = l + $;
+                              let $ = E * b, L = k * _;
+                              for (let z = 0; z <= this.depty[u][p]; z++) {
+                                let F = z * w, R = M + $, P = m + F, U = l + L;
                                 if (R < 0 || P < 0 || U < 0 || R >= this.pLength || P >= this.pWidth || U >= this.pHeight)
                                   continue;
-                                let N = R * p + P * this.pHeight + U;
+                                let N = R * g + P * this.pHeight + U;
                                 if (!(this.vpBits[N] & this.INOUT))
                                   this.vpBits[N] |= this.INOUT, this.vpAtomID[N] = A.serial;
                                 else {
                                   let B = x[this.vpAtomID[N]];
                                   if (B.serial != A.serial) {
-                                    let W = M + L - Math.floor(0.5 + this.scaleFactor * (B.x + this.ptranx)), V = m + O - Math.floor(0.5 + this.scaleFactor * (B.y + this.ptrany)), G = l + $ - Math.floor(0.5 + this.scaleFactor * (B.z + this.ptranz));
-                                    L * L + O * O + $ * $ < W * W + V * V + G * G && (this.vpAtomID[N] = A.serial);
+                                    let W = M + $ - Math.floor(0.5 + this.scaleFactor * (B.x + this.ptranx)), V = m + F - Math.floor(0.5 + this.scaleFactor * (B.y + this.ptrany)), G = l + L - Math.floor(0.5 + this.scaleFactor * (B.z + this.ptranz));
+                                    $ * $ + F * F + L * L < W * W + V * V + G * G && (this.vpAtomID[N] = A.serial);
                                   }
                                 }
                               }
                             }
                     }
-                    g++;
+                    p++;
                   }
               }
               fillvoxelswaals(A, x) {
@@ -27151,27 +27167,27 @@ ATOM`, b);
                 }
               }
               fillAtomWaals(A, x) {
-                let M = 0, m = Math.floor(0.5 + this.scaleFactor * (A.x + this.ptranx)), l = Math.floor(0.5 + this.scaleFactor * (A.y + this.ptrany)), u = Math.floor(0.5 + this.scaleFactor * (A.z + this.ptranz)), g = this.getVDWIndex(A), p = this.pWidth * this.pHeight;
-                for (let b = 0, c = this.widxz[g]; b < c; b++)
+                let M = 0, m = Math.floor(0.5 + this.scaleFactor * (A.x + this.ptranx)), l = Math.floor(0.5 + this.scaleFactor * (A.y + this.ptrany)), u = Math.floor(0.5 + this.scaleFactor * (A.z + this.ptranz)), p = this.getVDWIndex(A), g = this.pWidth * this.pHeight;
+                for (let b = 0, c = this.widxz[p]; b < c; b++)
                   for (let _ = 0; _ < c; _++) {
-                    if (this.depty[g][M] != -1) {
+                    if (this.depty[p][M] != -1) {
                       for (let E = -1; E < 2; E++)
                         for (let w = -1; w < 2; w++)
                           for (let k = -1; k < 2; k++)
                             if (E !== 0 && w !== 0 && k !== 0) {
-                              let L = E * b, $ = k * _;
-                              for (let z = 0; z <= this.depty[g][M]; z++) {
-                                let O = z * w, R = m + L, P = l + O, U = u + $;
+                              let $ = E * b, L = k * _;
+                              for (let z = 0; z <= this.depty[p][M]; z++) {
+                                let F = z * w, R = m + $, P = l + F, U = u + L;
                                 if (R < 0 || P < 0 || U < 0 || R >= this.pLength || P >= this.pWidth || U >= this.pHeight)
                                   continue;
-                                let N = R * p + P * this.pHeight + U;
+                                let N = R * g + P * this.pHeight + U;
                                 if (!(this.vpBits[N] & this.ISDONE))
                                   this.vpBits[N] |= this.ISDONE, this.vpAtomID[N] = A.serial;
                                 else {
                                   let B = x[this.vpAtomID[N]];
                                   if (B.serial != A.serial) {
-                                    let W = m + L - Math.floor(0.5 + this.scaleFactor * (B.x + this.ptranx)), V = l + O - Math.floor(0.5 + this.scaleFactor * (B.y + this.ptrany)), G = u + $ - Math.floor(0.5 + this.scaleFactor * (B.z + this.ptranz));
-                                    L * L + O * O + $ * $ < W * W + V * V + G * G && (this.vpAtomID[N] = A.serial);
+                                    let W = m + $ - Math.floor(0.5 + this.scaleFactor * (B.x + this.ptranx)), V = l + F - Math.floor(0.5 + this.scaleFactor * (B.y + this.ptrany)), G = u + L - Math.floor(0.5 + this.scaleFactor * (B.z + this.ptranz));
+                                    $ * $ + F * F + L * L < W * W + V * V + G * G && (this.vpAtomID[N] = A.serial);
                                   }
                                 }
                               }
@@ -27189,8 +27205,8 @@ ATOM`, b);
                       if (this.vpBits[l] & this.INOUT) {
                         let u = 0;
                         for (; u < 26; ) {
-                          let g = x + this.nb[u][0], p = M + this.nb[u][2], b = m + this.nb[u][1];
-                          if (g > -1 && g < this.pLength && b > -1 && b < this.pWidth && p > -1 && p < this.pHeight && !(this.vpBits[g * A + b * this.pHeight + p] & this.INOUT)) {
+                          let p = x + this.nb[u][0], g = M + this.nb[u][2], b = m + this.nb[u][1];
+                          if (p > -1 && p < this.pLength && b > -1 && b < this.pWidth && g > -1 && g < this.pHeight && !(this.vpBits[p * A + b * this.pHeight + g] & this.INOUT)) {
                             this.vpBits[l] |= this.ISBOUND;
                             break;
                           } else
@@ -27222,16 +27238,16 @@ ATOM`, b);
                     });
                 } while (m.length !== 0);
                 m = [], l = [], A = null;
-                let g = this.scaleFactor - 0.5;
-                g < 0 && (g = 0);
-                let p = M - 0.5 / (0.1 + g);
+                let p = this.scaleFactor - 0.5;
+                p < 0 && (p = 0);
+                let g = M - 0.5 / (0.1 + p);
                 for (let b = 0; b < this.pLength; b++)
                   for (let c = 0; c < this.pWidth; c++)
                     for (let _ = 0; _ < this.pHeight; _++)
-                      u = b * x + c * this.pHeight + _, this.vpBits[u] &= ~this.ISBOUND, this.vpBits[u] & this.INOUT && (!(this.vpBits[u] & this.ISDONE) || this.vpBits[u] & this.ISDONE && this.vpDistance[u] >= p) && (this.vpBits[u] |= this.ISBOUND);
+                      u = b * x + c * this.pHeight + _, this.vpBits[u] &= ~this.ISBOUND, this.vpBits[u] & this.INOUT && (!(this.vpBits[u] & this.ISDONE) || this.vpBits[u] & this.ISDONE && this.vpDistance[u] >= g) && (this.vpBits[u] |= this.ISBOUND);
               }
               fastoneshell(A, x) {
-                let M, m, l, u, g, p, b, c, _, E = [];
+                let M, m, l, u, p, g, b, c, _, E = [];
                 if (A.length === 0)
                   return E;
                 let w = {
@@ -27239,40 +27255,40 @@ ATOM`, b);
                   iy: -1,
                   iz: -1
                 }, k = this.pWidth * this.pHeight;
-                for (let L = 0, $ = A.length; L < $; L++) {
-                  M = A[L].ix, m = A[L].iy, l = A[L].iz, c = x.get(M, m, l);
+                for (let $ = 0, L = A.length; $ < L; $++) {
+                  M = A[$].ix, m = A[$].iy, l = A[$].iz, c = x.get(M, m, l);
                   for (let z = 0; z < 6; z++)
-                    w.ix = M + this.nb[z][0], w.iy = m + this.nb[z][1], w.iz = l + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (_ = w.ix * k + this.pHeight * w.iy + w.iz, this.vpBits[_] & this.INOUT && !(this.vpBits[_] & this.ISDONE) ? (x.set(w.ix, w.iy, l + this.nb[z][2], c), u = w.ix - c.ix, g = w.iy - c.iy, p = w.iz - c.iz, b = u * u + g * g + p * p, this.vpDistance[_] = b, this.vpBits[_] |= this.ISDONE, this.vpBits[_] |= this.ISBOUND, E.push({
+                    w.ix = M + this.nb[z][0], w.iy = m + this.nb[z][1], w.iz = l + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (_ = w.ix * k + this.pHeight * w.iy + w.iz, this.vpBits[_] & this.INOUT && !(this.vpBits[_] & this.ISDONE) ? (x.set(w.ix, w.iy, l + this.nb[z][2], c), u = w.ix - c.ix, p = w.iy - c.iy, g = w.iz - c.iz, b = u * u + p * p + g * g, this.vpDistance[_] = b, this.vpBits[_] |= this.ISDONE, this.vpBits[_] |= this.ISBOUND, E.push({
                       ix: w.ix,
                       iy: w.iy,
                       iz: w.iz
-                    })) : this.vpBits[_] & this.INOUT && this.vpBits[_] & this.ISDONE && (u = w.ix - c.ix, g = w.iy - c.iy, p = w.iz - c.iz, b = u * u + g * g + p * p, b < this.vpDistance[_] && (x.set(w.ix, w.iy, w.iz, c), this.vpDistance[_] = b, this.vpBits[_] & this.ISBOUND || (this.vpBits[_] |= this.ISBOUND, E.push({
+                    })) : this.vpBits[_] & this.INOUT && this.vpBits[_] & this.ISDONE && (u = w.ix - c.ix, p = w.iy - c.iy, g = w.iz - c.iz, b = u * u + p * p + g * g, b < this.vpDistance[_] && (x.set(w.ix, w.iy, w.iz, c), this.vpDistance[_] = b, this.vpBits[_] & this.ISBOUND || (this.vpBits[_] |= this.ISBOUND, E.push({
                       ix: w.ix,
                       iy: w.iy,
                       iz: w.iz
                     })))));
                 }
-                for (let L = 0, $ = A.length; L < $; L++) {
-                  M = A[L].ix, m = A[L].iy, l = A[L].iz, c = x.get(M, m, l);
+                for (let $ = 0, L = A.length; $ < L; $++) {
+                  M = A[$].ix, m = A[$].iy, l = A[$].iz, c = x.get(M, m, l);
                   for (let z = 6; z < 18; z++)
-                    w.ix = M + this.nb[z][0], w.iy = m + this.nb[z][1], w.iz = l + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (_ = w.ix * k + this.pHeight * w.iy + w.iz, this.vpBits[_] & this.INOUT && !(this.vpBits[_] & this.ISDONE) ? (x.set(w.ix, w.iy, l + this.nb[z][2], c), u = w.ix - c.ix, g = w.iy - c.iy, p = w.iz - c.iz, b = u * u + g * g + p * p, this.vpDistance[_] = b, this.vpBits[_] |= this.ISDONE, this.vpBits[_] |= this.ISBOUND, E.push({
+                    w.ix = M + this.nb[z][0], w.iy = m + this.nb[z][1], w.iz = l + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (_ = w.ix * k + this.pHeight * w.iy + w.iz, this.vpBits[_] & this.INOUT && !(this.vpBits[_] & this.ISDONE) ? (x.set(w.ix, w.iy, l + this.nb[z][2], c), u = w.ix - c.ix, p = w.iy - c.iy, g = w.iz - c.iz, b = u * u + p * p + g * g, this.vpDistance[_] = b, this.vpBits[_] |= this.ISDONE, this.vpBits[_] |= this.ISBOUND, E.push({
                       ix: w.ix,
                       iy: w.iy,
                       iz: w.iz
-                    })) : this.vpBits[_] & this.INOUT && this.vpBits[_] & this.ISDONE && (u = w.ix - c.ix, g = w.iy - c.iy, p = w.iz - c.iz, b = u * u + g * g + p * p, b < this.vpDistance[_] && (x.set(w.ix, w.iy, w.iz, c), this.vpDistance[_] = b, this.vpBits[_] & this.ISBOUND || (this.vpBits[_] |= this.ISBOUND, E.push({
+                    })) : this.vpBits[_] & this.INOUT && this.vpBits[_] & this.ISDONE && (u = w.ix - c.ix, p = w.iy - c.iy, g = w.iz - c.iz, b = u * u + p * p + g * g, b < this.vpDistance[_] && (x.set(w.ix, w.iy, w.iz, c), this.vpDistance[_] = b, this.vpBits[_] & this.ISBOUND || (this.vpBits[_] |= this.ISBOUND, E.push({
                       ix: w.ix,
                       iy: w.iy,
                       iz: w.iz
                     })))));
                 }
-                for (let L = 0, $ = A.length; L < $; L++) {
-                  M = A[L].ix, m = A[L].iy, l = A[L].iz, c = x.get(M, m, l);
+                for (let $ = 0, L = A.length; $ < L; $++) {
+                  M = A[$].ix, m = A[$].iy, l = A[$].iz, c = x.get(M, m, l);
                   for (let z = 18; z < 26; z++)
-                    w.ix = M + this.nb[z][0], w.iy = m + this.nb[z][1], w.iz = l + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (_ = w.ix * k + this.pHeight * w.iy + w.iz, this.vpBits[_] & this.INOUT && !(this.vpBits[_] & this.ISDONE) ? (x.set(w.ix, w.iy, l + this.nb[z][2], c), u = w.ix - c.ix, g = w.iy - c.iy, p = w.iz - c.iz, b = u * u + g * g + p * p, this.vpDistance[_] = b, this.vpBits[_] |= this.ISDONE, this.vpBits[_] |= this.ISBOUND, E.push({
+                    w.ix = M + this.nb[z][0], w.iy = m + this.nb[z][1], w.iz = l + this.nb[z][2], w.ix < this.pLength && w.ix > -1 && w.iy < this.pWidth && w.iy > -1 && w.iz < this.pHeight && w.iz > -1 && (_ = w.ix * k + this.pHeight * w.iy + w.iz, this.vpBits[_] & this.INOUT && !(this.vpBits[_] & this.ISDONE) ? (x.set(w.ix, w.iy, l + this.nb[z][2], c), u = w.ix - c.ix, p = w.iy - c.iy, g = w.iz - c.iz, b = u * u + p * p + g * g, this.vpDistance[_] = b, this.vpBits[_] |= this.ISDONE, this.vpBits[_] |= this.ISBOUND, E.push({
                       ix: w.ix,
                       iy: w.iy,
                       iz: w.iz
-                    })) : this.vpBits[_] & this.INOUT && this.vpBits[_] & this.ISDONE && (u = w.ix - c.ix, g = w.iy - c.iy, p = w.iz - c.iz, b = u * u + g * g + p * p, b < this.vpDistance[_] && (x.set(w.ix, w.iy, w.iz, c), this.vpDistance[_] = b, this.vpBits[_] & this.ISBOUND || (this.vpBits[_] |= this.ISBOUND, E.push({
+                    })) : this.vpBits[_] & this.INOUT && this.vpBits[_] & this.ISDONE && (u = w.ix - c.ix, p = w.iy - c.iy, g = w.iz - c.iz, b = u * u + p * p + g * g, b < this.vpDistance[_] && (x.set(w.ix, w.iy, w.iz, c), this.vpDistance[_] = b, this.vpBits[_] & this.ISBOUND || (this.vpBits[_] |= this.ISBOUND, E.push({
                       ix: w.ix,
                       iy: w.iy,
                       iz: w.iz
@@ -27346,64 +27362,64 @@ ATOM`, b);
                   y: 0,
                   z: 0
                 }, this.data = new Float32Array([]), this.matrix = null, this.inversematrix = null, this.isbinary = /* @__PURE__ */ new Set(["ccp4", "CCP4"]), this.getCoordinates = function(u) {
-                  var g = u / (this.size.y * this.size.z), p = u % (this.size.y * this.size.z), b = u % this.size.z;
-                  return g *= this.unit.x, p *= this.unit.y, b *= this.unit.z, g += this.origin.x, p += this.origin.y, b += this.origin.z, { x: g, y: p, z: b };
+                  var p = u / (this.size.y * this.size.z), g = u % (this.size.y * this.size.z), b = u % this.size.z;
+                  return p *= this.unit.x, g *= this.unit.y, b *= this.unit.z, p += this.origin.x, g += this.origin.y, b += this.origin.z, { x: p, y: g, z: b };
                 }, this.vasp = function(u) {
-                  var g = u.replace(/^\s+/, "").split(/[\n\r]/), p = (0, s.VASP)(u)[0], b = p.length;
+                  var p = u.replace(/^\s+/, "").split(/[\n\r]/), g = (0, s.VASP)(u)[0], b = g.length;
                   if (b == 0) {
                     console.warn("No good formating of CHG or CHGCAR file, not atomic information provided in the file."), this.data = [];
                     return;
                   }
-                  var c = 1.889725992, _ = 0.036749309, E = parseFloat(g[1]), w;
-                  w = g[2].replace(/^\s+/, "").split(/\s+/);
+                  var c = 1.889725992, _ = 0.036749309, E = parseFloat(p[1]), w;
+                  w = p[2].replace(/^\s+/, "").split(/\s+/);
                   var k = new a.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(E * c);
-                  w = g[3].replace(/^\s+/, "").split(/\s+/);
-                  var L = new a.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(E * c);
-                  w = g[4].replace(/^\s+/, "").split(/\s+/);
-                  var $ = new a.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(E * c), z = k.x * (L.y * $.z - $.y * L.z) - L.x * (k.y * $.z - $.y * k.z) + $.x * (k.y * L.z - L.y * k.z);
+                  w = p[3].replace(/^\s+/, "").split(/\s+/);
+                  var $ = new a.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(E * c);
+                  w = p[4].replace(/^\s+/, "").split(/\s+/);
+                  var L = new a.Vector3(parseFloat(w[0]), parseFloat(w[1]), parseFloat(w[2])).multiplyScalar(E * c), z = k.x * ($.y * L.z - L.y * $.z) - $.x * (k.y * L.z - L.y * k.z) + L.x * (k.y * $.z - $.y * k.z);
                   z = Math.abs(z) / Math.pow(c, 3);
-                  var O = 1 / z;
-                  g.splice(0, 8 + b + 1);
-                  var R = g[0].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), P = Math.abs(parseFloat(R[0])), U = Math.abs(parseFloat(R[1])), N = Math.abs(parseFloat(R[2])), B = this.origin = new a.Vector3(0, 0, 0);
-                  this.size = { x: P, y: U, z: N }, this.unit = new a.Vector3(k.x, L.y, $.z), k = k.multiplyScalar(1 / (c * P)), L = L.multiplyScalar(1 / (c * U)), $ = $.multiplyScalar(1 / (c * N)), (k.y != 0 || k.z != 0 || L.x != 0 || L.z != 0 || $.x != 0 || $.y != 0) && (this.matrix = new a.Matrix4(k.x, L.x, $.x, 0, k.y, L.y, $.y, 0, k.z, L.z, $.z, 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new a.Matrix4().makeTranslation(B.x, B.y, B.z)), this.origin = new a.Vector3(0, 0, 0), this.unit = new a.Vector3(1, 1, 1)), g.splice(0, 1);
-                  var W = g.join(" ");
+                  var F = 1 / z;
+                  p.splice(0, 8 + b + 1);
+                  var R = p[0].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), P = Math.abs(parseFloat(R[0])), U = Math.abs(parseFloat(R[1])), N = Math.abs(parseFloat(R[2])), B = this.origin = new a.Vector3(0, 0, 0);
+                  this.size = { x: P, y: U, z: N }, this.unit = new a.Vector3(k.x, $.y, L.z), k = k.multiplyScalar(1 / (c * P)), $ = $.multiplyScalar(1 / (c * U)), L = L.multiplyScalar(1 / (c * N)), (k.y != 0 || k.z != 0 || $.x != 0 || $.z != 0 || L.x != 0 || L.y != 0) && (this.matrix = new a.Matrix4(k.x, $.x, L.x, 0, k.y, $.y, L.y, 0, k.z, $.z, L.z, 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new a.Matrix4().makeTranslation(B.x, B.y, B.z)), this.origin = new a.Vector3(0, 0, 0), this.unit = new a.Vector3(1, 1, 1)), p.splice(0, 1);
+                  var W = p.join(" ");
                   W = W.replace(/^\s+/, "");
                   var V = W.split(/[\s\r]+/);
                   V.splice(P * U * N + 1);
                   for (var G = Float32Array.from(V, parseFloat), H = 0; H < G.length; H++)
-                    G[H] = G[H] * O * _;
+                    G[H] = G[H] * F * _;
                   this.data = G;
                 }, this.dx = function(u) {
-                  var g = u.split(/[\n\r]+/), p, b = /gridpositions\s+counts\s+(\d+)\s+(\d+)\s+(\d+)/, c = /^origin\s+(\S+)\s+(\S+)\s+(\S+)/, _ = /^delta\s+(\S+)\s+(\S+)\s+(\S+)/, E = /data follows/, w = 0;
-                  for (w = 0; w < g.length; w++) {
-                    var k = g[w];
-                    if (p = b.exec(k)) {
-                      var L = parseInt(p[1]), $ = parseInt(p[2]), z = parseInt(p[3]);
-                      this.size = { x: L, y: $, z };
-                    } else if (p = _.exec(k)) {
-                      var O = parseFloat(p[1]);
-                      if ((parseFloat(p[2]) != 0 || parseFloat(p[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), w += 1, k = g[w], p = _.exec(k), p == null) {
+                  var p = u.split(/[\n\r]+/), g, b = /gridpositions\s+counts\s+(\d+)\s+(\d+)\s+(\d+)/, c = /^origin\s+(\S+)\s+(\S+)\s+(\S+)/, _ = /^delta\s+(\S+)\s+(\S+)\s+(\S+)/, E = /data follows/, w = 0;
+                  for (w = 0; w < p.length; w++) {
+                    var k = p[w];
+                    if (g = b.exec(k)) {
+                      var $ = parseInt(g[1]), L = parseInt(g[2]), z = parseInt(g[3]);
+                      this.size = { x: $, y: L, z };
+                    } else if (g = _.exec(k)) {
+                      var F = parseFloat(g[1]);
+                      if ((parseFloat(g[2]) != 0 || parseFloat(g[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), w += 1, k = p[w], g = _.exec(k), g == null) {
                         console.error("Parse error in dx delta matrix");
                         return;
                       }
-                      var R = parseFloat(p[2]);
-                      if ((parseFloat(p[1]) != 0 || parseFloat(p[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), w += 1, k = g[w], p = _.exec(k), p == null) {
+                      var R = parseFloat(g[2]);
+                      if ((parseFloat(g[1]) != 0 || parseFloat(g[3]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), w += 1, k = p[w], g = _.exec(k), g == null) {
                         console.error("Parse error in dx delta matrix");
                         return;
                       }
-                      var P = parseFloat(p[3]);
-                      (parseFloat(p[1]) != 0 || parseFloat(p[2]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), this.unit = new a.Vector3(O, R, P);
-                    } else if (p = c.exec(k)) {
-                      var U = parseFloat(p[1]), N = parseFloat(p[2]), B = parseFloat(p[3]);
+                      var P = parseFloat(g[3]);
+                      (parseFloat(g[1]) != 0 || parseFloat(g[2]) != 0) && console.warn("Non-orthogonal delta matrix not currently supported in dx format"), this.unit = new a.Vector3(F, R, P);
+                    } else if (g = c.exec(k)) {
+                      var U = parseFloat(g[1]), N = parseFloat(g[2]), B = parseFloat(g[3]);
                       this.origin = new a.Vector3(U, N, B);
-                    } else if (p = E.exec(k))
+                    } else if (g = E.exec(k))
                       break;
                   }
                   if (w += 1, !this.size || !this.origin || !this.unit || !this.size) {
                     console.error("Error parsing dx format");
                     return;
                   }
-                  var W = g.splice(w).join(" "), V = W.split(/[\s\r]+/);
+                  var W = p.splice(w).join(" "), V = W.split(/[\s\r]+/);
                   this.data = Float32Array.from(V, parseFloat);
                 }, y = y.toLowerCase(), /\.gz$/.test(y)) {
                   y = y.replace(/\.gz$/, "");
@@ -27415,20 +27431,20 @@ ATOM`, b);
                 }
                 if (this[y] && (this.isbinary.has(y) && typeof f == "string" && (f = (0, r.base64ToArray)(f)), this[y](f)), A) {
                   if (A.negate)
-                    for (let u = 0, g = this.data.length; u < g; u++)
+                    for (let u = 0, p = this.data.length; u < p; u++)
                       this.data[u] = -this.data[u];
                   if (A.normalize) {
                     var x = 0;
-                    for (let u = 0, g = this.data.length; u < g; u++)
+                    for (let u = 0, p = this.data.length; u < p; u++)
                       x += this.data[u];
                     var M = x / this.data.length;
                     x = 0;
-                    for (let u = 0, g = this.data.length; u < g; u++) {
+                    for (let u = 0, p = this.data.length; u < p; u++) {
                       var m = this.data[u] - M;
                       x += m * m;
                     }
                     var l = x / this.data.length;
-                    for (let u = 0, g = this.data.length; u < g; u++)
+                    for (let u = 0, p = this.data.length; u < p; u++)
                       this.data[u] = (this.data[u] - M) / l;
                   }
                 }
@@ -27466,8 +27482,8 @@ ATOM`, b);
                   M < 0 && l++;
                   var u = y.splice(m + l).join(" ");
                   u = u.replace(/^\s+/, "");
-                  var g = u.split(/[\s\r]+/);
-                  this.data = Float32Array.from(g, parseFloat);
+                  var p = u.split(/[\s\r]+/);
+                  this.data = Float32Array.from(p, parseFloat);
                 }
               }
               //parse cp4 files
@@ -27479,11 +27495,11 @@ ATOM`, b);
                   for (var m = f.byteLength, l = 0; l < m; l += 4)
                     M.setFloat32(l, M.getFloat32(l), !0);
                 y.NX = A[0], y.NY = A[1], y.NZ = A[2], y.MODE = A[3], y.NXSTART = A[4], y.NYSTART = A[5], y.NZSTART = A[6], y.MX = A[7], y.MY = A[8], y.MZ = A[9], y.xlen = x[10], y.ylen = x[11], y.zlen = x[12], y.alpha = x[13], y.beta = x[14], y.gamma = x[15], y.MAPC = A[16], y.MAPR = A[17], y.MAPS = A[18], y.DMIN = x[19], y.DMAX = x[20], y.DMEAN = x[21], y.ISPG = A[22], y.NSYMBT = A[23], y.LSKFLG = A[24], y.originX = x[49], y.originY = x[50], y.originZ = x[51], y.ARMS = x[54];
-                var u = y, g = [
+                var u = y, p = [
                   u.xlen,
                   0,
                   0
-                ], p = [
+                ], g = [
                   u.ylen * Math.cos(Math.PI / 180 * u.gamma),
                   u.ylen * Math.sin(Math.PI / 180 * u.gamma),
                   0
@@ -27493,14 +27509,14 @@ ATOM`, b);
                   0
                 ];
                 b[2] = Math.sqrt(u.zlen * u.zlen * Math.sin(Math.PI / 180 * u.beta) * Math.sin(Math.PI / 180 * u.beta) - b[1] * b[1]);
-                var c = [0, g, p, b], _ = [0, u.MX, u.MY, u.MZ], E = [0, u.MAPC, u.MAPR, u.MAPS];
+                var c = [0, p, g, b], _ = [0, u.MX, u.MY, u.MZ], E = [0, u.MAPC, u.MAPR, u.MAPS];
                 this.matrix = new a.Matrix4(), this.matrix.set(c[E[1]][0] / _[E[1]], c[E[2]][0] / _[E[2]], c[E[3]][0] / _[E[3]], 0, c[E[1]][1] / _[E[1]], c[E[2]][1] / _[E[2]], c[E[3]][1] / _[E[3]], 0, c[E[1]][2] / _[E[1]], c[E[2]][2] / _[E[2]], c[E[3]][2] / _[E[3]], 0, 0, 0, 0, 1), this.matrix = this.matrix.multiplyMatrices(this.matrix, new a.Matrix4().makeTranslation(u.NXSTART + u.originX, u.NYSTART + u.originY, u.NZSTART + u.originZ)), this.origin = new a.Vector3(0, 0, 0), this.unit = new a.Vector3(1, 1, 1), this.size = { x: y.NX, y: y.NY, z: y.NZ }, this.dimensionorder = [y.MAPC, y.MAPR, y.MAPS];
-                var w = new Float32Array(f.buffer, 1024 + y.NSYMBT), k = y.NX, L = y.NY, $ = y.NZ;
-                this.data = new Float32Array(k * L * $);
+                var w = new Float32Array(f.buffer, 1024 + y.NSYMBT), k = y.NX, $ = y.NY, L = y.NZ;
+                this.data = new Float32Array(k * $ * L);
                 for (let z = 0; z < k; z++)
-                  for (let O = 0; O < L; O++)
-                    for (let R = 0; R < $; R++)
-                      this.data[(z * L + O) * $ + R] = w[(R * L + O) * k + z];
+                  for (let F = 0; F < $; F++)
+                    for (let R = 0; R < L; R++)
+                      this.data[(z * $ + F) * L + R] = w[(R * $ + F) * k + z];
               }
             }
           }
@@ -27544,8 +27560,8 @@ ATOM`, b);
                 var x = [], M = (f.length - 1) / (y - 1);
                 x[0] = f[0];
                 for (var m = 1; m < y - 1; m++) {
-                  var l = m * M, u = Math.floor(l), g = Math.ceil(l), p = l - u;
-                  x[m] = A(f[u], f[g], p);
+                  var l = m * M, u = Math.floor(l), p = Math.ceil(l), g = l - u;
+                  x[m] = A(f[u], f[p], g);
                 }
                 return x[y - 1] = f[f.length - 1], x;
               }
@@ -27554,32 +27570,32 @@ ATOM`, b);
                 var x = Object.assign([], y.transferfn);
                 this.subsamples = y.subsamples || 5;
                 let M = 256;
-                x.forEach(function(L) {
-                  L.value = parseFloat(L.value);
-                }), x.sort(function(L, $) {
-                  return L.value - $.value;
+                x.forEach(function($) {
+                  $.value = parseFloat($.value);
+                }), x.sort(function($, L) {
+                  return $.value - L.value;
                 }), this.min = x[0].value, x.length == 0 && x.push(x[0]), this.max = x[x.length - 1].value;
-                var m, l, u, g, p, b, c, _, E, w;
-                for (let L = 0; L < x.length - 1; L++)
-                  if (u = h.CC.color(x[L].color), g = h.CC.color(x[L + 1].color), E = x[L].opacity, w = x[L + 1].opacity, m = Math.floor((x[L].value - this.min) * M / (this.max - this.min)), l = Math.floor((x[L + 1].value - this.min) * M / (this.max - this.min)), m != l) {
-                    p = d.interpolateArray([u.r * 255, g.r * 255], l - m), b = d.interpolateArray([u.g * 255, g.g * 255], l - m), c = d.interpolateArray([u.b * 255, g.b * 255], l - m), _ = d.interpolateArray([E * 255, w * 255], l - m);
-                    for (let $ = 0; $ < p.length; $++)
-                      this.transferfunctionbuffer.push(p[$]), this.transferfunctionbuffer.push(b[$]), this.transferfunctionbuffer.push(c[$]), this.transferfunctionbuffer.push(_[$]);
+                var m, l, u, p, g, b, c, _, E, w;
+                for (let $ = 0; $ < x.length - 1; $++)
+                  if (u = h.CC.color(x[$].color), p = h.CC.color(x[$ + 1].color), E = x[$].opacity, w = x[$ + 1].opacity, m = Math.floor((x[$].value - this.min) * M / (this.max - this.min)), l = Math.floor((x[$ + 1].value - this.min) * M / (this.max - this.min)), m != l) {
+                    g = d.interpolateArray([u.r * 255, p.r * 255], l - m), b = d.interpolateArray([u.g * 255, p.g * 255], l - m), c = d.interpolateArray([u.b * 255, p.b * 255], l - m), _ = d.interpolateArray([E * 255, w * 255], l - m);
+                    for (let L = 0; L < g.length; L++)
+                      this.transferfunctionbuffer.push(g[L]), this.transferfunctionbuffer.push(b[L]), this.transferfunctionbuffer.push(c[L]), this.transferfunctionbuffer.push(_[L]);
                   }
                 if (this.transferfunctionbuffer = new Uint8ClampedArray(this.transferfunctionbuffer), f.matrix) {
-                  let L = new a.Vector3(0, 0, 0), $ = new a.Vector3(f.size.x, f.size.y, f.size.z), z = new a.Vector3(1, 1, 1);
-                  L.applyMatrix4(f.matrix), $.applyMatrix4(f.matrix), z.applyMatrix4(f.matrix).sub(L), this.extent = [[L.x, L.y, L.z], [$.x, $.y, $.z]];
+                  let $ = new a.Vector3(0, 0, 0), L = new a.Vector3(f.size.x, f.size.y, f.size.z), z = new a.Vector3(1, 1, 1);
+                  $.applyMatrix4(f.matrix), L.applyMatrix4(f.matrix), z.applyMatrix4(f.matrix).sub($), this.extent = [[$.x, $.y, $.z], [L.x, L.y, L.z]];
                   for (let U = 1; U < 7; U++)
-                    $.x = U & 1 ? f.size.x : 0, $.y = U & 2 ? f.size.y : 0, $.z = U & 4 ? f.size.z : 0, $.applyMatrix4(f.matrix), this.extent[0][0] = Math.min(this.extent[0][0], $.x), this.extent[0][1] = Math.min(this.extent[0][1], $.y), this.extent[0][2] = Math.min(this.extent[0][2], $.z), this.extent[1][0] = Math.max(this.extent[1][0], $.x), this.extent[1][1] = Math.max(this.extent[1][1], $.y), this.extent[1][2] = Math.max(this.extent[1][2], $.z);
-                  let O = $.x - L.x, R = $.y - L.y, P = $.z - L.z;
-                  this.maxdepth = Math.sqrt(O * O + R * R + P * P), this.minunit = Math.min(Math.min(z.x, z.y), z.z), this.texmatrix = new a.Matrix4().identity().scale({ x: f.size.x, y: f.size.y, z: f.size.z }), this.texmatrix = this.texmatrix.multiplyMatrices(f.matrix, this.texmatrix), this.texmatrix = this.texmatrix.getInverse(this.texmatrix);
+                    L.x = U & 1 ? f.size.x : 0, L.y = U & 2 ? f.size.y : 0, L.z = U & 4 ? f.size.z : 0, L.applyMatrix4(f.matrix), this.extent[0][0] = Math.min(this.extent[0][0], L.x), this.extent[0][1] = Math.min(this.extent[0][1], L.y), this.extent[0][2] = Math.min(this.extent[0][2], L.z), this.extent[1][0] = Math.max(this.extent[1][0], L.x), this.extent[1][1] = Math.max(this.extent[1][1], L.y), this.extent[1][2] = Math.max(this.extent[1][2], L.z);
+                  let F = L.x - $.x, R = L.y - $.y, P = L.z - $.z;
+                  this.maxdepth = Math.sqrt(F * F + R * R + P * P), this.minunit = Math.min(Math.min(z.x, z.y), z.z), this.texmatrix = new a.Matrix4().identity().scale({ x: f.size.x, y: f.size.y, z: f.size.z }), this.texmatrix = this.texmatrix.multiplyMatrices(f.matrix, this.texmatrix), this.texmatrix = this.texmatrix.getInverse(this.texmatrix);
                 } else {
                   this.texmatrix = new a.Matrix4().identity();
-                  let L = f.unit.x * f.size.x, $ = f.unit.y * f.size.y, z = f.unit.z * f.size.z;
-                  this.texmatrix.makeTranslation(-f.origin.x / L, -f.origin.y / $, -f.origin.z / z), this.texmatrix.scale({ x: 1 / L, y: 1 / $, z: 1 / z }), this.minunit = Math.min(Math.min(f.unit.x, f.unit.y), f.unit.z), this.extent = [
+                  let $ = f.unit.x * f.size.x, L = f.unit.y * f.size.y, z = f.unit.z * f.size.z;
+                  this.texmatrix.makeTranslation(-f.origin.x / $, -f.origin.y / L, -f.origin.z / z), this.texmatrix.scale({ x: 1 / $, y: 1 / L, z: 1 / z }), this.minunit = Math.min(Math.min(f.unit.x, f.unit.y), f.unit.z), this.extent = [
                     [f.origin.x, f.origin.y, f.origin.z],
-                    [f.origin.x + L, f.origin.y + $, f.origin.z + z]
-                  ], this.maxdepth = Math.sqrt(L * L + $ * $ + z * z);
+                    [f.origin.x + $, f.origin.y + L, f.origin.z + z]
+                  ], this.maxdepth = Math.sqrt($ * $ + L * L + z * z);
                 }
                 var k = new o.GLShape({});
                 if (k.addBox({
@@ -27590,19 +27606,19 @@ ATOM`, b);
                     d: this.extent[1][2] - this.extent[0][2]
                   }
                 }), this.geo = k.finalize(), this.boundingSphere.center = new a.Vector3((this.extent[0][0] + this.extent[1][0]) / 2, (this.extent[0][1] + this.extent[1][1]) / 2, (this.extent[0][2] + this.extent[1][2]) / 2), this.boundingSphere.radius = this.maxdepth / 2, y.coords === void 0 && y.selection !== void 0 && (A ? y.coords = A.selectedAtoms(y.selection) : console.log("Need to provide viewer to volumetric renderer if selection specified.")), y.coords !== void 0 && y.seldist !== void 0) {
-                  let L = new Uint8Array(f.data.length), $ = y.seldist, z = $ * $;
-                  for (let O = 0, R = y.coords.length; O < R; O++) {
-                    let P = y.coords[O], U = P.x - $, N = P.y - $, B = P.z - $, W = P.x + $, V = P.y + $, G = P.z + $;
+                  let $ = new Uint8Array(f.data.length), L = y.seldist, z = L * L;
+                  for (let F = 0, R = y.coords.length; F < R; F++) {
+                    let P = y.coords[F], U = P.x - L, N = P.y - L, B = P.z - L, W = P.x + L, V = P.y + L, G = P.z + L;
                     if (f.getIndex(U, N, B) >= 0 || f.getIndex(W, V, G) >= 0)
                       for (let H = U; H < W; H += this.minunit)
                         for (let Q = N; Q < V; Q += this.minunit)
                           for (let te = B; te < G; te += this.minunit) {
                             let ee = f.getIndex(H, Q, te);
-                            ee >= 0 && !L[ee] && (H - P.x) * (H - P.x) + (Q - P.y) * (Q - P.y) + (te - P.z) * (te - P.z) < z && (L[ee] = 1);
+                            ee >= 0 && !$[ee] && (H - P.x) * (H - P.x) + (Q - P.y) * (Q - P.y) + (te - P.z) * (te - P.z) < z && ($[ee] = 1);
                           }
                   }
-                  for (let O = 0, R = f.data.length; O < R; O++)
-                    L[O] == 0 && (f.data[O] = 1 / 0);
+                  for (let F = 0, R = f.data.length; F < R; F++)
+                    $[F] == 0 && (f.data[F] = 1 / 0);
                 }
                 this.data = f;
               }
@@ -27827,8 +27843,8 @@ ATOM`, b);
               getPrecision() {
                 return this._precision;
               }
-              setClearColorHex(u, g) {
-                this._clearColor.setHex(u), this._clearAlpha = g, this.isLost() || this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha);
+              setClearColorHex(u, p) {
+                this._clearColor.setHex(u), this._clearAlpha = p, this.isLost() || this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha);
               }
               enableOutline(u) {
                 this._outlineMaterial = new d.MeshOutlineMaterial(u), this._outlineSphereImposterMaterial = new d.SphereImposterOutlineMaterial(u), this._outlineStickImposterMaterial = new d.StickImposterOutlineMaterial(u), this._outlineEnabled = !0;
@@ -27844,25 +27860,25 @@ ATOM`, b);
               }
               setViewport() {
                 if (this._offscreen && (this._offscreen.width = this._canvas.width, this._offscreen.height = this._canvas.height), this.rows != null && this.cols != null && this.row != null && this.col != null) {
-                  var u = this._canvas.width / this.cols, g = this._canvas.height / this.rows;
-                  this._viewportWidth = u, this._viewportHeight = g, this.isLost() || (this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(u * this.col, g * this.row, u, g), this._gl.viewport(u * this.col, g * this.row, u, g));
+                  var u = this._canvas.width / this.cols, p = this._canvas.height / this.rows;
+                  this._viewportWidth = u, this._viewportHeight = p, this.isLost() || (this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(u * this.col, p * this.row, u, p), this._gl.viewport(u * this.col, p * this.row, u, p));
                 }
               }
-              setSize(u, g) {
+              setSize(u, p) {
                 if (this.devicePixelRatio = window.devicePixelRatio !== void 0 ? window.devicePixelRatio : 1, this._antialias && this.devicePixelRatio < 2 && (this.devicePixelRatio *= 2), this.rows != null && this.cols != null && this.row != null && this.col != null) {
-                  var p = u / this.cols, b = g / this.rows;
-                  this._canvas.width = u * this.devicePixelRatio, this._canvas.height = g * this.devicePixelRatio, this._viewportWidth = p * this.devicePixelRatio, this._viewportHeight = b * this.devicePixelRatio, this._canvas.style.width = u + "px", this._canvas.style.height = g + "px", this.setViewport();
+                  var g = u / this.cols, b = p / this.rows;
+                  this._canvas.width = u * this.devicePixelRatio, this._canvas.height = p * this.devicePixelRatio, this._viewportWidth = g * this.devicePixelRatio, this._viewportHeight = b * this.devicePixelRatio, this._canvas.style.width = u + "px", this._canvas.style.height = p + "px", this.setViewport();
                 } else
-                  this._viewportWidth = this._canvas.width = u * this.devicePixelRatio, this._viewportHeight = this._canvas.height = g * this.devicePixelRatio, this._canvas.style.width = u + "px", this._canvas.style.height = g + "px", this.isLost() || this._gl.viewport(0, 0, this._gl.drawingBufferWidth, this._gl.drawingBufferHeight);
+                  this._viewportWidth = this._canvas.width = u * this.devicePixelRatio, this._viewportHeight = this._canvas.height = p * this.devicePixelRatio, this._canvas.style.width = u + "px", this._canvas.style.height = p + "px", this.isLost() || this._gl.viewport(0, 0, this._gl.drawingBufferWidth, this._gl.drawingBufferHeight);
                 this.initFrameBuffer();
               }
-              clear(u, g, p) {
+              clear(u, p, g) {
                 var b = 0;
-                (u === void 0 || u) && (b |= this._gl.COLOR_BUFFER_BIT), (g === void 0 || g) && (b |= this._gl.DEPTH_BUFFER_BIT), (p === void 0 || p) && (b |= this._gl.STENCIL_BUFFER_BIT), this._gl.clear(b);
+                (u === void 0 || u) && (b |= this._gl.COLOR_BUFFER_BIT), (p === void 0 || p) && (b |= this._gl.DEPTH_BUFFER_BIT), (g === void 0 || g) && (b |= this._gl.STENCIL_BUFFER_BIT), this._gl.clear(b);
               }
-              setMaterialFaces(u, g) {
-                var p = u.side === a.DoubleSide, b = u.side === a.BackSide;
-                u.imposter || (b = g ? !b : b), this._oldDoubleSided !== p && (p ? this._gl.disable(this._gl.CULL_FACE) : this._gl.enable(this._gl.CULL_FACE), this._oldDoubleSided = p), this._oldFlipSided !== b && (b ? this._gl.frontFace(this._gl.CW) : this._gl.frontFace(this._gl.CCW), this._oldFlipSided = b), this._gl.cullFace(this._gl.BACK);
+              setMaterialFaces(u, p) {
+                var g = u.side === a.DoubleSide, b = u.side === a.BackSide;
+                u.imposter || (b = p ? !b : b), this._oldDoubleSided !== g && (g ? this._gl.disable(this._gl.CULL_FACE) : this._gl.enable(this._gl.CULL_FACE), this._oldDoubleSided = g), this._oldFlipSided !== b && (b ? this._gl.frontFace(this._gl.CW) : this._gl.frontFace(this._gl.CCW), this._oldFlipSided = b), this._gl.cullFace(this._gl.BACK);
               }
               setDepthTest(u) {
                 this._oldDepthTest !== u && (u ? this._gl.enable(this._gl.DEPTH_TEST) : this._gl.disable(this._gl.DEPTH_TEST), this._oldDepthTest = u);
@@ -27877,7 +27893,7 @@ ATOM`, b);
               // material object after attaching prgm
               // We need to attach appropriate uniform variables to material after shaders
               // have been chosen
-              initMaterial(u, g, p, b) {
+              initMaterial(u, p, g, b) {
                 u.addEventListener("dispose", this.onMaterialDispose.bind(this));
                 var c, _;
                 if (_ = u.shaderID, _) {
@@ -27891,21 +27907,21 @@ ATOM`, b);
                   shaded: u.shaded
                 }, u.program = this.buildProgram(u.fragmentShader, u.vertexShader, u.uniforms, c);
               }
-              renderBuffer(u, g, p, b, c, _) {
+              renderBuffer(u, p, g, b, c, _) {
                 if (b.visible) {
                   var E, w;
-                  if (E = this.setProgram(u, g, p, b, _, this), !!E) {
+                  if (E = this.setProgram(u, p, g, b, _, this), !!E) {
                     w = E.attributes;
-                    var k = !1, L = b.wireframe ? 1 : 0, $ = c.id * 16777215 + E.id * 2 + L;
-                    $ !== this._currentGeometryGroupHash && (this._currentGeometryGroupHash = $, k = !0), k && (this.disableAttributes(), w.position >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglVertexBuffer), this.enableAttribute(w.position), this._gl.vertexAttribPointer(w.position, 3, this._gl.FLOAT, !1, 0, 0)), w.color >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglColorBuffer), this.enableAttribute(w.color), this._gl.vertexAttribPointer(w.color, 3, this._gl.FLOAT, !1, 0, 0)), w.normal >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglNormalBuffer), this.enableAttribute(w.normal), this._gl.vertexAttribPointer(w.normal, 3, this._gl.FLOAT, !1, 0, 0)), w.offset >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglOffsetBuffer), this.enableAttribute(w.offset), this._gl.vertexAttribPointer(w.offset, 3, this._gl.FLOAT, !1, 0, 0)), w.radius >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglRadiusBuffer), this.enableAttribute(w.radius), this._gl.vertexAttribPointer(w.radius, 1, this._gl.FLOAT, !1, 0, 0)));
-                    var z, O;
+                    var k = !1, $ = b.wireframe ? 1 : 0, L = c.id * 16777215 + E.id * 2 + $;
+                    L !== this._currentGeometryGroupHash && (this._currentGeometryGroupHash = L, k = !0), k && (this.disableAttributes(), w.position >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglVertexBuffer), this.enableAttribute(w.position), this._gl.vertexAttribPointer(w.position, 3, this._gl.FLOAT, !1, 0, 0)), w.color >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglColorBuffer), this.enableAttribute(w.color), this._gl.vertexAttribPointer(w.color, 3, this._gl.FLOAT, !1, 0, 0)), w.normal >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglNormalBuffer), this.enableAttribute(w.normal), this._gl.vertexAttribPointer(w.normal, 3, this._gl.FLOAT, !1, 0, 0)), w.offset >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglOffsetBuffer), this.enableAttribute(w.offset), this._gl.vertexAttribPointer(w.offset, 3, this._gl.FLOAT, !1, 0, 0)), w.radius >= 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglRadiusBuffer), this.enableAttribute(w.radius), this._gl.vertexAttribPointer(w.radius, 1, this._gl.FLOAT, !1, 0, 0)));
+                    var z, F;
                     if (_ instanceof f.Mesh) {
                       if (b.shaderID === "instanced") {
                         var R = b.sphere.geometryGroups[0];
                         k && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, R.vertexArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, c.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, R.normalArray, this._gl.STATIC_DRAW), this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, R.faceArray, this._gl.STATIC_DRAW)), z = R.faceidx, this._extInstanced.vertexAttribDivisorANGLE(w.offset, 1), this._extInstanced.vertexAttribDivisorANGLE(w.radius, 1), this._extInstanced.vertexAttribDivisorANGLE(w.color, 1), this._extInstanced.drawElementsInstancedANGLE(this._gl.TRIANGLES, z, this._gl.UNSIGNED_SHORT, 0, c.radiusArray.length), this._extInstanced.vertexAttribDivisorANGLE(w.offset, 0), this._extInstanced.vertexAttribDivisorANGLE(w.radius, 0), this._extInstanced.vertexAttribDivisorANGLE(w.color, 0);
-                      } else b.wireframe ? (O = c.lineidx, this.setLineWidth(b.wireframeLinewidth), k && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglLineBuffer), this._gl.drawElements(this._gl.LINES, O, this._gl.UNSIGNED_SHORT, 0)) : (z = c.faceidx, k && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.drawElements(this._gl.TRIANGLES, z, this._gl.UNSIGNED_SHORT, 0));
+                      } else b.wireframe ? (F = c.lineidx, this.setLineWidth(b.wireframeLinewidth), k && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglLineBuffer), this._gl.drawElements(this._gl.LINES, F, this._gl.UNSIGNED_SHORT, 0)) : (z = c.faceidx, k && this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, c.__webglFaceBuffer), this._gl.drawElements(this._gl.TRIANGLES, z, this._gl.UNSIGNED_SHORT, 0));
                       this.info.render.calls++, this.info.render.vertices += z, this.info.render.faces += z / 3;
-                    } else _ instanceof f.Line && (O = c.vertices, this.setLineWidth(b.linewidth), this._gl.drawArrays(this._gl.LINES, 0, O), this.info.render.calls++);
+                    } else _ instanceof f.Line && (F = c.vertices, this.setLineWidth(b.linewidth), this._gl.drawArrays(this._gl.LINES, 0, F), this.info.render.calls++);
                   }
                 }
               }
@@ -27915,11 +27931,11 @@ ATOM`, b);
               }
               /* Setup the shading buffer to reflect desired shading (ambient occlusion) values.
                 Only the matching object with materialType are considered. */
-              setShading(u, g, p) {
+              setShading(u, p, g) {
                 let b = u.__lights, c = u.fog, _ = [];
-                for (let k = 0, L = u.__webglObjects.length; k < L; k++) {
-                  let $ = u.__webglObjects[k];
-                  $.render && $[p] && _.push($);
+                for (let k = 0, $ = u.__webglObjects.length; k < $; k++) {
+                  let L = u.__webglObjects[k];
+                  L.render && L[g] && _.push(L);
                 }
                 if (_.length == 0)
                   return;
@@ -27930,25 +27946,25 @@ ATOM`, b);
                   null,
                   //don't write colors (can we do this?)
                   0
-                ), this.renderObjects(u.__webglObjects, !0, p + "Depth", g, b, c, !1), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._scratchTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._AOshader), this._currentProgram = this._AOshader, this.setDepthTest(-1), this.setDepthWrite(-1);
+                ), this.renderObjects(u.__webglObjects, !0, g + "Depth", p, b, c, !1), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._scratchTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._AOshader), this._currentProgram = this._AOshader, this.setDepthTest(-1), this.setDepthWrite(-1);
                 let E = this._AOshader.uniforms;
                 this._gl.uniform1f(E.total_strength, this._AOstrength), this._gl.uniform1f(E.radius, this._AOradius), this._fullProjModelMatrix = new v.Matrix4(), this._fullProjModelMatrixInv = new v.Matrix4();
                 let w = _[0].object;
-                this._fullProjModelMatrix.multiplyMatrices(g.projectionMatrix, w._modelViewMatrix), this._fullProjModelMatrixInv.getInverse(this._fullProjModelMatrix), this._gl.uniformMatrix4fv(E.projectionMatrix, !1, this._fullProjModelMatrix.elements), this._gl.uniformMatrix4fv(E.projinv, !1, this._fullProjModelMatrixInv.elements), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._aovertexattribpos), this._gl.vertexAttribPointer(this._aovertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._blurshader), this._currentProgram = this._blurshader, this.setDepthTest(-1), this.setDepthWrite(-1), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._blurvertexattribpos), this._gl.vertexAttribPointer(this._blurvertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0);
+                this._fullProjModelMatrix.multiplyMatrices(p.projectionMatrix, w._modelViewMatrix), this._fullProjModelMatrixInv.getInverse(this._fullProjModelMatrix), this._gl.uniformMatrix4fv(E.projectionMatrix, !1, this._fullProjModelMatrix.elements), this._gl.uniformMatrix4fv(E.projinv, !1, this._fullProjModelMatrixInv.elements), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._aovertexattribpos), this._gl.vertexAttribPointer(this._aovertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this.clear(!1, !0, !1), this._gl.useProgram(this._blurshader), this._currentProgram = this._blurshader, this.setDepthTest(-1), this.setDepthWrite(-1), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, this._screenQuadVBO), this._gl.enableVertexAttribArray(this._blurvertexattribpos), this._gl.vertexAttribPointer(this._blurvertexattribpos, 2, this._gl.FLOAT, !1, 0, 0), this._gl.activeTexture(this._gl.TEXTURE0), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.drawArrays(this._gl.TRIANGLES, 0, 6), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0);
               }
-              render(u, g) {
-                if (!(g instanceof r.Camera)) {
+              render(u, p) {
+                if (!(p instanceof r.Camera)) {
                   console.error("Renderer.render: camera is not an instance of Camera.");
                   return;
                 }
-                var p, b, c, _, E, w = u.__lights, k = u.fog;
-                if (this._currentMaterialId = -1, this._lightsNeedUpdate = !0, this.autoUpdateScene && u.updateMatrixWorld(), g.parent === void 0 && g.updateMatrixWorld(), g.matrixWorldInverse.getInverse(g.matrixWorld), this.isLost())
+                var g, b, c, _, E, w = u.__lights, k = u.fog;
+                if (this._currentMaterialId = -1, this._lightsNeedUpdate = !0, this.autoUpdateScene && u.updateMatrixWorld(), p.parent === void 0 && p.updateMatrixWorld(), p.matrixWorldInverse.getInverse(p.matrixWorld), this.isLost())
                   return;
                 this.autoUpdateObjects && this.initWebGLObjects(u), this.info.render.calls = 0, this.info.render.vertices = 0, this.info.render.faces = 0, this.info.render.points = 0, this._currentWidth = this._viewportWidth, this._currentHeight = this._viewportHeight, this.setViewport(), this.setFrameBuffer(), this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha), this.clear(!0, !0, !0), E = u.__webglObjects;
-                let L = !1, $ = this._AOEnabled;
-                for (p = 0, b = E.length; p < b; p++)
-                  c = E[p], _ = c.object, c.render = !1, _.visible && (this.setupMatrices(_, g), this.unrollBufferMaterial(c), c.render = !0, c.volumetric && (L = !0), c.hasAO && ($ = !0));
-                if (this.setBlending(!1), $ && this.setShading(u, g, "opaque"), this.renderObjects(u.__webglObjects, !0, "opaque", g, w, k, !1), $ && this.clearShading(), this.renderSprites(u, g, !1), this.renderObjects(u.__webglObjects, !0, "transparentDepth", g, w, k, !0), this.renderObjects(u.__webglObjects, !1, "transparent", g, w, k, !0), L && this._fb && (this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, null, 0), this.renderObjects(u.__webglObjects, !1, "volumetric", g, w, k, !0)), this.renderFrameBuffertoScreen(), this.setDepthTest(!0), this.setDepthWrite(!0), this.renderSprites(u, g, !0), this._bitmap) {
+                let $ = !1, L = this._AOEnabled;
+                for (g = 0, b = E.length; g < b; g++)
+                  c = E[g], _ = c.object, c.render = !1, _.visible && (this.setupMatrices(_, p), this.unrollBufferMaterial(c), c.render = !0, c.volumetric && ($ = !0), c.hasAO && (L = !0));
+                if (this.setBlending(!1), L && this.setShading(u, p, "opaque"), this.renderObjects(u.__webglObjects, !0, "opaque", p, w, k, !1), L && this.clearShading(), this.renderSprites(u, p, !1), this.renderObjects(u.__webglObjects, !0, "transparentDepth", p, w, k, !0), this.renderObjects(u.__webglObjects, !1, "transparent", p, w, k, !0), $ && this._fb && (this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, null, 0), this.renderObjects(u.__webglObjects, !1, "volumetric", p, w, k, !0)), this.renderFrameBuffertoScreen(), this.setDepthTest(!0), this.setDepthWrite(!0), this.renderSprites(u, p, !0), this._bitmap) {
                   const z = this._offscreen.transferToImageBitmap();
                   this._bitmap.transferFromImageBitmap(z);
                 }
@@ -27957,17 +27973,17 @@ ATOM`, b);
               setFrameBuffer() {
                 if (this.isWebGL1() || !this._fb)
                   return;
-                let u = this._viewportWidth, g = this._viewportHeight;
-                this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, u, g), this._gl.viewport(0, 0, u, g), this._gl.bindTexture(this._gl.TEXTURE_2D, this._targetTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, u, g, 0, this._gl.RGBA, this._gl.UNSIGNED_BYTE, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, g, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._shadingTexture && (this._gl.deleteTexture(this._shadingTexture), this._shadingTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, g, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.deleteTexture(this._scratchTexture), this._scratchTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, g, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE)), this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, this._fb), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this._gl.clearDepth(1), this._gl.clear(this._gl.DEPTH_BUFFER_BIT), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0);
+                let u = this._viewportWidth, p = this._viewportHeight;
+                this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, u, p), this._gl.viewport(0, 0, u, p), this._gl.bindTexture(this._gl.TEXTURE_2D, this._targetTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, u, p, 0, this._gl.RGBA, this._gl.UNSIGNED_BYTE, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, p, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._shadingTexture && (this._gl.deleteTexture(this._shadingTexture), this._shadingTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, p, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.deleteTexture(this._scratchTexture), this._scratchTexture = this._gl.createTexture(), this._gl.bindTexture(this._gl.TEXTURE_2D, this._scratchTexture), this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.DEPTH_COMPONENT32F, u, p, 0, this._gl.DEPTH_COMPONENT, this._gl.FLOAT, null), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE)), this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, this._fb), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.COLOR_ATTACHMENT0, this._gl.TEXTURE_2D, this._targetTexture, 0), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._shadingTexture, 0), this._gl.clearDepth(1), this._gl.clear(this._gl.DEPTH_BUFFER_BIT), this._gl.framebufferTexture2D(this._gl.FRAMEBUFFER, this._gl.DEPTH_ATTACHMENT, this._gl.TEXTURE_2D, this._depthTexture, 0);
               }
               //allocate buffers for framebuffer, needs to be called with every resize
               initFrameBuffer() {
                 if (this.isWebGL1())
                   return;
-                let u = this._viewportWidth, g = this._viewportHeight;
-                this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, u, g), this._gl.viewport(0, 0, u, g), this._targetTexture = this._gl.createTexture(), this._depthTexture = this._gl.createTexture(), this._shadingTexture = this._gl.createTexture(), this._scratchTexture = this._gl.createTexture(), this._fb = this._gl.createFramebuffer();
-                var p = this._antialias ? y.ShaderLib.screenaa : y.ShaderLib.screen;
-                this._screenshader = this.buildProgram(p.fragmentShader, p.vertexShader, p.uniforms, {}), this._vertexattribpos = this._gl.getAttribLocation(this._screenshader, "vertexPosition");
+                let u = this._viewportWidth, p = this._viewportHeight;
+                this._gl.enable(this._gl.SCISSOR_TEST), this._gl.scissor(0, 0, u, p), this._gl.viewport(0, 0, u, p), this._targetTexture = this._gl.createTexture(), this._depthTexture = this._gl.createTexture(), this._shadingTexture = this._gl.createTexture(), this._scratchTexture = this._gl.createTexture(), this._fb = this._gl.createFramebuffer();
+                var g = this._antialias ? y.ShaderLib.screenaa : y.ShaderLib.screen;
+                this._screenshader = this.buildProgram(g.fragmentShader, g.vertexShader, g.uniforms, {}), this._vertexattribpos = this._gl.getAttribLocation(this._screenshader, "vertexPosition");
                 var b = [
                   // First triangle:
                   1,
@@ -28001,8 +28017,8 @@ ATOM`, b);
                 }
                 for (; u.__objectsRemoved.length; )
                   this.removeObject(u.__objectsRemoved[0], u), u.__objectsRemoved.splice(0, 1);
-                for (var g = 0, p = u.__webglObjects.length; g < p; g++)
-                  this.updateObject(u.__webglObjects[g].object);
+                for (var p = 0, g = u.__webglObjects.length; p < g; p++)
+                  this.updateObject(u.__webglObjects[p].object);
               }
               getYRatio() {
                 return this.rows !== void 0 && this.row !== void 0 ? this.rows : 1;
@@ -28010,22 +28026,22 @@ ATOM`, b);
               getXRatio() {
                 return this.cols !== void 0 && this.col !== void 0 ? this.cols : 1;
               }
-              getAspect(u, g) {
-                (u == null || g == null) && (u = this._canvas.width, g = this._canvas.height);
-                var p = u / g;
+              getAspect(u, p) {
+                (u == null || p == null) && (u = this._canvas.width, p = this._canvas.height);
+                var g = u / p;
                 if (this.rows != null && this.cols != null && this.row != null && this.col != null) {
-                  var b = u / this.cols, c = g / this.rows;
-                  p = b / c;
+                  var b = u / this.cols, c = p / this.rows;
+                  g = b / c;
                 }
-                return p;
+                return g;
               }
-              setTexture(u, g, p) {
+              setTexture(u, p, g) {
                 if (u.needsUpdate) {
-                  u.__webglInit || (u.__webglInit = !0, u.addEventListener("dispose", this.onTextureDispose.bind(this)), u.__webglTexture = this._gl.createTexture(), this.info.memory.textures++), this._gl.activeTexture(this._gl.TEXTURE0 + g);
-                  var b = p ? this._gl.TEXTURE_3D : this._gl.TEXTURE_2D;
+                  u.__webglInit || (u.__webglInit = !0, u.addEventListener("dispose", this.onTextureDispose.bind(this)), u.__webglTexture = this._gl.createTexture(), this.info.memory.textures++), this._gl.activeTexture(this._gl.TEXTURE0 + p);
+                  var b = g ? this._gl.TEXTURE_3D : this._gl.TEXTURE_2D;
                   this._gl.bindTexture(b, u.__webglTexture), this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, u.flipY), this._gl.pixelStorei(this._gl.UNPACK_PREMULTIPLY_ALPHA_WEBGL, u.premultiplyAlpha), this._gl.pixelStorei(this._gl.UNPACK_ALIGNMENT, u.unpackAlignment), this._gl.pixelStorei(this._gl.PACK_ALIGNMENT, u.unpackAlignment);
                   var c = this.paramToGL(u.format), _ = this.paramToGL(u.type);
-                  if (p)
+                  if (g)
                     this.setTextureParameters(this._gl.TEXTURE_3D, u), this._gl.texImage3D(this._gl.TEXTURE_3D, 0, this._gl.R32F, u.image.size.z, u.image.size.y, u.image.size.x, 0, this._gl.RED, this._gl.FLOAT, u.image.data);
                   else {
                     var E = u.image, w = E.width, k = E.height;
@@ -28033,7 +28049,7 @@ ATOM`, b);
                   }
                   u.needsUpdate = !1, u.onUpdate && u.onUpdate();
                 } else
-                  this._gl.activeTexture(this._gl.TEXTURE0 + g), p ? this._gl.bindTexture(this._gl.TEXTURE_3D, u.__webglTexture) : this._gl.bindTexture(this._gl.TEXTURE_2D, u.__webglTexture);
+                  this._gl.activeTexture(this._gl.TEXTURE0 + p), g ? this._gl.bindTexture(this._gl.TEXTURE_3D, u.__webglTexture) : this._gl.bindTexture(this._gl.TEXTURE_2D, u.__webglTexture);
               }
               supportsVolumetric() {
                 return !this.isWebGL1();
@@ -28045,7 +28061,7 @@ ATOM`, b);
                 for (let u in this._enabledAttributes)
                   this._enabledAttributes[u] && (this._gl.disableVertexAttribArray(u), this._enabledAttributes[u] = !1);
               }
-              setPolygonOffset(u, g, p) {
+              setPolygonOffset(u, p, g) {
                 this._oldPolygonOffset !== u && (u ? this._gl.enable(this._gl.POLYGON_OFFSET_FILL) : this._gl.disable(this._gl.POLYGON_OFFSET_FILL));
               }
               setLineWidth(u) {
@@ -28053,26 +28069,26 @@ ATOM`, b);
               }
               deallocateGeometry(u) {
                 if (u.__webglInit = void 0, u.__webglVertexBuffer !== void 0 && this._gl.deleteBuffer(u.__webglVertexBuffer), u.__webglColorBuffer !== void 0 && this._gl.deleteBuffer(u.__webglColorBuffer), u.geometryGroups !== void 0)
-                  for (var g = 0, p = u.groups; g < p; g++) {
-                    var b = u.geometryGroups[g];
+                  for (var p = 0, g = u.groups; p < g; p++) {
+                    var b = u.geometryGroups[p];
                     b.__webglVertexBuffer !== void 0 && this._gl.deleteBuffer(b.__webglVertexBuffer), b.__webglColorBuffer !== void 0 && this._gl.deleteBuffer(b.__webglColorBuffer), b.__webglNormalBuffer !== void 0 && this._gl.deleteBuffer(b.__webglNormalBuffer), b.__webglFaceBuffer !== void 0 && this._gl.deleteBuffer(b.__webglFaceBuffer), b.__webglLineBuffer !== void 0 && this._gl.deleteBuffer(b.__webglLineBuffer);
                   }
               }
               deallocateMaterial(u) {
-                var g = u.program;
-                if (g !== void 0) {
+                var p = u.program;
+                if (p !== void 0) {
                   u.program = void 0;
-                  var p, b, c, _ = !1;
-                  for (p = 0, b = this._programs.length; p < b; p++)
-                    if (c = this._programs[p], c.program === g) {
+                  var g, b, c, _ = !1;
+                  for (g = 0, b = this._programs.length; g < b; g++)
+                    if (c = this._programs[g], c.program === p) {
                       c.usedTimes--, c.usedTimes === 0 && (_ = !0);
                       break;
                     }
                   if (_ === !0) {
                     var E = [];
-                    for (p = 0, b = this._programs.length; p < b; p++)
-                      c = this._programs[p], c.program !== g && E.push(c);
-                    this._programs = E, this._gl.deleteProgram(g), this.info.memory.programs--;
+                    for (g = 0, b = this._programs.length; g < b; g++)
+                      c = this._programs[g], c.program !== p && E.push(c);
+                    this._programs = E, this._gl.deleteProgram(p), this.info.memory.programs--;
                   }
                 }
               }
@@ -28086,40 +28102,40 @@ ATOM`, b);
                 }
               }
               onGeometryDispose(u) {
-                var g = u.target;
-                g.removeEventListener("dispose", this.onGeometryDispose), this.deallocateGeometry(g), this.info.memory.geometries--;
+                var p = u.target;
+                p.removeEventListener("dispose", this.onGeometryDispose), this.deallocateGeometry(p), this.info.memory.geometries--;
               }
               onTextureDispose(u) {
-                var g = u.target;
-                g.removeEventListener("dispose", this.onTextureDispose), this.deallocateTexture(g), this.info.memory.textures--;
+                var p = u.target;
+                p.removeEventListener("dispose", this.onTextureDispose), this.deallocateTexture(p), this.info.memory.textures--;
               }
               onMaterialDispose(u) {
-                var g = u.target;
-                g.removeEventListener("dispose", this.onMaterialDispose), this.deallocateMaterial(g);
+                var p = u.target;
+                p.removeEventListener("dispose", this.onMaterialDispose), this.deallocateMaterial(p);
               }
               // Compile and return shader
-              getShader(u, g) {
-                var p;
-                return !this.isWebGL1() && !g.startsWith("#version") && (g = g.replace(/gl_FragDepthEXT/g, "gl_FragDepth"), u == "fragment" ? g = g.replace(/varying/g, "in") : g = g.replace(/varying/g, "out"), g = g.replace(/attribute/g, "in"), g = g.replace(/texture2D/g, "texture"), g = g.replace(/\/\/DEFINEFRAGCOLOR/g, "out vec4 glFragColor;"), g = g.replace(/gl_FragColor/g, "glFragColor"), g = `#version 300 es
-` + g), u === "fragment" ? p = this._gl.createShader(this._gl.FRAGMENT_SHADER) : u === "vertex" && (p = this._gl.createShader(this._gl.VERTEX_SHADER)), p == null ? null : (this._gl.shaderSource(p, g), this._gl.compileShader(p), this._gl.getShaderParameter(p, this._gl.COMPILE_STATUS) ? p : (console.error(this._gl.getShaderInfoLog(p)), console.error("could not initialize shader"), null));
+              getShader(u, p) {
+                var g;
+                return !this.isWebGL1() && !p.startsWith("#version") && (p = p.replace(/gl_FragDepthEXT/g, "gl_FragDepth"), u == "fragment" ? p = p.replace(/varying/g, "in") : p = p.replace(/varying/g, "out"), p = p.replace(/attribute/g, "in"), p = p.replace(/texture2D/g, "texture"), p = p.replace(/\/\/DEFINEFRAGCOLOR/g, "out vec4 glFragColor;"), p = p.replace(/gl_FragColor/g, "glFragColor"), p = `#version 300 es
+` + p), u === "fragment" ? g = this._gl.createShader(this._gl.FRAGMENT_SHADER) : u === "vertex" && (g = this._gl.createShader(this._gl.VERTEX_SHADER)), g == null ? null : (this._gl.shaderSource(g, p), this._gl.compileShader(g), this._gl.getShaderParameter(g, this._gl.COMPILE_STATUS) ? g : (console.error(this._gl.getShaderInfoLog(g)), console.error("could not initialize shader"), null));
               }
               // Compile appropriate shaders (if necessary) from source code and attach to
               // gl program.
