instruction
stringclasses
1 value
output
stringlengths
52
197
input
stringlengths
75
717
history
sequencelengths
0
0
For the chemical reaction, solvents CCOCC and O are used. ### The answer is CCOCC and O
Can you list the solvents that participate in the reaction involving the SMILES [Li]CCCC.C1CN2CCN1CC2.Clc1cncc(Cl)c1.CN(C)C=O>>O=Cc1ncc(Cl)cc1Cl.?
[]
CC(=O)O and ClCCl are the chosen solvents for this chemical reaction. ### The answer is CC(=O)O and ClCCl
Can you name the solvents used in the reaction depicted by the SMILES code O=C(NCCCCc1ccc(CCCCN(C[C@H](O)c2ccc(OCc3ccccc3)c(NS(=O)(=O)CCc3ccccc3)c2)C[C@H](O)c2ccc(OCc3ccccc3)c(NS(=O)(=O)CCc3ccccc3)c2)cc1)OCc1ccccc1.CO>>CC(=O)O.CC(=O)O.CS(=O)(=O)Nc1cc([C@@H](O)CN(CCCCc2ccc(CCCCN)cc2)C[C@H](O)c2ccc(O)c(NS(C)(=O)=O)c2)ccc1O.?
[]
This reaction is dependent on O=P(Cl)(Cl)Cl as solvents. ### The answer is O=P(Cl)(Cl)Cl
Can you tell me the solvents that react with the SMILES CCOC(=O)C(NC(=O)C=Cc1ccccc1)C(C)=O>>CCOC(=O)c1nc(C=Cc2ccccc2)oc1C.?
[]
In this chemical process, ClCCCl are used as solvents. ### The answer is ClCCCl
In the CC(=O)O[BH-](OC(C)=O)OC(C)=O.[Na+].CC[C@@H](C)[C@@H](N)C(=O)NC1CCCC1.COC(=O)c1cn(C(=O)OC(C)(C)C)c2nccc(C=O)c12>>CC[C@@H](C)[C@@H](NCc1ccnc2c1c(C(=O)OC)cn2C(=O)OC(C)(C)C)C(=O)NC1CCCC1. chemical reaction, what solvents are called into action?
[]
O and CC(=O)OC(C)=O are the solvents that make this chemical reaction possible. ### The answer is O and CC(=O)OC(C)=O
What could be the solvent substances involved in the reaction that has the SMILES code O=C1Nc2cc(Cl)cc(Cl)c2C1=O.CC(=O)O>>O=c1[nH]c2cc(Cl)cc(Cl)c2c(=O)o1.?
[]
The chemical solvents CCCCO, O, and c1ccccc1 are used in this reaction. ### The answer is CCCCO, O, and c1ccccc1
Could you tell me what the solvent medium for the reaction linked with the SMILES O=C(CBr)c1ccc(Cl)cc1Cl.OCC(O)COc1ccc2ccccc2c1.Cc1ccc(S(=O)(=O)O)cc1.c1ccccc1>>Clc1ccc(C2(CBr)OCC(COc3ccc4ccccc4c3)O2)c(Cl)c1. is?
[]
The solvents used for this chemical reaction are C1COCCO1. ### The answer is C1COCCO1
Can you specify the solvents used in the reaction having the SMILES notation CC(C)(C)OC(=O)N[C@H]1CCN(c2nccn3cccc23)C1.Cl>>N[C@H]1CCN(c2nccn3cccc23)C1.?
[]
Solvents C1CCOC1 are employed in this chemical reaction. ### The answer is C1CCOC1
I would like to know the solvents in the reaction associated with the SMILES notation CCOC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)cc2[nH]c1=O.CCI>>CCOC(=O)c1c(O)c2ncc(Cc3ccc(F)cc3)cc2n(CC)c1=O., could you tell me?
[]
In this reaction, the chemicals CC(=O)O and CO are utilized as solvents. ### The answer is CC(=O)O and CO
Do you have information on the solvent substances in the reaction with the designated SMILES code Cl.COC(=O)[C@@H](N)COC(C)(C)C.CC(=O)O.O=Cc1ccccc1.[BH3-]C#N.[Na+]>>COC(=O)[C@H](COC(C)(C)C)NCc1ccccc1.?
[]
The reaction is conducted using solvents ClC(Cl)(Cl)Cl. ### The answer is ClC(Cl)(Cl)Cl
Which solvents are included in the reaction with the SMILES notation CC(C)(C)C(=O)CC#N.O=C1CCC(=O)N1Br>>CC(C)(C)C(=O)C(Br)C#N.?
[]
The reaction uses CC(=O)N(C)C as solvents. ### The answer is CC(=O)N(C)C
Can you list the solvents that participate in the reaction involving the SMILES Cc1cccc(-c2nc(N)sc2-c2ccnc(C)n2)c1.O=C=Nc1ccccc1.O=C([O-])O.[Na+]>>Cc1cccc(-c2nc(NC(=O)Nc3ccccc3)sc2-c2ccnc(C)n2)c1.?
[]
CC#N and CCOC(C)=O are the solvents incorporated in this chemical reaction. ### The answer is CC#N and CCOC(C)=O
In the reaction with SMILES notation N#Cc1nc(Cl)ccc1[N+](=O)[O-].Sc1cc(Cl)cc(Cl)c1.O=C([O-])[O-].[K+].[K+].CCOC(C)=O>>N#Cc1nc(Sc2cc(Cl)cc(Cl)c2)ccc1[N+](=O)[O-]., can you point out the solvents used?
