Datasets:

haritzpuerto
/

the_pile_00_DM_Mathematics

Dataset card Viewer Files Files and versions Community

Split (3)

train · 63.5k rows

text stringlengths 518 8.19k	meta dict
e next term in -397063, -397053, -397043, -397033, -397023? -397013 What is the next term in 7870, 15000, 22130, 29260, 36390? 43520 What comes next: 7249, 14329, 21389, 28423, 35425, 42389, 49309? 56179 What is next in 407658, 1630586, 3668802, 6522306, 10191098, 14675178, 19974546? 26089202 What is the next term in -1022, -710, -242, 382, 1162, 2098, 3190? 4438 What is next in -2415, -4679, -6953, -9231, -11507, -13775, -16029? -18263 What is the next term in 230310201, 230310196, 230310187, 230310174, 230310157, 230310136? 230310111 What is the next term in 220385, 440787, 661205, 881639, 1102089? 1322555 What is the next term in 270, 342, 488, 708, 1002, 1370? 1812 What comes next: -9724079, -9724080, -9724081? -9724082 What comes next: -978542, -3914137, -8806780, -15656459, -24463162, -35226877? -47947592 What is next in -715, -2078, -3419, -4732, -6011, -7250, -8443? -9584 What is next in -34905, -69719, -104531, -139341? -174149 What is the next term in -1567, 933, 7721, 20945, 42753, 75293? 120713 What is next in 69751, 69730, 69707, 69682? 69655 What is the next term in 3557, 7502, 14077, 23282, 35117, 49582? 66677 What comes next: 18805, 18438, 18073, 17710? 17349 What comes next: -117991, -118032, -118095, -118180? -118287 What is the next term in 2482307, 4964628, 7446961, 9929306, 12411663, 14894032? 17376413 What is the next term in -178757, -357342, -535927, -714512, -893097, -1071682? -1250267 What is the next term in -1987173, -3974337, -5961501, -7948665? -9935829 What comes next: 16960, 136880, 462360, 1096180, 2141120, 3699960? 5875480 What is the next term in 5561, 4770, 2623, -1558, -8451, -18734, -33085? -52182 What is the next term in -814, -3233, -7256, -12877, -20090, -28889? -39268 What comes next: -42931, -42814, -42603, -42292, -41875, -41346? -40699 What is next in -184796, -369796, -555002, -740414? -926032 What is the next term in -20621, -20010, -18985, -17546, -15693, -13426, -10745? -7650 What comes next: -138698932, -138698933, -138698934? -138698935 What is the next term in 2858, 23562, 79762, 189206, 369642, 638818, 1014482, 1514382? 2156266 What comes next: -1209829, -4839462, -10888849, -19357990? -30246885 What is the next term in 532, 549, 548, 505, 396, 197, -116? -567 What comes next: -6033, -3737, 89, 5445? 12331 What is next in 473290, 473299, 473316, 473347, 473398, 473475? 473584 What comes next: 22650, 22359, 21528, 19887, 17166, 13095, 7404? -177 What comes next: 10177872, 20355744, 30533616, 40711488? 50889360 What is next in -23772, -47527, -71138, -94533, -117640, -140387, -162702, -184513? -205748 What is next in -27908586, -55817175, -83725764, -111634353? -139542942 What is the next term in -3173, -26884, -91213, -216464, -422941, -730948, -1160789? -1732768 What is next in 326858, 326867, 326888, 326927, 326990, 327083, 327212? 327383 What is the next term in 42350, 37575, 32800, 28025? 23250 What comes next: 425, 3149, 6035, 9089, 12317, 15725, 19319, 23105? 27089 What comes next: -24859528, -99438127, -223735794, -397752529, -621488332? -894943203 What comes next: 4891660, 4891690, 4891720, 4891750, 4891780? 4891810 What comes next: -325567, -325725, -325883, -326041, -326199, -326357? -326515 What comes next: 5290, 21315, 48336, 86611, 136398, 197955, 271540, 357411? 455826 What comes next: 1230938343, 1230938338, 1230938331, 1230938322, 1230938311, 1230938298? 1230938283 What is the next term in -369, -2284, -7251, -16794, -32437? -55704 What comes next: -855, -6549, -21971, -51987, -101463, -175265? -278259 What is next in -27527732, -55055472, -82583212, -110110952? -137638692 What comes next: -314, -280, -194, -56? 134 What is the next term in -3179878, -6359798, -9539718, -12719638? -15899558 What is the next term in 78208, 156230, 234252, 312274, 390296, 468318? 546340 What is next in -71650, -143971, -216292, -288613, -360934? -433255 What is the next term in -6593, -7469, -8345, -9221, -10097? -10973 What comes next: 246860, 493786, 740704, 987608, 1234492? 1481350 What comes next: -27908, -27844, -27694, -27416, -26968, -26308, -25394, -24184? -22636 What comes next: 7933073, 7933074, 7933075? 7933076 What comes next: 33633, 33609, 33565, 33501, 33417, 33313, 33189? 33045 What is next in -586, 1304, 3190, 5072, 6950, 8824? 10694 What is the next term in 13499898, 53999613, 121499140, 215998479, 337497630? 485996593 What comes next: 629, 1245, 2239, 3593, 5289, 7309, 9635, 12249? 15133 What is the next term in 34860796, 69721600, 104582404, 139443208, 174304012, 209164816? 244025620 What is next in -5427, -21808, -49179, -87594, -137107, -197772, -269643? -352774 What is next in -23653633, -23653638, -23653643? -23653648 What is next in -1609777, -3219789, -4829801, -6439813, -8049825? -9659837 What is the next term in 907, 2003, 3367, 4999, 6899, 9067? 11503 What is the next term in 12362, 23798, 35234, 46670, 58106? 69542 What is the next term in 5000, 11122, 21328, 35618, 53992? 76450 What is the next term in 24315, 46209, 68103, 89997, 111891, 133785? 155679 What is next in 49129522, 49129501, 49129480? 49129459 What is next in -320147, -320218, -320339, -320510, -320731, -321002, -321323? -321694 What is next in -7888, -7261, -5552, -2221, 3272, 11467? 22904 What is the next term in 17218, 17654, 18380, 19402, 20726, 22358, 24304? 26570 What is next in 67395, 134769, 202129, 269475, 336807, 404125, 471429? 538719 What is next in -7526, -29043, -64904, -115109, -179658, -258551? -351788 What is the next term in 3270056, 3270049, 3270032, 3269999, 3269944? 3269861 What is the next term in -124291, -124247, -124203? -124159 What comes next: -13278115, -13278101, -13278087, -13278073, -13278059, -13278045? -13278031 What comes next: -8632, -34515, -77632, -137977, -215544, -310327? -422320 What is the next term in -657611366, -1315222735, -1972834104, -2630445473, -3288056842, -3945668211? -4603279580 What is the next term in -33580, -66063, -120202, -195997, -293448, -412555? -553318 What is the next term in -3246067, -12984272, -29214613, -51937090? -81151703 What comes next: -1367288, -1367305, -1367322? -1367339 What is the next term in -2236, -2196, -2098, -1918, -1632? -1216 What comes next: 4360, 15914, 35172, 62134? 96800 What comes next: -324115, -324061, -324007? -323953 What comes next: 9719, 10223, 11063, 12239, 13751? 15599 What is next in 5118, 46049, 158618, 378645, 741950, 1284353, 2041674? 3049733 What is next in 1019745, 2039400, 3059053, 4078704, 5098353? 6118000 What is the next term in 26612, 26602, 26590, 26576? 26560 What comes next: 29558, 28318, 27078, 25838, 24598, 23358? 22118 What is the next term in 70786, 70874, 71116, 71590, 72374, 73546, 75184, 77366? 80170 What is next in -214237, -214207, -214177, -214147, -214117? -214087 What is next in -10134, -14504, -21786, -31980, -45086, -61104, -80034? -101876 What is next in -54543, -60929, -67315, -73701, -80087, -86473? -92859 What comes next: 555855629, 555855631, 555855633, 555855635, 555855637? 555855639 What is next in 1528194, 1528196, 1528200, 1528206, 1528214, 1528224? 1528236 What is next in 400012, 799912, 1199798, 1599664, 1999504? 2399312 What comes next: 3829, 14921, 33261, 58843, 91661, 131709, 178981? 233471 What is the next term in -39181021, -39180958, -39180907, -39180874, -39180865? -39180886 What is next in -435599, -1742399, -3920399, -6969599, -10889999, -15681599, -21344399? -27878399 What comes next: 76674, 153592, 230510, 307428? 384346 What comes next: -183486, -183409, -183332, -183255, -183178? -183101 What is next in 10759, 9250, 7743, 6238, 4735? 3234 What comes next: -9884072, -9884078, -9884084, -9884090, -9884096, -9884102? -9884108 What is the next term in -190920558, -190920559, -190920560? -190920561 What is the next term in -2188064, -8752059, -19692060, -35008073, -54700104, -78768159, -107212244, -140032365? -177228528 What is next in -951842, -1902255, -2852668? -3803081 What comes next: 363274, 1453120, 3269530, 5812504, 9082042? 13078144 What is the next term in 183, 1719, 6043, 14589, 28791, 50083? 79899 What is the next term in 72523347, 72523351, 72523357, 72523365, 72523375, 72523387? 72523401 What is next in 85439, 85427, 85413, 85397, 85379, 8535	{ "pile_set_name": "DM Mathematics" }
+ 18. Give b(8). -14 Let k(n) = n*3 + 5n*2 + 7n + 12. Give k(-3). 9 Let d(m) = m*3 + 3m*2 + 2m - 1. Calculate d(-3). -7 Let t(f) = -2f3 - 4f2 + f - 3. Determine t(-3). 12 Let o(b) = b3 - 8b2 + 3b + 12. What is o(7)? -16 Let d(j) = -3j - 31. Calculate d(-8). -7 Let n(z) = -z2 + 14z - 14. Calculate n(13). -1 Let g(t) = t*2 + 13t + 9. What is g(-15)? 39 Let i(o) = -2o3 + 13o*2 + 9o - 14. Determine i(7). 0 Let q(a) = -a*2 - 5a - 6. Determine q(-5). -6 Let j(v) = v*3 - 9v*2 + 5v + 4. Determine j(7). -59 Let f(h) = 15h + 185. Calculate f(-12). 5 Let t(b) = 12b - 16. Determine t(2). 8 Let g(h) = -h3 + h2 - 3h + 9. What is g(4)? -51 Let z(r) = -r2 + 2r + 12. Give z(3). 9 Let i(q) = 5q + 25. Determine i(-5). 0 Let k(t) = 14t*2 - 2t + 1. Give k(1). 13 Let j(p) = p + 4. What is j(17)? 21 Let k(x) = x*2 + 42x - 177. Determine k(4). 7 Let s(u) = -u*2 - 10u + 32. Calculate s(-13). -7 Let j(r) = -r*3 - 28r*2 - 28r - 49. Give j(-27). -22 Let s(q) = -9q + 55. Calculate s(7). -8 Let x(g) = -g3 - 5g - 24. What is x(-3)? 18 Let h(u) = -23u + 3. Give h(-3). 72 Let n(b) = -b3 + b2 - 4b - 17. Determine n(0). -17 Let k(y) = 29y2 + 2. Give k(1). 31 Let r(l) = -2l - 40. Give r(-22). 4 Let q(x) = -2x3 + x2 + 2x + 1. Calculate q(-2). 17 Let i(v) = 17v + 1. Calculate i(-1). -16 Let n(b) = -b + 7. Calculate n(8). -1 Let k(a) = 4a - 14. Give k(6). 10 Let v(b) = -6b + 7. What is v(17)? -95 Let v(w) = 2w - 3. What is v(-8)? -19 Let f(n) = 8n. Calculate f(-1). -8 Let w(g) = g - 10. Calculate w(6). -4 Let x(s) = -s3 + 9s*2 - 14s + 3. Calculate x(6). 27 Let c(m) = -8m + 5. Calculate c(6). -43 Let i(v) = -v2 + v + 10. What is i(3)? 4 Let w(p) = p2 + 9p - 8. Give w(-10). 2 Let f(b) = -b*3 + 5b*2 + 11b - 7. Calculate f(7). -28 Let w(v) = -v*3 + 30v*2 + 26v + 153. Determine w(31). -2 Let p(d) = 8d + 34. What is p(-4)? 2 Let q(n) = -42n*3 + 4n*2 + 5n + 1. Give q(-1). 42 Let g(l) = l + 9. Give g(-9). 0 Let k(y) = -2y2 + y - 3. Calculate k(-5). -58 Let j(g) = -9g*2 - 3g + 4. Determine j(1). -8 Let a(f) = f*3 + 11f*2 + 9f - 9. Calculate a(-10). 1 Let d(c) = 12c - 285. Determine d(23). -9 Let x(a) = -a3 - 4a*2 - 2a - 9. What is x(-4)? -1 Let y(k) = 34k + 4. Give y(-1). -30 Let q(x) = x3 + 22x*2 + 23x + 18. Calculate q(-21). -24 Let a(m) = -m*3 + 14m*2 - 42m + 17. What is a(10)? -3 Let y(a) = -8a + 56. Determine y(7). 0 Let s(t) = -t2 + 6t + 118. Determine s(14). 6 Let f(m) = m*3 + 3m*2 - 2m + 5. Determine f(-4). -3 Let g(u) = -8u + 10. Determine g(2). -6 Let t(o) = -11o + 2. Give t(-4). 46 Let u(c) = c*3 + 6c*2 - 3c + 1. Determine u(-6). 19 Let t(h) = 17h3 + 2h2 + 1. Give t(-1). -14 Let a(b) = b3 - 51b2 + 99b + 5. What is a(49)? 54 Let g(o) = o*2 + 27o + 114. Calculate g(-5). 4 Let o(g) = -g*3 + 7g*2 - 4g + 16. Determine o(7). -12 Let f(k) = -k*3 + 13k*2 + 12k + 20. Determine f(14). -8 Let j(y) = -2y2 + 13y - 26. Give j(5). -11 Let h(g) = -g*2 + 16g - 12. Calculate h(15). 3 Let n(p) = -p*3 + 15p*2 + 20p - 24. Give n(16). 40 Let j(u) = -116u2 - 4u + 2. Determine j(1). -118 Let x(b) = 2b3 - 18b*2 + b - 5. Give x(9). 4 Let b(n) = -20n*3 + 2n*2 + 2n + 1. What is b(-1)? 21 Let u(w) = 2w2 - 36w. Give u(18). 0 Let o(n) = n*3 + 7n*2 + 18n + 12. Calculate o(-4). -12 Let a(u) = 2u3 - 6u + 5. What is a(2)? 9 Let s(m) = 2m2 - 4m - 4. Determine s(-2). 12 Let x(r) = r*2 - r - 7. Calculate x(4). 5 Let n(b) = -3b*2 + 18b + 17. Give n(7). -4 Let w(x) = -3x3 - 17x*2 + 6x + 4. Determine w(-6). 4 Let a(g) = -g*2 - 7g - 9. Calculate a(-3). 3 Let o(c) = 2c + 16. Determine o(-18). -20 Let d(r) = r2 + 3r - 6. Give d(2). 4 Let t(y) = -31y - 14. Give t(2). -76 Let y(v) = 3v + 23. Determine y(-10). -7 Let d(o) = o - 1. Give d(1). 0 Let m(y) = y3 - y2 - 6y + 6. Determine m(4). 30 Let a(r) = -2r*2 + 3r - 4. Determine a(3). -13 Let m(q) = -q*3 - 3q - 8. What is m(-2)? 6 Let c(r) = -6r - 7. Calculate c(7). -49 Let l(p) = 2p*3 + 21p*2 + 8p + 9. Give l(-10). 29 Let q(m) = -m*3 + 28m2 - 66. What is q(28)? -66 Let h(l) = l2 + 13l + 3. What is h(-5)? -37 Let t(u) = 3u*2 - 14u - 7. Calculate t(7). 42 Let f(h) = -h*3 + 16h*2 - 50h + 30. What is f(12)? 6 Let r(a) = -2a3 - 17a*2 - 6a + 26. What is r(-8)? 10 Let b(p) = p*3 + 13p*2 - 11p + 32. Give b(-14). -10 Let b(r) = -r - 7. Calculate b(-5). -2 Let v(a) = a*3 + 19a*2 - 45a - 60. Calculate v(-21). 3 Let b(y) = y*2 - 16y + 28. Give b(2). 0 Let t(k) = 125k - 1012. Calculate t(8). -12 Let g(f) = -13f + 80. What is g(6)? 2 Let b(l) = -l*2 - 15l + 3. Calculate b(-13). 29 Let f(l) = l*2 - 9l + 16. Give f(6). -2 Let g(w) = -6w3 + 2w*2 + 3w + 2. Give g(-1). 7 Let y(r) = 2r2 + 39r - 28. Determine y(-21). 35 Let c(a) = 2a2 + 3a + 30. Determine c(0). 30 Let k(x) = -x*3 + 16x*2 - 32x + 41. What is k(14)? -15 Let m(f) = 5f - 22. Determine m(0). -22 Let o(w) = -w3 - 5w*2 - w + 4. Calculate o(-3). -11 Let c(a) = 2a*2 - 114a + 7. What is c(57)? 7 Let u(x) = 16x - 15. Give u(8). 113 Let b(t) = -42t - 3. What is b(2)? -87 Let z(w) = 2w - 8. Calculate z(-5). -18 Let g(x) = 2x*2 + 50x + 51. Determine g(-25). 51 Let x(j) = 16j2 + 8j + 1. Determine x(-2). 49 Let k(y) = 3y - 54. What is k(18)? 0 Let w(q) = 40q + 392. Give w(-10). -8 Let m(k) = -k*3 - 15k*2 - 15k - 10. Determine m(-14). 4 Let i(s) = -s*2 + 49s + 454. Calculate i(57). -2 Let i(p) = 32p + 52. Determine i(-2). -12 Let m(p) = -3p - 18. Determine m(-10). 12 Let v(h) = -h*2 + 27h - 166. Give v(14). 16 Let g(a) = -a*2 - 21a + 38. Calculate g(-26). -92 Let g(i) = -i*2 - 6i + 4. Determine g(-8). -12 Let w(a) = 4a. Determine w(-3). -12 Let n(r) = 2r - 25. What is n(3)? -19 Let d(a) = -8a + 94. Calculate d(15). -26 Let a(f) = -2f*3 + 7f2 - 5. Determine a(3). 4 Let w(z) = -z3 + 8z2 - 5z - 2. Calculate w(7). 12 Let q(a) = -31a2 + 2a + 1. Calculate q(-1). -32 Let y(i) = i*2 - 12i + 7. Give y(12). 7 Let x(j) = -j*3 + 12j*2 - 32j - 5. What is x(8)? -5 Let m(d) = -7d - 20. Give m(-5). 15 Let q(m) = m3 + 18m*2 - 2m - 64. Determine q(-18). -28 Let g(i) = -i - 6. Calculate g(-6). 0 Let s(y) = 3y2 + y - 8. Calculate s(4). 44 Let n(u) = 8u*2 + 199u - 19. Determine n(-25). 6 Let j(g) = 19g3 - g2 - 2g - 1. Give j(-1). -19 Let c(z) = -20z3 - z2 + 1. Calculate c(1). -20 Let n(g) = g2 - 60g - 118. Give n(-2). 6 Let r(d) = d*2 + 2d - 1. Calculate r(-3). 2 Let w(a) = 26a - 501. Determine w(18). -33 Let g(m) = 2m*3 - 10m*2 - 13m + 29. Give g(6). 23 Let f(z) = z*3 + 13z*2 + 12z - 2. What is f(-12)? -2 Let i(d) = -d*3 + 30d*2 + 33d - 22. Give i(31). 40 Let q(m) = -m*3 + 2m*2 + 4m - 4. Calculate q(3). -1 Let y(f) = -f*2 + 11f + 26. Calculate y(13). 0 Let v(z) = 8z2 + z + 3. Calculate v(3). 78 Let a(b) = -2b - 3. Calculate a(0). -3 Let f(i) = -6i3 + 2i*2 - 36i + 34. What is f(1)? -6 Let c(j) = j - 3. Give c(-1). -4 Let y(o) = 2o2 + 13o + 1. Calculate y(-6). -5 Let p(c) = c*3 + 5c*2 - 3c - 3. What is p(3)? 60 Let m(p) = p*2 + 22p + 10. Give m(-21). -11 Let w(y) = y*2 - 5y + 93. What is w(0)? 93 Let g(c) = c*3 + 12c*2 + 5c - 23. Give g(-12). -83 Let h(r) = -r - 8. Calculate h(-2). -6 Let i(z) = -10z2 - z. Give i(1). -11 Let d(s) = -s2 - 20s - 100. Give d(-11). -1 Let b(h) = -h*3 + 4h*2 + 3h - 14. Determine b(4). -2 Let a(w) = 19w - 22. Calculate a(7). 111 Let q(o) = o2 - 20o + 23. Give q(7). -68 Let k(a) = 16a - 73. What is k(4)? -9 Let i(p) = 3p - 3. Determine i(-11). -36 Let h(q) = 5q - 7. Calculate h(4). 13 Let y(x) = -x + 11. Give y(10). 1 Let r(c) = -2c + 16. Calculate r(4). 8 Let a(w) = -10w + 16. Give a(7). -54 Let h(a) = 2a*2 - 14a + 5. Determine h(7). 5 Let b(r) = -r*3 + 12r*2 + 3r + 55. What is b(13)? -75 Let f(d) = d*3 + 6d*2 + 9d - 3. What is f(-3)? -3 Let v(x) = -2x2 + 2x + 1. What is v(3)? -11 Let a(u) = -2u2 - u + 6. Calculate a(2). -4 Let i(s) = s2 - 2s - 8. Give i(6). 16 Let q(n) = -n - 33. Give q(-32). -1 Let s(p) = -p + 2. Calculate s(-1). 3 Let m(a) = 12*a + 1. What is m(-5)? -59	{ "pile_set_name": "DM Mathematics" }
- 33x - 39. Determine y(17). -22 Let d(j) = -j2 - 14j + 12. Calculate d(-13). 25 Let z(l) = -2l2 + 7l - 9. Give z(3). -6 Let j(v) = 2v - 45. Give j(0). -45 Let b(k) = -k + 2. Calculate b(6). -4 Let k(v) = -30v*2 - v - 2. Determine k(-1). -31 Let c(h) = -3h - 5. What is c(-7)? 16 Let t(s) = s*2 - 3s - 1. Determine t(4). 3 Let g(t) = t*3 - 5t*2 - 15t + 5. Determine g(7). -2 Let a(t) = -t*3 - 2t - 44. Determine a(0). -44 Let r(a) = -a*2 - 17a - 67. Give r(-9). 5 Let u(v) = 4v. What is u(-1)? -4 Let m(d) = -2d*2 - 20d - 4. What is m(-10)? -4 Let w(f) = f - 22. Determine w(15). -7 Let o(c) = -3c - 4. Calculate o(-4). 8 Let t(j) = j3 - 10j*2 + 2j - 15. Calculate t(9). -78 Let f(u) = 2u2 - 84u - 89. What is f(43)? -3 Let v(z) = -z*3 + 7z*2 + 17z + 21. Determine v(10). -109 Let b(f) = -f*3 - 4f*2 + f - 9. Calculate b(-4). -13 Let f(g) = -3g - 104. What is f(-36)? 4 Let r(i) = -i*3 - 14i*2 - 14i - 17. Give r(-13). -4 Let a(w) = 8w + 31. Determine a(-5). -9 Let i(a) = -a3 - 2a*2 - 2a - 7. Calculate i(-3). 8 Let d(a) = a*3 + 31a*2 - 37a - 155. Determine d(-32). 5 Let n(m) = -12m2 - 74m - 4. Determine n(-6). 8 Let o(k) = 12k3 - k2 - k. Give o(-1). -12 Let k(g) = -13g - 3. Determine k(2). -29 Let w(s) = 9s3 + 3s*2 - 2s + 1. Determine w(1). 11 Let y(z) = -4z2 - 157z + 113. What is y(-40)? -7 Let l(d) = -d*2 - 17d - 2. Give l(-17). -2 Let o(v) = 2v2 + 11v - 3. Determine o(-5). -8 Let f(i) = 5i + 3. Determine f(0). 3 Let a(c) = c3 - 10c*2 - 9c - 42. Determine a(11). -20 Let j(y) = -y*3 - 15y*2 - 14y - 7. Calculate j(-14). -7 Let k(l) = -2l3 + l2 + 2l + 2. What is k(-1)? 3 Let z(j) = j*2 + 11j + 6. Determine z(-7). -22 Let m(k) = -k*2 - 7k. Calculate m(-8). -8 Let c(x) = -x*3 + 8x*2 - 8x + 8. Calculate c(7). 1 Let f(c) = -c*2 + 7c + 1. What is f(6)? 7 Let h(c) = -c*3 - 22c*2 - 23c - 39. Calculate h(-21). 3 Let o(d) = 6d3 - 17d*2 + 16d + 2. What is o(1)? 7 Let j(o) = -33o - 196. Determine j(-6). 2 Let z(r) = -11r - 15. Calculate z(0). -15 Let c(y) = -y*2 - 11y + 41. Give c(-14). -1 Let h(b) = -b*3 + 3b*2 + 3b - 24. Calculate h(3). -15 Let k(g) = -4g - 4. What is k(-9)? 32 Let x(z) = -z3 - z2 + 2z + 3. Determine x(-2). 3 Let w(p) = p*2 - 9p + 7. Calculate w(8). -1 Let t(l) = -6l - 52. Give t(-11). 14 Let w(c) = c2 + 18c + 60. Calculate w(-14). 4 Let r(d) = -d*3 + 2d - 1. Calculate r(-2). 3 Let g(h) = 33h - 19. Determine g(1). 14 Let v(a) = 2a + 14. What is v(-3)? 8 Let j(p) = 3p + 26. Calculate j(-7). 5 Let r(k) = k - 4. Determine r(7). 3 Let j(i) = 9i + 89. Determine j(-7). 26 Let i(r) = -18r3 - 2r2 - r - 2. What is i(-2)? 136 Let s(k) = -k2 - 10k + 16. What is s(-7)? 37 Let o(r) = r3 - 8r*2 - 9r + 12. What is o(9)? 12 Let u(g) = -2g2 + 13g + 18. Calculate u(12). -114 Let n(h) = -3h3 - h2 + h + 3. Determine n(-1). 4 Let y(v) = -v2 + 4v - 31. Calculate y(0). -31 Let o(j) = 6j + 1. Give o(-4). -23 Let b(r) = -r3 + 7r*2 + r - 20. What is b(6)? 22 Let i(t) = 28t - 477. Calculate i(17). -1 Let u(b) = 7b + 41. Calculate u(-9). -22 Let b(q) = -q3 - q2 + 3q + 4. Give b(-3). 13 Let t(b) = b3 - b2 - b + 14. What is t(0)? 14 Let t(s) = -s*3 + 6s*2 - s + 1. Calculate t(5). 21 Let d(g) = -9g*2 + 9g + 17. What is d(-2)? -37 Let n(u) = -u*3 - u - 12. Give n(0). -12 Let f(a) = -10a*2 - 39a - 13. Give f(-3). 14 Let v(y) = -3y - 46. What is v(-15)? -1 Let o(n) = 3n + 4. Calculate o(-3). -5 Let b(d) = 3d + 3. What is b(1)? 6 Let k(l) = -11l*2 + 2l - 1. Calculate k(1). -10 Let j(m) = 2m2 + 6m + 7. What is j(4)? 63 Let x(h) = 133h - 537. What is x(4)? -5 Let s(q) = 6q + 36. Give s(-7). -6 Let s(j) = j*2 - 16j - 144. Give s(23). 17 Let c(l) = -l*3 + 4l*2 + 10l - 2. Determine c(6). -14 Let t(l) = -l*3 + 8l*2 - 20l + 14. Give t(4). -2 Let x(d) = d*2 + 7d + 1. Give x(-12). 61 Let h(c) = 8c. What is h(1)? 8 Let n(b) = 11b3 - b2 + b. Give n(2). 86 Let b(n) = n*3 - 12n*2 - 12n. Calculate b(13). 13 Let c(g) = -g*3 - 12g2 - g - 7. Give c(-12). 5 Let a(i) = i2 - 29i + 210. Give a(13). 2 Let i(a) = a2 + 9a - 21. What is i(-9)? -21 Let u(h) = h*3 + 6h*2 - 5h + 35. Determine u(-7). 21 Let r(p) = -p*2 - 23p - 115. What is r(-11)? 17 Let r(c) = 3c2 + 46c + 17. What is r(-15)? 2 Let l(n) = 15n3 - 21n*2 + 21n. Give l(1). 15 Let u(p) = -3p - 23. Calculate u(-6). -5 Let x(p) = -16p*2 - 30p - 3. Calculate x(-2). -7 Let p(o) = 36o + 332. Give p(-9). 8 Let p(c) = -12c - 21. Give p(-2). 3 Let d(b) = -b*3 - 6b*2 + 5b - 2. Determine d(-6). -32 Let h(v) = -8v - 11. Give h(4). -43 Let p(n) = -n3 - 6n*2 + 56n - 4. Give p(5). 1 Let r(i) = -20i + 32. Give r(1). 12 Let f(q) = -8q + 1. Give f(2). -15 Let c(r) = r*3 - 8r*2 - 10. Calculate c(7). -59 Let v(x) = 5x + 23. What is v(-4)? 3 Let x(n) = 11n2 - 2n - 2. Calculate x(-1). 11 Let t(x) = -x*2 - 18x + 36. Give t(-19). 17 Let r(a) = 5a3 - 3a*2 + 3a - 1. What is r(1)? 4 Let d(l) = l*2 - 5l - 2. What is d(-3)? 22 Let j(k) = -k*2 + 5k. Calculate j(5). 0 Let m(k) = -5k - 115. What is m(-22)? -5 Let i(s) = -16s*2 + s - 6. Determine i(0). -6 Let p(o) = -7o - 9. What is p(5)? -44 Let d(b) = b*2 + 11b - 3. Give d(-6). -33 Let c(o) = -o*3 - 8o*2 - 2o - 2. Determine c(-8). 14 Let f(l) = 4l - 48. Give f(14). 8 Let c(m) = m3 - 10m*2 + 17m + 9. Determine c(5). -31 Let n(i) = i*2 - 14i + 3. Give n(16). 35 Let f(g) = -g - 35. What is f(13)? -48 Let p(x) = x*2 - 22x - 12. Give p(11). -133 Let l(a) = a*3 - 19a*2 + 2a - 15. Give l(19). 23 Let r(i) = -i + 1. Give r(9). -8 Let f(o) = 2o3 + o2 + 2o - 7. Give f(2). 17 Let j(a) = a3 + a2 + 3a - 8. Determine j(0). -8 Let z(o) = o2 - 7o + 3. Calculate z(5). -7 Let o(w) = -w*3 + 5w*2 - 6w + 2. What is o(4)? -6 Let u(q) = -q*3 + 9q2 + q - 2. Determine u(9). 7 Let j(o) = o3 + 4o2 - 7o - 21. Determine j(-3). 9 Let v(z) = -38z - 262. Calculate v(-7). 4 Let v(m) = 7m2 - 1. Give v(1). 6 Let f(n) = n2 - 5n - 12. Calculate f(-2). 2 Let c(m) = -m3 - 4m2 + 2. Determine c(-4). 2 Let b(p) = -p2 - 23p + 129. Calculate b(-28). -11 Let i(o) = -o3 - 9o*2 + 9o - 13. Calculate i(-10). -3 Let u(n) = -3n + 1. Calculate u(4). -11 Let k(l) = 3l*2 - 50l + 1. Calculate k(17). 18 Let r(m) = m2 - m + 8. Calculate r(4). 20 Let q(x) = x2 - x - 19. Calculate q(-6). 23 Let b(f) = f*3 - 8f*2 + f + 1. Determine b(8). 9 Let k(g) = -3g*2 + 6g + 22. Give k(6). -50 Let w(g) = -3g3 - 2g2 + g + 1. Determine w(-2). 15 Let w(l) = l3 + 8l2 + 4l + 2. Calculate w(-5). 57 Let g(t) = 34t - 505. Calculate g(15). 5 Let g(f) = -f3 + 12f2. Give g(12). 0 Let a(t) = -t2 + 18t + 140. Calculate a(24). -4 Let x(s) = s2 + 11s - 22. Calculate x(-13). 4 Let t(u) = -u*2 - 37u + 637. What is t(13)? -13 Let x(v) = 71v. Determine x(-1). -71 Let a(i) = -i3 - 7i*2 + 3i - 19. Give a(-8). 21 Let c(g) = -g + 1. Calculate c(-4). 5 Let n(y) = -7y - 42. Determine n(-6). 0 Let t(i) = 25i2 - 2. Calculate t(1). 23 Let g(w) = w3 - 11w2 + 18w - 1. Determine g(9). -1 Let s(w) = 8w - 9. Give s(2). 7 Let g(j) = j2 - 66j + 604. What is g(55)? -1 Let z(m) = -7m + 209. Calculate z(29). 6 Let z(l) = -10l + 72. What is z(7)? 2 Let i(f) = -50f2 + 5f + 2. Give i(-1). -53 Let l(t) = t*2 + 5t + 3. What is l(-6)? 9 Let a(l) = -2l + 6. Give a(-2). 10 Let t(v) = v + 4. What is t(8)? 12 Let k(h) = h3 + 6h*2 - 4h + 3. Determine k(-5). 48 Let a(r) = r*3 - 15r*2 + 13r - 9. Calculate a(14). -23 Let k(d) = -2d2 - 44d - 65. Give k(-20). 15 Let x(k) = -k*2 + 9k - 16. Give x(5). 4 Let c(k) = -9k2 - k. Determine c(1). -10 Let q(k) = k3 + 31k*2 + 2k + 61. Calculate q(-31). -1 Let r(f) = 3f2 + 5f - 8. What is r(-4)? 20 Let z(c) = 32c2 + c + 1. What is z(1)? 34 Let i(u) = 11u + 5. What is i(0)? 5 Let d(z) = -z*3 - 20z*2 - 34z + 44. Determine d(-18). 8 Let u(x) = 4x2 + 6x + 9. Give u(-2). 13 Let w(h) = 21h3 + h2 - 2h. Calculate w(1). 20 Let p(j) = -2j3 - 33j*2 - 18j - 27. What is p(-16)? 5 Let t(b) = b*3 + 10b*2 - 6b + 5. What is t(-11)? -50 Let w(x)	{ "pile_set_name": "DM Mathematics" }
hat is the remainder when 80 is divided by k? 26 Let b(r) = r*2 + 14r - 12. Calculate the remainder when 8 is divided by b(-15). 2 Let y(s) = 3s2 + 3s - 3. Let g = 1 - -7. Suppose 0 = 3z - gn + 4n - 103, 0 = 3n + 12. What is the remainder when z is divided by y(2)? 14 Let v = 0 - -44. Suppose -2t - 14 = -v. What is the remainder when 28 is divided by t? 13 Let j(y) = 2y3 + y2 - y + 1. Let s be j(1). Suppose -3n = -sa + 36 + 18, 2n + 17 = a. Calculate the remainder when a is divided by 8. 3 Let v = -1 + 9. What is the remainder when 36 is divided by v? 4 Suppose 0 = 2n - 5 - 1. Suppose 0 = -nv + v + 24. What is the remainder when 34 is divided by v? 10 Let j(b) = -4b + 19. Calculate the remainder when j(0) is divided by 11. 8 Let q = 61 + -28. Calculate the remainder when q is divided by 12. 9 Let f(s) = -s + 10. Let q be f(8). Suppose -4v = qh - 2, 0 = -0h + 4h - 2v - 34. Calculate the remainder when h is divided by 2. 1 Let i = -3 + 3. Suppose 3j - 3b = 162, -4b + 29 - 9 = i. Let o = -34 + j. Calculate the remainder when o is divided by 9. 7 Let b(o) = -3o - 1. Let n be b(-15). Let v = 99 - n. Calculate the remainder when v is divided by 14. 13 Let p(x) = -11x - 79. Calculate the remainder when 61 is divided by p(-10). 30 Suppose 3f = -3f + 30. Calculate the remainder when 10 is divided by f. 0 Suppose -d + 11 = 3x + 2, -5d = -2x + 23. Let y(b) = b + 2. Let n be y(0). Calculate the remainder when 17 is divided by (d + n - -6) + 1. 5 Let h(j) = 11j - 6. Calculate the remainder when h(2) is divided by 5. 1 Let x(g) = 9 - g*2 - 3 - 5g + 0. Calculate the remainder when 16 is divided by x(-5). 4 Let x(h) = -h - 5. Let u be (18/15)/(2/10). Let g = u + -2. What is the remainder when x(-16) is divided by g? 3 Let g = 2 - 4. Let r(o) = -2o3 + 2o + 3. Let w be r(g). Calculate the remainder when (w/4)/((-15)/(-200)) is divided by 17. 16 Suppose 3r + z - 2 = -4z, -z + 13 = 2r. What is the remainder when r is divided by 4? 1 Let n = -11 - -19. Let l = 3 + n. What is the remainder when 52 is divided by l? 8 Suppose 39 - 147 = -l. Calculate the remainder when l is divided by 37. 34 Suppose 3p + 2t - 23 = 0, -t + 10 - 37 = -4p. Let f(x) = -x*2 + 13x - 40. What is the remainder when p is divided by f(6)? 1 Let o = 119 + -69. What is the remainder when o is divided by 13? 11 Suppose 5z + 102 + 23 = 0. Suppose 5n - 9 = -84. Let m = n - z. Calculate the remainder when m is divided by 6. 4 Suppose -2o = -8 - 2. Suppose -5d - ok = -480, 5k - 76 = -d - 0k. What is the remainder when d is divided by 26? 23 Suppose -28l + 30l - 18 = 0. What is the remainder when l is divided by 7? 2 Suppose -4u - 3v + 61 = 0, u - 3u + 5v + 63 = 0. Calculate the remainder when ((-18)/27)/(2/(-165)) is divided by u. 17 Suppose 5z - 25 - 3 = -q, -5z = -q - 12. What is the remainder when 20 is divided by q? 4 Suppose 2p + 2u + 9 - 45 = 0, -52 = -3p - 5u. What is the remainder when 34 is divided by p? 15 Suppose -14 = -5r + 11, 77 = 3a - 5r. Let v(p) = p*2 + 3p - 1. What is the remainder when a is divided by v(2)? 7 Suppose 0g - 25 = -5g. Let y be (117/12)/(3/12). Calculate the remainder when (y/(-6))/(4/(-8)) is divided by g. 3 Let h be (-2)/(-5) - (-1404)/(-10). Let m be (2 + -5)h/6. Suppose b - 3b + m = 0. Calculate the remainder when b is divided by 18. 17 Suppose -5o + 108 = m + 3m, 2o - 2m = 54. Let k = o + -40. Let j = 31 + k. Calculate the remainder when 28 is divided by j. 13 Let z(s) = -17s3 + 3 + 5s*3 - 2. Calculate the remainder when 37 is divided by z(-1). 11 Let d(r) = -4r3 + r2 - r - 1. Let s = 2 + -2. Suppose s = y + 4 - 12. Calculate the remainder when y is divided by d(-1). 3 Let n = -3 - -4. Let d be (-3)/(-6)0/1. Suppose 2x + 10 - 14 = d. What is the remainder when x is divided by n? 0 Let u(t) = -25t - 5. What is the remainder when 89 is divided by u(-2)? 44 Let r(l) = l2 + 13l + 47. Calculate the remainder when r(-8) is divided by 5. 2 Let c(v) = 14v3 - v + 1. What is the remainder when (0 + -1)1-27 is divided by c(1)? 13 What is the remainder when (-4)/(-10) + (-4836)/(-60) is divided by 7? 4 Suppose -20 = 4y - 4h, 15 = -5y - 4h + 35. Let c(w) = 0 - 9 - 5w + 8w2 + yw*2 - 7w*2. Calculate the remainder when 12 is divided by c(7). 2 Suppose 2d - 4g = 4d - 24, -g = d - 7. Suppose -dz - 4h = -44, 5z + h - 5h = 110. What is the remainder when 84 is divided by z? 18 Let n(i) = -2i3 - 2i*2 - 3i + 2. What is the remainder when n(-4) is divided by 28? 26 Suppose 228 - 44 = 8i. What is the remainder when i is divided by 8? 7 What is the remainder when 13 is divided by 42/10 + 3/(-15)? 1 Let a = 30 - 11. What is the remainder when a is divided by 8? 3 Let d = -10 - -23. Calculate the remainder when 64 is divided by d. 12 Suppose 0 = 5x + 126 - 316. Calculate the remainder when x is divided by (-2 - 9/(-3))13. 12 Let i = 13 + -6. Calculate the remainder when 12 is divided by i. 5 Let u = -45 - -67. Let k = -48 + 53. Calculate the remainder when u is divided by k. 2 Suppose 3v + 6 = 36. Calculate the remainder when 35 is divided by v. 5 Suppose -w - 2x - 43 = 0, -12 + 152 = -3w + 5x. Let f = w - -68. Calculate the remainder when f is divided by 8. 7 Let q(x) = -75x3 + x2 - x - 1. Let i be q(-1). Let f = i + -50. What is the remainder when f is divided by 7? 5 Let b(s) = -6s + 2. Suppose 4j = 3j - 8. What is the remainder when b(j) is divided by 17? 16 Let j = 0 - -1. Let s be 4 - 1 - j3. Suppose s = 3q + q - 8. Calculate the remainder when 2 is divided by q. 0 Let s = -275 + 390. Suppose 0 = -7c + 2c + s. What is the remainder when 89 is divided by c? 20 Let l be (-2)/7 - 345/(-7). Suppose 2y = -4s + 110, s - l = 3y - 228. Suppose -2g = -y + 15. What is the remainder when 43 is divided by g? 21 Let j(k) = k3 + 20k*2 - 3k + 1. What is the remainder when j(-20) is divided by 8? 5 Let z = -36 - -21. What is the remainder when (-68)/6z/10 is divided by 9? 8 Let m = -7 - -12. Suppose 410 = mu + 150. What is the remainder when u is divided by 18? 16 Suppose 1 = 5q - 4. Let c(g) = -11g - 3. Let x(m) = -23m - 7. Let f(a) = -9c(a) + 4x(a). What is the remainder when 16 is divided by f(q)? 4 Calculate the remainder when 20 is divided by (4/6)/((-24)/(-396)). 9 Suppose -21 = -3p - 6. Let d(q) = 2q2 - 96q + 101. What is the remainder when d(47) is divided by p? 2 Let q(h) = h*3 - 6h*2 - 6h - 4. What is the remainder when 9 is divided by q(7)? 0 What is the remainder when (12/(-40)-12)/((-6)/(-135)) is divided by 41? 40 Let o = -14 - -17. Suppose 64 = 7h - oh. Calculate the remainder when h is divided by 16/2 - (0 + -1). 7 Let g = -37 - -70. Calculate the remainder when g is divided by 12. 9 Let l(q) = -q + 2. Calculate the remainder when l(-7) is divided by 4. 1 Suppose 0 = -5b - 34 - 1. Let h(a) = -3a - 12. Calculate the remainder when 17 is divided by h(b). 8 Suppose 73 = 3z - 17. Let b be (-2)/6 - (-10)/3. Suppose 0 = 3q - z + b. Calculate the remainder when 25 is divided by q. 7 Let g = 42 - 76. Let c = g + 57. Calculate the remainder when c is divided by 12. 11 Let j(h) = -2h - 12. Calculate the remainder when 124 is divided by j(-19). 20 Let j = -5 + 8. Suppose w + 0w = 3. Suppose -wy + 25 = 1. What is the remainder when y is divided by j? 2 Suppose -2z - 4 = -12. What is the remainder when 21 is divided by z? 1 Let q = -29 - -33. Let s(u) = 7u - 2. What is the remainder when s(q) is divided by 15? 11 Suppose 28 - 8 = 2p. Let o(c) = 37c*3 - 2c*2 - 2c + 3. What is the remainder when o(1) is divided by p? 6 Let c = -453 - -472. Suppose 0k = 2k - 72. What is the remainder when k is divided by c? 17 Let q be 5-4(-2)/20. Let j(r) = -35r3 + 2r*2 - r - 2. What is the remainder when j(-1) is divided by -3 + 1 - (-30)/q? 10 Let v = -35 + 70. Calculate the remainder when v is divided by (-94)/(-8) + 4/16. 11 Suppose -k - 40 = -3q, 2q - 2k = -0k + 24. Suppose -8o + 246 - 38 = 0. Calculate the remainder when o is divided by q. 12 Calculate the remainder when 12 is divided by 2/(-4) + 299/26. 1 Suppose 49 = 3m - 26. Suppose 2h = h + 9. Calculate the remainder when m is divided by h. 7 Let	{ "pile_set_name": "DM Mathematics" }
22601 + -22602.1. What is the smallest value in -6, s, 2/7, 0.1, -1? -6 Let t = 19665 - 19666. Which is the second biggest value? (a) t (b) -2 (c) -9/158 a Suppose 11 = -5f + 4t - 4, 4t - 24 = -4f. Let k = -16.1 + -0.5. Let l = -16.8 - k. Which is the second biggest value? (a) -0.06 (b) f (c) l a Let t be (-7)/(-7) + 7 + 0. Let y be (3/12)/(3/t). Let h = -512 - -517. Which is the second biggest value? (a) -2/7 (b) h (c) y c Let s be (595293/(-3))/((-2207535)/9). Let b = 24/8657 + s. Let v = b + -7/17. What is the biggest value in -10, 1/5, v? v Let j = 109 - 156. Let d = -126367 - -126366.7. What is the smallest value in 2, d, j? j Let j = -163/9 + 18. Let l = -2237 - -2248. Let n = 5/22 - 43/44. Which is the smallest value? (a) n (b) l (c) j (d) 0.5 a Let k be 4238/58 + (-108)/1566. Which is the third smallest value? (a) k (b) -1/4 (c) 0 a Let l = -5.001 - -7.001. Which is the smallest value? (a) l (b) 8.4 (c) -1 (d) -4 d Let k = -9213 - -9251. Which is the second biggest value? (a) 0.3 (b) 2 (c) -0.4 (d) 0 (e) k b Let n = 6419 - 44935/7. What is the fifth smallest value in -1, 5, -0.5, -2/21, n? 5 Let v = 6.3 - 2.7. What is the biggest value in 4, 5, v, 2/5, 0.5? 5 Let r = 11459 + -11457. Which is the smallest value? (a) -2 (b) -219/2 (c) 0.5 (d) r b Let a = 39 + -191/5. Let c be ((-42)/32)/(9(-33)/(-42)). Let o = c + 2/33. What is the fourth biggest value in 5, o, -1/5, a? -1/5 Let l = -407.7 + 408. Let h = -2266/9 + 252. Which is the second biggest value? (a) h (b) 12 (c) 4 (d) l c Let i = -240 + 240.9. Let g = i - 0.4. Let j(x) = -x3 - x2 - x. Let f be j(0). Which is the second biggest value? (a) f (b) -4 (c) g (d) 0.2 d Let g = 41.05 + -42. Let a = g - -1.45. What is the second biggest value in a, 4/5, 0.018? a Let w = 4366 - 4365.937. Which is the second smallest value? (a) 0 (b) -4 (c) -1.5 (d) w c Let i(x) = -x2 - 31x + 140. Let s be i(-35). Let p be (s - 5/10)12/2. Which is the smallest value? (a) p (b) 0.4 (c) 14 (d) -4 d Suppose -14 - 1 = -5b. Let f = 2665.92 + -2666. What is the third biggest value in 0.5, -1, f, b? f Let m = -765/1351 + -1/193. Let r = -0.9 - -0.91. Which is the smallest value? (a) r (b) m (c) 2/9 b Let o = -42679 + 38227. What is the third biggest value in 2/19, o, 0.5? o Let y = 1.66 + -3.39. Let t = y + 1.23. Suppose -1 = 2m - 3. What is the second biggest value in m, t, 1/4? 1/4 Let v = 1210 - 1204. Let u = -10 - -10.03. Let m = u + 0.97. What is the third biggest value in 5, v, m, -2? m Let s = 147 + -179. Suppose 0 = 5o - 25 + 5. Suppose -16 = -2m - or, r = 5m - 2m + 4. Which is the smallest value? (a) 0.3 (b) m (c) -0.3 (d) s d Let i = 1449 - 976. Let j = i - 477. What is the third smallest value in -0.03, j, 0.5, 0? 0 Let c = 333.1 + -315. Let i = c + -8.1. What is the third biggest value in 2, 0.4, i? 0.4 Let q = -0.1361 + -61.8639. What is the third smallest value in q, 2, -0.4, -1? -0.4 Let z be (-2 + 3)/((-35)/15)(0 - -1). Let j = 15 - 10. What is the smallest value in j, z, -19? -19 Let o = 1/466 + -1871/3262. Let w(q) = -q3 - 8q*2 + 12q + 29. Let v be w(-9). Let f = -0.45 - -0.2. What is the third smallest value in v, f, o? v Let x = 2.7 - -109.3. Let g = x + -110. Which is the smallest value? (a) g (b) 4 (c) 0.6 c Let p = 47/2 + -25. Let t = 0.17212 - 0.47212. What is the second biggest value in p, t, -0.131? t Let i(u) = u*2 - 44u - 95. Let d be i(46). What is the second smallest value in 0.5, 518, d? 0.5 Let o = -92523/5 - -18506. Let k = 3 + -2.9. Which is the second biggest value? (a) o (b) 0 (c) k c Let o = -4.69546 + -0.30454. What is the fifth biggest value in 0.2, 4, o, 1, -0.98? o Let j be -28 + 50 + -23 - (-322)/2. What is the smallest value in j, 4, 0.8? 0.8 Let z = 223.7 + 28.3. Which is the biggest value? (a) 0.05 (b) 1/7 (c) z c Let w = 70.7 - 76.7. What is the third biggest value in -1, -0.287, w? w Let u be ((-2)/(8/(-38)))/(1/(-2)). Suppose 166o - 171o + 5r = -45, 32 = 3o - 4r. Which is the biggest value? (a) 0 (b) u (c) 0.4 (d) o d Let k = -2591 + 2624. What is the biggest value in 0.2, -2/11, -0.09, k? k Let h = -3673 - -3672.5. Which is the fifth smallest value? (a) -0.3 (b) h (c) -3 (d) -124 (e) 2 e Let r = -1913 + 2720. Let s = -806.7 + r. Which is the smallest value? (a) -2/41 (b) 2/5 (c) s (d) -4 d Let q be (-10)/4 - (-294)/252. Let g be (-1)/(-4)26/(-13)-7. What is the second smallest value in g, q, -0.4? -0.4 Let u be 8070/(-20)(-4)/6. Suppose uw - 18 = 260w. What is the fourth smallest value in 0.2, w, 2/11, 0.1? w Let a = 2010 + -2009.95. What is the third smallest value in 4, a, 7, 0.2? 4 Let q = 1078 - 1058. Suppose 79w - 74w + q = 0. Let j = 0.34 - -0.06. What is the third smallest value in w, -0.5, j, 1/5? 1/5 Let h = -625/488 - 21/61. What is the smallest value in -2/63, 3, h? h Suppose -3o - a + 5a + 7 = 0, 4o + 3a = 1. Let m be (0 + (3 - 8))(0 + o). What is the fourth biggest value in 5, -4, -2, m? m Let w = -4.66 - -1. Let y = w - -3.16. Let o = -0.5 + 0.4. What is the smallest value in -11, o, y? -11 Let n(j) = -204j - 798. Let m be n(-4). Which is the biggest value? (a) -0.06 (b) m (c) -0.4 (d) -1 b Let w = 0.3 - -0.3. Let j = 12.098 + 0.102. Let v = 12 - j. Which is the third smallest value? (a) w (b) v (c) 0.5 (d) 3/4 a Let x = 58.31 - 58.41. What is the third biggest value in x, -5, -0.3, -0.04, 0? x Let v = 21 + -11. Let i be ((v/(-40))/((-6)/(-16)))/2. Which is the third biggest value? (a) -0.3 (b) i (c) 22 b Let z = 5 - -81. Let l be (128/(-72))/(-8) - z/(-18). Let h be (-3)/20 + 2/(-8). Which is the biggest value? (a) h (b) l (c) -1/3 b Let p be (24 + -2)/((-4)/17). Let o = p + 96. Let j be 12(-4)/(-400) + (-5 - (-120)/25). What is the second smallest value in o, j, 0.5? 0.5 Let z = 10452 + -10471. What is the second biggest value in -0.06, 3, z, -0.1, -4? -0.06 Let s = -16083 + 16085. Which is the third smallest value? (a) -3 (b) s (c) -8 b Let y = -140.9 + 157. Let s = 14.1 - y. Which is the fourth biggest value? (a) s (b) -4 (c) 11 (d) 3 b Suppose -68o + 159o = 53o + 190. What is the third smallest value in 1/5, -3, 15, o? o Let a = 7114 - 7109. What is the fourth smallest value in -0.5, 1/30, a, -17? a Suppose 0 = 4q - 2m + 10, 0 = -4m + 702 - 714. Which is the third biggest value? (a) -1 (b) 2 (c) -5 (d) q d Let o = 3480.3 - 3497.3. What is the fourth biggest value in 5, 3, o, -5, -2/29? -5 Let s = 231 - 234. Let q = -4 + 3.9. Which is the third smallest value? (a) s (b) -2/11 (c) q (d) -2 b Let p = 1637 - 1640. Let v = -13 - -21. Let g be 17/4 - 2/v. What is the second biggest value in g, 1, p? 1 Let q = 1882 - 1881.895. Which is the third smallest value? (a) 3/4 (b) -4 (c) q a Let h be (-390)/585 + 4609/(-3). Which is the second biggest value? (a) 1/5 (b) 1 (c) h a Let q(y) = y2 - 24y + 133. Let m be q(16). Let z be -2 - (-3 - (-1 + 1)/(-3)). Which is the third biggest value? (a) z (b) -4 (c) m (d) 3/2 a Let t = -0.289 - 0.011. Let w = -2915 + 2886. Which is the second smallest value? (a) t (b) -4/7 (c) w (d) 0.2 b Let x = 16936.2 + -16936. Which is the third biggest value? (a) -5 (b) -128 (c) -0.2 (d) x (e) -0.1 c Let y = 252.5 + -252.33. What is the second smallest value in y, 0.5, 3, -11? y Let r be (0 + -2)-1 + (-16)/7. Let n = 394 - 389. Which is the second biggest value? (a) n (b) r (c) -1 (d) 3 d Let x = -3952.8 - -3953. Let t = -55/24 - -21/8. What is the smallest value in t, x, 1, -2? -2 Let n = 1.998 + 0.002. Let m = -435.8 + 436. Which is the second smallest value? (a) 1 (b) n (c) -2/5 (d) m d Let h = 0.34 + 0.06. Let u = 133 + -279. Let z = u - -144. Which is the second smallest value? (a) h (b) 2 (c) z a Let x = 209954/15 - 14000. What is the smallest value in x, -2/13, -3? x Let f = 7453 + -7450.7. What is the third smallest value in f, 1, -2, -3, -2.6? -2 Let y(t) = -t3 - 11t*2 - 10t + 2. Let a = 16 - 26. Let r be y(a). Let o = 114 + -113.9. What is the second smallest value in r, o, 4? r Let t = -1.9103 - 0.0797. Which is the second smallest value? (a) t (b) 4 (c) 5 b Let n = -17.158 + -24.842. What is the smallest value in 1/3, -1	{ "pile_set_name": "DM Mathematics" }
0.4 (d) -3/4 d Let k = -145 + 289/2. Let s = -10.7 + 1.7. Let j = s - -8.98. What is the second biggest value in j, k, -1/5? -1/5 Suppose 2g - 20 = -2g. Let i be 7/(-35) + 1/g. What is the biggest value in i, -0.2, -0.5? i Let x = 2.66 - 2.7. Which is the second biggest value? (a) x (b) -2 (c) -0.02 (d) -4 a Let z = 48 + -50. Let f be (-2)/z(5/(-4) - -1). Which is the second biggest value? (a) -2/11 (b) f (c) -3 (d) -0.2 d Let g = -40 - -31. Let r = -11 - g. What is the second biggest value in r, -1, -2/11? -1 Let v = 87 - 90. What is the fourth smallest value in -34, -2, v, 0.2? 0.2 Let m = 2.5 + 0.5. Let t = -305.81 - -306. What is the biggest value in 0.1, m, t? m Let g be 1/(-5) + 26/30. Let v be 22 + (-7)/((-28)/(-8)). Let d be (-38)/24 + v/16. Which is the biggest value? (a) d (b) 5 (c) g b Let s = 0.1845 - -2.8155. What is the third biggest value in s, 51, -3? -3 Suppose 2o + 9 - 35 = -4d, -5o = 4d - 53. Suppose -4q + oq = 20. Suppose q + 0 = 4x. What is the third smallest value in -0.3, x, 0.3? x Let r = -4.95 - 0.05. Let h = -90 + 86. Let q = -55/34 - -2/17. What is the second biggest value in r, h, q? h Let i = -10.99 + 11. Let d = -27.91 - -28. Let x = d + -0.39. Which is the third biggest value? (a) x (b) i (c) 2/7 a Let z be (-1)/((-4 + 3)/(-4)). Suppose 0 = 3i + 2i. Let y be (-33)/(-12) + -2 + i. What is the third biggest value in y, -5, z? -5 Let o = -420 + 419. What is the fourth smallest value in o, 7, 3/2, 3? 7 Let q = 148.3 + -148.8. What is the fourth biggest value in -7/16, -0.4, q, -4? -4 Let m = 45.1 - 8.1. Let v = m + -32. Which is the biggest value? (a) 1 (b) v (c) -1/3 b Let q be (-2)/(-6) + (-1)/(-1). Let f = -77 + 76.933. Let u = -0.033 + f. What is the smallest value in -0.2, q, u? -0.2 Let g = 0.2 - 0.3. Suppose d - 4k - 36 = -3d, 2d - 28 = 4k. Let c be (-5 - -4)/(14/d). What is the third smallest value in c, g, -5? g Let q = 4/17 - -22/51. Let n = -10 + 16. Let l = n - 5.5. Which is the third smallest value? (a) 16 (b) l (c) q a Let t = 175/9 - 190/9. What is the third biggest value in 2/9, t, -2/9? t Let s be ((-172)/60 + 1 - -2)-5. Let p = 7.05 + 0.95. What is the third smallest value in s, -3, p? p Let i be 54/90 - 2/5. Let w = 194 - 189.19. Let f = -0.19 - w. Which is the third smallest value? (a) i (b) -4 (c) f a Let i = 344 - 343.3. Which is the biggest value? (a) i (b) 12/5 (c) 0.3 b Let h = 13/2 - 35/6. Let j = 0.04 - 0.44. Which is the second biggest value? (a) j (b) h (c) -3 a Let i = 15.07 + -15. Let f = -4.07 + i. Let m be 2/5 - 6/15-9. What is the second smallest value in m, f, 0.2? 0.2 Let v = -34.9 - -32. Let l = 3 + v. Let i be (-1 + -1)(145/(-25) - -6). What is the second smallest value in i, -1, l? i Let t = -76.3 - -75.8. Suppose -8 = -4w, 2m + 0m = -3w + 42. Suppose -k - k = -m. Which is the biggest value? (a) t (b) k (c) 1/4 b Let x = 2/1117 - -25655/20106. Let q = -1/18 - x. Which is the biggest value? (a) 3/7 (b) q (c) -0.03 a Let i = -4 + 1. Let n = -220 - -1104/5. Which is the biggest value? (a) -0.4 (b) i (c) n c Let q = -6 + 4. Let x = -99 - -103. Suppose -2f - 2u = 4, 5f + 4u + x = 2f. What is the second biggest value in q, f, 1/3? q Let t = -0.18 - -96.18. Let n = 91 - t. Which is the third smallest value? (a) 0.1 (b) 4 (c) n b Let j = 2.287 - 0.287. Which is the fourth smallest value? (a) -1 (b) 9 (c) j (d) -4 b Suppose 0 = 4g - 14 + 42. Let k = -0.2 + 0.4. What is the second biggest value in k, g, -2? -2 Let r(v) = -v2 - 5v + 55. Let g be r(5). Which is the biggest value? (a) 0 (b) -29/4 (c) 1 (d) g d Let j be (-714)/(-2) + 12 + -9. Let d be 138/j - (-3)/(-12). Let o be -1(2 + (2 - 3)). What is the biggest value in d, o, 9? 9 Let q be 5/7 + -4 + 3. Let u = 0 - -0.5. Let t be 8/(-8)4 + 0. What is the biggest value in q, t, u? u Let z = 1966/39 - 151/3. Suppose 2091 = -4r - 4u + 2095, 4u = -2r. What is the smallest value in z, r, -4? -4 Let w = 1099/9972 - -1/1108. What is the biggest value in w, 0, -209? w Suppose 3 = -5n - 2. Let i = 1 - 7. Let h = i - -6.5. What is the biggest value in h, 0.1, n? h Let g = -27.3 - -31.3. What is the second smallest value in 6/5, -0.09, 3/5, g? 3/5 Let t = -1908 - -5726/3. What is the second biggest value in 1, -5, t, -144? t Suppose -16u - 2 = -17u. Which is the fourth smallest value? (a) 3/5 (b) 3 (c) u (d) -116 b Let w be -1 + ((-30)/(-25) - 1). Let v = 194/5 - 1189/30. Let m = -3 - -6. Which is the second smallest value? (a) w (b) v (c) m a Let g = -53.1 + 52.93. Which is the second biggest value? (a) g (b) 1 (c) 4 b Let z be -1(-1 + (-3 - -1)). Let t = 4 - 4.5. Let p be 4/34 - 04/(-20). What is the smallest value in z, p, t? t Let f = 352/5 - 70. Let o = -337 - -342. Which is the second smallest value? (a) f (b) o (c) -1 a Let v = -2/77 + 81/154. What is the second smallest value in 3/5, v, 3, 0? v Let c = 22 - 219/10. Let n = -0.056 + -54.944. Let l = n - -50. What is the smallest value in 0.5, c, l? l Let y be (-3 - 42/(-10))/(56/(-70)). Which is the third smallest value? (a) 0.4 (b) 2 (c) y b Let k = -3/88 + -131/1320. Let z be (14 - 8)(-2)/(0 - -42). Which is the fourth biggest value? (a) 1 (b) k (c) z (d) 1/3 c Suppose 0 = -2w - 2s - 26, 0w - 2s = -2w - 22. Let n be (567/w)/9 - -4. Which is the third smallest value? (a) -1.1 (b) 0.2 (c) n b Let l = 0.1 + 0.9. Let q(j) = 3j + j*2 + 3j*3 - 8 - 6j*3 + 5j + 16j2. Let d be q(6). Which is the biggest value? (a) l (b) d (c) -1 b Let v = -426 + 432. Which is the third smallest value? (a) -2/3 (b) v (c) -1/3 (d) -0.4 c Let n = 300 - 300.3. Which is the third smallest value? (a) 15 (b) n (c) -2 (d) 1/2 d Let k = -0.13 + 0.19. Let v = k - -0.24. Let g = -0.1 - v. What is the third smallest value in 2/15, -2/11, g? 2/15 Let q be (6/28)/(27/24). Let m = 41/105 - q. Let i = 2.966 - -0.034. What is the smallest value in i, -3, m? -3 Let r = -404.1 - -404. Let z = -0.34 + -0.06. Let d = 0.1 - z. Which is the biggest value? (a) d (b) -1/2 (c) r a Let z = -269.1 + 268.1. What is the second smallest value in 4, -39/16, z? z Suppose 2t = -2 + 18. Let h(m) = m*2 - 6m - 15. Let i be h(t). Which is the second smallest value? (a) -5 (b) 5 (c) i c Let y = -1326 + 1299. Which is the fourth smallest value? (a) 3/4 (b) y (c) 0.2 (d) -3 a Let h(y) = -27y + 158. Let u be h(6). What is the smallest value in 1/2, u, -0.03? u Let n = -131 - -97. Let v = n - -33.8. What is the second smallest value in v, 0.2, 5/2? 0.2 Let h = 1070 + -1065. What is the third smallest value in 0.3, -0.4, h, 4? 4 Let m(f) = f3 - 7f*2 - 7f - 3. Let z be 6 + (-1 - 3 - (-60)/10). Let o be m(z). What is the third smallest value in 2, 0.2, 8, o? o Let p = 0.07 - -2.93. Let j = -11 - -20. Let w be j/324 - (-2)/9. Which is the second biggest value? (a) p (b) w (c) -4 b Let p = -0.539 + 1.539. Which is the biggest value? (a) 20 (b) -2/9 (c) p a Suppose u + 2093 = 8u. Let f be 4/(-14) + 0 - u/(-91). What is the third smallest value in f, 0.1, -5, 0? 0.1 Let u be 3(-13 - 357/(-117)). Let c = -799/40 + 98/5. What is the third smallest value in u, -4, c, 2/5? u Let v(t) = -t2 + 6t + 5. Let k be v(6). Suppose kl + 0y + 21 = 4y, 2 = -2y. Suppose -6n + n + 5 = 0. What is the second smallest value in l, 0.1, n? 0.1 Let k = -29.9 + 29.4. Which is the third smallest value? (a) -1/7 (b) 3 (c) 0.3 (d) k c Let o be (-1264)/(-1896)(-2)/(16/3). Let s = 518/11 + -47. Which is the biggest value? (a) 3 (b) o (c) s (d) 0.01 a Let d be (-44)/(-10)75/6. Let g = 217/4 - d. Which is the second biggest value? (a) 5 (b) -6 (c) g c Let k = -3951/8 + 494. Let d = 0.7 - -1.3. What is the second biggest value in -48, d, k? k Let t = 0.7 - 0.5. Let g = -16 + 31. Let j = 18 - g. What is the third smallest value in t, j, -0.3? j Let j be -2 - ((-308)/33 - -8). What is the third smallest value in j, 84, 3/4? 84 Let g = -236 + 232.9. Which is the smallest value? (a) -1/7 (b) g (c) 1 b Suppose 0 = w - 6w + 4x + 13, 4x + 3 = -5w. What is the third smallest value in 29/5, -1, w, -2/3? w Let v(z) = -z3 - 6z*2 - 5z. Let x be v(-5). Let u = -42 - -42.72. Let p = 1.22 - u. Which is the	{ "pile_set_name": "DM Mathematics" }
b be (60/(-25))/(4/(-470)). Suppose -5i - 5d = -b + 62, 0 = -i + 3d + 52. List the prime factors of i. 2, 23 Suppose -26 = -2j - 2h + 3h, -3h = -2j + 30. Let s be (-312)/(-15) - j/15. Suppose -17p - 9 = -sp. What are the prime factors of p? 3 Let t(l) = -l - 1. Let r be t(1). Let u = 1 - r. What are the prime factors of (u - 5) + 8 + -2? 2 Suppose 3s - 6 = -0. Suppose -6z + sz + 3h + 123 = 0, 129 = 4z - h. What are the prime factors of z? 3, 11 Suppose 24w - 27w = -4p - 12843, 2w = 4p + 8566. What are the prime factors of w? 7, 13, 47 Let b(o) = 44o2 + 39o + 72. List the prime factors of b(-6). 2, 3, 79 Let y(k) = 4k2 - 3k - 12. What are the prime factors of y(6)? 2, 3, 19 Let f be (-3 - -3)/(-12). What are the prime factors of (3 + f)/((-45)/(-480))? 2 Let d be (-18)/3(-80)/6. Suppose 2b = 5r + d, 26 + 14 = b - r. List the prime factors of b. 2, 5 Let g(v) = 11v - 4. Let y be g(-7). What are the prime factors of -10(1 - -1 - y/(-9))? 2, 5, 7 Let t be -1(2 - (17 + -2)). Let w = t + -8. Suppose g = -5s + 10, -5g - ws + 79 = 9. What are the prime factors of g? 3, 5 Suppose -7m + 54 = -247. Let o = -38 + 13. Let l = m + o. What are the prime factors of l? 2, 3 Let c be 194/14 + 2/14. What are the prime factors of (0 - (1 + -20))196/c? 2, 7, 19 Let b(y) = -55y - y3 + 15 + 113y - 40y + 15y*2. What are the prime factors of b(16)? 47 Let f(i) = 24i*2 + 55i + 560. What are the prime factors of f(-13)? 47, 83 Let n be (4/(-6))/(10/1545). Let j be 5/(-25)0 - n. Let x = j + -40. List the prime factors of x. 3, 7 Let s = 2 + 2. Let p be (-3)/s + (-22)/(-8). Suppose -h - pz = -16, 2z + 3z - 50 = -3h. What are the prime factors of h? 2, 5 Suppose 0 = -2s + 5s + 33. Suppose 7x + 23 = 16. Let r = x - s. List the prime factors of r. 2, 5 Suppose 4a - 44 - 1678 = -2m, 3453 = 4m - a. What are the prime factors of m? 863 Let d(a) = a3 + 33a*2 + 26a + 42. What are the prime factors of d(-31)? 2, 3, 193 Suppose -15k = 2k - 51. Let j(l) = 24l2 + 7l - 5. List the prime factors of j(k). 2, 29 Suppose 23v + 26v = 243138. What are the prime factors of v? 2, 3, 827 Let z(n) = 6n2 + 5n - 6. Let h be z(3). Let q = -22 + h. What are the prime factors of q? 41 Suppose 0 = -5p + 230 - 20. Suppose d + 2d - p = 0. List the prime factors of d. 2, 7 Suppose 2z = -4i - 6, 2i - 4z - 2 = -0i. Let b be 10/(i - 5/(-4)). Suppose -g + b = 15. List the prime factors of g. 5 Let j be 10 - 7 - 312/3. Let m = -62 - j. What are the prime factors of m? 3, 13 Let m be 8/12 + 10/3. Let f be m + 7/((-7)/4). Suppose 4n = 4y - 50 + 214, f = -2n - 4y + 58. What are the prime factors of n? 37 Suppose -2m - 26 = -t, -5t - 3m - 48 = -178. List the prime factors of 3/2t/3. 13 Let c = 0 + 3. Let v(f) = f2 - 19f + 36. Let h be v(17). Suppose hq - c = 47. List the prime factors of q. 5 Suppose -17 = -i - 4. Let a = i + -3. Suppose -j + a = j. What are the prime factors of j? 5 Let w(a) = 15a*2 + 45a + 63. What are the prime factors of w(-12)? 3, 11, 17 Let y be (-45)/(-10)(4 - 2). Let w = y + -4. Suppose 3c = 5k - 231 - 155, -2k = wc - 142. What are the prime factors of k? 2, 19 What are the prime factors of (-5)/(30/(-6)) - -1041? 2, 521 Let i be (-6)/(-2)(-9 - -12). Suppose 2q - 4 + i = 3t, 0 = -2t + q + 4. Suppose 8g = tg + 15. What are the prime factors of g? 3 Let b(z) = z3 + 9z*2 - z + 8. Suppose -3m + 29 = 4q + 2, -3m + 6 = -3q. Let w(x) = x2 - 6x - 4. Let d be w(m). What are the prime factors of b(d)? 17 Let x(v) = -5v. Let a be x(2). Let i be 1/((9/(-3))/(-108)). Let h = i + a. List the prime factors of h. 2, 13 Let s be (-2 + 0)2/(-4). Let h = 125 + -105. Let u = h + s. What are the prime factors of u? 3, 7 Suppose -2165 = 22m - 9095. What are the prime factors of m? 3, 5, 7 Let m be 0 - (-1)/5 - 3735/(-75). Let p be 0/(2/(-1 + 0)). Suppose 5z = -pz + m. List the prime factors of z. 2, 5 Let x(r) = -r2 - r. Let t(k) = 5k*2 - 8k - 1. Let f(v) = t(v) - 4x(v). What are the prime factors of f(2)? 3 Suppose 3f - 174 = 5a, -4f = -3a + a - 246. What are the prime factors of f? 3, 7 List the prime factors of (14980/98)/(-1 - (-24)/21). 2, 5, 107 Let k(t) = t2 + 10t + 3. Let z be k(-10). Suppose 4j = zv - 166, 5v - 296 = -7j + 4j. List the prime factors of v. 2, 29 Suppose n + 2n - 831 = -3g, 4g - 1102 = -n. List the prime factors of g. 5, 11 Let f(w) = -w*2 + 101w - 107. List the prime factors of f(55). 2423 Let s(h) = -h3 - h2 + 142. Let u be s(0). Suppose -2z = -2j + 7j - u, -5j = -2z + 122. List the prime factors of z. 2, 3, 11 Let c = -130 - -303. What are the prime factors of c? 173 Let o = 1278 - 570. What are the prime factors of o? 2, 3, 59 Let z(w) = -11w - 2. Let h be -1 + ((-16)/(-1))/(-4). Let i be z(h). Let a = i + 1. What are the prime factors of a? 2, 3 Suppose 3q - 3t = 11145, -5t - 3003 + 17854 = 4q. What are the prime factors of q? 2, 3, 619 Suppose 3274 - 509 = 5i - 5y, 5y = i - 573. What are the prime factors of i? 2, 137 Let l(z) = 2z*2 + z - 1. Let b be l(-2). Suppose 460 - 100 = bs. List the prime factors of s. 2, 3 Suppose -4o + 2 = 54. Let l = 16 + o. Let r(q) = 2q*2 + 5q - 4. What are the prime factors of r(l)? 29 Suppose -12048 = -7b + 6495. List the prime factors of b. 3, 883 Suppose 61p + 60787 = 150p. List the prime factors of p. 683 Let i(h) be the third derivative of 1/20h*6 - 1/2h*3 + 0h + h*2 + 1/8h*4 - 1/30h*5 + 0. What are the prime factors of i(2)? 43 Suppose -5m = 5h - 270, -h + 231 = 3m + m. What are the prime factors of m? 59 Let c(i) = -i*3 + 2i*2 + 3i - 17. Let y(u) = u*2 - u - 1. Let a(k) = -c(k) - 2y(k). What are the prime factors of a(8)? 3, 89 Suppose g = 2787 - 354. List the prime factors of g. 3, 811 What are the prime factors of (1918 + -5 + 3)(-3)/(-12)? 479 Suppose 5i + 2l - 3570 = 0, 3i = -l + 685 + 1457. What are the prime factors of i? 2, 3, 7, 17 Let j(z) = -z*3 + 17z*2 + 4z - 8. Let f be -3 + 4 + 13 - -3. What are the prime factors of j(f)? 2, 3, 5 Let b = 1193 - -201. What are the prime factors of b? 2, 17, 41 Let f(x) = x*2 + 2x + 12. Let h be f(9). Suppose 4z - h = -t - 0t, -4z + 106 = 2t. List the prime factors of z. 29 What are the prime factors of 1540 - (2 + -6 + -2)? 2, 773 Let c = -132 - -137. Suppose -cp = -381 - 249. What are the prime factors of p? 2, 3, 7 Let m = 1542 + -366. Suppose 7g = -g + m. List the prime factors of g. 3, 7 Let n be (-3)/(-3 + (-364)/(-120)). Let v = n - -102. What are the prime factors of v? 2, 3 Suppose -6b + 436 = -194. List the prime factors of b. 3, 5, 7 Let i be (-1 + 1 - (-10 + 10))/3. What are the prime factors of i(-2 - (-10)/4) - -78? 2, 3, 13 Let u = 14 - 12. Let h be 19(u - 1)1. Let y = h + -16. List the prime factors of y. 3 Let w = -673 + 1200. List the prime factors of w. 17, 31 Let s(x) = 3x3 + 2x - 2. Let h be s(2). Suppose 2a - 3a + h = 0. Suppose 0 = -3w - y + 10, 0 = 5w + 4y - 0y - a. What are the prime factors of w? 2 Let y(z) = -z*3 + 14z*2 + 42z + 6. List the prime factors of y(15). 3, 137 Let j(u) = 5u3 - 7u*2 + 19u + 63. List the prime factors of j(7). 2, 7 Let i = -47 + 47. Suppose i = -u + 5g + 146, -4u - 3g + 240 = -2u. List the prime factors of u. 2, 3, 7 Let t be 732/(-20)-1 + (-3)/5. Let s = 6 + t. List the prime factors of s. 2, 3, 7 Suppose -16 = -u - 3u. Suppose 2z = -u, -32 = -w - 3z + 26. Suppose k = 2i - 0k - w, 4k + 106 = 3i. What are the prime factors of i? 2, 3, 5 Suppose -678 = -3z + 1455. What are the prime factors of z? 3, 79 Suppose -6 = b - 5y, 4 = -5y + y. Let z = b + 17. What are the prime factors of z? 2, 3 Suppose 872f = 854f + 66762. List the prime factors of f. 3709 Suppose 2718 = a - 15y + 13y, 2y + 5438 = 2a. List the prime factors of a. 2, 5, 17 Suppose 0 = -11x + 6x + 225. Let j = 179 + x. What are the prime factors of j? 2, 7 Let c be (2/(-8)6)/((-9)/12). Suppose 0s - 208 = -cs. What are the prime factors of s? 2, 13 Let k = -10 + 9. Let m(u) = -209u - 8. What are the prime factors of m(k)? 3, 67 Suppose -4y - 318 = -2l, y = -l - y + 143. Suppose 7w - 1677 = -l. What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
he tenth root of 34795 to the nearest integer? 3 What is the square root of 748386 to the nearest integer? 865 What is the square root of 471669 to the nearest integer? 687 What is 1153685 to the power of 1/6, to the nearest integer? 10 What is 21664104 to the power of 1/9, to the nearest integer? 7 What is 7654410 to the power of 1/2, to the nearest integer? 2767 What is the third root of 3244794 to the nearest integer? 148 What is the cube root of 12245437 to the nearest integer? 230 What is 144854 to the power of 1/2, to the nearest integer? 381 What is the square root of 8134 to the nearest integer? 90 What is 17441919 to the power of 1/6, to the nearest integer? 16 What is 179193 to the power of 1/2, to the nearest integer? 423 What is 2051786 to the power of 1/3, to the nearest integer? 127 What is the square root of 41369 to the nearest integer? 203 What is the cube root of 205777 to the nearest integer? 59 What is 508187 to the power of 1/2, to the nearest integer? 713 What is the third root of 873604 to the nearest integer? 96 What is 276948 to the power of 1/2, to the nearest integer? 526 What is 102228 to the power of 1/5, to the nearest integer? 10 What is 17070311 to the power of 1/2, to the nearest integer? 4132 What is 20582033 to the power of 1/2, to the nearest integer? 4537 What is 742109 to the power of 1/2, to the nearest integer? 861 What is the fifth root of 131093 to the nearest integer? 11 What is the sixth root of 3024182 to the nearest integer? 12 What is 107841 to the power of 1/10, to the nearest integer? 3 What is the fifth root of 31240 to the nearest integer? 8 What is the third root of 193188 to the nearest integer? 58 What is the seventh root of 2939387 to the nearest integer? 8 What is 788316 to the power of 1/7, to the nearest integer? 7 What is the cube root of 367635 to the nearest integer? 72 What is 194402 to the power of 1/8, to the nearest integer? 5 What is 229403 to the power of 1/2, to the nearest integer? 479 What is the third root of 787549 to the nearest integer? 92 What is the square root of 4953577 to the nearest integer? 2226 What is the sixth root of 193958 to the nearest integer? 8 What is the cube root of 17112119 to the nearest integer? 258 What is the square root of 2680570 to the nearest integer? 1637 What is the fourth root of 818641 to the nearest integer? 30 What is 3537179 to the power of 1/4, to the nearest integer? 43 What is the tenth root of 3076207 to the nearest integer? 4 What is 4578036 to the power of 1/10, to the nearest integer? 5 What is the cube root of 6871806 to the nearest integer? 190 What is 529750 to the power of 1/8, to the nearest integer? 5 What is 27662876 to the power of 1/8, to the nearest integer? 9 What is 6687444 to the power of 1/2, to the nearest integer? 2586 What is 2254 to the power of 1/2, to the nearest integer? 47 What is the fifth root of 5096321 to the nearest integer? 22 What is 7136065 to the power of 1/8, to the nearest integer? 7 What is the third root of 41617 to the nearest integer? 35 What is 1086702 to the power of 1/8, to the nearest integer? 6 What is the square root of 519817 to the nearest integer? 721 What is the cube root of 8959937 to the nearest integer? 208 What is the cube root of 8459363 to the nearest integer? 204 What is 437064 to the power of 1/3, to the nearest integer? 76 What is 188112 to the power of 1/2, to the nearest integer? 434 What is 3871942 to the power of 1/6, to the nearest integer? 13 What is the square root of 398647 to the nearest integer? 631 What is the sixth root of 451094 to the nearest integer? 9 What is the square root of 199185 to the nearest integer? 446 What is 239791 to the power of 1/2, to the nearest integer? 490 What is 193777 to the power of 1/3, to the nearest integer? 58 What is 119384 to the power of 1/2, to the nearest integer? 346 What is the square root of 354899 to the nearest integer? 596 What is 400066 to the power of 1/10, to the nearest integer? 4 What is 71072 to the power of 1/8, to the nearest integer? 4 What is the sixth root of 1307100 to the nearest integer? 10 What is 9426522 to the power of 1/6, to the nearest integer? 15 What is the square root of 709398 to the nearest integer? 842 What is the cube root of 13477035 to the nearest integer? 238 What is 8120648 to the power of 1/3, to the nearest integer? 201 What is the eighth root of 14489894 to the nearest integer? 8 What is the cube root of 5101085 to the nearest integer? 172 What is 396291 to the power of 1/3, to the nearest integer? 73 What is 17989772 to the power of 1/3, to the nearest integer? 262 What is the square root of 370676 to the nearest integer? 609 What is the eighth root of 241336 to the nearest integer? 5 What is the square root of 5553432 to the nearest integer? 2357 What is the third root of 1081103 to the nearest integer? 103 What is 1223034 to the power of 1/5, to the nearest integer? 17 What is the cube root of 137687 to the nearest integer? 52 What is 235264 to the power of 1/6, to the nearest integer? 8 What is the third root of 179574 to the nearest integer? 56 What is the third root of 1441361 to the nearest integer? 113 What is 5350535 to the power of 1/2, to the nearest integer? 2313 What is 63891 to the power of 1/3, to the nearest integer? 40 What is the square root of 281801 to the nearest integer? 531 What is 986646 to the power of 1/3, to the nearest integer? 100 What is the square root of 21406456 to the nearest integer? 4627 What is 641987 to the power of 1/2, to the nearest integer? 801 What is the square root of 214485 to the nearest integer? 463 What is 34436 to the power of 1/9, to the nearest integer? 3 What is 9087933 to the power of 1/8, to the nearest integer? 7 What is the square root of 401253 to the nearest integer? 633 What is 15891175 to the power of 1/3, to the nearest integer? 251 What is 9718591 to the power of 1/5, to the nearest integer? 25 What is 100041 to the power of 1/5, to the nearest integer? 10 What is the tenth root of 915263 to the nearest integer? 4 What is 186751 to the power of 1/2, to the nearest integer? 432 What is the tenth root of 1603366 to the nearest integer? 4 What is the eighth root of 99726 to the nearest integer? 4 What is 8024989 to the power of 1/2, to the nearest integer? 2833 What is 526053 to the power of 1/2, to the nearest integer? 725 What is the square root of 247833 to the nearest integer? 498 What is the third root of 33470597 to the nearest integer? 322 What is the cube root of 736704 to the nearest integer? 90 What is 4767179 to the power of 1/3, to the nearest integer? 168 What is 18837296 to the power of 1/7, to the nearest integer? 11 What is 6331249 to the power of 1/3, to the nearest integer? 185 What is the square root of 2528397 to the nearest integer? 1590 What is 13410373 to the power of 1/2, to the nearest integer? 3662 What is the square root of 1594429 to the nearest integer? 1263 What is the third root of 435984 to the nearest integer? 76 What is the third root of 13859831 to the nearest integer? 240 What is the third root of 8121413 to the nearest integer? 201 What is the square root of 1992571 to the nearest integer? 1412 What is 1927211 to the power of 1/2, to the nearest integer? 1388 What is 594603 to the power of 1/5, to the nearest integer? 14 What is the square root of 448338 to the nearest integer? 670 What is the eighth root of 136181 to the nearest integer? 4 What is 26535 to the power of 1/3, to the nearest integer? 30 What is the sixth root of 474239 to the nearest integer? 9 What is the cube root of 776788 to the nearest integer? 92 What is 244314 to the power of 1/2, to the nearest integer? 494 What is the third root of 192950 to the nearest integer? 58 What is 45799 to the power of 1/3, to the nearest integer? 36 What is the third root of 2032619 to the nearest integer? 127 What is the square root of 319974 to the nearest integer? 566 What is the third root of 3994785 to the nearest integer? 159 What is the sixth root of 9103758 to the nearest integer? 14 What is 767621 to the power of 1/2, to the nearest integer? 876 What is 12181371 to the power of 1/2, to the nearest integer? 3490 What is 6274687 to	{ "pile_set_name": "DM Mathematics" }