-              buildProgram(u, g, p, b) {
+              buildProgram(u, p, g, b) {
                 var c, _, E, w, k = [];
-                k.push(u), k.push(g);
+                k.push(u), k.push(p);
                 for (c in b)
                   k.push(c), k.push(b[c]);
                 for (w = k.join(), c = 0, _ = this._programs.length; c < _; c++) {
-                  var L = this._programs[c];
-                  if (L.code === w)
-                    return L.usedTimes++, L.program;
+                  var $ = this._programs[c];
+                  if ($.code === w)
+                    return $.usedTimes++, $.program;
                 }
                 if (this.isWebGL1() && b.volumetric)
                   throw new Error("Volumetric rendering requires webgl2 which is not supported by your hardware.");
                 if (E = this._gl.createProgram(), E == null)
                   return null;
-                var $ = this._precision, z = "precision " + $ + " float;", O = [
+                var L = this._precision, z = "precision " + L + " float;", F = [
                   b.volumetric ? "#version 300 es" : "",
                   z
                 ].join(`
@@ -28130,7 +28146,7 @@ ATOM`, b);
                   b.wireframe ? "#define WIREFRAME 1" : "",
                   z
                 ].join(`
-`), P = this.getShader("fragment", R + u), U = this.getShader("vertex", O + g);
+`), P = this.getShader("fragment", R + u), U = this.getShader("vertex", F + p);
                 U != null && this._gl.attachShader(E, U), P != null && this._gl.attachShader(E, P), this._gl.linkProgram(E), this._gl.getProgramParameter(E, this._gl.LINK_STATUS) || console.error("Could not initialize shader"), E.uniforms = {}, E.attributes = {};
                 var N, B, W;
                 N = [
@@ -28141,7 +28157,7 @@ ATOM`, b);
                   "vWidth",
                   "vHeight"
                 ];
-                for (B in p)
+                for (B in g)
                   N.push(B);
                 for (W = 0; W < N.length; W++) {
                   var V = N[W];
@@ -28164,92 +28180,92 @@ ATOM`, b);
                   usedTimes: 1
                 }), this.info.memory.programs = this._programs.length, E;
               }
-              setProgram(u, g, p, b, c, _) {
-                if (b.needsUpdate && (b.program && this.deallocateMaterial(b), this.initMaterial(b, g, p, c), b.needsUpdate = !1), b.program == null)
+              setProgram(u, p, g, b, c, _) {
+                if (b.needsUpdate && (b.program && this.deallocateMaterial(b), this.initMaterial(b, p, g, c), b.needsUpdate = !1), b.program == null)
                   return null;
-                var E = !1, w = b.program, k = w.uniforms, L = b.uniforms;
+                var E = !1, w = b.program, k = w.uniforms, $ = b.uniforms;
                 if (w != this._currentProgram && (this._gl.useProgram(w), this._currentProgram = w, E = !0), b.id != this._currentMaterialId && (this._currentMaterialId = b.id, E = !0), u != this._currentCamera && (this._currentCamera = u, E = !0), k.projectionMatrix && this._gl.uniformMatrix4fv(k.projectionMatrix, !1, u.projectionMatrix.elements), k.modelViewMatrix && this._gl.uniformMatrix4fv(k.modelViewMatrix, !1, c._modelViewMatrix.elements), k.normalMatrix && this._gl.uniformMatrix3fv(k.normalMatrix, !1, c._normalMatrix.elements), k.projinv && (this._projInverse.getInverse(u.projectionMatrix), this._gl.uniformMatrix4fv(k.projinv, !1, this._projInverse.elements)), k.viewMatrix && this._gl.uniformMatrix4fv(k.viewMatrix, !1, u.matrixWorldInverse.elements), k.vWidth && this._gl.uniform1f(k.vWidth, this._viewportWidth), k.vHeight && this._gl.uniform1f(k.vHeight, this._viewportHeight), E) {
-                  if (L.fogColor.value = p.color, L.fogNear.value = p.near, L.fogFar.value = p.far, b.shaderID.startsWith("lambert") || b.shaderID === "instanced" || b.shaderID.endsWith("imposter"))
-                    this._lightsNeedUpdate && (this.setupLights(w, g), this._lightsNeedUpdate = !1), L.directionalLightColor.value = this._lights.directional.colors, L.directionalLightDirection.value = this._lights.directional.positions;
+                  if ($.fogColor.value = g.color, $.fogNear.value = g.near, $.fogFar.value = g.far, b.shaderID.startsWith("lambert") || b.shaderID === "instanced" || b.shaderID.endsWith("imposter"))
+                    this._lightsNeedUpdate && (this.setupLights(w, p), this._lightsNeedUpdate = !1), $.directionalLightColor.value = this._lights.directional.colors, $.directionalLightDirection.value = this._lights.directional.positions;
                   else if (b.shaderID.endsWith("outline"))
-                    L.outlineColor.value = b.outlineColor, L.outlineWidth.value = b.outlineWidth, L.outlinePushback.value = b.outlinePushback, L.outlineMaxPixels.value = b.outlineMaxPixels * this.devicePixelRatio;
+                    $.outlineColor.value = b.outlineColor, $.outlineWidth.value = b.outlineWidth, $.outlinePushback.value = b.outlinePushback, $.outlineMaxPixels.value = b.outlineMaxPixels * this.devicePixelRatio;
                   else if (b.shaderID === "volumetric") {
                     c._modelViewMatrix.getScale(this._direction), this._worldInverse.getInverse(c._modelViewMatrix), this._projInverse.getInverse(u.projectionMatrix), this._textureMatrix.multiplyMatrices(c.material.texmatrix, this._worldInverse), this._gl.uniformMatrix4fv(k.textmat, !1, this._textureMatrix.elements), this._gl.uniformMatrix4fv(k.projinv, !1, this._projInverse.elements);
-                    let $ = Math.min(Math.min(this._direction.x, this._direction.y), this._direction.z);
-                    L.step.value = c.material.unit * $, L.maxdepth.value = c.material.maxdepth * $, L.transfermax.value = c.material.transfermax, L.transfermin.value = c.material.transfermin, L.subsamples.value = c.material.subsamples, _.setTexture(c.material.transferfn, 4, !1), _.setTexture(c.material.map, 3, !0), this._gl.activeTexture(this._gl.TEXTURE5), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture);
+                    let L = Math.min(Math.min(this._direction.x, this._direction.y), this._direction.z);
+                    $.step.value = c.material.unit * L, $.maxdepth.value = c.material.maxdepth * L, $.transfermax.value = c.material.transfermax, $.transfermin.value = c.material.transfermin, $.subsamples.value = c.material.subsamples, _.setTexture(c.material.transferfn, 4, !1), _.setTexture(c.material.map, 3, !0), this._gl.activeTexture(this._gl.TEXTURE5), this._gl.bindTexture(this._gl.TEXTURE_2D, this._depthTexture);
                   }
-                  L.opacity.value = b.opacity, this.loadMaterialUniforms(k, L);
+                  $.opacity.value = b.opacity, this.loadMaterialUniforms(k, $);
                 }
-                return L.shading && (L.shading.value == 3 ? (this._gl.activeTexture(this._gl.TEXTURE0 + this.SHADE_TEXTURE), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture)) : console.error("Invalid shading textures.")), w;
+                return $.shading && ($.shading.value == 3 ? (this._gl.activeTexture(this._gl.TEXTURE0 + this.SHADE_TEXTURE), this._gl.bindTexture(this._gl.TEXTURE_2D, this._shadingTexture)) : console.error("Invalid shading textures.")), w;
               }
-              loadMaterialUniforms(u, g) {
-                var p, b, c, _;
-                for (p in g)
-                  u[p] && (b = g[p].type, c = g[p].value, _ = u[p], b === "f" ? this._gl.uniform1f(_, c) : b === "i" ? this._gl.uniform1i(_, c) : b === "fv" ? this._gl.uniform3fv(_, c) : b === "c" ? this._gl.uniform3f(_, c.r, c.g, c.b) : b === "f4" && this._gl.uniform4f(_, c[0], c[1], c[2], c[3]));
+              loadMaterialUniforms(u, p) {
+                var g, b, c, _;
+                for (g in p)
+                  u[g] && (b = p[g].type, c = p[g].value, _ = u[g], b === "f" ? this._gl.uniform1f(_, c) : b === "i" ? this._gl.uniform1i(_, c) : b === "fv" ? this._gl.uniform3fv(_, c) : b === "c" ? this._gl.uniform3f(_, c.r, c.g, c.b) : b === "f4" && this._gl.uniform4f(_, c[0], c[1], c[2], c[3]));
               }
               // Objects adding
-              addObject(u, g) {
-                var p, b, c, _;
+              addObject(u, p) {
+                var g, b, c, _;
                 if (!u.__webglInit && (u.__webglInit = !0, u._modelViewMatrix = new v.Matrix4(), u._normalMatrix = new v.Matrix3(), u.geometry !== void 0 && u.geometry.__webglInit === void 0 && (u.geometry.__webglInit = !0, u.geometry.addEventListener("dispose", this.onGeometryDispose.bind(this))), u instanceof f.Mesh || u instanceof f.Line))
-                  for (c = u.geometry, p = 0, b = c.geometryGroups.length; p < b; p++)
-                    _ = c.geometryGroups[p], _.id = this._geometryGroupCounter++, _.__webglVertexBuffer || (u instanceof f.Mesh ? (this.createMeshBuffers(_), c.elementsNeedUpdate = !0, c.normalsNeedUpdate = !0) : u instanceof f.Line && this.createLineBuffers(_), c.verticesNeedUpdate = !0, c.colorsNeedUpdate = !0);
+                  for (c = u.geometry, g = 0, b = c.geometryGroups.length; g < b; g++)
+                    _ = c.geometryGroups[g], _.id = this._geometryGroupCounter++, _.__webglVertexBuffer || (u instanceof f.Mesh ? (this.createMeshBuffers(_), c.elementsNeedUpdate = !0, c.normalsNeedUpdate = !0) : u instanceof f.Line && this.createLineBuffers(_), c.verticesNeedUpdate = !0, c.colorsNeedUpdate = !0);
                 if (!u.__webglActive) {
                   if (u instanceof f.Mesh || u instanceof f.Line)
-                    for (c = u.geometry, p = 0, b = c.geometryGroups.length; p < b; p++)
-                      _ = c.geometryGroups[p], this.addBuffer(g.__webglObjects, _, u);
-                  else u instanceof f.Sprite && g.__webglSprites.push(u);
+                    for (c = u.geometry, g = 0, b = c.geometryGroups.length; g < b; g++)
+                      _ = c.geometryGroups[g], this.addBuffer(p.__webglObjects, _, u);
+                  else u instanceof f.Sprite && p.__webglSprites.push(u);
                   u.__webglActive = !0;
                 }
               }
               updateObject(u) {
-                var g = u.geometry, p;
+                var p = u.geometry, g;
                 if (u instanceof f.Mesh || u instanceof f.Line) {
-                  for (var b = 0, c = g.geometryGroups.length; b < c; b++)
-                    p = g.geometryGroups[b], (g.verticesNeedUpdate || g.elementsNeedUpdate || g.colorsNeedUpdate || g.normalsNeedUpdate) && this.setBuffers(p, this._gl.STATIC_DRAW);
-                  g.verticesNeedUpdate = !1, g.elementsNeedUpdate = !1, g.normalsNeedUpdate = !1, g.colorsNeedUpdate = !1, g.buffersNeedUpdate = !1;
+                  for (var b = 0, c = p.geometryGroups.length; b < c; b++)
+                    g = p.geometryGroups[b], (p.verticesNeedUpdate || p.elementsNeedUpdate || p.colorsNeedUpdate || p.normalsNeedUpdate) && this.setBuffers(g, this._gl.STATIC_DRAW);
+                  p.verticesNeedUpdate = !1, p.elementsNeedUpdate = !1, p.normalsNeedUpdate = !1, p.colorsNeedUpdate = !1, p.buffersNeedUpdate = !1;
                 }
               }
-              removeObject(u, g) {
-                u instanceof f.Mesh || u instanceof f.Line ? this.removeInstances(g.__webglObjects, u) : u instanceof f.Sprite && this.removeInstancesDirect(g.__webglSprites, u), u.__webglActive = !1;
+              removeObject(u, p) {
+                u instanceof f.Mesh || u instanceof f.Line ? this.removeInstances(p.__webglObjects, u) : u instanceof f.Sprite && this.removeInstancesDirect(p.__webglSprites, u), u.__webglActive = !1;
               }
-              removeInstances(u, g) {
-                for (var p = u.length - 1; p >= 0; --p)
-                  u[p].object === g && u.splice(p, 1);
+              removeInstances(u, p) {
+                for (var g = u.length - 1; g >= 0; --g)
+                  u[g].object === p && u.splice(g, 1);
               }
-              removeInstancesDirect(u, g) {
-                for (var p = u.length - 1; p >= 0; --p)
-                  u[p] === g && u.splice(p, 1);
+              removeInstancesDirect(u, p) {
+                for (var g = u.length - 1; g >= 0; --g)
+                  u[g] === p && u.splice(g, 1);
               }
               unrollBufferMaterial(u) {
-                var g = u.object, p = g.material;
-                if (p.volumetric)
-                  u.opaque = null, u.transparent = null, u.volumetric = p;
-                else if (p.transparent) {
-                  if (u.opaque = null, u.volumetric = null, u.transparent = p, !p.wireframe) {
-                    let b = p.clone();
+                var p = u.object, g = p.material;
+                if (g.volumetric)
+                  u.opaque = null, u.transparent = null, u.volumetric = g;
+                else if (g.transparent) {
+                  if (u.opaque = null, u.volumetric = null, u.transparent = g, !g.wireframe) {
+                    let b = g.clone();
                     b.opacity = 0, u.transparentDepth = b;
                   }
                 } else {
-                  if (u.opaque = p, u.transparent = null, u.volumetric = null, !p.wireframe) {
-                    let b = p.clone();
+                  if (u.opaque = g, u.transparent = null, u.volumetric = null, !g.wireframe) {
+                    let b = g.clone();
                     b.opacity = 0, u.opaqueDepth = b;
                   }
-                  p.hasAO && (u.hasAO = !0), (this._AOEnabled || u.hasAO) && (u.opaqueShaded = p.clone(), u.opaqueShaded.shaded = !0);
+                  g.hasAO && (u.hasAO = !0), (this._AOEnabled || u.hasAO) && (u.opaqueShaded = g.clone(), u.opaqueShaded.shaded = !0);
                 }
               }
-              setBuffers(u, g) {
-                var p = u.vertexArray, b = u.colorArray;
-                if (u.__webglOffsetBuffer !== void 0 ? (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglOffsetBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, p, g)) : (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, p, g)), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglColorBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, b, g), u.normalArray && u.__webglNormalBuffer !== void 0) {
+              setBuffers(u, p) {
+                var g = u.vertexArray, b = u.colorArray;
+                if (u.__webglOffsetBuffer !== void 0 ? (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglOffsetBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, g, p)) : (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglVertexBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, g, p)), this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglColorBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, b, p), u.normalArray && u.__webglNormalBuffer !== void 0) {
                   var c = u.normalArray;
-                  this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, c, g);
+                  this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglNormalBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, c, p);
                 }
-                if (u.radiusArray && u.__webglRadiusBuffer !== void 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglRadiusBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, u.radiusArray, g)), u.faceArray && u.__webglFaceBuffer !== void 0) {
+                if (u.radiusArray && u.__webglRadiusBuffer !== void 0 && (this._gl.bindBuffer(this._gl.ARRAY_BUFFER, u.__webglRadiusBuffer), this._gl.bufferData(this._gl.ARRAY_BUFFER, u.radiusArray, p)), u.faceArray && u.__webglFaceBuffer !== void 0) {
                   var _ = u.faceArray;
-                  this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, u.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, _, g);
+                  this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, u.__webglFaceBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, _, p);
                 }
                 if (u.lineArray && u.__webglLineBuffer !== void 0) {
                   var E = u.lineArray;
-                  this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, u.__webglLineBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, E, g);
+                  this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, u.__webglLineBuffer), this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, E, p);
                 }
               }
               // Creates appropriate gl buffers for geometry chunk
@@ -28261,37 +28277,37 @@ ATOM`, b);
               createLineBuffers(u) {
                 u.__webglVertexBuffer = this._gl.createBuffer(), u.__webglColorBuffer = this._gl.createBuffer(), this.info.memory.geometries++;
               }
-              addBuffer(u, g, p) {
+              addBuffer(u, p, g) {
                 u.push({
-                  buffer: g,
-                  object: p,
+                  buffer: p,
+                  object: g,
                   opaque: null,
                   transparent: null
                 });
               }
-              setupMatrices(u, g) {
-                u._modelViewMatrix.multiplyMatrices(g.matrixWorldInverse, u.matrixWorld), u._normalMatrix.getInverse(u._modelViewMatrix), u._normalMatrix.transpose();
+              setupMatrices(u, p) {
+                u._modelViewMatrix.multiplyMatrices(p.matrixWorldInverse, u.matrixWorld), u._normalMatrix.getInverse(u._modelViewMatrix), u._normalMatrix.transpose();
               }
               // Fallback filters for non-power-of-2 textures
               filterFallback(u) {
                 return this._gl.LINEAR;
               }
-              setTextureParameters(u, g) {
-                u == this._gl.TEXTURE_2D ? (this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this.filterFallback(g.magFilter)), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this.filterFallback(g.minFilter))) : (this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_R, this._gl.CLAMP_TO_EDGE), this._extColorBufferFloat && this._extFloatLinear ? (this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR)) : (this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST)));
+              setTextureParameters(u, p) {
+                u == this._gl.TEXTURE_2D ? (this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this.filterFallback(p.magFilter)), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this.filterFallback(p.minFilter))) : (this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE), this._gl.texParameteri(u, this._gl.TEXTURE_WRAP_R, this._gl.CLAMP_TO_EDGE), this._extColorBufferFloat && this._extFloatLinear ? (this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this._gl.LINEAR), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this._gl.LINEAR)) : (this._gl.texParameteri(u, this._gl.TEXTURE_MAG_FILTER, this._gl.NEAREST), this._gl.texParameteri(u, this._gl.TEXTURE_MIN_FILTER, this._gl.NEAREST)));
               }
               // Map constants to WebGL constants
               paramToGL(u) {
                 return u === s.UnsignedByteType ? this._gl.UNSIGNED_BYTE : u === s.RGBAFormat ? this._gl.RGBA : u === s.NearestFilter ? this._gl.NEAREST : 0;
               }
-              setupLights(u, g) {
-                var p, b, c, _ = 0, E = 0, w = 0, k, L, $ = this._lights, z = $.directional.colors, O = $.directional.positions, R = 0, P = 0;
-                for (p = 0, b = g.length; p < b; p++)
-                  if (c = g[p], k = c.color, L = c.intensity, c instanceof h.Light) {
+              setupLights(u, p) {
+                var g, b, c, _ = 0, E = 0, w = 0, k, $, L = this._lights, z = L.directional.colors, F = L.directional.positions, R = 0, P = 0;
+                for (g = 0, b = p.length; g < b; g++)
+                  if (c = p[g], k = c.color, $ = c.intensity, c instanceof h.Light) {
                     if (this._direction.getPositionFromMatrix(c.matrixWorld), this._vector3.getPositionFromMatrix(c.target.matrixWorld), this._direction.sub(this._vector3), this._direction.normalize(), this._direction.x === 0 && this._direction.y === 0 && this._direction.z === 0)
                       continue;
-                    O[P] = this._direction.x, O[P + 1] = this._direction.y, O[P + 2] = this._direction.z, z[P] = k.r * L, z[P + 1] = k.g * L, z[P + 2] = k.b * L, P += 3, R++;
+                    F[P] = this._direction.x, F[P + 1] = this._direction.y, F[P + 2] = this._direction.z, z[P] = k.r * $, z[P + 1] = k.g * $, z[P + 2] = k.b * $, P += 3, R++;
                   }
-                $.ambient[0] = _, $.ambient[1] = E, $.ambient[2] = w, $.directional.length = R;
+                L.ambient[0] = _, L.ambient[1] = E, L.ambient[2] = w, L.directional.length = R;
               }
               initGL() {
                 try {
@@ -28323,8 +28339,8 @@ ATOM`, b);
                     throw "Error creating WebGL context.";
                   var u = this._gl.getParameter(this._gl.VERSION);
                   this._webglversion = parseInt(u[6]);
-                } catch (g) {
-                  console.error(g);
+                } catch (p) {
+                  console.error(p);
                 }
               }
               isWebGL1() {
@@ -28334,23 +28350,23 @@ ATOM`, b);
                 this._gl.clearDepth(1), this._gl.clearStencil(0), this._gl.enable(this._gl.DEPTH_TEST), this._gl.depthFunc(this._gl.LEQUAL), this._gl.frontFace(this._gl.CCW), this._gl.cullFace(this._gl.BACK), this._gl.enable(this._gl.CULL_FACE), this._gl.enable(this._gl.BLEND), this._gl.blendEquation(this._gl.FUNC_ADD), this._gl.blendFunc(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA), this._gl.clearColor(this._clearColor.r, this._clearColor.g, this._clearColor.b, this._clearAlpha);
               }
               // rendering
-              renderObjects(u, g, p, b, c, _, E) {
-                var w, k, L, $, z, O, R;
-                g ? (z = u.length - 1, O = -1, R = -1) : (z = 0, O = u.length, R = 1);
-                for (var P = z; P !== O; P += R)
+              renderObjects(u, p, g, b, c, _, E) {
+                var w, k, $, L, z, F, R;
+                p ? (z = u.length - 1, F = -1, R = -1) : (z = 0, F = u.length, R = 1);
+                for (var P = z; P !== F; P += R)
                   if (w = u[P], w.render) {
-                    if (k = w.object, L = w.buffer, $ = w[p], (w.hasAO || this._AOEnabled) && w[p + "Shaded"] && ($ = w[p + "Shaded"]), !$)
+                    if (k = w.object, $ = w.buffer, L = w[g], (w.hasAO || this._AOEnabled) && w[g + "Shaded"] && (L = w[g + "Shaded"]), !L)
                       continue;
-                    E && this.setBlending(!0), this.setDepthTest($.depthTest), this.setDepthWrite($.depthWrite), this.setPolygonOffset($.polygonOffset, $.polygonOffsetFactor, $.polygonOffsetUnits);
+                    E && this.setBlending(!0), this.setDepthTest(L.depthTest), this.setDepthWrite(L.depthWrite), this.setPolygonOffset(L.polygonOffset, L.polygonOffsetFactor, L.polygonOffsetUnits);
                     var U = k._modelViewMatrix.isReflected();
-                    if (this.setMaterialFaces($, U), this.renderBuffer(b, c, _, $, L, k), (this._outlineEnabled || $.outline) && !$.wireframe && $.shaderID !== "basic" && $.opacity !== 0) {
+                    if (this.setMaterialFaces(L, U), this.renderBuffer(b, c, _, L, $, k), (this._outlineEnabled || L.outline) && !L.wireframe && L.shaderID !== "basic" && L.opacity !== 0) {
                       let N = this._outlineMaterial;
-                      $.shaderID == "sphereimposter" ? N = this._outlineSphereImposterMaterial : $.shaderID == "stickimposter" && (N = this._outlineStickImposterMaterial), this.renderBuffer(b, c, _, N, L, k);
+                      L.shaderID == "sphereimposter" ? N = this._outlineSphereImposterMaterial : L.shaderID == "stickimposter" && (N = this._outlineStickImposterMaterial), this.renderBuffer(b, c, _, N, $, k);
                     }
                   }
               }
-              renderSprites(u, g, p) {
-                this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1, this._lightsNeedUpdate = !0, this.sprites.render(u, g, this._currentWidth, this._currentHeight, p), this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1;
+              renderSprites(u, p, g) {
+                this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1, this._lightsNeedUpdate = !0, this.sprites.render(u, p, this._currentWidth, this._currentHeight, g), this._currentGeometryGroupHash = -1, this._currentProgram = null, this._currentCamera = null, this._oldDepthWrite = -1, this._oldDepthTest = -1, this._oldDoubleSided = -1, this._currentMaterialId = -1, this._oldFlipSided = -1;
               }
             }
           }
@@ -28398,7 +28414,7 @@ ATOM`, b);
                 this.sprite.attributes.position = this.gl.getAttribLocation(this.sprite.program, "position"), this.sprite.attributes.uv = this.gl.getAttribLocation(this.sprite.program, "uv"), v.uvOffset = this.gl.getUniformLocation(this.sprite.program, "uvOffset"), v.uvScale = this.gl.getUniformLocation(this.sprite.program, "uvScale"), v.rotation = this.gl.getUniformLocation(this.sprite.program, "rotation"), v.scale = this.gl.getUniformLocation(this.sprite.program, "scale"), v.alignment = this.gl.getUniformLocation(this.sprite.program, "alignment"), v.color = this.gl.getUniformLocation(this.sprite.program, "color"), v.map = this.gl.getUniformLocation(this.sprite.program, "map"), v.opacity = this.gl.getUniformLocation(this.sprite.program, "opacity"), v.useScreenCoordinates = this.gl.getUniformLocation(this.sprite.program, "useScreenCoordinates"), v.screenPosition = this.gl.getUniformLocation(this.sprite.program, "screenPosition"), v.modelViewMatrix = this.gl.getUniformLocation(this.sprite.program, "modelViewMatrix"), v.projectionMatrix = this.gl.getUniformLocation(this.sprite.program, "projectionMatrix"), v.fogType = this.gl.getUniformLocation(this.sprite.program, "fogType"), v.fogDensity = this.gl.getUniformLocation(this.sprite.program, "fogDensity"), v.fogNear = this.gl.getUniformLocation(this.sprite.program, "fogNear"), v.fogFar = this.gl.getUniformLocation(this.sprite.program, "fogFar"), v.fogColor = this.gl.getUniformLocation(this.sprite.program, "fogColor"), v.alphaTest = this.gl.getUniformLocation(this.sprite.program, "alphaTest"), this.sprite.uniforms = v;
               }
               render(o, d, v, f, y) {
-                var A, x, M, m, l, u, g, p, b, c;
+                var A, x, M, m, l, u, p, g, b, c;
                 if (!this.gl)
                   throw new Error("WebGLRenderer not initialized");
                 let _ = [];
@@ -28411,10 +28427,10 @@ ATOM`, b);
                 const w = this.sprite.attributes, k = this.sprite.uniforms;
                 if (!k)
                   throw new Error("Uniforms not defined");
-                var L = v * 0.5, $ = f * 0.5;
+                var $ = v * 0.5, L = f * 0.5;
                 this.gl.useProgram(this.sprite.program), this.gl.enableVertexAttribArray(w.position), this.gl.enableVertexAttribArray(w.uv), this.gl.disable(this.gl.CULL_FACE), this.gl.enable(this.gl.BLEND), this.gl.bindBuffer(this.gl.ARRAY_BUFFER, this.sprite.vertexBuffer), this.gl.vertexAttribPointer(w.position, 2, this.gl.FLOAT, !1, 16, 0), this.gl.vertexAttribPointer(w.uv, 2, this.gl.FLOAT, !1, 16, 8), this.gl.bindBuffer(this.gl.ELEMENT_ARRAY_BUFFER, this.sprite.elementBuffer), this.gl.uniformMatrix4fv(k.projectionMatrix, !1, d.projectionMatrix.elements), this.gl.activeTexture(this.gl.TEXTURE0), this.gl.uniform1i(k.map, 0);
-                var z = 0, O = 0, R = o.fog;
-                R ? (this.gl.uniform3f(k.fogColor, R.color.r, R.color.g, R.color.b), this.gl.uniform1f(k.fogNear, R.near), this.gl.uniform1f(k.fogFar, R.far), this.gl.uniform1i(k.fogType, 1), z = 1, O = 1) : (this.gl.uniform1i(k.fogType, 0), z = 0, O = 0);
+                var z = 0, F = 0, R = o.fog;
+                R ? (this.gl.uniform3f(k.fogColor, R.color.r, R.color.g, R.color.b), this.gl.uniform1f(k.fogNear, R.near), this.gl.uniform1f(k.fogFar, R.far), this.gl.uniform1i(k.fogType, 1), z = 1, F = 1) : (this.gl.uniform1i(k.fogType, 0), z = 0, F = 0);
                 var P;
                 let U, N, B, W, V = [];
                 for (P = 0; P < E; P++)
@@ -28423,9 +28439,9 @@ ATOM`, b);
                   if (U = _[P], N = U.material, !!N && !(!U.visible || N.opacity === 0) && N.map && N.map.image && N.map.image.width) {
                     this.gl.uniform1f(k?.alphaTest || null, N.alphaTest);
                     var G = N.map.image.width, H = N.map.image.height;
-                    V[0] = G * this.renderer.devicePixelRatio / v, V[1] = H * this.renderer.devicePixelRatio / f, N.useScreenCoordinates === !0 ? (this.gl.uniform1i(k.useScreenCoordinates, 1), this.gl.uniform3f(k.screenPosition, (U.position.x * this.renderer.devicePixelRatio - L) / L, ($ - U.position.y * this.renderer.devicePixelRatio) / $, Math.max(0, Math.min(1, U.position.z)))) : (this.gl.uniform1i(k.useScreenCoordinates, 0), this.gl.uniformMatrix4fv(k.modelViewMatrix, !1, U._modelViewMatrix.elements)), o.fog && N.fog ? W = O : W = 0, z !== W && (this.gl.uniform1i(k.fogType, W), z = W), B = 1 / (N.scaleByViewport ? f : 1), V[0] *= B * U.scale.x, V[1] *= B * U.scale.y;
+                    V[0] = G * this.renderer.devicePixelRatio / v, V[1] = H * this.renderer.devicePixelRatio / f, N.useScreenCoordinates === !0 ? (this.gl.uniform1i(k.useScreenCoordinates, 1), this.gl.uniform3f(k.screenPosition, (U.position.x * this.renderer.devicePixelRatio - $) / $, (L - U.position.y * this.renderer.devicePixelRatio) / L, Math.max(0, Math.min(1, U.position.z)))) : (this.gl.uniform1i(k.useScreenCoordinates, 0), this.gl.uniformMatrix4fv(k.modelViewMatrix, !1, U._modelViewMatrix.elements)), o.fog && N.fog ? W = F : W = 0, z !== W && (this.gl.uniform1i(k.fogType, W), z = W), B = 1 / (N.scaleByViewport ? f : 1), V[0] *= B * U.scale.x, V[1] *= B * U.scale.y;
                     let Q = (x = N?.alignment) === null || x === void 0 ? void 0 : x.x, te = (M = N?.alignment) === null || M === void 0 ? void 0 : M.y;
-                    N.screenOffset && (Q = (Q || 0) + 2 * N.screenOffset.x / G, te = (te || 0) + 2 * N.screenOffset.y / H), this.gl.uniform2f(k.uvScale, ((m = N?.uvScale) === null || m === void 0 ? void 0 : m.x) || 1, ((l = N?.uvScale) === null || l === void 0 ? void 0 : l.y) || 1), this.gl.uniform2f(k.uvOffset, ((u = N?.uvOffset) === null || u === void 0 ? void 0 : u.x) || 0, ((g = N?.uvOffset) === null || g === void 0 ? void 0 : g.y) || 0), this.gl.uniform2f(k.alignment, Q || 0, te || 0), this.gl.uniform1f(k.opacity, N.opacity), this.gl.uniform3f(k.color, ((p = N?.color) === null || p === void 0 ? void 0 : p.r) || 0, ((b = N?.color) === null || b === void 0 ? void 0 : b.g) || 0, ((c = N?.color) === null || c === void 0 ? void 0 : c.b) || 0), this.gl.uniform1f(k.rotation, U.rotation), this.gl.uniform2fv(k.scale, V), this.renderer.setDepthTest(N.depthTest), this.renderer.setDepthWrite(N.depthWrite), this.renderer.setTexture(N.map, 0), this.gl.drawElements(this.gl.TRIANGLES, 6, this.gl.UNSIGNED_SHORT, 0);
+                    N.screenOffset && (Q = (Q || 0) + 2 * N.screenOffset.x / G, te = (te || 0) + 2 * N.screenOffset.y / H), this.gl.uniform2f(k.uvScale, ((m = N?.uvScale) === null || m === void 0 ? void 0 : m.x) || 1, ((l = N?.uvScale) === null || l === void 0 ? void 0 : l.y) || 1), this.gl.uniform2f(k.uvOffset, ((u = N?.uvOffset) === null || u === void 0 ? void 0 : u.x) || 0, ((p = N?.uvOffset) === null || p === void 0 ? void 0 : p.y) || 0), this.gl.uniform2f(k.alignment, Q || 0, te || 0), this.gl.uniform1f(k.opacity, N.opacity), this.gl.uniform3f(k.color, ((g = N?.color) === null || g === void 0 ? void 0 : g.r) || 0, ((b = N?.color) === null || b === void 0 ? void 0 : b.g) || 0, ((c = N?.color) === null || c === void 0 ? void 0 : c.b) || 0), this.gl.uniform1f(k.rotation, U.rotation), this.gl.uniform2fv(k.scale, V), this.renderer.setDepthTest(N.depthTest), this.renderer.setDepthWrite(N.depthWrite), this.renderer.setTexture(N.map, 0), this.gl.drawElements(this.gl.TRIANGLES, 6, this.gl.UNSIGNED_SHORT, 0);
                   }
                 this.gl.enable(this.gl.CULL_FACE);
               }
@@ -28878,8 +28894,8 @@ ATOM`, b);
                     throw new Error("vertex array not initialized");
                   if (!M)
                     throw new Error("normal array not initialized");
-                  for (var m, l, u, g, p, b, c, _ = 0; _ < A.length / 3; ++_)
-                    m = A[_ * 3] * 3, l = A[_ * 3 + 1] * 3, u = A[_ * 3 + 2] * 3, g = new s.Vector3(x[m], x[m + 1], x[m + 2]), p = new s.Vector3(x[l], x[l + 1], x[l + 2]), b = new s.Vector3(x[u], x[u + 1], x[u + 2]), g.subVectors(g, p), b.subVectors(b, p), b.cross(g), c = b, c.normalize(), M[m] += c.x, M[l] += c.x, M[u] += c.x, M[m + 1] += c.y, M[l + 1] += c.y, M[u + 1] += c.y, M[m + 2] += c.z, M[l + 2] += c.z, M[u + 2] += c.z;
+                  for (var m, l, u, p, g, b, c, _ = 0; _ < A.length / 3; ++_)
+                    m = A[_ * 3] * 3, l = A[_ * 3 + 1] * 3, u = A[_ * 3 + 2] * 3, p = new s.Vector3(x[m], x[m + 1], x[m + 2]), g = new s.Vector3(x[l], x[l + 1], x[l + 2]), b = new s.Vector3(x[u], x[u + 1], x[u + 2]), p.subVectors(p, g), b.subVectors(b, g), b.cross(p), c = b, c.normalize(), M[m] += c.x, M[l] += c.x, M[u] += c.x, M[m + 1] += c.y, M[l + 1] += c.y, M[u + 1] += c.y, M[m + 2] += c.z, M[l + 2] += c.z, M[u + 2] += c.z;
                 }
               }
               /* sets line index array from face arr
@@ -28893,13 +28909,13 @@ ATOM`, b);
                   if (this.lineidx = this.faceidx * 2, !A)
                     throw new Error("face array not initialized");
                   for (var M = 0; M < this.faceidx / 3; ++M) {
-                    var m = M * 3, l = m * 2, u = A[m], g = A[m + 1], p = A[m + 2];
-                    x[l] = u, x[l + 1] = g, x[l + 2] = u, x[l + 3] = p, x[l + 4] = g, x[l + 5] = p;
+                    var m = M * 3, l = m * 2, u = A[m], p = A[m + 1], g = A[m + 2];
+                    x[l] = u, x[l + 1] = p, x[l + 2] = u, x[l + 3] = g, x[l + 4] = p, x[l + 5] = g;
                   }
                 }
               }
               vrml(A, x) {
-                var M, m, l, u, g, p, b, c, _, E, w, k, L, $, z, O, R, P, U = "";
+                var M, m, l, u, p, g, b, c, _, E, w, k, $, L, z, F, R, P, U = "";
                 if (U += A + `Shape {
 ` + A + ` appearance Appearance {
 ` + A + `  material Material {
@@ -28923,7 +28939,7 @@ ATOM`, b);
                   let B, W, V;
                   for (let G = 0; G < this.vertices; ++G) {
                     let H = G * 3;
-                    B = (u = this.vertexArray) === null || u === void 0 ? void 0 : u[H], W = (g = this.vertexArray) === null || g === void 0 ? void 0 : g[H + 1], V = (p = this.vertexArray) === null || p === void 0 ? void 0 : p[H + 2], U += A + "   " + B + " " + W + " " + V + `,
+                    B = (u = this.vertexArray) === null || u === void 0 ? void 0 : u[H], W = (p = this.vertexArray) === null || p === void 0 ? void 0 : p[H + 1], V = (g = this.vertexArray) === null || g === void 0 ? void 0 : g[H + 2], U += A + "   " + B + " " + W + " " + V + `,
 `;
                   }
                   if (U += A + `  ]
@@ -28974,7 +28990,7 @@ ATOM`, b);
 `;
                   for (let G = 0; G < this.vertices; ++G) {
                     let H = G * 3;
-                    B = (L = this.normalArray) === null || L === void 0 ? void 0 : L[H], W = ($ = this.normalArray) === null || $ === void 0 ? void 0 : $[H + 1], V = (z = this.normalArray) === null || z === void 0 ? void 0 : z[H + 2], U += A + "   " + B + " " + W + " " + V + `,
+                    B = ($ = this.normalArray) === null || $ === void 0 ? void 0 : $[H], W = (L = this.normalArray) === null || L === void 0 ? void 0 : L[H + 1], V = (z = this.normalArray) === null || z === void 0 ? void 0 : z[H + 2], U += A + "   " + B + " " + W + " " + V + `,
 `;
                   }
                   if (U += A + `  ]
@@ -28995,7 +29011,7 @@ ATOM`, b);
                   U += A + ` coordIndex [
 `;
                   for (let G = 0; G < this.faceidx; G += 3)
-                    B = (O = this.faceArray) === null || O === void 0 ? void 0 : O[G], W = (R = this.faceArray) === null || R === void 0 ? void 0 : R[G + 1], V = (P = this.faceArray) === null || P === void 0 ? void 0 : P[G + 2], U += A + "  " + B + ", " + W + ", " + V + `, -1,
+                    B = (F = this.faceArray) === null || F === void 0 ? void 0 : F[G], W = (R = this.faceArray) === null || R === void 0 ? void 0 : R[G + 1], V = (P = this.faceArray) === null || P === void 0 ? void 0 : P[G + 2], U += A + "  " + B + ", " + W + ", " + V + `, -1,
 `;
                   U += A + ` ]
 `, U += A + `}
@@ -29004,8 +29020,8 @@ ATOM`, b);
                 return U += N + "}", U;
               }
               truncateArrayBuffers(A = !0, x = !1) {
-                var M = this.vertexArray, m = this.colorArray, l = this.normalArray, u = this.faceArray, g = this.lineArray, p = this.radiusArray;
-                this.vertexArray = M?.subarray(0, this.vertices * 3) || null, this.colorArray = m?.subarray(0, this.vertices * 3) || null, A ? (this.normalArray = l?.subarray(0, this.vertices * 3) || null, this.faceArray = u?.subarray(0, this.faceidx) || null, this.lineidx > 0 ? this.lineArray = g?.subarray(0, this.lineidx) || null : this.lineArray = new Uint16Array(0)) : (this.normalArray = new Float32Array(0), this.faceArray = new Uint16Array(0), this.lineArray = new Uint16Array(0)), p && (this.radiusArray = p.subarray(0, this.vertices)), x && (this.normalArray && (this.normalArray = new Float32Array(this.normalArray)), this.faceArray && (this.faceArray = new Uint16Array(this.faceArray)), this.lineArray && (this.lineArray = new Uint16Array(this.lineArray)), this.vertexArray && (this.vertexArray = new Float32Array(this.vertexArray)), this.colorArray && (this.colorArray = new Float32Array(this.colorArray)), this.radiusArray && (this.radiusArray = new Float32Array(this.radiusArray))), this.__inittedArrays = !0;
+                var M = this.vertexArray, m = this.colorArray, l = this.normalArray, u = this.faceArray, p = this.lineArray, g = this.radiusArray;
+                this.vertexArray = M?.subarray(0, this.vertices * 3) || null, this.colorArray = m?.subarray(0, this.vertices * 3) || null, A ? (this.normalArray = l?.subarray(0, this.vertices * 3) || null, this.faceArray = u?.subarray(0, this.faceidx) || null, this.lineidx > 0 ? this.lineArray = p?.subarray(0, this.lineidx) || null : this.lineArray = new Uint16Array(0)) : (this.normalArray = new Float32Array(0), this.faceArray = new Uint16Array(0), this.lineArray = new Uint16Array(0)), g && (this.radiusArray = g.subarray(0, this.vertices)), x && (this.normalArray && (this.normalArray = new Float32Array(this.normalArray)), this.faceArray && (this.faceArray = new Uint16Array(this.faceArray)), this.lineArray && (this.lineArray = new Uint16Array(this.lineArray)), this.vertexArray && (this.vertexArray = new Float32Array(this.vertexArray)), this.colorArray && (this.colorArray = new Float32Array(this.colorArray)), this.radiusArray && (this.radiusArray = new Float32Array(this.radiusArray))), this.__inittedArrays = !0;
               }
             }
             class v extends a.EventDispatcher {
@@ -29282,70 +29298,70 @@ ATOM`, b);
               /*! ../shapes */
               "./src/WebGL/shapes/index.ts"
             );
-            const s = (g, p) => g.distance - p.distance, h = new r.Matrix4();
+            const s = (p, g) => p.distance - g.distance, h = new r.Matrix4();
             class o {
-              constructor(p, b, c, _) {
-                this.precision = 1e-4, this.linePrecision = 0.2, this.ray = new r.Ray(p, b), this.ray.direction.lengthSq() > 0 && this.ray.direction.normalize(), this.near = _ || 0, this.far = c || 1 / 0;
+              constructor(g, b, c, _) {
+                this.precision = 1e-4, this.linePrecision = 0.2, this.ray = new r.Ray(g, b), this.ray.direction.lengthSq() > 0 && this.ray.direction.normalize(), this.near = _ || 0, this.far = c || 1 / 0;
               }
-              set(p, b) {
-                this.ray.set(p, b);
+              set(g, b) {
+                this.ray.set(g, b);
               }
-              setFromCamera(p, b) {
-                b.ortho ? (this.ray.origin.set(p.x, p.y, (b.near + b.far) / (b.near - b.far)).unproject(b), this.ray.direction.set(0, 0, -1).transformDirection(b.matrixWorld)) : (this.ray.origin.setFromMatrixPosition(b.matrixWorld), this.ray.direction.set(p.x, p.y, p.z), b.projectionMatrixInverse.getInverse(b.projectionMatrix), h.multiplyMatrices(b.matrixWorld, b.projectionMatrixInverse), this.ray.direction.applyProjection(h), this.ray.direction.sub(this.ray.origin).normalize());
+              setFromCamera(g, b) {
+                b.ortho ? (this.ray.origin.set(g.x, g.y, (b.near + b.far) / (b.near - b.far)).unproject(b), this.ray.direction.set(0, 0, -1).transformDirection(b.matrixWorld)) : (this.ray.origin.setFromMatrixPosition(b.matrixWorld), this.ray.direction.set(g.x, g.y, g.z), b.projectionMatrixInverse.getInverse(b.projectionMatrix), h.multiplyMatrices(b.matrixWorld, b.projectionMatrixInverse), this.ray.direction.applyProjection(h), this.ray.direction.sub(this.ray.origin).normalize());
               }
-              intersectObjects(p, b) {
+              intersectObjects(g, b) {
                 for (var c = [], _ = 0, E = b.length; _ < E; _++)
-                  u(p, b[_], this, c);
+                  u(g, b[_], this, c);
                 return c.sort(s), c;
               }
             }
-            const d = (g) => Math.min(Math.max(g, -1), 1);
+            const d = (p) => Math.min(Math.max(p, -1), 1);
             var v = new a.Sphere(), f = new a.Cylinder(), y = new a.Triangle(), A = new r.Vector3(), x = new r.Vector3(), M = new r.Vector3(), m = new r.Vector3(), l = new r.Vector3();
-            function u(g, p, b, c) {
-              if (l.getPositionFromMatrix(g.matrixWorld), p.intersectionShape === void 0)
+            function u(p, g, b, c) {
+              if (l.getPositionFromMatrix(p.matrixWorld), g.intersectionShape === void 0)
                 return c;
-              var _ = p.intersectionShape, E = b.linePrecision;
-              E *= g.matrixWorld.getMaxScaleOnAxis();
+              var _ = g.intersectionShape, E = b.linePrecision;
+              E *= p.matrixWorld.getMaxScaleOnAxis();
               var w = E * E;
-              if (p.boundingSphere !== void 0 && p.boundingSphere instanceof a.Sphere && (v.copy(p.boundingSphere), v.applyMatrix4(g.matrixWorld), !b.ray.isIntersectionSphere(v)))
+              if (g.boundingSphere !== void 0 && g.boundingSphere instanceof a.Sphere && (v.copy(g.boundingSphere), v.applyMatrix4(p.matrixWorld), !b.ray.isIntersectionSphere(v)))
                 return c;
-              var k, L, $, z, O, R, P, U, N, B, W, V, G, H;
-              for (k = 0, L = _.triangle.length; k < L; k++)
+              var k, $, L, z, F, R, P, U, N, B, W, V, G, H;
+              for (k = 0, $ = _.triangle.length; k < $; k++)
                 if (_.triangle[k] instanceof a.Triangle) {
-                  if (y.copy(_.triangle[k]), y.applyMatrix4(g.matrixWorld), $ = y.getNormal(), z = b.ray.direction.dot($), z >= 0 || (A.subVectors(y.a, b.ray.origin), P = $.dot(A) / z, P < 0))
+                  if (y.copy(_.triangle[k]), y.applyMatrix4(p.matrixWorld), L = y.getNormal(), z = b.ray.direction.dot(L), z >= 0 || (A.subVectors(y.a, b.ray.origin), P = L.dot(A) / z, P < 0))
                     continue;
                   x.copy(b.ray.direction).multiplyScalar(P).add(b.ray.origin), x.sub(y.a), M.copy(y.b).sub(y.a), m.copy(y.c).sub(y.a);
                   var Q = M.dot(m), te = M.lengthSq(), ee = m.lengthSq();
                   if (V = (te * x.dot(m) - Q * x.dot(M)) / (te * ee - Q * Q), V < 0 || V > 1 || (W = (x.dot(M) - V * Q) / te, W < 0 || W > 1 || W + V > 1))
                     continue;
-                  c.push({ clickable: p, distance: P });
+                  c.push({ clickable: g, distance: P });
                 }
-              for (k = 0, L = _.cylinder.length; k < L; k++)
+              for (k = 0, $ = _.cylinder.length; k < $; k++)
                 if (_.cylinder[k] instanceof a.Cylinder) {
-                  if (f.copy(_.cylinder[k]), f.applyMatrix4(g.matrixWorld), A.subVectors(f.c1, b.ray.origin), O = A.dot(f.direction), R = A.dot(b.ray.direction), z = d(b.ray.direction.dot(f.direction)), N = 1 - z * z, N === 0)
+                  if (f.copy(_.cylinder[k]), f.applyMatrix4(p.matrixWorld), A.subVectors(f.c1, b.ray.origin), F = A.dot(f.direction), R = A.dot(b.ray.direction), z = d(b.ray.direction.dot(f.direction)), N = 1 - z * z, N === 0)
                     continue;
-                  G = (z * R - O) / N, H = (R - z * O) / N, x.copy(f.direction).multiplyScalar(G).add(f.c1), M.copy(b.ray.direction).multiplyScalar(H).add(b.ray.origin), U = m.subVectors(x, M).lengthSq();
+                  G = (z * R - F) / N, H = (R - z * F) / N, x.copy(f.direction).multiplyScalar(G).add(f.c1), M.copy(b.ray.direction).multiplyScalar(H).add(b.ray.origin), U = m.subVectors(x, M).lengthSq();
                   var ce = f.radius * f.radius;
                   if (U <= ce) {
-                    if (B = (z * O - R) * (z * O - R) - N * (A.lengthSq() - O * O - ce), B <= 0 ? V = P = Math.sqrt(U) : V = P = (R - z * O - Math.sqrt(B)) / N, W = z * V - O, W < 0 || W * W > f.lengthSq() || V < 0)
+                    if (B = (z * F - R) * (z * F - R) - N * (A.lengthSq() - F * F - ce), B <= 0 ? V = P = Math.sqrt(U) : V = P = (R - z * F - Math.sqrt(B)) / N, W = z * V - F, W < 0 || W * W > f.lengthSq() || V < 0)
                       continue;
-                    c.push({ clickable: p, distance: P });
+                    c.push({ clickable: g, distance: P });
                   }
                 }
-              for (k = 0, L = _.line.length; k < L; k += 2) {
-                x.copy(_.line[k]), x.applyMatrix4(g.matrixWorld), M.copy(_.line[k + 1]), M.applyMatrix4(g.matrixWorld), m.subVectors(M, x);
+              for (k = 0, $ = _.line.length; k < $; k += 2) {
+                x.copy(_.line[k]), x.applyMatrix4(p.matrixWorld), M.copy(_.line[k + 1]), M.applyMatrix4(p.matrixWorld), m.subVectors(M, x);
                 var fe = m.lengthSq();
                 m.normalize(), A.subVectors(x, b.ray.origin);
                 var oe = A.dot(m);
-                R = A.dot(b.ray.direction), z = d(b.ray.direction.dot(m)), N = 1 - z * z, N !== 0 && (G = (z * R - oe) / N, H = (R - z * oe) / N, x.add(m.multiplyScalar(G)), M.copy(b.ray.direction).multiplyScalar(H).add(b.ray.origin), U = m.subVectors(M, x).lengthSq(), U < w && G * G < fe && c.push({ clickable: p, distance: H }));
+                R = A.dot(b.ray.direction), z = d(b.ray.direction.dot(m)), N = 1 - z * z, N !== 0 && (G = (z * R - oe) / N, H = (R - z * oe) / N, x.add(m.multiplyScalar(G)), M.copy(b.ray.direction).multiplyScalar(H).add(b.ray.origin), U = m.subVectors(M, x).lengthSq(), U < w && G * G < fe && c.push({ clickable: g, distance: H }));
               }
-              for (k = 0, L = _.sphere.length; k < L; k++)
-                if (_.sphere[k] instanceof a.Sphere && (v.copy(_.sphere[k]), v.applyMatrix4(g.matrixWorld), b.ray.isIntersectionSphere(v))) {
+              for (k = 0, $ = _.sphere.length; k < $; k++)
+                if (_.sphere[k] instanceof a.Sphere && (v.copy(_.sphere[k]), v.applyMatrix4(p.matrixWorld), b.ray.isIntersectionSphere(v))) {
                   x.subVectors(v.center, b.ray.origin);
                   var he = x.dot(b.ray.direction);
                   if (B = he * he - (x.lengthSq() - v.radius * v.radius), he < 0)
                     return c;
-                  B <= 0 ? P = he : P = he - Math.sqrt(B), c.push({ clickable: p, distance: P });
+                  B <= 0 ? P = he : P = he - Math.sqrt(B), c.push({ clickable: g, distance: P });
                 }
               return c;
             }
@@ -30783,16 +30799,16 @@ ATOM`, b);
               "./src/WebGL/math/utils/clamp.ts"
             ), s, h, o, d, v;
             class f {
-              constructor(m = 1, l = 0, u = 0, g = 0, p = 0, b = 1, c = 0, _ = 0, E = 0, w = 0, k = 1, L = 0, $ = 0, z = 0, O = 0, R = 1) {
-                typeof m < "u" && typeof m != "number" ? this.elements = new Float32Array(m) : (this.elements = new Float32Array(16), this.elements[0] = m, this.elements[4] = l, this.elements[8] = u, this.elements[12] = g, this.elements[1] = p, this.elements[5] = b, this.elements[9] = c, this.elements[13] = _, this.elements[2] = E, this.elements[6] = w, this.elements[10] = k, this.elements[14] = L, this.elements[3] = $, this.elements[7] = z, this.elements[11] = O, this.elements[15] = R);
+              constructor(m = 1, l = 0, u = 0, p = 0, g = 0, b = 1, c = 0, _ = 0, E = 0, w = 0, k = 1, $ = 0, L = 0, z = 0, F = 0, R = 1) {
+                typeof m < "u" && typeof m != "number" ? this.elements = new Float32Array(m) : (this.elements = new Float32Array(16), this.elements[0] = m, this.elements[4] = l, this.elements[8] = u, this.elements[12] = p, this.elements[1] = g, this.elements[5] = b, this.elements[9] = c, this.elements[13] = _, this.elements[2] = E, this.elements[6] = w, this.elements[10] = k, this.elements[14] = $, this.elements[3] = L, this.elements[7] = z, this.elements[11] = F, this.elements[15] = R);
               }
               // eslint-disable-next-line no-unused-vars, class-methods-use-this
               makeScale(m, l, u) {
                 throw new Error("Method not implemented.");
               }
-              set(m, l, u, g, p, b, c, _, E, w, k, L, $, z, O, R) {
+              set(m, l, u, p, g, b, c, _, E, w, k, $, L, z, F, R) {
                 const P = this.elements;
-                return P[0] = m, P[4] = l, P[8] = u, P[12] = g, P[1] = p, P[5] = b, P[9] = c, P[13] = _, P[2] = E, P[6] = w, P[10] = k, P[14] = L, P[3] = $, P[7] = z, P[11] = O, P[15] = R, this;
+                return P[0] = m, P[4] = l, P[8] = u, P[12] = p, P[1] = g, P[5] = b, P[9] = c, P[13] = _, P[2] = E, P[6] = w, P[10] = k, P[14] = $, P[3] = L, P[7] = z, P[11] = F, P[15] = R, this;
               }
               identity() {
                 return this.set(1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1), this;
@@ -30806,21 +30822,21 @@ ATOM`, b);
                 return new A(m[0], m[4], m[8], m[1], m[5], m[9], m[2], m[6], m[10]);
               }
               setRotationFromEuler(m, l) {
-                const u = this.elements, { x: g, y: p, z: b } = m, c = Math.cos(g), _ = Math.sin(g), E = Math.cos(p), w = Math.sin(p), k = Math.cos(b), L = Math.sin(b);
+                const u = this.elements, { x: p, y: g, z: b } = m, c = Math.cos(p), _ = Math.sin(p), E = Math.cos(g), w = Math.sin(g), k = Math.cos(b), $ = Math.sin(b);
                 if (l === void 0 || l === "XYZ") {
-                  const $ = c * k, z = c * L, O = _ * k, R = _ * L;
-                  u[0] = E * k, u[4] = -E * L, u[8] = w, u[1] = z + O * w, u[5] = $ - R * w, u[9] = -_ * E, u[2] = R - $ * w, u[6] = O + z * w, u[10] = c * E;
+                  const L = c * k, z = c * $, F = _ * k, R = _ * $;
+                  u[0] = E * k, u[4] = -E * $, u[8] = w, u[1] = z + F * w, u[5] = L - R * w, u[9] = -_ * E, u[2] = R - L * w, u[6] = F + z * w, u[10] = c * E;
                 } else
                   console.error(`Error with matrix4 setRotationFromEuler. Order: ${l}`);
                 return this;
               }
               setRotationFromQuaternion(m) {
-                const l = this.elements, { x: u, y: g, z: p, w: b } = m, c = u + u, _ = g + g, E = p + p, w = u * c, k = u * _, L = u * E, $ = g * _, z = g * E, O = p * E, R = b * c, P = b * _, U = b * E;
-                return l[0] = 1 - ($ + O), l[4] = k - U, l[8] = L + P, l[1] = k + U, l[5] = 1 - (w + O), l[9] = z - R, l[2] = L - P, l[6] = z + R, l[10] = 1 - (w + $), this;
+                const l = this.elements, { x: u, y: p, z: g, w: b } = m, c = u + u, _ = p + p, E = g + g, w = u * c, k = u * _, $ = u * E, L = p * _, z = p * E, F = g * E, R = b * c, P = b * _, U = b * E;
+                return l[0] = 1 - (L + F), l[4] = k - U, l[8] = $ + P, l[1] = k + U, l[5] = 1 - (w + F), l[9] = z - R, l[2] = $ - P, l[6] = z + R, l[10] = 1 - (w + L), this;
               }
               multiplyMatrices(m, l) {
-                const u = m.elements, g = l.elements, p = this.elements, b = u[0], c = u[4], _ = u[8], E = u[12], w = u[1], k = u[5], L = u[9], $ = u[13], z = u[2], O = u[6], R = u[10], P = u[14], U = u[3], N = u[7], B = u[11], W = u[15], V = g[0], G = g[4], H = g[8], Q = g[12], te = g[1], ee = g[5], ce = g[9], fe = g[13], oe = g[2], he = g[6], Ae = g[10], Se = g[14], Ie = g[3], pe = g[7], le = g[11], ne = g[15];
-                return p[0] = b * V + c * te + _ * oe + E * Ie, p[4] = b * G + c * ee + _ * he + E * pe, p[8] = b * H + c * ce + _ * Ae + E * le, p[12] = b * Q + c * fe + _ * Se + E * ne, p[1] = w * V + k * te + L * oe + $ * Ie, p[5] = w * G + k * ee + L * he + $ * pe, p[9] = w * H + k * ce + L * Ae + $ * le, p[13] = w * Q + k * fe + L * Se + $ * ne, p[2] = z * V + O * te + R * oe + P * Ie, p[6] = z * G + O * ee + R * he + P * pe, p[10] = z * H + O * ce + R * Ae + P * le, p[14] = z * Q + O * fe + R * Se + P * ne, p[3] = U * V + N * te + B * oe + W * Ie, p[7] = U * G + N * ee + B * he + W * pe, p[11] = U * H + N * ce + B * Ae + W * le, p[15] = U * Q + N * fe + B * Se + W * ne, this;
+                const u = m.elements, p = l.elements, g = this.elements, b = u[0], c = u[4], _ = u[8], E = u[12], w = u[1], k = u[5], $ = u[9], L = u[13], z = u[2], F = u[6], R = u[10], P = u[14], U = u[3], N = u[7], B = u[11], W = u[15], V = p[0], G = p[4], H = p[8], Q = p[12], te = p[1], ee = p[5], ce = p[9], fe = p[13], oe = p[2], he = p[6], Ae = p[10], Se = p[14], Ie = p[3], pe = p[7], le = p[11], ne = p[15];
+                return g[0] = b * V + c * te + _ * oe + E * Ie, g[4] = b * G + c * ee + _ * he + E * pe, g[8] = b * H + c * ce + _ * Ae + E * le, g[12] = b * Q + c * fe + _ * Se + E * ne, g[1] = w * V + k * te + $ * oe + L * Ie, g[5] = w * G + k * ee + $ * he + L * pe, g[9] = w * H + k * ce + $ * Ae + L * le, g[13] = w * Q + k * fe + $ * Se + L * ne, g[2] = z * V + F * te + R * oe + P * Ie, g[6] = z * G + F * ee + R * he + P * pe, g[10] = z * H + F * ce + R * Ae + P * le, g[14] = z * Q + F * fe + R * Se + P * ne, g[3] = U * V + N * te + B * oe + W * Ie, g[7] = U * G + N * ee + B * he + W * pe, g[11] = U * H + N * ce + B * Ae + W * le, g[15] = U * Q + N * fe + B * Se + W * ne, this;
               }
               multiplyScalar(m) {
                 const l = this.elements;
@@ -30833,9 +30849,9 @@ ATOM`, b);
               // useful and identifying identity matrices
               snap(m) {
                 const l = Math.pow(10, 4), u = this.elements;
-                for (let g = 0; g < 16; g++) {
-                  const p = Math.round(u[g]);
-                  p === Math.round(u[g] * l) / l && (u[g] = p);
+                for (let p = 0; p < 16; p++) {
+                  const g = Math.round(u[p]);
+                  g === Math.round(u[p] * l) / l && (u[p] = g);
                 }
                 return this;
               }
@@ -30853,9 +30869,9 @@ ATOM`, b);
                 return l[12] += m.x, l[13] += m.y, l[14] += m.z, this;
               }
               getInverse(m, l) {
-                const u = this.elements, g = m.elements, p = g[0], b = g[4], c = g[8], _ = g[12], E = g[1], w = g[5], k = g[9], L = g[13], $ = g[2], z = g[6], O = g[10], R = g[14], P = g[3], U = g[7], N = g[11], B = g[15];
-                u[0] = k * R * U - L * O * U + L * z * N - w * R * N - k * z * B + w * O * B, u[4] = _ * O * U - c * R * U - _ * z * N + b * R * N + c * z * B - b * O * B, u[8] = c * L * U - _ * k * U + _ * w * N - b * L * N - c * w * B + b * k * B, u[12] = _ * k * z - c * L * z - _ * w * O + b * L * O + c * w * R - b * k * R, u[1] = L * O * P - k * R * P - L * $ * N + E * R * N + k * $ * B - E * O * B, u[5] = c * R * P - _ * O * P + _ * $ * N - p * R * N - c * $ * B + p * O * B, u[9] = _ * k * P - c * L * P - _ * E * N + p * L * N + c * E * B - p * k * B, u[13] = c * L * $ - _ * k * $ + _ * E * O - p * L * O - c * E * R + p * k * R, u[2] = w * R * P - L * z * P + L * $ * U - E * R * U - w * $ * B + E * z * B, u[6] = _ * z * P - b * R * P - _ * $ * U + p * R * U + b * $ * B - p * z * B, u[10] = b * L * P - _ * w * P + _ * E * U - p * L * U - b * E * B + p * w * B, u[14] = _ * w * $ - b * L * $ - _ * E * z + p * L * z + b * E * R - p * w * R, u[3] = k * z * P - w * O * P - k * $ * U + E * O * U + w * $ * N - E * z * N, u[7] = b * O * P - c * z * P + c * $ * U - p * O * U - b * $ * N + p * z * N, u[11] = c * w * P - b * k * P - c * E * U + p * k * U + b * E * N - p * w * N, u[15] = b * k * $ - c * w * $ + c * E * z - p * k * z - b * E * O + p * w * O;
-                const W = p * u[0] + E * u[4] + $ * u[8] + P * u[12];
+                const u = this.elements, p = m.elements, g = p[0], b = p[4], c = p[8], _ = p[12], E = p[1], w = p[5], k = p[9], $ = p[13], L = p[2], z = p[6], F = p[10], R = p[14], P = p[3], U = p[7], N = p[11], B = p[15];
+                u[0] = k * R * U - $ * F * U + $ * z * N - w * R * N - k * z * B + w * F * B, u[4] = _ * F * U - c * R * U - _ * z * N + b * R * N + c * z * B - b * F * B, u[8] = c * $ * U - _ * k * U + _ * w * N - b * $ * N - c * w * B + b * k * B, u[12] = _ * k * z - c * $ * z - _ * w * F + b * $ * F + c * w * R - b * k * R, u[1] = $ * F * P - k * R * P - $ * L * N + E * R * N + k * L * B - E * F * B, u[5] = c * R * P - _ * F * P + _ * L * N - g * R * N - c * L * B + g * F * B, u[9] = _ * k * P - c * $ * P - _ * E * N + g * $ * N + c * E * B - g * k * B, u[13] = c * $ * L - _ * k * L + _ * E * F - g * $ * F - c * E * R + g * k * R, u[2] = w * R * P - $ * z * P + $ * L * U - E * R * U - w * L * B + E * z * B, u[6] = _ * z * P - b * R * P - _ * L * U + g * R * U + b * L * B - g * z * B, u[10] = b * $ * P - _ * w * P + _ * E * U - g * $ * U - b * E * B + g * w * B, u[14] = _ * w * L - b * $ * L - _ * E * z + g * $ * z + b * E * R - g * w * R, u[3] = k * z * P - w * F * P - k * L * U + E * F * U + w * L * N - E * z * N, u[7] = b * F * P - c * z * P + c * L * U - g * F * U - b * L * N + g * z * N, u[11] = c * w * P - b * k * P - c * E * U + g * k * U + b * E * N - g * w * N, u[15] = b * k * L - c * w * L + c * E * z - g * k * z - b * E * F + g * w * F;
+                const W = g * u[0] + E * u[4] + L * u[8] + P * u[12];
                 if (W === 0) {
                   const V = "Matrix4.getInverse(): can't invert matrix, determinant is 0";
                   if (l)
@@ -30865,33 +30881,33 @@ ATOM`, b);
                 return this.multiplyScalar(1 / W), this;
               }
               isReflected() {
-                const m = this.elements, l = m[0], u = m[4], g = m[8], p = m[1], b = m[5], c = m[9], _ = m[2], E = m[6], w = m[10];
+                const m = this.elements, l = m[0], u = m[4], p = m[8], g = m[1], b = m[5], c = m[9], _ = m[2], E = m[6], w = m[10];
                 return l * b * w + // +aei
-                p * E * g + // +bfg
+                g * E * p + // +bfg
                 _ * u * c - // +cdh
-                _ * b * g - // -ceg
-                p * u * w - // -bdi
+                _ * b * p - // -ceg
+                g * u * w - // -bdi
                 l * E * c < 0;
               }
               scale(m) {
-                const l = this.elements, { x: u } = m, { y: g } = m, { z: p } = m;
-                return l[0] *= u, l[4] *= g, l[8] *= p, l[1] *= u, l[5] *= g, l[9] *= p, l[2] *= u, l[6] *= g, l[10] *= p, l[3] *= u, l[7] *= g, l[11] *= p, this;
+                const l = this.elements, { x: u } = m, { y: p } = m, { z: g } = m;
+                return l[0] *= u, l[4] *= p, l[8] *= g, l[1] *= u, l[5] *= p, l[9] *= g, l[2] *= u, l[6] *= p, l[10] *= g, l[3] *= u, l[7] *= p, l[11] *= g, this;
               }
               getMaxScaleOnAxis() {
-                const m = this.elements, l = m[0] * m[0] + m[1] * m[1] + m[2] * m[2], u = m[4] * m[4] + m[5] * m[5] + m[6] * m[6], g = m[8] * m[8] + m[9] * m[9] + m[10] * m[10];
-                return Math.sqrt(Math.max(l, Math.max(u, g)));
+                const m = this.elements, l = m[0] * m[0] + m[1] * m[1] + m[2] * m[2], u = m[4] * m[4] + m[5] * m[5] + m[6] * m[6], p = m[8] * m[8] + m[9] * m[9] + m[10] * m[10];
+                return Math.sqrt(Math.max(l, Math.max(u, p)));
               }
-              makeFrustum(m, l, u, g, p, b) {
-                const c = this.elements, _ = 2 * p / (l - m), E = 2 * p / (g - u), w = (l + m) / (l - m), k = (g + u) / (g - u), L = -(b + p) / (b - p), $ = -2 * b * p / (b - p);
-                return c[0] = _, c[4] = 0, c[8] = w, c[12] = 0, c[1] = 0, c[5] = E, c[9] = k, c[13] = 0, c[2] = 0, c[6] = 0, c[10] = L, c[14] = $, c[3] = 0, c[7] = 0, c[11] = -1, c[15] = 0, this;
+              makeFrustum(m, l, u, p, g, b) {
+                const c = this.elements, _ = 2 * g / (l - m), E = 2 * g / (p - u), w = (l + m) / (l - m), k = (p + u) / (p - u), $ = -(b + g) / (b - g), L = -2 * b * g / (b - g);
+                return c[0] = _, c[4] = 0, c[8] = w, c[12] = 0, c[1] = 0, c[5] = E, c[9] = k, c[13] = 0, c[2] = 0, c[6] = 0, c[10] = $, c[14] = L, c[3] = 0, c[7] = 0, c[11] = -1, c[15] = 0, this;
               }
-              makePerspective(m, l, u, g) {
-                const p = u * Math.tan((0, r.degToRad)(m * 0.5)), b = -p, c = b * l, _ = p * l;
-                return this.makeFrustum(c, _, b, p, u, g);
+              makePerspective(m, l, u, p) {
+                const g = u * Math.tan((0, r.degToRad)(m * 0.5)), b = -g, c = b * l, _ = g * l;
+                return this.makeFrustum(c, _, b, g, u, p);
               }
-              makeOrthographic(m, l, u, g, p, b) {
-                const c = this.elements, _ = 1 / (l - m), E = 1 / (u - g), w = 1 / (b - p), k = (l + m) * _, L = (u + g) * E, $ = (b + p) * w;
-                return c[0] = 2 * _, c[4] = 0, c[8] = 0, c[12] = -k, c[1] = 0, c[5] = 2 * E, c[9] = 0, c[13] = -L, c[2] = 0, c[6] = 0, c[10] = -2 * w, c[14] = -$, c[3] = 0, c[7] = 0, c[11] = 0, c[15] = 1, this;
+              makeOrthographic(m, l, u, p, g, b) {
+                const c = this.elements, _ = 1 / (l - m), E = 1 / (u - p), w = 1 / (b - g), k = (l + m) * _, $ = (u + p) * E, L = (b + g) * w;
+                return c[0] = 2 * _, c[4] = 0, c[8] = 0, c[12] = -k, c[1] = 0, c[5] = 2 * E, c[9] = 0, c[13] = -$, c[2] = 0, c[6] = 0, c[10] = -2 * w, c[14] = -L, c[3] = 0, c[7] = 0, c[11] = 0, c[15] = 1, this;
               }
               isEqual(m) {
                 const l = m.elements, u = this.elements;
@@ -30914,12 +30930,12 @@ ATOM`, b);
                 return m = m || new y(), o.set(l[0], l[1], l[2]), d.set(l[4], l[5], l[6]), v.set(l[8], l[9], l[10]), m.x = o.length(), m.y = d.length(), m.z = v.length(), m;
               }
               lookAt(m, l, u) {
-                const g = this.elements;
-                return v.subVectors(m, l).normalize(), v.length() === 0 && (v.z = 1), o.crossVectors(u, v).normalize(), o.length() === 0 && (v.x += 1e-4, o.crossVectors(u, v).normalize()), d.crossVectors(v, o), g[0] = o.x, g[4] = d.x, g[8] = v.x, g[1] = o.y, g[5] = d.y, g[9] = v.y, g[2] = o.z, g[6] = d.z, g[10] = v.z, this;
+                const p = this.elements;
+                return v.subVectors(m, l).normalize(), v.length() === 0 && (v.z = 1), o.crossVectors(u, v).normalize(), o.length() === 0 && (v.x += 1e-4, o.crossVectors(u, v).normalize()), d.crossVectors(v, o), p[0] = o.x, p[4] = d.x, p[8] = v.x, p[1] = o.y, p[5] = d.y, p[9] = v.y, p[2] = o.z, p[6] = d.z, p[10] = v.z, this;
               }
               compose(m, l, u) {
-                const g = this.elements;
-                return s.identity(), s.setRotationFromQuaternion(l), h.makeScale(u.x, u.y, u.z), this.multiplyMatrices(s, h), g[12] = m.x, g[13] = m.y, g[14] = m.z, this;
+                const p = this.elements;
+                return s.identity(), s.setRotationFromQuaternion(l), h.makeScale(u.x, u.y, u.z), this.multiplyMatrices(s, h), p[12] = m.x, p[13] = m.y, p[14] = m.z, this;
               }
             }
             s = new f(), h = new f();
@@ -30966,26 +30982,26 @@ ATOM`, b);
                 return Math.sqrt(this.distanceToSquared(m));
               }
               distanceToSquared(m) {
-                const l = this.x - m.x, u = this.y - m.y, g = this.z - m.z;
-                return l * l + u * u + g * g;
+                const l = this.x - m.x, u = this.y - m.y, p = this.z - m.z;
+                return l * l + u * u + p * p;
               }
               applyMatrix3(m) {
-                const { x: l } = this, { y: u } = this, { z: g } = this, p = m.elements;
-                return this.x = p[0] * l + p[3] * u + p[6] * g, this.y = p[1] * l + p[4] * u + p[7] * g, this.z = p[2] * l + p[5] * u + p[8] * g, this;
+                const { x: l } = this, { y: u } = this, { z: p } = this, g = m.elements;
+                return this.x = g[0] * l + g[3] * u + g[6] * p, this.y = g[1] * l + g[4] * u + g[7] * p, this.z = g[2] * l + g[5] * u + g[8] * p, this;
               }
               applyMatrix4(m) {
-                const { x: l } = this, { y: u } = this, { z: g } = this, p = m.elements;
-                return this.x = p[0] * l + p[4] * u + p[8] * g + p[12], this.y = p[1] * l + p[5] * u + p[9] * g + p[13], this.z = p[2] * l + p[6] * u + p[10] * g + p[14], this;
+                const { x: l } = this, { y: u } = this, { z: p } = this, g = m.elements;
+                return this.x = g[0] * l + g[4] * u + g[8] * p + g[12], this.y = g[1] * l + g[5] * u + g[9] * p + g[13], this.z = g[2] * l + g[6] * u + g[10] * p + g[14], this;
               }
               applyProjection(m) {
-                const { x: l } = this, { y: u } = this, { z: g } = this, p = m.elements, b = p[3] * l + p[7] * u + p[11] * g + p[15];
-                return this.x = (p[0] * l + p[4] * u + p[8] * g + p[12]) / b, this.y = (p[1] * l + p[5] * u + p[9] * g + p[13]) / b, this.z = (p[2] * l + p[6] * u + p[10] * g + p[14]) / b, this;
+                const { x: l } = this, { y: u } = this, { z: p } = this, g = m.elements, b = g[3] * l + g[7] * u + g[11] * p + g[15];
+                return this.x = (g[0] * l + g[4] * u + g[8] * p + g[12]) / b, this.y = (g[1] * l + g[5] * u + g[9] * p + g[13]) / b, this.z = (g[2] * l + g[6] * u + g[10] * p + g[14]) / b, this;
               }
               applyQuaternion(m) {
-                const { x: l } = this, { y: u } = this, { z: g } = this, p = m.x, b = m.y, c = m.z, _ = m.w, E = {};
-                E.x = 2 * (u * c - g * b), E.y = 2 * (g * p - l * c), E.z = 2 * (l * b - u * p);
+                const { x: l } = this, { y: u } = this, { z: p } = this, g = m.x, b = m.y, c = m.z, _ = m.w, E = {};
+                E.x = 2 * (u * c - p * b), E.y = 2 * (p * g - l * c), E.z = 2 * (l * b - u * g);
                 const w = {};
-                return w.x = E.y * c - E.z * b, w.y = E.z * p - E.x * c, w.z = E.x * b - E.y * p, this.x = l + _ * E.x + w.x, this.y = u + _ * E.y + w.y, this.z = g + _ * E.z + w.z, this;
+                return w.x = E.y * c - E.z * b, w.y = E.z * g - E.x * c, w.z = E.x * b - E.y * g, this.x = l + _ * E.x + w.x, this.y = u + _ * E.y + w.y, this.z = p + _ * E.z + w.z, this;
               }
               negate() {
                 return this.multiplyScalar(-1);
@@ -31003,8 +31019,8 @@ ATOM`, b);
                 return this.divideScalar(this.length());
               }
               cross(m) {
-                const { x: l } = this, { y: u } = this, { z: g } = this;
-                return this.x = u * m.z - g * m.y, this.y = g * m.x - l * m.z, this.z = l * m.y - u * m.x, this;
+                const { x: l } = this, { y: u } = this, { z: p } = this;
+                return this.x = u * m.z - p * m.y, this.y = p * m.x - l * m.z, this.z = l * m.y - u * m.x, this;
               }
               crossVectors(m, l) {
                 return this.x = m.y * l.z - m.z * l.y, this.y = m.z * l.x - m.x * l.z, this.z = m.x * l.y - m.y * l.x, this;
@@ -31016,12 +31032,12 @@ ATOM`, b);
                 return this.x = m.elements[12], this.y = m.elements[13], this.z = m.elements[14], this;
               }
               setEulerFromRotationMatrix(m, l) {
-                const u = m.elements, g = u[0], p = u[4], b = u[8], c = u[5], _ = u[9], E = u[6], w = u[10];
-                return l === void 0 || l === "XYZ" ? (this.y = Math.asin((0, a.clamp)(b, -1, 1)), Math.abs(b) < 0.99999 ? (this.x = Math.atan2(-_, w), this.z = Math.atan2(-p, g)) : (this.x = Math.atan2(E, c), this.z = 0)) : console.error(`Error with vector's setEulerFromRotationMatrix: Unknown order: ${l}`), this;
+                const u = m.elements, p = u[0], g = u[4], b = u[8], c = u[5], _ = u[9], E = u[6], w = u[10];
+                return l === void 0 || l === "XYZ" ? (this.y = Math.asin((0, a.clamp)(b, -1, 1)), Math.abs(b) < 0.99999 ? (this.x = Math.atan2(-_, w), this.z = Math.atan2(-g, p)) : (this.x = Math.atan2(E, c), this.z = 0)) : console.error(`Error with vector's setEulerFromRotationMatrix: Unknown order: ${l}`), this;
               }
               rotateAboutVector(m, l) {
                 m.normalize();
-                const u = Math.cos(l), g = Math.sin(l), p = this.clone().multiplyScalar(u), b = m.clone().cross(this).multiplyScalar(g), c = m.clone().multiplyScalar(m.clone().dot(this)).multiplyScalar(1 - u), _ = p.add(b).add(c);
+                const u = Math.cos(l), p = Math.sin(l), g = this.clone().multiplyScalar(u), b = m.clone().cross(this).multiplyScalar(p), c = m.clone().multiplyScalar(m.clone().dot(this)).multiplyScalar(1 - u), _ = g.add(b).add(c);
                 return this.x = _.x, this.y = _.y, this.z = _.z, this;
               }
               setFromMatrixPosition(m) {
@@ -31030,8 +31046,8 @@ ATOM`, b);
               }
               // unproject is defined after Matrix4
               transformDirection(m) {
-                const { x: l } = this, { y: u } = this, { z: g } = this, p = m.elements;
-                return this.x = p[0] * l + p[4] * u + p[8] * g, this.y = p[1] * l + p[5] * u + p[9] * g, this.z = p[2] * l + p[6] * u + p[10] * g, this.normalize();
+                const { x: l } = this, { y: u } = this, { z: p } = this, g = m.elements;
+                return this.x = g[0] * l + g[4] * u + g[8] * p, this.y = g[1] * l + g[5] * u + g[9] * p, this.z = g[2] * l + g[6] * u + g[10] * p, this.normalize();
               }
               clone() {
                 return new y(this.x, this.y, this.z);
@@ -31043,12 +31059,12 @@ ATOM`, b);
             }
             o = new y(), d = new y(), v = new y();
             class A {
-              constructor(m = 1, l = 0, u = 0, g = 0, p = 1, b = 0, c = 0, _ = 0, E = 1) {
-                this.elements = new Float32Array(9), this.set(m, l, u, g, p, b, c, _, E);
+              constructor(m = 1, l = 0, u = 0, p = 0, g = 1, b = 0, c = 0, _ = 0, E = 1) {
+                this.elements = new Float32Array(9), this.set(m, l, u, p, g, b, c, _, E);
               }
-              set(m, l, u, g, p, b, c, _, E) {
+              set(m, l, u, p, g, b, c, _, E) {
                 const w = this.elements;
-                return w[0] = m, w[3] = l, w[6] = u, w[1] = g, w[4] = p, w[7] = b, w[2] = c, w[5] = _, w[8] = E, this;
+                return w[0] = m, w[3] = l, w[6] = u, w[1] = p, w[4] = g, w[7] = b, w[2] = c, w[5] = _, w[8] = E, this;
               }
               identity() {
                 return this.set(1, 0, 0, 0, 1, 0, 0, 0, 1), this;
@@ -31064,20 +31080,20 @@ ATOM`, b);
               getInverse3(m) {
                 const l = m.elements, u = this.elements;
                 u[0] = l[4] * l[8] - l[5] * l[7], u[3] = l[6] * l[5] - l[3] * l[8], u[6] = l[3] * l[7] - l[6] * l[4], u[1] = l[7] * l[2] - l[1] * l[8], u[4] = l[0] * l[8] - l[6] * l[2], u[7] = l[1] * l[6] - l[0] * l[7], u[2] = l[1] * l[5] - l[2] * l[4], u[5] = l[2] * l[3] - l[0] * l[5], u[8] = l[0] * l[4] - l[1] * l[3];
-                const g = l[0] * u[0] + l[3] * u[1] + l[6] * u[2];
-                return this.multiplyScalar(1 / g), this;
+                const p = l[0] * u[0] + l[3] * u[1] + l[6] * u[2];
+                return this.multiplyScalar(1 / p), this;
               }
               getInverse(m, l) {
-                const u = m.elements, g = this.elements;
-                g[0] = u[10] * u[5] - u[6] * u[9], g[1] = -u[10] * u[1] + u[2] * u[9], g[2] = u[6] * u[1] - u[2] * u[5], g[3] = -u[10] * u[4] + u[6] * u[8], g[4] = u[10] * u[0] - u[2] * u[8], g[5] = -u[6] * u[0] + u[2] * u[4], g[6] = u[9] * u[4] - u[5] * u[8], g[7] = -u[9] * u[0] + u[1] * u[8], g[8] = u[5] * u[0] - u[1] * u[4];
-                const p = u[0] * g[0] + u[1] * g[3] + u[2] * g[6];
-                if (p === 0) {
+                const u = m.elements, p = this.elements;
+                p[0] = u[10] * u[5] - u[6] * u[9], p[1] = -u[10] * u[1] + u[2] * u[9], p[2] = u[6] * u[1] - u[2] * u[5], p[3] = -u[10] * u[4] + u[6] * u[8], p[4] = u[10] * u[0] - u[2] * u[8], p[5] = -u[6] * u[0] + u[2] * u[4], p[6] = u[9] * u[4] - u[5] * u[8], p[7] = -u[9] * u[0] + u[1] * u[8], p[8] = u[5] * u[0] - u[1] * u[4];
+                const g = u[0] * p[0] + u[1] * p[3] + u[2] * p[6];
+                if (g === 0) {
                   const b = "Matrix3.getInverse(): can't invert matrix, determinant is 0";
                   if (l)
                     throw new Error(b);
                   return console.warn(b), this.identity(), this;
                 }
-                return this.multiplyScalar(1 / p), this;
+                return this.multiplyScalar(1 / g), this;
               }
               // https://en.wikipedia.org/wiki/Determinant
               getDeterminant() {
@@ -31123,8 +31139,8 @@ ATOM`, b);
               closestPointToPoint(m, l) {
                 const u = l || new y();
                 u.subVectors(m, this.origin);
-                const g = u.dot(this.direction);
-                return u.copy(this.direction).multiplyScalar(g).add(this.origin);
+                const p = u.dot(this.direction);
+                return u.copy(this.direction).multiplyScalar(p).add(this.origin);
               }
               distanceToPoint(m) {
                 const l = o, u = l.subVectors(m, this.origin).dot(this.direction);
@@ -31605,7 +31621,7 @@ ATOM`, b);
               /* harmony export */
               ShaderLib: () => (
                 /* binding */
-                g
+                p
               ),
               /* harmony export */
               basic: () => (
@@ -31720,7 +31736,7 @@ ATOM`, b);
               /*! ./blur */
               "./src/WebGL/shaders/lib/blur/index.ts"
             );
-            const g = {
+            const p = {
               basic: r.basic,
               blur: u.blur,
               instanced: a.instanced,
@@ -32773,50 +32789,50 @@ ATOM`, b);
                 d = !0, y = y ?? null;
                 var l = 0;
                 document.querySelectorAll(".viewer_3Dmoljs").forEach((u) => {
-                  var g = [], p = [], b = "";
+                  var p = [], g = [], b = "";
                   u.style.position == "static" && (u.style.position = "relative");
                   var c = null;
                   if (m = null, u.dataset.pdb)
-                    g.push("https://files.rcsb.org/view/" + u.dataset.pdb + ".pdb"), p.push("pdb");
+                    p.push("https://files.rcsb.org/view/" + u.dataset.pdb + ".pdb"), g.push("pdb");
                   else if (u.dataset.cid)
-                    p.push("sdf"), g.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + u.dataset.cid + "/SDF?record_type=3d");
+                    g.push("sdf"), p.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + u.dataset.cid + "/SDF?record_type=3d");
                   else if (u.dataset.href || u.dataset.url) {
-                    if (u.dataset.href ? b = u.dataset.href : b = u.dataset.url, g.push(b), m = b.substring(b.lastIndexOf(".") + 1), m == "gz") {
+                    if (u.dataset.href ? b = u.dataset.href : b = u.dataset.url, p.push(b), m = b.substring(b.lastIndexOf(".") + 1), m == "gz") {
                       let pe = b.substring(0, b.lastIndexOf(".")).lastIndexOf(".");
                       m = b.substring(pe + 1);
                     }
-                    p.push(m);
+                    g.push(m);
                     var _ = b.substring(b.lastIndexOf("/") + 1, b.lastIndexOf("."));
-                    _ == "/" && (_ = b.substring(b.lastIndexOf("/") + 1)), u.dataset[p[p.length - 1]] = _;
+                    _ == "/" && (_ = b.substring(b.lastIndexOf("/") + 1)), u.dataset[g[g.length - 1]] = _;
                   }
                   let E = u.dataset;
                   for (x in E)
-                    x.substring(0, 3) === "pdb" && x !== "pdb" ? (g.push("https://files.rcsb.org/view/" + E[x] + ".pdb"), p.push("pdb")) : x.substring(0, 4) === "href" && x !== "href" ? (b = E[x], g.push(b), p.push(b.substring(b.lastIndexOf(".") + 1))) : x.substring(0, 3) === "cid" && x !== "cid" && (g.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + E[x] + "/SDF?record_type=3d"), p.push("sdf"));
+                    x.substring(0, 3) === "pdb" && x !== "pdb" ? (p.push("https://files.rcsb.org/view/" + E[x] + ".pdb"), g.push("pdb")) : x.substring(0, 4) === "href" && x !== "href" ? (b = E[x], p.push(b), g.push(b.substring(b.lastIndexOf(".") + 1))) : x.substring(0, 3) === "cid" && x !== "cid" && (p.push("https://pubchem.ncbi.nlm.nih.gov/rest/pug/compound/cid/" + E[x] + "/SDF?record_type=3d"), g.push("sdf"));
                   var w = {};
                   u.dataset.options && (w = (0, s.specStringToObject)(u.dataset.options));
-                  var k = h.CC.color(u.dataset.backgroundcolor), L = u.dataset.backgroundalpha;
-                  L = L == null ? 1 : parseFloat(L);
-                  var $ = { line: {} };
-                  u.dataset.style && ($ = (0, s.specStringToObject)(u.dataset.style));
+                  var k = h.CC.color(u.dataset.backgroundcolor), $ = u.dataset.backgroundalpha;
+                  $ = $ == null ? 1 : parseFloat($);
+                  var L = { line: {} };
+                  u.dataset.style && (L = (0, s.specStringToObject)(u.dataset.style));
                   var z = {};
                   u.dataset.select && (z = (0, s.specStringToObject)(u.dataset.select));
-                  var O = [], R = [], P = [], U = {}, N = null, B = u.dataset, W = /style(.+)/, V = /surface(.*)/, G = /labelres(.*)/, H = [];
+                  var F = [], R = [], P = [], U = {}, N = null, B = u.dataset, W = /style(.+)/, V = /surface(.*)/, G = /labelres(.*)/, H = [];
                   for (M in B)
                     Object.prototype.hasOwnProperty.call(B, M) && H.push(M);
                   for (H.sort(), x = 0; x < H.length; x++) {
                     M = H[x];
                     var Q = W.exec(M), te, ee, ce;
-                    Q && (te = "select" + Q[1], ee = (0, s.specStringToObject)(B[te]), ce = (0, s.specStringToObject)(B[M]), O.push([ee, ce])), Q = V.exec(M), Q && (te = "select" + Q[1], ee = (0, s.specStringToObject)(B[te]), ce = (0, s.specStringToObject)(B[M]), R.push([ee, ce])), Q = G.exec(M), Q && (te = "select" + Q[1], ee = (0, s.specStringToObject)(B[te]), ce = (0, s.specStringToObject)(B[M]), P.push([ee, ce])), M == "zoomto" && (U = (0, s.specStringToObject)(B[M])), M == "spin" && (N = (0, s.specStringToObject)(B[M]));
+                    Q && (te = "select" + Q[1], ee = (0, s.specStringToObject)(B[te]), ce = (0, s.specStringToObject)(B[M]), F.push([ee, ce])), Q = V.exec(M), Q && (te = "select" + Q[1], ee = (0, s.specStringToObject)(B[te]), ce = (0, s.specStringToObject)(B[M]), R.push([ee, ce])), Q = G.exec(M), Q && (te = "select" + Q[1], ee = (0, s.specStringToObject)(B[te]), ce = (0, s.specStringToObject)(B[M]), P.push([ee, ce])), M == "zoomto" && (U = (0, s.specStringToObject)(B[M])), M == "spin" && (N = (0, s.specStringToObject)(B[M]));
                   }
                   var fe = function(pe) {
-                    for (pe.setStyle(z, $), c && c.createSelectionAndStyle(z, $), x = 0; x < O.length; x++) {
-                      let le = O[x][0] || {}, ne = O[x][1] || { line: {} };
-                      pe.setStyle(le, ne), c && c.createSelectionAndStyle(z, $);
+                    for (pe.setStyle(z, L), c && c.createSelectionAndStyle(z, L), x = 0; x < F.length; x++) {
+                      let le = F[x][0] || {}, ne = F[x][1] || { line: {} };
+                      pe.setStyle(le, ne), c && c.createSelectionAndStyle(z, L);
                     }
                     for (x = 0; x < R.length; x++) {
                       let le = R[x][0] || {}, ne = R[x][1] || {};
-                      c ? pe.addSurface(a.SurfaceType.VDW, ne, le, le).then((Fe) => {
-                        c.loadSurface("VDW", le, ne, Fe);
+                      c ? pe.addSurface(a.SurfaceType.VDW, ne, le, le).then((Oe) => {
+                        c.loadSurface("VDW", le, ne, Oe);