[]
CCN(CC)CC and Cc1ccccc1 are the solvents that this reaction requires. ### The answer is CCN(CC)CC and Cc1ccccc1
What exactly is the solvent medium involved in the reaction that corresponds to the SMILES OCCC(c1ccccc1)C(O)(c1ccccc1)c1ccc(OCCOCCOCc2ccccc2)cc1.CCN(CC)CC.O=S(Cl)Cl>>ClCC/C(=C(\c1ccccc1)c1ccc(OCCOCCOCc2ccccc2)cc1)c1ccccc1.?
[]
The chemical reaction's solvents are CS(C)=O and O. ### The answer is CS(C)=O and O
Can you identify the solvents that help trigger the reaction indicated by the SMILES sequence CC(C)C(C)(C)C(=O)Cn1cncn1.[OH-].[K+].Clc1ccc(CBr)cc1>>CC(C)C(C)(C)C(=O)C(Cc1ccc(Cl)cc1)n1cncn1.?
[]
This chemical reaction is performed with CN(C)C=O as solvents. ### The answer is CN(C)C=O
What are the solvents used in the SMILES notation O=C1CCOCC1.O>>CCOC(=O)C=C1CCOCC1. reaction?
[]
C1CCOC1 and O are the solvents selected for this chemical reaction. ### The answer is C1CCOC1 and O
May I know the solvents utilized in the reaction that incorporates the SMILES notation [F-].CCCC[N+](CCCC)(CCCC)CCCC.CC(CO[Si](C)(C)C(C)(C)C)N1CC(COc2cccc(Cl)c2)OC1=O.O.[Cl-].[Na+]>>CC(CO)N1CC(COc2cccc(Cl)c2)OC1=O.?
[]
The chemical reaction utilizes ClCCl and O=C(O)C(F)(F)F as solvents. ### The answer is ClCCl and O=C(O)C(F)(F)F
Can you identify the solvents used in the CC(C)(C)OC(=O)Nc1ccc2nc(-c3cccc(Cl)c3)cc(N)c2c1.O=C(O)C(F)(F)F>>Nc1ccc2nc(-c3cccc(Cl)c3)cc(N)c2c1. reaction?
[]
This chemical process is carried out using solvents CCO and O. ### The answer is CCO and O
Do you know the dissolving agents in the reaction related to the SMILES O=[N+]([O-])c1cc(S(=O)(=O)c2ccccc2)ccc1O.O>>Nc1cc(S(=O)(=O)c2ccccc2)ccc1O.?
[]
CN(C)C=O are the solvents that this chemical reaction utilizes. ### The answer is CN(C)C=O
In carrying out the reaction involving .[Na+].c1cnc2[nH]ccc2c1.C[Si](C)(C)CCOCCl>>C[Si](C)(C)CCOCn1ccc2cccnc21., what solvents were employed?
[]
This chemical reaction is carried out with CCOC(C)=O, ClCCl, and O as solvents. ### The answer is CCOC(C)=O, ClCCl, and O
Would you please clarify which solvents exist in the CCCc1nc(C)n(-c2ccc(OC)c(F)c2)c(=O)c1Cc1ccc(-c2ccccc2C#N)cc1.BrB(Br)Br.CCOC(C)=O.O>>CCCc1nc(C)n(-c2ccc(O)c(F)c2)c(=O)c1Cc1ccc(-c2ccccc2C#N)cc1. reaction?
[]
This chemical reaction utilizes the solvents C1CCOC1, CO, and O. ### The answer is C1CCOC1, CO, and O
Could you tell me the dissolving agents employed in the reaction with the SMILES CCOC(=O)c1[nH]c2c(-c3ccccc3OC)cccc2c1CCCOc1ccc(Cl)c2ccccc12.[Li]O.O.Cl>>COc1ccccc1-c1cccc2c(CCCOc3ccc(Cl)c4ccccc34)c(C(=O)O)[nH]c12.?
[]
This chemical reaction is performed with CC(C)O, CN(C)C=O, CO, and O as solvents. ### The answer is CC(C)O, CN(C)C=O, CO, and O
What solvents are involved in the reaction described by the SMILES notation ClCCCN1CCOCC1.COc1cc2c(Cl)cnnc2cc1O.O=C([O-])[O-].[K+].[K+].[I-].[K+].Cl>>COc1cc2c(Cl)cnnc2cc1OCCCN1CCOCC1.?
[]
The solvents CCCO are utilized in the chemical reaction. ### The answer is CCCO
Would you tell me what the solvent substances are in the reaction with the SMILES code COc1ccc(Cn2c(=S)[nH]c(=O)c3[nH]c(C(C)C)nc32)cc1OCc1ccccc1>>COc1ccc(Cn2cnc(=O)c3[nH]c(C(C)C)nc32)cc1OCc1ccccc1.?
[]
C1CCOC1 are the solvents involved in this chemical process. ### The answer is C1CCOC1
Can you recall the solvents that were used in the reaction with O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1ccc(CCl)cc1.NCc1ccccc1.[I-].[Na+]>>O=C(NCCc1c[nH]c2ccc(Cl)cc12)c1ccc(CNCc2ccccc2)cc1.?
[]
The solvents CCN(CC)CC, CS(C)=O, and ClCCl are utilized in the chemical reaction. ### The answer is CCN(CC)CC, CS(C)=O, and ClCCl
Do you know the solvents that are part of the reaction with the SMILES COCCOCO[C@@H](CCCCO)COc1ccc(F)cc1.O=C(Cl)C(=O)Cl.CS(C)=O.CCN(CC)CC.Cl.O=C([O-])O.[Na+]>>COC1CCC[C@@H](COc2ccc(F)cc2)O1.?