ert 265.2233ug to nanograms. 265223.3 How many grams are there in 5/4 of a kilogram? 1250 How many nanometers are there in one fifth of a micrometer? 200 Convert 5684.338 litres to millilitres. 5684338 How many millilitres are there in 340606.2 litres? 340606200 What is 0.6064276um in millimeters? 0.0006064276 What is 5/8 of a litre in millilitres? 625 How many grams are there in seven halves of a kilogram? 3500 What is five quarters of a litre in millilitres? 1250 What is 1/10 of a meter in centimeters? 10 How many micrograms are there in 8/25 of a milligram? 320 How many millilitres are there in 12/25 of a litre? 480 What is three tenths of a decade in months? 36 How many tonnes are there in 233426.4ug? 0.0000002334264 What is 51/5 of a kilogram in grams? 10200 How many meters are there in 6455.88nm? 0.00000645588 How many days are there in 722.70324 minutes? 0.50187725 How many milligrams are there in 37/5 of a gram? 7400 What is 43.2411 days in seconds? 3736031.04 What is 7/2 of a meter in millimeters? 3500 What is one tenth of a gram in milligrams? 100 What is 7.764917 millilitres in litres? 0.007764917 How many micrometers are there in 6051.457 centimeters? 60514570 How many millilitres are there in 51/4 of a litre? 12750 What is one twentieth of a kilometer in millimeters? 50000 What is 0.7338853 millennia in months? 8806.6236 How many seconds are there in 2.684722us? 0.000002684722 What is three fifths of a milligram in micrograms? 600 What is eleven quarters of a litre in millilitres? 2750 How many minutes are there in 28/9 of a day? 4480 How many microseconds are there in eighty-eight fifths of a millisecond? 17600 What is 0.67501ml in litres? 0.00067501 How many millilitres are there in 8640.717l? 8640717 How many micrograms are there in 8/25 of a milligram? 320 Convert 35943.54 milligrams to nanograms. 35943540000 How many millilitres are there in one fifth of a litre? 200 What is 3/5 of a litre in millilitres? 600 What is three eighths of a week in hours? 63 What is six fifths of a milligram in micrograms? 1200 What is 0.5609745 millennia in years? 560.9745 How many months are there in 921544.8 decades? 110585376 What is 3/25 of a second in milliseconds? 120 What is 29/2 of a millennium in decades? 1450 What is three eighths of a kilogram in grams? 375 How many months are there in 1/24 of a millennium? 500 Convert 30.83452 seconds to milliseconds. 30834.52 How many decades are there in twenty-seven quarters of a millennium? 675 What is twenty-seven halves of a millennium in centuries? 135 How many minutes are there in 13/5 of a hour? 156 What is 869.672 micrograms in nanograms? 869672 What is 19.43727 nanoseconds in microseconds? 0.01943727 What is one fifth of a milligram in micrograms? 200 What is 11/2 of a decade in months? 660 What is 1/4 of a week in minutes? 2520 How many seconds are there in thirty-seven fifths of a minute? 444 Convert 0.773756 decades to months. 92.85072 Convert 2.656775 millimeters to centimeters. 0.2656775 How many millilitres are there in six fifths of a litre? 1200 Convert 7.84547 tonnes to nanograms. 7845470000000000 What is one twentieth of a centimeter in micrometers? 500 What is fourty-nine fifths of a week in minutes? 98784 How many millilitres are there in 5/4 of a litre? 1250 How many millilitres are there in 21/4 of a litre? 5250 How many years are there in 17/10 of a millennium? 1700 How many nanometers are there in 0.5061073 kilometers? 506107300000 What is three eighths of a decade in months? 45 How many nanograms are there in 3560.992g? 3560992000000 How many micrograms are there in 85337.78t? 85337780000000000 What is one tenth of a centimeter in micrometers? 1000 How many millimeters are there in three fifths of a centimeter? 6 What is 3/25 of a litre in millilitres? 120 Convert 553930.8 tonnes to milligrams. 553930800000000 How many centimeters are there in one tenth of a meter? 10 What is 74/5 of a century in years? 1480 How many hours are there in 93751.92ns? 0.0000000260422 How many millilitres are there in thirteen eighths of a litre? 1625 How many litres are there in 82.74624 millilitres? 0.08274624 How many decades are there in 496536.1 millennia? 49653610 How many litres are there in 6574.03ml? 6.57403 How many kilograms are there in 5.788256 grams? 0.005788256 How many meters are there in 9.324705 nanometers? 0.000000009324705 How many months are there in one sixteenth of a century? 75 What is 26/5 of a micrometer in nanometers? 5200 How many millimeters are there in 22618.4m? 22618400 Convert 0.619665km to nanometers. 619665000000 What is 6.073325nm in centimeters? 0.0000006073325 How many millilitres are there in 0.5016904l? 501.6904 How many millilitres are there in nineteen quarters of a litre? 4750 How many micrograms are there in 3/25 of a milligram? 120 How many micrograms are there in 4683.72 milligrams? 4683720 What is 48/5 of a litre in millilitres? 9600 What is 3/40 of a milligram in nanograms? 75000 How many micrometers are there in eleven eighths of a millimeter? 1375 What is twenty-seven quarters of a millimeter in micrometers? 6750 How many decades are there in 690.5549 centuries? 6905.549 How many millilitres are there in 8.973594 litres? 8973.594 How many millimeters are there in 33/5 of a centimeter? 66 What is 3/32 of a milligram in nanograms? 93750 How many millilitres are there in 569.5871l? 569587.1 What is 4.69455 millilitres in litres? 0.00469455 What is 7189.345cm in meters? 71.89345 What is 25/2 of a microgram in nanograms? 12500 What is 50.57202 nanometers in meters? 0.00000005057202 How many months are there in 7/4 of a decade? 210 What is 62.49238um in meters? 0.00006249238 What is 34.0629ml in litres? 0.0340629 What is 12/25 of a tonne in kilograms? 480 How many months are there in thirty-two fifths of a century? 7680 What is one twentieth of a second in microseconds? 50000 Convert 5.216155ml to litres. 0.005216155 What is one fifth of a kilometer in meters? 200 What is 4.15193g in kilograms? 0.00415193 What is 37/2 of a microsecond in nanoseconds? 18500 How many nanometers are there in 942.5152 micrometers? 942515.2 How many decades are there in 64/5 of a century? 128 What is thirty-four fifths of a microgram in nanograms? 6800 What is 2/125 of a gram in milligrams? 16 Convert 0.6907723nm to kilometers. 0.0000000000006907723 How many decades are there in thirty-one fifths of a millennium? 620 What is eleven tenths of a kilometer in meters? 1100 How many centuries are there in 63.07173 decades? 6.307173 How many micrometers are there in 228806.7cm? 2288067000 What is 22383.918us in hours? 0.000006217755 Convert 38.3389902s to weeks. 0.0000633911875 How many hours are there in twelve sevenths of a week? 288 What is 7/2 of a meter in millimeters? 3500 Convert 534545.8 micrometers to millimeters. 534.5458 What is 11.01139 litres in millilitres? 11011.39 What is 0.50536 years in millennia? 0.00050536 How many millilitres are there in one twentieth of a litre? 50 How many hours are there in 1/4 of a day? 6 What is 7/2 of a hour in minutes? 210 How many months are there in twenty-three thirds of a year? 92 How many millilitres are there in 1.3673l? 1367.3 What is eleven eighths of a tonne in kilograms? 1375 What is 7/2 of a micrometer in nanometers? 3500 What is 39439.89 millennia in centuries? 394398.9 What is eleven halves of a hour in seconds? 19800 What is 2698.67 decades in months? 323840.4 What is 84570.69 micrometers in kilometers? 0.00008457069 How many micrometers are there in 6/5 of a millimeter? 1200 How many millilitres are there in 70466.18 litres? 70466180 What is twenty-nine fifths of a decade in years? 58 How many kilograms are there in 956939.2ug? 0.0009569392 How many millilitres are there in 45/4 of a litre? 11250 How many millennia are there in 9253.767 months? 0.77114725 How many centimeters are there in 17.20534um? 0.001720534 What is 3/40 of a milligram in nanograms? 75000 How many centimeters are there in 6/5 of a meter? 120 Convert 995.5719 millilitres to litres. 0.9955719 What is 49609.5ug in grams? 0.0496095 How many weeks are there in 136.085124 hours? 0.8100305 What is 25.99961 tonnes in micrograms? 25999610000000 How many	{ "pile_set_name": "DM Mathematics" }
/48 + 5q3/12 - 19q. Factor c(s). 5s(s - 2)(s - 1)3/4 Let w(o) be the second derivative of o5/30 + o4/12 + 3o*2/2 + 2o. Let r(t) be the first derivative of w(t). Factor r(h). 2h(h + 1) Solve 48o4 + 21o - 10o3 + 20o*2 - 53o*4 + 19o = 0. -2, 0, 2 Let x(z) = 9z2 - 4. Let t(m) be the third derivative of 0m + 0 + 3m2 - m3 + 0m*4 + 7/30m*5. Let j(i) = -5t(i) + 8x(i). Factor j(k). 2(k - 1)(k + 1) Let z(t) = -4t - 50. Let w be z(-13). Determine n, given that 2/3n + 2/3n*w + 0 = 0. -1, 0 Let o = -4 + 9/2. What is n in -3/2n*4 + 3/2n - n*3 - on5 + 1/2 + n2 = 0? -1, 1 Suppose 2c3 + 48c + 20c + 2c*3 - 64c*2 - 16 + 8c*3 = 0. What is c? 1/3, 1, 4 Let d = 8 + 20. Suppose -27o - 1 + do + 1 - o3 = 0. What is o? -1, 0, 1 Factor -1 + 3/4k*2 + 1/4k*3 + 0k. (k - 1)(k + 2)2/4 Let s be -23 - -20 - (-2 - 14/5). Factor 1/5 + 33/5g*4 + 6g*2 + 46/5g*3 + 9/5g*5 + sg. (g + 1)*3(3g + 1)2/5 Suppose -10 = -3p - 5w, 0 = p - w - 1 + 3. Factor 6/5c*3 + 6/5c*2 + 2/5c*4 + 2/5c + p. 2c(c + 1)*3/5 Factor -1/4u*4 + 3/4u - 3/4u3 + 1/2 - 1/4u*2. -(u - 1)(u + 1)*2(u + 2)/4 Let q be (-5)/((-300)/35) + (-3)/12. Let p(g) be the first derivative of -g*2 - qg3 - g - 1. Factor p(f). -(f + 1)2 Let y be -1(-4)/123. Solve -y + b - 3 + b*2 + 2 = 0. -2, 1 Let b be 24/(9360/966) - 2/26. Find z such that 0 + bz*2 + 0z + 48/5z3 - 15z*5 + 3z*4 = 0. -2/5, 0, 1 Let i(r) be the first derivative of 2r*3/27 - 2r*2/9 + 12. Solve i(v) = 0. 0, 2 Let -3 - 10/3j - 1/3j2 = 0. Calculate j. -9, -1 Let m(j) be the second derivative of -j7/105 + j5/50 + 36j. Factor m(o). -2o3(o - 1)(o + 1)/5 Let n(d) = -d2 + 6d + 1. Let i be n(6). What is a in 6a2 + a2 + 16a - 13a2 + 7 + i - 18a*3 = 0? -2/3, 1 Let x(v) be the first derivative of 4v*5/5 + 10v*4 + 128v*3/3 + 64v*2 - 54. Factor x(k). 4k(k + 2)(k + 4)*2 Let u be ((-20)/(-5))/(-1) - -9. Let d(h) be the third derivative of 0 + 0h + 3h2 - 1/4h*4 + 7/120h*u - 1/3h3. Let d(y) = 0. Calculate y. -2/7, 2 Let x(c) = -c3 + c*2 + c. Let l(a) = 3a*4 + 2a + 7a - 9a3 + a4 + 5a2 - 2 - 2a*4. Let i(r) = -l(r) + 5x(r). Factor i(z). -2(z - 1)3(z + 1) Let f(g) be the first derivative of 5/16g4 - 1 + 3/4g*3 + 1/2g + 1/20g5 + 7/8g*2. Let f(b) = 0. Calculate b. -2, -1 Let t(k) be the second derivative of -3k5/80 + k4/12 + k3/24 - k2/4 - 24k. Suppose t(o) = 0. Calculate o. -2/3, 1 Suppose 2y + 11 = x, -5x + 0y = -3y - 27. Let v = 31 + -28. What is r in -rv + 4r + 2 + 0 - 2r4 - xr*3 = 0? -1, 1 Let d(b) be the third derivative of -1/2b*3 + 0b + 0b4 + 0 + 1/360b*5 + 2b*2 + 1/1080b*6. Let k(i) be the first derivative of d(i). Factor k(o). o(o + 1)/3 Let m = 252 - 248. What is n in 0 + 0n - 2/3n*2 - 16/3n*3 - 32/3nm = 0? -1/4, 0 Let f(w) = -w3 + w*2 - w + 1. Let m(i) = -18i*2 - 9i - 3. Let y(g) = 3f(g) + m(g). Factor y(r). -3r(r + 1)(r + 4) Let q(p) be the first derivative of -7p8/24 - p7/5 + 2p*6/5 - 2p5/15 + p2/2 + 1. Let m(c) be the second derivative of q(c). Solve m(s) = 0. -1, 0, 2/7 Suppose -x - 4x = 0. Let s be (-3)/(-4) - (x + 0). Factor 1/4 + st + 3/4t2 + 1/4t3. (t + 1)3/4 Let f be (3/(-2) + 1)0. Find v such that 2/9v*3 - 4/9v*2 + 0v + f = 0. 0, 2 Let w be 2/(1 + (-20)/12). Let g be (w/(-36))/((-3)/(-27)). Let -u - 1/4u2 - g = 0. Calculate u. -3, -1 Let s = -2 + 5. Factor c3 + 5c - 6cs + 0 + 2c*2 - 2. -(c - 1)(c + 1)(5c - 2) Factor 24/7k + 5/7k*3 + 4/7 + 3k2. (k + 2)2(5k + 1)/7 Factor 75z - 3z*2 + 18z2 + z3 + 125 + 0z3. (z + 5)3 Let m be (3/(-6))/(2/8). Let i = 5 + m. Factor 2f*4 - 4f + 5f + 3f - 4fi - 2. 2(f - 1)*3(f + 1) Let v(s) = -s*3 - 3s2 - 2. Let a(d) = -d3 - 2d2 + d - 2. Let f(t) = 3a(t) - 2v(t). Let i be f(1). Suppose iy - 1/4 + 1/4y2 = 0. Calculate y. -1, 1 Let i(m) = 14m*3 + 8m2 + 8. Let f(s) be the second derivative of s5/4 + s*4/4 + 3s*2/2 + s. Let p(x) = 8f(x) - 3i(x). Factor p(u). -2u*3 Suppose -24z = -44z + 80. Let 0l*2 - 3/2l*3 - 3/2l*z + 0l + 0 = 0. Calculate l. -1, 0 Let k(n) be the first derivative of -n*6/4 + 21n*5/10 - 99n*4/32 - 7n*3 - 3n*2 + 27. What is j in k(j) = 0? -1/2, 0, 4 Let f = 70 + -839/12. Let d(s) be the first derivative of 0s*5 - 1/4s*4 + fs*6 + 1/4s*2 + 0s*3 + 2 + 0s. Determine k, given that d(k) = 0. -1, 0, 1 Suppose -9/5g3 + 12/5g + 0g2 - 3/5g4 + 0 = 0. What is g? -2, 0, 1 Let o(t) be the third derivative of t8/1680 + t7/150 + t6/40 + 3t5/100 + 53t*2. Solve o(z) = 0. -3, -1, 0 Let f(n) = 4n*2 - 17n + 4. Let c be f(4). Determine k so that -8/7k3 + c + 10/7k*2 + 2/7k*4 - 4/7k = 0. 0, 1, 2 Let a(t) be the second derivative of t4/102 - t3/51 - 6t2/17 - 5t. Solve a(q) = 0. -2, 3 Suppose 5h + 2b - 10 = 0, 20 = 3h + h + 4b. Suppose h = 2i + 2v - 10, -4v + 3 + 5 = 0. Factor 0d*2 - 1/2d*4 + 1/2d*5 + 0d + 0 - di. d3(d - 2)(d + 1)/2 Let h(q) be the first derivative of q*6/6 + 3q*5/5 + 3q4/4 + q3/3 + 4. Factor h(u). u*2(u + 1)3 Let i(s) be the third derivative of s8/168 - 2s7/105 - s6/30 + 2s5/15 + s4/12 - 2s3/3 + 2s*2. Let i(o) = 0. Calculate o. -1, 1, 2 Let v be -1 - -2 - (-80)/(-144). Factor v - 4/9o*2 - 10/9o*3 + 10/9o. -2(o - 1)(o + 1)(5o + 2)/9 Let u(n) be the first derivative of n*7/14 + 7n6/30 + n5/4 + n*4/12 + 4n + 4. Let i(c) be the first derivative of u(c). Factor i(v). v*2(v + 1)*2(3v + 1) Let w(o) be the third derivative of 0 + 0o + 0o3 - 1/120o*6 + 1/12o*4 - 3o*2 - 1/60o*5. Suppose w(s) = 0. What is s? -2, 0, 1 Let d(f) = -4f*4 - 18f*3 - 46f*2 - 48f - 22. Let v(p) = 4p4 + 17p*3 + 45p*2 + 48p + 23. Let c(l) = -7d(l) - 6v(l). Let c(n) = 0. What is n? -2, -1 Let t = 7410 - 51669/7. Let r = 29 - t. Factor -r + 2/7b + 2/7b*2 - 2/7b*3. -2(b - 1)*2(b + 1)/7 Suppose 3x = -0x. Let m(f) be the third derivative of 0f - 1/144f*4 + 1/90f5 - f2 + 1/315f7 + xf*3 + 0 - 1/120f*6 - 1/2016f*8. Factor m(p). -p(p - 1)*4/6 Let j = 5/34382 - -4606613/3953930. Let y = j - -10/23. Factor yx*2 - 2x + 2/5. 2(x - 1)(4x - 1)/5 Let k(r) be the second derivative of 0 + 1/24r*4 - 1/240r*5 - 1/6r*3 - r + 3/2r2. Let h(b) be the first derivative of k(b). Factor h(x). -(x - 2)2/4 Let x(v) = 3v2 - v - 1. Let b be x(-1). Factor -4i*2 + 4i + 1 - b + 1 + i*2. -(i - 1)(3i - 1) Let i(z) be the first derivative of -z6/7 + 4z*5/5 - 13z*4/7 + 16z*3/7 - 11z*2/7 + 4z/7 + 5. Factor i(l). -2(l - 1)4(3l - 2)/7 Let g(s) = -s2 + 2. Let r be g(0). Let b be 6/(-8) - (-88)/32. Factor -10/9d*3 - 2/9d*4 - 4/9 - rd*b - 14/9d. -2(d + 1)3(d + 2)/9 Let d(w) be the third derivative of -w8/504 - w7/105 - w6/60 - w5/90 + 19w2. Factor d(q). -2q*2(q + 1)3/3 Let x(r) be the second derivative of -r5/30 + r4/9 - r3/9 + 20r. Solve x(f) = 0 for f. 0, 1 Let l(h) be the first derivative of h2/2 - 6h + 4. Let t be l(9). What is s in 0s + 6/5s*t - 8/5s*4 + 2/5s*2 + 0 = 0? -1/4, 0, 1 Determine k so that -88k*3 - 84k*4 - 200k*2 + 48k + 115k2 + 145k*2 - 16 = 0. -1, 2/7, 2/3 Let a be (-19)/(-4) - (-9)/(-12). Factor -3/4i*a + 3/4 + 0i*2 + 3/2i*3 - 3/2i. -3(i - 1)3(i + 1)/4 Let h(d) be the first derivative of d5/105 - d4/14 + 4d3/21 - d2/2 + 2. Let z(o) be the second derivative of h(o). Factor z(r). 4(r - 2)(r - 1)/7 Let d be (2 - 4)(-939)/30. Let t be (-2)/(130/132 - 1). Factor -4/5 - 484/5l4 - 12l - tl3 - dl*2. -(2l + 1)*2(11l + 2)2/5 Let g(r) = -r3 - r2 + 5r + 2. Let f = -8 - -5. Let n be g(f). Factor 0z3 + z4 + z3 + z5 - 2zn - z2. -z*2(z - 1)*2(z + 1) Suppose -b = -0b - 5. Suppose -2d + 0d = bs - 18, 2d - 14 = -3s. Factor 2t + 2/5 + 2t*4 + 4t*s + 4t*3 + 2/5t*5. 2(t + 1)*5/5 Factor -48/17a*2 + 0 + 288/17a + 2/17a3. 2a(a - 12)2/17 Let p(j) = 5j*4 - 9j*3 + 25j2 + j. Let a(h) = h4 - 2h3 + 5h*2. Let o(y) = 33a(y) - 6p(y). Factor o(m). 3m(m - 2)(m -	{ "pile_set_name": "DM Mathematics" }
m3 + 36m3. -m3 Collect the terms in -31 - 6t2 + 15 + 17. -6t*2 + 1 Collect the terms in 220k*3 + 2 + 0 - 2. 220k*3 Collect the terms in -556c*2 + 562c*2 + 3 - 3. 6c*2 Collect the terms in -4794 - 2j*2 + 1601 + 1597 + 1596. -2j*2 Collect the terms in 30m*2 + 71m*2 - 103m*2. -2m*2 Collect the terms in 54h - 68 + 9h + 68. 63h Collect the terms in -41 - 5h2 - 10h*2 + 20 + 21. -15h*2 Collect the terms in -1 + 112b - 112b + 10b*2. 10b*2 - 1 Collect the terms in -7c*2 - 6c*2 + 15c*2. 2c*2 Collect the terms in -5 + d + d + 7 + 19. 2d + 21 Collect the terms in 2v + v - 8v + 6v. v Collect the terms in 7 - 7 - 348g*2 + 1141g*2. 793g*2 Collect the terms in -54168v + 54168v + v3. v3 Collect the terms in 7y + 3y - 3y - 2y. 5y Collect the terms in 353 - 353 - 44c. -44c Collect the terms in -16 + 16 + 4j3. 4j*3 Collect the terms in -1199f*3 + 1192f*3 - 2f*2 + 2f*2. -7f*3 Collect the terms in 10w - 4w - 5w - 6w + 2w. -3w Collect the terms in 4x3 - x3 - 7x3. -4x*3 Collect the terms in -3 + 2 + 1 + 7k. 7k Collect the terms in 261y*3 + 267y*3 - 530y*3. -2y*3 Collect the terms in 398g*2 - 4 + 4 - 199g*2 - 215g*2. -16g*2 Collect the terms in 111d*2 - 62d*2 - 51d*2. -2d*2 Collect the terms in -143h + 239h + 364h. 460h Collect the terms in -2o + 0o + o + 0o. -o Collect the terms in 38p - 102p + 59p. -5p Collect the terms in 32 + 25w + 3w - 32. 28w Collect the terms in -32 + 16 - 24h + 16. -24h Collect the terms in 9 + 4 + 5c - 13. 5c Collect the terms in -8t - 9t + 30t - 9t. 4t Collect the terms in 3u + 10 + 7 - 10 - 7. 3u Collect the terms in 0 + 20 + j3 - 20. j3 Collect the terms in -9v2 + v3 + 9v*2 - 4v*3. -3v*3 Collect the terms in 3x*2 + 2x - 2x + 0x*2 - 5x*2. -2x*2 Collect the terms in 6j*2 - 4j*2 - 3j2. -j2 Collect the terms in 22t3 + 28t*3 - 53t*3. -3t*3 Collect the terms in -3g*3 + 166g - 166g. -3g*3 Collect the terms in 14r - 14r - 3r*3. -3r*3 Collect the terms in -30l + 6l + 9l. -15l Collect the terms in 2d - d - 3d + 113d*3 + d. 113d*3 - d Collect the terms in -7j + 10j + 5j. 8j Collect the terms in -17j*2 - 18j*2 + 58j*2 - 21j*2. 2j*2 Collect the terms in 6p*3 - 8p*3 - 18p*3. -20p*3 Collect the terms in 2x2 - x2 - 6 + 6. x*2 Collect the terms in 7 + 19b*2 - 5 - 2. 19b*2 Collect the terms in 111f*3 - 32f*3 - 40f*3 - 38f3. f3 Collect the terms in 3s2 + 21s*2 - 6s*2. 18s*2 Collect the terms in 21x + 17x + 19x - 75x + 16x. -2x Collect the terms in 3k + 32k2 - k - 8k + k. 32k2 - 5k Collect the terms in -799 - 3f2 + 1588 - 789. -3f*2 Collect the terms in -247 + 247 - 3i*2. -3i*2 Collect the terms in 571 + 5w - w - 571. 4w Collect the terms in 30y*2 - 30y*2 - 17y*3. -17y*3 Collect the terms in -16p*3 + 88p - 88p. -16p*3 Collect the terms in 10t - 35t - 8t. -33t Collect the terms in -21i*2 - 936i + 936i. -21i*2 Collect the terms in -725 - 2b*2 + 1449 - 724 + 0b*2. -2b*2 Collect the terms in -872r*3 - 214r*3 - 28r*3. -1114r*3 Collect the terms in -2050a2 - a3 + 2050a2. -a3 Collect the terms in -4w*3 + 3w*2 - 2w*2 - 4w2 + w2. -4w3 - 2w*2 Collect the terms in 1 + 7 + 18n*3 - 4. 18n*3 + 4 Collect the terms in -5b + 583 - 583. -5b Collect the terms in 51v*3 - 15v*3 - 37v3. -v3 Collect the terms in 1 + 2 - q - 6q - 6. -7q - 3 Collect the terms in -578a3 + 114 - 60 + 579a3 - 54. a3 Collect the terms in 3 - 3 - 4u2 + 13u. -4u2 + 13u Collect the terms in 0f + 19f + 333f. 352f Collect the terms in -31d3 + 2d - 2d + 6d*2 + 26d*3. -5d*3 + 6d*2 Collect the terms in 3r - 10r + r + 8r. 2r Collect the terms in 14q + 9q - 20q. 3q Collect the terms in 586l*2 - 78 + 78. 586l*2 Collect the terms in 76k + 7k - 28k. 55k Collect the terms in 15n - 4 + 4. 15n Collect the terms in 2u + 2u + u. 5u Collect the terms in 14 - 2a - 12 + 13 + 8. -2a + 23 Collect the terms in 12987 - t - 12987 - t. -2t Collect the terms in 7 - 3l - 7. -3l Collect the terms in 6t - 14t3 - 6t*3 - 5t + 2t. -20t*3 + 3t Collect the terms in -9 + 11p + 17 - 8. 11p Collect the terms in -2243v2 - 2v + 2v. -2243v*2 Collect the terms in 1582n - 3134n + 1548n. -4n Collect the terms in 31i + 31i + 106 - 60i. 2i + 106 Collect the terms in 5h*2 + 2h*3 - 1 - 3h*2 - 2h*2. 2h*3 - 1 Collect the terms in -3 + 25219k*3 + 3 - 25207k*3. 12k*3 Collect the terms in -15o - 1 + 1 + 0. -15o Collect the terms in 7u + 8 + 10 - 18. 7u Collect the terms in -5h*2 + 48h + 53h - 101h. -5h2 Collect the terms in 0s + 13s - 8s + 0s. 5s Collect the terms in -315849u + 157923u + 157928u. 2u Collect the terms in -47n + 24n - 123n3 + 23n. -123n3 Collect the terms in 3 - 4r + 2r + 54 + r. -r + 57 Collect the terms in 125r*2 + 72r*2 + 32r*2. 229r*2 Collect the terms in -3s*3 + 12s*3 - 7s*3. 2s*3 Collect the terms in -77 + 39 + 38 - 21p. -21p Collect the terms in -33 - 2d*2 + 353 - 280 + 0d*2 - 40. -2d*2 Collect the terms in -f - 317 + 158 + 159. -f Collect the terms in 9 - 5 - 4 - 2g. -2g Collect the terms in 191 + 172 - 538 + 4x + 175. 4x Collect the terms in -2968 + 9m + 2968. 9m Collect the terms in 2l*2 - 5l*2 - 3l*2 - 13l*2. -19l*2 Collect the terms in -55d*2 + 26d*2 + 24d*2 + 18d*2. 13d*2 Collect the terms in -3w*3 - 3w*3 + 12w*3. 6w3 Collect the terms in -h2 + 5h2 + 0 + 11. 4h*2 + 11 Collect the terms in 9j*2 - 4j - 12j2 + 4j. -3j2 Collect the terms in -7t*2 + 7t*2 + 3t*3 - 4t3. -t3 Collect the terms in -10m + 545 - 1090 + 545. -10m Collect the terms in 76a3 - 135a*3 + 54a*3. -5a*3 Collect the terms in -8z - 5z + 3z. -10z Collect the terms in -18x*2 + 8x*2 + 13x*2 + 17. 3x*2 + 17 Collect the terms in -1422g + 477g + 471g + 472g. -2g Collect the terms in -4f - 26 + 1 + 25. -4f Collect the terms in 3y + 3y - 2y2 + 0y. -2y2 + 6y Collect the terms in 225b2 - 471b*2 + 245b2. -b2 Collect the terms in 642 - 642 - n2. -n2 Collect the terms in -69l3 + 42l*3 + 2 - 2. -27l*3 Collect the terms in -4808f + 0 + 0 + 4877f. 69f Collect the terms in -6133 + 6133 - 5j2. -5j2 Collect the terms in -s3 + 3s3 + 3s3 + s3. 6s3 Collect the terms in -228k - 231k + 457k. -2k Collect the terms in -440 + 440 - 7m*3 + 6m3. -m3 Collect the terms in 7366 + 8u - 3687 - 3679. 8u Collect the terms in 0v3 - 445v + 445v + 2v*3. 2v*3 Collect the terms in 7f*2 - 6f*2 + 11f*2 + 2f*2. 14f*2 Collect the terms in -3w*3 - 14w*3 + 28w*3. 11w*3 Collect the terms in 0x3 - 35 - 29 + x3. x*3 - 64 Collect the terms in 9558a*3 - 4781a*3 - 4779a*3. -2a*3 Collect the terms in 125l + 117l + 4l*2 - 242l. 4l2 Collect the terms in -48416 + 3l*3 + 48416. 3l*3 Collect the terms in -22d*2 + 52d*2 - 41d*2. -11d*2 Collect the terms in -11z*2 - 13z*2 + 24z*2 - 12z*3. -12z*3 Collect the terms in 4u*3 - 2u*3 + 5u*3 - 3u*3. 4u*3 Collect the terms in -9p - 6 + 9p + 2p2 - p2. p*2 - 6 Collect the terms in 65r - 43r - 28 + 28 - 20r. 2r Collect the terms in -8b*3 + 10b*3 + 4b*3. 6b*3 Collect the terms in 219 - 219 - 6p. -6p Collect the terms in 4q*2 - 26q*2 + 23q2. q2 Collect the terms in 127s2 - 127s*2 - 9s*3. -9s*3 Collect the terms in 14b*2 + 2262b - 2262b. 14b*2 Collect the terms in -13x*3 - 7x*3 - 15x*3 - 12x*3 + 45x*3. -2x3 Collect the terms in -1 - 4 + 5 + c2 - 48c. c2 - 48c Collect the terms in 3d2 + 102d*3 - 80d*3 - 3d*2. 22d*3 Collect the terms in -6c*2 + 4c*2 - 2c*2 - 5c*2. -9c2 Collect the terms in 2353 - t2 - 11t2 - 2353. -12t*2 Collect the terms in 1 + 123a - 1. 123a Collect the terms in -9y3 - y2 + 7y3 - 72y + y*2. -2y*3 - 72y Collect the terms in 100p - 5p*3 - 100p. -5p3 Collect the terms in 0u + 4u + 3u +	{ "pile_set_name": "DM Mathematics" }
10. Let u be ((-12)/5)/(-4)-15. Give k(u). 1 Suppose -5a - 83 = -5b - 4a, -4a - 77 = -5b. Let d(x) = -2x2 + 4 + 12 - b + 2x. Give d(1). -1 Suppose 14 = -2g + 4k, -3g - 23 = 2g - 4k. Let y(a) = 3 - 5a - 2a2 - a2 - a3 + 3a. Give y(g). 9 Let h(a) be the third derivative of -1/24a4 - 5/6a*3 + 0a - 1/60a5 - 2a*2 + 0. Calculate h(0). -5 Let n = -11 + 16. Let i(c) = -5 + 12 + 4c2 - c3 + 0c - 8c + 2c2. Give i(n). -8 Let m be (-3)/(-27)6/8. Let w(z) be the second derivative of 2z + mz*4 - 5/6z3 + z2 + 0. Calculate w(3). -4 Let p = 14 - 18. Let c(u) = -u*3 - 4u*2 - 2u - 5. Calculate c(p). 3 Let w(b) = -b3 - b2 + 1. Let r(i) = 2i3 + 3i*2 + i - 3. Let o(q) = -r(q) - 3w(q). Let g be o(-2). Let h(j) = j*3 + 5j*2 - 8j - 2. What is h(g)? 10 Let a(u) = -u*2 + 9u + 2. Let i be a(9). Let o = 3 - 1. Let v(p) = p + 0p - ip2 + po. What is v(3)? -6 Let b(q) = -q + q*3 + 39 - 7q*2 + 3q*2 - 42 - 4q. Calculate b(5). -3 Let u(w) = w*3 - 16w*2 + 15w + 2. Let f be u(15). Let g(r) = fr + 5 + 0 - 4. What is g(2)? 5 Let w be -3 - ((-4 - 1) + 1). Let f(a) = -2 + 0 - 3a2 + 3 - a. Calculate f(w). -3 Let q(s) = -s3 + 2s + 4. Let c be q(2). Let w(y) = -y. Give w(c). 0 Let a(u) = -u3 + 5u*2 - u + 3. Let n = -8 + 8. Suppose n = -4j + 9j - 25. What is a(j)? -2 Let a(l) be the first derivative of -5l3/3 - l2/2 - 2l + 20. Calculate a(2). -24 Let j(s) be the second derivative of s5/60 - s4/12 + s3/6 - 3s*2/2 - s. Let b(i) be the first derivative of j(i). Determine b(2). 1 Suppose -1 = 2z - 3z. Let b(n) = -n2 + n - 1. Let c(k) = 8k*3 + 6k*2 - 4k + 7. Let i(u) = zc(u) + 6b(u). Determine i(-1). -9 Let u(f) be the first derivative of f*2 - 1 + 1/60f*5 - 1/3f*3 + 5/24f*4 + 0f. Let k(m) be the second derivative of u(m). Determine k(-4). -6 Let y be (4 - 7)(-1)/3. Let s be 4/(-6)6y. Let k(h) = 1 - 3 - h2 - 3 - 3h. Calculate k(s). -9 Let k(u) = 0 + 0 + 0 + u*2 - 11u - 3. Determine k(10). -13 Let j(p) = -1 + 13p - 2p*3 + 3p*2 - 17p + p*3. Calculate j(3). -13 Let u be 17/5 + (-6)/15. Let j = 0 + 3. Let q(b) = 3b*3 - 2b*j + 3b - 2b2 - b2 - 4. Determine q(u). 5 Suppose 2p - 3p + 33 = 0. Suppose 5h + 13 - p = 0. Let v(y) = 2y - 4 - 6y*3 + 4y*3 + hy2 - y2 + y*3. Give v(3). 2 Suppose 0v - 2y + 26 = v, 5y = 25. Suppose 2s - 4k = v, 5s - k - 25 = -3. Let a(z) = -z2 + 4z - 2. Calculate a(s). -2 Let i = 11 - 9. Suppose y + 2x - 4 = 0, 2 = -iy - x + 7. Let d(p) = -2 + 4p2 + 4 - p2 - p2 - yp. Determine d(2). 6 Let g(j) = -5j3 - 3j*2 - 3j - 6. Let d(x) = -x*3 - x - 1. Let p(y) = 6d(y) - g(y). Give p(3). -9 Let m(x) = -x3 + x2 - 2. Suppose 0 = -0s + s. Give m(s). -2 Let p(m) be the second derivative of -m5/20 + m4/3 + m3/6 + m2/2 + m. Let b be 34/6 + 1/3. Let k be (-6)/(1/((-4)/b)). Determine p(k). 5 Let x(z) = -2z*2 + z - 1. Let j = 0 + -9. Let s = 10 + j. Determine x(s). -2 Let n = -1 - -3. Suppose 3q - 44 = -n. Let j = q - 9. Let l(c) = c*3 - 5c*2 - 2c + 7. Calculate l(j). -3 Let d(h) be the second derivative of h*5/20 + 5h4/12 + h3/2 - 2h2 - 28h. Determine d(-3). 5 Let u = 78 + -69. Let z(v) = v - 12. Give z(u). -3 Let f(g) = g*3 - 3g + 1. Let w(o) = -o + 9. Let d = -6 + 13. Let z be w(d). Give f(z). 3 Suppose g + 5x = 22, g - 5x = -2g - 14. Let n(i) = -3i - 2 - g + 6i2 + 0i2 - i3 + 0i. Calculate n(5). 6 Let g be -3 + (-99)/(0 + -3). Suppose 2n - h + g = -n, 5n = -h - 50. Let z be (n/(-25))/(1/(-10)). Let o(f) = -f3 - 3f*2 + 5f + 2. What is o(z)? -2 Let q(v) = 6v + 3. Let a be q(-2). Let s = -5 - a. Let t(w) = -w2 + 3w + 5. Calculate t(s). 1 Let v be 0/((-1)/((-2)/2)). Let c = -6 - -8. Let o(u) = -u - cu + vu. Calculate o(1). -3 Let w(p) = -p*2 + 6p - 6. Suppose 6 = -2f + 3s, 3f + 0s = -s + 13. Suppose -5h + 6j = 7j - 28, -2h + 19 = fj. What is w(h)? -1 Let s(b) = -b - 5. Let a be s(-5). Let m(z) = 0z - z - 1 - 4 + 0. What is m(a)? -5 Let q(s) be the third derivative of 3s2 - 1/6s*3 + 0 - 1/60s*6 + 0s*4 + 0s + 0s5. Suppose 4x + 4o = -4, 2x + 8 = -0x - 5o. Calculate q(x). -3 Let q be (-4)/(-3)3/2. Suppose -a = a + 3c + 9, -6 = -2a + qc. Let u(x) = x - 6. Determine u(a). -6 Let y = -1 + 8. Let r(k) = -k + 10. Let v(f) = -3f + 21. Let d(i) = yr(i) - 3v(i). What is d(-6)? -5 Let z(g) = -g3 - 4g*2 - 4g. Let o = -44 + 41. What is z(o)? 3 Let t(a) = -a3 - a2 - a + 4. Let x be t(0). Suppose -xd + 5 - 13 = 0. Let u = -1 + d. Let p(o) = -o3 - 4o*2 - 2o - 2. Determine p(u). -5 Let n(x) = 11x2 + 23x - 20. Let r(w) = -7w2 - 15w + 13. Let j(z) = 5n(z) + 8r(z). Determine j(-4). 8 Let z(x) = 5x - x2 - 3 + 9 - x. Calculate z(5). 1 Let r(m) = m + 7. Let v = 13 + -8. Suppose -4n - v = -3n. What is r(n)? 2 Let i be (-12)/9(-3)/2. Let w(y) = 2y2 + 0y*2 + 2y - y*i - 3y + 8. What is w(0)? 8 Let u(z) = -z*2 - 3z + 3. Let y(f) = -2f2 - 7f + 5. Let t(g) = -5u(g) + 3y(g). Give t(-5). 5 Suppose -1 + 6 = s. Let d(f) = 2 - 1 + s - 2f + 0. Give d(5). -4 Let w(m) = 4m*2 + 2m - 1. Suppose -2y = -y - 1. What is w(y)? 5 Let s = -3 + 5. Let x be s + (1 - 4) + -4. Let z = -7 - x. Let d(q) = q2 + 4q + 2. Give d(z). -2 Let x be (-2)/(-3)3 + 0. Let y(i) be the second derivative of -i5/20 + i4/6 - i3/3 + i2 - 2i. Calculate y(x). -2 Let j be (-2)/(-7) - (-88)/(-14). Let f(y) = -y*3 + 10 - 6y2 - y2 - 16 - 6y. What is f(j)? -6 Let q(k) be the second derivative of k4/12 - k3/2 + 3k*2/2 + 15k. What is q(3)? 3 Let h(n) = n + 2. Suppose 7 = k + 5. What is h(k)? 4 Suppose -2j = -4o + 6, 0 = -2j + 4o - 5o - 16. Let q = 3 + j. Let p(c) = 5c + 1. Let a(n) = -3n - 1. Let u(z) = 11a(z) + 6p(z). Determine u(q). 7 Let c(y) = y2 - 15y - 13. Let q be c(16). Let j(d) = d*3 - 3d*2 - d + 2. Give j(q). -1 Let h(p) = 3p*3 - 2p*2 - 4p - 5. Let u(d) = -7d3 + 5d*2 + 9d + 11. Let a(o) = -9h(o) - 4u(o). Suppose -2l = -19 + 15. Determine a(l). 1 Suppose -2o + r = -5, -2r = -4r + 6. Suppose 4q = -2v - o, -q - v + 4 = 2v. Let z(d) = -d3 - 2d - 3. Give z(q). 9 Let o(k) = 3k2 - 3k + 1. Let d be o(2). Let y(i) = -4i + 12. Let a(t) = -11t + 35. Let b(x) = -3a(x) + 8y(x). Determine b(d). -2 Let r = -5 + 8. Suppose rf - f = -5m + 4, 4f = -4m + 8. Let u(o) = -o - 6. Calculate u(m). -6 Let u(h) = -13h + 37h - 19h. What is u(1)? 5 Let p be 22/4 + (-2)/4. Suppose 0 = pi - 7 - 8. Let j(n) = -3n - n3 + n2 + n + in - 14 + 5. Determine j(0). -9 Let i(f) = f + 8. Let b be i(-14). Let z(y) = -y*3 - 7y*2 - 9y - 5. What is z(b)? 13 Suppose 4f - 14 = -2o, -o - 4 = -f + 4. Let u = 2 - f. Let m(w) = -3 - 1 + 12w - 13w. Give m(u). -1 Let w(m) = -m - 2. Let g be w(-3). Let v(n) = -4n3 - 20n2. Let z(o) = o2. Let d(j) = v(j) + 20z(j). What is d(g)? -4 Let v(n) = n3 - 3n*2 - 2n - 3. Let q(d) = d*2 + 2d - 4. Let b be q(-4). What is v(b)? 5 Let r(z) = -z - 1. Let n(g) = 1. Let s(u) = -5n(u) - r(u). Let a = 1 + 13. Let y = a + -8. What is s(y)? 2 Let r(a) = -4a - 5a2 + 4a*2 + 1 - 6. Let n be (-3 - -1)/((-6)/(-12)). Determine r(n). -5 Let k(t) = -20t - 2. Let q be k(-1). Suppose y = -2j + 7j + 26, 4j = -2y - q. Let w(l) = -l*2 - 3l + 5. What is w(j)? -5 Let a(d) = 2d + 4. Let j(h) = h3 - 5h*2 - 15h + 3. Let s be j(7). Determine a(s). -4 Let s = -1 - 4. Let r(m) = -4m2 - 13. Let g(v) = 5v*2 + v + 14. Let h(y) = 6g(y) + 7r(y). Determine h(s). 13 Let u(j) = 4j*2 - j. Let k(x) = 4x*2 - x. Let v(c) = -3k(c) + 4u(c). Let q be -6(-1)/122. Calculate v(q). 3 Suppose -2p + p - 3 = -a, 2p + 10 = 3a. Let o(l) = 4l2 - l + 1. Let v be o(1). Let u(d) = -5d - 9d3 - 2 + 3 + 6d*2 + 8d*3 - v. Determine u(a). 9 Let n = 6 - 3. Let i(y) = -2. Let p(d) = -2d - 16. Let l(q) = -6i(q) + p(q). Determine l(n). -10 Suppose -3t = 3v - v - 11, -3t + 1 = 4v. Let r(a) = a3 - 8a*2 + 7a - 10. Give r(t). -10 Suppose -5q + 12a + 41 = 8a, 12 = 4q + 2a. Let f(u) = -u3 + 5u*2 - 6. What is f(q)? -6 Let f = 2 - 1. Let r(g) = -3g - 2g2 - f + g2 - g. Calculate r(-3). 2 Let n(l) = -l. Suppose 6 = -3v + 39. Let d = v	{ "pile_set_name": "DM Mathematics" }
et v be (-102)/(-4) - (-4)/(-8). Let o(d) = d*2 + 22d - 133. Suppose 67 = 4u + 55, -4s + 17 = -u. Let k be o(s). Solve -kh - v = 3h for h. -5 Suppose -53g - 42g = 42g - 5206. Solve gj + 5j + 129 = 0 for j. -3 Suppose 0 = 3w + 2q + 35 - 1, -5w - 3q = 56. Let y be (-104)/(-18) + 920/90 + w. Solve 2f - yf = -16 for f. 4 Suppose 15m + 170 = -24 + 1094. Solve -6 - m = 22l for l. -3 Let q be (-204)/4 - (2 - -1). Let x be ((-4)/(-6))/((-6)/q). Suppose 2z - xz = -68. Solve -1 + z = -4a for a. -4 Suppose -572 = 2j - 2h, 4j + 5h = -703 - 405. Let c = 282 + j. Solve -2q + c + 8 = 0 for q. 4 Let u = -33 - -54. Let c = u - -4. Suppose 30 = p + c. Solve 5l = p - 0 for l. 1 Let y = 4476 + -4458. Solve 5i + 91 = yi for i. 7 Let q be -4 + 11 + -7 + 12. Let z be (-6 - 264/(-32))q. Solve -4l = 5l + z for l. -3 Let d(a) = 17 + a2 - 9a + 6a + 0a*2 - 9a. Let v be d(12). Solve -3o = -5 + v for o. -4 Let f be -3 - ((-99)/(-22) - 3)/(1/(-2)). Solve 55o + 7 + 103 = f for o. -2 Let x(m) = -m*3 + 13m*2 - 24m + 16. Let q be x(11). Let c be (-2 - -2)/(10/((-30)/q)). Solve 0k - k + 4 = c for k. 4 Suppose -13x + 740 = -352. Let w = x + -92. Let b be (-3)/(w/(112/6)). Solve -9n + bn - 2 = 0 for n. -1 Let z be ((-42)/49)/((-14)/980). Solve zu - 67u + 7 = 0 for u. 1 Suppose -90 = -i - 100. Let y(d) = 4d + 44. Let t be y(i). Solve -t + 10 = 2b for b. 3 Let b(y) = y*2 - 26y + 163. Let f be b(9). Solve s = -fs + 16s for s. 0 Suppose 0 = -7j - 4k + 455, -23 = -2j - k + 106. Solve -6a - j + 73 = 0 for a. 2 Suppose 4 = -4w + 6w. Suppose -20 = 6n - 38. Suppose -ng + 5p + 30 = 0, -4p - 1 - 1 = 2g. Solve 12 = -gd + w for d. -2 Let f = -30740 - -30745. Suppose 2r + r - 4a + 20 = 0, 5a = -20. Let h be (-1)/4 + (-27)/r. Solve 0 = hp - fp - 12 for p. -4 Let g(l) = 2l*2 - 34l - 464. Let t be g(26). Solve 21o + 25 = -to for o. -1 Suppose -2f + 15 = 7. Let r(q) = 39q + 39. Let i be r(-1). Solve i = -6b + 8 + f for b. 2 Let x(w) = 169w - 768. Let q be x(10). Solve -925 = g - q for g. -3 Suppose -11k = -100 - 593. Suppose kt - 68t = -40. Let j be t - (12/10)/(9/(-30)). Solve -6x + j = -2x for x. 3 Let b be 2(272/5 + 13/130). Solve -18j - 37 = -b for j. 4 Let d(g) = -g3 + 35g + 64. Let z be d(-2). Solve -zc = 169 - 165 for c. -2 Let b(d) = -4d*2 - d - 1. Let i be b(-1). Let l(k) = -29k - 96. Let x be l(i). Solve 0 = 8y - 13y + x for y. 4 Suppose -3u + 466 = -83. Suppose -7j + 4j - u = 0. Let o = 65 + j. Solve on + 2 = 5n for n. 2 Let g(l) = -l3 + 22l*2 - 136l + 277. Let v be g(5). Let q(u) = 8u + 1. Let t be q(3). Solve -vf + 3 = -tf for f. -1 Suppose 34w - 38w + 1216 = 0. Suppose 0 = -7o - 9o + w. Solve og - 8 = 15g for g. 2 Let v(p) = 3p3 + p2 + 3p - 1. Let k be v(1). Let r be (48/8 - k) + 0. Solve -9q + 7q - 6 = r for q. -3 Suppose 5x = -2g + 917, -x - 36 = -5x. Solve -gu = -462u for u. 0 Let u(a) = -2a3 - a2 + 6a + 7. Let b be u(-4). Let y be (114/b)/(2 - 34/20). Solve 0 = -3l - 10 + y for l. -2 Let n = -16177 + 16216. Solve 278 + 34 = nf for f. 8 Let c(w) = 17w + 123. Let x = -416 - -409. Let y be c(x). Solve 0 = -z + y - 0 for z. 4 Let r = 3562 - 3527. Solve 0 = 1185s - 1180s + r for s. -7 Suppose p = m - 177, -3p + 5p - 2 = 0. Suppose m = 26z - 30. Solve 0 = -4b - 0b - z for b. -2 Let o = 3431 + -3425. Solve -4r + or = -3r for r. 0 Suppose 2i + 3n - 9 - 16 = 0, -4n = 5i - 52. Suppose 0 = p - it + 5t - 5, p - t = 7. Solve b - p = -6 for b. 2 Let l be (-12)/(0 - -2) - (304/(-16) + 13). Solve l = 19g - 588 + 455 for g. 7 Let z be (-1)/(1 - 16/8). Suppose 0 = 6j - 3j - 15. Suppose 0 = -0s + js - 120. Solve 5a = z + s for a. 5 Let i = -151112 + 151116. Suppose 3k = -0k. Solve iz = -kz for z. 0 Let x be 120/(-200) - (3/(-12) - 14/40). Suppose 2 = -l + 8. Suppose 0 = lw - 5w - 10. Solve 2s + 0s + w = x for s. -5 Suppose -3p + 224 = -106. Suppose -3j = 2j - p. Let i(g) = -2g2 + 4g + 10. Let x be i(3). Solve xo = 6 - j for o. -4 Suppose -8h = 3h + 583. Let w = h - -91. Let q = -38 + w. Solve q = 5b - b for b. 0 Let h(o) = o*3 - 19o*2 + 24o - 45. Let v be h(18). Suppose 9 = -6r + v. Suppose -ra + 10 = -4a. Solve -al - 3l = 0 for l. 0 Suppose 5d = 122 - 97. Suppose -65 = -dn + 15. Solve -t = -5t + n for t. 4 Let x be (-6)/1266 - (-11470)/14. Let c = x + -814. Solve -2w + c = 11 for w. -3 Let g(m) = 4m2 - 3m + 3. Suppose i + 8 = 5v, 2v + 3i - 14 = -2i. Let c be g(v). Let w be ((-2)/4)/(((-78)/108)/c). Solve 2b + 1 = -w for b. -5 Let u be (-214008)/(-7712) + 31/(-4). Let m(t) = 4t - 5. Let n be m(8). Solve ni - 7 = ui for i. 1 Let q(s) = -2s2 + 46s + 51. Suppose 26 = -17z + 4z. Let c be (z - (2 + -4)) + 24. Let v be q(c). Solve 7 + v = 2p for p. 5 Suppose 9 + 15 = 5u - 4r, -3u - 5r = -44. Suppose 2i - ui - 36 = 0. Let x be 29/6 + (0 - 1)/i. Solve 0m = -xm - 20 for m. -4 Suppose 13n + 9917 - 9982 = 0. Solve -no + 67 = 77 for o. -2 Let l be (-40)/(-35)(-315)/(-90). Solve 762 = -lc + 794 for c. 8 Let p(m) = -m3 + 28m*2 - 8m - 41. Let a be p(28). Let y = a - -268. Solve -5v + 2 + y = 0 for v. 1 Suppose 5 - 2 = y. Let t = 253 + -227. Suppose -4v - 10 = -t. Solve ys = vs for s. 0 Let g = -10 + 168. Let v = g - 151. Solve 6p = vp + 1 for p. -1 Suppose -t + 11 = -3a + 121, 2t = -a + 39. Suppose a = 5k - 198. Let r = -37 + k. Solve -2c - 3c + r = 0 for c. 2 Suppose 5l = -2q + 5, q + l + 135 = 142. Solve qv - 7v = 12 for v. 4 Suppose 7761 = -5d - 4v - 2328, -5v + 20 = 0. Let x be (-2)/(-3) - d/141. Solve -5b = -0b - x for b. 3 Let f(n) = -4n. Let d(o) = -18o + 57. Let l(y) = d(y) - 5f(y). Let c be l(-27). Solve -3b + 3 = c for b. 0 Suppose 137g = 32g + 839 + 6826. Solve g - 49 = -12u for u. -2 Let u(c) = c2 + c - 170. Let r be u(-14). Solve rm + 15 = -21 for m. -3 Let c = 3762 - 3762. Let q be (2/(6/9))/1. Suppose -4x + x = 3r - 36, qx - 26 = 2r. Solve c = 5p + 15 + x for p. -5 Let f(j) = -j3 - 2j*2 - 2j - 3. Let p be f(-2). Let v(z) = p + 14 + 6 + 0 - z. Let h be v(0). Solve 0 = 4d - 9 + h for d. -3 Suppose -162f - 1352 = -170f. Solve 16v = -265 + f for v. -6 Suppose 4q - 3f = 45, -2q + 7 = 4f - 21. Let w be (-108)/198 + q/22. Solve w = -5z - 0z for z. 0 Suppose -q + 2z = 10, q = -2q + 2z - 10. Let w = -29102 - -29104. Solve q = h + wh + 15 for h. -5 Suppose 78z - 5308 = 2960. Solve 0 = 101k - zk - 25 for k. -5 Let p = 1 + 1. Suppose 48c + 173 + 115 = 0. Let o be c/(-15) - 56/35-1. Solve oa - 12 = -p for a. 5 Let c(v) = v + 5v2 + 223 - 211 + v3 - 2v*2 + 9v*2. Let l be c(-12). Solve 3x + lx + 12 = 0 for x. -4 Suppose v = 5f - 39, 3f + 8v - 4v = 28. Let k = f - 22. Let y be (-33)/22 + k/(-4) + 1. Solve 4 = yw - 4w for w. -4 Suppose 5v = -5b - 8 + 18, 162 = 41b + v. Let t = -1 + 2. Solve -t = bp - 3p for p. -1 Let j(z) = z*3 - 68z*2 + 63z + 287. Let x be j(67). Solve x = n + 19 for n. 0 Let r be ((-8)/10)/(-2) + 356/(-890). Suppose r = -7w + 2w + 2w. Solve w - 1 = f for f. -1 Suppose -h = -5r - 34, 4h - 2r - 60 = -r. Suppose 0 = -o - o + h. Let b be 7 + (-41)/5 + 830/25. Solve -5l - b = -o for l. -5 Suppose -g - 757 = -3f, -8g - 1005 = -4f - 11g. Solve -7k - f = 35k for k. -6 Let w be ((-11)/(-462)35)/((-1)/(-6)). Solve f = f + wf for f. 0 Let h be (-1)/(-1)6/(-9)(260 - 593). Solve 3f = -h + 225 for f. 1 Let g be ((-36)/90)/(76/(-25) - -3). Solve ga = -19a - 29 for a. -1 Let k = -11 - -26. Suppose -5b + 15 = 3r, b + 0b + 3r + 9 = 0. Let w be ((-4)/(-3))/(4/b). Solve j - k = -wj for j. 5 Let p = 9 - 2. Suppose 27l - 24l = -5o + 21, -5l + 35 = 0. Solve pd + 2d - 9 = o for d. 1 Let w(r) = 35r*2 + 2r + 2. Let v be w(-2). Let t(m) = -32m + 991. Let l be t(27). Let h = v - l. Solve h = -3p + 2 for p. -3 Let m = -615 - -621. Solve 25o - 22o = -m for o. -2 Suppose 3j + 2s - 4s = 2, 5 = -5s. Solve j = -v + 11 - 13 for v. -2 Let m(o) = -70o - 742. Let y be m(-11). Solve 0 = yb - 6b for b. 0 Let n = -42 + 44. Suppose r + 4 = 5r. Suppose -4h = -11d + 16d - 15, d + 4h - 3 = 0. Solve -n - r = -df for f. 1 Suppose -15o + 13o = -3d + 10, 0 = -d + 2*o + 10. Sup	{ "pile_set_name": "DM Mathematics" }
a*3 + 12a + 19360 What is the second derivative of 1707d2i*3 + 6946d*2i + d*2 + 1644di5 - 69d wrt i? 10242d2i + 32880di*3 Differentiate 151g*2 + 658975g + 171051850. 302g + 658975 What is the second derivative of 11bdx*2y + 65bx*2 + 9bxy - 25bx + 428dx*2y - dxy + 8dy - 31y wrt x? 22bdy + 130b + 856dy What is the derivative of 3875002v + 23913239 wrt v? 3875002 What is the third derivative of 980716093k3 + 582009464k*2? 5884296558 Differentiate -158l*3v - 6672575l3 + 44154lv3 + 1 wrt v. -158l*3 + 132462lv2 What is the derivative of 227377190f - 182165034? 227377190 What is the third derivative of 16883107c3 - 21412711c*2? 101298642 Differentiate -33294696d*2r2 - d2r - 199975d*2 - d + 18 with respect to r. -66589392d*2r - d*2 Differentiate 651544r*4 - 13r*2 + 55520345 with respect to r. 2606176r*3 - 26r Find the second derivative of 71649262q4 - 2q + 2609947. 859791144q2 Differentiate 27kv3 - 39439kv2 + kv + k - 28254v3 - v2 - 4v - 20 with respect to k. 27v3 - 39439v*2 + v + 1 What is the derivative of 2d*2fv - d2 + 91dfv + 1106423df + 2284v wrt v? 2d*2f + 91df + 2284 Find the third derivative of 105754397v4 + 21v*2 + 9349v + 3 wrt v. 2538105528v Find the third derivative of -16777690iy3 - 60990968iy - y3 + 4y*2 wrt y. -100666140i - 6 What is the derivative of -163629822fj + 6907778f + 6 wrt j? -163629822f What is the first derivative of 388266790nw*2 - 296713w*2 - 115 wrt n? 388266790w*2 What is the first derivative of -118131752h*3m - 104325011h3 wrt m? -118131752h*3 What is the second derivative of 532f*5 + 70787f*3 - 38865595f wrt f? 10640f3 + 424722f Find the third derivative of -105885136r3 - 272455861r*2 wrt r. -635310816 Find the second derivative of -58b*4 + 911b*3 - 14b*2 - 365b + 1844. -696b2 + 5466b - 28 What is the derivative of -224503i3 + 7i*2 - 93136342 wrt i? -673509i*2 + 14i What is the second derivative of 2d5 + 54d*3 - 73033d*2 - 1213909d wrt d? 40d3 + 324d - 146066 Find the first derivative of -693232b3d*2 + 59bd2 - 200641849d*2 wrt b. -2079696b*2d*2 + 59d*2 Find the second derivative of 109515t*3 + 202t*2 + 26637816t wrt t. 657090t + 404 What is the first derivative of -9881482j*2 + j - 1288123531 wrt j? -19762964j + 1 What is the second derivative of 85g3 + 416409g*2 + g - 17428075? 510g + 832818 What is the second derivative of -2576349h2 - 68657h + 16 wrt h? -5152698 Find the first derivative of -2887887n + 69854. -2887887 What is the first derivative of -3580b*3cd + 2b*3cz - 5b*3c + 26b3z - 105b3 + 143bcdz - 2bc + bdz + b - 3z wrt d? -3580b3c + 143bcz + bz Differentiate -1250311jn + 4j - 31595n - 2005 with respect to j. -1250311n + 4 Find the second derivative of -30576294d*2 + 660d + 593 wrt d. -61152588 What is the second derivative of 7179n5 - 64n*3 + 4n*2 + 353460518n wrt n? 143580n3 - 384n + 8 What is the third derivative of -27d4 - 711123d*3 + 10d*2 + 14d + 20193 wrt d? -648d - 4266738 Find the third derivative of -241236102b*4 - 17b*2 + 265119b + 2 wrt b. -5789666448b Find the second derivative of -2759518c*4 - 11c*3 + 2545296c + 10 wrt c. -33114216c2 - 66c Find the second derivative of -78u4 + 123088u*3 - 22067339u + 1 wrt u. -936u2 + 738528u What is the second derivative of -12217p3 - 9505p*2 + 6p + 24011607 wrt p? -73302p - 19010 What is the third derivative of -712243015m*5 + 389m*2 + 2m + 246593? -42734580900m2 Differentiate 3sz2 + 4sz + 14007300s + 184335z2 + 2 wrt z. 6sz + 4s + 368670z What is the first derivative of -122521k*2q2 - k2 + 321kq*2 - 20218186k wrt q? -245042k2q + 642kq What is the third derivative of 298436u5 + 2u*4 - 6u*3 + 1661319u*2 - 1? 17906160u*2 + 48u - 36 What is the first derivative of -174500443d - 92341776? -174500443 What is the second derivative of 650760895w*2z*2 + 3w*2 + 78wz + 251092w + z + 1 wrt z? 1301521790w2 What is the second derivative of 76253125f*2 + f - 46745050? 152506250 Differentiate 8k*3 - 24k*2 - 287k + 9459458 wrt k. 24k2 - 48k - 287 Find the third derivative of 1408756816ag*6y*2 + 301606890ay - g2y*2 + gy*2 wrt g. 169050817920ag3y*2 Find the third derivative of 177329129m*3o - 237m2o + 2mo + 2m - 53942 wrt m. 1063974774o What is the third derivative of 852738b5 - 10b*3 - 17604222b*2 wrt b? 51164280b*2 - 60 What is the first derivative of -670391q*3w - q*3 + 12157q*2 - 11q wrt w? -670391q3 What is the second derivative of -3110839q*2x*2z*3 + 174q*2xz3 - 111q*2x - q*2z*3 + 2q*2z*2 - 23xz2 wrt x? -6221678q*2z*3 Find the second derivative of -51447av2y - 2avy2 - 10424avy + 3ay*3 - 8v*2y*3 + 2vy3 - 3vy2 wrt v. -102894ay - 16y*3 What is the first derivative of -241199439h - 318705422? -241199439 What is the second derivative of 2n3z - 243n3 - 641n*2z + 10n2 + 49nz + 2n - 243704z wrt n? 12nz - 1458n - 1282z + 20 What is the second derivative of -21u*5 + 161349u*3 + 10622u + 8523 wrt u? -420u3 + 968094u What is the first derivative of g*3st + 10188869gst*2 - 13st2 + 348597st wrt g? 3g*2st + 10188869st2 What is the third derivative of 127m*3n*2 + 8m*3nr + 102m*3r + m*3 + 2m*2nr - 7m*2r + 307mn*2r + 4mnr wrt m? 762n*2 + 48nr + 612r + 6 Differentiate 185952j3k*2 - 31jk2 + 4297773k*2 with respect to j. 557856j*2k*2 - 31k*2 What is the first derivative of 580o*4 + 324o*3 - 3o*2 - o + 44406330? 2320o*3 + 972o*2 - 6o - 1 Find the first derivative of 8619756b + 56301817. 8619756 Differentiate -13j*3 - 715354j*2 + 2j + 178239449 with respect to j. -39j2 - 1430708j + 2 What is the derivative of 8718625o2w*2 + 1249947o*2 wrt w? 17437250o*2w Differentiate -14c3 - 34013c*2 + 15c - 2265545. -42c2 - 68026c + 15 What is the second derivative of 112722063l5 - 137l - 20592 wrt l? 2254441260l3 Differentiate 12j*4s - 387086j3s - 4168s + 408 with respect to j. 48j*3s - 1161258j2s What is the third derivative of 45g5 - 210442g*4 + 229g*2 + 98g + 45? 2700g2 - 5050608g What is the second derivative of -132175744j3 - 2j*2 + 38109j - 10899 wrt j? -793054464j - 4 What is the second derivative of -11458640h*4 + 44h - 372534 wrt h? -137503680h2 What is the derivative of 1071564z*4 + 10521958 wrt z? 4286256z*3 Differentiate -272328772h + 355754848 with respect to h. -272328772 What is the second derivative of -15901k3p - 2k2p - 370k2 + 290kp - 34k + 2p - 41 wrt k? -95406kp - 4p - 740 What is the second derivative of -2267464d4 + 909958d? -27209568d2 Find the third derivative of 1005a*4 + 76401a*3 - 17a*2 - a - 107819. 24120a + 458406 What is the second derivative of 2o4 - 12362927o*3 + 21o*2 + 16406o - 5724 wrt o? 24o2 - 74177562o + 42 Differentiate -79o2t - 240o2 - 81o + 25779053t wrt o. -158ot - 480o - 81 What is the third derivative of 2ai*3tu + 70ai3t + 2ai*2t - 2ai*2u + 8aitu - at - 998i*3tu - 2686i*2 wrt i? 12atu + 420at - 5988tu Find the first derivative of -9l2 - 1708469l + 11566711 wrt l. -18l - 1708469 What is the second derivative of -253888883p*3y*4 + 10562p*3y - 1202p3 + py + y - 2 wrt y? -3046666596p3y*2 What is the second derivative of 1711265o*5 - 2o*3 - 27o*2 + 115832666o wrt o? 34225300o3 - 12o - 54 What is the second derivative of -4g5 + 330032g*2 - 2g - 1475306 wrt g? -80g3 + 660064 What is the third derivative of 335164g*4t + 11g4 - 2g*3t*2 - 87g*2t*2 + 2g*2 + 19gt + 20t - 3 wrt g? 8043936gt + 264g - 12t*2 Find the third derivative of -586992hx2z*2 - 2hxz*3 - 3hxz*2 - 10924x*3z3 - x3z + x2z*3 + 2xz2 wrt z. -12hx - 65544x*3 + 6x**2 Find the third derivative o	{ "pile_set_name": "DM Mathematics" }
s the common denominator of b and j? 36 Calculate the lowest common multiple of 18 and (-81)/(-1) - (74 + -65). 72 Let p(d) = d*3 - 9d*2 + 46d + 14. What is the least common multiple of p(7) and 2? 238 Let n = -1153 - -2223/2. Suppose 4u + 5x = -u + 9235, 0 = -2x. Let f = u - 14709/8. What is the common denominator of n and f? 8 Let z be 122 - 2 - (0/3 + -1). Suppose -18g = 13 - z. What is the least common multiple of g and 10? 30 Let i = -344117/20 + 17202. Find the common denominator of -127/18 and i. 180 Let i(n) = -n*2 - 81n - 572. What is the least common multiple of i(-8) and ((-4)/3)/(2/(-6))? 12 Let h = -7230 - 7082. Let u = -515321/36 - h. Find the common denominator of u and 49/36. 36 Let i be 2/(-16) + (-3490)/(-874). Let m = 3/437 + i. What is the common denominator of (-2)/(-3) - 411/198 and m? 88 Let j = 25825/14 - 1848. Let m = 2041/132 - 197/12. What is the common denominator of m and j? 154 Suppose -2s - 1080 = -12s. What is the lowest common multiple of s and 51? 1836 Suppose -182 = 15i - 19i + 3j, -51 = -i - 2j. Let v be (278/(-1))/(2/(-29)). Let o = v + -76571/19. Find the common denominator of i and o. 19 Suppose 1 + 1 = -2w - 4g, -1 = -g. Let l be 3 - (-4 + 3)w. Suppose -o + lo + 10 = 0. Calculate the smallest common multiple of 2 and o. 10 Suppose -3o = -h + 722, -h = 2h - 5o - 2154. Find the common denominator of ((-1)/(-3) - 0)/((-230)/h) and -67/30. 30 Let l = -5 + 16. What is the lowest common multiple of 30(-13)/(-858)11 and l? 55 What is the common denominator of (-3)/(-15) + 1371/(-180) and 52/(-56) - 96/16? 84 Calculate the smallest common multiple of (-13)/(26/16) + 14 and 599. 3594 Let f = -21601/6 + 3576. Let h = -48 + 3. Find the common denominator of (-156)/h(-6)/4 and f. 30 Let h = 14903 + -268367/18. Let g = 10 + 40. Find the common denominator of 14/(-10)g/32 and h. 144 Let b = 18/55 + -31/110. Find the common denominator of b and 133/30. 330 Let q(u) = 2u*2 + 7u - 8. What is the least common multiple of 10 and q(-6)? 110 Let o = -1/2629 + -249701/141966. Calculate the common denominator of -97/4 and o. 108 Let g(d) = 18d - 52. What is the lowest common multiple of 6 and g(16)? 708 Let p be (-4602)/(-14) - 6/(-21). Suppose -20x = -31 - p. Calculate the lowest common multiple of x and 14. 126 What is the common denominator of 79/156 and ((-152)/1596)/(48/161)? 936 Suppose -5d = -67 - 48. Let g be -4 - 87/(-6) - 2/(-4). Let v = d - g. Calculate the smallest common multiple of v and 36. 36 Let o be 3 + -2(-26)/(-4). Let i = o + 14. Calculate the lowest common multiple of 6 and -2 + i - (0 - 0). 6 Suppose 3d - 8 = -f, -3f + 13 = -d - d. Suppose -fp + 56 = 3n, 0 = -5n + n + 5p + 28. What is the least common multiple of n and 18? 36 Let q = -10/79 - -5819/1659. Find the common denominator of q and 97/182. 546 Suppose -n - n = 2v - 12, -3 = -5v + 4n. Suppose u = -vu + 144. What is the lowest common multiple of 3 and u? 36 What is the common denominator of 258/(-144) - 5 - -2 and 101/108? 216 Let u = 1911 + -9517/5. What is the common denominator of 21/8 and u? 40 Let v = 10 + -6. Suppose 27 = -2i + 3i - 5q, vi + 3q - 85 = 0. Calculate the smallest common multiple of 14 and i. 154 Let h = 130/59 + 905/1062. Find the common denominator of h and (-1)/(-2) - 312/2444. 846 Let a = -1368 - -1932. What is the smallest common multiple of a and 40? 5640 Suppose -z = -4v + 13 + 499, 395 = 3v + 2z. What is the least common multiple of v and 4? 516 Let u = -2240 + 2488. Calculate the smallest common multiple of 310 and u. 1240 Let u = -10683/34480 - 152/431. What is the common denominator of -69/40 and u? 80 Suppose 10m - 6m = 168. Calculate the least common multiple of 60 and m. 420 Let l be 3/(3/(-4)-2). Let m be ((-9)/6)/(l/(-4)). Let c = m - -4. What is the least common multiple of 8 and c? 56 Suppose 0 = -f + 1 + 1, -f + 26 = 4g. Calculate the least common multiple of 37 and (12/(-9) - 28/g)-1. 222 Let u be (-6)/2 + (-3 - 105) + -6. Calculate the common denominator of (u/(-40))/(6/(-5)) and -55/6. 48 Let f(w) = 0w*3 + 13w*3 - 14w*3 - 7w + 7w2 + 7. Suppose -2c + 6i - i = -15, 4i - 6 = -2c. Calculate the smallest common multiple of f(c) and 10. 110 What is the common denominator of (-6)/(-9)((-2565)/364)/15 and -32/77? 2002 Let a = -745/4 - -171. Let y = -3993027/58 + 68847. Find the common denominator of y and a. 116 Let l = -17417/1266 - 16/211. Calculate the common denominator of 43/598 and l. 1794 Let y = 51 - 48. Suppose 0 = yf + 3, 2h - f - 17 = -2f. Let v = 0 - -5. Calculate the least common multiple of v and h. 45 Let p(m) = 4m - 10. Let g be p(9). Suppose 4o - 3a - 34 = 0, 2o = -4a + a + g. What is the smallest common multiple of 8 and o? 40 Let r = -457 - -466. Calculate the least common multiple of 27 and r. 27 What is the common denominator of (-1878)/360 + ((-20)/15)/(-2) and 214/(-6)33/242? 220 Let u = 324279/98 + -3309. Calculate the common denominator of u and 11/126. 882 Suppose -2r - 60 = -5r. Let g(w) = 8w - 178. Calculate the lowest common multiple of g(25) and r. 220 Suppose -j = -5o - 190, 74j + 170 = 75j + 5o. Calculate the smallest common multiple of 180 and j. 180 Let b = 391/200 + -2/25. Let c = b + -107/40. What is the common denominator of 4/6 + 52/(-18) and c? 45 Let q = -38473/8 - -4800. Find the common denominator of -59/129 and q. 1032 Suppose -o + 4 + 16 = 0. Let v = -14 + o. Suppose 4b = 4t + 52, -5b - 5t = -b - 79. What is the lowest common multiple of b and v? 48 Let h(y) = y*3 - 5y*2 - 5y + 4. Let k(j) = 4j - 8. Let m be k(13). Suppose -5d + 66 + m = 0. What is the least common multiple of d and h(6)? 110 Let b = -7341/4 + 1844. What is the common denominator of (0 - 47/(-1))/(-11) and b? 44 Find the common denominator of 19/24 and -4 + (116/(-54) - (-12 - -7)). 216 Find the common denominator of 17/16 and ((-90)/(-1728))/((-3)/81). 32 Let v = -68 + 69. Suppose c + 2 = -2q, -2c + 7 = 2q + v. What is the least common multiple of c and 10? 40 Let w = -22111/6 + 3696. What is the common denominator of -94/15 and w? 30 Let y = 297 - 207. Find the common denominator of (-350)/(-72) - 5/(y/(-4)) and 53/14. 84 Let f be -2 + 4956 + 2 + 0. Suppose 2t = -2t + f. Let h = t - 3754/3. What is the common denominator of h and 59/3? 3 What is the smallest common multiple of 38 and ((-3)/(-2) + -2)(-135 + -17)? 76 Suppose -1 = -2z + 3. Let h(f) be the third derivative of f6/120 + f5/5 + 11f4/24 + f3 - f*2. Calculate the lowest common multiple of z and h(-11). 6 Let t = 18 - -5. Let x be 33t/(-2) - 0. Let q = -353 - x. Calculate the common denominator of q and 51/13. 26 Let n = -148749/14 - -10633. Calculate the common denominator of 111(-6)/15127 and n. 84 Suppose -2o + 436 = -6o. Let i = o - -159. Suppose 0 = 4t + 6 - i. What is the lowest common multiple of t and 8? 88 Suppose 0 = 5c - 72 - 303. What is the smallest common multiple of 30 and c? 150 Let n = -233 + 1197/5. Calculate the common denominator of (693/(-90) + 8)/(12/56) and n. 5 Let w = -2298533/140 + 16418. Find the common denominator of w and 83/50. 700 Let w = -155812919/494 + 315411. Calculate the common denominator of 137/6 and w. 1482 Calculate the common denominator of -44/3 and -6(-3)/(-12)(-528)/108. 3 Let g be 8/2 - (-220100)/3864. Let o = g + -1235/21. What is the common denominator of o and -95/14? 322 Suppose -42 = 8a - 658. What is the smallest common multiple of a and 22? 154 Suppose 0 = -6p + 3p - 24. What is the least common multiple of 6/p - (-27)/41 and 15? 30 Suppose -5v - 23 = 4t - 2t, 4t + 7 = 3v. Let k = v + 19. Let g(n) = 6n + 4. What is the lowest common multiple of k and g(3)? 176 Let n(b) = -b*2 - 5b + 3. Let l be n(-5). Suppose -c = lu - 8108, u + 2c - 2699 = -2c. Let i = 21593/8 - u. What is the common denominator of 47/6 and i? 24 Let z(g) = g3 + 5g*2 - 8g. Let k(v) = 3v - 4. Let x(t) = 7t - 9. Let p(n) = -5k(n) + 2x(n). What is the least common multiple of p(-10) and z(-6)? 12 Let w(c) = 16c + 128. Let z be (1 - 2/4)-2. Calculate the least common multiple of w(-7) and 1 - (-15 - (z - -3)). 144 Let s = 2931/40 + -1016/15. Find the common denominator of s and	{ "pile_set_name": "DM Mathematics" }
33. Let r = -43 + s. Suppose rv = -0v + 40. Solve v + 0 = -2q for q. -5 Let d be 1/(((-12)/(-8))/(-3)). Let q be 15/(7 + d) - 1. Solve -5 = qx + 3x for x. -1 Let i(k) = -k3 - 5k*2 + 64k + 262. Let q be i(-9). Solve 12z - qz = -6 for z. -3 Suppose 336j - 17 = 335j + 67. Solve v = 15v - j for v. 6 Let c(g) = -g + 2. Let o be c(2). Suppose -4y - 5p - 13 = -9, -4 = y + 2p. Solve ov = v - y for v. 4 Let w(y) = y + 135. Let h be w(-18). Let b be (-2)/9 - (-4121)/h. Solve -q + b = 6q for q. 5 Suppose 4k + 2i - 20 = 6i, -i + 1 = 2k. Let o be (-1)/k0/(-17). Suppose 0 = -3w - 4j - 4 + 26, 3w - j - 2 = o. Solve 2v + w - 4 = 0 for v. 1 Suppose 6b = 2b - 52. Let j = b + 20. Solve 0 = -jz + 2z - 10 for z. -2 Let h(k) = -k - 12. Let s(d) = 6. Let o(v) = -3h(v) - 5s(v). Suppose 27p + 48 = 3p. Let l be o(p). Solve l = -5j - 0j + 20 for j. 4 Let l(q) = -10q - 10. Let i be l(-1). Suppose -3v + iv + 21 = 0. Solve -vg - 2 = -5g for g. -1 Let h(r) = 16r - 91. Suppose -117o = -126o + 54. Let m be h(o). Solve -a - 3 = -m for a. 2 Let g(b) = 28b*3 + 4b*2 - 6b + 1. Let r be g(2). Solve -11l + 163 = r for l. -6 Suppose -d + 0a + 2a = 5, a = -4d - 20. Let w be d/(20/16) + (-24)/(-2). Solve -p + 5p + w = 0 for p. -2 Let q(o) = o2 - 25o + 44. Let s be q(22). Let p = s + 34. Suppose -w - w + 3h + p = 0, -8 = -4w + 2h. Solve w = k - 0 - 1 for k. 1 Let l = 66 + -61. Suppose lk - 2k - 2w - 4 = 0, 4w + 8 = 0. Let m(h) = 3h*2 - 5h + 4. Let c be m(2). Solve c + k = -2d for d. -3 Let b = -8976 - -8978. Solve bw = -8w - 20 for w. -2 Let c(h) = 2h - 2. Let r be c(4). Let b be 0/(15/(-35) - 20/(-14)). Solve -rg + g + 15 = b for g. 3 Let w(n) = -24 + 5 + 9n - 4. Let l be w(3). Solve -g + 10 = lg for g. 2 Let c = 27 - -155. Suppose -62 = -t + 2q, 6t - 3t = 2q + c. Solve -65z = -tz + 20 for z. -4 Suppose -670x + 614x = -1960. Solve xa = 29a + 36 for a. 6 Suppose u + 64 = 17u. Suppose -2i - 3n - n + 42 = 0, 3i = -un + 55. Solve -9 = j - i for j. 4 Let a = -613 - -645. Let c = a + -15. Solve 14k + 12 = ck for k. 4 Suppose -3647s - 202 - 203 = -3692s. Solve 0 = si + 691 - 727 for i. 4 Let m(l) = 33l + 3764. Let f be m(-114). Let j(r) = -r + 1. Let n be j(5). Let h = n - -6. Solve -fc + 6 = h for c. 2 Let r = 5533 + -5324. Solve 0 = rz - 201z - 32 for z. 4 Suppose -967 = 5r - 4h + 1490, -4r - 4h = 1980. Let v = r + 505. Solve 14u + 10 = vu for u. -5 Let x = 175 + -157. Let a be 6/x(1 + -1). Solve 0 = -p - a - 3 for p. -3 Let a(k) be the third derivative of k6/120 - k5/30 - k*4/6 + 5k*3/3 - 191k*2. Let l be a(2). Solve -ly + 38 = 28 for y. 5 Let q(j) = 333j + 2333. Let t be q(-7). Solve 0 = -123b + 122b + t for b. 2 Let z(u) = u2 - 16u - 41. Let g be z(19). Suppose k - 4 = 3k - 4l, -3l + g = 5k. Solve -kw + 9 + 1 = 0 for w. 5 Suppose c = j, 2j + 3j - 3c - 10 = 0. Let x(a) = a*2 + 2a - 11. Let g be x(j). Suppose -b = g - 27. Solve -5h + 4h + b = 0 for h. 3 Suppose -11z + 77 = 0, 25z - 21z - 28 = -3y. Solve -75w + 21w - 54 = y for w. -1 Let f(a) = a*3 - 14a*2 + 10a + 33. Let q be f(13). Let d(i) = -2i3 - 11i*2 + 4i - 12. Let b be d(q). Solve bu = 2u + 6 for u. -3 Let v(g) = -1460g - 2872. Let x be v(-2). Solve 0 = -16n + 28n + x for n. -4 Suppose 4i + 21 = q, -q - 71i + 70i + 21 = 0. Solve 0 = -14o + q + 7 for o. 2 Let u = 1178 + -1155. Solve -ut = -27t + 4 for t. 1 Let n be (-36)/30(2 + (-12)/(-1 - -2)). Solve -36h = -nh - 72 for h. 3 Let f = 14258 + -14217. Solve 0 = -fb + 66 + 16 for b. 2 Suppose -2z + 159 = v, 3v = -3z - 0v + 237. Suppose -14y - z = -22y. Suppose -3u - 15 = -5c, -2c = 4u - y + 4. Solve -c = -3n - 0n for n. 1 Let z be (-3)/(-45)6 + 6409/65. Solve 28g + z = -5g for g. -3 Suppose 34o = 38o - 44. Solve ob - 5b = -18 for b. -3 Suppose 4h - 360 = 152. Let g be (-32)/h - (1 + 17/(-4)). Suppose -5m - 6k + 150 = -k, gm - 2k - 80 = 0. Solve -4p = 8 - m for p. 5 Let v(c) = -22c + 132. Let s(o) = -9o + 33. Let r be s(3). Let w be v(r). Solve -3l + 5l - 4 = w for l. 2 Let h(r) = 9r - 114. Let v be h(15). Suppose -15u = -vu + 120. Solve 0 = -16k + 12k - u for k. -5 Suppose 276o - 4451 = 1897. Solve -6p = 5 - o for p. 3 Let d = -9 - -10. Let b(t) = -18t*3 - 3t + 2. Let q be b(d). Let l(z) = -z*2 - 21z - 35. Let c be l(q). Solve o + 6 - c = 0 for o. -3 Let i = 17 + -16. Let j(h) = 33h2 - h. Let t be j(-1). Let k be i/(4/t) + 39/(-26). Solve -13 - k = 4r for r. -5 Let y = -526 - -528. Suppose 0 = -3c - 2c - 15, 0 = yx + c - 7. Solve xd = -2d + d for d. 0 Let l = -134 + 138. Suppose -ls + 14 = -3q - 2q, -q + 2 = 4s. Solve 2h + s + 9 = 0 for h. -5 Let a be (3/8)/(11/88). Let h be -5 + a + -12 + 18. Solve 7t - 3 = ht for t. 1 Let p = -3118 + 3181. Solve 59h - ph - 16 = 0 for h. -4 Suppose -5p = -p - 20. Suppose ph = h. Solve h = -m + 3m for m. 0 Let h(t) = -2t + 31. Let m be h(13). Suppose 0 = -mp - 402 - 448. Let f be (-2)/16 - p/80. Solve -o - 2 = f for o. -4 Suppose -4k + 10k - 3k = 0. Suppose k = -4t + 3t + 3. Suppose -4l - t = -7. Solve l - 4 = n for n. -3 Let i(g) = -g3 + 10g*2 - 15g - 14. Let c be i(8). Let x be c/8 + (-9)/((-252)/161). Solve -xk - 7 = -17 for k. 2 Suppose 0 = -718q - 39508 + 105564. Solve 110r - 133r = -q for r. 4 Let x be 6/(-4)(-88)/6. Suppose -214u + 209u - 3o = -88, -2u + 2o + 32 = 0. Solve -xi + 15 = -ui for i. 3 Let c = 10 + -4. Suppose -49k + 45 = -40k. Solve -3z + kz = c for z. 3 Let x = -32 + 34. Suppose -o - 175 = -xu, 3u + 0o - 264 = 2o. Suppose 9v = 139 + u. Solve 7g - 2g = -v for g. -5 Suppose 3p + 84 = -4h - 25, 103 = -4h - p. Let u = -16 - h. Solve 3a - u = -0a for a. 3 Suppose 6n - 226 + 208 = 0. Suppose -nk + 18k - 210 = 0. Solve kd = 18d - 4 for d. 1 Let l(k) = -5k - 12. Let w be l(-2). Let h(c) = 6c2 - c - 7. Let f be h(w). Solve -14v = -fv + 5 for v. 1 Let s be 19 + (-150)/15 - 9. Solve 29q - 31q + 10 = s for q. 5 Let x be 0 + 8/(-4) - 14. Let y = x - 5. Let j = y - -21. Solve j = -v - 4 for v. -4 Suppose -5r - 3r = -9r + 112. Solve 114 = rg - 93g for g. 6 Let m be (-10 + 7)(0 + -1). Let a be -1(13 + -4 - m). Let w be (-23 + 22)/(2/a). Solve -2y + wy = -2 for y. -2 Suppose -v = -k - 1, -17k + v + 8 = -13k. Solve 6l - l - kl = 0 for l. 0 Let t(u) = 88u2 - 131u - 130. Let l be t(-1). Solve -l = -3w - 74 for w. 5 Let d = -3565 + 3612. Solve -2v + d = 57 for v. -5 Let j = 51 + -46. Suppose -4c + jc = 36. Let u be ((-10)/(-12))/(6/c). Solve 4g + u = -3 for g. -2 Let j be (-12)/918/(-4). Suppose c + 4 = -22d + 23d, 5c = -5d + 80. Solve -jh - 2 = d for h. -2 Suppose 3120 = 241b - 193b. Solve -21q - 23 = -b for q. 2 Suppose -20 = -5z + 3m, -2z - 2z + 16 = 3m. Let c be ((-4)/11)/(4/(-22)1). Suppose 0 = ck - 20 - 0. Solve -zh = h - k for h. 2 Suppose -2282j + 2284j = 112. Solve -88 = 18f + j for f. -8 Let c = -75 + 72. Let r(p) = -10p - 29. Let o be r(c). Solve -o = 2i + 3 for i. -2 Let z = -465 - -468. Suppose -3g + 12 = 2g - n, 4n + 8 = 0. Solve -17 + g = -zh for h. 5 Suppose 2q = 6q - 140. Suppose k + 4s - s + q = 0, k - 4s = -14. Let p = k + 26. Solve p = -6w + w - 20 for w. -4 Suppose -25 = -6l + 23. Let x be 5((-1768)/85 - -22). Solve 0 = lt + x + 10 for t. -2 Let y be 1/(-8) - 1155/(-24). Suppose -y = m + m - 4d, d + 4 = 0. Let q be ((-80)/m)/(1/2). Solve qv + 4 = 4v for v. -4 Let j(p) = -p*3 - 25p*2 - 47p + 17. Let a be j(-23). Suppose 3s = 5x + 16, 5x = 5s + 10x - a. Solve 9t - st - 2 = 0 for t. 1 Let z be (20 - 10)180/25 + 2 + -4. Solve -67m - z = 3m for m. -1 Let g be (-20)/80 + (-13)/(-4). Suppose 132 = 5d - gi, i - 138 = -5d - 2i. Suppose 0 = 4a + 2b - 24 - 30, -3a + 3b + d = 0. Solve 2n - a = -n for n. 4 Let a(v) = -2v*2 - 52v + 291. Let o be a(-22). Solve o = -8p + 483 for p. 2 Let d be 5 + 0 + -1 - 1. Suppose -4b + 8 = 36. Let f be b/21(-62 - -2). Solve dz + z = -f for z. -5 Suppose -22m - 16767 = 5m. Let k = m + 637. Solve 0 = 10o - ko + 30 for o. 5 Let g be -6 - (-58 - -5 - -2). Suppose 0 = 5v + 4d - g, 3v - 66 + 7 = 4d. Solve 8*o - v = -5 for o. 1 Let k(t) = -4	{ "pile_set_name": "DM Mathematics" }