                       }) : pe.addSurface(a.SurfaceType.VDW, ne, le, le);
                     }
                     for (x = 0; x < P.length; x++) {
@@ -32828,21 +32844,21 @@ ATOM`, b);
                   let oe = y;
                   try {
                     var he = (0, s.specStringToObject)(u.dataset.config) || {};
-                    he.backgroundColor === void 0 && (he.backgroundColor = k), he.backgroundAlpha === void 0 && (he.backgroundAlpha = L), oe == null ? oe = v[u.id || l++] = (0, r.createViewer)(u, he) : (oe.setBackgroundColor(k, L), oe.setConfig(he), c && c.initiateUI()), u.dataset.ui && $3Dmol.StateManager && (c = new $3Dmol.StateManager(oe));
+                    he.backgroundColor === void 0 && (he.backgroundColor = k), he.backgroundAlpha === void 0 && (he.backgroundAlpha = $), oe == null ? oe = v[u.id || l++] = (0, r.createViewer)(u, he) : (oe.setBackgroundColor(k, $), oe.setConfig(he), c && c.initiateUI()), u.dataset.ui && $3Dmol.StateManager && (c = new $3Dmol.StateManager(oe));
                   } catch (pe) {
                     console.log(pe), u.textContent = "WebGL appears to be disabled.";
                   }
-                  if (g.length != 0) {
-                    let pe = 0, le = /* @__PURE__ */ ((ne, Te) => function(Fe) {
-                      b = g[pe];
-                      var Be = ne.dataset.type || ne.dataset.datatype || p[pe];
-                      if (Te.addModel(Fe, Be, w), c) {
-                        var Ue = ne.dataset[p[pe]];
+                  if (p.length != 0) {
+                    let pe = 0, le = /* @__PURE__ */ ((ne, Te) => function(Oe) {
+                      b = p[pe];
+                      var Be = ne.dataset.type || ne.dataset.datatype || g[pe];
+                      if (Te.addModel(Oe, Be, w), c) {
+                        var Ue = ne.dataset[g[pe]];
                         c.setModelTitle(Ue);
                       }
-                      pe += 1, pe < g.length ? (0, s.get)(g[pe]).then(le) : (fe(Te), ne.dataset.callback && (0, s.makeFunction)(ne.dataset.callback)(Te), d = !1, A && A(Te));
+                      pe += 1, pe < p.length ? (0, s.get)(p[pe]).then(le) : (fe(Te), ne.dataset.callback && (0, s.makeFunction)(ne.dataset.callback)(Te), d = !1, A && A(Te));
                     })(u, oe);
-                    m && m.endsWith("gz") ? (0, s.getbin)(g[0]).then(le) : (0, s.get)(g[0]).then(le);
+                    m && m.endsWith("gz") ? (0, s.getbin)(p[0]).then(le) : (0, s.get)(p[0]).then(le);
                   } else {
                     if (u.dataset.element) {
                       var Ae = "#" + u.dataset.element, Se = document.querySelector(Ae), Ie = Se ? Se.textContent : "";
@@ -32961,10 +32977,10 @@ ATOM`, b);
                   if (l) {
                     l[1] != "" && console.log("WARNING: Opacity value in rgba ignored.  Specify separately as opacity attribute.");
                     let u = 0;
-                    for (let g = 2; g < 5; g++) {
+                    for (let p = 2; p < 5; p++) {
                       u *= 256;
-                      let p = l[g].endsWith("%") ? 255 * parseFloat(l[g]) / 100 : parseFloat(l[g]);
-                      u += Math.round(p);
+                      let g = l[p].endsWith("%") ? 255 * parseFloat(l[p]) / 100 : parseFloat(l[p]);
+                      u += Math.round(g);
                     }
                     return u;
                   }
@@ -33579,17 +33595,17 @@ ATOM`, b);
               /*! ./utilities */
               "./src/utilities.ts"
             );
-            function f(O, R) {
-              var P = [], U = O;
-              U = [], U.push(O[0]);
+            function f(F, R) {
+              var P = [], U = F;
+              U = [], U.push(F[0]);
               var N, B, W, V, G, H, Q, te, ee;
-              for (N = 1, B = O.length - 1; N < B; N++)
-                if (G = O[N], H = O[N + 1], G.smoothen) {
+              for (N = 1, B = F.length - 1; N < B; N++)
+                if (G = F[N], H = F[N + 1], G.smoothen) {
                   var ce = new r.Vector3((G.x + H.x) / 2, (G.y + H.y) / 2, (G.z + H.z) / 2);
                   ce.atom = G.atom, U.push(ce);
                 } else
                   U.push(G);
-              for (U.push(O[O.length - 1]), N = -1, W = U.length; N <= W - 3; N++)
+              for (U.push(F[F.length - 1]), N = -1, W = U.length; N <= W - 3; N++)
                 if (V = U[N === -1 ? 0 : N], G = U[N + 1], H = U[N + 2], Q = U[N === W - 3 ? W - 1 : N + 3], te = new r.Vector3().subVectors(H, V).multiplyScalar(0.5), ee = new r.Vector3().subVectors(Q, G).multiplyScalar(0.5), !H.skip)
                   for (var fe = 0; fe < R; fe++) {
                     var oe = 1 / R * fe, he = G.x + oe * te.x + oe * oe * (-3 * G.x + 3 * H.x - 2 * te.x - ee.x) + oe * oe * oe * (2 * G.x - 2 * H.x + te.x + ee.x), Ae = G.y + oe * te.y + oe * oe * (-3 * G.y + 3 * H.y - 2 * te.y - ee.y) + oe * oe * oe * (2 * G.y - 2 * H.y + te.y + ee.y), Se = G.z + oe * te.z + oe * oe * (-3 * G.z + 3 * H.z - 2 * te.z - ee.z) + oe * oe * oe * (2 * G.z - 2 * H.z + te.z + ee.z), Ie = new r.Vector3(he, Ae, Se);
@@ -33598,10 +33614,10 @@ ATOM`, b);
               return P.push(U[U.length - 1]), P;
             }
             const y = 0.5, A = 1.3, x = 0.8, M = 0.4, m = 0.4;
-            function l(O, R, P, U) {
+            function l(F, R, P, U) {
               for (var N, B, W, V, G = 0, H = R.length; G < H; G++) {
                 V = Math.round(G * (U.length - 1) / H), W = o.CC.color(U[V]);
-                var Q = O.updateGeoGroup(2), te = Q.vertexArray, ee = Q.colorArray, ce = Q.faceArray;
+                var Q = F.updateGeoGroup(2), te = Q.vertexArray, ee = Q.colorArray, ce = Q.faceArray;
                 N = Q.vertices, B = N * 3, te[B] = R[G].x, te[B + 1] = R[G].y, te[B + 2] = R[G].z, te[B + 3] = P[G].x, te[B + 4] = P[G].y, te[B + 5] = P[G].z;
                 for (var fe = 0; fe < 6; ++fe)
                   ee[B + 3 * fe] = W.r, ee[B + 1 + 3 * fe] = W.g, ee[B + 2 + 3 * fe] = W.b;
@@ -33612,14 +33628,14 @@ ATOM`, b);
                 Q.vertices += 2;
               }
             }
-            function u(O, R, P, U, N, B, W) {
+            function u(F, R, P, U, N, B, W) {
               var V, G, H, Q;
               if (H = R.length, H < 2 || R[0].length < 2)
                 return;
               for (V = 0; V < H; V++)
                 R[V] = f(R[V], U);
               if (Q = R[0].length, !N)
-                return l(O, R[0], R[H - 1], P);
+                return l(F, R[0], R[H - 1], P);
               var te, ee, ce, fe, oe, he, Ae = [], Se = [], Ie = [];
               for (G = 0; G < H; G++)
                 Ae.push(0.25 + 1.5 * Math.sqrt((H - 1) * G - Math.pow(G, 2)) / (H - 1)), Se.push(0.5), Ie.push(2 * (Math.pow(G / H, 2) - G / H) + 0.6);
@@ -33632,11 +33648,11 @@ ATOM`, b);
                 G + 1 - 4 * H,
                 G - 2 * H
               ];
-              var le, ne, Te, Fe, Be, Ue, Pe, Ge, Ne, Re;
-              let De = O.updateGeoGroup();
+              var le, ne, Te, Oe, Be, Ue, Pe, Ge, Ne, Re;
+              let De = F.updateGeoGroup();
               for (V = 0; V < Q; V++) {
-                let q = O.groups, re = !1;
-                De = O.updateGeoGroup(2 * H), q != O.groups && V > 0 && (V = V - 1, re = !0), Ue = Math.round(V * (P.length - 1) / Q), Be = o.CC.color(P[Ue]), oe = ce, he = fe, ce = [], fe = [], te = [], R[0][V].atom !== void 0 && (Fe = R[0][V].atom, W === "oval" ? ee = Ae : W === "rectangle" ? ee = Se : W === "parabola" && (ee = Ie)), ee || (ee = Se);
+                let q = F.groups, re = !1;
+                De = F.updateGeoGroup(2 * H), q != F.groups && V > 0 && (V = V - 1, re = !0), Ue = Math.round(V * (P.length - 1) / Q), Be = o.CC.color(P[Ue]), oe = ce, he = fe, ce = [], fe = [], te = [], R[0][V].atom !== void 0 && (Oe = R[0][V].atom, W === "oval" ? ee = Ae : W === "rectangle" ? ee = Se : W === "parabola" && (ee = Ie)), ee || (ee = Se);
                 var je, Xe;
                 for (G = 0; G < H; G++)
                   V < Q - 1 ? je = R[G][V + 1].clone().sub(R[G][V]) : je = R[G][V - 1].clone().sub(R[G][V]).negate(), G < H - 1 ? Xe = R[G + 1][V].clone().sub(R[G][V]) : Xe = R[G - 1][V].clone().sub(R[G][V]).negate(), te[G] = Xe.cross(je).normalize().multiplyScalar(N * ee[G]);
@@ -33658,11 +33674,11 @@ ATOM`, b);
                       le + pe[G][2],
                       le + pe[G][3]
                     ], Te = De.faceidx, Ne[Te] = Re[0], Ne[Te + 1] = Re[1], Ne[Te + 2] = Re[3], Ne[Te + 3] = Re[1], Ne[Te + 4] = Re[2], Ne[Te + 5] = Re[3], De.faceidx += 6;
-                  if (Fe.clickable || Fe.hoverable) {
+                  if (Oe.clickable || Oe.hoverable) {
                     var X = [];
                     X.push(new a.Triangle(oe[0], ce[0], ce[H - 1])), X.push(new a.Triangle(oe[0], ce[H - 1], oe[H - 1])), X.push(new a.Triangle(oe[H - 1], ce[H - 1], fe[H - 1])), X.push(new a.Triangle(oe[H - 1], fe[H - 1], he[H - 1])), X.push(new a.Triangle(fe[0], he[0], he[H - 1])), X.push(new a.Triangle(fe[H - 1], fe[0], he[H - 1])), X.push(new a.Triangle(ce[0], oe[0], he[0])), X.push(new a.Triangle(fe[0], ce[0], he[0]));
                     for (G in X)
-                      Fe.intersectionShape.triangle.push(X[G]);
+                      Oe.intersectionShape.triangle.push(X[G]);
                   }
                 }
                 De.vertices += 2 * H;
@@ -33677,38 +33693,38 @@ ATOM`, b);
                   le - 2 * H + V
                 ], Te = De.faceidx, Ne[Te] = Re[0], Ne[Te + 1] = Re[1], Ne[Te + 2] = Re[3], Ne[Te + 3] = Re[1], Ne[Te + 4] = Re[2], Ne[Te + 5] = Re[3], De.faceidx += 6;
             }
-            function g(O, R, P, U, N, B) {
+            function p(F, R, P, U, N, B) {
               if (!(R.length < 2)) {
                 var W, V;
                 if (W = R[0], V = R[R.length - 1], W = f(W, U), V = f(V, U), !N)
-                  return l(O, W, V, P);
+                  return l(F, W, V, P);
                 var G = [], H, Q, te, ee, ce, fe = [
                   [0, 2, -6, -8],
                   [-4, -2, 6, 4],
                   [7, -1, -5, 3],
                   [-3, 5, 1, -7]
-                ], oe, he, Ae, Se, Ie, pe, le, ne, Te, Fe, Be, Ue, Pe, Ge, Ne, Re, De;
+                ], oe, he, Ae, Se, Ie, pe, le, ne, Te, Oe, Be, Ue, Pe, Ge, Ne, Re, De;
                 for (ne = 0, Te = W.length; ne < Te; ne++) {
                   if (Ie = Math.round(ne * (P.length - 1) / Te), Se = o.CC.color(P[Ie]), G.push(Q = W[ne]), G.push(Q), G.push(te = V[ne]), G.push(te), ne < Te - 1) {
                     var je = W[ne + 1].clone().sub(W[ne]), Xe = V[ne].clone().sub(W[ne]);
                     H = Xe.cross(je).normalize().multiplyScalar(N);
                   }
-                  for (G.push(ee = W[ne].clone().add(H)), G.push(ee), G.push(ce = V[ne].clone().add(H)), G.push(ce), Q.atom !== void 0 && (pe = Q.atom), Ge = O.updateGeoGroup(8), Ne = Ge.vertexArray, Re = Ge.colorArray, De = Ge.faceArray, oe = Ge.vertices, he = oe * 3, Ne[he] = Q.x, Ne[he + 1] = Q.y, Ne[he + 2] = Q.z, Ne[he + 3] = Q.x, Ne[he + 4] = Q.y, Ne[he + 5] = Q.z, Ne[he + 6] = te.x, Ne[he + 7] = te.y, Ne[he + 8] = te.z, Ne[he + 9] = te.x, Ne[he + 10] = te.y, Ne[he + 11] = te.z, Ne[he + 12] = ee.x, Ne[he + 13] = ee.y, Ne[he + 14] = ee.z, Ne[he + 15] = ee.x, Ne[he + 16] = ee.y, Ne[he + 17] = ee.z, Ne[he + 18] = ce.x, Ne[he + 19] = ce.y, Ne[he + 20] = ce.z, Ne[he + 21] = ce.x, Ne[he + 22] = ce.y, Ne[he + 23] = ce.z, Fe = 0; Fe < 8; ++Fe)
-                    Re[he + 3 * Fe] = Se.r, Re[he + 1 + 3 * Fe] = Se.g, Re[he + 2 + 3 * Fe] = Se.b;
+                  for (G.push(ee = W[ne].clone().add(H)), G.push(ee), G.push(ce = V[ne].clone().add(H)), G.push(ce), Q.atom !== void 0 && (pe = Q.atom), Ge = F.updateGeoGroup(8), Ne = Ge.vertexArray, Re = Ge.colorArray, De = Ge.faceArray, oe = Ge.vertices, he = oe * 3, Ne[he] = Q.x, Ne[he + 1] = Q.y, Ne[he + 2] = Q.z, Ne[he + 3] = Q.x, Ne[he + 4] = Q.y, Ne[he + 5] = Q.z, Ne[he + 6] = te.x, Ne[he + 7] = te.y, Ne[he + 8] = te.z, Ne[he + 9] = te.x, Ne[he + 10] = te.y, Ne[he + 11] = te.z, Ne[he + 12] = ee.x, Ne[he + 13] = ee.y, Ne[he + 14] = ee.z, Ne[he + 15] = ee.x, Ne[he + 16] = ee.y, Ne[he + 17] = ee.z, Ne[he + 18] = ce.x, Ne[he + 19] = ce.y, Ne[he + 20] = ce.z, Ne[he + 21] = ce.x, Ne[he + 22] = ce.y, Ne[he + 23] = ce.z, Oe = 0; Oe < 8; ++Oe)
+                    Re[he + 3 * Oe] = Se.r, Re[he + 1 + 3 * Oe] = Se.g, Re[he + 2 + 3 * Oe] = Se.b;
                   if (ne > 0) {
                     var X = le !== void 0 && pe !== void 0 && le.serial !== pe.serial;
-                    for (Fe = 0; Fe < 4; Fe++) {
+                    for (Oe = 0; Oe < 4; Oe++) {
                       var q = [
-                        oe + fe[Fe][0],
-                        oe + fe[Fe][1],
-                        oe + fe[Fe][2],
-                        oe + fe[Fe][3]
+                        oe + fe[Oe][0],
+                        oe + fe[Oe][1],
+                        oe + fe[Oe][2],
+                        oe + fe[Oe][3]
                       ];
                       if (Ae = Ge.faceidx, De[Ae] = q[0], De[Ae + 1] = q[1], De[Ae + 2] = q[3], De[Ae + 3] = q[1], De[Ae + 4] = q[2], De[Ae + 5] = q[3], Ge.faceidx += 6, pe.clickable || le.clickable || pe.hoverable || le.hoverable) {
                         var re = G[q[3]].clone(), ye = G[q[0]].clone(), me = G[q[2]].clone(), ze = G[q[1]].clone();
                         if (re.atom = G[q[3]].atom || null, me.atom = G[q[2]].atom || null, ye.atom = G[q[0]].atom || null, ze.atom = G[q[1]].atom || null, X) {
                           var ke = re.clone().add(ye).multiplyScalar(0.5), K = me.clone().add(ze).multiplyScalar(0.5), ae = re.clone().add(ze).multiplyScalar(0.5);
-                          Fe % 2 === 0 ? ((le.clickable || le.hoverable) && (Be = new a.Triangle(ke, ae, re), Ue = new a.Triangle(K, me, ae), Pe = new a.Triangle(ae, me, re), le.intersectionShape.triangle.push(Be), le.intersectionShape.triangle.push(Ue), le.intersectionShape.triangle.push(Pe)), (pe.clickable || pe.hoverable) && (Be = new a.Triangle(ye, ze, ae), Ue = new a.Triangle(ze, K, ae), Pe = new a.Triangle(ye, ae, ke), pe.intersectionShape.triangle.push(Be), pe.intersectionShape.triangle.push(Ue), pe.intersectionShape.triangle.push(Pe))) : ((pe.clickable || pe.hoverable) && (Be = new a.Triangle(ke, ae, re), Ue = new a.Triangle(K, me, ae), Pe = new a.Triangle(ae, me, re), pe.intersectionShape.triangle.push(Be), pe.intersectionShape.triangle.push(Ue), pe.intersectionShape.triangle.push(Pe)), (le.clickable || le.hoverable) && (Be = new a.Triangle(ye, ze, ae), Ue = new a.Triangle(ze, K, ae), Pe = new a.Triangle(ye, ae, ke), le.intersectionShape.triangle.push(Be), le.intersectionShape.triangle.push(Ue), le.intersectionShape.triangle.push(Pe)));
+                          Oe % 2 === 0 ? ((le.clickable || le.hoverable) && (Be = new a.Triangle(ke, ae, re), Ue = new a.Triangle(K, me, ae), Pe = new a.Triangle(ae, me, re), le.intersectionShape.triangle.push(Be), le.intersectionShape.triangle.push(Ue), le.intersectionShape.triangle.push(Pe)), (pe.clickable || pe.hoverable) && (Be = new a.Triangle(ye, ze, ae), Ue = new a.Triangle(ze, K, ae), Pe = new a.Triangle(ye, ae, ke), pe.intersectionShape.triangle.push(Be), pe.intersectionShape.triangle.push(Ue), pe.intersectionShape.triangle.push(Pe))) : ((pe.clickable || pe.hoverable) && (Be = new a.Triangle(ke, ae, re), Ue = new a.Triangle(K, me, ae), Pe = new a.Triangle(ae, me, re), pe.intersectionShape.triangle.push(Be), pe.intersectionShape.triangle.push(Ue), pe.intersectionShape.triangle.push(Pe)), (le.clickable || le.hoverable) && (Be = new a.Triangle(ye, ze, ae), Ue = new a.Triangle(ze, K, ae), Pe = new a.Triangle(ye, ae, ke), le.intersectionShape.triangle.push(Be), le.intersectionShape.triangle.push(Ue), le.intersectionShape.triangle.push(Pe)));
                         } else (pe.clickable || pe.hoverable) && (Be = new a.Triangle(ye, ze, re), Ue = new a.Triangle(ze, me, re), pe.intersectionShape.triangle.push(Be), pe.intersectionShape.triangle.push(Ue));
                       }
                     }
@@ -33716,7 +33732,7 @@ ATOM`, b);
                   Ge.vertices += 8, le = pe;
                 }
                 var ge = G.length - 8;
-                for (Ge = O.updateGeoGroup(8), Ne = Ge.vertexArray, Re = Ge.colorArray, De = Ge.faceArray, oe = Ge.vertices, he = oe * 3, Ae = Ge.faceidx, ne = 0; ne < 4; ne++) {
+                for (Ge = F.updateGeoGroup(8), Ne = Ge.vertexArray, Re = Ge.colorArray, De = Ge.faceArray, oe = Ge.vertices, he = oe * 3, Ae = Ge.faceidx, ne = 0; ne < 4; ne++) {
                   G.push(G[ne * 2]), G.push(G[ge + ne * 2]);
                   var xe = G[ne * 2], ue = G[ge + ne * 2];
                   Ne[he + 6 * ne] = xe.x, Ne[he + 1 + 6 * ne] = xe.y, Ne[he + 2 + 6 * ne] = xe.z, Ne[he + 3 + 6 * ne] = ue.x, Ne[he + 4 + 6 * ne] = ue.y, Ne[he + 5 + 6 * ne] = ue.z, Re[he + 6 * ne] = Se.r, Re[he + 1 + 6 * ne] = Se.g, Re[he + 2 + 6 * ne] = Se.b, Re[he + 3 + 6 * ne] = Se.r, Re[he + 4 + 6 * ne] = Se.g, Re[he + 5 + 6 * ne] = Se.b;
@@ -33724,36 +33740,36 @@ ATOM`, b);
                 ge += 8, Be = [oe, oe + 2, oe + 6, oe + 4], Ue = [oe + 1, oe + 5, oe + 7, oe + 3], De[Ae] = Be[0], De[Ae + 1] = Be[1], De[Ae + 2] = Be[3], De[Ae + 3] = Be[1], De[Ae + 4] = Be[2], De[Ae + 5] = Be[3], De[Ae + 6] = Ue[0], De[Ae + 7] = Ue[1], De[Ae + 8] = Ue[3], De[Ae + 9] = Ue[1], De[Ae + 10] = Ue[2], De[Ae + 11] = Ue[3], Ge.faceidx += 12, Ge.vertices += 8;
               }
             }
-            function p(O, R, P, U, N, B, W) {
-              (!W || W === "default") && (W = "rectangle"), W === "edged" ? g(O, R, P, U, N) : (W === "rectangle" || W === "oval" || W === "parabola") && u(O, R, P, U, N, B, W);
+            function g(F, R, P, U, N, B, W) {
+              (!W || W === "default") && (W = "rectangle"), W === "edged" ? p(F, R, P, U, N) : (W === "rectangle" || W === "oval" || W === "parabola") && u(F, R, P, U, N, B, W);
             }
-            function b(O) {
-              return O && O.elem === "C" && O.atom === "CA";
+            function b(F) {
+              return F && F.elem === "C" && F.atom === "CA";
             }
-            function c(O, R) {
-              if (O && R && O.chain === R.chain) {
-                if (!O.hetflag && !R.hetflag && O.reschain === R.reschain && (O.resi === R.resi || O.resi === R.resi - 1))
+            function c(F, R) {
+              if (F && R && F.chain === R.chain) {
+                if (!F.hetflag && !R.hetflag && F.reschain === R.reschain && (F.resi === R.resi || F.resi === R.resi - 1))
                   return !0;
-                if (O.resi < R.resi) {
-                  var P = O.x - R.x, U = O.y - R.y, N = O.z - R.z, B = P * P + U * U + N * N;
-                  if (O.atom == "CA" && R.atom == "CA" && B < 16)
+                if (F.resi < R.resi) {
+                  var P = F.x - R.x, U = F.y - R.y, N = F.z - R.z, B = P * P + U * U + N * N;
+                  if (F.atom == "CA" && R.atom == "CA" && B < 16)
                     return !0;
-                  if ((O.atom == "P" || R.atom == "P") && B < 64)
+                  if ((F.atom == "P" || R.atom == "P") && B < 64)
                     return !0;
                 }
               }
               return !1;
             }
-            function _(O, R, P, U, N) {
+            function _(F, R, P, U, N) {
               if (!(R == null || R.vertices == 0)) {
                 N && (R.initTypedArrays(), R.setUpNormals());
                 var B = new s.MeshDoubleLambertMaterial();
                 B.vertexColors = s.Coloring.FaceColors, typeof P == "number" && P >= 0 && P < 1 && (B.transparent = !0, B.opacity = P), B.outline = U;
                 var W = new s.Mesh(R, B);
-                O.add(W);
+                F.add(W);
               }
             }
-            function E(O, R, P, U, N, B, W, V, G) {
+            function E(F, R, P, U, N, B, W, V, G) {
               var H, Q, te, ee, ce, fe;
               if (!(!U || !N || !W)) {
                 var oe = N.sub(U);
@@ -33768,11 +33784,11 @@ ATOM`, b);
                   oe.rotateAboutVector(Se, 0.43);
                 }
                 for (W.style.cartoon.ribbon ? H = W.style.cartoon.thickness || M : W.style.cartoon.width ? H = W.style.cartoon.width : W.ss === "c" ? W.atom === "P" ? H = x : H = y : W.ss === "arrow start" ? (H = A, ce = !0) : W.ss === "arrow end" || W.ss === "h" && W.style.cartoon.tubes || W.ss === "tube start" ? H = y : H = A, B != null && oe.dot(B) < 0 && oe.negate(), oe.multiplyScalar(H), Q = 0; Q < R; Q++)
-                  te = -1 + Q * 2 / (R - 1), ee = new r.Vector3(U.x + te * oe.x, U.y + te * oe.y, U.z + te * oe.z), ee.atom = W, W.ss === "s" && (ee.smoothen = !0), O[Q].push(ee);
+                  te = -1 + Q * 2 / (R - 1), ee = new r.Vector3(U.x + te * oe.x, U.y + te * oe.y, U.z + te * oe.z), ee.atom = W, W.ss === "s" && (ee.smoothen = !0), F[Q].push(ee);
                 if (ce)
                   for (oe.multiplyScalar(2), Q = 0; Q < R; Q++)
-                    te = -1 + Q * 2 / (R - 1), ee = new r.Vector3(U.x + te * oe.x, U.y + te * oe.y, U.z + te * oe.z), ee.atom = W, ee.smoothen = !1, ee.skip = !0, O[Q].push(ee);
-                return fe = W.style.cartoon.style || "default", O.style ? O.style != fe && (console.log("Warning: a cartoon chain's strand-style is ambiguous"), O.style = "default") : O.style = fe, (W.ss === "arrow start" || W.ss === "arrow end") && (W.ss = "s"), ce;
+                    te = -1 + Q * 2 / (R - 1), ee = new r.Vector3(U.x + te * oe.x, U.y + te * oe.y, U.z + te * oe.z), ee.atom = W, ee.smoothen = !1, ee.skip = !0, F[Q].push(ee);
+                return fe = W.style.cartoon.style || "default", F.style ? F.style != fe && (console.log("Warning: a cartoon chain's strand-style is ambiguous"), F.style = "default") : F.style = fe, (W.ss === "arrow start" || W.ss === "arrow end") && (W.ss = "s"), ce;
               }
             }
             const w = {
@@ -33792,14 +33808,14 @@ ATOM`, b);
               "C2*": !0,
               N1: !0,
               N3: !0
-            }, k = { DA: !0, DG: !0, A: !0, G: !0 }, L = { DT: !0, DC: !0, U: !0, C: !0, T: !0 }, $ = { DA: !0, DG: !0, A: !0, G: !0, DT: !0, DC: !0, U: !0, C: !0, T: !0 };
-            function z(O, R, P, U = 10) {
+            }, k = { DA: !0, DG: !0, A: !0, G: !0 }, $ = { DT: !0, DC: !0, U: !0, C: !0, T: !0 }, L = { DA: !0, DG: !0, A: !0, G: !0, DT: !0, DC: !0, U: !0, C: !0, T: !0 };
+            function z(F, R, P, U = 10) {
               let N = U, B = U;
-              var W, V, G, H, Q, te, ee, ce, fe, oe, he, Ae, Se, Ie, pe, le, ne, Te, Fe = new s.Geometry(!0), Be = new s.Geometry(!0), Ue = [], Pe = [], Ge = 1, Ne = !1, Re = {};
+              var W, V, G, H, Q, te, ee, ce, fe, oe, he, Ae, Se, Ie, pe, le, ne, Te, Oe = new s.Geometry(!0), Be = new s.Geometry(!0), Ue = [], Pe = [], Ge = 1, Ne = !1, Re = {};
               for (var De in h.Gradient.builtinGradients)
                 h.Gradient.builtinGradients.hasOwnProperty(De) && (Re[De] = new h.Gradient.builtinGradients[De](P[1], P[0]));
-              var je = function(Z, Oe) {
-                return P && Oe.color === "spectrum" ? Oe.colorscheme in Re ? Re[Oe.colorscheme].valueToHex(Z.resi) : Re.sinebow.valueToHex(Z.resi) : (0, v.getColorFromStyle)(Z, Oe).getHex();
+              var je = function(Z, Fe) {
+                return P && Fe.color === "spectrum" ? Fe.colorscheme in Re ? Re[Fe.colorscheme].valueToHex(Z.resi) : Re.sinebow.valueToHex(Z.resi) : (0, v.getColorFromStyle)(Z, Fe).getHex();
               };
               for (ce = 0; ce < N; ce++)
                 Pe[ce] = [];
@@ -33813,36 +33829,36 @@ ATOM`, b);
               }
               X && G.style.cartoon.tubes && (G.ss = "tube end", X = !1);
               var ye = function(Z) {
-                Pe[0].length > 0 && p(Be, Pe, Ue, B, ee, Ge, Pe.style);
-                var Oe = [], We = null;
+                Pe[0].length > 0 && g(Be, Pe, Ue, B, ee, Ge, Pe.style);
+                var Fe = [], We = null;
                 if (Z) {
                   for (ce = 0; ce < N; ce++)
-                    Oe[ce] = Pe[ce][Pe[ce].length - 1];
+                    Fe[ce] = Pe[ce][Pe[ce].length - 1];
                   We = Ue[Ue.length - 1];
                 }
                 for (Pe = [], ce = 0; ce < N; ce++)
                   Pe[ce] = [];
                 if (Ue = [], Z) {
                   for (ce = 0; ce < N; ce++)
-                    Pe[ce].push(Oe[ce]);
+                    Pe[ce].push(Fe[ce]);
                   Ue.push(We);
                 }
-                _(O, Be, Ge, Ne, !0), _(O, Fe, Ge, Ne, !1), Be = new s.Geometry(!0), Fe = new s.Geometry(!0);
+                _(F, Be, Ge, Ne, !0), _(F, Oe, Ge, Ne, !1), Be = new s.Geometry(!0), Oe = new s.Geometry(!0);
               };
               G = void 0;
               for (var me = 0; me < q.length; me++) {
                 H = q[me];
-                var ze = H.resn.trim(), ke = ze in $;
+                var ze = H.resn.trim(), ke = ze in L;
                 if (Ge = 1, W = H.style.cartoon, G && G.style.cartoon && (Ge = G.style.cartoon.opacity), G && G.style.cartoon && G.style.cartoon.outline && (Ne = G.style.cartoon.outline), G && G.style.cartoon && (!H.style.cartoon || G.style.cartoon.opacity != H.style.cartoon.opacity) && ye(G.chain == H.chain), W.style === "trace") {
                   if (!H.hetflag) {
                     if (H.elem === "C" && H.atom === "CA" || ke && H.atom === "P" || H.atom === "BB") {
                       if (te = je(H, W), (0, v.isNumeric)(W.thickness) ? ee = W.thickness : ee = M, c(G, H))
                         if (te == Q) {
                           var K = o.CC.color(te);
-                          d.GLDraw.drawCylinder(Fe, G, H, ee, K, 2, 2);
+                          d.GLDraw.drawCylinder(Oe, G, H, ee, K, 2, 2);
                         } else {
                           var ae = new r.Vector3().addVectors(G, H).multiplyScalar(0.5), ge = o.CC.color(Q), xe = o.CC.color(te);
-                          d.GLDraw.drawCylinder(Fe, G, ae, ee, ge, 2, 0), d.GLDraw.drawCylinder(Fe, ae, H, ee, xe, 0, 2);
+                          d.GLDraw.drawCylinder(Oe, G, ae, ee, ge, 2, 0), d.GLDraw.drawCylinder(Oe, ae, H, ee, xe, 0, 2);
                         }
                       if ((H.clickable === !0 || H.hoverable) && H.intersectionShape !== void 0) {
                         var ue = new r.Vector3(H.x, H.y, H.z);
@@ -33855,13 +33871,13 @@ ATOM`, b);
                   if (b(H) || ke && (H.atom === "P" || H.atom.indexOf("O5") == 0)) {
                     if (Te)
                       if (H.ss === "tube end")
-                        Te = !1, ne = new r.Vector3(H.x, H.y, H.z), d.GLDraw.drawCylinder(Fe, le, ne, 2, o.CC.color(Q), 1, 1), H.ss = "h";
+                        Te = !1, ne = new r.Vector3(H.x, H.y, H.z), d.GLDraw.drawCylinder(Oe, le, ne, 2, o.CC.color(Q), 1, 1), H.ss = "h";
                       else if (G.chain != H.chain || G.ss === "tube end")
-                        Te = !1, G.ss = "h", ne = new r.Vector3(G.x, G.y, G.z), d.GLDraw.drawCylinder(Fe, le, ne, 2, o.CC.color(Q), 1, 1);
+                        Te = !1, G.ss = "h", ne = new r.Vector3(G.x, G.y, G.z), d.GLDraw.drawCylinder(Oe, le, ne, 2, o.CC.color(Q), 1, 1);
                       else
                         continue;
                     if (G && (!c(G, H) || G.ss === "tube start")) {
-                      for (G.ss === "tube start" && (Te = !0, le = new r.Vector3(G.x, G.y, G.z), G.ss = "h"), pe && (Ae ? Ie = new r.Vector3().addVectors(G, Ae).multiplyScalar(0.5) : Ie = new r.Vector3(G.x, G.y, G.z), d.GLDraw.drawCylinder(Fe, Ie, pe, m, o.CC.color(pe.color), 0, 2), E(Pe, N, !0, Ae, Se, he, G, q, me), Ue.push(te), Ie = null, pe = null), Pe[0].length > 0 && p(Be, Pe, Ue, B, ee, Ge, Pe.style), Pe = [], ce = 0; ce < N; ce++)
+                      for (G.ss === "tube start" && (Te = !0, le = new r.Vector3(G.x, G.y, G.z), G.ss = "h"), pe && (Ae ? Ie = new r.Vector3().addVectors(G, Ae).multiplyScalar(0.5) : Ie = new r.Vector3(G.x, G.y, G.z), d.GLDraw.drawCylinder(Oe, Ie, pe, m, o.CC.color(pe.color), 0, 2), E(Pe, N, !0, Ae, Se, he, G, q, me), Ue.push(te), Ie = null, pe = null), Pe[0].length > 0 && g(Be, Pe, Ue, B, ee, Ge, Pe.style), Pe = [], ce = 0; ce < N; ce++)
                         Pe[ce] = [];
                       Ue = [];
                     }
@@ -33869,7 +33885,7 @@ ATOM`, b);
                       if (pe && G != null) {
                         Ie = new r.Vector3().addVectors(G, H).multiplyScalar(0.5);
                         var Ce = Ie.clone().sub(pe).multiplyScalar(0.02);
-                        Ie.add(Ce), d.GLDraw.drawCylinder(Fe, Ie, pe, m, o.CC.color(pe.color), 0, 2), Ie = null, pe = null;
+                        Ie.add(Ce), d.GLDraw.drawCylinder(Oe, Ie, pe, m, o.CC.color(pe.color), 0, 2), Ie = null, pe = null;
                       }
                       te = je(H, W), Ue.push(te), (0, v.isNumeric)(W.thickness) ? ee = W.thickness : ee = M, G = H, fe = new r.Vector3(G.x, G.y, G.z), fe.resi = G.resi, Q = te;
                     }
@@ -33879,11 +33895,11 @@ ATOM`, b);
                       line: [],
                       triangle: []
                     });
-                  } else G != null && (b(G) && H.atom === "O" || ke && G.atom === "P" && (H.atom === "OP2" || H.atom === "O2P") || ke && G.atom.indexOf("O5") == 0 && H.atom.indexOf("C5") == 0) ? (oe = new r.Vector3(H.x, H.y, H.z), oe.resi = H.resi, (H.atom === "OP2" || H.atom === "O2P") && (Se = new r.Vector3(H.x, H.y, H.z))) : ke && H.atom.indexOf("O3") == 0 ? Ae = new r.Vector3(H.x, H.y, H.z) : (H.atom === "N1" && ze in k || H.atom === "N3" && ze in L) && (pe = new r.Vector3(H.x, H.y, H.z), pe.color = (0, v.getColorFromStyle)(H, W).getHex());
+                  } else G != null && (b(G) && H.atom === "O" || ke && G.atom === "P" && (H.atom === "OP2" || H.atom === "O2P") || ke && G.atom.indexOf("O5") == 0 && H.atom.indexOf("C5") == 0) ? (oe = new r.Vector3(H.x, H.y, H.z), oe.resi = H.resi, (H.atom === "OP2" || H.atom === "O2P") && (Se = new r.Vector3(H.x, H.y, H.z))) : ke && H.atom.indexOf("O3") == 0 ? Ae = new r.Vector3(H.x, H.y, H.z) : (H.atom === "N1" && ze in k || H.atom === "N3" && ze in $) && (pe = new r.Vector3(H.x, H.y, H.z), pe.color = (0, v.getColorFromStyle)(H, W).getHex());
                   oe && fe && oe.resi === fe.resi && (E(Pe, N, !0, fe, oe, he, G, q, me), he = oe, fe = null, oe = null, Ue.push(te));
                 }
               }
-              pe && (Ae ? Ie = new r.Vector3().addVectors(G, Ae).multiplyScalar(0.5) : Ie = new r.Vector3(G.x, G.y, G.z), d.GLDraw.drawCylinder(Fe, Ie, pe, m, o.CC.color(pe.color), 0, 2), E(Pe, N, !0, Ae, Se, he, G, q, me), Ue.push(te)), ye(!1);
+              pe && (Ae ? Ie = new r.Vector3().addVectors(G, Ae).multiplyScalar(0.5) : Ie = new r.Vector3(G.x, G.y, G.z), d.GLDraw.drawCylinder(Oe, Ie, pe, m, o.CC.color(pe.color), 0, 2), E(Pe, N, !0, Ae, Se, he, G, q, me), Ue.push(te)), ye(!1);
             }
           }
         ),
@@ -33908,7 +33924,7 @@ ATOM`, b);
               /* harmony export */
               CONTEXTS_PER_VIEWPORT: () => (
                 /* reexport safe */
-                g.CONTEXTS_PER_VIEWPORT
+                p.CONTEXTS_PER_VIEWPORT
               ),
               /* harmony export */
               Color: () => (
@@ -33943,7 +33959,7 @@ ATOM`, b);
               /* harmony export */
               GLViewer: () => (
                 /* reexport safe */
-                g.GLViewer
+                p.GLViewer
               ),
               /* harmony export */
               GLVolumetricRender: () => (
@@ -34078,12 +34094,12 @@ ATOM`, b);
               /* harmony export */
               autoinit: () => (
                 /* reexport safe */
-                p.autoinit
+                g.autoinit
               ),
               /* harmony export */
               autoload: () => (
                 /* reexport safe */
-                p.autoload
+                g.autoload
               ),
               /* harmony export */
               base64ToArray: () => (
@@ -34123,17 +34139,17 @@ ATOM`, b);
               /* harmony export */
               createStereoViewer: () => (
                 /* reexport safe */
-                g.createStereoViewer
+                p.createStereoViewer
               ),
               /* harmony export */
               createViewer: () => (
                 /* reexport safe */
-                g.createViewer
+                p.createViewer
               ),
               /* harmony export */
               createViewerGrid: () => (
                 /* reexport safe */
-                g.createViewerGrid
+                p.createViewerGrid
               ),
               /* harmony export */
               deepCopy: () => (
@@ -34248,7 +34264,7 @@ ATOM`, b);
               /* harmony export */
               processing_autoinit: () => (
                 /* reexport safe */
-                p.processing_autoinit
+                g.processing_autoinit
               ),
               /* harmony export */
               residues: () => (
@@ -34293,7 +34309,7 @@ ATOM`, b);
               /* harmony export */
               viewers: () => (
                 /* reexport safe */
-                p.viewers
+                g.viewers
               )
               /* harmony export */
             });
@@ -34342,10 +34358,10 @@ ATOM`, b);
             ), u = t(
               /*! ./GLModel */
               "./src/GLModel.ts"
-            ), g = t(
+            ), p = t(
               /*! ./GLViewer */
               "./src/GLViewer.ts"
-            ), p = t(
+            ), g = t(
               /*! ./autoload */
               "./src/autoload.ts"
             );
@@ -34398,26 +34414,26 @@ ATOM`, b);
             class y {
               constructor(l) {
                 if (this.C = {}, l) {
-                  let u = l.getField("comp_id"), g = l.getField("atom_id_1"), p = l.getField("atom_id_2"), b = l.getField("value_order");
+                  let u = l.getField("comp_id"), p = l.getField("atom_id_1"), g = l.getField("atom_id_2"), b = l.getField("value_order");
                   for (let c = 0; c < u.length; c++) {
-                    let _ = u[c], E = g[c], w = p[c], k = b[c], L = 1;
-                    k == "doub" ? L = 2 : k == "trip" && (L = 3), this.C[_] == null && (this.C[_] = {}), this.C[_][E] == null && (this.C[_][E] = {}), this.C[_][w] == null && (this.C[_][w] = {}), this.C[_][E][w] = L, this.C[_][w][E] = L;
+                    let _ = u[c], E = p[c], w = g[c], k = b[c], $ = 1;
+                    k == "doub" ? $ = 2 : k == "trip" && ($ = 3), this.C[_] == null && (this.C[_] = {}), this.C[_][E] == null && (this.C[_][E] = {}), this.C[_][w] == null && (this.C[_][w] = {}), this.C[_][E][w] = $, this.C[_][w][E] = $;
                   }
                 }
               }
               //returns bond order, zero if not connected
-              order(l, u, g) {
-                return this.C[l] !== void 0 && this.C[l][u] !== void 0 && this.C[l][u][g] !== void 0 ? this.C[l][u][g] : 0;
+              order(l, u, p) {
+                return this.C[l] !== void 0 && this.C[l][u] !== void 0 && this.C[l][u][p] !== void 0 ? this.C[l][u][p] : 0;
               }
             }
             class A {
               constructor(l) {
                 if (this.C = [], l) {
-                  let u = l.getField("conn_type_id"), g = l.getField("ptnr1_label_asym_id"), p = l.getField("ptnr1_label_seq_id"), b = l.getField("ptnr1_label_comp_id"), c = l.getField("ptnr1_label_atom_id"), _ = l.getField("ptnr2_label_asym_id"), E = l.getField("ptnr2_label_seq_id"), w = l.getField("ptnr2_label_comp_id"), k = l.getField("ptnr2_label_atom_id"), L = l.getField("pdbx_value_order");
-                  for (let $ = 0; $ < u.length; $++)
-                    if (u[$] == "disulf" || u[$] == "covale") {
-                      let z = L ? L[$] == "" ? 1 : parseInt(L[$]) : 1;
-                      this.C.push([[g[$], p[$], b[$], c[$]], [_[$], E[$], w[$], k[$]], z]);
+                  let u = l.getField("conn_type_id"), p = l.getField("ptnr1_label_asym_id"), g = l.getField("ptnr1_label_seq_id"), b = l.getField("ptnr1_label_comp_id"), c = l.getField("ptnr1_label_atom_id"), _ = l.getField("ptnr2_label_asym_id"), E = l.getField("ptnr2_label_seq_id"), w = l.getField("ptnr2_label_comp_id"), k = l.getField("ptnr2_label_atom_id"), $ = l.getField("pdbx_value_order");
+                  for (let L = 0; L < u.length; L++)
+                    if (u[L] == "disulf" || u[L] == "covale") {
+                      let z = $ ? $[L] == "" ? 1 : parseInt($[L]) : 1;
+                      this.C.push([[p[L], g[L], b[L], c[L]], [_[L], E[L], w[L], k[L]], z]);
                     }
                 }
               }
@@ -34429,29 +34445,29 @@ ATOM`, b);
               add(l) {
                 this.R[l.lchain] == null && (this.R[l.lchain] = {}), this.R[l.lchain][l.lresi] == null && (this.R[l.lchain][l.lresi] = {}), this.R[l.lchain][l.lresi][l.lresn] == null && (this.R[l.lchain][l.lresi][l.lresn] = []), this.R[l.lchain][l.lresi][l.lresn].push(l), this.R[l.lchain][l.lresi][l.lresn][l.atom] = l;
               }
-              geta([l, u, g, p]) {
-                if (this.R[l] !== void 0 && this.R[l][u] !== void 0 && this.R[l][u][g] !== void 0)
-                  return this.R[l][u][g][p];
+              geta([l, u, p, g]) {
+                if (this.R[l] !== void 0 && this.R[l][u] !== void 0 && this.R[l][u][p] !== void 0)
+                  return this.R[l][u][p][g];
               }
               setBonds(l, u) {
-                for (let g in this.R)
-                  for (let p in this.R[g])
-                    for (let b in this.R[g][p]) {
-                      let c = this.R[g][p][b];
+                for (let p in this.R)
+                  for (let g in this.R[p])
+                    for (let b in this.R[p][g]) {
+                      let c = this.R[p][g][b];
                       for (let _ = 0; _ < c.length; _++)
                         for (let E = _ + 1; E < c.length; E++) {
-                          let w = c[_], k = c[E], L = l.order(b, w.atom, k.atom);
-                          L > 0 && (w.bonds.push(k.index), k.bonds.push(w.index), w.bondOrder.push(L), k.bondOrder.push(L));
+                          let w = c[_], k = c[E], $ = l.order(b, w.atom, k.atom);
+                          $ > 0 && (w.bonds.push(k.index), k.bonds.push(w.index), w.bondOrder.push($), k.bondOrder.push($));
                         }
                     }
-                for (let g of u.C) {
-                  let p = g[0], b = g[1], c = g[2], _ = this.geta(p), E = this.geta(b);
+                for (let p of u.C) {
+                  let g = p[0], b = p[1], c = p[2], _ = this.geta(g), E = this.geta(b);
                   _ != null && E != null && (_.bonds.push(E.index), E.bonds.push(_.index), _.bondOrder.push(c), E.bondOrder.push(c));
                 }
               }
             }
             function M(m, l) {
-              var u = !l.keepH, g = l.altLoc ? l.altLoc : "A", p = !l.noComputeSecondaryStructure;
+              var u = !l.keepH, p = l.altLoc ? l.altLoc : "A", g = !l.noComputeSecondaryStructure;
               const b = !l.doAssembly, c = l.assignBonds === void 0 ? !0 : l.assignBonds;
               if (typeof m == "string")
                 try {
@@ -34467,12 +34483,12 @@ ATOM`, b);
               if (k == 0)
                 return E;
               l.multimodel || (k = 1);
-              for (let L = 0; L < k; L++) {
-                let $ = E.length;
+              for (let $ = 0; $ < k; $++) {
+                let L = E.length;
                 const z = [];
                 w.push({ symmetries: [] }), E.push([]);
-                const O = _.dataBlocks[L], R = /* @__PURE__ */ Object.create(null);
-                for (const Re of O.categories)
+                const F = _.dataBlocks[$], R = /* @__PURE__ */ Object.create(null);
+                for (const Re of F.categories)
                   R[Re.name.substr(1)] = (0, h.Category)(Re);
                 let P = {}, U = R.struct_conf;
                 if (U) {
@@ -34505,7 +34521,7 @@ ATOM`, b);
                     w[w.length - 1].symmetries.push(ge);
                   }
                 }
-                let V = new y(R.chem_comp_bond), G = new x(), H = new A(R.struct_conn), Q = R.atom_site, te = Q.rowCount, ee = Q.getField("group_PDB"), ce = Q.getField("Cartn_x"), fe = Q.getField("Cartn_y"), oe = Q.getField("Cartn_z"), he = Q.getField("auth_asym_id"), Ae = Q.getField("label_asym_id"), Se = Q.getField("auth_seq_id"), Ie = Q.getField("label_seq_id"), pe = Q.getField("auth_comp_id"), le = Q.getField("label_comp_id"), ne = Q.getField("auth_atom_id"), Te = Q.getField("label_atom_id"), Fe = Q.getField("type_symbol"), Be = Q.getField("B_iso_or_equiv"), Ue = Q.getField("id"), Pe = Q.getField("label_alt_id"), Ge = Q.getField("pdbx_PDB_model_num"), Ne = Ge ? Ge[0] : 0;
+                let V = new y(R.chem_comp_bond), G = new x(), H = new A(R.struct_conn), Q = R.atom_site, te = Q.rowCount, ee = Q.getField("group_PDB"), ce = Q.getField("Cartn_x"), fe = Q.getField("Cartn_y"), oe = Q.getField("Cartn_z"), he = Q.getField("auth_asym_id"), Ae = Q.getField("label_asym_id"), Se = Q.getField("auth_seq_id"), Ie = Q.getField("label_seq_id"), pe = Q.getField("auth_comp_id"), le = Q.getField("label_comp_id"), ne = Q.getField("auth_atom_id"), Te = Q.getField("label_atom_id"), Oe = Q.getField("type_symbol"), Be = Q.getField("B_iso_or_equiv"), Ue = Q.getField("id"), Pe = Q.getField("label_alt_id"), Ge = Q.getField("pdbx_PDB_model_num"), Ne = Ge ? Ge[0] : 0;
                 for (let Re = 0; Re < te; Re++) {
                   if (ee !== void 0 && ee[Re] === "TER")
                     continue;
@@ -34517,10 +34533,10 @@ ATOM`, b);
                   const De = {};
                   De.x = ce[Re], De.y = fe[Re], De.z = oe[Re], De.chain = he ? he[Re] : Ae ? Ae[Re] : void 0, De.lchain = Ae ? Ae[Re] : void 0, De.resi = Se ? Se[Re] : Ie ? Ie[Re] : void 0, De.lresi = Ie ? Ie[Re] : void 0, De.resn = pe ? pe[Re].trim() : le ? le[Re].trim() : void 0, De.lresn = le ? le[Re].trim() : void 0, De.atom = ne ? ne[Re].replace(/"/gm, "") : Te ? Te[Re].replace(/"/gm, "") : void 0, De.icode = Pe ? Pe[Re] : void 0, De.altLoc = De.icode, De.hetflag = !ee || ee[Re] === "HETA" || ee[Re] === "HETATM";
                   let je = "X";
-                  Fe && (je = Fe[Re].replace(/\(?\+?\d+.*/, "")), De.elem = je[0].toUpperCase() + je.substring(1, 2).toLowerCase(), Be && (De.b = Be[Re]), !(u && De.elem == "H") && (De.altLoc != "" && De.altLoc != g && g != "*" || (De.bonds = [], De.ss = "c", De.serial = Ue[Re], De.model = Ne, De.bondOrder = [], De.properties = {}, De.index = E[E.length - 1].length, z[De.serial] = [E.length, De.index], E[E.length - 1].push(De), G.add(De)));
+                  Oe && (je = Oe[Re].replace(/\(?\+?\d+.*/, "")), De.elem = je[0].toUpperCase() + je.substring(1, 2).toLowerCase(), Be && (De.b = Be[Re]), !(u && De.elem == "H") && (De.altLoc != "" && De.altLoc != p && p != "*" || (De.bonds = [], De.ss = "c", De.serial = Ue[Re], De.model = Ne, De.bondOrder = [], De.properties = {}, De.index = E[E.length - 1].length, z[De.serial] = [E.length, De.index], E[E.length - 1].push(De), G.add(De)));
                 }
                 if (G.setBonds(V, H), !(0, v.isEmpty)(P))
-                  for (let Re = $; Re < E.length; Re++) {
+                  for (let Re = L; Re < E.length; Re++) {
                     let De = E[Re];
                     for (let je = 0; je < De.length; je++) {
                       const Xe = De[je];
@@ -34530,10 +34546,10 @@ ATOM`, b);
                       }
                     }
                   }
-                l.multimodel && L < k - 1 && (l.onemol || (E.push([]), w.push({ symmetries: [] })));
+                l.multimodel && $ < k - 1 && (l.onemol || (E.push([]), w.push({ symmetries: [] })));
               }
-              for (let L = 0; L < E.length; L++)
-                c && !(l.duplicateAssemblyAtoms && !l.dontConnectDuplicatedAtoms) && (0, o.assignPDBBonds)(E[L], l), p && (0, a.computeSecondaryStructure)(E[L], l.hbondCutoff), (0, s.processSymmetries)(w[L].symmetries, E[L], l, w[L].cryst), l.duplicateAssemblyAtoms && !l.dontConnectDuplicatedAtoms && c && (0, o.assignPDBBonds)(E[L], l);
+              for (let $ = 0; $ < E.length; $++)
+                c && !(l.duplicateAssemblyAtoms && !l.dontConnectDuplicatedAtoms) && (0, o.assignPDBBonds)(E[$], l), g && (0, a.computeSecondaryStructure)(E[$], l.hbondCutoff), (0, s.processSymmetries)(w[$].symmetries, E[$], l, w[$].cryst), l.duplicateAssemblyAtoms && !l.dontConnectDuplicatedAtoms && c && (0, o.assignPDBBonds)(E[$], l);
               return E;
             }
           }
@@ -34563,8 +34579,8 @@ ATOM`, b);
                 m.elem = l[0].toUpperCase() + l.substring(1).toLowerCase(), m.serial = h[h.length - 1].length, y && (m.style = f[M.s || 0]), h[h.length - 1].push(m);
               }
               for (let u = 0; u < v.length; u++) {
-                let g = v[u], p = g.b + A, b = g.e + A, c = g.o || 1, _ = h[h.length - 1][p], E = h[h.length - 1][b];
-                _.bonds.push(b), _.bondOrder.push(c), E.bonds.push(p), E.bondOrder.push(c);
+                let p = v[u], g = p.b + A, b = p.e + A, c = p.o || 1, _ = h[h.length - 1][g], E = h[h.length - 1][b];
+                _.bonds.push(b), _.bondOrder.push(c), E.bonds.push(g), E.bondOrder.push(c);
               }
               return h;
             }
@@ -34624,18 +34640,18 @@ ATOM`, b);
                 return E;
               }
               const l = v.split(/\r?\n|\r/), u = [];
-              let g = !1;
+              let p = !1;
               for (let c = 0; c < l.length; c++) {
-                var p = l[c].split("#")[0];
-                if (g ? p[0] === ";" && (g = !1) : p[0] === ";" && (g = !0), g || p !== "") {
-                  if (!g && (p = p.trim(), p[0] === "_")) {
-                    const _ = p.split(/\s/)[0].indexOf(".");
+                var g = l[c].split("#")[0];
+                if (p ? g[0] === ";" && (p = !1) : g[0] === ";" && (p = !0), p || g !== "") {
+                  if (!p && (g = g.trim(), g[0] === "_")) {
+                    const _ = g.split(/\s/)[0].indexOf(".");
                     if (_ > -1) {
-                      let E = p.split("");
-                      E[_] = "_", p = E.join(""), p = p.substring(0, _) + "_" + p.substring(_ + 1);
+                      let E = g.split("");
+                      E[_] = "_", g = E.join(""), g = g.substring(0, _) + "_" + g.substring(_ + 1);
                     }
                   }
-                  u.push(p);
+                  u.push(g);
                 }
               }
               let b = 0;
@@ -34648,34 +34664,34 @@ ATOM`, b);
                   if (u[b][0] === void 0)
                     b++;
                   else if (u[b][0] === "_") {
-                    const k = u[b].split(/\s/)[0].toLowerCase(), L = c[k] = c[k] || [], $ = u[b].substring(u[b].indexOf(k) + k.length);
-                    if ($ === "")
+                    const k = u[b].split(/\s/)[0].toLowerCase(), $ = c[k] = c[k] || [], L = u[b].substring(u[b].indexOf(k) + k.length);
+                    if (L === "")
                       if (b++, u[b][0] === ";") {
                         let z = u[b].substring(1);
                         for (b++; u[b] !== ";"; )
                           z = z + `
 ` + u[b], b++;
-                        L.push(z);
+                        $.push(z);
                       } else
-                        L.push(u[b]);
+                        $.push(u[b]);
                     else
-                      L.push($.trim());
+                      $.push(L.trim());
                     b++;
                   } else if (u[b].substring(0, 5) === "loop_") {
                     b++;
                     const k = [];
                     for (; u[b] === "" || u[b][0] === "_"; ) {
                       if (u[b] !== "") {
-                        let $ = u[b].split(/\s/)[0].toLowerCase(), z = c[$] = c[$] || [];
+                        let L = u[b].split(/\s/)[0].toLowerCase(), z = c[L] = c[L] || [];
                         k.push(z);
                       }
                       b++;
                     }
-                    let L = 0;
+                    let $ = 0;
                     for (; b < u.length && u[b][0] !== "_" && !u[b].startsWith("loop_") && !u[b].startsWith("data_"); ) {
-                      let $ = m(u[b], " ");
-                      for (let z = 0; z < $.length; z++)
-                        $[z] !== "" && (k[L].push($[z]), L = (L + 1) % k.length);
+                      let L = m(u[b], " ");
+                      for (let z = 0; z < L.length; z++)
+                        L[z] !== "" && (k[$].push(L[z]), $ = ($ + 1) % k.length);
                       b++;
                     }
                   } else
@@ -34684,50 +34700,50 @@ ATOM`, b);
                 const _ = c._atom_site_id !== void 0 ? c._atom_site_id.length : c._atom_site_label.length;
                 let E;
                 if (c._cell_length_a !== void 0) {
-                  const k = parseFloat(c._cell_length_a), L = parseFloat(c._cell_length_b), $ = parseFloat(c._cell_length_c), z = parseFloat(c._cell_angle_alpha) || 90, O = parseFloat(c._cell_angle_beta) || 90, R = parseFloat(c._cell_angle_gamma) || 90;
-                  E = (0, s.conversionMatrix3)(k, L, $, z, O, R), x[x.length - 1].cryst = {
+                  const k = parseFloat(c._cell_length_a), $ = parseFloat(c._cell_length_b), L = parseFloat(c._cell_length_c), z = parseFloat(c._cell_angle_alpha) || 90, F = parseFloat(c._cell_angle_beta) || 90, R = parseFloat(c._cell_angle_gamma) || 90;
+                  E = (0, s.conversionMatrix3)(k, $, L, z, F, R), x[x.length - 1].cryst = {
                     a: k,
-                    b: L,
-                    c: $,
+                    b: $,
+                    c: L,
                     alpha: z,
-                    beta: O,
+                    beta: F,
                     gamma: R
                   };
                 }
                 for (let k = 0; k < _; k++) {
                   if (c._atom_site_group_pdb !== void 0 && c._atom_site_group_pdb[k] === "TER")
                     continue;
-                  const L = {};
+                  const $ = {};
                   if (c._atom_site_cartn_x !== void 0)
-                    L.x = parseFloat(c._atom_site_cartn_x[k]), L.y = parseFloat(c._atom_site_cartn_y[k]), L.z = parseFloat(c._atom_site_cartn_z[k]);
+                    $.x = parseFloat(c._atom_site_cartn_x[k]), $.y = parseFloat(c._atom_site_cartn_y[k]), $.z = parseFloat(c._atom_site_cartn_z[k]);
                   else {
                     const z = o(E, parseFloat(c._atom_site_fract_x[k]), parseFloat(c._atom_site_fract_y[k]), parseFloat(c._atom_site_fract_z[k]));
-                    L.x = z.x, L.y = z.y, L.z = z.z;
+                    $.x = z.x, $.y = z.y, $.z = z.z;
                   }
-                  L.chain = c._atom_site_auth_asym_id ? c._atom_site_auth_asym_id[k] : c._atom_site_label_asym_id ? c._atom_site_label_asym_id[k] : void 0, L.resi = c._atom_site_auth_seq_id ? parseInt(c._atom_site_auth_seq_id[k]) : c._atom_site_label_seq_id ? c._atom_site_label_seq_id[k] : void 0, L.resn = c._atom_site_auth_comp_id ? c._atom_site_auth_comp_id[k].trim() : c._atom_site_label_comp_id ? c._atom_site_label_comp_id[k].trim() : void 0, L.atom = c._atom_site_auth_atom_id ? c._atom_site_auth_atom_id[k].replace(/"/gm, "") : c._atom_site_label_atom_id ? c._atom_site_label_atom_id[k].replace(/"/gm, "") : void 0, L.hetflag = !c._atom_site_group_pdb || c._atom_site_group_pdb[k] === "HETA" || c._atom_site_group_pdb[k] === "HETATM", c._atom_site_b_iso_or_equiv && (L.b = parseFloat(c._atom_site_b_iso_or_equiv[k]));
-                  let $ = "X";
-                  c._atom_site_type_symbol ? $ = c._atom_site_type_symbol[k].replace(/\(?\+?\d+.*/, "") : c._atom_site_label && ($ = c._atom_site_label[k].split("_")[0].replace(/\(?\d+.*/, "")), L.elem = $[0].toUpperCase() + $.substring(1, 2).toLowerCase(), L.bonds = [], L.ss = "c", L.serial = k, L.bondOrder = [], L.properties = {}, y[y.length - 1].push(L);
+                  $.chain = c._atom_site_auth_asym_id ? c._atom_site_auth_asym_id[k] : c._atom_site_label_asym_id ? c._atom_site_label_asym_id[k] : void 0, $.resi = c._atom_site_auth_seq_id ? parseInt(c._atom_site_auth_seq_id[k]) : c._atom_site_label_seq_id ? c._atom_site_label_seq_id[k] : void 0, $.resn = c._atom_site_auth_comp_id ? c._atom_site_auth_comp_id[k].trim() : c._atom_site_label_comp_id ? c._atom_site_label_comp_id[k].trim() : void 0, $.atom = c._atom_site_auth_atom_id ? c._atom_site_auth_atom_id[k].replace(/"/gm, "") : c._atom_site_label_atom_id ? c._atom_site_label_atom_id[k].replace(/"/gm, "") : void 0, $.hetflag = !c._atom_site_group_pdb || c._atom_site_group_pdb[k] === "HETA" || c._atom_site_group_pdb[k] === "HETATM", c._atom_site_b_iso_or_equiv && ($.b = parseFloat(c._atom_site_b_iso_or_equiv[k]));
+                  let L = "X";
+                  c._atom_site_type_symbol ? L = c._atom_site_type_symbol[k].replace(/\(?\+?\d+.*/, "") : c._atom_site_label && (L = c._atom_site_label[k].split("_")[0].replace(/\(?\d+.*/, "")), $.elem = L[0].toUpperCase() + L.substring(1, 2).toLowerCase(), $.bonds = [], $.ss = "c", $.serial = k, $.bondOrder = [], $.properties = {}, y[y.length - 1].push($);
                 }
                 if (c._pdbx_struct_oper_list_id !== void 0 && !A)
                   for (let k = 0; k < c._pdbx_struct_oper_list_id.length; k++) {
-                    const L = parseFloat(c["_pdbx_struct_oper_list_matrix[1][1]"][k]), $ = parseFloat(c["_pdbx_struct_oper_list_matrix[1][2]"][k]), z = parseFloat(c["_pdbx_struct_oper_list_matrix[1][3]"][k]), O = parseFloat(c["_pdbx_struct_oper_list_vector[1]"][k]), R = parseFloat(c["_pdbx_struct_oper_list_matrix[2][1]"][k]), P = parseFloat(c["_pdbx_struct_oper_list_matrix[2][2]"][k]), U = parseFloat(c["_pdbx_struct_oper_list_matrix[2][3]"][k]), N = parseFloat(c["_pdbx_struct_oper_list_vector[2]"][k]), B = parseFloat(c["_pdbx_struct_oper_list_matrix[3][1]"][k]), W = parseFloat(c["_pdbx_struct_oper_list_matrix[3][2]"][k]), V = parseFloat(c["_pdbx_struct_oper_list_matrix[3][3]"][k]), G = parseFloat(c["_pdbx_struct_oper_list_vector[3]"][k]), H = new s.Matrix4(L, $, z, O, R, P, U, N, B, W, V, G);
+                    const $ = parseFloat(c["_pdbx_struct_oper_list_matrix[1][1]"][k]), L = parseFloat(c["_pdbx_struct_oper_list_matrix[1][2]"][k]), z = parseFloat(c["_pdbx_struct_oper_list_matrix[1][3]"][k]), F = parseFloat(c["_pdbx_struct_oper_list_vector[1]"][k]), R = parseFloat(c["_pdbx_struct_oper_list_matrix[2][1]"][k]), P = parseFloat(c["_pdbx_struct_oper_list_matrix[2][2]"][k]), U = parseFloat(c["_pdbx_struct_oper_list_matrix[2][3]"][k]), N = parseFloat(c["_pdbx_struct_oper_list_vector[2]"][k]), B = parseFloat(c["_pdbx_struct_oper_list_matrix[3][1]"][k]), W = parseFloat(c["_pdbx_struct_oper_list_matrix[3][2]"][k]), V = parseFloat(c["_pdbx_struct_oper_list_matrix[3][3]"][k]), G = parseFloat(c["_pdbx_struct_oper_list_vector[3]"][k]), H = new s.Matrix4($, L, z, F, R, P, U, N, B, W, V, G);
                     x[x.length - 1].symmetries.push(H);
                   }
                 const w = function(k) {
-                  const L = k.match("-");
+                  const $ = k.match("-");
                   k = k.replace(/[-xyz]/g, "");
-                  const $ = k.split("/");
-                  let z, O;
-                  return $[1] === void 0 ? O = 1 : O = parseInt($[1]), $[0] === "" ? z = 1 : z = parseInt($[0]), z / O * (L ? -1 : 1);
+                  const L = k.split("/");
+                  let z, F;
+                  return L[1] === void 0 ? F = 1 : F = parseInt(L[1]), L[0] === "" ? z = 1 : z = parseInt(L[0]), z / F * ($ ? -1 : 1);
                 };
                 if (c._symmetry_equiv_pos_as_xyz !== void 0 && !A)
                   for (let k = 0; k < c._symmetry_equiv_pos_as_xyz.length; k++) {
-                    const $ = c._symmetry_equiv_pos_as_xyz[k].replace(/["' ]/g, "").split(",").map(function(P) {
+                    const L = c._symmetry_equiv_pos_as_xyz[k].replace(/["' ]/g, "").split(",").map(function(P) {
                       return P.replace(/-/g, "+-");
                     });
                     let z = new s.Matrix4(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1);
                     for (let P = 0; P < 3; P++) {
-                      const U = $[P].split("+");
+                      const U = L[P].split("+");
                       for (let N = 0; N < U.length; N++) {
                         const B = U[N];
                         if (B === "")
@@ -34736,8 +34752,8 @@ ATOM`, b);
                         B.match("x") ? z.elements[P + 0] = W : B.match("y") ? z.elements[P + 4] = W : B.match("z") ? z.elements[P + 8] = W : z.elements[P + 12] = W;
                       }
                     }
-                    const O = E.getMatrix4(), R = new s.Matrix4().getInverse(O, !0);
-                    z = new s.Matrix4().multiplyMatrices(z, R), z = new s.Matrix4().multiplyMatrices(O, z), x[x.length - 1].symmetries.push(z);
+                    const F = E.getMatrix4(), R = new s.Matrix4().getInverse(F, !0);
+                    z = new s.Matrix4().multiplyMatrices(z, R), z = new s.Matrix4().multiplyMatrices(F, z), x[x.length - 1].symmetries.push(z);
                   }
               }
               for (let c = 0; c < y.length; c++)
@@ -34791,26 +34807,26 @@ ATOM`, b);
               A = f[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), A = f[3].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
               const l = A[0] > 0 ? 0.529177 : 1;
               m.multiplyScalar(l);
-              const u = Math.abs(A[0]), g = new r.Vector3(parseFloat(A[1]), parseFloat(A[2]), parseFloat(A[3])).multiplyScalar(l);
+              const u = Math.abs(A[0]), p = new r.Vector3(parseFloat(A[1]), parseFloat(A[2]), parseFloat(A[3])).multiplyScalar(l);
               A = f[4].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
-              const p = Math.abs(A[0]), b = new r.Vector3(parseFloat(A[1]), parseFloat(A[2]), parseFloat(A[3])).multiplyScalar(l);
+              const g = Math.abs(A[0]), b = new r.Vector3(parseFloat(A[1]), parseFloat(A[2]), parseFloat(A[3])).multiplyScalar(l);
               A = f[5].replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
               const c = Math.abs(A[0]), _ = new r.Vector3(parseFloat(A[1]), parseFloat(A[2]), parseFloat(A[3])).multiplyScalar(l);
-              if (M.size = { x: u, y: p, z: c }, M.unit = new r.Vector3(g.x, b.y, _.z), g.y != 0 || g.z != 0 || b.x != 0 || b.z != 0 || _.x != 0 || _.y != 0) {
-                M.matrix4 = new r.Matrix4(g.x, b.x, _.x, 0, g.y, b.y, _.y, 0, g.z, b.z, _.z, 0, 0, 0, 0, 1);
-                let O = new r.Matrix4().makeTranslation(m.x, m.y, m.z);
-                M.matrix4 = M.matrix4.multiplyMatrices(O, M.matrix4), M.matrix = M.matrix4.matrix3FromTopLeft(), M.origin = new r.Vector3(0, 0, 0), M.unit = new r.Vector3(1, 1, 1);
+              if (M.size = { x: u, y: g, z: c }, M.unit = new r.Vector3(p.x, b.y, _.z), p.y != 0 || p.z != 0 || b.x != 0 || b.z != 0 || _.x != 0 || _.y != 0) {
+                M.matrix4 = new r.Matrix4(p.x, b.x, _.x, 0, p.y, b.y, _.y, 0, p.z, b.z, _.z, 0, 0, 0, 0, 1);
+                let F = new r.Matrix4().makeTranslation(m.x, m.y, m.z);
+                M.matrix4 = M.matrix4.multiplyMatrices(F, M.matrix4), M.matrix = M.matrix4.matrix3FromTopLeft(), M.origin = new r.Vector3(0, 0, 0), M.unit = new r.Vector3(1, 1, 1);
               }
               v.modelData = [{ cryst: M }], f = f.splice(6, x);
               for (var E = v[v.length - 1].length, w = E + f.length, k = E; k < w; ++k) {
-                var L = {};
-                L.serial = k;
-                var $ = f[k - E], z = $.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
-                L.elem = s.anumToSymbol[z[0]], L.x = parseFloat(z[2]) * l, L.y = parseFloat(z[3]) * l, L.z = parseFloat(z[4]) * l, L.hetflag = !0, L.bonds = [], L.bondOrder = [], L.properties = {}, v[v.length - 1].push(L);
+                var $ = {};
+                $.serial = k;
+                var L = f[k - E], z = L.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
+                $.elem = s.anumToSymbol[z[0]], $.x = parseFloat(z[2]) * l, $.y = parseFloat(z[3]) * l, $.z = parseFloat(z[4]) * l, $.hetflag = !0, $.bonds = [], $.bondOrder = [], $.properties = {}, v[v.length - 1].push($);
               }
               if (y)
-                for (let O = 0; O < v.length; O++)
-                  (0, a.assignBonds)(v[O], d);
+                for (let F = 0; F < v.length; F++)
+                  (0, a.assignBonds)(v[F], d);
               return v;
             }
           }
@@ -34848,14 +34864,14 @@ ATOM`, b);
                 let x = 2;
                 const M = A.length, m = M + f;
                 for (let l = M; l < m; l++) {
-                  const u = v[x++], g = {};
-                  g.serial = l, g.atom = u.slice(10, 15).trim(), g.elem = (0, a.atomNameToElem)(g.atom, !0), g.x = 10 * parseFloat(u.slice(20, 28)), g.y = 10 * parseFloat(u.slice(28, 36)), g.z = 10 * parseFloat(u.slice(36, 44)), g.resi = parseInt(u.slice(0, 5)), g.resn = u.slice(5, 10).trim(), g.bonds = [], g.bondOrder = [], g.properties = {}, u.length > 44 && (g.dx = 10 * parseFloat(u.slice(44, 52)), g.dy = 10 * parseFloat(u.slice(52, 60)), g.dz = 10 * parseFloat(u.slice(60, 68))), A[l] = g;
+                  const u = v[x++], p = {};
+                  p.serial = l, p.atom = u.slice(10, 15).trim(), p.elem = (0, a.atomNameToElem)(p.atom, !0), p.x = 10 * parseFloat(u.slice(20, 28)), p.y = 10 * parseFloat(u.slice(28, 36)), p.z = 10 * parseFloat(u.slice(36, 44)), p.resi = parseInt(u.slice(0, 5)), p.resn = u.slice(5, 10).trim(), p.bonds = [], p.bondOrder = [], p.properties = {}, u.length > 44 && (p.dx = 10 * parseFloat(u.slice(44, 52)), p.dy = 10 * parseFloat(u.slice(52, 60)), p.dz = 10 * parseFloat(u.slice(60, 68))), A[l] = p;
                 }
                 if (v.length <= x + 3) {
                   const u = v[x++].trim().split(/\s+/);
                   if (u.length === 3) {
-                    for (let g = 0; g < 3; g++)
-                      u[g] = (parseFloat(u[g]) * 10).toString();
+                    for (let p = 0; p < 3; p++)
+                      u[p] = (parseFloat(u[p]) * 10).toString();
                     d.box = u;
                   }
                 }
@@ -34917,10 +34933,10 @@ ATOM`, b);
                 const M = v[f - 1].replace("ITEM: ATOMS ", "").split(" ");
                 d.push([]);
                 for (let m = f; m < f + y; m++) {
-                  const l = {}, u = {}, g = v[m].split(" ");
-                  for (let p = 0; p < g.length; p++) {
-                    const b = a[M[p]];
-                    b !== void 0 && (b === "serial" ? l[b] = parseInt(g[p]) : b === "x" || b === "y" || b === "z" ? l[b] = parseFloat(g[p]) : b === "charge" || b === "radius" ? u[b] = parseFloat(g[p]) : l[b] = g[p]), l.properties = u, l.bonds = [], l.bondOrder = [];
+                  const l = {}, u = {}, p = v[m].split(" ");
+                  for (let g = 0; g < p.length; g++) {
+                    const b = a[M[g]];
+                    b !== void 0 && (b === "serial" ? l[b] = parseInt(p[g]) : b === "x" || b === "y" || b === "z" ? l[b] = parseFloat(p[g]) : b === "charge" || b === "radius" ? u[b] = parseFloat(p[g]) : l[b] = p[g]), l.properties = u, l.bonds = [], l.bondOrder = [];
                   }
                   d[d.length - 1][m - f] = l;
                 }
@@ -34981,15 +34997,15 @@ ATOM`, b);
               "SACCHARIDE"
             ]);
             function y(A, x) {
-              var M = !x.keepH, m = x.altLoc ? x.altLoc : "A", l = !!x.noSecondaryStructure, u = !x.noComputeSecondaryStructure, g = !x.doAssembly, p = x.assemblyIndex ? x.assemblyIndex : 0;
+              var M = !x.keepH, m = x.altLoc ? x.altLoc : "A", l = !!x.noSecondaryStructure, u = !x.noComputeSecondaryStructure, p = !x.doAssembly, g = x.assemblyIndex ? x.assemblyIndex : 0;
               typeof A == "string" ? A = (0, r.base64ToArray)(A) : A = new Uint8Array(A);
-              var b = o.decode(A), c = [[]], _ = c.modelData = [], E = 0, w = 0, k = 0, L = b.secStructList, $ = b.bFactorList, z = b.altLocList, O = b.occupancyList, R = b.bondAtomList, P = b.bondOrderList, U = b.numModels;
+              var b = o.decode(A), c = [[]], _ = c.modelData = [], E = 0, w = 0, k = 0, $ = b.secStructList, L = b.bFactorList, z = b.altLocList, F = b.occupancyList, R = b.bondAtomList, P = b.bondOrderList, U = b.numModels;
               if (U == 0)
                 return c;
               x.multimodel || (U = 1);
               var N, B, W, V, G, H, Q = [];
-              if (!g && b.bioAssemblyList && b.bioAssemblyList.length > 0) {
-                var te = b.bioAssemblyList[p].transformList;
+              if (!p && b.bioAssemblyList && b.bioAssemblyList.length > 0) {
+                var te = b.bioAssemblyList[g].transformList;
                 for (N = 0, H = te.length; N < H; N++) {
                   var ee = new a.Matrix4(te[N].matrix);
                   ee.transpose(), Q.push(ee);
@@ -35014,35 +35030,35 @@ ATOM`, b);
                   b.chainNameList && (le = d(b.chainNameList.subarray(E * 4, E * 4 + 4)));
                   var ne = w, Te = "";
                   for (B = 0; B < pe; ++B) {
-                    var Fe = b.groupList[b.groupTypeList[w]], Be = Fe.atomNameList.length, Ue = 0, Pe = !1, Ge = !1;
-                    if (L) {
-                      Ue = L[w];
+                    var Oe = b.groupList[b.groupTypeList[w]], Be = Oe.atomNameList.length, Ue = 0, Pe = !1, Ge = !1;
+                    if ($) {
+                      Ue = $[w];
                       var Ne = v(Ue);
                       (w == 0 || Ne != Te) && (Pe = !0), Te = Ne;
                       var Re = w + 1;
-                      (Re >= L.length || v(L[Re] != Ne)) && (Ge = !0);
+                      (Re >= $.length || v($[Re] != Ne)) && (Ge = !0);
                     }
-                    var De = b.groupIdList[w], je = Fe.groupName;
-                    let ve = Fe.chemCompType;
+                    var De = b.groupIdList[w], je = Oe.groupName;
+                    let ve = Oe.chemCompType;
                     var Xe = k;
                     let Y = f.has(ve) || !oe[E];
                     for (W = 0; W < Be; ++W) {
-                      var X = Fe.elementList[W];
+                      var X = Oe.elementList[W];
                       if (M && X == "H") {
                         k += 1;
                         continue;
                       }
                       var q = "";
-                      $ && (q = $[k]);
+                      L && (q = L[k]);
                       var re = "";
                       z && z[k] && (re = String.fromCharCode(z[k]));
                       var ye = "";
-                      if (O && (ye = O[k]), re != "" && re != m && m != "*") {
+                      if (F && (ye = F[k]), re != "" && re != m && m != "*") {
                         k += 1;
                         continue;
                       }
-                      var me = b.atomIdList[k], ze = Fe.atomNameList[W], ke = 0;
-                      Fe.atomChargeList && (ke = Fe.atomChargeList[W]);
+                      var me = b.atomIdList[k], ze = Oe.atomNameList[W], ke = 0;
+                      Oe.atomChargeList && (ke = Oe.atomChargeList[W]);
                       var K = b.xCoordList[k], ae = b.yCoordList[k], ge = b.zCoordList[k];
                       Ie[k] = Se.length, Se.push({
                         resn: je,
@@ -35071,10 +35087,10 @@ ATOM`, b);
                         b: q
                       }), k += 1;
                     }
-                    var xe = Fe.bondAtomList;
-                    for (W = 0, V = Fe.bondOrderList.length; W < V; ++W) {
-                      var ue = Xe + xe[W * 2], Ce = Xe + xe[W * 2 + 1], Z = Fe.bondOrderList[W], Oe = Ie[ue], We = Ie[Ce], I = Se[Oe], we = Se[We];
-                      I && we && (I.bonds.push(We), I.bondOrder.push(Z), we.bonds.push(Oe), we.bondOrder.push(Z));
+                    var xe = Oe.bondAtomList;
+                    for (W = 0, V = Oe.bondOrderList.length; W < V; ++W) {
+                      var ue = Xe + xe[W * 2], Ce = Xe + xe[W * 2 + 1], Z = Oe.bondOrderList[W], Fe = Ie[ue], We = Ie[Ce], I = Se[Fe], we = Se[We];
+                      I && we && (I.bonds.push(We), I.bondOrder.push(Z), we.bonds.push(Fe), we.bondOrder.push(Z));
                     }
                     w += 1;
                   }
@@ -35094,7 +35110,7 @@ ATOM`, b);
                   }
                 x.multimodel && (x.onemol || c.push([]));
               }
-              if (!g)
+              if (!p)
                 for (let ve = 0; ve < c.length; ve++)
                   (0, h.processSymmetries)(_[ve].symmetries, c[ve], x, _[ve].cryst);
               return u && !l && (0, s.computeSecondaryStructure)(c, x.hbondCutoff), c;
@@ -35181,8 +35197,8 @@ ATOM`, b);
                     l = u + 1;
                     break;
                   }
-                var g = o[o.length - 1].length, p = g + M, b;
-                for (u = g; u < p; u++) {
+                var p = o[o.length - 1].length, g = p + M, b;
+                for (u = p; u < g; u++) {
                   b = y[l++], x = b.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
                   var c = {}, _ = x[5];
                   if (r[_] !== void 0 ? _ = r[_] : (_ = _.split(".")[0], _ = _[0].toUpperCase() + _.substring(1).toLowerCase()), c.atom = x[1], c.elem = _, !(c.elem == "H" && d)) {
@@ -35195,16 +35211,16 @@ ATOM`, b);
                     }, A[w] = E, o[o.length - 1].push(c);
                   }
                 }
-                for (var L = !1; l < y.length; )
+                for (var $ = !1; l < y.length; )
                   if (y[l++] == "@<TRIPOS>BOND") {
-                    L = !0;
+                    $ = !0;
                     break;
                   }
-                if (L && m)
+                if ($ && m)
                   for (u = 0; u < m; u++) {
                     b = y[l++], x = b.replace(/^\s+/, "").replace(/\s+/g, " ").split(" ");
-                    var $ = parseInt(x[1]), z = o[o.length - 1][A[$]], O = parseInt(x[2]), R = o[o.length - 1][A[O]], P = parseInt(x[3]);
-                    isNaN(P) && (P = 1), z !== void 0 && R !== void 0 && (z.bonds.push(A[O]), z.bondOrder.push(P), R.bonds.push(A[$]), R.bondOrder.push(P));
+                    var L = parseInt(x[1]), z = o[o.length - 1][A[L]], F = parseInt(x[2]), R = o[o.length - 1][A[F]], P = parseInt(x[3]);
+                    isNaN(P) && (P = 1), z !== void 0 && R !== void 0 && (z.bonds.push(A[F]), z.bondOrder.push(P), R.bonds.push(A[L]), R.bondOrder.push(P));
                   }
                 if (h.multimodel) {
                   h.onemol || o.push([]), y.splice(0, l), s = y.join(`
@@ -35287,8 +35303,8 @@ ATOM`, b);
               var d = [[]], v = !o.noSecondaryStructure;
               d.modelData = [{ symmetries: [] }];
               var f = [], y = h.split(/\r?\n|\r/), A;
-              for (let L = 0; L < y.length; L++) {
-                A = y[L].replace(/^\s*/, "");
+              for (let $ = 0; $ < y.length; $++) {
+                A = y[$].replace(/^\s*/, "");
                 var x = A.substring(0, 6);
                 if (x.indexOf("END") == 0)
                   if (o.multimodel) {
@@ -35298,39 +35314,39 @@ ATOM`, b);
                     break;
                 else if (x == "ATOM  " || x == "HETATM") {
                   var M;
-                  let $ = parseInt(A.substring(6, 11)), z = A.substring(12, 16).replace(/ /g, ""), O = A.substring(17, 20).trim(), R = A.substring(21, 22), P = parseInt(A.substring(22, 26));
-                  var m = A.substring(30).trim().split(/\s+/), l = parseFloat(m[0]), u = parseFloat(m[1]), g = parseFloat(m[2]), p = parseFloat(m[3]), b = parseFloat(m[4]), c = z[0];
-                  z.length > 1 && z[1].toUpperCase() != z[1] && (c = z.substring(0, 2)), A[0] == "H" ? M = !0 : M = !1, f[$] = d[d.length - 1].length, d[d.length - 1].push({
-                    resn: O,
+                  let L = parseInt(A.substring(6, 11)), z = A.substring(12, 16).replace(/ /g, ""), F = A.substring(17, 20).trim(), R = A.substring(21, 22), P = parseInt(A.substring(22, 26));
+                  var m = A.substring(30).trim().split(/\s+/), l = parseFloat(m[0]), u = parseFloat(m[1]), p = parseFloat(m[2]), g = parseFloat(m[3]), b = parseFloat(m[4]), c = z[0];
+                  z.length > 1 && z[1].toUpperCase() != z[1] && (c = z.substring(0, 2)), A[0] == "H" ? M = !0 : M = !1, f[L] = d[d.length - 1].length, d[d.length - 1].push({
+                    resn: F,
                     x: l,
                     y: u,
-                    z: g,
+                    z: p,
                     elem: c,
                     hetflag: M,
                     chain: R,
                     resi: P,
-                    serial: $,
+                    serial: L,
                     atom: z,
                     bonds: [],
                     ss: "c",
                     bondOrder: [],
                     properties: {
-                      charge: p,
-                      partialCharge: p,
+                      charge: g,
+                      partialCharge: g,
                       radius: b
                     },
                     pdbline: A
                   });
                 } else if (x == "CONECT") {
                   var _ = parseInt(A.substring(6, 11)), E = d[d.length - 1][f[_]];
-                  for (let $ = 0; $ < 4; $++) {
-                    var w = parseInt(A.substring([11, 16, 21, 26][$], [11, 16, 21, 26][$] + 5)), k = d[d.length - 1][f[w]];
+                  for (let L = 0; L < 4; L++) {
+                    var w = parseInt(A.substring([11, 16, 21, 26][L], [11, 16, 21, 26][L] + 5)), k = d[d.length - 1][f[w]];
                     E !== void 0 && k !== void 0 && (E.bonds.push(f[w]), E.bondOrder.push(1));
                   }
                 }
               }
-              for (let L = 0; L < d.length; L++)
-                (0, r.assignPDBBonds)(d[L], o), v && (0, a.computeSecondaryStructure)(d[L], o.hbondCutoff);
+              for (let $ = 0; $ < d.length; $++)
+                (0, r.assignPDBBonds)(d[$], o), v && (0, a.computeSecondaryStructure)(d[$], o.hbondCutoff);
               return d;
             }
           }
@@ -35368,8 +35384,8 @@ ATOM`, b);
                 for (let l = 0; l < A / y[0]; l++) {
                   l == parseInt(A / y[0]) && (x = A % y[0]);
                   for (let u = 0; u < x; u++) {
-                    let g = {}, p = { charge: "", radii: "" };
-                    g.serial = o, g.x = 0, g.y = 0, g.z = 0, g.atom = d[f + 1].slice(y[1] * u, y[1] * (u + 1)).trim(), g.elem = d[f + 1].slice(y[1] * u, y[1] * u + 1).trim(), g.properties = p, g.bonds = [], g.bondOrder = [], s.push(g), o++;
+                    let p = {}, g = { charge: "", radii: "" };
+                    p.serial = o, p.x = 0, p.y = 0, p.z = 0, p.atom = d[f + 1].slice(y[1] * u, y[1] * (u + 1)).trim(), p.elem = d[f + 1].slice(y[1] * u, y[1] * u + 1).trim(), p.properties = g, p.bonds = [], p.bondOrder = [], s.push(p), o++;
                   }
                   f++;
                 }
@@ -35408,8 +35424,8 @@ ATOM`, b);
               } else
                 return [];
               function M(l) {
-                var u = d.indexOf(v.filter(function(g) {
-                  return g.includes(l);
+                var u = d.indexOf(v.filter(function(p) {
+                  return p.includes(l);
                 })[0]);
                 if (Number.isInteger(u) && u > 0) {
                   for (; !d[u].includes("FORMAT"); )
@@ -35419,8 +35435,8 @@ ATOM`, b);
                   return -1;
               }
               function m(l) {
-                var u = d[l].match(/\((\d*)\S*/), g = d[l].match(/[a-zA-Z](\d*)\)\s*/);
-                return g == null && (g = d[l].match(/[a-zA-Z](\d*)\.\d*\)\s*/)), [u[1], g[1]];
+                var u = d[l].match(/\((\d*)\S*/), p = d[l].match(/[a-zA-Z](\d*)\)\s*/);
+                return p == null && (p = d[l].match(/[a-zA-Z](\d*)\.\d*\)\s*/)), [u[1], p[1]];
               }
               return [s];
             }
@@ -35453,8 +35469,8 @@ ATOM`, b);
                 var x = [], M = d[d.length - 1].length, m = M + f, l, u;
                 for (l = M; l < m; l++, A++) {
                   u = h[A];
-                  var g = {}, p = u.substring(31, 34).replace(/ /g, "");
-                  g.atom = g.elem = p[0].toUpperCase() + p.substring(1).toLowerCase(), (g.elem !== "H" || !v) && (g.serial = l, x[l] = d[d.length - 1].length, g.x = parseFloat(u.substring(0, 10)), g.y = parseFloat(u.substring(10, 20)), g.z = parseFloat(u.substring(20, 30)), g.hetflag = !0, g.bonds = [], g.bondOrder = [], g.properties = {}, g.index = d[d.length - 1].length, d[d.length - 1].push(g));
+                  var p = {}, g = u.substring(31, 34).replace(/ /g, "");
+                  p.atom = p.elem = g[0].toUpperCase() + g.substring(1).toLowerCase(), (p.elem !== "H" || !v) && (p.serial = l, x[l] = d[d.length - 1].length, p.x = parseFloat(u.substring(0, 10)), p.y = parseFloat(u.substring(10, 20)), p.z = parseFloat(u.substring(20, 30)), p.hetflag = !0, p.bonds = [], p.bondOrder = [], p.properties = {}, p.index = d[d.length - 1].length, d[d.length - 1].push(p));
                 }
                 for (l = 0; l < y; l++, A++) {
                   u = h[A];
@@ -35481,13 +35497,13 @@ ATOM`, b);
                 var A = parseInt(f[1]), x = 7;
                 if (h.length < 8 + y + A)
                   break;
-                var M = [], m = d[d.length - 1].length, l = m + y, u, g;
+                var M = [], m = d[d.length - 1].length, l = m + y, u, p;
                 for (u = m; u < l; u++, x++) {
-                  g = h[x];
-                  var p = g.substring(6).match(/\S+/g);
-                  if (p.length > 4) {
-                    var b = {}, c = p[1].replace(/ /g, "");
-                    b.atom = b.elem = c[0].toUpperCase() + c.substring(1).toLowerCase(), (b.elem !== "H" || !v) && (b.serial = u, M[u] = d[d.length - 1].length, b.x = parseFloat(p[2]), b.y = parseFloat(p[3]), b.z = parseFloat(p[4]), b.hetflag = !0, b.bonds = [], b.bondOrder = [], b.properties = {}, b.index = d[d.length - 1].length, d[d.length - 1].push(b));
+                  p = h[x];
+                  var g = p.substring(6).match(/\S+/g);
+                  if (g.length > 4) {
+                    var b = {}, c = g[1].replace(/ /g, "");
+                    b.atom = b.elem = c[0].toUpperCase() + c.substring(1).toLowerCase(), (b.elem !== "H" || !v) && (b.serial = u, M[u] = d[d.length - 1].length, b.x = parseFloat(g[2]), b.y = parseFloat(g[3]), b.z = parseFloat(g[4]), b.hetflag = !0, b.bonds = [], b.bondOrder = [], b.properties = {}, b.index = d[d.length - 1].length, d[d.length - 1].push(b));
                   }
                 }
                 if (h[x] === "M  V30 END ATOM")
@@ -35499,8 +35515,8 @@ ATOM`, b);
                 else
                   break;
                 for (u = 0; u < A; u++, x++) {
-                  g = h[x];
-                  var _ = g.substring(6).match(/\S+/g);
+                  p = h[x];
+                  var _ = p.substring(6).match(/\S+/g);
                   if (_.length > 3) {
                     var E = M[parseInt(_[2]) - 1 + m], w = M[parseInt(_[3]) - 1 + m], k = parseFloat(_[1]);
                     typeof E < "u" && typeof w < "u" && (d[d.length - 1][E].bonds.push(w), d[d.length - 1][E].bondOrder.push(k), d[d.length - 1][w].bonds.push(E), d[d.length - 1][w].bondOrder.push(k));
@@ -35568,12 +35584,12 @@ ATOM`, b);
               if (x.length != M.length)
                 return console.log("Warning: declaration of atomary species wrong:"), console.log(x), console.log(M), d;
               l ? y.splice(0, 9) : y.splice(0, 8);
-              for (var u = 0, g = 0, p = x.length; g < p; g++) {
-                for (var b = x[g], c = 0, _ = M[g]; c < _; c++) {
+              for (var u = 0, p = 0, g = x.length; p < g; p++) {
+                for (var b = x[p], c = 0, _ = M[p]; c < _; c++) {
                   var E = new Float32Array(y[u + c].trim().split(/\s+/)), w = {};
                   w.elem = b, m == "cartesian" ? (w.x = v.length * E[0], w.y = v.length * E[1], w.z = v.length * E[2]) : (w.x = v.length * (E[0] * v.xVec[0] + E[1] * v.yVec[0] + E[2] * v.zVec[0]), w.y = v.length * (E[0] * v.xVec[1] + E[1] * v.yVec[1] + E[2] * v.zVec[1]), w.z = v.length * (E[0] * v.xVec[2] + E[1] * v.yVec[2] + E[2] * v.zVec[2])), w.bonds = [], w.bondOrder = [], d[0].push(w);
                 }
-                u += M[g];
+                u += M[p];
               }
               if (f)