[]
This chemical reaction is conducted with O=C(O)C(F)(F)F as the solvents. ### The answer is O=C(O)C(F)(F)F
Which are the agents responsible for dissolution in the reaction for SMILES Cc1ccc(Nc2cnc(-c3ccccc3)c(Cl)c2)c(C(=O)OC(C)(C)C)c1>>Cc1ccc(Nc2cnc(-c3ccccc3)c(Cl)c2)c(C(=O)O)c1.?
[]
The solvents for this reaction are CO. ### The answer is CO
Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence CC(=O)c1ccc(OCc2ccccc2)c(NS(C)(=O)=O)c1.O=C[O-].[NH4+]>>CC(=O)c1ccc(O)c(NS(C)(=O)=O)c1.?
[]
CC(=O)O serve as the solvents in this chemical reaction. ### The answer is CC(=O)O
Do you know the solvents used in the N#CCc1nc2ccccc2[nH]1.CC(=O)O>>CC(=O)O.CC(=O)O.NCCc1nc2ccccc2[nH]1. reaction?
[]
For this chemical reaction, CCN(CC)CC and ClCCl act as solvents. ### The answer is CCN(CC)CC and ClCCl
What agents tend to dissolve in the reaction of SMILES CC1(C(=O)O)CC1.O=C1OCCN1P(=O)(Cl)N1CCOC1=O.CCN(CC)CC.Nc1c[nH]c2ncc(Br)c(F)c12.O=C([O-])[O-].[Na+].[Na+]>>CC1(C(=O)Nc2c[nH]c3ncc(Br)c(F)c23)CC1.?
[]
This reaction involves C1CCOC1 as the solvents. ### The answer is C1CCOC1
Are you aware of the solvent substances in the reaction with the SMILES code B.C1CCOC1.O=C1COC[C@@H]2C[C@H](Nc3ccc(Br)cc3[N+](=O)[O-])CN12>>O=[N+]([O-])c1cc(Br)ccc1N[C@H]1C[C@H]2COCCN2C1.?
[]
O are the solvents selected for this chemical reaction. ### The answer is O
What exactly is the solvent medium involved in the reaction that corresponds to the SMILES CC(C)(C)OC(=O)N1C[C@H](OS(C)(=O)=O)C[C@H]1C(=O)N1CCSC1.O.CN(C)C=O>>CC(C)(C)OC(=O)N1C[C@@H](C#N)C[C@H]1C(=O)N1CCSC1.?
[]
Solvents COc1ccccc1, ClCCl, and O=C(O)C(F)(F)F play a role in this chemical reaction. ### The answer is COc1ccccc1, ClCCl, and O=C(O)C(F)(F)F
Would you mind sharing the solvent medium in the reaction that corresponds to the SMILES C=CCOC(=O)[C@@H](CCc1ccccc1)NC(=O)OC(C)(C)C.COc1ccccc1.O=C(O)C(F)(F)F.O=C([O-])O.[Na+]>>C=CCOC(=O)[C@H](N)CCc1ccccc1.?
[]
The chemical reaction makes use of solvents O and c1ccncc1. ### The answer is O and c1ccncc1
What are the solvents that are being used in the chemical reaction according to Cl.NO.O=C1OC(=O)c2cc([N+](=O)[O-])cc3cccc1c23>>O=C1c2cccc3cc([N+](=O)[O-])cc(c23)C(=O)N1O.?
[]
The chemical solvents used here are CC(=O)O, CCO, and O. ### The answer is CC(=O)O, CCO, and O
Which solvents help to activate the reaction represented by the SMILES sequence OC1(c2ccc(C(F)(F)F)cc2)CCN(Cc2ccccc2)CC1.CCO.CC(=O)O.[OH-].[Na+]>>OC1(c2ccc(C(F)(F)F)cc2)CCNCC1.?
[]
The solvents participating in this chemical reaction are CCN(CC)CC and ClCCl. ### The answer is CCN(CC)CC and ClCCl
Can you specify the solvents involved in the OC[C@@H]1CO1.CCN(CC)CC.CC(C)(C)[Si](C)(C)Cl>>CC(C)(C)[Si](C)(C)OC[C@@H]1CO1. reaction?
[]
C1CCOC1 and CCN(C(C)C)C(C)C are the chosen solvents for this chemical reaction. ### The answer is C1CCOC1 and CCN(C(C)C)C(C)C
Can you specify the solvent medium used for the reaction corresponding to the SMILES Cl.CCOC(=O)C(C)(C)SC1CCNCC1.CCN(C(C)C)C(C)C.CS(=O)(=O)Cl>>CCOC(=O)C(C)(C)SC1CCN(S(C)(=O)=O)CC1.?
[]
This chemical reaction is carried out with solvents ClCCl and O. ### The answer is ClCCl and O
In the reaction involving the SMILES COCCCN1C(=O)C(C)(C)Oc2ccc(N(C(=O)[C@@H]3C[C@H](NC(=O)C(COCC[Si](C)(C)C)C(C)C)CN(C(=O)OCC4c5ccccc5-c5ccccc54)C3)C3CC3)cc21>>COCCCN1C(=O)C(C)(C)Oc2ccc(N(C(=O)[C@@H]3C[C@H](NC(=O)C(CO)C(C)C)CN(C(=O)OCC4c5ccccc5-c5ccccc54)C3)C3CC3)cc21., what are the agents that promote dissolution?
[]
The solvents for this chemical reaction are identified as Cc1ccccc1 and O. ### The answer is Cc1ccccc1 and O
Could you point out the solvent substances included in the reaction characterized by the SMILES code CN(C)C(=O)Cl.[Cl-].[Al+3].[Cl-].[Cl-].CC(C)(C)c1cc(N)no1>>CN(C)C(=O)Nc1cc(C(C)(C)C)on1.?