49? 81 Calculate the highest common divisor of 19 and 51756. 19 Calculate the greatest common factor of 1990950 and 11700. 1950 Calculate the highest common factor of 2 and 367754. 2 What is the greatest common divisor of 166198 and 598? 46 What is the greatest common divisor of 4599 and 302512? 511 What is the highest common factor of 3125 and 100? 25 Calculate the greatest common factor of 200392 and 17464. 296 What is the highest common divisor of 405 and 2565? 135 What is the highest common divisor of 20 and 15248? 4 What is the greatest common divisor of 1337 and 35? 7 What is the highest common divisor of 1654995 and 19? 19 What is the highest common divisor of 2007680 and 40? 40 Calculate the highest common divisor of 80 and 70340. 20 Calculate the highest common factor of 8316 and 19932. 132 Calculate the highest common factor of 4078 and 16432301. 2039 Calculate the highest common factor of 4961 and 8349. 121 Calculate the greatest common divisor of 22 and 1939619. 11 What is the highest common factor of 1745358 and 3438? 1146 Calculate the highest common divisor of 18328 and 28. 4 What is the greatest common divisor of 143201 and 1157? 89 Calculate the greatest common divisor of 1420804 and 5390. 1078 What is the greatest common factor of 18189 and 69273? 387 What is the highest common divisor of 5184 and 183708? 324 What is the greatest common factor of 26622 and 210222? 918 What is the highest common factor of 72 and 31380? 12 Calculate the highest common factor of 1808 and 11074. 226 What is the greatest common divisor of 30 and 91920? 30 Calculate the greatest common factor of 483861 and 84. 21 Calculate the highest common factor of 22 and 162371. 11 What is the highest common divisor of 4 and 1006? 2 Calculate the greatest common divisor of 29440 and 3008. 64 What is the highest common divisor of 3192 and 248304? 168 Calculate the greatest common factor of 421164 and 684. 36 Calculate the greatest common divisor of 20 and 607990. 10 Calculate the highest common divisor of 36596 and 70. 14 What is the greatest common divisor of 59 and 126319? 59 Calculate the highest common divisor of 18414 and 130878. 198 What is the highest common factor of 32 and 202144? 32 Calculate the highest common divisor of 44608 and 2006. 34 Calculate the greatest common divisor of 532 and 59318. 266 Calculate the greatest common divisor of 49649 and 393. 131 What is the highest common divisor of 768 and 469632? 384 What is the highest common factor of 55476 and 460? 92 Calculate the greatest common factor of 6 and 26538. 6 Calculate the greatest common factor of 12 and 1369284. 12 What is the greatest common divisor of 6854 and 1633? 23 Calculate the greatest common factor of 1573 and 335291. 121 What is the greatest common divisor of 9040 and 2453456? 1808 What is the highest common divisor of 6930 and 90720? 630 Calculate the highest common divisor of 357 and 22629159. 357 Calculate the greatest common divisor of 2682234 and 486. 486 What is the greatest common divisor of 27030 and 5610? 510 Calculate the highest common factor of 244 and 301828. 244 Calculate the highest common divisor of 295440 and 720. 240 Calculate the highest common factor of 162355 and 95. 95 What is the greatest common divisor of 231099 and 66? 33 What is the greatest common factor of 8090 and 40? 10 Calculate the greatest common factor of 12174 and 18. 6 Calculate the highest common factor of 5192 and 198. 22 What is the greatest common factor of 7891 and 20163? 13 Calculate the highest common factor of 1800 and 32904. 72 Calculate the highest common factor of 1790451 and 26. 13 Calculate the greatest common factor of 3751 and 452848. 341 Calculate the greatest common divisor of 4304 and 3878980. 1076 What is the highest common divisor of 231 and 5901? 21 What is the greatest common factor of 12 and 79248? 12 What is the greatest common divisor of 874 and 6726? 38 What is the greatest common divisor of 7350 and 174300? 1050 What is the greatest common divisor of 3353 and 2443? 7 What is the highest common factor of 10712 and 6136? 104 What is the highest common factor of 44 and 859903? 11 What is the highest common factor of 612 and 20910? 102 Calculate the greatest common divisor of 614 and 95477. 307 What is the greatest common factor of 475 and 6289? 19 What is the greatest common factor of 2608469 and 923? 71 Calculate the greatest common factor of 19 and 207518. 19 What is the greatest common divisor of 92169 and 24339? 399 What is the greatest common divisor of 139755 and 945? 105 Calculate the highest common divisor of 175 and 176575. 175 Calculate the highest common factor of 354583 and 261. 29 Calculate the highest common divisor of 153790 and 175084. 2366 Calculate the highest common divisor of 1692202 and 92. 46 Calculate the greatest common divisor of 32572 and 884. 68 Calculate the greatest common factor of 1108 and 63710. 554 What is the greatest common factor of 11 and 304? 1 What is the greatest common divisor of 5122 and 14184? 394 Calculate the highest common factor of 658886 and 68. 34 What is the greatest common divisor of 531005 and 305? 305 Calculate the highest common divisor of 75075 and 650. 325 Calculate the highest common factor of 19762 and 943. 41 What is the highest common factor of 42048 and 102528? 576 Calculate the highest common divisor of 6848 and 268864. 64 Calculate the greatest common divisor of 68796 and 270. 54 Calculate the greatest common divisor of 20851 and 337211. 719 What is the greatest common divisor of 2560 and 376? 8 What is the greatest common divisor of 431808 and 858? 78 Calculate the greatest common factor of 940 and 187860. 20 Calculate the highest common factor of 82925 and 125. 25 What is the highest common factor of 2444 and 1872? 52 What is the greatest common divisor of 434 and 13361? 31 What is the highest common divisor of 493 and 1463717? 493 What is the highest common divisor of 45356 and 1700? 68 Calculate the highest common divisor of 162619 and 137. 137 What is the greatest common factor of 706448 and 1608? 536 What is the greatest common divisor of 154 and 1342? 22 What is the highest common divisor of 13226 and 2584? 34 What is the highest common divisor of 78858 and 17082? 234 What is the highest common factor of 28106 and 36566? 94 What is the greatest common divisor of 4575 and 2074? 61 Calculate the highest common divisor of 107746 and 68. 34 Calculate the greatest common factor of 2520 and 55020. 420 Calculate the highest common factor of 878 and 3951. 439 What is the greatest common factor of 3834 and 144982? 142 What is the greatest common factor of 16 and 14088656? 16 What is the greatest common divisor of 163408 and 112? 112 Calculate the highest common factor of 344 and 197671. 43 Calculate the greatest common factor of 224361 and 194. 97 What is the greatest common divisor of 3008 and 9400? 376 Calculate the highest common divisor of 32315 and 805. 115 What is the highest common divisor of 460772 and 338? 26 Calculate the greatest common divisor of 79 and 188731. 79 Calculate the greatest common divisor of 19635 and 15477. 231 What is the greatest common factor of 10932 and 6384? 12 What is the highest common divisor of 308 and 1739276? 308 What is the greatest common factor of 3186 and 108? 54 What is the greatest common divisor of 4393 and 37858? 23 Calculate the greatest common divisor of 99 and 47179. 11 What is the highest common divisor of 5944 and 4912? 8 What is the greatest common factor of 4223 and 10496? 41 What is the highest common divisor of 28779 and 4399? 53 Calculate the highest common divisor of 84 and 133588. 28 Calculate the highest common factor of 26 and 71474. 26 What is the greatest common divisor of 3765223 and 5243? 749 What is the highest common divisor of 2394 and 179151? 399 Calculate the highest common divisor of 340985 and 705. 235 What is the greatest common divisor of 364 and 3874? 26 Calculate the greatest common divisor of 210 and 3750. 30 Calculate the highest common divisor of 49301 and 112. 7 What is the highest common factor of 8814 and 2262? 78 What is the greatest common factor of 4958 and 65046? 74 Calculate the highest common factor of 902635 and 1035	{ "pile_set_name": "DM Mathematics" }
mmon multiple of 54915 and 17996430. 125975010 Find the common denominator of 133/201450 and 52/84609. 4230450 What is the least common multiple of 183325 and 412? 75529900 What is the least common multiple of 1440 and 48573? 7771680 Calculate the smallest common multiple of 1824432 and 624. 23717616 What is the common denominator of 37/1183 and 83/686816? 4807712 Find the common denominator of 28/17373 and 58/30141. 174546531 Calculate the common denominator of 47/29132561 and 5/4. 116530244 Calculate the smallest common multiple of 50 and 121376795. 1213767950 Calculate the common denominator of 151/42 and -227/166803000. 166803000 What is the common denominator of 121/17995020 and 3/5998340? 17995020 What is the least common multiple of 177268 and 5140772? 5140772 Calculate the lowest common multiple of 19490 and 11736. 114367320 What is the smallest common multiple of 111783 and 15969? 111783 Calculate the lowest common multiple of 1768 and 170. 8840 Calculate the common denominator of -49/12851 and 91/963825. 963825 Calculate the lowest common multiple of 30941091 and 17189495. 154705455 What is the least common multiple of 12541992 and 40? 62709960 Calculate the lowest common multiple of 415 and 212397. 1061985 Calculate the lowest common multiple of 7986 and 517759. 3106554 What is the smallest common multiple of 4031517 and 4? 16126068 Calculate the least common multiple of 292860 and 2466. 40121820 What is the smallest common multiple of 950 and 2385450? 2385450 Calculate the common denominator of 91/10573476 and -143/30. 52867380 Calculate the common denominator of 89/364 and 79/892808. 11606504 Calculate the smallest common multiple of 93060 and 54648. 12842280 What is the common denominator of 61/26070 and -119/253590? 2789490 What is the smallest common multiple of 1320 and 62664030? 250656120 Calculate the common denominator of -117/6296020 and -111/958090. 44072140 What is the least common multiple of 55567116 and 14? 388969812 What is the common denominator of 46/17540965 and -19/3368? 140327720 What is the least common multiple of 4496500 and 19334950? 193349500 Calculate the smallest common multiple of 81435081 and 156. 325740324 What is the common denominator of -51/462446 and 25/14? 3237122 What is the common denominator of 31/64682756 and -33/210218957? 840875828 Find the common denominator of -49/27981 and -229/11970. 37214730 Calculate the common denominator of 37/4864 and 77/37294. 90699008 Calculate the least common multiple of 46 and 46410274. 46410274 Find the common denominator of 37/186289 and 7/27679. 16579721 Calculate the common denominator of 31/4059 and 23/227. 921393 What is the common denominator of -25/5284 and 43/1348? 1780708 Calculate the common denominator of -85/84546 and -151/391986. 4311846 What is the least common multiple of 8858 and 1522340? 65460620 Calculate the lowest common multiple of 129626 and 10857. 4277658 Calculate the common denominator of 59/154343 and 32/83. 12810469 Calculate the lowest common multiple of 1620630 and 196440. 6482520 Calculate the least common multiple of 42 and 2315523. 4631046 Calculate the least common multiple of 43999683 and 14666561. 43999683 Calculate the lowest common multiple of 68572 and 53088. 1645728 Find the common denominator of 61/537880 and -167/510. 1613640 Calculate the smallest common multiple of 930870 and 42. 6516090 Find the common denominator of 43/244051236 and 49/312. 488102472 Calculate the lowest common multiple of 208558 and 12460. 185616620 What is the lowest common multiple of 5249376 and 10498752? 10498752 Calculate the common denominator of 37/29614 and -1/19822. 17264962 Calculate the least common multiple of 1258 and 134436. 4974132 What is the least common multiple of 284 and 197592? 14029032 What is the smallest common multiple of 134824 and 74784? 66333408 Find the common denominator of 59/222192 and 27/3468664. 62435952 What is the lowest common multiple of 4823 and 648? 3125304 Calculate the common denominator of -127/3552 and -45/917504. 101842944 What is the least common multiple of 841590 and 413100? 429210900 What is the smallest common multiple of 3138800 and 33180? 743895600 Calculate the lowest common multiple of 168638182 and 4. 337276364 Calculate the smallest common multiple of 48 and 5487066. 43896528 What is the common denominator of 137/31824 and -65/2908836? 151259472 What is the common denominator of 169/420 and 151/2797860? 19585020 Calculate the lowest common multiple of 1096596 and 1340284. 12062556 Calculate the common denominator of 11/136476 and 65/1674. 12692268 Find the common denominator of -41/10514300 and 57/210286. 10514300 What is the smallest common multiple of 1081 and 10026275? 10026275 What is the common denominator of -31/50444 and -97/396? 4993956 What is the least common multiple of 95912 and 2385811? 19086488 Calculate the least common multiple of 3173112 and 9871904. 88847136 Find the common denominator of -127/10968912 and 101/276. 252284976 Find the common denominator of -32/1446207 and 58/48433. 588606249 What is the least common multiple of 260 and 932438? 9324380 What is the lowest common multiple of 20403810 and 6990? 20403810 What is the smallest common multiple of 51939 and 1935? 11166885 What is the least common multiple of 10262864 and 240? 153942960 What is the common denominator of -77/539277 and -93/75688? 4314216 Calculate the common denominator of 85/21636 and -75/104. 562536 What is the common denominator of -113/56077044 and 93/158884958? 953309748 Calculate the smallest common multiple of 621 and 143505. 3300615 Calculate the common denominator of 3/209 and 149/282690246. 3109592706 Calculate the least common multiple of 155463 and 14302596. 14302596 Calculate the lowest common multiple of 283680 and 6048. 5957280 Find the common denominator of -7/2957 and 73/26110. 77207270 Calculate the lowest common multiple of 253238 and 80. 10129520 Calculate the common denominator of -47/3507 and 68/55089125. 165267375 Find the common denominator of -7/1284228 and 101/17296. 5136912 What is the smallest common multiple of 6739 and 128? 862592 Calculate the smallest common multiple of 2806512 and 1637132. 19645584 What is the common denominator of 89/401940 and 107/18270? 401940 Calculate the lowest common multiple of 3005 and 54390. 32688390 What is the smallest common multiple of 180 and 96120? 96120 What is the least common multiple of 1548 and 4368800? 39319200 Find the common denominator of -17/5690760 and -149/2845380. 5690760 Find the common denominator of -87/121550 and -10/8697. 81316950 Find the common denominator of -67/564928 and -19/257244. 28811328 What is the lowest common multiple of 53899608 and 40? 269498040 Calculate the least common multiple of 1124 and 9109. 10238516 Find the common denominator of -33/8 and 69/615612515. 4924900120 What is the common denominator of -131/4939250 and -8/25? 4939250 Calculate the common denominator of -55/2988 and 31/108031140. 108031140 What is the common denominator of -16/38894865 and -43/146615? 272264055 Calculate the common denominator of 41/156 and 95/51047022. 102094044 What is the least common multiple of 3677508 and 1634448? 14710032 Find the common denominator of 137/10824 and 43/896. 1212288 What is the common denominator of -28/1167 and 56/6873? 2673597 Calculate the least common multiple of 42942285 and 2979. 42942285 Calculate the least common multiple of 171718855 and 668745. 1545469695 What is the common denominator of -107/196 and -87/5956202? 83386828 What is the least common multiple of 120610 and 56? 482440 Find the common denominator of 3/820708 and 80/63. 7386372 Calculate the common denominator of -93/7252 and -11/15122380. 559528060 Calculate the least common multiple of 268464 and 1280. 21477120 Find the common denominator of -101/4345428 and -53/66. 47799708 What is the smallest common multiple of 10 and 1406238531? 14062385310 Calculate the smallest common multiple of 15147560 and 797240. 15147560 What is the least common multiple of 75168 and 135544? 1273571424 Calculate the smallest common multiple of 1265697 and 2109495. 6328485 Calculate the least common multiple of 3900 and 11319360. 56596800 What i	{ "pile_set_name": "DM Mathematics" }
. Which is greater: x or 1? 1 Let r = -4 - -3. Let x = 3 + r. Suppose -3p = -5p - xd + 24, 4d = 4p - 64. Is 14 <= p? True Suppose 3q - 526 = -d + 388, 2q + 2d - 604 = 0. Which is smaller: 307 or q? q Let n be (-1 - 3) + 13/1. Let l(d) = d*2 - 11d + 19. Let j be l(n). Let a be (-24)/36 + j/(-3). Which is greater: a or -2? a Let m = 1565 - 1563.6. Which is greater: -3 or m? m Let y be (-3)/(-15) + (-218)/(-10). Let d = 38 - y. Let n be ((-1)/(-3))/(2/d). Which is smaller: n or 2? 2 Let l be (3 - (-34)/(-10)) + (-91)/(-65). Which is greater: l or 26/121? l Let b be -3(-9)/(2187/18). Which is smaller: -57/10 or b? -57/10 Let o = 118.1 - 118. Which is smaller: -4/9 or o? -4/9 Let o(t) = t3 + 20t*2 + 3t + 61. Let h be o(-20). Are -4/227 and h equal? False Let k = -20.84 + -20.69. Let o = k - -0.53. Let l = -36 - o. Is l at least -3? True Let j be ((-10)/(-120))/((-8)/(-64)). Which is bigger: j or 0.486? j Let c = -437 + 437.3. Is -9/16 not equal to c? True Suppose 3y - 5 = 16. Let u = 6 - y. Which is smaller: 2/5 or u? u Let h be (-3 + 33/9)3. Let x be (-68)/(-28) + -4 + h. Is -1 less than or equal to x? True Let w be ((-8)/2088-12)/4. Which is greater: 1 or w? 1 Suppose 0 = -5x + 35 - 5. Suppose -x = 4v - 5d, 0d + 10 = -v - 3d. Let y(c) = -c*3 + 6c*2 - 4c - 7. Let j be y(5). Is v at least j? False Let g be (19/(-114))/((-2)/(-13) + (-50)/156). Let u be (-1)/(-2) - 95/198. Does g = u? False Suppose -3p = p + 12. Let t be (p/21)/((-6)/452). Let l = t + -66/7. Does l = -2/7? False Let c = -249 + 216. Is -35 at most as big as c? True Let j be (-331)/1540(-38)/5. Let p = 1/350 + j. Do 2 and p have different values? True Let u be 120/69 - (2 - 0). Suppose 3b - 313 = 14. Let m = b - 109. Which is bigger: m or u? m Let w(a) = -9a*3 + 10a + 18. Let u be w(-2). Is u at most 72? True Suppose -29j + 10 = -34j. Which is smaller: j or -30/23? j Let t be 7 + (3 - (5 - -1)). Suppose -s - 49 = -ts - 4d, -4d = 4s - 72. Suppose 0q - 5y - s = -2q, -2q + 5 = y. Is 3 greater than or equal to q? False Suppose -2m + 0m = 4k - 2, 0 = 3m - 5k - 3. Is m bigger than 2/1503? True Let y be ((-1)/((-15)/38))/((-22)/33). Let n = 0.06 - -0.04. Is n < y? False Suppose -2 - 10 = 6c. Let r be (c/(-3))/(48/(-72)). Is r at most as big as -3/116? True Let f(q) = q*3 - 2q*2 + q - 1. Let y be (-28)/7(-2)/4. Let w be f(y). Let k = 12 - 7. Is k greater than or equal to w? True Let t = 254 - 242. Is 14 smaller than t? False Let w be 3/21 - (-280)/(-245). Which is greater: w or -1/1358? -1/1358 Let y = 0.151 + -80.151. Let s = y - -51. Let d = 29 + s. Is d at least as big as 11? False Let b be (1 - 4/12) + (-52)/105. Which is greater: 1 or b? 1 Suppose 0 = -2w - l + 36, -3w = w + 5l - 84. Let t = -14 + w. Let r be (t/(-3))/((-8)/12). Which is smaller: -1/11 or r? -1/11 Let q = -33 + 37.5. Let d = 2.5 - q. Are d and 1/2 equal? False Let r(x) = -x2 - 2x + 13. Let m be r(-4). Suppose ms - 5 = 0, -3s - s = 3n - 112. Is 36 at most as big as n? True Let f = 3 - 0. Suppose 0 = fj + 5d, 4j + j = -5d. Let g be 2/(-2)1/11. Is j greater than g? True Let x = 0.08 + 9.92. Let p = x - 10.19. Let n = -0.09 - p. Which is greater: n or -18? n Suppose 0n - v + 5 = n, 3n - 13 = -v. Suppose -3r - 13 = 2s, 4 = 4s - nr - 0r. Let i = s - 3. Which is smaller: -4 or i? i Let c be (-115/25)/((-14)/(-25)). Is c at least 1? False Let v(g) = -g*2 + 11g - 28. Let p be v(5). Does -41 = p? False Let u be 34(0 + (-12)/(-8)). Let n = 16 - 16. Let v be 2/(n + (-6)/u). Are v and -17 equal? True Let k = 4 + -8. Let w be (-9)/3(-4)/6. Suppose 0 = -m - 0m - 3, wt - 11 = 5m. Which is smaller: t or k? k Suppose 5z - 4 = 6. Suppose z = -0k - 2k. Which is smaller: k or -81? -81 Let o be (-78)/18 - (-2)/(-3). Let d(w) = w*3 + 5w*2 - 2w. Let a be d(-4). Suppose a = -i - 2i. Which is smaller: i or o? i Let o be 85/5 + (-1 - (2 - 0)). Let v be 7/72/(-2) - o. Is -15 equal to v? True Suppose -11z - 684 = -9z + 4g, 3g + 9 = 0. Which is bigger: -335 or z? -335 Let i(v) = 4v - 8. Suppose -5b + 51 - 10 = 2h, -4h + 40 = 4b. Let w be i(b). Suppose 3q + 4p - 35 = 8q, -p + w = -5q. Which is smaller: -1/4 or q? q Let n = -51/5 - -199/20. Is 0.066 greater than n? True Let w = 37052/79 + -469. Is w > -1? True Suppose 5 = -3z - 1. Let v = 10 - 21/2. Which is bigger: z or v? v Let d = 24768/7 - 3549. Is d at most -0.3? True Let z = -43 + 18.6. Let t = -24 - z. Are t and -0.05 non-equal? True Let d be 1 - -1 - 5 - 1. Are d and -20 nonequal? True Let m = 10 + -3. Suppose 3t = -m + 22. Suppose -tc + 16 = x - 42, 4x = -4c + 56. Is c not equal to 11? False Let w be 33/(-44) - 222/24. Let p(h) = 5h - 2. Let u be p(2). Let m = w + u. Which is smaller: -3 or m? -3 Suppose 0 = -2c + 5c + m + 211, -5c + 5m = 385. Let x = 72 + c. Is x smaller than 3/23? True Let j(o) = -o3 - 9o*2 + 19o - 33. Let g be j(-11). Which is smaller: -2 or g? -2 Let o be (7/21)/((-1)/39) - 3. Is o > -16? False Let w = 91 - 89. Suppose t = wp - 16, -4p + 3p - 17 = 2t. Which is bigger: t or -6? -6 Suppose o + n = 6, 3o - 5n + 18 - 4 = 0. Suppose 3s = -q + 2q - 16, 4q = os + 24. Suppose 2 + 2 = -qj. Which is smaller: -1/4 or j? j Let a = 39/68 - 1069/204. Is a > -4? False Let b = -5858/11 + 533. Let j be (-7)/(-1) - 0 - 4. Let c(v) = v3 - 4v*2 + 4v - 3. Let i be c(j). Which is greater: i or b? b Suppose 2c - 2 = 0, -2c - 41 = -3f + 41. Is 25 != f? True Let k(m) = m2 - 2m - 3. Let q be k(3). Let f be 68/(-2686)(-3)/6. Is q at most as big as f? True Let k = 67 + -18. Let d = k - 49.1. Is -14 less than d? True Suppose h + 1 = a - 2, a - 5h + 1 = 0. Suppose -5t + 5 = -at - 2x, 4x - 5 = t. Which is smaller: t or 14? 14 Let x be 11/(-25)150/45. Are x and -2/7 non-equal? True Let h(z) = -6z + 1. Let b be h(2). Let m = 32 - 33. Which is smaller: b or m? b Let j be ((-1)/1)/(0 - 1). Let w be (1 + 1 - j)/(-11). Which is smaller: 1 or w? w Let a(m) = m - 7. Let f be a(7). Let t = -3/46 + -10/23. Which is greater: t or f? f Let c(w) = 14w - 677. Let o be c(54). Are 81 and o non-equal? True Let r be 27 - -1 - ((-36)/(-2) + -19). Let z be 28/36/2. Which is smaller: r or z? z Let c = 193/2 - 15635/162. Which is bigger: 0 or c? 0 Let n = 0.14 + 20.86. Let h = -4/83 - 146/415. Which is smaller: h or n? h Let h be (-12)/(-14)238/51. Suppose 0 = 4v - 3s - h - 25, 0 = -2v + 4s + 22. Let d(f) = f + 2. Let p be d(4). Is v at most as big as p? True Let j be (-14)/2 + (-46)/(-6). Which is bigger: j or 77? 77 Let l = -6 + 16. Suppose 0q - l = -5q. Suppose 3w = -qw. Which is greater: -1 or w? w Let f(y) = 8y - 30. Let w be f(14). Which is bigger: w or 5? w Let s be 30/(-288)-8 + (-5)/6. Let f be (2/7)/(69/7). Are s and f nonequal? True Suppose 0 = 5p + 40 + 30. Suppose 20t = 74t + 648. Is t not equal to p? True Let y be (-9)/(-2)((-333)/54 + 6). Is 21 < y? False Suppose 3d - 109 = 5s, -s + 2d = 2s + 66. Which is greater: s or 3? 3 Suppose i - 305 = -20. Let w = -3993/14 + i. Which is bigger: w or 1? 1 Suppose 6 = -3q + 2v - 8, 0 = -2v + 2. Let a be (2 - q) + (-4)/2. Let y be -4 - (9/(-24) - a). Which is smaller: y or 1? y Let s = 0.04 + -0.01. Let h = s - 0.04. Let u = 0.01 + h. Is 1 smaller than u? False Let l(c) = -31c3 - c2 - 2c - 1. Let y be l(-1). Suppose 0 = -33h + yh + 44. Is h bigger than 20? True Suppose -3 + 1 = 2r. Let h = 4192 + -280863/67. Is r at least as big as h? False Let s be ((-19)/8 - -2)96/648. Suppose -2t = -7 + 5. Which is smaller: s or t? s Let j be (-3)/(21/(-14)) - 0. Which is greater: j or -0.62? j Let a be (2 - -6) + (14 - (6 + 7)). Let t = 2933/3 + -969. Which is smaller: a or t? t Let l be (3 + 0)(-7 - -24). Let n be -1 + 0 + 367/7. Let w = n - l. Which is bigger: w or -1? w Suppose c + 2o - 101 = 0, 0 = -3c - 9o + 10o + 268. Is c > 181/2? True Let u = 1640365757/187 - 8772064. Let x = u + 622/11. Let i = x + -2. Is 1 <= i? False Suppose 338 = -6m + 19m. Suppose 0 = -2q + 7q. Which is smaller: m or q? q Let d(i) = i*2 - 2i - 7. Let k be d(-2). Which is smaller: k or 4/259? 4/259 Let k be 16/(-88) + (-189)/(-11). Suppose -k = 4c - 17. Let g = 0 + 2. Is g bigger than c? True Let b(n) = n*2	{ "pile_set_name": "DM Mathematics" }
itive. w(579/7) Simplify (y(1/3)/y)*(2/15)y*(-6/13)y(4/5)/y assuming y is positive. y(-439/585) Simplify (l*(-3/2)l(-1/10))(-2/99) assuming l is positive. l*(16/495) Simplify ((p/(p/(pp/(p/(p/(p/p*(-4))))p))p)/(ppp(-3/14)p))/(p(1/4)/p(-2/61)) assuming p is positive. p(-6949/1708) Simplify (l(-2)l(-12))/(l3)(2/3) assuming l is positive. l(-16) Simplify k/k14k*(-31)(k/(k(-15/8)/k))(-8/17) assuming k is positive. k(-779/17) Simplify (t4)(2/7)/(t(-1)/t)34 assuming t is positive. t(484/7) Simplify (aa/(a(-7/3)/a))(4/17)a/(aa(1/3)/aa)a(12/7)aa assuming a is positive. a(1655/357) Simplify (bbb(-1/2)b(bb(-2/5)/b)/b)/((b/(b/b(2/43)))/b6) assuming b is positive. b(3033/430) Simplify ((j/j*24j)/jjj(-28))(-33) assuming j is positive. j1650 Simplify (f/f(-2/7))*(5/3)/((ff*(1/2)f)/(f/f(-8/3))) assuming f is positive. f(139/42) Simplify (i(-3/2))(2/19)/(i*8i(-12)) assuming i is positive. i(73/19) Simplify (c/c(2/5))(-47)(c(2/13)c)(-1/4) assuming c is positive. c(-7407/260) Simplify (((p*(-11)p)/(pp(1/17)/p))(-22/3))(-34) assuming p is positive. p(-2508) Simplify (x4xx(1/2))/(xx*(3/7)xx(1/7)) assuming x is positive. x(41/14) Simplify (f((f/(f(((ffff*(-4/7)ff)/f)/f)/f))/f)/f)(-1/23)/(f(3/11)/f(-1/5)) assuming f is positive. f(-3251/8855) Simplify (n/(n(-1/6)n))/(nnn*(-2)n)(nn10/n)/(n(-3/4)/n) assuming n is positive. n(131/12) Simplify z(-4)/(((z*(-6/11)/z)/z)/z)(zz/(zz/(zz0/z)z))26 assuming z is positive. z(-291/11) Simplify ((m20)(-33))(-30) assuming m is positive. m19800 Simplify (w(-1/5))(-2/153)(w(1/16)w)/ww(-1/16) assuming w is positive. w(2/765) Simplify (l(-7)/l(4/3))/(l/(l((l/(l/l*(-2/25)))/l)/l)l)(-10/13) assuming l is positive. l(-1163/195) Simplify v(-8/3)/v(-6)v31/v(-24) assuming v is positive. v(175/3) Simplify (oo*30oo(2/7))/((o/((o/o(2/19))/o))/o2) assuming o is positive. o(4413/133) Simplify (((cc0)/c)/c)(7/8)/((c/(((c(c/c14)/c)/c)/c))/(c/c2)) assuming c is positive. c(-143/8) Simplify ((p/(p(-10)/p))/((ppp(2/9))/p))/(p(-1/2))(-17/4) assuming p is positive. p(623/72) Simplify (z(-1/11)zz(-2/31))/(z/z(-7)z/z(7/5)) assuming z is positive. z(-11518/1705) Simplify (i*(-11/5)i(-5/6))(-8/11) assuming i is positive. i*(364/165) Simplify (((pp(-7))/p)/p)/p(-2/9)p(-2/11)/p(-4) assuming p is positive. p(-392/99) Simplify ((v(-24))(-4/17))(2/19) assuming v is positive. v(192/323) Simplify (ff/((f/(fff(ff*(2/3)ff)/f))/f))40/(ff4/f)(-25) assuming f is positive. f(1220/3) Simplify ((i/i(2/59)i)/(i(1/6)i))/(i(2/49))(15/7) assuming i is positive. i*(86449/121422) Simplify (xxx(-2)x/(x(x(-2)/x)/xx)(x(2/7))(-6/17))(1/2) assuming x is positive. x(345/238) Simplify (((ll*7)/lll(2/11))/(l(1/4)l(-3)))7 assuming l is positive. l*(3367/44) Simplify ((((mm*5)/m)/mm/m*(1/6))/(mm(-3/2))16)(6/5) assuming m is positive. m(77/5) Simplify (w*(-2/3)/ww(1/3)/w)/(w/(w/(w/(w/w(-5)))w)w)(-1/35) assuming w is positive. w(-52/21) Simplify f*(7/6)/ff*(1/7)f/(f/((ff(-5/4))/f))f(2/3) assuming f is positive. f(-23/84) Simplify (l/(l/((ll(6/11)/l)/l)))/l11(l(-2/9))(-13/7) assuming l is positive. l(-7652/693) Simplify u(-2/7)/u*(-2/15)u*(-17)uu10 assuming u is positive. u(-646/105) Simplify ((r/(r((r*(-2/5)/r)/rr)/r))/rrr1)/((r/(r(-1/2)rr))/((rr/(rr(rr*(-7)/r)/rrr))/r)) assuming r is positive. r(89/10) Simplify (((t/(ttt(1/8)tt))/t(-2/5))/(ttt0)(2/25))(-2/23) assuming t is positive. t(577/2300) Simplify ((jj/(j/((j/(jj/(j(-24)jj))j)/j))jjjj)/((jjj(-1/44)/j)/j))15 assuming j is positive. j(-11865/44) Simplify (f(-1/8))(-43)/(f18/fffff10) assuming f is positive. f(-197/8) Simplify (f/(ff3))30f(-3)/(f(1/10)f) assuming f is positive. f(-941/10) Simplify ((cc/(c/(c*(1/11)/c))ccc/c*(-1/6)c)/(c*(-8)c10))(-5) assuming c is positive. c(-745/66) Simplify (v/v(-2/35)(v/(vv*(-9)v))/v)/((v/(v*(2/17)/vv)v)/((vv/(v/(v/(v/(v*(-7)vv)v))))/vv)) assuming v is positive. v(699/595) Simplify ((z(-10)/z)/z(-19))/(z/z(-16))(-20) assuming z is positive. z348 Simplify (a(6/5))(40/3)/((aa*8)/aaa/(aa*(-9/5)a)) assuming a is positive. a(31/5) Simplify (s(6/5)/ss(-1)((s*1s)/s)(-5/2))(-16) assuming s is positive. s(264/5) Simplify (r6/r0)/(r13rr(-3)) assuming r is positive. r(-5) Simplify (((b/(bb(b/(bb(-2/11)))/bb))/(b((b/(b(-1/2)/b))/bb)/b))/(b(-5/3)/((b(-8)/b)/b)))(-1/2) assuming b is positive. b(793/132) Simplify j*(5/3)/j(j/j*(-18))/jj*(1/13)j/(j/((jj(-4/5)jj)/j)) assuming j is positive. j(3889/195) Simplify ((jj/j(-3))/j)(-8/13)(j0)(2/187) assuming j is positive. j(-32/13) Simplify (g(2/45)/gg/(g(-2/5)/g))/(g(-2/19)/(gg(-10)g)) assuming g is positive. g*(-1103/171) Simplify (((ff*(-17))/fff)/f)(-36)/((ff*(-1/5)f)/ff(f(ff/f(15/2))/f)/f) assuming f is positive. f(5807/10) Simplify ((l/(ll/l0l)l6)/(l8/ll(4/5)))15 assuming l is positive. l*(-57) Simplify (zz/(z*(-1)z)zz)/(z*(-1/17)/z)(z(-3/2))(5/2) assuming z is positive. z(89/68) Simplify h/h(-3)h(1/7)((h*(1/11)h)/h)/h(-12) assuming h is positive. h(1250/77) Simplify (f(-10))(-47)(f/f(-1/4))(-34) assuming f is positive. f(855/2) Simplify (c(2/41)/c)/c(2/15)(c*(5/4)c)/(c7/c) assuming c is positive. c(-11893/2460) Simplify o(-10)/((o(-4)o)/oo)(o(o/(o/o17))/o)(2/105) assuming o is positive. o*(-701/105) Simplify ((uu*(2/5)u)/(u*(-15)u))/((u(1/2)/u)/(u(-2)u)) assuming u is positive. u(159/10) Simplify (m(-29)/(m/(mm(5/3))))(-37/4) assuming m is positive. m(1517/6) Simplify (a/(a(2/25)/a))*33/((aa*(-21)aa)/a(-10/3)) assuming a is positive. a(5852/75) Simplify (u/u(-6))7u*(5/8)u(-2/15) assuming u is positive. u(5939/120) Simplify (((r*1r)/(rr(-1/13)))/(r(r/r*7)/rr(1/3)))(2/17) assuming r is positive. r(526/663) Simplify ((v(-8)/(v/(v/(v*9/vvv))))/(vv*(2/5)v)(-23))(-32) assuming v is positive. v(-5952/5) Simplify l(-19)/(l/(ll16))(l*(-4/11)/ll)/l(-5/7) assuming l is positive. l(-204/77) Simplify (n/n*(2/11)n*(-4/7)(n/((nn/n(-1))/n))/n(-2/9))(-1/23) assuming n is positive. n(16/693) Simplify (kk/(k/(k*(3/5)/k)k))(3/8)/(k(1/19)/kkk19) assuming k is positive. k(-7297/380) Simplify (l*6/(ll/l*(-7/4)ll)ll(6/11)lll(-7))(-4) assuming l is positive. l*(141/11) Simplify ((r(r*(1/2)/rrr)/r)/(r(6/11)r)r(3/4)r/r*(-6/11)r)(2/25) assuming r is positive. r(13/50) Simplify ((((ss(1/4)s)/s)/(s/(ss(-4))s))(1/30))(-29/5) assuming s is positive. s(29/40) Simplify ((d(-7)dd(1/2))/(d6/((d*(-8)d)/d)))45 assuming d is positive. d(-1755/2) Simplify ((u/(u/u*(23/2))(uu(-2/39))/u)(6/19))34 assuming u is positive. u(1598/13) Simplify (oo*(-2/37)o(1/4)/o)/(o7oo(-3)/o) assuming o is positive. o(-563/148) Simplify ((w(www6)/ww)/w(-14))/(w(-1)/w(-1/3)) assuming w is positive. w(71/3) Simplify t(-1/7)/(t/(t/t(-3/8)))t(-1/6)t5 assuming t is positive. t(851/168) Simplify n*(8/7)n/(n(nn*(1/3)/nn)/n)(n/(n/(((n/(n/(((n21n)/n)/n)n))/n)/n)))/nn(2/27) assuming n is positive. n(3191/189) Simplify (jj(-2))(-3/29)(j/(j/j*(-2))jj)47 assuming j is positive. j(3/29) Simplify (x(25/3)/x)/((x(21/4)x)/x)xx*(-1/4)(x/x(6/11))/x assuming x is positive. x(151/66) Simplify (o*(-3)o(-9/5))/(o3)(-30) assuming o is positive. o(426/5) Simplify (mm(-3/4))(-18/13)/(mm4)(-5/9) assuming m is positive. m*(569/234) Simplify (jj*(-6)/jj)*(-29)/(jjj(4/7))50 assuming j is positive. j(115/7) Simplify p(-2/27)/p(2/5)(p0)(1/12) assuming p is positive. p(-64/135) Simplify b3/b*(-32)b**(	{ "pile_set_name": "DM Mathematics" }
36151016j + 11241696? 36151016 Find the first derivative of -362820862d + 455329683 wrt d. -362820862 Find the second derivative of -2409579d2j*2s*2 - 24d*2js3 + 324dj2s*2 - 3ds + 2j*2s*2 + 3js3 + 4js - 71s*3 wrt d. -4819158j*2s*2 - 48js3 What is the first derivative of -7897587dk + 16172723k wrt d? -7897587k What is the second derivative of 45c*4n + 35465c4 + 6572611cn wrt c? 540c*2n + 425580c2 Differentiate 33643866g - 12778834 wrt g. 33643866 Differentiate 2h3m - 114548776h3 - 25h*2m + 5hm - 291m with respect to m. 2h*3 - 25h*2 + 5h - 291 What is the third derivative of l*5 - 9l*4 - 58596l*3 - 81382l*2 + l - 5? 60l*2 - 216l - 351576 Find the third derivative of -7485466s3 - 2s*2 - 665703. -44912796 Find the first derivative of -1530953c*2 + 13153471 wrt c. -3061906c What is the derivative of -2q3 - 3697q*2 - 7555q + 12199732? -6q2 - 7394q - 7555 Find the second derivative of d*4 + 7038d*3r - 598d2r + 5dr - d - 133r + 105828 wrt d. 12d*2 + 42228dr - 1196r What is the third derivative of -34975486q3 + 225643593q*2 wrt q? -209852916 Find the third derivative of -2017171n*4 + 2803824n*2. -48412104n Find the third derivative of -26789840y6 - 207850392y*2 wrt y. -3214780800y3 Find the second derivative of -b4 - 194640b3 - 6b*2 - 9127341b. -12b2 - 1167840b - 12 Differentiate -391443276w2 + 242642353 with respect to w. -782886552w What is the first derivative of -6160045f3t*4 - 21f*3 + 27f*2 - 2f - 2t4 - 33 wrt t? -24640180f*3t*3 - 8t*3 What is the second derivative of 87907v*3 - 319v*2 - 176293336v wrt v? 527442v - 638 Differentiate 111734al2 + 16al + 4823420l*2 with respect to a. 111734l*2 + 16l What is the derivative of -119412669u4 - 177255549 wrt u? -477650676u*3 Find the third derivative of 2196kr3t - 2kr*3 + 2kr2t - 30690krt + 63kr - 3r*3t + 272r3 - r2t + 3r2 wrt r. 13176kt - 12k - 18t + 1632 What is the first derivative of -2c*2h*3 + 92791965c*2h*2 - 247523658h*3 wrt c? -4ch3 + 185583930ch2 Find the second derivative of 6846316r*2 - 6258r - 1187 wrt r. 13692632 What is the first derivative of 9u4 - 909262u*2 - 48498401? 36u*3 - 1818524u What is the third derivative of -px3 + 1561440px2 - 304623x*3 - 35x wrt x? -6p - 1827738 Find the third derivative of 2203936k*5 + 5431976k*2 wrt k. 132236160k*2 What is the first derivative of -1608514q*3 - 15q*2 - 3q + 182186275? -4825542q2 - 30q - 3 What is the third derivative of 262186557z5 + 454375229z*2 + 1? 15731193420z*2 Find the first derivative of 4215bcz + 81109bz*2 - 11bz + 2cz2 + 526cz - c + 4z*2 wrt c. 4215bz + 2z*2 + 526z - 1 Find the first derivative of 2l2q - l*2 - 16363763lq + 2174003l - 9 wrt q. 2l2 - 16363763l What is the derivative of 3741814n4 + 875041 wrt n? 14967256n*3 Find the third derivative of 2k*3sz3 - 411842k*3s + 2k3z - 58981k2sz - 2ksz*2 + 5ksz - 3sz*3 + 2z*3 wrt k. 12sz3 - 2471052s + 12z Find the third derivative of 378p*4 - 10273p*3 - 6214635p*2 wrt p. 9072p - 61638 What is the third derivative of -452i4q + 3i4 + 6i*3q + 10i3 + i2q - 711i2 - iq + i - 9q - 110 wrt i? -10848iq + 72i + 36q + 60 Find the second derivative of -19068458k*2 - 29830185k. -38136916 Find the third derivative of -24k6 - 3379054k*3x*2 + 5k*2 - 11kx2 - 749x + 20 wrt k. -2880k3 - 20274324x*2 What is the third derivative of 6o*3p*3 - 4283236o*3r - 2275o2p*3 + 2o*2r + 969o2 wrt o? 36p*3 - 25699416r What is the second derivative of 3482c5 - 123c*3r*2 + 599cr2 + 16cr - 9r*2 wrt c? 69640c*3 - 738cr2 Find the first derivative of 66z*3 - 3z*2 + 2200z + 6514616 wrt z. 198z2 - 6z + 2200 Find the second derivative of -28167263n2 + 58612261n wrt n. -56334526 What is the first derivative of -7p3r - 89p3 + 67p*2r - 180p2 + 3pr + 2p - 63r + 6 wrt r? -7p*3 + 67p*2 + 3p - 63 Differentiate 7452af*2 + 1792af + 54788a + 446 wrt f. 14904af + 1792a What is the third derivative of -12nx4 + 15nx3 - 3nx2 - 44559nx + 7n + 164357x4 + 31 wrt x? -288nx + 90n + 3944568x Differentiate 6919847b + 8264601 wrt b. 6919847 Find the third derivative of -9807520i3 + 10i*2 + 9141i - 3 wrt i. -58845120 What is the derivative of -7393b2iw - 2b*2w + 23616673b2 + 5bi - 1167iw wrt w? -7393b*2i - 2b2 - 1167i Find the second derivative of u*2z*2 - 2u*2z + 18u2 - 55uz2 - 6uz + 3u + 52171z2 - 180z + 4 wrt z. 2u2 - 110u + 104342 Find the third derivative of -5b3f*2 + 502239b*3 - 24615b*2f*2 - 5bf2 wrt b. -30f*2 + 3013434 Differentiate -2i*4q + 167104i3q*2 + 22671q*2 + 2q - 3 with respect to i. -8i3q + 501312i2q*2 Differentiate -17644570k*3 - 6k*2 + 341878248 wrt k. -52933710k*2 - 12k Find the second derivative of 13207667s2 - 138554730s + 1 wrt s. 26415334 Find the third derivative of 186526r5 - 3r*4 + 16r*3 - 1223444r*2 + r + 4 wrt r. 11191560r*2 - 72r + 96 What is the second derivative of 322855a3 - 33a*2 - 446234229a? 1937130a - 66 Find the second derivative of 107734775a*4 - 2864a + 6990. 1292817300a2 What is the second derivative of 83473k4 + k3 - 3k2 + 475358k + 2? 1001676k2 + 6k - 6 Differentiate 191073020q - 508580193. 191073020 Find the second derivative of -211q*2s*2 - 18479q*2s - 12qs*2 - 60632q - 1 wrt q. -422s2 - 36958s Find the second derivative of -528890731w2 + w + 24250114 wrt w. -1057781462 Differentiate 1233jk2q - 194jkqt + jkt + 8k2q - 52835qt - t wrt j. 1233k2q - 194kqt + kt What is the first derivative of 2461fq*2z*2 - 3348fq2 - 4q*2z*2 - 2q*2z + q*2 + 150qz - 2z*2 - 20z wrt f? 2461q2z*2 - 3348q*2 What is the second derivative of -94859c*2i*2l - 582c2l*3 - cil3 + 37979i*2l*2 + 1177il3 wrt c? -189718i*2l - 1164l3 Find the second derivative of 104x*4 - 53628x*2 + 5x + 6704766. 1248x2 - 107256 What is the third derivative of -2055712ox3 + 2ox2 - 60ox - 11o - 3x3 + 63x*2 + 2x wrt x? -12334272o - 18 What is the second derivative of -6125551w*3 - 19880244w? -36753306w What is the third derivative of -10887858j*3 - 24634j*2 + 5j + 82? -65327148 What is the second derivative of 591c4 - 11c*3 + 29c*2 - 433204c - 35 wrt c? 7092c2 - 66c + 58 What is the first derivative of -519577x4 + 3x*2 - 5792148 wrt x? -2078308x*3 + 6x Find the second derivative of 2g3 + 6832348g*2 + 51201822g. 12g + 13664696 What is the second derivative of -61598804q*5v*2 - 32qv2 + qv - 2v2 + 2119v wrt q? -1231976080q3v2 Find the third derivative of m4 + 4461501m3 - 98455023m*2 + m. 24m + 26769006 Find the first derivative of -128648454r3w - 5627r3 - 4r*2 - 4r - 1 wrt w. -128648454r3 Find the third derivative of -142944912h*3z + 103h2z - 344875h2 wrt h. -857669472z Find the third derivative of 74c6y - 34161c6 - c2y - 2c2 + 11c + 2y - 8827 wrt c. 8880c*3y - 4099320c3 Find the second derivative of -14002g*5 - 11496g*3 - 16695857g. -280040g3 - 68976g Find the first derivative of -81123946k3y + k*3 + 49923566k wrt y. -81123946k3 Find the second derivative of -2815h*2ku2 - 2h*2ku + 90743hku*2 + 583hku - 2hk + 12796k - 2 wrt u. -5630h*2k + 181486hk Find the third derivative of 209923297ck*3 - 144ck2 + 3ck - 41c - 63k2 + 3k wrt k. 1259539782c What is the third derivative of -1170d*3f*2 - 41d*3f + 411d3 - 2d*2f*2 - 14401d*2 - df*2 + d - 4f*2 - 2 wrt d? -7020f*2 - 246f + 2466 What is the derivative of -4840s2 - 19765s - 412952716 wrt s? -9680s - 19765 What is the third derivative of 84617dy4 - 12dy3 - 1770845d - y*2 wrt y? 2030808dy - 72d What is the second derivative of -2522661g*4 +	{ "pile_set_name": "DM Mathematics" }
ded by o? 2 Suppose 2z - 4z = 6, 2f + 4z = 142. Calculate the remainder when f is divided by 16. 13 Let s be -1 - (3/(-1) + 0). Suppose -2n - 13 + 5 = -sk, 4k - 2 = -3n. What is the remainder when 4 is divided by k? 0 Let o = 38 - 14. Suppose -18r - 203 + 1877 = 0. Calculate the remainder when r is divided by o. 21 Let m be 1/(-31/(-6)). Suppose u + mu = 24. What is the remainder when 14 is divided by u? 6 Suppose 14x - 440 = 78. Calculate the remainder when 295 is divided by x. 36 What is the remainder when 177 is divided by (84/9 - -6)(3 + 0)? 39 Let z(i) = -37i*3 - i - 1. Let q(d) = d + 1. Suppose -2s + 0s = 4. Let x be q(s). What is the remainder when z(x) is divided by 19? 18 Suppose 2h = 2i + h - 36, h - 60 = -4i. What is the remainder when i is divided by 9? 7 Let t(r) = -12r - 2 + 3 - 7r. Calculate the remainder when 38 is divided by t(-1). 18 Calculate the remainder when 91/2 - ((-28)/(-8) + -4) is divided by 17. 12 Suppose 2v - 71 = 11. Suppose 3 = x + 24. Let y = x - -35. Calculate the remainder when v is divided by y. 13 Let n(w) = w3 + 6w*2 - 6w - 6. Let f be n(-6). Let d(q) = -q*2 + 4q + 1. Let a be d(5). What is the remainder when a/(-3)f/4 is divided by 4? 2 Let y be 34 - 0/(2/2). Suppose 2g - 4d = y, 19 = -3g + 4g - 4d. Calculate the remainder when 57 is divided by g. 12 Let j(l) = -l + 17. Calculate the remainder when 19 is divided by j(7). 9 Let j(f) = f*3 - 10f*2 - 12f + 16. Let h be j(11). Let k(m) = m + 12. Calculate the remainder when 48 is divided by k(h). 14 Suppose -24 = -3v - v. Suppose -5c + 8 = 2r - c, 5c = -5r + 15. What is the remainder when r is divided by 1/v + 15/18? 0 Let g be 6/(-4)(-20)/15. Suppose -5v = -7d + 4d + 94, -5d = -gv - 163. Calculate the remainder when d is divided by 17. 16 Let s(p) = 0 + 2 + 8p - 1 + 2p. Calculate the remainder when 32 is divided by s(1). 10 Let s(b) be the third derivative of 0b + 1/3b3 + 1/6b*4 + 2b*2 + 0. Calculate the remainder when 18 is divided by s(2). 8 Suppose 0 = 3x - x - 4. Suppose 4h - 68 = 4f, 26 = 4h - xf - 46. Calculate the remainder when h is divided by 10. 9 Suppose 212 = -2l + 6l. Calculate the remainder when l is divided by 11. 9 Let j(t) = -t*2 - 5t + 7. Let x(f) = 2f2 + 6f - 6. Let o(v) = 3j(v) + 2x(v). Calculate the remainder when o(7) is divided by 13. 11 Let d(f) = -f*3 - 2f2 - 4. What is the remainder when d(-4) is divided by 6? 4 Let b(w) = -w2 - 8w + 6. Let s be b(-8). Suppose sr - 20 = 2r. Calculate the remainder when 9 is divided by r. 4 Let p(q) = q3 - 8q*2 + 6q - 12. Suppose 0m = 4d - 3m - 27, -4d - 8 = 4m. Suppose -dc = -15 - 9. Calculate the remainder when p(c) is divided by 19. 17 Let x(v) = v*2 + v + 7. Let m = -5 - -7. Suppose 7u = mu. Calculate the remainder when 13 is divided by x(u). 6 Let p be (0 + -1 - -2) + 0. Let n = 1 - p. Suppose 58 = -nu + 2u. Calculate the remainder when u is divided by 10. 9 Let v(y) = -y - 9. Let d be v(-9). Let n(u) = d + u - 4 - 3u. Calculate the remainder when 14 is divided by n(-6). 6 Let r be -3 - 3(-39 - 2). Suppose n = -2a - 4n + 140, -5n - r = -2a. What is the remainder when a is divided by 17? 14 Suppose 0 = 4x + 26 - 10. Let h = 5 - x. Calculate the remainder when h is divided by 6 + 0 + (-1 - 0). 4 Calculate the remainder when (2/3)/(7/504) is divided by 25. 23 Let b = -56 + 67. What is the remainder when 19 is divided by b? 8 Let w(i) = -4i + 9i2 + 0 - 12 + 2 - i3 - 2i. Calculate the remainder when 15 is divided by w(8). 3 Suppose -r + 24 = -2z - 5r, -9 = -3z + 3r. Let h = z + 3. What is the remainder when h + (-1)/(3/(-9)) is divided by 3? 1 Suppose -1 + 0 = -j. Let f be 3/(-9)j6. Calculate the remainder when 8 is divided by (-38)/(-8) + f/(-8). 3 Let b(f) = f2 - 13f - 32. Let j(h) = h*2 + 2h - 1. What is the remainder when j(-9) is divided by b(16)? 14 Let g = -3 + 2. Let k = 7 + g. Suppose -33 = -kn + 3n. What is the remainder when 20 is divided by n? 9 Suppose -p - 7 = -4u + 3u, -5p - 29 = -3u. Let w = 6 - p. What is the remainder when 29 is divided by w? 9 Suppose 3m - 399 = 4q, 2q - 4q = -3m + 393. Calculate the remainder when m is divided by 44. 41 Let o(a) = -a3 + 10a*2 - 7a - 9. Let x be o(9). Suppose 0 = j - 0j - x. Let d = j + -3. Calculate the remainder when 17 is divided by d. 5 Suppose -r - 63 = -4c, c + 3c - 60 = 4r. Calculate the remainder when 60 is divided by c. 12 Suppose 6i = 2i. Suppose -4g = -2b - 5 - 3, 5b = i. Suppose 4n - 2t + 2 = 0, -5n - t + 15 = -0t. Calculate the remainder when g is divided by n. 0 Let z = -41 - -44. Calculate the remainder when 7 is divided by z. 1 Suppose 2f = 58 + 20. Calculate the remainder when 115 is divided by f. 37 Suppose -5x = -65 + 20. Suppose x = 3b - 15. What is the remainder when b is divided by 3? 2 Let a = 942 + -657. Suppose 21 + a = 6z. Calculate the remainder when z is divided by 14. 9 Suppose -3t + 3i = -3, 3t + 0i = -2i - 17. Calculate the remainder when 39 is divided by t - 2(-51)/6. 11 Let a(h) = h3 + 2h*2 - 4h + 4. Let q be ((-4)/4)/((-2)/6). Suppose qb = 42 + 15. Calculate the remainder when a(3) is divided by b. 18 Let r = 3 - -7. Let u = r + -1. Calculate the remainder when (0 + -17)(-1 - 0) is divided by u. 8 Let c = 87 + 148. Suppose -2r + c = 3r. Suppose 3v - b - 9 - 44 = 0, 2b = -3v + r. What is the remainder when 49 is divided by v? 15 Let c(a) = -a2 - 6a - 7. Let j be c(-5). What is the remainder when (3/9)/(j/(-156)) is divided by (14/5)/(1/5)? 12 What is the remainder when 20 is divided by (-8 - -2)/(-18)15? 0 Let i(c) = 3c*2 - 2c - 1. Let h be i(2). Let t = 9 - h. Suppose 2r + 8 = 4r. Calculate the remainder when r is divided by t. 0 Suppose 33 + 37 = 2s. Let p(y) = 2y*3 - 4y*2 + y - 3. What is the remainder when s is divided by p(3)? 17 Suppose -6 = 3k - 24. What is the remainder when 9 is divided by k? 3 Let a be 0/(-2) - (-1 - 0). Let d be a/(-2)2-1. Let u(s) = 3s3 + 2s - 1. What is the remainder when u(d) is divided by 3? 1 What is the remainder when 51 is divided by (-2)/(-1) + (-25)/(-1)? 24 Suppose t - 4t = -4b + 10, 5t - 5b + 15 = 0. Calculate the remainder when t/(4/(-6)) - 1 is divided by 1. 0 Let p(a) = -7a2 - 4. Let v be p(3). Let n = v + 21. Let r = -31 - n. Calculate the remainder when 28 is divided by r. 13 Suppose -3t = 2b - 16, -20 = -b - b - 5t. What is the remainder when 20 is divided by b? 0 Suppose -14 + 4 = -2p - 4l, -p + 6 = 3l. Let u be (3/p + 2)1. Suppose 4f - 11 = -3w, -uf - 2 - 10 = 0. Calculate the remainder when 26 is divided by w. 8 Let n be (-12 - -24)/(-2 - -4). Let u = 4 + 9. Calculate the remainder when (29 - 4)/(3/n) is divided by u. 11 Let v = 16 + -2. Suppose m - 4u = 24, u = -4m + 196 - 32. Calculate the remainder when m is divided by v. 12 Let d(k) = -k + 34. Let l(p) = 0p - 2 + p*2 + 0p*2 + 0p + p. Calculate the remainder when d(0) is divided by l(4). 16 Let v = 10 + -7. Let r = 10 - 1. Calculate the remainder when r is divided by v. 0 Let q(p) = 3p2 - 3p. Let f(h) = 3h - 4. Let v be f(3). Let t(r) = r2 - 2r - 5. What is the remainder when t(v) is divided by q(2)? 4 Suppose a + 3y = 0, -y = 3a - 5a + 21. Suppose 6s = 4s + 48. Calculate the remainder when s is divided by a. 6 Let v(o) = o3 - 9o*2 + 4o - 1. Let u be (-38)/(-4) - (-1)/(-2). Calculate the remainder when v(u) is divided by 9. 8 Suppose 4p - 66 = 78. Let v = 80 - p. What is the remainder when v is divided by 23? 21 Let s = -8 - -13. Calculate the remainder when 22 is divided by s. 2 Suppose 16 = q - 1. Let i be (-1)/(-4) - 2/8. Suppose i = -2k - 2k + 24. What is the remainder when q is divided by k? 5 Let z = 12 + -18. Suppose c = 5w + 3 + 3, -4w - 30 = -5c. Calculate the remainder when (60 - c)(-4)/z is divided by 13. 10 Calculate the remainder when (-2)/4(-76 + 0) is divided by 11. 5 Let z(g) = 2g2 + 1. Calculate the remainder when 3 is divided by z(-1). 0 Suppose -m + 0m = -6. Let p = m - 3. Suppose -3j = 4f - 23 - 12, -2f + 31 = pj. What is the remainder when 34 is divided by j? 7 Suppose 3c + 26 = 4r, -3r + 3 + 2 = 5c. Let t be 1 + -2 - (-36)/(-3). What i	{ "pile_set_name": "DM Mathematics" }
+ kd + h and give u. 936 Express (0k2 - k2 + 0k2)(-k + 2 - 2)((-2 + 0 + 3)(-90 - 97 + 19) - 5 + 2 + 1) in the form ik2 + gk*3 + t + ok and give g. -170 Express -154f + 102f + 732f + 898f + 219f in the form kf + v and give k. 1797 Express b*3 - 4b - 4200 - 3b3 + 4202 in the form nb + yb2 + c + rb*3 and give r. -2 Rearrange (68x + 34x - 40x)(6x - 3x + 2x)(-4 + 5 + 0)(1 - 4 + 1) to the form f + rx2 + yx and give f. 0 Express -20y2 + 6y - y*3 + 9y2 + y2 + 6y2 + 2y*3 in the form jy*2 + qy + ky3 + a and give j. -4 Express 412l*2 - 23l*2 + 316l2 - l2 in the form dl2 + kl + t and give k. 0 Express -586 + 1177 - 591 + 138f2 in the form n + wf + qf2 and give q. 138 Rearrange ((-3x + x + 3x)(0 + 2 - 3) + 24 + 1 - 8x - 13)(x + 3x - 5x) to the form ox2 + fx + y and give y. 0 Express 342a2 + 3 + 455a*2 - 3 as b + sa*2 + na and give s. 797 Rearrange ((-t + 0t + 3t)(1 + 2 - 4) - 2t - t - t + (-4 + 4 - 2)(-2t - 2t + 2t))(4t + 3t - 3t) to the form q + wt + vt*2 and give v. -8 Rearrange (-3o*3 - 3o*3 + 20o*3)(-19 + 19 + 13o) to co*4 + do*2 + n + zo + io3 and give c. 182 Rearrange 135c*2 + 124c*2 + 144c*2 - 127c*2 to oc*2 + jc + w and give w. 0 Rearrange 0c2 - 26 + 39c - 36c - 2c*2 to pc*2 + u + ac and give u. -26 Rearrange 1 + 2n - 21n*2 - 1983n*3 - 1985n*3 + 3969n*3 to xn + tn2 + z + cn*3 and give t. -21 Express 40i*2 - 2i - 115i2 + 4i - 52i2 - i as oi*2 + vi + r and give o. -127 Rearrange 6 - v*3 - 12 + 6 - 2v*2 + 3 + 6v - 1 to qv3 + xv + rv2 + t and give t. 2 Express 2w*4 - 2w3 + 529 + w2 + 7w - 542 + 0w*3 + 2w*3 in the form tw*4 + iw + aw3 + gw*2 + q and give t. 2 Rearrange -44 + 38 - 50 - s - 48 + 3s to l + hs and give h. 2 Express 2r*3 + 28r*3 + 28 - 26 - 11r*3 + 30 - 30 + (-r - 4r + 3r)(0 - r*2 + 0) in the form nr*3 + y + qr*2 + tr and give n. 21 Express -2h4 + 1 + 124h*3 - 2h - 2h4 - 108h*3 + 74h*3 in the form lh*2 + gh + th3 + jh*4 + r and give j. -4 Express -3j*3 - 2j*2 - 6j*2 + 4j*2 + 16j*2 - 1 + 19j*3 in the form xj + dj2 + zj*3 + i and give d. 12 Express (-1 + 2 + 4)(d + 0d - 3d)(2d + d + 40d) + (2d - 3d + 0d)(3d - d - d) in the form ud2 + h + id and give u. -431 Rearrange (-2 - 3 + 2)(1 - 1 + a3) + (-96a*2 - 64a*2 - 77a*2)(-3a - a + 6a) to da + w + ka*3 + za*2 and give k. -477 Express 844l*2 - 2l + 2l - 843l*2 + 3 as m + ol*2 + kl and give o. 1 Rearrange -4k + 4k - 760k2 - 553k*2 + 456k*2 to t + bk*2 + lk and give b. -857 Rearrange (0a3 - 2a*3 + 0 - 1)(-2a - 7a + 5a) to ha*4 + ra*3 + ca*2 + n + ya and give y. 4 Rearrange -45i + 0 - 3i*2 + 5 + 40i to the form c + pi2 + mi and give m. -5 Rearrange 125 - 125 + 20z3 + (-4 + 0 + 3)(z*3 + 1 - 1) - 96z*3 + 470z*3 - 239z*3 to the form kz + u + bz3 + vz*2 and give k. 0 Rearrange -12133q*2 - 37q - q*4 + 12131q*2 + 0 - 2 to the form l + cq*3 + pq + zq4 + dq*2 and give l. -2 Rearrange (0 + 1 + 1)(15 + 8 + 627w + 8 - 31) to u + iw and give u. 0 Express 1989b + 510 - 997b - 989b + (-2 - 4 + 5)(0b + 4b - 5b) as h + zb and give z. 4 Express -25 - p2 - p2 - 10p - 16 + 62 + p2 as sp + fp2 + a and give s. -10 Rearrange -6t*2 + 9014t - 2t3 - 8799t + 4t2 to the form rt*3 + ft*2 + l + qt and give f. -2 Express (y - y*2 - y)(-16y + 3 - 3 + 436y) as v + by3 + oy*2 + zy and give b. -420 Rearrange 0q3 + 3q*3 - 2q - 13q2 + 6q - q + 7q2 to uq + lq3 + jq*2 + k and give j. -6 Express -2w*2 + 0w + 0w + (24w - 27w - 96w)(4w + 2w - 4w) as ow + p + rw2 and give r. -200 Express -o3 - 3o4 + 106 + 23o*2 - 108 + 2o*4 as ao*3 + uo + h + mo2 + io*4 and give h. -2 Express 0 + 75g*2 - 157g*2 - 38g*2 - 1 as qg + ag2 + p and give a. -120 Express 4n*3 - 14n*2 - 1 + 6n*3 - 12n*3 + 0 + 6n*3 - 3n as sn + qn*2 + i + yn*3 and give q. -14 Express -45h*2 - 2h*2 + 2h + 36 - 36 as sh2 + mh + v and give s. -47 Rearrange (-2 - 3 - 9)(q + 8 - 8)(3 - 4 + 0)(1 - 5 + 1)(1 + 0 + 1)(-q + 1 - 1) to aq + mq2 + k and give a. 0 Rearrange (-d + 3 - 3)(3d2 - d2 - 5d*2)(-18 - 11 - 11) to the form p + md3 + qd + td2 and give m. -120 Rearrange (-5t - 3t + t)(6t + 3 - 9t - 7) to the form yt + p + ut2 and give u. 21 Rearrange q4 - 1374 + 6q4 + 1382 - q3 - q2 to i + vq*2 + kq*3 + zq + dq4 and give v. -1 Express 36j*4 - 145j*4 + 3573j*3 - 3575j*3 - 4j + 2j + 2 as bj*3 + g + xj*4 + rj + lj2 and give x. -109 Rearrange -1 - 46l + 39l - 3l*3 - 2 + 3 to the form cl*3 + tl + v + jl2 and give t. -7 Express 5n + 5n + 98 + 6n - 15n as on + j and give j. 98 Rearrange -2 + 8a3 + 4 - 8 + 4 - 7a to the form ra + ia*2 + ka*3 + w and give w. -2 Express -124 + 71 + 65 - 3s3 - s2 as bs2 + hs + rs3 + q and give r. -3 Rearrange (3u + 1 - 1)(-213u*2 + 30u*2 - 51u*2) to pu*2 + lu*3 + k + hu and give l. -702 Rearrange -8 + 4s + 4 - 17 + s to v + ps and give v. -21 Express (-1 - 1 + 0)(-p2 + 3p*2 - 3p*2)(182186 - 182186 + 922p) as rp + o + ap2 + cp*3 and give c. 1844 Express (-1 + 1 - x)(2x3 - 3x*3 + 0x*3) + (-2x + 2x + x2)(-x*2 - 10x*2 + 2x*2) in the form lx + t + ax3 + dx*2 + px*4 and give p. -8 Express (21505 - 21505 - 603f)(4f - f - 5f)(-3f + 6f - 2f) as bf*2 + if + df3 + l and give l. 0 Express -w2 + 3w - 3w + (-3w + 14 - 14)(2w - 2w + 2w) + 2w2 - 13 - w2 - 3824w + 3823w in the form tw*2 + vw + c and give t. -6 Express -3z + z2 + 1234 + 4z - 1459 as sz + fz*2 + v and give s. 1 Rearrange 8p + 35 + 11p - 15p to x + wp and give x. 35 Rearrange (-1 - 1 + 3)(23 + 32 - 15)(-19t*2 + 2t*2 + 4t*2) to the form r + ct*2 + pt and give r. 0 Express (-3 - 3 + 4)(38s + 82s - 25375 + 25375) in the form cs + o and give c. -240 Rearrange (-1 + 1 - 3i)(-2 + 2 + 2i2) + 24947i*2 - 24947i*2 + 151i*3 + 2i to ki3 + z + pi + ti2 and give p. 2 Rearrange (-37t*3 - 989t*3 - 1093t*3)(-1 - 3 + 2) to the form mt2 + u + at + gt3 and give g. 4238 Rearrange 4a - 8a - 283a*3 - 1 + a + 3a to ba + f + ya*3 + ra*2 and give f. -1 Express 2 - 12j*3 + 6j*2 - 14j*4 - 17j*3 + 2j + 27j3 + 5j*4 in the form fj*3 + lj*4 + mj + n + sj2 and give f. -2 Express (-10 + 12n + 10)(2n*3 - 3n*3 + 4n*3) + (-4 - 1 + 1)(5n4 - 3n*4 - 4n*4) in the form wn*2 + pn + jn3 + k + hn*4 and give h. 44 Express 219x*2 - 62x*2 - 14x*2 + 165x*2 in the form sx + t + ox2 and give o. 308 Express -2r*2 + 0 + 9r*3 - 8 + 5 - 3 as wr*2 + ar + mr3 + q and give q. -6 Express 3081j*2 - 3573j*2 - 2 + 0 as fj*2 + aj + o and give o. -2 Express -v*4 + 2v*4 + 0v*4 + (33v - 378v + 37v)(-2v*3 - 5v*3 + 4v*3) as bv*3 + dv*4 + q + iv + yv2 and give d. 925 Express -2m*2 - 5 + 555m*3 - 292m*3 - 3m - 269m3 as om*2 + n + hm*3 + bm and give b. -3 Express -29f + 12 + 7 - 21 in the form of + k and give k. -2 Rearrange -14 - 7 + 11d2 + 18 + (-1 - d + 2 + 0)(d + 4 - 4) to ud + id*2 + q and give i. 10 Rearrange (-3 - 1 + 3)(3s2 - 7s*2 + 3s*2) + (4s - s - 2s)(-60s - 34s - 15s) to x + ps + ys2 and give y. -108 Rearrange (-3g + 0g + 2g)(10 - 32 - 406) to mg + f and give m. 428 Express 53 - 101 + 820i + 48 as wi + l and give w. 820 Rearrange -3v3 - v4 - 2v - 14v3 - 11v*3 + 2v3 + v2 + 11v3 to kv*3 + m + tv*4 + yv + bv2 and give b. 1 Rearrange 7d + 2527d2 - 4d*4 - 5069d2 + d3 + 2537d2 to the form fd*2 + yd*4 + a + md + sd3 and give s. 1 Express -7z - 1379z3 + 3z + 1407z3 in the form oz + y + wz2 + nz3 and give n. 28 Rearrange -x4 + 13997x3 - 1 - 8x2 - x2 - 13998x3 - x2 - 7x + 2 to fx2 + tx + mx4 + yx*3 + l and give t. -7 Rearrange ((-11l - 10l - 15l)(-2 + 3 - 2) + 0l - 6l + 4l)*(1 + 1 - 3)	{ "pile_set_name": "DM Mathematics" }
: -10 or y? y Let d(f) = f*2 - 2f - 25. Suppose 0 = -32x + 35x + 18. Let g be d(x). Suppose 5v + 21 = -3w, 0v = 5v + 4w + g. Which is bigger: -2 or v? -2 Let b = 20421 + -428843/21. Is -0.153 less than b? True Let d = 6577.595 - 6578. Which is smaller: d or 8? d Let w(o) = 35o + 565. Let x be w(-17). Let c be 22350/(-40). Are x and c non-equal? True Let c = 11741 - 11742. Is c < -11/907? True Let v = 84 - 84. Suppose -5o = -5j - 70, vj = -4j + 16. Suppose -b = -10b + o. Which is bigger: 3/5 or b? b Let l = -5.985 - -6. Let k be (-5 - -1)((-147)/(-150) + -1)5. Which is smaller: l or k? l Let g = 283 + -235. Let m = -206 + g. Are m and 0 unequal? True Let v be (3353/(-35))/((-24)/(-5) + -5). Is v at least as big as 473? True Let y be 1(-5 + 0) + 108953/6032. Is 12 at least as big as y? False Suppose 2 = -27z + 29z. Suppose 3l - z = 5. Suppose 0 = 2o + lo - 48. Which is smaller: o or 25/2? o Suppose -f = 922 + 2140. Let p be (-2700500)/882 - (-2)/(-9). Let n = p - f. Do -1 and n have different values? True Let r(q) = 15q - 26. Let i be r(2). Let n(h) = -h*3 + 6h*2 - 3h - 18. Let j be n(i). Which is bigger: j or 14/11? j Let m(t) = -t*2 + 26t - 19. Let a be m(25). Suppose -n + 0 - a = 3c, 24 = -3n - 3c. Is n greater than -11? True Let o be (-2)/(-3)(442 + -16). Let a = 325 - o. Is a less than 40? False Suppose n + 3m - 14 = 0, -4n = n - 5m - 10. Suppose -40 = -3v - 5j, -22 = 4v + nj - 67. Suppose 17l - 18l - v = 0. Is -5 less than l? False Let r(t) = 2t*2 + 1173t - 14. Let s be r(17). Which is smaller: 20504 or s? 20504 Let n = 9.293 - 9.3. Let j = 125.993 - n. Let o = -126.5 + j. Do o and 1/3 have the same value? False Let d(u) = u*2 - 5u + 5. Let q be d(4). Let l = q - 2. Let x = -450 - -449.94. Is x at most as big as l? False Let s = -0.15 - 0.55. Let q = s - -0.5. Let b be (-19)/((-19)/21) + (-8)/2-1. Is b at least q? True Let g(m) = 2m*3 + 45m*2 - 31m + 58. Let c be g(-23). Suppose 0 = -a - c + 293. Which is greater: a or 59? 59 Suppose -u + 10u - 18 = 0. Let z be (0 - u)3/(-6). Which is smaller: -67 or z? -67 Let q = -23/3 + 8. Let o(v) = 5v - 77. Let k(x) = -x + 13. Let p(j) = -34k(j) - 6o(j). Let u be p(-5). Which is smaller: q or u? u Let x be (4/(-3))/((10/225)/((-23)/(-345))). Which is greater: x or -102/67? -102/67 Let q be 1038/(-21) + 4/(-7). Let v be -11 + 13 + q/21. Let l be (-608)/(-532) + (-2)/14. Which is smaller: l or v? v Let o be 4 - 671 - ((1 - -1) + -2). Which is bigger: o or -669? o Let b = -2054 - -2093. Which is smaller: b or 119/3? b Let c = 0 + 3. Let w = -2.1936 - -2.2306. Which is greater: c or w? c Suppose -3s + n = -964, -2s + 0s + 626 = -4n. Let v be ((-6)/8)/(s/(-228)). Do v and 2 have the same value? False Let v be (36/(-1449))/(5/(-5)). Is 1 > v? True Suppose -9g + 13g = 5b + 944, 5b - 211 = -g. Let d be 1/(-2) - (-99)/g. Which is smaller: 5 or d? d Let x = 95 - 111. Let b = x + 13. Let h be b/4 - 345/(-120). Which is greater: h or -43? h Let y = 837 + -854.4. Which is greater: 1/11 or y? 1/11 Suppose 5k - 5o = k, 2k + 5o = 0. Let y be 4/(-3) - (2/(-6) - k). Which is smaller: -32 or y? -32 Let l be (-6 - (-5 - 1)) + 32 + 5. Is -36 <= l? True Suppose -123y = -4586 - 17677. Which is greater: 77 or y? y Let j(r) = -r3 - 10r*2 - 129. Let b be j(10). Which is smaller: -2130 or b? -2130 Suppose -54b = 92b - 32b - 19494. Let d = 11 + 161. Which is bigger: d or b? d Let m(p) = -p*3 + 15p*2 - 2p + 16. Let v be m(15). Let c be 0/17/v. Which is greater: 5/39 or c? 5/39 Let o(r) = r3 - 25r*2 - 25r - 17. Let t be o(26). Suppose 9q - 6q - t = 0, -2l = 4q - 14. Which is greater: -0.3 or l? l Suppose -4 = 2y - 4p, 0 = 2y + 4p + 1 - 13. Let i be 1/(4/24y). Let k = -597 - -597.3. Is i greater than k? True Let n be (-6 + -1)/(-5(-10)/(-1050)). Suppose -3t = -4s - t + 182, -4s - 5t = -n. Are 41 and s equal? False Let s = -2526 + 5706. Is s at most as big as 3180? True Suppose -5o = q + 190, 0 = -8q + 3q - 2o - 1019. Is q greater than or equal to -213? True Let q = 13735 + -13562. Which is greater: -0.4 or q? q Let p(t) = -t*3 - 4t*2 + 9t + 9. Let g be p(-6). Suppose 6066 = 24l - 2694. Let a = l - 339. Is g bigger than a? True Suppose -p = z + 1, -4p = -2z + 4z - 6. Suppose -10 = py - 3f + f, 0 = -3y + 3f - 6. Let m be (9/(-30))/(y/8). Which is greater: -3 or m? m Let w be (10/10)/(24/(-24)). Is 5/252 not equal to w? True Let l = -573 + 594. Suppose -ln - 1517 = 3796. Is n bigger than -254? True Let q = -272 - -274. Suppose -v + 5 = 0, -4c = -qv - v + 43. Is -4 at least as big as c? True Let q = 124 + -125. Let g be (-1246)/(-616) - (1 + q + 2). Let k = 12 + -12. Which is greater: g or k? g Let v = 74 + -182. Let t = v + 115. Let z be -28 - (3 - -1 - t). Is z < -13? False Let w = 0 + -1. Let c = -0.04461 + 33.04461. Is c smaller than w? False Let a(g) be the first derivative of -g*4/4 + 2g*3 + 3g*2 + 6g + 12. Let n be a(7). Let m be (-25)/19 - 0 - n. Which is smaller: 1 or m? m Suppose -r - n = -0n + 6, -9 = 4r + n. Let g be 3 + -4 - (r + 3). Let i be g + (3/(-18))/((-1)/29). Which is smaller: i or 3? i Let c(s) = 255s - 538. Let i be c(3). Which is bigger: 3 or i? i Let m = 968 - 282. Let c(s) = 684s*2 + 530s - 528. Let j be c(1). Is m >= j? True Let r(t) = t*3 + 4t*2 - 13t - 10. Let a be r(-6). Let f(s) = -s*3 - 3s*2 + 3s - 6. Let i be f(a). Let z be (i + 10/(-5))/19. Is 0 not equal to z? True Let s(f) = -57f + 2112. Let r be s(-4). Are r and 2340 equal? True Let z be ((-1)/(-19))/(1/(-2)). Let k = -120 - -152. Suppose ks + 40 - 8 = 0. Which is smaller: s or z? s Let a(o) = -o*2 + 26o + 84. Let t = -491 + 520. Let w be a(t). Let n = -2244 + 29142/13. Is w != n? True Suppose 3y = -2q - 2, -4q - q = -y - 12. Let a be (-2 + 15/6)(2 - q). Suppose 0 = u + 5o - 11, 4o - 8 = -ao. Does u = 2/93? False Suppose 8p - 3p = -4z - 42, 2p = -5z - 61. Let n(v) = -3v + 7. Suppose -16 = -r + h - 7, 0 = -3r + 5h + 33. Let d be n(r). Is d >= z? True Suppose -539 = -2c + 3p + 723, 0 = -c - 4p + 620. Is 629 < c? False Let w be 2/(-1)66/12. Let o = -2 + 106. Let u = -115 + o. Is u at least as big as w? True Let i = -296 + 310. Which is bigger: -142 or i? i Let j = -224 - -218. Let l be 28/((220/(-30))/(4/j)). Is l not equal to 2? True Let l(n) = -2n - 91 - 2n + 222. Let o be l(33). Which is smaller: 3/70 or o? o Suppose -15r + 279180 = -7r + 14r. Which is smaller: r or 12689? 12689 Let c be 4/((22/4)/(-11)). Suppose 3i - 2u - 9 = -23, i + 3u - 10 = 0. Let y be 2/(i + (-5)/(-3)). Which is smaller: y or c? c Let a = -156554221171/695638595547 + 1/109325569. Let r = a - -2/707. Which is smaller: r or 4? r Let i be (7/((-42)/3))/(5/(-26)). Which is greater: i or 2/107? i Let k = -2599 + 2721. Which is smaller: 2/15 or k? 2/15 Let f be -1 + (264/(-220))/(9/255). Which is greater: -118 or f? f Let a be (14 - (-646)/(-38))/(106/78). Which is smaller: a or -3? -3 Suppose -5 = -4v + 5v. Suppose -a = -6a + s + 121, 0 = -2a + 2s + 50. Suppose -a = 5l - r, -2l + 6r - 7 = 3r. Do l and v have the same value? True Let t(o) = -o*2 - o + 11. Let x be t(-10). Let p = 18504 + -18585. Is x not equal to p? True Let d = -11 - -8. Suppose 4g - 113 + 185 = 0. Let u be 5 + 69/g - 5. Which is smaller: u or d? u Let o(h) = -h3 + h2 + 6h - 1. Let u be o(5). Let f = 784 - 780. Let i be 3/f + 8/(160/(-1415)). Which is bigger: i or u? i Suppose 2i + 3f + 315 = 0, 5i - 23f = -28f - 775. Which is bigger: i or -148? -148 Let j be (3 - 1546) + (-45)/(-63)7. Are j and -1533 unequal? True Let z be 0 - (-3)/(-1) - (-20 + 10). Suppose -zi + 280 - 245 = 0. Are 7 and i equal? False Let w = -8.1 + -2.6. Let n = -45 - -34.4. Let b = w - n. Which is smaller: b or -2/19? -2/19 Let k be 4(21/6 + -4). Suppose -o - 11 = 3b, 8 = 3b + 2o + 21. Let h be (k/b)/((-6)/(-297) + 0). Is 33 greater than h? False Let n(l) = -l*2 + 19l + 21. Let q be n(20). Let f(o) be the first derivative of -32o3/3 + 2o*2 - o - 6. Let s be f(q). Is -27 > s? True Let x = 415 + -405.22. Let p = 0.78 - x. Let h = 2.6 - 7.6. Is p greater than or equal to h? False Suppose -399t + 404t - 12045 = 0. Suppose ts - 2407*	{ "pile_set_name": "DM Mathematics" }