                 for (let k = 0; k < d.length; k++)
@@ -35615,11 +35631,11 @@ ATOM`, b);
                   var M = new Float32Array(x[1].split(/\s+/)), m = new r.Matrix3(M[0], M[3], M[6], M[1], M[4], M[7], M[2], M[5], M[8]);
                   d.modelData = [{ cryst: { matrix: m } }];
                 }
-                for (var l = 2, u = d[d.length - 1].length, g = u + y, p = u; p < g; p++) {
+                for (var l = 2, u = d[d.length - 1].length, p = u + y, g = u; g < p; g++) {
                   var b = f[l++], c = b.replace(/^\s+/, "").replace(/\s+/g, " ").split(" "), _ = {};
-                  _.serial = p;
+                  _.serial = g;
                   var E = c[0];
-                  _.atom = _.elem = E[0].toUpperCase() + E.substring(1, 2).toLowerCase(), _.x = parseFloat(c[1]), _.y = parseFloat(c[2]), _.z = parseFloat(c[3]), _.hetflag = !0, _.bonds = [], _.bondOrder = [], _.properties = {}, d[d.length - 1][p] = _, c.length >= 7 && (_.dx = parseFloat(c[4]), _.dy = parseFloat(c[5]), _.dz = parseFloat(c[6]));
+                  _.atom = _.elem = E[0].toUpperCase() + E.substring(1, 2).toLowerCase(), _.x = parseFloat(c[1]), _.y = parseFloat(c[2]), _.z = parseFloat(c[3]), _.hetflag = !0, _.bonds = [], _.bondOrder = [], _.properties = {}, d[d.length - 1][g] = _, c.length >= 7 && (_.dx = parseFloat(c[4]), _.dy = parseFloat(c[5]), _.dz = parseFloat(c[6]));
                 }
                 if (o.multimodel)
                   d.push([]), f.splice(0, l);
@@ -35633,11 +35649,11 @@ ATOM`, b);
                 var w = d;
                 d = [], d.push(w[0]);
                 for (let k = 1; k < w.length; k++) {
-                  let L = d[0].length;
-                  for (let $ = 0; $ < w[k].length; $++) {
-                    let z = w[k][$];
-                    for (let O = 0; O < z.bonds.length; O++)
-                      z.bonds[O] = z.bonds[O] + L;
+                  let $ = d[0].length;
+                  for (let L = 0; L < w[k].length; L++) {
+                    let z = w[k][L];
+                    for (let F = 0; F < z.bonds.length; F++)
+                      z.bonds[F] = z.bonds[F] + $;
                     z.index = d[0].length, z.serial = d[0].length, d[0].push(z);
                   }
                 }
@@ -35702,173 +35718,173 @@ ATOM`, b);
               "./src/parsers/cifutils/encoding.ts"
             );
             const a = new Uint16Array(new Uint8Array([18, 52]).buffer)[0] === 13330;
-            function s(L, $) {
-              const z = new ArrayBuffer(L.length), O = new Uint8Array(z);
-              for (let R = 0, P = L.length; R < P; R += $)
-                for (let U = 0; U < $; U++)
-                  O[R + $ - U - 1] = L[R + U];
+            function s($, L) {
+              const z = new ArrayBuffer($.length), F = new Uint8Array(z);
+              for (let R = 0, P = $.length; R < P; R += L)
+                for (let U = 0; U < L; U++)
+                  F[R + L - U - 1] = $[R + U];
               return z;
             }
-            function h(L) {
-              let $ = L.data;
-              for (let z = L.encoding.length - 1; z >= 0; z--)
-                $ = o($, L.encoding[z]);
-              return $;
+            function h($) {
+              let L = $.data;
+              for (let z = $.encoding.length - 1; z >= 0; z--)
+                L = o(L, $.encoding[z]);
+              return L;
             }
-            function o(L, $) {
-              switch ($.kind) {
+            function o($, L) {
+              switch (L.kind) {
                 case "ByteArray":
-                  switch ($.type) {
+                  switch (L.type) {
                     case r.Encoding.IntDataType.Uint8:
-                      return L;
+                      return $;
                     case r.Encoding.IntDataType.Int8:
-                      return f(L);
+                      return f($);
                     case r.Encoding.IntDataType.Int16:
-                      return A(L);
+                      return A($);
                     case r.Encoding.IntDataType.Uint16:
-                      return x(L);
+                      return x($);
                     case r.Encoding.IntDataType.Int32:
-                      return M(L);
+                      return M($);
                     case r.Encoding.IntDataType.Uint32:
-                      return m(L);
+                      return m($);
                     case r.Encoding.FloatDataType.Float32:
-                      return l(L);
+                      return l($);
                     case r.Encoding.FloatDataType.Float64:
-                      return u(L);
+                      return u($);
                     default:
                       throw new Error("unreachable");
                   }
                 case "FixedPoint":
-                  return g(L, $);
+                  return p($, L);
                 case "IntervalQuantization":
-                  return p(L, $);
+                  return g($, L);
                 case "RunLength":
-                  return b(L, $);
+                  return b($, L);
                 case "Delta":
-                  return c(L, $);
+                  return c($, L);
                 case "IntegerPacking":
-                  return w(L, $);
+                  return w($, L);
                 case "StringArray":
-                  return k(L, $);
+                  return k($, L);
               }
             }
-            function d(L, $) {
-              switch (L) {
+            function d($, L) {
+              switch ($) {
                 case r.Encoding.IntDataType.Int8:
-                  return new Int8Array($);
+                  return new Int8Array(L);
                 case r.Encoding.IntDataType.Int16:
-                  return new Int16Array($);
+                  return new Int16Array(L);
                 case r.Encoding.IntDataType.Int32:
-                  return new Int32Array($);
+                  return new Int32Array(L);
                 case r.Encoding.IntDataType.Uint8:
-                  return new Uint8Array($);
+                  return new Uint8Array(L);
                 case r.Encoding.IntDataType.Uint16:
-                  return new Uint16Array($);
+                  return new Uint16Array(L);
                 case r.Encoding.IntDataType.Uint32:
-                  return new Uint32Array($);
+                  return new Uint32Array(L);
                 default:
-                  return new Int32Array($);
+                  return new Int32Array(L);
               }
             }
-            function v(L, $) {
-              switch (L) {
+            function v($, L) {
+              switch ($) {
                 case r.Encoding.FloatDataType.Float32:
-                  return new Float32Array($);
+                  return new Float32Array(L);
                 case r.Encoding.FloatDataType.Float64:
-                  return new Float64Array($);
+                  return new Float64Array(L);
                 default:
-                  return new Float64Array($);
+                  return new Float64Array(L);
               }
             }
-            function f(L) {
-              return new Int8Array(L.buffer, L.byteOffset);
+            function f($) {
+              return new Int8Array($.buffer, $.byteOffset);
             }
-            function y(L, $, z) {
-              return (L.byteOffset != 0 || L.byteLength != L.buffer.byteLength) && (L = new Uint8Array(L)), a ? new z(L.buffer) : new z(s(L, $));
+            function y($, L, z) {
+              return ($.byteOffset != 0 || $.byteLength != $.buffer.byteLength) && ($ = new Uint8Array($)), a ? new z($.buffer) : new z(s($, L));
             }
-            function A(L) {
-              return y(L, 2, Int16Array);
+            function A($) {
+              return y($, 2, Int16Array);
             }
-            function x(L) {
-              return y(L, 2, Uint16Array);
+            function x($) {
+              return y($, 2, Uint16Array);
             }
-            function M(L) {
-              return y(L, 4, Int32Array);
+            function M($) {
+              return y($, 4, Int32Array);
             }
-            function m(L) {
-              return y(L, 4, Uint32Array);
+            function m($) {
+              return y($, 4, Uint32Array);
             }
-            function l(L) {
-              return y(L, 4, Float32Array);
+            function l($) {
+              return y($, 4, Float32Array);
             }
-            function u(L) {
-              return y(L, 8, Float64Array);
+            function u($) {
+              return y($, 8, Float64Array);
             }
-            function g(L, $) {
-              const z = L.length, O = v($.srcType, z), R = 1 / $.factor;
+            function p($, L) {
+              const z = $.length, F = v(L.srcType, z), R = 1 / L.factor;
               for (let P = 0; P < z; P++)
-                O[P] = R * L[P];
-              return O;
+                F[P] = R * $[P];
+              return F;
             }
-            function p(L, $) {
-              const z = L.length, O = v($.srcType, z), R = ($.max - $.min) / ($.numSteps - 1), P = $.min;
+            function g($, L) {
+              const z = $.length, F = v(L.srcType, z), R = (L.max - L.min) / (L.numSteps - 1), P = L.min;
               for (let U = 0; U < z; U++)
-                O[U] = P + R * L[U];
-              return O;
+                F[U] = P + R * $[U];
+              return F;
             }
-            function b(L, $) {
-              const z = d($.srcType, $.srcSize);
-              let O = 0;
-              for (let R = 0, P = L.length; R < P; R += 2) {
-                const U = L[R], N = L[R + 1];
+            function b($, L) {
+              const z = d(L.srcType, L.srcSize);
+              let F = 0;
+              for (let R = 0, P = $.length; R < P; R += 2) {
+                const U = $[R], N = $[R + 1];
                 for (let B = 0; B < N; ++B)
-                  z[O++] = U;
+                  z[F++] = U;
               }
               return z;
             }
-            function c(L, $) {
-              const z = L.length, O = d($.srcType, z);
+            function c($, L) {
+              const z = $.length, F = d(L.srcType, z);
               if (!z)
-                return L;
-              O[0] = L[0] + ($.origin | 0);
+                return $;
+              F[0] = $[0] + (L.origin | 0);
               for (let R = 1; R < z; ++R)
-                O[R] = L[R] + O[R - 1];
-              return O;
+                F[R] = $[R] + F[R - 1];
+              return F;
             }
-            function _(L, $) {
-              const z = $.byteCount === 1 ? 127 : 32767, O = -z - 1, R = L.length, P = new Int32Array($.srcSize);
+            function _($, L) {
+              const z = L.byteCount === 1 ? 127 : 32767, F = -z - 1, R = $.length, P = new Int32Array(L.srcSize);
               let U = 0, N = 0;
               for (; U < R; ) {
-                let B = 0, W = L[U];
-                for (; W === z || W === O; )
-                  B += W, U++, W = L[U];
+                let B = 0, W = $[U];
+                for (; W === z || W === F; )
+                  B += W, U++, W = $[U];
                 B += W, P[N] = B, U++, N++;
               }
               return P;
             }
-            function E(L, $) {
-              const z = $.byteCount === 1 ? 255 : 65535, O = L.length, R = new Int32Array($.srcSize);
+            function E($, L) {
+              const z = L.byteCount === 1 ? 255 : 65535, F = $.length, R = new Int32Array(L.srcSize);
               let P = 0, U = 0;
-              for (; P < O; ) {
-                let N = 0, B = L[P];
+              for (; P < F; ) {
+                let N = 0, B = $[P];
                 for (; B === z; )
-                  N += B, P++, B = L[P];
+                  N += B, P++, B = $[P];
                 N += B, R[U] = N, P++, U++;
               }
               return R;
             }
-            function w(L, $) {
-              return L.length === $.srcSize ? L : $.isUnsigned ? E(L, $) : _(L, $);
+            function w($, L) {
+              return $.length === L.srcSize ? $ : L.isUnsigned ? E($, L) : _($, L);
             }
-            function k(L, $) {
-              const z = h({ encoding: $.offsetEncoding, data: $.offsets }), O = h({ encoding: $.dataEncoding, data: L }), R = $.stringData, P = new Array(z.length);
+            function k($, L) {
+              const z = h({ encoding: L.offsetEncoding, data: L.offsets }), F = h({ encoding: L.dataEncoding, data: $ }), R = L.stringData, P = new Array(z.length);
               P[0] = "";
               for (let B = 1, W = z.length; B < W; B++)
                 P[B] = R.substring(z[B - 1], z[B]);
               let U = 0;
-              const N = new Array(O.length);
-              for (let B = 0, W = O.length; B < W; B++)
-                N[U++] = P[O[B] + 1];
+              const N = new Array(F.length);
+              for (let B = 0, W = F.length; B < W; B++)
+                N[U++] = P[F[B] + 1];
               return N;
             }
           }
@@ -35929,7 +35945,7 @@ ATOM`, b);
               /* harmony export */
               Parsers: () => (
                 /* binding */
-                g
+                p
               ),
               /* harmony export */
               bondLength: () => (
@@ -35989,7 +36005,7 @@ ATOM`, b);
               /*! ./utils/bondLength */
               "./src/parsers/utils/bondLength.ts"
             );
-            const g = {
+            const p = {
               vasp: r.VASP,
               VASP: r.VASP,
               cube: a.CUBE,
@@ -36300,8 +36316,8 @@ ATOM`, b);
                   for (let m = 0; m < A.length; m++) {
                     const l = A[m];
                     if ((0, r.areConnected)(M, l, d)) {
-                      const u = M.bonds.indexOf(l.index), g = l.bonds.indexOf(M.index);
-                      u === -1 && g === -1 ? (M.bonds.push(l.index), M.bondOrder.push(1), l.bonds.push(M.index), l.bondOrder.push(1)) : u === -1 ? (M.bonds.push(l.index), M.bondOrder.push(l.bondOrder[g])) : g === -1 && (l.bonds.push(M.index), l.bondOrder.push(M.bondOrder[u]));
+                      const u = M.bonds.indexOf(l.index), p = l.bonds.indexOf(M.index);
+                      u === -1 && p === -1 ? (M.bonds.push(l.index), M.bondOrder.push(1), l.bonds.push(M.index), l.bondOrder.push(1)) : u === -1 ? (M.bonds.push(l.index), M.bondOrder.push(l.bondOrder[p])) : p === -1 && (l.bonds.push(M.index), l.bondOrder.push(M.bondOrder[u]));
                     }
                   }
                 }
@@ -36312,18 +36328,18 @@ ATOM`, b);
                   const M = parseInt(x);
                   for (let m in v[A][M]) {
                     const l = parseInt(m), u = v[A][M][l];
-                    for (let g = 0; g < u.length; g++) {
-                      const p = u[g];
-                      for (let b = g + 1; b < u.length; b++) {
+                    for (let p = 0; p < u.length; p++) {
+                      const g = u[p];
+                      for (let b = p + 1; b < u.length; b++) {
                         const c = u[b];
-                        (0, r.areConnected)(p, c, d) && p.bonds.indexOf(c.index) == -1 && (p.bonds.push(c.index), p.bondOrder.push(1), c.bonds.push(p.index), c.bondOrder.push(1));
+                        (0, r.areConnected)(g, c, d) && g.bonds.indexOf(c.index) == -1 && (g.bonds.push(c.index), g.bondOrder.push(1), c.bonds.push(g.index), c.bondOrder.push(1));
                       }
                     }
-                    for (let g = 0; g < a.length; g++) {
-                      const p = a[g];
-                      if (!v[A + p.x] || !v[A + p.x][M + p.y] || !v[A + p.x][M + p.y][l + p.z])
+                    for (let p = 0; p < a.length; p++) {
+                      const g = a[p];
+                      if (!v[A + g.x] || !v[A + g.x][M + g.y] || !v[A + g.x][M + g.y][l + g.z])
                         continue;
-                      const b = v[A + p.x][M + p.y][l + p.z];
+                      const b = v[A + g.x][M + g.y][l + g.z];
                       f(u, b);
                     }
                   }
@@ -36371,10 +36387,10 @@ ATOM`, b);
                 const l = v[M];
                 l.resi !== y && (y = l.resi, x || A++, x = !1), l.reschain = A;
                 for (let u = M + 1; u < v.length; u++) {
-                  const g = v[u];
-                  if (g.chain !== l.chain || g.resi - l.resi > 1)
+                  const p = v[u];
+                  if (p.chain !== l.chain || p.resi - l.resi > 1)
                     break;
-                  (0, r.areConnected)(l, g, d) && (l.bonds.indexOf(g.index) === -1 && (l.bonds.push(g.index), l.bondOrder.push(1), g.bonds.push(l.index), g.bondOrder.push(1)), l.resi !== g.resi && (x = !0));
+                  (0, r.areConnected)(l, p, d) && (l.bonds.indexOf(p.index) === -1 && (l.bonds.push(p.index), l.bondOrder.push(1), p.bonds.push(l.index), p.bondOrder.push(1)), l.resi !== p.resi && (x = !0));
                 }
               }
             }
@@ -36609,25 +36625,25 @@ ATOM`, b);
               "./src/parsers/utils/validateBonds.ts"
             );
             function y(A, x, M) {
-              const m = [], l = x.assignBonds === void 0 ? !0 : x.assignBonds, u = !x.keepH, g = !!x.noSecondaryStructure, p = !x.noComputeSecondaryStructure, b = !x.doAssembly, c = x.altLoc ? x.altLoc : "A", _ = { symmetries: [], cryst: void 0 };
+              const m = [], l = x.assignBonds === void 0 ? !0 : x.assignBonds, u = !x.keepH, p = !!x.noSecondaryStructure, g = !x.noComputeSecondaryStructure, b = !x.doAssembly, c = x.altLoc ? x.altLoc : "A", _ = { symmetries: [], cryst: void 0 };
               let E, w = [];
               const k = [];
-              let L;
-              const $ = {};
+              let $;
+              const L = {};
               for (let z = 0; z < A.length; z++) {
-                L = A[z].replace(/^\s*/, "");
-                const O = L.substring(0, 6);
+                $ = A[z].replace(/^\s*/, "");
+                const F = $.substring(0, 6);
                 let R, P, U;
-                if (O.indexOf("END") === 0) {
-                  if (w = A.slice(z + 1), O === "END")
+                if (F.indexOf("END") === 0) {
+                  if (w = A.slice(z + 1), F === "END")
                     for (const N in M)
                       M.hasOwnProperty(N) && delete M[N];
                   break;
-                } else if (O === "ATOM  " || O === "HETATM") {
+                } else if (F === "ATOM  " || F === "HETATM") {
                   let N, B, W, V, G, H, Q, te, ee, ce, fe, oe;
-                  if (fe = L.substring(16, 17), fe !== " " && fe !== c && c !== "*" || (ce = parseInt(L.substring(6, 11)), E = L.substring(12, 16).replace(/ /g, ""), N = L.substring(17, 20).replace(/ /g, ""), B = L.substring(21, 22), W = parseInt(L.substring(22, 26)), V = L.substring(26, 27), G = parseFloat(L.substring(30, 38)), H = parseFloat(L.substring(38, 46)), Q = parseFloat(L.substring(46, 54)), oe = parseFloat(L.substring(60, 68)), ee = L.substring(76, 78).replace(/ /g, ""), ee === "" || s.bondTable[ee] === void 0 ? ee = (0, a.atomNameToElem)(L.substring(12, 14), L[0] == "A") : ee = ee[0].toUpperCase() + ee.substring(1).toLowerCase(), ee === "H" && u))
+                  if (fe = $.substring(16, 17), fe !== " " && fe !== c && c !== "*" || (ce = parseInt($.substring(6, 11)), E = $.substring(12, 16).replace(/ /g, ""), N = $.substring(17, 20).replace(/ /g, ""), B = $.substring(21, 22), W = parseInt($.substring(22, 26)), V = $.substring(26, 27), G = parseFloat($.substring(30, 38)), H = parseFloat($.substring(38, 46)), Q = parseFloat($.substring(46, 54)), oe = parseFloat($.substring(60, 68)), ee = $.substring(76, 78).replace(/ /g, ""), ee === "" || s.bondTable[ee] === void 0 ? ee = (0, a.atomNameToElem)($.substring(12, 14), $[0] == "A") : ee = ee[0].toUpperCase() + ee.substring(1).toLowerCase(), ee === "H" && u))
                     continue;
-                  O[0] == "H" ? te = !0 : te = !1, k[ce] = m.length, m.push({
+                  F[0] == "H" ? te = !0 : te = !1, k[ce] = m.length, m.push({
                     resn: N,
                     x: G,
                     y: H,
@@ -36649,48 +36665,48 @@ ATOM`, b);
                     bondOrder: [],
                     properties: {},
                     b: oe,
-                    pdbline: L
+                    pdbline: $
                   });
-                } else if (O === "SHEET ") {
-                  R = L.substring(21, 22), P = parseInt(L.substring(22, 26)), U = parseInt(L.substring(33, 37)), R in M || (M[R] = {}), M[R][P] = "s1";
+                } else if (F === "SHEET ") {
+                  R = $.substring(21, 22), P = parseInt($.substring(22, 26)), U = parseInt($.substring(33, 37)), R in M || (M[R] = {}), M[R][P] = "s1";
                   for (let N = P + 1; N < U; N++)
                     M[R][N] = "s";
                   M[R][U] = "s2";
-                } else if (O === "CONECT") {
-                  const N = parseInt(L.substring(6, 11)), B = k[N], W = m[B], V = [11, 16, 21, 26];
+                } else if (F === "CONECT") {
+                  const N = parseInt($.substring(6, 11)), B = k[N], W = m[B], V = [11, 16, 21, 26];
                   for (let G = 0; G < 4; G++) {
-                    const H = parseInt(L.substring(V[G], V[G] + 5)), Q = k[H];
+                    const H = parseInt($.substring(V[G], V[G] + 5)), Q = k[H];
                     let te = B + ":" + Q;
                     const ee = m[Q];
                     if (W !== void 0 && ee !== void 0)
-                      if (!$[te])
-                        $[te] = 1, (W.bonds.length == 0 || W.bonds[W.bonds.length - 1] !== Q) && (W.bonds.push(Q), W.bondOrder.push(1));
+                      if (!L[te])
+                        L[te] = 1, (W.bonds.length == 0 || W.bonds[W.bonds.length - 1] !== Q) && (W.bonds.push(Q), W.bondOrder.push(1));
                       else {
-                        $[te] += 1;
+                        L[te] += 1;
                         for (let ce = 0; ce < W.bonds.length; ce++)
                           if (W.bonds[ce] == Q) {
-                            const fe = $[te];
+                            const fe = L[te];
                             fe >= 4 ? W.bondOrder[ce] = 1 : W.bondOrder[ce] = fe;
                           }
                       }
                   }
-                } else if (O === "HELIX ") {
-                  R = L.substring(19, 20), P = parseInt(L.substring(21, 25)), U = parseInt(L.substring(33, 37)), R in M || (M[R] = {}), M[R][P] = "h1";
+                } else if (F === "HELIX ") {
+                  R = $.substring(19, 20), P = parseInt($.substring(21, 25)), U = parseInt($.substring(33, 37)), R in M || (M[R] = {}), M[R][P] = "h1";
                   for (let N = P + 1; N < U; N++)
                     M[R][N] = "h";
                   M[R][U] = "h2";
-                } else if (!b && O === "REMARK" && L.substring(13, 18) === "BIOMT") {
+                } else if (!b && F === "REMARK" && $.substring(13, 18) === "BIOMT") {
                   let N, B = new r.Matrix4();
                   for (N = 1; N <= 3; N++)
-                    if (L = A[z].replace(/^\s*/, ""), parseInt(L.substring(18, 19)) == N)
-                      B.elements[N - 1] = parseFloat(L.substring(23, 33)), B.elements[N - 1 + 4] = parseFloat(L.substring(33, 43)), B.elements[N - 1 + 8] = parseFloat(L.substring(43, 53)), B.elements[N - 1 + 12] = parseFloat(L.substring(53)), z++;
+                    if ($ = A[z].replace(/^\s*/, ""), parseInt($.substring(18, 19)) == N)
+                      B.elements[N - 1] = parseFloat($.substring(23, 33)), B.elements[N - 1 + 4] = parseFloat($.substring(33, 43)), B.elements[N - 1 + 8] = parseFloat($.substring(43, 53)), B.elements[N - 1 + 12] = parseFloat($.substring(53)), z++;
                     else
-                      for (; L.substring(13, 18) === "BIOMT"; )
-                        z++, L = A[z].replace(/^\s*/, "");
+                      for (; $.substring(13, 18) === "BIOMT"; )
+                        z++, $ = A[z].replace(/^\s*/, "");
                   B.elements[3] = 0, B.elements[7] = 0, B.elements[11] = 0, B.elements[15] = 1, _.symmetries.push(B), z--;
-                } else if (O === "CRYST1") {
+                } else if (F === "CRYST1") {
                   let N, B, W, V, G, H;
-                  N = parseFloat(L.substring(7, 15)), B = parseFloat(L.substring(16, 24)), W = parseFloat(L.substring(25, 33)), V = parseFloat(L.substring(34, 40)), G = parseFloat(L.substring(41, 47)), H = parseFloat(L.substring(48, 54)), _.cryst = {
+                  N = parseFloat($.substring(7, 15)), B = parseFloat($.substring(16, 24)), W = parseFloat($.substring(25, 33)), V = parseFloat($.substring(34, 40)), G = parseFloat($.substring(41, 47)), H = parseFloat($.substring(48, 54)), _.cryst = {
                     a: N,
                     b: B,
                     c: W,
@@ -36698,10 +36714,10 @@ ATOM`, b);
                     beta: G,
                     gamma: H
                   };
-                } else if (O === "ANISOU") {
-                  const N = parseInt(L.substring(6, 11)), B = k[N], W = m[B];
+                } else if (F === "ANISOU") {
+                  const N = parseInt($.substring(6, 11)), B = k[N], W = m[B];
                   if (W) {
-                    const V = L.substring(30).trim().split(/\s+/), G = {
+                    const V = $.substring(30).trim().split(/\s+/), G = {
                       u11: parseInt(V[0]),
                       u22: parseInt(V[1]),
                       u33: parseInt(V[2]),
@@ -36713,12 +36729,12 @@ ATOM`, b);
                   }
                 }
               }
-              if ((0, f.validateBonds)(m, k), l && (0, v.assignPDBBonds)(m, x), b || (0, d.processSymmetries)(_.symmetries, m, x, _.cryst), p && !g && (0, h.computeSecondaryStructure)(m, x.hbondCutoff), !(0, o.isEmpty)(M))
+              if ((0, f.validateBonds)(m, k), l && (0, v.assignPDBBonds)(m, x), b || (0, d.processSymmetries)(_.symmetries, m, x, _.cryst), g && !p && (0, h.computeSecondaryStructure)(m, x.hbondCutoff), !(0, o.isEmpty)(M))
                 for (let z = 0; z < m.length; z++) {
-                  const O = m[z];
-                  if (O !== void 0 && O.chain in M && O.resi in M[O.chain]) {
-                    const R = M[O.chain][O.resi];
-                    O.ss = R[0], R.length > 1 && (R[1] == "1" ? O.ssbegin = !0 : R[1] == "2" && (O.ssend = !0));
+                  const F = m[z];
+                  if (F !== void 0 && F.chain in M && F.resi in M[F.chain]) {
+                    const R = M[F.chain][F.resi];
+                    F.ss = R[0], R.length > 1 && (R[1] == "1" ? F.ssbegin = !0 : R[1] == "2" && (F.ssend = !0));
                   }
                 }
               return [m, _, w];
@@ -36770,9 +36786,9 @@ ATOM`, b);
               const v = !o.duplicateAssemblyAtoms, f = h.length;
               let y = f, A = -1, x = null, M = null;
               (o.normalizeAssembly || o.wrapAtoms) && d && (x = (0, r.conversionMatrix3)(d.a, d.b, d.c, d.alpha, d.beta, d.gamma), M = new r.Matrix3(), M.getInverse3(x));
-              let m = function(g) {
-                let p = g.clone().applyMatrix3(M);
-                const b = [p.x, p.y, p.z], c = [0, 0, 0];
+              let m = function(p) {
+                let g = p.clone().applyMatrix3(M);
+                const b = [g.x, g.y, g.z], c = [0, 0, 0];
                 for (let E = 0; E < 3; E++) {
                   for (; b[E] < -1e-3; )
                     b[E] += 1, c[E] += 1;
@@ -36783,62 +36799,62 @@ ATOM`, b);
                 return _.applyMatrix3(x), _;
               };
               if (o.normalizeAssembly && d)
-                for (let g = 0; g < s.length; g++) {
-                  const p = new r.Vector3(0, 0, 0);
+                for (let p = 0; p < s.length; p++) {
+                  const g = new r.Vector3(0, 0, 0);
                   for (let c = 0; c < f; c++) {
                     const _ = new r.Vector3(h[c].x, h[c].y, h[c].z);
-                    _.applyMatrix4(s[g]), p.add(_);
+                    _.applyMatrix4(s[p]), g.add(_);
                   }
-                  p.divideScalar(f);
-                  const b = m(p);
-                  s[g].isNearlyIdentity() && b.lengthSq() > 1e-3 && (A = g), s[g].translate(b);
+                  g.divideScalar(f);
+                  const b = m(g);
+                  s[p].isNearlyIdentity() && b.lengthSq() > 1e-3 && (A = p), s[p].translate(b);
                 }
               if (v) {
                 if (s.length > 1)
-                  for (let g = 0; g < h.length; g++) {
+                  for (let p = 0; p < h.length; p++) {
                     var l = [];
-                    for (let p = 0; p < s.length; p++)
-                      if (!s[p].isNearlyIdentity()) {
+                    for (let g = 0; g < s.length; g++)
+                      if (!s[g].isNearlyIdentity()) {
                         var u = new r.Vector3();
-                        u.set(h[g].x, h[g].y, h[g].z), u.applyMatrix4(s[p]), l.push(u);
+                        u.set(h[p].x, h[p].y, h[p].z), u.applyMatrix4(s[g]), l.push(u);
                       }
-                    h[g].symmetries = l;
+                    h[p].symmetries = l;
                   }
               } else {
-                for (let g = 0; g < f; g++)
-                  h[g].sym = -1;
-                for (let g = 0; g < s.length; g++)
-                  if (!s[g].isNearlyIdentity() && A != g) {
-                    let p = new r.Vector3();
+                for (let p = 0; p < f; p++)
+                  h[p].sym = -1;
+                for (let p = 0; p < s.length; p++)
+                  if (!s[p].isNearlyIdentity() && A != p) {
+                    let g = new r.Vector3();
                     for (let b = 0; b < f; b++) {
                       const c = [];
                       for (let E = 0; E < h[b].bonds.length; E++)
                         c.push(h[b].bonds[E] + y);
-                      if (p.set(h[b].x, h[b].y, h[b].z), p.applyMatrix4(s[g]), o.wrapAtoms && d) {
-                        let E = m(p);
-                        p.add(E);
+                      if (g.set(h[b].x, h[b].y, h[b].z), g.applyMatrix4(s[p]), o.wrapAtoms && d) {
+                        let E = m(g);
+                        g.add(E);
                       }
                       const _ = {};
                       for (const E in h[b])
                         _[E] = h[b][E];
-                      _.x = p.x, _.y = p.y, _.z = p.z, _.bonds = c, _.sym = g, _.index = h.length, h.push(_);
+                      _.x = g.x, _.y = g.y, _.z = g.z, _.bonds = c, _.sym = p, _.index = h.length, h.push(_);
                     }
                     y = h.length;
                   } else
-                    for (let p = 0; p < f; p++)
-                      h[p].sym = g;
+                    for (let g = 0; g < f; g++)
+                      h[g].sym = p;
                 if (o.wrapAtoms && d) {
-                  let g = new r.Vector3();
-                  for (let p = 0; p < f; p++) {
-                    g.set(h[p].x, h[p].y, h[p].z);
-                    let b = m(g);
-                    g.add(b), h[p].x = g.x, h[p].y = g.y, h[p].z = g.z;
+                  let p = new r.Vector3();
+                  for (let g = 0; g < f; g++) {
+                    p.set(h[g].x, h[g].y, h[g].z);
+                    let b = m(p);
+                    p.add(b), h[g].x = p.x, h[g].y = p.y, h[g].z = p.z;
                   }
                 }
                 if (A >= 0) {
-                  const g = new r.Vector3();
-                  for (let p = 0; p < f; p++)
-                    g.set(h[p].x, h[p].y, h[p].z), g.applyMatrix4(s[A]), h[p].x = g.x, h[p].y = g.y, h[p].z = g.z;
+                  const p = new r.Vector3();
+                  for (let g = 0; g < f; g++)
+                    p.set(h[g].x, h[g].y, h[g].z), p.applyMatrix4(s[A]), h[g].x = p.x, h[g].y = p.y, h[g].z = p.z;
                 }
                 s.length = 0;
               }
@@ -37510,9 +37526,9 @@ ATOM`, b);
                   var f = [];
                   o.frames[0].data == null && (o.frames[0].data = o.data);
                   for (var y, A = new Uint8Array(d * v * 4), x = 0; x < o.frames.length; x++) {
-                    var M = o.frames[x], m = M.rect.x, l = M.rect.y, u = M.rect.width, g = M.rect.height, p = s.toRGBA8.decodeImage(M.data, u, g, o);
-                    if (x == 0 ? y = p : M.blend == 0 ? s._copyTile(p, u, g, y, d, v, m, l, 0) : M.blend == 1 && s._copyTile(p, u, g, y, d, v, m, l, 1), f.push(y.buffer), y = y.slice(0), M.dispose != 0) {
-                      if (M.dispose == 1) s._copyTile(A, u, g, y, d, v, m, l, 0);
+                    var M = o.frames[x], m = M.rect.x, l = M.rect.y, u = M.rect.width, p = M.rect.height, g = s.toRGBA8.decodeImage(M.data, u, p, o);
+                    if (x == 0 ? y = g : M.blend == 0 ? s._copyTile(g, u, p, y, d, v, m, l, 0) : M.blend == 1 && s._copyTile(g, u, p, y, d, v, m, l, 1), f.push(y.buffer), y = y.slice(0), M.dispose != 0) {
+                      if (M.dispose == 1) s._copyTile(A, u, p, y, d, v, m, l, 0);
                       else if (M.dispose == 2) {
                         for (var b = x - 1; o.frames[b].dispose == 2; ) b--;
                         y = new Uint8Array(f[b]).slice(0);
@@ -37521,43 +37537,43 @@ ATOM`, b);
                   }
                   return f;
                 }, s.toRGBA8.decodeImage = function(o, d, v, f) {
-                  var y = d * v, A = s.decode._getBPP(f), x = Math.ceil(d * A / 8), M = new Uint8Array(y * 4), m = new Uint32Array(M.buffer), l = f.ctype, u = f.depth, g = s._bin.readUshort;
+                  var y = d * v, A = s.decode._getBPP(f), x = Math.ceil(d * A / 8), M = new Uint8Array(y * 4), m = new Uint32Array(M.buffer), l = f.ctype, u = f.depth, p = s._bin.readUshort;
                   if (l == 6) {
-                    var p = y << 2;
-                    if (u == 8) for (var b = 0; b < p; b++)
+                    var g = y << 2;
+                    if (u == 8) for (var b = 0; b < g; b++)
                       M[b] = o[b];
-                    if (u == 16) for (var b = 0; b < p; b++)
+                    if (u == 16) for (var b = 0; b < g; b++)
                       M[b] = o[b << 1];
                   } else if (l == 2) {
                     var c = f.tabs.tRNS, _ = -1, E = -1, w = -1;
                     if (c && (_ = c[0], E = c[1], w = c[2]), u == 8) for (var b = 0; b < y; b++) {
-                      var k = b << 2, L = b * 3;
-                      M[k] = o[L], M[k + 1] = o[L + 1], M[k + 2] = o[L + 2], M[k + 3] = 255, _ != -1 && o[L] == _ && o[L + 1] == E && o[L + 2] == w && (M[k + 3] = 0);
+                      var k = b << 2, $ = b * 3;
+                      M[k] = o[$], M[k + 1] = o[$ + 1], M[k + 2] = o[$ + 2], M[k + 3] = 255, _ != -1 && o[$] == _ && o[$ + 1] == E && o[$ + 2] == w && (M[k + 3] = 0);
                     }
                     if (u == 16) for (var b = 0; b < y; b++) {
-                      var k = b << 2, L = b * 6;
-                      M[k] = o[L], M[k + 1] = o[L + 2], M[k + 2] = o[L + 4], M[k + 3] = 255, _ != -1 && g(o, L) == _ && g(o, L + 2) == E && g(o, L + 4) == w && (M[k + 3] = 0);
+                      var k = b << 2, $ = b * 6;
+                      M[k] = o[$], M[k + 1] = o[$ + 2], M[k + 2] = o[$ + 4], M[k + 3] = 255, _ != -1 && p(o, $) == _ && p(o, $ + 2) == E && p(o, $ + 4) == w && (M[k + 3] = 0);
                     }
                   } else if (l == 3) {
-                    var $ = f.tabs.PLTE, z = f.tabs.tRNS, O = z ? z.length : 0;
+                    var L = f.tabs.PLTE, z = f.tabs.tRNS, F = z ? z.length : 0;
                     if (u == 1) for (var R = 0; R < v; R++)
                       for (var P = R * x, U = R * d, b = 0; b < d; b++) {
                         var k = U + b << 2, N = o[P + (b >> 3)] >> 7 - ((b & 7) << 0) & 1, B = 3 * N;
-                        M[k] = $[B], M[k + 1] = $[B + 1], M[k + 2] = $[B + 2], M[k + 3] = N < O ? z[N] : 255;
+                        M[k] = L[B], M[k + 1] = L[B + 1], M[k + 2] = L[B + 2], M[k + 3] = N < F ? z[N] : 255;
                       }
                     if (u == 2) for (var R = 0; R < v; R++)
                       for (var P = R * x, U = R * d, b = 0; b < d; b++) {
                         var k = U + b << 2, N = o[P + (b >> 2)] >> 6 - ((b & 3) << 1) & 3, B = 3 * N;
-                        M[k] = $[B], M[k + 1] = $[B + 1], M[k + 2] = $[B + 2], M[k + 3] = N < O ? z[N] : 255;
+                        M[k] = L[B], M[k + 1] = L[B + 1], M[k + 2] = L[B + 2], M[k + 3] = N < F ? z[N] : 255;
                       }
                     if (u == 4) for (var R = 0; R < v; R++)
                       for (var P = R * x, U = R * d, b = 0; b < d; b++) {
                         var k = U + b << 2, N = o[P + (b >> 1)] >> 4 - ((b & 1) << 2) & 15, B = 3 * N;
-                        M[k] = $[B], M[k + 1] = $[B + 1], M[k + 2] = $[B + 2], M[k + 3] = N < O ? z[N] : 255;
+                        M[k] = L[B], M[k + 1] = L[B + 1], M[k + 2] = L[B + 2], M[k + 3] = N < F ? z[N] : 255;
                       }
                     if (u == 8) for (var b = 0; b < y; b++) {
                       var k = b << 2, N = o[b], B = 3 * N;
-                      M[k] = $[B], M[k + 1] = $[B + 1], M[k + 2] = $[B + 2], M[k + 3] = N < O ? z[N] : 255;
+                      M[k] = L[B], M[k + 1] = L[B + 1], M[k + 2] = L[B + 2], M[k + 3] = N < F ? z[N] : 255;
                     }
                   } else if (l == 4) {
                     if (u == 8) for (var b = 0; b < y; b++) {
@@ -37587,13 +37603,13 @@ ATOM`, b);
                       m[b] = G << 24 | V << 16 | V << 8 | V;
                     }
                     if (u == 16) for (var b = 0; b < y; b++) {
-                      var V = o[b << 1], G = g(o, b << 1) == _ ? 0 : 255;
+                      var V = o[b << 1], G = p(o, b << 1) == _ ? 0 : 255;
                       m[b] = G << 24 | V << 16 | V << 8 | V;
                     }
                   }
                   return M;
                 }, s.decode = function(o) {
-                  for (var d = new Uint8Array(o), v = 8, f = s._bin, y = f.readUshort, A = f.readUint, x = { tabs: {}, frames: [] }, M = new Uint8Array(d.length), m = 0, l, u = 0, g = [137, 80, 78, 71, 13, 10, 26, 10], p = 0; p < 8; p++) if (d[p] != g[p]) throw "The input is not a PNG file!";
+                  for (var d = new Uint8Array(o), v = 8, f = s._bin, y = f.readUshort, A = f.readUint, x = { tabs: {}, frames: [] }, M = new Uint8Array(d.length), m = 0, l, u = 0, p = [137, 80, 78, 71, 13, 10, 26, 10], g = 0; g < 8; g++) if (d[g] != p[g]) throw "The input is not a PNG file!";
                   for (; v < d.length; ) {
                     var b = f.readUint(d, v);
                     v += 4;
@@ -37601,7 +37617,7 @@ ATOM`, b);
                     if (v += 4, c == "IHDR")
                       s.decode._IHDR(d, v, x);
                     else if (c == "IDAT") {
-                      for (var p = 0; p < b; p++) M[m + p] = d[v + p];
+                      for (var g = 0; g < b; g++) M[m + g] = d[v + g];
                       m += b;
                     } else if (c == "acTL")
                       x.tabs[c] = { num_frames: A(d, v), num_plays: A(d, v + 4) }, l = new Uint8Array(d.length);
@@ -37615,31 +37631,31 @@ ATOM`, b);
                       var k = { rect: E, delay: Math.round(w * 1e3), dispose: d[v + 24], blend: d[v + 25] };
                       x.frames.push(k);
                     } else if (c == "fdAT") {
-                      for (var p = 0; p < b - 4; p++) l[u + p] = d[v + p + 4];
+                      for (var g = 0; g < b - 4; g++) l[u + g] = d[v + g + 4];
                       u += b - 4;
                     } else if (c == "pHYs")
                       x.tabs[c] = [f.readUint(d, v), f.readUint(d, v + 4), d[v + 8]];
                     else if (c == "cHRM") {
                       x.tabs[c] = [];
-                      for (var p = 0; p < 8; p++) x.tabs[c].push(f.readUint(d, v + p * 4));
+                      for (var g = 0; g < 8; g++) x.tabs[c].push(f.readUint(d, v + g * 4));
                     } else if (c == "tEXt") {
                       x.tabs[c] == null && (x.tabs[c] = {});
-                      var L = f.nextZero(d, v), $ = f.readASCII(d, v, L - v), z = f.readASCII(d, L + 1, v + b - L - 1);
-                      x.tabs[c][$] = z;
+                      var $ = f.nextZero(d, v), L = f.readASCII(d, v, $ - v), z = f.readASCII(d, $ + 1, v + b - $ - 1);
+                      x.tabs[c][L] = z;
                     } else if (c == "iTXt") {
                       x.tabs[c] == null && (x.tabs[c] = {});
-                      var L = 0, O = v;
-                      L = f.nextZero(d, O);
-                      var $ = f.readASCII(d, O, L - O);
-                      O = L + 1, d[O], d[O + 1], O += 2, L = f.nextZero(d, O), f.readASCII(d, O, L - O), O = L + 1, L = f.nextZero(d, O), f.readUTF8(d, O, L - O), O = L + 1;
-                      var z = f.readUTF8(d, O, b - (O - v));
-                      x.tabs[c][$] = z;
+                      var $ = 0, F = v;
+                      $ = f.nextZero(d, F);
+                      var L = f.readASCII(d, F, $ - F);
+                      F = $ + 1, d[F], d[F + 1], F += 2, $ = f.nextZero(d, F), f.readASCII(d, F, $ - F), F = $ + 1, $ = f.nextZero(d, F), f.readUTF8(d, F, $ - F), F = $ + 1;
+                      var z = f.readUTF8(d, F, b - (F - v));
+                      x.tabs[c][L] = z;
                     } else if (c == "PLTE")
                       x.tabs[c] = f.readBytes(d, v, b);
                     else if (c == "hIST") {
                       var R = x.tabs.PLTE.length / 3;
                       x.tabs[c] = [];
-                      for (var p = 0; p < R; p++) x.tabs[c].push(y(d, v + p * 2));
+                      for (var g = 0; g < R; g++) x.tabs[c].push(y(d, v + g * 2));
                     } else if (c == "tRNS")
                       x.ctype == 3 ? x.tabs[c] = f.readBytes(d, v, b) : x.ctype == 0 ? x.tabs[c] = y(d, v) : x.ctype == 2 && (x.tabs[c] = [y(d, v), y(d, v + 2), y(d, v + 4)]);
                     else if (c == "gAMA") x.tabs[c] = f.readUint(d, v) / 1e5;
@@ -37662,34 +37678,34 @@ ATOM`, b);
                 }, s.decode._inflate = function(o) {
                   return h.inflate(o);
                 }, s.decode._readInterlace = function(o, d) {
-                  for (var v = d.width, f = d.height, y = s.decode._getBPP(d), A = y >> 3, x = Math.ceil(v * y / 8), M = new Uint8Array(f * x), m = 0, l = [0, 0, 4, 0, 2, 0, 1], u = [0, 4, 0, 2, 0, 1, 0], g = [8, 8, 8, 4, 4, 2, 2], p = [8, 8, 4, 4, 2, 2, 1], b = 0; b < 7; ) {
-                    for (var c = g[b], _ = p[b], E = 0, w = 0, k = l[b]; k < f; )
+                  for (var v = d.width, f = d.height, y = s.decode._getBPP(d), A = y >> 3, x = Math.ceil(v * y / 8), M = new Uint8Array(f * x), m = 0, l = [0, 0, 4, 0, 2, 0, 1], u = [0, 4, 0, 2, 0, 1, 0], p = [8, 8, 8, 4, 4, 2, 2], g = [8, 8, 4, 4, 2, 2, 1], b = 0; b < 7; ) {
+                    for (var c = p[b], _ = g[b], E = 0, w = 0, k = l[b]; k < f; )
                       k += c, w++;
-                    for (var L = u[b]; L < v; )
-                      L += _, E++;
-                    var $ = Math.ceil(E * y / 8);
+                    for (var $ = u[b]; $ < v; )
+                      $ += _, E++;
+                    var L = Math.ceil(E * y / 8);
                     s.decode._filterZero(o, d, m, E, w);
-                    for (var z = 0, O = l[b]; O < f; ) {
-                      for (var R = u[b], P = m + z * $ << 3; R < v; ) {
+                    for (var z = 0, F = l[b]; F < f; ) {
+                      for (var R = u[b], P = m + z * L << 3; R < v; ) {
                         if (y == 1) {
                           var U = o[P >> 3];
-                          U = U >> 7 - (P & 7) & 1, M[O * x + (R >> 3)] |= U << 7 - ((R & 3) << 0);
+                          U = U >> 7 - (P & 7) & 1, M[F * x + (R >> 3)] |= U << 7 - ((R & 3) << 0);
                         }
                         if (y == 2) {
                           var U = o[P >> 3];
-                          U = U >> 6 - (P & 7) & 3, M[O * x + (R >> 2)] |= U << 6 - ((R & 3) << 1);
+                          U = U >> 6 - (P & 7) & 3, M[F * x + (R >> 2)] |= U << 6 - ((R & 3) << 1);
                         }
                         if (y == 4) {
                           var U = o[P >> 3];
-                          U = U >> 4 - (P & 7) & 15, M[O * x + (R >> 1)] |= U << 4 - ((R & 1) << 2);
+                          U = U >> 4 - (P & 7) & 15, M[F * x + (R >> 1)] |= U << 4 - ((R & 1) << 2);
                         }
                         if (y >= 8)
-                          for (var N = O * x + R * A, B = 0; B < A; B++) M[N + B] = o[(P >> 3) + B];
+                          for (var N = F * x + R * A, B = 0; B < A; B++) M[N + B] = o[(P >> 3) + B];
                         P += y, R += _;
                       }
-                      z++, O += c;
+                      z++, F += c;
                     }
-                    E * w != 0 && (m += w * (1 + $)), b = b + 1;
+                    E * w != 0 && (m += w * (1 + L)), b = b + 1;
                   }
                   return M;
                 }, s.decode._getBPP = function(o) {
@@ -37699,26 +37715,26 @@ ATOM`, b);
                   var A = s.decode._getBPP(d), x = Math.ceil(f * A / 8), M = s.decode._paeth;
                   A = Math.ceil(A / 8);
                   for (var m = 0; m < y; m++) {
-                    var l = v + m * x, u = l + m + 1, g = o[u - 1];
-                    if (g == 0) for (var p = 0; p < x; p++) o[l + p] = o[u + p];
-                    else if (g == 1) {
-                      for (var p = 0; p < A; p++) o[l + p] = o[u + p];
-                      for (var p = A; p < x; p++) o[l + p] = o[u + p] + o[l + p - A] & 255;
+                    var l = v + m * x, u = l + m + 1, p = o[u - 1];
+                    if (p == 0) for (var g = 0; g < x; g++) o[l + g] = o[u + g];
+                    else if (p == 1) {
+                      for (var g = 0; g < A; g++) o[l + g] = o[u + g];
+                      for (var g = A; g < x; g++) o[l + g] = o[u + g] + o[l + g - A] & 255;
                     } else if (m == 0) {
-                      for (var p = 0; p < A; p++) o[l + p] = o[u + p];
-                      if (g == 2) for (var p = A; p < x; p++) o[l + p] = o[u + p] & 255;
-                      if (g == 3) for (var p = A; p < x; p++) o[l + p] = o[u + p] + (o[l + p - A] >> 1) & 255;
-                      if (g == 4) for (var p = A; p < x; p++) o[l + p] = o[u + p] + M(o[l + p - A], 0, 0) & 255;
+                      for (var g = 0; g < A; g++) o[l + g] = o[u + g];
+                      if (p == 2) for (var g = A; g < x; g++) o[l + g] = o[u + g] & 255;
+                      if (p == 3) for (var g = A; g < x; g++) o[l + g] = o[u + g] + (o[l + g - A] >> 1) & 255;
+                      if (p == 4) for (var g = A; g < x; g++) o[l + g] = o[u + g] + M(o[l + g - A], 0, 0) & 255;
                     } else {
-                      if (g == 2)
-                        for (var p = 0; p < x; p++) o[l + p] = o[u + p] + o[l + p - x] & 255;
-                      if (g == 3) {
-                        for (var p = 0; p < A; p++) o[l + p] = o[u + p] + (o[l + p - x] >> 1) & 255;
-                        for (var p = A; p < x; p++) o[l + p] = o[u + p] + (o[l + p - x] + o[l + p - A] >> 1) & 255;
+                      if (p == 2)
+                        for (var g = 0; g < x; g++) o[l + g] = o[u + g] + o[l + g - x] & 255;
+                      if (p == 3) {
+                        for (var g = 0; g < A; g++) o[l + g] = o[u + g] + (o[l + g - x] >> 1) & 255;
+                        for (var g = A; g < x; g++) o[l + g] = o[u + g] + (o[l + g - x] + o[l + g - A] >> 1) & 255;
                       }
-                      if (g == 4) {
-                        for (var p = 0; p < A; p++) o[l + p] = o[u + p] + M(0, o[l + p - x], 0) & 255;
-                        for (var p = A; p < x; p++) o[l + p] = o[u + p] + M(o[l + p - A], o[l + p - x], o[l + p - A - x]) & 255;
+                      if (p == 4) {
+                        for (var g = 0; g < A; g++) o[l + g] = o[u + g] + M(0, o[l + g - x], 0) & 255;
+                        for (var g = A; g < x; g++) o[l + g] = o[u + g] + M(o[l + g - A], o[l + g - x], o[l + g - A - x]) & 255;
                       }
                     }
                   }
@@ -37770,64 +37786,64 @@ ATOM`, b);
                     return y;
                   }
                 }, s._copyTile = function(o, d, v, f, y, A, x, M, m) {
-                  for (var l = Math.min(d, y), u = Math.min(v, A), g = 0, p = 0, b = 0; b < u; b++)
+                  for (var l = Math.min(d, y), u = Math.min(v, A), p = 0, g = 0, b = 0; b < u; b++)
                     for (var c = 0; c < l; c++)
-                      if (x >= 0 && M >= 0 ? (g = b * d + c << 2, p = (M + b) * y + x + c << 2) : (g = (-M + b) * d - x + c << 2, p = b * y + c << 2), m == 0)
-                        f[p] = o[g], f[p + 1] = o[g + 1], f[p + 2] = o[g + 2], f[p + 3] = o[g + 3];
+                      if (x >= 0 && M >= 0 ? (p = b * d + c << 2, g = (M + b) * y + x + c << 2) : (p = (-M + b) * d - x + c << 2, g = b * y + c << 2), m == 0)
+                        f[g] = o[p], f[g + 1] = o[p + 1], f[g + 2] = o[p + 2], f[g + 3] = o[p + 3];
                       else if (m == 1) {
-                        var _ = o[g + 3] * 0.00392156862745098, E = o[g] * _, w = o[g + 1] * _, k = o[g + 2] * _, L = f[p + 3] * (1 / 255), $ = f[p] * L, z = f[p + 1] * L, O = f[p + 2] * L, R = 1 - _, P = _ + L * R, U = P == 0 ? 0 : 1 / P;
-                        f[p + 3] = 255 * P, f[p + 0] = (E + $ * R) * U, f[p + 1] = (w + z * R) * U, f[p + 2] = (k + O * R) * U;
+                        var _ = o[p + 3] * 0.00392156862745098, E = o[p] * _, w = o[p + 1] * _, k = o[p + 2] * _, $ = f[g + 3] * (1 / 255), L = f[g] * $, z = f[g + 1] * $, F = f[g + 2] * $, R = 1 - _, P = _ + $ * R, U = P == 0 ? 0 : 1 / P;
+                        f[g + 3] = 255 * P, f[g + 0] = (E + L * R) * U, f[g + 1] = (w + z * R) * U, f[g + 2] = (k + F * R) * U;
                       } else if (m == 2) {
-                        var _ = o[g + 3], E = o[g], w = o[g + 1], k = o[g + 2], L = f[p + 3], $ = f[p], z = f[p + 1], O = f[p + 2];
-                        _ == L && E == $ && w == z && k == O ? (f[p] = 0, f[p + 1] = 0, f[p + 2] = 0, f[p + 3] = 0) : (f[p] = E, f[p + 1] = w, f[p + 2] = k, f[p + 3] = _);
+                        var _ = o[p + 3], E = o[p], w = o[p + 1], k = o[p + 2], $ = f[g + 3], L = f[g], z = f[g + 1], F = f[g + 2];
+                        _ == $ && E == L && w == z && k == F ? (f[g] = 0, f[g + 1] = 0, f[g + 2] = 0, f[g + 3] = 0) : (f[g] = E, f[g + 1] = w, f[g + 2] = k, f[g + 3] = _);
                       } else if (m == 3) {
-                        var _ = o[g + 3], E = o[g], w = o[g + 1], k = o[g + 2], L = f[p + 3], $ = f[p], z = f[p + 1], O = f[p + 2];
-                        if (_ == L && E == $ && w == z && k == O) continue;
-                        if (_ < 220 && L > 20) return !1;
+                        var _ = o[p + 3], E = o[p], w = o[p + 1], k = o[p + 2], $ = f[g + 3], L = f[g], z = f[g + 1], F = f[g + 2];
+                        if (_ == $ && E == L && w == z && k == F) continue;
+                        if (_ < 220 && $ > 20) return !1;
                       }
                   return !0;
                 }, s.encode = function(o, d, v, f, y, A) {
                   f == null && (f = 0), A == null && (A = !1);
                   for (var x = new Uint8Array(o[0].byteLength * o.length + 100), M = [137, 80, 78, 71, 13, 10, 26, 10], m = 0; m < 8; m++) x[m] = M[m];
-                  var l = 8, u = s._bin, g = s.crc.crc, p = u.writeUint, b = u.writeUshort, c = u.writeASCII, _ = s.encode.compressPNG(o, d, v, f, A);
-                  p(x, l, 13), l += 4, c(x, l, "IHDR"), l += 4, p(x, l, d), l += 4, p(x, l, v), l += 4, x[l] = _.depth, l++, x[l] = _.ctype, l++, x[l] = 0, l++, x[l] = 0, l++, x[l] = 0, l++, p(x, l, g(x, l - 17, 17)), l += 4, p(x, l, 1), l += 4, c(x, l, "sRGB"), l += 4, x[l] = 1, l++, p(x, l, g(x, l - 5, 5)), l += 4;
+                  var l = 8, u = s._bin, p = s.crc.crc, g = u.writeUint, b = u.writeUshort, c = u.writeASCII, _ = s.encode.compressPNG(o, d, v, f, A);
+                  g(x, l, 13), l += 4, c(x, l, "IHDR"), l += 4, g(x, l, d), l += 4, g(x, l, v), l += 4, x[l] = _.depth, l++, x[l] = _.ctype, l++, x[l] = 0, l++, x[l] = 0, l++, x[l] = 0, l++, g(x, l, p(x, l - 17, 17)), l += 4, g(x, l, 1), l += 4, c(x, l, "sRGB"), l += 4, x[l] = 1, l++, g(x, l, p(x, l - 5, 5)), l += 4;
                   var E = o.length > 1;
-                  if (E && (p(x, l, 8), l += 4, c(x, l, "acTL"), l += 4, p(x, l, o.length), l += 4, p(x, l, 0), l += 4, p(x, l, g(x, l - 12, 12)), l += 4), _.ctype == 3) {
+                  if (E && (g(x, l, 8), l += 4, c(x, l, "acTL"), l += 4, g(x, l, o.length), l += 4, g(x, l, 0), l += 4, g(x, l, p(x, l - 12, 12)), l += 4), _.ctype == 3) {
                     var w = _.plte.length;
-                    p(x, l, w * 3), l += 4, c(x, l, "PLTE"), l += 4;
+                    g(x, l, w * 3), l += 4, c(x, l, "PLTE"), l += 4;
                     for (var m = 0; m < w; m++) {
-                      var k = m * 3, L = _.plte[m], $ = L & 255, z = L >> 8 & 255, O = L >> 16 & 255;
-                      x[l + k + 0] = $, x[l + k + 1] = z, x[l + k + 2] = O;
+                      var k = m * 3, $ = _.plte[m], L = $ & 255, z = $ >> 8 & 255, F = $ >> 16 & 255;
+                      x[l + k + 0] = L, x[l + k + 1] = z, x[l + k + 2] = F;
                     }
-                    if (l += w * 3, p(x, l, g(x, l - w * 3 - 4, w * 3 + 4)), l += 4, _.gotAlpha) {
-                      p(x, l, w), l += 4, c(x, l, "tRNS"), l += 4;
+                    if (l += w * 3, g(x, l, p(x, l - w * 3 - 4, w * 3 + 4)), l += 4, _.gotAlpha) {
+                      g(x, l, w), l += 4, c(x, l, "tRNS"), l += 4;
                       for (var m = 0; m < w; m++) x[l + m] = _.plte[m] >> 24 & 255;
-                      l += w, p(x, l, g(x, l - w - 4, w + 4)), l += 4;
+                      l += w, g(x, l, p(x, l - w - 4, w + 4)), l += 4;
                     }
                   }
                   for (var R = 0, P = 0; P < _.frames.length; P++) {
                     var U = _.frames[P];
-                    E && (p(x, l, 26), l += 4, c(x, l, "fcTL"), l += 4, p(x, l, R++), l += 4, p(x, l, U.rect.width), l += 4, p(x, l, U.rect.height), l += 4, p(x, l, U.rect.x), l += 4, p(x, l, U.rect.y), l += 4, b(x, l, y[P]), l += 2, b(x, l, 1e3), l += 2, x[l] = U.dispose, l++, x[l] = U.blend, l++, p(x, l, g(x, l - 30, 30)), l += 4);
+                    E && (g(x, l, 26), l += 4, c(x, l, "fcTL"), l += 4, g(x, l, R++), l += 4, g(x, l, U.rect.width), l += 4, g(x, l, U.rect.height), l += 4, g(x, l, U.rect.x), l += 4, g(x, l, U.rect.y), l += 4, b(x, l, y[P]), l += 2, b(x, l, 1e3), l += 2, x[l] = U.dispose, l++, x[l] = U.blend, l++, g(x, l, p(x, l - 30, 30)), l += 4);
                     var N = U.cimg, w = N.length;
-                    p(x, l, w + (P == 0 ? 0 : 4)), l += 4;
+                    g(x, l, w + (P == 0 ? 0 : 4)), l += 4;
                     var B = l;
-                    c(x, l, P == 0 ? "IDAT" : "fdAT"), l += 4, P != 0 && (p(x, l, R++), l += 4);
+                    c(x, l, P == 0 ? "IDAT" : "fdAT"), l += 4, P != 0 && (g(x, l, R++), l += 4);
                     for (var m = 0; m < w; m++) x[l + m] = N[m];
-                    l += w, p(x, l, g(x, B, l - B)), l += 4;
+                    l += w, g(x, l, p(x, B, l - B)), l += 4;
                   }
-                  return p(x, l, 0), l += 4, c(x, l, "IEND"), l += 4, p(x, l, g(x, l - 4, 4)), l += 4, x.buffer.slice(0, l);
+                  return g(x, l, 0), l += 4, c(x, l, "IEND"), l += 4, g(x, l, p(x, l - 4, 4)), l += 4, x.buffer.slice(0, l);
                 }, s.encode.compressPNG = function(o, d, v, f, y) {
                   for (var A = s.encode.compress(o, d, v, f, !1, y), x = 0; x < o.length; x++) {
                     var M = A.frames[x];
                     M.rect.width;
-                    var m = M.rect.height, l = M.bpl, u = M.bpp, g = new Uint8Array(m * l + m);
-                    M.cimg = s.encode._filterZero(M.img, m, u, l, g);
+                    var m = M.rect.height, l = M.bpl, u = M.bpp, p = new Uint8Array(m * l + m);
+                    M.cimg = s.encode._filterZero(M.img, m, u, l, p);
                   }
                   return A;
                 }, s.encode.compress = function(o, d, v, f, y, A) {
                   A == null && (A = !1);
                   for (var x = 6, M = 8, m = 4, l = 255, u = 0; u < o.length; u++)
-                    for (var g = new Uint8Array(o[u]), p = g.length, b = 0; b < p; b += 4) l &= g[b + 3];
+                    for (var p = new Uint8Array(o[u]), g = p.length, b = 0; b < g; b += 4) l &= p[b + 3];
                   var c = l != 255, _ = {}, E = [];
                   if (o.length != 0 && (_[0] = 0, E.push(0), f != 0 && f--), f != 0) {
                     var w = s.quantize(o, f, y);
@@ -37838,17 +37854,17 @@ ATOM`, b);
                     }
                   } else
                     for (var u = 0; u < o.length; u++)
-                      for (var L = new Uint32Array(o[u]), p = L.length, b = 0; b < p; b++) {
-                        var k = L[b];
-                        if ((b < d || k != L[b - 1] && k != L[b - d]) && _[k] == null && (_[k] = E.length, E.push(k), E.length >= 300))
+                      for (var $ = new Uint32Array(o[u]), g = $.length, b = 0; b < g; b++) {
+                        var k = $[b];
+                        if ((b < d || k != $[b - 1] && k != $[b - d]) && _[k] == null && (_[k] = E.length, E.push(k), E.length >= 300))
                           break;
                       }
-                  var $ = c ? y : !1, z = E.length;
+                  var L = c ? y : !1, z = E.length;
                   z <= 256 && A == !1 && (z <= 2 ? M = 1 : z <= 4 ? M = 2 : z <= 16 ? M = 4 : M = 8, y && (M = 8), c = !0);
-                  for (var O = [], u = 0; u < o.length; u++) {
+                  for (var F = [], u = 0; u < o.length; u++) {
                     var R = new Uint8Array(o[u]), P = new Uint32Array(R.buffer), U = 0, N = 0, B = d, W = v, V = 0;
-                    if (u != 0 && !$) {
-                      for (var G = y || u == 1 || O[O.length - 2].dispose == 2 ? 1 : 2, H = 0, Q = 1e9, te = 0; te < G; te++) {
+                    if (u != 0 && !L) {
+                      for (var G = y || u == 1 || F[F.length - 2].dispose == 2 ? 1 : 2, H = 0, Q = 1e9, te = 0; te < G; te++) {
                         for (var pe = new Uint8Array(o[u - 1 - te]), ee = new Uint32Array(o[u - 1 - te]), ce = d, fe = v, oe = -1, he = -1, Ae = 0; Ae < v; Ae++) for (var Se = 0; Se < d; Se++) {
                           var b = Ae * d + Se;
                           P[b] != ee[b] && (Se < ce && (ce = Se), Se > oe && (oe = Se), Ae < fe && (fe = Ae), Ae > he && (he = Ae));
@@ -37857,7 +37873,7 @@ ATOM`, b);
                         Ie < Q && (Q = Ie, H = te, oe == -1 ? (U = N = 0, B = W = 1) : (U = ce, N = fe, B = oe - ce + 1, W = he - fe + 1));
                       }
                       var pe = new Uint8Array(o[u - 1 - H]);
-                      H == 1 && (O[O.length - 1].dispose = 2);
+                      H == 1 && (F[F.length - 1].dispose = 2);
                       var le = new Uint8Array(B * W * 4);
                       new Uint32Array(le.buffer), s._copyTile(pe, d, v, le, B, W, -U, -N, 0), s._copyTile(R, d, v, le, B, W, -U, -N, 3) ? (s._copyTile(R, d, v, le, B, W, -U, -N, 2), V = 1) : (s._copyTile(R, d, v, le, B, W, -U, -N, 0), V = 0), R = le, P = new Uint32Array(R.buffer);
                     }
@@ -37873,15 +37889,15 @@ ATOM`, b);
                       }
                       R = le, x = 3, m = 1;
                     } else if (c == !1 && o.length == 1) {
-                      for (var le = new Uint8Array(B * W * 3), Fe = B * W, b = 0; b < Fe; b++) {
+                      for (var le = new Uint8Array(B * W * 3), Oe = B * W, b = 0; b < Oe; b++) {
                         var Be = b * 3, Ue = b * 4;
                         le[Be] = R[Ue], le[Be + 1] = R[Ue + 1], le[Be + 2] = R[Ue + 2];
                       }
                       R = le, x = 2, m = 3, ne = 3 * B;
                     }
-                    O.push({ rect: { x: U, y: N, width: B, height: W }, img: R, bpl: ne, bpp: m, blend: V, dispose: $ ? 1 : 0 });
+                    F.push({ rect: { x: U, y: N, width: B, height: W }, img: R, bpl: ne, bpp: m, blend: V, dispose: L ? 1 : 0 });
                   }
-                  return { ctype: x, depth: M, plte: E, gotAlpha: c, frames: O };
+                  return { ctype: x, depth: M, plte: E, gotAlpha: c, frames: F };
                 }, s.encode._filterZero = function(o, d, v, f, y) {
                   for (var A = [], x = 0; x < 5; x++)
                     if (!(d * f > 5e5 && (x == 2 || x == 3 || x == 4))) {
@@ -37933,31 +37949,31 @@ ATOM`, b);
                   for (var f = [], y = 0, A = 0; A < o.length; A++)
                     f.push(s.encode.alphaMul(new Uint8Array(o[A]), v)), y += o[A].byteLength;
                   for (var x = new Uint8Array(y), M = new Uint32Array(x.buffer), m = 0, A = 0; A < f.length; A++) {
-                    for (var l = f[A], u = l.length, g = 0; g < u; g++) x[m + g] = l[g];
+                    for (var l = f[A], u = l.length, p = 0; p < u; p++) x[m + p] = l[p];
                     m += u;
                   }
-                  var p = { i0: 0, i1: x.length, bst: null, est: null, tdst: 0, left: null, right: null };
-                  p.bst = s.quantize.stats(x, p.i0, p.i1), p.est = s.quantize.estats(p.bst);
-                  for (var b = [p]; b.length < d; ) {
+                  var g = { i0: 0, i1: x.length, bst: null, est: null, tdst: 0, left: null, right: null };
+                  g.bst = s.quantize.stats(x, g.i0, g.i1), g.est = s.quantize.estats(g.bst);
+                  for (var b = [g]; b.length < d; ) {
                     for (var c = 0, _ = 0, A = 0; A < b.length; A++) b[A].est.L > c && (c = b[A].est.L, _ = A);
                     if (c < 1e-3) break;
                     var E = b[_], w = s.quantize.splitPixels(x, M, E.i0, E.i1, E.est.e, E.est.eMq255), k = { i0: E.i0, i1: w, bst: null, est: null, tdst: 0, left: null, right: null };
                     k.bst = s.quantize.stats(x, k.i0, k.i1), k.est = s.quantize.estats(k.bst);
-                    var L = { i0: w, i1: E.i1, bst: null, est: null, tdst: 0, left: null, right: null };
-                    L.bst = { R: [], m: [], N: E.bst.N - k.bst.N };
-                    for (var A = 0; A < 16; A++) L.bst.R[A] = E.bst.R[A] - k.bst.R[A];
-                    for (var A = 0; A < 4; A++) L.bst.m[A] = E.bst.m[A] - k.bst.m[A];
-                    L.est = s.quantize.estats(L.bst), E.left = k, E.right = L, b[_] = k, b.push(L);
+                    var $ = { i0: w, i1: E.i1, bst: null, est: null, tdst: 0, left: null, right: null };
+                    $.bst = { R: [], m: [], N: E.bst.N - k.bst.N };
+                    for (var A = 0; A < 16; A++) $.bst.R[A] = E.bst.R[A] - k.bst.R[A];
+                    for (var A = 0; A < 4; A++) $.bst.m[A] = E.bst.m[A] - k.bst.m[A];
+                    $.est = s.quantize.estats($.bst), E.left = k, E.right = $, b[_] = k, b.push($);
                   }
                   b.sort(function(G, H) {
                     return H.bst.N - G.bst.N;
                   });
-                  for (var $ = 0; $ < f.length; $++) {
-                    for (var z = s.quantize.planeDst, O = new Uint8Array(f[$].buffer), R = new Uint32Array(f[$].buffer), P = O.length, A = 0; A < P; A += 4) {
-                      for (var U = O[A] * 0.00392156862745098, N = O[A + 1] * (1 / 255), B = O[A + 2] * (1 / 255), W = O[A + 3] * (1 / 255), V = p; V.left; ) V = z(V.est, U, N, B, W) <= 0 ? V.left : V.right;
+                  for (var L = 0; L < f.length; L++) {
+                    for (var z = s.quantize.planeDst, F = new Uint8Array(f[L].buffer), R = new Uint32Array(f[L].buffer), P = F.length, A = 0; A < P; A += 4) {
+                      for (var U = F[A] * 0.00392156862745098, N = F[A + 1] * (1 / 255), B = F[A + 2] * (1 / 255), W = F[A + 3] * (1 / 255), V = g; V.left; ) V = z(V.est, U, N, B, W) <= 0 ? V.left : V.right;
                       R[A >> 2] = V.est.rgba;
                     }
-                    f[$] = R.buffer;
+                    f[L] = R.buffer;
                   }
                   return { bufs: f, plte: b };
                 }, s.quantize.getNearest = function(o, d, v, f, y) {
@@ -38012,18 +38028,18 @@ ATOM`, b);
                     d[13] - M * A * m,
                     d[14] - M * x * m,
                     d[15] - M * M * m
-                  ], u = l, g = s.M4, p = [0.5, 0.5, 0.5, 0.5], b = 0, c = 0;
+                  ], u = l, p = s.M4, g = [0.5, 0.5, 0.5, 0.5], b = 0, c = 0;
                   if (f != 0)
-                    for (var _ = 0; _ < 10 && (p = g.multVec(u, p), c = Math.sqrt(g.dot(p, p)), p = g.sml(1 / c, p), !(Math.abs(c - b) < 1e-9)); _++)
+                    for (var _ = 0; _ < 10 && (g = p.multVec(u, g), c = Math.sqrt(p.dot(g, g)), g = p.sml(1 / c, g), !(Math.abs(c - b) < 1e-9)); _++)
                       b = c;
-                  var E = [y * m, A * m, x * m, M * m], w = g.dot(g.sml(255, E), p), k = E[3] < 1e-3 ? 0 : 1 / E[3];
+                  var E = [y * m, A * m, x * m, M * m], w = p.dot(p.sml(255, E), g), k = E[3] < 1e-3 ? 0 : 1 / E[3];
                   return {
                     Cov: l,
                     q: E,
-                    e: p,
+                    e: g,
                     L: b,
                     eMq255: w,
-                    eMq: g.dot(p, E),
+                    eMq: p.dot(g, E),
                     rgba: (Math.round(255 * E[3]) << 24 | Math.round(255 * E[2] * k) << 16 | Math.round(255 * E[1] * k) << 8 | Math.round(255 * E[0] * k) << 0) >>> 0
                   };
                 }, s.M4 = {
@@ -38131,34 +38147,34 @@ ATOM`, b);
               }
             }
             u.prototype.push = function(c, _) {
-              var E = this.strm, w = this.options.chunkSize, k, L;
+              var E = this.strm, w = this.options.chunkSize, k, $;
               if (this.ended)
                 return !1;
-              L = _ === ~~_ ? _ : _ === !0 ? f : v, typeof c == "string" ? E.input = s.string2buf(c) : d.call(c) === "[object ArrayBuffer]" ? E.input = new Uint8Array(c) : E.input = c, E.next_in = 0, E.avail_in = E.input.length;
+              $ = _ === ~~_ ? _ : _ === !0 ? f : v, typeof c == "string" ? E.input = s.string2buf(c) : d.call(c) === "[object ArrayBuffer]" ? E.input = new Uint8Array(c) : E.input = c, E.next_in = 0, E.avail_in = E.input.length;
               do {
-                if (E.avail_out === 0 && (E.output = new a.Buf8(w), E.next_out = 0, E.avail_out = w), k = r.deflate(E, L), k !== A && k !== y)
+                if (E.avail_out === 0 && (E.output = new a.Buf8(w), E.next_out = 0, E.avail_out = w), k = r.deflate(E, $), k !== A && k !== y)
                   return this.onEnd(k), this.ended = !0, !1;
-                (E.avail_out === 0 || E.avail_in === 0 && (L === f || L === x)) && (this.options.to === "string" ? this.onData(s.buf2binstring(a.shrinkBuf(E.output, E.next_out))) : this.onData(a.shrinkBuf(E.output, E.next_out)));
+                (E.avail_out === 0 || E.avail_in === 0 && ($ === f || $ === x)) && (this.options.to === "string" ? this.onData(s.buf2binstring(a.shrinkBuf(E.output, E.next_out))) : this.onData(a.shrinkBuf(E.output, E.next_out)));
               } while ((E.avail_in > 0 || E.avail_out === 0) && k !== A);
-              return L === f ? (k = r.deflateEnd(this.strm), this.onEnd(k), this.ended = !0, k === y) : (L === x && (this.onEnd(y), E.avail_out = 0), !0);
+              return $ === f ? (k = r.deflateEnd(this.strm), this.onEnd(k), this.ended = !0, k === y) : ($ === x && (this.onEnd(y), E.avail_out = 0), !0);
             }, u.prototype.onData = function(c) {
               this.chunks.push(c);
             }, u.prototype.onEnd = function(c) {
               c === y && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = a.flattenChunks(this.chunks)), this.chunks = [], this.err = c, this.msg = this.strm.msg;
             };
-            function g(c, _) {
+            function p(c, _) {
               var E = new u(_);
               if (E.push(c, !0), E.err)
                 throw E.msg || h[E.err];
               return E.result;
             }
-            function p(c, _) {
-              return _ = _ || {}, _.raw = !0, g(c, _);
+            function g(c, _) {
+              return _ = _ || {}, _.raw = !0, p(c, _);
             }
             function b(c, _) {
-              return _ = _ || {}, _.gzip = !0, g(c, _);
+              return _ = _ || {}, _.gzip = !0, p(c, _);
             }
-            e.Deflate = u, e.deflate = g, e.deflateRaw = p, e.gzip = b;
+            e.Deflate = u, e.deflate = p, e.deflateRaw = g, e.gzip = b;
           }
         ),
         /***/
@@ -38209,16 +38225,16 @@ ATOM`, b);
                 throw new Error(o[l]);
             }
             y.prototype.push = function(M, m) {
-              var l = this.strm, u = this.options.chunkSize, g = this.options.dictionary, p, b, c, _, E, w = !1;
+              var l = this.strm, u = this.options.chunkSize, p = this.options.dictionary, g, b, c, _, E, w = !1;
               if (this.ended)
                 return !1;
               b = m === ~~m ? m : m === !0 ? h.Z_FINISH : h.Z_NO_FLUSH, typeof M == "string" ? l.input = s.binstring2buf(M) : f.call(M) === "[object ArrayBuffer]" ? l.input = new Uint8Array(M) : l.input = M, l.next_in = 0, l.avail_in = l.input.length;
               do {
-                if (l.avail_out === 0 && (l.output = new a.Buf8(u), l.next_out = 0, l.avail_out = u), p = r.inflate(l, h.Z_NO_FLUSH), p === h.Z_NEED_DICT && g && (p = r.inflateSetDictionary(this.strm, g)), p === h.Z_BUF_ERROR && w === !0 && (p = h.Z_OK, w = !1), p !== h.Z_STREAM_END && p !== h.Z_OK)
-                  return this.onEnd(p), this.ended = !0, !1;
-                l.next_out && (l.avail_out === 0 || p === h.Z_STREAM_END || l.avail_in === 0 && (b === h.Z_FINISH || b === h.Z_SYNC_FLUSH)) && (this.options.to === "string" ? (c = s.utf8border(l.output, l.next_out), _ = l.next_out - c, E = s.buf2string(l.output, c), l.next_out = _, l.avail_out = u - _, _ && a.arraySet(l.output, l.output, c, _, 0), this.onData(E)) : this.onData(a.shrinkBuf(l.output, l.next_out))), l.avail_in === 0 && l.avail_out === 0 && (w = !0);
-              } while ((l.avail_in > 0 || l.avail_out === 0) && p !== h.Z_STREAM_END);
-              return p === h.Z_STREAM_END && (b = h.Z_FINISH), b === h.Z_FINISH ? (p = r.inflateEnd(this.strm), this.onEnd(p), this.ended = !0, p === h.Z_OK) : (b === h.Z_SYNC_FLUSH && (this.onEnd(h.Z_OK), l.avail_out = 0), !0);
+                if (l.avail_out === 0 && (l.output = new a.Buf8(u), l.next_out = 0, l.avail_out = u), g = r.inflate(l, h.Z_NO_FLUSH), g === h.Z_NEED_DICT && p && (g = r.inflateSetDictionary(this.strm, p)), g === h.Z_BUF_ERROR && w === !0 && (g = h.Z_OK, w = !1), g !== h.Z_STREAM_END && g !== h.Z_OK)
+                  return this.onEnd(g), this.ended = !0, !1;
+                l.next_out && (l.avail_out === 0 || g === h.Z_STREAM_END || l.avail_in === 0 && (b === h.Z_FINISH || b === h.Z_SYNC_FLUSH)) && (this.options.to === "string" ? (c = s.utf8border(l.output, l.next_out), _ = l.next_out - c, E = s.buf2string(l.output, c), l.next_out = _, l.avail_out = u - _, _ && a.arraySet(l.output, l.output, c, _, 0), this.onData(E)) : this.onData(a.shrinkBuf(l.output, l.next_out))), l.avail_in === 0 && l.avail_out === 0 && (w = !0);
+              } while ((l.avail_in > 0 || l.avail_out === 0) && g !== h.Z_STREAM_END);
+              return g === h.Z_STREAM_END && (b = h.Z_FINISH), b === h.Z_FINISH ? (g = r.inflateEnd(this.strm), this.onEnd(g), this.ended = !0, g === h.Z_OK) : (b === h.Z_SYNC_FLUSH && (this.onEnd(h.Z_OK), l.avail_out = 0), !0);
             }, y.prototype.onData = function(M) {
               this.chunks.push(M);
             }, y.prototype.onEnd = function(M) {
@@ -38484,11 +38500,11 @@ ATOM`, b);
             ), o = t(
               /*! ./messages */
               "./node_modules/upng-js/node_modules/pako/lib/zlib/messages.js"
-            ), d = 0, v = 1, f = 3, y = 4, A = 5, x = 0, M = 1, m = -2, l = -3, u = -5, g = -1, p = 1, b = 2, c = 3, _ = 4, E = 0, w = 2, k = 8, L = 9, $ = 15, z = 8, O = 29, R = 256, P = R + 1 + O, U = 30, N = 19, B = 2 * P + 1, W = 15, V = 3, G = 258, H = G + V + 1, Q = 32, te = 42, ee = 69, ce = 73, fe = 91, oe = 103, he = 113, Ae = 666, Se = 1, Ie = 2, pe = 3, le = 4, ne = 3;
+            ), d = 0, v = 1, f = 3, y = 4, A = 5, x = 0, M = 1, m = -2, l = -3, u = -5, p = -1, g = 1, b = 2, c = 3, _ = 4, E = 0, w = 2, k = 8, $ = 9, L = 15, z = 8, F = 29, R = 256, P = R + 1 + F, U = 30, N = 19, B = 2 * P + 1, W = 15, V = 3, G = 258, H = G + V + 1, Q = 32, te = 42, ee = 69, ce = 73, fe = 91, oe = 103, he = 113, Ae = 666, Se = 1, Ie = 2, pe = 3, le = 4, ne = 3;
             function Te(I, we) {
               return I.msg = o[we], we;
             }
-            function Fe(I) {
+            function Oe(I) {
               return (I << 1) - (I > 4 ? 9 : 0);
             }
             function Be(I) {
@@ -38599,7 +38615,7 @@ ATOM`, b);
                   if (I.lookahead === 0)
                     break;
                 }
-                if (ve = 0, I.lookahead >= V && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + V - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), I.prev_length = I.match_length, I.prev_match = I.match_start, I.match_length = V - 1, ve !== 0 && I.prev_length < I.max_lazy_match && I.strstart - ve <= I.w_size - H && (I.match_length = De(I, ve), I.match_length <= 5 && (I.strategy === p || I.match_length === V && I.strstart - I.match_start > 4096) && (I.match_length = V - 1)), I.prev_length >= V && I.match_length <= I.prev_length) {
+                if (ve = 0, I.lookahead >= V && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + V - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart), I.prev_length = I.match_length, I.prev_match = I.match_start, I.match_length = V - 1, ve !== 0 && I.prev_length < I.max_lazy_match && I.strstart - ve <= I.w_size - H && (I.match_length = De(I, ve), I.match_length <= 5 && (I.strategy === g || I.match_length === V && I.strstart - I.match_start > 4096) && (I.match_length = V - 1)), I.prev_length >= V && I.match_length <= I.prev_length) {
                   de = I.strstart + I.lookahead - V, Y = a._tr_tally(I, I.strstart - 1 - I.prev_match, I.prev_length - V), I.lookahead -= I.prev_length - 1, I.prev_length -= 2;
                   do
                     ++I.strstart <= de && (I.ins_h = (I.ins_h << I.hash_shift ^ I.window[I.strstart + V - 1]) & I.hash_mask, ve = I.prev[I.strstart & I.w_mask] = I.head[I.ins_h], I.head[I.ins_h] = I.strstart);
@@ -38694,14 +38710,14 @@ ATOM`, b);
               if (!I)
                 return m;
               var Ye = 1;
-              if (we === g && (we = 6), Y < 0 ? (Ye = 0, Y = -Y) : Y > 15 && (Ye = 2, Y -= 16), de < 1 || de > L || ve !== k || Y < 8 || Y > 15 || we < 0 || we > 9 || Me < 0 || Me > _)
+              if (we === p && (we = 6), Y < 0 ? (Ye = 0, Y = -Y) : Y > 15 && (Ye = 2, Y -= 16), de < 1 || de > $ || ve !== k || Y < 8 || Y > 15 || we < 0 || we > 9 || Me < 0 || Me > _)
                 return Te(I, m);
               Y === 8 && (Y = 9);
               var Ze = new K();
               return I.state = Ze, Ze.strm = I, Ze.wrap = Ye, Ze.gzhead = null, Ze.w_bits = Y, Ze.w_size = 1 << Ze.w_bits, Ze.w_mask = Ze.w_size - 1, Ze.hash_bits = de + 7, Ze.hash_size = 1 << Ze.hash_bits, Ze.hash_mask = Ze.hash_size - 1, Ze.hash_shift = ~~((Ze.hash_bits + V - 1) / V), Ze.window = new r.Buf8(Ze.w_size * 2), Ze.head = new r.Buf16(Ze.hash_size), Ze.prev = new r.Buf16(Ze.w_size), Ze.lit_bufsize = 1 << de + 6, Ze.pending_buf_size = Ze.lit_bufsize * 4, Ze.pending_buf = new r.Buf8(Ze.pending_buf_size), Ze.d_buf = 1 * Ze.lit_bufsize, Ze.l_buf = 3 * Ze.lit_bufsize, Ze.level = we, Ze.strategy = Me, Ze.method = ve, ge(I);
             }
             function Ce(I, we) {
-              return ue(I, we, k, $, z, E);
+              return ue(I, we, k, L, z, E);
             }
             function Z(I, we) {
               var ve, Y, de, Me;
@@ -38755,7 +38771,7 @@ ATOM`, b);
               if (Y.status === oe && (Y.gzhead.hcrc ? (Y.pending + 2 > Y.pending_buf_size && Ue(I), Y.pending + 2 <= Y.pending_buf_size && (Ge(Y, I.adler & 255), Ge(Y, I.adler >> 8 & 255), I.adler = 0, Y.status = he)) : Y.status = he), Y.pending !== 0) {
                 if (Ue(I), I.avail_out === 0)
                   return Y.last_flush = -1, x;
-              } else if (I.avail_in === 0 && Fe(we) <= Fe(ve) && we !== y)
+              } else if (I.avail_in === 0 && Oe(we) <= Oe(ve) && we !== y)
                 return Te(I, u);
               if (Y.status === Ae && I.avail_in !== 0)
                 return Te(I, u);
@@ -38768,7 +38784,7 @@ ATOM`, b);
               }
               return we !== y ? x : Y.wrap <= 0 ? M : (Y.wrap === 2 ? (Ge(Y, I.adler & 255), Ge(Y, I.adler >> 8 & 255), Ge(Y, I.adler >> 16 & 255), Ge(Y, I.adler >> 24 & 255), Ge(Y, I.total_in & 255), Ge(Y, I.total_in >> 8 & 255), Ge(Y, I.total_in >> 16 & 255), Ge(Y, I.total_in >> 24 & 255)) : (Ne(Y, I.adler >>> 16), Ne(Y, I.adler & 65535)), Ue(I), Y.wrap > 0 && (Y.wrap = -Y.wrap), Y.pending !== 0 ? x : M);
             }
-            function Oe(I) {
+            function Fe(I) {
               var we;
               return !I || !I.state ? m : (we = I.state.status, we !== te && we !== ee && we !== ce && we !== fe && we !== oe && we !== he && we !== Ae ? Te(I, m) : (I.state = null, we === he ? Te(I, l) : x));
             }
@@ -38785,7 +38801,7 @@ ATOM`, b);
               }
               return Y.strstart += Y.lookahead, Y.block_start = Y.strstart, Y.insert = Y.lookahead, Y.lookahead = 0, Y.match_length = Y.prev_length = V - 1, Y.match_available = 0, I.next_in = Ke, I.input = rt, I.avail_in = Ze, Y.wrap = Ye, x;
             }
-            e.deflateInit = Ce, e.deflateInit2 = ue, e.deflateReset = ge, e.deflateResetKeep = ae, e.deflateSetHeader = xe, e.deflate = Z, e.deflateEnd = Oe, e.deflateSetDictionary = We, e.deflateInfo = "pako deflate (from Nodeca project)";
+            e.deflateInit = Ce, e.deflateInit2 = ue, e.deflateReset = ge, e.deflateResetKeep = ae, e.deflateSetHeader = xe, e.deflate = Z, e.deflateEnd = Fe, e.deflateSetDictionary = We, e.deflateInfo = "pako deflate (from Nodeca project)";
           }
         ),
         /***/
@@ -38810,67 +38826,67 @@ ATOM`, b);
           (n) => {
             var e = 30, t = 12;
             n.exports = function(a, s) {
-              var h, o, d, v, f, y, A, x, M, m, l, u, g, p, b, c, _, E, w, k, L, $, z, O, R;
-              h = a.state, o = a.next_in, O = a.input, d = o + (a.avail_in - 5), v = a.next_out, R = a.output, f = v - (s - a.avail_out), y = v + (a.avail_out - 257), A = h.dmax, x = h.wsize, M = h.whave, m = h.wnext, l = h.window, u = h.hold, g = h.bits, p = h.lencode, b = h.distcode, c = (1 << h.lenbits) - 1, _ = (1 << h.distbits) - 1;
+              var h, o, d, v, f, y, A, x, M, m, l, u, p, g, b, c, _, E, w, k, $, L, z, F, R;
+              h = a.state, o = a.next_in, F = a.input, d = o + (a.avail_in - 5), v = a.next_out, R = a.output, f = v - (s - a.avail_out), y = v + (a.avail_out - 257), A = h.dmax, x = h.wsize, M = h.whave, m = h.wnext, l = h.window, u = h.hold, p = h.bits, g = h.lencode, b = h.distcode, c = (1 << h.lenbits) - 1, _ = (1 << h.distbits) - 1;
               e:
                 do {
-                  g < 15 && (u += O[o++] << g, g += 8, u += O[o++] << g, g += 8), E = p[u & c];
+                  p < 15 && (u += F[o++] << p, p += 8, u += F[o++] << p, p += 8), E = g[u & c];
                   t:
                     for (; ; ) {
-                      if (w = E >>> 24, u >>>= w, g -= w, w = E >>> 16 & 255, w === 0)
+                      if (w = E >>> 24, u >>>= w, p -= w, w = E >>> 16 & 255, w === 0)
                         R[v++] = E & 65535;
                       else if (w & 16) {
-                        k = E & 65535, w &= 15, w && (g < w && (u += O[o++] << g, g += 8), k += u & (1 << w) - 1, u >>>= w, g -= w), g < 15 && (u += O[o++] << g, g += 8, u += O[o++] << g, g += 8), E = b[u & _];
+                        k = E & 65535, w &= 15, w && (p < w && (u += F[o++] << p, p += 8), k += u & (1 << w) - 1, u >>>= w, p -= w), p < 15 && (u += F[o++] << p, p += 8, u += F[o++] << p, p += 8), E = b[u & _];
                         r:
                           for (; ; ) {
-                            if (w = E >>> 24, u >>>= w, g -= w, w = E >>> 16 & 255, w & 16) {
-                              if (L = E & 65535, w &= 15, g < w && (u += O[o++] << g, g += 8, g < w && (u += O[o++] << g, g += 8)), L += u & (1 << w) - 1, L > A) {
+                            if (w = E >>> 24, u >>>= w, p -= w, w = E >>> 16 & 255, w & 16) {
+                              if ($ = E & 65535, w &= 15, p < w && (u += F[o++] << p, p += 8, p < w && (u += F[o++] << p, p += 8)), $ += u & (1 << w) - 1, $ > A) {
                                 a.msg = "invalid distance too far back", h.mode = e;
                                 break e;
                               }
-                              if (u >>>= w, g -= w, w = v - f, L > w) {
-                                if (w = L - w, w > M && h.sane) {
+                              if (u >>>= w, p -= w, w = v - f, $ > w) {
+                                if (w = $ - w, w > M && h.sane) {
                                   a.msg = "invalid distance too far back", h.mode = e;
                                   break e;
                                 }
-                                if ($ = 0, z = l, m === 0) {
-                                  if ($ += x - w, w < k) {
+                                if (L = 0, z = l, m === 0) {
+                                  if (L += x - w, w < k) {
                                     k -= w;
                                     do
-                                      R[v++] = l[$++];
+                                      R[v++] = l[L++];
                                     while (--w);
-                                    $ = v - L, z = R;
+                                    L = v - $, z = R;
                                   }
                                 } else if (m < w) {
-                                  if ($ += x + m - w, w -= m, w < k) {
+                                  if (L += x + m - w, w -= m, w < k) {
                                     k -= w;
                                     do
-                                      R[v++] = l[$++];
+                                      R[v++] = l[L++];
                                     while (--w);
-                                    if ($ = 0, m < k) {
+                                    if (L = 0, m < k) {
                                       w = m, k -= w;
                                       do
-                                        R[v++] = l[$++];
+                                        R[v++] = l[L++];
                                       while (--w);
-                                      $ = v - L, z = R;
+                                      L = v - $, z = R;
                                     }
                                   }
-                                } else if ($ += m - w, w < k) {
+                                } else if (L += m - w, w < k) {
                                   k -= w;
                                   do
-                                    R[v++] = l[$++];
+                                    R[v++] = l[L++];
                                   while (--w);
-                                  $ = v - L, z = R;
+                                  L = v - $, z = R;
                                 }
                                 for (; k > 2; )
-                                  R[v++] = z[$++], R[v++] = z[$++], R[v++] = z[$++], k -= 3;
-                                k && (R[v++] = z[$++], k > 1 && (R[v++] = z[$++]));
+                                  R[v++] = z[L++], R[v++] = z[L++], R[v++] = z[L++], k -= 3;
+                                k && (R[v++] = z[L++], k > 1 && (R[v++] = z[L++]));
                               } else {
-                                $ = v - L;
+                                L = v - $;
                                 do
-                                  R[v++] = R[$++], R[v++] = R[$++], R[v++] = R[$++], k -= 3;
+                                  R[v++] = R[L++], R[v++] = R[L++], R[v++] = R[L++], k -= 3;
                                 while (k > 2);
-                                k && (R[v++] = R[$++], k > 1 && (R[v++] = R[$++]));
+                                k && (R[v++] = R[L++], k > 1 && (R[v++] = R[L++]));
                               }
                             } else if (w & 64) {
                               a.msg = "invalid distance code", h.mode = e;
@@ -38890,13 +38906,13 @@ ATOM`, b);
                           break e;
                         }
                       else {
-                        E = p[(E & 65535) + (u & (1 << w) - 1)];
+                        E = g[(E & 65535) + (u & (1 << w) - 1)];
                         continue t;
                       }
                       break;
                     }
                 } while (o < d && v < y);
-              k = g >> 3, o -= k, g -= k << 3, u &= (1 << g) - 1, a.next_in = o, a.next_out = v, a.avail_in = o < d ? 5 + (d - o) : 5 - (o - d), a.avail_out = v < y ? 257 + (y - v) : 257 - (v - y), h.hold = u, h.bits = g;
+              k = p >> 3, o -= k, p -= k << 3, u &= (1 << p) - 1, a.next_in = o, a.next_out = v, a.avail_in = o < d ? 5 + (d - o) : 5 - (o - d), a.avail_out = v < y ? 257 + (y - v) : 257 - (v - y), h.hold = u, h.bits = p;
             };
           }
         ),
@@ -38922,7 +38938,7 @@ ATOM`, b);
             ), o = t(
               /*! ./inftrees */
               "./node_modules/upng-js/node_modules/pako/lib/zlib/inftrees.js"
-            ), d = 0, v = 1, f = 2, y = 4, A = 5, x = 6, M = 0, m = 1, l = 2, u = -2, g = -3, p = -4, b = -5, c = 8, _ = 1, E = 2, w = 3, k = 4, L = 5, $ = 6, z = 7, O = 8, R = 9, P = 10, U = 11, N = 12, B = 13, W = 14, V = 15, G = 16, H = 17, Q = 18, te = 19, ee = 20, ce = 21, fe = 22, oe = 23, he = 24, Ae = 25, Se = 26, Ie = 27, pe = 28, le = 29, ne = 30, Te = 31, Fe = 32, Be = 852, Ue = 592, Pe = 15, Ge = Pe;
+            ), d = 0, v = 1, f = 2, y = 4, A = 5, x = 6, M = 0, m = 1, l = 2, u = -2, p = -3, g = -4, b = -5, c = 8, _ = 1, E = 2, w = 3, k = 4, $ = 5, L = 6, z = 7, F = 8, R = 9, P = 10, U = 11, N = 12, B = 13, W = 14, V = 15, G = 16, H = 17, Q = 18, te = 19, ee = 20, ce = 21, fe = 22, oe = 23, he = 24, Ae = 25, Se = 26, Ie = 27, pe = 28, le = 29, ne = 30, Te = 31, Oe = 32, Be = 852, Ue = 592, Pe = 15, Ge = Pe;
             function Ne(ue) {
               return (ue >>> 24 & 255) + (ue >>> 8 & 65280) + ((ue & 65280) << 8) + ((ue & 255) << 24);
             }
@@ -38938,12 +38954,12 @@ ATOM`, b);
               return !ue || !ue.state ? u : (Ce = ue.state, Ce.wsize = 0, Ce.whave = 0, Ce.wnext = 0, De(ue));
             }
             function Xe(ue, Ce) {
-              var Z, Oe;
-              return !ue || !ue.state || (Oe = ue.state, Ce < 0 ? (Z = 0, Ce = -Ce) : (Z = (Ce >> 4) + 1, Ce < 48 && (Ce &= 15)), Ce && (Ce < 8 || Ce > 15)) ? u : (Oe.window !== null && Oe.wbits !== Ce && (Oe.window = null), Oe.wrap = Z, Oe.wbits = Ce, je(ue));
+              var Z, Fe;
+              return !ue || !ue.state || (Fe = ue.state, Ce < 0 ? (Z = 0, Ce = -Ce) : (Z = (Ce >> 4) + 1, Ce < 48 && (Ce &= 15)), Ce && (Ce < 8 || Ce > 15)) ? u : (Fe.window !== null && Fe.wbits !== Ce && (Fe.window = null), Fe.wrap = Z, Fe.wbits = Ce, je(ue));
             }
             function X(ue, Ce) {
-              var Z, Oe;
-              return ue ? (Oe = new Re(), ue.state = Oe, Oe.window = null, Z = Xe(ue, Ce), Z !== M && (ue.state = null), Z) : u;
+              var Z, Fe;
+              return ue ? (Fe = new Re(), ue.state = Fe, Fe.window = null, Z = Xe(ue, Ce), Z !== M && (ue.state = null), Z) : u;
             }
             function q(ue) {
               return X(ue, Ge);
@@ -38966,18 +38982,18 @@ ATOM`, b);
               }
               ue.lencode = ye, ue.lenbits = 9, ue.distcode = me, ue.distbits = 5;
             }
-            function ke(ue, Ce, Z, Oe) {
+            function ke(ue, Ce, Z, Fe) {
               var We, I = ue.state;
-              return I.window === null && (I.wsize = 1 << I.wbits, I.wnext = 0, I.whave = 0, I.window = new r.Buf8(I.wsize)), Oe >= I.wsize ? (r.arraySet(I.window, Ce, Z - I.wsize, I.wsize, 0), I.wnext = 0, I.whave = I.wsize) : (We = I.wsize - I.wnext, We > Oe && (We = Oe), r.arraySet(I.window, Ce, Z - Oe, We, I.wnext), Oe -= We, Oe ? (r.arraySet(I.window, Ce, Z - Oe, Oe, 0), I.wnext = Oe, I.whave = I.wsize) : (I.wnext += We, I.wnext === I.wsize && (I.wnext = 0), I.whave < I.wsize && (I.whave += We))), 0;
+              return I.window === null && (I.wsize = 1 << I.wbits, I.wnext = 0, I.whave = 0, I.window = new r.Buf8(I.wsize)), Fe >= I.wsize ? (r.arraySet(I.window, Ce, Z - I.wsize, I.wsize, 0), I.wnext = 0, I.whave = I.wsize) : (We = I.wsize - I.wnext, We > Fe && (We = Fe), r.arraySet(I.window, Ce, Z - Fe, We, I.wnext), Fe -= We, Fe ? (r.arraySet(I.window, Ce, Z - Fe, Fe, 0), I.wnext = Fe, I.whave = I.wsize) : (I.wnext += We, I.wnext === I.wsize && (I.wnext = 0), I.whave < I.wsize && (I.whave += We))), 0;
             }
             function K(ue, Ce) {
-              var Z, Oe, We, I, we, ve, Y, de, Me, Ye, Ze, Ke, rt, wt, st = 0, ot, at, Mt, gt, Lt, Pt, Et, St, yt = new r.Buf8(4), zt, qe, be = (
+              var Z, Fe, We, I, we, ve, Y, de, Me, Ye, Ze, Ke, rt, wt, st = 0, ot, at, Mt, gt, $t, Pt, Et, St, yt = new r.Buf8(4), zt, qe, be = (
                 /* permutation of code lengths */
                 [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]
               );
               if (!ue || !ue.state || !ue.output || !ue.input && ue.avail_in !== 0)
                 return u;
-              Z = ue.state, Z.mode === N && (Z.mode = B), we = ue.next_out, We = ue.output, Y = ue.avail_out, I = ue.next_in, Oe = ue.input, ve = ue.avail_in, de = Z.hold, Me = Z.bits, Ye = ve, Ze = Y, St = M;
+              Z = ue.state, Z.mode === N && (Z.mode = B), we = ue.next_out, We = ue.output, Y = ue.avail_out, I = ue.next_in, Fe = ue.input, ve = ue.avail_in, de = Z.hold, Me = Z.bits, Ye = ve, Ze = Y, St = M;
               e:
                 for (; ; )
                   switch (Z.mode) {
@@ -38989,7 +39005,7 @@ ATOM`, b);
                       for (; Me < 16; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       if (Z.wrap & 2 && de === 35615) {
                         Z.check = 0, yt[0] = de & 255, yt[1] = de >>> 8 & 255, Z.check = s(Z.check, yt, 2, 0), de = 0, Me = 0, Z.mode = E;
@@ -39016,7 +39032,7 @@ ATOM`, b);
                       for (; Me < 16; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       if (Z.flags = de, (Z.flags & 255) !== c) {
                         ue.msg = "unknown compression method", Z.mode = ne;
@@ -39031,37 +39047,37 @@ ATOM`, b);
                       for (; Me < 32; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       Z.head && (Z.head.time = de), Z.flags & 512 && (yt[0] = de & 255, yt[1] = de >>> 8 & 255, yt[2] = de >>> 16 & 255, yt[3] = de >>> 24 & 255, Z.check = s(Z.check, yt, 4, 0)), de = 0, Me = 0, Z.mode = k;
                     case k:
                       for (; Me < 16; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
-                      Z.head && (Z.head.xflags = de & 255, Z.head.os = de >> 8), Z.flags & 512 && (yt[0] = de & 255, yt[1] = de >>> 8 & 255, Z.check = s(Z.check, yt, 2, 0)), de = 0, Me = 0, Z.mode = L;
-                    case L:
+                      Z.head && (Z.head.xflags = de & 255, Z.head.os = de >> 8), Z.flags & 512 && (yt[0] = de & 255, yt[1] = de >>> 8 & 255, Z.check = s(Z.check, yt, 2, 0)), de = 0, Me = 0, Z.mode = $;
+                    case $:
                       if (Z.flags & 1024) {
                         for (; Me < 16; ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         Z.length = de, Z.head && (Z.head.extra_len = de), Z.flags & 512 && (yt[0] = de & 255, yt[1] = de >>> 8 & 255, Z.check = s(Z.check, yt, 2, 0)), de = 0, Me = 0;
                       } else Z.head && (Z.head.extra = null);
-                      Z.mode = $;
-                    case $:
+                      Z.mode = L;
+                    case L:
                       if (Z.flags & 1024 && (Ke = Z.length, Ke > ve && (Ke = ve), Ke && (Z.head && (Et = Z.head.extra_len - Z.length, Z.head.extra || (Z.head.extra = new Array(Z.head.extra_len)), r.arraySet(
                         Z.head.extra,
-                        Oe,
+                        Fe,
                         I,
                         // extra field is limited to 65536 bytes
                         // - no need for additional size check
                         Ke,
                         /*len + copy > state.head.extra_max - len ? state.head.extra_max : copy,*/
                         Et
-                      )), Z.flags & 512 && (Z.check = s(Z.check, Oe, Ke, I)), ve -= Ke, I += Ke, Z.length -= Ke), Z.length))
+                      )), Z.flags & 512 && (Z.check = s(Z.check, Fe, Ke, I)), ve -= Ke, I += Ke, Z.length -= Ke), Z.length))
                         break e;
                       Z.length = 0, Z.mode = z;
                     case z:
@@ -39070,21 +39086,21 @@ ATOM`, b);
                           break e;
                         Ke = 0;
                         do
-                          Et = Oe[I + Ke++], Z.head && Et && Z.length < 65536 && (Z.head.name += String.fromCharCode(Et));
+                          Et = Fe[I + Ke++], Z.head && Et && Z.length < 65536 && (Z.head.name += String.fromCharCode(Et));
                         while (Et && Ke < ve);
-                        if (Z.flags & 512 && (Z.check = s(Z.check, Oe, Ke, I)), ve -= Ke, I += Ke, Et)
+                        if (Z.flags & 512 && (Z.check = s(Z.check, Fe, Ke, I)), ve -= Ke, I += Ke, Et)
                           break e;
                       } else Z.head && (Z.head.name = null);
-                      Z.length = 0, Z.mode = O;
-                    case O:
+                      Z.length = 0, Z.mode = F;
+                    case F:
                       if (Z.flags & 4096) {
                         if (ve === 0)
                           break e;
                         Ke = 0;
                         do
-                          Et = Oe[I + Ke++], Z.head && Et && Z.length < 65536 && (Z.head.comment += String.fromCharCode(Et));
+                          Et = Fe[I + Ke++], Z.head && Et && Z.length < 65536 && (Z.head.comment += String.fromCharCode(Et));
                         while (Et && Ke < ve);
-                        if (Z.flags & 512 && (Z.check = s(Z.check, Oe, Ke, I)), ve -= Ke, I += Ke, Et)
+                        if (Z.flags & 512 && (Z.check = s(Z.check, Fe, Ke, I)), ve -= Ke, I += Ke, Et)
                           break e;
                       } else Z.head && (Z.head.comment = null);
                       Z.mode = R;
@@ -39093,7 +39109,7 @@ ATOM`, b);
                         for (; Me < 16; ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         if (de !== (Z.check & 65535)) {
                           ue.msg = "header crc mismatch", Z.mode = ne;
@@ -39107,7 +39123,7 @@ ATOM`, b);
                       for (; Me < 32; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       ue.adler = Z.check = Ne(de), de = 0, Me = 0, Z.mode = U;
                     case U:
@@ -39125,7 +39141,7 @@ ATOM`, b);
                       for (; Me < 3; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       switch (Z.last = de & 1, de >>>= 1, Me -= 1, de & 3) {
                         case 0:
@@ -39149,7 +39165,7 @@ ATOM`, b);
                       for (de >>>= Me & 7, Me -= Me & 7; Me < 32; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       if ((de & 65535) !== (de >>> 16 ^ 65535)) {
                         ue.msg = "invalid stored block lengths", Z.mode = ne;
@@ -39163,7 +39179,7 @@ ATOM`, b);
                       if (Ke = Z.length, Ke) {
                         if (Ke > ve && (Ke = ve), Ke > Y && (Ke = Y), Ke === 0)
                           break e;
-                        r.arraySet(We, Oe, I, Ke, we), ve -= Ke, I += Ke, Y -= Ke, we += Ke, Z.length -= Ke;
+                        r.arraySet(We, Fe, I, Ke, we), ve -= Ke, I += Ke, Y -= Ke, we += Ke, Z.length -= Ke;
                         break;
                       }
                       Z.mode = N;
@@ -39172,7 +39188,7 @@ ATOM`, b);
                       for (; Me < 14; ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       if (Z.nlen = (de & 31) + 257, de >>>= 5, Me -= 5, Z.ndist = (de & 31) + 1, de >>>= 5, Me -= 5, Z.ncode = (de & 15) + 4, de >>>= 4, Me -= 4, Z.nlen > 286 || Z.ndist > 30) {
                         ue.msg = "too many length or distance symbols", Z.mode = ne;
@@ -39184,7 +39200,7 @@ ATOM`, b);
                         for (; Me < 3; ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         Z.lens[be[Z.have++]] = de & 7, de >>>= 3, Me -= 3;
                       }
@@ -39200,7 +39216,7 @@ ATOM`, b);
                         for (; st = Z.lencode[de & (1 << Z.lenbits) - 1], ot = st >>> 24, at = st >>> 16 & 255, Mt = st & 65535, !(ot <= Me); ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         if (Mt < 16)
                           de >>>= ot, Me -= ot, Z.lens[Z.have++] = Mt;
@@ -39209,7 +39225,7 @@ ATOM`, b);
                             for (qe = ot + 2; Me < qe; ) {
                               if (ve === 0)
                                 break e;
-                              ve--, de += Oe[I++] << Me, Me += 8;
+                              ve--, de += Fe[I++] << Me, Me += 8;
                             }
                             if (de >>>= ot, Me -= ot, Z.have === 0) {
                               ue.msg = "invalid bit length repeat", Z.mode = ne;
@@ -39220,14 +39236,14 @@ ATOM`, b);
                             for (qe = ot + 3; Me < qe; ) {
                               if (ve === 0)
                                 break e;
-                              ve--, de += Oe[I++] << Me, Me += 8;
+                              ve--, de += Fe[I++] << Me, Me += 8;
                             }
                             de >>>= ot, Me -= ot, Et = 0, Ke = 3 + (de & 7), de >>>= 3, Me -= 3;
                           } else {
                             for (qe = ot + 7; Me < qe; ) {
                               if (ve === 0)
                                 break e;
-                              ve--, de += Oe[I++] << Me, Me += 8;
+                              ve--, de += Fe[I++] << Me, Me += 8;
                             }
                             de >>>= ot, Me -= ot, Et = 0, Ke = 11 + (de & 127), de >>>= 7, Me -= 7;
                           }
@@ -39259,19 +39275,19 @@ ATOM`, b);
                       Z.mode = ce;
                     case ce:
                       if (ve >= 6 && Y >= 258) {
-                        ue.next_out = we, ue.avail_out = Y, ue.next_in = I, ue.avail_in = ve, Z.hold = de, Z.bits = Me, h(ue, Ze), we = ue.next_out, We = ue.output, Y = ue.avail_out, I = ue.next_in, Oe = ue.input, ve = ue.avail_in, de = Z.hold, Me = Z.bits, Z.mode === N && (Z.back = -1);
+                        ue.next_out = we, ue.avail_out = Y, ue.next_in = I, ue.avail_in = ve, Z.hold = de, Z.bits = Me, h(ue, Ze), we = ue.next_out, We = ue.output, Y = ue.avail_out, I = ue.next_in, Fe = ue.input, ve = ue.avail_in, de = Z.hold, Me = Z.bits, Z.mode === N && (Z.back = -1);
                         break;
                       }
                       for (Z.back = 0; st = Z.lencode[de & (1 << Z.lenbits) - 1], ot = st >>> 24, at = st >>> 16 & 255, Mt = st & 65535, !(ot <= Me); ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       if (at && !(at & 240)) {
-                        for (gt = ot, Lt = at, Pt = Mt; st = Z.lencode[Pt + ((de & (1 << gt + Lt) - 1) >> gt)], ot = st >>> 24, at = st >>> 16 & 255, Mt = st & 65535, !(gt + ot <= Me); ) {
+                        for (gt = ot, $t = at, Pt = Mt; st = Z.lencode[Pt + ((de & (1 << gt + $t) - 1) >> gt)], ot = st >>> 24, at = st >>> 16 & 255, Mt = st & 65535, !(gt + ot <= Me); ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         de >>>= gt, Me -= gt, Z.back += gt;
                       }
@@ -39293,7 +39309,7 @@ ATOM`, b);
                         for (qe = Z.extra; Me < qe; ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         Z.length += de & (1 << Z.extra) - 1, de >>>= Z.extra, Me -= Z.extra, Z.back += Z.extra;
                       }
@@ -39302,13 +39318,13 @@ ATOM`, b);
                       for (; st = Z.distcode[de & (1 << Z.distbits) - 1], ot = st >>> 24, at = st >>> 16 & 255, Mt = st & 65535, !(ot <= Me); ) {
                         if (ve === 0)
                           break e;
-                        ve--, de += Oe[I++] << Me, Me += 8;
+                        ve--, de += Fe[I++] << Me, Me += 8;
                       }
                       if (!(at & 240)) {
-                        for (gt = ot, Lt = at, Pt = Mt; st = Z.distcode[Pt + ((de & (1 << gt + Lt) - 1) >> gt)], ot = st >>> 24, at = st >>> 16 & 255, Mt = st & 65535, !(gt + ot <= Me); ) {
+                        for (gt = ot, $t = at, Pt = Mt; st = Z.distcode[Pt + ((de & (1 << gt + $t) - 1) >> gt)], ot = st >>> 24, at = st >>> 16 & 255, Mt = st & 65535, !(gt + ot <= Me); ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         de >>>= gt, Me -= gt, Z.back += gt;
                       }
@@ -39322,7 +39338,7 @@ ATOM`, b);
                         for (qe = Z.extra; Me < qe; ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         Z.offset += de & (1 << Z.extra) - 1, de >>>= Z.extra, Me -= Z.extra, Z.back += Z.extra;
                       }
@@ -39358,7 +39374,7 @@ ATOM`, b);
                         for (; Me < 32; ) {
                           if (ve === 0)
                             break e;
-                          ve--, de |= Oe[I++] << Me, Me += 8;
+                          ve--, de |= Fe[I++] << Me, Me += 8;
                         }
                         if (Ze -= Y, ue.total_out += Ze, Z.total += Ze, Ze && (ue.adler = Z.check = /*UPDATE(state.check, put - _out, _out);*/
                         Z.flags ? s(Z.check, We, Ze, we - Ze) : a(Z.check, We, Ze, we - Ze)), Ze = Y, (Z.flags ? de : Ne(de)) !== Z.check) {
@@ -39373,7 +39389,7 @@ ATOM`, b);
                         for (; Me < 32; ) {
                           if (ve === 0)
                             break e;
-                          ve--, de += Oe[I++] << Me, Me += 8;
+                          ve--, de += Fe[I++] << Me, Me += 8;
                         }
                         if (de !== (Z.total & 4294967295)) {
                           ue.msg = "incorrect length check", Z.mode = ne;
@@ -39386,11 +39402,11 @@ ATOM`, b);
                       St = m;
                       break e;
                     case ne:
-                      St = g;
+                      St = p;
                       break e;
                     case Te:
-                      return p;
-                    case Fe:
+                      return g;
+                    case Oe:
                     default:
                       return u;
                   }
@@ -39408,8 +39424,8 @@ ATOM`, b);
               return !ue || !ue.state || (Z = ue.state, !(Z.wrap & 2)) ? u : (Z.head = Ce, Ce.done = !1, M);
             }
             function xe(ue, Ce) {
-              var Z = Ce.length, Oe, We, I;
-              return !ue || !ue.state || (Oe = ue.state, Oe.wrap !== 0 && Oe.mode !== U) ? u : Oe.mode === U && (We = 1, We = a(We, Ce, Z, 0), We !== Oe.check) ? g : (I = ke(ue, Ce, Z, Z), I ? (Oe.mode = Te, p) : (Oe.havedict = 1, M));
+              var Z = Ce.length, Fe, We, I;
+              return !ue || !ue.state || (Fe = ue.state, Fe.wrap !== 0 && Fe.mode !== U) ? u : Fe.mode === U && (We = 1, We = a(We, Ce, Z, 0), We !== Fe.check) ? p : (I = ke(ue, Ce, Z, Z), I ? (Fe.mode = Te, g) : (Fe.havedict = 1, M));
             }
             e.inflateReset = je, e.inflateReset2 = Xe, e.inflateResetKeep = De, e.inflateInit = q, e.inflateInit2 = X, e.inflate = K, e.inflateEnd = ae, e.inflateGetHeader = ge, e.inflateSetDictionary = xe, e.inflateInfo = "pako inflate (from Nodeca project)";
           }
@@ -39559,50 +39575,50 @@ ATOM`, b);
               64,
               64
             ];
-            n.exports = function(m, l, u, g, p, b, c, _) {
-              var E = _.bits, w = 0, k = 0, L = 0, $ = 0, z = 0, O = 0, R = 0, P = 0, U = 0, N = 0, B, W, V, G, H, Q = null, te = 0, ee, ce = new r.Buf16(a + 1), fe = new r.Buf16(a + 1), oe = null, he = 0, Ae, Se, Ie;
+            n.exports = function(m, l, u, p, g, b, c, _) {
+              var E = _.bits, w = 0, k = 0, $ = 0, L = 0, z = 0, F = 0, R = 0, P = 0, U = 0, N = 0, B, W, V, G, H, Q = null, te = 0, ee, ce = new r.Buf16(a + 1), fe = new r.Buf16(a + 1), oe = null, he = 0, Ae, Se, Ie;
               for (w = 0; w <= a; w++)
                 ce[w] = 0;
-              for (k = 0; k < g; k++)
+              for (k = 0; k < p; k++)
                 ce[l[u + k]]++;
-              for (z = E, $ = a; $ >= 1 && ce[$] === 0; $--)
+              for (z = E, L = a; L >= 1 && ce[L] === 0; L--)
                 ;
-              if (z > $ && (z = $), $ === 0)
-                return p[b++] = 20971520, p[b++] = 20971520, _.bits = 1, 0;
-              for (L = 1; L < $ && ce[L] === 0; L++)
+              if (z > L && (z = L), L === 0)
+                return g[b++] = 20971520, g[b++] = 20971520, _.bits = 1, 0;
+              for ($ = 1; $ < L && ce[$] === 0; $++)
                 ;
-              for (z < L && (z = L), P = 1, w = 1; w <= a; w++)
+              for (z < $ && (z = $), P = 1, w = 1; w <= a; w++)
                 if (P <<= 1, P -= ce[w], P < 0)
                   return -1;
-              if (P > 0 && (m === o || $ !== 1))
+              if (P > 0 && (m === o || L !== 1))
                 return -1;
               for (fe[1] = 0, w = 1; w < a; w++)
                 fe[w + 1] = fe[w] + ce[w];
-              for (k = 0; k < g; k++)
+              for (k = 0; k < p; k++)
                 l[u + k] !== 0 && (c[fe[l[u + k]]++] = k);
-              if (m === o ? (Q = oe = c, ee = 19) : m === d ? (Q = f, te -= 257, oe = y, he -= 257, ee = 256) : (Q = A, oe = x, ee = -1), N = 0, k = 0, w = L, H = b, O = z, R = 0, V = -1, U = 1 << z, G = U - 1, m === d && U > s || m === v && U > h)
+              if (m === o ? (Q = oe = c, ee = 19) : m === d ? (Q = f, te -= 257, oe = y, he -= 257, ee = 256) : (Q = A, oe = x, ee = -1), N = 0, k = 0, w = $, H = b, F = z, R = 0, V = -1, U = 1 << z, G = U - 1, m === d && U > s || m === v && U > h)
                 return 1;
               for (; ; ) {
-                Ae = w - R, c[k] < ee ? (Se = 0, Ie = c[k]) : c[k] > ee ? (Se = oe[he + c[k]], Ie = Q[te + c[k]]) : (Se = 96, Ie = 0), B = 1 << w - R, W = 1 << O, L = W;
+                Ae = w - R, c[k] < ee ? (Se = 0, Ie = c[k]) : c[k] > ee ? (Se = oe[he + c[k]], Ie = Q[te + c[k]]) : (Se = 96, Ie = 0), B = 1 << w - R, W = 1 << F, $ = W;
                 do
-                  W -= B, p[H + (N >> R) + W] = Ae << 24 | Se << 16 | Ie | 0;
+                  W -= B, g[H + (N >> R) + W] = Ae << 24 | Se << 16 | Ie | 0;
                 while (W !== 0);
                 for (B = 1 << w - 1; N & B; )
                   B >>= 1;
                 if (B !== 0 ? (N &= B - 1, N += B) : N = 0, k++, --ce[w] === 0) {
-                  if (w === $)
+                  if (w === L)
                     break;
                   w = l[u + c[k]];
                 }
                 if (w > z && (N & G) !== V) {
-                  for (R === 0 && (R = z), H += L, O = w - R, P = 1 << O; O + R < $ && (P -= ce[O + R], !(P <= 0)); )
-                    O++, P <<= 1;
-                  if (U += 1 << O, m === d && U > s || m === v && U > h)
+                  for (R === 0 && (R = z), H += $, F = w - R, P = 1 << F; F + R < L && (P -= ce[F + R], !(P <= 0)); )
+                    F++, P <<= 1;
+                  if (U += 1 << F, m === d && U > s || m === v && U > h)
                     return 1;
-                  V = N & G, p[V] = z << 24 | O << 16 | H - b | 0;
+                  V = N & G, g[V] = z << 24 | F << 16 | H - b | 0;
                 }
               }
-              return N !== 0 && (p[H + N] = w - R << 24 | 4194304 | 0), _.bits = z, 0;
+              return N !== 0 && (g[H + N] = w - R << 24 | 4194304 | 0), _.bits = z, 0;
             };
           }
         ),
@@ -39650,13 +39666,13 @@ ATOM`, b);
               for (var ae = K.length; --ae >= 0; )
                 K[ae] = 0;
             }
-            var v = 0, f = 1, y = 2, A = 3, x = 258, M = 29, m = 256, l = m + 1 + M, u = 30, g = 19, p = 2 * l + 1, b = 15, c = 16, _ = 7, E = 256, w = 16, k = 17, L = 18, $ = (
+            var v = 0, f = 1, y = 2, A = 3, x = 258, M = 29, m = 256, l = m + 1 + M, u = 30, p = 19, g = 2 * l + 1, b = 15, c = 16, _ = 7, E = 256, w = 16, k = 17, $ = 18, L = (
               /* extra bits for each length code */
               [0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0]
             ), z = (
               /* extra bits for each distance code */
               [0, 0, 0, 0, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13]
-            ), O = (
+            ), F = (
               /* extra bits for each bit length code */
               [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 3, 7]
             ), R = [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15], P = 512, U = new Array((l + 2) * 2);
@@ -39706,11 +39722,11 @@ ATOM`, b);
               K.bi_valid === 16 ? (oe(K, K.bi_buf), K.bi_buf = 0, K.bi_valid = 0) : K.bi_valid >= 8 && (K.pending_buf[K.pending++] = K.bi_buf & 255, K.bi_buf >>= 8, K.bi_valid -= 8);
             }
             function pe(K, ae) {
-              var ge = ae.dyn_tree, xe = ae.max_code, ue = ae.stat_desc.static_tree, Ce = ae.stat_desc.has_stree, Z = ae.stat_desc.extra_bits, Oe = ae.stat_desc.extra_base, We = ae.stat_desc.max_length, I, we, ve, Y, de, Me, Ye = 0;
+              var ge = ae.dyn_tree, xe = ae.max_code, ue = ae.stat_desc.static_tree, Ce = ae.stat_desc.has_stree, Z = ae.stat_desc.extra_bits, Fe = ae.stat_desc.extra_base, We = ae.stat_desc.max_length, I, we, ve, Y, de, Me, Ye = 0;
               for (Y = 0; Y <= b; Y++)
                 K.bl_count[Y] = 0;
-              for (ge[K.heap[K.heap_max] * 2 + 1] = 0, I = K.heap_max + 1; I < p; I++)
-                we = K.heap[I], Y = ge[ge[we * 2 + 1] * 2 + 1] + 1, Y > We && (Y = We, Ye++), ge[we * 2 + 1] = Y, !(we > xe) && (K.bl_count[Y]++, de = 0, we >= Oe && (de = Z[we - Oe]), Me = ge[we * 2], K.opt_len += Me * (Y + de), Ce && (K.static_len += Me * (ue[we * 2 + 1] + de)));
+              for (ge[K.heap[K.heap_max] * 2 + 1] = 0, I = K.heap_max + 1; I < g; I++)
+                we = K.heap[I], Y = ge[ge[we * 2 + 1] * 2 + 1] + 1, Y > We && (Y = We, Ye++), ge[we * 2 + 1] = Y, !(we > xe) && (K.bl_count[Y]++, de = 0, we >= Fe && (de = Z[we - Fe]), Me = ge[we * 2], K.opt_len += Me * (Y + de), Ce && (K.static_len += Me * (ue[we * 2 + 1] + de)));
               if (Ye !== 0) {
                 do {
                   for (Y = We - 1; K.bl_count[Y] === 0; )
@@ -39727,14 +39743,14 @@ ATOM`, b);
               for (Ce = 1; Ce <= b; Ce++)
                 xe[Ce] = ue = ue + ge[Ce - 1] << 1;
               for (Z = 0; Z <= ae; Z++) {
-                var Oe = K[Z * 2 + 1];
-                Oe !== 0 && (K[Z * 2] = Se(xe[Oe]++, Oe));
+                var Fe = K[Z * 2 + 1];
+                Fe !== 0 && (K[Z * 2] = Se(xe[Fe]++, Fe));
               }
             }
             function ne() {
               var K, ae, ge, xe, ue, Ce = new Array(b + 1);
               for (ge = 0, xe = 0; xe < M - 1; xe++)
-                for (V[xe] = ge, K = 0; K < 1 << $[xe]; K++)
+                for (V[xe] = ge, K = 0; K < 1 << L[xe]; K++)
                   W[ge++] = xe;
               for (W[ge - 1] = xe, ue = 0, xe = 0; xe < 16; xe++)
                 for (G[xe] = ue, K = 0; K < 1 << z[xe]; K++)
@@ -39754,7 +39770,7 @@ ATOM`, b);
                 U[K * 2 + 1] = 8, K++, Ce[8]++;
               for (le(U, l + 1, Ce), K = 0; K < u; K++)
                 N[K * 2 + 1] = 5, N[K * 2] = Se(K, 5);
-              Q = new H(U, $, m + 1, l, b), te = new H(N, z, 0, u, b), ee = new H(new Array(0), O, 0, g, _);
+              Q = new H(U, L, m + 1, l, b), te = new H(N, z, 0, u, b), ee = new H(new Array(0), F, 0, p, _);
             }
             function Te(K) {
               var ae;
@@ -39762,15 +39778,15 @@ ATOM`, b);
                 K.dyn_ltree[ae * 2] = 0;
               for (ae = 0; ae < u; ae++)
                 K.dyn_dtree[ae * 2] = 0;
-              for (ae = 0; ae < g; ae++)
+              for (ae = 0; ae < p; ae++)
                 K.bl_tree[ae * 2] = 0;
               K.dyn_ltree[E * 2] = 1, K.opt_len = K.static_len = 0, K.last_lit = K.matches = 0;
             }
-            function Fe(K) {
+            function Oe(K) {
               K.bi_valid > 8 ? oe(K, K.bi_buf) : K.bi_valid > 0 && (K.pending_buf[K.pending++] = K.bi_buf), K.bi_buf = 0, K.bi_valid = 0;
             }
             function Be(K, ae, ge, xe) {
-              Fe(K), oe(K, ge), oe(K, ~ge), r.arraySet(K.pending_buf, K.window, ae, ge, K.pending), K.pending += ge;
+              Oe(K), oe(K, ge), oe(K, ~ge), r.arraySet(K.pending_buf, K.window, ae, ge, K.pending), K.pending += ge;
             }
             function Ue(K, ae, ge, xe) {
               var ue = ae * 2, Ce = ge * 2;
@@ -39782,16 +39798,16 @@ ATOM`, b);
               K.heap[ge] = xe;
             }
             function Ge(K, ae, ge) {
-              var xe, ue, Ce = 0, Z, Oe;
+              var xe, ue, Ce = 0, Z, Fe;
               if (K.last_lit !== 0)
                 do
-                  xe = K.pending_buf[K.d_buf + Ce * 2] << 8 | K.pending_buf[K.d_buf + Ce * 2 + 1], ue = K.pending_buf[K.l_buf + Ce], Ce++, xe === 0 ? Ae(K, ue, ae) : (Z = W[ue], Ae(K, Z + m + 1, ae), Oe = $[Z], Oe !== 0 && (ue -= V[Z], he(K, ue, Oe)), xe--, Z = fe(xe), Ae(K, Z, ge), Oe = z[Z], Oe !== 0 && (xe -= G[Z], he(K, xe, Oe)));
+                  xe = K.pending_buf[K.d_buf + Ce * 2] << 8 | K.pending_buf[K.d_buf + Ce * 2 + 1], ue = K.pending_buf[K.l_buf + Ce], Ce++, xe === 0 ? Ae(K, ue, ae) : (Z = W[ue], Ae(K, Z + m + 1, ae), Fe = L[Z], Fe !== 0 && (ue -= V[Z], he(K, ue, Fe)), xe--, Z = fe(xe), Ae(K, Z, ge), Fe = z[Z], Fe !== 0 && (xe -= G[Z], he(K, xe, Fe)));
                 while (Ce < K.last_lit);
               Ae(K, E, ae);
             }
             function Ne(K, ae) {
-              var ge = ae.dyn_tree, xe = ae.stat_desc.static_tree, ue = ae.stat_desc.has_stree, Ce = ae.stat_desc.elems, Z, Oe, We = -1, I;
-              for (K.heap_len = 0, K.heap_max = p, Z = 0; Z < Ce; Z++)
+              var ge = ae.dyn_tree, xe = ae.stat_desc.static_tree, ue = ae.stat_desc.has_stree, Ce = ae.stat_desc.elems, Z, Fe, We = -1, I;
+              for (K.heap_len = 0, K.heap_max = g, Z = 0; Z < Ce; Z++)
                 ge[Z * 2] !== 0 ? (K.heap[++K.heap_len] = We = Z, K.depth[Z] = 0) : ge[Z * 2 + 1] = 0;
               for (; K.heap_len < 2; )
                 I = K.heap[++K.heap_len] = We < 2 ? ++We : 0, ge[I * 2] = 1, K.depth[I] = 0, K.opt_len--, ue && (K.static_len -= xe[I * 2 + 1]);
@@ -39810,10 +39826,10 @@ ATOM`, b);
                   ge,
                   1
                   /*SMALLEST*/
-                ), Oe = K.heap[
+                ), Fe = K.heap[
                   1
                   /*SMALLEST*/
-                ], K.heap[--K.heap_max] = Z, K.heap[--K.heap_max] = Oe, ge[I * 2] = ge[Z * 2] + ge[Oe * 2], K.depth[I] = (K.depth[Z] >= K.depth[Oe] ? K.depth[Z] : K.depth[Oe]) + 1, ge[Z * 2 + 1] = ge[Oe * 2 + 1] = I, K.heap[
+                ], K.heap[--K.heap_max] = Z, K.heap[--K.heap_max] = Fe, ge[I * 2] = ge[Z * 2] + ge[Fe * 2], K.depth[I] = (K.depth[Z] >= K.depth[Fe] ? K.depth[Z] : K.depth[Fe]) + 1, ge[Z * 2 + 1] = ge[Fe * 2 + 1] = I, K.heap[
                   1
                   /*SMALLEST*/
                 ] = I++, Pe(
@@ -39829,25 +39845,25 @@ ATOM`, b);
               ], pe(K, ae), le(ge, We, K.bl_count);
             }
             function Re(K, ae, ge) {
-              var xe, ue = -1, Ce, Z = ae[0 * 2 + 1], Oe = 0, We = 7, I = 4;
+              var xe, ue = -1, Ce, Z = ae[0 * 2 + 1], Fe = 0, We = 7, I = 4;
               for (Z === 0 && (We = 138, I = 3), ae[(ge + 1) * 2 + 1] = 65535, xe = 0; xe <= ge; xe++)
-                Ce = Z, Z = ae[(xe + 1) * 2 + 1], !(++Oe < We && Ce === Z) && (Oe < I ? K.bl_tree[Ce * 2] += Oe : Ce !== 0 ? (Ce !== ue && K.bl_tree[Ce * 2]++, K.bl_tree[w * 2]++) : Oe <= 10 ? K.bl_tree[k * 2]++ : K.bl_tree[L * 2]++, Oe = 0, ue = Ce, Z === 0 ? (We = 138, I = 3) : Ce === Z ? (We = 6, I = 3) : (We = 7, I = 4));
+                Ce = Z, Z = ae[(xe + 1) * 2 + 1], !(++Fe < We && Ce === Z) && (Fe < I ? K.bl_tree[Ce * 2] += Fe : Ce !== 0 ? (Ce !== ue && K.bl_tree[Ce * 2]++, K.bl_tree[w * 2]++) : Fe <= 10 ? K.bl_tree[k * 2]++ : K.bl_tree[$ * 2]++, Fe = 0, ue = Ce, Z === 0 ? (We = 138, I = 3) : Ce === Z ? (We = 6, I = 3) : (We = 7, I = 4));
             }
             function De(K, ae, ge) {
-              var xe, ue = -1, Ce, Z = ae[0 * 2 + 1], Oe = 0, We = 7, I = 4;
+              var xe, ue = -1, Ce, Z = ae[0 * 2 + 1], Fe = 0, We = 7, I = 4;
               for (Z === 0 && (We = 138, I = 3), xe = 0; xe <= ge; xe++)
-                if (Ce = Z, Z = ae[(xe + 1) * 2 + 1], !(++Oe < We && Ce === Z)) {
-                  if (Oe < I)
+                if (Ce = Z, Z = ae[(xe + 1) * 2 + 1], !(++Fe < We && Ce === Z)) {
+                  if (Fe < I)
                     do
                       Ae(K, Ce, K.bl_tree);
-                    while (--Oe !== 0);
-                  else Ce !== 0 ? (Ce !== ue && (Ae(K, Ce, K.bl_tree), Oe--), Ae(K, w, K.bl_tree), he(K, Oe - 3, 2)) : Oe <= 10 ? (Ae(K, k, K.bl_tree), he(K, Oe - 3, 3)) : (Ae(K, L, K.bl_tree), he(K, Oe - 11, 7));
-                  Oe = 0, ue = Ce, Z === 0 ? (We = 138, I = 3) : Ce === Z ? (We = 6, I = 3) : (We = 7, I = 4);
+                    while (--Fe !== 0);
+                  else Ce !== 0 ? (Ce !== ue && (Ae(K, Ce, K.bl_tree), Fe--), Ae(K, w, K.bl_tree), he(K, Fe - 3, 2)) : Fe <= 10 ? (Ae(K, k, K.bl_tree), he(K, Fe - 3, 3)) : (Ae(K, $, K.bl_tree), he(K, Fe - 11, 7));
+                  Fe = 0, ue = Ce, Z === 0 ? (We = 138, I = 3) : Ce === Z ? (We = 6, I = 3) : (We = 7, I = 4);
                 }
             }
             function je(K) {
               var ae;
-              for (Re(K, K.dyn_ltree, K.l_desc.max_code), Re(K, K.dyn_dtree, K.d_desc.max_code), Ne(K, K.bl_desc), ae = g - 1; ae >= 3 && K.bl_tree[R[ae] * 2 + 1] === 0; ae--)
+              for (Re(K, K.dyn_ltree, K.l_desc.max_code), Re(K, K.dyn_dtree, K.d_desc.max_code), Ne(K, K.bl_desc), ae = p - 1; ae >= 3 && K.bl_tree[R[ae] * 2 + 1] === 0; ae--)
                 ;
               return K.opt_len += 3 * (ae + 1) + 5 + 5 + 4, ae;
             }
@@ -39881,7 +39897,7 @@ ATOM`, b);
             }
             function ze(K, ae, ge, xe) {
               var ue, Ce, Z = 0;
-              K.level > 0 ? (K.strm.data_type === o && (K.strm.data_type = X(K)), Ne(K, K.l_desc), Ne(K, K.d_desc), Z = je(K), ue = K.opt_len + 3 + 7 >>> 3, Ce = K.static_len + 3 + 7 >>> 3, Ce <= ue && (ue = Ce)) : ue = Ce = ge + 5, ge + 4 <= ue && ae !== -1 ? ye(K, ae, ge, xe) : K.strategy === a || Ce === ue ? (he(K, (f << 1) + (xe ? 1 : 0), 3), Ge(K, U, N)) : (he(K, (y << 1) + (xe ? 1 : 0), 3), Xe(K, K.l_desc.max_code + 1, K.d_desc.max_code + 1, Z + 1), Ge(K, K.dyn_ltree, K.dyn_dtree)), Te(K), xe && Fe(K);
+              K.level > 0 ? (K.strm.data_type === o && (K.strm.data_type = X(K)), Ne(K, K.l_desc), Ne(K, K.d_desc), Z = je(K), ue = K.opt_len + 3 + 7 >>> 3, Ce = K.static_len + 3 + 7 >>> 3, Ce <= ue && (ue = Ce)) : ue = Ce = ge + 5, ge + 4 <= ue && ae !== -1 ? ye(K, ae, ge, xe) : K.strategy === a || Ce === ue ? (he(K, (f << 1) + (xe ? 1 : 0), 3), Ge(K, U, N)) : (he(K, (y << 1) + (xe ? 1 : 0), 3), Xe(K, K.l_desc.max_code + 1, K.d_desc.max_code + 1, Z + 1), Ge(K, K.dyn_ltree, K.dyn_dtree)), Te(K), xe && Oe(K);
             }
             function ke(K, ae, ge) {
               return K.pending_buf[K.d_buf + K.last_lit * 2] = ae >>> 8 & 255, K.pending_buf[K.d_buf + K.last_lit * 2 + 1] = ae & 255, K.pending_buf[K.l_buf + K.last_lit] = ge & 255, K.last_lit++, ae === 0 ? K.dyn_ltree[ge * 2]++ : (K.matches++, ae--, K.dyn_ltree[(W[ge] + m + 1) * 2]++, K.dyn_dtree[fe(ae) * 2]++), K.last_lit === K.lit_bufsize - 1;
@@ -40125,13 +40141,13 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 for (var ye = v(q), me = 0; re > me; ++me) ye.setInt32(4 * me, X[me]);
                 return f(q);
               }
-              function g(X, q) {
+              function p(X, q) {
                 var re = X.length;
                 q || (q = new Float32Array(re / 4));
                 for (var ye = v(q), me = v(X), ze = 0, ke = 0, K = re / 4; K > ze; ++ze, ke += 4) ye.setFloat32(ke, me.getFloat32(ke), !0);
                 return q;
               }
-              function p(X, q, re) {
+              function g(X, q, re) {
                 var ye = X.length, me = 1 / q;
                 re || (re = new Float32Array(ye));
                 for (var ze = 0; ye > ze; ++ze) re[ze] = X[ze] * me;
@@ -40187,7 +40203,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 }
                 return q;
               }
-              function L(X, q) {
+              function $(X, q) {
                 var re, ye = 32767, me = -ye - 1, ze = X.length, ke = 0;
                 for (re = 0; ze > re; ++re) {
                   var K = X[re];
@@ -40202,33 +40218,33 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 }
                 return ae;
               }
-              function $(X, q) {
+              function L(X, q) {
                 return E(c(X), q);
               }
               function z(X) {
                 return _(w(X));
               }
-              function O(X, q, re) {
-                return p(c(X, A(re)), q, re);
+              function F(X, q, re) {
+                return g(c(X, A(re)), q, re);
               }
               function R(X, q) {
                 return _(b(X, q));
               }
               function P(X, q, re) {
-                return p(E(X, A(re)), q, re);
+                return g(E(X, A(re)), q, re);
               }
               function U(X, q, re) {
                 return w(b(X, q), re);
               }
               function N(X, q, re) {
-                return p(k(X, A(re)), q, re);
+                return g(k(X, A(re)), q, re);
               }
               function B(X, q, re) {
                 var ye = k(X, A(re));
                 return P(ye, q, x(ye));
               }
               function W(X, q, re) {
-                return L(U(X, q));
+                return $(U(X, q));
               }
               function V(ze) {
                 var q = v(ze), re = q.getInt32(0), ye = q.getInt32(4), me = ze.subarray(8, 12), ze = ze.subarray(12);
@@ -40357,7 +40373,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               function Se(X, q, re, ye) {
                 switch (X) {
                   case 1:
-                    return g(q);
+                    return p(q);
                   case 2:
                     return y(q);
                   case 3:
@@ -40371,13 +40387,13 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                   case 7:
                     return c(l(q));
                   case 8:
-                    return $(l(q));
+                    return L(l(q));
                   case 9:
-                    return O(l(q), l(ye)[0]);
+                    return F(l(q), l(ye)[0]);
                   case 10:
                     return B(M(q), l(ye)[0]);
                   case 11:
-                    return p(M(q), l(ye)[0]);
+                    return g(M(q), l(ye)[0]);
                   case 12:
                     return N(M(q), l(ye)[0]);
                   case 13:
@@ -40401,16 +40417,16 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               }
               function le(X, q, re) {
                 re = re || {};
-                var ye, me, ze, ke, K, ae, ge = re.firstModelOnly, xe = q.onModel, ue = q.onChain, Ce = q.onGroup, Z = q.onAtom, Oe = q.onBond, We = 0, I = 0, we = 0, ve = 0, Y = 0, de = -1, Me = X.chainNameList, Ye = X.secStructList, Ze = X.insCodeList, Ke = X.sequenceIndexList, rt = X.atomIdList, wt = X.bFactorList, st = X.altLocList, ot = X.occupancyList, at = X.bondAtomList, Mt = X.bondOrderList;
+                var ye, me, ze, ke, K, ae, ge = re.firstModelOnly, xe = q.onModel, ue = q.onChain, Ce = q.onGroup, Z = q.onAtom, Fe = q.onBond, We = 0, I = 0, we = 0, ve = 0, Y = 0, de = -1, Me = X.chainNameList, Ye = X.secStructList, Ze = X.insCodeList, Ke = X.sequenceIndexList, rt = X.atomIdList, wt = X.bFactorList, st = X.altLocList, ot = X.occupancyList, at = X.bondAtomList, Mt = X.bondOrderList;
                 for (ye = 0, me = X.chainsPerModel.length; me > ye && !(ge && We > 0); ++ye) {
                   var gt = X.chainsPerModel[We];
                   for (xe && xe({ chainCount: gt, modelIndex: We }), ze = 0; gt > ze; ++ze) {
-                    var Lt = X.groupsPerChain[I];
+                    var $t = X.groupsPerChain[I];
                     if (ue) {
                       var Pt = pe(X.chainIdList.subarray(4 * I, 4 * I + 4)), Et = null;
-                      Me && (Et = pe(Me.subarray(4 * I, 4 * I + 4))), ue({ groupCount: Lt, chainIndex: I, modelIndex: We, chainId: Pt, chainName: Et });
+                      Me && (Et = pe(Me.subarray(4 * I, 4 * I + 4))), ue({ groupCount: $t, chainIndex: I, modelIndex: We, chainId: Pt, chainName: Et });
                     }
-                    for (ke = 0; Lt > ke; ++ke) {
+                    for (ke = 0; $t > ke; ++ke) {
                       var St = X.groupList[X.groupTypeList[we]], yt = St.atomNameList.length;
                       if (Ce) {
                         var zt = null;
@@ -40433,17 +40449,17 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                         }
                         ve += 1;
                       }
-                      if (Oe) {
+                      if (Fe) {
                         var Tt = St.bondAtomList;
-                        for (K = 0, ae = St.bondOrderList.length; ae > K; ++K) Oe({ atomIndex1: ve - yt + Tt[2 * K], atomIndex2: ve - yt + Tt[2 * K + 1], bondOrder: St.bondOrderList[K] });
+                        for (K = 0, ae = St.bondOrderList.length; ae > K; ++K) Fe({ atomIndex1: ve - yt + Tt[2 * K], atomIndex2: ve - yt + Tt[2 * K + 1], bondOrder: St.bondOrderList[K] });
                       }
                       we += 1;
                     }
                     I += 1;
                   }
-                  if (Y = de + 1, de = ve - 1, Oe && at) for (K = 0, ae = at.length; ae > K; K += 2) {
-                    var $t = at[K], It = at[K + 1];
-                    ($t >= Y && de >= $t || It >= Y && de >= It) && Oe({ atomIndex1: $t, atomIndex2: It, bondOrder: Mt ? Mt[K / 2] : null });
+                  if (Y = de + 1, de = ve - 1, Fe && at) for (K = 0, ae = at.length; ae > K; K += 2) {
+                    var Lt = at[K], It = at[K + 1];
+                    (Lt >= Y && de >= Lt || It >= Y && de >= It) && Fe({ atomIndex1: Lt, atomIndex2: It, bondOrder: Mt ? Mt[K / 2] : null });
                   }
                   We += 1;
                 }
@@ -40456,7 +40472,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 var re;
                 return re = X instanceof Uint8Array ? Ae(X) : X, Ie(re, q);
               }
-              function Fe(X, q, re, ye) {
+              function Oe(X, q, re, ye) {
                 function me() {
                   try {
                     var ke = Te(ze.response);
@@ -40469,10 +40485,10 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 ze.addEventListener("load", me, !0), ze.addEventListener("error", ye, !0), ze.responseType = "arraybuffer", ze.open("GET", q + X.toUpperCase()), ze.send();
               }
               function Be(X, q, re) {
-                Fe(X, je, q, re);
+                Oe(X, je, q, re);
               }
               function Ue(X, q, re) {
-                Fe(X, Xe, q, re);
+                Oe(X, Xe, q, re);
               }
               var Pe = ["mmtfVersion", "mmtfProducer", "unitCell", "spaceGroup", "structureId", "title", "depositionDate", "releaseDate", "experimentalMethods", "resolution", "rFree", "rWork", "bioAssemblyList", "ncsOperatorList", "entityList", "groupList", "numBonds", "numAtoms", "numGroups", "numChains", "numModels", "groupsPerChain", "chainsPerModel"], Ge = ["xCoordList", "yCoordList", "zCoordList", "groupIdList", "groupTypeList", "chainIdList", "bFactorList", "atomIdList", "altLocList", "occupancyList", "secStructList", "insCodeList", "sequenceIndexList", "chainNameList", "bondAtomList", "bondOrderList"], Ne = Pe.concat(Ge), Re = "v1.0.1", De = "//mmtf.rcsb.org/v1.0/", je = De + "full/", Xe = De + "reduced/";
               t.encode = ne, t.decode = Te, t.traverse = le, t.fetch = Be, t.fetchReduced = Ue, t.version = Re, t.fetchUrl = je, t.fetchReducedUrl = Xe, t.encodeMsgpack = o, t.encodeMmtf = he, t.decodeMsgpack = Ae, t.decodeMmtf = Ie;
@@ -40546,16 +40562,16 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               for (; --j >= 0; )
                 C[j] = 0;
             }
-            const d = 0, v = 1, f = 2, y = 3, A = 258, x = 29, M = 256, m = M + 1 + x, l = 30, u = 19, g = 2 * m + 1, p = 15, b = 16, c = 7, _ = 256, E = 16, w = 17, k = 18, L = (
+            const d = 0, v = 1, f = 2, y = 3, A = 258, x = 29, M = 256, m = M + 1 + x, l = 30, u = 19, p = 2 * m + 1, g = 15, b = 16, c = 7, _ = 256, E = 16, w = 17, k = 18, $ = (
               /* extra bits for each length code */
               new Uint8Array([0, 0, 0, 0, 0, 0, 0, 0, 1, 1, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 4, 4, 4, 4, 5, 5, 5, 5, 0])
-            ), $ = (
+            ), L = (
               /* extra bits for each distance code */
               new Uint8Array([0, 0, 0, 0, 1, 1, 2, 2, 3, 3, 4, 4, 5, 5, 6, 6, 7, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 13, 13])
             ), z = (
               /* extra bits for each bit length code */
               new Uint8Array([0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 2, 3, 7])
-            ), O = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]), R = 512, P = new Array((m + 2) * 2);
+            ), F = new Uint8Array([16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]), R = 512, P = new Array((m + 2) * 2);
             o(P);
             const U = new Array(l * 2);
             o(U);
@@ -40567,8 +40583,8 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
             o(W);
             const V = new Array(l);
             o(V);
-            function G(C, j, F, J, se) {
-              this.static_tree = C, this.extra_bits = j, this.extra_base = F, this.elems = J, this.max_length = se, this.has_stree = C && C.length;
+            function G(C, j, O, J, se) {
+              this.static_tree = C, this.extra_bits = j, this.extra_base = O, this.elems = J, this.max_length = se, this.has_stree = C && C.length;
             }
             let H, Q, te;
             function ee(C, j) {
@@ -40576,30 +40592,30 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
             }
             const ce = (C) => C < 256 ? N[C] : N[256 + (C >>> 7)], fe = (C, j) => {
               C.pending_buf[C.pending++] = j & 255, C.pending_buf[C.pending++] = j >>> 8 & 255;
-            }, oe = (C, j, F) => {
-              C.bi_valid > b - F ? (C.bi_buf |= j << C.bi_valid & 65535, fe(C, C.bi_buf), C.bi_buf = j >> b - C.bi_valid, C.bi_valid += F - b) : (C.bi_buf |= j << C.bi_valid & 65535, C.bi_valid += F);
-            }, he = (C, j, F) => {
+            }, oe = (C, j, O) => {
+              C.bi_valid > b - O ? (C.bi_buf |= j << C.bi_valid & 65535, fe(C, C.bi_buf), C.bi_buf = j >> b - C.bi_valid, C.bi_valid += O - b) : (C.bi_buf |= j << C.bi_valid & 65535, C.bi_valid += O);
+            }, he = (C, j, O) => {
               oe(
                 C,
-                F[j * 2],
-                F[j * 2 + 1]
+                O[j * 2],
+                O[j * 2 + 1]
                 /*.Len*/
               );
             }, Ae = (C, j) => {
-              let F = 0;
+              let O = 0;
               do
-                F |= C & 1, C >>>= 1, F <<= 1;
+                O |= C & 1, C >>>= 1, O <<= 1;
               while (--j > 0);
-              return F >>> 1;
+              return O >>> 1;
             }, Se = (C) => {
               C.bi_valid === 16 ? (fe(C, C.bi_buf), C.bi_buf = 0, C.bi_valid = 0) : C.bi_valid >= 8 && (C.pending_buf[C.pending++] = C.bi_buf & 255, C.bi_buf >>= 8, C.bi_valid -= 8);
             }, Ie = (C, j) => {
-              const F = j.dyn_tree, J = j.max_code, se = j.stat_desc.static_tree, ie = j.stat_desc.has_stree, Le = j.stat_desc.extra_bits, Ee = j.stat_desc.extra_base, tt = j.stat_desc.max_length;
-              let _e, $e, pt, Je, He, it, Ct = 0;
-              for (Je = 0; Je <= p; Je++)
+              const O = j.dyn_tree, J = j.max_code, se = j.stat_desc.static_tree, ie = j.stat_desc.has_stree, $e = j.stat_desc.extra_bits, Ee = j.stat_desc.extra_base, tt = j.stat_desc.max_length;
+              let _e, Le, pt, Je, He, it, Ct = 0;
+              for (Je = 0; Je <= g; Je++)
                 C.bl_count[Je] = 0;
-              for (F[C.heap[C.heap_max] * 2 + 1] = 0, _e = C.heap_max + 1; _e < g; _e++)
-                $e = C.heap[_e], Je = F[F[$e * 2 + 1] * 2 + 1] + 1, Je > tt && (Je = tt, Ct++), F[$e * 2 + 1] = Je, !($e > J) && (C.bl_count[Je]++, He = 0, $e >= Ee && (He = Le[$e - Ee]), it = F[$e * 2], C.opt_len += it * (Je + He), ie && (C.static_len += it * (se[$e * 2 + 1] + He)));
+              for (O[C.heap[C.heap_max] * 2 + 1] = 0, _e = C.heap_max + 1; _e < p; _e++)
+                Le = C.heap[_e], Je = O[O[Le * 2 + 1] * 2 + 1] + 1, Je > tt && (Je = tt, Ct++), O[Le * 2 + 1] = Je, !(Le > J) && (C.bl_count[Je]++, He = 0, Le >= Ee && (He = $e[Le - Ee]), it = O[Le * 2], C.opt_len += it * (Je + He), ie && (C.static_len += it * (se[Le * 2 + 1] + He)));
               if (Ct !== 0) {
                 do {
                   for (Je = tt - 1; C.bl_count[Je] === 0; )
@@ -40607,31 +40623,31 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                   C.bl_count[Je]--, C.bl_count[Je + 1] += 2, C.bl_count[tt]--, Ct -= 2;
                 } while (Ct > 0);
                 for (Je = tt; Je !== 0; Je--)
-                  for ($e = C.bl_count[Je]; $e !== 0; )
-                    pt = C.heap[--_e], !(pt > J) && (F[pt * 2 + 1] !== Je && (C.opt_len += (Je - F[pt * 2 + 1]) * F[pt * 2], F[pt * 2 + 1] = Je), $e--);
-              }
-            }, pe = (C, j, F) => {
-              const J = new Array(p + 1);
-              let se = 0, ie, Le;
-              for (ie = 1; ie <= p; ie++)
-                se = se + F[ie - 1] << 1, J[ie] = se;
-              for (Le = 0; Le <= j; Le++) {
-                let Ee = C[Le * 2 + 1];
-                Ee !== 0 && (C[Le * 2] = Ae(J[Ee]++, Ee));
+                  for (Le = C.bl_count[Je]; Le !== 0; )
+                    pt = C.heap[--_e], !(pt > J) && (O[pt * 2 + 1] !== Je && (C.opt_len += (Je - O[pt * 2 + 1]) * O[pt * 2], O[pt * 2 + 1] = Je), Le--);
+              }
+            }, pe = (C, j, O) => {
+              const J = new Array(g + 1);
+              let se = 0, ie, $e;
+              for (ie = 1; ie <= g; ie++)
+                se = se + O[ie - 1] << 1, J[ie] = se;
+              for ($e = 0; $e <= j; $e++) {
+                let Ee = C[$e * 2 + 1];
+                Ee !== 0 && (C[$e * 2] = Ae(J[Ee]++, Ee));
               }
             }, le = () => {
-              let C, j, F, J, se;
-              const ie = new Array(p + 1);
-              for (F = 0, J = 0; J < x - 1; J++)
-                for (W[J] = F, C = 0; C < 1 << L[J]; C++)
-                  B[F++] = J;
-              for (B[F - 1] = J, se = 0, J = 0; J < 16; J++)
-                for (V[J] = se, C = 0; C < 1 << $[J]; C++)
+              let C, j, O, J, se;
+              const ie = new Array(g + 1);
+              for (O = 0, J = 0; J < x - 1; J++)
+                for (W[J] = O, C = 0; C < 1 << $[J]; C++)
+                  B[O++] = J;
+              for (B[O - 1] = J, se = 0, J = 0; J < 16; J++)
+                for (V[J] = se, C = 0; C < 1 << L[J]; C++)
                   N[se++] = J;
               for (se >>= 7; J < l; J++)
-                for (V[J] = se << 7, C = 0; C < 1 << $[J] - 7; C++)
+                for (V[J] = se << 7, C = 0; C < 1 << L[J] - 7; C++)
                   N[256 + se++] = J;
-              for (j = 0; j <= p; j++)
+              for (j = 0; j <= g; j++)
                 ie[j] = 0;
               for (C = 0; C <= 143; )
                 P[C * 2 + 1] = 8, C++, ie[8]++;
@@ -40643,7 +40659,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 P[C * 2 + 1] = 8, C++, ie[8]++;
               for (pe(P, m + 1, ie), C = 0; C < l; C++)
                 U[C * 2 + 1] = 5, U[C * 2] = Ae(C, 5);
-              H = new G(P, L, M + 1, m, p), Q = new G(U, $, 0, l, p), te = new G(new Array(0), z, 0, u, c);
+              H = new G(P, $, M + 1, m, g), Q = new G(U, L, 0, l, g), te = new G(new Array(0), z, 0, u, c);
             }, ne = (C) => {
               let j;
               for (j = 0; j < m; j++)
@@ -40655,34 +40671,34 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               C.dyn_ltree[_ * 2] = 1, C.opt_len = C.static_len = 0, C.sym_next = C.matches = 0;
             }, Te = (C) => {
               C.bi_valid > 8 ? fe(C, C.bi_buf) : C.bi_valid > 0 && (C.pending_buf[C.pending++] = C.bi_buf), C.bi_buf = 0, C.bi_valid = 0;
-            }, Fe = (C, j, F, J) => {
-              const se = j * 2, ie = F * 2;
-              return C[se] < C[ie] || C[se] === C[ie] && J[j] <= J[F];
-            }, Be = (C, j, F) => {
-              const J = C.heap[F];
-              let se = F << 1;
-              for (; se <= C.heap_len && (se < C.heap_len && Fe(j, C.heap[se + 1], C.heap[se], C.depth) && se++, !Fe(j, J, C.heap[se], C.depth)); )
-                C.heap[F] = C.heap[se], F = se, se <<= 1;
-              C.heap[F] = J;
-            }, Ue = (C, j, F) => {
-              let J, se, ie = 0, Le, Ee;
+            }, Oe = (C, j, O, J) => {
+              const se = j * 2, ie = O * 2;
+              return C[se] < C[ie] || C[se] === C[ie] && J[j] <= J[O];
+            }, Be = (C, j, O) => {
+              const J = C.heap[O];
+              let se = O << 1;
+              for (; se <= C.heap_len && (se < C.heap_len && Oe(j, C.heap[se + 1], C.heap[se], C.depth) && se++, !Oe(j, J, C.heap[se], C.depth)); )
+                C.heap[O] = C.heap[se], O = se, se <<= 1;
+              C.heap[O] = J;
+            }, Ue = (C, j, O) => {
+              let J, se, ie = 0, $e, Ee;
               if (C.sym_next !== 0)
                 do
-                  J = C.pending_buf[C.sym_buf + ie++] & 255, J += (C.pending_buf[C.sym_buf + ie++] & 255) << 8, se = C.pending_buf[C.sym_buf + ie++], J === 0 ? he(C, se, j) : (Le = B[se], he(C, Le + M + 1, j), Ee = L[Le], Ee !== 0 && (se -= W[Le], oe(C, se, Ee)), J--, Le = ce(J), he(C, Le, F), Ee = $[Le], Ee !== 0 && (J -= V[Le], oe(C, J, Ee)));
+                  J = C.pending_buf[C.sym_buf + ie++] & 255, J += (C.pending_buf[C.sym_buf + ie++] & 255) << 8, se = C.pending_buf[C.sym_buf + ie++], J === 0 ? he(C, se, j) : ($e = B[se], he(C, $e + M + 1, j), Ee = $[$e], Ee !== 0 && (se -= W[$e], oe(C, se, Ee)), J--, $e = ce(J), he(C, $e, O), Ee = L[$e], Ee !== 0 && (J -= V[$e], oe(C, J, Ee)));
                 while (ie < C.sym_next);
               he(C, _, j);
             }, Pe = (C, j) => {
-              const F = j.dyn_tree, J = j.stat_desc.static_tree, se = j.stat_desc.has_stree, ie = j.stat_desc.elems;
-              let Le, Ee, tt = -1, _e;
-              for (C.heap_len = 0, C.heap_max = g, Le = 0; Le < ie; Le++)
-                F[Le * 2] !== 0 ? (C.heap[++C.heap_len] = tt = Le, C.depth[Le] = 0) : F[Le * 2 + 1] = 0;
+              const O = j.dyn_tree, J = j.stat_desc.static_tree, se = j.stat_desc.has_stree, ie = j.stat_desc.elems;
+              let $e, Ee, tt = -1, _e;
+              for (C.heap_len = 0, C.heap_max = p, $e = 0; $e < ie; $e++)
+                O[$e * 2] !== 0 ? (C.heap[++C.heap_len] = tt = $e, C.depth[$e] = 0) : O[$e * 2 + 1] = 0;
               for (; C.heap_len < 2; )
-                _e = C.heap[++C.heap_len] = tt < 2 ? ++tt : 0, F[_e * 2] = 1, C.depth[_e] = 0, C.opt_len--, se && (C.static_len -= J[_e * 2 + 1]);
-              for (j.max_code = tt, Le = C.heap_len >> 1; Le >= 1; Le--)
-                Be(C, F, Le);
+                _e = C.heap[++C.heap_len] = tt < 2 ? ++tt : 0, O[_e * 2] = 1, C.depth[_e] = 0, C.opt_len--, se && (C.static_len -= J[_e * 2 + 1]);
+              for (j.max_code = tt, $e = C.heap_len >> 1; $e >= 1; $e--)
+                Be(C, O, $e);
               _e = ie;
               do
-                Le = C.heap[
+                $e = C.heap[
                   1
                   /*SMALLEST*/
                 ], C.heap[
@@ -40690,18 +40706,18 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                   /*SMALLEST*/
                 ] = C.heap[C.heap_len--], Be(
                   C,
-                  F,
+                  O,
                   1
                   /*SMALLEST*/
                 ), Ee = C.heap[
                   1
                   /*SMALLEST*/
-                ], C.heap[--C.heap_max] = Le, C.heap[--C.heap_max] = Ee, F[_e * 2] = F[Le * 2] + F[Ee * 2], C.depth[_e] = (C.depth[Le] >= C.depth[Ee] ? C.depth[Le] : C.depth[Ee]) + 1, F[Le * 2 + 1] = F[Ee * 2 + 1] = _e, C.heap[
+                ], C.heap[--C.heap_max] = $e, C.heap[--C.heap_max] = Ee, O[_e * 2] = O[$e * 2] + O[Ee * 2], C.depth[_e] = (C.depth[$e] >= C.depth[Ee] ? C.depth[$e] : C.depth[Ee]) + 1, O[$e * 2 + 1] = O[Ee * 2 + 1] = _e, C.heap[
                   1
                   /*SMALLEST*/
                 ] = _e++, Be(
                   C,
-                  F,
+                  O,
                   1
                   /*SMALLEST*/
                 );
@@ -40709,87 +40725,87 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               C.heap[--C.heap_max] = C.heap[
                 1
                 /*SMALLEST*/
-              ], Ie(C, j), pe(F, tt, C.bl_count);
-            }, Ge = (C, j, F) => {
-              let J, se = -1, ie, Le = j[0 * 2 + 1], Ee = 0, tt = 7, _e = 4;
-              for (Le === 0 && (tt = 138, _e = 3), j[(F + 1) * 2 + 1] = 65535, J = 0; J <= F; J++)
-                ie = Le, Le = j[(J + 1) * 2 + 1], !(++Ee < tt && ie === Le) && (Ee < _e ? C.bl_tree[ie * 2] += Ee : ie !== 0 ? (ie !== se && C.bl_tree[ie * 2]++, C.bl_tree[E * 2]++) : Ee <= 10 ? C.bl_tree[w * 2]++ : C.bl_tree[k * 2]++, Ee = 0, se = ie, Le === 0 ? (tt = 138, _e = 3) : ie === Le ? (tt = 6, _e = 3) : (tt = 7, _e = 4));
-            }, Ne = (C, j, F) => {
-              let J, se = -1, ie, Le = j[0 * 2 + 1], Ee = 0, tt = 7, _e = 4;
-              for (Le === 0 && (tt = 138, _e = 3), J = 0; J <= F; J++)
-                if (ie = Le, Le = j[(J + 1) * 2 + 1], !(++Ee < tt && ie === Le)) {
+              ], Ie(C, j), pe(O, tt, C.bl_count);
+            }, Ge = (C, j, O) => {
+              let J, se = -1, ie, $e = j[0 * 2 + 1], Ee = 0, tt = 7, _e = 4;
+              for ($e === 0 && (tt = 138, _e = 3), j[(O + 1) * 2 + 1] = 65535, J = 0; J <= O; J++)
+                ie = $e, $e = j[(J + 1) * 2 + 1], !(++Ee < tt && ie === $e) && (Ee < _e ? C.bl_tree[ie * 2] += Ee : ie !== 0 ? (ie !== se && C.bl_tree[ie * 2]++, C.bl_tree[E * 2]++) : Ee <= 10 ? C.bl_tree[w * 2]++ : C.bl_tree[k * 2]++, Ee = 0, se = ie, $e === 0 ? (tt = 138, _e = 3) : ie === $e ? (tt = 6, _e = 3) : (tt = 7, _e = 4));
+            }, Ne = (C, j, O) => {
+              let J, se = -1, ie, $e = j[0 * 2 + 1], Ee = 0, tt = 7, _e = 4;
+              for ($e === 0 && (tt = 138, _e = 3), J = 0; J <= O; J++)
+                if (ie = $e, $e = j[(J + 1) * 2 + 1], !(++Ee < tt && ie === $e)) {
                   if (Ee < _e)
                     do
                       he(C, ie, C.bl_tree);
                     while (--Ee !== 0);
                   else ie !== 0 ? (ie !== se && (he(C, ie, C.bl_tree), Ee--), he(C, E, C.bl_tree), oe(C, Ee - 3, 2)) : Ee <= 10 ? (he(C, w, C.bl_tree), oe(C, Ee - 3, 3)) : (he(C, k, C.bl_tree), oe(C, Ee - 11, 7));
-                  Ee = 0, se = ie, Le === 0 ? (tt = 138, _e = 3) : ie === Le ? (tt = 6, _e = 3) : (tt = 7, _e = 4);
+                  Ee = 0, se = ie, $e === 0 ? (tt = 138, _e = 3) : ie === $e ? (tt = 6, _e = 3) : (tt = 7, _e = 4);
                 }
             }, Re = (C) => {
               let j;
-              for (Ge(C, C.dyn_ltree, C.l_desc.max_code), Ge(C, C.dyn_dtree, C.d_desc.max_code), Pe(C, C.bl_desc), j = u - 1; j >= 3 && C.bl_tree[O[j] * 2 + 1] === 0; j--)
+              for (Ge(C, C.dyn_ltree, C.l_desc.max_code), Ge(C, C.dyn_dtree, C.d_desc.max_code), Pe(C, C.bl_desc), j = u - 1; j >= 3 && C.bl_tree[F[j] * 2 + 1] === 0; j--)
                 ;
               return C.opt_len += 3 * (j + 1) + 5 + 5 + 4, j;
-            }, De = (C, j, F, J) => {
+            }, De = (C, j, O, J) => {
               let se;
-              for (oe(C, j - 257, 5), oe(C, F - 1, 5), oe(C, J - 4, 4), se = 0; se < J; se++)
-                oe(C, C.bl_tree[O[se] * 2 + 1], 3);
-              Ne(C, C.dyn_ltree, j - 1), Ne(C, C.dyn_dtree, F - 1);
+              for (oe(C, j - 257, 5), oe(C, O - 1, 5), oe(C, J - 4, 4), se = 0; se < J; se++)
+                oe(C, C.bl_tree[F[se] * 2 + 1], 3);
+              Ne(C, C.dyn_ltree, j - 1), Ne(C, C.dyn_dtree, O - 1);
             }, je = (C) => {
-              let j = 4093624447, F;
-              for (F = 0; F <= 31; F++, j >>>= 1)
-                if (j & 1 && C.dyn_ltree[F * 2] !== 0)
+              let j = 4093624447, O;
+              for (O = 0; O <= 31; O++, j >>>= 1)
+                if (j & 1 && C.dyn_ltree[O * 2] !== 0)
                   return a;
               if (C.dyn_ltree[9 * 2] !== 0 || C.dyn_ltree[10 * 2] !== 0 || C.dyn_ltree[13 * 2] !== 0)
                 return s;
-              for (F = 32; F < M; F++)
-                if (C.dyn_ltree[F * 2] !== 0)
+              for (O = 32; O < M; O++)
+                if (C.dyn_ltree[O * 2] !== 0)
                   return s;
               return a;
             };
             let Xe = !1;
             const X = (C) => {
               Xe || (le(), Xe = !0), C.l_desc = new ee(C.dyn_ltree, H), C.d_desc = new ee(C.dyn_dtree, Q), C.bl_desc = new ee(C.bl_tree, te), C.bi_buf = 0, C.bi_valid = 0, ne(C);
-            }, q = (C, j, F, J) => {
-              oe(C, (d << 1) + (J ? 1 : 0), 3), Te(C), fe(C, F), fe(C, ~F), F && C.pending_buf.set(C.window.subarray(j, j + F), C.pending), C.pending += F;
+            }, q = (C, j, O, J) => {
+              oe(C, (d << 1) + (J ? 1 : 0), 3), Te(C), fe(C, O), fe(C, ~O), O && C.pending_buf.set(C.window.subarray(j, j + O), C.pending), C.pending += O;
             }, re = (C) => {
               oe(C, v << 1, 3), he(C, _, P), Se(C);
-            }, ye = (C, j, F, J) => {
-              let se, ie, Le = 0;
-              C.level > 0 ? (C.strm.data_type === h && (C.strm.data_type = je(C)), Pe(C, C.l_desc), Pe(C, C.d_desc), Le = Re(C), se = C.opt_len + 3 + 7 >>> 3, ie = C.static_len + 3 + 7 >>> 3, ie <= se && (se = ie)) : se = ie = F + 5, F + 4 <= se && j !== -1 ? q(C, j, F, J) : C.strategy === r || ie === se ? (oe(C, (v << 1) + (J ? 1 : 0), 3), Ue(C, P, U)) : (oe(C, (f << 1) + (J ? 1 : 0), 3), De(C, C.l_desc.max_code + 1, C.d_desc.max_code + 1, Le + 1), Ue(C, C.dyn_ltree, C.dyn_dtree)), ne(C), J && Te(C);
-            }, me = (C, j, F) => (C.pending_buf[C.sym_buf + C.sym_next++] = j, C.pending_buf[C.sym_buf + C.sym_next++] = j >> 8, C.pending_buf[C.sym_buf + C.sym_next++] = F, j === 0 ? C.dyn_ltree[F * 2]++ : (C.matches++, j--, C.dyn_ltree[(B[F] + M + 1) * 2]++, C.dyn_dtree[ce(j) * 2]++), C.sym_next === C.sym_end);
+            }, ye = (C, j, O, J) => {
+              let se, ie, $e = 0;
+              C.level > 0 ? (C.strm.data_type === h && (C.strm.data_type = je(C)), Pe(C, C.l_desc), Pe(C, C.d_desc), $e = Re(C), se = C.opt_len + 3 + 7 >>> 3, ie = C.static_len + 3 + 7 >>> 3, ie <= se && (se = ie)) : se = ie = O + 5, O + 4 <= se && j !== -1 ? q(C, j, O, J) : C.strategy === r || ie === se ? (oe(C, (v << 1) + (J ? 1 : 0), 3), Ue(C, P, U)) : (oe(C, (f << 1) + (J ? 1 : 0), 3), De(C, C.l_desc.max_code + 1, C.d_desc.max_code + 1, $e + 1), Ue(C, C.dyn_ltree, C.dyn_dtree)), ne(C), J && Te(C);
+            }, me = (C, j, O) => (C.pending_buf[C.sym_buf + C.sym_next++] = j, C.pending_buf[C.sym_buf + C.sym_next++] = j >> 8, C.pending_buf[C.sym_buf + C.sym_next++] = O, j === 0 ? C.dyn_ltree[O * 2]++ : (C.matches++, j--, C.dyn_ltree[(B[O] + M + 1) * 2]++, C.dyn_dtree[ce(j) * 2]++), C.sym_next === C.sym_end);
             var ze = X, ke = q, K = ye, ae = me, ge = re, xe = {
               _tr_init: ze,
               _tr_stored_block: ke,
               _tr_flush_block: K,
               _tr_tally: ae,
               _tr_align: ge
-            }, Ce = (C, j, F, J) => {
-              let se = C & 65535 | 0, ie = C >>> 16 & 65535 | 0, Le = 0;
-              for (; F !== 0; ) {
-                Le = F > 2e3 ? 2e3 : F, F -= Le;
+            }, Ce = (C, j, O, J) => {
+              let se = C & 65535 | 0, ie = C >>> 16 & 65535 | 0, $e = 0;
+              for (; O !== 0; ) {
+                $e = O > 2e3 ? 2e3 : O, O -= $e;
                 do
                   se = se + j[J++] | 0, ie = ie + se | 0;
-                while (--Le);
+                while (--$e);
                 se %= 65521, ie %= 65521;
               }
               return se | ie << 16 | 0;
             };
             const Z = () => {
               let C, j = [];
-              for (var F = 0; F < 256; F++) {
-                C = F;
+              for (var O = 0; O < 256; O++) {
+                C = O;
                 for (var J = 0; J < 8; J++)
                   C = C & 1 ? 3988292384 ^ C >>> 1 : C >>> 1;
-                j[F] = C;
+                j[O] = C;
               }
               return j;
-            }, Oe = new Uint32Array(Z());
-            var I = (C, j, F, J) => {
-              const se = Oe, ie = J + F;
+            }, Fe = new Uint32Array(Z());
+            var I = (C, j, O, J) => {
+              const se = Fe, ie = J + O;
               C ^= -1;
-              for (let Le = J; Le < ie; Le++)
-                C = C >>> 8 ^ se[(C ^ j[Le]) & 255];
+              for (let $e = J; $e < ie; $e++)
+                C = C >>> 8 ^ se[(C ^ j[$e]) & 255];
               return C ^ -1;
             }, we = {
               2: "need dictionary",
@@ -40859,7 +40875,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               Z_OK: at,
               Z_STREAM_END: Mt,
               Z_STREAM_ERROR: gt,
-              Z_DATA_ERROR: Lt,
+              Z_DATA_ERROR: $t,
               Z_BUF_ERROR: Pt,
               Z_DEFAULT_COMPRESSION: Et,
               Z_FILTERED: St,
@@ -40869,74 +40885,74 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               Z_DEFAULT_STRATEGY: be,
               Z_UNKNOWN: Ve,
               Z_DEFLATED: et
-            } = ve, _t = 9, kt = 15, Tt = 8, Ht = 256 + 1 + 29, Ot = 30, xr = 19, wr = 2 * Ht + 1, an = 15, ut = 3, Kt = 258, Gt = Kt + ut + 1, sn = 32, rr = 42, Fr = 57, Or = 69, zr = 73, Ir = 91, Rr = 103, Yt = 113, or = 666, Rt = 1, ir = 2, qt = 3, nr = 4, ln = 3, Qt = (C, j) => (C.msg = we[j], j), Yr = (C) => C * 2 - (C > 4 ? 9 : 0), Xt = (C) => {
+            } = ve, _t = 9, kt = 15, Tt = 8, Ht = 256 + 1 + 29, Ft = 30, xr = 19, wr = 2 * Ht + 1, an = 15, ut = 3, Kt = 258, Gt = Kt + ut + 1, sn = 32, rr = 42, Or = 57, Fr = 69, zr = 73, Ir = 91, Rr = 103, Yt = 113, or = 666, Rt = 1, ir = 2, qt = 3, nr = 4, ln = 3, Qt = (C, j) => (C.msg = we[j], j), Yr = (C) => C * 2 - (C > 4 ? 9 : 0), Xt = (C) => {
               let j = C.length;
               for (; --j >= 0; )
                 C[j] = 0;
             }, on = (C) => {
-              let j, F, J, se = C.w_size;
+              let j, O, J, se = C.w_size;
               j = C.hash_size, J = j;
               do
-                F = C.head[--J], C.head[J] = F >= se ? F - se : 0;
+                O = C.head[--J], C.head[J] = O >= se ? O - se : 0;
               while (--j);
               j = se, J = j;
               do
-                F = C.prev[--J], C.prev[J] = F >= se ? F - se : 0;
+                O = C.prev[--J], C.prev[J] = O >= se ? O - se : 0;
               while (--j);
             };
-            let Zt = (C, j, F) => (j << C.hash_shift ^ F) & C.hash_mask;
+            let Zt = (C, j, O) => (j << C.hash_shift ^ O) & C.hash_mask;
             const Bt = (C) => {
               const j = C.state;
-              let F = j.pending;
-              F > C.avail_out && (F = C.avail_out), F !== 0 && (C.output.set(j.pending_buf.subarray(j.pending_out, j.pending_out + F), C.next_out), C.next_out += F, j.pending_out += F, C.total_out += F, C.avail_out -= F, j.pending -= F, j.pending === 0 && (j.pending_out = 0));
+              let O = j.pending;
+              O > C.avail_out && (O = C.avail_out), O !== 0 && (C.output.set(j.pending_buf.subarray(j.pending_out, j.pending_out + O), C.next_out), C.next_out += O, j.pending_out += O, C.total_out += O, C.avail_out -= O, j.pending -= O, j.pending === 0 && (j.pending_out = 0));
             }, Nt = (C, j) => {
               Me(C, C.block_start >= 0 ? C.block_start : -1, C.strstart - C.block_start, j), C.block_start = C.strstart, Bt(C.strm);
             }, vt = (C, j) => {
               C.pending_buf[C.pending++] = j;
             }, cr = (C, j) => {
               C.pending_buf[C.pending++] = j >>> 8 & 255, C.pending_buf[C.pending++] = j & 255;
-            }, Pr = (C, j, F, J) => {
+            }, Pr = (C, j, O, J) => {
               let se = C.avail_in;
-              return se > J && (se = J), se === 0 ? 0 : (C.avail_in -= se, j.set(C.input.subarray(C.next_in, C.next_in + se), F), C.state.wrap === 1 ? C.adler = Ce(C.adler, j, se, F) : C.state.wrap === 2 && (C.adler = I(C.adler, j, se, F)), C.next_in += se, C.total_in += se, se);
+              return se > J && (se = J), se === 0 ? 0 : (C.avail_in -= se, j.set(C.input.subarray(C.next_in, C.next_in + se), O), C.state.wrap === 1 ? C.adler = Ce(C.adler, j, se, O) : C.state.wrap === 2 && (C.adler = I(C.adler, j, se, O)), C.next_in += se, C.total_in += se, se);
             }, qr = (C, j) => {
-              let F = C.max_chain_length, J = C.strstart, se, ie, Le = C.prev_length, Ee = C.nice_match;
-              const tt = C.strstart > C.w_size - Gt ? C.strstart - (C.w_size - Gt) : 0, _e = C.window, $e = C.w_mask, pt = C.prev, Je = C.strstart + Kt;
-              let He = _e[J + Le - 1], it = _e[J + Le];
-              C.prev_length >= C.good_match && (F >>= 2), Ee > C.lookahead && (Ee = C.lookahead);
+              let O = C.max_chain_length, J = C.strstart, se, ie, $e = C.prev_length, Ee = C.nice_match;
+              const tt = C.strstart > C.w_size - Gt ? C.strstart - (C.w_size - Gt) : 0, _e = C.window, Le = C.w_mask, pt = C.prev, Je = C.strstart + Kt;
+              let He = _e[J + $e - 1], it = _e[J + $e];
+              C.prev_length >= C.good_match && (O >>= 2), Ee > C.lookahead && (Ee = C.lookahead);
               do
-                if (se = j, !(_e[se + Le] !== it || _e[se + Le - 1] !== He || _e[se] !== _e[J] || _e[++se] !== _e[J + 1])) {
+                if (se = j, !(_e[se + $e] !== it || _e[se + $e - 1] !== He || _e[se] !== _e[J] || _e[++se] !== _e[J + 1])) {
                   J += 2, se++;
                   do
                     ;
                   while (_e[++J] === _e[++se] && _e[++J] === _e[++se] && _e[++J] === _e[++se] && _e[++J] === _e[++se] && _e[++J] === _e[++se] && _e[++J] === _e[++se] && _e[++J] === _e[++se] && _e[++J] === _e[++se] && J < Je);
-                  if (ie = Kt - (Je - J), J = Je - Kt, ie > Le) {
-                    if (C.match_start = j, Le = ie, ie >= Ee)
+                  if (ie = Kt - (Je - J), J = Je - Kt, ie > $e) {
+                    if (C.match_start = j, $e = ie, ie >= Ee)
                       break;
-                    He = _e[J + Le - 1], it = _e[J + Le];
+                    He = _e[J + $e - 1], it = _e[J + $e];
                   }
                 }
-              while ((j = pt[j & $e]) > tt && --F !== 0);
-              return Le <= C.lookahead ? Le : C.lookahead;
+              while ((j = pt[j & Le]) > tt && --O !== 0);
+              return $e <= C.lookahead ? $e : C.lookahead;
             }, ar = (C) => {
               const j = C.w_size;
-              let F, J, se;
+              let O, J, se;
               do {
                 if (J = C.window_size - C.lookahead - C.strstart, C.strstart >= j + (j - Gt) && (C.window.set(C.window.subarray(j, j + j - J), 0), C.match_start -= j, C.strstart -= j, C.block_start -= j, C.insert > C.strstart && (C.insert = C.strstart), on(C), J += j), C.strm.avail_in === 0)
                   break;
-                if (F = Pr(C.strm, C.window, C.strstart + C.lookahead, J), C.lookahead += F, C.lookahead + C.insert >= ut)
+                if (O = Pr(C.strm, C.window, C.strstart + C.lookahead, J), C.lookahead += O, C.lookahead + C.insert >= ut)
                   for (se = C.strstart - C.insert, C.ins_h = C.window[se], C.ins_h = Zt(C, C.ins_h, C.window[se + 1]); C.insert && (C.ins_h = Zt(C, C.ins_h, C.window[se + ut - 1]), C.prev[se & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = se, se++, C.insert--, !(C.lookahead + C.insert < ut)); )
                     ;
               } while (C.lookahead < Gt && C.strm.avail_in !== 0);
             }, Qr = (C, j) => {
-              let F = C.pending_buf_size - 5 > C.w_size ? C.w_size : C.pending_buf_size - 5, J, se, ie, Le = 0, Ee = C.strm.avail_in;
+              let O = C.pending_buf_size - 5 > C.w_size ? C.w_size : C.pending_buf_size - 5, J, se, ie, $e = 0, Ee = C.strm.avail_in;
               do {
-                if (J = 65535, ie = C.bi_valid + 42 >> 3, C.strm.avail_out < ie || (ie = C.strm.avail_out - ie, se = C.strstart - C.block_start, J > se + C.strm.avail_in && (J = se + C.strm.avail_in), J > ie && (J = ie), J < F && (J === 0 && j !== st || j === Ke || J !== se + C.strm.avail_in)))
+                if (J = 65535, ie = C.bi_valid + 42 >> 3, C.strm.avail_out < ie || (ie = C.strm.avail_out - ie, se = C.strstart - C.block_start, J > se + C.strm.avail_in && (J = se + C.strm.avail_in), J > ie && (J = ie), J < O && (J === 0 && j !== st || j === Ke || J !== se + C.strm.avail_in)))
                   break;
-                Le = j === st && J === se + C.strm.avail_in ? 1 : 0, de(C, 0, 0, Le), C.pending_buf[C.pending - 4] = J, C.pending_buf[C.pending - 3] = J >> 8, C.pending_buf[C.pending - 2] = ~J, C.pending_buf[C.pending - 1] = ~J >> 8, Bt(C.strm), se && (se > J && (se = J), C.strm.output.set(C.window.subarray(C.block_start, C.block_start + se), C.strm.next_out), C.strm.next_out += se, C.strm.avail_out -= se, C.strm.total_out += se, C.block_start += se, J -= se), J && (Pr(C.strm, C.strm.output, C.strm.next_out, J), C.strm.next_out += J, C.strm.avail_out -= J, C.strm.total_out += J);
-              } while (Le === 0);
-              return Ee -= C.strm.avail_in, Ee && (Ee >= C.w_size ? (C.matches = 2, C.window.set(C.strm.input.subarray(C.strm.next_in - C.w_size, C.strm.next_in), 0), C.strstart = C.w_size, C.insert = C.strstart) : (C.window_size - C.strstart <= Ee && (C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, C.insert > C.strstart && (C.insert = C.strstart)), C.window.set(C.strm.input.subarray(C.strm.next_in - Ee, C.strm.next_in), C.strstart), C.strstart += Ee, C.insert += Ee > C.w_size - C.insert ? C.w_size - C.insert : Ee), C.block_start = C.strstart), C.high_water < C.strstart && (C.high_water = C.strstart), Le ? nr : j !== Ke && j !== st && C.strm.avail_in === 0 && C.strstart === C.block_start ? ir : (ie = C.window_size - C.strstart, C.strm.avail_in > ie && C.block_start >= C.w_size && (C.block_start -= C.w_size, C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, ie += C.w_size, C.insert > C.strstart && (C.insert = C.strstart)), ie > C.strm.avail_in && (ie = C.strm.avail_in), ie && (Pr(C.strm, C.window, C.strstart, ie), C.strstart += ie, C.insert += ie > C.w_size - C.insert ? C.w_size - C.insert : ie), C.high_water < C.strstart && (C.high_water = C.strstart), ie = C.bi_valid + 42 >> 3, ie = C.pending_buf_size - ie > 65535 ? 65535 : C.pending_buf_size - ie, F = ie > C.w_size ? C.w_size : ie, se = C.strstart - C.block_start, (se >= F || (se || j === st) && j !== Ke && C.strm.avail_in === 0 && se <= ie) && (J = se > ie ? ie : se, Le = j === st && C.strm.avail_in === 0 && J === se ? 1 : 0, de(C, C.block_start, J, Le), C.block_start += J, Bt(C.strm)), Le ? qt : Rt);
+                $e = j === st && J === se + C.strm.avail_in ? 1 : 0, de(C, 0, 0, $e), C.pending_buf[C.pending - 4] = J, C.pending_buf[C.pending - 3] = J >> 8, C.pending_buf[C.pending - 2] = ~J, C.pending_buf[C.pending - 1] = ~J >> 8, Bt(C.strm), se && (se > J && (se = J), C.strm.output.set(C.window.subarray(C.block_start, C.block_start + se), C.strm.next_out), C.strm.next_out += se, C.strm.avail_out -= se, C.strm.total_out += se, C.block_start += se, J -= se), J && (Pr(C.strm, C.strm.output, C.strm.next_out, J), C.strm.next_out += J, C.strm.avail_out -= J, C.strm.total_out += J);