[]
CCN(CC)CC and ClCCl are the solvents incorporated in this chemical reaction. ### The answer is CCN(CC)CC and ClCCl
What types of solvents does the chemical reaction of COc1ccc(-c2nn3c(NCCCCN)cccc3c2-c2ccnc(NC3CCCC3)n2)cc1.CCN(CC)CC.CS(=O)(=O)Cl.O=C([O-])O.[Na+]>>COc1ccc(-c2nn3c(NCCCCNS(C)(=O)=O)cccc3c2-c2ccnc(NC3CCCC3)n2)cc1. involve?
[]
In this reaction, solvents CO are used. ### The answer is CO
Could you tell me the solvents applied in the chemical reaction that CC(=O)C1C(=O)OC2(C#Cc3ccccc3)C=CC(=O)CC12.[Cl-].c1cc[nH+]cc1>>COc1ccc(C#Cc2ccccc2)c(CC(C)=O)c1. describes?
[]
The chemical reaction takes place with the use of solvents CCCCCC. ### The answer is CCCCCC
In the reaction with SMILES notation CC(C)(C)[N-]C=C[N-]C(C)(C)C.[Li+].[Li+].Cl[SiH](Cl)Cl>>CC(C)(C)N1C=CN(C(C)(C)C)[SiH]1Cl., can you point out the solvents used?
[]
This chemical reaction is carried out with CC(=O)O as solvents. ### The answer is CC(=O)O
What solvents are involved in the chemical reaction that is defined by Nc1n[nH]c(SCc2ccccc2)n1.CC(=O)C(Cl)C(C)=O>>Cc1nc2nc(SCc3ccccc3)nn2c(C)c1Cl.?
[]
This chemical process uses COCCOC as the solvents. ### The answer is COCCOC
Could you identify the solvents involved in the SMILES-determined reaction COc1ccc(Br)cc1-c1nc(-c2ccccn2)no1.c1cncc(B2OCCCO2)c1.O=C([O-])[O-].[Na+].[Na+]>>COc1ccc(-c2cccnc2)cc1-c1nc(-c2ccccn2)no1.?
[]
The reaction is conducted using solvents C1CCOC1. ### The answer is C1CCOC1
Can you identify the particular solvent medium that is connected with the SMILES S=C(Cl)Cl.NNC(=O)c1ccc(OCc2ccc3ccccc3n2)cc1C1(c2ccccc2)CC2CCC1C2.O=C([O-])O.[Na+]>>S=c1[nH]nc(-c2ccc(OCc3ccc4ccccc4n3)cc2C2(c3ccccc3)CC3CCC2C3)o1. reaction?
[]
The reaction uses CCN(CC)CC, CCOC(C)=O, and ClCCl as its solvents. ### The answer is CCN(CC)CC, CCOC(C)=O, and ClCCl
Would you tell me what the solvent substances are in the reaction with the SMILES code CCOC(=O)C[C@@H](Nc1nc(N(C)C2CCCCC2)ncc1-c1ccccc1F)c1ccc(O)cc1.CCN(CC)CC.CN(C)C(=O)Cl>>CCOC(=O)C[C@@H](Nc1nc(N(C)C2CCCCC2)ncc1-c1ccccc1F)c1ccc(OC(=O)N(C)C)cc1.?
[]
This reaction's chemical process involves solvents CCOC(C)=O and OCC1CCCO1. ### The answer is CCOC(C)=O and OCC1CCCO1
Please specify, what are the solvents present in the reaction with the SMILES CN(C)CC1CCc2cc(NC(=O)c3ccc(-c4ccc(C=O)cc4)cc3)ccc2C1.[BH4-].[Na+].CCOC(C)=O>>CN(C)CC1CCc2cc(NC(=O)c3ccc(-c4ccc(CO)cc4)cc3)ccc2C1.?
[]
This chemical reaction is carried out with solvents CC(C)(C)O and O. ### The answer is CC(C)(C)O and O
Do you know the dissolving agents in the reaction related to the SMILES CC1=C2OC(C)(C=O)CC2C(C)C([N+](=O)[O-])=C1C.CC=C(C)C.[O-][Cl+][O-].[Na+].[Na].[H][H]>>CC1=C2OC(C)(C(=O)O)CC2C(C)C([N+](=O)[O-])=C1C.?
[]
CCO and Cc1ccccc1 are the solvents that facilitate this chemical reaction. ### The answer is CCO and Cc1ccccc1
What solvents are being used in handling the reaction of SMILES CC(C)(C)OC(=O)N1CCN(c2nc(Cl)nc(N3CC4CCC(C3)O4)n2)CC1.Nc1ccc(B(O)O)cc1.CCO.Cc1ccccc1>>CC(C)(C)OC(=O)N1CCN(c2nc(-c3ccc(N)cc3)nc(N3CC4CCC(C3)O4)n2)CC1.?
[]
The chemical reaction utilizes CC(=O)O and CO as the solvents. ### The answer is CC(=O)O and CO
Do you know the solvents being leveraged in the chemical reaction detailed by CSC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C.CSc1sc(C(=N)NC(=O)OC(C)(C)C)cc1S(=O)(=O)c1cccc(-c2c(C)cc(N)cc2NC(=O)NCCCCCOc2ccc(C(=O)O)cc2)c1>>CSc1sc(C(=N)NC(=O)OC(C)(C)C)cc1S(=O)(=O)c1cccc(-c2c(C)cc(NC(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2NC(=O)NCCCCCOc2ccc(C(=O)O)cc2)c1.?