tor of 880 and 1567940. 220 Calculate the highest common divisor of 134530 and 242. 22 Calculate the greatest common divisor of 13087 and 23. 23 What is the highest common divisor of 60650 and 19150? 50 What is the greatest common factor of 2362806 and 18? 18 Calculate the greatest common factor of 104142 and 3060. 102 What is the greatest common factor of 105 and 15099? 21 What is the greatest common factor of 9 and 57240? 9 Calculate the highest common factor of 17 and 11176888. 17 What is the highest common factor of 95802 and 1050? 42 Calculate the highest common factor of 890 and 4272. 178 Calculate the highest common factor of 34750 and 500. 250 Calculate the highest common divisor of 80 and 44816. 16 What is the highest common factor of 64572 and 44? 4 What is the highest common divisor of 2 and 5652? 2 What is the highest common factor of 33376 and 14900? 596 Calculate the greatest common divisor of 1066 and 56810. 26 What is the highest common factor of 513 and 11647? 19 What is the highest common divisor of 13967 and 27? 1 Calculate the highest common divisor of 2223 and 20691. 171 Calculate the greatest common divisor of 5592 and 111141. 699 What is the highest common factor of 128298 and 96? 6 What is the highest common factor of 78 and 797979? 39 Calculate the highest common factor of 20 and 27950. 10 What is the highest common divisor of 16 and 516564? 4 What is the highest common divisor of 55420 and 680? 340 What is the greatest common divisor of 72640 and 720? 80 Calculate the highest common divisor of 122 and 7042511. 61 What is the highest common factor of 18791 and 133? 19 What is the greatest common divisor of 37009 and 280833? 2177 What is the highest common divisor of 4489 and 25393? 67 Calculate the greatest common factor of 465 and 4476245. 155 What is the highest common divisor of 705 and 303? 3 Calculate the greatest common divisor of 18 and 6614. 2 Calculate the greatest common factor of 13248 and 171. 9 What is the highest common divisor of 100284 and 8418? 366 Calculate the greatest common divisor of 3337992 and 111. 111 What is the highest common factor of 144 and 15648? 48 What is the greatest common divisor of 7565 and 2550? 85 What is the greatest common divisor of 1225 and 8036? 49 Calculate the highest common divisor of 54 and 831114. 54 Calculate the highest common factor of 22671 and 99. 99 What is the greatest common divisor of 624 and 5239? 13 Calculate the greatest common divisor of 17 and 132243. 17 Calculate the greatest common factor of 631495 and 53. 53 What is the greatest common factor of 43512 and 2590? 518 Calculate the greatest common factor of 832 and 12. 4 What is the greatest common divisor of 296 and 86664? 8 What is the greatest common divisor of 245 and 20531? 49 What is the greatest common divisor of 6372714 and 114? 114 What is the greatest common divisor of 708 and 541620? 708 Calculate the greatest common factor of 26 and 1079. 13 Calculate the greatest common factor of 18736 and 224. 16 Calculate the highest common divisor of 515350 and 1650. 550 What is the highest common factor of 53743 and 2899? 223 What is the greatest common divisor of 183340 and 267? 89 Calculate the highest common factor of 335 and 5360. 335 Calculate the highest common factor of 95364 and 216. 108 Calculate the greatest common divisor of 4800 and 2280. 120 Calculate the highest common factor of 4625 and 17875. 125 What is the greatest common divisor of 4750 and 35? 5 Calculate the greatest common factor of 63 and 47691. 63 What is the greatest common factor of 1384 and 458796? 692 Calculate the highest common divisor of 34338 and 388. 194 What is the highest common factor of 9936 and 714288? 1104 Calculate the greatest common divisor of 192 and 4273728. 192 What is the greatest common factor of 34080 and 96? 96 What is the greatest common factor of 10 and 141730? 10 Calculate the greatest common factor of 96373 and 119. 17 What is the highest common divisor of 9 and 2821977? 9 Calculate the highest common divisor of 4385 and 1246217. 877 What is the highest common divisor of 19075 and 19838? 763 What is the greatest common divisor of 5605 and 1830593? 1121 Calculate the highest common divisor of 54 and 118866. 6 Calculate the greatest common factor of 558 and 4465116. 558 What is the highest common factor of 30044 and 56? 28 What is the greatest common factor of 77 and 4535839? 77 Calculate the greatest common factor of 258 and 7122. 6 What is the greatest common factor of 14136 and 105772? 124 What is the greatest common factor of 485 and 404102? 97 Calculate the highest common factor of 441 and 22323. 21 What is the greatest common divisor of 81875 and 500? 125 What is the highest common factor of 30199 and 1394406? 1313 Calculate the greatest common divisor of 4 and 30068. 4 Calculate the greatest common divisor of 149925 and 75. 75 What is the highest common factor of 6305 and 217765? 485 Calculate the greatest common divisor of 1820 and 469. 7 Calculate the greatest common factor of 24 and 2913. 3 Calculate the highest common divisor of 53 and 2442452. 53 Calculate the greatest common factor of 8806 and 230860. 238 Calculate the greatest common factor of 298 and 4058. 2 What is the highest common factor of 1914 and 178200? 66 Calculate the highest common factor of 1736 and 485212. 868 What is the greatest common divisor of 15312 and 7986? 66 Calculate the greatest common divisor of 77985 and 105. 15 Calculate the highest common factor of 58026 and 152. 38 What is the highest common divisor of 443745 and 4275? 855 Calculate the greatest common divisor of 199830 and 2580. 30 What is the greatest common factor of 768 and 379992? 24 What is the greatest common factor of 15622 and 1679? 73 Calculate the greatest common factor of 119 and 43876. 7 Calculate the highest common divisor of 9 and 84345. 3 Calculate the highest common factor of 8 and 28460. 4 Calculate the greatest common factor of 55943 and 4042. 43 Calculate the highest common divisor of 9360 and 143676. 468 What is the highest common divisor of 41635 and 55? 55 What is the greatest common divisor of 1848 and 97482? 462 What is the highest common factor of 12169 and 43? 43 Calculate the greatest common factor of 72807 and 357. 21 Calculate the greatest common factor of 9893 and 364. 13 What is the greatest common divisor of 42440 and 100? 20 Calculate the highest common factor of 5343 and 205647. 39 Calculate the greatest common divisor of 757 and 1. 1 Calculate the highest common factor of 1016 and 1990852. 508 What is the highest common factor of 5397 and 259? 7 Calculate the highest common factor of 196 and 109956. 196 Calculate the highest common divisor of 1036 and 7056. 28 What is the highest common factor of 288 and 99556? 4 What is the greatest common factor of 1498034 and 86? 86 Calculate the highest common factor of 2685720 and 16. 8 What is the highest common divisor of 89796 and 168? 84 Calculate the highest common divisor of 19095 and 7236. 201 What is the greatest common factor of 174 and 184353? 87 Calculate the greatest common factor of 56 and 5832. 8 Calculate the greatest common divisor of 1905 and 4515. 15 What is the highest common divisor of 120170 and 230? 10 Calculate the highest common divisor of 57 and 34561. 19 What is the highest common divisor of 272602 and 22? 22 Calculate the highest common factor of 1724 and 76. 4 Calculate the greatest common divisor of 14703 and 87. 87 Calculate the highest common divisor of 94 and 55131. 47 Calculate the highest common factor of 455 and 11193. 91 Calculate the highest common divisor of 524 and 13362. 262 What is the greatest common divisor of 30 and 634815? 15 Calculate the greatest common factor of 39 and 608868. 39 What is the greatest common divisor of 5811 and 1872? 39 Calculate the highest common factor of 1565692 and 74. 74 Calculate the greatest common factor of 3456 and 1620. 108 Calculate the highest common divisor of 33 and 207339. 33 Calculate the highest common factor of 15 and 5393280. 15 What is the highest common factor of 8 and 877636? 4 Calculate the greatest common factor of 62139 and 1056. 33 What is the highest common factor of 218752 and 3712? 128 What is	{ "pile_set_name": "DM Mathematics" }
by 116. 113 What is the remainder when 482 is divided by 23? 22 What is the remainder when 2238 is divided by 22? 16 What is the remainder when 465 is divided by 36? 33 Calculate the remainder when 1082 is divided by 335. 77 What is the remainder when 36 is divided by 10? 6 Calculate the remainder when 178 is divided by 26. 22 What is the remainder when 74 is divided by 11? 8 Calculate the remainder when 598 is divided by 275. 48 Calculate the remainder when 239 is divided by 82. 75 Calculate the remainder when 1226 is divided by 30. 26 Calculate the remainder when 2282 is divided by 109. 102 What is the remainder when 224 is divided by 12? 8 Calculate the remainder when 1895 is divided by 73. 70 Calculate the remainder when 381 is divided by 35. 31 Calculate the remainder when 340 is divided by 99. 43 Calculate the remainder when 728 is divided by 195. 143 Calculate the remainder when 307 is divided by 53. 42 Calculate the remainder when 21005 is divided by 26. 23 Calculate the remainder when 196 is divided by 27. 7 Calculate the remainder when 115 is divided by 25. 15 Calculate the remainder when 590 is divided by 279. 32 What is the remainder when 547 is divided by 135? 7 What is the remainder when 5464 is divided by 37? 25 Calculate the remainder when 75 is divided by 38. 37 What is the remainder when 3989 is divided by 14? 13 What is the remainder when 272 is divided by 35? 27 What is the remainder when 1252 is divided by 38? 36 What is the remainder when 1617 is divided by 538? 3 What is the remainder when 48 is divided by 38? 10 Calculate the remainder when 20166 is divided by 67. 66 What is the remainder when 5371 is divided by 28? 23 Calculate the remainder when 60 is divided by 11. 5 Calculate the remainder when 1117 is divided by 551. 15 Calculate the remainder when 136 is divided by 20. 16 Calculate the remainder when 326 is divided by 19. 3 Calculate the remainder when 1550 is divided by 97. 95 Calculate the remainder when 97 is divided by 34. 29 Calculate the remainder when 918 is divided by 193. 146 Calculate the remainder when 110 is divided by 36. 2 What is the remainder when 538 is divided by 32? 26 What is the remainder when 96 is divided by 50? 46 What is the remainder when 72 is divided by 60? 12 Calculate the remainder when 605 is divided by 128. 93 What is the remainder when 1149 is divided by 69? 45 Calculate the remainder when 520 is divided by 58. 56 What is the remainder when 197 is divided by 26? 15 What is the remainder when 105 is divided by 56? 49 Calculate the remainder when 17 is divided by 11. 6 Calculate the remainder when 2012 is divided by 13. 10 Calculate the remainder when 338 is divided by 12. 2 Calculate the remainder when 211 is divided by 72. 67 What is the remainder when 139 is divided by 139? 0 Calculate the remainder when 5 is divided by 3. 2 What is the remainder when 278 is divided by 57? 50 What is the remainder when 1411 is divided by 101? 98 What is the remainder when 425 is divided by 270? 155 What is the remainder when 366 is divided by 97? 75 What is the remainder when 227 is divided by 23? 20 Calculate the remainder when 221 is divided by 172. 49 Calculate the remainder when 2651 is divided by 95. 86 Calculate the remainder when 454 is divided by 28. 6 Calculate the remainder when 2570 is divided by 31. 28 Calculate the remainder when 38 is divided by 9. 2 Calculate the remainder when 35 is divided by 11. 2 Calculate the remainder when 928 is divided by 54. 10 What is the remainder when 98 is divided by 71? 27 Calculate the remainder when 3749 is divided by 1248. 5 What is the remainder when 243 is divided by 68? 39 Calculate the remainder when 646 is divided by 36. 34 Calculate the remainder when 187 is divided by 64. 59 What is the remainder when 45 is divided by 23? 22 What is the remainder when 317 is divided by 9? 2 What is the remainder when 440 is divided by 15? 5 Calculate the remainder when 70 is divided by 18. 16 What is the remainder when 266 is divided by 91? 84 What is the remainder when 425 is divided by 6? 5 What is the remainder when 748 is divided by 8? 4 Calculate the remainder when 369 is divided by 41. 0 What is the remainder when 11 is divided by 4? 3 Calculate the remainder when 582 is divided by 186. 24 Calculate the remainder when 330 is divided by 34. 24 Calculate the remainder when 102 is divided by 48. 6 What is the remainder when 6727 is divided by 1679? 11 Calculate the remainder when 1904 is divided by 127. 126 Calculate the remainder when 320 is divided by 153. 14 What is the remainder when 62 is divided by 31? 0 What is the remainder when 420 is divided by 395? 25 Calculate the remainder when 5089 is divided by 268. 265 What is the remainder when 29 is divided by 14? 1 Calculate the remainder when 33 is divided by 13. 7 What is the remainder when 1017 is divided by 85? 82 What is the remainder when 763 is divided by 12? 7 Calculate the remainder when 261 is divided by 90. 81 What is the remainder when 1546 is divided by 129? 127 Calculate the remainder when 1749 is divided by 175. 174 Calculate the remainder when 4651 is divided by 1546. 13 What is the remainder when 20 is divided by 7? 6 Calculate the remainder when 757 is divided by 48. 37 Calculate the remainder when 3790 is divided by 12. 10 Calculate the remainder when 2115 is divided by 142. 127 Calculate the remainder when 112 is divided by 39. 34 What is the remainder when 447 is divided by 11? 7 What is the remainder when 3510 is divided by 864? 54 What is the remainder when 74 is divided by 65? 9 What is the remainder when 129 is divided by 29? 13 What is the remainder when 280 is divided by 95? 90 Calculate the remainder when 1120 is divided by 125. 120 Calculate the remainder when 455 is divided by 168. 119 Calculate the remainder when 2185 is divided by 27. 25 Calculate the remainder when 1603 is divided by 177. 10 Calculate the remainder when 597 is divided by 199. 0 What is the remainder when 272 is divided by 271? 1 Calculate the remainder when 108 is divided by 23. 16 What is the remainder when 7071 is divided by 262? 259 Calculate the remainder when 283 is divided by 57. 55 Calculate the remainder when 87 is divided by 11. 10 What is the remainder when 169 is divided by 7? 1 What is the remainder when 2275 is divided by 82? 61 Calculate the remainder when 555 is divided by 6. 3 Calculate the remainder when 448 is divided by 115. 103 Calculate the remainder when 1966 is divided by 10. 6 Calculate the remainder when 699 is divided by 9. 6 What is the remainder when 171 is divided by 81? 9 Calculate the remainder when 68 is divided by 28. 12 Calculate the remainder when 498 is divided by 28. 22 What is the remainder when 248 is divided by 68? 44 What is the remainder when 125 is divided by 114? 11 Calculate the remainder when 848 is divided by 71. 67 What is the remainder when 151 is divided by 38? 37 What is the remainder when 3497 is divided by 159? 158 What is the remainder when 511 is divided by 43? 38 Calculate the remainder when 1207 is divided by 298. 15 What is the remainder when 117 is divided by 17? 15 Calculate the remainder when 1507 is divided by 54. 49 Calculate the remainder when 97 is divided by 40. 17 What is the remainder when 262 is divided by 67? 61 What is the remainder when 1752 is divided by 15? 12 What is the remainder when 255 is divided by 170? 85 Calculate the remainder when 272 is divided by 80. 32 Calculate the remainder when 378 is divided by 76. 74 Calculate the remainder when 122 is divided by 67. 55 Calculate the remainder when 970 is divided by 36. 34 What is the remainder when 214 is divided by 127? 87 Calculate the remainder when 235 is divided by 37. 13 Calculate the remainder when 2257 is divided by 374. 13 Calculate the remainder when 526 is divided by 79. 52 Calculate the remainder when 193 is divided by 16. 1 What is the remainder when 1279 is divided by 21? 19 Calculate the remainder when 1243 is divided by 50. 43 What is the remainder when 4488 is divided by 155? 148 What is the remainder when 368 is divided by 27? 17 What is the remainder when 124 is divided by 61? 2 What is the remainder when 153 is divided by 28? 13 What is the remainder when	{ "pile_set_name": "DM Mathematics" }
)/(-25) - 4). Let y be b(f). Factor 1/3v3 - 1/3v + 1/3vy + 0 - 1/3v*2. v(v - 1)(v + 1)2/3 Let 18/5a*4 + 138/5a*3 - 408/5a + 152/5a2 + 32 = 0. Calculate a. -5, -4, 2/3 Factor -2587o*3 + 118o*3 - 123o*3 - 20736o*2 - 39470o - 3o5 - 10o*4 - 134o*4 - 22738o. -3o(o + 12)*4 What is d in 538d*4 + 2d*3 - 6d*2 - 532d*4 - 4d + 12d5 - 10d*5 = 0? -2, -1, 0, 1 Let q = 8 + -8. Suppose 5f - 4 = -4y, f + qy + 5 = 5y. Factor 4g*2 - 2g2 + g2 + 3 + 6g + f. 3(g + 1)*2 Let b(z) be the third derivative of 0z + 1/14z3 + 1/392z*8 + 10z*2 + 0 + 9/490z*7 + 3/28z*4 + 1/10z*5 + 2/35z*6. Let b(c) = 0. Calculate c. -1, -1/2 Let s(c) be the first derivative of 0c*2 - 10/63c*3 + 8/21c + 2/105c5 + 1 + 0c*4. Let s(v) = 0. What is v? -2, -1, 1, 2 Let z = -1/9 + 19/90. Let x(d) be the first derivative of -1/15d*3 + 0d + 2 + 0d2 + zd*4 - 1/25d5. Factor x(u). -u2(u - 1)2/5 Suppose 4d = 7d - 4i, -3d = 2d - 3i. Let dm*3 + 0 + 4/5m*5 - 8/5m*2 - 4/5m + 8/5m4 = 0. Calculate m. -1, 0, 1 Let v(s) be the third derivative of -s6/210 + s4/14 - 4s*3/21 + 92s*2. Let v(c) = 0. What is c? -2, 1 Determine w so that 1/2w*2 - 3/4w*4 + 1/4 - 3/4w + 1/4w5 + 1/2w*3 = 0. -1, 1 Suppose f = 1 + 1. Suppose -5i + 7 + 12 = x, 10 = -2i + 4x. Solve 4di - d3 + 16d*2 - 12d*2 - 10d*f = 0. 0, 2 Let s(i) be the first derivative of 3i*5/35 - 3i4/14 - i3/7 + 3i2/7 + 85. Factor s(r). 3r(r - 2)(r - 1)(r + 1)/7 Let r(f) be the first derivative of 1/18f*4 + 0f - 2/45f5 + 11 + 0f*2 + 0f*3. Let r(g) = 0. Calculate g. 0, 1 Suppose 30 = -3t + 3. Let q(g) = g*3 + 10g*2 + 10g + 12. Let p be q(t). Factor -10ap + 8a + 7 - 3a2 - 2a*3 + 4a - 4. -3(a - 1)(a + 1)(4a + 1) Let i(f) be the first derivative of f7/28 - f6/4 + 27f5/40 - 7f4/8 + f3/2 - f + 5. Let w(q) be the first derivative of i(q). Solve w(o) = 0. 0, 1, 2 Let s(z) be the second derivative of z*6/10 + 3z5/10 - z4 - z*3 + 9z*2/2 - 6z - 22. Suppose s(g) = 0. Calculate g. -3, -1, 1 Let z(p) = p*2 - 3p - 7. Let o be z(5). Factor -or2 + 7r*2 + 8r + 0r2 + 0r*2. 4r(r + 2) Determine v so that 4v*4 - 4v*4 - 27 - 3v*4 + 15v*2 + 15v*2 = 0. -3, -1, 1, 3 Let i(t) be the second derivative of -31t + 7/18t3 + t2 - 1/60t*5 + 0 + 0t*4. Factor i(w). -(w - 3)(w + 1)(w + 2)/3 Let d = 24713 - 24713. Solve -48/7a*3 - 12/7a*2 + 0 - 3a*4 + da = 0. -2, -2/7, 0 Let i(m) be the third derivative of -m6/360 - m5/120 + m*4/12 - 19m*3/6 + 17m2. Let r(o) be the first derivative of i(o). Let r(g) = 0. What is g? -2, 1 Let u(n) = -n2 - 4n - 4. Let z be u(-2). Suppose z = -2f + 6 + 36. Suppose 5d3 + 8 + 3 - 15d - f = 0. What is d? -1, 2 Let t(l) = -l*3 + 4l*2 - 8. Suppose 5k - 100 = -0k. Suppose 4n = 6 + 10. Let b(o) = -o*2 + o + 1. Let i(f) = kb(f) + nt(f). Factor i(d). -4(d - 1)*2(d + 3) Let g(m) = -2m - 2. Let l = -25 + 23. Let q be g(l). Factor -2o*2 + 4o*q - 4o + 0o2 - 6. 2(o - 3)(o + 1) Let q = 211/1880 + 3/235. What is p in -1/8p + 3/8p2 + 1/4p*5 - qp*3 - 3/8p*4 + 0 = 0? -1, 0, 1/2, 1 Let w be -1(1 - 5) + (-2299)/1045. Find h, given that 16/5h - 4/5 + wh*2 = 0. -2, 2/9 Let w(u) be the second derivative of -5u8/336 - u7/42 + u6/24 + u5/12 - 11u2/2 + 5u. Let i(c) be the first derivative of w(c). Factor i(h). -5h2(h - 1)(h + 1)2 Let t(p) = p2 - 17p + 20. Let g be t(15). Let s be (-36)/g + (-14)/(-35) - 2. Factor 1/5m + 4/5m*5 - 7/5m*s + 3m*3 + 0 - 13/5m*4. m(m - 1)*3(4m - 1)/5 Let v(h) be the second derivative of -1/336h*7 + 1/240h*6 + 0h*3 + 0h*5 + 0 - 23h + 0h4 + 0h*2. Find f, given that v(f) = 0. 0, 1 Let g(d) be the third derivative of 1/300d*6 + 0d*5 + 0 - 1/20d*4 + 0d - 20d2 + 2/15d*3. Factor g(h). 2(h - 1)*2(h + 2)/5 Suppose -16v + 65 = 17. Suppose p - vp = -5t + 10, -t - 3p - 15 = 0. Factor t + 1/2m - 1/2m*2. -m(m - 1)/2 Let i = -11786 - -11791. Factor 0 - 2/9x4 + 2/9x*i + 10/9x*2 - 2/3x*3 - 4/9x. 2x(x - 1)*3(x + 2)/9 Let m(t) = t - 11. Let a be m(14). Find v such that 25 - 2v2 + 4v - 2va - 23 - 2v = 0. -1, 1 Let p(o) be the second derivative of o8/13440 + o7/5040 + o*4/12 - 15o. Let s(k) be the third derivative of p(k). Factor s(m). m*2(m + 1)/2 Let w(g) be the first derivative of -18 + 0g + 20/21g*3 - 3/7g*4 - 4/7g*2. Factor w(u). -4u(u - 1)(3u - 2)/7 Let o(r) be the third derivative of r6/300 - 2r5/75 - r4/12 - 42r2. Let o(t) = 0. Calculate t. -1, 0, 5 Let a(s) be the second derivative of 5s*4/72 + 287s*3/36 + 19s*2/2 + 166s. Factor a(n). (n + 57)(5n + 2)/6 Let m(u) = -3u2 - 24u - 9. Let y(i) = -i*2 - 6i - 2. Suppose 0 = 15d - 39 - 96. Let j = -5 + 3. Let r(z) = dy(z) + jm(z). Factor r(x). -3x(x + 2) Let w(p) be the third derivative of -p8/1344 + p7/420 + p6/60 - p5/15 - p4/6 + 4p*3/3 + 6p*2 + 10p. Factor w(z). -(z - 2)*3(z + 2)*2/4 Let y be 20/(-50) + 104/10. Suppose y = 3v - v. Factor 4f3 - 6f + 0f2 + 2f*v - 2 - 5f*2 + 6f4 + f2. 2(f - 1)(f + 1)*4 Let m be (-32 + 2)(-80)/120. Factor -2/3 + 10/3w + mw3 - 16/3w*2. 2(w - 1)(2w - 1)2/3 Let c(i) be the second derivative of -i6/1800 - 5i3/6 - 3i. Let b(s) be the second derivative of c(s). Factor b(p). -p*2/5 Let l = 23119/35 - 3302/5. Factor -3/7 - lo*2 - 4/7o. -(o + 1)(o + 3)/7 Let z(y) be the third derivative of -y8/60480 - 13y*5/30 + 20y*2. Let l(h) be the third derivative of z(h). Suppose l(p) = 0. Calculate p. 0 Suppose 3d + h + 18 = -3h, h = -3d. Find c such that -3/5cd + 1/5c*3 - 9/5c - 1 = 0. -1, 5 Solve 3064m2 + 28m - 2m - 1530m*2 + 32 - 1529m*2 = 0 for m. -16/5, -2 Let p(c) be the first derivative of 2c*3/21 - 66c*2/7 + 2178c/7 - 176. Factor p(i). 2(i - 33)2/7 Let f(b) be the second derivative of -b7/56 - 3b*6/20 + 9b*5/80 + 5b*4/4 + 3b*3/2 + 22b - 5. Determine c so that f(c) = 0. -6, -1, 0, 2 Let v(i) be the second derivative of 3i8/728 + 4i*7/105 + 23i*6/260 - 3i*5/65 + 23i*2 - 30i. Let f(m) be the first derivative of v(m). Factor f(w). 2w2(w + 3)*2(9w - 2)/13 Suppose -3h + 3x + 0 + 12 = 0, 5x + 4 = h. Suppose -2d + 2f - 13 + 109 = 0, 4f - 168 = -hd. Factor 12v2 + d - 45 - 8v. 4v(3v - 2) Factor 1/2f*2 - 9 - 3/2f. (f - 6)(f + 3)/2 Let d be 29 + 2 + 4/(-1). Solve -3r*3 - 24r - dr2 - 1 - 11 + 12r2 = 0. -2, -1 Let o(d) be the third derivative of -d5/450 - d*4/10 - 8d*3/5 - 199d*2 + 2. Determine x, given that o(x) = 0. -12, -6 Let w = -2802 + 11211/4. Determine y, given that -3/8y - w + 3/8y2 = 0. -1, 2 Let f(r) = 6r*2 + 3. Let t(p) = -5p*2 - 2. Let c(b) = -b + 1. Let a be c(4). Let w(q) = at(q) - 2f(q). Factor w(s). 3s*2 Solve 1800/11 - 52/11a*3 + 2/11a*4 + 1560/11a + 218/11a2 = 0. -2, 15 Let a(b) be the first derivative of 3b*3 + 15/2b*2 + 6b - 3/4b4 + 8 - 3/5b*5. Factor a(i). -3(i - 2)(i + 1)3 Let n(q) = q + 6. Let v be n(-3). Let z(t) = -3t*3 + 31t*2 - 3t - 6. Let o be z(10). Factor 4 - 160xv - 30x - 13x + ox*4 + 132x*2 + 3x. 4(x - 1)2(4x - 1)2 Suppose 0 = 5o + 5a - 20, -10o - 13 = -13o - 2a. Suppose -1/2co + 0 + 0c*2 + 0c*3 + 0c + 0c4 = 0. Calculate c. 0 Let x(z) be the second derivative of -81z*5/10 - 283z*4/28 - 43z*3/14 + 3z*2/7 - 219z. Suppose x(m) = 0. Calculate m. -1/2, -2/7, 1/27 Let y(f) be the second derivative of 1/30f5 + 1/45f*6 + 1/54f*4 + 0f*3 + 0 + 1/189f*7 + 0f*2 - 14f. Factor y(t). 2t2(t + 1)*3/9 Suppose -2o = 2i - 20, o - 2i + 10 = i. Factor -118u2 + 28 + 20u*3 + 45u*o - 65u - 38 + 28u2 + 100u*4. 5(u - 1)(u + 1)3(9u + 2) Let h(n) be the third derivative of 0 + 6n*2 - 1/5n5 - n3 - 5/8n4 + 0n - 1/40n6. Factor h(c). -3(c + 1)*2(c + 2) Let q(s) = -s*3 - 4s*2 - 5s - 2. Let x be q(-3). Suppose -2 = -3k + x. Factor 2/3j*4 - 8/3j*3 + kj*2 - 8/3 + 8/3j. 2(j - 2)2(j - 1)(j + 1)/3 Let x(f) = -12f*3 + 63f*2 + 27f - 9. Let y(m) = m*3 - 2m*2 - 3m + 1.	{ "pile_set_name": "DM Mathematics" }
ms in 23p2 + 16p*2 + 13p*2 - 15p*2 - 32p*2. 5p*2 Collect the terms in 92442442i + 1 - 8 - 92442440i - 5 + 12. 2i Collect the terms in -1 - 10g2 - 34g*2 + 1 + 51g*2. 7g*2 Collect the terms in 13 + 96c*2 - 3 - 11. 96c*2 - 1 Collect the terms in -68799p + 206403p - 68809p + p*2 - 68795p. p*2 Collect the terms in 67q*2 + 88 - 88. 67q*2 Collect the terms in -114 - 112 + 226 - 2688b. -2688b Collect the terms in -158201w*2 + 316405w*2 + 2w*3 - 158204w*2. 2w*3 Collect the terms in 11b*3 - 49b*3 + 16b*3 + 8b*3. -14b*3 Collect the terms in 1381g*2 + 1 - 1 - 1533g*2. -152g*2 Collect the terms in 8z + 33z - 9z*2 + 7z - 2z - 46z. -9z2 Collect the terms in -2912z*3 - 3186z*3 + 583z*3 - 1439z*3. -6954z*3 Collect the terms in 767 - 767 + 491j*2 + 309j*2. 800j*2 Collect the terms in -11y + 19y2 + 5y + 4y + 16y - 14y. 19y*2 Collect the terms in 337 - 166 + 18v + 2v - 171. 20v Collect the terms in -337b2 - 15 + 15 + 3b. -337b2 + 3b Collect the terms in -1290m3 + 443m*3 + 407m*3 + 379m*3. -61m*3 Collect the terms in 2198o - 969o - 1228o. o Collect the terms in 4 - 61l + 0 - 11l + 10l. -62l + 4 Collect the terms in 31007n + 31010n - 62022n. -5n Collect the terms in 1 - 7 + h*3 + 2 - 7 - 58h - 3. h*3 - 58h - 14 Collect the terms in 64y + 472y + 454y. 990y Collect the terms in -978156 + 978156 + 3t. 3t Collect the terms in -33 + 6 + 7s - 2s + 27. 5s Collect the terms in -285x + 544x - 259x - x*3 + 7x*3. 6x*3 Collect the terms in -168q + 27q3 - 165q - 171q + 504q. 27q3 Collect the terms in 27927p*2 - 57424p*2 + 29504p*2. 7p*2 Collect the terms in 7227 - 3d*3 - 6d*3 + 6d*3 - 7227. -3d*3 Collect the terms in 5093 + 15w*2 + 14w*2 - 15286 + 5096 + 5096. 29w*2 - 1 Collect the terms in 113300 - 10t - 113300. -10t Collect the terms in -62l*2 + 145l*2 - 15l*2. 68l*2 Collect the terms in 0o*2 + 8 + 8o*2 + 3o*2 + 38. 11o*2 + 46 Collect the terms in -665 + 3s + 175 + 4s - 11s. -4s - 490 Collect the terms in 29j + 133j - 48j + 210j + 177j. 501j Collect the terms in 165 - 289 + 162 + a. a + 38 Collect the terms in -10n - 177n - 180n - 47n. -414n Collect the terms in -3b + 5172 - 5172 - 27b. -30b Collect the terms in 1189 - 1189 + 331509x*3 - 331506x*3. 3x*3 Collect the terms in 390253 + 369s*2 - 390253. 369s*2 Collect the terms in 5v + 333033 + 4v - 8v - 333033. v Collect the terms in -147z2 - 269z*2 - 834z*2. -1250z*2 Collect the terms in -49077227481270 + 2g*2 + 49077227481270. 2g*2 Collect the terms in 50l*3 + 19l*3 + 45l*3 - 47l*3. 67l*3 Collect the terms in -2l - 41760l2 + 18l*3 + 41760l*2. 18l*3 - 2l Collect the terms in -41 - 33 - l + 7l + 12 + 62. 6l Collect the terms in 276p3 - 3p*2 + 278p*3 - 558p*3. -4p*3 - 3p*2 Collect the terms in 49 - 259p*3 - 154 + 49 + 56. -259p*3 Collect the terms in 0j2 - j3 + 9 + 0j2 + 8j*3. 7j*3 + 9 Collect the terms in 96a + 200 - 80a - 200. 16a Collect the terms in -437h3 - 528h*3 + 963h*3 - 22h*2. -2h*3 - 22h*2 Collect the terms in 11s + 6 - 7 + 2 + 5. 11s + 6 Collect the terms in d - 383d*3 - d + 241d*3. -142d*3 Collect the terms in -6951n*2 - 36945n*2 + 2668n*2. -41228n*2 Collect the terms in -233k - 361k + 126k. -468k Collect the terms in 3 - 1 - 2 + 38156p*3 - 38142p*3. 14p*3 Collect the terms in -2 + 172f*2 + 147f*2 - 4 + 12. 319f*2 + 6 Collect the terms in 13f*2 + 12f*2 - 12f*2 - 22f*2. -9f*2 Collect the terms in -2927 + 5867 - 2933 + v. v + 7 Collect the terms in 104 + 340n*3 - 103 + 0n*2 + 0n*2. 340n*3 + 1 Collect the terms in -67r*2 + r + 8r*3 + 10r - 10r3. -2r*3 - 67r*2 + 11r Collect the terms in 13 - 26 + 11 - 108y. -108y - 2 Collect the terms in 803b3 - 425b*3 - 366b*3. 12b*3 Collect the terms in 4785q + 1 - 5 + 19 - 15. 4785q Collect the terms in -303752 + 2x*3 + 303752. 2x*3 Collect the terms in -9514c*2 - 2c*3 + 4753c*2 + 4761c*2. -2c*3 Collect the terms in -39t*3 - 6 + 9t*3 + 5t*3 - 21t*3. -46t*3 - 6 Collect the terms in 47d - 59d - 1 + 68. -12d + 67 Collect the terms in -r*3 + 4r + 4r - 2r + 6r2 + 1. -r3 + 6r*2 + 6r + 1 Collect the terms in -115271s2 + 230543s*2 - 115271s2. s2 Collect the terms in 42556756h + 7h*2 - 42556756h. 7h2 Collect the terms in -8r + 0r - 75236r*3 + 8r + 75232r3. -4r*3 Collect the terms in 2687o*3 - 5o*2 - 2576o*3 + 3o*2 + 2o*2. 111o*3 Collect the terms in -30 + 9b*3 + 40 - 10. 9b*3 Collect the terms in -59h + 23h + 36h - 45h2. -45h2 Collect the terms in -261 + 80 - f2 - 15f + 181. -f2 - 15f Collect the terms in 190q2 - q + q + 291q*2 - 472q*2. 9q*2 Collect the terms in -18o - 9o + 8o. -19o Collect the terms in -3c2 + 636750 - 636750 - c2 - 2c2. -6c*2 Collect the terms in 172i - 21i + 24i. 175i Collect the terms in 27 - 8 + 38g - 60g. -22g + 19 Collect the terms in -3p3 - 23p*2 + 23p*2. -3p*3 Collect the terms in 5v + 1668v2 - 4194v*2 - 4v + 2519v2 - v. -7v*2 Collect the terms in -294k - 579k + 925k. 52k Collect the terms in -2521z - 2488z + 5018z. 9z Collect the terms in -5v + 2v2 - 8 + 0v*2 - 25v + 3v. 2v*2 - 27v - 8 Collect the terms in 149d3 + 1254 - 1254 - 151d*3. -2d*3 Collect the terms in 20j + 10j - 79j + 42j + 10j. 3j Collect the terms in -72w - 320w + 473w - 76w. 5w Collect the terms in 466n2 - 1117n*2 - 48n*2. -699n*2 Collect the terms in 25i*3 + 16i*3 - 47i*3 + 2i*3. -4i*3 Collect the terms in -33o + 8o - 889030 + 889030. -25o Collect the terms in -2 - 370p - 288p + 232p + 5. -426p + 3 Collect the terms in 10o3 + 7o*3 + 7o*3 - 6o*3 - 7o*3. 11o*3 Collect the terms in -5l + 2l + l + 2l - 26l2. -26l*2 Collect the terms in 2291k*2 - 765k*2 - 765k*2 - 763k*2 - 5k*3. -5k*3 - 2k*2 Collect the terms in -2535i*2 + 1107i*2 + 1420i*2. -8i2 Collect the terms in y2 - 3y2 - 38346y + 38343y. -2y*2 - 3y Collect the terms in 7344225854 - 7344225854 - 9o3. -9o*3 Collect the terms in -450 + 14f*3 + 450 + 88f*2 - 88f*2. 14f*3 Collect the terms in -7 - 30999p + 4 + 1 + 4. -30999p + 2 Collect the terms in -201 - l - 226 + 9l*2 + 427. 9l*2 - l Collect the terms in -24j*3 + 33j*2 + 17j*3 - 20j - 33j2. -7j*3 - 20j Collect the terms in 1160 + 69q2 - 579 - 587. 69q*2 - 6 Collect the terms in 4343f - 8688 + 8688. 4343f Collect the terms in 6 + 256597b - 256591b - 20. 6b - 14 Collect the terms in -163 + q*3 + 200 + 0q3. q3 + 37 Collect the terms in -2d2 - 98961051764d + 98961051764d. -2d*2 Collect the terms in -340s + 38s - 922s + 31s. -1193s Collect the terms in -552x + 182x + 180x + 34 + 192x. 2x + 34 Collect the terms in -90970l*2 + 90970l*2 - 5 + 2l*3 + 5. 2l*3 Collect the terms in 3b3 + b3 - 3355b2 + 3355b*2. 4b*3 Collect the terms in 41s + 14s2 + 39s - 16s2 + 19 - 80s. -2s2 + 19 Collect the terms in -12u*2 - 76u*2 - 178u + 185u. -88u*2 + 7u Collect the terms in 1118g - 605g - 678g. -165g Collect the terms in -30 + 67 - 520b2 - 37. -520b*2 Collect the terms in 135 - 135 + 6812v. 6812v Collect the terms in 85f + 4076f + 30 - 30. 4161f Collect the terms in -187i2 + 362i*2 - 186i*2. -11i*2 Collect the terms in -256t*2 + 35t*2 + 55t*2 + 137t*2. -29t*2 Collect the terms in -7b*3 - 8b*3 - 10 + 15. -15b3 + 5 Collect the terms in b2 + 0b2 - 1009b - 1014b - 1006b + 3029b. b2 Collect the terms in -5005s*2 + 7551s*2 + 7703s*2. 10249s*2 Collect the terms in 222a - 120a - 131a. -29a Collect the terms in 1116q*3 - 2237q*3 + 1115q*3. -6q3 Collect the terms in g2 - 3024g + 3024g - 9g2. -8g*2 Collect the terms in -2b*2 - 235b*3 + 438b*3 - 237b*3 + 2b*2. -34b*3 Collect the terms in 103f*2 + 103f*2 + 91f*2 - 263f*2. 34f**2 Collect the terms in 19754674 - 19754674 + p. p Coll	{ "pile_set_name": "DM Mathematics" }
-2, 3k = -4w + 2 for k. 2 Solve -3g = 2c + 2, -2c + 14 = -g - 4g for c. 2 Solve 0 = -2a - 7o + 10o, 16 = -2a - 5o for a. -3 Solve -x + 4x + 9 = -3g, 2g - x + 3 = 0 for g. -2 Solve 0 = -4z - 2m + 10, 5z - 9m = -5m - 20 for z. 0 Solve 5i + 21 = 2p, i + 188 = 3p + 189 for i. -5 Solve 0 = 5j + 4f - 26, 9j = 14j - 4f + 6 for j. 2 Solve 0 = -2k + 3i + 15, -k + 0 = 3i + 15 for k. 0 Solve 5j - 3 = -g + 17, 0 = -4j - 5g + 37 for j. 3 Solve -q + 2u = -0q - 9, 0 = 2u + 10 for q. -1 Solve 2a + 16 = 4o - o, -4a - 16 = 2o for a. -5 Solve 0 = -3v + 2t + 7, 0 = -3v + 4v - 2t + 3 for v. 5 Solve 2s = -4, 5d + 2s + 2s + 3 = 0 for d. 1 Solve -2d + 16 = 4v + 8, 0 = v - 1 for d. 2 Solve -4d = 2p + 2, d - 7 = p - 0p for p. -5 Solve -6 = -4g - 77k + 79k, 5g + k = -10 for g. -1 Solve 3r = h - 1, r - 4h + 5h = -3 for r. -1 Solve -26 = -22g + 25g + 2r, -4g - 23 = r for g. -4 Solve -t - 3 = 2y, 4 = -2t + 19y - 22y for t. 1 Solve 0 = -4k + 3g - 1 - 8, 0 = 5k - 4g + 12 for k. 0 Solve -4q = g + 6, g + 13q = 17q + 10 for g. 2 Solve -5m - 7 = -0u - u, 3u + 5m = -19 for u. -3 Solve 0 = -b, -15 = -2m - 3m + 5b for m. 3 Solve -5r + 2 = -7r + 3o, -2o = -2r for r. 2 Solve 0 = -3z - 2u, 2z + 16 = 4z - 4u for z. 2 Solve -5h = 5, 3h = 3l - 0 + 6 for l. -3 Solve 7b - 8b - s - 1 = 0, -s + 14 = -2b for b. -5 Solve -108r + 112r + 16 = 5q, -2r = -3q + 8 for q. 0 Solve 8 = -x + 3i, -5x = 4i - 20 + 3 for x. 1 Solve -4g + 0t = 3t, 0 = g - 5t for g. 0 Solve -3x = -t + 7 - 1, 5x = 3t - 10 for x. -2 Solve 0 = -3k + 18g - 14g - 17, 5g - 1 = -3k for k. -3 Solve 14 = -2d - 4h, 5h = 4d - 3d for d. -5 Solve 4w + 15 = -5j, 3w + 8 = -j + 5 for w. 0 Solve 6f - 34 = v, 4v - 3 = -4f + 1 for v. -4 Solve 10 = -5j - 5f, f = -f for j. -2 Solve -6b + 4b - 2p = 0, -2b + 4p - 18 = 0 for b. -3 Solve -5 = 4d + 5s, 0 = d + 2d + 5s + 10 for d. 5 Solve m - 5c + 4 - 1 = 0, -3m - 3c + 9 = 0 for m. 2 Solve 2a - 2 + 5 = -5o, 2 = -5a - 7o for a. 1 Solve -2j + 0q + 2q = 10, 0 = 2j - 4q + 12 for j. -4 Solve -5p + 505 = l + 517, 0 = -p - 3l + 6 for p. -3 Solve 10z - 8z = -5y + 10, 2y = 8 for z. -5 Solve 2u + 4n - 6 = 0, 0 = 4u + 4n - 12 - 4 for u. 5 Solve -3k - 14 = 3l + k, 6 = -2l - 2k for l. 2 Solve 11 = g - 4k, 5 = -4g + 4k + 1 for g. -5 Solve l - 7 = 5n - n, 5l - n = 16 for l. 3 Solve -4 = -4x + 4v, -v + 16 = 3v for x. 5 Solve -12 = -3d - s, -4d + 3s = -37 + 8 for d. 5 Solve n - 1 = s - n, -4s - 14 = 2n for s. -3 Solve -3s = 2g + 5, 0s - 2g = -5s + 13 for s. 1 Solve 2p + 8v = 3v + 20, 4v - 18 = -2p for p. 5 Solve -3n = -x - 7n + 9, 0 = 5n - 15 for x. -3 Solve k = 4y + 17, 3k - y - 12 = -2y for k. 5 Solve 1 = 2c + 2q + 17, -2q = -c + 1 for c. -5 Solve -7 = -2q - 3u, -q = 4u - 17 + 11 for q. 2 Solve 2u + 6 = 4u, -5m + 5u - 30 = 0 for m. -3 Solve 2u - 21 = 5y, -2u = -0y - 2y - 12 for y. -3 Solve t - 3j + 1 = 0, -j - 17 = 5t - 4j for t. -4 Solve 0 = 2d - 10, -2d - 13 = u - 4d for u. -3 Solve 5x - 38 = -2h - 6, 8h - 3x = 36 for h. 6 Solve 0 = -u - 1, 4z + 911u = 913u - 14 for z. -4 Solve c - 20 = 5t, -3c - 5t - 45 = c for c. -5 Solve 3l + 3 = 0, 4h - 36l + 4 = -32l for h. -2 Solve 11 = -4l - 9, 0 = -2q + 4l + 30 for q. 5 Solve 2l + 304s - 2 = 300s, -5s + 15 = 0 for l. -5 Solve 2d - 1 = u + 2u, -d - 2 = u for d. -1 Solve -26c - 13 = 5f - 24c, -3f + c = 10 for f. -3 Solve 12i + 10 = 7i + 4d, 4i - 13 = -d for i. 2 Solve -2x - 4h - 18 = 0, 2x + 4h + 14 = 4x for x. -1 Solve -3g - 5y + 2 - 14 = 0, -y - 3 = 0 for g. 1 Solve 7 = -h + 3w, 3 = 5h + 2w + 2w for h. -1 Solve -3g = p - 4 - 6, -5g = 2p - 15 for p. -5 Solve -5j = 2z + 15, -j + 2z + 16 - 19 = 0 for j. -3 Solve 2j - 4g + 10 = -2g, 5 = 2j + 3g for j. -2 Solve -2 = 5q + 4o, -2q - 22 = -o - 16 for q. -2 Solve 2t = 6t + 3p - 19, -t + 3p = 14 for t. 1 Solve -5o + 47 = 4k + 14, 3k + o = 11 for k. 2 Solve -4y + 5t - 8 = 0, -2y + 2t - 41 = -39 for y. 3 Solve -2v = 4n, -5v + 2v + 14 = -n for n. -2 Solve -2t = -2, -7b + t - 11 = -12b for b. 2 Solve -3r = -2y - r - 2, 0 = -y - 4r + 24 for y. 4 Solve -4m + v = -4, m + 28v = 24v + 1 for m. 1 Solve -2 = -s - 7, -2s + 5 = -5p for p. -3 Solve -2b - 6 + 3 = -3f, -4b - 3f = -3 for b. 0 Solve 5d + 3r = -2r + 40, 3r = 2d + 4 for d. 4 Solve 5o + 3u - 37 = 0, 3u - 21 = -o - u for o. 5 Solve -2o + 5o + 9 = -4h, 2 = 2o for h. -3 Solve -4q - 3s + 17 = 0, -s - 2 = 5q - 15 for q. 2 Solve 3o - 4b = 0, o + 4b + 2 = 18 for o. 4 Solve 10 + 8 = -3u + x, 0 = -3u - 2x - 9 for u. -5 Solve -2q = -3q - 4c - 19, -3c - 11 = 4q for q. 1 Solve -4 = 3d - 2i, -2i - 20 = 3i for d. -4 Solve t = 4c + 7, t - 2c + 1 = 6 for t. 3 Solve -2q - 14 = 3i, 4q - 4i = -136 + 148 for q. -1 Solve -1 = q - 3l, q + 28 - 37 = -2l for q. 5 Solve -30 = r + 5y, -5r = -r + 3y + 35 for r. -5 Solve 4l + 15 = -3r, -3r = -9 + 12 for l. -3 Solve 5q + 30 = 4m, 4q - 11 + 14 = -m for m. 5 Solve 0 = -11d + 12d + 3, 5d = -2n - 13 for n. 1 Solve 3b + 12 = -3y, 12y + 30 = 7y + 5b for y. -5 Solve 6c = 7c - 1, 0 = -4h - 2c + 14 for h. 3 Solve -2j + 15 = -5c + 10, -c + 4j - 1 = 0 for c. -1 Solve -104f + 16 = -100f, -3f - 3 = 5v for v. -3 Solve 0 = 2f - 10, -2f - 5 = 3g - 15 for g. 0 Solve 0 = -2d - 3h - 11 - 4, -2d + 2h = 0 for d. -3 Solve 0 = -4z, 4s + 0s - 4z + 4 = 0 for s. -1 Solve -15 = -5o - 4r, 0 = 4o - 5o + 4r - 21 for o. -1 Solve 10 = -5n + g + g, -11 = -n + 3g for n. -4 Solve -2m = 3u + 4, 4u - 3m - 19 = -47 for u. -4 Solve 0 + 3 = v + 4k, k = -4v + 12 for v. 3 Solve -2r + 0r - 6 = -5q, 4q - 9 = 3r for r. -3 Solve 0 = -2a - 3t - 1, 2a - 8 = 4t - 2 for a. 1 Solve -23 = -5k + 3l, 0 = -15k + 12k + l + 13 for k. 4 Solve 0 = -3p + a + 14, -3a - 7 = 12p - 14p for p. 5 Solve 3p = -4l - 1, 0 = 4l + 3p + p + 4 for l. 2 Solve -46u + 42u = 4n - 4, -n = -2u - 7 for u. -2 Solve -3w - 13s = -10s - 6, -3s + 6 = w for w. 0 Solve b = -3b + 20, 2w - 11 = -b for w. 3 Solve l + 1 = -2k, 20 = -0l - 4l for k. 2 Solve 12q - 10q + 18 = -4o, -5q + 3o + 20 = 0 for q. 1 Solve 5z = 3r + 15, -3r + 4r = -z - 5 for z. 0 Solve i - 32 = -4t, -14i + 15i = 0 for t. 8 Solve -4x - 5l - 11 = -42, -3x + 5l - 3 = 0 for x. 4 Solve j - 2s + 6 = 0, s + 0s + 4 = -3j for j. -2 Solve 2i = 4y + 4i - 4, y - 2 = -i for y. 0 Solve 0 = -5a - 4j + 28, -5a + 30 = 5j - 0 for a. 4 Solve h + 2 - 8 = 5l, 0 = -3l - 6 for h. -4 Solve -18 = c + c + 2a, -4a = 16 for c. -5 Solve 4k - 12b = -17b + 3, -5k - 4b = -15 for k. 7 Solve 2f + 0f + 5 = 5g, 5f = -5g + 5 for g. 1 Solve 17v = 19v - 2p + 2, 2 = 2v - p for v. 3 Solve 4r + 14 = -y, -3y - 5r - 16 = -y for y. 2 Solve 4x + 20 = 0, -3s + 2x + 19 = -0x for s. 3 Solve -3a + 3 = 5z, -4a - 1 = -5a + 3z for a. 1 Solve -l + 5l - 4 = -2z, 0 = 5l + 4z - 5 for l. 1 Solve 5u - 6 = -4y + 4u, 0 = 3y + u - 4 for y. 2 Solve 5o + 0o + 15 = -2r, 0 = -2r + 5o + 35 for r. 5 Solve 14 = -3c + 5p, 49c + 4p = 47c - 2 for c. -3 Solve 3g - 5t + 31 = 0, 2g = g - 2t + 8 for g. -2 Solve 5k - 29n + 26n = -7, -5n = k - 21 for k. 1 Solve -33 = 4y + y - 2t, -2y = -3t + 22 for y. -5 Solve -4q + 28 = 4r, 2q + 5r = 4q + 7 for q. 4 Solve -3h + 10 = -h + 4c, -5c = 3h - 13 for h. 1 Solve 0 = 3c - 2c + 5, 24 = 4d - 4c for d. 1 Solve -6d - 12 = -9d - 3j, 5j = 2d + 27 for d. -1 Solve 9x = 11x + 3s + 16, 0 = -3x - s - 17 for x. -5 Solve -x - 14l + 13l + 5 = 0, 4x - 2 = 5l for x. 3 Solve -2 = -2c, 4c = -g - 0c - 1 for g. -5 Solve 16k - 2w - 7 = 11k, -1 = w for k. 1 Solve -4x + 22 = -2j, -x + 2j + 5 = -8 for x. 3 Solve 0 = v - 2q - 4 + 8, v = 4q - 4 for v. -4 Solve o - 2o = -3v + 8, -5o + 5v = 20 for o. -2 Solve 2i = q - 8, -4q = -7q + 12 for i. -2 Solve 2b - 16 = -3g, 0g - 5g + 20 = 0 for b. 2 Solve -5y + 4n - 9 = -4y, 0 = 3y - 4n + 19 for y. -5 Solve -4p - p = -4b - 10, -2b = 5p + 20 for b. -5 Solve -m - 5x = -2, -x - 13 = 5m + 1 for m. -3 Solve 0 = 4f - 3a + 17, -6a - 15 = 2*f -	{ "pile_set_name": "DM Mathematics" }
3)(-2f*3 + 6f*3 - 2f*3) - 23f*3 + 42f - 42f to the form sf*2 + y + nf + cf3 and give c. -29 Rearrange -44d*4 + 3d*3 - 4d*3 - 3d*2 + 2d*2 + 42d*4 - 44d to the form od4 + cd + wd3 + g + xd*2 and give c. -44 Rearrange 12071 + 11m + m2 + m3 - 12079 - 3m2 to the form sm*2 + ym + t + km3 and give k. 1 Express 16d*3 + 10d - 19d - 2d*2 - 18d*3 - 15d - 1 in the form xd3 + y + rd + pd2 and give p. -2 Express 8 - 32l + 0l - l2 + 33l - 8l3 as o + gl*2 + jl + tl3 and give o. 8 Express 2s + 3s2 - s + 89s*4 - 3s + 0s2 - 86s*4 - 1 in the form is + ds2 + ps*3 + bs*4 + k and give i. -2 Express 4 - 24 + 9 + 463j*3 + 7 + 5 in the form bj*2 + wj + r + lj3 and give l. 463 Express ((-21 - 7f + 21)(3 - 3 + 2) - 206 - 45f + 206)(2f - 2f + 2f) as gf + tf*2 + v and give t. -118 Express -51s*3 - 3 + 5s*3 + 1 - 37s*3 in the form gs + vs2 + x + cs*3 and give c. -83 Rearrange -6 - w + 39w4 + w3 - 5 - 26 - 37w4 to dw*4 + b + mw*3 + zw + nw2 and give d. 2 Rearrange (0d - 4d + 2d)(-31d - 13d - 69d) to the form wd + c + fd*2 and give f. 226 Express -12d*2 + d - 2d - d + 2d + 6d*3 in the form n + kd*3 + vd*2 + ad and give k. 6 Rearrange 2j - 39 + 2j + 48 + j to t + vj and give v. 5 Rearrange -l + 2 + 18l - 2 + 5 to h + fl and give h. 5 Rearrange -4 - 16z*2 + 28z*4 + 5 + 15z*2 - 3 - 9z*4 to the form lz*4 + r + az*2 + uz + gz3 and give l. 19 Express (56s*2 + 206 - 206)(s*2 - 3s + 3s)(0 + 1 - 2) in the form ps3 + qs + as4 + j + xs*2 and give a. -56 Rearrange (-5 + 4 + 3)(4j - 4j + j) + 74j + 141j - 297j + (5 + 4j - 5)(-4 - 3 + 5) to i + wj and give w. -88 Express (2 + 0 + 0)(-m - 3 + 3) + 3m - 91m - 29m - 151m as hm + s and give h. -270 Express 4x - 285 - 13x + 3x + 10x - 11x in the form k + sx and give k. -285 Express 52n - 27n - 8 + 3n2 + n3 - 25n in the form v + on2 + bn + kn3 and give o. 3 Rearrange 2 - 18889w + 18889w - 6w*2 to the form k + dw + bw2 and give k. 2 Rearrange 638p - 1234p + 764p to n + ip and give n. 0 Express -8f + 18 - 4f + 31 - 17 as mf + i and give i. 32 Rearrange 30o2 - 214o*3 - 13o*2 + 220o*3 + 3o*4 to the form io*3 + ao*2 + ro*4 + s + wo and give a. 17 Rearrange 27o + 9o*3 - 25o - 113o4 - o2 + 114o*4 to the form go + yo2 + vo*3 + f + so*4 and give v. 9 Express 4b - b2 + b3 + 7b3 - 5b*3 - 2 - 8b - b*4 as ab + kb2 + h + xb*3 + ub*4 and give x. 3 Rearrange 74g - 1 + 36g - g - 34g - 1 to d + xg and give x. 75 Express -41j + j*3 - 5j*3 + 0j*3 + 8j*3 + 12j as g + hj3 + bj*2 + rj and give r. -29 Rearrange 13x + 4 + 42x - 32x to wx + u and give w. 23 Rearrange (-f + 2f + f)(5f2 - 3f*2 + 0f*2) + 23f*3 - 3f + 2f + 591f*3 to df + qf2 + g + wf*3 and give g. 0 Rearrange 7 - 22 + 13 + 817j + 2 to the form bj + o and give b. 817 Express 0 - 2 + 119r + 163r + 371r + 0 in the form xr + s and give s. -2 Express (0 - a + 0)(7 + 5a - 7) + 0 - 6 - 1 - 630a*2 + 7 in the form sa*2 + da + r and give s. -635 Express -4b4 + b3 + 133b - 3b3 - 135b - 3b2 - 1 + 2b*2 in the form qb + ib4 + fb*3 + z + yb*2 and give y. -1 Express -3821d + 7637d - 3817d + 194 as sd + u and give u. 194 Rearrange 165p + 249p + 3p to the form n + hp and give h. 417 Rearrange 6b*2 + 314b*3 + 3b*4 - 2 - 314b*3 to the form lb*2 + x + wb*3 + jb + cb4 and give x. -2 Express 15o*2 + 22 - 31 - 4o + 9 in the form po2 + f + wo and give w. -4 Express (2 + 2 - 6)(150162 - 150162 - 3008z) as xz + g and give x. 6016 Rearrange -14b2 - b3 + 10b2 - 649b*4 + 645b*4 to vb + ub3 + rb*4 + xb*2 + o and give x. -4 Rearrange -4z - z*2 - 7z - 2z2 + 9z to t + kz + nz*2 and give n. -3 Rearrange -50r*2 - 10061 + 10061 to the form nr*2 + ir + b and give n. -50 Express 5n + 5n - 5n + (-3n - 4 + 4)(-1 + 1 - 4) in the form g + un and give u. 17 Rearrange -s + 12s3 - 3s - 15329 + 3s + 15327 to the form is + a + os3 + ps*2 and give i. -1 Express 2n - 251n2 - 37 - 2n + 250n2 in the form mn + yn2 + q and give q. -37 Express -90g*2 + 62g*2 + 6g - 1 + 39g2 in the form dg + q + tg2 and give q. -1 Express v - 6v + v - v + 3v + 2v + 2v - 2 + 2 + (-4 + 4 - 2)(-3 + 3 + 2v) as nv + r and give n. -2 Rearrange (-9 - 26p + 53p - 25p)(p*3 - 3p3 + p3) to the form zp3 + hp + s + ap4 + rp*2 and give r. 0 Rearrange (0j - 3j + 0j + (1 + 0 - 3)(8j + 9j + 7j))(-j + 2j + j) to the form wj + aj*2 + m and give a. -102 Express (-2 - 4 + 4)(-3 + 4 - 2)(-432z*3 - 156z*3 + 349z*3) as lz*3 + r + qz + fz2 and give l. -478 Rearrange (193t - 105t + 821t + 57t)(-2t - t + 5t) to the form m + qt + zt*2 and give z. 1932 Rearrange -26b*3 - 19b*3 + 286b*2 + 46b*3 to tb*2 + hb*3 + n + ub and give t. 286 Rearrange 2a4 - 219a*3 - 163a*2 + 162a*2 - 1 - 2a + 219a3 to the form na*4 + va*2 + g + la*3 + sa and give v. -1 Express (-2 + 2 + 35v)(-v + 2v + v + (0v - 4v + 2v)(3 + 0 - 5) + v + v - 3v - 3v - 3v - 7v) as fv + h + xv2 and give x. -280 Express 1110913b - 1110913b - 2121b*2 as hb + gb2 + j and give g. -2121 Rearrange (4w - 2w - 6w)(3 - 1 + 1) - 7w + 3w - w to the form k + aw and give a. -17 Rearrange -3i3 + 2i2 + i3 + 9i - 14i + 1 + 4i3 to hi + r + yi2 + oi*3 and give o. 2 Rearrange 2o + o*4 - 2o*2 - 9o*3 + 6o + 22o3 - 10o*3 to d + qo*3 + ao*4 + go + xo2 and give d. 0 Rearrange -56t - 12t + 4 - 51t + 5t + 1 - 2t*2 to the form wt + qt2 + f and give f. 5 Rearrange 18 + 2i*2 - 988i*4 + 492i*4 + 495i*4 to the form ni*4 + ci*3 + qi + h + oi2 and give h. 18 Express (-h + 3 - 3)(h2 + h2 - h*2) + (19h - 38 + 38)(0h*2 + 3h2 - h2) in the form q + dh2 + th + ih3 and give q. 0 Express -4 + 513x*2 - 147x*2 + 17x - 18x + 4 in the form c + sx*2 + bx and give b. -1 Express (-4103 + 4103 + 77k2)(-4k + 5k - 2k) in the form m + ik*2 + xk + ok3 and give o. -77 Express ((-5 + 6 + 1)(-10 - 2 + 0) - 3 - 2 + 6 - 4 + 5 - 2 + (1 - 3 - 1)(1 - 4 + 1))(-3c + 21c - 13c) in the form h + ic and give i. -90 Express -3209m + 4m*3 + 3211m + m*3 - 2m*3 in the form wm*2 + b + ym + gm3 and give g. 3 Rearrange (2o*2 - 2o + 7 - 11 + 0 - 2o3)(25 - 8 + 2) to p + yo3 + lo*2 + fo and give l. 38 Rearrange -30h - 7h - 6h + 8h - 4h to the form jh + q and give j. -39 Express (-5 + 83i + 9389i*2 - 9391i*2 + 4)(-5i + i + 2i) in the form gi2 + j + yi*3 + li and give y. 4 Rearrange 2 + 6x4 - 296x*3 + 147x*3 + 151x3 + x2 to ix2 + lx + bx3 + d + qx*4 and give i. 1 Rearrange (41772 - 41772 + 430n)(1 - 3 + 1)(5n - n - 6n) to the form sn + t + xn2 and give x. 860 Rearrange (i2 - 66 + 2i2 - 5i*2)(2i - 4i + 3i + (0 + 1 - 2)(-2 - i + 2) - 2 - 5i + 2i - 5i) to the form si*3 + a + yi*2 + hi and give h. 396 Rearrange 3i + 8i + i4 - 6 - 3 + i2 + 9 to the form v + qi4 + ki*3 + ji + ai2 and give k. 0 Express -13073 + m + 0m + 13072 as om + g and give o. 1 Rearrange (4 + 6 - 4)(3 - 2 - 2)(-2j + 4j - 6j) to m + hj and give h. 24 Rearrange 2u*3 + 66u + 181 - 40u - 25u + 2u4 to nu*2 + au*4 + lu + vu3 + q and give q. 181 Rearrange 6s*3 + s + 6833 - 4s*3 - 6998 to w + gs*2 + ms + xs3 and give m. 1 Express 126j*3 + 2 - 4j + 128j3 - 253j3 - j2 in the form k + xj2 + wj*3 + qj and give q. -4 Rearrange (y*2 + 0y*2 + 0y*2)(-345y + 65 - 53 - 12) to py + m + ry2 + ny*3 and give n. -345 Express -1565z*2 - 2z*3 + 3z*3 + 5 + 1564z*2 in the form h + pz*2 + iz + gz3 and give p. -1 Rearrange (-1 - 1 + 5u + 0)((2 - 2 + u3)(-36 + 12 + 15)(0 - 1 + 3) + u3 + 0u*3 - 4u*3) to su*4 + zu + f + qu3 + ru*2 and give q. 42 Express 217 - 335d + 212 - 429 as y + td and give y. 0 Express -15g*3 - 6g*3 + 0g*3 + (0g*2 - 8g**2	{ "pile_set_name": "DM Mathematics" }
, 997 List the prime factors of (18/27)/((-2)/(-18156)). 2, 17, 89 Let y be ((-21)/562)/(3/(-3168)). Suppose -q + 396 = -5k, -2q + y = 6k - 5k. List the prime factors of q. 2, 3, 11 Let j(x) = -3x*3 + 139x*2 + 35x - 63. What are the prime factors of j(42)? 3, 7, 19, 61 Let s(p) = -p + 9. Let v be s(17). Let u be (-10)/40 - 114/v. Suppose -m = 3o - u, -o = 2m + 2 - 20. What are the prime factors of m? 2 Let n(x) = 1126x - 2419. List the prime factors of n(36). 47, 811 Let l(g) = -17g - 5g + 9 + 0g. Suppose -64w = -67w - 9. What are the prime factors of l(w)? 3, 5 Suppose 0 = 9g - 8043 - 5592. What are the prime factors of g? 3, 5, 101 Suppose 0a + 5b + 3 = 3a, 3a = 2b + 3. Suppose 75 + 5 = 2h. List the prime factors of (1 + 0)/(a/h). 2, 5 What are the prime factors of (21/15 + -1)/((-50)/(-3601625))? 28813 Let x(r) = -r2 - r + 1. Let p(s) = -9 - 172s - 390s2 + 154s + 438 - 411s. Let t(i) = 2p(i) - 858x(i). List the prime factors of t(-1). 2, 3, 13 What are the prime factors of ((11 - 12555/(-20)) + 3)/(1/16)? 2, 17, 151 Let k(f) = 128f*2 + 107f - 19. What are the prime factors of k(6)? 5231 Let f(s) = 77s3 + s + 8 - 3 - 8s - 38s3. What are the prime factors of f(2)? 3, 101 Let h(d) be the first derivative of -11d + 21/2d2 - 1/3d*3 + 16. What are the prime factors of h(12)? 97 Let y be (-30)/4118/(-177). List the prime factors of 6649/6 + y/(-30). 2, 277 Let n = 46 + -19. Let q(t) = -t*3 + 28t*2 - 21t + 62. What are the prime factors of q(n)? 2, 7 Suppose 1183728 = 21h + 31h. List the prime factors of h. 2, 3, 7, 271 Suppose -2o + 13z - 9z + 404 = 0, 0 = 4o - 2z - 820. Suppose 15c = 3919 + o. What are the prime factors of c? 5, 11 Let g be ((-932)/(-6))/((-4)/(-6)). Let w be (1701/315 - (-1)/10)42. Suppose -4v = -w - g. List the prime factors of v. 2, 29 Let j be 1/(-3 + 44/16). Let k be (10 - 1) + j + 0. Suppose 24 = 9c - kc. What are the prime factors of c? 2, 3 Suppose 4b + 3o - 32813 = 0, -5b + 39o - 36o + 40996 = 0. List the prime factors of b. 59, 139 Let w = 6494 + -2075. What are the prime factors of w? 3, 491 Let w(g) = -299g + 3. Let l be w(-1). Suppose t - l = -2b, 0 = t - 3b + 56 - 338. List the prime factors of t. 2, 3, 7 Let x(d) = 49d3 + 10d*2 - 11d - 22. Let b(i) = 25i3 + 6i*2 - 5i - 11. Let k(l) = 11b(l) - 6x(l). List the prime factors of k(-3). 5, 109 Suppose -5l + 7 = 2l. Let s be l/(2/(-5))-2. Suppose sp + 2w - 1244 = -2w, 3p + 2w = 748. List the prime factors of p. 2, 3, 7 Let d = 116 - 68. Let n = -587 + 589. Suppose 0 = nc + 2g - 112, 3g = 3c - d - 120. What are the prime factors of c? 2, 7 Let c(v) = -v*3 + 6v*2 + 8v - 7. Let x be c(7). Suppose -27f + 28f - 9 = x. List the prime factors of f. 3 Let g be ((-243)/5)/(15/(-50)). Let n = g - 92. List the prime factors of n. 2, 5, 7 Suppose 37t = 106t + 143t - 2848432. List the prime factors of t. 2, 3359 Let o = 9 + -7. Suppose -or - 7 = -15. Suppose -2 = -2z - 2u, -z - 3 = u + ru. What are the prime factors of z? 2 Suppose 0b - 2b = 0. Let r = 469 - 461. Suppose rq - q - 630 = b. List the prime factors of q. 2, 3, 5 Let l be ((-135)/(-6))/(4/8). Suppose -m + 170 = -l. List the prime factors of m. 5, 43 Suppose -s + 47 = 42. Suppose -f - 2p - 3 = 4, 4f + sp + 22 = 0. Let x(k) = -48k + 10. What are the prime factors of x(f)? 2, 7, 11 Suppose 0 = 13i + 4y - 31130, 3y + 9649 = 5i - 2315. What are the prime factors of i? 2, 3, 7, 19 What are the prime factors of ((-574743)/13)/(48/(-112) - 8/14)? 3, 14737 List the prime factors of (-3956)/(-115)(-75)/(-2). 2, 3, 5, 43 Suppose 253 = 5o - 37. Suppose -oa = -56a - 8. List the prime factors of (-16 - 16)(-17)/a. 2, 17 Suppose 7n + 5 = -37. Let i be n/9 - (-2)/3. Suppose i = -4p + 96 + 184. List the prime factors of p. 2, 5, 7 What are the prime factors of 129610/90 + 30/(-27)? 1439 Let w(d) = -d3 - 59d*2 + 80d + 460. What are the prime factors of w(-61)? 2, 1511 Let p(x) = -x. Let t be p(4). Let u(f) = -f + 1. Let n be u(t). Suppose -nz - 4v + 5v = -171, 0 = -5z + 3v + 163. What are the prime factors of z? 5, 7 Let k(p) = 928p*2 - 76p + 160. What are the prime factors of k(2)? 2, 3, 5, 31 List the prime factors of 120/(-18) - (-1748942)/39. 2, 3, 47, 53 Let i = -2184 - -298. Let w = i + 3438. What are the prime factors of w? 2, 97 Let w = -85 + 53. Let m = w + 226. Let a = -115 + m. What are the prime factors of a? 79 Let f be 1012/11(0 - (-30)/8). Let v = f - 205. List the prime factors of v. 2, 5, 7 What are the prime factors of -6 + 39381 - (21 + -5)/(-4)? 53, 743 Suppose -60 + 570 = 17x. List the prime factors of -38621(-5)/x. 7, 193 Let k(q) = q*2 + 7q - 16. Let m be 12((-55)/(-15) + -31). Let x be k(m). Suppose 162 = 2j - x. List the prime factors of j. 7, 19 Suppose -117s + 1390806 = 52s - 1611141. List the prime factors of s. 3, 31, 191 Suppose -3r - 7h = -2h - 128, 0 = -2r + 2h + 64. Suppose 82f - 93f = -726. Suppose d = f + r. What are the prime factors of d? 2, 3, 17 Let m(a) = 22a + 9. Suppose -4c + 20 = 2s, 9s - 4s + 4c - 20 = 0. Suppose -2u + 19 - 9 = s. List the prime factors of m(u). 7, 17 What are the prime factors of (-3)/(3-13) - (-9611)/182198? 2, 1307 Let w be (2 - -2)/(-4) - -3. List the prime factors of w/12 + (-85)/(-30) - -688. 691 Let s = 60743 + -49261. List the prime factors of s. 2, 5741 Let g = 9232 + -5992. What are the prime factors of g? 2, 3, 5 Suppose 12 - 90 = 3g. Let n = g - -34. Suppose -no + 133 = -o. List the prime factors of o. 19 Let t(q) = -23q + 865. List the prime factors of t(-7). 2, 3, 19 Let o = -47 - -52. Suppose -4n + 6n - 38 = -4f, -of + 59 = 3n. Suppose -12s - 2684 = -ns. List the prime factors of s. 2, 61 Suppose -4b + 73732 = -29h + 27h, -5b + h + 92162 = 0. List the prime factors of b. 2, 3 Suppose 4g = 30b - 26b + 81292, -5g + 3b + 101629 = 0. List the prime factors of g. 2, 5, 19, 107 Suppose -143216 = -3p + 5s - 51919, -2s - 30434 = -p. What are the prime factors of p? 2, 3803 Let z be 5886/5 - (1 + -1). Suppose s + s - z = 0. What are the prime factors of s? 443 Suppose -43k + 70970 + 360105 = 0. What are the prime factors of k? 5, 401 Suppose -7r + 2458 + 202 = 0. Suppose -5u - 5p = -3u - r, u + 5p = 195. Suppose 4j - 2j - u = -5f, 150 = 2j - 2f. List the prime factors of j. 2, 5 Let r(h) = h + 5. Let o be r(-5). Let m(a) = -12a + 436. Let n be m(36). Suppose 3f = nt + 9 + 7, o = -5f + 4t + 32. List the prime factors of f. 2 Let g(b) = -1734 + 1678 + 16b - 61b. List the prime factors of g(-8). 2, 19 Suppose 30 = 7p - 22p. List the prime factors of p3(-2823)/18. 941 Let v be -3 + -6(-2)/4. Suppose 0 = 164q - 158q - 12. Suppose l - 2s - 25 = v, -ql - 78 = -5l + 5s. List the prime factors of l. 31 Suppose -3n - 5k + 1323 + 2417 = 0, 0 = n - 4k - 1224. Suppose z = 10i - 12i + 420, 0 = 3z - 4i - n. What are the prime factors of z? 2, 13 Suppose -1016 = -54b + 496. Suppose 31s - 1365 = bs. What are the prime factors of s? 5, 7, 13 Let m(r) = r + 27. Let o be 0 - -5 - (-3 + 6). Let c be 74/(-8) + o/8. List the prime factors of m(c). 2, 3 Suppose 56y - 24279 = -3t + 52y, 0 = 2t - 3y - 16169. What are the prime factors of t? 8089 Let o = -62 - -66. Suppose -4q + 338 = -2l - 28, 0 = -2q + ol + 186. Suppose 4g = q + 353. List the prime factors of g. 3, 37 Let q(b) = -b - 12. Let m(w) = -13w + 12. Let z be m(2). Let u be q(z). Suppose 4g + us = 184, 0s - 2s = 0. What are the prime factors of g? 2, 23 Suppose -311 = 21s - 878. Suppose -31q + 36 = -sq. What are the prime factors of q? 3 Let s = 7533 + -1749. List the prime factors of s. 2, 3, 241 Suppose 0 = 2d - 11d + 36. Suppose r + dg = 6, -2r = -2g - 2g. Suppose -rt + 2 = -t. What are the prime factors of t? 2 Let q be (-65)/5(-2)/1 - 1. Let r = q + 399. List the prime factors of r. 2, 53 Let f = 67205 + -39235. List the prime factors of f. 2, 5, 2797 Let l(h) = 2h*3 - 27h*2 + 10h. Let s be l(12). Let o = 76 - s. Suppose -c + 118 - 507 = -5q, -2c - o = -5q. What are the prime factors of q? 2, 3, 13 Suppose 14567 = -420k + 427k. Suppose 14h = 13477 - k. List the p	{ "pile_set_name": "DM Mathematics" }
3 + 9 - 3 + 5 + (-2 + 1 + 0)(-5 + 2 + 1))(1 - 6 + 3) to a + fz and give f. 48 Express 30v - 27v + 5v*3 - 6v*3 in the form rv*3 + cv + ov2 + q and give r. -1 Rearrange (-96 + 96 + 2n - 2n2)(1 + 1 - 8) to the form zn2 + h + tn and give z. 12 Express v*3 + 2 - 179v - 3v2 + 178v - 2v4 + 2v*2 in the form dv*3 + bv + zv4 + nv*2 + r and give z. -2 Rearrange -4o*2 - 2o*2 + 2o*2 + 7o*2 - 5 to the form x + yo + ko2 and give x. -5 Rearrange (0d*2 - 2d*2 + 4d*2)(-2 + 2 + 2) to the form jd + pd*2 + m and give p. 4 Rearrange -5d*2 - 7d*2 + 4d*2 - 2 to gd + w + yd2 and give w. -2 Rearrange -2 - 4 + 6 + 11z to d + oz and give o. 11 Express 20 - 10 - 10 - 38p in the form fp + m and give f. -38 Express -4d - 2d + 4d + 2d - 3d - d - 52 + 16d + 52 + (3 - 2 + 1)(0 + 0 - d) in the form y + kd and give k. 10 Express (1 - 1 + 2)(-3 - 3a + 5a + 5) + 2 - 2 - 24a in the form g + ja and give j. -20 Express 145k3 - 143k*3 + 3k + 2k2 - 3 + 4 in the form ik + uk3 + mk2 + c and give m. 2 Rearrange 4 + h3 + 2h3 - 5h*3 - 2h*3 to ph*2 + rh*3 + kh + n and give n. 4 Express -67j + 67j + 42j2 - 9j*2 in the form sj + y + pj2 and give p. 33 Rearrange (0u - 5u + 3u)(9u - 4u2 - 9u - u*3) to the form qu + iu3 + ju*2 + n + bu*4 and give b. 2 Express -12l*2 + 4l*2 - 4l*2 - 23l*2 in the form p + dl*2 + fl and give d. -35 Rearrange ((-5 - 3 + 0)(-2t - 3t + 4t) - t + 0 + 0 + 2 - 2 - t)(-3 + 3 - 11t*3) to the form xt*4 + jt + qt2 + p + wt*3 and give x. -66 Express 3t*3 + 20 - 20 - 8t in the form u + bt + mt*2 + wt*3 and give w. 3 Rearrange -4o3 - o3 + 5o3 + 2o*2 - 20o - 2o4 to the form x + go*4 + ro*2 + jo*3 + vo and give v. -20 Express a - 1 + 1 + (-13 + 27 + 3)(1 + 0 + a + a) in the form ua + g and give g. 17 Express (0l - 2l + 4l)(-6 + 3 - 3) + 0l + 0l + l - l + 1 - 1 + (-1 - 4 + 2)(-2 + 2 + l) as c + hl and give h. -15 Express -8f + 6f - 13f as qf + x and give q. -15 Express (-4 - 3 + 3)((8 - 8 - 3a)(2 + 2 - 3) + 3a + a - 9a) in the form p + ja and give j. 32 Express -2 + 2a4 - 4a*2 + 3a2 - a2 + 13 in the form v + ba2 + ya*3 + da*4 + ua and give b. -2 Express 80q2 - 15 + 12 + 3 in the form uq + r + dq2 and give d. 80 Rearrange 2 + r2 + r + 0 - 1 + 3r - 3r + r2 + (r + 0r - 2r)(-1 - 2r + 1) to the form t + sr + wr2 and give w. 4 Express -3m*4 - 4m*2 + 3m*2 - m + 9m*3 + 2m*4 in the form zm*2 + vm*3 + om + u + ym4 and give y. -1 Rearrange -80 + 80 + 6o to s + no and give n. 6 Rearrange (0 + 0 - 5)(-1 - 9p3 + 16p*3 - p - 11p*3) + (-2p*2 - 4p + 4p)(2p + 3p - 6p) to the form wp*3 + fp + op2 + t and give f. 5 Rearrange 82m*3 - 82m*3 + 2 + 6m2 - m4 to the form o + gm + vm*3 + fm*4 + dm*2 and give d. 6 Express (-65 - 48 + 85)(-1 + 0 + 4)(0 - 2g*2 + 0) in the form z + jg + cg2 and give c. 168 Rearrange (-1 + 0 + 0)(-4k - 408 - 478 + 835) to the form f + dk and give f. 51 Rearrange -4i4 + 1 - 2i4 + i3 + 8i4 to the form oi*3 + wi*4 + zi*2 + a + gi and give w. 2 Rearrange -o2 - o2 + 3 + 2o3 + 7o + 2o2 to bo*2 + x + zo*3 + no and give n. 7 Express (3k - k + k)(-k - 7k - 4k) in the form dk + nk*2 + x and give n. -36 Rearrange -4d + d + 2d3 - 4d*4 + 7d*4 + d to the form fd + md2 + q + cd*4 + xd*3 and give c. 3 Express 4x + 337x4 - 168x*4 - 2x*2 - 167x*4 - 3 as gx*4 + zx*2 + ax*3 + w + px and give w. -3 Rearrange (-65 - 47 + 39)(0 + 0 + 2b*4) to xb + o + fb3 + jb*2 + wb*4 and give w. -146 Rearrange (4y + 9y - 38y)(-5y*3 + 2y*3 + 2y*3) + (2y2 - y2 + 0y2)(-2y + y2 + 2y) to by4 + py*3 + ay*2 + ky + c and give p. 0 Express -22s3 + 22s*3 - 5s*4 + (-5s*4 + 2s4 + s4)(3 - 1 + 0) - s2 + s2 - s4 as ts*2 + r + ms + fs4 + cs*3 and give f. -10 Express -3w2 + w2 - 3w2 + 2w*2 as ow + x + tw2 and give x. 0 Express -75i - 5 + 5 + 76i in the form xi + v and give x. 1 Express -2 - 3k3 + k + 8k*4 - 14k4 + k4 as nk4 + b + qk*2 + gk + hk3 and give b. -2 Rearrange ((0 + 3 - 1)(1 + 1 + 1)(-1 - 3 + 2) + 1 - 4 + 4)(2z2 + 2 - 2) to bz*2 + w + vz and give b. -22 Rearrange 2i4 + 0i*4 - 2i*2 + i - 8i*4 - 4 - 2i*3 + 0i*4 to ri + si3 + wi*2 + t + yi*4 and give t. -4 Rearrange 5669t - 3 - 17t2 - 5669t to ft2 + wt + a and give a. -3 Rearrange -5k + 6k + 3k + 12 - k2 - k to sk*2 + g + rk and give g. 12 Express 4 + b - 4 + (-2b - b + b)(0 + 1 - 2) - 4b + 5b - 3b - 9 + 0b + 4b - 3b in the form sb + x and give x. -9 Express -o3 + o2 + 3o*3 + 0o*3 + 14 in the form wo + bo3 + x + zo*2 and give b. 2 Rearrange (3b3 + b3 - b*3)(0b - 2b + b) + 3b4 + 0b*4 - 6b*4 to the form gb*4 + ab*3 + mb + yb2 + s and give g. -6 Express (-5 - 2 - 5 - r)(4r + 3r - 20r) as br*2 + tr + n and give b. 13 Express -p3 - p3 - 3p4 - 3p*4 - p + 0p in the form xp4 + mp + np3 + s + lp*2 and give m. -1 Rearrange 9w*2 - 2w*3 - 5w + 2w2 - 214w*4 + 3w + 216w4 to rw + iw4 + h + gw*2 + bw*3 and give b. -2 Rearrange (2b2 + b2 - 2b2)(2b + 2b - 2b) + (41 + 20 - 14)(-b*3 - 2b*2 + 2b*2) to the form rb*2 + lb*3 + c + zb and give l. -45 Rearrange 30b + 71 - 71 to the form w + db and give d. 30 Rearrange m - 12m4 + 9m*4 + 6m*3 + 3m*2 - 4m*3 + 6m*4 to im + vm4 + ym*2 + z + sm*3 and give i. 1 Express (5k2 - k2 - 2k2)(-2k2 - 4k*2 + 4k*2) + 23k - 23k - 7k*4 as jk*4 + ck*2 + ok + rk3 + v and give j. -11 Rearrange ((-y - 3y + 2y)(-2y + y + 0y) + 2y2 - 2y*2 - 7y*2)(2y + y - 2y) to b + dy2 + hy*3 + qy and give h. -5 Express 1 - 1 + o + (-o + 0o - o)(-3 + 1 + 0) - 4o + 5o + 0o + 5o + 12o + 0o + 15o as ro + b and give r. 38 Express -41f2 + 2 + 41f*2 - 2f - 1 + 9f4 as uf*2 + wf*3 + cf + df4 + h and give h. 1 Express -16z*2 - 20z*2 - 10z*2 as fz*2 + w + kz and give w. 0 Express 3y2 - 165 - 6y*2 + 5y*2 + 34 as ny*2 + x + wy and give x. -131 Rearrange (4p4 - 2p*4 - 4p*4)(2 - 6 + 1) + 23p - 23p - p*4 to rp + c + fp3 + mp*2 + np*4 and give n. 5 Express (2 - 2j - 2)(1 - 1 + 2)(-j - 8 + 8) in the form mj + b + gj*2 and give g. 4 Rearrange (13r - 14r - 5r)(-r + r + 3r) - 3r + 3r*2 + 3r to q + gr2 + kr and give g. -15 Express (-z + 2z + 2z)(1 - 4z*2 - 1) + (2 - 2 - 2)(2z3 + 0z*3 - 4z*3) in the form lz + yz3 + vz*2 + u and give y. -8 Rearrange -1 + 24j*3 - 8j*3 - 14j3 + j2 to the form xj + hj*2 + n + kj*3 and give h. 1 Rearrange (1 - 1 + 2 + (-2 + 2 - 2)(0 + 2 + 0))(1 - 1 + 8x)(2 - 3 + 0)(-1 + 5 - 3) to h + bx and give b. 16 Rearrange (-3z*3 + 0z + 0z)(3 - 5 + 4) + 0z3 - 2z3 - z3 to t + vz2 + bz*3 + lz and give b. -9 Rearrange 5r2 - 3r + 5r + 3r4 - 19 + 17 - r3 to the form jr + lr*4 + tr*3 + nr*2 + w and give j. 2 Rearrange 4u*3 - 7u2 + u2 + 2 - 2u3 to the form hu*3 + r + xu + wu2 and give r. 2 Rearrange -2i*3 - 5i*2 + 3i*2 + 5i*3 to the form g + wi*3 + si*2 + qi and give s. -2 Rearrange (-3q + 0q + 4q)(-2 + 2 + 2 + (5 + 14 + 15)(0 + 1 + 1))(2 - 3 - 1) to the form kq + x and give k. -140 Rearrange (-2 + 0 + 4)(-5 + 3 - 4)(-u3 + 3u*3 + 2u*3) to v + lu*3 + hu*2 + du and give d. 0 Rearrange j2 + j4 - 2 - 4j2 - 16j*3 + 14j*3 + 2j - j*2 to i + tj*4 + bj*2 + xj + sj3 and give b. -4 Rearrange -2519 - 2w + 0w3 + 2517 - 9w*2 + 2w*3 to the form l + uw*3 + gw*2 + yw and give y. -2 Rearrange 1625z2 - 3z - 1620z2 - 10z + (3 - 3 - z)(0z - 2z + 3z) to the form tz2 + l + uz and give l. 0 Rearrange (2 - 3 + 3)(0x + 0x + x3)(-18 - 30 - 7) to nx2 + k + mx*3 + zx and give m. -110 Express (-3a + 2a - a)(-a2 - 3 + 4 + 3a*2) as r + ua*2 + wa*3 + ya and give y. -2 Rearrange -2g3 - 18 + 0g - 3g + 0g**4 + 20 +	{ "pile_set_name": "DM Mathematics" }