+              } while ($e === 0);
+              return Ee -= C.strm.avail_in, Ee && (Ee >= C.w_size ? (C.matches = 2, C.window.set(C.strm.input.subarray(C.strm.next_in - C.w_size, C.strm.next_in), 0), C.strstart = C.w_size, C.insert = C.strstart) : (C.window_size - C.strstart <= Ee && (C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, C.insert > C.strstart && (C.insert = C.strstart)), C.window.set(C.strm.input.subarray(C.strm.next_in - Ee, C.strm.next_in), C.strstart), C.strstart += Ee, C.insert += Ee > C.w_size - C.insert ? C.w_size - C.insert : Ee), C.block_start = C.strstart), C.high_water < C.strstart && (C.high_water = C.strstart), $e ? nr : j !== Ke && j !== st && C.strm.avail_in === 0 && C.strstart === C.block_start ? ir : (ie = C.window_size - C.strstart, C.strm.avail_in > ie && C.block_start >= C.w_size && (C.block_start -= C.w_size, C.strstart -= C.w_size, C.window.set(C.window.subarray(C.w_size, C.w_size + C.strstart), 0), C.matches < 2 && C.matches++, ie += C.w_size, C.insert > C.strstart && (C.insert = C.strstart)), ie > C.strm.avail_in && (ie = C.strm.avail_in), ie && (Pr(C.strm, C.window, C.strstart, ie), C.strstart += ie, C.insert += ie > C.w_size - C.insert ? C.w_size - C.insert : ie), C.high_water < C.strstart && (C.high_water = C.strstart), ie = C.bi_valid + 42 >> 3, ie = C.pending_buf_size - ie > 65535 ? 65535 : C.pending_buf_size - ie, O = ie > C.w_size ? C.w_size : ie, se = C.strstart - C.block_start, (se >= O || (se || j === st) && j !== Ke && C.strm.avail_in === 0 && se <= ie) && (J = se > ie ? ie : se, $e = j === st && C.strm.avail_in === 0 && J === se ? 1 : 0, de(C, C.block_start, J, $e), C.block_start += J, Bt(C.strm)), $e ? qt : Rt);
             }, Br = (C, j) => {
-              let F, J;
+              let O, J;
               for (; ; ) {
                 if (C.lookahead < Gt) {
                   if (ar(C), C.lookahead < Gt && j === Ke)
@@ -40944,11 +40960,11 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                   if (C.lookahead === 0)
                     break;
                 }
-                if (F = 0, C.lookahead >= ut && (C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), F !== 0 && C.strstart - F <= C.w_size - Gt && (C.match_length = qr(C, F)), C.match_length >= ut)
+                if (O = 0, C.lookahead >= ut && (C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), O = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), O !== 0 && C.strstart - O <= C.w_size - Gt && (C.match_length = qr(C, O)), C.match_length >= ut)
                   if (J = Ye(C, C.strstart - C.match_start, C.match_length - ut), C.lookahead -= C.match_length, C.match_length <= C.max_lazy_match && C.lookahead >= ut) {
                     C.match_length--;
                     do
-                      C.strstart++, C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart;
+                      C.strstart++, C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), O = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart;
                     while (--C.match_length !== 0);
                     C.strstart++;
                   } else
@@ -40960,7 +40976,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               }
               return C.insert = C.strstart < ut - 1 ? C.strstart : ut - 1, j === st ? (Nt(C, !0), C.strm.avail_out === 0 ? qt : nr) : C.sym_next && (Nt(C, !1), C.strm.avail_out === 0) ? Rt : ir;
             }, sr = (C, j) => {
-              let F, J, se;
+              let O, J, se;
               for (; ; ) {
                 if (C.lookahead < Gt) {
                   if (ar(C), C.lookahead < Gt && j === Ke)
@@ -40968,10 +40984,10 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                   if (C.lookahead === 0)
                     break;
                 }
-                if (F = 0, C.lookahead >= ut && (C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), C.prev_length = C.match_length, C.prev_match = C.match_start, C.match_length = ut - 1, F !== 0 && C.prev_length < C.max_lazy_match && C.strstart - F <= C.w_size - Gt && (C.match_length = qr(C, F), C.match_length <= 5 && (C.strategy === St || C.match_length === ut && C.strstart - C.match_start > 4096) && (C.match_length = ut - 1)), C.prev_length >= ut && C.match_length <= C.prev_length) {
+                if (O = 0, C.lookahead >= ut && (C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), O = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart), C.prev_length = C.match_length, C.prev_match = C.match_start, C.match_length = ut - 1, O !== 0 && C.prev_length < C.max_lazy_match && C.strstart - O <= C.w_size - Gt && (C.match_length = qr(C, O), C.match_length <= 5 && (C.strategy === St || C.match_length === ut && C.strstart - C.match_start > 4096) && (C.match_length = ut - 1)), C.prev_length >= ut && C.match_length <= C.prev_length) {
                   se = C.strstart + C.lookahead - ut, J = Ye(C, C.strstart - 1 - C.prev_match, C.prev_length - ut), C.lookahead -= C.prev_length - 1, C.prev_length -= 2;
                   do
-                    ++C.strstart <= se && (C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), F = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart);
+                    ++C.strstart <= se && (C.ins_h = Zt(C, C.ins_h, C.window[C.strstart + ut - 1]), O = C.prev[C.strstart & C.w_mask] = C.head[C.ins_h], C.head[C.ins_h] = C.strstart);
                   while (--C.prev_length !== 0);
                   if (C.match_available = 0, C.match_length = ut - 1, C.strstart++, J && (Nt(C, !1), C.strm.avail_out === 0))
                     return Rt;
@@ -40983,8 +40999,8 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               }
               return C.match_available && (J = Ye(C, 0, C.window[C.strstart - 1]), C.match_available = 0), C.insert = C.strstart < ut - 1 ? C.strstart : ut - 1, j === st ? (Nt(C, !0), C.strm.avail_out === 0 ? qt : nr) : C.sym_next && (Nt(C, !1), C.strm.avail_out === 0) ? Rt : ir;
             }, hn = (C, j) => {
-              let F, J, se, ie;
-              const Le = C.window;
+              let O, J, se, ie;
+              const $e = C.window;
               for (; ; ) {
                 if (C.lookahead <= Kt) {
                   if (ar(C), C.lookahead <= Kt && j === Ke)
@@ -40992,32 +41008,32 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                   if (C.lookahead === 0)
                     break;
                 }
-                if (C.match_length = 0, C.lookahead >= ut && C.strstart > 0 && (se = C.strstart - 1, J = Le[se], J === Le[++se] && J === Le[++se] && J === Le[++se])) {
+                if (C.match_length = 0, C.lookahead >= ut && C.strstart > 0 && (se = C.strstart - 1, J = $e[se], J === $e[++se] && J === $e[++se] && J === $e[++se])) {
                   ie = C.strstart + Kt;
                   do
                     ;
-                  while (J === Le[++se] && J === Le[++se] && J === Le[++se] && J === Le[++se] && J === Le[++se] && J === Le[++se] && J === Le[++se] && J === Le[++se] && se < ie);
+                  while (J === $e[++se] && J === $e[++se] && J === $e[++se] && J === $e[++se] && J === $e[++se] && J === $e[++se] && J === $e[++se] && J === $e[++se] && se < ie);
                   C.match_length = Kt - (ie - se), C.match_length > C.lookahead && (C.match_length = C.lookahead);
                 }
-                if (C.match_length >= ut ? (F = Ye(C, 1, C.match_length - ut), C.lookahead -= C.match_length, C.strstart += C.match_length, C.match_length = 0) : (F = Ye(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++), F && (Nt(C, !1), C.strm.avail_out === 0))
+                if (C.match_length >= ut ? (O = Ye(C, 1, C.match_length - ut), C.lookahead -= C.match_length, C.strstart += C.match_length, C.match_length = 0) : (O = Ye(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++), O && (Nt(C, !1), C.strm.avail_out === 0))
                   return Rt;
               }
               return C.insert = 0, j === st ? (Nt(C, !0), C.strm.avail_out === 0 ? qt : nr) : C.sym_next && (Nt(C, !1), C.strm.avail_out === 0) ? Rt : ir;
             }, cn = (C, j) => {
-              let F;
+              let O;
               for (; ; ) {
                 if (C.lookahead === 0 && (ar(C), C.lookahead === 0)) {
                   if (j === Ke)
                     return Rt;
                   break;
                 }
-                if (C.match_length = 0, F = Ye(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++, F && (Nt(C, !1), C.strm.avail_out === 0))
+                if (C.match_length = 0, O = Ye(C, 0, C.window[C.strstart]), C.lookahead--, C.strstart++, O && (Nt(C, !1), C.strm.avail_out === 0))
                   return Rt;
               }
               return C.insert = 0, j === st ? (Nt(C, !0), C.strm.avail_out === 0 ? qt : nr) : C.sym_next && (Nt(C, !1), C.strm.avail_out === 0) ? Rt : ir;
             };
-            function Wt(C, j, F, J, se) {
-              this.good_length = C, this.max_lazy = j, this.nice_length = F, this.max_chain = J, this.func = se;
+            function Wt(C, j, O, J, se) {
+              this.good_length = C, this.max_lazy = j, this.nice_length = O, this.max_chain = J, this.func = se;
             }
             const ur = [
               /*      good lazy nice chain */
@@ -41045,152 +41061,152 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               C.window_size = 2 * C.w_size, Xt(C.head), C.max_lazy_match = ur[C.level].max_lazy, C.good_match = ur[C.level].good_length, C.nice_match = ur[C.level].nice_length, C.max_chain_length = ur[C.level].max_chain, C.strstart = 0, C.block_start = 0, C.lookahead = 0, C.insert = 0, C.match_length = C.prev_length = ut - 1, C.match_available = 0, C.ins_h = 0;
             };
             function dn() {
-              this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = et, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new Uint16Array(wr * 2), this.dyn_dtree = new Uint16Array((2 * Ot + 1) * 2), this.bl_tree = new Uint16Array((2 * xr + 1) * 2), Xt(this.dyn_ltree), Xt(this.dyn_dtree), Xt(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new Uint16Array(an + 1), this.heap = new Uint16Array(2 * Ht + 1), Xt(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new Uint16Array(2 * Ht + 1), Xt(this.depth), this.sym_buf = 0, this.lit_bufsize = 0, this.sym_next = 0, this.sym_end = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0;
+              this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = et, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new Uint16Array(wr * 2), this.dyn_dtree = new Uint16Array((2 * Ft + 1) * 2), this.bl_tree = new Uint16Array((2 * xr + 1) * 2), Xt(this.dyn_ltree), Xt(this.dyn_dtree), Xt(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new Uint16Array(an + 1), this.heap = new Uint16Array(2 * Ht + 1), Xt(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new Uint16Array(2 * Ht + 1), Xt(this.depth), this.sym_buf = 0, this.lit_bufsize = 0, this.sym_next = 0, this.sym_end = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0;
             }
             const dr = (C) => {
               if (!C)
                 return 1;
               const j = C.state;
               return !j || j.strm !== C || j.status !== rr && //#ifdef GZIP
-              j.status !== Fr && //#endif
-              j.status !== Or && j.status !== zr && j.status !== Ir && j.status !== Rr && j.status !== Yt && j.status !== or ? 1 : 0;
+              j.status !== Or && //#endif
+              j.status !== Fr && j.status !== zr && j.status !== Ir && j.status !== Rr && j.status !== Yt && j.status !== or ? 1 : 0;
             }, Jr = (C) => {
               if (dr(C))
                 return Qt(C, gt);
               C.total_in = C.total_out = 0, C.data_type = Ve;
               const j = C.state;
               return j.pending = 0, j.pending_out = 0, j.wrap < 0 && (j.wrap = -j.wrap), j.status = //#ifdef GZIP
-              j.wrap === 2 ? Fr : (
+              j.wrap === 2 ? Or : (
                 //#endif
                 j.wrap ? rr : Yt
               ), C.adler = j.wrap === 2 ? 0 : 1, j.last_flush = -2, Y(j), at;
             }, ei = (C) => {
               const j = Jr(C);
               return j === at && un(C.state), j;
-            }, fn = (C, j) => dr(C) || C.state.wrap !== 2 ? gt : (C.state.gzhead = j, at), ti = (C, j, F, J, se, ie) => {
+            }, fn = (C, j) => dr(C) || C.state.wrap !== 2 ? gt : (C.state.gzhead = j, at), ti = (C, j, O, J, se, ie) => {
               if (!C)
                 return gt;
-              let Le = 1;
-              if (j === Et && (j = 6), J < 0 ? (Le = 0, J = -J) : J > 15 && (Le = 2, J -= 16), se < 1 || se > _t || F !== et || J < 8 || J > 15 || j < 0 || j > 9 || ie < 0 || ie > qe || J === 8 && Le !== 1)
+              let $e = 1;
+              if (j === Et && (j = 6), J < 0 ? ($e = 0, J = -J) : J > 15 && ($e = 2, J -= 16), se < 1 || se > _t || O !== et || J < 8 || J > 15 || j < 0 || j > 9 || ie < 0 || ie > qe || J === 8 && $e !== 1)
                 return Qt(C, gt);
               J === 8 && (J = 9);
               const Ee = new dn();
-              return C.state = Ee, Ee.strm = C, Ee.status = rr, Ee.wrap = Le, Ee.gzhead = null, Ee.w_bits = J, Ee.w_size = 1 << Ee.w_bits, Ee.w_mask = Ee.w_size - 1, Ee.hash_bits = se + 7, Ee.hash_size = 1 << Ee.hash_bits, Ee.hash_mask = Ee.hash_size - 1, Ee.hash_shift = ~~((Ee.hash_bits + ut - 1) / ut), Ee.window = new Uint8Array(Ee.w_size * 2), Ee.head = new Uint16Array(Ee.hash_size), Ee.prev = new Uint16Array(Ee.w_size), Ee.lit_bufsize = 1 << se + 6, Ee.pending_buf_size = Ee.lit_bufsize * 4, Ee.pending_buf = new Uint8Array(Ee.pending_buf_size), Ee.sym_buf = Ee.lit_bufsize, Ee.sym_end = (Ee.lit_bufsize - 1) * 3, Ee.level = j, Ee.strategy = ie, Ee.method = F, ei(C);
+              return C.state = Ee, Ee.strm = C, Ee.status = rr, Ee.wrap = $e, Ee.gzhead = null, Ee.w_bits = J, Ee.w_size = 1 << Ee.w_bits, Ee.w_mask = Ee.w_size - 1, Ee.hash_bits = se + 7, Ee.hash_size = 1 << Ee.hash_bits, Ee.hash_mask = Ee.hash_size - 1, Ee.hash_shift = ~~((Ee.hash_bits + ut - 1) / ut), Ee.window = new Uint8Array(Ee.w_size * 2), Ee.head = new Uint16Array(Ee.hash_size), Ee.prev = new Uint16Array(Ee.w_size), Ee.lit_bufsize = 1 << se + 6, Ee.pending_buf_size = Ee.lit_bufsize * 4, Ee.pending_buf = new Uint8Array(Ee.pending_buf_size), Ee.sym_buf = Ee.lit_bufsize, Ee.sym_end = (Ee.lit_bufsize - 1) * 3, Ee.level = j, Ee.strategy = ie, Ee.method = O, ei(C);
             }, mn = (C, j) => ti(C, j, et, kt, Tt, be), pn = (C, j) => {
               if (dr(C) || j > ot || j < 0)
                 return C ? Qt(C, gt) : gt;
-              const F = C.state;
-              if (!C.output || C.avail_in !== 0 && !C.input || F.status === or && j !== st)
+              const O = C.state;
+              if (!C.output || C.avail_in !== 0 && !C.input || O.status === or && j !== st)
                 return Qt(C, C.avail_out === 0 ? Pt : gt);
-              const J = F.last_flush;
-              if (F.last_flush = j, F.pending !== 0) {
+              const J = O.last_flush;
+              if (O.last_flush = j, O.pending !== 0) {
                 if (Bt(C), C.avail_out === 0)
-                  return F.last_flush = -1, at;
+                  return O.last_flush = -1, at;
               } else if (C.avail_in === 0 && Yr(j) <= Yr(J) && j !== st)
                 return Qt(C, Pt);
-              if (F.status === or && C.avail_in !== 0)
+              if (O.status === or && C.avail_in !== 0)
                 return Qt(C, Pt);
-              if (F.status === rr && F.wrap === 0 && (F.status = Yt), F.status === rr) {
-                let se = et + (F.w_bits - 8 << 4) << 8, ie = -1;
-                if (F.strategy >= yt || F.level < 2 ? ie = 0 : F.level < 6 ? ie = 1 : F.level === 6 ? ie = 2 : ie = 3, se |= ie << 6, F.strstart !== 0 && (se |= sn), se += 31 - se % 31, cr(F, se), F.strstart !== 0 && (cr(F, C.adler >>> 16), cr(F, C.adler & 65535)), C.adler = 1, F.status = Yt, Bt(C), F.pending !== 0)
-                  return F.last_flush = -1, at;
+              if (O.status === rr && O.wrap === 0 && (O.status = Yt), O.status === rr) {
+                let se = et + (O.w_bits - 8 << 4) << 8, ie = -1;
+                if (O.strategy >= yt || O.level < 2 ? ie = 0 : O.level < 6 ? ie = 1 : O.level === 6 ? ie = 2 : ie = 3, se |= ie << 6, O.strstart !== 0 && (se |= sn), se += 31 - se % 31, cr(O, se), O.strstart !== 0 && (cr(O, C.adler >>> 16), cr(O, C.adler & 65535)), C.adler = 1, O.status = Yt, Bt(C), O.pending !== 0)
+                  return O.last_flush = -1, at;
               }
-              if (F.status === Fr) {
-                if (C.adler = 0, vt(F, 31), vt(F, 139), vt(F, 8), F.gzhead)
+              if (O.status === Or) {
+                if (C.adler = 0, vt(O, 31), vt(O, 139), vt(O, 8), O.gzhead)
                   vt(
-                    F,
-                    (F.gzhead.text ? 1 : 0) + (F.gzhead.hcrc ? 2 : 0) + (F.gzhead.extra ? 4 : 0) + (F.gzhead.name ? 8 : 0) + (F.gzhead.comment ? 16 : 0)
-                  ), vt(F, F.gzhead.time & 255), vt(F, F.gzhead.time >> 8 & 255), vt(F, F.gzhead.time >> 16 & 255), vt(F, F.gzhead.time >> 24 & 255), vt(F, F.level === 9 ? 2 : F.strategy >= yt || F.level < 2 ? 4 : 0), vt(F, F.gzhead.os & 255), F.gzhead.extra && F.gzhead.extra.length && (vt(F, F.gzhead.extra.length & 255), vt(F, F.gzhead.extra.length >> 8 & 255)), F.gzhead.hcrc && (C.adler = I(C.adler, F.pending_buf, F.pending, 0)), F.gzindex = 0, F.status = Or;
-                else if (vt(F, 0), vt(F, 0), vt(F, 0), vt(F, 0), vt(F, 0), vt(F, F.level === 9 ? 2 : F.strategy >= yt || F.level < 2 ? 4 : 0), vt(F, ln), F.status = Yt, Bt(C), F.pending !== 0)
-                  return F.last_flush = -1, at;
-              }
-              if (F.status === Or) {
-                if (F.gzhead.extra) {
-                  let se = F.pending, ie = (F.gzhead.extra.length & 65535) - F.gzindex;
-                  for (; F.pending + ie > F.pending_buf_size; ) {
-                    let Ee = F.pending_buf_size - F.pending;
-                    if (F.pending_buf.set(F.gzhead.extra.subarray(F.gzindex, F.gzindex + Ee), F.pending), F.pending = F.pending_buf_size, F.gzhead.hcrc && F.pending > se && (C.adler = I(C.adler, F.pending_buf, F.pending - se, se)), F.gzindex += Ee, Bt(C), F.pending !== 0)
-                      return F.last_flush = -1, at;
+                    O,
+                    (O.gzhead.text ? 1 : 0) + (O.gzhead.hcrc ? 2 : 0) + (O.gzhead.extra ? 4 : 0) + (O.gzhead.name ? 8 : 0) + (O.gzhead.comment ? 16 : 0)
+                  ), vt(O, O.gzhead.time & 255), vt(O, O.gzhead.time >> 8 & 255), vt(O, O.gzhead.time >> 16 & 255), vt(O, O.gzhead.time >> 24 & 255), vt(O, O.level === 9 ? 2 : O.strategy >= yt || O.level < 2 ? 4 : 0), vt(O, O.gzhead.os & 255), O.gzhead.extra && O.gzhead.extra.length && (vt(O, O.gzhead.extra.length & 255), vt(O, O.gzhead.extra.length >> 8 & 255)), O.gzhead.hcrc && (C.adler = I(C.adler, O.pending_buf, O.pending, 0)), O.gzindex = 0, O.status = Fr;
+                else if (vt(O, 0), vt(O, 0), vt(O, 0), vt(O, 0), vt(O, 0), vt(O, O.level === 9 ? 2 : O.strategy >= yt || O.level < 2 ? 4 : 0), vt(O, ln), O.status = Yt, Bt(C), O.pending !== 0)
+                  return O.last_flush = -1, at;
+              }
+              if (O.status === Fr) {
+                if (O.gzhead.extra) {
+                  let se = O.pending, ie = (O.gzhead.extra.length & 65535) - O.gzindex;
+                  for (; O.pending + ie > O.pending_buf_size; ) {
+                    let Ee = O.pending_buf_size - O.pending;
+                    if (O.pending_buf.set(O.gzhead.extra.subarray(O.gzindex, O.gzindex + Ee), O.pending), O.pending = O.pending_buf_size, O.gzhead.hcrc && O.pending > se && (C.adler = I(C.adler, O.pending_buf, O.pending - se, se)), O.gzindex += Ee, Bt(C), O.pending !== 0)
+                      return O.last_flush = -1, at;
                     se = 0, ie -= Ee;
                   }
-                  let Le = new Uint8Array(F.gzhead.extra);
-                  F.pending_buf.set(Le.subarray(F.gzindex, F.gzindex + ie), F.pending), F.pending += ie, F.gzhead.hcrc && F.pending > se && (C.adler = I(C.adler, F.pending_buf, F.pending - se, se)), F.gzindex = 0;
+                  let $e = new Uint8Array(O.gzhead.extra);
+                  O.pending_buf.set($e.subarray(O.gzindex, O.gzindex + ie), O.pending), O.pending += ie, O.gzhead.hcrc && O.pending > se && (C.adler = I(C.adler, O.pending_buf, O.pending - se, se)), O.gzindex = 0;
                 }
-                F.status = zr;
+                O.status = zr;
               }
-              if (F.status === zr) {
-                if (F.gzhead.name) {
-                  let se = F.pending, ie;
+              if (O.status === zr) {
+                if (O.gzhead.name) {
+                  let se = O.pending, ie;
                   do {
-                    if (F.pending === F.pending_buf_size) {
-                      if (F.gzhead.hcrc && F.pending > se && (C.adler = I(C.adler, F.pending_buf, F.pending - se, se)), Bt(C), F.pending !== 0)
-                        return F.last_flush = -1, at;
+                    if (O.pending === O.pending_buf_size) {
+                      if (O.gzhead.hcrc && O.pending > se && (C.adler = I(C.adler, O.pending_buf, O.pending - se, se)), Bt(C), O.pending !== 0)
+                        return O.last_flush = -1, at;
                       se = 0;
                     }
-                    F.gzindex < F.gzhead.name.length ? ie = F.gzhead.name.charCodeAt(F.gzindex++) & 255 : ie = 0, vt(F, ie);
+                    O.gzindex < O.gzhead.name.length ? ie = O.gzhead.name.charCodeAt(O.gzindex++) & 255 : ie = 0, vt(O, ie);
                   } while (ie !== 0);
-                  F.gzhead.hcrc && F.pending > se && (C.adler = I(C.adler, F.pending_buf, F.pending - se, se)), F.gzindex = 0;
+                  O.gzhead.hcrc && O.pending > se && (C.adler = I(C.adler, O.pending_buf, O.pending - se, se)), O.gzindex = 0;
                 }
-                F.status = Ir;
+                O.status = Ir;
               }
-              if (F.status === Ir) {
-                if (F.gzhead.comment) {
-                  let se = F.pending, ie;
+              if (O.status === Ir) {
+                if (O.gzhead.comment) {
+                  let se = O.pending, ie;
                   do {
-                    if (F.pending === F.pending_buf_size) {
-                      if (F.gzhead.hcrc && F.pending > se && (C.adler = I(C.adler, F.pending_buf, F.pending - se, se)), Bt(C), F.pending !== 0)
-                        return F.last_flush = -1, at;
+                    if (O.pending === O.pending_buf_size) {
+                      if (O.gzhead.hcrc && O.pending > se && (C.adler = I(C.adler, O.pending_buf, O.pending - se, se)), Bt(C), O.pending !== 0)
+                        return O.last_flush = -1, at;
                       se = 0;
                     }
-                    F.gzindex < F.gzhead.comment.length ? ie = F.gzhead.comment.charCodeAt(F.gzindex++) & 255 : ie = 0, vt(F, ie);
+                    O.gzindex < O.gzhead.comment.length ? ie = O.gzhead.comment.charCodeAt(O.gzindex++) & 255 : ie = 0, vt(O, ie);
                   } while (ie !== 0);
-                  F.gzhead.hcrc && F.pending > se && (C.adler = I(C.adler, F.pending_buf, F.pending - se, se));
+                  O.gzhead.hcrc && O.pending > se && (C.adler = I(C.adler, O.pending_buf, O.pending - se, se));
                 }
-                F.status = Rr;
+                O.status = Rr;
               }
-              if (F.status === Rr) {
-                if (F.gzhead.hcrc) {
-                  if (F.pending + 2 > F.pending_buf_size && (Bt(C), F.pending !== 0))
-                    return F.last_flush = -1, at;
-                  vt(F, C.adler & 255), vt(F, C.adler >> 8 & 255), C.adler = 0;
+              if (O.status === Rr) {
+                if (O.gzhead.hcrc) {
+                  if (O.pending + 2 > O.pending_buf_size && (Bt(C), O.pending !== 0))
+                    return O.last_flush = -1, at;
+                  vt(O, C.adler & 255), vt(O, C.adler >> 8 & 255), C.adler = 0;
                 }
-                if (F.status = Yt, Bt(C), F.pending !== 0)
-                  return F.last_flush = -1, at;
+                if (O.status = Yt, Bt(C), O.pending !== 0)
+                  return O.last_flush = -1, at;
               }
-              if (C.avail_in !== 0 || F.lookahead !== 0 || j !== Ke && F.status !== or) {
-                let se = F.level === 0 ? Qr(F, j) : F.strategy === yt ? cn(F, j) : F.strategy === zt ? hn(F, j) : ur[F.level].func(F, j);
-                if ((se === qt || se === nr) && (F.status = or), se === Rt || se === qt)
-                  return C.avail_out === 0 && (F.last_flush = -1), at;
-                if (se === ir && (j === rt ? Ze(F) : j !== ot && (de(F, 0, 0, !1), j === wt && (Xt(F.head), F.lookahead === 0 && (F.strstart = 0, F.block_start = 0, F.insert = 0))), Bt(C), C.avail_out === 0))
-                  return F.last_flush = -1, at;
+              if (C.avail_in !== 0 || O.lookahead !== 0 || j !== Ke && O.status !== or) {
+                let se = O.level === 0 ? Qr(O, j) : O.strategy === yt ? cn(O, j) : O.strategy === zt ? hn(O, j) : ur[O.level].func(O, j);
+                if ((se === qt || se === nr) && (O.status = or), se === Rt || se === qt)
+                  return C.avail_out === 0 && (O.last_flush = -1), at;
+                if (se === ir && (j === rt ? Ze(O) : j !== ot && (de(O, 0, 0, !1), j === wt && (Xt(O.head), O.lookahead === 0 && (O.strstart = 0, O.block_start = 0, O.insert = 0))), Bt(C), C.avail_out === 0))
+                  return O.last_flush = -1, at;
               }
-              return j !== st ? at : F.wrap <= 0 ? Mt : (F.wrap === 2 ? (vt(F, C.adler & 255), vt(F, C.adler >> 8 & 255), vt(F, C.adler >> 16 & 255), vt(F, C.adler >> 24 & 255), vt(F, C.total_in & 255), vt(F, C.total_in >> 8 & 255), vt(F, C.total_in >> 16 & 255), vt(F, C.total_in >> 24 & 255)) : (cr(F, C.adler >>> 16), cr(F, C.adler & 65535)), Bt(C), F.wrap > 0 && (F.wrap = -F.wrap), F.pending !== 0 ? at : Mt);
+              return j !== st ? at : O.wrap <= 0 ? Mt : (O.wrap === 2 ? (vt(O, C.adler & 255), vt(O, C.adler >> 8 & 255), vt(O, C.adler >> 16 & 255), vt(O, C.adler >> 24 & 255), vt(O, C.total_in & 255), vt(O, C.total_in >> 8 & 255), vt(O, C.total_in >> 16 & 255), vt(O, C.total_in >> 24 & 255)) : (cr(O, C.adler >>> 16), cr(O, C.adler & 65535)), Bt(C), O.wrap > 0 && (O.wrap = -O.wrap), O.pending !== 0 ? at : Mt);
             }, gn = (C) => {
               if (dr(C))
                 return gt;
               const j = C.state.status;
-              return C.state = null, j === Yt ? Qt(C, Lt) : at;
+              return C.state = null, j === Yt ? Qt(C, $t) : at;
             }, _n = (C, j) => {
-              let F = j.length;
+              let O = j.length;
               if (dr(C))
                 return gt;
               const J = C.state, se = J.wrap;
               if (se === 2 || se === 1 && J.status !== rr || J.lookahead)
                 return gt;
-              if (se === 1 && (C.adler = Ce(C.adler, j, F, 0)), J.wrap = 0, F >= J.w_size) {
+              if (se === 1 && (C.adler = Ce(C.adler, j, O, 0)), J.wrap = 0, O >= J.w_size) {
                 se === 0 && (Xt(J.head), J.strstart = 0, J.block_start = 0, J.insert = 0);
                 let tt = new Uint8Array(J.w_size);
-                tt.set(j.subarray(F - J.w_size, F), 0), j = tt, F = J.w_size;
+                tt.set(j.subarray(O - J.w_size, O), 0), j = tt, O = J.w_size;
               }
-              const ie = C.avail_in, Le = C.next_in, Ee = C.input;
-              for (C.avail_in = F, C.next_in = 0, C.input = j, ar(J); J.lookahead >= ut; ) {
+              const ie = C.avail_in, $e = C.next_in, Ee = C.input;
+              for (C.avail_in = O, C.next_in = 0, C.input = j, ar(J); J.lookahead >= ut; ) {
                 let tt = J.strstart, _e = J.lookahead - (ut - 1);
                 do
                   J.ins_h = Zt(J, J.ins_h, J.window[tt + ut - 1]), J.prev[tt & J.w_mask] = J.head[J.ins_h], J.head[J.ins_h] = tt, tt++;
                 while (--_e);
                 J.strstart = tt, J.lookahead = ut - 1, ar(J);
               }
-              return J.strstart += J.lookahead, J.block_start = J.strstart, J.insert = J.lookahead, J.lookahead = 0, J.match_length = J.prev_length = ut - 1, J.match_available = 0, C.next_in = Le, C.input = Ee, C.avail_in = ie, J.wrap = se, at;
+              return J.strstart += J.lookahead, J.block_start = J.strstart, J.insert = J.lookahead, J.lookahead = 0, J.match_length = J.prev_length = ut - 1, J.match_available = 0, C.next_in = $e, C.input = Ee, C.avail_in = ie, J.wrap = se, at;
             };
             var vn = mn, bn = ti, yn = ei, xn = Jr, wn = fn, En = pn, Sn = gn, An = _n, Mn = "pako deflate (from Nodeca project)", fr = {
               deflateInit: vn,
@@ -41207,12 +41223,12 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
             var Cn = function(C) {
               const j = Array.prototype.slice.call(arguments, 1);
               for (; j.length; ) {
-                const F = j.shift();
-                if (F) {
-                  if (typeof F != "object")
-                    throw new TypeError(F + "must be non-object");
-                  for (const J in F)
-                    Dn(F, J) && (C[J] = F[J]);
+                const O = j.shift();
+                if (O) {
+                  if (typeof O != "object")
+                    throw new TypeError(O + "must be non-object");
+                  for (const J in O)
+                    Dn(O, J) && (C[J] = O[J]);
                 }
               }
               return C;
@@ -41220,12 +41236,12 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               let j = 0;
               for (let J = 0, se = C.length; J < se; J++)
                 j += C[J].length;
-              const F = new Uint8Array(j);
+              const O = new Uint8Array(j);
               for (let J = 0, se = 0, ie = C.length; J < ie; J++) {
-                let Le = C[J];
-                F.set(Le, se), se += Le.length;
+                let $e = C[J];
+                O.set($e, se), se += $e.length;
               }
-              return F;
+              return O;
             }, Er = {
               assign: Cn,
               flattenChunks: Tn
@@ -41243,62 +41259,62 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
             var kn = (C) => {
               if (typeof TextEncoder == "function" && TextEncoder.prototype.encode)
                 return new TextEncoder().encode(C);
-              let j, F, J, se, ie, Le = C.length, Ee = 0;
-              for (se = 0; se < Le; se++)
-                F = C.charCodeAt(se), (F & 64512) === 55296 && se + 1 < Le && (J = C.charCodeAt(se + 1), (J & 64512) === 56320 && (F = 65536 + (F - 55296 << 10) + (J - 56320), se++)), Ee += F < 128 ? 1 : F < 2048 ? 2 : F < 65536 ? 3 : 4;
+              let j, O, J, se, ie, $e = C.length, Ee = 0;
+              for (se = 0; se < $e; se++)
+                O = C.charCodeAt(se), (O & 64512) === 55296 && se + 1 < $e && (J = C.charCodeAt(se + 1), (J & 64512) === 56320 && (O = 65536 + (O - 55296 << 10) + (J - 56320), se++)), Ee += O < 128 ? 1 : O < 2048 ? 2 : O < 65536 ? 3 : 4;
               for (j = new Uint8Array(Ee), ie = 0, se = 0; ie < Ee; se++)
-                F = C.charCodeAt(se), (F & 64512) === 55296 && se + 1 < Le && (J = C.charCodeAt(se + 1), (J & 64512) === 56320 && (F = 65536 + (F - 55296 << 10) + (J - 56320), se++)), F < 128 ? j[ie++] = F : F < 2048 ? (j[ie++] = 192 | F >>> 6, j[ie++] = 128 | F & 63) : F < 65536 ? (j[ie++] = 224 | F >>> 12, j[ie++] = 128 | F >>> 6 & 63, j[ie++] = 128 | F & 63) : (j[ie++] = 240 | F >>> 18, j[ie++] = 128 | F >>> 12 & 63, j[ie++] = 128 | F >>> 6 & 63, j[ie++] = 128 | F & 63);
+                O = C.charCodeAt(se), (O & 64512) === 55296 && se + 1 < $e && (J = C.charCodeAt(se + 1), (J & 64512) === 56320 && (O = 65536 + (O - 55296 << 10) + (J - 56320), se++)), O < 128 ? j[ie++] = O : O < 2048 ? (j[ie++] = 192 | O >>> 6, j[ie++] = 128 | O & 63) : O < 65536 ? (j[ie++] = 224 | O >>> 12, j[ie++] = 128 | O >>> 6 & 63, j[ie++] = 128 | O & 63) : (j[ie++] = 240 | O >>> 18, j[ie++] = 128 | O >>> 12 & 63, j[ie++] = 128 | O >>> 6 & 63, j[ie++] = 128 | O & 63);
               return j;
             };
-            const Ln = (C, j) => {
+            const $n = (C, j) => {
               if (j < 65534 && C.subarray && ri)
                 return String.fromCharCode.apply(null, C.length === j ? C : C.subarray(0, j));
-              let F = "";
+              let O = "";
               for (let J = 0; J < j; J++)
-                F += String.fromCharCode(C[J]);
-              return F;
+                O += String.fromCharCode(C[J]);
+              return O;
             };
-            var $n = (C, j) => {
-              const F = j || C.length;
+            var Ln = (C, j) => {
+              const O = j || C.length;
               if (typeof TextDecoder == "function" && TextDecoder.prototype.decode)
                 return new TextDecoder().decode(C.subarray(0, j));
               let J, se;
-              const ie = new Array(F * 2);
-              for (se = 0, J = 0; J < F; ) {
-                let Le = C[J++];
-                if (Le < 128) {
-                  ie[se++] = Le;
+              const ie = new Array(O * 2);
+              for (se = 0, J = 0; J < O; ) {
+                let $e = C[J++];
+                if ($e < 128) {
+                  ie[se++] = $e;
                   continue;
                 }
-                let Ee = mr[Le];
+                let Ee = mr[$e];
                 if (Ee > 4) {
                   ie[se++] = 65533, J += Ee - 1;
                   continue;
                 }
-                for (Le &= Ee === 2 ? 31 : Ee === 3 ? 15 : 7; Ee > 1 && J < F; )
-                  Le = Le << 6 | C[J++] & 63, Ee--;
+                for ($e &= Ee === 2 ? 31 : Ee === 3 ? 15 : 7; Ee > 1 && J < O; )
+                  $e = $e << 6 | C[J++] & 63, Ee--;
                 if (Ee > 1) {
                   ie[se++] = 65533;
                   continue;
                 }
-                Le < 65536 ? ie[se++] = Le : (Le -= 65536, ie[se++] = 55296 | Le >> 10 & 1023, ie[se++] = 56320 | Le & 1023);
+                $e < 65536 ? ie[se++] = $e : ($e -= 65536, ie[se++] = 55296 | $e >> 10 & 1023, ie[se++] = 56320 | $e & 1023);
               }
-              return Ln(ie, se);
-            }, Fn = (C, j) => {
+              return $n(ie, se);
+            }, On = (C, j) => {
               j = j || C.length, j > C.length && (j = C.length);
-              let F = j - 1;
-              for (; F >= 0 && (C[F] & 192) === 128; )
-                F--;
-              return F < 0 || F === 0 ? j : F + mr[C[F]] > j ? F : j;
+              let O = j - 1;
+              for (; O >= 0 && (C[O] & 192) === 128; )
+                O--;
+              return O < 0 || O === 0 ? j : O + mr[C[O]] > j ? O : j;
             }, pr = {
               string2buf: kn,
-              buf2string: $n,
-              utf8border: Fn
+              buf2string: Ln,
+              utf8border: On
             };
-            function On() {
+            function Fn() {
               this.input = null, this.next_in = 0, this.avail_in = 0, this.total_in = 0, this.output = null, this.next_out = 0, this.avail_out = 0, this.total_out = 0, this.msg = "", this.state = null, this.data_type = 2, this.adler = 0;
             }
-            var ii = On;
+            var ii = Fn;
             const ni = Object.prototype.toString, {
               Z_NO_FLUSH: zn,
               Z_SYNC_FLUSH: In,
@@ -41321,7 +41337,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               }, C || {});
               let j = this.options;
               j.raw && j.windowBits > 0 ? j.windowBits = -j.windowBits : j.gzip && j.windowBits > 0 && j.windowBits < 16 && (j.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new ii(), this.strm.avail_out = 0;
-              let F = fr.deflateInit2(
+              let O = fr.deflateInit2(
                 this.strm,
                 j.level,
                 j.method,
@@ -41329,36 +41345,36 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 j.memLevel,
                 j.strategy
               );
-              if (F !== Sr)
-                throw new Error(we[F]);
+              if (O !== Sr)
+                throw new Error(we[O]);
               if (j.header && fr.deflateSetHeader(this.strm, j.header), j.dictionary) {
                 let J;
-                if (typeof j.dictionary == "string" ? J = pr.string2buf(j.dictionary) : ni.call(j.dictionary) === "[object ArrayBuffer]" ? J = new Uint8Array(j.dictionary) : J = j.dictionary, F = fr.deflateSetDictionary(this.strm, J), F !== Sr)
-                  throw new Error(we[F]);
+                if (typeof j.dictionary == "string" ? J = pr.string2buf(j.dictionary) : ni.call(j.dictionary) === "[object ArrayBuffer]" ? J = new Uint8Array(j.dictionary) : J = j.dictionary, O = fr.deflateSetDictionary(this.strm, J), O !== Sr)
+                  throw new Error(we[O]);
                 this._dict_set = !0;
               }
             }
             gr.prototype.push = function(C, j) {
-              const F = this.strm, J = this.options.chunkSize;
+              const O = this.strm, J = this.options.chunkSize;
               let se, ie;
               if (this.ended)
                 return !1;
-              for (j === ~~j ? ie = j : ie = j === !0 ? Pn : zn, typeof C == "string" ? F.input = pr.string2buf(C) : ni.call(C) === "[object ArrayBuffer]" ? F.input = new Uint8Array(C) : F.input = C, F.next_in = 0, F.avail_in = F.input.length; ; ) {
-                if (F.avail_out === 0 && (F.output = new Uint8Array(J), F.next_out = 0, F.avail_out = J), (ie === In || ie === Rn) && F.avail_out <= 6) {
-                  this.onData(F.output.subarray(0, F.next_out)), F.avail_out = 0;
+              for (j === ~~j ? ie = j : ie = j === !0 ? Pn : zn, typeof C == "string" ? O.input = pr.string2buf(C) : ni.call(C) === "[object ArrayBuffer]" ? O.input = new Uint8Array(C) : O.input = C, O.next_in = 0, O.avail_in = O.input.length; ; ) {
+                if (O.avail_out === 0 && (O.output = new Uint8Array(J), O.next_out = 0, O.avail_out = J), (ie === In || ie === Rn) && O.avail_out <= 6) {
+                  this.onData(O.output.subarray(0, O.next_out)), O.avail_out = 0;
                   continue;
                 }
-                if (se = fr.deflate(F, ie), se === Bn)
-                  return F.next_out > 0 && this.onData(F.output.subarray(0, F.next_out)), se = fr.deflateEnd(this.strm), this.onEnd(se), this.ended = !0, se === Sr;
-                if (F.avail_out === 0) {
-                  this.onData(F.output);
+                if (se = fr.deflate(O, ie), se === Bn)
+                  return O.next_out > 0 && this.onData(O.output.subarray(0, O.next_out)), se = fr.deflateEnd(this.strm), this.onEnd(se), this.ended = !0, se === Sr;
+                if (O.avail_out === 0) {
+                  this.onData(O.output);
                   continue;
                 }
-                if (ie > 0 && F.next_out > 0) {
-                  this.onData(F.output.subarray(0, F.next_out)), F.avail_out = 0;
+                if (ie > 0 && O.next_out > 0) {
+                  this.onData(O.output.subarray(0, O.next_out)), O.avail_out = 0;
                   continue;
                 }
-                if (F.avail_in === 0) break;
+                if (O.avail_in === 0) break;
               }
               return !0;
             }, gr.prototype.onData = function(C) {
@@ -41367,10 +41383,10 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               C === Sr && (this.result = Er.flattenChunks(this.chunks)), this.chunks = [], this.err = C, this.msg = this.strm.msg;
             };
             function Nr(C, j) {
-              const F = new gr(j);
-              if (F.push(C, !0), F.err)
-                throw F.msg || we[F.err];
-              return F.result;
+              const O = new gr(j);
+              if (O.push(C, !0), O.err)
+                throw O.msg || we[O.err];
+              return O.result;
             }
             function Wn(C, j) {
               return j = j || {}, j.raw = !0, Nr(C, j);
@@ -41386,10 +41402,10 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               constants: Zn
             };
             const Ar = 16209, qn = 16191;
-            var Qn = function(j, F) {
-              let J, se, ie, Le, Ee, tt, _e, $e, pt, Je, He, it, Ct, ft, ht, xt, ct, Qe, bt, Ft, nt, At, mt, lt;
+            var Qn = function(j, O) {
+              let J, se, ie, $e, Ee, tt, _e, Le, pt, Je, He, it, Ct, ft, ht, xt, ct, Qe, bt, Ot, nt, At, mt, lt;
               const dt = j.state;
-              J = j.next_in, mt = j.input, se = J + (j.avail_in - 5), ie = j.next_out, lt = j.output, Le = ie - (F - j.avail_out), Ee = ie + (j.avail_out - 257), tt = dt.dmax, _e = dt.wsize, $e = dt.whave, pt = dt.wnext, Je = dt.window, He = dt.hold, it = dt.bits, Ct = dt.lencode, ft = dt.distcode, ht = (1 << dt.lenbits) - 1, xt = (1 << dt.distbits) - 1;
+              J = j.next_in, mt = j.input, se = J + (j.avail_in - 5), ie = j.next_out, lt = j.output, $e = ie - (O - j.avail_out), Ee = ie + (j.avail_out - 257), tt = dt.dmax, _e = dt.wsize, Le = dt.whave, pt = dt.wnext, Je = dt.window, He = dt.hold, it = dt.bits, Ct = dt.lencode, ft = dt.distcode, ht = (1 << dt.lenbits) - 1, xt = (1 << dt.distbits) - 1;
               e:
                 do {
                   it < 15 && (He += mt[J++] << it, it += 8, He += mt[J++] << it, it += 8), ct = Ct[He & ht];
@@ -41402,12 +41418,12 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                         r:
                           for (; ; ) {
                             if (Qe = ct >>> 24, He >>>= Qe, it -= Qe, Qe = ct >>> 16 & 255, Qe & 16) {
-                              if (Ft = ct & 65535, Qe &= 15, it < Qe && (He += mt[J++] << it, it += 8, it < Qe && (He += mt[J++] << it, it += 8)), Ft += He & (1 << Qe) - 1, Ft > tt) {
+                              if (Ot = ct & 65535, Qe &= 15, it < Qe && (He += mt[J++] << it, it += 8, it < Qe && (He += mt[J++] << it, it += 8)), Ot += He & (1 << Qe) - 1, Ot > tt) {
                                 j.msg = "invalid distance too far back", dt.mode = Ar;
                                 break e;
                               }
-                              if (He >>>= Qe, it -= Qe, Qe = ie - Le, Ft > Qe) {
-                                if (Qe = Ft - Qe, Qe > $e && dt.sane) {
+                              if (He >>>= Qe, it -= Qe, Qe = ie - $e, Ot > Qe) {
+                                if (Qe = Ot - Qe, Qe > Le && dt.sane) {
                                   j.msg = "invalid distance too far back", dt.mode = Ar;
                                   break e;
                                 }
@@ -41417,7 +41433,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                                     do
                                       lt[ie++] = Je[nt++];
                                     while (--Qe);
-                                    nt = ie - Ft, At = lt;
+                                    nt = ie - Ot, At = lt;
                                   }
                                 } else if (pt < Qe) {
                                   if (nt += _e + pt - Qe, Qe -= pt, Qe < bt) {
@@ -41430,7 +41446,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                                       do
                                         lt[ie++] = Je[nt++];
                                       while (--Qe);
-                                      nt = ie - Ft, At = lt;
+                                      nt = ie - Ot, At = lt;
                                     }
                                   }
                                 } else if (nt += pt - Qe, Qe < bt) {
@@ -41438,13 +41454,13 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                                   do
                                     lt[ie++] = Je[nt++];
                                   while (--Qe);
-                                  nt = ie - Ft, At = lt;
+                                  nt = ie - Ot, At = lt;
                                 }
                                 for (; bt > 2; )
                                   lt[ie++] = At[nt++], lt[ie++] = At[nt++], lt[ie++] = At[nt++], bt -= 3;
                                 bt && (lt[ie++] = At[nt++], bt > 1 && (lt[ie++] = At[nt++]));
                               } else {
-                                nt = ie - Ft;
+                                nt = ie - Ot;
                                 do
                                   lt[ie++] = lt[nt++], lt[ie++] = lt[nt++], lt[ie++] = lt[nt++], bt -= 3;
                                 while (bt > 2);
@@ -41611,15 +41627,15 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               64,
               64
             ]);
-            var _r = (C, j, F, J, se, ie, Le, Ee) => {
+            var _r = (C, j, O, J, se, ie, $e, Ee) => {
               const tt = Ee.bits;
-              let _e = 0, $e = 0, pt = 0, Je = 0, He = 0, it = 0, Ct = 0, ft = 0, ht = 0, xt = 0, ct, Qe, bt, Ft, nt, At = null, mt;
+              let _e = 0, Le = 0, pt = 0, Je = 0, He = 0, it = 0, Ct = 0, ft = 0, ht = 0, xt = 0, ct, Qe, bt, Ot, nt, At = null, mt;
               const lt = new Uint16Array(lr + 1), dt = new Uint16Array(lr + 1);
-              let tr = null, nn, Lr, $r;
+              let tr = null, nn, $r, Lr;
               for (_e = 0; _e <= lr; _e++)
                 lt[_e] = 0;
-              for ($e = 0; $e < J; $e++)
-                lt[j[F + $e]]++;
+              for (Le = 0; Le < J; Le++)
+                lt[j[O + Le]]++;
               for (He = tt, Je = lr; Je >= 1 && lt[Je] === 0; Je--)
                 ;
               if (He > Je && (He = Je), Je === 0)
@@ -41633,28 +41649,28 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 return -1;
               for (dt[1] = 0, _e = 1; _e < lr; _e++)
                 dt[_e + 1] = dt[_e] + lt[_e];
-              for ($e = 0; $e < J; $e++)
-                j[F + $e] !== 0 && (Le[dt[j[F + $e]]++] = $e);
-              if (C === li ? (At = tr = Le, mt = 20) : C === Ur ? (At = Jn, tr = ea, mt = 257) : (At = ta, tr = ra, mt = 0), xt = 0, $e = 0, _e = pt, nt = ie, it = He, Ct = 0, bt = -1, ht = 1 << He, Ft = ht - 1, C === Ur && ht > ai || C === oi && ht > si)
+              for (Le = 0; Le < J; Le++)
+                j[O + Le] !== 0 && ($e[dt[j[O + Le]]++] = Le);
+              if (C === li ? (At = tr = $e, mt = 20) : C === Ur ? (At = Jn, tr = ea, mt = 257) : (At = ta, tr = ra, mt = 0), xt = 0, Le = 0, _e = pt, nt = ie, it = He, Ct = 0, bt = -1, ht = 1 << He, Ot = ht - 1, C === Ur && ht > ai || C === oi && ht > si)
                 return 1;
               for (; ; ) {
-                nn = _e - Ct, Le[$e] + 1 < mt ? (Lr = 0, $r = Le[$e]) : Le[$e] >= mt ? (Lr = tr[Le[$e] - mt], $r = At[Le[$e] - mt]) : (Lr = 96, $r = 0), ct = 1 << _e - Ct, Qe = 1 << it, pt = Qe;
+                nn = _e - Ct, $e[Le] + 1 < mt ? ($r = 0, Lr = $e[Le]) : $e[Le] >= mt ? ($r = tr[$e[Le] - mt], Lr = At[$e[Le] - mt]) : ($r = 96, Lr = 0), ct = 1 << _e - Ct, Qe = 1 << it, pt = Qe;
                 do
-                  Qe -= ct, se[nt + (xt >> Ct) + Qe] = nn << 24 | Lr << 16 | $r | 0;
+                  Qe -= ct, se[nt + (xt >> Ct) + Qe] = nn << 24 | $r << 16 | Lr | 0;
                 while (Qe !== 0);
                 for (ct = 1 << _e - 1; xt & ct; )
                   ct >>= 1;
-                if (ct !== 0 ? (xt &= ct - 1, xt += ct) : xt = 0, $e++, --lt[_e] === 0) {
+                if (ct !== 0 ? (xt &= ct - 1, xt += ct) : xt = 0, Le++, --lt[_e] === 0) {
                   if (_e === Je)
                     break;
-                  _e = j[F + Le[$e]];
+                  _e = j[O + $e[Le]];
                 }
-                if (_e > He && (xt & Ft) !== bt) {
+                if (_e > He && (xt & Ot) !== bt) {
                   for (Ct === 0 && (Ct = He), nt += pt, it = _e - Ct, ft = 1 << it; it + Ct < Je && (ft -= lt[it + Ct], !(ft <= 0)); )
                     it++, ft <<= 1;
                   if (ht += 1 << it, C === Ur && ht > ai || C === oi && ht > si)
                     return 1;
-                  bt = xt & Ft, se[bt] = He << 24 | it << 16 | nt - ie | 0;
+                  bt = xt & Ot, se[bt] = He << 24 | it << 16 | nt - ie | 0;
                 }
               }
               return xt !== 0 && (se[nt + xt] = _e - Ct << 24 | 64 << 16 | 0), Ee.bits = He, 0;
@@ -41671,7 +41687,7 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               Z_MEM_ERROR: fi,
               Z_BUF_ERROR: la,
               Z_DEFLATED: mi
-            } = ve, Dr = 16180, pi = 16181, gi = 16182, vi = 16183, bi = 16184, yi = 16185, xi = 16186, wi = 16187, Ei = 16188, Si = 16189, Cr = 16190, Vt = 16191, Gr = 16192, Ai = 16193, Wr = 16194, Mi = 16195, Di = 16196, Ci = 16197, Ti = 16198, Tr = 16199, kr = 16200, ki = 16201, Li = 16202, $i = 16203, Fi = 16204, Oi = 16205, Hr = 16206, zi = 16207, Ii = 16208, Dt = 16209, Ri = 16210, Pi = 16211, oa = 852, ha = 592, ca = 15, Bi = (C) => (C >>> 24 & 255) + (C >>> 8 & 65280) + ((C & 65280) << 8) + ((C & 255) << 24);
+            } = ve, Dr = 16180, pi = 16181, gi = 16182, vi = 16183, bi = 16184, yi = 16185, xi = 16186, wi = 16187, Ei = 16188, Si = 16189, Cr = 16190, Vt = 16191, Gr = 16192, Ai = 16193, Wr = 16194, Mi = 16195, Di = 16196, Ci = 16197, Ti = 16198, Tr = 16199, kr = 16200, ki = 16201, $i = 16202, Li = 16203, Oi = 16204, Fi = 16205, Hr = 16206, zi = 16207, Ii = 16208, Dt = 16209, Ri = 16210, Pi = 16211, oa = 852, ha = 592, ca = 15, Bi = (C) => (C >>> 24 & 255) + (C >>> 8 & 65280) + ((C & 65280) << 8) + ((C & 255) << 24);
             function ua() {
               this.strm = null, this.mode = 0, this.last = !1, this.wrap = 0, this.havedict = !1, this.flags = 0, this.dmax = 0, this.check = 0, this.total = 0, this.head = null, this.wbits = 0, this.wsize = 0, this.whave = 0, this.wnext = 0, this.window = null, this.hold = 0, this.bits = 0, this.length = 0, this.offset = 0, this.extra = 0, this.lencode = null, this.distcode = null, this.lenbits = 0, this.distbits = 0, this.ncode = 0, this.nlen = 0, this.ndist = 0, this.have = 0, this.next = null, this.lens = new Uint16Array(320), this.work = new Uint16Array(288), this.lendyn = null, this.distdyn = null, this.sane = 0, this.back = 0, this.was = 0;
             }
@@ -41691,16 +41707,16 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               const j = C.state;
               return j.wsize = 0, j.whave = 0, j.wnext = 0, Ni(C);
             }, Gi = (C, j) => {
-              let F;
+              let O;
               if (er(C))
                 return Ut;
               const J = C.state;
-              return j < 0 ? (F = 0, j = -j) : (F = (j >> 4) + 5, j < 48 && (j &= 15)), j && (j < 8 || j > 15) ? Ut : (J.window !== null && J.wbits !== j && (J.window = null), J.wrap = F, J.wbits = j, Ui(C));
+              return j < 0 ? (O = 0, j = -j) : (O = (j >> 4) + 5, j < 48 && (j &= 15)), j && (j < 8 || j > 15) ? Ut : (J.window !== null && J.wbits !== j && (J.window = null), J.wrap = O, J.wbits = j, Ui(C));
             }, Wi = (C, j) => {
               if (!C)
                 return Ut;
-              const F = new ua();
-              C.state = F, F.strm = C, F.window = null, F.mode = Dr;
+              const O = new ua();
+              C.state = O, O.strm = C, O.window = null, O.mode = Dr;
               const J = Gi(C, j);
               return J !== Jt && (C.state = null), J;
             }, da = (C) => Wi(C, ca);
@@ -41722,12 +41738,12 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                 _r(ci, C.lens, 0, 32, jr, 0, C.work, { bits: 5 }), Hi = !1;
               }
               C.lencode = Vr, C.lenbits = 9, C.distcode = jr, C.distbits = 5;
-            }, Vi = (C, j, F, J) => {
+            }, Vi = (C, j, O, J) => {
               let se;
               const ie = C.state;
-              return ie.window === null && (ie.wsize = 1 << ie.wbits, ie.wnext = 0, ie.whave = 0, ie.window = new Uint8Array(ie.wsize)), J >= ie.wsize ? (ie.window.set(j.subarray(F - ie.wsize, F), 0), ie.wnext = 0, ie.whave = ie.wsize) : (se = ie.wsize - ie.wnext, se > J && (se = J), ie.window.set(j.subarray(F - J, F - J + se), ie.wnext), J -= se, J ? (ie.window.set(j.subarray(F - J, F), 0), ie.wnext = J, ie.whave = ie.wsize) : (ie.wnext += se, ie.wnext === ie.wsize && (ie.wnext = 0), ie.whave < ie.wsize && (ie.whave += se))), 0;
+              return ie.window === null && (ie.wsize = 1 << ie.wbits, ie.wnext = 0, ie.whave = 0, ie.window = new Uint8Array(ie.wsize)), J >= ie.wsize ? (ie.window.set(j.subarray(O - ie.wsize, O), 0), ie.wnext = 0, ie.whave = ie.wsize) : (se = ie.wsize - ie.wnext, se > J && (se = J), ie.window.set(j.subarray(O - J, O - J + se), ie.wnext), J -= se, J ? (ie.window.set(j.subarray(O - J, O), 0), ie.wnext = J, ie.whave = ie.wsize) : (ie.wnext += se, ie.wnext === ie.wsize && (ie.wnext = 0), ie.whave < ie.wsize && (ie.whave += se))), 0;
             }, ma = (C, j) => {
-              let F, J, se, ie, Le, Ee, tt, _e, $e, pt, Je, He, it, Ct, ft = 0, ht, xt, ct, Qe, bt, Ft, nt, At;
+              let O, J, se, ie, $e, Ee, tt, _e, Le, pt, Je, He, it, Ct, ft = 0, ht, xt, ct, Qe, bt, Ot, nt, At;
               const mt = new Uint8Array(4);
               let lt, dt;
               const tr = (
@@ -41736,80 +41752,80 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               );
               if (er(C) || !C.output || !C.input && C.avail_in !== 0)
                 return Ut;
-              F = C.state, F.mode === Vt && (F.mode = Gr), Le = C.next_out, se = C.output, tt = C.avail_out, ie = C.next_in, J = C.input, Ee = C.avail_in, _e = F.hold, $e = F.bits, pt = Ee, Je = tt, At = Jt;
+              O = C.state, O.mode === Vt && (O.mode = Gr), $e = C.next_out, se = C.output, tt = C.avail_out, ie = C.next_in, J = C.input, Ee = C.avail_in, _e = O.hold, Le = O.bits, pt = Ee, Je = tt, At = Jt;
               e:
                 for (; ; )
-                  switch (F.mode) {
+                  switch (O.mode) {
                     case Dr:
-                      if (F.wrap === 0) {
-                        F.mode = Gr;
+                      if (O.wrap === 0) {
+                        O.mode = Gr;
                         break;
                       }
-                      for (; $e < 16; ) {
+                      for (; Le < 16; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
-                      if (F.wrap & 2 && _e === 35615) {
-                        F.wbits === 0 && (F.wbits = 15), F.check = 0, mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, F.check = I(F.check, mt, 2, 0), _e = 0, $e = 0, F.mode = pi;
+                      if (O.wrap & 2 && _e === 35615) {
+                        O.wbits === 0 && (O.wbits = 15), O.check = 0, mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, O.check = I(O.check, mt, 2, 0), _e = 0, Le = 0, O.mode = pi;
                         break;
                       }
-                      if (F.head && (F.head.done = !1), !(F.wrap & 1) || /* check if zlib header allowed */
+                      if (O.head && (O.head.done = !1), !(O.wrap & 1) || /* check if zlib header allowed */
                       (((_e & 255) << 8) + (_e >> 8)) % 31) {
-                        C.msg = "incorrect header check", F.mode = Dt;
+                        C.msg = "incorrect header check", O.mode = Dt;
                         break;
                       }
                       if ((_e & 15) !== mi) {
-                        C.msg = "unknown compression method", F.mode = Dt;
+                        C.msg = "unknown compression method", O.mode = Dt;
                         break;
                       }
-                      if (_e >>>= 4, $e -= 4, nt = (_e & 15) + 8, F.wbits === 0 && (F.wbits = nt), nt > 15 || nt > F.wbits) {
-                        C.msg = "invalid window size", F.mode = Dt;
+                      if (_e >>>= 4, Le -= 4, nt = (_e & 15) + 8, O.wbits === 0 && (O.wbits = nt), nt > 15 || nt > O.wbits) {
+                        C.msg = "invalid window size", O.mode = Dt;
                         break;
                       }
-                      F.dmax = 1 << F.wbits, F.flags = 0, C.adler = F.check = 1, F.mode = _e & 512 ? Si : Vt, _e = 0, $e = 0;
+                      O.dmax = 1 << O.wbits, O.flags = 0, C.adler = O.check = 1, O.mode = _e & 512 ? Si : Vt, _e = 0, Le = 0;
                       break;
                     case pi:
-                      for (; $e < 16; ) {
+                      for (; Le < 16; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
-                      if (F.flags = _e, (F.flags & 255) !== mi) {
-                        C.msg = "unknown compression method", F.mode = Dt;
+                      if (O.flags = _e, (O.flags & 255) !== mi) {
+                        C.msg = "unknown compression method", O.mode = Dt;
                         break;
                       }
-                      if (F.flags & 57344) {
-                        C.msg = "unknown header flags set", F.mode = Dt;
+                      if (O.flags & 57344) {
+                        C.msg = "unknown header flags set", O.mode = Dt;
                         break;
                       }
-                      F.head && (F.head.text = _e >> 8 & 1), F.flags & 512 && F.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, F.check = I(F.check, mt, 2, 0)), _e = 0, $e = 0, F.mode = gi;
+                      O.head && (O.head.text = _e >> 8 & 1), O.flags & 512 && O.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, O.check = I(O.check, mt, 2, 0)), _e = 0, Le = 0, O.mode = gi;
                     case gi:
-                      for (; $e < 32; ) {
+                      for (; Le < 32; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
-                      F.head && (F.head.time = _e), F.flags & 512 && F.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, mt[2] = _e >>> 16 & 255, mt[3] = _e >>> 24 & 255, F.check = I(F.check, mt, 4, 0)), _e = 0, $e = 0, F.mode = vi;
+                      O.head && (O.head.time = _e), O.flags & 512 && O.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, mt[2] = _e >>> 16 & 255, mt[3] = _e >>> 24 & 255, O.check = I(O.check, mt, 4, 0)), _e = 0, Le = 0, O.mode = vi;
                     case vi:
-                      for (; $e < 16; ) {
+                      for (; Le < 16; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
-                      F.head && (F.head.xflags = _e & 255, F.head.os = _e >> 8), F.flags & 512 && F.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, F.check = I(F.check, mt, 2, 0)), _e = 0, $e = 0, F.mode = bi;
+                      O.head && (O.head.xflags = _e & 255, O.head.os = _e >> 8), O.flags & 512 && O.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, O.check = I(O.check, mt, 2, 0)), _e = 0, Le = 0, O.mode = bi;
                     case bi:
-                      if (F.flags & 1024) {
-                        for (; $e < 16; ) {
+                      if (O.flags & 1024) {
+                        for (; Le < 16; ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        F.length = _e, F.head && (F.head.extra_len = _e), F.flags & 512 && F.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, F.check = I(F.check, mt, 2, 0)), _e = 0, $e = 0;
-                      } else F.head && (F.head.extra = null);
-                      F.mode = yi;
+                        O.length = _e, O.head && (O.head.extra_len = _e), O.flags & 512 && O.wrap & 4 && (mt[0] = _e & 255, mt[1] = _e >>> 8 & 255, O.check = I(O.check, mt, 2, 0)), _e = 0, Le = 0;
+                      } else O.head && (O.head.extra = null);
+                      O.mode = yi;
                     case yi:
-                      if (F.flags & 1024 && (He = F.length, He > Ee && (He = Ee), He && (F.head && (nt = F.head.extra_len - F.length, F.head.extra || (F.head.extra = new Uint8Array(F.head.extra_len)), F.head.extra.set(
+                      if (O.flags & 1024 && (He = O.length, He > Ee && (He = Ee), He && (O.head && (nt = O.head.extra_len - O.length, O.head.extra || (O.head.extra = new Uint8Array(O.head.extra_len)), O.head.extra.set(
                         J.subarray(
                           ie,
                           // extra field is limited to 65536 bytes
@@ -41818,327 +41834,327 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                         ),
                         /*len + copy > state.head.extra_max - len ? state.head.extra_max : copy,*/
                         nt
-                      )), F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, J, He, ie)), Ee -= He, ie += He, F.length -= He), F.length))
+                      )), O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, He, ie)), Ee -= He, ie += He, O.length -= He), O.length))
                         break e;
-                      F.length = 0, F.mode = xi;
+                      O.length = 0, O.mode = xi;
                     case xi:
-                      if (F.flags & 2048) {
+                      if (O.flags & 2048) {
                         if (Ee === 0)
                           break e;
                         He = 0;
                         do
-                          nt = J[ie + He++], F.head && nt && F.length < 65536 && (F.head.name += String.fromCharCode(nt));
+                          nt = J[ie + He++], O.head && nt && O.length < 65536 && (O.head.name += String.fromCharCode(nt));
                         while (nt && He < Ee);
-                        if (F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, J, He, ie)), Ee -= He, ie += He, nt)
+                        if (O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, He, ie)), Ee -= He, ie += He, nt)
                           break e;
-                      } else F.head && (F.head.name = null);
-                      F.length = 0, F.mode = wi;
+                      } else O.head && (O.head.name = null);
+                      O.length = 0, O.mode = wi;
                     case wi:
-                      if (F.flags & 4096) {
+                      if (O.flags & 4096) {
                         if (Ee === 0)
                           break e;
                         He = 0;
                         do
-                          nt = J[ie + He++], F.head && nt && F.length < 65536 && (F.head.comment += String.fromCharCode(nt));
+                          nt = J[ie + He++], O.head && nt && O.length < 65536 && (O.head.comment += String.fromCharCode(nt));
                         while (nt && He < Ee);
-                        if (F.flags & 512 && F.wrap & 4 && (F.check = I(F.check, J, He, ie)), Ee -= He, ie += He, nt)
+                        if (O.flags & 512 && O.wrap & 4 && (O.check = I(O.check, J, He, ie)), Ee -= He, ie += He, nt)
                           break e;
-                      } else F.head && (F.head.comment = null);
-                      F.mode = Ei;
+                      } else O.head && (O.head.comment = null);
+                      O.mode = Ei;
                     case Ei:
-                      if (F.flags & 512) {
-                        for (; $e < 16; ) {
+                      if (O.flags & 512) {
+                        for (; Le < 16; ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        if (F.wrap & 4 && _e !== (F.check & 65535)) {
-                          C.msg = "header crc mismatch", F.mode = Dt;
+                        if (O.wrap & 4 && _e !== (O.check & 65535)) {
+                          C.msg = "header crc mismatch", O.mode = Dt;
                           break;
                         }
-                        _e = 0, $e = 0;
+                        _e = 0, Le = 0;
                       }
-                      F.head && (F.head.hcrc = F.flags >> 9 & 1, F.head.done = !0), C.adler = F.check = 0, F.mode = Vt;
+                      O.head && (O.head.hcrc = O.flags >> 9 & 1, O.head.done = !0), C.adler = O.check = 0, O.mode = Vt;
                       break;
                     case Si:
-                      for (; $e < 32; ) {
+                      for (; Le < 32; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
-                      C.adler = F.check = Bi(_e), _e = 0, $e = 0, F.mode = Cr;
+                      C.adler = O.check = Bi(_e), _e = 0, Le = 0, O.mode = Cr;
                     case Cr:
-                      if (F.havedict === 0)
-                        return C.next_out = Le, C.avail_out = tt, C.next_in = ie, C.avail_in = Ee, F.hold = _e, F.bits = $e, sa;
-                      C.adler = F.check = 1, F.mode = Vt;
+                      if (O.havedict === 0)
+                        return C.next_out = $e, C.avail_out = tt, C.next_in = ie, C.avail_in = Ee, O.hold = _e, O.bits = Le, sa;
+                      C.adler = O.check = 1, O.mode = Vt;
                     case Vt:
                       if (j === na || j === Mr)
                         break e;
                     case Gr:
-                      if (F.last) {
-                        _e >>>= $e & 7, $e -= $e & 7, F.mode = Hr;
+                      if (O.last) {
+                        _e >>>= Le & 7, Le -= Le & 7, O.mode = Hr;
                         break;
                       }
-                      for (; $e < 3; ) {
+                      for (; Le < 3; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
-                      switch (F.last = _e & 1, _e >>>= 1, $e -= 1, _e & 3) {
+                      switch (O.last = _e & 1, _e >>>= 1, Le -= 1, _e & 3) {
                         case 0:
-                          F.mode = Ai;
+                          O.mode = Ai;
                           break;
                         case 1:
-                          if (fa(F), F.mode = Tr, j === Mr) {
-                            _e >>>= 2, $e -= 2;
+                          if (fa(O), O.mode = Tr, j === Mr) {
+                            _e >>>= 2, Le -= 2;
                             break e;
                           }
                           break;
                         case 2:
-                          F.mode = Di;
+                          O.mode = Di;
                           break;
                         case 3:
-                          C.msg = "invalid block type", F.mode = Dt;
+                          C.msg = "invalid block type", O.mode = Dt;
                       }
-                      _e >>>= 2, $e -= 2;
+                      _e >>>= 2, Le -= 2;
                       break;
                     case Ai:
-                      for (_e >>>= $e & 7, $e -= $e & 7; $e < 32; ) {
+                      for (_e >>>= Le & 7, Le -= Le & 7; Le < 32; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
                       if ((_e & 65535) !== (_e >>> 16 ^ 65535)) {
-                        C.msg = "invalid stored block lengths", F.mode = Dt;
+                        C.msg = "invalid stored block lengths", O.mode = Dt;
                         break;
                       }
-                      if (F.length = _e & 65535, _e = 0, $e = 0, F.mode = Wr, j === Mr)
+                      if (O.length = _e & 65535, _e = 0, Le = 0, O.mode = Wr, j === Mr)
                         break e;
                     case Wr:
-                      F.mode = Mi;
+                      O.mode = Mi;
                     case Mi:
-                      if (He = F.length, He) {
+                      if (He = O.length, He) {
                         if (He > Ee && (He = Ee), He > tt && (He = tt), He === 0)
                           break e;
-                        se.set(J.subarray(ie, ie + He), Le), Ee -= He, ie += He, tt -= He, Le += He, F.length -= He;
+                        se.set(J.subarray(ie, ie + He), $e), Ee -= He, ie += He, tt -= He, $e += He, O.length -= He;
                         break;
                       }
-                      F.mode = Vt;
+                      O.mode = Vt;
                       break;
                     case Di:
-                      for (; $e < 14; ) {
+                      for (; Le < 14; ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
-                      if (F.nlen = (_e & 31) + 257, _e >>>= 5, $e -= 5, F.ndist = (_e & 31) + 1, _e >>>= 5, $e -= 5, F.ncode = (_e & 15) + 4, _e >>>= 4, $e -= 4, F.nlen > 286 || F.ndist > 30) {
-                        C.msg = "too many length or distance symbols", F.mode = Dt;
+                      if (O.nlen = (_e & 31) + 257, _e >>>= 5, Le -= 5, O.ndist = (_e & 31) + 1, _e >>>= 5, Le -= 5, O.ncode = (_e & 15) + 4, _e >>>= 4, Le -= 4, O.nlen > 286 || O.ndist > 30) {
+                        C.msg = "too many length or distance symbols", O.mode = Dt;
                         break;
                       }
-                      F.have = 0, F.mode = Ci;
+                      O.have = 0, O.mode = Ci;
                     case Ci:
-                      for (; F.have < F.ncode; ) {
-                        for (; $e < 3; ) {
+                      for (; O.have < O.ncode; ) {
+                        for (; Le < 3; ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        F.lens[tr[F.have++]] = _e & 7, _e >>>= 3, $e -= 3;
+                        O.lens[tr[O.have++]] = _e & 7, _e >>>= 3, Le -= 3;
                       }
-                      for (; F.have < 19; )
-                        F.lens[tr[F.have++]] = 0;
-                      if (F.lencode = F.lendyn, F.lenbits = 7, lt = { bits: F.lenbits }, At = _r(ia, F.lens, 0, 19, F.lencode, 0, F.work, lt), F.lenbits = lt.bits, At) {
-                        C.msg = "invalid code lengths set", F.mode = Dt;
+                      for (; O.have < 19; )
+                        O.lens[tr[O.have++]] = 0;
+                      if (O.lencode = O.lendyn, O.lenbits = 7, lt = { bits: O.lenbits }, At = _r(ia, O.lens, 0, 19, O.lencode, 0, O.work, lt), O.lenbits = lt.bits, At) {
+                        C.msg = "invalid code lengths set", O.mode = Dt;
                         break;
                       }
-                      F.have = 0, F.mode = Ti;
+                      O.have = 0, O.mode = Ti;
                     case Ti:
-                      for (; F.have < F.nlen + F.ndist; ) {
-                        for (; ft = F.lencode[_e & (1 << F.lenbits) - 1], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(ht <= $e); ) {
+                      for (; O.have < O.nlen + O.ndist; ) {
+                        for (; ft = O.lencode[_e & (1 << O.lenbits) - 1], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(ht <= Le); ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
                         if (ct < 16)
-                          _e >>>= ht, $e -= ht, F.lens[F.have++] = ct;
+                          _e >>>= ht, Le -= ht, O.lens[O.have++] = ct;
                         else {
                           if (ct === 16) {
-                            for (dt = ht + 2; $e < dt; ) {
+                            for (dt = ht + 2; Le < dt; ) {
                               if (Ee === 0)
                                 break e;
-                              Ee--, _e += J[ie++] << $e, $e += 8;
+                              Ee--, _e += J[ie++] << Le, Le += 8;
                             }
-                            if (_e >>>= ht, $e -= ht, F.have === 0) {
-                              C.msg = "invalid bit length repeat", F.mode = Dt;
+                            if (_e >>>= ht, Le -= ht, O.have === 0) {
+                              C.msg = "invalid bit length repeat", O.mode = Dt;
                               break;
                             }
-                            nt = F.lens[F.have - 1], He = 3 + (_e & 3), _e >>>= 2, $e -= 2;
+                            nt = O.lens[O.have - 1], He = 3 + (_e & 3), _e >>>= 2, Le -= 2;
                           } else if (ct === 17) {
-                            for (dt = ht + 3; $e < dt; ) {
+                            for (dt = ht + 3; Le < dt; ) {
                               if (Ee === 0)
                                 break e;
-                              Ee--, _e += J[ie++] << $e, $e += 8;
+                              Ee--, _e += J[ie++] << Le, Le += 8;
                             }
-                            _e >>>= ht, $e -= ht, nt = 0, He = 3 + (_e & 7), _e >>>= 3, $e -= 3;
+                            _e >>>= ht, Le -= ht, nt = 0, He = 3 + (_e & 7), _e >>>= 3, Le -= 3;
                           } else {
-                            for (dt = ht + 7; $e < dt; ) {
+                            for (dt = ht + 7; Le < dt; ) {
                               if (Ee === 0)
                                 break e;
-                              Ee--, _e += J[ie++] << $e, $e += 8;
+                              Ee--, _e += J[ie++] << Le, Le += 8;
                             }
-                            _e >>>= ht, $e -= ht, nt = 0, He = 11 + (_e & 127), _e >>>= 7, $e -= 7;
+                            _e >>>= ht, Le -= ht, nt = 0, He = 11 + (_e & 127), _e >>>= 7, Le -= 7;
                           }
-                          if (F.have + He > F.nlen + F.ndist) {
-                            C.msg = "invalid bit length repeat", F.mode = Dt;
+                          if (O.have + He > O.nlen + O.ndist) {
+                            C.msg = "invalid bit length repeat", O.mode = Dt;
                             break;
                           }
                           for (; He--; )
-                            F.lens[F.have++] = nt;
+                            O.lens[O.have++] = nt;
                         }
                       }
-                      if (F.mode === Dt)
+                      if (O.mode === Dt)
                         break;
-                      if (F.lens[256] === 0) {
-                        C.msg = "invalid code -- missing end-of-block", F.mode = Dt;
+                      if (O.lens[256] === 0) {
+                        C.msg = "invalid code -- missing end-of-block", O.mode = Dt;
                         break;
                       }
-                      if (F.lenbits = 9, lt = { bits: F.lenbits }, At = _r(hi, F.lens, 0, F.nlen, F.lencode, 0, F.work, lt), F.lenbits = lt.bits, At) {
-                        C.msg = "invalid literal/lengths set", F.mode = Dt;
+                      if (O.lenbits = 9, lt = { bits: O.lenbits }, At = _r(hi, O.lens, 0, O.nlen, O.lencode, 0, O.work, lt), O.lenbits = lt.bits, At) {
+                        C.msg = "invalid literal/lengths set", O.mode = Dt;
                         break;
                       }
-                      if (F.distbits = 6, F.distcode = F.distdyn, lt = { bits: F.distbits }, At = _r(ci, F.lens, F.nlen, F.ndist, F.distcode, 0, F.work, lt), F.distbits = lt.bits, At) {
-                        C.msg = "invalid distances set", F.mode = Dt;
+                      if (O.distbits = 6, O.distcode = O.distdyn, lt = { bits: O.distbits }, At = _r(ci, O.lens, O.nlen, O.ndist, O.distcode, 0, O.work, lt), O.distbits = lt.bits, At) {
+                        C.msg = "invalid distances set", O.mode = Dt;
                         break;
                       }
-                      if (F.mode = Tr, j === Mr)
+                      if (O.mode = Tr, j === Mr)
                         break e;
                     case Tr:
-                      F.mode = kr;
+                      O.mode = kr;
                     case kr:
                       if (Ee >= 6 && tt >= 258) {
-                        C.next_out = Le, C.avail_out = tt, C.next_in = ie, C.avail_in = Ee, F.hold = _e, F.bits = $e, Qn(C, Je), Le = C.next_out, se = C.output, tt = C.avail_out, ie = C.next_in, J = C.input, Ee = C.avail_in, _e = F.hold, $e = F.bits, F.mode === Vt && (F.back = -1);
+                        C.next_out = $e, C.avail_out = tt, C.next_in = ie, C.avail_in = Ee, O.hold = _e, O.bits = Le, Qn(C, Je), $e = C.next_out, se = C.output, tt = C.avail_out, ie = C.next_in, J = C.input, Ee = C.avail_in, _e = O.hold, Le = O.bits, O.mode === Vt && (O.back = -1);
                         break;
                       }
-                      for (F.back = 0; ft = F.lencode[_e & (1 << F.lenbits) - 1], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(ht <= $e); ) {
+                      for (O.back = 0; ft = O.lencode[_e & (1 << O.lenbits) - 1], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(ht <= Le); ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
                       if (xt && !(xt & 240)) {
-                        for (Qe = ht, bt = xt, Ft = ct; ft = F.lencode[Ft + ((_e & (1 << Qe + bt) - 1) >> Qe)], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(Qe + ht <= $e); ) {
+                        for (Qe = ht, bt = xt, Ot = ct; ft = O.lencode[Ot + ((_e & (1 << Qe + bt) - 1) >> Qe)], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(Qe + ht <= Le); ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        _e >>>= Qe, $e -= Qe, F.back += Qe;
+                        _e >>>= Qe, Le -= Qe, O.back += Qe;
                       }
-                      if (_e >>>= ht, $e -= ht, F.back += ht, F.length = ct, xt === 0) {
-                        F.mode = Oi;
+                      if (_e >>>= ht, Le -= ht, O.back += ht, O.length = ct, xt === 0) {
+                        O.mode = Fi;
                         break;
                       }
                       if (xt & 32) {
-                        F.back = -1, F.mode = Vt;
+                        O.back = -1, O.mode = Vt;
                         break;
                       }
                       if (xt & 64) {
-                        C.msg = "invalid literal/length code", F.mode = Dt;
+                        C.msg = "invalid literal/length code", O.mode = Dt;
                         break;
                       }
-                      F.extra = xt & 15, F.mode = ki;
+                      O.extra = xt & 15, O.mode = ki;
                     case ki:
-                      if (F.extra) {
-                        for (dt = F.extra; $e < dt; ) {
+                      if (O.extra) {
+                        for (dt = O.extra; Le < dt; ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        F.length += _e & (1 << F.extra) - 1, _e >>>= F.extra, $e -= F.extra, F.back += F.extra;
+                        O.length += _e & (1 << O.extra) - 1, _e >>>= O.extra, Le -= O.extra, O.back += O.extra;
                       }
-                      F.was = F.length, F.mode = Li;
-                    case Li:
-                      for (; ft = F.distcode[_e & (1 << F.distbits) - 1], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(ht <= $e); ) {
+                      O.was = O.length, O.mode = $i;
+                    case $i:
+                      for (; ft = O.distcode[_e & (1 << O.distbits) - 1], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(ht <= Le); ) {
                         if (Ee === 0)
                           break e;
-                        Ee--, _e += J[ie++] << $e, $e += 8;
+                        Ee--, _e += J[ie++] << Le, Le += 8;
                       }
                       if (!(xt & 240)) {
-                        for (Qe = ht, bt = xt, Ft = ct; ft = F.distcode[Ft + ((_e & (1 << Qe + bt) - 1) >> Qe)], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(Qe + ht <= $e); ) {
+                        for (Qe = ht, bt = xt, Ot = ct; ft = O.distcode[Ot + ((_e & (1 << Qe + bt) - 1) >> Qe)], ht = ft >>> 24, xt = ft >>> 16 & 255, ct = ft & 65535, !(Qe + ht <= Le); ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        _e >>>= Qe, $e -= Qe, F.back += Qe;
+                        _e >>>= Qe, Le -= Qe, O.back += Qe;
                       }
-                      if (_e >>>= ht, $e -= ht, F.back += ht, xt & 64) {
-                        C.msg = "invalid distance code", F.mode = Dt;
+                      if (_e >>>= ht, Le -= ht, O.back += ht, xt & 64) {
+                        C.msg = "invalid distance code", O.mode = Dt;
                         break;
                       }
-                      F.offset = ct, F.extra = xt & 15, F.mode = $i;
-                    case $i:
-                      if (F.extra) {
-                        for (dt = F.extra; $e < dt; ) {
+                      O.offset = ct, O.extra = xt & 15, O.mode = Li;
+                    case Li:
+                      if (O.extra) {
+                        for (dt = O.extra; Le < dt; ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        F.offset += _e & (1 << F.extra) - 1, _e >>>= F.extra, $e -= F.extra, F.back += F.extra;
+                        O.offset += _e & (1 << O.extra) - 1, _e >>>= O.extra, Le -= O.extra, O.back += O.extra;
                       }
-                      if (F.offset > F.dmax) {