[]
This reaction's solvents include CCO and O. ### The answer is CCO and O
Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm CC(=O)N1CC=C(c2cc3cccc(Oc4ccc([N+](=O)[O-])cc4F)c3s2)CC1.[NH4+].[Cl-].O>>CC(=O)N1CC=C(c2cc3nccc(Oc4ccc(N)cc4F)c3s2)CC1. represents?
[]
The chemical reaction utilizes CO as the solvents. ### The answer is CO
I'm wondering what solvents help provoke the reaction shown in the SMILES sequence CCC1(CC)CC(=O)CC(C)(C)N1>>CCC1(CC)CC(O)CC(C)(C)N1.?
[]
For this chemical reaction, the solvents CCOC(C)=O and O are used. ### The answer is CCOC(C)=O and O
In carrying out the reaction involving COC(=O)c1n[nH]c(C(=O)OC)c1OCc1ccccc1.Cl.CCOC(C)=O>>COC(=O)c1[nH]nc(C(=O)O)c1OCc1ccccc1., what solvents were employed?
[]
The solvents, namely CCOCC, are used in this chemical reaction. ### The answer is CCOCC
What solvents are employed in the chemical reaction represented by Fc1c(Cl)cccc1Br.[Li]CCCCCC.CC(C)(C)OC(=O)N1CCC(=O)C1>>CC(C)(C)OC(=O)N1CCC(O)(c2cccc(Cl)c2F)C1.?
[]
CCN(CC)CC and CCO are the solvents selected for this chemical reaction. ### The answer is CCN(CC)CC and CCO
Do you know the solvents used in the OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@H](O)[C@@H]1O.NCC1=CCc2ccccc21.CCN(CC)CC>>OC[C@H]1O[C@@H](n2cnc3c(NCC4=CCc5ccccc54)ncnc32)[C@H](O)[C@@H]1O. reaction?
[]
CC(=O)O and CCOCC are utilized as the solvents in this chemical reaction. ### The answer is CC(=O)O and CCOCC
Which solvents are involved in the reaction represented by the SMILES CC(C)(C)[Si](C)(C)OCCCCCC1CCC2C1CC(=O)C2(Cl)Cl.CCOCC>>O=C1CC2CCC(CCCCCO)C2C1.?
[]
C1CCOC1, as solvents, are employed in this chemical reaction. ### The answer is C1CCOC1
In the CCOC(OCC)[PH](=O)C(C)(C)C.[Li]CCCC.BrCc1ccccc1.[Cl-].[NH4+]>>CCOC(OCC)P(=O)(Cc1ccccc1)C(C)(C)C. reaction, which solvents are being used?
[]
In this chemical process, ClCCl are used as solvents. ### The answer is ClCCl
Can you tell me the solvents that react with the SMILES OC1COC2C(OC3CCCCO3)COC12.O=C(CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O.CCN=C=NCCCN(C)C>>O=C(CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-])O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC1CCCCO1.?
[]
This chemical reaction makes use of CN(C)C=O and O as solvents. ### The answer is CN(C)C=O and O
Can you recall the solvents that were used in the reaction with .[Na+].CCC(C)Oc1ccc(O)cc1.CS(=O)(=O)OCC1=COc2ccccc2O1.O>>CCC(C)Oc1ccc(OCC2=COc3ccccc3O2)cc1.?
[]
For this reaction, the solvents employed are CCN(CC)CC, CS(C)=O, and Cc1ccccc1. ### The answer is CCN(CC)CC, CS(C)=O, and Cc1ccccc1
Which solvents are involved in the reaction represented by the SMILES COc1ccc(OCC(=O)N2CCC[C@H]2C(=O)N2CCC[C@H]2C(O)COCc2ccccc2)cc1.Cc1ccccc1.CS(C)=O>>COc1ccc(OCC(=O)N2CCC[C@H]2C(=O)N2CCC[C@H]2C(=O)CO)cc1.?
[]
C1CCOC1, CC(=O)O, CN(C)C=O, and O, functioning as solvents, are used in this chemical reaction. ### The answer is C1CCOC1, CC(=O)O, CN(C)C=O, and O
Which solvents does the COc1cccc(C(=O)CBr)c1.O=C1CSC(=O)N1.O=C([O-])[O-].[K+].[K+].O.[OH-].[Li+].CC(=O)O>>COc1cccc(-c2c[nH]c(=O)o2)c1. chemical reaction require?
[]
The solvents CC(=O)N(C)C are utilized in the chemical reaction. ### The answer is CC(=O)N(C)C
Can you specify the solvents involved in the CS(=O)(=O)c1cccc(-c2ccc(CNS(=O)(=O)c3ccccc3Cl)s2)c1.[H].[H][Na+].BrCc1ccccc1>>CS(=O)(=O)c1cccc(-c2ccc(CN(Cc3ccccc3)S(=O)(=O)c3ccccc3Cl)s2)c1. reaction?
[]
In this chemical reaction, Cc1ccccc1 are the solvents. ### The answer is Cc1ccccc1
Can you tell me the solvents that react with the SMILES CCCCCCCCCCCC(C)=O.OCC(O)CO>>CCCCCCCCCCCC1(C)OCC(CO)O1.?
[]
The solvents, CCOC(C)=O and c1ccncc1, are utilized in this chemical reaction. ### The answer is CCOC(C)=O and c1ccncc1
What solvent substances can be found in the reaction that corresponds with the SMILES code Cl.CC(=O)NCCC1CCc2ccc(N)c(O)c21.CCOC(=S)[S-].[K+]>>CC(=O)NCCC1CCc2ccc3nc(S)oc3c21.?