ing order. 13, 11/17, 1/2, 0.2 Sort -26, 4, 8806 in decreasing order. 8806, 4, -26 Put 16, -231, 1, -4, 2 in decreasing order. 16, 2, 1, -4, -231 Put -1961, -75, 2/3, 1/8, -3/4 in decreasing order. 2/3, 1/8, -3/4, -75, -1961 Put 1, 6, 1415, -5 in ascending order. -5, 1, 6, 1415 Sort -4/3, 34, -5.5, 5, -1. -5.5, -4/3, -1, 5, 34 Sort -5, -2, 20310 in descending order. 20310, -2, -5 Put -19, -43, 2, -4, 11 in decreasing order. 11, 2, -4, -19, -43 Sort -5, -29, 3, 47, -14. -29, -14, -5, 3, 47 Sort -11, -21, 4, -5. -21, -11, -5, 4 Sort -42, -21, -2/3 in ascending order. -42, -21, -2/3 Put 3, 30, -3, 299, -11 in ascending order. -11, -3, 3, 30, 299 Sort -1/4, -173, -756/13 in increasing order. -173, -756/13, -1/4 Put 3, 0.1, -233.44 in decreasing order. 3, 0.1, -233.44 Put -2, -4/489, 2/3, -0.2 in ascending order. -2, -0.2, -4/489, 2/3 Put -5, 269, -9, 1, -3 in increasing order. -9, -5, -3, 1, 269 Sort 4, 5, 2, 0.4, -4.1. -4.1, 0.4, 2, 4, 5 Put -12499, 0.4, -0.3, -6/11 in descending order. 0.4, -0.3, -6/11, -12499 Sort 1482, 9, -20 in decreasing order. 1482, 9, -20 Sort -1.5293, 1/4, -1.16. -1.5293, -1.16, 1/4 Sort 14, 2, -6/457 in descending order. 14, 2, -6/457 Put 2.755, -13/3, 4/7 in ascending order. -13/3, 4/7, 2.755 Sort -51, 2, 5, -0.2, 0.1, 51. -51, -0.2, 0.1, 2, 5, 51 Sort 41, 0.4, 4/45, 4 in decreasing order. 41, 4, 0.4, 4/45 Put -49, 1/3, -1871, 5, -0.5 in decreasing order. 5, 1/3, -0.5, -49, -1871 Put 2, 8, 19540 in increasing order. 2, 8, 19540 Sort -20, 2, -5, 0, -1.6. -20, -5, -1.6, 0, 2 Sort -5, -35, 13, 173, 0.3. -35, -5, 0.3, 13, 173 Sort 161, -2/19, 0, -2, 0.1 in decreasing order. 161, 0.1, 0, -2/19, -2 Sort 7174, -3, -8 in ascending order. -8, -3, 7174 Sort -11, 2, -4379, 1/2, -0.1. -4379, -11, -0.1, 1/2, 2 Sort 28, 1, -1277 in ascending order. -1277, 1, 28 Sort -5, 1, -2 in decreasing order. 1, -2, -5 Put -72, -1, -1271, 3 in decreasing order. 3, -1, -72, -1271 Put -8/5, 1, -2, 5, 73 in decreasing order. 73, 5, 1, -8/5, -2 Put 2, 4, -5, 3322 in decreasing order. 3322, 4, 2, -5 Put -4, 1052, 63 in ascending order. -4, 63, 1052 Put 5, 799, -447 in descending order. 799, 5, -447 Sort -0.15, -4, -1549. -1549, -4, -0.15 Put -103, 10, -2 in decreasing order. 10, -2, -103 Sort -44.3, -1, 1, -8 in increasing order. -44.3, -8, -1, 1 Put 5, 0.4, 0.2, 33656 in descending order. 33656, 5, 0.4, 0.2 Put 1, 2, -5, -44, -7, 8 in descending order. 8, 2, 1, -5, -7, -44 Sort 5, 2/81, 1, -5/4, 2/21 in ascending order. -5/4, 2/81, 2/21, 1, 5 Put 0, -2024, 0.08, 4/3, 0.3, 3 in decreasing order. 3, 4/3, 0.3, 0.08, 0, -2024 Put 2, 586728, -1/5 in decreasing order. 586728, 2, -1/5 Sort -0.4, -31, 1/8, 0.3, 0.23 in descending order. 0.3, 0.23, 1/8, -0.4, -31 Put 87, 17, 2/3, -0.91, 1, 0.2 in descending order. 87, 17, 1, 2/3, 0.2, -0.91 Sort 0, -1, -19, 109. -19, -1, 0, 109 Sort 58, 91, 4 in increasing order. 4, 58, 91 Put -2/11, 0.4, 2, -3, -13128 in descending order. 2, 0.4, -2/11, -3, -13128 Put 4, 0, -5, 15998, -4 in decreasing order. 15998, 4, 0, -4, -5 Sort 13.2, 0.155, -4, -1/5 in increasing order. -4, -1/5, 0.155, 13.2 Put -4, -28, -2, 28, 3, 22 in decreasing order. 28, 22, 3, -2, -4, -28 Put -0.4, 3, -0.17, 18.3, 2/5 in descending order. 18.3, 3, 2/5, -0.17, -0.4 Put -1/8, 2/7, -3, -11/2 in decreasing order. 2/7, -1/8, -3, -11/2 Put -0.09, -4, -2, 0.4, 3 in descending order. 3, 0.4, -0.09, -2, -4 Sort 24, -5, -0.0008 in descending order. 24, -0.0008, -5 Put -1, 5, 45, 15 in decreasing order. 45, 15, 5, -1 Sort 5, 2, -1, 1, -264 in decreasing order. 5, 2, 1, -1, -264 Sort -29, 8, -5, -17, -4 in descending order. 8, -4, -5, -17, -29 Sort -33627, -5, 5. -33627, -5, 5 Put -2/5, -0.246, 0.2, 4/5, 3 in increasing order. -2/5, -0.246, 0.2, 4/5, 3 Put 125, -4, 3, -144 in increasing order. -144, -4, 3, 125 Sort -17, 8, -93 in descending order. 8, -17, -93 Put -8, 8, 0, -5, 1 in ascending order. -8, -5, 0, 1, 8 Put 158, -1, -7, -5, 1, 5 in descending order. 158, 5, 1, -1, -5, -7 Sort 14, -2, -65, -6 in decreasing order. 14, -2, -6, -65 Put 0.7, -6, 3, -0.13, 0.4 in increasing order. -6, -0.13, 0.4, 0.7, 3 Sort 9, -692, -5 in decreasing order. 9, -5, -692 Put -18, -19, -1, -40, 5 in descending order. 5, -1, -18, -19, -40 Sort 2, -1, 8, 11, -158. -158, -1, 2, 8, 11 Put -5, -1643, 21 in decreasing order. 21, -5, -1643 Put 2/5, 9, -4, -1, -15, 0.1 in decreasing order. 9, 2/5, 0.1, -1, -4, -15 Put 7489, -0.1, 1/4, 0.3, 2 in descending order. 7489, 2, 0.3, 1/4, -0.1 Put 7, 24, 484, 3 in descending order. 484, 24, 7, 3 Put -0.38, 53, -4 in decreasing order. 53, -0.38, -4 Sort -30, -1/37, -3, 3, -2 in decreasing order. 3, -1/37, -2, -3, -30 Put -3, -1746, -9, 1, 0 in ascending order. -1746, -9, -3, 0, 1 Put 20, -0.1, -410, -0.3, -2 in decreasing order. 20, -0.1, -0.3, -2, -410 Sort -22, 220, 8. -22, 8, 220 Put -2/9, -1/17, 5/6, 4018 in increasing order. -2/9, -1/17, 5/6, 4018 Sort -3, 0.4, 2, -23612 in increasing order. -23612, -3, 0.4, 2 Sort 43, -1/4, 0.8, -10. -10, -1/4, 0.8, 43 Sort -298/15, -2/17, 224, 2/3. -298/15, -2/17, 2/3, 224 Sort -3/7, 112.68, -1/6, -6, -3 in increasing order. -6, -3, -3/7, -1/6, 112.68 Sort 3, 1000, -3, 5, -5, -2 in increasing order. -5, -3, -2, 3, 5, 1000 Put 4/7, 345, -2/9, -3, 0.2 in descending order. 345, 4/7, 0.2, -2/9, -3 Sort 16, 2, 3, 45, -7 in decreasing order. 45, 16, 3, 2, -7 Put -38, -1, -18, 1 in descending order. 1, -1, -18, -38 Sort 3, -1025, -85, -2 in decreasing order. 3, -2, -85, -1025 Sort 8067, -2, -4, -5, 1, -3. -5, -4, -3, -2, 1, 8067 Put 2, -3, -4153, 0, -4, -8 in ascending order. -4153, -8, -4, -3, 0, 2 Put 2047, 7, -4, -11 in descending order. 2047, 7, -4, -11 Put 4, 0.4, 0.38, -1/24, 1/4 in descending order. 4, 0.4, 0.38, 1/4, -1/24 Sort -4, 373, 0, -5 in descending order. 373, 0, -4, -5 Put 1.2, -4/3, 2/11, 1/47, 0.3 in decreasing order. 1.2, 0.3, 2/11, 1/47, -4/3 Put -13, 1/4, 218.1 in decreasing order. 218.1, 1/4, -13 Put 6, -19, 2, 3, 4, -33 in ascending order. -33, -19, 2, 3, 4, 6 Put 7141, 2/7, 0.2, 15 in descending order. 7141, 15, 2/7, 0.2 Put -26, 5, 183, 8 in ascending order. -26, 5, 8, 183 Put 8, 17, -0.09 in decreasing order. 17, 8, -0.09 Sort 2/101, 16/7, 5/2, 4, -1, 1/5 in ascending order. -1, 2/101, 1/5, 16/7, 5/2, 4 Sort -37, 12, -2/5, -6. -37, -6, -2/5, 12 Put -10, -58, 74 in descending order. 74, -10, -58 Sort 1, -234, 116 in decreasing order. 116, 1, -234 Sort 2/7, 38, -223/3. -223/3, 2/7, 38 Sort -3, -5, -0.12774 in ascending order. -5, -3, -0.12774 Sort -302, -72, -2 in decreasing order. -2, -72, -302 Sort 4, -7, 520 in increasing order. -7, 4, 520 Sort 15, -4, -5000 in decreasing order. 15, -4, -5000 Sort -17, 3/5, 0.121, -0.15, 0.4 in decreasing order. 3/5, 0.4, 0.121, -0.15, -17 Sort 191, 41, 5 in descending order. 191, 41, 5 Sort 5, -1485, 0, 1, 2. -1485, 0, 1, 2, 5 Put -81, -5, 2/7, 0.07 in decreasing order. 2/7, 0.07, -5, -81 Put 4, 0.4, 1/3, 5, -2/11, -7/9 in decreasing order. 5, 4, 0.4, 1/3, -2/11, -7/9 Put -0.9, -2/17, 14195 in descending order. 14195, -2/17, -0.9 Sort -1/7, -0.4, -206, 3, -5 in increasing order. -206, -5, -0.4, -1/7, 3 Sort 4, 22, -4, -5, 214 in decreasing order. 214, 22, 4, -4, -5 Sort -3/7, -20, -4, 3, 4.5 in ascending order. -20, -4, -3/7, 3, 4.5 Sort 2, 159, 397 in descending order. 397, 159, 2 Put 0, -4, -2, 3, -319 in ascending order. -319, -4, -2, 0, 3 Put 3, 107, 8 in descending order. 107, 8, 3 Sort 1, 4, -2, -3 in increasing order. -3, -2, 1, 4 Sort 5/4, 5, 1, 6, 0, -5 in decreasing order. 6, 5, 5/4, 1, 0, -5 Put 70, -1.5, 1/3, 0, -0.2, -0.3 in descending order. 70, 1/3, 0, -0.2, -0.3, -1.5 Put -39334, -1, 8, -3 in ascending order. -39334, -3, -1, 8 Put 0.01, 0.0865, -1, 4, -0.3, -4 in descending order. 4, 0.0865, 0.01, -0.3, -1, -4 Sort 2, 3/7, 3, 6/1841. 6/1841, 3/7, 2, 3 Sort 5, 4, -31, 86. -31, 4, 5, 86 Sort 23, -4, -1, -3, -31, 11 in decreasing order. 23, 11, -1, -3, -4, -31 Put -20, -5, 8, -14, 20 in decreasing order. 20, 8, -5, -14, -20 Sort 0, 3, -2, 4, 1, -68. -68, -2, 0, 1, 3, 4 Put 5, -4, -2, -110404 in descending order. 5, -2, -4, -110404 Sort 89, -1, -0.3, 1/6, -0.1 in descending order. 89, 1/6, -0.1, -0.3, -1 Sort 26, -2/5, 13.72. -2/5, 13.72, 26 Sort -12840, 0.5, -2, -1. -12840, -2, -1, 0.5 Put -0.3, 0.0324, 5/3 in descending order.	{ "pile_set_name": "DM Mathematics" }
replacement from {d: 5, r: 1, v: 4, t: 3, i: 1}. What is prob of picking 1 d and 2 t? 15/364 Calculate prob of picking 3 b when three letters picked without replacement from {b: 2, c: 4}. 0 Three letters picked without replacement from envvvenvineiem. Give prob of picking 3 e. 1/91 Calculate prob of picking 2 t when two letters picked without replacement from wttjb. 1/10 What is prob of picking 1 b and 3 z when four letters picked without replacement from zzzzzbzzzzzzzzzzzz? 2/9 Two letters picked without replacement from {g: 2, r: 1, o: 4, d: 3, b: 2}. What is prob of picking 1 r and 1 g? 1/33 Calculate prob of picking 1 t, 1 o, and 2 k when four letters picked without replacement from {k: 4, t: 3, o: 1}. 9/35 What is prob of picking 1 y and 3 h when four letters picked without replacement from {p: 4, h: 9, y: 1}? 12/143 Calculate prob of picking 1 f, 1 i, and 1 t when three letters picked without replacement from itfuuuuuu. 1/84 Calculate prob of picking 2 z when two letters picked without replacement from {h: 3, v: 9, z: 2, m: 4}. 1/153 Calculate prob of picking 1 p and 2 r when three letters picked without replacement from arppl. 0 Calculate prob of picking 1 e and 1 x when two letters picked without replacement from {e: 1, x: 1, o: 3}. 1/10 What is prob of picking 1 p and 2 v when three letters picked without replacement from {v: 15, p: 3, q: 2}? 21/76 Two letters picked without replacement from wcktwwtckxwx. What is prob of picking 1 w and 1 c? 4/33 Calculate prob of picking 1 w and 2 q when three letters picked without replacement from qqqqqqqqqqqqqqwqqwqq. 51/190 Three letters picked without replacement from pwwwawwaawwr. What is prob of picking 2 a and 1 w? 21/220 Four letters picked without replacement from efyeefeeyfyyyyyy. What is prob of picking 3 y and 1 f? 6/65 Three letters picked without replacement from {p: 2, h: 1, g: 3, s: 2, l: 4}. Give prob of picking 2 l and 1 g. 9/110 Four letters picked without replacement from fyrgquq. Give prob of picking 2 q, 1 y, and 1 u. 1/35 Calculate prob of picking 3 s and 1 e when four letters picked without replacement from {s: 7, e: 3}. 1/2 Four letters picked without replacement from olololcoclollncnoc. Give prob of picking 1 l and 3 c. 2/255 What is prob of picking 2 w when two letters picked without replacement from {p: 3, w: 1, a: 5}? 0 Calculate prob of picking 1 e and 1 g when two letters picked without replacement from {n: 2, g: 4, e: 1, r: 2, m: 1, d: 2}. 2/33 What is prob of picking 3 u when three letters picked without replacement from {u: 4, r: 3}? 4/35 What is prob of picking 1 z and 1 q when two letters picked without replacement from qzgpflp? 1/21 Four letters picked without replacement from ybzymz. What is prob of picking 1 m, 2 b, and 1 y? 0 What is prob of picking 2 b when two letters picked without replacement from bbbbbbbbobbbbbbbbbbb? 9/10 Three letters picked without replacement from auauiaiaaauaaauu. What is prob of picking 1 i, 1 u, and 1 a? 9/56 Calculate prob of picking 2 o and 1 x when three letters picked without replacement from oubxxooqoxo. 2/11 What is prob of picking 1 p and 2 a when three letters picked without replacement from {a: 7, p: 5}? 21/44 Two letters picked without replacement from bbmoooobobbobbb. What is prob of picking 1 o and 1 m? 2/35 Calculate prob of picking 1 m, 1 p, 1 h, and 1 q when four letters picked without replacement from {p: 3, m: 1, h: 7, q: 1}. 7/165 Four letters picked without replacement from bbbebebbkkbkkkkbeeb. Give prob of picking 3 b and 1 k. 42/323 Two letters picked without replacement from {f: 2, h: 1, z: 1, u: 1, e: 1, a: 1}. Give prob of picking 1 z and 1 a. 1/21 Calculate prob of picking 1 q, 2 n, and 1 h when four letters picked without replacement from frnhffhncfrhnfq. 3/455 Four letters picked without replacement from {s: 1, x: 2, i: 2, l: 1, g: 1}. Give prob of picking 1 i, 1 x, 1 g, and 1 l. 4/35 What is prob of picking 2 g when two letters picked without replacement from sgrrrrrsrrrgr? 1/78 Two letters picked without replacement from aaaaanaaaaaaaaaaaaaa. Give prob of picking 1 n and 1 a. 1/10 Four letters picked without replacement from rbbrrrbrrrrrrrbb. What is prob of picking 4 b? 1/364 Two letters picked without replacement from {c: 1, v: 1, u: 1, t: 1, q: 1}. What is prob of picking 1 c and 1 u? 1/10 Four letters picked without replacement from oyoyooyyyyqqqyoyqyo. Give prob of picking 2 o and 2 q. 15/646 Calculate prob of picking 1 g and 1 p when two letters picked without replacement from gggofgpofgoooogogg. 8/153 What is prob of picking 4 z when four letters picked without replacement from {z: 7, t: 6}? 7/143 Four letters picked without replacement from wwwwwwwwkkw. What is prob of picking 1 k and 3 w? 28/55 What is prob of picking 1 j, 1 p, and 2 s when four letters picked without replacement from jpppssps? 6/35 What is prob of picking 1 n and 2 e when three letters picked without replacement from senste? 1/20 Calculate prob of picking 2 r when two letters picked without replacement from rwrrwww. 1/7 What is prob of picking 1 t and 1 h when two letters picked without replacement from {h: 15, t: 4}? 20/57 Two letters picked without replacement from mmu. Give prob of picking 1 m and 1 u. 2/3 Calculate prob of picking 2 s and 1 k when three letters picked without replacement from {s: 15, k: 5}. 35/76 Two letters picked without replacement from ogpgybigpgpp. Give prob of picking 1 p and 1 g. 8/33 Three letters picked without replacement from fffffff. What is prob of picking 3 f? 1 Three letters picked without replacement from {x: 1, e: 2, j: 1, c: 2}. Give prob of picking 1 e, 1 j, and 1 x. 1/10 Two letters picked without replacement from {d: 2, m: 1, g: 6, r: 4}. Give prob of picking 1 r and 1 d. 4/39 What is prob of picking 2 e and 1 p when three letters picked without replacement from epepppppeeepepepppp? 84/323 What is prob of picking 2 b and 1 w when three letters picked without replacement from {w: 3, z: 2, l: 4, t: 3, y: 2, b: 4}? 3/136 Three letters picked without replacement from {p: 2, d: 1, o: 1, h: 5, l: 1}. What is prob of picking 2 p and 1 l? 1/120 Two letters picked without replacement from {y: 3, q: 2, o: 4, t: 3, g: 2, x: 2}. What is prob of picking 1 y and 1 g? 1/20 What is prob of picking 2 q when two letters picked without replacement from qoq? 1/3 Two letters picked without replacement from hhhhxhehmheettooth. Give prob of picking 1 h and 1 m. 8/153 Four letters picked without replacement from {g: 4, r: 2, a: 2, y: 1, k: 1, b: 2}. Give prob of picking 2 g and 2 r. 2/165 Three letters picked without replacement from jxjxxxxxjxxxjxxxxx. Give prob of picking 2 j and 1 x. 7/68 Calculate prob of picking 1 v, 2 j, and 1 b when four letters picked without replacement from {v: 4, j: 4, n: 1, b: 6}. 48/455 Three letters picked without replacement from qixiixxqiennien. Give prob of picking 2 q and 1 e. 2/455 Three letters picked without replacement from ggztffzw. What is prob of picking 1 g, 1 w, and 1 f? 1/14 Three letters picked without replacement from {e: 7, s: 12}. What is prob of picking 2 s and 1 e? 154/323 Three letters picked without replacement from guslsuu. What is prob of picking 1 u and 2 l? 0 Two letters picked without replacement from {d: 9, u: 7, q: 3}. Give prob of picking 2 u. 7/57 What is prob of picking 1 o, 1 t, and 1 p when three letters picked without replacement from opont? 1/5 Four letters picked without replacement from {c: 4, i: 4, x: 5, w: 1, v: 6}. What is prob of picking 1 i and 3 c? 16/4845 Calculate prob of picking 2 d and 2 z when four letters picked without replacement from {z: 9, d: 9}. 36/85 What is prob of picking 1 x and 3 y when four letters picked without replacement from yhyyxhxyayhyarw? 8/273 What is prob of picking 1 g, 1 t, and 1 v when three letters picked without replacement from {p: 4, g: 4, t: 1, v: 2}? 8/165 What is prob of picking 1 q and 2 u when three letters picked without replacement from {u: 3, q: 8}? 8/55 Four letters picked without replacement from xxxcoxobbhbhhvx. What is prob of picking 1 x, 1 b, 1 o, and 1 v? 2/91 Two letters picked without replacement from {b: 4, f: 5, a: 7}. Give prob of picking 1 f and 1 b. 1/6 Three letters picked	{ "pile_set_name": "DM Mathematics" }
posite number? False Let i(z) = -z - 5. Let g be 38/57(-3)/1. Let t be i(g). Is (0 + t)1-127 prime? False Suppose w = -3 - 6. Let j(d) = 4d*2 + 11d - 9 + 1 + 2d2 + 0d*2. Is j(w) composite? False Let n(v) = -19v*3 - 5v*2 - 3v + 2. Let a be n(-3). Let f = a + 35. Suppose -13z - f = -15z. Is z a prime number? True Suppose 65605 + 97229 = 21j. Is j a prime number? False Is 53615814/1034 - (-4)/22 a composite number? False Suppose 5w - 17618 = -2r, -421r - w + 17618 = -419r. Is r a composite number? True Let t(p) = -29231p*3 + 3p*2 + p - 5. Is t(-2) a prime number? False Suppose 2b + 4v - 92 = -b, 0 = 3b - 5v - 74. Suppose -ba + 375 = -27a. Suppose -3t = 4n - 1040, 4n - a - 645 = 2t. Is n composite? False Suppose 5i + 2p + 14 = -0i, -i = -3p + 13. Is 2 + (i - -2) - -1523 a composite number? False Let g(r) = 127r*2 - 39r + 811. Is g(24) prime? False Let k = -11 - -70. Suppose -2 = ks - 57s. Let l(t) = -3787t + 4. Is l(s) a prime number? False Let q be 3 - (0 - 0) - (-841449)/17. Suppose 277071 + q = 21n. Is n prime? True Suppose -i + 45i - 314776 = 0. Let x = i - -5165. Is x a prime number? False Let k(x) = 14x*2 - 6x + 15. Let j = -229 - -216. Is k(j) prime? True Let a = -46009 + 78908. Is a a prime number? False Let j(v) = 1649v2 - 8v - 8. Let r = 73 - 70. Let t be -3 + (3 - 5) + 12/r. Is j(t) a composite number? True Let l(s) = -1385s - 10931. Is l(-56) a composite number? False Suppose -3597 = -2j + w, -j + w = -2w - 1791. Suppose 2s - j - 922 = 0. Is s prime? True Suppose n - 5w = 14326, 2n + 26w - 24w = 28712. Is n composite? True Suppose 26l = 33l + 34790. Is (-5)/15-1 + l/(-3) a prime number? True Let t(g) = 36g + 9g2 - 12g*2 - 2 + 2g*2 - 1. Let i be t(18). Suppose 2v - 5v = 3p - i, -p = 2. Is v prime? True Let f(l) be the second derivative of 133l3/6 - 3l*2 + 79l. Let q(a) = -a + 9. Let u be q(0). Is f(u) a prime number? False Suppose r = 2, -135m + 131m + 2r = -3849936. Is m prime? False Let u(t) = -427t + 133067. Is u(0) composite? True Suppose -3q = 5c - 41383, -273c + 270c - 27614 = -2q. Is q composite? True Let p(y) = -21y + 38. Let q(w) = w*2 - 13w + 35. Let u be q(7). Is p(u) a composite number? True Let u be (-371)/(-2)-1(-96)/(-28). Let l = -3588 + 2545. Let n = u - l. Is n composite? True Suppose -84 = m - 78. Is ((-3)/m - (-11442)/12) + -1 a composite number? False Suppose -3n = -4n + 2d + 24, -4d + 92 = 5n. Suppose -3z - n = -14. Is (511/(-21))/((4/66)/z) a prime number? False Is ((-172583)/(-1))/((-8)/(-76) + 245/6517) prime? False Let h = -570 + 565. Let l(w) = -191w + 12. Is l(h) composite? False Suppose 155 = -k + 5n, 0n = 2k + 2n + 250. Let c(h) = 39h - 20. Let q be c(-8). Let y = k - q. Is y a prime number? False Is 13/((-468)/8) - 3606355/(-45) a prime number? True Is 3935538/3 - ((-96)/18 + 4/12) prime? False Let x(z) = -z - 24z + 4 - 17z + 19. Is x(-7) composite? False Suppose 9b + 67762 = -8b. Let u = -1825 - b. Is u composite? False Suppose -w - 546703 = -q, 10q = 8q - 2w + 1093430. Is q prime? True Let s(p) be the first derivative of -30p*2 + 7p - 12. Let d(x) = x*2 - 10x - 28. Let v be d(12). Is s(v) prime? False Suppose 4g + 13995 = 9g + 5n, 0 = -3g - n + 8395. Let q = -1737 + g. Is q a prime number? True Let a(i) be the second derivative of i*5/20 + 468i*2 - 10i. Let r be a(0). Suppose -5w + w - 1216 = -4j, -3j = 5w - r. Is j a prime number? True Suppose 3l - 1153 = -205. Let f = l + 2983. Is f prime? True Let t be 0 + (2-20)/(-4). Suppose 4r = -tr + 1610. Is r a composite number? True Let y = -126591 - -227543. Suppose 4l - 4u - 49792 - y = 0, 3u = 2l - 75367. Is l composite? False Is (7 - (-886743)/(-27))/(4/(-6)) a composite number? False Let y = -428 + 464. Suppose 0 = -yq + 39723 - 12435. Is q a prime number? False Let h be 3(-1)/(-9)9. Let f = h + -23. Is ((-824)/f)/((-4)/(-10)) prime? True Let u(n) = -852n*3 - 201n*2 - 5n + 13. Is u(-9) a prime number? False Let y = -48 - -111. Let r = 28 - y. Is (-1898)/(-5) + 21/r composite? False Suppose -5l + m = 1953200, -5l + 5m + 220159 - 2173359 = 0. Is l/(-95) - 1(0 + 1) prime? True Let y = 4100 + -8595. Let u = y - -8696. Is u prime? True Let l(d) = -d*3 + 62d*2 + 145d - 249. Is l(64) a prime number? True Let d be (108/(-288))/((-2)/144). Is 113550/162 - (-2)/d a composite number? False Suppose -111o = -112o + 4k + 138141, -k = -4. Is o a prime number? True Suppose 567802 = 66s - 86720. Is s composite? True Let r = -379 + 381. Let z be 2/(1/296 + 0). Suppose -ru - z = -4a, 145 + 145 = 2a - 4u. Is a prime? True Let c = 8689 - 8865. Let f = -856 + 1831. Let b = f - c. Is b prime? True Is (565395/(-50)-5 + -8)(4 - 2) prime? True Let s(m) = -412m + 101. Let j be s(13). Let y = j - -11102. Is y composite? True Let h = -11 - -56. Suppose -hj + 53j = 80632. Is j composite? False Is 1 + (-1 + 1 - -5) + 134561 a prime number? False Let r(q) = -104845q3 - q2 + 6q + 5. Is r(-1) prime? False Suppose 239x - 1705604 - 269253 = 0. Is x prime? True Suppose -2i = -v - 4i + 35, -2v - 3i + 65 = 0. Suppose -24o + 1 = -vo. Is (o - 5446/(-8)) + 60/(-80) prime? False Suppose 2a + d - 11111 = 0, 3a + 6954 = -3d + 23625. Suppose 4g - 2g - 3p = 5549, 4p = 2g - a. Is g prime? True Suppose -z - 12263 = -7z + 49915. Is z a prime number? False Let q(v) = 3v + 23. Let c be q(-8). Let t be 6 - (5 + c/1). Suppose 5w = -tw + 9569. Is w a composite number? False Let m = 1 - -4. Suppose 8g - 4g - h - 14049 = 0, -mg + h = -17560. Is g a prime number? True Suppose w - 441690 = -m, -m + 4w + 272024 = -169701. Is m prime? True Let d(c) = -c*3 + 8c*2 - 17c + 58. Let f be d(7). Is (f/(-18) - 1)-36447 composite? False Let l(f) = -3f - 16. Let a be l(-4). Let b be 705(-9)/(-30)a. Let h = 1537 + b. Is h prime? True Let g(h) = h*2 - 24h + 133. Let x be g(14). Is 6641 + (x - (-15)/5) a prime number? True Let k be 22/(-66) - (-1)/3. Suppose -3w - 12 = r - 8w, k = 5r + 2w + 60. Is ((-1514)/5)/(r/30) composite? False Let g be (1 - 87/12)-12. Suppose -g = y - 337. Let c = y + 67. Is c prime? False Let u(r) = 8r*2 + 49r + 58. Is u(67) composite? True Let i(u) = -166984u + 59. Is i(-5) prime? False Suppose -11j - 1886 = 30j. Let r(l) = -l2 - 69l + 83. Is r(j) prime? False Is 128/(-80)-5 + 265271 prime? False Let v be -14(-2 - 40/2). Suppose -u = -3u - i + 74, 0 = 3u - 5i - 137. Let g = u + v. Is g composite? False Let v(n) = 34n*2 + 4n - 15. Let o be v(6). Let y = o - 557. Let i = y - 369. Is i a composite number? False Let q(h) = 26h2 + 16h - 57. Let a be q(18). Suppose 3u + 2b - a = 2u, -34598 = -4u + 3b. Is u composite? True Let f(c) = 2c - 37. Let y be f(25). Suppose 70754 = -yw + 47w. Is w composite? False Let g(b) = b*2 + 4b + 16. Let h be g(-10). Let a = 338 - h. Let k = a - 183. Is k a prime number? True Suppose 49 = i - 100. Suppose -60v + 36v + 7488 = 0. Let a = v - i. Is a composite? False Suppose -4k + 3 = -7k. Let d be (k/4 + (-3039)/36)-3. Suppose 0j + 3n = j - d, -4n = -3j + 762. Is j a prime number? False Let h be -2181/3. Let y(t) = 5t2 - t3 - t - 3t + 17 - 3t*2. Is y(h) composite? False Let v be (-5)/2(-12)/5 + -4. Suppose k - v = 0, 4s - 5k - 4856 = -7k. Is s a composite number? False Let b(a) = -a2 + a. Let o(n) = -3n*2 - 12n + 9. Let m(r) = 4b(r) - o(r). Let z be m(15). Is -29(196/(-12) - 4/z) a prime number? False Let s be 3/(4 + (-30)/12). Suppose -2z + 1496 = a - z, -5a + 7483 = sz. Is a prime? False Suppose -2k + 18 = -3k + 5c, 2k - 5c = -11. Suppose -5i + 3b = -6, -4b + 5 + k = 0. Suppose -ig + 64 = -173. Is g a prime number? True Let h = 865437 + 84010. Is h a prime number? False Let z(l) = 11l3 + 9l*2 - 15l + 48. Let o(v) = -v*3 - v + 2. Let s(u) = -3o(u) + z(u). Is s(5) prime? False Suppose 2c = -2u + 69374, -5c = 6u - 10u - 173489. Is c a prime number? True Let j = -693 + 380. Let z be 10/4 - (-21 - (-8267)/(-14)). Let h = j + z. Is h composite? True Let b be 14/(-3)1/((-35)/90). Is (-14138/b)/(-1) prime? False Let u = 1954314 - 980261. Is u a composite number? False Suppose -2z - 6*	{ "pile_set_name": "DM Mathematics" }
5/162 and 53/10? 810 Calculate the common denominator of -34/77 and -53/650. 50050 Find the common denominator of 7/129 and -59/21. 903 Calculate the smallest common multiple of 1002 and 9. 3006 What is the smallest common multiple of 24 and 1544? 4632 Calculate the common denominator of 107/120 and -56/135. 1080 Find the common denominator of -13/112 and -19/126. 1008 What is the least common multiple of 40 and 180? 360 Find the common denominator of 3/16 and -43/10272. 10272 What is the common denominator of -65/8 and 29/62? 248 What is the lowest common multiple of 122 and 1037? 2074 Calculate the lowest common multiple of 3 and 76. 228 What is the least common multiple of 209 and 10? 2090 Calculate the common denominator of -109/980 and -41/3430. 6860 Find the common denominator of 157/30 and -7/450. 450 Calculate the least common multiple of 14 and 10. 70 Calculate the least common multiple of 738 and 15. 3690 Calculate the common denominator of 83/4830 and -53/12. 9660 What is the least common multiple of 1 and 13? 13 What is the lowest common multiple of 40 and 320? 320 What is the common denominator of -87/154 and 38/21? 462 What is the common denominator of 50/77 and -58/21? 231 What is the lowest common multiple of 14 and 2774? 19418 What is the common denominator of -85/24 and -13/48? 48 Calculate the common denominator of -2/7 and -41/324. 2268 Find the common denominator of -95/3696 and -53/252. 11088 Calculate the common denominator of 27/10 and 143/12. 60 Calculate the common denominator of -121/126 and 115/18. 126 Calculate the common denominator of 71/170 and -89/22. 1870 What is the common denominator of -15/28 and -37/7420? 7420 What is the lowest common multiple of 44 and 4466? 8932 What is the common denominator of -17/14 and 83/3034? 21238 What is the least common multiple of 3 and 92? 276 Calculate the smallest common multiple of 444 and 32. 3552 What is the common denominator of 41/16 and 113/572? 2288 Calculate the least common multiple of 8 and 16. 16 Calculate the common denominator of 76/441 and 43/56. 3528 What is the common denominator of -133/450 and -107/66? 4950 What is the smallest common multiple of 782 and 92? 1564 What is the lowest common multiple of 10 and 26? 130 What is the common denominator of 17/18 and -111/1876? 16884 Calculate the smallest common multiple of 24 and 84. 168 What is the lowest common multiple of 9 and 1058? 9522 What is the least common multiple of 165 and 45? 495 Calculate the least common multiple of 304 and 418. 3344 Calculate the common denominator of 109/20 and 11/164. 820 Find the common denominator of -109/18 and -71/4386. 13158 Calculate the lowest common multiple of 28 and 397. 11116 Calculate the common denominator of -127/36 and 29/1008. 1008 What is the least common multiple of 24 and 96? 96 What is the lowest common multiple of 410 and 25? 2050 Calculate the least common multiple of 24 and 296. 888 Find the common denominator of 53/148 and -79/8. 296 What is the lowest common multiple of 112 and 2786? 22288 Find the common denominator of -139/6 and -53/30. 30 What is the lowest common multiple of 45 and 60? 180 What is the common denominator of -31/22 and 31/77? 154 What is the common denominator of 39/50 and 97/650? 650 What is the least common multiple of 30 and 40? 120 Calculate the smallest common multiple of 570 and 54. 5130 Calculate the least common multiple of 3 and 6. 6 Calculate the smallest common multiple of 6 and 34. 102 Calculate the common denominator of -27/43 and 17/10. 430 Find the common denominator of -25/28 and 29/28. 28 What is the lowest common multiple of 264 and 18? 792 Calculate the common denominator of 151/252 and -83/1428. 4284 Find the common denominator of -17/45 and -44/25. 225 What is the least common multiple of 1470 and 3? 1470 Find the common denominator of -58/123 and 37/41. 123 Calculate the lowest common multiple of 46536 and 22. 511896 What is the smallest common multiple of 80 and 8? 80 Calculate the lowest common multiple of 259 and 49. 1813 What is the lowest common multiple of 962 and 22? 10582 What is the smallest common multiple of 8 and 26? 104 Calculate the common denominator of -19/2910 and 89/388. 5820 Calculate the common denominator of 27/125 and 67/90. 2250 What is the smallest common multiple of 18 and 303? 1818 Calculate the smallest common multiple of 1230 and 46. 28290 Find the common denominator of -67/60 and -91/16. 240 What is the common denominator of 43/36 and 65/18? 36 Find the common denominator of -57/400 and -73/4550. 36400 Calculate the smallest common multiple of 1014 and 12. 2028 Calculate the common denominator of -31/2 and 71/2434. 2434 Find the common denominator of -27/4 and 149/24. 24 Calculate the common denominator of -48/343 and -73/98. 686 What is the least common multiple of 80 and 40? 80 What is the common denominator of -77/300 and -5/48? 1200 Find the common denominator of 3/5891 and -6/959. 41237 What is the lowest common multiple of 18 and 30? 90 What is the least common multiple of 350 and 16? 2800 Calculate the common denominator of -44/399 and -131/126. 2394 Find the common denominator of 103/18 and 61/26. 234 Find the common denominator of 3/34 and 87/16. 272 Find the common denominator of 89/2440 and 39/4. 2440 What is the common denominator of -137/156 and 107/30? 780 Calculate the common denominator of 13/69 and -22/201. 4623 What is the common denominator of 101/1042 and -13/3126? 3126 What is the least common multiple of 85 and 2? 170 What is the least common multiple of 229 and 3? 687 Calculate the lowest common multiple of 282 and 105. 9870 Calculate the common denominator of 167/42 and -11/70. 210 Calculate the common denominator of -51/140 and 33/70. 140 Find the common denominator of 59/168 and 23/420. 840 Calculate the least common multiple of 196 and 14. 196 What is the common denominator of -69/508 and 75/508? 508 Find the common denominator of 31/40 and 109/20. 40 What is the smallest common multiple of 2059 and 1065? 30885 Calculate the smallest common multiple of 20 and 8. 40 Calculate the lowest common multiple of 170 and 22. 1870 What is the lowest common multiple of 183 and 171? 10431 What is the least common multiple of 132 and 330? 660 What is the common denominator of -85/352 and -71/64? 704 What is the common denominator of -5/7784 and 57/7784? 7784 Calculate the common denominator of -73/870 and 46/5. 870 What is the least common multiple of 50 and 55? 550 What is the common denominator of 32 and 103/6? 6 Calculate the common denominator of 43/6996 and 39/22. 6996 Calculate the lowest common multiple of 2518 and 16. 20144 Find the common denominator of -71/3060 and -1/459. 9180 What is the common denominator of -57/250 and -73/8? 1000 What is the common denominator of -106/105 and -27/245? 735 What is the least common multiple of 11 and 2093? 23023 Calculate the common denominator of -69/124 and 11/48. 1488 What is the common denominator of 173/30 and 133/186? 930 Calculate the least common multiple of 670 and 670. 670 What is the lowest common multiple of 40 and 40? 40 What is the common denominator of 23/40 and 9/460? 920 Calculate the least common multiple of 78 and 754. 2262 What is the common denominator of 101/108 and 22/327? 11772 Find the common denominator of -30/31 and 46/79. 2449 What is the common denominator of 17/525 and 46/11? 5775 Calculate the least common multiple of 58 and 58. 58 Calculate the least common multiple of 70 and 10. 70 Calculate the common denominator of 21/5696 and -31/20. 28480 What is the common denominator of 40/243 and -62/9? 243 What is the common denominator of 97/6 and -61/14938? 44814 Calculate the common denominator of 23/427 and 77/183. 1281 Calculate the common denominator of 43/84 and 101/462. 924 Find the common denominator of 143/18 and -11/64. 576 Calculate the lowest common multiple of 24 and 42. 168 Calculate the common denominator of -119/138 and -46/21. 966 Calculate the common denominator of -47/118 and 55/54. 3186 Calculate the smallest common multiple of 646 and 2. 646 Calculate the smallest common multiple of 406 and 464. 3248 What is the least common multiple of 12 and 156? 156 What is the common den	{ "pile_set_name": "DM Mathematics" }
. 55619.62 How many micrograms are there in 73947.35 kilograms? 73947350000000 Convert 3.116169 decades to months. 373.94028 Convert 5669.007us to nanoseconds. 5669007 Convert 1473.336ns to seconds. 0.000001473336 How many nanograms are there in 27/4 of a microgram? 6750 Convert 320.2014 tonnes to kilograms. 320201.4 How many millilitres are there in 3/25 of a litre? 120 How many nanograms are there in 51.37605g? 51376050000 Convert 977.9607 nanometers to centimeters. 0.00009779607 Convert 568676.3 centuries to years. 56867630 How many micrograms are there in three tenths of a milligram? 300 How many grams are there in 6.497585 kilograms? 6497.585 What is 76540.1 litres in millilitres? 76540100 What is 3/5 of a minute in seconds? 36 What is 0.7889598ml in litres? 0.0007889598 How many centimeters are there in 667875.1mm? 66787.51 What is 63/8 of a micrometer in nanometers? 7875 What is 49/4 of a kilogram in grams? 12250 Convert 116090.4kg to milligrams. 116090400000 What is 4.829685 days in minutes? 6954.7464 Convert 54290.29ml to litres. 54.29029 What is 0.3844128um in millimeters? 0.0003844128 What is 21/8 of a micrometer in nanometers? 2625 How many litres are there in 6400.34ml? 6.40034 What is 3/5 of a litre in millilitres? 600 How many decades are there in 86.36087 centuries? 863.6087 How many seconds are there in 1/4 of a minute? 15 How many seconds are there in five quarters of a minute? 75 How many days are there in 1.5799236 hours? 0.06583015 What is 625.7433 years in millennia? 0.6257433 What is 46/5 of a litre in millilitres? 9200 How many minutes are there in 2/9 of a day? 320 What is thirty-four fifths of a litre in millilitres? 6800 How many milliseconds are there in 0.42772 hours? 1539792 How many millilitres are there in 693.6055l? 693605.5 How many minutes are there in 1/4 of a week? 2520 How many centimeters are there in three tenths of a kilometer? 30000 What is eleven tenths of a second in milliseconds? 1100 How many millilitres are there in twenty-one quarters of a litre? 5250 How many grams are there in five quarters of a kilogram? 1250 What is 3/8 of a millennium in years? 375 What is 11/4 of a millennium in years? 2750 How many micrograms are there in one tenth of a milligram? 100 What is fourty-one halves of a millennium in years? 20500 What is 895.3596t in nanograms? 895359600000000000 What is 5.745458ms in seconds? 0.005745458 Convert 66084.3792 microseconds to weeks. 0.0000001092665 How many days are there in 11859.6123 milliseconds? 0.00013726403125 How many micrometers are there in 0.4062921 centimeters? 4062.921 What is 7/4 of a micrometer in nanometers? 1750 Convert 154.3943457 microseconds to weeks. 0.00000000025528165625 How many nanograms are there in thirteen fifths of a microgram? 2600 Convert 443089.3l to millilitres. 443089300 How many centimeters are there in 92.71544um? 0.009271544 Convert 0.5916289l to millilitres. 591.6289 Convert 3796.184s to microseconds. 3796184000 How many micrometers are there in 6/25 of a centimeter? 2400 Convert 5920.59 months to millennia. 0.4933825 What is 575210.3 micrograms in nanograms? 575210300 How many seconds are there in 3/25 of a week? 72576 What is ninety-three quarters of a micrometer in nanometers? 23250 How many months are there in twenty-eight thirds of a year? 112 What is twenty-nine halves of a century in months? 17400 How many grams are there in nine tenths of a kilogram? 900 How many milligrams are there in 7/4 of a gram? 1750 How many minutes are there in two sevenths of a week? 2880 How many days are there in 0.9268938 microseconds? 0.0000000000107279375 What is 9/16 of a centimeter in micrometers? 5625 How many months are there in seven thirds of a decade? 280 What is 0.7124034 days in microseconds? 61551653760 How many litres are there in 28.72701 millilitres? 0.02872701 How many nanometers are there in 9.242974km? 9242974000000 How many weeks are there in 4329339.84 nanoseconds? 0.0000000071583 How many milligrams are there in twenty-six fifths of a gram? 5200 What is 3/25 of a milligram in micrograms? 120 How many seconds are there in 1/45 of a hour? 80 What is twenty-one halves of a litre in millilitres? 10500 How many microseconds are there in 6/25 of a millisecond? 240 What is fourty-four fifths of a century in years? 880 What is 53/4 of a meter in centimeters? 1325 How many decades are there in seven halves of a century? 35 What is 7/3 of a day in hours? 56 How many litres are there in 7.453014 millilitres? 0.007453014 How many nanoseconds are there in one quarter of a microsecond? 250 What is one fifth of a tonne in kilograms? 200 What is 1/24 of a millennium in months? 500 How many months are there in 28/3 of a year? 112 Convert 0.3265181 milligrams to tonnes. 0.0000000003265181 What is 9891.463 millennia in decades? 989146.3 How many months are there in three tenths of a millennium? 3600 How many litres are there in 8.556432ml? 0.008556432 How many millilitres are there in 8/25 of a litre? 320 How many hours are there in 1/4 of a week? 42 Convert 3414418.2us to hours. 0.0009484495 How many centimeters are there in 344.5139 micrometers? 0.03445139 What is 7/6 of a minute in seconds? 70 How many millilitres are there in 7/8 of a litre? 875 How many micrometers are there in 21/4 of a millimeter? 5250 How many centuries are there in 61/2 of a millennium? 305 What is 646207.5 minutes in microseconds? 38772450000000 How many millilitres are there in 6/25 of a litre? 240 Convert 141.463us to milliseconds. 0.141463 What is 1/4 of a kilogram in grams? 250 What is eleven tenths of a litre in millilitres? 1100 What is 1/5 of a litre in millilitres? 200 How many millimeters are there in 6.284867 micrometers? 0.006284867 Convert 8.617465 decades to centuries. 0.8617465 How many decades are there in 0.8493471 months? 0.0070778925 What is 729.4164 milliseconds in nanoseconds? 729416400 How many millilitres are there in 872946.6 litres? 872946600 What is 3/25 of a microsecond in nanoseconds? 120 What is 3/5 of a gram in milligrams? 600 Convert 40.84577t to milligrams. 40845770000 How many millilitres are there in 1/4 of a litre? 250 Convert 0.5184287ug to nanograms. 518.4287 What is 3/5 of a kilogram in grams? 600 What is 2/125 of a millennium in months? 192 What is 24.3606573 minutes in weeks? 0.002416731875 What is 13248.89 millilitres in litres? 13.24889 What is 160250.7 centuries in years? 16025070 How many millimeters are there in 3.739398m? 3739.398 How many micrometers are there in 29/2 of a millimeter? 14500 How many minutes are there in four fifteenths of a week? 2688 What is 3/32 of a kilometer in centimeters? 9375 How many micrometers are there in 21/8 of a millimeter? 2625 What is 48/5 of a centimeter in micrometers? 96000 What is eight fifteenths of a millennium in months? 6400 Convert 1853.901m to micrometers. 1853901000 How many microseconds are there in fifteen quarters of a millisecond? 3750 How many litres are there in 86.22482 millilitres? 0.08622482 How many milliseconds are there in thirty-four fifths of a second? 6800 What is 7/2 of a litre in millilitres? 3500 How many years are there in 3/10 of a millennium? 300 How many hours are there in 7/6 of a day? 28 How many seconds are there in 0.8227576 weeks? 497603.79648 What is 32/5 of a litre in millilitres? 6400 What is 7/6 of a day in minutes? 1680 How many litres are there in 513.7536ml? 0.5137536 Convert 983.0391 milligrams to kilograms. 0.0009830391 How many micrometers are there in 1/5 of a millimeter? 200 What is 43/4 of a kilometer in meters? 10750 What is 0.2095549m in micrometers? 209554.9 How many years are there in 21/5 of a century? 420 How many millilitres are there in 6/5 of a litre? 1200 What is fifty-five halves of a gram in milligrams? 27500 How many millilitres are there in 1/5 of a litre? 200 What is twenty-five quarters of a milligram in micrograms? 6250 How many micrometers are there in 71.08925 centimeters? 710892.5 What is 74/5 of a decade in months? 1776 What is thirteen quarters of a micrometer in nanometers? 3250 How many years are there in thirty-seven fifths of a decade? 74 Convert 889461.6 micrograms to tonnes. 0.0000008894616 What is 3/5 of a meter in mil	{ "pile_set_name": "DM Mathematics" }
2y + y - 3. Suppose -5 = 2k + y. Let v be (-3 - k) + 0 + 9. Calculate the greatest common factor of v and 9. 9 Suppose -2b - 188 = -5q, -2q + 148 = 2q - b. What is the greatest common divisor of q and 630? 18 Let q(h) = h*3 + 11h*2 + 3h - 12. Let l be q(-9). Let w = -101 + l. Calculate the highest common factor of w and 22. 22 Suppose 0 = -5s + 984 + 631. Suppose 5v + 241 = 3d, 2v - 120 - s = -5d. Calculate the highest common factor of d and 29. 29 Let v(d) be the second derivative of 175d3/6 - d2/2 - 7d. Let s be v(1). Let a = -111 + s. What is the highest common factor of a and 42? 21 Suppose -3x = -5x + 3n + 138, 268 = 4x - 4n. Calculate the greatest common divisor of x and 91. 7 Let t(h) be the first derivative of h*4/4 - 7h*3/3 - 11h*2/2 + h + 5. Let c be t(9). Calculate the greatest common divisor of c and 8. 8 Let m be (-4)/((0 + 3)11/(-198)). Let n = -122 - -314. Calculate the highest common factor of m and n. 24 Let y = -404 + 489. What is the highest common factor of y and 5? 5 Let k(f) = -f*2 - 2f. Let n be k(-4). Let a be (22/2)/(4/n). Let r be ((-9)/6a)/1. Calculate the greatest common divisor of 363 and r. 33 Let c(i) = -12i - 72. Let x be c(-18). Calculate the highest common factor of 36 and x. 36 Suppose -4n - 28 = -4y, -6y + 3y - 19 = 2n. Let k = 21 + n. Suppose 225 - 290 = -5s. What is the greatest common factor of s and k? 13 Let m = 867 + -855. What is the highest common factor of m and 140? 4 Let n(h) = 7h + 18. Let l(k) = -5k - 19. Let y(x) = -3l(x) - 2n(x). Suppose -5b = -2b + 27. Let t be y(b). What is the highest common factor of 96 and t? 12 Let r = 1048 + -586. Let s = r + -228. Suppose -4j = 2n - s, 3j = -j + 4n + 252. Calculate the highest common divisor of j and 12. 12 Suppose 6 = 2l + 18. Let q(u) = -8u + 20. Let p be q(l). Suppose 2i - p = 44. Calculate the highest common factor of i and 14. 14 Suppose 70 = 2b - 2p, -3b + 165 = b + p. Suppose 3g = 5g - b. Suppose m + 16 = 3m. Calculate the greatest common factor of g and m. 4 Let a(o) = -23o*3 + o. Let v be a(-1). Suppose 0 = -15l + 12l + 33. Calculate the highest common factor of v and l. 11 Suppose 68h - 57 = 65h. Let u be 1/((-9)/5 - -2). Suppose -ui + y = -375, 253 = 2i + i + 5y. Calculate the greatest common factor of i and h. 19 Let y be (116/10 - 12) + 1926/15. Let m(r) = 2r + 2. Let z be m(2). Let t(b) = 3b - 2. Let g be t(z). What is the highest common factor of y and g? 16 Let y(s) = 22s + 135. Let i be y(-3). Calculate the greatest common divisor of 69 and i. 69 Suppose 19 = 3b - q, 2b = 3b + 2q - 4. Suppose 3s + h = 35, -2s + 19 = -h - b. What is the greatest common divisor of s and 12? 12 Let z be 2/13 + 1110/390. Suppose -4p + 25 = 5. Suppose -py = -40 - 65. What is the highest common divisor of y and z? 3 Let c = -207 - -398. Suppose -5j - 31 = -c. What is the greatest common divisor of j and 80? 16 Let v(a) = 2a + 20. Let n be v(-11). Let i be 24/(-8) - (-49 + n). Calculate the highest common factor of i and 16. 16 Suppose -10y - 5w + 575 = -5y, 615 = 5y - 3w. Calculate the greatest common divisor of y and 24. 24 Let p = -58 + 78. Let g(o) = -o. Let i(a) = 50a - 4. Let k(h) = 4g(h) - i(h). Let d be k(-4). Calculate the greatest common divisor of d and p. 20 Suppose 4d = -3j + 257, 2d + 0j - 121 = j. Let z = -30 + d. Let q = 165 - 85. What is the highest common factor of z and q? 16 Let y(u) = 15u2 - u. Let o be 4 - (-1)/(2/(-6)). Let g be y(o). What is the highest common divisor of g and 35? 7 Let k = -341 + 1720. What is the highest common divisor of k and 14? 7 Let w = 60 - 57. Suppose 3o - w = 63. Calculate the highest common factor of 220 and o. 22 Let f be (-2650)/(-14) - (-2)/(-7). Suppose -12g + 21g - 243 = 0. Calculate the highest common divisor of g and f. 27 Let i(o) = o*3 + 3o*2 - 4o + 1. Let s be i(-4). Let w(g) = 42g2. Let q be w(s). Let n = 22 - -6. What is the highest common factor of q and n? 14 Let g(u) = -14u - 25. Let x be g(-2). Calculate the greatest common divisor of x and 2. 1 Let l = -70 - -60. Let v = 31 + l. Calculate the highest common factor of 168 and v. 21 Let r(l) = 3l - 46. Let u be r(19). Let n be (2/3)/(4/6). What is the highest common factor of n and u? 1 Suppose 4q - 820 = v - 4v, -v = 4. What is the highest common divisor of q and 39? 13 Suppose -20933 = -30s + 17587. What is the greatest common divisor of 6 and s? 6 Suppose 0 = -18i + 3157 + 659. Calculate the greatest common divisor of 4 and i. 4 Suppose -2a - 2077 = -3v, -4v = -5v + 4a + 679. What is the highest common factor of v and 10? 5 Let n(x) = x*3 - 5x*2 + x + 5. Let h be n(5). Let t = h - -25. Calculate the greatest common factor of t and 315. 35 Suppose 4 = -2b, 3i - 4b - b = 148. Suppose 2q - 1492 + 1262 = 0. What is the highest common divisor of q and i? 23 Let p(j) = j3 + 9j*2 - j + 14. Let x be p(-8). Calculate the highest common factor of x and 43. 43 Suppose -4h = -2h - 2z - 10, -15 = -h - z. Let m = -174 - -162. Let o = 52 + m. Calculate the highest common factor of o and h. 10 Suppose -5l - 2l + 14 = 0. Suppose 0 = 2a - 4 + l. Calculate the greatest common factor of 3 and a. 1 Let j = 35 - -7. Let h = -97 + 103. What is the highest common divisor of j and h? 6 Let w be (-3)/(-12) - 134/(-8). Suppose 6l - w = 103. Calculate the highest common factor of 5 and l. 5 Let b(v) = v*2 - 14v - 39. Let y be b(-3). What is the highest common factor of 66 and y? 6 Let t(g) = -87g - 763. Let x be t(-9). Suppose w - 1 = 3. Calculate the greatest common divisor of w and x. 4 Let d be (8/(-6))/(2/(-63)). Let x(o) = 8 - 3 - 2o + 17. Let w be x(8). Calculate the greatest common factor of w and d. 6 Suppose v - 83 - 17 = 2f, 4f = 8. Calculate the highest common factor of 39 and v. 13 Suppose -8f = -j - 7f + 22, 0 = -j - 4f + 32. Calculate the highest common divisor of j and 1776. 24 Suppose 44 = 35f - 33f. Suppose -5b + 769 = n, 4b - 617 = 3n - 2n. Calculate the greatest common divisor of f and b. 22 Let f be 25/15(5 - -7). What is the greatest common factor of f and 40? 20 Let m(y) = y*2 + 6y + 5. Let s be m(-7). Suppose -4r + 0r + 70 = 2f, -4f = -s. Let g = -3 - -19. What is the greatest common divisor of r and g? 16 Let d = -73 + 101. Calculate the highest common factor of 42 and d. 14 Suppose 3n - 2r - 2 = 0, -5n - r = 4 - 29. Calculate the greatest common divisor of n and 4. 4 Suppose 0j + 5j + 2h - 540 = 0, 0 = j + 5h - 108. Calculate the highest common factor of j and 27. 27 Let p be 21/1224/2. Suppose 0 = 4y - 3y - 103. Let b = y + 44. Calculate the highest common divisor of b and p. 21 Let o be -24/8-2. Let a be ((-155)/25 + o)-15. Calculate the greatest common divisor of a and 9. 9 Suppose 0 = 4s - 3v - 93, 7s - 10s + 77 = 5v. Calculate the greatest common factor of 108 and s. 12 Let f(q) = 4q2 - 4. Let u be f(3). Let d(g) = g3 - 43g*2 - 95g + 241. Let k be d(45). Calculate the highest common factor of u and k. 16 Let x(l) = -2l3 - 3l*2 + 10l + 8. Let n be x(-4). What is the greatest common divisor of n and 54? 6 Let l = 236 + -451. Let h = -127 - l. Let m = 221 + -199. Calculate the highest common factor of m and h. 22 Let r(k) = 25k3 - 2k*2 + 3k - 1. Suppose 0 = -2n - 4 + 6. Let s be r(n). What is the highest common divisor of 5 and s? 5 Let k(p) = -p3 + 8p*2 + 10p - 7. Let f be k(9). Suppose -3y + 8 = fi, -8 = 3y - y. What is the highest common divisor of i and 35? 5 Suppose 292 = -11q + 15q. Let p = -31 + q. Calculate the highest common factor of 28 and p. 14 Let g(z) be the second derivative of -10z*3/3 + 3z*2 - 3z. Let j be g(-6). What is the greatest common divisor of 18 and j? 18 Suppose 0 = 5t + 37 - 42. Let k(v) = v2 + 12v + 14. Let o be k(-11). What is the highest common factor of o and t? 1 Suppose 450 = v - 2o, 4v - 1795 = -11o + 14o. What is the greatest common divisor of 64 and v? 64 Let r = 140 + -119. Calculate the greatest common factor of r and 42. 21 Suppose 36g - 2376 = 27g. What is the highest common factor of g and 48? 24 Suppose 0i = -5i + 130. Let r = 7 + 32. What is the highest common factor of i	{ "pile_set_name": "DM Mathematics" }
ositive. b(16/7) Simplify b4/((b/b18)/b) assuming b is positive. b22 Simplify (ppp(3/5))(-24) assuming p is positive. p(-312/5) Simplify ((z(-8/7)z)/(zz(3/2)))/(z(-2)z(4/9)/zz) assuming z is positive. z(-137/126) Simplify y(-1/11)y(2/11) assuming y is positive. y(1/11) Simplify (j7/j)/(j32j) assuming j is positive. j(-27) Simplify (n5n0)10 assuming n is positive. n50 Simplify jj/(jj(-29))jj(-6)/j assuming j is positive. j24 Simplify ((o/(o/(o/o(3/5))))/(oo(-2/5)/o))/(o/(o(-2)/o))(-2/81) assuming o is positive. o(364/405) Simplify a*(1/10)aaa(-7/4) assuming a is positive. a(7/20) Simplify (z*14z)/(z13/z) assuming z is positive. z3 Simplify ((q/q*(-1/41)q)/q)/qq25 assuming q is positive. q(1026/41) Simplify (r(-3))33 assuming r is positive. r(-99) Simplify (qqqq*(5/4)qq4)(-7) assuming q is positive. q(-259/4) Simplify ((((y/y(-25))/y)/y)/yy)36 assuming y is positive. y864 Simplify a*34a(-5/3) assuming a is positive. a(97/3) Simplify (x(-2)/x(8/9))(3/10) assuming x is positive. x(-13/15) Simplify (m(m((m*(1/3)m)/m)/mmm)/mm)(-32/5) assuming m is positive. m(-64/3) Simplify y7y(-7/5) assuming y is positive. y(28/5) Simplify ((t/(t/t*(-9))t)/ttt(-3)/t)/(t(-9)t1) assuming t is positive. t(-4) Simplify (f/(ff(3/4)))(-9/5) assuming f is positive. f(27/20) Simplify (c/c(-9))/((cc(1/3)c)/c) assuming c is positive. c(26/3) Simplify ((w/w(-1/3))(-4/19))(1/11) assuming w is positive. w(-16/627) Simplify (x7xx3)/(x(2/9)/xxxxx2) assuming x is positive. x(61/9) Simplify (ll(1/4))(-23/5)(l/l(5/6))/l(3/2) assuming l is positive. l(-85/12) Simplify (s(-4/9))15 assuming s is positive. s(-20/3) Simplify (z*(-7)z/z4)/(z(2/9))5 assuming z is positive. z(-100/9) Simplify zz(2/11)zzz(z(-2/31)z)/z assuming z is positive. z(1404/341) Simplify (c/((c/c0)/c))(1/35)/(c(-1/4))(2/19) assuming c is positive. c(73/1330) Simplify c*24/cccc/c*26c assuming c is positive. c Simplify (s3)(4/9) assuming s is positive. s*(4/3) Simplify dd/d*1d*(5/2)((d/(ddd1))/d)(-24/7) assuming d is positive. d*(193/14) Simplify (uu*(-9)u/(uuu/((u/u(-9))/u)))(-16/5) assuming u is positive. u(16/5) Simplify (p21)(1/19) assuming p is positive. p(21/19) Simplify ((u(2/5))(-24/5))(1/6) assuming u is positive. u(-8/25) Simplify nn(-4)nn(-1)nn(-2/11)/n(-8) assuming n is positive. n(64/11) Simplify (((pp9)/p)/(p/(p/p0)p))/(p(-3/5)/(p/((p/(p/(p/(p/(ppp/(pp/p*(7/2)))))))/pp))) assuming p is positive. p(51/10) Simplify (((r(2/3)/rr)/r)/(r/(rr(-6))))(3/38) assuming r is positive. 1/sqrt(r) Simplify (y/(y/(y/y(-23))))/(y(2/11)yy) assuming y is positive. y*(240/11) Simplify (p/((pp*0)/pp)p)38/(p0)42 assuming p is positive. p38 Simplify (m(1/2))25(m0)(-28) assuming m is positive. m*(25/2) Simplify (d(d9/d)/d)/d23 assuming d is positive. d(-15) Simplify n(-3/5)/(n*11nn) assuming n is positive. n(-68/5) Simplify (s/(sss/(s/((s20s)/s))))/(s/s(-4)) assuming s is positive. s(-26) Simplify ((zz/(zz/z2))(6/31))(-3/4) assuming z is positive. z(-9/31) Simplify (www*(-1))/w(w/(w/(w/(ww(-1/33)/w)))w)/ww assuming w is positive. w(67/33) Simplify c(2/53)/((c/(c/(c/(c/c15))))/c) assuming c is positive. c(-740/53) Simplify v(-15)/((vv*(1/9)v)/v) assuming v is positive. v(-145/9) Simplify t35/tt(1/27) assuming t is positive. t(919/27) Simplify (g(-3)g*(-13)g)(-16) assuming g is positive. g240 Simplify ((a*(2/7)a)42)43 assuming a is positive. a2322 Simplify (f(-5)f)(-2/103) assuming f is positive. f(8/103) Simplify (y39yyy)/y(-12/13) assuming y is positive. y(558/13) Simplify l*(-13)l/(ll(-6/5)/lll)l assuming l is positive. l(-59/5) Simplify (n9n(3/4)/n)/(nn(1/2))(-49) assuming n is positive. n(329/4) Simplify a(-4/7)a(-1)(a1)(-26) assuming a is positive. a*(-193/7) Simplify (((q/(qq*0/qq))/q)(-7/4))1 assuming q is positive. q(7/4) Simplify u(2/3)u(5/6)(u(2/3))(-3/2) assuming u is positive. sqrt(u) Simplify (x/(x/(x*(-1/4)x)))*(2/79)(xx/x(2/7))(-28) assuming x is positive. x(-7581/158) Simplify r(1/5)(r/(r*22/r)r)/r assuming r is positive. r(-99/5) Simplify (h/(h(-3/5)hh))19 assuming h is positive. h(-38/5) Simplify (y11)(-11) assuming y is positive. y(-121) Simplify (v1)*(-3/25)(v(1/3))(11/6) assuming v is positive. v(221/450) Simplify ((m1/m)(-33))(-23) assuming m is positive. 1 Simplify (i*8iii0)(1/17) assuming i is positive. i(10/17) Simplify (t(-10))(-33/2) assuming t is positive. t165 Simplify r(-2)/(r(-9/4)r)(r/(rr/(rr*(-1/6))rrr))23 assuming r is positive. r(-883/12) Simplify k/(k*(-1)/k)k*(1/9)kk(-5/4)kk1 assuming k is positive. k(175/36) Simplify (((i/(ii*(-2/7)i))/iii)/i)*(-37)/((ii(-2/7)/i)/i4) assuming i is positive. i(215/7) Simplify (a(-20))(-28) assuming a is positive. a560 Simplify (((ww(-2/9))/w)/w)11/(w(-3)/ww(ww(-1/6))/w) assuming w is positive. w(-185/18) Simplify n*8/(nn(-11/2)) assuming n is positive. n(25/2) Simplify (f*(-2/5)f(-2))/(f(-3)f(-4)/f) assuming f is positive. f(28/5) Simplify (zz*(-2))/(zzz(-5/13)) assuming z is positive. z(-34/13) Simplify (g(-9)/g1)/(g(-2/3)g)(-4/21) assuming g is positive. g(-626/63) Simplify ppp*(4/13)p/(p*(-1/3)p)p assuming p is positive. p(142/39) Simplify ((f(3/7)f)/f)39 assuming f is positive. f(117/7) Simplify (((v(v/((v5/v)/v))/v)/v)/vvvvvv(1/7))/(v6vv(1/4)) assuming v is positive. v(-199/28) Simplify (((dd(1/4))/d)(1/40))(-37/5) assuming d is positive. d(-37/800) Simplify ((v/v5)/((((vv/(vvvvv*16)v)/v)/v)/vv))(-3/5) assuming v is positive. v(-9) Simplify i(-6)/(i/(i/((i(ii4)/i)/i))) assuming i is positive. i(-10) Simplify n(4/15)/n(3/4) assuming n is positive. n(-29/60) Simplify ((m/(mm/(mm(-25)/m)))/m)/(m12m) assuming m is positive. m(-40) Simplify (p(-2/13))(-11) assuming p is positive. p(22/13) Simplify (i*(1/9)iii*(1/2))/((iii(3/4)ii)/(i(i(i/((ii(i/((iii(-6))/i))/i)/ii))/ii)/ii)) assuming i is positive. i(-221/36) Simplify x(-3/4)/(xx(xx(-3))/x)(x/x(1/4))(-11/4) assuming x is positive. x(-29/16) Simplify ((o1/o)/((oo(o(o/(oo*(-2/9)))/oo)/oo)/o))/((ooo(-3/2)/o)/((ooo/o(1/6))/oo)) assuming o is positive. o*(10/9) Simplify mm*(-1/2)m(-9) assuming m is positive. m(-17/2) Simplify ((y*0yy)/(y(-11)y))/(yy/(y/(y/y(-10)))y/(yy(-3/7))) assuming y is positive. y(-3/7) Simplify (h2/h)/h(h*(-5)/h)/hh assuming h is positive. h*(-6) Simplify j/(j/(j/(j(j/j*18)/jj)))j(-1/29) assuming j is positive. j(492/29) Simplify (k/k(-8))(-6/5) assuming k is positive. k(-54/5) Simplify (h/h(2/13)h)(-10) assuming h is positive. h(-240/13) Simplify ((l(-1))21)(-1/42) assuming l is positive. sqrt(l) Simplify (g(1/4))(-3)/((((g/(g/((g(-4)g)/g)))/g)/g)/(g/(g(-5)g))) assuming g is positive. g(41/4) Simplify (s/s(1/7))(-26) assuming s is positive. s(-156/7) Simplify d/(dd(2/11)d)d(1/40) assuming d is positive. d(-509/440) Simplify (zz(2/7))(-2/9)(z/(z/z1))(12/19) assuming z is positive. z(46/133) Simplify ((q/q9)/qq)/q*4(q/q*(1/3)q)(-2/107) assuming q is positive. q(-3862/321) Simplify (h(-4)/h(-2))/((h/(h/(hh(-1)/hh)h))/hh(1/10)) assuming h is positive. h(-1/10) Simplify l*(-25)(l/(((l*3/ll)/l)/l))/l assuming l is positive. l(-26) Simplify (t(-8)t/t2)/(((tt*(1/3)t)/t)/t)17 assuming t is positive. t(-44/3) Simplify (h12/h)11 assuming h is positive. h121 Simplify (i/((i(3/10)i)/iii)i)/i7 assuming i is positive. i(-73/10) Simplify c*(-7)c/(c*2c)(cc(-1))40 assuming c is positive. c(-9) Simplify (o(-2/17)/(o*(-4)o))**(-15)	{ "pile_set_name": "DM Mathematics" }
ut replacement from {a: 7, g: 6}. What is prob of picking 2 a? 7/26 Calculate prob of picking 1 g and 3 z when four letters picked without replacement from ggpzggzpgpgzg. 7/715 Calculate prob of picking 1 x, 1 f, and 1 k when three letters picked without replacement from jffjrrxkrr. 1/60 What is prob of picking 1 n, 1 x, and 1 i when three letters picked without replacement from {i: 1, n: 3, f: 3, x: 4}? 4/55 Calculate prob of picking 2 z when two letters picked without replacement from {q: 1, e: 1, p: 1, y: 2, z: 2, o: 1}. 1/28 Calculate prob of picking 1 r and 2 y when three letters picked without replacement from yyyyryryy. 1/2 What is prob of picking 1 n and 1 v when two letters picked without replacement from vvvvvznvvvvvvzvvv? 7/68 What is prob of picking 1 x and 1 j when two letters picked without replacement from ffvfjxffffvfffjf? 1/60 Calculate prob of picking 4 t when four letters picked without replacement from {t: 19, n: 1}. 4/5 What is prob of picking 1 p and 1 s when two letters picked without replacement from {l: 1, m: 3, p: 2, t: 1, s: 3, e: 2}? 1/11 Calculate prob of picking 3 q when three letters picked without replacement from mqmqmq. 1/20 Three letters picked without replacement from bpbfbpbbabpapbppp. Give prob of picking 3 a. 0 What is prob of picking 1 c and 1 t when two letters picked without replacement from {x: 3, t: 7, c: 4}? 4/13 Three letters picked without replacement from {w: 4, m: 2, z: 1, o: 1}. What is prob of picking 1 z, 1 w, and 1 o? 1/14 Four letters picked without replacement from iaazaaaziiaaiia. What is prob of picking 3 a and 1 z? 16/195 What is prob of picking 2 j, 1 p, and 1 b when four letters picked without replacement from bjpmjb? 2/15 Calculate prob of picking 1 w, 1 o, and 1 s when three letters picked without replacement from fsfsosofkwfwksffof. 1/34 Two letters picked without replacement from {n: 1, k: 9, l: 4, x: 1, d: 3}. What is prob of picking 1 k and 1 n? 1/17 What is prob of picking 1 x, 2 k, and 1 z when four letters picked without replacement from xvrxxrkvxxxkxrzxxdx? 5/1938 Three letters picked without replacement from {n: 6, c: 4, f: 2}. Give prob of picking 3 c. 1/55 What is prob of picking 2 q and 2 n when four letters picked without replacement from qqnqqqqnqqqnqqqqqqn? 105/646 Four letters picked without replacement from {p: 8, k: 1, j: 11}. What is prob of picking 1 k and 3 j? 11/323 What is prob of picking 2 a when two letters picked without replacement from aayyltaxutxu? 1/22 What is prob of picking 2 q when two letters picked without replacement from {t: 4, a: 8, f: 4, q: 4}? 3/95 Calculate prob of picking 2 l when two letters picked without replacement from {s: 3, r: 2, l: 2, b: 2}. 1/36 Two letters picked without replacement from {z: 2, q: 4}. Give prob of picking 2 q. 2/5 Calculate prob of picking 3 z and 1 m when four letters picked without replacement from kzkzmzz. 4/35 What is prob of picking 1 u and 2 e when three letters picked without replacement from {u: 8, e: 3}? 8/55 Three letters picked without replacement from tjjjknjjy. Give prob of picking 1 k, 1 t, and 1 n. 1/84 Four letters picked without replacement from rrsyyryyysrs. Give prob of picking 2 y and 2 r. 4/33 Two letters picked without replacement from {p: 2, q: 4, t: 4, x: 1, d: 1, v: 6}. What is prob of picking 1 t and 1 p? 8/153 Calculate prob of picking 1 t and 2 a when three letters picked without replacement from dtdadhsssaa. 1/55 What is prob of picking 1 b and 3 d when four letters picked without replacement from dbdbbbddbb? 4/35 Two letters picked without replacement from {n: 1, z: 2, p: 1, l: 8, f: 4, x: 4}. Give prob of picking 1 p and 1 l. 4/95 Four letters picked without replacement from kkkiijjkipi. Give prob of picking 2 i, 1 j, and 1 k. 8/55 What is prob of picking 1 k, 1 f, and 1 r when three letters picked without replacement from {i: 2, r: 1, f: 1, k: 1, p: 1, b: 1}? 1/35 Calculate prob of picking 1 c and 2 k when three letters picked without replacement from xaxauakkmkmc. 3/220 Two letters picked without replacement from {s: 7, r: 4, h: 2, m: 6, t: 1}. What is prob of picking 1 s and 1 r? 14/95 What is prob of picking 1 f and 3 i when four letters picked without replacement from {i: 4, f: 2}? 8/15 Two letters picked without replacement from skfqv. What is prob of picking 1 q and 1 v? 1/10 What is prob of picking 1 m and 1 v when two letters picked without replacement from oomivmvooioiiom? 2/35 Calculate prob of picking 1 v and 1 g when two letters picked without replacement from {l: 2, v: 1, g: 1, n: 1}. 1/10 Calculate prob of picking 4 s when four letters picked without replacement from seee. 0 Four letters picked without replacement from wqaooaa. What is prob of picking 1 o and 3 a? 2/35 Calculate prob of picking 1 t, 1 w, and 1 u when three letters picked without replacement from wtwrwprpurrruwj. 8/455 Calculate prob of picking 1 i, 1 j, and 1 d when three letters picked without replacement from jemdi. 1/10 Calculate prob of picking 1 i and 1 g when two letters picked without replacement from tyjgiyb. 1/21 Two letters picked without replacement from gitegueguggtuuuggkgk. Give prob of picking 2 k. 1/190 Two letters picked without replacement from {b: 3, v: 13}. What is prob of picking 1 v and 1 b? 13/40 Four letters picked without replacement from cjcjjajtoantoc. Give prob of picking 3 j and 1 a. 8/1001 Calculate prob of picking 2 m when two letters picked without replacement from mmmmm. 1 Two letters picked without replacement from ddqqqdqdsqssddq. What is prob of picking 1 d and 1 s? 6/35 Three letters picked without replacement from xxkxxxxxxxukxxxxx. What is prob of picking 1 k and 2 x? 91/340 Four letters picked without replacement from nsyfy. Give prob of picking 2 s, 1 y, and 1 f. 0 What is prob of picking 2 z when two letters picked without replacement from zuuzuuuzuu? 1/15 Calculate prob of picking 4 g when four letters picked without replacement from ggggggggg. 1 Four letters picked without replacement from orkofgofooogg. Give prob of picking 2 f and 2 g. 3/715 Calculate prob of picking 1 a, 2 i, and 1 v when four letters picked without replacement from lchcicvilclllcla. 1/1820 Four letters picked without replacement from iastnixsntnn. Give prob of picking 1 n, 1 a, and 2 i. 4/495 Three letters picked without replacement from yeypppgepypegppppegg. Give prob of picking 3 e. 1/285 Calculate prob of picking 2 z and 2 y when four letters picked without replacement from zzyyyyyyynyyyyyyy. 13/340 Two letters picked without replacement from hhhhzzyzzhyhhz. What is prob of picking 2 h? 3/13 Three letters picked without replacement from iihhcqlhh. What is prob of picking 1 c, 1 l, and 1 h? 1/21 Calculate prob of picking 4 p when four letters picked without replacement from pppaapppppppaappppap. 91/323 Two letters picked without replacement from {f: 8, q: 4, n: 8}. What is prob of picking 1 q and 1 f? 16/95 What is prob of picking 1 c and 2 b when three letters picked without replacement from {b: 7, c: 11, w: 2}? 77/380 Calculate prob of picking 1 b and 1 d when two letters picked without replacement from abad. 1/6 Calculate prob of picking 3 q when three letters picked without replacement from {z: 13, q: 5}. 5/408 Four letters picked without replacement from {x: 1, v: 12}. Give prob of picking 4 v. 9/13 Two letters picked without replacement from {u: 1, e: 1, b: 1, a: 1, d: 1}. What is prob of picking 1 e and 1 d? 1/10 Calculate prob of picking 1 h and 1 m when two letters picked without replacement from mhmmmh. 8/15 What is prob of picking 2 w when two letters picked without replacement from bbrrbwwbbbwwbww? 1/7 What is prob of picking 1 u, 1 x, 1 o, and 1 y when four letters picked without replacement from {g: 2, s: 3, u: 2, y: 2, x: 5, o: 2}? 2/91 Calculate prob of picking 1 v and 1 g when two letters picked without replacement from govvgvgyivvivigyoh. 8/51 Calculate prob of picking 1 l, 1 m, and 1 a when three letters picked without replacement from ambabbalalamm. 15/143 Calculate prob of picking 2 q and 1 n when three letters picked without replacement from {q: 3, m: 1, l: 3, n: 3}. 3/40 What is prob of picking 3 v when three letters picked without replacement from {w: 4, v: 5,	{ "pile_set_name": "DM Mathematics" }