-                        C.msg = "invalid distance too far back", F.mode = Dt;
+                      if (O.offset > O.dmax) {
+                        C.msg = "invalid distance too far back", O.mode = Dt;
                         break;
                       }
-                      F.mode = Fi;
-                    case Fi:
+                      O.mode = Oi;
+                    case Oi:
                       if (tt === 0)
                         break e;
-                      if (He = Je - tt, F.offset > He) {
-                        if (He = F.offset - He, He > F.whave && F.sane) {
-                          C.msg = "invalid distance too far back", F.mode = Dt;
+                      if (He = Je - tt, O.offset > He) {
+                        if (He = O.offset - He, He > O.whave && O.sane) {
+                          C.msg = "invalid distance too far back", O.mode = Dt;
                           break;
                         }
-                        He > F.wnext ? (He -= F.wnext, it = F.wsize - He) : it = F.wnext - He, He > F.length && (He = F.length), Ct = F.window;
+                        He > O.wnext ? (He -= O.wnext, it = O.wsize - He) : it = O.wnext - He, He > O.length && (He = O.length), Ct = O.window;
                       } else
-                        Ct = se, it = Le - F.offset, He = F.length;
-                      He > tt && (He = tt), tt -= He, F.length -= He;
+                        Ct = se, it = $e - O.offset, He = O.length;
+                      He > tt && (He = tt), tt -= He, O.length -= He;
                       do
-                        se[Le++] = Ct[it++];
+                        se[$e++] = Ct[it++];
                       while (--He);
-                      F.length === 0 && (F.mode = kr);
+                      O.length === 0 && (O.mode = kr);
                       break;
-                    case Oi:
+                    case Fi:
                       if (tt === 0)
                         break e;
-                      se[Le++] = F.length, tt--, F.mode = kr;
+                      se[$e++] = O.length, tt--, O.mode = kr;
                       break;
                     case Hr:
-                      if (F.wrap) {
-                        for (; $e < 32; ) {
+                      if (O.wrap) {
+                        for (; Le < 32; ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e |= J[ie++] << $e, $e += 8;
+                          Ee--, _e |= J[ie++] << Le, Le += 8;
                         }
-                        if (Je -= tt, C.total_out += Je, F.total += Je, F.wrap & 4 && Je && (C.adler = F.check = /*UPDATE_CHECK(state.check, put - _out, _out);*/
-                        F.flags ? I(F.check, se, Je, Le - Je) : Ce(F.check, se, Je, Le - Je)), Je = tt, F.wrap & 4 && (F.flags ? _e : Bi(_e)) !== F.check) {
-                          C.msg = "incorrect data check", F.mode = Dt;
+                        if (Je -= tt, C.total_out += Je, O.total += Je, O.wrap & 4 && Je && (C.adler = O.check = /*UPDATE_CHECK(state.check, put - _out, _out);*/
+                        O.flags ? I(O.check, se, Je, $e - Je) : Ce(O.check, se, Je, $e - Je)), Je = tt, O.wrap & 4 && (O.flags ? _e : Bi(_e)) !== O.check) {
+                          C.msg = "incorrect data check", O.mode = Dt;
                           break;
                         }
-                        _e = 0, $e = 0;
+                        _e = 0, Le = 0;
                       }
-                      F.mode = zi;
+                      O.mode = zi;
                     case zi:
-                      if (F.wrap && F.flags) {
-                        for (; $e < 32; ) {
+                      if (O.wrap && O.flags) {
+                        for (; Le < 32; ) {
                           if (Ee === 0)
                             break e;
-                          Ee--, _e += J[ie++] << $e, $e += 8;
+                          Ee--, _e += J[ie++] << Le, Le += 8;
                         }
-                        if (F.wrap & 4 && _e !== (F.total & 4294967295)) {
-                          C.msg = "incorrect length check", F.mode = Dt;
+                        if (O.wrap & 4 && _e !== (O.total & 4294967295)) {
+                          C.msg = "incorrect length check", O.mode = Dt;
                           break;
                         }
-                        _e = 0, $e = 0;
+                        _e = 0, Le = 0;
                       }
-                      F.mode = Ii;
+                      O.mode = Ii;
                     case Ii:
                       At = aa;
                       break e;
@@ -42151,8 +42167,8 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
                     default:
                       return Ut;
                   }
-              return C.next_out = Le, C.avail_out = tt, C.next_in = ie, C.avail_in = Ee, F.hold = _e, F.bits = $e, (F.wsize || Je !== C.avail_out && F.mode < Dt && (F.mode < Hr || j !== ui)) && Vi(C, C.output, C.next_out, Je - C.avail_out), pt -= C.avail_in, Je -= C.avail_out, C.total_in += pt, C.total_out += Je, F.total += Je, F.wrap & 4 && Je && (C.adler = F.check = /*UPDATE_CHECK(state.check, strm.next_out - _out, _out);*/
-              F.flags ? I(F.check, se, Je, C.next_out - Je) : Ce(F.check, se, Je, C.next_out - Je)), C.data_type = F.bits + (F.last ? 64 : 0) + (F.mode === Vt ? 128 : 0) + (F.mode === Tr || F.mode === Wr ? 256 : 0), (pt === 0 && Je === 0 || j === ui) && At === Jt && (At = la), At;
+              return C.next_out = $e, C.avail_out = tt, C.next_in = ie, C.avail_in = Ee, O.hold = _e, O.bits = Le, (O.wsize || Je !== C.avail_out && O.mode < Dt && (O.mode < Hr || j !== ui)) && Vi(C, C.output, C.next_out, Je - C.avail_out), pt -= C.avail_in, Je -= C.avail_out, C.total_in += pt, C.total_out += Je, O.total += Je, O.wrap & 4 && Je && (C.adler = O.check = /*UPDATE_CHECK(state.check, strm.next_out - _out, _out);*/
+              O.flags ? I(O.check, se, Je, C.next_out - Je) : Ce(O.check, se, Je, C.next_out - Je)), C.data_type = O.bits + (O.last ? 64 : 0) + (O.mode === Vt ? 128 : 0) + (O.mode === Tr || O.mode === Wr ? 256 : 0), (pt === 0 && Je === 0 || j === ui) && At === Jt && (At = la), At;
             }, pa = (C) => {
               if (er(C))
                 return Ut;
@@ -42161,12 +42177,12 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
             }, ga = (C, j) => {
               if (er(C))
                 return Ut;
-              const F = C.state;
-              return F.wrap & 2 ? (F.head = j, j.done = !1, Jt) : Ut;
+              const O = C.state;
+              return O.wrap & 2 ? (O.head = j, j.done = !1, Jt) : Ut;
             }, _a = (C, j) => {
-              const F = j.length;
+              const O = j.length;
               let J, se, ie;
-              return er(C) || (J = C.state, J.wrap !== 0 && J.mode !== Cr) ? Ut : J.mode === Cr && (se = 1, se = Ce(se, j, F, 0), se !== J.check) ? di : (ie = Vi(C, j, F, F), ie ? (J.mode = Ri, fi) : (J.havedict = 1, Jt));
+              return er(C) || (J = C.state, J.wrap !== 0 && J.mode !== Cr) ? Ut : J.mode === Cr && (se = 1, se = Ce(se, j, O, 0), se !== J.check) ? di : (ie = Vi(C, j, O, O), ie ? (J.mode = Ri, fi) : (J.havedict = 1, Jt));
             };
             var va = Ui, ba = Gi, ya = Ni, xa = da, wa = Wi, Ea = ma, Sa = pa, Aa = ga, Ma = _a, Da = "pako inflate (from Nodeca project)", jt = {
               inflateReset: va,
@@ -42186,13 +42202,13 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
             var Ta = Ca;
             const ji = Object.prototype.toString, {
               Z_NO_FLUSH: ka,
-              Z_FINISH: La,
+              Z_FINISH: $a,
               Z_OK: vr,
               Z_STREAM_END: Kr,
               Z_NEED_DICT: Xr,
-              Z_STREAM_ERROR: $a,
+              Z_STREAM_ERROR: La,
               Z_DATA_ERROR: Ki,
-              Z_MEM_ERROR: Fa
+              Z_MEM_ERROR: Oa
             } = ve;
             function yr(C) {
               this.options = Er.assign({
@@ -42202,39 +42218,39 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               }, C || {});
               const j = this.options;
               j.raw && j.windowBits >= 0 && j.windowBits < 16 && (j.windowBits = -j.windowBits, j.windowBits === 0 && (j.windowBits = -15)), j.windowBits >= 0 && j.windowBits < 16 && !(C && C.windowBits) && (j.windowBits += 32), j.windowBits > 15 && j.windowBits < 48 && (j.windowBits & 15 || (j.windowBits |= 15)), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new ii(), this.strm.avail_out = 0;
-              let F = jt.inflateInit2(
+              let O = jt.inflateInit2(
                 this.strm,
                 j.windowBits
               );
-              if (F !== vr)
-                throw new Error(we[F]);
-              if (this.header = new Ta(), jt.inflateGetHeader(this.strm, this.header), j.dictionary && (typeof j.dictionary == "string" ? j.dictionary = pr.string2buf(j.dictionary) : ji.call(j.dictionary) === "[object ArrayBuffer]" && (j.dictionary = new Uint8Array(j.dictionary)), j.raw && (F = jt.inflateSetDictionary(this.strm, j.dictionary), F !== vr)))
-                throw new Error(we[F]);
+              if (O !== vr)
+                throw new Error(we[O]);
+              if (this.header = new Ta(), jt.inflateGetHeader(this.strm, this.header), j.dictionary && (typeof j.dictionary == "string" ? j.dictionary = pr.string2buf(j.dictionary) : ji.call(j.dictionary) === "[object ArrayBuffer]" && (j.dictionary = new Uint8Array(j.dictionary)), j.raw && (O = jt.inflateSetDictionary(this.strm, j.dictionary), O !== vr)))
+                throw new Error(we[O]);
             }
             yr.prototype.push = function(C, j) {
-              const F = this.strm, J = this.options.chunkSize, se = this.options.dictionary;
-              let ie, Le, Ee;
+              const O = this.strm, J = this.options.chunkSize, se = this.options.dictionary;
+              let ie, $e, Ee;
               if (this.ended) return !1;
-              for (j === ~~j ? Le = j : Le = j === !0 ? La : ka, ji.call(C) === "[object ArrayBuffer]" ? F.input = new Uint8Array(C) : F.input = C, F.next_in = 0, F.avail_in = F.input.length; ; ) {
-                for (F.avail_out === 0 && (F.output = new Uint8Array(J), F.next_out = 0, F.avail_out = J), ie = jt.inflate(F, Le), ie === Xr && se && (ie = jt.inflateSetDictionary(F, se), ie === vr ? ie = jt.inflate(F, Le) : ie === Ki && (ie = Xr)); F.avail_in > 0 && ie === Kr && F.state.wrap > 0 && C[F.next_in] !== 0; )
-                  jt.inflateReset(F), ie = jt.inflate(F, Le);
+              for (j === ~~j ? $e = j : $e = j === !0 ? $a : ka, ji.call(C) === "[object ArrayBuffer]" ? O.input = new Uint8Array(C) : O.input = C, O.next_in = 0, O.avail_in = O.input.length; ; ) {
+                for (O.avail_out === 0 && (O.output = new Uint8Array(J), O.next_out = 0, O.avail_out = J), ie = jt.inflate(O, $e), ie === Xr && se && (ie = jt.inflateSetDictionary(O, se), ie === vr ? ie = jt.inflate(O, $e) : ie === Ki && (ie = Xr)); O.avail_in > 0 && ie === Kr && O.state.wrap > 0 && C[O.next_in] !== 0; )
+                  jt.inflateReset(O), ie = jt.inflate(O, $e);
                 switch (ie) {
-                  case $a:
+                  case La:
                   case Ki:
                   case Xr:
-                  case Fa:
+                  case Oa:
                     return this.onEnd(ie), this.ended = !0, !1;
                 }
-                if (Ee = F.avail_out, F.next_out && (F.avail_out === 0 || ie === Kr))
+                if (Ee = O.avail_out, O.next_out && (O.avail_out === 0 || ie === Kr))
                   if (this.options.to === "string") {
-                    let tt = pr.utf8border(F.output, F.next_out), _e = F.next_out - tt, $e = pr.buf2string(F.output, tt);
-                    F.next_out = _e, F.avail_out = J - _e, _e && F.output.set(F.output.subarray(tt, tt + _e), 0), this.onData($e);
+                    let tt = pr.utf8border(O.output, O.next_out), _e = O.next_out - tt, Le = pr.buf2string(O.output, tt);
+                    O.next_out = _e, O.avail_out = J - _e, _e && O.output.set(O.output.subarray(tt, tt + _e), 0), this.onData(Le);
                   } else
-                    this.onData(F.output.length === F.next_out ? F.output : F.output.subarray(0, F.next_out));
+                    this.onData(O.output.length === O.next_out ? O.output : O.output.subarray(0, O.next_out));
                 if (!(ie === vr && Ee === 0)) {
                   if (ie === Kr)
                     return ie = jt.inflateEnd(this.strm), this.onEnd(ie), this.ended = !0, !0;
-                  if (F.avail_in === 0) break;
+                  if (O.avail_in === 0) break;
                 }
               }
               return !0;
@@ -42244,14 +42260,14 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
               C === vr && (this.options.to === "string" ? this.result = this.chunks.join("") : this.result = Er.flattenChunks(this.chunks)), this.chunks = [], this.err = C, this.msg = this.strm.msg;
             };
             function Zr(C, j) {
-              const F = new yr(j);
-              if (F.push(C), F.err) throw F.msg || we[F.err];
-              return F.result;
+              const O = new yr(j);
+              if (O.push(C), O.err) throw O.msg || we[O.err];
+              return O.result;
             }
-            function Oa(C, j) {
+            function Fa(C, j) {
               return j = j || {}, j.raw = !0, Zr(C, j);
             }
-            var za = yr, Ia = Zr, Ra = Oa, Pa = Zr, Ba = ve, Na = {
+            var za = yr, Ia = Zr, Ra = Fa, Pa = Zr, Ba = ve, Na = {
               Inflate: za,
               inflate: Ia,
               inflateRaw: Ra,
@@ -42308,20 +42324,23 @@ var ProteinSurface = ` + $3Dmol.ProteinSurface.toString() + `;
       return __webpack_exports__;
     })()
   ));
-})(_3Dmol);
-var _3DmolExports = _3Dmol.exports;
-const Dmol = /* @__PURE__ */ getDefaultExportFromCjs(_3DmolExports), {
+})(_3Dmol$1);
+var _3DmolExports = _3Dmol$1.exports;
+const _3Dmol = /* @__PURE__ */ getDefaultExportFromCjs(_3DmolExports), mol = /* @__PURE__ */ _mergeNamespaces({
+  __proto__: null,
+  default: _3Dmol
+}, [_3DmolExports]), {
   SvelteComponent: SvelteComponent$7,
   append_hydration: append_hydration$5,
   attr: attr$6,
   binding_callbacks: binding_callbacks$4,
   children: children$5,
   claim_element: claim_element$6,
-  claim_space: claim_space$5,
+  claim_space: claim_space$6,
   claim_text: claim_text$5,
   detach: detach$7,
   element: element$6,
-  get_svelte_dataset: get_svelte_dataset$2,
+  get_svelte_dataset: get_svelte_dataset$3,
   init: init$7,
   insert_hydration: insert_hydration$7,
   listen: listen$2,
@@ -42329,80 +42348,80 @@ const Dmol = /* @__PURE__ */ getDefaultExportFromCjs(_3DmolExports), {
   run_all: run_all$2,
   safe_not_equal: safe_not_equal$8,
   set_data: set_data$5,
-  space: space$5,
+  space: space$6,
   text: text$6,
   toggle_class: toggle_class$5
 } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$4, afterUpdate: afterUpdate$2 } = window.__gradio__svelte__internal;
-function create_if_block$5(n) {
-  let e, t = "Covalent Modification", r, a, s = '<svg data-slot="icon" fill="none" stroke-width="1.5" class="w-4 h-4 svelte-1jhdl43" stroke="currentColor" viewBox="0 0 24 24" xmlns="http://www.w3.org/2000/svg" aria-hidden="true"><path stroke-linecap="round" stroke-linejoin="round" d="M15.042 21.672 13.684 16.6m0 0-2.51 2.225.569-9.47 5.227 7.917-3.286-.672Zm-7.518-.267A8.25 8.25 0 1 1 20.25 10.5M8.288 14.212A5.25 5.25 0 1 1 17.25 10.5" class="svelte-1jhdl43"></path></svg> <span class="px-2 svelte-1jhdl43">click on atoms in viewer to select them</span>', h, o, d, v = '<svg xmlns="http://www.w3.org/2000/svg" fill="none" viewBox="0 0 24 24" stroke-width="1.5" stroke="currentColor" class="mx-1 h-4 w-4 svelte-1jhdl43"><path stroke-linecap="round" stroke-linejoin="round" d="m18.375 12.739-7.693 7.693a4.5 4.5 0 0 1-6.364-6.364l10.94-10.94A3 3 0 1 1 19.5 7.372L8.552 18.32m.009-.01-.01.01m5.699-9.941-7.81 7.81a1.5 1.5 0 0 0 2.112 2.13" class="svelte-1jhdl43"></path></svg> <span class="svelte-1jhdl43">Attachment atom</span>', f, y, A = '<svg xmlns="http://www.w3.org/2000/svg" fill="none" viewBox="0 0 24 24" stroke-width="1.5" stroke="currentColor" class="mx-1 h-4 w-4 svelte-1jhdl43"><path stroke-linecap="round" stroke-linejoin="round" d="m14.74 9-.346 9m-4.788 0L9.26 9m9.968-3.21c.342.052.682.107 1.022.166m-1.022-.165L18.16 19.673a2.25 2.25 0 0 1-2.244 2.077H8.084a2.25 2.25 0 0 1-2.244-2.077L4.772 5.79m14.456 0a48.108 48.108 0 0 0-3.478-.397m-12 .562c.34-.059.68-.114 1.022-.165m0 0a48.11 48.11 0 0 1 3.478-.397m7.5 0v-.916c0-1.18-.91-2.164-2.09-2.201a51.964 51.964 0 0 0-3.32 0c-1.18.037-2.09 1.022-2.09 2.201v.916m7.5 0a48.667 48.667 0 0 0-7.5 0" class="svelte-1jhdl43"></path></svg> <span class="svelte-1jhdl43">Atoms to delete</span>', x, M, m, l, u = '<tr class="svelte-1jhdl43"><th scope="col" class="px-6 py-3 svelte-1jhdl43"></th> <th scope="col" class="px-6 py-3 svelte-1jhdl43">index</th></tr>', g, p, b, c, _ = "Attachment atom", E, w, k, L, $, z = "Deleted atoms", O, R, P, U;
+function create_if_block$6(n) {
+  let e, t = "Covalent Modification", r, a, s = '<svg data-slot="icon" fill="none" stroke-width="1.5" class="w-4 h-4 svelte-oz981t" stroke="currentColor" viewBox="0 0 24 24" xmlns="http://www.w3.org/2000/svg" aria-hidden="true"><path stroke-linecap="round" stroke-linejoin="round" d="M15.042 21.672 13.684 16.6m0 0-2.51 2.225.569-9.47 5.227 7.917-3.286-.672Zm-7.518-.267A8.25 8.25 0 1 1 20.25 10.5M8.288 14.212A5.25 5.25 0 1 1 17.25 10.5" class="svelte-oz981t"></path></svg> <span class="px-2 svelte-oz981t">click on atoms in viewer to select them</span>', h, o, d, v = '<svg xmlns="http://www.w3.org/2000/svg" fill="none" viewBox="0 0 24 24" stroke-width="1.5" stroke="currentColor" class="mx-1 h-4 w-4 svelte-oz981t"><path stroke-linecap="round" stroke-linejoin="round" d="m18.375 12.739-7.693 7.693a4.5 4.5 0 0 1-6.364-6.364l10.94-10.94A3 3 0 1 1 19.5 7.372L8.552 18.32m.009-.01-.01.01m5.699-9.941-7.81 7.81a1.5 1.5 0 0 0 2.112 2.13" class="svelte-oz981t"></path></svg> <span class="svelte-oz981t">Attachment atom</span>', f, y, A = '<svg xmlns="http://www.w3.org/2000/svg" fill="none" viewBox="0 0 24 24" stroke-width="1.5" stroke="currentColor" class="mx-1 h-4 w-4 svelte-oz981t"><path stroke-linecap="round" stroke-linejoin="round" d="m14.74 9-.346 9m-4.788 0L9.26 9m9.968-3.21c.342.052.682.107 1.022.166m-1.022-.165L18.16 19.673a2.25 2.25 0 0 1-2.244 2.077H8.084a2.25 2.25 0 0 1-2.244-2.077L4.772 5.79m14.456 0a48.108 48.108 0 0 0-3.478-.397m-12 .562c.34-.059.68-.114 1.022-.165m0 0a48.11 48.11 0 0 1 3.478-.397m7.5 0v-.916c0-1.18-.91-2.164-2.09-2.201a51.964 51.964 0 0 0-3.32 0c-1.18.037-2.09 1.022-2.09 2.201v.916m7.5 0a48.667 48.667 0 0 0-7.5 0" class="svelte-oz981t"></path></svg> <span class="svelte-oz981t">Atoms to delete</span>', x, M, m, l, u = '<tr class="svelte-oz981t"><th scope="col" class="px-6 py-3 svelte-oz981t"></th> <th scope="col" class="px-6 py-3 svelte-oz981t">index</th></tr>', p, g, b, c, _ = "Attachment atom", E, w, k, $, L, z = "Deleted atoms", F, R, P, U;
   function N(Q, te) {
     return (
       /*attachmentIndex*/
-      Q[1] !== null ? create_if_block_2$3 : create_else_block_1$2
+      Q[1] !== null ? create_if_block_2$4 : create_else_block_1$3
     );
   }
   let B = N(n), W = B(n);
   function V(Q, te) {
     return (
       /*deleteIndexes*/
-      Q[2].length > 0 ? create_if_block_1$4 : create_else_block$4
+      Q[2].length > 0 ? create_if_block_1$5 : create_else_block$5
     );
   }
   let G = V(n), H = G(n);
   return {
     c() {
-      e = element$6("div"), e.textContent = t, r = space$5(), a = element$6("div"), a.innerHTML = s, h = space$5(), o = element$6("div"), d = element$6("button"), d.innerHTML = v, f = space$5(), y = element$6("button"), y.innerHTML = A, x = space$5(), M = element$6("div"), m = element$6("table"), l = element$6("thead"), l.innerHTML = u, g = space$5(), p = element$6("tbody"), b = element$6("tr"), c = element$6("th"), c.textContent = _, E = space$5(), w = element$6("td"), W.c(), k = space$5(), L = element$6("tr"), $ = element$6("th"), $.textContent = z, O = space$5(), R = element$6("td"), H.c(), this.h();
+      e = element$6("div"), e.textContent = t, r = space$6(), a = element$6("div"), a.innerHTML = s, h = space$6(), o = element$6("div"), d = element$6("button"), d.innerHTML = v, f = space$6(), y = element$6("button"), y.innerHTML = A, x = space$6(), M = element$6("div"), m = element$6("table"), l = element$6("thead"), l.innerHTML = u, p = space$6(), g = element$6("tbody"), b = element$6("tr"), c = element$6("th"), c.textContent = _, E = space$6(), w = element$6("td"), W.c(), k = space$6(), $ = element$6("tr"), L = element$6("th"), L.textContent = z, F = space$6(), R = element$6("td"), H.c(), this.h();
     },
     l(Q) {
-      e = claim_element$6(Q, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(e) !== "svelte-1ws80r8" && (e.textContent = t), r = claim_space$5(Q), a = claim_element$6(Q, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(a) !== "svelte-au1964" && (a.innerHTML = s), h = claim_space$5(Q), o = claim_element$6(Q, "DIV", { class: !0 });
+      e = claim_element$6(Q, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$3(e) !== "svelte-1ws80r8" && (e.textContent = t), r = claim_space$6(Q), a = claim_element$6(Q, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$3(a) !== "svelte-au1964" && (a.innerHTML = s), h = claim_space$6(Q), o = claim_element$6(Q, "DIV", { class: !0 });
       var te = children$5(o);
       d = claim_element$6(te, "BUTTON", {
         class: !0,
         id: !0,
         "data-svelte-h": !0
-      }), get_svelte_dataset$2(d) !== "svelte-1x319mo" && (d.innerHTML = v), f = claim_space$5(te), y = claim_element$6(te, "BUTTON", {
+      }), get_svelte_dataset$3(d) !== "svelte-1x319mo" && (d.innerHTML = v), f = claim_space$6(te), y = claim_element$6(te, "BUTTON", {
         class: !0,
         id: !0,
         "data-svelte-h": !0
-      }), get_svelte_dataset$2(y) !== "svelte-vlrg5g" && (y.innerHTML = A), te.forEach(detach$7), x = claim_space$5(Q), M = claim_element$6(Q, "DIV", { class: !0 });
+      }), get_svelte_dataset$3(y) !== "svelte-vlrg5g" && (y.innerHTML = A), te.forEach(detach$7), x = claim_space$6(Q), M = claim_element$6(Q, "DIV", { class: !0 });
       var ee = children$5(M);
       m = claim_element$6(ee, "TABLE", { class: !0 });
       var ce = children$5(m);
-      l = claim_element$6(ce, "THEAD", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(l) !== "svelte-1cl8b2m" && (l.innerHTML = u), g = claim_space$5(ce), p = claim_element$6(ce, "TBODY", { class: !0 });
-      var fe = children$5(p);
+      l = claim_element$6(ce, "THEAD", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$3(l) !== "svelte-1cl8b2m" && (l.innerHTML = u), p = claim_space$6(ce), g = claim_element$6(ce, "TBODY", { class: !0 });
+      var fe = children$5(g);
       b = claim_element$6(fe, "TR", { class: !0 });
       var oe = children$5(b);
       c = claim_element$6(oe, "TH", {
         scope: !0,
         class: !0,
         "data-svelte-h": !0
-      }), get_svelte_dataset$2(c) !== "svelte-1j0kl0r" && (c.textContent = _), E = claim_space$5(oe), w = claim_element$6(oe, "TD", { class: !0 });
+      }), get_svelte_dataset$3(c) !== "svelte-1j0kl0r" && (c.textContent = _), E = claim_space$6(oe), w = claim_element$6(oe, "TD", { class: !0 });
       var he = children$5(w);
-      W.l(he), he.forEach(detach$7), oe.forEach(detach$7), k = claim_space$5(fe), L = claim_element$6(fe, "TR", { class: !0 });
-      var Ae = children$5(L);
-      $ = claim_element$6(Ae, "TH", {
+      W.l(he), he.forEach(detach$7), oe.forEach(detach$7), k = claim_space$6(fe), $ = claim_element$6(fe, "TR", { class: !0 });
+      var Ae = children$5($);
+      L = claim_element$6(Ae, "TH", {
         scope: !0,
         class: !0,
         "data-svelte-h": !0
-      }), get_svelte_dataset$2($) !== "svelte-nv6kl6" && ($.textContent = z), O = claim_space$5(Ae), R = claim_element$6(Ae, "TD", { class: !0 });
+      }), get_svelte_dataset$3(L) !== "svelte-nv6kl6" && (L.textContent = z), F = claim_space$6(Ae), R = claim_element$6(Ae, "TD", { class: !0 });
       var Se = children$5(R);
       H.l(Se), Se.forEach(detach$7), Ae.forEach(detach$7), fe.forEach(detach$7), ce.forEach(detach$7), ee.forEach(detach$7), this.h();
     },
     h() {
-      attr$6(e, "class", "w-full text-center text-lg mb-2 svelte-1jhdl43"), attr$6(a, "class", "flex items-center space-x-2 justify-center mb-2 text-xs svelte-1jhdl43"), attr$6(d, "class", "w-1/2 flex items-center rounded-l-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-1jhdl43"), attr$6(d, "id", "attach"), toggle_class$5(
+      attr$6(e, "class", "w-full text-center text-lg mb-2 svelte-oz981t"), attr$6(a, "class", "flex items-center space-x-2 justify-center mb-2 text-xs svelte-oz981t"), attr$6(d, "class", "w-1/2 flex items-center rounded-l-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-oz981t"), attr$6(d, "id", "attach"), toggle_class$5(
         d,
         "active",
         /*mode*/
         n[3] === "attach"
-      ), attr$6(y, "class", "w-1/2 flex items-center rounded-r-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-1jhdl43"), attr$6(y, "id", "delete"), toggle_class$5(
+      ), attr$6(y, "class", "w-1/2 flex items-center rounded-r-full px-4 py-2 transition-colors duration-300 ease-in hover:text-orange-600 focus:text-orange-600 focus:outline-none svelte-oz981t"), attr$6(y, "id", "delete"), toggle_class$5(
         y,
         "active",
         /*mode*/
         n[3] === "delete"
-      ), attr$6(o, "class", "flex rounded-full border-2 border-gray-200 bg-gray-200 text-sm leading-none text-gray-500 svelte-1jhdl43"), attr$6(l, "class", "text-xs text-gray-700 uppercase bg-gray-50 dark:bg-gray-700 dark:text-gray-400 svelte-1jhdl43"), attr$6(c, "scope", "row"), attr$6(c, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-1jhdl43"), attr$6(w, "class", "px-6 py-4 font-mono svelte-1jhdl43"), attr$6(b, "class", "bg-white border-b dark:bg-gray-800 dark:border-gray-700 svelte-1jhdl43"), attr$6($, "scope", "row"), attr$6($, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-1jhdl43"), attr$6(R, "class", "px-6 py-4 font-mono svelte-1jhdl43"), attr$6(L, "class", "bg-white dark:bg-gray-800 svelte-1jhdl43"), attr$6(p, "class", "svelte-1jhdl43"), attr$6(m, "class", "w-full text-sm text-left rtl:text-right text-gray-500 dark:text-gray-400 svelte-1jhdl43"), attr$6(M, "class", "relative overflow-x-auto mt-3 svelte-1jhdl43");
+      ), attr$6(o, "class", "flex rounded-full border-2 border-gray-200 bg-gray-200 text-sm leading-none text-gray-500 svelte-oz981t"), attr$6(l, "class", "text-xs text-gray-700 uppercase bg-gray-50 dark:bg-gray-700 dark:text-gray-400 svelte-oz981t"), attr$6(c, "scope", "row"), attr$6(c, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-oz981t"), attr$6(w, "class", "px-6 py-4 font-mono svelte-oz981t"), attr$6(b, "class", "bg-white border-b dark:bg-gray-800 dark:border-gray-700 svelte-oz981t"), attr$6(L, "scope", "row"), attr$6(L, "class", "px-6 py-4 font-medium text-gray-900 whitespace-nowrap dark:text-white text-right svelte-oz981t"), attr$6(R, "class", "px-6 py-4 font-mono svelte-oz981t"), attr$6($, "class", "bg-white dark:bg-gray-800 svelte-oz981t"), attr$6(g, "class", "svelte-oz981t"), attr$6(m, "class", "w-full text-sm text-left rtl:text-right text-gray-500 dark:text-gray-400 svelte-oz981t"), attr$6(M, "class", "relative overflow-x-auto mt-3 svelte-oz981t");
     },
     m(Q, te) {
-      insert_hydration$7(Q, e, te), insert_hydration$7(Q, r, te), insert_hydration$7(Q, a, te), insert_hydration$7(Q, h, te), insert_hydration$7(Q, o, te), append_hydration$5(o, d), append_hydration$5(o, f), append_hydration$5(o, y), insert_hydration$7(Q, x, te), insert_hydration$7(Q, M, te), append_hydration$5(M, m), append_hydration$5(m, l), append_hydration$5(m, g), append_hydration$5(m, p), append_hydration$5(p, b), append_hydration$5(b, c), append_hydration$5(b, E), append_hydration$5(b, w), W.m(w, null), append_hydration$5(p, k), append_hydration$5(p, L), append_hydration$5(L, $), append_hydration$5(L, O), append_hydration$5(L, R), H.m(R, null), P || (U = [
+      insert_hydration$7(Q, e, te), insert_hydration$7(Q, r, te), insert_hydration$7(Q, a, te), insert_hydration$7(Q, h, te), insert_hydration$7(Q, o, te), append_hydration$5(o, d), append_hydration$5(o, f), append_hydration$5(o, y), insert_hydration$7(Q, x, te), insert_hydration$7(Q, M, te), append_hydration$5(M, m), append_hydration$5(m, l), append_hydration$5(m, p), append_hydration$5(m, g), append_hydration$5(g, b), append_hydration$5(b, c), append_hydration$5(b, E), append_hydration$5(b, w), W.m(w, null), append_hydration$5(g, k), append_hydration$5(g, $), append_hydration$5($, L), append_hydration$5($, F), append_hydration$5($, R), H.m(R, null), P || (U = [
         listen$2(
           d,
           "click",
@@ -42437,7 +42456,7 @@ function create_if_block$5(n) {
     }
   };
 }
-function create_else_block_1$2(n) {
+function create_else_block_1$3(n) {
   let e;
   return {
     c() {
@@ -42455,7 +42474,7 @@ function create_else_block_1$2(n) {
     }
   };
 }
-function create_if_block_2$3(n) {
+function create_if_block_2$4(n) {
   let e;
   return {
     c() {
@@ -42487,7 +42506,7 @@ function create_if_block_2$3(n) {
     }
   };
 }
-function create_else_block$4(n) {
+function create_else_block$5(n) {
   let e;
   return {
     c() {
@@ -42505,7 +42524,7 @@ function create_else_block$4(n) {
     }
   };
 }
-function create_if_block_1$4(n) {
+function create_if_block_1$5(n) {
   let e = (
     /*deleteIndexes*/
     n[2].join(", ") + ""
@@ -42533,30 +42552,30 @@ function create_if_block_1$4(n) {
 function create_fragment$7(n) {
   let e, t, r, a, s, h = (
     /*showCovMod*/
-    n[0] > -1 && create_if_block$5(n)
+    n[0] > -1 && create_if_block$6(n)
   );
   return {
     c() {
-      e = element$6("div"), t = element$6("div"), r = element$6("div"), a = space$5(), s = element$6("div"), h && h.c(), this.h();
+      e = element$6("div"), t = element$6("div"), r = element$6("div"), a = space$6(), s = element$6("div"), h && h.c(), this.h();
     },
     l(o) {
       e = claim_element$6(o, "DIV", { class: !0 });
       var d = children$5(e);
       t = claim_element$6(d, "DIV", { class: !0 });
       var v = children$5(t);
-      r = claim_element$6(v, "DIV", { class: !0 }), children$5(r).forEach(detach$7), v.forEach(detach$7), a = claim_space$5(d), s = claim_element$6(d, "DIV", { class: !0 });
+      r = claim_element$6(v, "DIV", { class: !0 }), children$5(r).forEach(detach$7), v.forEach(detach$7), a = claim_space$6(d), s = claim_element$6(d, "DIV", { class: !0 });
       var f = children$5(s);
       h && h.l(f), f.forEach(detach$7), d.forEach(detach$7), this.h();
     },
     h() {
-      attr$6(r, "class", "mol-canvas svelte-1jhdl43"), attr$6(t, "class", "relative svelte-1jhdl43"), attr$6(s, "class", "flex flex-col justify-center svelte-1jhdl43"), attr$6(e, "class", "mol-wrapper svelte-1jhdl43");
+      attr$6(r, "class", "mol-canvas svelte-oz981t"), attr$6(t, "class", "relative svelte-oz981t"), attr$6(s, "class", "flex flex-col justify-center svelte-oz981t"), attr$6(e, "class", "mol-wrapper svelte-oz981t");
     },
     m(o, d) {
       insert_hydration$7(o, e, d), append_hydration$5(e, t), append_hydration$5(t, r), n[6](r), append_hydration$5(e, a), append_hydration$5(e, s), h && h.m(s, null);
     },
     p(o, [d]) {
       /*showCovMod*/
-      o[0] > -1 ? h ? h.p(o, d) : (h = create_if_block$5(o), h.c(), h.m(s, null)) : h && (h.d(1), h = null);
+      o[0] > -1 ? h ? h.p(o, d) : (h = create_if_block$6(o), h.c(), h.m(s, null)) : h && (h.d(1), h = null);
     },
     i: noop$7,
     o: noop$7,
@@ -42567,43 +42586,45 @@ function create_fragment$7(n) {
 }
 function instance$7(n, e, t) {
   const r = createEventDispatcher$4();
-  let a = null, s = [], h = "attach";
-  function o(m) {
-    m.setStyle({ stick: {} }), f > -1 && (a !== null && m.addStyle({ index: a }, { sphere: { color: "blue", scale: 0.5 } }), m.addStyle({ index: s }, { sphere: { color: "red", scale: 0.5 } }), r("updateMol", {
-      attachmentIndex: a,
-      deleteIndexes: s,
-      index: f,
-      mol: m.exportJSON()
+  let a = mol;
+  console.log(a);
+  let s = null, h = [], o = "attach";
+  function d(l) {
+    l.setStyle({ stick: {} }), y > -1 && (s !== null && l.addStyle({ index: s }, { sphere: { color: "blue", scale: 0.5 } }), l.addStyle({ index: h }, { sphere: { color: "red", scale: 0.5 } }), r("updateMol", {
+      attachmentIndex: s,
+      deleteIndexes: h,
+      index: y,
+      mol: l.exportJSON()
     }));
   }
-  function d(m, l) {
-    let u = Dmol.createViewer(l, {});
-    return u.addModel(m, "sdf"), o(u), u.setBackgroundColor("white"), u.zoomTo(), u.getModel(0).setClickable({}, !0, function(g, p, b, c) {
-      f > -1 && (h === "attach" ? t(1, a = g.serial) : (s.includes(g.serial) ? t(2, s = s.filter((_) => _ !== g.serial)) : s.push(g.serial), t(2, s), o(p)));
-    }), u.render(), u;
+  function v(l, u) {
+    let p = a.createViewer(u, {});
+    return p.addModel(l, "sdf"), d(p), p.setBackgroundColor("white"), p.zoomTo(), p.getModel(0).setClickable({}, !0, function(g, b, c, _) {
+      y > -1 && (o === "attach" ? t(1, s = g.serial) : (h.includes(g.serial) ? t(2, h = h.filter((E) => E !== g.serial)) : h.push(g.serial), t(2, h), d(b)));
+    }), p.render(), p;
   }
-  let { molvalue: v = "" } = e, { showCovMod: f = -1 } = e, y = null;
+  let { molvalue: f = "" } = e, { showCovMod: y = -1 } = e, A = null;
   afterUpdate$2(() => {
-    d(v, y);
+    v(f, A);
   });
-  function A(m) {
-    binding_callbacks$4[m ? "unshift" : "push"](() => {
-      y = m, t(4, y);
+  function x(l) {
+    binding_callbacks$4[l ? "unshift" : "push"](() => {
+      A = l, t(4, A);
     });
   }
-  const x = () => t(3, h = "attach"), M = () => t(3, h = "delete");
-  return n.$$set = (m) => {
-    "molvalue" in m && t(5, v = m.molvalue), "showCovMod" in m && t(0, f = m.showCovMod);
+  const M = () => t(3, o = "attach"), m = () => t(3, o = "delete");
+  return n.$$set = (l) => {
+    "molvalue" in l && t(5, f = l.molvalue), "showCovMod" in l && t(0, y = l.showCovMod);
   }, [
-    f,
-    a,
+    y,
     s,
     h,
-    y,
-    v,
+    o,
     A,
+    f,
     x,
-    M
+    M,
+    m
   ];
 }
 class Molecule extends SvelteComponent$7 {
@@ -42620,17 +42641,17 @@ const {
   children: children$4,
   claim_component: claim_component$4,
   claim_element: claim_element$5,
-  claim_space: claim_space$4,
+  claim_space: claim_space$5,
   claim_svg_element: claim_svg_element$1,
   claim_text: claim_text$4,
   create_component: create_component$4,
   destroy_component: destroy_component$4,
-  destroy_each: destroy_each$1,
+  destroy_each: destroy_each$2,
   detach: detach$6,
   element: element$5,
-  empty: empty$3,
-  ensure_array_like: ensure_array_like$1,
-  get_svelte_dataset: get_svelte_dataset$1,
+  empty: empty$4,
+  ensure_array_like: ensure_array_like$2,
+  get_svelte_dataset: get_svelte_dataset$2,
   group_outros: group_outros$4,
   init: init$6,
   insert_hydration: insert_hydration$6,
@@ -42643,14 +42664,14 @@ const {
   select_value,
   set_data: set_data$4,
   set_input_value: set_input_value$1,
-  space: space$4,
+  space: space$5,
   svg_element: svg_element$1,
   text: text$5,
   toggle_class: toggle_class$4,
   transition_in: transition_in$4,
   transition_out: transition_out$4
 } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$3 } = window.__gradio__svelte__internal;
-function get_each_context$1(n, e, t) {
+function get_each_context$2(n, e, t) {
   const r = n.slice();
   return r[35] = e[t], r[36] = e, r[37] = t, r;
 }
@@ -42691,10 +42712,10 @@ function create_if_block_11$1(n) {
   let a = r(n, [-1, -1]), s = a(n);
   return {
     c() {
-      s.c(), t = empty$3();
+      s.c(), t = empty$4();
     },
     l(h) {
-      s.l(h), t = empty$3();
+      s.l(h), t = empty$4();
     },
     m(h, o) {
       s.m(h, o), insert_hydration$6(h, t, o);
@@ -42811,14 +42832,14 @@ function create_if_block_8$1(n) {
   };
 }
 function create_if_block_10$1(n) {
-  let e, t, r, a, s = "- or -", h, o, d, v, f = "- or -", y, A, x, M, m, l = "- or -", u, g, p = "Metal ion", b, c, _, E, w;
-  function k(...O) {
+  let e, t, r, a, s = "- or -", h, o, d, v, f = "- or -", y, A, x, M, m, l = "- or -", u, p, g = "Metal ion", b, c, _, E, w;
+  function k(...F) {
     return (
       /*input_handler_1*/
       n[17](
         /*i*/
         n[37],
-        ...O
+        ...F
       )
     );
   }
@@ -42835,39 +42856,39 @@ function create_if_block_10$1(n) {
     /*handleMessage*/
     n[13]
   );
-  function L(...O) {
+  function $(...F) {
     return (
       /*input_handler_2*/
       n[18](
         /*i*/
         n[37],
-        ...O
+        ...F
       )
     );
   }
-  let $ = ensure_array_like$1(
+  let L = ensure_array_like$2(
     /*metals*/
     n[8]
   ), z = [];
-  for (let O = 0; O < $.length; O += 1)
-    z[O] = create_each_block_6(get_each_context_6(n, $, O));
+  for (let F = 0; F < L.length; F += 1)
+    z[F] = create_each_block_6(get_each_context_6(n, L, F));
   return {
     c() {
-      e = element$5("textarea"), r = space$4(), a = element$5("div"), a.textContent = s, h = space$4(), create_component$4(o.$$.fragment), d = space$4(), v = element$5("div"), v.textContent = f, y = space$4(), A = element$5("textarea"), M = space$4(), m = element$5("div"), m.textContent = l, u = space$4(), g = element$5("div"), g.textContent = p, b = space$4(), c = element$5("div");
-      for (let O = 0; O < z.length; O += 1)
-        z[O].c();
+      e = element$5("textarea"), r = space$5(), a = element$5("div"), a.textContent = s, h = space$5(), create_component$4(o.$$.fragment), d = space$5(), v = element$5("div"), v.textContent = f, y = space$5(), A = element$5("textarea"), M = space$5(), m = element$5("div"), m.textContent = l, u = space$5(), p = element$5("div"), p.textContent = g, b = space$5(), c = element$5("div");
+      for (let F = 0; F < z.length; F += 1)
+        z[F].c();
       this.h();
     },
-    l(O) {
-      e = claim_element$5(O, "TEXTAREA", {
+    l(F) {
+      e = claim_element$5(F, "TEXTAREA", {
         rows: !0,
         class: !0,
         placeholder: !0
-      }), children$4(e).forEach(detach$6), r = claim_space$4(O), a = claim_element$5(O, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(a) !== "svelte-1f0b7yn" && (a.textContent = s), h = claim_space$4(O), claim_component$4(o.$$.fragment, O), d = claim_space$4(O), v = claim_element$5(O, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(v) !== "svelte-1f0b7yn" && (v.textContent = f), y = claim_space$4(O), A = claim_element$5(O, "TEXTAREA", {
+      }), children$4(e).forEach(detach$6), r = claim_space$5(F), a = claim_element$5(F, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(a) !== "svelte-1f0b7yn" && (a.textContent = s), h = claim_space$5(F), claim_component$4(o.$$.fragment, F), d = claim_space$5(F), v = claim_element$5(F, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(v) !== "svelte-1f0b7yn" && (v.textContent = f), y = claim_space$5(F), A = claim_element$5(F, "TEXTAREA", {
         rows: !0,
         class: !0,
         placeholder: !0
-      }), children$4(A).forEach(detach$6), M = claim_space$4(O), m = claim_element$5(O, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(m) !== "svelte-1f0b7yn" && (m.textContent = l), u = claim_space$4(O), g = claim_element$5(O, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(g) !== "svelte-5ik8xi" && (g.textContent = p), b = claim_space$4(O), c = claim_element$5(O, "DIV", { class: !0 });
+      }), children$4(A).forEach(detach$6), M = claim_space$5(F), m = claim_element$5(F, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(m) !== "svelte-1f0b7yn" && (m.textContent = l), u = claim_space$5(F), p = claim_element$5(F, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(p) !== "svelte-5ik8xi" && (p.textContent = g), b = claim_space$5(F), c = claim_element$5(F, "DIV", { class: !0 });
       var R = children$4(c);
       for (let P = 0; P < z.length; P += 1)
         z[P].l(R);
@@ -42876,46 +42897,46 @@ function create_if_block_10$1(n) {
     h() {
       attr$5(e, "rows", "1"), attr$5(e, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-bt9x4p"), attr$5(e, "placeholder", "SMILES like CCC ..."), e.value = t = /*item*/
       n[48].smiles, attr$5(a, "class", "text-center text-gray-400 w-full my-2 svelte-bt9x4p"), attr$5(v, "class", "text-center text-gray-400 w-full my-2 svelte-bt9x4p"), attr$5(A, "rows", "3"), attr$5(A, "class", "block p-2.5 w-full text-sm text-gray-900 bg-gray-50 rounded-lg border border-gray-300 focus:ring-blue-500 focus:border-blue-500 dark:bg-gray-700 dark:border-gray-600 dark:placeholder-gray-400 dark:text-white dark:focus:ring-blue-500 dark:focus:border-blue-500 svelte-bt9x4p"), attr$5(A, "placeholder", "SDF format 3D molecule ..."), A.value = x = /*item*/
-      n[48].sdf, attr$5(m, "class", "text-center text-gray-400 w-full my-2 svelte-bt9x4p"), attr$5(g, "class", "text-center text-gray-600 font-bold mb-2 svelte-bt9x4p"), attr$5(c, "class", "flex justify-center space-x-2 svelte-bt9x4p");
+      n[48].sdf, attr$5(m, "class", "text-center text-gray-400 w-full my-2 svelte-bt9x4p"), attr$5(p, "class", "text-center text-gray-600 font-bold mb-2 svelte-bt9x4p"), attr$5(c, "class", "flex justify-center space-x-2 svelte-bt9x4p");
     },
-    m(O, R) {
-      insert_hydration$6(O, e, R), insert_hydration$6(O, r, R), insert_hydration$6(O, a, R), insert_hydration$6(O, h, R), mount_component$4(o, O, R), insert_hydration$6(O, d, R), insert_hydration$6(O, v, R), insert_hydration$6(O, y, R), insert_hydration$6(O, A, R), insert_hydration$6(O, M, R), insert_hydration$6(O, m, R), insert_hydration$6(O, u, R), insert_hydration$6(O, g, R), insert_hydration$6(O, b, R), insert_hydration$6(O, c, R);
+    m(F, R) {
+      insert_hydration$6(F, e, R), insert_hydration$6(F, r, R), insert_hydration$6(F, a, R), insert_hydration$6(F, h, R), mount_component$4(o, F, R), insert_hydration$6(F, d, R), insert_hydration$6(F, v, R), insert_hydration$6(F, y, R), insert_hydration$6(F, A, R), insert_hydration$6(F, M, R), insert_hydration$6(F, m, R), insert_hydration$6(F, u, R), insert_hydration$6(F, p, R), insert_hydration$6(F, b, R), insert_hydration$6(F, c, R);
       for (let P = 0; P < z.length; P += 1)
         z[P] && z[P].m(c, null);
       _ = !0, E || (w = [
         listen$1(e, "input", k),
-        listen$1(A, "input", L)
+        listen$1(A, "input", $)
       ], E = !0);
     },
-    p(O, R) {
-      if (n = O, (!_ || R[0] & /*vals*/
+    p(F, R) {
+      if (n = F, (!_ || R[0] & /*vals*/
       1 && t !== (t = /*item*/
       n[48].smiles)) && (e.value = t), (!_ || R[0] & /*vals*/
       1 && x !== (x = /*item*/
       n[48].sdf)) && (A.value = x), R[0] & /*vals, metals, dispatch*/
       289) {
-        $ = ensure_array_like$1(
+        L = ensure_array_like$2(
           /*metals*/
           n[8]
         );
         let P;
-        for (P = 0; P < $.length; P += 1) {
-          const U = get_each_context_6(n, $, P);
+        for (P = 0; P < L.length; P += 1) {
+          const U = get_each_context_6(n, L, P);
           z[P] ? z[P].p(U, R) : (z[P] = create_each_block_6(U), z[P].c(), z[P].m(c, null));
         }
         for (; P < z.length; P += 1)
           z[P].d(1);
-        z.length = $.length;
+        z.length = L.length;
       }
     },
-    i(O) {
-      _ || (transition_in$4(o.$$.fragment, O), _ = !0);
+    i(F) {
+      _ || (transition_in$4(o.$$.fragment, F), _ = !0);
     },
-    o(O) {
-      transition_out$4(o.$$.fragment, O), _ = !1;
+    o(F) {
+      transition_out$4(o.$$.fragment, F), _ = !1;
     },
-    d(O) {
-      O && (detach$6(e), detach$6(r), detach$6(a), detach$6(h), detach$6(d), detach$6(v), detach$6(y), detach$6(A), detach$6(M), detach$6(m), detach$6(u), detach$6(g), detach$6(b), detach$6(c)), destroy_component$4(o, O), destroy_each$1(z, O), E = !1, run_all$1(w);
+    d(F) {
+      F && (detach$6(e), detach$6(r), detach$6(a), detach$6(h), detach$6(d), detach$6(v), detach$6(y), detach$6(A), detach$6(M), detach$6(m), detach$6(u), detach$6(p), detach$6(b), detach$6(c)), destroy_component$4(o, F), destroy_each$2(z, F), E = !1, run_all$1(w);
     }
   };
 }
@@ -42980,14 +43001,14 @@ function create_each_block_6(n) {
   }
   return {
     c() {
-      e = element$5("button"), t = element$5("span"), a = text$5(r), s = space$4(), this.h();
+      e = element$5("button"), t = element$5("span"), a = text$5(r), s = space$5(), this.h();
     },
     l(v) {
       e = claim_element$5(v, "BUTTON", { class: !0 });
       var f = children$4(e);
       t = claim_element$5(f, "SPAN", { class: !0 });
       var y = children$4(t);
-      a = claim_text$4(y, r), y.forEach(detach$6), s = claim_space$4(f), f.forEach(detach$6), this.h();
+      a = claim_text$4(y, r), y.forEach(detach$6), s = claim_space$5(f), f.forEach(detach$6), this.h();
     },
     h() {
       attr$5(t, "class", "font-medium text-gray-600 dark:text-gray-300 svelte-bt9x4p"), attr$5(e, "class", "relative inline-flex items-center justify-center w-10 h-10 overflow-hidden rounded-full dark:bg-gray-600 svelte-bt9x4p"), toggle_class$4(
@@ -43029,9 +43050,9 @@ function create_each_block_6(n) {
     }
   };
 }
-function create_if_block_3$2(n) {
+function create_if_block_3$3(n) {
   let e, t, r, a, s;
-  const h = [create_if_block_4$2, create_if_block_6$1], o = [];
+  const h = [create_if_block_4$3, create_if_block_6$1], o = [];
   function d(v, f) {
     return f[0] & /*vals*/
     1 && (e = null), e == null && (e = !!["DNA", "RNA", "protein"].includes(
@@ -43044,10 +43065,10 @@ function create_if_block_3$2(n) {
   }
   return ~(t = d(n, [-1, -1])) && (r = o[t] = h[t](n)), {
     c() {
-      r && r.c(), a = empty$3();
+      r && r.c(), a = empty$4();
     },
     l(v) {
-      r && r.l(v), a = empty$3();
+      r && r.l(v), a = empty$4();
     },
     m(v, f) {
       ~t && o[t].m(v, f), insert_hydration$6(v, a, f), s = !0;
@@ -43076,10 +43097,10 @@ function create_if_block_6$1(n) {
   );
   return {
     c() {
-      r && r.c(), e = empty$3();
+      r && r.c(), e = empty$4();
     },
     l(a) {
-      r && r.l(a), e = empty$3();
+      r && r.l(a), e = empty$4();
     },
     m(a, s) {
       r && r.m(a, s), insert_hydration$6(a, e, s), t = !0;
@@ -43102,10 +43123,10 @@ function create_if_block_6$1(n) {
     }
   };
 }
-function create_if_block_4$2(n) {
+function create_if_block_4$3(n) {
   let e, t, r, a = (
     /*item*/
-    n[48].sequence !== "" && create_if_block_5$2(n)
+    n[48].sequence !== "" && create_if_block_5$3(n)
   );
   return {
     c() {
@@ -43139,7 +43160,7 @@ function create_if_block_4$2(n) {
     p(s, h) {
       /*item*/
       s[48].sequence !== "" ? a ? (a.p(s, h), h[0] & /*vals*/
-      1 && transition_in$4(a, 1)) : (a = create_if_block_5$2(s), a.c(), transition_in$4(a, 1), a.m(t, null)) : a && (group_outros$4(), transition_out$4(a, 1, 1, () => {
+      1 && transition_in$4(a, 1)) : (a = create_if_block_5$3(s), a.c(), transition_in$4(a, 1), a.m(t, null)) : a && (group_outros$4(), transition_out$4(a, 1, 1, () => {
         a = null;
       }), check_outros$4()), (!r || h[0] & /*vals*/
       1) && toggle_class$4(
@@ -43233,7 +43254,7 @@ function create_if_block_7$1(n) {
     }
   };
 }
-function create_if_block_5$2(n) {
+function create_if_block_5$3(n) {
   let e, t;
   return e = new Sequence({
     props: { seq: (
@@ -43277,10 +43298,10 @@ function create_each_block_5(n) {
       /*item*/
       n[48].class
     ] + ""
-  ), y, A, x, M, m, l, u, g, p, b, c, _, E, w, k, L, $, z = !/*item*/
+  ), y, A, x, M, m, l, u, p, g, b, c, _, E, w, k, $, L, z = !/*item*/
   n[48].open && /*item*/
   n[48].class === "ligand" && create_if_block_11$1(n);
-  function O(...N) {
+  function F(...N) {
     return (
       /*click_handler*/
       n[14](
@@ -43307,10 +43328,10 @@ function create_each_block_5(n) {
     /*item*/
     n[48].open && create_if_block_8$1(n)
   ), U = !/*item*/
-  n[48].open && create_if_block_3$2(n);
+  n[48].open && create_if_block_3$3(n);
   return {
     c() {
-      e = element$5("h2"), t = element$5("button"), r = element$5("div"), a = element$5("span"), h = text$5(s), d = space$4(), v = element$5("span"), y = text$5(f), A = space$4(), x = element$5("span"), z && z.c(), M = space$4(), m = element$5("div"), l = svg_element$1("svg"), u = svg_element$1("path"), g = space$4(), p = svg_element$1("svg"), b = svg_element$1("path"), _ = space$4(), P && P.c(), E = space$4(), U && U.c(), w = empty$3(), this.h();
+      e = element$5("h2"), t = element$5("button"), r = element$5("div"), a = element$5("span"), h = text$5(s), d = space$5(), v = element$5("span"), y = text$5(f), A = space$5(), x = element$5("span"), z && z.c(), M = space$5(), m = element$5("div"), l = svg_element$1("svg"), u = svg_element$1("path"), p = space$5(), g = svg_element$1("svg"), b = svg_element$1("path"), _ = space$5(), P && P.c(), E = space$5(), U && U.c(), w = empty$4(), this.h();
     },
     l(N) {
       e = claim_element$5(N, "H2", { id: !0, class: !0 });
@@ -43327,11 +43348,11 @@ function create_each_block_5(n) {
       var V = children$4(r);
       a = claim_element$5(V, "SPAN", { class: !0 });
       var G = children$4(a);
-      h = claim_text$4(G, s), G.forEach(detach$6), d = claim_space$4(V), v = claim_element$5(V, "SPAN", { class: !0 });
+      h = claim_text$4(G, s), G.forEach(detach$6), d = claim_space$5(V), v = claim_element$5(V, "SPAN", { class: !0 });
       var H = children$4(v);
-      y = claim_text$4(H, f), H.forEach(detach$6), A = claim_space$4(V), x = claim_element$5(V, "SPAN", { class: !0 });
+      y = claim_text$4(H, f), H.forEach(detach$6), A = claim_space$5(V), x = claim_element$5(V, "SPAN", { class: !0 });
       var Q = children$4(x);
-      z && z.l(Q), Q.forEach(detach$6), V.forEach(detach$6), M = claim_space$4(W), m = claim_element$5(W, "DIV", { class: !0 });
+      z && z.l(Q), Q.forEach(detach$6), V.forEach(detach$6), M = claim_space$5(W), m = claim_element$5(W, "DIV", { class: !0 });
       var te = children$4(m);
       l = claim_svg_element$1(te, "svg", {
         "data-slot": !0,
@@ -43349,7 +43370,7 @@ function create_each_block_5(n) {
         "stroke-linejoin": !0,
         d: !0,
         class: !0
-      }), children$4(u).forEach(detach$6), ee.forEach(detach$6), g = claim_space$4(te), p = claim_svg_element$1(te, "svg", {
+      }), children$4(u).forEach(detach$6), ee.forEach(detach$6), p = claim_space$5(te), g = claim_svg_element$1(te, "svg", {
         "data-accordion-icon": !0,
         class: !0,
         "aria-hidden": !0,
@@ -43357,7 +43378,7 @@ function create_each_block_5(n) {
         fill: !0,
         viewBox: !0
       });
-      var ce = children$4(p);
+      var ce = children$4(g);
       b = claim_svg_element$1(ce, "path", {
         stroke: !0,
         "stroke-linecap": !0,
@@ -43365,19 +43386,19 @@ function create_each_block_5(n) {
         "stroke-width": !0,
         d: !0,
         class: !0
-      }), children$4(b).forEach(detach$6), ce.forEach(detach$6), te.forEach(detach$6), W.forEach(detach$6), B.forEach(detach$6), _ = claim_space$4(N), P && P.l(N), E = claim_space$4(N), U && U.l(N), w = empty$3(), this.h();
+      }), children$4(b).forEach(detach$6), ce.forEach(detach$6), te.forEach(detach$6), W.forEach(detach$6), B.forEach(detach$6), _ = claim_space$5(N), P && P.l(N), E = claim_space$5(N), U && U.l(N), w = empty$4(), this.h();
     },
     h() {
       attr$5(a, "class", o = "inline-flex items-center justify-center p-1 px-2 text-xs font-semibold rounded-full " + /*colorCode*/
       n[7][
         /*item*/
         n[48].class
-      ] + " svelte-bt9x4p"), attr$5(v, "class", "svelte-bt9x4p"), attr$5(x, "class", "px-2 text-gray-800 font-bold svelte-bt9x4p"), attr$5(r, "class", "svelte-bt9x4p"), attr$5(u, "stroke-linecap", "round"), attr$5(u, "stroke-linejoin", "round"), attr$5(u, "d", "M6 18 18 6M6 6l12 12"), attr$5(u, "class", "svelte-bt9x4p"), attr$5(l, "data-slot", "icon"), attr$5(l, "fill", "none"), attr$5(l, "stroke-width", "3"), attr$5(l, "stroke", "currentColor"), attr$5(l, "viewBox", "0 0 24 24"), attr$5(l, "xmlns", "http://www.w3.org/2000/svg"), attr$5(l, "aria-hidden", "true"), attr$5(l, "class", "w-4 h-4 text-red-800 svelte-bt9x4p"), attr$5(b, "stroke", "currentColor"), attr$5(b, "stroke-linecap", "round"), attr$5(b, "stroke-linejoin", "round"), attr$5(b, "stroke-width", "2"), attr$5(b, "d", "M9 5 5 1 1 5"), attr$5(b, "class", "svelte-bt9x4p"), attr$5(p, "data-accordion-icon", ""), attr$5(p, "class", "w-3 h-3 shrink-0 svelte-bt9x4p"), attr$5(p, "aria-hidden", "true"), attr$5(p, "xmlns", "http://www.w3.org/2000/svg"), attr$5(p, "fill", "none"), attr$5(p, "viewBox", "0 0 10 6"), toggle_class$4(
-        p,
+      ] + " svelte-bt9x4p"), attr$5(v, "class", "svelte-bt9x4p"), attr$5(x, "class", "px-2 text-gray-800 font-bold svelte-bt9x4p"), attr$5(r, "class", "svelte-bt9x4p"), attr$5(u, "stroke-linecap", "round"), attr$5(u, "stroke-linejoin", "round"), attr$5(u, "d", "M6 18 18 6M6 6l12 12"), attr$5(u, "class", "svelte-bt9x4p"), attr$5(l, "data-slot", "icon"), attr$5(l, "fill", "none"), attr$5(l, "stroke-width", "3"), attr$5(l, "stroke", "currentColor"), attr$5(l, "viewBox", "0 0 24 24"), attr$5(l, "xmlns", "http://www.w3.org/2000/svg"), attr$5(l, "aria-hidden", "true"), attr$5(l, "class", "w-4 h-4 text-red-800 svelte-bt9x4p"), attr$5(b, "stroke", "currentColor"), attr$5(b, "stroke-linecap", "round"), attr$5(b, "stroke-linejoin", "round"), attr$5(b, "stroke-width", "2"), attr$5(b, "d", "M9 5 5 1 1 5"), attr$5(b, "class", "svelte-bt9x4p"), attr$5(g, "data-accordion-icon", ""), attr$5(g, "class", "w-3 h-3 shrink-0 svelte-bt9x4p"), attr$5(g, "aria-hidden", "true"), attr$5(g, "xmlns", "http://www.w3.org/2000/svg"), attr$5(g, "fill", "none"), attr$5(g, "viewBox", "0 0 10 6"), toggle_class$4(
+        g,
         "rotate-180",
         /*item*/
         n[48].open
-      ), toggle_class$4(p, "-rotate-90", !/*item*/
+      ), toggle_class$4(g, "-rotate-90", !/*item*/
       n[48].open), attr$5(m, "class", "flex items-center space-x-2 svelte-bt9x4p"), attr$5(t, "type", "button"), attr$5(t, "class", "flex items-center justify-between w-full p-5 font-medium rtl:text-right text-gray-500 border border-gray-200 dark:border-gray-700 dark:text-gray-400 hover:bg-gray-100 dark:hover:bg-gray-800 gap-3 svelte-bt9x4p"), attr$5(t, "data-accordion-target", `#accordion-collapse-body-${/*i*/
       n[37]}`), attr$5(t, "aria-expanded", c = /*item*/
       n[48].open), attr$5(t, "aria-controls", `accordion-collapse-body-${/*i*/
@@ -43402,10 +43423,10 @@ function create_each_block_5(n) {
       n[37]}`), attr$5(e, "class", "svelte-bt9x4p");
     },
     m(N, B) {
-      insert_hydration$6(N, e, B), append_hydration$4(e, t), append_hydration$4(t, r), append_hydration$4(r, a), append_hydration$4(a, h), append_hydration$4(r, d), append_hydration$4(r, v), append_hydration$4(v, y), append_hydration$4(r, A), append_hydration$4(r, x), z && z.m(x, null), append_hydration$4(t, M), append_hydration$4(t, m), append_hydration$4(m, l), append_hydration$4(l, u), append_hydration$4(m, g), append_hydration$4(m, p), append_hydration$4(p, b), insert_hydration$6(N, _, B), P && P.m(N, B), insert_hydration$6(N, E, B), U && U.m(N, B), insert_hydration$6(N, w, B), k = !0, L || ($ = [
-        listen$1(l, "click", O),
+      insert_hydration$6(N, e, B), append_hydration$4(e, t), append_hydration$4(t, r), append_hydration$4(r, a), append_hydration$4(a, h), append_hydration$4(r, d), append_hydration$4(r, v), append_hydration$4(v, y), append_hydration$4(r, A), append_hydration$4(r, x), z && z.m(x, null), append_hydration$4(t, M), append_hydration$4(t, m), append_hydration$4(m, l), append_hydration$4(l, u), append_hydration$4(m, p), append_hydration$4(m, g), append_hydration$4(g, b), insert_hydration$6(N, _, B), P && P.m(N, B), insert_hydration$6(N, E, B), U && U.m(N, B), insert_hydration$6(N, w, B), k = !0, $ || (L = [
+        listen$1(l, "click", F),
         listen$1(t, "click", R)
-      ], L = !0);
+      ], $ = !0);
     },
     p(N, B) {
       n = N, (!k || B[0] & /*vals*/
@@ -43424,12 +43445,12 @@ function create_each_block_5(n) {
       n[48].open && /*item*/
       n[48].class === "ligand" ? z ? z.p(n, B) : (z = create_if_block_11$1(n), z.c(), z.m(x, null)) : z && (z.d(1), z = null), (!k || B[0] & /*vals*/
       1) && toggle_class$4(
-        p,
+        g,
         "rotate-180",
         /*item*/
         n[48].open
       ), (!k || B[0] & /*vals*/
-      1) && toggle_class$4(p, "-rotate-90", !/*item*/
+      1) && toggle_class$4(g, "-rotate-90", !/*item*/
       n[48].open), (!k || B[0] & /*vals*/
       1 && c !== (c = /*item*/
       n[48].open)) && attr$5(t, "aria-expanded", c), (!k || B[0] & /*vals*/
@@ -43454,7 +43475,7 @@ function create_each_block_5(n) {
       n[48].open ? U && (group_outros$4(), transition_out$4(U, 1, 1, () => {
         U = null;
       }), check_outros$4()) : U ? (U.p(n, B), B[0] & /*vals*/
-      1 && transition_in$4(U, 1)) : (U = create_if_block_3$2(n), U.c(), transition_in$4(U, 1), U.m(w.parentNode, w));
+      1 && transition_in$4(U, 1)) : (U = create_if_block_3$3(n), U.c(), transition_in$4(U, 1), U.m(w.parentNode, w));
     },
     i(N) {
       k || (transition_in$4(P), transition_in$4(U), k = !0);
@@ -43463,29 +43484,29 @@ function create_each_block_5(n) {
       transition_out$4(P), transition_out$4(U), k = !1;
     },
     d(N) {
-      N && (detach$6(e), detach$6(_), detach$6(E), detach$6(w)), z && z.d(), P && P.d(N), U && U.d(N), L = !1, run_all$1($);
+      N && (detach$6(e), detach$6(_), detach$6(E), detach$6(w)), z && z.d(), P && P.d(N), U && U.d(N), $ = !1, run_all$1(L);
     }
   };
 }
-function create_if_block$4(n) {
-  let e, t = "Covalent Modification", r, a, s = ensure_array_like$1(
+function create_if_block$5(n) {
+  let e, t = "Covalent Modification", r, a, s = ensure_array_like$2(
     /*covMods*/
     n[1]
   ), h = [];
   for (let o = 0; o < s.length; o += 1)
-    h[o] = create_each_block$1(get_each_context$1(n, s, o));
+    h[o] = create_each_block$2(get_each_context$2(n, s, o));
   return {
     c() {
-      e = element$5("h4"), e.textContent = t, r = space$4();
+      e = element$5("h4"), e.textContent = t, r = space$5();
       for (let o = 0; o < h.length; o += 1)
         h[o].c();
-      a = empty$3(), this.h();
+      a = empty$4(), this.h();
     },
     l(o) {
-      e = claim_element$5(o, "H4", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(e) !== "svelte-vfdyc9" && (e.textContent = t), r = claim_space$4(o);
+      e = claim_element$5(o, "H4", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(e) !== "svelte-vfdyc9" && (e.textContent = t), r = claim_space$5(o);
       for (let d = 0; d < h.length; d += 1)
         h[d].l(o);
-      a = empty$3(), this.h();
+      a = empty$4(), this.h();
     },
     h() {
       attr$5(e, "class", "text-center font-bold text-xl svelte-bt9x4p");
@@ -43499,14 +43520,14 @@ function create_if_block$4(n) {
     p(o, d) {
       if (d[0] & /*dispatch, covMods, ligandChains, getResAtoms, getResname, getResidues, proteinChains*/
       3642) {
-        s = ensure_array_like$1(
+        s = ensure_array_like$2(
           /*covMods*/
           o[1]
         );
         let v;
         for (v = 0; v < s.length; v += 1) {
-          const f = get_each_context$1(o, s, v);
-          h[v] ? h[v].p(f, d) : (h[v] = create_each_block$1(f), h[v].c(), h[v].m(a.parentNode, a));
+          const f = get_each_context$2(o, s, v);
+          h[v] ? h[v].p(f, d) : (h[v] = create_each_block$2(f), h[v].c(), h[v].m(a.parentNode, a));
         }
         for (; v < h.length; v += 1)
           h[v].d(1);
@@ -43514,7 +43535,7 @@ function create_if_block$4(n) {
       }
     },
     d(o) {
-      o && (detach$6(e), detach$6(r), detach$6(a)), destroy_each$1(h, o);
+      o && (detach$6(e), detach$6(r), detach$6(a)), destroy_each$2(h, o);
     }
   };
 }
@@ -43561,12 +43582,12 @@ function create_each_block_3(n) {
   ), h;
   return {
     c() {
-      e = element$5("option"), r = text$5(t), a = space$4(), h = text$5(s), this.h();
+      e = element$5("option"), r = text$5(t), a = space$5(), h = text$5(s), this.h();
     },
     l(o) {
       e = claim_element$5(o, "OPTION", { class: !0 });
       var d = children$4(e);
-      r = claim_text$4(d, t), a = claim_space$4(d), h = claim_text$4(d, s), d.forEach(detach$6), this.h();
+      r = claim_text$4(d, t), a = claim_space$5(d), h = claim_text$4(d, s), d.forEach(detach$6), this.h();
     },
     h() {
       e.__value = /*i*/
@@ -43585,7 +43606,7 @@ function create_each_block_3(n) {
     }
   };
 }
-function create_else_block_1$1(n) {
+function create_else_block_1$2(n) {
   let e;
   return {
     c() {
@@ -43606,8 +43627,8 @@ function create_else_block_1$1(n) {
     }
   };
 }
-function create_if_block_2$2(n) {
-  let e, t = ensure_array_like$1(
+function create_if_block_2$3(n) {
+  let e, t = ensure_array_like$2(
     /*getResAtoms*/
     n[9](
       /*covMod*/
@@ -43620,12 +43641,12 @@ function create_if_block_2$2(n) {
     c() {
       for (let a = 0; a < r.length; a += 1)
         r[a].c();
-      e = empty$3();
+      e = empty$4();
     },
     l(a) {
       for (let s = 0; s < r.length; s += 1)
         r[s].l(a);
-      e = empty$3();
+      e = empty$4();
     },
     m(a, s) {
       for (let h = 0; h < r.length; h += 1)
@@ -43635,7 +43656,7 @@ function create_if_block_2$2(n) {
     p(a, s) {
       if (s[0] & /*getResAtoms, covMods, getResname*/
       2562) {
-        t = ensure_array_like$1(
+        t = ensure_array_like$2(
           /*getResAtoms*/
           a[9](
             /*covMod*/
@@ -43653,7 +43674,7 @@ function create_if_block_2$2(n) {
       }
     },
     d(a) {
-      a && detach$6(e), destroy_each$1(r, a);
+      a && detach$6(e), destroy_each$2(r, a);
     }
   };
 }
@@ -43741,14 +43762,14 @@ function create_each_block_1$1(n) {
     }
   };
 }
-function create_else_block$3(n) {
+function create_else_block$4(n) {
   let e, t = "click on atom";
   return {
     c() {
       e = element$5("p"), e.textContent = t, this.h();
     },
     l(r) {
-      e = claim_element$5(r, "P", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(e) !== "svelte-1dm8y5e" && (e.textContent = t), this.h();
+      e = claim_element$5(r, "P", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(e) !== "svelte-1dm8y5e" && (e.textContent = t), this.h();
     },
     h() {
       attr$5(e, "class", "font-mono svelte-bt9x4p");
@@ -43762,7 +43783,7 @@ function create_else_block$3(n) {
     }
   };
 }
-function create_if_block_1$3(n) {
+function create_if_block_1$4(n) {
   let e, t, r = (
     /*covMod*/
     n[35].attachmentIndex + ""
@@ -43792,13 +43813,13 @@ function create_if_block_1$3(n) {
     }
   };
 }
-function create_each_block$1(n) {
-  let e, t, r, a, s = '<span class="text-base font-medium text-gray-900 svelte-bt9x4p">Protein</span>', h, o, d = '<span class="svelte-bt9x4p">Chain</span> <span class="svelte-bt9x4p">Residue</span> <span class="svelte-bt9x4p">Atom</span> <span class="svelte-bt9x4p">Chirality</span>', v, f, y, A, x, M, m, l, u, g, p = "no chirality defined", b, c = "CW", _, E = "CCW", w, k, L, $, z = '<span class="w-full whitespace-nowrap text-center text-base font-medium text-gray-900 svelte-bt9x4p">Small molecule</span>', O, R, P = '<span class="svelte-bt9x4p">Chain</span> <span title="click on atom in structure" class="svelte-bt9x4p">Atom index</span> <span class="svelte-bt9x4p">Chirality</span>', U, N, B, W, V, G, H, Q, te = "no chirality defined", ee, ce = "CW", fe, oe = "CCW", he, Ae, Se, Ie, pe, le, ne, Te = ensure_array_like$1(
+function create_each_block$2(n) {
+  let e, t, r, a, s = '<span class="text-base font-medium text-gray-900 svelte-bt9x4p">Protein</span>', h, o, d = '<span class="svelte-bt9x4p">Chain</span> <span class="svelte-bt9x4p">Residue</span> <span class="svelte-bt9x4p">Atom</span> <span class="svelte-bt9x4p">Chirality</span>', v, f, y, A, x, M, m, l, u, p, g = "no chirality defined", b, c = "CW", _, E = "CCW", w, k, $, L, z = '<span class="w-full whitespace-nowrap text-center text-base font-medium text-gray-900 svelte-bt9x4p">Small molecule</span>', F, R, P = '<span class="svelte-bt9x4p">Chain</span> <span title="click on atom in structure" class="svelte-bt9x4p">Atom index</span> <span class="svelte-bt9x4p">Chirality</span>', U, N, B, W, V, G, H, Q, te = "no chirality defined", ee, ce = "CW", fe, oe = "CCW", he, Ae, Se, Ie, pe, le, ne, Te = ensure_array_like$2(
     /*proteinChains*/
     n[3]
-  ), Fe = [];
+  ), Oe = [];
   for (let ae = 0; ae < Te.length; ae += 1)
-    Fe[ae] = create_each_block_4(get_each_context_4(n, Te, ae));
+    Oe[ae] = create_each_block_4(get_each_context_4(n, Te, ae));
   function Be() {
     n[20].call(
       y,
@@ -43806,7 +43827,7 @@ function create_each_block$1(n) {
       n[37]
     );
   }
-  let Ue = ensure_array_like$1(
+  let Ue = ensure_array_like$2(
     /*getResidues*/
     n[10](
       /*covMod*/
@@ -43825,7 +43846,7 @@ function create_each_block$1(n) {
   function Ne(ae, ge) {
     return (
       /*covMod*/
-      ae[35].residue != "" ? create_if_block_2$2 : create_else_block_1$1
+      ae[35].residue != "" ? create_if_block_2$3 : create_else_block_1$2
     );
   }
   let Re = Ne(n), De = Re(n);
@@ -43843,7 +43864,7 @@ function create_each_block$1(n) {
       n[37]
     );
   }
-  let X = ensure_array_like$1(
+  let X = ensure_array_like$2(
     /*ligandChains*/
     n[4]
   ), q = [];
@@ -43859,7 +43880,7 @@ function create_each_block$1(n) {
   function ye(ae, ge) {
     return (
       /*covMod*/
-      ae[35].attachmentIndex ? create_if_block_1$3 : create_else_block$3
+      ae[35].attachmentIndex ? create_if_block_1$4 : create_else_block$4
     );
   }
   let me = ye(n), ze = me(n);
@@ -43882,16 +43903,16 @@ function create_each_block$1(n) {
   }
   return {
     c() {
-      e = element$5("div"), t = element$5("div"), r = element$5("div"), a = element$5("div"), a.innerHTML = s, h = space$4(), o = element$5("div"), o.innerHTML = d, v = space$4(), f = element$5("div"), y = element$5("select");
-      for (let ae = 0; ae < Fe.length; ae += 1)
-        Fe[ae].c();
-      A = space$4(), x = element$5("select");
+      e = element$5("div"), t = element$5("div"), r = element$5("div"), a = element$5("div"), a.innerHTML = s, h = space$5(), o = element$5("div"), o.innerHTML = d, v = space$5(), f = element$5("div"), y = element$5("select");
+      for (let ae = 0; ae < Oe.length; ae += 1)
+        Oe[ae].c();
+      A = space$5(), x = element$5("select");
       for (let ae = 0; ae < Pe.length; ae += 1)
         Pe[ae].c();
-      M = space$4(), m = element$5("select"), De.c(), l = space$4(), u = element$5("select"), g = element$5("option"), g.textContent = p, b = element$5("option"), b.textContent = c, _ = element$5("option"), _.textContent = E, w = space$4(), k = element$5("div"), L = element$5("div"), $ = element$5("div"), $.innerHTML = z, O = space$4(), R = element$5("div"), R.innerHTML = P, U = space$4(), N = element$5("div"), B = element$5("select");
+      M = space$5(), m = element$5("select"), De.c(), l = space$5(), u = element$5("select"), p = element$5("option"), p.textContent = g, b = element$5("option"), b.textContent = c, _ = element$5("option"), _.textContent = E, w = space$5(), k = element$5("div"), $ = element$5("div"), L = element$5("div"), L.innerHTML = z, F = space$5(), R = element$5("div"), R.innerHTML = P, U = space$5(), N = element$5("div"), B = element$5("select");
       for (let ae = 0; ae < q.length; ae += 1)
         q[ae].c();
-      W = space$4(), V = element$5("div"), ze.c(), G = space$4(), H = element$5("select"), Q = element$5("option"), Q.textContent = te, ee = element$5("option"), ee.textContent = ce, fe = element$5("option"), fe.textContent = oe, he = space$4(), Ae = element$5("div"), Se = svg_element$1("svg"), Ie = svg_element$1("path"), pe = space$4(), this.h();
+      W = space$5(), V = element$5("div"), ze.c(), G = space$5(), H = element$5("select"), Q = element$5("option"), Q.textContent = te, ee = element$5("option"), ee.textContent = ce, fe = element$5("option"), fe.textContent = oe, he = space$5(), Ae = element$5("div"), Se = svg_element$1("svg"), Ie = svg_element$1("path"), pe = space$5(), this.h();
     },
     l(ae) {
       e = claim_element$5(ae, "DIV", { class: !0 });
@@ -43900,25 +43921,25 @@ function create_each_block$1(n) {
       var xe = children$4(t);
       r = claim_element$5(xe, "DIV", { class: !0 });
       var ue = children$4(r);
-      a = claim_element$5(ue, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(a) !== "svelte-1eqot16" && (a.innerHTML = s), h = claim_space$4(ue), o = claim_element$5(ue, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(o) !== "svelte-1k2x92t" && (o.innerHTML = d), v = claim_space$4(ue), f = claim_element$5(ue, "DIV", { class: !0 });
+      a = claim_element$5(ue, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(a) !== "svelte-1eqot16" && (a.innerHTML = s), h = claim_space$5(ue), o = claim_element$5(ue, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(o) !== "svelte-1k2x92t" && (o.innerHTML = d), v = claim_space$5(ue), f = claim_element$5(ue, "DIV", { class: !0 });
       var Ce = children$4(f);
       y = claim_element$5(Ce, "SELECT", { name: !0, id: !0, class: !0 });
       var Z = children$4(y);
-      for (let rt = 0; rt < Fe.length; rt += 1)
-        Fe[rt].l(Z);
-      Z.forEach(detach$6), A = claim_space$4(Ce), x = claim_element$5(Ce, "SELECT", { name: !0, id: !0, class: !0 });
-      var Oe = children$4(x);
+      for (let rt = 0; rt < Oe.length; rt += 1)
+        Oe[rt].l(Z);
+      Z.forEach(detach$6), A = claim_space$5(Ce), x = claim_element$5(Ce, "SELECT", { name: !0, id: !0, class: !0 });
+      var Fe = children$4(x);
       for (let rt = 0; rt < Pe.length; rt += 1)
-        Pe[rt].l(Oe);
-      Oe.forEach(detach$6), M = claim_space$4(Ce), m = claim_element$5(Ce, "SELECT", { name: !0, id: !0, class: !0 });
+        Pe[rt].l(Fe);
+      Fe.forEach(detach$6), M = claim_space$5(Ce), m = claim_element$5(Ce, "SELECT", { name: !0, id: !0, class: !0 });
       var We = children$4(m);
-      De.l(We), We.forEach(detach$6), l = claim_space$4(Ce), u = claim_element$5(Ce, "SELECT", { name: !0, id: !0, class: !0 });
+      De.l(We), We.forEach(detach$6), l = claim_space$5(Ce), u = claim_element$5(Ce, "SELECT", { name: !0, id: !0, class: !0 });
       var I = children$4(u);
-      g = claim_element$5(I, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(g) !== "svelte-1d780p1" && (g.textContent = p), b = claim_element$5(I, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(b) !== "svelte-wvq2yy" && (b.textContent = c), _ = claim_element$5(I, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(_) !== "svelte-wxh7b0" && (_.textContent = E), I.forEach(detach$6), Ce.forEach(detach$6), ue.forEach(detach$6), w = claim_space$4(xe), k = claim_element$5(xe, "DIV", { class: !0 });
+      p = claim_element$5(I, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(p) !== "svelte-1d780p1" && (p.textContent = g), b = claim_element$5(I, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(b) !== "svelte-wvq2yy" && (b.textContent = c), _ = claim_element$5(I, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(_) !== "svelte-wxh7b0" && (_.textContent = E), I.forEach(detach$6), Ce.forEach(detach$6), ue.forEach(detach$6), w = claim_space$5(xe), k = claim_element$5(xe, "DIV", { class: !0 });
       var we = children$4(k);
-      L = claim_element$5(we, "DIV", { class: !0 });
-      var ve = children$4(L);
-      $ = claim_element$5(ve, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1($) !== "svelte-80ph3f" && ($.innerHTML = z), O = claim_space$4(ve), R = claim_element$5(ve, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(R) !== "svelte-1xhu24v" && (R.innerHTML = P), U = claim_space$4(ve), N = claim_element$5(ve, "DIV", { class: !0 });
+      $ = claim_element$5(we, "DIV", { class: !0 });
+      var ve = children$4($);
+      L = claim_element$5(ve, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(L) !== "svelte-80ph3f" && (L.innerHTML = z), F = claim_space$5(ve), R = claim_element$5(ve, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(R) !== "svelte-1xhu24v" && (R.innerHTML = P), U = claim_space$5(ve), N = claim_element$5(ve, "DIV", { class: !0 });
       var Y = children$4(N);
       B = claim_element$5(Y, "SELECT", {
         name: !0,
@@ -43929,11 +43950,11 @@ function create_each_block$1(n) {
       var de = children$4(B);
       for (let rt = 0; rt < q.length; rt += 1)
         q[rt].l(de);
-      de.forEach(detach$6), W = claim_space$4(Y), V = claim_element$5(Y, "DIV", { class: !0 });
+      de.forEach(detach$6), W = claim_space$5(Y), V = claim_element$5(Y, "DIV", { class: !0 });
       var Me = children$4(V);
-      ze.l(Me), Me.forEach(detach$6), G = claim_space$4(Y), H = claim_element$5(Y, "SELECT", { name: !0, id: !0, class: !0 });
+      ze.l(Me), Me.forEach(detach$6), G = claim_space$5(Y), H = claim_element$5(Y, "SELECT", { name: !0, id: !0, class: !0 });
       var Ye = children$4(H);
-      Q = claim_element$5(Ye, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(Q) !== "svelte-1d780p1" && (Q.textContent = te), ee = claim_element$5(Ye, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(ee) !== "svelte-wvq2yy" && (ee.textContent = ce), fe = claim_element$5(Ye, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(fe) !== "svelte-wxh7b0" && (fe.textContent = oe), Ye.forEach(detach$6), Y.forEach(detach$6), ve.forEach(detach$6), we.forEach(detach$6), xe.forEach(detach$6), he = claim_space$4(ge), Ae = claim_element$5(ge, "DIV", { class: !0 });
+      Q = claim_element$5(Ye, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(Q) !== "svelte-1d780p1" && (Q.textContent = te), ee = claim_element$5(Ye, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(ee) !== "svelte-wvq2yy" && (ee.textContent = ce), fe = claim_element$5(Ye, "OPTION", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$2(fe) !== "svelte-wxh7b0" && (fe.textContent = oe), Ye.forEach(detach$6), Y.forEach(detach$6), ve.forEach(detach$6), we.forEach(detach$6), xe.forEach(detach$6), he = claim_space$5(ge), Ae = claim_element$5(ge, "DIV", { class: !0 });
       var Ze = children$4(Ae);
       Se = claim_svg_element$1(Ze, "svg", {
         "data-slot": !0,
@@ -43951,7 +43972,7 @@ function create_each_block$1(n) {
         "stroke-linejoin": !0,
         d: !0,
         class: !0
-      }), children$4(Ie).forEach(detach$6), Ke.forEach(detach$6), Ze.forEach(detach$6), pe = claim_space$4(ge), ge.forEach(detach$6), this.h();
+      }), children$4(Ie).forEach(detach$6), Ke.forEach(detach$6), Ze.forEach(detach$6), pe = claim_space$5(ge), ge.forEach(detach$6), this.h();
     },
     h() {
       attr$5(a, "class", "flex justify-center svelte-bt9x4p"), attr$5(o, "class", "grid grid-cols-4 font-bold svelte-bt9x4p"), attr$5(y, "name", ""), attr$5(y, "id", ""), attr$5(y, "class", "svelte-bt9x4p"), /*covMods*/
@@ -43966,11 +43987,11 @@ function create_each_block$1(n) {
       n[1][
         /*i*/
         n[37]
-      ].atom === void 0 && add_render_callback$2(je), g.__value = "", set_input_value$1(g, g.__value), attr$5(g, "class", "svelte-bt9x4p"), b.__value = "CW", set_input_value$1(b, b.__value), attr$5(b, "class", "svelte-bt9x4p"), _.__value = "CCW", set_input_value$1(_, _.__value), attr$5(_, "class", "svelte-bt9x4p"), attr$5(u, "name", ""), attr$5(u, "id", ""), attr$5(u, "class", "svelte-bt9x4p"), /*covMods*/
+      ].atom === void 0 && add_render_callback$2(je), p.__value = "", set_input_value$1(p, p.__value), attr$5(p, "class", "svelte-bt9x4p"), b.__value = "CW", set_input_value$1(b, b.__value), attr$5(b, "class", "svelte-bt9x4p"), _.__value = "CCW", set_input_value$1(_, _.__value), attr$5(_, "class", "svelte-bt9x4p"), attr$5(u, "name", ""), attr$5(u, "id", ""), attr$5(u, "class", "svelte-bt9x4p"), /*covMods*/
       n[1][
         /*i*/
         n[37]
-      ].protein_symmetry === void 0 && add_render_callback$2(Xe), attr$5(f, "class", "grid grid-cols-4 svelte-bt9x4p"), attr$5(r, "class", "w-3/5 flex-col px-2 svelte-bt9x4p"), attr$5($, "class", "flex justify-center svelte-bt9x4p"), attr$5(R, "class", "grid grid-cols-3 font-bold svelte-bt9x4p"), attr$5(B, "name", ""), attr$5(B, "id", ""), attr$5(B, "title", "click on atom in structure"), attr$5(B, "class", "svelte-bt9x4p"), /*covMods*/
+      ].protein_symmetry === void 0 && add_render_callback$2(Xe), attr$5(f, "class", "grid grid-cols-4 svelte-bt9x4p"), attr$5(r, "class", "w-3/5 flex-col px-2 svelte-bt9x4p"), attr$5(L, "class", "flex justify-center svelte-bt9x4p"), attr$5(R, "class", "grid grid-cols-3 font-bold svelte-bt9x4p"), attr$5(B, "name", ""), attr$5(B, "id", ""), attr$5(B, "title", "click on atom in structure"), attr$5(B, "class", "svelte-bt9x4p"), /*covMods*/
       n[1][
         /*i*/
         n[37]
@@ -43978,12 +43999,12 @@ function create_each_block$1(n) {
       n[1][
         /*i*/
         n[37]
-      ].ligand_symmetry === void 0 && add_render_callback$2(ke), attr$5(N, "class", "grid grid-cols-3 svelte-bt9x4p"), attr$5(L, "class", "flex-col p-1 svelte-bt9x4p"), attr$5(k, "class", "w-2/5 px-2 svelte-bt9x4p"), attr$5(t, "class", "flex divide-x rounded border p-1 w-full svelte-bt9x4p"), attr$5(Ie, "stroke-linecap", "round"), attr$5(Ie, "stroke-linejoin", "round"), attr$5(Ie, "d", "M6 18 18 6M6 6l12 12"), attr$5(Ie, "class", "svelte-bt9x4p"), attr$5(Se, "data-slot", "icon"), attr$5(Se, "fill", "none"), attr$5(Se, "stroke-width", "2"), attr$5(Se, "stroke", "currentColor"), attr$5(Se, "viewBox", "0 0 24 24"), attr$5(Se, "xmlns", "http://www.w3.org/2000/svg"), attr$5(Se, "aria-hidden", "true"), attr$5(Se, "class", "w-8 h-8 text-red-800 cursor-pointer svelte-bt9x4p"), attr$5(Ae, "class", "flex items-center p-2 svelte-bt9x4p"), attr$5(e, "class", "flex p-10 svelte-bt9x4p");
+      ].ligand_symmetry === void 0 && add_render_callback$2(ke), attr$5(N, "class", "grid grid-cols-3 svelte-bt9x4p"), attr$5($, "class", "flex-col p-1 svelte-bt9x4p"), attr$5(k, "class", "w-2/5 px-2 svelte-bt9x4p"), attr$5(t, "class", "flex divide-x rounded border p-1 w-full svelte-bt9x4p"), attr$5(Ie, "stroke-linecap", "round"), attr$5(Ie, "stroke-linejoin", "round"), attr$5(Ie, "d", "M6 18 18 6M6 6l12 12"), attr$5(Ie, "class", "svelte-bt9x4p"), attr$5(Se, "data-slot", "icon"), attr$5(Se, "fill", "none"), attr$5(Se, "stroke-width", "2"), attr$5(Se, "stroke", "currentColor"), attr$5(Se, "viewBox", "0 0 24 24"), attr$5(Se, "xmlns", "http://www.w3.org/2000/svg"), attr$5(Se, "aria-hidden", "true"), attr$5(Se, "class", "w-8 h-8 text-red-800 cursor-pointer svelte-bt9x4p"), attr$5(Ae, "class", "flex items-center p-2 svelte-bt9x4p"), attr$5(e, "class", "flex p-10 svelte-bt9x4p");
     },
     m(ae, ge) {
       insert_hydration$6(ae, e, ge), append_hydration$4(e, t), append_hydration$4(t, r), append_hydration$4(r, a), append_hydration$4(r, h), append_hydration$4(r, o), append_hydration$4(r, v), append_hydration$4(r, f), append_hydration$4(f, y);
-      for (let xe = 0; xe < Fe.length; xe += 1)
-        Fe[xe] && Fe[xe].m(y, null);
+      for (let xe = 0; xe < Oe.length; xe += 1)
+        Oe[xe] && Oe[xe].m(y, null);
       select_option(
         y,
         /*covMods*/
@@ -44011,7 +44032,7 @@ function create_each_block$1(n) {
           n[37]
         ].atom,
         !0
-      ), append_hydration$4(f, l), append_hydration$4(f, u), append_hydration$4(u, g), append_hydration$4(u, b), append_hydration$4(u, _), select_option(
+      ), append_hydration$4(f, l), append_hydration$4(f, u), append_hydration$4(u, p), append_hydration$4(u, b), append_hydration$4(u, _), select_option(
         u,
         /*covMods*/
         n[1][
@@ -44019,7 +44040,7 @@ function create_each_block$1(n) {
           n[37]
         ].protein_symmetry,
         !0
-      ), append_hydration$4(t, w), append_hydration$4(t, k), append_hydration$4(k, L), append_hydration$4(L, $), append_hydration$4(L, O), append_hydration$4(L, R), append_hydration$4(L, U), append_hydration$4(L, N), append_hydration$4(N, B);
+      ), append_hydration$4(t, w), append_hydration$4(t, k), append_hydration$4(k, $), append_hydration$4($, L), append_hydration$4($, F), append_hydration$4($, R), append_hydration$4($, U), append_hydration$4($, N), append_hydration$4(N, B);
       for (let xe = 0; xe < q.length; xe += 1)
         q[xe] && q[xe].m(B, null);
       select_option(
@@ -44087,18 +44108,18 @@ function create_each_block$1(n) {
     p(ae, ge) {
       if (n = ae, ge[0] & /*proteinChains*/
       8) {
-        Te = ensure_array_like$1(
+        Te = ensure_array_like$2(
           /*proteinChains*/
           n[3]
         );
         let xe;
         for (xe = 0; xe < Te.length; xe += 1) {
           const ue = get_each_context_4(n, Te, xe);
-          Fe[xe] ? Fe[xe].p(ue, ge) : (Fe[xe] = create_each_block_4(ue), Fe[xe].c(), Fe[xe].m(y, null));
+          Oe[xe] ? Oe[xe].p(ue, ge) : (Oe[xe] = create_each_block_4(ue), Oe[xe].c(), Oe[xe].m(y, null));