[]
The chemical reaction takes place with the use of solvents CCN(C(C)C)C(C)C and CN(C)C=O. ### The answer is CCN(C(C)C)C(C)C and CN(C)C=O
Which solvents were utilized in the chemical reaction involving CC(C)(C)OC(=O)Nc1sc(-c2c(F)cccc2F)nc1C(=O)O.C[C@H]1CN(c2c(N)cnc3c2CCO3)C[C@@H](NC(=O)OC(C)(C)C)[C@]1(C)O.CN(C)C(On1nnc2cccnc21)=[N+](C)C.F[P-](F)(F)(F)(F)F.CCN(C(C)C)C(C)C>>C[C@H]1CN(c2c(NC(=O)c3nc(-c4c(F)cccc4F)sc3N)cnc3c2CCO3)C[C@@H](N)[C@]1(C)O.?
[]
In this reaction, solvents CO are used. ### The answer is CO
Which are the solvents interacting in the SMILES CN1CCC(=O)CC1.CCN(CC)c1ccc(C=O)cc1.[OH-].[Na+]>>CCN(CC)c1ccc(C=C2CN(C)CC(=Cc3ccc(N(CC)CC)cc3)C2=O)cc1. reaction?
[]
This chemical process uses CO as the solvents. ### The answer is CO
Could you clarify which solvents are employed in the reaction represented by the SMILES syntax CCCCOC(=O)N1CCN(C(=O)[C@H](CCC(=O)O)NC(=O)c2nc(-c3ccccc3)sc2/C=C/C(=O)O)CC1>>CCCCOC(=O)N1CCN(C(=O)[C@H](CCC(=O)O)NC(=O)c2nc(-c3ccccc3)sc2CCC(=O)O)CC1.?
[]
This chemical reaction incorporates CO as solvents. ### The answer is CO
What solvents are involved in the reaction described by the SMILES notation C=Cc1ccc2c(c1Cl)CC[C@]1(C)CN(Cc3ccccc3)C[C@@H]21>>CCc1ccc2c(c1Cl)CC[C@]1(C)CN(Cc3ccccc3)C[C@@H]21.?
[]
For this chemical reaction, the solvents O and c1ccccc1 are used. ### The answer is O and c1ccccc1
Could you clarify which solvents are employed in the reaction represented by the SMILES syntax O.OC(O)C(Cl)(Cl)Cl.CCCCO.Cc1ccc(S(=O)(=O)O)cc1>>CCCCOC(OCCCC)C(Cl)(Cl)Cl.?
[]
This chemical reaction utilizes the solvents O=C(O)C(F)(F)F. ### The answer is O=C(O)C(F)(F)F
Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence O=C(O)c1ccc(-c2ccc(=O)[nH]c2)nc1.O=C(O)C(F)(F)F.O=C(c1ccc(-c2ccc(=O)[nH]c2)nc1)N1CCC(c2cc3c(Cl)nccc3[nH]2)CC1>>O=C(O)C(F)(F)F.Nc1nccc2[nH]c(C3CCN(C(=O)c4ccc(-c5ccc(=O)[nH]c5)nc4)CC3)cc12.?
[]
This reaction's chemical process involves solvents C1CCOC1 and CCOC(C)=O. ### The answer is C1CCOC1 and CCOC(C)=O
What are the solvents that facilitate the SMILES sequence Cc1c(N)c2cc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3Cl)nc2n(CC(C)C)c1=O.[H].[H][Na+].CC(=O)Cl>>CC(=O)Nc1c(C)c(=O)n(CC(C)C)c2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc12. reaction?
[]
This chemical reaction makes use of CCO as solvents. ### The answer is CCO
Could you enumerate the solvents utilized in the reaction signified by the SMILES notation CS(=O)(=O)Nc1cccc(N(Cc2ccccc2)Cc2ccccc2)c1C=O.[BH4-].[Na+]>>CS(=O)(=O)Nc1cccc(N(Cc2ccccc2)Cc2ccccc2)c1CO.?
[]
The chemical reaction takes place with the use of solvents CCN(CC)CC and ClCCl. ### The answer is CCN(CC)CC and ClCCl
What are the solvents that have been used in the CCN(CC)CC.CCOC(=O)CCc1ccc(Oc2ccc(N)cn2)cc1.OB(O)c1ccc(Cl)c(Cl)c1>>CCOC(=O)CCc1ccc(Oc2ccc(Nc3ccc(Cl)c(Cl)c3)cn2)cc1. reaction?
[]
COC(C)(C)OC and ClCCl are the solvents involved in this chemical process. ### The answer is COC(C)(C)OC and ClCCl
Would you mind identifying the solvents within the reaction labeled as O=S(=O)(c1ccccc1)n1ccc2cc(C(O)CO)cnc21.Cc1ccc(S(=O)(=O)O)cc1.COC(C)(C)OC>>CC1(C)OCC(c2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2)O1. SMILES?
[]
The solvents in this chemical reaction are CCOC(C)=O and CO. ### The answer is CCOC(C)=O and CO
Could you enumerate the solvents utilized in the reaction signified by the SMILES notation NC(=O)Nc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1N.COC(=O)N=C(NC(=O)OC)SC.Cc1ccc(S(=O)(=O)O)cc1>>COC(=O)NC(=Nc1cc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)ccc1NC(N)=O)NC(=O)OC.?
[]
This chemical reaction is carried out with CC(C)=O as solvents. ### The answer is CC(C)=O
Which solvents were utilized in the chemical reaction involving Cc1cc(CCl)c(O)c(-n2nc3ccccc3n2)c1.CC(C)CCO.O=C([O-])[O-].[Na+].[Na+]>>Cc1cc(COCCC(C)C)c(O)c(-n2nc3ccccc3n2)c1.?