+ 6g(x). -2x + 1 Let j(c) = 8c2 - 1. Let w be j(1). Let h(o) = -6o + 4. Let a(z) = -z - 3. Let t(i) = i. Let l(x) = a(x) + 5t(x). Calculate wl(n) + 5h(n). -2n - 1 Let a(g) = g*2 - 4g + 3. Let z(y) = y. What is -a(p) - 4z(p)? -p2 - 3 Suppose -5 - 4 = -3j. Let s(d) = -3d2 + d3 - 4d*j + 0d*3. Let k(t) = 4t*3 + 4t*2. Calculate -2k(z) - 3s(z). z3 + z2 Let h(z) = z + 1. Let b(m) = -1. Determine -3b(a) - h(a). -a + 2 Let y(w) = -15w2 - 9w + 4. Let g(v) = 38v2 + 22v - 10. Determine 5g(n) + 12y(n). 10n2 + 2n - 2 Let v(z) = -2z2 + z. Let j(x) = 11x - 6x2 - 4x - 2x - 2x. Determine -4j(u) + 11v(u). 2u2 - u Let n(r) = r3 + 4r*2 - 12r + 2. Let m(j) = -2j3 - 5j*2 + 11j - 3. Calculate -2m(h) - 3n(h). h*3 - 2h*2 + 14h Let s(m) = 3m - 5. Let w(j) = 8j - 12. Let v(l) = l*2 + 10l + 5. Let g be v(-10). Give gw(k) - 12s(k). 4k Let f(l) = 54l*3 - 45l*2. Let a(z) = 5z*3 - 4z*2. Give 45a(s) - 4f(s). 9s*3 Let i(v) = 12v*3 - 3v*2 - 3v - 3. Let m(j) = -35j3 + 8j*2 + 8j + 8. Determine 8i(w) + 3m(w). -9w3 Let a(w) = -w + 1. Let p(l) = 3l + 3. Let x(q) = 4a(q) + p(q). Let y(m) = -m - 15. Let j(n) = 15. Let h(t) = 3j(t) + 2y(t). What is 6h(s) - 13x(s)? s - 1 Let g(t) = 40t*3 + 2t*2 - 2. Let n(q) = 40q*3 + 3q*2 - 3. Calculate 3g(k) - 2n(k). 40k3 Let f(g) = g2 + g + 1. Suppose 0y - 3y + 6 = 0. Let a(l) = -l - 1 + 0l2 - l - 2ly + l2. Calculate -3a(u) - 5f(u). -2u2 + u - 2 Let d(g) = -3g*2 + 11g - 8. Let j(n) = -n*2 + 4n - 3. Suppose 3k + 12 = -15. Let v(f) = f3 + 10f*2 + 10f - 2. Let u be v(k). What is uj(s) + 4d(s)? -s*2 + 1 Let h(g) = 7g*2 - 13g + 7. Let j(b) = 3b2 - 7b + 3. Give -2h(s) + 5j(s). s*2 - 9s + 1 Let s(a) = a*3 + 3a*2 + 2a + 3. Let l = -4 + 1. Let r(k) = -2k3 - 5k*2 - 3k - 5. Calculate lr(i) - 5s(i). i*3 - i Let w(u) = -4u*2 - 9u. Let m(g) = 21g - 2g2 - g2 - 17g + 5g*2. Give 9m(s) + 4w(s). 2s*2 Suppose -10 = 5d - 2h, d - 5d + 2h = 8. Let w(t) = t - 1. Let u(s) = -11. Let r(y) = 39. Let i(v) = -5r(v) - 18u(v). Determine dw(c) - i(c). -2c - 1 Let n(f) = -9f - 11. Let p(c) = -c. Let l(j) = -n(j) + 4p(j). Let g(x) = 5x - 2x - 4 + 11. Calculate -8g(s) + 5l(s). s - 1 Let c(q) = 3q*3 - 6q*2 - q + 7. Let u(f) = 3f*3 - 5f*2 - f + 6. Give -5c(x) + 6u(x). 3x*3 - x + 1 Let i(y) = 11y*2 - 14y - 11. Let f(s) = -2s2 + s - 2. Let x be f(2). Let b(p) = -7p*2 + 9p + 7. What is xb(k) - 5i(k)? k*2 - 2k - 1 Let t(x) = 2x3 + 5x*2 + 4x - 2. Let q = -8 - -10. Suppose -7 = -ql + 1. Let k(u) = -2u*3 - 4u*2 - 3u + 1. Give lk(c) + 3t(c). -2c3 - c2 - 2 Let t(s) = s + 13. Let v be t(-7). Let y(d) = -5d*3 + 7d*2 + 2d - 1. Let p(r) = -2r3 + 2r - 2r3 + 1 + 6r*2 - 2. Calculate vy(l) - 7p(l). -2l*3 - 2l + 1 Let p(b) = -2b2 + b - 18. Let a(r) = 2r*2 - r + 18. Calculate 6a(z) + 7p(z). -2z*2 + z - 18 Suppose 16 = 7n - 3n. Suppose 4v - nc + 0c + 8 = 0, v = 5c + 10. Let w be ((-8)/6)/((-2)/3). Let q(x) = x. Let o(s) = 3s - 1. What is vq(r) + wo(r)? r - 2 Let a(m) = -m*3 + 1 - 1 - 2m*2 - 3m. Let j(l) be the first derivative of l*4/2 + 2l*3/3 + 2l*2 + 2. Give -4a(c) - 3j(c). -2c*3 + 2c*2 Let n(f) = 4f*3 - 6f*2 + 3f + 2. Let b(g) = -9g3 + 13g*2 - 7g - 5. Calculate -3b(r) - 7n(r). -r*3 + 3r*2 + 1 Let n(o) = -2o + 1. Suppose 7z - 5z = -4y + 10, -3y + z + 5 = 0. Let a(u) = 8u - 4. Give ya(x) + 9n(x). -2x + 1 Let v(u) = 3u2 + 4u - 7. Let j(o) = 9o2 + 12o - 22. Let q(r) = -2j(r) + 7v(r). Let m(b) = 5b2 + 7b - 9. Calculate -4m(i) + 7q(i). i*2 + 1 Let n(g) = -5g - 2. Let v(p) be the first derivative of -p*3/3 - p + 38. Determine n(u) - 2v(u). 2u2 - 5u Let h(o) = -o*2 - 11o - 1. Let m(v) = v*2 + 16v + 1. Suppose 0 = -2x - 3 - 11. What is xh(p) - 5m(p)? 2p*2 - 3p + 2 Let h(m) = 2m2 - 2m + 1. Let a(g) = -g*2 - 3g + 2g + 7g - 5g. Give 3a(p) + h(p). -p*2 + p + 1 Let r = -6 - -3. Let k(v) be the second derivative of 0v*2 + 0 - 1/2v*3 + 2v. Let h(z) = 4z + 1. What is rk(c) - 2h(c)? c - 2 Let x(w) = -6w - 5. Let c be 0 + -1 - 2/(-1). Let b(z) = -z - 1. Let l(a) = 3a + 3. Let y(u) = cl(u) + 4b(u). Calculate -2x(k) + 11y(k). k - 1 Let p(f) = f3 - f2 + f. Let a(t) = t3 - 4t*2 + 4t. Let o be ((-48)/15)/((-4)/(-20)). Let b = 15 + o. Give ba(c) + 4p(c). 3c3 Let x(o) = 5o*3 - 5. Let n(v) = 3v*3 - 2. What is -5n(j) + 2x(j)? -5j*3 Let a(c) = -17c - 13. Let d = 8 - 6. Suppose f = -do + 4 + 8, -f = o - 6. Let s(p) be the third derivative of -p4/3 - p3 + 4p*2. Give oa(g) - 13s(g). 2g Let w(m) = m*2 - m + 1. Let n(y) = 4y*2 - 5y + 4. Let v be (-5)/(7 - 5 - 1). What is vw(q) + n(q)? -q2 - 1 Let x(p) = 1. Let j(c) = 2c + 3. Let v(r) = r. Let u(m) = -2j(m) + 6v(m). Determine u(n) + 5x(n). 2n - 1 Let q(u) = -5u - 30 + 12 + 0u*2 - 3u*2 + 21. Let h(b) = -1 + 0 + 0 + 4 - 6b - 4b2. Calculate 5h(j) - 6q(j). -2j*2 - 3 Let i(j) = 16 - 8 - j - 4. Let m(b) = 3. Give 2i(h) - 3m(h). -2h - 1 Let r(p) = 4p2 - 13p - 9. Let f(b) = 2b2 - 6b - 4. Let x be (0 - (-3)/1) + -1. Suppose 25 = 3w - x. Calculate wf(u) - 4r(u). 2u*2 - 2u Let o(f) = 2f2 - 2. Let i(d) = 2d*2 - 2. Let r be 1/((-2)/(-6 + 0)). Let t = -47 - -45. Give ri(a) + to(a). 2a2 - 2 Let i(l) = -l3 + 2l - 2. Let v(c) = 5 - 5c - 1 + 3c3 + 1. Suppose 5k - 20 = -3o, -2k + 10 + 2 = 2o. Let s = o - 3. What is sv(j) + 5i(j)? j3 Let g(m) = -391m - 68. Let c(b) = 29b + 5. What is 68c(s) + 5g(s)? 17s Let z(y) = -1. Let m(q) = -2q2 - 9q - 4. Calculate -m(j) + 2z(j). 2j*2 + 9j + 2 Let x(j) = -2j - 2. Let c(y) = 5y + 4. Determine -6c(n) - 13x(n). -4n + 2 Let x(k) = -2k + 19. Let d be x(10). Let g(j) = j*2 + j + 1. Let l(a) = -6a*2 - 2a - 2. What is dl(z) - 2g(z)? 4z2 Let f(v) = v. Let n(z) = -3z*2 + 12z. Let x = -7 - -6. What is xn(w) + 12f(w)? 3w2 Let h(y) = 2y*3 - 8y + 5. Let t(s) = s*3 - 3s + 2. Give 3h(b) - 8t(b). -2b3 - 1 Let l(g) = g2 - 2g + 4. Let q be (-2 + 5)/((-1)/2). Let y = -4 - q. Let h(r) = 2 + y - 3. Give -4h(b) + l(b). b2 - 2b Let z(n) = 2n3 - 3n*2 - n + 8. Let a(y) = 4y*3 - 5y*2 - y + 15. Determine 3a(h) - 5z(h). 2h*3 + 2h + 5 Let d(z) = -6z2 + 4z + 4. Suppose -o + 3 = -4o. Let n(p) = p2 - 7p - 7. Let a(f) = f + 1. Let u(i) = 6a(i) + n(i). Calculate od(v) - 4u(v). 2v*2 Let b(u) = 41u - 40u - u2 - 8 + 9. Let v(f) = -2f*3 - 6f*2 + 5f + 7. Determine -6b(p) + v(p). -2p*3 - p + 1 Let q(t) = 4t + 3. Let s(w) = 4w2 - 2w + 1. Let i be s(1). Let v(o) = o + 1. Let k(m) = 3m2 - 17m - 7. Let n be k(6). Give iv(l) + nq(l). -l Let q(p) = p + 6. Let r be 17/(-3) - 4/(-6). Let k(o) be the first derivative of o*2/2 + 5o + 1. Give rq(m) + 6k(m). m Let z(b) be the second derivative of -b3/6 + b2/2 + 6b. Let i(v) = -v + 1. Calculate i(c) - 2z(c). c - 1 Let f(m) = -2m3 - 9m*2 - 2m. Let w(t) = 6t - t3 + 11t*2 - 4t - 15t2 - 3t. Give -3f(u) + 7w(u). -u3 - u2 - u Let z(l) = 5l3 - 8l*3 - 2l*2 + 2l*3. Let r(g) = -2g*3 - 2g*2. Calculate -3r(j) + 4z(j). 2j*3 - 2j*2 Let x(c) = -5. Let l(y) = -y - 25. Determine -2l(z) + 11x(z). 2z - 5 Let p(a) = -a + 11. Let u(c) = -1. What is p(z) - 6u(z)? -z + 17 Let o(u) = -u2 + 6u + 3. Let s be o(4). Let n(f) = -4f2 + 4f + 5. Let r(j) = -7j2 + 7j + 9. Determine sn(v) - 6r(v). -2v2 + 2v + 1 Let f(p) = 4p3 - 2p*2 - 2p - 4. Let w be 9 - 5/(10/(-4)). Let l(x) = -4x - 6x*2 - 4x*2 - 21 + 23x*3 - 7x - 2x3. What is wf(a) - 2l(a)? 2a*3 - 2a*2 - 2 Let s(g) = -6g*2 + 16g + 5. Let x(f) = f*2 + 8. Let v be x(0). Suppose -2r - v = 2r. Let t(m) = m2 - 3m - 1. What is rs(w) - 11t(w)? w*2 + w + 1 Let t(r) = r + 1. Let d(j) = -4j + 0 + 6j + 1 + 1. Determine -d(f) + t(f). -f - 1 Let m(g) = -6. Let b(i) = 1. Let l(r) = -5b(r) - m(r). Let f(h) = 1 - 6 - h + 3. Let s(a) = a + 1. Let u be s(0). What is uf(z) + 2l(z)? -z Let c(b) = b*2. Let a(u) be the second derivative of 7u4/12 + u3/3 + u**2/	{ "pile_set_name": "DM Mathematics" }
u = 53 + g. Let j = u + -4.5. Which is the closest to 1? (a) -2/5 (b) j (c) 5 b Let v = -1537 - -1538.486. Let i = v + 0.014. Let o = 1.5 + i. What is the nearest to -0.1 in 3/5, -2/11, o? -2/11 Let m = 1.98486 + 0.01514. Which is the closest to m? (a) 2/3 (b) -5 (c) -1/7 (d) -20 a Let i = 22 + -11. Suppose 4m + m = -2b + i, -3b = 4m - 6. Let z = 102158 + -102158. What is the nearest to z in m, 4/3, 1? 1 Let q be (2 + 57/(-21))(-37)/19. Let r = q - 9/7. Let x = -1.82 - -9.82. Which is the nearest to -0.1? (a) r (b) 0 (c) x b Let b = -15141/4 - -3785. What is the nearest to b in 0.3, -16, 8? 0.3 Let o be 806/4680 - 4/18. Which is the nearest to 0.3? (a) -0.2 (b) 0 (c) o (d) -0.5 b Let y = 5.08 + -0.08. Let s = 2 + -1.6. What is the nearest to 1/17 in y, s, -0.5? s Let v = -1.76 + 1.66. Let w = 13.8 + -14. Which is the closest to -5? (a) v (b) w (c) -3/5 c Let t(o) = -13o. Let i be t(0). Let z = 4.43 - 6.43. Which is the nearest to i? (a) z (b) 0.5 (c) 3.5 (d) -0.3 d Let h = -486 - -487. Let m = 21/13 - 175/52. Which is the nearest to -1? (a) 4 (b) h (c) m c Let r be (71 - 2) + 4 - (2 - 5). Suppose 0 = 6s - 92 - r. What is the nearest to s in -1/3, 1/3, 0.3? 1/3 Let t = 34 + -53. Let v = t + 16. Suppose -40 + 44 = -4p. What is the closest to v in -3, p, 5? -3 Let h = 2661 - 2665. Which is the nearest to 0.1? (a) 0 (b) h (c) 143 (d) -7 a Let l = 5935 - 5925. What is the closest to -2 in 4, l, -20? 4 Let x = -97.99 + 98. Let a be 80/72-33/15. What is the nearest to a in -2, 1, x? x Let u = 168 + -308. Let x be (-7)/u52 + -3. Suppose 2j + 3w = 3j - 8, 5w = -j + 32. Which is the nearest to j? (a) 5 (b) 3/5 (c) x a Let x = 518 + -518.3. Suppose 4v - 6v = -h + 13, -4h = -2v - 28. Let z be (-9 + 8)/(v3). What is the nearest to -3 in z, -3, x? -3 Let t = 0.03 - 4.03. Suppose -17n = -3l - 22n + 10, -3l - 30 = -3n. What is the closest to 2 in -2, l, -1, t? -1 Let b = -10.2 - -0.2. Let x be (-1)/3 - 2/3. Let t = 143297 + -143297.2. What is the nearest to x in 0, t, b? t Let d = 0.6832 - 0.6732. Let s be 0/(-1 - -2) + -5. What is the nearest to 3 in d, s, 2? 2 Let w = -0.2 + 0. Let v = 2/1941 + 17453/15528. Let p = v - 59/24. What is the closest to 1/3 in w, p, 3? w Let h = 424.4705 - -0.0295. Let y = h + -425. What is the closest to 0.2 in 5, 0.85, y? 0.85 Let x = 0.0597 - -0.0403. Let d = 178.15 + -173. Let n = -0.15 + d. Which is the nearest to x? (a) -0.2 (b) n (c) -0.5 a Let t(s) = 4s + 13. Let r be t(-8). Let w = 56/3 + r. Suppose 0h - h - 5o - 11 = 0, 0 = 5h + o + 79. Which is the closest to w? (a) -4/7 (b) -0.1 (c) h b Let x = -27 + 32. Let v be (2/6)/(4/(-6)). Let g(s) = -32s - 1852. Let u be g(-58). Which is the nearest to v? (a) x (b) 2/15 (c) u b Let n(p) = p*3 + 11p*2 - 11p + 16. Let g be n(-12). Let k = -2083 - -18749/9. Which is the closest to 2? (a) -6/23 (b) k (c) g b Suppose -1 = -4d + 5q + 4, 2q = -2d - 20. Let f be ((12/18)/((176/12)/(-4)))/(-1). Which is the nearest to f? (a) d (b) -2/13 (c) -1/5 b Let s be (0/(-664))/((-4)/2). Let l(f) = -f*3 + 5f*2 + 6f - 3. Let w be l(6). What is the nearest to s in 5, w, -6/35, -4? -6/35 Let n be (1/3(-2)/3)/((-10194)/(-15291)). Let a = 0.4 - 0.9. What is the closest to 0.1 in n, -0.1, a, 1? -0.1 Let j = 6488 + -6487.6. Suppose 2p = 4 + 6, -2i - 2p + 12 = 0. Which is the nearest to 0.1? (a) i (b) 5/4 (c) j c Let g = 799 + -932.5. Let w = g + 133. What is the closest to 1/4 in w, -7/6, 0.1? 0.1 Let v = -3018 + 3022. Let f(h) = h*3 + 3h*2 + 4h + 3. Let m be f(-2). Let j be ((-3)/(-21) - 0)/m. Which is the nearest to 4? (a) j (b) 1 (c) v c Let y = 6.9 - 140.9. Let z = y - -135. What is the nearest to -0.1 in 5/3, 2, z? z Let v = 0.3257 + 7.3743. Which is the closest to 0? (a) v (b) -0.5 (c) 3/8 (d) -2/11 d Suppose 11w = 17w - 36. Suppose 2b = s + 141, 0 = -b + ws - s + 75. Let q = b + -699/10. What is the nearest to -3/5 in 1/4, q, -1/2? -1/2 Let r = 9013.03 + -9013. Which is the closest to 1.2? (a) 0.06 (b) r (c) -6/5 a Let y(r) = 59r2 + 52r - 6. Let p be y(-1). Let q = 6.7 + -1.7. Which is the closest to p? (a) -2/3 (b) q (c) 37 (d) -4 a Suppose 5k - 4z = 128, 5k = 3z + 123 + 8. Which is the nearest to 0.1? (a) 5 (b) k (c) -2/3 (d) -0.2 d Let t be (-4601)/(-1806) + 10/6. Let m = 9/2 - t. Which is the closest to 1? (a) -7/2 (b) 3 (c) m c Let v = 1.2 + -1. Let i = 929 - 923.84. Let o = 10.16 - i. What is the closest to -2 in 4, v, o? v Let y = 0.1 + 2.1. Let x = 0.765 + -18.565. Let w = x - y. What is the closest to -1 in 3/2, -0.3, w? -0.3 Let b = -1313.9 - -1314. Let o(n) = 2n2 - 7n - 4. Let h be o(4). What is the nearest to -5 in h, b, 4? h Let v = -0.46 - -99.46. Let p = -99.3 + v. Which is the nearest to 0.3? (a) p (b) 4 (c) -0.2 c Let n = -2.5 - -1.6. Let i = -0.1 + n. Let k = -1634 + 1626. Which is the closest to i? (a) -0.2 (b) -3 (c) k a Let s = -6.9891 - 0.2109. What is the nearest to -1 in 3/5, -0.1, s? -0.1 Let s be 1/(((-10)/150)/(2/6)). Let p = 0.42 + -0.32. Which is the nearest to -0.5? (a) -1/2 (b) s (c) p a Let q = 3.946 - -0.054. Let g = 14 - 14.1. Let j = -1.908 + 7.908. What is the closest to 1/3 in q, g, j? g Let t = -28.484 - -157.474. Let b = 129 - t. What is the closest to b in 1/2, 1/5, -1? 1/5 Suppose -2 = 2f - 2s, 4f - 24 = -18s + 15s. Which is the closest to -14? (a) 0.1 (b) f (c) 2/5 (d) -1 d Let n(p) = p. Let f be n(-1). Let v be -44/(-16)-1. Let w = -1.1 - -1. What is the closest to f in w, v, -2/21? v Suppose 15122 + 10798 = 288t + 32t. What is the closest to t in -1/10, -3, 3? 3 Suppose 5b = -3o - 2, 4b + 1569 = -5o + 1583. What is the nearest to -2/5 in 0.05, b, 0.2? 0.05 Let x = 4 + -22. Let y = x + 23. Let i = -853 + 852.8. Which is the nearest to i? (a) 4 (b) y (c) -1/8 c Let f = -1.01 + 1.05. Which is the closest to 9? (a) f (b) -3/2 (c) -5 (d) 0.08 d Let f = -5305 - -5304.9. Which is the nearest to -6/11? (a) -0.2 (b) 2/5 (c) -0.7 (d) f c Let x be 72/(89 - 17)1(-2)/(-4). What is the nearest to 0.1 in x, 5, 0.073? 0.073 Let u = 1453 + -1453. What is the nearest to -0.1 in u, 2, -0.02? -0.02 Let d = -4097/13 - -315. Let n = 5.05 - 4.05. Let y = 0.108 + -0.158. What is the nearest to n in d, 5, y? y Suppose 5d - 1111o = -1114o - 21, -4o = -2d + 2. Let m = 0.17 + 0.03. Which is the closest to m? (a) -5 (b) d (c) 3/2 c Let a = 2 - 2.2. Let b be -3546/(-230) + (-18)/(1 - -2). What is the nearest to b in 2, 0.2, a, 1? 1 Let s be (4/12)/((-5)/3). Let t be (-5)/6 + 2 - 44/88. Which is the nearest to 6? (a) s (b) t (c) -0.4 b Let c = 1571.6 - 1571.3. What is the nearest to -0.209 in 0.5, 16, c? c Let l = 2.673 + -2.173. Which is the nearest to -1? (a) 2/19 (b) 5 (c) -5 (d) l a Let b(y) = -y2 + 18y + 7. Let t be b(-3). Let n = t - 15. Let v = -214/3 - n. What is the closest to -2/7 in -4/3, -0.5, v? v Let o = -0.03 + -1.97. Let u be (-8)/(-6)(-6)/(-4). Let k be (80/350)/((-400)/(-700)). Which is the nearest to k? (a) o (b) u (c) 3 b Let i = 951 - 4759/5. Let f = 0.11 + -1.51. Let z = f - -1.7. Which is the nearest to 0? (a) z (b) 35 (c) i a Let n = -13.6 - 536.4. Let u = n - -550. Let r be (-1)/(15/(-12) + 1). What is the nearest to u in -0.1, -1/5, r? -0.1 Let p = 56 - 56.024. Let o = p - 54.976. Let z = 56 + o. What is the nearest to 1 in -0.4, -0.1, z? z Let d = -0.60611 - -2.60611. Let k = -705/8 + 88. What is the nearest to 1 in k, d, -2? d Let x = -33.51 - -36.51. Suppose 4k + u = -16, 0 = -2k - 3u + 4 - 22. Which is the closest to -0.6? (a) x (b) 0.2 (c) k b Let n = 0.47 + -0.57. Let l = 75.07 - -0.93. Let i = l - 75.8. Which is the nearest to 2/7? (a) n (b) i (c) -3/4 b Let f = -3/58 - 42/29. Let a be 3(218/27 + -8). What is the nearest to -1.7 in f, 4/9, a? f Let y = 30/11 - 112/33. Let f be 4(-2)/(-50)(-10)/(-4). Which is the closest to y? (a) 0.9 (b) f (c) 0.3 c Let k = -18853 - -18860. Which is the nearest to -0.2? (a) k (b) 1/6 (c) 58 b Let x be (6120/75)/4 - 20. What is the closest to 1 in -20, -19, x? x Suppose 5o - 5 = g, 5o - 5g + 8*g - 5 = 0. Let m be 1 + o + (-8)/(-4). Let w = 0.27 + 2.73. Which is the nearest to -1/2? (a) w (b) m	{ "pile_set_name": "DM Mathematics" }
illigrams. 301812.3 What is thirteen quarters of a week in minutes? 32760 What is 66271.07 litres in millilitres? 66271070 Convert 902.8815g to milligrams. 902881.5 How many kilograms are there in 933697.7 nanograms? 0.0000009336977 What is 53/4 of a kilogram in grams? 13250 What is 7/2 of a microgram in nanograms? 3500 Convert 96.31643 millimeters to kilometers. 0.00009631643 What is six fifths of a microgram in nanograms? 1200 How many milliseconds are there in 1/4 of a minute? 15000 Convert 0.6117011 millimeters to kilometers. 0.0000006117011 What is 9.895392s in minutes? 0.1649232 How many days are there in 0.6061162 weeks? 4.2428134 What is five quarters of a litre in millilitres? 1250 How many milliseconds are there in 968.6094 weeks? 585814965120 How many millilitres are there in ninety-seven halves of a litre? 48500 What is 13/5 of a meter in centimeters? 260 How many micrometers are there in 5/4 of a millimeter? 1250 How many meters are there in six fifths of a kilometer? 1200 What is two ninths of a week in minutes? 2240 Convert 0.1163293 centimeters to kilometers. 0.000001163293 How many micrograms are there in 27/2 of a milligram? 13500 How many milligrams are there in 0.2273238ug? 0.0002273238 What is 2/7 of a week in days? 2 How many grams are there in twenty-nine halves of a kilogram? 14500 Convert 6067.13um to millimeters. 6.06713 Convert 594.366 micrometers to kilometers. 0.000000594366 How many centimeters are there in 0.6612346 millimeters? 0.06612346 What is nineteen quarters of a milligram in micrograms? 4750 How many hours are there in 5.638691 weeks? 947.300088 How many millennia are there in 98087.91 centuries? 9808.791 What is twenty-nine fifths of a centimeter in millimeters? 58 What is 29/6 of a millennium in months? 58000 What is 64.86387 grams in nanograms? 64863870000 How many meters are there in 802.5754 centimeters? 8.025754 What is eleven quarters of a year in months? 33 How many millilitres are there in 290.8223 litres? 290822.3 Convert 446.944 millennia to decades. 44694.4 Convert 67.202023 days to weeks. 9.600289 Convert 282.4801 millimeters to micrometers. 282480.1 What is 3/5 of a millisecond in microseconds? 600 What is 3/8 of a microgram in nanograms? 375 What is 0.3260588 years in decades? 0.03260588 What is 25/2 of a meter in centimeters? 1250 How many milligrams are there in nineteen quarters of a gram? 4750 How many decades are there in 11/4 of a millennium? 275 What is 5.0064 milligrams in tonnes? 0.0000000050064 How many nanograms are there in 2.820101 milligrams? 2820101 How many millimeters are there in 994433.6 centimeters? 9944336 How many kilometers are there in 4.728804cm? 0.00004728804 Convert 696.6374 centuries to millennia. 69.66374 Convert 723.551 millilitres to litres. 0.723551 How many milligrams are there in 583.5926ng? 0.0005835926 What is 43/3 of a century in months? 17200 How many micrometers are there in 47.68543m? 47685430 Convert 47.93742 years to decades. 4.793742 How many grams are there in three fifths of a kilogram? 600 Convert 2.331231 days to weeks. 0.333033 What is 0.283227ml in litres? 0.000283227 How many grams are there in 2.064735 milligrams? 0.002064735 What is 11/10 of a minute in seconds? 66 How many milliseconds are there in three eighths of a minute? 22500 What is 749.9516 centimeters in micrometers? 7499516 What is three eighths of a day in hours? 9 What is 0.9090068 minutes in seconds? 54.540408 How many millilitres are there in 29/5 of a litre? 5800 How many seconds are there in 1/30 of a hour? 120 What is 75.04901 kilometers in centimeters? 7504901 How many millilitres are there in one quarter of a litre? 250 What is 3/8 of a millennium in years? 375 How many centimeters are there in 1/20 of a kilometer? 5000 How many hours are there in 362.05407 nanoseconds? 0.000000000100570575 How many decades are there in thirty-two fifths of a century? 64 What is 8.446292nm in kilometers? 0.000000000008446292 Convert 41.50254l to millilitres. 41502.54 What is fourty-one halves of a milligram in micrograms? 20500 What is 21/4 of a millennium in decades? 525 How many micrometers are there in seven halves of a millimeter? 3500 How many nanograms are there in twenty-seven fifths of a microgram? 5400 What is 4658.682 millimeters in meters? 4.658682 Convert 621.846 millilitres to litres. 0.621846 Convert 0.1569986 meters to kilometers. 0.0001569986 Convert 89.4393 millennia to years. 89439.3 What is 73.3846 years in millennia? 0.0733846 Convert 6228.29 weeks to microseconds. 3766869792000000 How many grams are there in 47/4 of a kilogram? 11750 What is 1/10 of a decade in years? 1 What is twenty-seven halves of a meter in centimeters? 1350 What is 1752338.7 days in weeks? 250334.1 What is 6/25 of a kilometer in meters? 240 What is three eighths of a century in months? 450 Convert 1.57363ml to litres. 0.00157363 How many nanoseconds are there in 3/5 of a microsecond? 600 What is 51/8 of a millimeter in micrometers? 6375 What is thirteen quarters of a tonne in kilograms? 3250 How many centimeters are there in 6829.231um? 0.6829231 How many days are there in 2.9297889 nanoseconds? 0.00000000000003390959375 How many decades are there in twenty-five quarters of a millennium? 625 What is 3/40 of a milligram in micrograms? 75 How many millilitres are there in 61.6648l? 61664.8 How many nanoseconds are there in 90480.22 days? 7817491008000000000 How many years are there in 1924.196 decades? 19241.96 What is one fifteenth of a day in seconds? 5760 What is 35114.4 weeks in microseconds? 21237189120000000 What is 17/4 of a micrometer in nanometers? 4250 How many seconds are there in seven halves of a hour? 12600 What is 7.942905 weeks in days? 55.600335 How many seconds are there in two ninths of a hour? 800 How many litres are there in 0.7953384 millilitres? 0.0007953384 How many hours are there in five eighths of a week? 105 What is 21/8 of a day in hours? 63 How many months are there in 49.63761 millennia? 595651.32 How many millilitres are there in 76.1116l? 76111.6 What is 48.90561l in millilitres? 48905.61 Convert 86.65315 litres to millilitres. 86653.15 How many millilitres are there in 1/20 of a litre? 50 How many minutes are there in fifty-five sixths of a day? 13200 Convert 3202.224 weeks to days. 22415.568 How many weeks are there in 24431.3937 minutes? 2.423749375 What is 0.5834728 litres in millilitres? 583.4728 Convert 537965.8 litres to millilitres. 537965800 What is 27.05288 years in centuries? 0.2705288 How many millilitres are there in three fifths of a litre? 600 Convert 97.61399 litres to millilitres. 97613.99 How many milligrams are there in 5.3581ug? 0.0053581 Convert 536.9925 microseconds to nanoseconds. 536992.5 How many minutes are there in 2/15 of a hour? 8 What is 39.69243ng in micrograms? 0.03969243 How many kilograms are there in one quarter of a tonne? 250 What is 1/4 of a litre in millilitres? 250 How many hours are there in 53/4 of a week? 2226 How many days are there in 703.94508ms? 0.0000081475125 What is three tenths of a centimeter in millimeters? 3 What is seven quarters of a litre in millilitres? 1750 Convert 487.554 nanometers to meters. 0.000000487554 How many milligrams are there in 45/2 of a gram? 22500 What is 3/40 of a kilogram in milligrams? 75000 What is eleven tenths of a gram in milligrams? 1100 Convert 7.042011t to grams. 7042011 What is 11/2 of a tonne in kilograms? 5500 What is six fifths of a millennium in years? 1200 How many hours are there in fourty-eight sevenths of a week? 1152 What is one fifteenth of a decade in months? 8 How many hours are there in 51/7 of a week? 1224 What is 0.3877519 years in millennia? 0.0003877519 What is 2.726991ns in seconds? 0.000000002726991 What is seven eighths of a kilometer in centimeters? 87500 What is 3/40 of a day in seconds? 6480 What is 3/32 of a milligram in nanograms? 93750 How many months are there in 11/10 of a century? 1320 Convert 982.1454 minutes to seconds. 58928.724 What is one quarter of a millennium in years? 250 What is 3.787475 weeks in minutes? 38177.748 How many millimeters are there in 413.0108cm? 4130.108 What is 39.27001 meters in micrometers? 39270010 What is 13.385547s i	{ "pile_set_name": "DM Mathematics" }
253. Suppose -2i = 5i - u. Suppose -5y + 327 = -223. What is the highest common factor of i and y? 22 Suppose 0 = 453v - 447v - 468. What is the greatest common factor of v and 12? 6 Suppose 4n + 79 = 139. What is the greatest common divisor of 105 and n? 15 Let i(v) = -v*2 - 5v + 12. Let b be i(-10). Let w = b - -56. Calculate the highest common factor of w and 54. 18 Let a be (66/4)/(7 - (-91)/(-14)). Let m = a - 3. What is the highest common divisor of m and 90? 30 Let h be (150/4)/(15/20). Let o = -70 - -163. Let r = o + -18. Calculate the greatest common factor of h and r. 25 Let s be ((1 - -10) + 0)(-187)/(-11). Calculate the highest common divisor of 136 and s. 17 Suppose f = -2f - 12. Let a be (-483)/f + (-2)/(-8). Let p(c) = -c*3 - 3c*2 - 7c - 10. Let r be p(-3). What is the greatest common factor of a and r? 11 Suppose -4b = -3b - 16. Let v be (-4 + -1)4/(-10). Calculate the greatest common divisor of v and b. 2 Let y(d) = d + 11. Let x = 10 - 7. Let m be x/7 - 18/42. Let j be y(m). What is the greatest common divisor of 11 and j? 11 Suppose 2f - 4j = 676, -2f + 360 + 314 = -5j. Calculate the greatest common factor of f and 90. 18 Suppose -21s - 255 + 1158 = 0. What is the greatest common divisor of 86 and s? 43 Let s = -13 + 15. Let l be 384/4(s - 1). What is the highest common factor of 64 and l? 32 Let w be -1 - (-18)/14 - 166/(-7). Let q be 6/w - -1192/8. What is the highest common divisor of 150 and q? 30 Let l(u) = -18u + 88. Let w be l(0). Calculate the greatest common divisor of 40 and w. 8 Suppose 7y - 12 = 3y, 0 = -4c - 5y + 55. Let u = 7 + -18. Let m be c(u/5 - -3). Calculate the greatest common divisor of m and 8. 8 Let v be (-4 - -9) + (-357)/(-7). Calculate the greatest common divisor of 14 and v. 14 Suppose 2x - 410 = -3g, -5x - 539 = 12g - 16g. What is the greatest common factor of g and 24? 8 Let n(d) = 9d - 3d + 12d + 5 + 2d. Let o be n(3). Let h(p) = -7p - 2. Let t be h(-4). What is the greatest common factor of o and t? 13 Suppose 0 = -4c - 5r + 28, -3c + 2 = -4r + 3r. Suppose -5b = -v + 6, 0 = -0b + 4b + 4. Calculate the highest common factor of v and c. 1 Suppose 4b = -4l + 373 + 71, 0 = 5b - 2l - 548. Calculate the greatest common factor of 10 and b. 10 Suppose z = -0z + 41. Let p = 55 - z. Calculate the greatest common factor of 112 and p. 14 Let u be (874/57 + -16)/((-2)/108). Calculate the greatest common divisor of u and 396. 36 Let a(r) = 11r*2 - 34r + 8. Let g be a(4). What is the highest common divisor of 6 and g? 6 Let c = -40 - -46. Suppose 3q - 51 = 21. What is the highest common divisor of q and c? 6 Let f(p) = 20p + 119. Let x be f(-5). Calculate the greatest common factor of 209 and x. 19 Suppose 0 = -8h + 115 + 461. Calculate the highest common divisor of h and 396. 36 Suppose 0 = 3v + r - 10, -2r = -5r - 6. Suppose -vu - 9 = 3, 144 = 3c - 4u. What is the greatest common factor of c and 4? 4 Let x = -348 - -372. Calculate the greatest common divisor of x and 108. 12 Let p(s) = 2s*3 - 3s*2 - 8s - 2. Let z be p(4). What is the highest common factor of 138 and z? 46 Suppose -b = s - 5s + 44, -3s + 111 = -4b. Let m = 17 + b. Let h be 1/((14/(-48))/m). What is the highest common divisor of h and 60? 12 Let y(a) be the third derivative of -a6/120 - 7a*5/20 + 7a4/8 - a3/3 + 7a2. Let b be y(-22). What is the highest common divisor of b and 180? 20 Let t be ((-3)/4)/((-1)/4). Suppose -2 = -o + to, 2o = 4v - 2. Let c = 28 - v. Calculate the highest common factor of 224 and c. 28 Let v = 318 + -285. What is the greatest common divisor of v and 44? 11 Suppose 14n - 38 = 12n. Calculate the highest common factor of 38 and n. 19 Suppose 3n = -3y + 255, -2n - 268 + 38 = -3y. Calculate the greatest common factor of y and 16. 16 Let p be 7050/70 + 4/14. Suppose -27 = -j - 2m + p, 0 = -5j - 3m + 654. Calculate the highest common divisor of j and 12. 12 Let k(z) = -z + 41. Let r be k(26). Calculate the greatest common factor of 6 and r. 3 Let k be (-43)/(-1) - 10/(-190)-19. Let h be (4/5)/(2/35). Calculate the highest common factor of h and k. 14 Let a be (-3 - (-2)/1)-26. Let v(g) = 38g2 + g. Let p be v(1). What is the greatest common factor of p and a? 13 Let b(q) = q2 + 3q - 3. Let r be b(3). Suppose -4u = 54 - 534. Calculate the greatest common divisor of u and r. 15 Let f be (-7)/(-1) - ((-738 - -9) + 10). Calculate the highest common factor of 66 and f. 66 Let f = 79 + -42. Let l(t) = -5t3 + 2t*2 - t - 13. Let n be l(-2). Calculate the greatest common factor of n and f. 37 Let g be (564/(-1))/((-4)/6). Suppose -9h - 252 = -g. What is the greatest common factor of h and 6? 6 Let t = -8 + 22. Suppose 62 = -3q + 29. Let s = t + q. Calculate the highest common divisor of 21 and s. 3 Suppose -1 = 8s - 209. Let w = s + -22. What is the highest common divisor of 28 and w? 4 Let t(r) = r*2 - 15r + 17. Let d = 10 - -2. Let p be t(d). Let j = 27 + p. Calculate the greatest common divisor of 24 and j. 8 Let m(y) = -y*2 + 21y - 48. Let t be m(4). Calculate the greatest common divisor of t and 16. 4 Let l be (-4(-8)/(-48))/(3/(-594)). Let q be (-4)/(-41) + 11. What is the greatest common factor of q and l? 12 Let i = -151 - -166. Calculate the greatest common factor of 111 and i. 3 Suppose 2f = 5 + 35. Suppose -i = 5i - 240. Suppose -6q + 20 = -i. Calculate the greatest common divisor of f and q. 10 Let d = 1938 - 1836. Calculate the highest common factor of d and 459. 51 Suppose 4q - 126 = -5q. Calculate the greatest common divisor of 266 and q. 14 Let k be 18/27 - (2 + (-596)/6). Suppose -4i - 6 + k = 0. What is the greatest common divisor of i and 230? 23 Let i be (-3)/(-2) - 9009/(-42). What is the highest common factor of i and 56? 8 Let x = 1037 - 855. Calculate the highest common factor of 130 and x. 26 Let h be -32/(-48) - 30771/(-104). Calculate the greatest common divisor of h and 4. 4 Let f(a) = -3 + 3 - 14 + 9a + 27a2 - 28a*2. Let g be f(6). Calculate the greatest common factor of 44 and g. 4 Let t be (-3685)/(-110)(1 + 3). Calculate the greatest common factor of t and 335. 67 Let a = 1252 - 787. What is the highest common divisor of a and 155? 155 Suppose a - 230 = 43. Let u = 827 - 788. Calculate the highest common factor of u and a. 39 Let u be 13(0 + 1/1). Let y = u + 4. Suppose -15 = 5f, -5t - 2f = 2f - 243. Calculate the greatest common factor of t and y. 17 Suppose g - 4g = -6. Suppose 89 = 3h + u, 2h - 3h - gu + 38 = 0. Let b = -1 + 8. What is the highest common divisor of b and h? 7 Let m be 15 + 2 + 2/(-1). Suppose 1192 + 173 = 7i. Calculate the highest common divisor of i and m. 15 Let b = 19 - 11. Suppose 6j + 9 = x + j, -x + 4j + b = 0. Calculate the greatest common factor of 20 and x. 4 Let f(w) = -11w + 86. Let o be f(-3). What is the greatest common divisor of 34 and o? 17 Suppose 0 = 5d - 90 - 40. Let l = 149 - 35. Suppose -146 = -4p + l. Calculate the greatest common factor of d and p. 13 Suppose t = 10 - 23. Let l = 35 + t. What is the greatest common factor of 2 and l? 2 Let s(q) = -7q + 12. Let h be s(1). Let f be ((-3)/6)/(1/(-4)). Calculate the greatest common divisor of h and f. 1 Suppose r = -2r - 72. Let k = r + 40. Suppose t - 114 = -0t - 2u, -5u - 443 = -4t. Calculate the greatest common factor of k and t. 16 Let f(v) = -v + 23. Let u be f(12). Suppose -uj = -14j. Let l be -7 + 7 - (-10 - j). What is the highest common factor of l and 50? 10 Let y be (13/2)/(30/540). What is the greatest common divisor of y and 104? 13 Let g be (((-64)/20)/(2/(-45)))/1. Let n = g + -36. What is the greatest common factor of n and 4? 4 Let f(k) = -2k - 17. Let u be f(-9). Suppose 0 = 3l - 5j + 14, 5l + 3j = 33 - 11. Calculate the greatest common factor of u and l. 1 Let r = 136 - 73. Suppose -45 = -2u - 3u. Calculate the highest common divisor of u and r. 9 Let x be 2/(0 + -1 + (-7)/(-6)). What is the greatest common factor of 156 and x? 12 Suppose -2s = -s - 20. Suppose y + 3a = 50, -y - s = -2y + 3a. Suppose 0 = -2q - q + 21. What is the highest common divisor of q and y? 7 Let g be 2*((-3)/6 + -2). Let c be 6 - (6 + 12/(-4)) -	{ "pile_set_name": "DM Mathematics" }
integer? 24 What is 4224109 to the power of 1/7, to the nearest integer? 9 What is 26361503 to the power of 1/2, to the nearest integer? 5134 What is 395030 to the power of 1/2, to the nearest integer? 629 What is the fifth root of 16069447 to the nearest integer? 28 What is the third root of 111857 to the nearest integer? 48 What is 2905007 to the power of 1/3, to the nearest integer? 143 What is 7914245 to the power of 1/3, to the nearest integer? 199 What is the tenth root of 231466 to the nearest integer? 3 What is 331815 to the power of 1/3, to the nearest integer? 69 What is the third root of 10553703 to the nearest integer? 219 What is the eighth root of 2613965 to the nearest integer? 6 What is 301935 to the power of 1/2, to the nearest integer? 549 What is the tenth root of 1560387 to the nearest integer? 4 What is the cube root of 239236 to the nearest integer? 62 What is 188703 to the power of 1/5, to the nearest integer? 11 What is 304467 to the power of 1/10, to the nearest integer? 4 What is 587171 to the power of 1/6, to the nearest integer? 9 What is the square root of 669139 to the nearest integer? 818 What is 3846150 to the power of 1/2, to the nearest integer? 1961 What is 90239 to the power of 1/3, to the nearest integer? 45 What is 38334428 to the power of 1/2, to the nearest integer? 6191 What is 2511430 to the power of 1/9, to the nearest integer? 5 What is the fifth root of 148329 to the nearest integer? 11 What is the tenth root of 4089364 to the nearest integer? 5 What is the third root of 8545406 to the nearest integer? 204 What is 12936030 to the power of 1/10, to the nearest integer? 5 What is 11212661 to the power of 1/7, to the nearest integer? 10 What is the seventh root of 85682 to the nearest integer? 5 What is 486489 to the power of 1/9, to the nearest integer? 4 What is the ninth root of 420158 to the nearest integer? 4 What is the third root of 81571 to the nearest integer? 43 What is the third root of 26876838 to the nearest integer? 300 What is the fourth root of 1885510 to the nearest integer? 37 What is 557067 to the power of 1/2, to the nearest integer? 746 What is the sixth root of 8973034 to the nearest integer? 14 What is 8882165 to the power of 1/2, to the nearest integer? 2980 What is the cube root of 16309765 to the nearest integer? 254 What is the third root of 5239676 to the nearest integer? 174 What is the seventh root of 951449 to the nearest integer? 7 What is 31523374 to the power of 1/4, to the nearest integer? 75 What is the ninth root of 251557 to the nearest integer? 4 What is 234151 to the power of 1/3, to the nearest integer? 62 What is 1646076 to the power of 1/2, to the nearest integer? 1283 What is the sixth root of 394963 to the nearest integer? 9 What is the sixth root of 809422 to the nearest integer? 10 What is the square root of 6149595 to the nearest integer? 2480 What is the cube root of 349049 to the nearest integer? 70 What is 1799930 to the power of 1/3, to the nearest integer? 122 What is the square root of 4387289 to the nearest integer? 2095 What is 2162004 to the power of 1/9, to the nearest integer? 5 What is 1120582 to the power of 1/3, to the nearest integer? 104 What is 637048 to the power of 1/2, to the nearest integer? 798 What is 498739 to the power of 1/6, to the nearest integer? 9 What is 28712163 to the power of 1/9, to the nearest integer? 7 What is the square root of 6458 to the nearest integer? 80 What is 62610 to the power of 1/9, to the nearest integer? 3 What is 15628439 to the power of 1/10, to the nearest integer? 5 What is the fourth root of 807323 to the nearest integer? 30 What is 7990540 to the power of 1/3, to the nearest integer? 200 What is the third root of 31603 to the nearest integer? 32 What is the eighth root of 862888 to the nearest integer? 6 What is the square root of 1596118 to the nearest integer? 1263 What is the seventh root of 1081967 to the nearest integer? 7 What is the eighth root of 746412 to the nearest integer? 5 What is the tenth root of 1703478 to the nearest integer? 4 What is 1327725 to the power of 1/2, to the nearest integer? 1152 What is the cube root of 48597 to the nearest integer? 36 What is 954332 to the power of 1/2, to the nearest integer? 977 What is the third root of 2487761 to the nearest integer? 135 What is 103754 to the power of 1/2, to the nearest integer? 322 What is the seventh root of 294874 to the nearest integer? 6 What is the cube root of 1562896 to the nearest integer? 116 What is 7588870 to the power of 1/5, to the nearest integer? 24 What is 1700409 to the power of 1/3, to the nearest integer? 119 What is the third root of 82751 to the nearest integer? 44 What is the fifth root of 1009188 to the nearest integer? 16 What is the fifth root of 46493 to the nearest integer? 9 What is 25596824 to the power of 1/3, to the nearest integer? 295 What is 148216 to the power of 1/2, to the nearest integer? 385 What is 301921 to the power of 1/2, to the nearest integer? 549 What is the sixth root of 191871 to the nearest integer? 8 What is the third root of 2071168 to the nearest integer? 127 What is 5583552 to the power of 1/5, to the nearest integer? 22 What is 7875421 to the power of 1/9, to the nearest integer? 6 What is the third root of 7663304 to the nearest integer? 197 What is the fourth root of 615740 to the nearest integer? 28 What is the third root of 23990112 to the nearest integer? 288 What is the cube root of 1780342 to the nearest integer? 121 What is the square root of 3603304 to the nearest integer? 1898 What is the square root of 873231 to the nearest integer? 934 What is the third root of 48919 to the nearest integer? 37 What is 6663904 to the power of 1/2, to the nearest integer? 2581 What is 21676224 to the power of 1/2, to the nearest integer? 4656 What is the fifth root of 2298703 to the nearest integer? 19 What is 207192 to the power of 1/9, to the nearest integer? 4 What is the square root of 445794 to the nearest integer? 668 What is the square root of 176971 to the nearest integer? 421 What is 341073 to the power of 1/2, to the nearest integer? 584 What is the square root of 30852 to the nearest integer? 176 What is the third root of 326211 to the nearest integer? 69 What is the ninth root of 11373379 to the nearest integer? 6 What is the square root of 96373 to the nearest integer? 310 What is the cube root of 5216362 to the nearest integer? 173 What is the square root of 6822673 to the nearest integer? 2612 What is the square root of 28045 to the nearest integer? 167 What is the square root of 2707969 to the nearest integer? 1646 What is the cube root of 4961325 to the nearest integer? 171 What is the tenth root of 921626 to the nearest integer? 4 What is 297840 to the power of 1/3, to the nearest integer? 67 What is 14261913 to the power of 1/3, to the nearest integer? 243 What is the cube root of 1183478 to the nearest integer? 106 What is the cube root of 149978 to the nearest integer? 53 What is the square root of 436002 to the nearest integer? 660 What is the cube root of 4193347 to the nearest integer? 161 What is 828352 to the power of 1/2, to the nearest integer? 910 What is the third root of 1938520 to the nearest integer? 125 What is the seventh root of 227720 to the nearest integer? 6 What is the square root of 5727147 to the nearest integer? 2393 What is the cube root of 3752006 to the nearest integer? 155 What is 1636158 to the power of 1/4, to the nearest integer? 36 What is the tenth root of 14412939 to the nearest integer? 5 What is the cube root of 229933 to the nearest integer? 61 What is the square root of 1293798 to the nearest integer? 1137 What is the seventh root of 2176420 to the nearest integer? 8 What is 2906860 to the power of 1/2, to the nearest integer? 1705 What is the square root of 8341821 to the nearest integer? 2888 What is 350431 to the power of 1/2, to the nearest integer? 592 What is 164589 to the power of 1/6, to the nearest integer? 7 What is the square root of 34270826 to the nearest integer? 5854 What is 1502701 to the power of 1/2, to the nearest integer? 1226 What is the third root of 3368289 to the nearest integer? 150 What is 147	{ "pile_set_name": "DM Mathematics" }
Let w = d + 27. Factor 1/3l2 + wl - 1/3. (l - 1)(l + 1)/3 Let y(b) be the first derivative of -3b4/8 + b3/12 + 47. Factor y(l). -l*2(6l - 1)/4 Let s(p) be the second derivative of p7/10080 - 7p*6/1440 + 49p5/480 + p4/6 + 4p3 - 51p. Let l(t) be the third derivative of s(t). Factor l(y). (y - 7)*2/4 Let o(r) be the third derivative of 0r*3 + 0 + 1/240r*6 - 1/48r*4 + 0r*5 + 0r + 39r2. Let o(a) = 0. What is a? -1, 0, 1 Let w(t) be the third derivative of t6/30 - 8t*4 + 256t*3/3 - 4t*2 - 11. Let w(f) = 0. What is f? -8, 4 Factor -1957j + 430j2 + 12 - 6j3 - 12 + j3 - 7288j. -5j(j - 43)2 Let b(a) be the second derivative of -a5/110 + 9a*4/22 - 17a*3/11 + 25a*2/11 - 61a. Factor b(c). -2(c - 25)(c - 1)*2/11 Let x be -5 + 4 + 1 + 1. Let s be (15/(-6) + x)8/(-6). What is c in -94/3c3 - 16/3c*4 + 32/3c*5 + 26/3c - 16/3cs - 4/3 = 0? -1, 1/4, 2 Let f(g) = 2g*3 - 32g*2 + 61g + 75. Let m(p) = -4p3 + 48p*2 - 92p - 112. Let v(n) = 8f(n) + 5m(n). Suppose v(s) = 0. Calculate s. -5, -1, 2 Let p = 5 - 11. Let a be p/(-3) + (-3 - -4). Factor 4/3m2 - 1/3m*a + 0 - m. -m(m - 3)(m - 1)/3 Suppose -2c + 2o = -8, -20 = c - 3o + 8o. Let w(r) be the first derivative of -9 + 1/15r*3 + cr + 0r2. Solve w(l) = 0 for l. 0 Let w(g) be the first derivative of -g4/4 + 151g*3/3 - 5775g*2/2 + 5625g - 392. Factor w(c). -(c - 75)*2(c - 1) Let x be -2 - 284/(-120) - (-7 + 144/20). Let xv4 - 1/6 + 0v*2 - 1/3v*3 + 1/3v = 0. What is v? -1, 1 Let o(l) = 3l2 - 6l + 3. Let t(v) = -v*2 + v - 1. Suppose -2g - 11 = -1. Let d(y) = go(y) - 20t(y). Find m such that d(m) = 0. -1 Let h(p) be the second derivative of p5/30 - p4/3 + p*3 - 9p*2/2 + 6p. Let v(g) be the first derivative of h(g). Factor v(s). 2(s - 3)(s - 1) Let r(k) be the second derivative of 1/30k5 + 1/135k*6 + 5k - 1/27k4 + 0 - 8/9k*2 - 4/9k*3. Factor r(z). 2(z - 2)(z + 1)(z + 2)*2/9 Let q(f) be the third derivative of -1/20f*5 + 7f*2 + 0f + 1/2f4 + 0 - 3/2f*3. Factor q(k). -3(k - 3)(k - 1) Let c(n) be the first derivative of n3/21 - 118n*2/7 + 235n/7 + 453. Factor c(t). (t - 235)(t - 1)/7 Let i(n) = 37n - 5. Let j be i(2). Determine r so that jr - 70r - 2r2 + 3r*2 = 0. 0, 1 Let q(n) be the first derivative of 2n*5/5 - 17n*4 + 280n*3 - 2200n*2 + 8000n - 89. Factor q(g). 2(g - 10)3(g - 4) Let f = 40874/981 - -1/981. Let k = -41 + f. What is l in 0 + kl2 + 2/3l = 0? -1, 0 Let c be 33/(-99) + 14/6. Factor -1/2xc + 1/2x + 0. -x(x - 1)/2 Let j(y) be the first derivative of -11 + 5/3y3 + y5 + 80y - 15/2y*4 + 60y*2. Suppose j(d) = 0. What is d? -1, 4 Let k be (-411)/(-630) - 180/(-840) - (-2)/(-10). Factor -5/3i*2 + 1/2 - ki*3 + 2/3i + 7/6i4. (i - 1)2(i + 1)(7i + 3)/6 Let o(y) be the first derivative of 0y - 2/3y*3 - 1/6y*4 - 1/9y*6 - 1 + 2/5y*5 + 2/3y2. Let o(g) = 0. What is g? -1, 0, 1, 2 Let g(c) = c3 + c - 1. Suppose 0 = -v - 3v - 8, -2v - 12 = -k. Let j(d) = -22d3 + 46d*2 - 48d + 16. Let f(o) = kg(o) + j(o). What is h in f(h) = 0? 2/7, 1, 2 Let k(b) be the second derivative of 5/4b*4 + 0b*3 + 1/4b*5 + 0 + 0b*2 - 36b. Factor k(u). 5u2(u + 3) Suppose 9/4k3 - 81/4k + 27/8 + 30k2 - 27/8k*4 = 0. What is k? -3, 1/3, 3 Let b(g) = -11g2 - g3 + 41g - 78g + 28 + 51g. Let h be b(-12). Factor 2/5u + 0 + 2/5uh - 2/5u*3 - 2/5u*2. 2u(u - 1)2(u + 1)/5 Factor 48/7x2 - 768/7 + 36/7x*3 - 320/7x + 4/7x4. 4(x - 3)(x + 4)3/7 Let p(o) be the first derivative of -o6/6 + o5/10 + 3o*4/2 - 11o*3/3 + 7o*2/2 - 3o/2 + 71. Let p(c) = 0. Calculate c. -3, 1/2, 1 Let f(z) be the first derivative of -2/9z2 - 2/9z*3 + 31 + 0z - 1/18z4. Factor f(p). -2p(p + 1)(p + 2)/9 Suppose 7d - 13 - 1 = 0. Find s such that 0s*2 - 7s*3 + 6s*3 + s - ds*2 + 2 = 0. -2, -1, 1 Let l be (-5)/6(864/60 - 15). Factor 0 - lj2 - j. -j(j + 2)/2 Let v(y) = -y*2 + 58y - 52. Let k be v(57). Let t(r) be the first derivative of -1/5rk - 4r - 13/3r3 - 6r*2 - 3/2r4 - 11. Factor t(a). -(a + 1)2(a + 2)2 Let o = -11573/4 + 2894. Factor 3/8z*3 + 3/2 - 21/8z + oz2. 3(z - 1)*2(z + 4)/8 Let b be -12(12/(-8) - -1) + -2. Suppose -bc + c = -6. What is l in -cl2 - 4/3l + 10/3l3 + 0 = 0? -2/5, 0, 1 Let s(y) = -y3 + 5y*2 - 3y + 1. Let z be s(4). Factor 12b2 - 63b*4 + 29b*4 + 28b*4 - 6 + 2b3 - b - bz. -(b - 1)*2(b + 1)*2(b + 6) Suppose -2v + 8v = -558. Let n = 281/3 + v. Solve -np + 1/3p2 + 0 = 0. 0, 2 Let h(z) be the first derivative of z4/36 + z3/9 - z2/2 + 2z + 10. Let s(y) be the first derivative of h(y). Determine a so that s(a) = 0. -3, 1 Let c(n) be the first derivative of -n3/15 + 7n*2/2 - 261. What is y in c(y) = 0? 0, 35 Suppose 3/2 + 9z*2 - 6z*3 + 3/2z*4 - 6z = 0. Calculate z. 1 Let h(c) be the third derivative of c*7/840 - 29c*6/480 + 27c*5/80 - 79c*4/96 + 13c*3/12 - 29c*2 - 2c. Factor h(f). (f - 26)(f - 1)3/4 Let f(g) be the second derivative of g7/378 + g6/54 + g5/30 - g4/27 - 4g*3/27 + 451g. Factor f(q). q(q - 1)(q + 2)3/9 Let l(b) be the third derivative of b5/60 - 5b4/24 - b3 - 52b*2 + b. Factor l(i). (i - 6)(i + 1) Let q(x) = 2x - 7. Let j be q(-7). Let l = j + 23. Determine h so that -2h - 2hl - 1 - 3 + 4 = 0. -1, 0 Let r be 35/(-4) + -1 - (-3)/4. Let q be 3/r + 33/45. Factor -q + 0o + 0o3 + 4/5o*2 - 2/5o*4. -2(o - 1)*2(o + 1)*2/5 Factor -17i - 8i4 - 127i*3 - 5 + 249i3 + 1 - i5 - 144i3 - 28i2. -(i + 1)4(i + 4) Let f = -73 - -112. Let d be 306/f + (-4)/(-26). What is i in 2i*3 + 0i + 19i2 - d + 0i - 13i2 = 0? -2, 1 Let o(v) = -v - 4. Let t be o(-6). Let d = 1567/14 - 689/7. What is c in -dc + 3 + 6ct = 0? 1/4, 2 Suppose 7 = 4n + 3. Let f be ((21 - n) + -8)4/18. Let -fm + 0 - 2/3m2 = 0. What is m? -4, 0 Let s(a) = a3 - 9a*2 - 9a - 6. Let q be s(10). Factor qj2 + 48 + 16j - 19 - 17. 4(j + 1)(j + 3) Find h, given that 1/2h - 1/6h*3 + 1/3 + 0h*2 = 0. -1, 2 Let w(n) be the first derivative of 4n*3/3 + 214n*2 - 26. Let w(z) = 0. Calculate z. -107, 0 Suppose 37 = -6o + 49. Solve 20 + 253x + 5x*o + 265x - 538x = 0. 2 Let d = 9 - 3. Suppose 4t = -3c + d, -6 = -5c + 2c - 3t. What is z in -4/3zc - 2/9 + 8/9z - 2/9z4 + 8/9z*3 = 0? 1 Let l(s) = -5s*4 + 19s*3 - 28s*2 - 13s + 24. Let i(t) = -4t4 + 18t*3 - 28t*2 - 14t + 26. Let c(j) = 6i(j) - 4l(j). Find d, given that c(d) = 0. -1, 1, 3, 5 Let d(i) be the first derivative of 0i - 3/4i*4 - 27 - 2i*2 + 2/5i*5 - 8/3i*3 + 1/6i*6. Factor d(c). c(c - 2)(c + 1)2(c + 2) Suppose 9 + 5 = 7y. Find n such that 2n - 6n2 + 5n - 2n + ny = 0. 0, 1 Solve 2/3n*3 - 52/3n*2 - 18n + 0 = 0 for n. -1, 0, 27 Solve -37u2 + 16u*2 + 20u*2 - 15 + 16u = 0 for u. 1, 15 Let u(m) be the second derivative of -m*5/10 + 20m*4/3 - 400m*3/3 - 37m. Determine s, given that u(s) = 0. 0, 20 Let m(s) be the first derivative of s6/30 - s5/10 - 32s + 32. Let w(a) be the first derivative of m(a). Find k such that w(k) = 0. 0, 2 Let t(z) be the third derivative of -25z8/336 + z7/42 + 5z6/24 - z5/12 - 4z*2 - 9z. Determine s so that t(s) = 0. -1, 0, 1/5, 1 Let y be 2/(-40)2(-30)/72. Let i(l) be the second derivative of -yl4 + 1/2l*2 + 0 + 6l - 1/12l3. Factor i(m). -(m - 1)(m + 2)/2 Determine v, given that 7/4v - 1/4v*5 + 3/4 - 5/4v*4 + 1/2v*2 - 3/2v3 = 0. -3, -1, 1 What is o in o5 - 3o5 - o3 + 3o*3 - 4o*2 - 1503 + 1503 + 4o*4 = 0? -1, 0, 1, 2 Let r(f) be the third derivative of 1/45f*4 + 0f + 2/225f5 + 0 - f2 + 0f*3 + 1/900f*6. Factor r(w). 2w(w + 2)2/15 Solve -1/8m*2 + 0 - 2m = 0. -16, 0 Suppose 3d + 0d = 0. Suppose d = -6t + 5t + 3. Determine q so that 2/3 + 2/3qt + 2q + 2q2 = 0. -1 Let v(w) = 3w*2 - w - 1. Let f(g) = 23g*2 + 29g - 96. Let y(z) = f(z) - 6v(z). Factor y(p). 5(p - 2)(p + 9) Let o(s) = -3s*3 - 5s*2 - 2s. Let z(d) = -d*2 - d. Let r(u) = -u + 10. Let i be r(7). Suppose -5 = -2c	{ "pile_set_name": "DM Mathematics" }
755 or 23596752? 23596752 Which is greater: -119366824 or -119366823? -119366823 Do -15 and -537361/5 have the same value? False Is -5.82 at most 23107? True Do -470247 and -470085 have the same value? False Is 228618 greater than -8? True Which is bigger: 6/8603 or -194? 6/8603 Is -172468956 equal to -172468956? True Which is smaller: 264980 or 265739? 264980 Which is bigger: -0.04 or 15660/31? 15660/31 Is 5153382 < 5153389? True Which is bigger: 0.05 or 40987? 40987 Which is smaller: 0 or -7212/67703? -7212/67703 Which is bigger: -3 or 107300266? 107300266 Is 2294176/3 not equal to 764726? True Which is bigger: 0 or -2/379278971? 0 Which is greater: -752557 or -9783222/13? -9783222/13 Which is bigger: 2/9 or 3/34133255? 2/9 Which is bigger: 69/3260887 or -2? 69/3260887 Which is greater: 3 or 16678/6395? 3 Which is smaller: -2332610/1067 or -2185? -2332610/1067 Which is bigger: -2485 or -221098/89? -221098/89 Are 60607637 and 60607627 nonequal? True Is 1197176 greater than or equal to 0.11? True Is 14699879 < 14699877? False Is 5/4 != -0.01880794? True Is 1 < -3268/18397? False Which is greater: -31/1579 or -1.9? -31/1579 Which is smaller: 26973398 or 26973385? 26973385 Which is smaller: -3030046 or -3030080? -3030080 Which is smaller: -2 or -1576/2007? -2 Is -16881494 equal to -16881494? True Is 73892/103 at least 716? True Is 6934028 bigger than 6934036? False Which is bigger: 36670 or 36362? 36670 Is 8 != 30411/3685? True Which is bigger: 115924864 or 115924849? 115924864 Which is smaller: -45499 or -0.178? -45499 Is -604129/1995 < -303? False Is -455 equal to 548/41? False Is -46 less than or equal to 12530047? True Which is greater: -409215 or -409227? -409215 Which is smaller: 36567967 or 36567982? 36567967 Is 128777/1164 >= 112? False Which is bigger: -9177 or -807577/88? -9177 Which is bigger: 2425.0004 or 1? 2425.0004 Is -3/67439 bigger than 0? False Is 2/5 smaller than 436.167? True Which is bigger: 25606 or 20087? 25606 Which is smaller: 1 or -4/219438897? -4/219438897 Which is smaller: 35847 or 38936? 35847 Which is smaller: 1 or 6629/50636? 6629/50636 Which is smaller: 0.1 or 5865373/7? 0.1 Is 21/166595 > 1? False Which is smaller: 1 or -59/1057611? -59/1057611 Which is bigger: 1 or 51/78053990? 1 Does 73 = 18127/244? False Which is smaller: 1126367 or 6758195/6? 6758195/6 Which is greater: 119894 or -0.21? 119894 Is -20899824 > -20899826? True Is -641787 at least as big as 1688? False Which is bigger: 1071 or -4572? 1071 Do -7 and -1399591 have different values? True Are 0 and 2/2292029 nonequal? True Is 28872.698 less than or equal to -8? False Which is smaller: 1 or 1/1489769207? 1/1489769207 Which is smaller: -93 or 1318.809? -93 Is 68651/4385 smaller than 17? True Which is bigger: -2520830.3 or -1? -1 Is 1382 less than 695128/503? False Which is smaller: 0.0175 or 31.82? 0.0175 Is 337/13 at most 14/139? False Is -1/3 at most 24/286807? True Which is smaller: 1 or -1/20583958? -1/20583958 Is -5/12995412 at least as big as 0? False Which is smaller: -1 or 20/1575231? -1 Are -31629269 and -31629268 non-equal? True Which is smaller: -24833 or -71832? -71832 Are 2.814998 and 1 equal? False Do 2/11 and 23793572/31 have different values? True Which is smaller: -1 or -3/170382616? -1 Is 18629313/8 greater than 2328665? False Which is bigger: -58393 or -59189? -58393 Does -177285735 = -177285734? False Are 125588 and 2888490/23 nonequal? True Does 267/21908 = -1? False Is -0.038183504 equal to 3? False Which is smaller: -3/4 or 14? -3/4 Which is bigger: 6384500 or 6384483? 6384500 Which is smaller: 4179.14 or -330? -330 Which is smaller: 268514 or 2498? 2498 Which is smaller: 128156909 or 128156908? 128156908 Is -384669548 >= -384669550? True Is 7379330 at most as big as 7379330? True Does -1 = 9/47340863? False Is 0 >= -1/370411198? True Is -85898819 <= -85898822? False Is -1 not equal to 189/654739? True Is 0 smaller than 7923/16583? True Is -2255329 >= -72? False Is -1607458 < -1607460? False Is -2149 at least as big as -676472/315? False Which is greater: 63224 or 1074798/17? 63224 Is 3661641 at most as big as 3661641? True Is -1293358/59 at most as big as -21921? True Which is bigger: 141451407 or 0? 141451407 Are -462/1671973 and 0 non-equal? True Which is bigger: 1408484 or 1408580? 1408580 Which is smaller: 23014/927 or 24? 24 Is -2869675 at most as big as -2869673? True Are -124820.05 and 2 equal? False Is 3702978 bigger than 3702978? False Which is smaller: -25291068 or -25291067? -25291068 Which is smaller: 4/7963227 or 1? 4/7963227 Are -3/148819 and 0.032 non-equal? True Which is greater: 758.7592 or -0.2? 758.7592 Which is greater: 1023 or 350800/343? 1023 Which is greater: -10049 or -13027? -10049 Which is bigger: -1/85 or 62/29691? 62/29691 Is 306.2322 equal to -33? False Are 3.579537 and -1/3 unequal? True Which is greater: 342962962 or 342962958? 342962962 Which is greater: -325337 or -325503? -325337 Is -142 bigger than -1058/2963? False Which is greater: -14/1132465 or 1? 1 Is 359638 less than 27/4? False Which is smaller: 5/9141497 or 1? 5/9141497 Which is greater: -1 or -106/2097443? -106/2097443 Which is smaller: 1310/11 or 822? 1310/11 Is -580 less than -57550/99? False Which is bigger: -190 or 7/8964? 7/8964 Which is bigger: -0.4 or 0.30231459? 0.30231459 Is 6394173 >= 6394172? True Is 0.057911 at least as big as -407? True Which is bigger: -284228 or -284276? -284228 Is 2523670 less than 2523667? False Which is bigger: -0.3 or -114064764? -0.3 Is -177732 greater than -177261? False Is 524 less than or equal to -0.46519? False Is -487.802 < 113.4? True Which is greater: 6609/6110 or 1? 6609/6110 Which is smaller: 8126651 or 8126677? 8126651 Is 2.001 equal to -0.0046? False Which is smaller: 0 or 2/533647233? 0 Which is smaller: -2/4803 or 349280? -2/4803 Which is smaller: 7900149 or 7900144? 7900144 Which is smaller: -1878511 or -1878507? -1878511 Which is smaller: 214.25 or -552? -552 Which is smaller: 19435979 or 19435978? 19435978 Is 33010032 at most -25? False Which is smaller: -0.1397508 or 0? -0.1397508 Which is bigger: -527106 or -11? -11 Is -44/80981 bigger than -1? True Which is bigger: 72397862/15 or 4826523? 72397862/15 Are 8089 and 1803783/223 unequal? True Is 464228129/5 > 92845627? False Is -2196 < -1834623/835? False Do -121680081 and -5 have different values? True Which is bigger: -1 or -538/1059747? -538/1059747 Is 0 < 1/146391685? True Which is smaller: 159259047 or 318518093/2? 318518093/2 Which is greater: 21346 or 226? 21346 Which is smaller: 839528 or 839150? 839150 Which is smaller: -849/32794 or -1? -1 Which is bigger: -2832434 or -2832436? -2832434 Is -13539909 at least -13539911? True Is -1 at most as big as -16/1463199? True Which is greater: 0 or -4188174? 0 Is 84373645 less than or equal to 84373646? True Which is greater: -1/5 or -376622240? -1/5 Is 1609555/16 <= 100598? True Which is bigger: -73.6 or 558752? 558752 Which is greater: 36688427 or 36688426? 36688427 Which is greater: 2369706 or 2369705? 2369706 Which is smaller: 1678254/1075 or 1562? 1678254/1075 Which is smaller: -276141 or -276072? -276141 Is -224620 bigger than -227308? True Is 597154 bigger than -34? True Is -2/5951 at least 7910? False Which is smaller: 7/99840189 or 1? 7/99840189 Is 6/1691357 at most as big as -7? False Is 5816 bigger than 4872? True Which is smaller: 4/23 or -400213? -400213 Is 0 less than or equal to 2/488836369? True Which is smaller: 652952 or 652919? 652919 Is 1055 > 41021? False Which is greater: -4/11783163 or 1? 1 Is -709 greater than -1891? True Which is smaller: 0.04292 or -6105/2? -6105/2 Are 0 and 16/20150361 unequal? True Which is smaller: 287 or -9/6185? -9/6185 Which is bigger: 1/8 or -993423? 1/8 Is -331786316 at least -331786316? True Is -5511 less than -253501/46? True Which is greater: 51143.7 or 5/9? 51143.7 Which is smaller: -96661 or -98604? -98604 Is -38767890 != -38767890? False Is 0.29 equal to 12/53239? False Which is bigger: 242764 or 242763? 242764 Which is smaller: -279639 or -239? -279639 Is 0 equal to 31020/35177? False Are 1/984464975 and -1 unequal? True Is -113.078758 at most -1/5? True Are 15194/9483 and 2 equal? False Which is smaller: -1 or -13/2668297	{ "pile_set_name": "DM Mathematics" }
What is the remainder when 8236 is divided by 7801? 435 Calculate the remainder when 303140 is divided by 37620. 2180 Calculate the remainder when 3612150 is divided by 756. 738 Calculate the remainder when 856242 is divided by 285381. 99 What is the remainder when 18038019 is divided by 901? 900 Calculate the remainder when 2895292 is divided by 22. 4 Calculate the remainder when 315167 is divided by 315043. 124 Calculate the remainder when 7336697 is divided by 27. 14 What is the remainder when 3953686 is divided by 2569? 2564 What is the remainder when 278265 is divided by 139063? 139 Calculate the remainder when 143728 is divided by 28697. 243 What is the remainder when 53467 is divided by 52692? 775 Calculate the remainder when 22370 is divided by 701. 639 Calculate the remainder when 2229043 is divided by 171463. 24 Calculate the remainder when 8890503 is divided by 366. 363 Calculate the remainder when 98037 is divided by 285. 282 What is the remainder when 5383945 is divided by 1794634? 43 What is the remainder when 264436 is divided by 70? 46 Calculate the remainder when 1077983 is divided by 538989. 5 What is the remainder when 47887 is divided by 212? 187 What is the remainder when 43811082 is divided by 58182? 36 What is the remainder when 112776 is divided by 56352? 72 What is the remainder when 3789365 is divided by 19? 5 Calculate the remainder when 25566717 is divided by 133. 127 What is the remainder when 67885018 is divided by 3507? 19 Calculate the remainder when 107662 is divided by 1054. 154 Calculate the remainder when 4845280 is divided by 43. 40 What is the remainder when 1743564118 is divided by 8760? 8758 What is the remainder when 202826 is divided by 28855? 841 What is the remainder when 624415 is divided by 156087? 67 What is the remainder when 260972 is divided by 65175? 272 What is the remainder when 9331966 is divided by 3346? 3318 Calculate the remainder when 1070639 is divided by 1205. 599 Calculate the remainder when 585768 is divided by 99. 84 What is the remainder when 122520 is divided by 4529? 237 Calculate the remainder when 1012259 is divided by 1878. 17 What is the remainder when 715539 is divided by 5185? 9 Calculate the remainder when 3745524 is divided by 3745513. 11 What is the remainder when 9873232 is divided by 147? 124 Calculate the remainder when 1509863 is divided by 217. 194 Calculate the remainder when 4113325 is divided by 10520. 5 What is the remainder when 392113112 is divided by 1941154? 4 What is the remainder when 119738 is divided by 129? 26 What is the remainder when 10519038 is divided by 94766? 12 What is the remainder when 911942 is divided by 29416? 46 What is the remainder when 3061734 is divided by 661? 643 Calculate the remainder when 224695134 is divided by 60. 54 What is the remainder when 17328453 is divided by 8339? 11 What is the remainder when 19482189 is divided by 36? 33 What is the remainder when 176610 is divided by 5095? 3380 What is the remainder when 50622 is divided by 16362? 1536 What is the remainder when 3518203 is divided by 703632? 43 Calculate the remainder when 295633 is divided by 2835. 793 Calculate the remainder when 59798124 is divided by 41. 34 What is the remainder when 86500 is divided by 14359? 346 Calculate the remainder when 790559 is divided by 170. 59 What is the remainder when 215526 is divided by 798? 66 What is the remainder when 7367918 is divided by 663? 662 What is the remainder when 553685 is divided by 5272? 125 What is the remainder when 79345110 is divided by 5? 0 Calculate the remainder when 75553880 is divided by 18888468. 8 Calculate the remainder when 669773 is divided by 669743. 30 Calculate the remainder when 11095788 is divided by 366. 132 Calculate the remainder when 2785086 is divided by 214195. 551 Calculate the remainder when 251659 is divided by 50304. 139 What is the remainder when 5866061 is divided by 87? 86 Calculate the remainder when 564977 is divided by 826. 819 What is the remainder when 182744 is divided by 2762? 452 What is the remainder when 275733 is divided by 40? 13 Calculate the remainder when 577138 is divided by 134. 0 Calculate the remainder when 315343549 is divided by 42. 31 Calculate the remainder when 2608775 is divided by 115. 0 Calculate the remainder when 6378283 is divided by 15827. 2 Calculate the remainder when 29151 is divided by 1391. 1331 What is the remainder when 64647 is divided by 7039? 1296 Calculate the remainder when 120452835 is divided by 26340. 15 What is the remainder when 369688 is divided by 13690? 58 What is the remainder when 61389 is divided by 20370? 279 Calculate the remainder when 692915003 is divided by 1687. 1684 Calculate the remainder when 1278562 is divided by 71. 65 Calculate the remainder when 1324209 is divided by 5448. 345 Calculate the remainder when 10284883 is divided by 703. 696 Calculate the remainder when 107723 is divided by 87. 17 What is the remainder when 18154 is divided by 1374? 292 Calculate the remainder when 5379162 is divided by 672394. 10 Calculate the remainder when 1849355 is divided by 616355. 290 What is the remainder when 946329 is divided by 16869? 1665 Calculate the remainder when 12450053 is divided by 2224. 101 Calculate the remainder when 13029723 is divided by 658. 7 What is the remainder when 96784 is divided by 11943? 1240 What is the remainder when 11186206 is divided by 132? 130 What is the remainder when 792062158 is divided by 4856? 4854 Calculate the remainder when 13164097 is divided by 2632818. 7 What is the remainder when 1720547 is divided by 2291? 6 What is the remainder when 2508612 is divided by 66010? 232 Calculate the remainder when 79439 is divided by 85. 49 What is the remainder when 3098154 is divided by 619617? 69 What is the remainder when 897118 is divided by 183? 52 Calculate the remainder when 1524057 is divided by 380990. 97 Calculate the remainder when 13891704 is divided by 85225. 29 What is the remainder when 195513 is divided by 4370? 3233 What is the remainder when 1019088 is divided by 59? 40 What is the remainder when 11115916 is divided by 33? 31 Calculate the remainder when 18683 is divided by 353. 327 What is the remainder when 161728477 is divided by 1089? 1087 Calculate the remainder when 6132361 is divided by 6132330. 31 What is the remainder when 5258877 is divided by 25653? 12 What is the remainder when 7357488 is divided by 565? 58 What is the remainder when 224246 is divided by 1228? 750 Calculate the remainder when 4215198 is divided by 978. 18 Calculate the remainder when 92921 is divided by 81294. 11627 What is the remainder when 882028 is divided by 38269? 1841 Calculate the remainder when 15648 is divided by 3110. 98 What is the remainder when 71475 is divided by 10027? 1286 What is the remainder when 10096822 is divided by 2072? 2038 Calculate the remainder when 18512735 is divided by 97. 91 What is the remainder when 2156870 is divided by 14? 2 What is the remainder when 47442 is divided by 22668? 2106 What is the remainder when 251493 is divided by 198? 33 What is the remainder when 1815071 is divided by 781? 27 What is the remainder when 4672064 is divided by 72? 56 Calculate the remainder when 4559771 is divided by 689. 658 Calculate the remainder when 61455 is divided by 1009. 915 What is the remainder when 2998639 is divided by 1499303? 33 What is the remainder when 198459 is divided by 227? 61 Calculate the remainder when 21051163 is divided by 701705. 13 Calculate the remainder when 62423272 is divided by 607. 606 Calculate the remainder when 1817999 is divided by 750. 749 Calculate the remainder when 110204443 is divided by 52. 11 Calculate the remainder when 75190 is divided by 37450. 290 Calculate the remainder when 61101 is divided by 1608. 1605 What is the remainder when 12792687 is divided by 20534? 5 What is the remainder when 842899 is divided by 77? 57 Calculate the remainder when 30809755 is divided by 159636. 7 Calculate the remainder when 160057 is divided by 3490. 3007 What is the remainder when 42458025 is divided by 505452? 57 What is the remainder when 1032941 is divided by 114647? 1118 What is the remainder when 5995233 is divided by 285487? 6 Calculate the r	{ "pile_set_name": "DM Mathematics" }