         }
-        for (; xe < Fe.length; xe += 1)
-          Fe[xe].d(1);
-        Fe.length = Te.length;
+        for (; xe < Oe.length; xe += 1)
+          Oe[xe].d(1);
+        Oe.length = Te.length;
       }
       if (ge[0] & /*covMods, proteinChains*/
       10 && select_option(
@@ -44110,7 +44131,7 @@ function create_each_block$1(n) {
         ].protein
       ), ge[0] & /*getResidues, covMods*/
       1026) {
-        Ue = ensure_array_like$1(
+        Ue = ensure_array_like$2(
           /*getResidues*/
           n[10](
             /*covMod*/
@@ -44152,7 +44173,7 @@ function create_each_block$1(n) {
         ].protein_symmetry
       ), ge[0] & /*ligandChains, covMods*/
       18) {
-        X = ensure_array_like$1(
+        X = ensure_array_like$2(
           /*ligandChains*/
           n[4]
         );
@@ -44184,12 +44205,12 @@ function create_each_block$1(n) {
       );
     },
     d(ae) {
-      ae && detach$6(e), destroy_each$1(Fe, ae), destroy_each$1(Pe, ae), De.d(), destroy_each$1(q, ae), ze.d(), le = !1, run_all$1(ne);
+      ae && detach$6(e), destroy_each$2(Oe, ae), destroy_each$2(Pe, ae), De.d(), destroy_each$2(q, ae), ze.d(), le = !1, run_all$1(ne);
     }
   };
 }
 function create_fragment$6(n) {
-  let e, t, r, a, s = ensure_array_like$1(
+  let e, t, r, a, s = ensure_array_like$2(
     /*vals*/
     n[0]
   ), h = [];
@@ -44200,14 +44221,14 @@ function create_fragment$6(n) {
   });
   let d = (
     /*covMods*/
-    n[1].length > 0 && create_if_block$4(n)
+    n[1].length > 0 && create_if_block$5(n)
   );
   return {
     c() {
       e = element$5("div");
       for (let v = 0; v < h.length; v += 1)
         h[v].c();
-      t = space$4(), r = element$5("div"), d && d.c(), this.h();
+      t = space$5(), r = element$5("div"), d && d.c(), this.h();
     },
     l(v) {
       e = claim_element$5(v, "DIV", {
@@ -44218,7 +44239,7 @@ function create_fragment$6(n) {
       var f = children$4(e);
       for (let A = 0; A < h.length; A += 1)
         h[A].l(f);
-      t = claim_space$4(f), r = claim_element$5(f, "DIV", { class: !0 });
+      t = claim_space$5(f), r = claim_element$5(f, "DIV", { class: !0 });
       var y = children$4(r);
       d && d.l(y), y.forEach(detach$6), f.forEach(detach$6), this.h();
     },
@@ -44234,7 +44255,7 @@ function create_fragment$6(n) {
     p(v, f) {
       if (f[0] & /*vals, showCovModVals, updateMol, dispatch, metals, handleMessage, labels, colorCode*/
       12773) {
-        s = ensure_array_like$1(
+        s = ensure_array_like$2(
           /*vals*/
           v[0]
         );
@@ -44248,7 +44269,7 @@ function create_fragment$6(n) {
         check_outros$4();
       }
       /*covMods*/
-      v[1].length > 0 ? d ? d.p(v, f) : (d = create_if_block$4(v), d.c(), d.m(r, null)) : d && (d.d(1), d = null);
+      v[1].length > 0 ? d ? d.p(v, f) : (d = create_if_block$5(v), d.c(), d.m(r, null)) : d && (d.d(1), d = null);
     },
     i(v) {
       if (!a) {
@@ -44264,7 +44285,7 @@ function create_fragment$6(n) {
       a = !1;
     },
     d(v) {
-      v && detach$6(e), destroy_each$1(h, v), d && d.d();
+      v && detach$6(e), destroy_each$2(h, v), d && d.d();
     }
   };
 }
@@ -44358,7 +44379,7 @@ function instance$6(n, e, t) {
     let Q = H.detail.index;
     t(1, s[Q].mol = H.detail.mol, s), t(1, s[Q].attachmentIndex = H.detail.attachmentIndex, s), t(1, s[Q].deleteIndexes = H.detail.deleteIndexes, s), r("updateCovMod", s);
   }
-  function g(H) {
+  function p(H) {
     fetch(`https://files.rcsb.org/ligands/download/${H.detail.text}_ideal.sdf`).then((Q) => {
       if (!Q.ok)
         throw new Error("Network response was not ok");
@@ -44373,7 +44394,7 @@ function instance$6(n, e, t) {
       alert("Error fetching sdf file");
     });
   }
-  const p = (H, Q) => {
+  const g = (H, Q) => {
     r("removeVal", H);
   }, b = (H, Q, te) => t(0, Q[te].open = !H.open, a), c = (H, Q) => {
     r("updateVals", { sequence: Q.target.value, index: H });
@@ -44385,12 +44406,12 @@ function instance$6(n, e, t) {
   function k(H) {
     s[H].protein = select_value(this), t(1, s), t(3, f), t(0, a);
   }
-  const L = () => r("updateCovMod", s);
-  function $(H) {
+  const $ = () => r("updateCovMod", s);
+  function L(H) {
     s[H].residue = select_value(this), t(1, s), t(3, f), t(0, a);
   }
   const z = () => r("updateCovMod", s);
-  function O(H) {
+  function F(H) {
     s[H].atom = select_value(this), t(1, s), t(3, f), t(0, a);
   }
   const R = () => r("updateCovMod", s);
@@ -44429,18 +44450,18 @@ function instance$6(n, e, t) {
     m,
     l,
     u,
-    g,
     p,
+    g,
     b,
     c,
     _,
     E,
     w,
     k,
-    L,
     $,
+    L,
     z,
-    O,
+    F,
     R,
     P,
     U,
@@ -44462,27 +44483,27 @@ const {
   check_outros: check_outros$3,
   claim_component: claim_component$3,
   claim_element: claim_element$4,
-  claim_space: claim_space$3,
+  claim_space: claim_space$4,
   create_component: create_component$3,
   destroy_component: destroy_component$3,
   detach: detach$5,
   element: element$4,
-  empty: empty$2,
+  empty: empty$3,
   flush: flush$1,
-  get_svelte_dataset,
+  get_svelte_dataset: get_svelte_dataset$1,
   group_outros: group_outros$3,
   init: init$5,
   insert_hydration: insert_hydration$5,
   mount_component: mount_component$3,
   noop: noop$5,
   safe_not_equal: safe_not_equal$6,
-  space: space$3,
+  space: space$4,
   transition_in: transition_in$3,
   transition_out: transition_out$3
 } = window.__gradio__svelte__internal, { tick: tick$2 } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$2, onMount: onMount$3, afterUpdate: afterUpdate$1 } = window.__gradio__svelte__internal;
-function create_if_block$3(n) {
+function create_if_block$4(n) {
   let e, t, r, a;
-  const s = [create_if_block_1$2, create_else_block$2], h = [];
+  const s = [create_if_block_1$3, create_else_block$3], h = [];
   function o(d, v) {
     return (
       /*vals*/
@@ -44491,10 +44512,10 @@ function create_if_block$3(n) {
   }
   return e = o(n), t = h[e] = s[e](n), {
     c() {
-      t.c(), r = empty$2();
+      t.c(), r = empty$3();
     },
     l(d) {
-      t.l(d), r = empty$2();
+      t.l(d), r = empty$3();
     },
     m(d, v) {
       h[e].m(d, v), insert_hydration$5(d, r, v), a = !0;
@@ -44516,7 +44537,7 @@ function create_if_block$3(n) {
     }
   };
 }
-function create_else_block$2(n) {
+function create_else_block$3(n) {
   let e, t = "Empty input", r, a, s = "You can import a protein from the PDB", h, o, d, v, f = "- or create the input from scratch -", y;
   return o = new SearchInput({ props: { database: "rcsb-bioass" } }), o.$on(
     "triggerFetch",
@@ -44524,10 +44545,10 @@ function create_else_block$2(n) {
     n[2]
   ), {
     c() {
-      e = element$4("div"), e.textContent = t, r = space$3(), a = element$4("div"), a.textContent = s, h = space$3(), create_component$3(o.$$.fragment), d = space$3(), v = element$4("div"), v.textContent = f, this.h();
+      e = element$4("div"), e.textContent = t, r = space$4(), a = element$4("div"), a.textContent = s, h = space$4(), create_component$3(o.$$.fragment), d = space$4(), v = element$4("div"), v.textContent = f, this.h();
     },
     l(A) {
-      e = claim_element$4(A, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset(e) !== "svelte-1vyb54w" && (e.textContent = t), r = claim_space$3(A), a = claim_element$4(A, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset(a) !== "svelte-15ru6yv" && (a.textContent = s), h = claim_space$3(A), claim_component$3(o.$$.fragment, A), d = claim_space$3(A), v = claim_element$4(A, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset(v) !== "svelte-17yf25u" && (v.textContent = f), this.h();
+      e = claim_element$4(A, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(e) !== "svelte-1vyb54w" && (e.textContent = t), r = claim_space$4(A), a = claim_element$4(A, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(a) !== "svelte-15ru6yv" && (a.textContent = s), h = claim_space$4(A), claim_component$3(o.$$.fragment, A), d = claim_space$4(A), v = claim_element$4(A, "DIV", { class: !0, "data-svelte-h": !0 }), get_svelte_dataset$1(v) !== "svelte-17yf25u" && (v.textContent = f), this.h();
     },
     h() {
       attr$4(e, "class", "my-8 text-center text-gray-600 svelte-13zuw1o"), attr$4(a, "class", "text-center text-gray-400 svelte-13zuw1o"), attr$4(v, "class", "text-center text-gray-400 w-full my-2 svelte-13zuw1o");
@@ -44547,7 +44568,7 @@ function create_else_block$2(n) {
     }
   };
 }
-function create_if_block_1$2(n) {
+function create_if_block_1$3(n) {
   let e, t;
   return e = new Accordion({
     props: {
@@ -44608,7 +44629,7 @@ function create_if_block_1$2(n) {
 function create_fragment$5(n) {
   let e, t, r, a = (
     /*vals*/
-    n[0] != null && create_if_block$3(n)
+    n[0] != null && create_if_block$4(n)
   );
   return t = new Button({ props: { vals: (
     /*vals*/
@@ -44623,10 +44644,10 @@ function create_fragment$5(n) {
     n[6]
   ), {
     c() {
-      a && a.c(), e = space$3(), create_component$3(t.$$.fragment);
+      a && a.c(), e = space$4(), create_component$3(t.$$.fragment);
     },
     l(s) {
-      a && a.l(s), e = claim_space$3(s), claim_component$3(t.$$.fragment, s);
+      a && a.l(s), e = claim_space$4(s), claim_component$3(t.$$.fragment, s);
     },
     m(s, h) {
       a && a.m(s, h), insert_hydration$5(s, e, h), mount_component$3(t, s, h), r = !0;
@@ -44634,7 +44655,7 @@ function create_fragment$5(n) {
     p(s, [h]) {
       /*vals*/
       s[0] != null ? a ? (a.p(s, h), h & /*vals*/
-      1 && transition_in$3(a, 1)) : (a = create_if_block$3(s), a.c(), transition_in$3(a, 1), a.m(e.parentNode, e)) : a && (group_outros$3(), transition_out$3(a, 1, 1, () => {
+      1 && transition_in$3(a, 1)) : (a = create_if_block$4(s), a.c(), transition_in$3(a, 1), a.m(e.parentNode, e)) : a && (group_outros$3(), transition_out$3(a, 1, 1, () => {
         a = null;
       }), check_outros$3());
       const o = {};
@@ -44742,84 +44763,84 @@ function instance$5(n, e, t) {
   let { value: r = { chains: [], covMods: [] } } = e;
   const a = createEventDispatcher$2();
   let s = ["ZN", "MG", "CA", "FE", "NA", "K", "CL", "CU", "MN", "CO", "NI"];
-  async function h(l) {
-    let u = l.detail.text;
-    u = u.toLowerCase();
-    let g = await importBioAssembly(u), p = [], b = "";
-    await Promise.all(g.map(async (c) => {
-      if (["DNA", "RNA", "protein"].includes(c.class))
-        for (let _ = 0; _ < c.count; _++)
-          b = nextChainTemp(b), p.push({
-            class: c.class,
+  async function h(u) {
+    let p = u.detail.text;
+    p = p.toLowerCase();
+    let g = await importBioAssembly(p), b = [], c = "";
+    await Promise.all(g.map(async (_) => {
+      if (["DNA", "RNA", "protein"].includes(_.class))
+        for (let E = 0; E < _.count; E++)
+          c = nextChainTemp(c), b.push({
+            class: _.class,
             name: "",
             smiles: "",
             sdf: "",
-            sequence: c.entityInfo,
+            sequence: _.entityInfo,
             open: !1,
-            chain: b
+            chain: c
           }), await tick$2();
-      else if (c.class === "ligand") {
-        let _ = "", E = "";
-        s.includes(c.entityInfo) ? _ = c.entityInfo : E = await getSDF(c.entityInfo);
-        for (let w = 0; w < c.count; w++)
-          b = nextChainTemp(b), p.push({
-            class: c.class,
-            name: _,
+      else if (_.class === "ligand") {
+        let E = "", w = "";
+        s.includes(_.entityInfo) ? E = _.entityInfo : w = await getSDF(_.entityInfo);
+        for (let k = 0; k < _.count; k++)
+          c = nextChainTemp(c), b.push({
+            class: _.class,
+            name: E,
             smiles: "",
-            sdf: E,
+            sdf: w,
             sequence: "",
             open: !1,
-            chain: b
+            chain: c
           });
         await tick$2();
       }
-    })), t(0, o = p), a("updateVals", o);
+    })), t(0, o = b), a("updateVals", o);
   }
   let o = [], d = [];
-  function v(l) {
-    l.detail.sequence !== void 0 && t(0, o[l.detail.index].sequence = l.detail.sequence, o), l.detail.name !== void 0 && (t(0, o[l.detail.index].name = l.detail.name, o), t(0, o[l.detail.index].open = l.detail.open, o), t(0, o[l.detail.index].sdf = "", o), t(0, o[l.detail.index].smiles = "", o)), l.detail.smiles !== void 0 && (t(0, o[l.detail.index].smiles = l.detail.smiles, o), t(0, o[l.detail.index].sdf = "", o), t(0, o[l.detail.index].name = "", o)), l.detail.sdf !== void 0 && (l.detail.close == !0 && t(0, o[l.detail.index].open = !1, o), t(0, o[l.detail.index].sdf = l.detail.sdf, o), t(0, o[l.detail.index].name = "", o), t(0, o[l.detail.index].smiles = "", o)), a("updateVals", o);
+  function v(u) {
+    u.detail.sequence !== void 0 && t(0, o[u.detail.index].sequence = u.detail.sequence, o), u.detail.name !== void 0 && (t(0, o[u.detail.index].name = u.detail.name, o), t(0, o[u.detail.index].open = u.detail.open, o), t(0, o[u.detail.index].sdf = "", o), t(0, o[u.detail.index].smiles = "", o)), u.detail.smiles !== void 0 && (t(0, o[u.detail.index].smiles = u.detail.smiles, o), t(0, o[u.detail.index].sdf = "", o), t(0, o[u.detail.index].name = "", o)), u.detail.sdf !== void 0 && (u.detail.close == !0 && t(0, o[u.detail.index].open = !1, o), t(0, o[u.detail.index].sdf = u.detail.sdf, o), t(0, o[u.detail.index].name = "", o), t(0, o[u.detail.index].smiles = "", o)), a("updateVals", o);
   }
   function f() {
-    let l = "A";
+    let u = "A";
     for (let g of o)
-      g.chain > l && (l = g.chain);
-    let u = "";
-    if (l < "Z")
-      u = String.fromCharCode(l.charCodeAt(0) + 1);
+      g.chain > u && (u = g.chain);
+    let p = "";
+    if (u < "Z")
+      p = String.fromCharCode(u.charCodeAt(0) + 1);
     else {
-      let g = l.slice(-1);
-      g < "Z" ? u = l.slice(0, -1) + String.fromCharCode(g.charCodeAt(0) + 1) : u = l + "A";
+      let g = u.slice(-1);
+      g < "Z" ? p = u.slice(0, -1) + String.fromCharCode(g.charCodeAt(0) + 1) : p = u + "A";
     }
-    return u;
+    return p;
   }
-  function y(l) {
-    let u = f();
+  function y(u) {
+    let p = f();
     o.push({
-      class: l.detail.type,
+      class: u.detail.type,
       name: "",
       smiles: "",
       sdf: "",
       sequence: "",
       open: !0,
-      chain: u
-    }), t(0, o);
+      chain: p
+    }), t(0, o), t(10, l), t(9, r);
   }
-  function A(l) {
-    o.splice(l.detail, 1), t(0, o), a("updateVals", o);
+  function A(u) {
+    o.splice(u.detail, 1), t(0, o), t(10, l), t(9, r), a("updateVals", o);
   }
-  function x(l) {
-    let u = o.find((b) => b.class === "protein").chain;
-    if (u === void 0) {
+  function x(u) {
+    let p = o.find((c) => c.class === "protein").chain;
+    if (p === void 0) {
       alert("Please add a protein chain first");
       return;
     }
-    let g = o.find((b) => b.class === "ligand").chain;
+    let g = o.find((c) => c.class === "ligand").chain;
     if (g === void 0) {
       alert("Please add a ligand chain first");
       return;
     }
-    let p = {
-      protein: u,
+    let b = {
+      protein: p,
       residue: "1",
       atom: "N",
       protein_symmetry: "CW",
@@ -44828,18 +44849,23 @@ function instance$5(n, e, t) {
       deleteIndexes: [],
       ligand_symmetry: "CW"
     };
-    d.push(p), t(1, d), t(0, o), a("updateCovMod", d);
+    d.push(b), t(1, d), t(10, l), t(9, r), t(0, o), t(10, l), t(9, r), a("updateCovMod", d);
   }
-  function M(l) {
-    d.splice(l.detail, 1), t(1, d);
+  function M(u) {
+    d.splice(u.detail, 1), t(1, d), t(10, l), t(9, r);
   }
-  function m(l) {
-    t(1, d = l.detail), a("updateCovMod", d);
+  function m(u) {
+    t(1, d = u.detail), a("updateCovMod", d);
   }
-  return onMount$3(async () => {
+  onMount$3(async () => {
     t(0, o = r.chains), t(1, d = r.covMods);
-  }), n.$$set = (l) => {
-    "value" in l && t(9, r = l.value);
+  });
+  let l = r;
+  return n.$$set = (u) => {
+    "value" in u && t(9, r = u.value);
+  }, n.$$.update = () => {
+    n.$$.dirty & /*old_value, value*/
+    1536 && JSON.stringify(l) !== JSON.stringify(r) && (t(0, o = r.chains), t(1, d = r.covMods), t(10, l = r));
   }, [
     o,
     d,
@@ -44850,7 +44876,8 @@ function instance$5(n, e, t) {
     x,
     M,
     m,
-    r
+    r,
+    l
   ];
 }
 class SequenceInput extends SvelteComponent$5 {
@@ -44958,8 +44985,8 @@ function spring(n, e = {}) {
   let h, o, d, v = n, f = n, y = 1, A = 0, x = !1;
   function M(l, u = {}) {
     f = l;
-    const g = d = {};
-    return n == null || u.hard || m.stiffness >= 1 && m.damping >= 1 ? (x = !0, h = now(), v = l, t.set(n = f), Promise.resolve()) : (u.soft && (A = 1 / ((u.soft === !0 ? 0.5 : +u.soft) * 60), y = 0), o || (h = now(), x = !1, o = loop((p) => {
+    const p = d = {};
+    return n == null || u.hard || m.stiffness >= 1 && m.damping >= 1 ? (x = !0, h = now(), v = l, t.set(n = f), Promise.resolve()) : (u.soft && (A = 1 / ((u.soft === !0 ? 0.5 : +u.soft) * 60), y = 0), o || (h = now(), x = !1, o = loop((g) => {
       if (x)
         return x = !1, o = null, !1;
       y = Math.min(y + A, 1);
@@ -44967,12 +44994,12 @@ function spring(n, e = {}) {
         inv_mass: y,
         opts: m,
         settled: !0,
-        dt: (p - h) * 60 / 1e3
+        dt: (g - h) * 60 / 1e3
       }, c = tick_spring(b, v, n, f);
-      return h = p, v = n, t.set(n = c), b.settled && (o = null), !b.settled;
-    })), new Promise((p) => {
+      return h = g, v = n, t.set(n = c), b.settled && (o = null), !b.settled;
+    })), new Promise((g) => {
       o.promise.then(() => {
-        g === d && p();
+        p === d && g();
       });
     }));
   }
@@ -45117,16 +45144,16 @@ const {
   children: children$2,
   claim_component: claim_component$2,
   claim_element: claim_element$2,
-  claim_space: claim_space$2,
+  claim_space: claim_space$3,
   claim_text: claim_text$3,
   create_component: create_component$2,
   create_slot,
   destroy_component: destroy_component$2,
-  destroy_each,
+  destroy_each: destroy_each$1,
   detach: detach$3,
   element: element$2,
-  empty: empty$1,
-  ensure_array_like,
+  empty: empty$2,
+  ensure_array_like: ensure_array_like$1,
   get_all_dirty_from_scope,
   get_slot_changes,
   group_outros: group_outros$2,
@@ -45137,14 +45164,14 @@ const {
   safe_not_equal: safe_not_equal$3,
   set_data: set_data$3,
   set_style,
-  space: space$2,
+  space: space$3,
   text: text$4,
   toggle_class: toggle_class$2,
   transition_in: transition_in$2,
   transition_out: transition_out$2,
   update_slot_base
 } = window.__gradio__svelte__internal, { tick: tick$1 } = window.__gradio__svelte__internal, { onDestroy } = window.__gradio__svelte__internal, { createEventDispatcher: createEventDispatcher$1 } = window.__gradio__svelte__internal, get_error_slot_changes = (n) => ({}), get_error_slot_context = (n) => ({}), get_additional_loading_text_slot_changes = (n) => ({}), get_additional_loading_text_slot_context = (n) => ({});
-function get_each_context(n, e, t) {
+function get_each_context$1(n, e, t) {
   const r = n.slice();
   return r[40] = e[t], r[42] = t, r;
 }
@@ -45183,14 +45210,14 @@ function create_if_block_17(n) {
   );
   return {
     c() {
-      e = element$2("div"), create_component$2(t.$$.fragment), r = space$2(), a = element$2("span"), h = text$4(s), o = space$2(), f && f.c(), this.h();
+      e = element$2("div"), create_component$2(t.$$.fragment), r = space$3(), a = element$2("span"), h = text$4(s), o = space$3(), f && f.c(), this.h();
     },
     l(y) {
       e = claim_element$2(y, "DIV", { class: !0 });
       var A = children$2(e);
-      claim_component$2(t.$$.fragment, A), A.forEach(detach$3), r = claim_space$2(y), a = claim_element$2(y, "SPAN", { class: !0 });
+      claim_component$2(t.$$.fragment, A), A.forEach(detach$3), r = claim_space$3(y), a = claim_element$2(y, "SPAN", { class: !0 });
       var x = children$2(a);
-      h = claim_text$3(x, s), x.forEach(detach$3), o = claim_space$2(y), f && f.l(y), this.h();
+      h = claim_text$3(x, s), x.forEach(detach$3), o = claim_space$3(y), f && f.l(y), this.h();
     },
     h() {
       attr$2(e, "class", "clear-status svelte-17v219f"), attr$2(a, "class", "error svelte-17v219f");
@@ -45235,54 +45262,54 @@ function create_if_block_17(n) {
     }
   };
 }
-function create_if_block$2(n) {
+function create_if_block$3(n) {
   let e, t, r, a, s, h, o, d, v, f = (
     /*variant*/
     n[8] === "default" && /*show_eta_bar*/
     n[18] && /*show_progress*/
     n[6] === "full" && create_if_block_16(n)
   );
-  function y(p, b) {
+  function y(g, b) {
     if (
       /*progress*/
-      p[7]
+      g[7]
     ) return create_if_block_11;
     if (
       /*queue_position*/
-      p[2] !== null && /*queue_size*/
-      p[3] !== void 0 && /*queue_position*/
-      p[2] >= 0
+      g[2] !== null && /*queue_size*/
+      g[3] !== void 0 && /*queue_position*/
+      g[2] >= 0
     ) return create_if_block_14;
     if (
       /*queue_position*/
-      p[2] === 0
+      g[2] === 0
     ) return create_if_block_15;
   }
   let A = y(n), x = A && A(n), M = (
     /*timer*/
     n[5] && create_if_block_10(n)
   );
-  const m = [create_if_block_2$1, create_if_block_9], l = [];
-  function u(p, b) {
+  const m = [create_if_block_2$2, create_if_block_9], l = [];
+  function u(g, b) {
     return (
       /*last_progress_level*/
-      p[15] != null ? 0 : (
+      g[15] != null ? 0 : (
         /*show_progress*/
-        p[6] === "full" ? 1 : -1
+        g[6] === "full" ? 1 : -1
       )
     );
   }
   ~(s = u(n)) && (h = l[s] = m[s](n));
-  let g = !/*timer*/
-  n[5] && create_if_block_1$1(n);
+  let p = !/*timer*/
+  n[5] && create_if_block_1$2(n);
   return {
     c() {
-      f && f.c(), e = space$2(), t = element$2("div"), x && x.c(), r = space$2(), M && M.c(), a = space$2(), h && h.c(), o = space$2(), g && g.c(), d = empty$1(), this.h();
+      f && f.c(), e = space$3(), t = element$2("div"), x && x.c(), r = space$3(), M && M.c(), a = space$3(), h && h.c(), o = space$3(), p && p.c(), d = empty$2(), this.h();
     },
-    l(p) {
-      f && f.l(p), e = claim_space$2(p), t = claim_element$2(p, "DIV", { class: !0 });
+    l(g) {
+      f && f.l(g), e = claim_space$3(g), t = claim_element$2(g, "DIV", { class: !0 });
       var b = children$2(t);
-      x && x.l(b), r = claim_space$2(b), M && M.l(b), b.forEach(detach$3), a = claim_space$2(p), h && h.l(p), o = claim_space$2(p), g && g.l(p), d = empty$1(), this.h();
+      x && x.l(b), r = claim_space$3(b), M && M.l(b), b.forEach(detach$3), a = claim_space$3(g), h && h.l(g), o = claim_space$3(g), p && p.l(g), d = empty$2(), this.h();
     },
     h() {
       attr$2(t, "class", "progress-text svelte-17v219f"), toggle_class$2(
@@ -45297,44 +45324,44 @@ function create_if_block$2(n) {
         n[8] === "default"
       );
     },
-    m(p, b) {
-      f && f.m(p, b), insert_hydration$3(p, e, b), insert_hydration$3(p, t, b), x && x.m(t, null), append_hydration$2(t, r), M && M.m(t, null), insert_hydration$3(p, a, b), ~s && l[s].m(p, b), insert_hydration$3(p, o, b), g && g.m(p, b), insert_hydration$3(p, d, b), v = !0;
+    m(g, b) {
+      f && f.m(g, b), insert_hydration$3(g, e, b), insert_hydration$3(g, t, b), x && x.m(t, null), append_hydration$2(t, r), M && M.m(t, null), insert_hydration$3(g, a, b), ~s && l[s].m(g, b), insert_hydration$3(g, o, b), p && p.m(g, b), insert_hydration$3(g, d, b), v = !0;
     },
-    p(p, b) {
+    p(g, b) {
       /*variant*/
-      p[8] === "default" && /*show_eta_bar*/
-      p[18] && /*show_progress*/
-      p[6] === "full" ? f ? f.p(p, b) : (f = create_if_block_16(p), f.c(), f.m(e.parentNode, e)) : f && (f.d(1), f = null), A === (A = y(p)) && x ? x.p(p, b) : (x && x.d(1), x = A && A(p), x && (x.c(), x.m(t, r))), /*timer*/
-      p[5] ? M ? M.p(p, b) : (M = create_if_block_10(p), M.c(), M.m(t, null)) : M && (M.d(1), M = null), (!v || b[0] & /*variant*/
+      g[8] === "default" && /*show_eta_bar*/
+      g[18] && /*show_progress*/
+      g[6] === "full" ? f ? f.p(g, b) : (f = create_if_block_16(g), f.c(), f.m(e.parentNode, e)) : f && (f.d(1), f = null), A === (A = y(g)) && x ? x.p(g, b) : (x && x.d(1), x = A && A(g), x && (x.c(), x.m(t, r))), /*timer*/
+      g[5] ? M ? M.p(g, b) : (M = create_if_block_10(g), M.c(), M.m(t, null)) : M && (M.d(1), M = null), (!v || b[0] & /*variant*/
       256) && toggle_class$2(
         t,
         "meta-text-center",
         /*variant*/
-        p[8] === "center"
+        g[8] === "center"
       ), (!v || b[0] & /*variant*/
       256) && toggle_class$2(
         t,
         "meta-text",
         /*variant*/
-        p[8] === "default"
+        g[8] === "default"
       );
       let c = s;
-      s = u(p), s === c ? ~s && l[s].p(p, b) : (h && (group_outros$2(), transition_out$2(l[c], 1, 1, () => {
+      s = u(g), s === c ? ~s && l[s].p(g, b) : (h && (group_outros$2(), transition_out$2(l[c], 1, 1, () => {
         l[c] = null;
-      }), check_outros$2()), ~s ? (h = l[s], h ? h.p(p, b) : (h = l[s] = m[s](p), h.c()), transition_in$2(h, 1), h.m(o.parentNode, o)) : h = null), /*timer*/
-      p[5] ? g && (group_outros$2(), transition_out$2(g, 1, 1, () => {
-        g = null;
-      }), check_outros$2()) : g ? (g.p(p, b), b[0] & /*timer*/
-      32 && transition_in$2(g, 1)) : (g = create_if_block_1$1(p), g.c(), transition_in$2(g, 1), g.m(d.parentNode, d));
+      }), check_outros$2()), ~s ? (h = l[s], h ? h.p(g, b) : (h = l[s] = m[s](g), h.c()), transition_in$2(h, 1), h.m(o.parentNode, o)) : h = null), /*timer*/
+      g[5] ? p && (group_outros$2(), transition_out$2(p, 1, 1, () => {
+        p = null;
+      }), check_outros$2()) : p ? (p.p(g, b), b[0] & /*timer*/
+      32 && transition_in$2(p, 1)) : (p = create_if_block_1$2(g), p.c(), transition_in$2(p, 1), p.m(d.parentNode, d));
     },
-    i(p) {
-      v || (transition_in$2(h), transition_in$2(g), v = !0);
+    i(g) {
+      v || (transition_in$2(h), transition_in$2(p), v = !0);
     },
-    o(p) {
-      transition_out$2(h), transition_out$2(g), v = !1;
+    o(g) {
+      transition_out$2(h), transition_out$2(p), v = !1;
     },
-    d(p) {
-      p && (detach$3(e), detach$3(t), detach$3(a), detach$3(o), detach$3(d)), f && f.d(p), x && x.d(), M && M.d(), ~s && l[s].d(p), g && g.d(p);
+    d(g) {
+      g && (detach$3(e), detach$3(t), detach$3(a), detach$3(o), detach$3(d)), f && f.d(g), x && x.d(), M && M.d(), ~s && l[s].d(g), p && p.d(g);
     }
   };
 }
@@ -45420,7 +45447,7 @@ function create_if_block_14(n) {
   };
 }
 function create_if_block_11(n) {
-  let e, t = ensure_array_like(
+  let e, t = ensure_array_like$1(
     /*progress*/
     n[7]
   ), r = [];
@@ -45430,12 +45457,12 @@ function create_if_block_11(n) {
     c() {
       for (let a = 0; a < r.length; a += 1)
         r[a].c();
-      e = empty$1();
+      e = empty$2();
     },
     l(a) {
       for (let s = 0; s < r.length; s += 1)
         r[s].l(a);
-      e = empty$1();
+      e = empty$2();
     },
     m(a, s) {
       for (let h = 0; h < r.length; h += 1)
@@ -45445,7 +45472,7 @@ function create_if_block_11(n) {
     p(a, s) {
       if (s[0] & /*progress*/
       128) {
-        t = ensure_array_like(
+        t = ensure_array_like$1(
           /*progress*/
           a[7]
         );
@@ -45460,7 +45487,7 @@ function create_if_block_11(n) {
       }
     },
     d(a) {
-      a && detach$3(e), destroy_each(r, a);
+      a && detach$3(e), destroy_each$1(r, a);
     }
   };
 }
@@ -45472,16 +45499,16 @@ function create_if_block_12(n) {
   function o(f, y) {
     return (
       /*p*/
-      f[40].length != null ? create_if_block_13 : create_else_block$1
+      f[40].length != null ? create_if_block_13 : create_else_block$2
     );
   }
   let d = o(n), v = d(n);
   return {
     c() {
-      v.c(), e = space$2(), r = text$4(t), a = text$4(" | "), h = text$4(s);
+      v.c(), e = space$3(), r = text$4(t), a = text$4(" | "), h = text$4(s);
     },
     l(f) {
-      v.l(f), e = claim_space$2(f), r = claim_text$3(f, t), a = claim_text$3(f, " | "), h = claim_text$3(f, s);
+      v.l(f), e = claim_space$3(f), r = claim_text$3(f, t), a = claim_text$3(f, " | "), h = claim_text$3(f, s);
     },
     m(f, y) {
       v.m(f, y), insert_hydration$3(f, e, y), insert_hydration$3(f, r, y), insert_hydration$3(f, a, y), insert_hydration$3(f, h, y);
@@ -45496,7 +45523,7 @@ function create_if_block_12(n) {
     }
   };
 }
-function create_else_block$1(n) {
+function create_else_block$2(n) {
   let e = pretty_si(
     /*p*/
     n[40].index || 0
@@ -45564,10 +45591,10 @@ function create_each_block_1(n) {
   );
   return {
     c() {
-      t && t.c(), e = empty$1();
+      t && t.c(), e = empty$2();
     },
     l(r) {
-      t && t.l(r), e = empty$1();
+      t && t.l(r), e = empty$2();
     },
     m(r, a) {
       t && t.m(r, a), insert_hydration$3(r, e, a);
@@ -45654,22 +45681,22 @@ function create_if_block_9(n) {
     }
   };
 }
-function create_if_block_2$1(n) {
+function create_if_block_2$2(n) {
   let e, t, r, a, s, h = `${/*last_progress_level*/
   n[15] * 100}%`, o = (
     /*progress*/
-    n[7] != null && create_if_block_3$1(n)
+    n[7] != null && create_if_block_3$2(n)
   );
   return {
     c() {
-      e = element$2("div"), t = element$2("div"), o && o.c(), r = space$2(), a = element$2("div"), s = element$2("div"), this.h();
+      e = element$2("div"), t = element$2("div"), o && o.c(), r = space$3(), a = element$2("div"), s = element$2("div"), this.h();
     },
     l(d) {
       e = claim_element$2(d, "DIV", { class: !0 });
       var v = children$2(e);
       t = claim_element$2(v, "DIV", { class: !0 });
       var f = children$2(t);
-      o && o.l(f), f.forEach(detach$3), r = claim_space$2(v), a = claim_element$2(v, "DIV", { class: !0 });
+      o && o.l(f), f.forEach(detach$3), r = claim_space$3(v), a = claim_element$2(v, "DIV", { class: !0 });
       var y = children$2(a);
       s = claim_element$2(y, "DIV", { class: !0 }), children$2(s).forEach(detach$3), y.forEach(detach$3), v.forEach(detach$3), this.h();
     },
@@ -45681,7 +45708,7 @@ function create_if_block_2$1(n) {
     },
     p(d, v) {
       /*progress*/
-      d[7] != null ? o ? o.p(d, v) : (o = create_if_block_3$1(d), o.c(), o.m(t, null)) : o && (o.d(1), o = null), v[0] & /*last_progress_level*/
+      d[7] != null ? o ? o.p(d, v) : (o = create_if_block_3$2(d), o.c(), o.m(t, null)) : o && (o.d(1), o = null), v[0] & /*last_progress_level*/
       32768 && h !== (h = `${/*last_progress_level*/
       d[15] * 100}%`) && set_style(s, "width", h);
     },
@@ -45692,23 +45719,23 @@ function create_if_block_2$1(n) {
     }
   };
 }
-function create_if_block_3$1(n) {
-  let e, t = ensure_array_like(
+function create_if_block_3$2(n) {
+  let e, t = ensure_array_like$1(
     /*progress*/
     n[7]
   ), r = [];
   for (let a = 0; a < t.length; a += 1)
-    r[a] = create_each_block(get_each_context(n, t, a));
+    r[a] = create_each_block$1(get_each_context$1(n, t, a));
   return {
     c() {
       for (let a = 0; a < r.length; a += 1)
         r[a].c();
-      e = empty$1();
+      e = empty$2();
     },
     l(a) {
       for (let s = 0; s < r.length; s += 1)
         r[s].l(a);
-      e = empty$1();
+      e = empty$2();
     },
     m(a, s) {
       for (let h = 0; h < r.length; h += 1)
@@ -45718,14 +45745,14 @@ function create_if_block_3$1(n) {
     p(a, s) {
       if (s[0] & /*progress_level, progress*/
       16512) {
-        t = ensure_array_like(
+        t = ensure_array_like$1(
           /*progress*/
           a[7]
         );
         let h;
         for (h = 0; h < t.length; h += 1) {
-          const o = get_each_context(a, t, h);
-          r[h] ? r[h].p(o, s) : (r[h] = create_each_block(o), r[h].c(), r[h].m(e.parentNode, e));
+          const o = get_each_context$1(a, t, h);
+          r[h] ? r[h].p(o, s) : (r[h] = create_each_block$1(o), r[h].c(), r[h].m(e.parentNode, e));
         }
         for (; h < r.length; h += 1)
           r[h].d(1);
@@ -45733,11 +45760,11 @@ function create_if_block_3$1(n) {
       }
     },
     d(a) {
-      a && detach$3(e), destroy_each(r, a);
+      a && detach$3(e), destroy_each$1(r, a);
     }
   };
 }
-function create_if_block_4$1(n) {
+function create_if_block_4$2(n) {
   let e, t, r, a, s = (
     /*i*/
     n[42] !== 0 && create_if_block_8()
@@ -45754,14 +45781,14 @@ function create_if_block_4$1(n) {
     ] != null && create_if_block_6()
   ), d = (
     /*progress_level*/
-    n[14] != null && create_if_block_5$1(n)
+    n[14] != null && create_if_block_5$2(n)
   );
   return {
     c() {
-      s && s.c(), e = space$2(), h && h.c(), t = space$2(), o && o.c(), r = space$2(), d && d.c(), a = empty$1();
+      s && s.c(), e = space$3(), h && h.c(), t = space$3(), o && o.c(), r = space$3(), d && d.c(), a = empty$2();
     },
     l(v) {
-      s && s.l(v), e = claim_space$2(v), h && h.l(v), t = claim_space$2(v), o && o.l(v), r = claim_space$2(v), d && d.l(v), a = empty$1();
+      s && s.l(v), e = claim_space$3(v), h && h.l(v), t = claim_space$3(v), o && o.l(v), r = claim_space$3(v), d && d.l(v), a = empty$2();
     },
     m(v, f) {
       s && s.m(v, f), insert_hydration$3(v, e, f), h && h.m(v, f), insert_hydration$3(v, t, f), o && o.m(v, f), insert_hydration$3(v, r, f), d && d.m(v, f), insert_hydration$3(v, a, f);
@@ -45775,7 +45802,7 @@ function create_if_block_4$1(n) {
         /*i*/
         v[42]
       ] != null ? o || (o = create_if_block_6(), o.c(), o.m(r.parentNode, r)) : o && (o.d(1), o = null), /*progress_level*/
-      v[14] != null ? d ? d.p(v, f) : (d = create_if_block_5$1(v), d.c(), d.m(a.parentNode, a)) : d && (d.d(1), d = null);
+      v[14] != null ? d ? d.p(v, f) : (d = create_if_block_5$2(v), d.c(), d.m(a.parentNode, a)) : d && (d.d(1), d = null);
     },
     d(v) {
       v && (detach$3(e), detach$3(t), detach$3(r), detach$3(a)), s && s.d(v), h && h.d(v), o && o.d(v), d && d.d(v);
@@ -45841,7 +45868,7 @@ function create_if_block_6(n) {
     }
   };
 }
-function create_if_block_5$1(n) {
+function create_if_block_5$2(n) {
   let e = (100 * /*progress_level*/
   (n[14][
     /*i*/
@@ -45870,7 +45897,7 @@ function create_if_block_5$1(n) {
     }
   };
 }
-function create_each_block(n) {
+function create_each_block$1(n) {
   let e, t = (
     /*p*/
     (n[40].desc != null || /*progress_level*/
@@ -45878,14 +45905,14 @@ function create_each_block(n) {
     n[14][
       /*i*/
       n[42]
-    ] != null) && create_if_block_4$1(n)
+    ] != null) && create_if_block_4$2(n)
   );
   return {
     c() {
-      t && t.c(), e = empty$1();
+      t && t.c(), e = empty$2();
     },
     l(r) {
-      t && t.l(r), e = empty$1();
+      t && t.l(r), e = empty$2();
     },
     m(r, a) {
       t && t.m(r, a), insert_hydration$3(r, e, a);
@@ -45897,14 +45924,14 @@ function create_each_block(n) {
       r[14][
         /*i*/
         r[42]
-      ] != null ? t ? t.p(r, a) : (t = create_if_block_4$1(r), t.c(), t.m(e.parentNode, e)) : t && (t.d(1), t = null);
+      ] != null ? t ? t.p(r, a) : (t = create_if_block_4$2(r), t.c(), t.m(e.parentNode, e)) : t && (t.d(1), t = null);
     },
     d(r) {
       r && detach$3(e), t && t.d(r);
     }
   };
 }
-function create_if_block_1$1(n) {
+function create_if_block_1$2(n) {
   let e, t, r, a;
   const s = (
     /*#slots*/
@@ -45921,7 +45948,7 @@ function create_if_block_1$1(n) {
       e = element$2("p"), t = text$4(
         /*loading_text*/
         n[9]
-      ), r = space$2(), h && h.c(), this.h();
+      ), r = space$3(), h && h.c(), this.h();
     },
     l(o) {
       e = claim_element$2(o, "P", { class: !0 });
@@ -45930,7 +45957,7 @@ function create_if_block_1$1(n) {
         d,
         /*loading_text*/
         n[9]
-      ), d.forEach(detach$3), r = claim_space$2(o), h && h.l(o), this.h();
+      ), d.forEach(detach$3), r = claim_space$3(o), h && h.l(o), this.h();
     },
     h() {
       attr$2(e, "class", "loading svelte-17v219f");
@@ -45977,7 +46004,7 @@ function create_if_block_1$1(n) {
 }
 function create_fragment$3(n) {
   let e, t, r, a, s;
-  const h = [create_if_block$2, create_if_block_17], o = [];
+  const h = [create_if_block$3, create_if_block_17], o = [];
   function d(v, f) {
     return (
       /*status*/
@@ -46118,17 +46145,17 @@ async function scroll_into_view(n, e = !0) {
 function instance$3(n, e, t) {
   let r, { $$slots: a = {}, $$scope: s } = e;
   const h = createEventDispatcher$1();
-  let { i18n: o } = e, { eta: d = null } = e, { queue_position: v } = e, { queue_size: f } = e, { status: y } = e, { scroll_to_output: A = !1 } = e, { timer: x = !0 } = e, { show_progress: M = "full" } = e, { message: m = null } = e, { progress: l = null } = e, { variant: u = "default" } = e, { loading_text: g = "Loading..." } = e, { absolute: p = !0 } = e, { translucent: b = !1 } = e, { border: c = !1 } = e, { autoscroll: _ } = e, E, w = !1, k = 0, L = 0, $ = null, z = null, O = 0, R = null, P, U = null, N = !0;
+  let { i18n: o } = e, { eta: d = null } = e, { queue_position: v } = e, { queue_size: f } = e, { status: y } = e, { scroll_to_output: A = !1 } = e, { timer: x = !0 } = e, { show_progress: M = "full" } = e, { message: m = null } = e, { progress: l = null } = e, { variant: u = "default" } = e, { loading_text: p = "Loading..." } = e, { absolute: g = !0 } = e, { translucent: b = !1 } = e, { border: c = !1 } = e, { autoscroll: _ } = e, E, w = !1, k = 0, $ = 0, L = null, z = null, F = 0, R = null, P, U = null, N = !0;
   const B = () => {
-    t(0, d = t(27, $ = t(19, G = null))), t(25, k = performance.now()), t(26, L = 0), w = !0, W();
+    t(0, d = t(27, L = t(19, G = null))), t(25, k = performance.now()), t(26, $ = 0), w = !0, W();
   };
   function W() {
     raf(() => {
-      t(26, L = (performance.now() - k) / 1e3), w && W();
+      t(26, $ = (performance.now() - k) / 1e3), w && W();
     });
   }
   function V() {
-    t(26, L = 0), t(0, d = t(27, $ = t(19, G = null))), w && (w = !1);
+    t(26, $ = 0), t(0, d = t(27, L = t(19, G = null))), w && (w = !1);
   }
   onDestroy(() => {
     w && V();
@@ -46148,11 +46175,11 @@ function instance$3(n, e, t) {
     });
   }
   return n.$$set = (ee) => {
-    "i18n" in ee && t(1, o = ee.i18n), "eta" in ee && t(0, d = ee.eta), "queue_position" in ee && t(2, v = ee.queue_position), "queue_size" in ee && t(3, f = ee.queue_size), "status" in ee && t(4, y = ee.status), "scroll_to_output" in ee && t(22, A = ee.scroll_to_output), "timer" in ee && t(5, x = ee.timer), "show_progress" in ee && t(6, M = ee.show_progress), "message" in ee && t(23, m = ee.message), "progress" in ee && t(7, l = ee.progress), "variant" in ee && t(8, u = ee.variant), "loading_text" in ee && t(9, g = ee.loading_text), "absolute" in ee && t(10, p = ee.absolute), "translucent" in ee && t(11, b = ee.translucent), "border" in ee && t(12, c = ee.border), "autoscroll" in ee && t(24, _ = ee.autoscroll), "$$scope" in ee && t(29, s = ee.$$scope);
+    "i18n" in ee && t(1, o = ee.i18n), "eta" in ee && t(0, d = ee.eta), "queue_position" in ee && t(2, v = ee.queue_position), "queue_size" in ee && t(3, f = ee.queue_size), "status" in ee && t(4, y = ee.status), "scroll_to_output" in ee && t(22, A = ee.scroll_to_output), "timer" in ee && t(5, x = ee.timer), "show_progress" in ee && t(6, M = ee.show_progress), "message" in ee && t(23, m = ee.message), "progress" in ee && t(7, l = ee.progress), "variant" in ee && t(8, u = ee.variant), "loading_text" in ee && t(9, p = ee.loading_text), "absolute" in ee && t(10, g = ee.absolute), "translucent" in ee && t(11, b = ee.translucent), "border" in ee && t(12, c = ee.border), "autoscroll" in ee && t(24, _ = ee.autoscroll), "$$scope" in ee && t(29, s = ee.$$scope);
   }, n.$$.update = () => {
     n.$$.dirty[0] & /*eta, old_eta, timer_start, eta_from_start*/
-    436207617 && (d === null && t(0, d = $), d != null && $ !== d && (t(28, z = (performance.now() - k) / 1e3 + d), t(19, G = z.toFixed(1)), t(27, $ = d))), n.$$.dirty[0] & /*eta_from_start, timer_diff*/
-    335544320 && t(17, O = z === null || z <= 0 || !L ? null : Math.min(L / z, 1)), n.$$.dirty[0] & /*progress*/
+    436207617 && (d === null && t(0, d = L), d != null && L !== d && (t(28, z = (performance.now() - k) / 1e3 + d), t(19, G = z.toFixed(1)), t(27, L = d))), n.$$.dirty[0] & /*eta_from_start, timer_diff*/
+    335544320 && t(17, F = z === null || z <= 0 || !$ ? null : Math.min($ / z, 1)), n.$$.dirty[0] & /*progress*/
     128 && l != null && t(18, N = !1), n.$$.dirty[0] & /*progress, progress_level, progress_bar, last_progress_level*/
     114816 && (l != null ? t(14, R = l.map((ee) => {
       if (ee.index != null && ee.length != null)
@@ -46163,7 +46190,7 @@ function instance$3(n, e, t) {
     16 && (y === "pending" ? B() : V()), n.$$.dirty[0] & /*el, scroll_to_output, status, autoscroll*/
     20979728 && E && A && (y === "pending" || y === "complete") && scroll_into_view(E, _), n.$$.dirty[0] & /*status, message*/
     8388624, n.$$.dirty[0] & /*timer_diff*/
-    67108864 && t(20, r = L.toFixed(1));
+    67108864 && t(20, r = $.toFixed(1));
   }, [
     d,
     o,
@@ -46174,15 +46201,15 @@ function instance$3(n, e, t) {
     M,
     l,
     u,
-    g,
     p,
+    g,
     b,
     c,
     E,
     R,
     P,
     U,
-    O,
+    F,
     N,
     G,
     r,
@@ -46191,8 +46218,8 @@ function instance$3(n, e, t) {
     m,
     _,
     k,
-    L,
     $,
+    L,
     z,
     s,
     a,
@@ -46392,7 +46419,7 @@ function createDOMPurify() {
     HTMLFormElement: y,
     DOMParser: A,
     trustedTypes: x
-  } = n, M = d.prototype, m = lookupGetter(M, "cloneNode"), l = lookupGetter(M, "remove"), u = lookupGetter(M, "nextSibling"), g = lookupGetter(M, "childNodes"), p = lookupGetter(M, "parentNode");
+  } = n, M = d.prototype, m = lookupGetter(M, "cloneNode"), l = lookupGetter(M, "remove"), u = lookupGetter(M, "nextSibling"), p = lookupGetter(M, "childNodes"), g = lookupGetter(M, "parentNode");
   if (typeof h == "function") {
     const qe = t.createElement("template");
     qe.content && qe.content.ownerDocument && (t = qe.content.ownerDocument);
@@ -46404,13 +46431,13 @@ function createDOMPurify() {
     createDocumentFragment: w,
     getElementsByTagName: k
   } = t, {
-    importNode: L
+    importNode: $
   } = r;
-  let $ = {};
-  e.isSupported = typeof entries == "function" && typeof p == "function" && _ && _.createHTMLDocument !== void 0;
+  let L = {};
+  e.isSupported = typeof entries == "function" && typeof g == "function" && _ && _.createHTMLDocument !== void 0;
   const {
     MUSTACHE_EXPR: z,
-    ERB_EXPR: O,
+    ERB_EXPR: F,
     TMPLIT_EXPR: R,
     DATA_ATTR: P,
     ARIA_ATTR: U,
@@ -46443,7 +46470,7 @@ function createDOMPurify() {
       enumerable: !0,
       value: !1
     }
-  })), ce = null, fe = null, oe = !0, he = !0, Ae = !1, Se = !0, Ie = !1, pe = !0, le = !1, ne = !1, Te = !1, Fe = !1, Be = !1, Ue = !1, Pe = !0, Ge = !1;
+  })), ce = null, fe = null, oe = !0, he = !0, Ae = !1, Se = !0, Ie = !1, pe = !0, le = !1, ne = !1, Te = !1, Oe = !1, Be = !1, Ue = !1, Pe = !0, Ge = !1;
   const Ne = "user-content-";
   let Re = !0, De = !1, je = {}, Xe = null;
   const X = addToSet({}, ["annotation-xml", "audio", "colgroup", "desc", "foreignobject", "head", "iframe", "math", "mi", "mn", "mo", "ms", "mtext", "noembed", "noframes", "noscript", "plaintext", "script", "style", "svg", "template", "thead", "title", "video", "xmp"]);
@@ -46454,7 +46481,7 @@ function createDOMPurify() {
   let ae = K, ge = !1, xe = null;
   const ue = addToSet({}, [ze, ke, K], stringToString);
   let Ce = null;
-  const Z = ["application/xhtml+xml", "text/html"], Oe = "text/html";
+  const Z = ["application/xhtml+xml", "text/html"], Fe = "text/html";
   let We = null, I = null;
   const we = t.createElement("form"), ve = function(be) {
     return be instanceof RegExp || be instanceof Function;
@@ -46462,7 +46489,7 @@ function createDOMPurify() {
     let be = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
     if (!(I && I === be)) {
       if ((!be || typeof be != "object") && (be = {}), be = clone(be), Ce = // eslint-disable-next-line unicorn/prefer-includes
-      Z.indexOf(be.PARSER_MEDIA_TYPE) === -1 ? Oe : be.PARSER_MEDIA_TYPE, We = Ce === "application/xhtml+xml" ? stringToString : stringToLowerCase, G = objectHasOwnProperty(be, "ALLOWED_TAGS") ? addToSet({}, be.ALLOWED_TAGS, We) : H, Q = objectHasOwnProperty(be, "ALLOWED_ATTR") ? addToSet({}, be.ALLOWED_ATTR, We) : te, xe = objectHasOwnProperty(be, "ALLOWED_NAMESPACES") ? addToSet({}, be.ALLOWED_NAMESPACES, stringToString) : ue, ye = objectHasOwnProperty(be, "ADD_URI_SAFE_ATTR") ? addToSet(
+      Z.indexOf(be.PARSER_MEDIA_TYPE) === -1 ? Fe : be.PARSER_MEDIA_TYPE, We = Ce === "application/xhtml+xml" ? stringToString : stringToLowerCase, G = objectHasOwnProperty(be, "ALLOWED_TAGS") ? addToSet({}, be.ALLOWED_TAGS, We) : H, Q = objectHasOwnProperty(be, "ALLOWED_ATTR") ? addToSet({}, be.ALLOWED_ATTR, We) : te, xe = objectHasOwnProperty(be, "ALLOWED_NAMESPACES") ? addToSet({}, be.ALLOWED_NAMESPACES, stringToString) : ue, ye = objectHasOwnProperty(be, "ADD_URI_SAFE_ATTR") ? addToSet(
         clone(me),
         // eslint-disable-line indent
         be.ADD_URI_SAFE_ATTR,
@@ -46476,7 +46503,7 @@ function createDOMPurify() {
         // eslint-disable-line indent
         We
         // eslint-disable-line indent
-      ) : re, Xe = objectHasOwnProperty(be, "FORBID_CONTENTS") ? addToSet({}, be.FORBID_CONTENTS, We) : X, ce = objectHasOwnProperty(be, "FORBID_TAGS") ? addToSet({}, be.FORBID_TAGS, We) : {}, fe = objectHasOwnProperty(be, "FORBID_ATTR") ? addToSet({}, be.FORBID_ATTR, We) : {}, je = objectHasOwnProperty(be, "USE_PROFILES") ? be.USE_PROFILES : !1, oe = be.ALLOW_ARIA_ATTR !== !1, he = be.ALLOW_DATA_ATTR !== !1, Ae = be.ALLOW_UNKNOWN_PROTOCOLS || !1, Se = be.ALLOW_SELF_CLOSE_IN_ATTR !== !1, Ie = be.SAFE_FOR_TEMPLATES || !1, pe = be.SAFE_FOR_XML !== !1, le = be.WHOLE_DOCUMENT || !1, Fe = be.RETURN_DOM || !1, Be = be.RETURN_DOM_FRAGMENT || !1, Ue = be.RETURN_TRUSTED_TYPE || !1, Te = be.FORCE_BODY || !1, Pe = be.SANITIZE_DOM !== !1, Ge = be.SANITIZE_NAMED_PROPS || !1, Re = be.KEEP_CONTENT !== !1, De = be.IN_PLACE || !1, V = be.ALLOWED_URI_REGEXP || IS_ALLOWED_URI, ae = be.NAMESPACE || K, ee = be.CUSTOM_ELEMENT_HANDLING || {}, be.CUSTOM_ELEMENT_HANDLING && ve(be.CUSTOM_ELEMENT_HANDLING.tagNameCheck) && (ee.tagNameCheck = be.CUSTOM_ELEMENT_HANDLING.tagNameCheck), be.CUSTOM_ELEMENT_HANDLING && ve(be.CUSTOM_ELEMENT_HANDLING.attributeNameCheck) && (ee.attributeNameCheck = be.CUSTOM_ELEMENT_HANDLING.attributeNameCheck), be.CUSTOM_ELEMENT_HANDLING && typeof be.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements == "boolean" && (ee.allowCustomizedBuiltInElements = be.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements), Ie && (he = !1), Be && (Fe = !0), je && (G = addToSet({}, text$3), Q = [], je.html === !0 && (addToSet(G, html$1), addToSet(Q, html)), je.svg === !0 && (addToSet(G, svg$1), addToSet(Q, svg), addToSet(Q, xml)), je.svgFilters === !0 && (addToSet(G, svgFilters), addToSet(Q, svg), addToSet(Q, xml)), je.mathMl === !0 && (addToSet(G, mathMl$1), addToSet(Q, mathMl), addToSet(Q, xml))), be.ADD_TAGS && (G === H && (G = clone(G)), addToSet(G, be.ADD_TAGS, We)), be.ADD_ATTR && (Q === te && (Q = clone(Q)), addToSet(Q, be.ADD_ATTR, We)), be.ADD_URI_SAFE_ATTR && addToSet(ye, be.ADD_URI_SAFE_ATTR, We), be.FORBID_CONTENTS && (Xe === X && (Xe = clone(Xe)), addToSet(Xe, be.FORBID_CONTENTS, We)), Re && (G["#text"] = !0), le && addToSet(G, ["html", "head", "body"]), G.table && (addToSet(G, ["tbody"]), delete ce.tbody), be.TRUSTED_TYPES_POLICY) {
+      ) : re, Xe = objectHasOwnProperty(be, "FORBID_CONTENTS") ? addToSet({}, be.FORBID_CONTENTS, We) : X, ce = objectHasOwnProperty(be, "FORBID_TAGS") ? addToSet({}, be.FORBID_TAGS, We) : {}, fe = objectHasOwnProperty(be, "FORBID_ATTR") ? addToSet({}, be.FORBID_ATTR, We) : {}, je = objectHasOwnProperty(be, "USE_PROFILES") ? be.USE_PROFILES : !1, oe = be.ALLOW_ARIA_ATTR !== !1, he = be.ALLOW_DATA_ATTR !== !1, Ae = be.ALLOW_UNKNOWN_PROTOCOLS || !1, Se = be.ALLOW_SELF_CLOSE_IN_ATTR !== !1, Ie = be.SAFE_FOR_TEMPLATES || !1, pe = be.SAFE_FOR_XML !== !1, le = be.WHOLE_DOCUMENT || !1, Oe = be.RETURN_DOM || !1, Be = be.RETURN_DOM_FRAGMENT || !1, Ue = be.RETURN_TRUSTED_TYPE || !1, Te = be.FORCE_BODY || !1, Pe = be.SANITIZE_DOM !== !1, Ge = be.SANITIZE_NAMED_PROPS || !1, Re = be.KEEP_CONTENT !== !1, De = be.IN_PLACE || !1, V = be.ALLOWED_URI_REGEXP || IS_ALLOWED_URI, ae = be.NAMESPACE || K, ee = be.CUSTOM_ELEMENT_HANDLING || {}, be.CUSTOM_ELEMENT_HANDLING && ve(be.CUSTOM_ELEMENT_HANDLING.tagNameCheck) && (ee.tagNameCheck = be.CUSTOM_ELEMENT_HANDLING.tagNameCheck), be.CUSTOM_ELEMENT_HANDLING && ve(be.CUSTOM_ELEMENT_HANDLING.attributeNameCheck) && (ee.attributeNameCheck = be.CUSTOM_ELEMENT_HANDLING.attributeNameCheck), be.CUSTOM_ELEMENT_HANDLING && typeof be.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements == "boolean" && (ee.allowCustomizedBuiltInElements = be.CUSTOM_ELEMENT_HANDLING.allowCustomizedBuiltInElements), Ie && (he = !1), Be && (Oe = !0), je && (G = addToSet({}, text$3), Q = [], je.html === !0 && (addToSet(G, html$1), addToSet(Q, html)), je.svg === !0 && (addToSet(G, svg$1), addToSet(Q, svg), addToSet(Q, xml)), je.svgFilters === !0 && (addToSet(G, svgFilters), addToSet(Q, svg), addToSet(Q, xml)), je.mathMl === !0 && (addToSet(G, mathMl$1), addToSet(Q, mathMl), addToSet(Q, xml))), be.ADD_TAGS && (G === H && (G = clone(G)), addToSet(G, be.ADD_TAGS, We)), be.ADD_ATTR && (Q === te && (Q = clone(Q)), addToSet(Q, be.ADD_ATTR, We)), be.ADD_URI_SAFE_ATTR && addToSet(ye, be.ADD_URI_SAFE_ATTR, We), be.FORBID_CONTENTS && (Xe === X && (Xe = clone(Xe)), addToSet(Xe, be.FORBID_CONTENTS, We)), Re && (G["#text"] = !0), le && addToSet(G, ["html", "head", "body"]), G.table && (addToSet(G, ["tbody"]), delete ce.tbody), be.TRUSTED_TYPES_POLICY) {
         if (typeof be.TRUSTED_TYPES_POLICY.createHTML != "function")
           throw typeErrorCreate('TRUSTED_TYPES_POLICY configuration option must provide a "createHTML" hook.');
         if (typeof be.TRUSTED_TYPES_POLICY.createScriptURL != "function")
@@ -46487,7 +46514,7 @@ function createDOMPurify() {
       freeze && freeze(be), I = be;
     }
   }, de = addToSet({}, ["mi", "mo", "mn", "ms", "mtext"]), Me = addToSet({}, ["annotation-xml"]), Ye = addToSet({}, ["title", "style", "font", "a", "script"]), Ze = addToSet({}, [...svg$1, ...svgFilters, ...svgDisallowed]), Ke = addToSet({}, [...mathMl$1, ...mathMlDisallowed]), rt = function(be) {
-    let Ve = p(be);
+    let Ve = g(be);
     (!Ve || !Ve.tagName) && (Ve = {
       namespaceURI: ae,
       tagName: "template"
@@ -46499,7 +46526,7 @@ function createDOMPurify() {
       element: be
     });
     try {
-      p(be).removeChild(be);
+      g(be).removeChild(be);
     } catch {
       l(be);
     }
@@ -46516,7 +46543,7 @@ function createDOMPurify() {
       });
     }
     if (Ve.removeAttribute(be), be === "is" && !Q[be])
-      if (Fe || Be)
+      if (Oe || Be)
         try {
           wt(Ve);
         } catch {
@@ -46562,16 +46589,16 @@ function createDOMPurify() {
     return be instanceof y && (typeof be.nodeName != "string" || typeof be.textContent != "string" || typeof be.removeChild != "function" || !(be.attributes instanceof f) || typeof be.removeAttribute != "function" || typeof be.setAttribute != "function" || typeof be.namespaceURI != "string" || typeof be.insertBefore != "function" || typeof be.hasChildNodes != "function");
   }, gt = function(be) {
     return typeof o == "function" && be instanceof o;
-  }, Lt = function(be, Ve, et) {
-    $[be] && arrayForEach($[be], (_t) => {
+  }, $t = function(be, Ve, et) {
+    L[be] && arrayForEach(L[be], (_t) => {
       _t.call(e, Ve, et, I);
     });
   }, Pt = function(be) {
     let Ve = null;
-    if (Lt("beforeSanitizeElements", be, null), Mt(be))
+    if ($t("beforeSanitizeElements", be, null), Mt(be))
       return wt(be), !0;
     const et = We(be.nodeName);
-    if (Lt("uponSanitizeElement", be, {
+    if ($t("uponSanitizeElement", be, {
       tagName: et,
       allowedTags: G
     }), be.hasChildNodes() && !gt(be.firstElementChild) && regExpTest(/<[/\w]/g, be.innerHTML) && regExpTest(/<[/\w]/g, be.textContent) || be.nodeType === NODE_TYPE.progressingInstruction || pe && be.nodeType === NODE_TYPE.comment && regExpTest(/<[/\w]/g, be.data))
@@ -46580,22 +46607,22 @@ function createDOMPurify() {
       if (!ce[et] && St(et) && (ee.tagNameCheck instanceof RegExp && regExpTest(ee.tagNameCheck, et) || ee.tagNameCheck instanceof Function && ee.tagNameCheck(et)))
         return !1;
       if (Re && !Xe[et]) {
-        const _t = p(be) || be.parentNode, kt = g(be) || be.childNodes;
+        const _t = g(be) || be.parentNode, kt = p(be) || be.childNodes;
         if (kt && _t) {
           const Tt = kt.length;
-          for (let $t = Tt - 1; $t >= 0; --$t) {
-            const It = m(kt[$t], !0);
+          for (let Lt = Tt - 1; Lt >= 0; --Lt) {
+            const It = m(kt[Lt], !0);
             It.__removalCount = (be.__removalCount || 0) + 1, _t.insertBefore(It, u(be));
           }
         }
       }
       return wt(be), !0;
     }
-    return be instanceof d && !rt(be) || (et === "noscript" || et === "noembed" || et === "noframes") && regExpTest(/<\/no(script|embed|frames)/i, be.innerHTML) ? (wt(be), !0) : (Ie && be.nodeType === NODE_TYPE.text && (Ve = be.textContent, arrayForEach([z, O, R], (_t) => {
+    return be instanceof d && !rt(be) || (et === "noscript" || et === "noembed" || et === "noframes") && regExpTest(/<\/no(script|embed|frames)/i, be.innerHTML) ? (wt(be), !0) : (Ie && be.nodeType === NODE_TYPE.text && (Ve = be.textContent, arrayForEach([z, F, R], (_t) => {
       Ve = stringReplace(Ve, _t, " ");
     }), be.textContent !== Ve && (arrayPush(e.removed, {
       element: be.cloneNode()
-    }), be.textContent = Ve)), Lt("afterSanitizeElements", be, null), !1);
+    }), be.textContent = Ve)), $t("afterSanitizeElements", be, null), !1);
   }, Et = function(be, Ve, et) {
     if (Pe && (Ve === "id" || Ve === "name") && (et in t || et in we))
       return !1;
@@ -46626,7 +46653,7 @@ function createDOMPurify() {
   }, St = function(be) {
     return be !== "annotation-xml" && stringMatch(be, W);
   }, yt = function(be) {
-    Lt("beforeSanitizeAttributes", be, null);
+    $t("beforeSanitizeAttributes", be, null);
     const {
       attributes: Ve
     } = be;
@@ -46642,49 +46669,49 @@ function createDOMPurify() {
     for (; _t--; ) {
       const kt = Ve[_t], {
         name: Tt,
-        namespaceURI: $t,
+        namespaceURI: Lt,
         value: It
       } = kt, Ht = We(Tt);
-      let Ot = Tt === "value" ? It : stringTrim(It);
-      if (et.attrName = Ht, et.attrValue = Ot, et.keepAttr = !0, et.forceKeepAttr = void 0, Lt("uponSanitizeAttribute", be, et), Ot = et.attrValue, et.forceKeepAttr || (st(Tt, be), !et.keepAttr))
+      let Ft = Tt === "value" ? It : stringTrim(It);
+      if (et.attrName = Ht, et.attrValue = Ft, et.keepAttr = !0, et.forceKeepAttr = void 0, $t("uponSanitizeAttribute", be, et), Ft = et.attrValue, et.forceKeepAttr || (st(Tt, be), !et.keepAttr))
         continue;
-      if (!Se && regExpTest(/\/>/i, Ot)) {
+      if (!Se && regExpTest(/\/>/i, Ft)) {
         st(Tt, be);
         continue;
       }
-      Ie && arrayForEach([z, O, R], (wr) => {
-        Ot = stringReplace(Ot, wr, " ");
+      Ie && arrayForEach([z, F, R], (wr) => {
+        Ft = stringReplace(Ft, wr, " ");
       });
       const xr = We(be.nodeName);
-      if (Et(xr, Ht, Ot)) {
-        if (Ge && (Ht === "id" || Ht === "name") && (st(Tt, be), Ot = Ne + Ot), pe && regExpTest(/((--!?|])>)|<\/(style|title)/i, Ot)) {
+      if (Et(xr, Ht, Ft)) {
+        if (Ge && (Ht === "id" || Ht === "name") && (st(Tt, be), Ft = Ne + Ft), pe && regExpTest(/((--!?|])>)|<\/(style|title)/i, Ft)) {
           st(Tt, be);
           continue;
         }
-        if (b && typeof x == "object" && typeof x.getAttributeType == "function" && !$t)
+        if (b && typeof x == "object" && typeof x.getAttributeType == "function" && !Lt)
           switch (x.getAttributeType(xr, Ht)) {
             case "TrustedHTML": {
-              Ot = b.createHTML(Ot);
+              Ft = b.createHTML(Ft);
               break;
             }
             case "TrustedScriptURL": {
-              Ot = b.createScriptURL(Ot);
+              Ft = b.createScriptURL(Ft);
               break;
             }
           }
         try {
-          $t ? be.setAttributeNS($t, Tt, Ot) : be.setAttribute(Tt, Ot), Mt(be) ? wt(be) : arrayPop(e.removed);
+          Lt ? be.setAttributeNS(Lt, Tt, Ft) : be.setAttribute(Tt, Ft), Mt(be) ? wt(be) : arrayPop(e.removed);
         } catch {
         }
       }
     }
-    Lt("afterSanitizeAttributes", be, null);
+    $t("afterSanitizeAttributes", be, null);
   }, zt = function qe(be) {
     let Ve = null;
     const et = at(be);
-    for (Lt("beforeSanitizeShadowDOM", be, null); Ve = et.nextNode(); )
-      Lt("uponSanitizeShadowNode", Ve, null), !Pt(Ve) && (Ve.content instanceof s && qe(Ve.content), yt(Ve));
-    Lt("afterSanitizeShadowDOM", be, null);
+    for ($t("beforeSanitizeShadowDOM", be, null); Ve = et.nextNode(); )
+      $t("uponSanitizeShadowNode", Ve, null), !Pt(Ve) && (Ve.content instanceof s && qe(Ve.content), yt(Ve));
+    $t("afterSanitizeShadowDOM", be, null);
   };
   return e.sanitize = function(qe) {
     let be = arguments.length > 1 && arguments[1] !== void 0 ? arguments[1] : {}, Ve = null, et = null, _t = null, kt = null;
@@ -46705,11 +46732,11 @@ function createDOMPurify() {
     } else if (qe instanceof o)
       Ve = ot("<!---->"), et = Ve.ownerDocument.importNode(qe, !0), et.nodeType === NODE_TYPE.element && et.nodeName === "BODY" || et.nodeName === "HTML" ? Ve = et : Ve.appendChild(et);
     else {
-      if (!Fe && !Ie && !le && // eslint-disable-next-line unicorn/prefer-includes
+      if (!Oe && !Ie && !le && // eslint-disable-next-line unicorn/prefer-includes
       qe.indexOf("<") === -1)
         return b && Ue ? b.createHTML(qe) : qe;
       if (Ve = ot(qe), !Ve)
-        return Fe ? null : Ue ? c : "";
+        return Oe ? null : Ue ? c : "";
     }
     Ve && Te && wt(Ve.firstChild);
     const Tt = at(De ? qe : Ve);
@@ -46717,19 +46744,19 @@ function createDOMPurify() {
       Pt(_t) || (_t.content instanceof s && zt(_t.content), yt(_t));
     if (De)
       return qe;
-    if (Fe) {
+    if (Oe) {
       if (Be)
         for (kt = w.call(Ve.ownerDocument); Ve.firstChild; )
           kt.appendChild(Ve.firstChild);
       else
         kt = Ve;
-      return (Q.shadowroot || Q.shadowrootmode) && (kt = L.call(r, kt, !0)), kt;
+      return (Q.shadowroot || Q.shadowrootmode) && (kt = $.call(r, kt, !0)), kt;
     }
-    let $t = le ? Ve.outerHTML : Ve.innerHTML;
-    return le && G["!doctype"] && Ve.ownerDocument && Ve.ownerDocument.doctype && Ve.ownerDocument.doctype.name && regExpTest(DOCTYPE_NAME, Ve.ownerDocument.doctype.name) && ($t = "<!DOCTYPE " + Ve.ownerDocument.doctype.name + `>
-` + $t), Ie && arrayForEach([z, O, R], (It) => {
-      $t = stringReplace($t, It, " ");
-    }), b && Ue ? b.createHTML($t) : $t;
+    let Lt = le ? Ve.outerHTML : Ve.innerHTML;
+    return le && G["!doctype"] && Ve.ownerDocument && Ve.ownerDocument.doctype && Ve.ownerDocument.doctype.name && regExpTest(DOCTYPE_NAME, Ve.ownerDocument.doctype.name) && (Lt = "<!DOCTYPE " + Ve.ownerDocument.doctype.name + `>
+` + Lt), Ie && arrayForEach([z, F, R], (It) => {
+      Lt = stringReplace(Lt, It, " ");
+    }), b && Ue ? b.createHTML(Lt) : Lt;
   }, e.setConfig = function() {
     let qe = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
     Y(qe), ne = !0;
@@ -46740,14 +46767,14 @@ function createDOMPurify() {
     const et = We(qe), _t = We(be);
     return Et(et, _t, Ve);
   }, e.addHook = function(qe, be) {
-    typeof be == "function" && ($[qe] = $[qe] || [], arrayPush($[qe], be));
+    typeof be == "function" && (L[qe] = L[qe] || [], arrayPush(L[qe], be));
   }, e.removeHook = function(qe) {
-    if ($[qe])
-      return arrayPop($[qe]);
+    if (L[qe])
+      return arrayPop(L[qe]);
   }, e.removeHooks = function(qe) {
-    $[qe] && ($[qe] = []);
+    L[qe] && (L[qe] = []);
   }, e.removeAllHooks = function() {
-    $ = {};
+    L = {};
   }, e;
 }
 createDOMPurify();
@@ -46760,36 +46787,343 @@ const {
   binding_callbacks: binding_callbacks$2,
   children: children$1,
   claim_element: claim_element$1,
+  claim_space: claim_space$2,
   claim_text: claim_text$2,
+  destroy_each,
   detach: detach$2,
   element: element$1,
+  empty: empty$1,
+  ensure_array_like,
+  get_svelte_dataset,
   init: init$2,
   insert_hydration: insert_hydration$2,
   noop: noop$1,
   safe_not_equal: safe_not_equal$2,
   set_data: set_data$2,
+  space: space$2,
   text: text$2,
   toggle_class: toggle_class$1
 } = window.__gradio__svelte__internal, { onMount: onMount$1 } = window.__gradio__svelte__internal;
-function create_fragment$2(n) {
-  let e, t = (
+function get_each_context(n, e, t) {
+  const r = n.slice();
+  return r[8] = e[t], r;
+}
+function create_if_block$2(n) {
+  let e, t, r, a, s, h = (
     /*value*/
-    (n[0] ? (
+    n[0].covMods.length + ""
+  ), o, d;
+  function v(M, m) {
+    return (
       /*value*/
-      n[0]
-    ) : "") + ""
-  ), r, a;
+      M[0].chains.length > 1 ? create_if_block_5$1 : create_else_block_1$1
+    );
+  }
+  let f = v(n), y = f(n), A = ensure_array_like(
+    /*value*/
+    n[0].chains
+  ), x = [];
+  for (let M = 0; M < A.length; M += 1)
+    x[M] = create_each_block(get_each_context(n, A, M));
   return {
     c() {
-      e = element$1("div"), r = text$2(t), this.h();
+      y.c(), e = space$2(), t = element$1("ul");
+      for (let M = 0; M < x.length; M += 1)
+        x[M].c();
+      r = space$2(), a = element$1("ul"), s = element$1("li"), o = text$2(h), d = text$2(" covalent modifications");
+    },
+    l(M) {
+      y.l(M), e = claim_space$2(M), t = claim_element$1(M, "UL", {});
+      var m = children$1(t);
+      for (let p = 0; p < x.length; p += 1)
+        x[p].l(m);
+      m.forEach(detach$2), r = claim_space$2(M), a = claim_element$1(M, "UL", {});
+      var l = children$1(a);
+      s = claim_element$1(l, "LI", {});
+      var u = children$1(s);
+      o = claim_text$2(u, h), d = claim_text$2(u, " covalent modifications"), u.forEach(detach$2), l.forEach(detach$2);
+    },
+    m(M, m) {
+      y.m(M, m), insert_hydration$2(M, e, m), insert_hydration$2(M, t, m);
+      for (let l = 0; l < x.length; l += 1)
+        x[l] && x[l].m(t, null);
+      insert_hydration$2(M, r, m), insert_hydration$2(M, a, m), append_hydration$1(a, s), append_hydration$1(s, o), append_hydration$1(s, d);
+    },
+    p(M, m) {
+      if (f === (f = v(M)) && y ? y.p(M, m) : (y.d(1), y = f(M), y && (y.c(), y.m(e.parentNode, e))), m & /*value, undefined*/
+      1) {
+        A = ensure_array_like(
+          /*value*/
+          M[0].chains
+        );
+        let l;
+        for (l = 0; l < A.length; l += 1) {
+          const u = get_each_context(M, A, l);
+          x[l] ? x[l].p(u, m) : (x[l] = create_each_block(u), x[l].c(), x[l].m(t, null));
+        }
+        for (; l < x.length; l += 1)
+          x[l].d(1);
+        x.length = A.length;
+      }
+      m & /*value*/
+      1 && h !== (h = /*value*/
+      M[0].covMods.length + "") && set_data$2(o, h);
+    },
+    d(M) {
+      M && (detach$2(e), detach$2(t), detach$2(r), detach$2(a)), y.d(M), destroy_each(x, M);
+    }
+  };
+}
+function create_else_block_1$1(n) {
+  let e, t, r = (
+    /*value*/
+    n[0].chains.length + ""
+  ), a, s, h;
+  return {
+    c() {
+      e = element$1("b"), t = text$2("Input composed of "), a = text$2(r), s = text$2(" chain "), h = element$1("br");
+    },
+    l(o) {
+      e = claim_element$1(o, "B", {});
+      var d = children$1(e);
+      t = claim_text$2(d, "Input composed of "), a = claim_text$2(d, r), s = claim_text$2(d, " chain "), d.forEach(detach$2), h = claim_element$1(o, "BR", {});
+    },
+    m(o, d) {
+      insert_hydration$2(o, e, d), append_hydration$1(e, t), append_hydration$1(e, a), append_hydration$1(e, s), insert_hydration$2(o, h, d);
+    },
+    p(o, d) {
+      d & /*value*/
+      1 && r !== (r = /*value*/
+      o[0].chains.length + "") && set_data$2(a, r);
+    },
+    d(o) {
+      o && (detach$2(e), detach$2(h));
+    }
+  };
+}
+function create_if_block_5$1(n) {
+  let e, t, r = (
+    /*value*/
+    n[0].chains.length + ""
+  ), a, s, h, o;
+  return {
+    c() {
+      e = element$1("b"), t = text$2("Input composed of "), a = text$2(r), s = text$2(" chains"), h = space$2(), o = element$1("br");
+    },
+    l(d) {
+      e = claim_element$1(d, "B", {});
+      var v = children$1(e);
+      t = claim_text$2(v, "Input composed of "), a = claim_text$2(v, r), s = claim_text$2(v, " chains"), v.forEach(detach$2), h = claim_space$2(d), o = claim_element$1(d, "BR", {});
+    },
+    m(d, v) {
+      insert_hydration$2(d, e, v), append_hydration$1(e, t), append_hydration$1(e, a), append_hydration$1(e, s), insert_hydration$2(d, h, v), insert_hydration$2(d, o, v);
+    },
+    p(d, v) {
+      v & /*value*/
+      1 && r !== (r = /*value*/
+      d[0].chains.length + "") && set_data$2(a, r);
+    },
+    d(d) {
+      d && (detach$2(e), detach$2(h), detach$2(o));
+    }
+  };
+}
+function create_if_block_4$1(n) {
+  let e, t, r = (
+    /*val*/
+    n[8].class + ""
+  ), a, s, h = (
+    /*val*/
+    n[8].sequence.length + ""
+  ), o, d;
+  return {
+    c() {
+      e = element$1("li"), t = element$1("div"), a = text$2(r), s = space$2(), o = text$2(h), d = text$2(" residues"), this.h();
+    },
+    l(v) {
+      e = claim_element$1(v, "LI", {});
+      var f = children$1(e);
+      t = claim_element$1(f, "DIV", { class: !0 });
+      var y = children$1(t);
+      a = claim_text$2(y, r), s = claim_space$2(y), o = claim_text$2(y, h), d = claim_text$2(y, " residues"), y.forEach(detach$2), f.forEach(detach$2), this.h();
+    },
+    h() {
+      attr$1(t, "class", "svelte-1r1gryw");
+    },
+    m(v, f) {
+      insert_hydration$2(v, e, f), append_hydration$1(e, t), append_hydration$1(t, a), append_hydration$1(t, s), append_hydration$1(t, o), append_hydration$1(t, d);
+    },
+    p(v, f) {
+      f & /*value*/
+      1 && r !== (r = /*val*/
+      v[8].class + "") && set_data$2(a, r), f & /*value*/
+      1 && h !== (h = /*val*/
+      v[8].sequence.length + "") && set_data$2(o, h);
+    },
+    d(v) {
+      v && detach$2(e);
+    }
+  };
+}
+function create_if_block_1$1(n) {
+  let e;
+  function t(s, h) {
+    return (
+      /*val*/
+      s[8].name != null ? create_if_block_2$1 : (
+        /*val*/
+        s[8].smiles != null ? create_if_block_3$1 : create_else_block$1
+      )
+    );
+  }
+  let r = t(n), a = r(n);
+  return {
+    c() {
+      a.c(), e = empty$1();
     },
     l(s) {
-      e = claim_element$1(s, "DIV", { class: !0 });
-      var h = children$1(e);
-      r = claim_text$2(h, t), h.forEach(detach$2), this.h();
+      a.l(s), e = empty$1();
+    },
+    m(s, h) {
+      a.m(s, h), insert_hydration$2(s, e, h);
+    },
+    p(s, h) {
+      r === (r = t(s)) && a ? a.p(s, h) : (a.d(1), a = r(s), a && (a.c(), a.m(e.parentNode, e)));
+    },
+    d(s) {
+      s && detach$2(e), a.d(s);
+    }
+  };
+}
+function create_else_block$1(n) {
+  let e, t = '<div class="svelte-1r1gryw">Ligand</div>';
+  return {
+    c() {
+      e = element$1("li"), e.innerHTML = t;
+    },
+    l(r) {
+      e = claim_element$1(r, "LI", { "data-svelte-h": !0 }), get_svelte_dataset(e) !== "svelte-z73xb2" && (e.innerHTML = t);
+    },
+    m(r, a) {
+      insert_hydration$2(r, e, a);
+    },
+    p: noop$1,
+    d(r) {
+      r && detach$2(e);
+    }
+  };
+}
+function create_if_block_3$1(n) {
+  let e, t, r, a = (
+    /*val*/
+    n[8].smiles.length + ""
+  ), s, h;
+  return {
+    c() {
+      e = element$1("li"), t = element$1("div"), r = text$2("Ligand SMILES with "), s = text$2(a), h = text$2(" atoms"), this.h();
+    },
+    l(o) {
+      e = claim_element$1(o, "LI", {});
+      var d = children$1(e);
+      t = claim_element$1(d, "DIV", { class: !0 });
+      var v = children$1(t);
+      r = claim_text$2(v, "Ligand SMILES with "), s = claim_text$2(v, a), h = claim_text$2(v, " atoms"), v.forEach(detach$2), d.forEach(detach$2), this.h();
+    },
+    h() {
+      attr$1(t, "class", "svelte-1r1gryw");
+    },
+    m(o, d) {
+      insert_hydration$2(o, e, d), append_hydration$1(e, t), append_hydration$1(t, r), append_hydration$1(t, s), append_hydration$1(t, h);
+    },
+    p(o, d) {
+      d & /*value*/
+      1 && a !== (a = /*val*/
+      o[8].smiles.length + "") && set_data$2(s, a);
+    },
+    d(o) {
+      o && detach$2(e);
+    }
+  };
+}
+function create_if_block_2$1(n) {
+  let e, t, r, a = (
+    /*val*/
+    n[8].name + ""
+  ), s;
+  return {
+    c() {
+      e = element$1("li"), t = element$1("div"), r = text$2("Ligand "), s = text$2(a), this.h();
+    },
+    l(h) {
+      e = claim_element$1(h, "LI", {});
+      var o = children$1(e);
+      t = claim_element$1(o, "DIV", { class: !0 });
+      var d = children$1(t);
+      r = claim_text$2(d, "Ligand "), s = claim_text$2(d, a), d.forEach(detach$2), o.forEach(detach$2), this.h();
     },
     h() {
-      attr$1(e, "class", "svelte-84cxb8"), add_render_callback$1(() => (
+      attr$1(t, "class", "svelte-1r1gryw");
+    },
+    m(h, o) {
+      insert_hydration$2(h, e, o), append_hydration$1(e, t), append_hydration$1(t, r), append_hydration$1(t, s);
+    },
+    p(h, o) {
+      o & /*value*/
+      1 && a !== (a = /*val*/
+      h[8].name + "") && set_data$2(s, a);
+    },
+    d(h) {
+      h && detach$2(e);
+    }
+  };
+}
+function create_each_block(n) {
+  let e = ["protein", "DNA", "RNA"].includes(
+    /*val*/
+    n[8].class
+  ), t, r, a = e && create_if_block_4$1(n), s = (
+    /*val*/
+    n[8].class == "ligand" && create_if_block_1$1(n)
+  );
+  return {
+    c() {
+      a && a.c(), t = space$2(), s && s.c(), r = empty$1();
+    },
+    l(h) {
+      a && a.l(h), t = claim_space$2(h), s && s.l(h), r = empty$1();
+    },
+    m(h, o) {
+      a && a.m(h, o), insert_hydration$2(h, t, o), s && s.m(h, o), insert_hydration$2(h, r, o);
+    },
+    p(h, o) {
+      o & /*value*/
+      1 && (e = ["protein", "DNA", "RNA"].includes(
+        /*val*/
+        h[8].class
+      )), e ? a ? a.p(h, o) : (a = create_if_block_4$1(h), a.c(), a.m(t.parentNode, t)) : a && (a.d(1), a = null), /*val*/
+      h[8].class == "ligand" ? s ? s.p(h, o) : (s = create_if_block_1$1(h), s.c(), s.m(r.parentNode, r)) : s && (s.d(1), s = null);
+    },
+    d(h) {
+      h && (detach$2(t), detach$2(r)), a && a.d(h), s && s.d(h);
+    }
+  };
+}
+function create_fragment$2(n) {
+  let e, t, r = (
+    /*value*/
+    n[0] && create_if_block$2(n)
+  );
+  return {
+    c() {
+      e = element$1("div"), r && r.c(), this.h();
+    },
+    l(a) {
+      e = claim_element$1(a, "DIV", { class: !0 });
+      var s = children$1(e);
+      r && r.l(s), s.forEach(detach$2), this.h();
+    },
+    h() {
+      attr$1(e, "class", "svelte-1r1gryw"), add_render_callback$1(() => (
         /*div_elementresize_handler*/
         n[5].call(e)
       )), toggle_class$1(
@@ -46809,43 +47143,39 @@ function create_fragment$2(n) {
         n[2]
       );
     },
-    m(s, h) {
-      insert_hydration$2(s, e, h), append_hydration$1(e, r), a = add_iframe_resize_listener(
+    m(a, s) {
+      insert_hydration$2(a, e, s), r && r.m(e, null), t = add_iframe_resize_listener(
         e,
         /*div_elementresize_handler*/
         n[5].bind(e)
       ), n[6](e);
     },
-    p(s, [h]) {
-      h & /*value*/
-      1 && t !== (t = /*value*/
-      (s[0] ? (
-        /*value*/
-        s[0]
-      ) : "") + "") && set_data$2(r, t), h & /*type*/
+    p(a, [s]) {
+      /*value*/
+      a[0] ? r ? r.p(a, s) : (r = create_if_block$2(a), r.c(), r.m(e, null)) : r && (r.d(1), r = null), s & /*type*/
       2 && toggle_class$1(
         e,
         "table",
         /*type*/
-        s[1] === "table"
-      ), h & /*type*/
+        a[1] === "table"
+      ), s & /*type*/
       2 && toggle_class$1(
         e,
         "gallery",
         /*type*/
-        s[1] === "gallery"
-      ), h & /*selected*/
+        a[1] === "gallery"
+      ), s & /*selected*/
       4 && toggle_class$1(
         e,
         "selected",
         /*selected*/
-        s[2]
+        a[2]
       );
     },
     i: noop$1,
     o: noop$1,
-    d(s) {
-      s && detach$2(e), a(), n[6](null);
+    d(a) {
+      a && detach$2(e), r && r.d(), t(), n[6](null);
     }
   };
 }
@@ -47578,24 +47908,24 @@ function create_fragment$1(n) {
   };
 }
 function instance$1(n, e, t) {
-  let { value: r = "" } = e, { value_is_output: a = !1 } = e, { lines: s = 1 } = e, { placeholder: h = "Type here..." } = e, { label: o } = e, { info: d = void 0 } = e, { disabled: v = !1 } = e, { show_label: f = !0 } = e, { container: y = !0 } = e, { max_lines: A } = e, { type: x = "text" } = e, { show_copy_button: M = !1 } = e, { rtl: m = !1 } = e, { autofocus: l = !1 } = e, { text_align: u = void 0 } = e, { autoscroll: g = !0 } = e, p, b = !1, c, _, E = 0, w = !1;
+  let { value: r = "" } = e, { value_is_output: a = !1 } = e, { lines: s = 1 } = e, { placeholder: h = "Type here..." } = e, { label: o } = e, { info: d = void 0 } = e, { disabled: v = !1 } = e, { show_label: f = !0 } = e, { container: y = !0 } = e, { max_lines: A } = e, { type: x = "text" } = e, { show_copy_button: M = !1 } = e, { rtl: m = !1 } = e, { autofocus: l = !1 } = e, { text_align: u = void 0 } = e, { autoscroll: p = !0 } = e, g, b = !1, c, _, E = 0, w = !1;
   const k = createEventDispatcher();
   beforeUpdate(() => {
-    _ = p && p.offsetHeight + p.scrollTop > p.scrollHeight - 100;
+    _ = g && g.offsetHeight + g.scrollTop > g.scrollHeight - 100;
   });
-  const L = () => {
-    _ && g && !w && p.scrollTo(0, p.scrollHeight);
+  const $ = () => {
+    _ && p && !w && g.scrollTo(0, g.scrollHeight);
   };
-  function $() {
+  function L() {
     k("change", r), a || k("input");
   }
   afterUpdate(() => {
-    l && p.focus(), _ && g && L(), t(21, a = !1);
+    l && g.focus(), _ && p && $(), t(21, a = !1);
   });
   async function z() {
-    "clipboard" in navigator && (await navigator.clipboard.writeText(r), O());
+    "clipboard" in navigator && (await navigator.clipboard.writeText(r), F());
   }
-  function O() {
+  function F() {
     t(15, b = !0), c && clearTimeout(c), c = setTimeout(
       () => {
         t(15, b = !1);
@@ -47604,25 +47934,25 @@ function instance$1(n, e, t) {
     );
   }
   function R(ne) {
-    const Te = ne.target, Fe = Te.value, Be = [Te.selectionStart, Te.selectionEnd];
-    k("select", { value: Fe.substring(...Be), index: Be });
+    const Te = ne.target, Oe = Te.value, Be = [Te.selectionStart, Te.selectionEnd];
+    k("select", { value: Oe.substring(...Be), index: Be });
   }
   async function P(ne) {
     await tick(), (ne.key === "Enter" && ne.shiftKey && s > 1 || ne.key === "Enter" && !ne.shiftKey && s === 1 && A >= 1) && (ne.preventDefault(), k("submit"));
   }
   function U(ne) {
-    const Te = ne.target, Fe = Te.scrollTop;
-    Fe < E && (w = !0), E = Fe;
+    const Te = ne.target, Oe = Te.scrollTop;
+    Oe < E && (w = !0), E = Oe;
     const Be = Te.scrollHeight - Te.clientHeight;
-    Fe >= Be && (w = !1);
+    Oe >= Be && (w = !1);
   }
   async function N(ne) {
     if (await tick(), s === A) return;
-    let Te = A === void 0 ? !1 : A === void 0 ? 21 * 11 : 21 * (A + 1), Fe = 21 * (s + 1);
+    let Te = A === void 0 ? !1 : A === void 0 ? 21 * 11 : 21 * (A + 1), Oe = 21 * (s + 1);
     const Be = ne.target;
     Be.style.height = "1px";
     let Ue;
-    Te && Be.scrollHeight > Te ? Ue = Te : Be.scrollHeight < Fe ? Ue = Fe : Ue = Be.scrollHeight, Be.style.height = `${Ue}px`;
+    Te && Be.scrollHeight > Te ? Ue = Te : Be.scrollHeight < Oe ? Ue = Oe : Ue = Be.scrollHeight, Be.style.height = `${Ue}px`;
   }
   function B(ne, Te) {
     if (s !== A && (ne.style.overflowY = "scroll", ne.addEventListener("input", N), !!Te.trim()))
@@ -47659,7 +47989,7 @@ function instance$1(n, e, t) {
   }
   function oe(ne) {
     binding_callbacks$1[ne ? "unshift" : "push"](() => {
-      p = ne, t(14, p);
+      g = ne, t(14, g);
     });
   }
   function he() {
@@ -47667,7 +47997,7 @@ function instance$1(n, e, t) {
   }
   function Ae(ne) {
     binding_callbacks$1[ne ? "unshift" : "push"](() => {
-      p = ne, t(14, p);
+      g = ne, t(14, g);
     });
   }
   function Se() {
@@ -47675,7 +48005,7 @@ function instance$1(n, e, t) {
   }
   function Ie(ne) {
     binding_callbacks$1[ne ? "unshift" : "push"](() => {
-      p = ne, t(14, p);
+      g = ne, t(14, g);
     });
   }
   function pe() {
@@ -47683,16 +48013,16 @@ function instance$1(n, e, t) {
   }
   function le(ne) {
     binding_callbacks$1[ne ? "unshift" : "push"](() => {
-      p = ne, t(14, p);
+      g = ne, t(14, g);
     });
   }
   return n.$$set = (ne) => {
-    "value" in ne && t(0, r = ne.value), "value_is_output" in ne && t(21, a = ne.value_is_output), "lines" in ne && t(1, s = ne.lines), "placeholder" in ne && t(2, h = ne.placeholder), "label" in ne && t(3, o = ne.label), "info" in ne && t(4, d = ne.info), "disabled" in ne && t(5, v = ne.disabled), "show_label" in ne && t(6, f = ne.show_label), "container" in ne && t(7, y = ne.container), "max_lines" in ne && t(8, A = ne.max_lines), "type" in ne && t(9, x = ne.type), "show_copy_button" in ne && t(10, M = ne.show_copy_button), "rtl" in ne && t(11, m = ne.rtl), "autofocus" in ne && t(12, l = ne.autofocus), "text_align" in ne && t(13, u = ne.text_align), "autoscroll" in ne && t(22, g = ne.autoscroll);
+    "value" in ne && t(0, r = ne.value), "value_is_output" in ne && t(21, a = ne.value_is_output), "lines" in ne && t(1, s = ne.lines), "placeholder" in ne && t(2, h = ne.placeholder), "label" in ne && t(3, o = ne.label), "info" in ne && t(4, d = ne.info), "disabled" in ne && t(5, v = ne.disabled), "show_label" in ne && t(6, f = ne.show_label), "container" in ne && t(7, y = ne.container), "max_lines" in ne && t(8, A = ne.max_lines), "type" in ne && t(9, x = ne.type), "show_copy_button" in ne && t(10, M = ne.show_copy_button), "rtl" in ne && t(11, m = ne.rtl), "autofocus" in ne && t(12, l = ne.autofocus), "text_align" in ne && t(13, u = ne.text_align), "autoscroll" in ne && t(22, p = ne.autoscroll);
   }, n.$$.update = () => {
     n.$$.dirty[0] & /*value*/
     1 && r === null && t(0, r = ""), n.$$.dirty[0] & /*value, el, lines, max_lines*/
-    16643 && p && s !== A && N({ target: p }), n.$$.dirty[0] & /*value*/
-    1 && $();
+    16643 && g && s !== A && N({ target: g }), n.$$.dirty[0] & /*value*/
+    1 && L();
   }, [
     r,
     s,
@@ -47708,7 +48038,7 @@ function instance$1(n, e, t) {
     m,
     l,
     u,
-    p,
+    g,
     b,
     z,
     R,
@@ -47716,7 +48046,7 @@ function instance$1(n, e, t) {
     U,
     B,
     a,
-    g,
+    p,
     W,
     V,
     G,
@@ -48030,20 +48360,23 @@ function create_fragment(n) {
 }
 function instance(n, e, t) {
   let { gradio: r } = e, { label: a = "CofoldingInput" } = e, { info: s = void 0 } = e, { elem_id: h = "" } = e, { elem_classes: o = [] } = e, { visible: d = !0 } = e, { value: v = { chains: [], covMods: [] } } = e, { show_label: f } = e, { container: y = !0 } = e, { scale: A = null } = e, { min_width: x = void 0 } = e, { loading_status: M = void 0 } = e;
-  function m(g) {
-    let p = g.detail.map((b) => Object.fromEntries(Object.entries(b).filter(([c, _]) => c !== "open" && _ !== "")));
-    t(0, v.chains = p, v);
+  function m(p) {
+    let g = p.detail.map((b) => Object.fromEntries(Object.entries(b).filter(([c, _]) => c !== "open" && _ !== "")));
+    t(0, v.chains = g, v);
   }
-  function l(g) {
-    t(0, v.covMods = g.detail, v);
+  function l(p) {
+    t(0, v.covMods = p.detail, v);
   }
   onMount(() => {
   });
-  function u(g) {
-    v = g, t(0, v);
+  function u(p) {
+    v = p, t(0, v);
   }
-  return n.$$set = (g) => {
-    "gradio" in g && t(1, r = g.gradio), "label" in g && t(2, a = g.label), "info" in g && t(3, s = g.info), "elem_id" in g && t(4, h = g.elem_id), "elem_classes" in g && t(5, o = g.elem_classes), "visible" in g && t(6, d = g.visible), "value" in g && t(0, v = g.value), "show_label" in g && t(7, f = g.show_label), "container" in g && t(8, y = g.container), "scale" in g && t(9, A = g.scale), "min_width" in g && t(10, x = g.min_width), "loading_status" in g && t(11, M = g.loading_status);
+  return n.$$set = (p) => {
+    "gradio" in p && t(1, r = p.gradio), "label" in p && t(2, a = p.label), "info" in p && t(3, s = p.info), "elem_id" in p && t(4, h = p.elem_id), "elem_classes" in p && t(5, o = p.elem_classes), "visible" in p && t(6, d = p.visible), "value" in p && t(0, v = p.value), "show_label" in p && t(7, f = p.show_label), "container" in p && t(8, y = p.container), "scale" in p && t(9, A = p.scale), "min_width" in p && t(10, x = p.min_width), "loading_status" in p && t(11, M = p.loading_status);
+  }, n.$$.update = () => {
+    n.$$.dirty & /*value*/
+    1 && console.log(v);
   }, [
     v,
     r,