[]
CCO are the solvents selected for this chemical reaction. ### The answer is CCO
Could you enumerate the solvents utilized in the reaction signified by the SMILES notation CCN(CC(O)Cc1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C>>CCN(CC(O)Cc1ccc(N)cc1)C(=O)OC(C)(C)C.?
[]
The chemical reaction employs C1CCOC1 and CO as solvents. ### The answer is C1CCOC1 and CO
Which solvents were utilized in the chemical reaction involving COC(=O)C(Cc1cc(OCCc2ccc(-c3ccc(C(F)(F)F)cc3)nc2C)c2ccccc2c1)OC.[Li+].[OH-]>>COC(Cc1cc(OCCc2ccc(-c3ccc(C(F)(F)F)cc3)nc2C)c2ccccc2c1)C(=O)O.?
[]
In this chemical reaction, CO and O are the solvents. ### The answer is CO and O
What solvent substances can be found in the reaction that corresponds with the SMILES code O=C[C@H](O)[C@@H](O)[C@@H](O)CO.O.NN>>NN=C[C@H](O)[C@@H](O)[C@@H](O)CO.?
[]
The chemical reaction involves CCO as solvents. ### The answer is CCO
Would you be able to provide the names of the solvents involved in the reaction that the SMILES algorithm BrCCc1ccc2nonc2c1.Cl.CS(=O)(=O)Nc1ccc2c(c1)C(=O)CC1(CCNCC1)O2.O=C([O-])O.[Na+]>>Cl.CS(=O)(=O)Nc1ccc2c(c1)C(=O)CC1(CCN(CCc3ccc4nonc4c3)CC1)O2. represents?
[]
This chemical reaction is carried out with solvents Cc1ccccc1, ClCCl, and O=C(O)C(F)(F)F. ### The answer is Cc1ccccc1, ClCCl, and O=C(O)C(F)(F)F
Could you tell me about the solvents in the reaction that includes the SMILES notation CCC[C@H](NC(=O)[C@@H]1C[C@@H](Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)CN1C(=O)OC(C)(C)C)C(=O)NS(=O)(=O)c1ccccc1.Cc1ccccc1>>CCC[C@H](NC(=O)[C@@H]1C[C@@H](Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)CN1)C(=O)NS(=O)(=O)c1ccccc1.?
[]
CN(C)C=O are the solvents that this chemical reaction utilizes. ### The answer is CN(C)C=O
Which solvents were utilized in the chemical reaction involving CCOC(=O)CC1CCCn2c1cc1cc(O)ccc12.O=C([O-])[O-].[Cs+].[Cs+].CC(C)Oc1ccc(CCl)cc1C#N>>CCOC(=O)CC1CCCn2c1cc1cc(OCc3ccc(OC(C)C)c(C#N)c3)ccc12.?
[]
The chemical solvents used here are CC#N and O. ### The answer is CC#N and O
Can you identify the solvents used in the CCC(C)CC(C)CC(C)CC(C)/C=C(C)/C=C(/CC(C)C(=O)OC1C(=O)OC(C(=O)OC(C)(C)C)C1C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.CC#N.[OH-].[Na+]>>CCC(C)CC(C)CC(C)CC(C)/C=C(C)/C=C(/CC(C)C(=O)O)C(=O)OC(C)(C)C. reaction?
[]
The chemical solvents CCO are used in this reaction. ### The answer is CCO
What exactly is the solvent medium involved in the reaction that corresponds to the SMILES Cl.Cc1cc(Nc2ccccc2)c2c(ccc3nc[nH]c32)n1.Cc1ccc(N)cc1[N+](=O)[O-]>>Cl.Cc1cc(Nc2ccc(C)c([N+](=O)[O-])c2)c2c(ccc3nc[nH]c32)n1.?
[]
For this reaction, Cc1ccccc1, O, and O=CO are the solvents used. ### The answer is Cc1ccccc1, O, and O=CO
Could you tell me what solvents accelerate the reaction denoted by the SMILES sequence O=[N+]([O-])c1ccccc1F.C1CCOC1.[H][H].Nc1ccccc1F>>O=CNc1ccccc1F.?
[]
The chemical reaction utilizes ClCCl and c1ccncc1 as the solvents. ### The answer is ClCCl and c1ccncc1
Could you tell me what the solvent medium for the reaction linked with the SMILES CCc1nc2cc(C(F)(F)F)c(Cl)cc2n1-c1ccc(CCO)cc1.O=C(Cl)Oc1ccccc1>>CCc1nc2cc(C(F)(F)F)c(Cl)cc2n1-c1ccc(CCOC(=O)Oc2ccccc2)cc1. is?
[]
Solvents CO and O play a role in this chemical reaction. ### The answer is CO and O
What are the solvents that have been used in the C=CCCNc1ncccc1C(=O)NC1(C(=O)OCC)Cc2ccccc2C1.C1COCCO1.CO>>C=CCN(C)c1ncccc1C(=O)NC1(C(=O)O)Cc2ccccc2C1. reaction?
[]
In this chemical process, CC#N and O are used as solvents. ### The answer is CC#N and O
Do you know the dissolving agents in the reaction related to the SMILES c1cn2c(n1)CCCCC2.C=O.CC1(C)OC(=O)CC(=O)O1.O>>O=C(O)CCc1cnc2n1CCCCC2.?