least -2? False Does 2/5 = 102? False Which is smaller: 66/23 or -1/2? -1/2 Does 193/23 = 7? False Which is smaller: -3792 or 1? -3792 Which is greater: 278/11 or 24? 278/11 Which is smaller: -1/2 or 262? -1/2 Are -4/1779 and 1 nonequal? True Does 423/43 = 10? False Which is smaller: 150 or 5? 5 Is 13024 < 13022? False Are 1/332 and 0 unequal? True Is 644 at least as big as 644? True Is 7 at most -0.717? False Is 4/4789 greater than -1? True Which is greater: 2257 or 2258? 2258 Which is smaller: 0.1 or 391? 0.1 Does 188 = 189? False Is -1702 <= -1697? True Are 0 and 8/13521 non-equal? True Which is bigger: -0.67 or -4? -0.67 Which is smaller: -121 or -119? -121 Which is smaller: 128 or 132? 128 Is 122/73 greater than or equal to 1? True Is 1501/15 less than 99? False Are -367 and -333 equal? False Is 1331 greater than 1332? False Is -166 less than -166? False Is -552 <= -527? True Which is smaller: 2 or 217/68? 2 Is -388 at most -388? True Do -14 and -22 have the same value? False Which is smaller: -409 or -411? -411 Which is smaller: 126 or 127? 126 Which is smaller: -486/11 or -43? -486/11 Is -327 greater than or equal to -328? True Is 2/21 > -18? True Is 5 at most 24/5? False Is 11154 bigger than 11152? True Which is greater: -1/1301 or -1? -1/1301 Are 449 and 452 non-equal? True Is -1/5 greater than -3/155? False Is -6 smaller than -33/7? True Are -288 and -20 equal? False Is -53/8 at most as big as -8? False Which is bigger: -6036 or -6034? -6034 Which is smaller: -4/3925 or -1? -1 Is -59 < 8? True Is -57 > -62? True Are 1 and 8/21569 non-equal? True Is 11277 at least as big as 11277? True Is -1466 at least as big as -1470? True Is 131 smaller than 117? False Which is smaller: 2 or -1.73? -1.73 Which is smaller: 10 or 379? 10 Which is bigger: -49 or 174? 174 Is 11 greater than or equal to 528/43? False Is 2 not equal to 4? True Which is bigger: -4/35 or -1? -4/35 Which is bigger: -0.1 or -12674? -0.1 Are 4 and -6 unequal? True Is 1 less than 1/2275? False Is -2/7 bigger than -387? True Which is smaller: -1/1500 or 1? -1/1500 Which is greater: -60 or -0.075? -0.075 Which is bigger: 1 or -1/21948? 1 Does -0.1 = 16? False Which is smaller: -4 or -10? -10 Which is smaller: 505 or 507? 505 Are -40 and -290/7 equal? False Is -164/57 less than -4? False Is 39 <= 30? False Is -1062.5 not equal to 0.1? True Which is greater: 2/5 or -2604? 2/5 Which is greater: 3 or 4753? 4753 Which is smaller: -0.0321 or 40? -0.0321 Which is smaller: -1 or 5/476? -1 Which is smaller: -166 or -661/4? -166 Which is greater: 80 or 568/7? 568/7 Which is smaller: 7 or 97/3? 7 Which is bigger: 129 or 4? 129 Which is greater: 11/4 or 0? 11/4 Which is greater: -2 or 1/7? 1/7 Are -160 and -2 nonequal? True Which is smaller: -1084 or -2/5? -1084 Are 6396 and 6397 nonequal? True Which is bigger: -1.3 or -0.169? -0.169 Which is smaller: 2/407 or 1? 2/407 Which is smaller: -8 or 46? -8 Is 1 equal to 17/421? False Is 4778 bigger than 4778? False Which is greater: 1/13 or -1? 1/13 Which is greater: -656 or -657? -656 Which is smaller: -1703 or -1705? -1705 Which is bigger: 399 or 387? 399 Do 32/7 and 5 have different values? True Is 288 >= 288? True Is -7 at least as big as 664? False Which is smaller: 1 or 3/1493? 3/1493 Is 3322 at least 3329? False Is 5 less than 22? True Which is greater: -343 or -344? -343 Is -0.496 bigger than 0? False Are -72 and -70 non-equal? True Does 17 = 45? False Are -1/4 and 2432 equal? False Which is bigger: 700 or 698? 700 Is 264 < 286? True Which is greater: 7/4 or -5? 7/4 Which is smaller: -193 or -197? -197 Is -25 less than or equal to -13? True Is 2808 < 2806? False Is -26915 greater than -26915? False Which is bigger: 29 or 473/17? 29 Which is greater: 0 or 22/2019? 22/2019 Is -2189 > -2189? False Which is smaller: 1/16 or 0? 0 Which is smaller: 4536 or 4535? 4535 Which is greater: 1/2 or -3/4099? 1/2 Is -1/653 at least as big as -1? True Are 883 and 886 nonequal? True Which is bigger: -5 or -34/7? -34/7 Is 35/71 equal to -1? False Is -1 <= -1/574? True Is 4295 equal to 4297? False Which is smaller: 1 or -5/847? -5/847 Is 98 bigger than 92? True Which is smaller: 0 or 1/4776? 0 Which is bigger: 2250/17 or 132? 2250/17 Is -14/5 not equal to 0? True Is -2/3 > 62.243? False Is 2 > -5/24? True Are -3 and -159/43 unequal? True Which is greater: -3167/6 or -528? -3167/6 Is -10 greater than -3? False Is -5.3 >= 2? False Which is smaller: 1/3 or -1126? -1126 Which is smaller: 37961 or 37962? 37961 Which is bigger: -1/822 or 0? 0 Is 120 > 0.023? True Which is bigger: -489 or -490? -489 Which is smaller: 2/6347 or -1? -1 Is -6 > -136/19? True Which is greater: 31 or 27? 31 Which is smaller: 1788 or 1789? 1788 Which is greater: 0.06 or 259? 259 Which is smaller: 1 or -2/15537? -2/15537 Are 1799 and 1/4 non-equal? True Which is greater: 18 or 27? 27 Do -3/604 and 0 have different values? True Are -2 and 22 non-equal? True Which is smaller: -1 or -2/2287? -1 Which is greater: 1 or -1/3910? 1 Which is smaller: 28 or -0.016? -0.016 Which is bigger: -0.16 or 2/4383? 2/4383 Which is greater: -3/793 or 0? 0 Which is greater: -6/5537 or 1? 1 Is -6397 <= -19192/3? False Which is smaller: 157/31 or 4? 4 Is 14 equal to 12? False Is -0.1 equal to 13/44? False Are -194 and -193 equal? False Is -1/5 > 4055? False Is 6192 < 6192? False Which is smaller: -5/12218 or 0? -5/12218 Which is smaller: -6/7 or 0? -6/7 Which is smaller: 12 or 1/7? 1/7 Which is greater: -8/7 or 13? 13 Is -1634 < -1648? False Is 38 > 42? False Is -223 at most as big as -3815/17? False Is -15/79 > -1? True Are 41/8 and 5 non-equal? True Which is greater: -304 or -305? -304 Which is greater: -47 or -415/9? -415/9 Which is smaller: 0.12 or -7? -7 Which is greater: -306/127 or -3? -306/127 Which is smaller: -21 or 2? -21 Is 86 smaller than -11? False Which is smaller: -7925 or 0.3? -7925 Which is bigger: -14 or -25? -14 Which is bigger: 249 or 248? 249 Which is smaller: 14/1423 or 0? 0 Is 8/5 less than 1? False Which is bigger: 3/65740 or 1? 1 Is 172 greater than 175? False Which is smaller: -1 or 59? -1 Which is smaller: -4/13 or -1? -1 Is 0 at least 4/1829? False Is -128 not equal to -125? True Which is smaller: 54 or 77? 54 Is 26/25 at most 2? True Which is smaller: -1295 or -1296? -1296 Is -2737 > -2737? False Is 1 at most as big as 6/419? False Is -33/208 at least as big as -1? True Do 89/180 and 0 have the same value? False Which is smaller: -7/1843 or -1? -1 Is -2/7 less than or equal to -502? False Is 10 >= 624? False Is 37 >= 0.038? True Which is smaller: 1 or 11/135? 11/135 Do 1/2 and 1058 have the same value? False Which is greater: -0.667 or -1? -0.667 Is 327 at most as big as 346? True Is 30 >= 42? False Which is greater: -130 or 25? 25 Which is smaller: 42 or 643/15? 42 Which is smaller: -11/240 or 0? -11/240 Are -2186 and -2186 non-equal? False Which is smaller: 5 or -10/9? -10/9 Which is bigger: 105 or -1/4? 105 Which is bigger: -173 or -170? -170 Are -2.2 and 2/275 nonequal? True Which is bigger: -1035 or -1? -1 Which is smaller: 0.1 or -2755? -2755 Which is smaller: 4/251 or 0? 0 Are 1 and -43868 nonequal? True Which is greater: -850 or -852? -850 Which is greater: -458.3 or 0.2? 0.2 Which is smaller: 7/1027 or 0? 0 Which is smaller: -2006 or -2005? -2006 Which is smaller: 2/707 or -1? -1 Is -1 < -2/673? True Which is bigger: -6276 or 2/7? 2/7 Which is bigger: -1761 or 0.3? 0.3 Do 9 and 0.3545 have the same value? False Are -135 and 3/5 nonequal? True Which is bigger: -4/201 or 1? 1 Which is smaller: -0.2 or 3/8? -0.2 Which is greater: -2/3 or 63? 63 Is -10471 equal to -10470? False Which is greater: 5240/11 or 475? 5240/11 Which is smaller: -0.1 or -1671? -1671 Which is smaller: 2/61 or -0.02? -0.02 Which is smaller: 38 or -224? -224 Is 33 bigger than 41? False Do -107 and -1 have the same value? False Which is smaller: -0.2 or -9.3? -9.3 Which is smaller: 21411 or 21412? 21411 Which is greater: 441 or 443? 443 Which is greater: -7 or -3.14? -3.14 Is -10559 at least -10560? True Is 3/5 != 852? True Which is greater: 507/10 or 50? 507/10 Which is greater: -1/31 or -1? -1/31 Is 4361 bigger than 4361? False Which is smaller: 12 or -4? -4 Which is greater: 3 or -0.27? 3 Is 1 bigg	{ "pile_set_name": "DM Mathematics" }
picked without replacement from ffjjffffffffffffjfff. Give prob of sequence fff. 34/57 Calculate prob of sequence xx when two letters picked without replacement from xyxyxggxx. 5/18 What is prob of sequence lyy when three letters picked without replacement from {l: 2, y: 5}? 4/21 Calculate prob of sequence tkkk when four letters picked without replacement from kkkkkkkkkkkkktkkkktt. 2/19 Three letters picked without replacement from {d: 2, f: 1, n: 1, y: 2, a: 7, v: 1}. What is prob of sequence nad? 1/156 Four letters picked without replacement from {g: 1, j: 1, s: 14}. Give prob of sequence gsss. 1/20 Three letters picked without replacement from ppp. Give prob of sequence ppp. 1 Four letters picked without replacement from {h: 3, e: 2, d: 4, r: 2}. What is prob of sequence erhr? 1/660 Two letters picked without replacement from gwwgg. Give prob of sequence gw. 3/10 Four letters picked without replacement from ffpfpffff. Give prob of sequence pfff. 5/36 Calculate prob of sequence qq when two letters picked without replacement from {b: 3, q: 8}. 28/55 What is prob of sequence et when two letters picked without replacement from {t: 4, e: 2}? 4/15 What is prob of sequence ii when two letters picked without replacement from {i: 3}? 1 What is prob of sequence tetl when four letters picked without replacement from {z: 1, l: 1, e: 4, t: 2}? 1/210 Three letters picked without replacement from ugfmgfumfhfffug. Give prob of sequence fgg. 6/455 Calculate prob of sequence tttt when four letters picked without replacement from {z: 3, t: 9}. 14/55 What is prob of sequence miim when four letters picked without replacement from {i: 2, m: 16}? 1/153 Two letters picked without replacement from eeneeneneneneeeeeee. Give prob of sequence ee. 91/171 Three letters picked without replacement from {p: 1, d: 2, n: 1, o: 1, l: 4, g: 6}. Give prob of sequence pgn. 1/455 Calculate prob of sequence phyq when four letters picked without replacement from {h: 8, m: 2, y: 2, p: 1, q: 5}. 1/918 Three letters picked without replacement from xcjiijjehxhjj. What is prob of sequence hce? 1/858 Two letters picked without replacement from {v: 3, o: 3, w: 9, n: 2}. Give prob of sequence ov. 9/272 Four letters picked without replacement from mmmmmmm. What is prob of sequence mmmm? 1 Calculate prob of sequence thh when three letters picked without replacement from {t: 5, h: 14}. 455/2907 Calculate prob of sequence yny when three letters picked without replacement from {h: 4, s: 3, y: 10, n: 1}. 5/272 Four letters picked without replacement from reeddedeerrerrrdrk. Give prob of sequence eeke. 1/612 What is prob of sequence hhhh when four letters picked without replacement from {h: 10}? 1 Two letters picked without replacement from {b: 3, q: 1}. What is prob of sequence bb? 1/2 Two letters picked without replacement from lqqllqqqqql. Give prob of sequence qq. 21/55 What is prob of sequence ls when two letters picked without replacement from clsllsslllllcll? 1/7 What is prob of sequence bwb when three letters picked without replacement from ssbbsfssswssfw? 1/546 Calculate prob of sequence sslj when four letters picked without replacement from ssjjjslsjssjjijjs. 1/170 Three letters picked without replacement from {c: 5, d: 5, k: 3, w: 2}. Give prob of sequence ddw. 4/273 Two letters picked without replacement from wbcmcbbcbbbblbwbbbbl. What is prob of sequence ww? 1/190 What is prob of sequence mmx when three letters picked without replacement from {n: 4, x: 2, d: 2, m: 4, e: 1, k: 1}? 1/91 Two letters picked without replacement from zdjzgjjzzdjjzddz. Give prob of sequence dj. 1/12 What is prob of sequence ma when two letters picked without replacement from {m: 4, f: 1, q: 1, a: 1, s: 1}? 1/14 Calculate prob of sequence bbb when three letters picked without replacement from ppb. 0 Four letters picked without replacement from {p: 7, c: 4}. What is prob of sequence pppp? 7/66 What is prob of sequence jrr when three letters picked without replacement from rrjrjjjjrjrjjrjrrrr? 45/323 Four letters picked without replacement from vvrrvvtmx. What is prob of sequence mxrv? 1/378 Calculate prob of sequence gg when two letters picked without replacement from {h: 1, u: 1, g: 13}. 26/35 What is prob of sequence io when two letters picked without replacement from {h: 2, i: 1, o: 1, w: 1}? 1/20 Calculate prob of sequence ooe when three letters picked without replacement from {o: 14, e: 1}. 1/15 Four letters picked without replacement from {b: 2, t: 4, x: 2, g: 1}. Give prob of sequence tbgt. 1/126 Three letters picked without replacement from hjjjhjhhqjhffpjjjj. Give prob of sequence hpq. 5/4896 What is prob of sequence akhw when four letters picked without replacement from wakht? 1/120 What is prob of sequence yy when two letters picked without replacement from muyyymymummyyyyy? 3/10 Two letters picked without replacement from {m: 5, o: 2}. What is prob of sequence mm? 10/21 What is prob of sequence faf when three letters picked without replacement from {f: 7, a: 2, w: 1}? 7/60 Four letters picked without replacement from {f: 2, t: 4, k: 1}. What is prob of sequence tktk? 0 Two letters picked without replacement from qqkkkrhrqr. What is prob of sequence rk? 1/10 What is prob of sequence hh when two letters picked without replacement from {t: 2, n: 7, j: 8, h: 3}? 3/190 What is prob of sequence pdd when three letters picked without replacement from pdbdpddnpdpppp? 5/78 Calculate prob of sequence sqq when three letters picked without replacement from {s: 14, q: 4}. 7/204 Three letters picked without replacement from {e: 8, j: 3}. What is prob of sequence ejj? 8/165 What is prob of sequence wty when three letters picked without replacement from yymmyymmymwttmr? 1/273 What is prob of sequence vv when two letters picked without replacement from {u: 2, m: 3, v: 4, d: 1}? 2/15 Three letters picked without replacement from rrerretrxreje. Give prob of sequence ejr. 2/143 Three letters picked without replacement from {a: 2, l: 4, i: 2, c: 2, z: 2}. Give prob of sequence alc. 2/165 Two letters picked without replacement from {n: 4, q: 1, h: 2, v: 9}. Give prob of sequence vv. 3/10 Three letters picked without replacement from {j: 2, n: 2, m: 1}. Give prob of sequence njm. 1/15 Two letters picked without replacement from bcccbcccchchi. What is prob of sequence ib? 1/78 What is prob of sequence ukkk when four letters picked without replacement from uuukkkkkukk? 7/66 Two letters picked without replacement from wlwrvhrt. What is prob of sequence hr? 1/28 Two letters picked without replacement from {i: 1, m: 1, k: 1, w: 1, x: 1, g: 2}. Give prob of sequence ix. 1/42 Two letters picked without replacement from vvvvbevivffevfvfife. What is prob of sequence eb? 1/114 Calculate prob of sequence szst when four letters picked without replacement from {s: 2, c: 1, t: 1, n: 1, z: 5}. 1/504 What is prob of sequence yt when two letters picked without replacement from {t: 2, z: 1, y: 1, p: 1, b: 2}? 1/21 Calculate prob of sequence zirb when four letters picked without replacement from wubzizriurru. 1/990 Calculate prob of sequence zv when two letters picked without replacement from {z: 17, v: 3}. 51/380 Three letters picked without replacement from {i: 1, d: 3, s: 3, z: 1, w: 2, h: 8}. Give prob of sequence idd. 1/816 What is prob of sequence za when two letters picked without replacement from {z: 2, a: 3, l: 4}? 1/12 What is prob of sequence mm when two letters picked without replacement from eisfmms? 1/21 Two letters picked without replacement from lgpepcppceceppepbbep. Give prob of sequence bb. 1/190 Two letters picked without replacement from hwlwhlhvwwwwhlhw. Give prob of sequence lv. 1/80 What is prob of sequence iwi when three letters picked without replacement from wiiwwqiddi? 1/20 Calculate prob of sequence rssm when four letters picked without replacement from rmsmmsmmmrsssmsrr. 1/68 Two letters picked without replacement from {y: 4, i: 6, a: 2}. What is prob of sequence yy? 1/11 Calculate prob of sequence ww when two letters picked without replacement from wuww. 1/2 What is prob of sequence kykk when four letters picked without replacement from {y: 4, r: 1, k: 3, p: 11}? 1/3876 Two letters picked without replace	{ "pile_set_name": "DM Mathematics" }
90. Solve 16a - 94 = -n for a. 4 Let w = -39249 + 39249. Solve w = -25d + 135 - 310 for d. -7 Suppose 3 + 36 = 13v. Suppose -vs - 34 + 4 = 0. Let b(i) = -2i - 8. Let g be b(s). Solve 3o = 6o + g for o. -4 Let r = -12 - -57. Let q = 47 - r. Suppose q = 5l - 3l. Solve b + l = -1 for b. -2 Suppose 2r + 2x = 10, -41r + 45r = -5x + 17. Solve 4 = ru - 28 for u. 4 Suppose 0 = 5q + 5w - 75, 2 = -2w + 6. Suppose n = -4k - 4 + q, 7 = -n + 4k. Solve -4t - n + 9 = 0 for t. 2 Suppose -p - r + 631 = 0, -9p + 1266 = -7p + r. Let f = -633 + p. Solve -fi = -0i + 10 for i. -5 Let o(j) = j2 - 10j - 21. Let i be o(12). Suppose -18t + 3t = -it. Solve -8b - b - 9 = t for b. -1 Let f be (226/33)/((-2)/(-4)). Solve f = 31q - 33q for q. -4 Let y(f) = -f3 - 12f*2 - 40f - 87. Let o be y(-9). Solve 17u - o = 22u for u. -6 Suppose b + 1 = 0, -4 = -5a - b - 5. Suppose 5h - 3c = 26, 43c = 38c + 15. Solve -2q + 3 + h = a for q. 5 Let t(a) = -3a + 18. Let y be t(-2). Suppose 0 = 5q - 101 - y. Solve 45 = 5o + q for o. 4 Let p(v) = -v3 + 17v*2 + 22v - 558. Let b be p(16). Solve -b = -2s - 56 for s. -3 Suppose 6f - 10f + o = -16, 3f - o = 12. Suppose 0z - 3 = 4z + p, -fz + p = -3. Solve 0 = -zv + 4v for v. 0 Let h(r) = 2r - 43. Let c be h(35). Let y = c - 23. Solve ys = -17 + 21 for s. 1 Let c(r) = r3 + 112r*2 + 782r - 277. Let q be c(-104). Solve 4928x = qx + 30 for x. 6 Let g = 9566 - 9564. Solve -28 + 24 = gj for j. -2 Let g(p) = p3 + 4p*2 - 5p - 4. Let l be g(-3). Let w = 140 + -136. Suppose -5b = wb - 36. Solve n + bn = l for n. 4 Suppose -2g + 213 = -3p, -3p - 98 - 115 = 3g. Let k(u) = -35u + 1. Let m be k(2). Let j = m - p. Solve 25 = -7i + ji for i. -5 Let j(m) = m*2 - 31m + 246. Let w be j(17). Solve 9 = wh - 47 for h. 7 Let s = -7089 - -7100. Solve sm - 6m - 35 = 0 for m. 7 Let v(k) be the first derivative of -k3/3 + 3k*2/2 - k + 17. Let u be v(3). Let s be (0/(-2 + 1))/u. Solve sb = -b for b. 0 Let q be (1421)/(9 - (-235)/(-25)). Let j = 359 + q. Solve -j + 2 = -d for d. 2 Suppose 3z = -k + 2, -2k + 0k = 4z. Let n be (8/10)/(k/(-20)). Suppose -2j + nj = -3j. Solve j = -s - 5 + 1 for s. -4 Let i(y) = -3y3 + 55y*2 + 38y + 83. Let d be i(19). Solve -36 = dl - 89l for l. 6 Let i be (-26)/13 - (375 - 6)(-3 + 2). Solve 0 = iw - 359w + 24 for w. -3 Let s(x) = -5x + 31. Let m(f) = -16f + 91. Let j(q) = -2m(q) + 7s(q). Let v be j(10). Solve 0 = 2w - 3w - v for w. -5 Let d(g) = -5g - 5. Let u be d(-3). Let b = u - 6. Suppose 0 = -4o - bo + 24. Solve oi = -0i for i. 0 Let s = 6 + -3. Suppose 64 = p + 84. Let h be (354/(-5))/(-6) - 4/p. Solve -st - h = t for t. -3 Let x = 3 + 2. Let v be (-9)/(-3 + 58/20). Let m = v - 64. Solve m = xd + 6 for d. 4 Suppose -20 + 10 = -5a. Suppose -3r = 5l - 85, 0 = -0l - al - 2r + 38. Solve -6 = -5j + l for j. 4 Suppose -10 = 2u, -33b + 37b - 4u - 44 = 0. Let j be b/4 + 63/6. Solve j = 13z - 7z for z. 2 Let c(n) = -134n*2 + 1478n - 24. Let y be c(11). Solve -21 = yp - 13p for p. -3 Let y = 4137 - 4112. Solve -yf = 28f - 318 for f. 6 Let g(w) = -18w2 - 128w - 12. Let q be g(-7). Solve 7 = -qb - 7 for b. -7 Let j be ((-2)/3)/((198/27)/11) + 34. Solve -20a = -j - 47 for a. 4 Let x = 13 - 20. Let q be 16/28 + (-66)/x. Let w be (-5)/((-25)/12)(-695)/(-417). Solve -3l + w = q for l. -2 Let x(d) = -d + 20. Let o be x(14). Suppose -op = -6p + 5p. Let t be 1(2 + (-4)/2). Solve t = -pw + 5w - 10 for w. 2 Let l = 6022 + -5909. Solve -2b - l = -109 for b. -2 Let r be (-2 + (-16)/(-6))-3. Let v(g) = -2g. Let z be v(r). Let k be (z + 90/(-21))-14. Solve -2y + 6 = k for y. 1 Let g be (2 - 2) + -1 + -9 + 12. Let w be (-2 + g + 3)/((-18)/(-30)). Solve -11 = wn + 9 for n. -4 Let n(h) = h - 7. Let g be n(7). Let s be (-2050)/(-650) - (-2)/(-13). Suppose -sr = 8 - 23. Solve gd + d = r for d. 5 Suppose 2g + 9 - 15 = 0. Suppose gs - t = -0s + 122, -4t = s - 19. Let h = s - 33. Solve h - 2 = -x for x. -4 Let w(l) = l + 10. Suppose o + 0c + c = -11, 5c - 35 = 4o. Let j be w(o). Solve 3s = -js + 3 for s. 1 Let d be 4/143465/330. Solve d = -6l - 9 for l. -2 Let y be (-4)/14 - (-30)/105. Let t be y/((5 - (-4)/(-1)) + -2). Suppose tk = -k + 5. Solve -2f - 13 + k = 0 for f. -4 Suppose -3k - 6k = -7k. Let n = k + 7. Suppose 0 = -2v - v + 5p + n, -v = -2p - 1. Solve -6g + 12 = -vg for g. -4 Let b(s) = s + 7. Suppose 0 = 10j - 7j. Let z be b(j). Suppose 22 = -10501p + 10512p. Solve 0 = w + p - z for w. 5 Suppose -2w + 62 = -4u, 17w + 3u = 21w - 124. Solve 9a = -13 + w for a. 2 Suppose p = -103j + 105j + 79, -3j = -p + 85. Solve -pm = -12m + 165 for m. -3 Let l(o) = 3o2 - 34o + 61. Let n be l(11). Solve 5802i = 5812i - n for i. 5 Let x = -81 - -84. Let w be 22 + -5 - (x - -2). Solve -5z - w = -z for z. -3 Suppose w - 360 = -3c + 4w, 0 = -w. Let k = -75 + c. Suppose u = 50 - k. Solve q - 12 = uq for q. -3 Suppose -2i = -4i - 4a - 4, 2i + 5a + 7 = 0. Let l be (-8)/(-28) + (-52)/(-14). Suppose -t + it = lt. Solve t = -2y - y - 12 for y. -4 Let v(s) = -s + 22. Let g be v(6). Suppose -gl + 86 - 22 = 0. Solve u = lu for u. 0 Let k be (3 - 9/15) + (-86)/215. Solve -12 = 7i + k for i. -2 Let v be (-1)/(-3)(-3)/(-1). Let p(k) = 2k + 42. Let x be p(-16). Suppose 21b - 55 = xb. Solve -br + v = -4 for r. 1 Suppose -1520 = -13f + 1405. Solve 0 = 18j + 7j + f for j. -9 Let v(s) = s3 + 19s*2 + 30s - 65. Let a be v(-17). Suppose -g + 53 = ac - 44, 2g = 4c - 146. Solve 10 = -6w + c for w. 4 Suppose 8r + 60 = 13r. Let p be r - 11/(66/12). Solve 2g - p = -2 for g. 4 Let w(m) = -15m*2 - 19m*2 + 35m*2 + 10 + 5m. Let t be w(-3). Suppose 15 = 3u, -20 = -2s - 0s - 2u. Solve -1 = tx - s for x. 1 Let n(y) = -2y*3 + 2y*2 - 10y - 81. Let q be n(-5). Suppose -32 = 265b - qb. Solve b = 5h - 9h for h. -2 Let v be -12 + -2 - -1(-1 - -2). Let j(y) = -2y*3 - 26y*2 - y - 11. Let l be j(v). Solve n + 0 + l = 0 for n. -2 Let v be -6 + (-17)/((-34)/(-24)). Let y be (v + 2 - -10)/(-2 + 1). Solve -4x - y = -2 for x. -1 Suppose g - 2g + i = -6, -g = -2i - 7. Suppose 12 = 8p - gp. Solve -7 = ph - 3 for h. -1 Let h be 4 - (-1 - -7) - -7. Suppose -7 = -4i - 3c - 3, -5c - h = -5i. Solve -7 = 2n + i for n. -4 Let t(y) = 2y3 + 23y*2 - 16y - 29. Let q be t(-12). Suppose 0 = 5x - 39 + q. Solve -m = -xm + 6 for m. 2 Suppose -16i + 11i = -20. Let c = i + -1. Suppose w - 211z - 10 = -209z, -z + 13 = 4w. Solve 0 = wu - 1 - c for u. 1 Let d be -4 + (-2)/46 + 1. Let h be (d - (-1 - 2))/1. Let y be 0/(4/(-24)h-2). Solve 3 = -yp + p for p. 3 Let q(d) = 7d + 175. Let r be -713/(364/96). Let a be q(r). Solve b = ab for b. 0 Let g be ((-4)/6)/((-80)/600). Suppose 8u - 6u + 5q + 4 = 0, 2u - gq = 16. Solve -up - 16 = -31 for p. 5 Let u = 126 + -124. Suppose ux + 2x = 16. Solve -2z = -0z - x for z. 2 Suppose 2j + 3w = 25, -93w - 50 = -3j - 95w. Solve -48t - 28 - j = 0 for t. -1 Let v = 3970 + -3715. Solve vn + 6 = 249n for n. -1 Suppose 11b + 350 = 3507. Let k = b - 285. Solve -v = 3 + k for v. -5 Suppose -5v = 3i - 84, -v + 42 = 2v - i. Solve -v = -g - 10 for g. 5 Let n be (-46)/(-8) + (-54)/(-216). Let a be -2 + 5/5 + 4. Let x be ((-27)/n)/a-2. Solve -3o + 0o = -x for o. 1 Let l(q) = -140q - 115. Let t be l(5). Let b = t - -819. Solve 0 = -6h + bh + 10 for h. 5 Let o(f) = -f2 + 5. Let m be o(0). Suppose -x - m = 4n + 7, -4x + 12 = n. Solve 9 = -k + xk for k. 3 Suppose 5d + 4592 - 4592 = 0. Solve -f + 12f + 0f = d for f. 0 Let p(k) = 44k + 3267. Let w be p(-66). Solve -4s + w = 387 for s. -6 Let h = 66 - 63. Suppose 5n - 8n = -30. Suppose -4b + ha + 37 = -n, a = -5. Solve -r - r = b for r. -4 Let i(o) = -2o*2 - 17o - 52. Let a be i(-9). Let q = 65 + a. Solve 0 = -qj + j for j. 0 Let q = -45 - -93. Suppose -2i = q + 94. Let b = i + 77. Solve bh - 4h - 8 = 0 for h. 4 Let s = 445 + -442. Suppose -3 = p + 3l, -9 = 4p - 7p - sl. Solve 17i = pi + 22 for i. 2 Let s(j) = 3j2 + 16j - 18. Let f be s(-8). Suppose 48q = fq. Suppose -3z + qz + 9 = 0. Solve -4r + 3r + z = 0 for r. 3	{ "pile_set_name": "DM Mathematics" }
z*4 Let z(u) = 10u - 41. Let s(v) = 2v2. Determine s(z(w)). 200w*2 - 1640w + 3362 Let v(h) = 14h2. Let n(d) = -99d*2 + 200d*2 - 98d*2. Give v(n(q)). 126q4 Let v(u) = -u2. Let f(y) = -13y - 6. Let h(c) = 532c + 247. Let z(q) = -247f(q) - 6h(q). Calculate z(v(k)). -19k2 Let n(j) = 4j2. Let g(b) be the second derivative of -b3/3 - b. What is g(n(a))? -8a2 Let c(y) = 5y - 3. Let d(n) = 26n - 16. Let f(j) = 16c(j) - 3d(j). Let a(u) be the first derivative of u2 + 3 - 4 + 4. Determine f(a(r)). 4r Let n(s) = -s*2 - 1236s + 1236s. Let o(f) = 35f. Calculate n(o(i)). -1225i2 Let h(x) be the first derivative of -2x + 1/6x3 + 0x*2 - 2. Let q(l) be the first derivative of h(l). Let d(i) = i. Calculate d(q(o)). o Let r(i) = -i - 2. Let n(q) = 24q*2 + 12q + 24. Let m(f) = -3n(f) - 36r(f). Let h(v) = -v. Give h(m(d)). 72d2 Let b(h) = 15h*2. Let r(x) = 183x. Give b(r(q)). 502335q2 Let f(m) = 1. Let k(w) = 7w + 6. Let v = 4 - 10. Let a(p) = vf(p) + k(p). Let i(s) = -7s*2 - 3s*2 + 5s*2 + 3s*2. Calculate a(i(n)). -14n*2 Let n be 6/4 - 2/(-4). Let g be 7/(-28) + (-18)/(-8). Let k(s) = 3s*2 - g - 4s*2 + n. Let w(m) = -5m*2. Calculate w(k(q)). -5q4 Let n(t) = -t. Let x(l) be the first derivative of l4/3 - 6l - 1. Let b(c) be the first derivative of x(c). What is n(b(g))? -4g2 Let p(g) be the first derivative of -g5/30 - g*2/2 - 1. Let v(m) be the second derivative of p(m). Let x(z) = -31z + 7z + 11z + 12z. What is x(v(h))? 2h*2 Suppose 3h + 15 = -3s, 2h - s - 2 = 3. Suppose i + 2u - 13 = -3u, 4i = -4u + 20. Let x(l) = 4l + hl - il. Let q(p) = 2p. Give q(x(j)). 2j Let k(c) = -c2. Let b(g) = -153g. Calculate b(k(v)). 153v2 Let r(h) = 3h. Let n(b) = 116b2. Determine n(r(y)). 1044y*2 Let g(x) be the third derivative of 0 + 0x*3 + 2x*2 + 0x - 1/24x4. Let j(u) = -u + 2u + 3u. What is g(j(n))? -4n Let i(n) = -18n2. Let d(p) = -p2 + 9p*2 - 5p*2. Calculate i(d(t)). -162t4 Let r(d) be the second derivative of d3/2 - d. Let y(w) be the second derivative of -2w + 0w*2 - 1/3w*3 + 0. Determine y(r(c)). -6c Let y(n) be the first derivative of -5n4/12 + 3n + 2. Let m(b) be the first derivative of y(b). Let t(s) = 2s2. What is t(m(w))? 50w4 Let z(h) be the second derivative of -h4/12 + 4h - 2. Let q(x) = -78x*2. Calculate q(z(a)). -78a*4 Let s(v) be the third derivative of 0 + 0v*3 - 1/24v*4 + 2v*2 + 0v. Let y(f) = -5f2. Determine s(y(h)). 5h*2 Let t(x) = -27x*2. Let y(f) = -31f. What is t(y(h))? -25947h2 Let h(b) = b. Let z(s) = -1161s. What is z(h(g))? -1161g Let r(u) be the second derivative of u3/3 + 5u*2/2 + 2u. Let j(g) = -g - 3. Let h(t) = 10j(t) + 6r(t). Let b(x) = 2x. Give b(h(p)). 4p Let f(y) = 4y2 - 3. Let a(g) = -7g*2 + 5. Let w(j) = 3a(j) + 5f(j). Let u(p) be the second derivative of 0 + 0p*2 + 1/6p*3 + 3p. What is w(u(d))? -d*2 Let b be -14/(-2)1. Let d(s) = 0 + s2 - 2 + b. Let a(v) be the first derivative of 2v*3/3 - 1. Determine a(d(y)). 2y*4 Let a(d) = -99d*2. Let x(f) = -3f. What is x(a(c))? 297c2 Let u(p) = -11p + 2. Let z(f) = 41f2. Determine z(u(o)). 4961o*2 - 1804o + 164 Let m(r) = 2r. Suppose 0 = -y + 2y - 4t - 24, -3 = t. Let u(k) = y - 2k - 2k - 12. Determine m(u(v)). -8v Let y(s) be the first derivative of s*2 - 51. Let h(p) = -3p + 11. Calculate h(y(c)). -6c + 11 Suppose -q - q = -12. Let h(l) = -8l - l + ql - l. Let v(k) = 2k*2. Calculate h(v(f)). -8f*2 Let k(g) = 14g. Let v(z) be the first derivative of -z*2/2 + 12. What is k(v(m))? -14m Let a(l) = -l + 1. Let u(d) = d - 4. Let j(m) = -4a(m) - u(m). Let k(v) be the first derivative of -1 - 3/2v*2 + 0v. Calculate j(k(y)). -9y Let a(v) = v2. Let x(y) = -215y. Give a(x(d)). 46225d2 Let t(y) = y2. Let c(h) = 1 + 1 - h + 2 - 3. Let i be (2/(-4))/((-2)/(-4)). Let g(w) = -3w - 2. Let v(b) = ig(b) - 2c(b). Give t(v(x)). 25x2 Let n(m) = -4m. Suppose 5i = 2i + 93. Let b(a) = 31 - i + a*2. Give n(b(x)). -4x*2 Let b(r) = 2r*2. Let d(a) be the first derivative of -4a*3/3 - 9. Give b(d(g)). 32g*4 Let b(d) = -3d*2. Let z(f) = 5f*2 - 2f - 2. Let i(p) = -81p2 + 33p + 33. Let o(x) = 6i(x) + 99z(x). What is b(o(y))? -243y4 Let w(z) = -11z + 5. Let a(s) = s*2. Calculate a(w(f)). 121f*2 - 110f + 25 Let h(l) = 26l2. Let w(n) = 3n. What is w(h(g))? 78g2 Let d(n) = -96n + 2. Let x(h) = 45h2. Calculate d(x(c)). -4320c*2 + 2 Let y(x) = 10x*2 + x. Let v(w) = -72 + 2w + 72. What is y(v(i))? 40i2 + 2i Let l(j) = 394j2 - 3j + 1. Let c(g) = -g*2. Calculate l(c(f)). 394f*4 + 3f*2 + 1 Let a(c) = -2c. Suppose 0 = -p + 3n + 3, n - 2n - 1 = -5p. Let f(o) be the first derivative of 5 + 0o*2 + po + 5/3o3. Calculate f(a(k)). 20k*2 Let u(a) = 13a*2. Let g(b) = 23b. What is u(g(q))? 6877q2 Let w(y) = y2. Let u(r) be the third derivative of 0r3 + r2 + 0 + 0r + 1/8r*4. What is u(w(p))? 3p*2 Let r(f) = -25f*2. Let m(w) = -13w*2. Calculate r(m(h)). -4225h*4 Let z(o) be the first derivative of 0o - 4 - 1/3o3 + 0o2. Let a(q) = -q2. Calculate a(z(g)). -g*4 Let b(a) = -a - 205 + 205. Let s(o) = 2o*2 + 2o. What is s(b(h))? 2h2 - 2h Let t(w) be the third derivative of w*4/4 - 19w*2. Let g(a) = -2a. What is g(t(q))? -12q Let u(o) = -o + 5o + 2o. Let g(b) = -6b + 16. Let f(m) = -2m + 5. Suppose -k = -3 - 13. Let x(j) = kf(j) - 5g(j). Give u(x(h)). -12h Let w(p) = -29p - 9. Let u(m) = 7m + 2. Let o(l) = -9u(l) - 2w(l). Let g(t) = 3t. Give o(g(n)). -15n Let r(w) = 4w2 + 3w + 3. Let y(l) = 9l2 + 7l + 7. Let p(g) = -14r(g) + 6y(g). Let n(q) = -3q2. Calculate n(p(z)). -12z*4 Let h be 1 + 1(-2)/(-2). Suppose y - 5 = 3d, 0y = 2d + 5y - 25. Let c(n) = -3n + 0 + hn + d. Let m(a) = -2a2. Calculate m(c(t)). -2t*2 Let w(v) = v. Let s(z) = 411z*2. Determine w(s(t)). 411t*2 Let v(x) = -2x. Let y(z) be the third derivative of -z*5/20 - 10z*2. What is y(v(l))? -12l*2 Let a(r) = 2r. Let b(z) = z - 3. Let d be b(5). Suppose 0 = -3v - dc + 4, 4c = 2v - 9 + 1. Let j(l) = l + vl - 7l. Give j(a(m)). -8m Let s(f) = -3f*2. Let w(h) = 69h*2. Give w(s(n)). 621n*4 Let p(m) = -m + 2. Let v(i) = -3i + 9. Let f(y) = -9p(y) + 2v(y). Let b(x) = -3x. Give f(b(l)). -9l Let v(q) = q*2 + q + 1. Let x(u) = -5u*2 - 4u - 4. Let i(k) = -4v(k) - x(k). Let a(n) be the third derivative of n4/12 - n2. What is i(a(c))? 4c*2 Let m(b) = -88b. Let p(x) = x - 14. Calculate m(p(d)). -88d + 1232 Let t(v) = -v2 + 0v*2 + 2v*2. Let m(j) be the first derivative of -2j*3 + 5j*3 + 2 - 2j*3. Give m(t(k)). 3k4 Let a(v) be the second derivative of -v3/3 - v. Let w(g) = -g2 - g2 + 5g2. What is w(a(k))? 12k*2 Let m(b) = -3b*2. Let u(d) = 366d. What is u(m(y))? -1098y2 Let c(s) = -16s*2. Let g(b) = 13b*2 + 3. Let m be g(5). Let r(o) = -o + m - 328. What is c(r(w))? -16w*2 Let c(y) = -2y*2. Let v(t) = -29609t. What is v(c(f))? 59218f2 Let o(l) = 2l*2. Suppose 5j + y = 65, -3j - 3y + 0y = -51. Let g be 28/j + 1/(-3). Let t(z) = z2 + 0z2 + zg. Determine t(o(w)). 8w4 Let z(l) = -l. Let u(t) = -3t*2 + 2t. Let i(f) = 7f2 - 5f. Let b(s) = -2i(s) - 5u(s). What is z(b(j))? -j*2 Let i(c) = 18c*2. Let s(u) = 3u. Determine s(i(j)). 54j2 Let o(p) = -p2. Let v(m) = m. Suppose 4 = -d - w + 2w, 5w - 10 = -5d. Let c(j) = j - j - j + 0. Let g(r) = dv(r) + c(r). Determine o(g(k)). -4k*2 Let j(n) be the third derivative of -7n*5/30 - 23n*2. Let s(g) = g. Calculate j(s(h)). -14h*2 Let r(x) = -4x + 3. Let n(i) = -i + 1. Suppose 3v - 4t = -6, -2v = -2t - 3t - 3. Let w(d) = vn(d) + 2r(d). Let g(q) = 3q - 5q + q. Calculate g(w(p)). 2p Let n(k) be the third derivative of -k5/30 + k2. Let g(i) = -5i. Let a(q) = 16q. Let m(l) = -3a(l) - 10g(l). Give n(m(x)). -8x2 Let u(a) = 38a*2. Let g(n) = -16n*2. Give g(u(x)). -23104x*4 Let o(b) = 29b*2. Let n(s) = 15s. Give o(n(x)). 6525x2 Let d(u) = -4u*2. Let z(m) = -15m*2 + 27m. Determine z(d(y)). -240*y	{ "pile_set_name": "DM Mathematics" }
7, what is -13301202 - -5? -13301164 In base 13, what is 4 + -b17143? -b1713c In base 8, what is 2423 + -30513? -26070 In base 12, what is 419 - -21602a? 216447 In base 8, what is 2740174 + -20? 2740154 In base 4, what is 1212123 - -1202221? 3021010 In base 4, what is 2 + 2212111021001? 2212111021003 In base 2, what is 100 + -1101101000100100000011? -1101101000100011111111 In base 7, what is 5 - -2031440511? 2031440516 In base 6, what is 245300322 - 2? 245300320 In base 5, what is 1021211 - 424? 1020232 In base 16, what is 5d27 + -106f? 4cb8 In base 15, what is -3 - -e0497a? e04977 In base 4, what is -22200 + 231221323? 231133123 In base 2, what is -1000 - -100101101010011000111? 100101101010010111111 In base 15, what is -3 - -6dd988? 6dd985 In base 7, what is 440342 + 3334? 444006 In base 3, what is 222 - -101000222121? 101001000120 In base 2, what is 111111111000010100000010110101 - 100? 111111111000010100000010110001 In base 6, what is -3521105235 + 0? -3521105235 In base 11, what is 53a1820a - 3? 53a18207 In base 13, what is -9921b + 23? -991c8 In base 2, what is 10000100111010011 + -111001000? 10000100000001011 In base 14, what is -5ac401 + 10? -5ac3d1 In base 7, what is -55443 + -35164? -123640 In base 6, what is -121 - -1120433? 1120312 In base 13, what is -2b5 + 2535c1? 253309 In base 11, what is -19591 + 12? -1957a In base 3, what is -221200010111102 - 21? -221200010111200 In base 10, what is -4045 - -4937? 892 In base 13, what is 5cc41 - 42? 5cbcc In base 5, what is 4 + -204011201004? -204011201000 In base 6, what is 2455 - 132501? -130002 In base 9, what is -115355870 - 5? -115355875 In base 9, what is 28 + 461183? 461222 In base 4, what is 21221 + -2310030? -2222203 In base 8, what is -16057 - 44244? -62323 In base 4, what is -201120110133 + 10? -201120110123 In base 16, what is -4 + 1084261? 108425d In base 16, what is -2 + d89e8e? d89e8c In base 5, what is -33211131 - 2? -33211133 In base 15, what is -e + -4d5c4? -4d5d3 In base 15, what is 65ad2 - d5d? 64c74 In base 4, what is 103021 - -1223313? 1333000 In base 6, what is 13153335343 + 2? 13153335345 In base 6, what is 12543224 + 445? 12544113 In base 10, what is 0 - 76821041? -76821041 In base 3, what is -200122222200221111 + 12? -200122222200221022 In base 6, what is -1450122 - -313? -1445405 In base 7, what is -46345316 - 5? -46345324 In base 4, what is -13131 + 1132320? 1113123 In base 15, what is -8e9ed + -7? -8ea05 In base 2, what is -1 - 101011011100010011001? -101011011100010011010 In base 13, what is -86738 + -48? -86783 In base 11, what is -2813419 + 21? -28133a8 In base 4, what is -1300011211 + 1032? -1300010113 In base 3, what is 10 - -1011121022022002211? 1011121022022002221 In base 7, what is 1526 - -24154? 26013 In base 2, what is -110011100110111110 + 1001101100101? -110010011001011001 In base 16, what is 12e7885 - 1? 12e7884 In base 10, what is 7 - 841762? -841755 In base 7, what is -153266011 + 3? -153266005 In base 13, what is -71131 - -25? -71109 In base 11, what is 2 + 2086aaaa? 20870001 In base 9, what is -63588 + 13438? -50150 In base 9, what is 107 + 2383733? 2383841 In base 11, what is -3 + -5a9a5941? -5a9a5944 In base 6, what is 13211430 + 201? 13212031 In base 4, what is 23 + 1123210012? 1123210101 In base 10, what is 92936399 + -1? 92936398 In base 5, what is 2 - 1013033142? -1013033140 In base 10, what is 3484 - -3027? 6511 In base 12, what is -6b - 9499b? -94a4a In base 11, what is 849847 - -99? 849935 In base 15, what is 3a + -7a4e8? -7a4ad In base 2, what is -1011 + -10100110010010000110100? -10100110010010000111111 In base 11, what is -21 - 2345627? -2345648 In base 13, what is -5 - -20aa93? 20aa8b In base 12, what is 562445 - -62b? 562a74 In base 9, what is 78775 + -5? 78770 In base 14, what is -45 + 120ad? 12068 In base 6, what is 32402110 - -332? 32402442 In base 8, what is 67113 + -354? 66537 In base 13, what is 1b14 + -192a? 1b7 In base 6, what is 2241431352 - 4? 2241431344 In base 10, what is -1212 + -260309? -261521 In base 4, what is 30 + -32023233001? -32023232311 In base 9, what is -3 - 260454? -260457 In base 15, what is -348 + -8ca3? -90eb In base 8, what is -631 + -21637? -22470 In base 12, what is 2 + -244a2651? -244a264b In base 4, what is 11211201010 - -3203? 11211210213 In base 10, what is -2 - -3321441? 3321439 In base 6, what is 113105314 + 4? 113105322 In base 12, what is -565b625 + 14? -565b611 In base 11, what is -7481a + 1052? -73778 In base 10, what is 909 - 60870? -59961 In base 13, what is a43b7 - -711? a4ac8 In base 3, what is -11002121110 - -200222? -11001220111 In base 10, what is -587 + -16652? -17239 In base 13, what is 58 + 25258? 252b3 In base 13, what is 2386 - 4a2bc? -47c36 In base 2, what is -100 + -10010110110011100110? -10010110110011101010 In base 7, what is -5232 + -23023? -31255 In base 5, what is -21010 - -304033332? 304012322 In base 10, what is -2 + 285145? 285143 In base 16, what is 9 - -64159? 64162 In base 16, what is -1 + -1f24e0? -1f24e1 In base 6, what is 1 + -35020405323? -35020405322 In base 8, what is -15 - -103516324? 103516307 In base 12, what is -58b01 + b? -58ab2 In base 6, what is 415012541352 - 3? 415012541345 In base 4, what is 3110301330313 + -2? 3110301330311 In base 16, what is -13 + -20e? -221 In base 4, what is 31312122221 - -3? 31312122230 In base 5, what is -10 - 430123401022? -430123401032 In base 2, what is -10111001000011011 + 111101110? -10111000000101101 In base 14, what is -5 - cab682? -cab687 In base 6, what is -40132 + 101? -40031 In base 10, what is -6284503 + 30? -6284473 In base 6, what is 143541 + 1415? 145400 In base 7, what is -2 + -30100033? -30100035 In base 8, what is 3564327 - 2? 3564325 In base 3, what is 101212001 - 1201201012? -1022212011 In base 10, what is 68701 - -286? 68987 In base 6, what is -13 - 224405011? -224405024 In base 5, what is 2304434032 + 2? 2304434034 In base 12, what is -63482 - 2b1? -63773 In base 10, what is -738 - 426047? -426785 In base 12, what is b55 - 67222? -66289 In base 8, what is 4 - 15733040? -15733034 In base 15, what is -51 + 1eddb8? 1edd67 In base 13, what is 3 - 2ca3b593? -2ca3b590 In base 13, what is -1b46472 - -2? -1b46470 In base 12, what is 822 - -47b6? 5418 In base 10, what is 2195 + -62220? -60025 In base 13, what is 2b7b9 - -29b? 2ba87 In base 8, what is -13744650 + 66? -13744562 In base 9, what is 12861114 + 6? 12861121 In base 7, what is 33 - 1051251? -1051215 In base 9, what is 1564062 + 382? 1564454 In base 5, what is -113202 + 330322? 212120 In base 13, what is -5 + -3a45438b? -3a454393 In base 11, what is 17 + 169555a7? 16955613 In base 12, what is -6462945 - 2a? -6462973 In base 5, what is 12130 - -1022432? 1040112 In base 9, what is 1887542 - -48? 1887601 In base 6, what is -411321 - -22? -411255 In base 5, what is -4 - 2014330223? -2014330232 In base 9, what is 3 + -2582465? -2582462 In base 7, what is -65 - -22623610? 22623512 In base 15, what is 14 - -205369? 20537d In base 13, what is -15cc738 - -4? -15cc734 In base 15, what is 6 - -228d9d6? 228d9dc In base 8, what is -2716567 - 74? -2716663 In base 10, what is 44326 - -1558? 45884 In base 14, what is 45b5 - 1c248? -17a73 In base 4, what is 0 - 11022131121333? -11022131121333 In base 10, what is -3569538 + 3? -3569535 In base 12, what is 5 - -303985? 30398a In base 12, what is 4903 + 15a08? 1a70b In base 5, what is -140 + -1320231140? -1320231330 In base 14, what is -24c0423 + 5? -24c041c In base 14, what is 4 - 5d2682d? -5d26829 In base 13, what is 2a51057 + -1? 2a51056 In base 12, what is a65a1 - 76? a6527 In base 15, what is 3 - -5a918c? 5a9190 In base 2, what is -1111111000101100111001 - 10101? -1111111000101101001110 In base 9, what is 2 - 25100562? -25100560 In base 11, what is -631804135 - 4? -631804139 In base 10, what is 154210 - 24? 154186 In base 11, what is -8177294 - 5? -8177299 In base 3, what is -22211 - -202101221? 202002010 In base 10, what is 297 + -110849? -110552 In base 8, what is 2 - -56044275? 56044277 In base 10, what is 70640 - -3103? 73743 In base 9, what is -1624 + 1152? -462 In base 3, what is -1 - -1000200112001112? 1000200112001111 In base 16, what is -11349af6 + -4? -11349afa In base 10, what is -40125 - 113? -40238 In ba	{ "pile_set_name": "DM Mathematics" }
, i, 3/8 Let q = 63.202 + -63.8. Let y = q - -0.098. Let u(v) = v*3 + 3v*2 + v. Let m be u(-3). Sort -1/4, m, y. m, y, -1/4 Suppose 0 = -5z + 5b - 15, z - 12 = -2b - 3. Sort -2/9, z, -0.4, 1/9 in descending order. z, 1/9, -2/9, -0.4 Suppose -5o + 2 = 22, 0 = -2l - 4o - 12. Let n(d) = -d - 12. Let k be n(-9). Put l, -2, k in increasing order. k, -2, l Let c = 3 + -1. Let q(l) = l3 + l2 - 5l + 4. Let y be q(1). Put c, -4, y in decreasing order. c, y, -4 Let n = -14 + 14. Suppose n = -z + 4z + 15. Sort 0.05, z, -4/5 in decreasing order. 0.05, -4/5, z Let r = -49 + 40. Put r, 4, 3 in decreasing order. 4, 3, r Let w = 1 + 4. Let f = -12436105/56844 + -11/6316. Let u = f - -219. Put w, u, -0.4 in increasing order. -0.4, u, w Suppose 165t - 6 = 159t. Put t, -4, 3 in ascending order. -4, t, 3 Let p = 839 + -3357/4. Put 21, 0, p, -5 in descending order. 21, 0, p, -5 Let y = -3/277 + -527/2493. Sort 2, y, -5, -0.1. -5, y, -0.1, 2 Let i be (6/1356)/((-18)/(-75)). Sort i, -2, 4/7. -2, 4/7, i Let h = -801 - -8809/11. Sort h, -4, -11. -11, -4, h Let q = -9.07 - -0.07. Let u = q + 7. Let r be (-12)/57/21. Put u, r, 0.9 in ascending order. u, r, 0.9 Suppose -4c = 4x - 8, -8 = -4x - 26c + 27c. Put x, 0, -6, -14 in decreasing order. x, 0, -6, -14 Let l = 0.7 + -0.5. Let i = -0.3 + l. Let t = -2.65 - 0.35. Sort 0.3, i, t in descending order. 0.3, i, t Let i be 2/11 - 224/(-99). Let x = i + -35/18. Sort -2, 0.4, x in increasing order. -2, 0.4, x Let l = -15 + 30. Let s = 244 + -229. Let r = l - s. Sort 2, r, 0.3 in increasing order. r, 0.3, 2 Suppose -3 = -5n + 22. Suppose -3m - 2m + 20 = 0. Let f(r) = r + 11. Let h be f(-9). Put m, n, h in descending order. n, m, h Suppose -1 + 13 = 4c. Suppose 85g + 36 = 103g. Sort c, 1, g in decreasing order. c, g, 1 Let z = -600.721 + 601. Let q = z - -0.021. Sort -0.3, q, -6, 0.5 in ascending order. -6, -0.3, q, 0.5 Let m = -110.4 + 106.4. Let y(b) = -b*2 + b + 1. Let g be y(6). Let h = g - -202/7. Sort 0.1, h, m in descending order. 0.1, h, m Let z be -2(305/75 + -4). Put -1/3, z, -1/6 in descending order. z, -1/6, -1/3 Suppose -2d = -4d + 2. Suppose 2p - 20 = -o - 22, 5o = 3p + 16. Sort -1, d, p in increasing order. p, -1, d Let c(q) be the first derivative of -q2/2 - 9q - 2. Let u be c(-7). Let j(h) = -6h2 + 78h + 1. Let r be j(13). Sort u, r, -3 in increasing order. -3, u, r Let i = -0.265 + 0.465. Let j be (-1 + 0)(-4)/(-28). Sort i, -3/5, 0, j in increasing order. -3/5, j, 0, i Let r = -172/3 - -57. Let v = -3/70 + 31/70. Let q = -3/5 + v. Sort 2, q, r. r, q, 2 Let q = 0.21 - 0.01. Let v = 1445 - 5779/4. Sort -0.03, 0.03, q, v in descending order. v, q, 0.03, -0.03 Let i = -23.5 + 26.5. Put 2/13, 5, -4, i in descending order. 5, i, 2/13, -4 Let h(x) = -x3 + 23x*2 + 22x + 49. Let g be h(24). Sort -3, g, 12, 4 in increasing order. -3, g, 4, 12 Let c = -0.78 - -0.78. Let g be ((-32)/(-40))/((-2)/5). Put c, g, 0.5 in increasing order. g, c, 0.5 Suppose 17 + 55 = -18y. Sort 57, 1, y in decreasing order. 57, 1, y Let k = -9 + 19. Let t = k + -21. Let y = 10.8 + t. Sort 0.4, y, 0.3 in increasing order. y, 0.3, 0.4 Suppose 4a + v - 315 = 0, -5a + 4v = 3v - 387. Let u be ((-3)/(-6))/(3/a). Put -1, u, 2 in decreasing order. u, 2, -1 Let x(i) = i2 + 9i + 15. Let m be x(-6). Let y be (1 - -3) + 18/m. Put y, 2, -6 in descending order. 2, y, -6 Let l = 3102 - 3103. Suppose -2q - 2v = -4, 4v = 5q + v - 18. Put q, -4, 0, l in increasing order. -4, l, 0, q Let g = 235/434 - 69/62. Let v = -0.8 + 1.1. Sort v, g, 2 in descending order. 2, v, g Let m be ((-6)/(3/(0 - 1)))/(5/10). Suppose 4c = -4o - 28, -3 - 2 = 5c - o. Put 5, -3, c, m in descending order. 5, m, c, -3 Let w = 61/85 + -2/17. Let u be 9/35 - 4/10. Let p = -0.3 + 0.1. Put p, w, u in descending order. w, u, p Let u(d) be the second derivative of d4/12 - 5d*3/3 - 9d*2/2 + 9d. Let i be u(11). Let t = 6 - 1. Put i, t, 0 in decreasing order. t, i, 0 Let c be (-1)/((5 - 10)/10). Suppose 0v = o + v - 1, -4 = co - 4v. Put -2, 2, o in increasing order. -2, o, 2 Suppose -2b - 4 = -f, -f = -3f - 3b - 13. Let u be (-11)/(11/4) + 4. Sort f, 5, -5, u in descending order. 5, u, f, -5 Let n = -36 - -39. Suppose -37 = 4m + 2s + 21, ns = 2m + 9. Let z be (m + 12)1/(-2). Sort z, 4, 3 in decreasing order. 4, 3, z Let o(d) = -d + 5. Let v be o(0). Let j = 13517 - 13502. Sort j, v, -2 in increasing order. -2, v, j Let h be 0 + (-4)/(8/(-6)). Sort 2, h, 5 in decreasing order. 5, h, 2 Let g = -30 + 30. Suppose -h = -n + 4, -n + 2n + 3h + 4 = g. Put 7, n, 1 in ascending order. 1, n, 7 Let l be (-12 + -54)(-40)/(-9534). Let g = l - 2/227. Let f = -12/119 - 2/119. Sort g, f, -4. -4, g, f Suppose k = -0 - 6. Let o = 1.85 - 0.8. Let n = o - 0.05. Sort -2, k, n in increasing order. k, -2, n Let z = 8 - 9. Let c = 5 - z. Let v = -4 + c. Sort -4/5, v, 8 in descending order. 8, v, -4/5 Let f = 947 - 942. Put 21, f, -3 in descending order. 21, f, -3 Let d = -4 + 1. Let t = 23 + -36. Let l(c) = c*3 + 12c*2 - 13c - 4. Let r be l(t). Put r, d, -1 in ascending order. r, d, -1 Let c = 220 - 225. Sort -8, c, 0.1 in descending order. 0.1, c, -8 Let w = 4.8 - 0.8. Let h = 66 - 63. Let k be (1/(-8))/(3/(-4))9. Put h, k, w in descending order. w, h, k Suppose -k - 21 = -5v + 3k, -4v + 5k + 15 = 0. Let r = 1006 + -1006.1. Put 0, v, r in decreasing order. v, 0, r Let i(g) = g3 + 8g2 - g - 10. Let x be i(-8). Let o(l) = l2 + 23l + 112. Let q be o(-16). Sort q, -20, x in descending order. q, x, -20 Let x = 187 + -184. Sort x, 4, -15, -1 in ascending order. -15, -1, x, 4 Let a = -51.7 + 51.8. Put -4, 3, a, -1/9 in decreasing order. 3, a, -1/9, -4 Let y be ((-7)/(-2) + -2)1. Let m = 56 - 60. Sort y, m, -0.3, 2/11 in decreasing order. y, 2/11, -0.3, m Suppose -2o - 2o - 25 = -5y, -4y + 29 = -5o. Sort o, 0, -20 in increasing order. -20, o, 0 Let g = 603 + -605. Sort g, -4, -349 in ascending order. -349, -4, g Let f = 104 + -102. Sort -8, f, -4. -8, -4, f Let l(v) = v3 - 5v2 - v + 2. Let x be l(5). Let h(g) = g2 - 10g + 7. Let p = -13 - -22. Let j be h(p). Sort j, x, 1 in descending order. 1, j, x Let r = -0.064 - -0.064. Sort r, -0.08, 1 in decreasing order. 1, r, -0.08 Suppose 0 = 2z - 0z + 26. Let a be (-11)/(14/(11 + 3)). Sort a, z, -2, -5 in decreasing order. a, -2, -5, z Let h = 0 + -4. Let r = -6.76 - -7. Let n = r + -2.24. Sort n, 3, h in descending order. 3, n, h Let w = 4.6 - -0.4. Let o = -26.2 + 26. Sort 1, w, o in decreasing order. w, 1, o Suppose -4z + 0 - 6 = 2w, z - w = 0. Put z, -8, -10 in decreasing order. z, -8, -10 Let r = -71 + 71.6. Sort r, -0.3, -31 in descending order. r, -0.3, -31 Let a = -8 - -12. Let u be 2/(-11) - (-6 + (-112)/11). Let c(b) = b*3 - 16b*2 - b + 19. Let y be c(u). Put -3/7, a, y in ascending order. -3/7, y, a Let d be (1/66)/((-2)/(-14)). Suppose -x - x + 4 = 0. Suppose -4w + 3z + 21 = -w, xw + d = -5z. Sort w, -2, 3 in descending order. w, 3, -2 Suppose 2d + 18 = -4y - y, -19 = 4y - 3d. Suppose -21 = -3g + 3i, -2g + 32 = 3g - 2i. Let q(k) = k3 - 6k*2 + 1. Let u be q(g). Sort 2, y, u. y, u, 2 Let x = -77.77 - -76. Let p = -0.77 - x. Sort 0.02, p, 2/37 in increasing order. 0.02, 2/37, p Let t be (-12)/(-126)-3 - 312/84. Sort 5, t, -19, -6 in ascending order. -19, -6, t, 5 Let d be (6 + -3)(-2)/(-6). Let y = -31 - -29. Put -12, y, -0.2, d in decreasing order. d, -0.2, y, -12 Let h = 7 + -11. Let f = -32 - -31. Let z = h + f. Put 1/3, -1, z in descending order. 1/3, -1, z Let g(u) = -2u*2 - 38u - 64. Let z be g(-17). Put -1, z, -21, -0.2 in descending order. z, -0.2, -1, -21 Let i be 9/(-15)1/(-3). Suppose -2x + x + 3n = 15, 3n - 123 = 5x. Let q be ((-1)/(-6))/(6/x). Sort i, -1.2, q in descending order. i, q, -1.2 Let o be (-1)/(-3) - 2/6067. Let b = o - -419/210. Let n = 0 - -2. Sort b, 1/4, n in increasing order. b, 1/4, n Suppose -89 + 109 = -5j. Put -5, j, -3/2, 4 in increasing order. -5, j, -3/2, 4 Suppose 2 = -2p + 4. Let w be (-3 + (-9)/3)/(-1). Suppose wf = 8f - 6. Sort f, -4, p in ascending order. -4, p, f Suppose -3x - 45 = 3n, -1 = 4n - 2x + 89. Let u = 20 + n. Put 0.2, 6/11, u in descending order. 6/11, 0.2, u Le	{ "pile_set_name": "DM Mathematics" }
e factors of v? 2351 Let o(b) = -b*2 + 36b + 78. List the prime factors of o(35). 113 Suppose -5o - 7 = -62. Suppose -17 = -4x + o. Let r(u) = u*2 - 7u + 6. List the prime factors of r(x). 2, 3 Let k be -8(14/(-8) + 1). Let g(j) = 3j*2 - 2j + 11. Let u be g(k). Suppose q = -0v - 4v + 181, u = 2v - 5q. List the prime factors of v. 2, 23 Suppose -16f + 17f = 0. Suppose -2m + 3o = -246, -3m + 2o + 186 + 193 = f. List the prime factors of m. 3, 43 Suppose 2h - 4 = -0h. Let d be h/(-3)(-45)/(-10). What are the prime factors of (7 + d)/(-4)-14? 2, 7 Suppose -11q + 8q + 1749 = 0. List the prime factors of q. 11, 53 Let g be 10/(-5) + -2 + 7. Suppose -52 = gs - 418. List the prime factors of s. 2, 61 Suppose -5c - 7 - 8 = 0, -4i + 5c = -103. Suppose k = -k - d - 26, -k - i = 5d. Let q = k - -39. What are the prime factors of q? 3 Suppose 2v - 6v = -24. Suppose -vy + 63 = -3y. What are the prime factors of y? 3, 7 Let f = 9557 + -4582. What are the prime factors of f? 5, 199 What are the prime factors of 5(1 - -6) + -13? 2 Suppose 20 = -5g, -2g - 8 = -z + 1. Let d = 9 + z. Suppose 38 = o + d. What are the prime factors of o? 2, 7 Let f = 1228 + 17. List the prime factors of f. 3, 5, 83 Let x(p) be the third derivative of p4/24 + 19p*3/6 + 5p*2. Let i be x(-18). Let z(v) = 4v - 1. What are the prime factors of z(i)? 3 Let n be (102/(-8))/((-6)/(-24)). Let z = n + 103. What are the prime factors of 4 + z + -2 + 6? 2, 3, 5 Suppose -6v + 23 = -31. Suppose -5r - v = -4. What are the prime factors of (r + 36)8/5? 2, 7 Let m = 9 + -5. Suppose -15 = -ms + s. Suppose -31 = -n - 4p, 4n + 39 = sp + 121. What are the prime factors of n? 23 Let r(f) = 5f + 151. Let u be r(-30). Let t = 4 - 0. Suppose -g = -t + u. List the prime factors of g. 3 Suppose 4b = -98 + 4686. What are the prime factors of b? 31, 37 Let r be (-8)/8 - (-1 - 2). Suppose 0a - 3a = h - 85, 3a + rh = 80. What are the prime factors of a? 2, 3, 5 Suppose 0 = 3x + f - 0f - 68, 4f + 102 = 5x. Suppose -2v - 4 = -4d, -4v = 5d - 35 - x. What are the prime factors of v? 2 Let a = 1703 - 1120. List the prime factors of a. 11, 53 What are the prime factors of 194364/51 + 42/(-714)? 37, 103 Let b = 232 - -44. Let p = 600 - b. List the prime factors of p. 2, 3 List the prime factors of (-2716)/(-6) - 11/(-132)4. 3, 151 Let s = 225 + -147. Suppose s = -4u + 594. What are the prime factors of u? 3, 43 Let w(z) = z3 + 32z*2 - 19z - 121. What are the prime factors of w(-30)? 13, 173 Suppose 0 = -3o - 428 - 784. What are the prime factors of (24/9 - 3)(o - -5)? 7, 19 Let i be (0/1)/(-9 + 7). Let x = 2 - i. What are the prime factors of x? 2 Suppose 0 = -2v - 32u + 37u + 6065, -2u = 10. What are the prime factors of v? 2, 5, 151 List the prime factors of 148925/63 + (-7 - 128/(-18)). 2, 3, 197 Let j(q) = -q3 + q2 - 2q + 37. Let h be (-119)/(-42) - (-2)/12. Suppose -2f = hf. What are the prime factors of j(f)? 37 Suppose -5u - 43 = -3h, 3h - 55 = -2h + 5u. Suppose hb + 0b = -1182. What are the prime factors of 12/(-30) - b/5? 3, 13 Let j(a) = 863a2 + a - 1. Let q be j(1). Suppose 3s + r - q = -r, 0 = -2s - r + 575. What are the prime factors of s? 7, 41 Let b(v) be the second derivative of -2v3/3 - v2/2 + 6v. Let q be b(2). What are the prime factors of (244/12)/((-3)/q)? 61 Suppose -2777 = -4b - 5p, 0 = -2b - 4p + 273 + 1111. List the prime factors of b. 2, 349 Let n(w) = -w3 + 14w*2 + 10w - 35. What are the prime factors of n(9)? 2, 5, 23 Let g(d) = d*3 + 30d*2 - d - 54. List the prime factors of g(-29). 2, 3, 17 Suppose k + 3a = -22, -4k + 3a - 38 = 5a. Let j be (-2)/k + 640/14. Suppose 0 = 2i + 8 - j. List the prime factors of i. 19 What are the prime factors of (-1 + -406 + 20/(-10))-1? 409 List the prime factors of (0 + 1 + 0)(1889 - -17). 2, 953 Suppose -w = -5w + 20. Suppose q = -wu + 35, 0 = q - u + 3u - 29. What are the prime factors of q? 5 Let u(o) = 17o*3 - 3o*2 + 6o - 4. List the prime factors of u(3). 2, 223 Let f(g) = -13g2 + 255g - 5. List the prime factors of f(18). 373 Let n(q) = 2q2 + 10q + 3. What are the prime factors of n(11)? 5, 71 Let i(t) = -t - 15. Let m be i(-8). Let n(a) = -3a - 10. Let v(o) = -4o - 15. Let d(q) = mn(q) + 5v(q). List the prime factors of d(8). 3 Suppose 0 = -24m + 20m - 12. List the prime factors of ((-30)/(-35))/m + 16/7. 2 Let l = -852 - -1152. List the prime factors of l. 2, 3, 5 Let t(f) = -109f - 72. What are the prime factors of t(-2)? 2, 73 Suppose -2y + 32 = -2t, 4y + 0t = t + 55. Let i be ((-6)/4)/((-3)/6). Let l = i + y. List the prime factors of l. 2 Suppose 340t + 1060 = 341t. List the prime factors of t. 2, 5, 53 Suppose -25t + 4t + 23730 = 0. What are the prime factors of t? 2, 5, 113 Let w be (-39)/(-4) + (-17)/(-68). List the prime factors of (232/(-5))/(w/(-25)). 2, 29 Suppose 0w - 3y - 15 = 2w, 4y + 20 = 2w. Let f be -2 + (-4 - w) + 1. What are the prime factors of 3 + 0 - (f - -1)? 7 Let h(b) = 8b - 18. Let z be h(-8). Let i = 182 + z. What are the prime factors of i? 2, 5 List the prime factors of 203(40/6)/(280/60). 2, 5, 29 Suppose 0b = -2b - 4y + 2750, b - 4y - 1351 = 0. What are the prime factors of b? 1367 Suppose -4 = -4v, 2l + 3 = 3v + 190. Let y = l + -43. What are the prime factors of y? 2, 13 Suppose 2685 = 3i - 3315. List the prime factors of i. 2, 5 Let f(m) = -m*2 - 7m + 2. Let j(r) = -7r + 28. Let k be j(5). List the prime factors of f(k). 2 Let v = 151 + 10. Suppose v + 46 = i - 2g, i - 5g - 219 = 0. List the prime factors of i. 199 Suppose -2u - 4 = -10. Let i be ((-48)/(-9))/(u/9). List the prime factors of (1 - i/12)-48. 2 Suppose 1 = 5b - 19. Suppose -5t + 6 + b = 0. Suppose -tm = -m - 25. List the prime factors of m. 5 Let g(v) = v*3 - 11v*2 + 9v + 12. Let a be g(10). Let r(q) = -3 - aq2 - 5q*2 + 9q*2 + 2q + 3q3 + 4q*3. What are the prime factors of r(2)? 5, 13 Suppose 0 = 5l + 77 - 10677. What are the prime factors of l? 2, 5, 53 Let a(s) = 30s + 31. Let b be a(17). Let x = -334 + b. List the prime factors of x. 3, 23 Suppose -20 = -t - 5. Let i = t + 11. What are the prime factors of i? 2, 13 Let v be (2 - 0) + (2 - 3). Let n(k) = 3k*2. Let g be n(v). Suppose -1 = gh - 31. What are the prime factors of h? 2, 5 Let j(r) = 22r2 - 8r + 12. Let h(y) = -7y2 + 3y - 4. Let i(t) = 7h(t) + 2j(t). Let p be i(3). Let x = -17 - p. What are the prime factors of x? 17 Suppose -2u + 4 = 2u. Let h(i) = 18i. Let q be h(u). Let y = q + -8. What are the prime factors of y? 2, 5 Suppose 0b + 568 = 4b. Suppose -11r = -9r - b. What are the prime factors of r? 71 Suppose 3r = 6r - 9. Let m(q) be the second derivative of 2q3/3 - q2/2 - 30q. List the prime factors of m(r). 11 Let x = -43 - -55. Suppose 11b - xb = -32. List the prime factors of b. 2 Suppose -2w = -6 + 2. Suppose -wb + 4v - 308 = -4b, 4v = -b + 148. What are the prime factors of b? 2, 5 Let d(t) be the first derivative of t*4/4 + 13t*3/3 + 9t*2/2 + 6t - 11. List the prime factors of d(-12). 2, 3, 7 Suppose 401 = 4x - 7q + 6q, -399 = -4x - q. What are the prime factors of x? 2, 5 Let x(k) = -k*2 + 2k - 3. Let f be x(2). What are the prime factors of (7/f)/7-213? 71 Let f be (-1)/6 - 355/(-6). Let u = 3 + -30. Let g = u + f. What are the prime factors of g? 2 Suppose -32 = -2o - 2a, 0 = 2o - 3o - 4a + 28. Suppose -oi + 15i = 135. List the prime factors of i. 3, 5 Let c = 107 - 98. Suppose -5k + 214 = 5i + c, 5k + 182 = 4i. What are the prime factors of i? 43 Let h = 56 + -119. Let m = h + 128. What are the prime factors of m? 5, 13 Suppose 4m + 2u = 1299 + 2771, -3u + 3 = 0. What are the prime factors of m? 3, 113 Suppose 6x + u = 9x - 1978, 3u = -3. List the prime factors of x. 659 Let q = 30 + 8. Suppose 0z - z = -q. List the prime factors of z. 2, 19 Let f(c) = 26c + c*2 - 47c - 4 + 28c. What are the prime factors of f(-11)? 2, 5 Let o(i) = 3i - 2. Let r be o(2). Suppose -11z = -10z - r. Let t = 20 + z. What are the prime factors of t? 2, 3 Let m(f) = -f*3 - 11f*2 - 65f - 19. What are the prime factors of m(-12	{ "pile_set_name": "DM Mathematics" }
2)((-2m + 0m + m)(4 - 2 - 5) + m + 0m - 3m + 2m + 0m - m) as im*3 + a + sm + vm2 and give i. -6798 Rearrange 2l - 6453 + 299l2 - 2l + 222l2 + 6450 to j + yl*2 + nl and give j. -3 Express (2z - 3z*2 - 2z)(6z - 29 + 29) - 42z3 - 41z*3 + 75z*3 + 2z*3 + 2z - 2z in the form o + hz*2 + tz*3 + bz and give t. -24 Express -31896z2 + 129z + 31503z2 + 5 - 131z in the form s + wz + cz*2 and give s. 5 Rearrange 12 - 2094j - 6314j - 38 + 26 to hj + m and give h. -8408 Express -q*3 + 0q4 - 344 + q2 + 0q4 + q - 208 + q4 as jq*3 + b + lq*2 + mq + fq4 and give m. 1 Express -211w*2 - 1120w*2 + 133w*2 as nw*2 + hw + r and give n. -1198 Express (-647g + 1202g - 597g + 2g*2 - 13)(-g + 3g + 2g) as r + ag3 + qg*2 + jg and give a. 8 Rearrange -1 - 2973t - 3t*2 + 172t*3 + 1481t + 1493t to xt*2 + r + zt + yt3 and give r. -1 Rearrange 102 - 62 - 38 + 878w to the form sw + g and give g. 2 Rearrange -3 - r + 3 + (1 + 2 - 2)(0r - 4r + 2r) + (-136 + 238 - 166)(-111r - 13 + 241r - 121r) to xr + j and give x. -579 Express (-381610 + 1821w3 + 381610)(71 - 11w - 71) in the form c + dw*4 + bw + xw2 + zw*3 and give d. -20031 Express -3w*2 + 0w + 0w + (2 - w2 - 2)(-4 + 4 + 2) - w*2 + 2w*2 - 3w*2 + 3349 + 132w*2 - 6696 + 3352 in the form vw*2 + fw + i and give v. 125 Express (z - 2z - z)(-2z + 1 - 1)(-4 - 11 + 3)(-1 - 3 + 3 + (1 + 1 + 1)(-2 + 1 + 3)) as az2 + kz + p and give a. -240 Rearrange -4605k3 + 1088k*3 - 5395k*3 - 648k3 + (0 + 0 + k2)(-k - 1 + 1) to the form ik*3 + gk + z + bk2 and give i. -9561 Express (-y - 2y + 2y)(11y + 8y - 7y) + 5y - 5y + 2y*2 + (1 - 12 + 2)(2 - 2 + y*2) in the form dy*2 + t + ny and give d. -19 Rearrange -63 - 11z2 + 0z*2 + 17z + 27z + 19z - 64z to the form l + uz*2 + vz and give v. -1 Rearrange (-3v + 2v + 2v)(-1 + 4 - 1)(-42 + 15 - 35)(-12 - 2 - 13) to the form o + rv and give r. 3348 Express 9 + 2841g - 1409g - 1444g + g3 + g2 as tg + b + mg*2 + kg*3 and give t. -12 Express ((0 + c + 0)(-6c - c - c) + 884 - 884 - 14c*2)(-6 + 2 + 5c + c) as ic*3 + z + oc*2 + sc and give o. 88 Express -8u - 8u - 26u + 1675u*2 + 42u as vu + w + fu*2 and give f. 1675 Rearrange (-5 - 1 + 5)(-r - 3r + 3r) + (-7 + 3 + 2)(-4 + 2r + 4) + 10r + 6r + 16r + 76r + 76r - 148r + 9 to the form vr + j and give v. 33 Rearrange (1 + 3 - 2)(-559 + 1238 - 187)(-125l + 127l - 37l*2 - 5l*2) to pl + s + yl2 and give y. -41328 Rearrange -7491a - 1366 + 2757 - 1391 to the form w + oa and give o. -7491 Rearrange -b - 21b*2 - 2b*2 - 8b*2 + (-30b - 3b2 + 30b)(-4 + 2 - 1) + (1 + 3b - 1)(-1 - b + 1) to the form gb + k + rb2 and give g. -1 Rearrange (159d - 8d + 166d)(17 - 17 - 28) to j + ld and give j. 0 Express -397 - 8s - 5s + 14s + s in the form ys + d and give d. -397 Express 2h3 - 15 + 308h*2 - 89h*2 - 133h*2 - 85h*2 + 43h as qh2 + l + dh + sh3 and give s. 2 Rearrange 19 - 33s*3 - 9s*2 - 2s2 - s2 - 1 + 10s2 to the form g + rs*2 + is + ls3 and give l. -33 Rearrange 0p*3 + 509p*4 - 165p*4 - 7p + 4p3 - 176p*4 - 166p*4 + 2p*2 to zp*2 + np*4 + up*3 + t + yp and give z. 2 Rearrange (408u + 392u - 87u)(-5 - 1 - 8) to o + iu and give i. -9982 Express -46b - 3b2 - 320b + 155b - b2 as qb*2 + mb + k and give m. -211 Rearrange -48 + 23n - n2 - 7n + 53291n3 - 53293n*3 to mn*2 + y + cn + qn3 and give y. -48 Rearrange (-4b - 2b - 2b)(-b - 4b + 3b) + (18b - 8b + 12b)(-227b - 123b + 557b) to jb + t + wb*2 and give w. 4570 Express -10520 - 3f*2 - 3f*2 + 5247 + 5255 - 2f - f*3 as x + kf*3 + uf + if2 and give u. -2 Express -468n*2 + 9n*3 + n - 6n3 - n4 - 464n2 - 2n*3 + 0n in the form s + wn2 + yn*4 + un*3 + gn and give w. -932 Express 2705a - 8119a - 25a3 + 2709a + 9 + 2a2 + 2707a in the form ba2 + ma*3 + za + w and give w. 9 Rearrange ((2a2 + 7a*2 + 8a*2)(-5 + 4 + 4) + 43 + 17a2 - 43)(-2 + 0 - 2) to the form ga + m + wa*2 and give w. -272 Express -8z*3 - 9608996 - 36z*2 + 9608994 + 101z*3 as vz + mz2 + hz*3 + d and give h. 93 Rearrange 2m*2 + 351m - 312m + 441m to pm + z + wm*2 and give w. 2 Rearrange g - g - 6893g*2 + 6958g*2 to the form pg*2 + ug + i and give p. 65 Express 27755 - 13871 - 4d2 - 184d - 13885 as g + xd + sd*2 and give x. -184 Express (4i + 0i - 2i)(-3 - 5 + 0)(1357 + 124 - 168) in the form hi + j and give h. -21008 Express -4f*2 + 2f*2 + 3f2 + (f2 - 2f + 2f)(-4 - 2 + 4) + (28f - 5f + 179f)(-f + 8f + 0f) as jf + nf2 + i and give n. 1413 Rearrange 3861003 - 6613v - 3861003 - 3v + 4v - 2v + (-2v - 3v + 3v)(3 - 2 + 0) - 4v + v + 4v + (2 - 2 - 2)(-2 - 2v + 2) to t + mv and give m. -6611 Express (57q2 - 26q*2 + 1651q - 1643q)(76 - 76 - 20q) as vq + iq3 + n + wq*2 and give w. -160 Rearrange (2m + 6m + 0m)(5m - m - 2m)(246 - 298 + 987) to the form t + qm + hm*2 and give h. 14960 Rearrange -54v*3 - 87v*2 + 12v - 18v - 6 - v4 + 7v + 25v3 + 27v*3 to zv*4 + gv + y + sv2 + nv*3 and give z. -1 Express -36253y - 5 - 62590y + 5 + 76028y in the form cy + i and give c. -22815 Rearrange (-2 + 2 + b)(2b2 + 0b*2 - 4b*2) + (-2579b + 2294b2 + 2579b)(-1 + 1 + 5b) to vb2 + jb*3 + nb + o and give j. 11468 Rearrange -33 + 7947l2 + 2l*3 - 5l + 27 - 7964l2 to the form sl*3 + ml + tl2 + o and give t. -17 Express 21q + 136074q2 + 111 - 68038q*2 - 68039q*2 in the form y + zq*2 + oq and give z. -3 Express ((-24 + 24 + 12t)(-2 - 1 + 5) + t + 0t + 0t - 4t + 3t + 0t)(-2 - 1 + 6 + (2 + 4 - 5)(-5 + 1 + 2)) in the form gt + c and give c. 0 Express (w + 3 - 3)(-849 - 1100 - 751) + (-3w + 4w + w)(-1 + 5 - 5) in the form y + dw and give d. -2702 Express (-8356142f + 8356142f + 10197f*2)(0 + 2 + 0)(0 - 1 + 3)(1 + f - 1) as l + if3 + jf + kf2 and give i. 40788 Rearrange -3w - 70w3 - 1302 + 71w*3 + 3w + 224w2 + 1301 to the form yw*3 + pw + v + hw2 and give y. 1 Express -14a*2 - a + 31a*2 - 12a*2 - 11a*2 - 60 - 2a*4 as ga + v + ja3 + ya*4 + sa*2 and give v. -60 Rearrange 9j*3 + j - 86j*2 - 3j - 117j2 - 66j*2 + 41j*2 to qj*3 + a + gj*2 + wj and give q. 9 Rearrange 3b3 + 4783 - 2b*3 + 677b - 4784 to wb2 + vb*3 + l + tb and give l. -1 Express 25c - 30c - 154c2 + 99c*2 + 226c*2 + 3c*3 as nc*3 + zc + s + uc2 and give z. -5 Rearrange -11f + 28 - 13 - f*3 + 2f*2 - 6f*3 + 15f*3 - 18 + 2f*4 to the form tf + pf4 + jf*2 + uf*3 + q and give j. 2 Rearrange 3807r - 3736002 + 3736002 to z + ur and give u. 3807 Express (2 + 2 - 3)(-43o2 + 22o*2 + 24o*2)(-654 - 1060o + 654) as l + vo + co2 + so*3 and give s. -3180 Rearrange 7881a*4 + 11a + 117 + a*3 - 3938a*4 - 3944a*4 - 2a*3 to the form ia*3 + ma*4 + xa*2 + ua + f and give f. 117 Express -2z3 + z2 + 3z - 4389 + z2 - z4 + 4512 in the form yz3 + uz + oz4 + f + jz*2 and give y. -2 Rearrange (-4r*2 + 4r*2 + 225r*2)(-2r + 2r - 639r2 + 440r*2) to f + pr + lr4 + nr*2 + kr*3 and give l. -44775 Express 6 + 27742x + 10602x - 6 as tx + s and give t. 38344 Rearrange -72655 + 449z3 + 72655 + (-z2 + 1 - 1)(-2z + 3z + z) - 71z2 + 65z*2 - 4z*3 + 0z*3 to lz + kz3 + iz*2 + j and give i. -6 Rearrange 433m - 1349m + 443m + 450m + 69 to the form l + vm and give l. 69 Express (-413f - 21 - 10 - 44 + 22)(2 + 0 - 1) in the form pf + t and give t. -53 Express 5f*3 - 4f*3 - 13f3 + f3 - f*3 + 4f*3 + (-7f*2 + 5f - 5f)(2f - 5 + 5) as a + of*3 + bf*2 + wf and give w. 0 Express (31w + 5w + 41w)(87w - 79w - 66w) in the form s + vw + qw2 and give q. -4466 Express j - 274 - 10j*2 - 416 + 11j*2 + 0j in the form kj + fj*2 + t and give t. -690 Express 2i + 6i4 - 2i + (-13i2 + 2i + 13i2 - i3)(i - 3i + 3i)*	{ "pile_set_name": "DM Mathematics" }