[]
The solvents CC(C)N, CCN(CC)CC, and ClCCl are utilized in the chemical reaction. ### The answer is CC(C)N, CCN(CC)CC, and ClCCl
In the O=C(O)c1ccc(C(=O)N2CCN(c3ncccc3[N+](=O)[O-])CC2)nc1.CC(C)(C)C(=O)Cl.CCN(C(C)C)C(C)C.CC(C)N>>CC(C)NC(=O)c1ccc(C(=O)N2CCN(c3ncccc3[N+](=O)[O-])CC2)nc1. reaction, which solvents are being used?
[]
In this reaction, solvents C1COCCO1 are used. ### The answer is C1COCCO1
In the context of the SMILES C[C@H]1[C@H](NC(=O)OC(C)(C)C)C(=O)Nc2ccccc2N1C(=O)C1CCOCC1.Cl>>Cl.C[C@H]1[C@H](N)C(=O)Nc2ccccc2N1C(=O)C1CCOCC1. reaction, could you state the solvent medium?
[]
This reaction involves CCCCO and O as the solvents. ### The answer is CCCCO and O
What exactly is the solvent medium involved in the reaction that corresponds to the SMILES CCCCCCc1ccc(-c2ncc(-c3ccc(O)cc3)s2)cc1.[OH-].[K+].CCCCO.Cc1ccc(S(=O)(=O)OCCC[Si](C)(C)C)cc1>>CCCCCCc1ccc(-c2ncc(-c3ccc(OCCC[Si](C)(C)C)cc3)s2)cc1.?
[]
CN(C)C=O are the solvents that facilitate this chemical reaction. ### The answer is CN(C)C=O
What are the solvents needed for the chemical reaction as described in CC(C)(C)OC(=O)N[C@@H](Cc1ccc(I)c(Cl)c1)C(=O)NCC(=O)c1ccccc1.CC(=O)[O-].[NH4+]>>CC(C)(C)OC(=O)N[C@@H](Cc1ccc(I)c(Cl)c1)c1ncc(-c2ccccc2)[nH]1.?
[]
This chemical reaction is facilitated by the solvents ClCCl and c1ccncc1. ### The answer is ClCCl and c1ccncc1
Could you point out the solvent substances included in the reaction characterized by the SMILES code CC1(C)CCC(C)(C)c2cc3c(cc21)Nc1ccccc1N=C3c1ccc(C(=O)O)cc1.c1ccncc1.CC(=O)Cl.Cl>>CC(=O)N1c2ccccc2N=C(c2ccc(C(=O)O)cc2)c2cc3c(cc21)C(C)(C)CCC3(C)C.?
[]
In this chemical reaction, CC#N are the solvents. ### The answer is CC#N
What are the solvents that are being used in the chemical reaction according to CC1(n2cc(C(=O)O)c(=O)c3cc(F)c(F)c(F)c32)CC1.CCNCC1CCNC1>>CCNCC1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4(C)CC4)c3c2F)C1.?
[]
In this chemical reaction, C1CCOC1, CCN(CC)CC, and ClCCl are the solvents. ### The answer is C1CCOC1, CCN(CC)CC, and ClCCl
Do you have information on the solvent substances in the reaction with the designated SMILES code CN(CCNC(=O)c1ncc2c(=O)n(Cc3ccccc3)ccc2c1O)C(=O)OC(C)(C)C.O=C(O)C(F)(F)F.CCN(CC)CC.CCOC(=O)C(F)(F)F>>CN(CCNC(=O)c1ncc2c(=O)n(Cc3ccccc3)ccc2c1O)C(=O)C(F)(F)F.?
[]
Solvents C1CCOC1 are the substances used in this chemical reaction. ### The answer is C1CCOC1
What dissolving substances are used in the reaction that includes the SMILES COC(=O)c1ccc(Cl)c(C(F)(F)F)c1.[Br-].[Zn+]CC1CCCCC1>>COC(=O)c1ccc(CC2CCCCC2)c(C(F)(F)F)c1.?
[]
The solvents in this chemical reaction are CC(=O)O, CCO, and O. ### The answer is CC(=O)O, CCO, and O
What solvents can be found in the reaction denoted by the SMILES Nc1nc(Cl)c2c(n1)CCCS2.CCOC(=O)C1SCCCC1=O.[Na].O>>Nc1nc(O)c2c(n1)CCCS2.?
[]
The chemical reaction involves using C1COCCO1 and CO as solvents. ### The answer is C1COCCO1 and CO
Are you aware of the solvent substances in the reaction with the SMILES code COc1ccc(CN(c2ccccc2)c2cc(Cl)nn3c(C#N)cnc23)cc1.[OH-].[Na+].CO>>COc1ccc(CN(c2ccccc2)c2cc(Cl)nn3c(C(N)=O)cnc23)cc1.?
[]
CCOCC, the solvents, are integral to this chemical reaction. ### The answer is CCOCC
Do you know the solvents being leveraged in the chemical reaction detailed by [Li]C.COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)c2cc(Br)ccc2CCC1>>COC(=O)C1=C(C)c2cc(Br)ccc2CCC1.?
[]
CN(C)C=O are the solvents that make this chemical reaction possible. ### The answer is CN(C)C=O
Do you know the solvents being leveraged in the chemical reaction detailed by Oc1ccc2c(c1)CCN(C1CCC1)CC2.[H].[H][Na+].Clc1cnc(Cl)cn1>>Clc1cnc(Oc2ccc3c(c2)CCN(C2CCC2)CC3)cn1.?
[]
This chemical reaction is performed with C1CCOC1 as solvents. ### The answer is C1CCOC1
Could you specify the solvents participating in the SMILES COc1cccc(S(=O)(=O)NCCC(=O)O)c1>>COc1cccc(S(=O)(=O)NCCCO)c1. reaction?
[]
README.md exists but content is empty.
Downloads last month
35