the first derivative of r(j) wrt j. 62 Let n = -54 - -54. Let i be (n - (-1)/(-4)) + 204/48. What is the third derivative of -ic2 + 20c*2 - 8c5 + c5 + 20c5 wrt c? 780c*2 Let q(s) = 9s + 30. Let h be q(-3). Find the third derivative of -hz2 - 79 + 86 + z2 + 45z*6 wrt z. 5400z*3 What is the derivative of 182 + 278 + 2135l - 1849 + 806l wrt l? 2941 Let j(z) = 71z. Let x be j(1). Let r = x - 28. Differentiate 30 + r - 63 + 22s2 wrt s. 44s Suppose 0 = 4f - 12f + 32. Find the first derivative of 15 + 19b3 + 9b*f - 6b*4 - 16b*4 - 21b*3 wrt b. -52b*3 - 6b*2 Find the second derivative of 2347j*2 + 6 + 2867j*2 + 1091j*2 - 2809j*2 - 789j wrt j. 6992 Find the third derivative of 12f2 - 2961f*4 + 360f*4 - 18 + 272f*4 - 39f*2 wrt f. -55896f What is the derivative of -49j2 - 22j - 764 + 2j3 + 15j*2 + 4j*3 + 33j*2 wrt j? 18j*2 - 2j - 22 Suppose -k = -2p - 8, -4k + 0 + 38 = -5p. Suppose m = k - 8. Find the second derivative of 10t*m - 4t*3 - 5t*4 + 4t*3 - 8t wrt t. 60t2 Let t(r) = -r. Let k(l) = -15l*2 + 5l - 6. Let n be (-4)/30-256/(-5). Let o(f) = nt(f) - k(f). Find the second derivative of o(c) wrt c. 30 Suppose z = 3, 6c - 5z + 7 = 2c. Find the third derivative of 13q3 + 91q*c + 97q*2 - 209q*2 wrt q. 78 Let h = 497 - 495. Find the third derivative of -19y*3 - 26y*h - 818y + 407y + 408y wrt y. -114 Let w(n) be the first derivative of 8975n4/4 + 817n*2 - n + 2350. Find the second derivative of w(f) wrt f. 53850f Let j be -1 - 1(-2 - 5 - -6). Let k(s) be the second derivative of js*3 - 14s*2 + 4/5s*6 + 0 + 0s*4 - 9s + 0s5. Differentiate k(d) wrt d. 96d*3 Let z(k) = -5k + 39. Let w be z(4). Suppose 0 = -wn + 3n + 32. Find the third derivative of -10pn + 10p*2 - 2p*5 + 4p*2 - 8p*5 wrt p. -600p*2 Let q = 2327 + -2324. Let f be (6-1)/(1 + -3). What is the first derivative of -b*q - 12 + 6b*3 + 0b*f + 3 wrt b? 15b2 Let z(v) = v3 + 21v2 + 18v - 36. Let j be z(-20). What is the first derivative of -121b2 - 148 - 88b*4 + 2b*j - 51b*4 + 121b*2 wrt b? -548b*3 Let s(i) = i + 26. Let u be s(-21). What is the third derivative of -12k*5 - 57k*u - 16k*5 - 92k*2 wrt k? -5100k*2 Let r(c) be the third derivative of 2c*2 + 0c*5 + 0c*4 + 0 + 67/60c*6 + 37/2c*3 - 18c. What is the first derivative of r(d) wrt d? 402d2 Let x(d) = 610d*2 + 11d + 3395. Let q(m) = 304m2 + 5m + 1698. Let n(y) = 11q(y) - 5x(y). Differentiate n(g) with respect to g. 588g Let w(y) be the third derivative of y9/56 - y6/3 + 109y*5/20 + 5y*2 - 14y. Find the third derivative of w(a) wrt a. 1080a3 - 240 Let s(k) be the first derivative of 13k*2 + 5k*4 + 169 - 35k - 34k2 + 20k*2 + 148k. Find the first derivative of s(r) wrt r. 60r2 - 2 What is the third derivative of -1479541n + 2 - 695n5 + 1479541n - 655n2 wrt n? -41700n*2 Suppose 0 = 3y + 4i - 17, 69y - 2 = 67y + 2i. Let b(a) be the first derivative of -8 + 0a2 + 31a + 29/3ay. What is the derivative of b(f) wrt f? 58f Suppose -80 = 2f - 3a, -f + 4f + 146 = -2a. Let x = -44 - f. Find the second derivative of 7v2 + 5v*x - 6v*2 - 27v wrt v. 12 Let n(s) be the third derivative of -s*5/10 + 517s*4/24 + 985s*3/2 + 654s*2. Differentiate n(x) with respect to x. -12x + 517 Suppose 50a = 42a + 16. Find the second derivative of -162ra - 2000r + 31r2 + 1998r + 94 wrt r. -262 Suppose -4t + 24 = -0i + i, i + 4 = 3t. Find the second derivative of 3l*4 + 37l - l*4 + il*4 wrt l. 120l*2 Let x(j) be the first derivative of 1120j*3/3 - 1065j*2/2 - 958. Find the second derivative of x(p) wrt p. 2240 Suppose 3s = 5n + 2s - 19, 3n = 3s + 21. Find the second derivative of -9 + n + 6 - 6y2 + 53y wrt y. -12 Let p be (1/(2/1))/((-15)/(-240)). Suppose -3v = -c - p, 0v + 2v - 8 = 0. Differentiate -5 - 33g*c - 25 + 4 with respect to g. -132g*3 Let w(f) = 3f + 4. Let b be w(18). Let q = b - 53. What is the second derivative of 4kq - 65 + 65 + 10k wrt k? 80k3 Let k(h) = 21h + 146. Let x be k(-6). Find the second derivative of -8n - 5 - 34 - x + 11n + 15 + 165n5 wrt n. 3300n3 Let m(i) be the second derivative of -i4/12 + 63i3 + 1204i*2 + 40i - 18. Differentiate m(f) with respect to f. -2f + 378 Let m(d) be the first derivative of -77/3d*3 - 32d*2 - 31 + 0d. What is the second derivative of m(v) wrt v? -154 Let u(o) be the first derivative of 0o2 + 29o + 0o3 - 58/5o*5 + 0o*4 + 61. What is the first derivative of u(t) wrt t? -232t*3 Find the third derivative of 12h*2 - 87747h*3 + 94577h*3 - 3h*2 + 104h wrt h. 40980 Let t be ((-93)/6)/(-4 - 34/(-8)). Let v = t + 105. What is the derivative of 5h4 - 9h*4 + v - 19h*4 + 3h*4 wrt h? -80h*3 Let b(k) = -2000k - 750. Let x(r) = -500r - 195. Let n(i) = 6b(i) - 25x(i). What is the derivative of n(l) wrt l? 500 Let p = 6453 - 6423. Let t(w) be the first derivative of -31/4w*4 + 0w*2 + 0w - 10w3 - p. What is the third derivative of t(v) wrt v? -186 Let w(b) be the third derivative of -b8/56 - 11b7/105 + b6/60 - 1063b4/24 - 4583b*2. Find the second derivative of w(s) wrt s. -120s*3 - 264s*2 + 12s Let q(x) be the third derivative of 137x8/24 + x4/24 - 27x*3/2 - 1610x*2. What is the second derivative of q(w) wrt w? 38360w*3 Let q(x) be the second derivative of 0x*6 - 34/21x*7 + 0x*5 + 8x*3 + 27 - 2x + 0x4 + 0x*2. What is the second derivative of q(z) wrt z? -1360z*3 Let j(u) be the third derivative of 65u*4/3 - 619u*3/6 - 29u*2 - 2u + 68. What is the first derivative of j(a) wrt a? 520 What is the first derivative of 409j2 - 1341 - 979 - 1850j*3 - 409j*2 - 1286j*3 wrt j? -9408j*2 Let z(d) be the first derivative of -4d*2 - 32 - 115/4d*4 + 0d*3 + 0d. Find the second derivative of z(r) wrt r. -690r Let j be 4(-18)/(-12) + 22. Find the third derivative of 15f3 + 16142 - 16142 + jf2 wrt f. 90 Let d(u) be the second derivative of -u6/30 + u*4/12 - 401u*3/6 + 5u - 113. Find the second derivative of d(w) wrt w. -12w2 + 2 Differentiate 188 - 63i*4 - 20 + 799 - 4i*2 - 21i*4 with respect to i. -336i*3 - 8i Let o(l) = l*2 - 7l - 160. Let u be o(-10). Let h(d) be the first derivative of 0d + 13/3d*3 + 13d*2 + u. What is the second derivative of h(z) wrt z? 26 Find the third derivative of -3020q*3 - 734q*2 + 27q*3 + 299q*2 wrt q. -17958 Differentiate 1099 + 288 - 295s*2 + 109s*2 + 125s*2 - 1837s*2 wrt s. -3796s Let v(f) = -f*2 - 35f + 2. Let q be v(-35). What is the third derivative of y*2 + 5 - q - 7y*4 - 3 - 20y - 5y3 wrt y? -168y - 30 What is the third derivative of 20176l2 + 311l*6 + 630l*6 - 18993l*2 wrt l? 112920l*3 Suppose -2f + 40 = -4. What is the second derivative of 2l5 + 23l - fl - 4l*2 - 4l*2 + 11 wrt l? 40l*3 - 16 Let d = 358 - 356. Find the third derivative of -117g*2 + 0gd - g4 - 15g5 - 2g*4 - 2g*2 wrt g. -900g*2 - 72g Let t(q) = -699q2 - 4047q + 4. Let v(z) = -2799z2 - 16188z + 18. Let c(i) = 9t(i) - 2v(i). Find the second derivative of c(h) wrt h. -1386 Let c(m) = -15m - 15. Let b(n) = -3n - 3. Let r = 73 - 78. Let t = 16 + r. Let x(q) = tb(q) - 2c(q). What is the derivative of x(d) wrt d? -3 Find the first derivative of 133p2 - 150757p + 110p2 + 150745p - 4204 wrt p. 486p - 12 Let m(n) be the first derivative of -76n + 0n4 - 51 - 3/2n*2 + 0n*3 + 6/5n*5. Differentiate m(b) wrt b. 24b*3 - 3 Let f(v) be the first derivative of 12 + 0v*2 + 8/3v*3 - 7/12v*4 + 13/120v*5 + 0v. Let m(b) be the third derivative of f(b). Differentiate m(k) wrt k. 13 Let m(a) be the third derivative of -787a8/42 + a5/60 + 1657a*4/24 + 13708a*2. Find the third derivative of m(v) wrt v. -377760v*2 What is the first derivative of 38051 + 1984f*2 + 39134 - 75421 wrt f? 3968f Let a(c) be the third derivative of 119/60c5 - 5/6c*3 - 87c*2 + 0 + 0c + 1/2c4. What is the second derivative of a(n) wrt n? 238 Let z(a) be the first derivative of -a*	{ "pile_set_name": "DM Mathematics" }
1. Let q be s(-1). Let y be (-2)/q - (-35)/11. Let p = y + 11. What is the units digit of p? 4 Suppose s + 16 = 66. Suppose -126 = 4j + 2. Let y = j + s. What is the units digit of y? 8 Let f = -863 + 2991. What is the hundreds digit of f? 1 Let j be (-2)/(-7) - (-19)/7. Suppose u = 2h + j, h = -u - 0h - 12. Let m = -1 - u. What is the units digit of m? 6 What is the hundreds digit of (-1)/(9/(-2)) - (-38024)/126? 3 Let y(a) = -a3 + 13a*2 + 4a - 13. Let q(r) = -2r3 + 25r*2 + 7r - 25. Let b(n) = 6q(n) - 11y(n). What is the units digit of b(5)? 3 Suppose 10s + 368 = 12s. Let i = -118 + s. What is the tens digit of i? 6 Suppose 0r + 76 = -19r. Suppose -55 = -2x - 169. What is the units digit of 2 + -10 - r - x? 3 Suppose 0 = 62s - 173504 + 41692. What is the tens digit of s? 2 Let l be 10/(-6) + 2 - 545/(-3). Let a = l - 82. What is the hundreds digit of a? 1 What is the tens digit of (28/(-21))/(4/(-3)) + 766? 6 Suppose 2s + 2x = 4x + 66, x - 137 = -4s. Suppose 8 = 3p - 1. Suppose g = 5i - 61, 3i + pg - g - s = 0. What is the units digit of i? 2 What is the units digit of -2 + (3330/17 - 6/(-51))? 4 Let o(t) = 5t3 + 5t*2 + 2t - 4. Let q be o(-3). Let w = q + 159. What is the tens digit of w? 5 Let h = 562 + -398. What is the hundreds digit of h? 1 Let z = 31 - 28. Suppose -3n - 3u - u = -599, -2n + 400 = zu. What is the tens digit of n? 9 Suppose 0 = k - 1 - 19. Let l = 20 - k. Suppose h - 5o = 40, 3h = -lo - o + 56. What is the units digit of h? 0 Let b(m) = -2m*2 + m. Let q be b(2). Let h be (-327)/q - 2/(-4). Let j = 116 - h. What is the units digit of j? 1 Let k(l) = -4l*2 + 11l - 5. Let f(q) = -7q2 + 21q - 9. Let w(h) = 6f(h) - 11k(h). What is the tens digit of w(-5)? 2 Suppose -q - 154 = -3q. Suppose -p + 5h = p - 151, p - 2h = q. What is the tens digit of p? 8 Suppose 3 + 29 = 2q. Suppose -3g = -0g, x + 3g + q = 0. Let p = 26 + x. What is the tens digit of p? 1 Suppose -d + 1 = 2q + 9, 0 = -4d - 4q - 12. Suppose 9i - 4i + dp - 163 = 0, 0 = 4i - 3p - 112. What is the tens digit of i? 3 Suppose -578952 = -67h - 65h. What is the thousands digit of h? 4 Let j = -993 - -1724. What is the units digit of j? 1 Let d(k) = k3 - 3k*2 + 28k + 12. What is the units digit of d(12)? 4 Suppose -3n - 22 = -1. Let h be 6/7(0 + n). What is the units digit of 40/h(-96)/20? 2 Let a(u) = -u3 + 2u*2 + 3u + 1. Suppose -5z + 2l + 0l = 111, z + 15 = -2l. Let d be 48/z + (-8)/(-28). What is the tens digit of a(d)? 1 Let h be (60/24)/((-2)/(-4)). Suppose 2g + r - 303 = g, 1509 = hg - r. What is the tens digit of g? 0 Let d(m) = -4m3 - 4m*2 + 5. Let w be d(-3). Let f = w + -9. What is the tens digit of f? 6 Let h = 57 - 114. Let k = h + 106. What is the units digit of k? 9 Suppose -50q + 52q - 288 = 0. What is the tens digit of q? 4 Let n be ((-15)/3 - -4)/1. Let g be n + (8 - 1 - 2). What is the tens digit of 67 - (g - 2) - 2? 6 Let p = -8 - -114. Let k = p + -36. Let i = k - 50. What is the units digit of i? 0 Let f(t) = -t2 + 4t + 6. Let k be f(9). Let u = 69 + k. What is the tens digit of u? 3 Suppose -4s + 3g + 18675 = 0, -2s + 6g + 9330 = 2g. What is the tens digit of s? 7 Suppose 4t = -4u - 20, -t = -3u - 2t - 5. Suppose u = 2x + x + 3k - 180, -55 = -x + 4k. What is the units digit of x? 9 What is the thousands digit of (-6)/(-20) - (-1877655)/650? 2 Suppose -3m - l = -0l + 105, -4l - 182 = 5m. Let q = 37 + m. What is the units digit of q? 3 Let s = -6 - -10. What is the tens digit of 55 - (-5 + -1)s/8? 5 Let a(g) = -g2 - 14g + 10. Let z be a(-12). Let l = z - 20. What is the tens digit of l? 1 Suppose 15j + 600 = 18j. What is the hundreds digit of -3 + 16/4 + (j - 2)? 1 Let u = -19 + 25. Suppose -n = -5 - u. What is the units digit of n? 1 What is the tens digit of (41/5)/((-4)/(-100))? 0 Suppose -5 = -2v + v. Suppose -vr = -q + 3q - 46, -r + q + 12 = 0. What is the tens digit of r? 1 Suppose -1428 = -3k - 354. What is the tens digit of (k/4)/(1/42)? 7 Suppose l = -4l - 3r + 20, 20 = 5l - 5r. Suppose ly + 1 - 37 = 0. What is the units digit of y? 9 Suppose -3y + 2r + 1858 = 4r, 2y - 5r = 1226. What is the tens digit of y? 1 Let i(q) = -2q*2 + 14q - 29. Let s be i(5). What is the units digit of ((-15)/s)/((-2)/(-318))? 5 Suppose 4m = -3p + 546, 3p - p + 131 = m. What is the hundreds digit of m? 1 Suppose 0 = 4m + m + 70. Let f be (9 + m)(-774)/10. What is the units digit of 3/15 - f/(-15)? 6 Let w be 40/2(712/(-4))/(-2). What is the hundreds digit of (-2)/(-3) + w/12? 1 Let i(z) = 10z3 - 3z*2 + 2z. Let g be (-15)/(-12) - (-27)/36. What is the units digit of i(g)? 2 Let k(l) = -3l + 15. Let n be (6/(-4))/(3/20). Let o be k(n). Let f = o + -26. What is the units digit of f? 9 Let h(u) = 2u*2 - 9u - 1. Let w be h(5). Let s = w - 18. Let y = s + 19. What is the units digit of y? 5 Let g(k) = 10k2 - k - 4. Let a be g(2). Let q = a - -2. What is the units digit of q? 6 Let z(q) = -1372q + 406. What is the tens digit of z(-4)? 9 Let t be 48/(-20)35. Let q be 5/(-2)t/45. Suppose 3n - 9 = 0, 3n + n - 58 = -qh. What is the units digit of h? 3 Let m = 142 + -85. Suppose 10g + m = 13g. What is the tens digit of g? 1 Let s = -109 + 31. Let m = s - -150. What is the units digit of m? 2 What is the tens digit of -1841-35/21? 1 Let m(v) = 19v - 10. Let o(g) = -20g + 10. Let t(s) = 4m(s) + 5o(s). Let a be t(7). What is the units digit of (-4)/(-18) + a/(-18)? 9 Suppose -2i - 204 = i. Let c = -38 - i. What is the units digit of c? 0 Suppose -n - 9 = 2. Let q be (10 - (5 - 2))3. Let i = q + n. What is the tens digit of i? 1 Let u(s) = -61s - 107. What is the units digit of u(-14)? 7 Suppose 0 = 2h - 3w - 7716, -h + 16w = 20w - 3847. What is the units digit of h? 5 Suppose 381 = 2m - 5l - 578, -l = -2m + 979. What is the hundreds digit of m? 4 Let w = -11 - 12. Let t = w - -28. Suppose ty = 3d + d, 0 = -2y - 3d + 23. What is the units digit of y? 4 Suppose 4l - 15l = -33. Suppose 0q - 590 = -3u - 4q, -lq + 393 = 2u. What is the hundreds digit of u? 1 Let k(o) = o2 - 5o + 4. Let z(i) = -i. Let m(l) = k(l) + 5z(l). Let v(a) = a2 + 10a + 26. Let x be v(-8). What is the units digit of m(x)? 4 Let i = -164 - -170. Let f(p) = -p + 14. Let d be f(6). What is the units digit of 44/d - i/4? 4 Let n(o) = o*3 + 9o*2 - 6o - 16. Let z(r) = 3r - r3 - 9r*2 + 3r + 17 + 0r. Let b(l) = 6n(l) + 5z(l). What is the units digit of b(-9)? 3 Suppose 3o = -o. Suppose o = -n + 2n + 6. Let x(l) = -5l - 1. What is the units digit of x(n)? 9 Let s(w) = w*3 - 2w*2 - 3w + 2. Let u be 4 + (2 - (-6)/(-3)). Suppose -5j + 23 = -2m, uj - j + 5m = 20. What is the tens digit of s(j)? 6 Suppose -4c + 2620 = 5g, -8c = -4g - 5c + 2096. What is the units digit of g? 4 Suppose 5u - 69 = 11. Let m = 14 - u. What is the units digit of (m/1)/((-2)/38)? 8 What is the thousands digit of (9 - 27)/9 + 2022? 2 Suppose 623 = 6i - 1873. Let k = 672 - i. What is the units digit of k? 6 Suppose -f - 13 = -33. Let d(b) = -b3 + 10b*2 - 21b + 5. Let r be d(7). Suppose -ru = -f, 3i - 4u = 6i - 100. What is the tens digit of i? 2 Let v be (-16)/(-3) + 20/30. Suppose 480 = vh - 3h. Suppose 0 = -2r - 2r - 4s + 220, 3r + 4s - h = 0. What is the tens digit of r? 6 Let m = -60 - -60. Suppose m = -a + 93 + 114. What is the units digit of a? 7 Suppose 0 = 25f + 3f - 476. What is the units digit of f? 7 Let u(n) = -12n - 36. Let a be u(-16). Suppose 4z = 8z - a. What is the units digit of z? 9 Suppose -3f - 4m = -17, -2f + 4m + 1 = -17. Let u = -7 + f. Suppose ut + 1 = -t, 6 = b - 3t. What is the units digit of b? 3 Let u be -1 + 0 + -4 + 5. Let w be (2(u - 87))/(-2). Let l = 130 - w. What is the tens digit of l? 4 Suppose 7 = 5f - 8. Suppose 9 = -m - s, 2s - f = 3s. Let g(l) = -l*2 - 7l + 4. What is the units digit of g(m)? 0 Let m(d) = 62d + 16. What is the units digit of m(6)? 8 Suppose 65w - 62w = -4r + 4071, -5r = 5w - 6790. What is the thousands digit of w? 1 Let r be (-2)/8 + -3 + 4956/(-16). Let p = -216 - r. What is the tens digit of p? 9 Let i(u) = -u*2 + 22u -	{ "pile_set_name": "DM Mathematics" }
- m. Calculate the least common multiple of 14 and y. 140 Suppose -19 + 49 = 5u. Let k be ((-30)/(-9))/(u/27). Calculate the common denominator of ((-53)/3)/(k/9) and -47/9. 45 Let c(t) = -11t + 5 + 10t + 8 + 1. What is the least common multiple of c(5) and 27? 27 What is the common denominator of -16/3 and (-7)/7274/36 + 1? 18 Suppose 86 = 3k + 4o, -3k - 4o = -4k + 2. What is the smallest common multiple of k and (-39 + -1)(-4)/10? 176 Suppose -47r - 21 = -48r. Calculate the least common multiple of r and 27. 189 Let j = -266/51 + 2089/306. What is the common denominator of 34/69 and j? 414 Let d(a) = a*2 + 12a - 24. What is the smallest common multiple of d(-16) and 15? 120 Let t be ((-16)/(-10))/(7/175). Suppose t = -3g - g. Let c(o) = -o2 - 10o + 10. Calculate the smallest common multiple of c(g) and 8. 40 Let b = 28 + -35. Find the common denominator of 131/12 and (-28)/b + 94/(-40). 60 Let a be (-10)/(-237)156/(-8). Let h = -4383/1106 + a. Let j = 30 + -455/16. Find the common denominator of j and h. 112 Let b = -29/258 - -14815/6708. Calculate the common denominator of b and 89/16. 208 What is the common denominator of 1529/(-1782) - -3 - 2 and -7/10? 810 Let g(q) = 10q - 64. What is the smallest common multiple of 30 and g(7)? 30 Let c = -150 - -154. What is the lowest common multiple of 9 and c? 36 Let o = -572087/756042 - -11/8043. What is the common denominator of -11/5 and o? 470 Suppose -3y - a + 14 = 0, y - 4a = -y - 14. Suppose -5t + y = 3r + 10, 13 = 5t - 2r. Find the common denominator of -9/2 and 61(t/(-14))/(-1). 14 Let i(x) = 2x*2 + 81x + 7. Calculate the smallest common multiple of 10 and i(-41). 240 Let d = -81 - -84. Let b(k) = k*3 - 3k*2 - 2k + 4. Calculate the least common multiple of d and b(4). 12 Let i be (0 - 28)/(12/244). Let a = -562 - i. Calculate the common denominator of a and 139/30. 30 Let c = -6 + -1. What is the common denominator of 65/18 and (-104)/(-10) + c/(-14)? 90 Let z(v) = -9v - 2. Let o be z(-1). Suppose n + 77 = 4d, -4n + on + 71 = 4d. Calculate the least common multiple of d and 4. 20 Let y be (-3 + 3)(5/(-2))/5. What is the lowest common multiple of (0 - 8/2)(y - 4) and 14? 112 Let h = 12798 + -460807/36. Calculate the common denominator of h and -32/9. 36 Let q = 71150947/590 + -120595. Calculate the common denominator of 5/2 and q. 590 Let s = -54956221/297 + 185038. Calculate the common denominator of s and 43/165. 1485 What is the common denominator of 5/(-35) + (-430)/(-21) and (-47 + 2)1/(-17)? 51 Suppose 0 = -t + 2q + 7, -4q = -3q. Let u(p) = p2 - 6p + 3. Calculate the least common multiple of 340/35 - ((-9)/t - -1) and u(6). 30 Suppose -w + 112 = w + 5a, 2w + 2a = 112. What is the common denominator of (-96)/362/w and -74/33? 231 Suppose -3k = -3u - 3, 0 = -4k - 0u - u + 24. Suppose 0 = n - kc - 22, -c - 56 = -4n + 3c. Calculate the least common multiple of 3 and n. 12 Suppose 74k = 242 + 202. Let a = -5 + 8. Calculate the least common multiple of a and k. 6 Let i be 1197/(-81) + (-4)/18. Let d = i - -23. Let n = 11 - 8. What is the smallest common multiple of d and n? 24 Let r be (-12)/(-15)10(-3)/12. Calculate the lowest common multiple of 6 and 40 - ((-1 - r) + (-3)/1). 42 Let w = -555563/51 - -10893. Let t = w - 1073/255. Calculate the common denominator of (-35)/42318/15 and t. 15 Let z be (6/4)/(21/2212). Let p = z + -110. Suppose p = 4w - l, 5w - 2l = -l + 60. What is the smallest common multiple of 4 and w? 12 Let u = -2112/5 - -4181/10. Let j = -10/1921 - 255433/11526. What is the common denominator of j and u? 30 Find the common denominator of (-379)/60 - 1/(-4) and 2666/15580/(-576). 90 Let m be 2148/60 - 1/(-5). What is the common denominator of (26/20 + -1)/(m/65) and -50/9? 72 Let x(t) = t3 - 15t*2 + 46t - 11. Calculate the lowest common multiple of x(11) and 63. 693 Let m(s) = -2s + 1. Let k(d) = 5d - 11. Let r(n) = 2k(n) + 14m(n). Suppose -y - 2y = -48. What is the smallest common multiple of r(-2) and y? 112 Let i = 2129 - 4345/2. Let z = -166421/12030 + 1/2005. Calculate the common denominator of i and z. 6 Let h = -841/715 - 24/65. What is the common denominator of 8/28 - 1/(28/442) and h? 22 Let m = -267 - 207. Calculate the common denominator of (-3)/((-216)/m) + -3 and 55/6. 12 Suppose -21w = -546 + 105. What is the smallest common multiple of w and 35? 105 Let p(l) = -3l + 3. Let q be p(0). Suppose 5t = -qt + 72. What is the lowest common multiple of t and 16? 144 Suppose 0 = 3h - 73 - 89. What is the lowest common multiple of h and 90? 270 Suppose -118 = x + x. Let v = -45 - x. Let j(k) = -k + 2. What is the smallest common multiple of j(-6) and v? 56 What is the lowest common multiple of (-1 + -5)/(1 - (-9)/(-6)) and 12? 12 Let n = -261 + 277. Calculate the least common multiple of 14 and n. 112 Calculate the least common multiple of ((-13284)/205)/((-2)/5) and 18. 162 Let q be -1 + 149 + -1 + (-10)/(-5). Suppose 14s - 145 = q. What is the least common multiple of 18 and s? 126 Let s = 35/186 - -5161/744. Let g = 8 + -19. Calculate the common denominator of (-69)/4(g + 10) and s. 8 Find the common denominator of -5/27 and 14/(-96) - (-1)/2. 432 Let a = 1311/5 - 259. What is the common denominator of a and (-5)/15 - (0 + (-476)/132)? 55 Let d be 1/4 - 9/(-12). Let s be 63/(1 + -3 + d). Calculate the least common multiple of (1 + -4)/(27/s) and 6. 42 Suppose -15n + 170 = 50. Suppose 0 = -3x - t + 82, 0x = -2x + 4t + 64. Calculate the lowest common multiple of x and n. 56 Let c = -1409 - -1494. Calculate the smallest common multiple of c and 51. 255 Suppose -2y + 6 = -4y. What is the common denominator of y/(-15)(-930)/36 and 51/10? 30 Suppose 4q - 2c - 75 = 23, -2q + 43 = -3c. Suppose 2o = n - q, -n - o + 57 = 2n. What is the lowest common multiple of n and 16? 80 Let z = -22 + 23. Suppose -6 = -7r + z. Suppose -6u + 19 = -4u - 3d, 0 = 5u - 2d - 42. What is the smallest common multiple of r and u? 8 Let x be (2/(-25046))/((-90)/(-3461967)). Let b = x - -2/8945. Find the common denominator of b and 121/20. 140 Suppose 2j - 17d = -12d - 55, -3d = -15. Calculate the smallest common multiple of ((-162)/(-30))/(j/(-50)) and 4. 36 Let d be 2/(-2) + 28/(-539). Let j = d + 9397/1540. Let o = -1035/4 + 6281/24. Calculate the common denominator of j and o. 120 Let c be 4 + (-208)/6 + -4. Let u = 695/21 + c. Calculate the common denominator of -34/11 and u. 77 Let o = 28 + 7. Suppose -s - 71 = 4d - 85, 0 = -3d - 5s + 19. Calculate the least common multiple of d and o. 105 Let o = 59879/9 + -6645. Find the common denominator of o and 34/69. 207 Suppose 4z + 2 - 10 = 0. Calculate the common denominator of -63/22 and 1306/440 + z/11. 220 What is the common denominator of 4/(-6) + 6649/(-2289) and 26/99? 693 Suppose 13d - 2100 = 8d. What is the least common multiple of d and 14? 420 Calculate the smallest common multiple of 45 and (-6 + (-132)/(-18))30. 360 Let z be (19/38)/(2/16). Suppose 2t = -5y + 37, 0t = -t + 2y - z. Calculate the lowest common multiple of (-26)/(-11 - 0) and t. 78 Find the common denominator of 69/(-27)(-5)/86 and 41/78. 156 Suppose -75 = -6x + 51. Find the common denominator of -5/82 and (-418)/168 + (-9)/x. 492 Suppose -2x + 3b - 23 = 0, -5b = -4x - 20 - 21. What is the common denominator of -4 - 3063/(-1386) - x/(-14) and 87/10? 330 Suppose 5y + 40 = 5w, -3w - 4y + 6 = -4. Suppose wh - 7h = -14161. Let q = -226657/16 + h. Find the common denominator of 1/14 and q. 112 Suppose -3i + 4i - 68 = -4t, t = -2i + 150. Find the common denominator of -61/8 and (2 + -1)i/(-20). 40 Suppose -3q - 592 + 663 = 2a, a = -4q + 48. What is the common denominator of a and 1/(-8)89 - 0? 8 Let k = -10583/70 - -777/5. Let r = 3981 + -31911/8. What is the common denominator of k and r? 56 What is the common denominator of 120/(-90) - (-172)/63 and -87/70? 630 Let l = 58517 + -12873841/220. Find the common denominator of 109/40 and l. 440 Let z(y) = -y - 5 + 5y - 6y + y. Let d(t) = 15t3 + 2t - 1. Calculate the lowest common multiple of d(1) and z(-15). 80 Let a = -97 - -93. What is the common denominator of ((-35)/a)/(-5 - 3/(	{ "pile_set_name": "DM Mathematics" }
r? True Suppose -79q - 17801 = -86q. Is q prime? True Is (4476 - 50) + (1 - 0) prime? False Let h = 3384 - -3563. Is h composite? False Let l = 1415 + 75516. Is l prime? False Let n be 3/(1/(3 - 0)). Suppose -3b - 5u + 2969 = 0, nb - 7b = -2u + 1982. Is b composite? True Let o be (6/(-9))/(2/(-9)). Suppose -o = 4r - 5r - f, 0 = -3f. Suppose -4v + 459 = rw - v, w = 2v + 165. Is w prime? True Is (42140/15 + -3)/((-3)/(-9)) a prime number? True Let b(j) = j2 + j + 1. Let y(h) = h2 - 2h + 2. Let v(q) = -2b(q) + y(q). Let k be v(3). Let s = k + 58. Is s a prime number? True Let x = 86 + 210. Suppose 10a + 27 = 13a. Suppose 0 = am - 13m + x. Is m composite? True Let f(m) = m3 + 3m*2 - m + 2. Let z be f(-3). Suppose -4b + 1395 = 4c - b, 717 = 2c - zb. Let o = c - 114. Is o composite? True Let m = 14 - 10. Suppose q = -mq - 395. Let u = 188 + q. Is u composite? False Suppose 0 = -r - 0r - 32. Let x be 2/(-7) + r/(-14). Suppose -5q = 5s - 2055, 3q = xs - 7s + 2059. Is s prime? False Let d(b) = 10b3 + 2b*2 - 10b - 8. Let v be d(6). Let k = v - 473. Is k composite? True Let r = -268 + 119. Suppose 3d - 2d + 280 = 0. Let v = r - d. Is v composite? False Let r(k) = 13k3 - 4k2 - 62. Is r(7) a composite number? False Let u(m) = m3 - 8m2 - 24m - 9. Let a be u(13). Suppose 5k - 3740 = -5y, 227 + a = k - 2y. Is k a composite number? True Let j(b) = b3 + 3b*2 - 8b + 2. Let m be j(4). Suppose -2u = -u + t - m, -u + t + 92 = 0. Is u prime? False Let q = -1413 - -2759. Is q prime? False Let n be 7/(-2) + 6/12. Is (-1)/n + 1406/3 prime? False Suppose -4a + 16 = 4t - 0t, 2a + 4t - 10 = 0. Let r = -2 - a. Let p(v) = -8v3 - v2 + 6v + 8. Is p(r) prime? True Let w be 14/6 - (-12)/(-36). Is ((-381)/w)/(6/(-4)) prime? True Suppose -q + 2c + 11 = 0, 4q - c + 5c = -4. Suppose -p = qp + 4. Is (-393)/(-3)(2 + p) composite? False Suppose -2r - r + 12 = 0. Suppose ra = 7a - 159. Is a composite? False Let j(k) = 34k3 + 2k*2 - k. Suppose 2n + 6m - 23 = 3m, -5n - 2m = -74. Let u = -15 + n. Is j(u) a prime number? False Let b = 104 - 99. Suppose 5s - 9559 = 2q, bs - 2724 = q + 6838. Is s composite? False Let c(i) be the first derivative of 221i*2/2 + 5i - 2. Let l be (-1)/((-5)/30) + -2. Is c(l) a prime number? False Suppose -2m = 3c - 3771, 0c = c - m - 1252. Is c a prime number? False Let a(h) = -h2 - 3h + 54. Let p be a(6). Let l = 188 + -95. Suppose -x - 4 + l = p. Is x a prime number? True Is (1 - -6978 - 0)(-170 + 171) prime? False Is (-17)/(((-2)/(-4))/((-238)/28)) a prime number? False Suppose -2 = -2p + 2. Suppose -3i + r + 2862 = -2r, 3i - pr = 2863. Is i a prime number? False Suppose -3p + 8p = -1510. Suppose -2s + 1006 = -0s. Let r = s + p. Is r composite? True Let f(m) = 16m2 - 13m + 3. Let w be f(3). Let x be -362(2/4 + -1). Let a = x + w. Is a composite? True Suppose 4y = -4, 2r + 5 = -3y + 2. Suppose 3j - 4308 - 954 = r. Is j composite? True Suppose 7d - 13d = -14538. Is d prime? True Let i = -13002 + 25519. Is i a composite number? False Let v be (-144)/(-24)1/3. Suppose i - 5i + 4f + 28 = 0, 4f - 20 = -vi. Let d(w) = 26w + 1. Is d(i) composite? True Suppose -5w + 30 = 5z, -5w + 4z - 7 + 19 = 0. Is w122 + (18 - 19) composite? False Let n = -97 - -53. Let b be ((-1469)/39)/(1/(-3)). Let y = b - n. Is y composite? False Let k = -15 + 18. Suppose 4a + 3c = -11, 8c = -2a + kc - 23. Let g(w) = 77w + 2. Is g(a) composite? False Let d(j) be the second derivative of -677j5/2 + j4/4 + j3/3 - j2 - 27j. Is d(-1) prime? False Suppose -2 = -4k + 2k. Let v be 2/2 + 28k. Suppose -4u + v = -55. Is u prime? False Let i be 5 - (4/(-6) + 28/6). Is (6297/(-9))/(i/(-3)) prime? True Let i(y) = -10y3 + 2 + 3 - 5y + 24y3 + y2 + 9y*3. Is i(2) a composite number? True Let t be (18/(-12))/(3/36). Let v be -123/(t/(-21)). Is (v - (0 + 1))-1 a prime number? True Let s = -30738 + 48881. Is s composite? False Let b = 1715 + -198. Is b prime? False Is (0 + -12)(-25362)/72 a composite number? True Let z be ((-118)/6)/((-15)/4950). Suppose -3j - p - p = -4867, 3p = -4j + z. Is j composite? False Let g(n) = n + 8. Let s be g(-4). Suppose so = 2y - 238, 2y + y = 5o + 357. Is y a prime number? False Let h(j) = -13j*2 - 2j + 4. Let p(n) = -13n2 - 2n + 4. Let a(r) = 6h(r) - 7p(r). Is a(11) a prime number? False Suppose 104 = 4m + 5h, 0 = -2m + 5h + 67 + 15. Suppose 95 + m = -2b. Let c = -10 - b. Is c a composite number? False Let s(j) = 119j*3 - 3j*2 + 2j - 2. Let y be s(2). Let k = 3275 - y. Is k composite? False Suppose c - w = 0, 3 = 3c - 2w + 1. Let g be ((-2)/c)/((-1)/2). Is (g/(-3))/((-6)/1269) a composite number? True Let o be 11/44 - ((-19523)/4 + 0). Suppose 4u = -w + o, 1 + 4 = w. Is u prime? False Let h(p) = 435p*2 + 14p - 42. Is h(5) a composite number? False Let c = -5226 - -9005. Is c a composite number? False Let d be 2/(8/28)1. Let z(n) = 15n + 4. Let x be z(d). Let b = x + -3. Is b composite? True Suppose 33 = -4c + 1. Let p = 11 + c. Suppose -u = -pj + 339, 0j + 4j + 5u - 452 = 0. Is j composite? False Let x = -47 - -222. Suppose 4y - x = 197. Is y a prime number? False Suppose -4y + 84 = -y. Suppose 14 = 2g - y. Let a = g + 26. Is a composite? False Suppose 27w = 8w + 26543. Is w a composite number? True Let o(q) be the third derivative of -5q4/24 - 7q*3/6 - 4q*2. Let k be o(-7). Let u = 39 + k. Is u composite? False Suppose 0 = 3f - k + 6k - 2684, -2f = k - 1787. Is f a composite number? True Suppose 0 = 3p - 0k + 3k - 567, 0 = -5p + 5k + 965. Is p composite? False Suppose -9805 = -14h + 9h. Is h prime? False Suppose 9s + 711 = 10s. Let u = -224 + s. Let d = 936 - u. Is d a composite number? False Is 6(1343/6 - -3) composite? False Let p = 21 - 16. Is 10/p + 992 + -1 prime? False Let z(o) = 756o2 - 20o - 4. Let m(h) = 757h2 - 19h - 5. Let y(i) = -5m(i) + 4z(i). Let g be y(-6). Is (-1)/(-8) - g/24 a composite number? True Let v(z) = 4z3 + 6z*2 + z - 7. Let j(q) = -5q*3 - 6q*2 - q + 8. Let y(u) = 5j(u) + 6v(u). Let p be y(6). Suppose pr - 464 = 28. Is r a prime number? False Let g(j) = 3j2 - 22j - 10. Let r be g(8). Let d(b) = -b*3 + 10b*2 + 4b - 10. Is d(r) composite? True Suppose i = 5j + 104, 88 = -4j - 2i - 2i. Let r be 4/14 + 237/j. Is ((-1)/2)/(r/946) prime? True Suppose 17 = -x - 4f - f, -3x + 2f + 34 = 0. Suppose 3p - x + 38 = 0. Is (-2112)/(-40) - 2/p a composite number? False Suppose 32j - 34j + 326 = 0. Is j a composite number? False Is ((-2480334)/(-136))/((-3)/(-20)) prime? False Let y(i) = i + 22. Let k be y(-20). Suppose 1166 = -0v + kv. Is v a composite number? True Suppose 17015 + 642 = k. Is k a prime number? True Let u be (-22)/(-110) - 39612/10. Let k = 6718 + u. Is k composite? True Suppose -14h + 12h = 4. Let l be h/4(-1884)/3. Suppose -l = -c - c. Is c prime? True Let q = 197795 + -105244. Is q a prime number? True Let i be ((-25)/15)/(2/(-6)). Is 14767/i - 10/25 prime? True Suppose 0 = -w + 2 - 7. Is (115/w)/(1/(-5)) a composite number? True Suppose 3 = -3q + 9. Suppose -3r = -3b - 1362, 0b - 2b = qr - 896. Is r a composite number? True Is (1/(-2))/((-10)/(-3970))-38 composite? True Let d(p) = -6 - 3p + p - p2 + 3 + 2. Let o be d(-3). Is 232 - 26/o prime? False Let q = 1 + 6. Let z be ((-7)/(q/(-3)))/1. Suppose -zu - 5l + 693 = -1005, -4u + 2290 = -2l. Is u a prime number? True Suppose -4a + 1 = -3. Suppose -o = -a - 4. Suppose -s - oc = -2, -5c - 3 = -2c. Is s a prime number? True Let s(z) = z - 1. Let v(m) = 3m + 7. Let d(f) = -4s(f) + v(f). Let t be d(-12). Let a = t + 34. Is a composite? True Let s be (0 + 0)(-3)/6. Let d be 3 + s/(20/4). Suppose 2y = dq - 397, -755 + 249 = -4q - 2y. Is q prime? False Suppose 3d = -5b + 84, 2b - b = 0. Is (-2)/(-3) - d/(-3) a composite number? True Suppose 6 = 2t, 4t + 6 = n + 18. Is (n - -1)/((-1)/(-703)) a composite number? True Suppose 5t - 20v = -15v + 72450, t - 14496 = -5v. Is t composite? True Let l = 249506 - 50611. Is l a prime number? False Let h(z) = 3z2 + 5z + 1. Let x be h(-2). Let m be -4 -	{ "pile_set_name": "DM Mathematics" }
)/(-10)). Put 2/5, -28, w in ascending order. -28, w, 2/5 Let r = -1 + 2. Suppose -6a - 20 = -2. Put a, r, 4 in increasing order. a, r, 4 Let l = -0.053 - -2.953. Let o = -1.1 - l. Put -3, o, 5 in ascending order. o, -3, 5 Let u be (-4)/(1 + 0 + -2). Suppose -4k - 28 = 4w, -4k + w = -3w + u. Put -1, 3, k in descending order. 3, -1, k Let c = -0.35 + 3.35. Sort -5, -0.4, 0.2, c in ascending order. -5, -0.4, 0.2, c Let x be 28/12 + -2 - (-14)/(-6). Sort 3, x, -11. -11, x, 3 Let y be (-50)/18 - 2(-12)/8. Put y, 5, -1/5 in descending order. 5, y, -1/5 Let h = 23 + -38. Let k = h - -11. Sort 1/8, k, 1/4 in descending order. 1/4, 1/8, k Suppose -2c + 30 = -5c. Let l(o) = o + 12. Let s be l(c). Suppose sg = g. Put 4/5, -5, g in increasing order. -5, g, 4/5 Suppose -12t + 10t - 6 = 0. Sort 0, 1, t in decreasing order. 1, 0, t Let i = -0.6 + 3.6. Sort 0.02, 5, i in ascending order. 0.02, i, 5 Let p(z) = 3z + 8z2 - 7z*2 - 4z. Let r be p(3). Put r, -4, 3 in decreasing order. r, 3, -4 Let y = 79/42 + 35/6. Let b = -277/35 + y. Sort b, 2, -5 in ascending order. -5, b, 2 Let c be (-10)/35 + 65/7. Let a = c - 4. Let s(b) = b*2 - 8b + 8. Let z be s(7). Put -1, a, z in ascending order. -1, z, a Suppose 0t + 8 = 2t. Sort -5, -4, t. -5, -4, t Let s = 0.037 - -4.963. Put s, -0.2, 2/21 in descending order. s, 2/21, -0.2 Let q(u) = 2u2 + u + 2. Let l be q(-1). Suppose -lt - 2t = -10. Sort t, -5, -2 in descending order. t, -2, -5 Let a = -19.8 - -16. Let d = -4 - a. Let q = -0.01 - 0.39. Sort q, 0.4, d in ascending order. q, d, 0.4 Suppose -r = -7 + 3. Let u be ((-65)/(-3))/(r/6). Let f = u + -127/4. Sort 3, f, 4 in increasing order. f, 3, 4 Suppose -c = 3 - 0. Let v be -3(-2)/(-16). Sort c, v, -4 in decreasing order. v, c, -4 Let m(h) = 2h*2 + 5h - 7. Let k be m(-4). Sort -2, 3, 0.3, k. -2, 0.3, 3, k Let b = -0.3 + 0. Let s = -0.3 - -0.6. Sort b, 1, s in decreasing order. 1, s, b Suppose r + 2r - 60 = 0. Let h = r - 25. Put -3, h, 0 in descending order. 0, -3, h Suppose -y = -2r + 4r + 12, y + 5r + 21 = 0. Put -4, -5, y in descending order. -4, -5, y Suppose -n + 3n = 0. Sort 1, 2, n in descending order. 2, 1, n Let r = -2 - -2.05. Let z = r - -4.95. Let p = -1 + z. Put 0.1, 2, p in descending order. p, 2, 0.1 Let v = -3 + 2.9. Let t = -0.3 + v. Let w = t + 2.4. Sort -0.2, w, -1/10 in increasing order. -0.2, -1/10, w Let y = -50/11 + 48/11. Put 5, 1/5, -0.2, y in descending order. 5, 1/5, y, -0.2 Let k(i) = -6i3 + 1. Let q be k(1). Let j(w) = w2 - w + 1. Let u be j(1). Suppose t = 2t + u. Put q, 4, t in descending order. 4, t, q Let o = -4 + 12. Let s = -9 + o. Let t = -7 - -2. Put s, t, 3 in descending order. 3, s, t Suppose 2k - 4 + 6 = 0. Let x = 3 + k. Suppose 2y - x = 4j, -15 = -5y + 2j + 6. Sort 4, y, 2 in descending order. y, 4, 2 Let s be 2 + 1/((-10)/21). Let h = -67/3 + 23. Put s, -1/5, h in descending order. h, s, -1/5 Suppose 2u - 4i = 24, -8 = u - 0u + 2i. Let k be (6/5)/(4/10). Suppose 3n + k = -12. Sort n, -1, u in increasing order. n, -1, u Let s(x) = -2x*3 - 3x*2 - 4x - 3. Let a be s(-2). Let b(y) = 3y - y - 5y + 2y + 12. Let v be b(a). Sort -5, v, 2 in ascending order. -5, 2, v Let t = -2.19 - -7.19. Let p = 2 + -4. Sort p, -1/4, t. p, -1/4, t Let y be 3/(-27)-1(2 - 3). Sort -1/3, 5, 1/2, y. -1/3, y, 1/2, 5 Suppose 2q + 3q - 20 = 0. Suppose -6 = j - q. Put 1, 0, j in decreasing order. 1, 0, j Let b be 1/5 + 54/30. Sort b, -2/5, -2/11 in increasing order. -2/5, -2/11, b Let g = 6.29 + -0.29. Put -3/2, g, 0.2, 3 in descending order. g, 3, 0.2, -3/2 Let b be (60/35 + -1)14/2. Let d(g) = g*3 - 5g*2 - 8g + 7. Let c be d(6). Sort 4, b, c in increasing order. c, 4, b Let q = -8 - -11. Let g = 350 + -4552/13. Let h = 2.04 - 0.04. Put q, h, g in descending order. q, h, g Suppose 5 = 5g, -1 = 2t - g + 4. Let m be 15/(-5) - 7/(-1). Suppose -4s = 4f + 8, 0 = -2f + ms - 2 - 8. Sort f, -5, t in descending order. t, f, -5 Let x be (3/2)/(27/(-4)). Let m = 1/12 - -29/84. Sort -1/3, x, m. -1/3, x, m Let p(a) = 1 - 7 - a + 3. Let i be p(-5). Let w = -1 + 2. Put 4, w, i in decreasing order. 4, i, w Let z = -42 - -46. Let c be 6-1 + (1 - 1). Sort -1, z, c in decreasing order. z, -1, c Let n = 0.53 - -0.07. Let t = 0.2 - n. Sort 0.1, t, 0 in decreasing order. 0.1, 0, t Let t(a) = -5a + 2. Let z be t(1). Sort z, -2/3, 0.3, -12/7 in ascending order. z, -12/7, -2/3, 0.3 Let x be (-1)/2 + (-10)/(-4). Let h be 2/(-6)-16 - (-2)/3. Sort x, -5, h in descending order. h, x, -5 Let x = -3 - -5. Suppose 5u - 4u = 10. Let i = 15 - u. Put x, 3, i in descending order. i, 3, x Let o(d) = d3 - 5d*2 - 5d - 7. Let s be o(6). Let m be -1 - (4/s)/(-1). Suppose -2w = -5w + 15. Sort -3, w, m in ascending order. m, -3, w Let l = 33041/6 - 5593. Let o = l - -86. Let f be (31/(-28) - -1)/(14/(-56)). Sort f, 0.5, o in decreasing order. 0.5, f, o Let a = 108 - 110. Suppose 3g = 4y + 43, -g + 10 + 2 = -y. Sort a, 1, y in descending order. 1, a, y Let s be (2 - -1 - 3)/1. Suppose -2v - 8 + s = 4a, 5v + 10 = 0. Put a, 4, -2 in descending order. 4, a, -2 Let c = 1 + -0.9. Let a be (0/(-7))/3 - 4/(-26). Put a, c, -0.1 in ascending order. -0.1, c, a Suppose 3c = c + 6. Suppose -10 = -3l + 2f - 5, -cl - 5f - 2 = 0. Put l, 6, -3 in decreasing order. 6, l, -3 Let a = 0.05 + -0.55. Let o = 0.5 + a. Sort -0.3, 3/8, o in ascending order. -0.3, o, 3/8 Suppose -11b = b - 12. Put b, -3, 0.01 in descending order. b, 0.01, -3 Let p(m) = -5 - 2 - 1 + 4m*2 - 3m*2 + 4m. Let g be p(-6). Suppose -1 + 3 = 2t. Sort t, 3, g in descending order. g, 3, t Let w = -0.13 - -0.01. Let x(t) = t3 - 11t*2 + 32t - 29. Let q be x(7). Sort w, q, 0.3 in decreasing order. 0.3, w, q Let t = -0.17 - -10.17. Let g = t + -14. Put g, 0.4, 5 in ascending order. g, 0.4, 5 Let v = 128 - 126. Put v, 1, 8, -3/7 in decreasing order. 8, v, 1, -3/7 Let b = 4.6 + -6.6. Let z = -2 + 1.6. Sort z, b, 5 in increasing order. b, z, 5 Let t = -67/63 - -9/7. Sort 5, t, -3/5 in decreasing order. 5, t, -3/5 Let f = -0.05 + -0.65. Sort -1/7, 2/9, f. f, -1/7, 2/9 Let r be 113/(-3). Sort r, 7, -4 in descending order. 7, r, -4 Suppose 3a + 39 = 2g, 3g = -3a + 49 + 47. Suppose 18 = 3p - w, -g = -3p + 3w + w. Let q be (-1 + -2)/3 + 2. Put p, q, -2 in descending order. p, q, -2 Suppose -4l = -l + 2h + 9, 35 = -4l + 5h. Let f = 8 - 4. Put -4/5, l, f in decreasing order. f, -4/5, l Let z = 22/155 + 8/31. Let v = -3.22 + -0.08. Let k = -3 - v. Sort 2/3, k, z in increasing order. k, z, 2/3 Let c(s) = -5s - 37. Let o be c(-7). Let w = -2 + 1. Sort o, w, -2/5 in descending order. -2/5, w, o Let a be (-3)/(-12)-210. Suppose -v - 2h = -7, -4h + 15 = 4v + 3. Sort v, a, -4 in decreasing order. v, -4, a Let y = -0.2 - -3.2. Let c = -3 - -2.8. Let a = -0.6 - c. Sort y, 2/9, a in descending order. y, 2/9, a Let r = -223/70 + 29/10. Put r, -0.3, 5 in decreasing order. 5, r, -0.3 Let m = 0.4 + -0.45. Let x = m + 0.55. Put x, -5, 5 in increasing order. -5, x, 5 Suppose 0 = 4v - 11 + 23. Put -4, 4, v in ascending order. -4, v, 4 Let t = -69 - -74. Sort 1, t, 0, -4 in ascending order. -4, 0, 1, t Let h = -8 + 5. Sort 2, -1, h in increasing order. h, -1, 2 Let h = 5 + -3. Suppose -f - 3q + hq = -3, 5f - 33 = 4q. Put -4, f, -5 in decreasing order. f, -4, -5 Let k = 5 - 7. Let m be (-4 - 2)1/k. Suppose 2w - 4 = mp, 4p - w + 2 = 9p. Sort 5, 3, p in decreasing order. 5, 3, p Let n be 1 + 3 + (-820)/200. Put -3, -0.5, n in decreasing order. n, -0.5, -3 Let x(w) = w + 4 + 3 + 0. Let y be x(-5). Let b(q) = -q2 + 11q - 15. Let u be b(9). Put 4, y, u in ascending order. y, u, 4 Let v = -3.2 + 2.8. Let w(y) be the third derivative of -y4/24 + y3 + y*2. Let t be w(6). Put v, -5, t in ascending order. -5, v, t Suppose -2v = 2 + 18. Let i = v + 13. Sort 1, i, 0 in ascending order. 0, 1, i Let r be (15/(-6) - -3)-2. Let l be -3 + -3(r + 0). Sort l, 2, -3 in descending order. 2, l, -3 Let k(u) = u - 8. Suppose -3o + 14 = 2. Let h be k(o). Let n = 2.1 + -0.1. Sort h, n, 1/7. h, 1/7, n Let w = 6 - 9. Sort w, -1, 0. w, -1, 0 Let w = 0.062 - 3.062. Sort w, 2/9, -20. -20, w, 2/9 Let q be ((-63)/(-27) + (-2)/6)1. Sort -0.2, 0.4, q, 0.2 in decreasin	{ "pile_set_name": "DM Mathematics" }
of 31541254. 2, 19, 53, 15661 What are the prime factors of 1992975377? 53, 461, 81569 List the prime factors of 104630195. 5, 3259, 6421 List the prime factors of 178518864. 2, 3, 1223, 3041 What are the prime factors of 3717854033? 167, 22262599 What are the prime factors of 190332476? 2, 17, 673, 4159 List the prime factors of 543438437. 19, 28602023 List the prime factors of 1040259981. 3, 346753327 What are the prime factors of 463640581? 8821, 52561 List the prime factors of 85118439. 3, 7, 17, 34061 List the prime factors of 113062005. 3, 5, 7, 151, 2377 List the prime factors of 40592356. 2, 7, 167, 8681 What are the prime factors of 1353325326? 2, 3, 43, 1223, 4289 What are the prime factors of 52442438? 2, 23, 461, 2473 What are the prime factors of 942732662? 2, 471366331 List the prime factors of 2584218530. 2, 5, 151, 983, 1741 What are the prime factors of 15772905? 3, 5, 41, 83, 103 What are the prime factors of 1144788164? 2, 13, 22015157 What are the prime factors of 149819235? 3, 5, 9987949 What are the prime factors of 949459318? 2, 179, 347, 7643 List the prime factors of 5006653213. 41, 122113493 List the prime factors of 4447190701. 17, 313, 877, 953 What are the prime factors of 1860528118? 2, 29, 823, 38977 List the prime factors of 776806919. 7, 110972417 List the prime factors of 2872008306. 2, 3, 53185339 List the prime factors of 99431071. 2281, 43591 List the prime factors of 1847892247. 107, 151, 114371 List the prime factors of 3309537494. 2, 31, 67, 796711 What are the prime factors of 968394847? 7, 3361, 41161 What are the prime factors of 4895821? 7, 331, 2113 What are the prime factors of 511906300? 2, 5, 5119063 List the prime factors of 16950447. 3, 1883383 List the prime factors of 1485815096. 2, 17, 10925111 What are the prime factors of 67521197? 67521197 What are the prime factors of 27228494? 2, 13614247 What are the prime factors of 188476849? 11, 3359, 5101 What are the prime factors of 2437799375? 5, 11, 139, 2551 List the prime factors of 4246933729. 4246933729 What are the prime factors of 73582680? 2, 3, 5, 613189 What are the prime factors of 319366253? 397, 804449 What are the prime factors of 2930734568? 2, 4241, 86381 What are the prime factors of 157998567? 3, 52666189 List the prime factors of 221391838. 2, 19, 773, 7537 List the prime factors of 317358575. 5, 12694343 What are the prime factors of 3395562091? 31, 109534261 List the prime factors of 1549456265. 5, 7, 44270179 What are the prime factors of 1731842277? 3, 11, 61, 173, 4973 List the prime factors of 27648666. 2, 3, 1536037 List the prime factors of 937677495. 3, 5, 37, 47, 103, 349 What are the prime factors of 46746239? 379, 123341 What are the prime factors of 676255316? 2, 11, 15369439 What are the prime factors of 28248807? 3, 23, 43, 9521 List the prime factors of 58159435. 5, 43, 270509 What are the prime factors of 2712366100? 2, 5, 73, 569, 653 What are the prime factors of 2122384166? 2, 7, 151598869 What are the prime factors of 283965818? 2, 131, 1083839 What are the prime factors of 41922751? 13, 103, 131, 239 What are the prime factors of 30577846? 2, 13, 6959 List the prime factors of 5117135815. 5, 11, 4751, 19583 List the prime factors of 609765661. 37, 173, 95261 What are the prime factors of 90609568? 2, 7, 404507 What are the prime factors of 1098409703? 19, 57811037 What are the prime factors of 5582724510? 2, 3, 5, 11, 211, 80177 List the prime factors of 115488235. 5, 67, 103, 3347 List the prime factors of 3750494. 2, 11, 227, 751 What are the prime factors of 41582695? 5, 7, 11, 108007 What are the prime factors of 239441093? 167, 1097, 1307 What are the prime factors of 188234186? 2, 7, 29, 107, 619 List the prime factors of 3643634886. 2, 3, 607272481 List the prime factors of 22156967. 7, 17, 67, 397 What are the prime factors of 217271931? 3, 971, 74587 What are the prime factors of 3394444485? 3, 5, 17, 13311547 What are the prime factors of 217613158? 2, 7, 17, 29, 41, 769 What are the prime factors of 33375640? 2, 5, 41, 47, 433 List the prime factors of 4789819690. 2, 5, 23, 107, 191, 1019 List the prime factors of 50958759. 3, 71, 239243 What are the prime factors of 781409019? 3, 3061, 85093 List the prime factors of 25411697. 25411697 List the prime factors of 126208959. 3, 47, 557, 1607 What are the prime factors of 145519941? 3, 7, 29, 238949 List the prime factors of 378024211. 113, 131, 25537 List the prime factors of 1162095639. 3, 17, 853, 26713 List the prime factors of 1157449888. 2, 7, 5167187 What are the prime factors of 128324923? 128324923 List the prime factors of 181585416. 2, 3, 7566059 List the prime factors of 276974756. 2, 69243689 List the prime factors of 1406790634. 2, 701, 1003417 What are the prime factors of 26313958? 2, 11, 1196089 List the prime factors of 47527088. 2, 7, 73, 5813 List the prime factors of 25735275. 3, 5, 23, 4973 What are the prime factors of 3642077605? 5, 19, 38337659 What are the prime factors of 5698346? 2, 2849173 List the prime factors of 676494521. 179, 3779299 List the prime factors of 99962810. 2, 5, 109, 293, 313 List the prime factors of 7843077. 3, 11, 227, 349 List the prime factors of 74649063. 3, 24883021 List the prime factors of 475333130. 2, 5, 47533313 What are the prime factors of 601276258? 2, 11, 23, 1188293 List the prime factors of 252140719. 17, 1657, 8951 List the prime factors of 337180891. 149, 2262959 What are the prime factors of 398765059? 7, 11, 31, 15187 List the prime factors of 120391901. 7, 137, 125539 What are the prime factors of 188859133? 188859133 List the prime factors of 426936868. 2, 109, 317, 3089 What are the prime factors of 2374961717? 2374961717 What are the prime factors of 80517685? 5, 313, 51449 What are the prime factors of 509755287? 3, 169918429 What are the prime factors of 79618578? 2, 3, 13, 1020751 What are the prime factors of 48271038? 2, 3, 8045173 What are the prime factors of 41271982? 2, 23, 181, 4957 List the prime factors of 1706061755. 5, 613, 556627 What are the prime factors of 145122505? 5, 11, 571, 4621 List the prime factors of 279733075. 5, 79, 141637 List the prime factors of 70701372. 2, 3, 7, 280561 What are the prime factors of 126563493? 3, 7, 1259, 4787 List the prime factors of 77870140. 2, 5, 31, 125597 List the prime factors of 142515342. 2, 3, 37, 71329 List the prime factors of 2983786083. 3, 131, 2530777 What are the prime factors of 21936623? 31, 707633 What are the prime factors of 1102333078? 2, 7, 11, 71, 181, 557 What are the prime factors of 433530583? 17, 25501799 What are the prime factors of 1335740304? 2, 3, 43, 647161 List the prime factors of 1466486605. 5, 293297321 What are the prime factors of 1184315326? 2, 859, 689357 List the prime factors of 1526912769. 3, 163, 1051, 2971 List the prime factors of 2493030248. 2, 311628781 List the prime factors of 664412972. 2, 17, 9770779 List the prime factors of 273530493. 3, 17, 595927 List the prime factors of 100475647. 100475647 List the prime factors of 140944212. 2, 3, 17, 25589 List the prime factors of 2597673430. 2, 5, 11, 37, 43, 14843 List the prime factors of 160715498. 2, 107, 751007 What are the prime factors of 1740253503? 3, 580084501 What are the prime factors of 268655581? 268655581 What are the prime factors of 204944589? 3, 22771621 List the prime factors of 71381912. 2, 7, 17, 97, 773 List the prime factors of 777336037. 19, 23, 1778801 List the prime factors of 294675910. 2, 5, 3917, 7523 List the prime factors of 6714435. 3, 5, 7, 13, 4919 List the prime factors of 138321861. 3, 46107287 What are the prime factors of 342297598? 2, 31, 5520929 What are the prime factors of 802773434? 2, 1979, 202823 List the prime factors of 7983262. 2, 7, 570233 List the prime factors of 36218287. 7, 1193, 4337 List the prime factors of 1918458317. 127, 2203, 6857 List the prime factors of 234805879. 7, 11, 3049427 What are the prime factors of 2950134993? 3, 13, 167, 50329 List the prime factors of 60573181. 37, 241, 6793 What are the prime factors of 4671520720? 2, 5, 58394009 What are the prime factors of 432828750? 2, 3, 5, 115421 What are the prime factors of 221663516? 2, 31, 173, 10333 List	{ "pile_set_name": "DM Mathematics" }
, s: 3}. 1/42 Two letters picked without replacement from jjjrtrtkjrtktyryaar. What is prob of sequence ra? 5/171 What is prob of sequence bh when two letters picked without replacement from hhhhbhhzhhshh? 5/78 What is prob of sequence orh when three letters picked without replacement from hroerrhhrhhhoxoo? 1/35 Four letters picked without replacement from oyyvyhj. What is prob of sequence hvyy? 1/140 What is prob of sequence yy when two letters picked without replacement from {k: 1, h: 5, y: 3, w: 3}? 1/22 Four letters picked without replacement from qaaqgccqco. What is prob of sequence qacq? 1/140 What is prob of sequence xrfr when four letters picked without replacement from {w: 5, r: 2, x: 3, e: 1, f: 1}? 1/1980 What is prob of sequence mlmm when four letters picked without replacement from nnmnmxmmmmnlm? 7/572 Four letters picked without replacement from zbkkzkbbkbbzkbk. Give prob of sequence zzkb. 3/455 What is prob of sequence ppp when three letters picked without replacement from {d: 1, p: 7}? 5/8 What is prob of sequence gghh when four letters picked without replacement from {g: 11, h: 9}? 22/323 What is prob of sequence lh when two letters picked without replacement from {h: 11, l: 1}? 1/12 Calculate prob of sequence jc when two letters picked without replacement from {c: 2, j: 2, w: 1, o: 1, g: 1, p: 2}. 1/18 Two letters picked without replacement from bbbbwwbbbwwww. Give prob of sequence bw. 7/26 Calculate prob of sequence dddd when four letters picked without replacement from ddwddddddwddwdddww. 143/612 Four letters picked without replacement from {g: 9, i: 4, j: 1}. Give prob of sequence igji. 9/2002 Two letters picked without replacement from rsrssrqswwwsrsq. Give prob of sequence ss. 1/7 Two letters picked without replacement from {v: 1, w: 3}. What is prob of sequence vw? 1/4 Four letters picked without replacement from {s: 1, e: 1, d: 3, n: 1, z: 1, u: 5}. What is prob of sequence uzde? 1/792 Two letters picked without replacement from {l: 1, w: 3, q: 1}. What is prob of sequence wq? 3/20 Four letters picked without replacement from tttftfttttftfftttf. Give prob of sequence fttt. 11/102 Three letters picked without replacement from {u: 1, m: 2, d: 2, g: 1, p: 2}. What is prob of sequence mpp? 1/84 Two letters picked without replacement from boybnsbsosss. What is prob of sequence bs? 5/44 Three letters picked without replacement from {x: 15, o: 5}. What is prob of sequence oox? 5/114 Two letters picked without replacement from {b: 2, j: 1, q: 1, e: 1, y: 1, h: 1}. What is prob of sequence by? 1/21 What is prob of sequence ppp when three letters picked without replacement from {l: 4, p: 6}? 1/6 What is prob of sequence tyq when three letters picked without replacement from {t: 10, w: 1, q: 4, y: 3}? 5/204 What is prob of sequence hash when four letters picked without replacement from shah? 1/12 Two letters picked without replacement from {s: 5, q: 3, p: 4, w: 7}. Give prob of sequence qw. 7/114 Four letters picked without replacement from {l: 7, p: 2, j: 1, o: 2}. Give prob of sequence ollo. 7/990 Two letters picked without replacement from lvvz. What is prob of sequence vl? 1/6 Calculate prob of sequence wwwv when four letters picked without replacement from {j: 3, p: 1, v: 3, w: 6}. 3/143 Calculate prob of sequence rxoo when four letters picked without replacement from orrrxxoooo. 1/42 Calculate prob of sequence zzv when three letters picked without replacement from zaviiaiziav. 2/495 What is prob of sequence qtqq when four letters picked without replacement from {q: 4, n: 1, t: 1, o: 1, u: 4, s: 3}? 1/1001 Four letters picked without replacement from munnnunnnnnnurnuunm. What is prob of sequence rmum? 5/46512 Four letters picked without replacement from {p: 2, o: 6, l: 7}. What is prob of sequence oplp? 1/390 Calculate prob of sequence xm when two letters picked without replacement from {x: 1, a: 5, m: 4}. 2/45 What is prob of sequence ceec when four letters picked without replacement from {e: 2, c: 3}? 1/10 Four letters picked without replacement from euuukxhhxuehhhfxhxe. Give prob of sequence exex. 1/1292 What is prob of sequence htt when three letters picked without replacement from thhhhhthhthh? 9/220 Calculate prob of sequence xb when two letters picked without replacement from {b: 3, x: 11}. 33/182 Four letters picked without replacement from dedd. What is prob of sequence dded? 1/4 Two letters picked without replacement from {e: 1, m: 2, f: 1, u: 1, j: 2, y: 2}. What is prob of sequence jm? 1/18 Two letters picked without replacement from rfwwfwf. What is prob of sequence rf? 1/14 Three letters picked without replacement from qvqqjjaqqvqq. What is prob of sequence qvq? 7/110 Calculate prob of sequence fkkk when four letters picked without replacement from kookokooooookfokoof. 5/3876 Calculate prob of sequence ll when two letters picked without replacement from leelelelelle. 5/22 Four letters picked without replacement from dedpapaddepd. What is prob of sequence epae? 1/990 Three letters picked without replacement from rrouuoobur. What is prob of sequence bro? 1/80 What is prob of sequence pwc when three letters picked without replacement from mcwmmopmmwmmmmmmpowm? 1/1140 Three letters picked without replacement from {t: 2, r: 3, n: 3, e: 2, b: 1, y: 1}. Give prob of sequence brn. 3/440 Two letters picked without replacement from eeesheshehseh. Give prob of sequence es. 3/26 Three letters picked without replacement from hbykybyhyl. What is prob of sequence hyb? 1/45 Three letters picked without replacement from {a: 1, d: 1, m: 1, z: 1, v: 1}. What is prob of sequence daz? 1/60 What is prob of sequence vqh when three letters picked without replacement from {a: 13, q: 3, v: 3, h: 1}? 1/760 What is prob of sequence jjde when four letters picked without replacement from {d: 1, j: 6, e: 7}? 5/572 Two letters picked without replacement from nnnnnnffmnnnhwnfen. Give prob of sequence hn. 11/306 Calculate prob of sequence ane when three letters picked without replacement from acxxacxacncxen. 1/364 Four letters picked without replacement from {k: 9, t: 10}. Give prob of sequence tttk. 45/646 Two letters picked without replacement from rsrssnuyryrar. Give prob of sequence yu. 1/78 Two letters picked without replacement from {n: 3, s: 4}. Give prob of sequence ss. 2/7 Four letters picked without replacement from itittttztivt. What is prob of sequence zvtt? 7/1980 Two letters picked without replacement from {z: 5, p: 3, l: 3, y: 4, t: 4}. Give prob of sequence pt. 2/57 Calculate prob of sequence gg when two letters picked without replacement from iiigiigii. 1/36 Calculate prob of sequence pwo when three letters picked without replacement from jjyjyppwjobp. 1/440 Calculate prob of sequence qhh when three letters picked without replacement from {q: 2, h: 4, s: 1}. 4/35 Three letters picked without replacement from xxxtxtxxxxtxxxx. What is prob of sequence xtx? 66/455 Calculate prob of sequence fv when two letters picked without replacement from vvffvzvfz. 1/6 Two letters picked without replacement from vppvppqqppppqpp. What is prob of sequence vv? 1/105 Four letters picked without replacement from {k: 14, o: 5}. What is prob of sequence kkoo? 455/11628 Calculate prob of sequence tttr when four letters picked without replacement from ttrttpttn. 5/126 What is prob of sequence gg when two letters picked without replacement from {n: 2, g: 7}? 7/12 Three letters picked without replacement from rrrrrrrrberrrr. Give prob of sequence rer. 11/182 What is prob of sequence tqsw when four letters picked without replacement from sesseqsetwqwqhw? 1/910 What is prob of sequence hhm when three letters picked without replacement from zmhzhzzzhhhhhz? 1/52 What is prob of sequence iwwi when four letters picked without replacement from wwwii? 1/10 Four letters picked without replacement from vvavavvv. What is prob of sequence vava? 1/28 Two letters picked without replacement from iddssodiosd. Give prob of sequence io. 2/55 What is prob of sequence gjg when three letters picked without replacement from rjrjgrrgggyyjgj? 8/273 What is prob of sequence jcdd when four letters picked without replacement from vvvjddvjcjjdvjd? 1/546 Four letters picked wit	{ "pile_set_name": "DM Mathematics" }
+ 8p + 2 + 6p + up2. 2(p - 1)*2 Let r be 35486/(-143) - 4/(-26). Let t = 1740/7 + r. Solve 8/7m*3 - 2m*2 + 0 + 8/7m*4 + tm = 0 for m. -2, 0, 1/2 Suppose 0 = 5h - 6h + 8. Suppose -s*2 + 2s*3 - hs - 4s3 + 9s*2 = 0. Calculate s. 0, 2 Let p = -11 - -11. What is o in 7/2o*3 - 5/2o4 - o2 + p + 0o = 0? 0, 2/5, 1 Let v(a) = -a3 - 10a*2 + 11a + 6. Let k(j) = -15j3 - 140j*2 + 155j + 85. Let t(s) = -6k(s) + 85v(s). Suppose t(h) = 0. Calculate h. 0, 1 What is t in -2/5t3 + 0 + 2/5t*2 + 4/5t = 0? -1, 0, 2 Let x = 19 + -17. Factor c + 5c3 - xc*3 - 5c + c*3. 4c(c - 1)(c + 1) Let v(r) = -2r3 + 4r*2 + 2r - 8. Let s(f) = f*2 - f - 1. Let c(o) = -4s(o) + v(o). Factor c(w). -2(w - 1)2(w + 2) Let i = 0 - -5. Let 0m3 - im*4 - 6m*4 - 10m*3 - 3m*4 + 4m2 = 0. Calculate m. -1, 0, 2/7 Let o(z) be the second derivative of z4/6 - z*3/3 - 6z. Find n, given that o(n) = 0. 0, 1 What is b in -b*4 - 1 + 2b*3 + 2b + 2 - 4b3 = 0? -1, 1 Let m = -15 + 17. What is n in 4 - 85n + 89n + 2n2 - n2 - 4n3 - 5n*m = 0? -1, 1 Let z = 3 + 0. Find d, given that 2d*2 + 3d*4 - 5d*4 - 4d*z + 4d4 = 0. 0, 1 Let w(a) be the second derivative of a5/15 + 5a4/36 - 7a3/18 - a2/3 - 10a. Factor w(h). (h - 1)(h + 2)(4h + 1)/3 Let w(r) = r*3 - 4r*2 + 4r - 1. Let o be w(3). Let l(g) be the first derivative of -2/3g - 1 - 2/3g*3 - 4/3g*o. What is m in l(m) = 0? -1, -1/3 Let p(s) = -1 + 27s*2 + 12s*3 + 9 + 3s*4 + 18s + 1. Let m(w) = -6w4 - 25w*3 - 54w*2 - 37w - 17. Let d(x) = -3m(x) - 5p(x). Factor d(b). 3(b + 1)3(b + 2) Let x(l) be the first derivative of l*5/10 - 5l*4/8 + 4l3/3 - l2 + 48. Factor x(w). w(w - 2)2(w - 1)/2 Let x(g) be the third derivative of g5/90 + g4/36 + 14g2. Let x(a) = 0. What is a? -1, 0 Suppose -12/5t*2 - 3/5t + 0 - 3t5 + 18/5t*3 + 12/5t*4 = 0. What is t? -1, -1/5, 0, 1 Factor 4/7j*3 - 12/7j - 8/7j2 + 0. 4j(j - 3)(j + 1)/7 Let a(h) be the second derivative of -h*6/105 - 3h*5/70 - 2h - 2. Factor a(g). -2g3(g + 3)/7 Let a(k) be the third derivative of k*8/21 + 34k*7/105 + 2k*6/3 + 4k*5/15 + 16k*2. Factor a(p). 4p*2(p + 2)*2(4p + 1) Let u = -719/630 - -52/45. Let b(m) be the third derivative of 0m*4 + 0m + 4/21m3 - 2m*2 - 1/420m*6 - um*5 + 0. Determine j, given that b(j) = 0. -2, 1 Let y be (-220)/(-330) - (14/6)/(-1). Factor -2/5o*2 + 0 + 1/5o*y + 1/5o. o(o - 1)2/5 Factor b - 3b*2 + 0b*2 - 3 + 5b + 0. -3(b - 1)2 Let n(c) be the third derivative of c5/120 - c4/96 - 17c*2. Solve n(q) = 0. 0, 1/2 Let r be (-2)/(-7) - (-664)/28. Let z be r/14 - 10/(-35). Factor 0h - 1/5hz + 0 + 1/5h*4 + 0h3. h2(h - 1)(h + 1)/5 Let r(l) be the second derivative of -l + 0l5 + 0 + 0l*3 - 1/24l*4 + 1/120l*6 + 1/8l2. Let r(f) = 0. What is f? -1, 1 Let i(b) = -b2 + 3 + 2b + 1 - 3b*2 - 7b*3. Let q(v) = -6v*3 - 4v*2 + 2v + 4. Let l(j) = 4i(j) - 5q(j). Factor l(d). 2(d - 1)(d + 1)(d + 2) Suppose -3r + 1 = -5. Let d = -77 + 79. Factor -4/9 - 14/9md - rm. -2(m + 1)(7m + 2)/9 Factor 4/11 + 14/11j + 6/11j3 + 16/11j*2. 2(j + 1)*2(3j + 2)/11 Let m be 4/((-16)/(-20)) + -2. Suppose 0 = 4x - mx - 2. Find t, given that 0 - 4/7t + 2/7tx = 0. 0, 2 Let v(x) be the second derivative of 3x + 0 - 1/42x4 - 1/21x*3 + 1/70x*5 + 1/7x*2. Factor v(l). 2(l - 1)*2(l + 1)/7 Let q(r) = 7r4 + r3 - 13r*2 - 5. Let t(m) = 6m*4 + 2m*3 - 14m*2 - 6. Let g(n) = 6q(n) - 5t(n). Solve g(o) = 0 for o. -2/3, 0, 1 Let b(v) = -v2 + 4v + 2. Let s be b(4). Let so4 + o4 + 0o*2 + 0o*4 - 3o2 = 0. Calculate o. -1, 0, 1 Let w(l) = -l2 + 34l + 86. Let a(y) = -10y*2 + 305y + 775. Let x(t) = -6a(t) + 55w(t). Factor x(n). 5(n + 4)2 Let z(r) be the first derivative of r4/16 - r3/6 + r2/8 - 5. What is d in z(d) = 0? 0, 1 Let s be (-2)/(-63)2/4. Let t(l) be the second derivative of 2/45l6 + l + 0 - sl*7 - 1/30l*5 + 0l*3 + 0l*2 + 0l*4. Factor t(q). -2q*3(q - 1)*2/3 Let l be 6/(-8)-22. Factor g5 - 3g*3 - 9g + g*l + 10g. g(g - 1)2(g + 1)2 Let l(z) be the first derivative of z3/3 - z*2 - 6. Determine w so that l(w) = 0. 0, 2 Factor -4/5p*3 - 4/5p*5 + 0p*2 + 8/5p*4 + 0 + 0p. -4p3(p - 1)*2/5 Suppose -m + 0m + 1 = 0, -j = -3m + 1. Factor 6z*3 - 5z*3 - 2z*3 - 2zj. -z2(z + 2) Let h(k) be the second derivative of k7/28 + k6/4 + 9k5/20 - k4/4 - 7k3/4 - 9k*2/4 - k + 7. Suppose h(m) = 0. Calculate m. -3, -1, 1 Let p be ((-6)/(-15))/((-4)/(-20)). Factor -187z + 48z3 - 123z*3 - 36 - 131z*p - 5z - 154z2. -3(z + 3)(5z + 2)*2 Let c = -20 - -22. Let n(f) be the first derivative of 0f*3 + 1 + 0f*c - 1/20f*5 - 1/16f*4 + 0f. Factor n(v). -v*3(v + 1)/4 Let p(x) be the second derivative of -x5/8 + x4/12 - 5x. Factor p(i). -i2(5i - 2)/2 Let x(i) = 3i*2 + 2i + 5. Let l(s) = -5s2 - 3s - 8. Let c(w) = 5l(w) + 8x(w). Factor c(f). -f(f - 1) Let r(n) be the third derivative of -n5/30 - n4/6 - 2n2. Determine t so that r(t) = 0. -2, 0 Let f(g) be the third derivative of g7/525 + g6/180 + g5/450 - g*4/180 - 23g*2. Solve f(k) = 0. -1, 0, 1/3 Let i(h) be the second derivative of 0 + 2/21h*3 + h + 0h*2 - 1/42h*4. Factor i(v). -2v(v - 2)/7 Let a(d) = d5 - d3 + d - 1. Let n(i) = -i5 + i3 + 2i - 2. Suppose 2s + 5k - 28 = -9, 3s - 3k = -3. Let m(u) = sa(u) - n(u). Solve m(l) = 0. -1, 0, 1 Let -6 - 3/2b*2 - 15/2b = 0. What is b? -4, -1 Let o(p) be the third derivative of p7/210 + p6/60 - p*5/20 + 25p2. Factor o(q). q2(q - 1)(q + 3) Let o = 10 + -9. Find h, given that -h + 3 + 2h + 2h*4 + o - 3h + 2h3 - 6h*2 = 0. -2, -1, 1 Suppose x = 2x - 3. Solve -6f + 7f*2 + 0f*2 + 8f*2 - 6f*x = 0 for f. 0, 1/2, 2 Let i(k) be the second derivative of -3/16k*2 + 3/80k*5 + 6k + 0 - 1/240k6 - 1/8k*4 + 5/24k*3. Factor i(w). -(w - 3)(w - 1)*3/8 Suppose -3c + c = -5c. Factor cw + 0 - 1/4w5 + 1/2w*4 + 0w*2 - 1/4w3. -w3(w - 1)2/4 Let s = -11 + 11. Let n = 3 - s. Factor 3l*n + 4l*4 - 3l2 - l4 + 0l - 3l. 3l(l - 1)(l + 1)2 Determine t so that -12/11t - 16/11t2 - 2/11t*4 + 12/11t*3 + 18/11 = 0. -1, 1, 3 Let r be (4/(-16)0)/(-1). Let m be 0 + 42/10 - 3. Factor 0j4 + r - mj*3 + 3/5j*5 + 0j*2 + 3/5j. 3j(j - 1)*2(j + 1)*2/5 Let r(l) be the first derivative of -1/3l - 2 - 1/9l3 - 1/3l*2. Determine n, given that r(n) = 0. -1 Let c(f) be the third derivative of -3f*6/80 + 11f*5/40 - 5f*4/16 - 3f*3/4 + 9f*2. Determine l, given that c(l) = 0. -1/3, 1, 3 Suppose -4a = -5d - 0d - 63, -3a + 51 = -5d. Let g be (a/(-16))/((-6)/4). Factor z + g + 1/2z2. (z + 1)2/2 Let k(t) be the first derivative of -t6/150 + 2t*5/75 + 2t*4/15 + 2t*3/3 - 10. Let j(p) be the third derivative of k(p). Factor j(h). -4(h - 2)(3h + 2)/5 Determine p so that 4p - p4 + 4 - 4p*3 - 3p*2 + 2p - p - p = 0. -2, -1, 1 Let g(i) = 5i3 + 7i*2 - 17i - 1. Let k(j) = -j*3 + j + 1. Let n(p) = -g(p) - 6k(p). Solve n(v) = 0. 1, 5 Let c(s) be the first derivative of -3s5/5 - 9s*4/4 + 6s*2 + 5. Factor c(n). -3n(n - 1)(n + 2)2 Let w(l) be the second derivative of -l5/20 - l4/6 - l3/6 - l. Let z(q) = 3q3 + 3q*2 + 3q. Let j(v) = 9w(v) + 4z(v). Solve j(h) = 0 for h. 0, 1 Suppose -4s - 22 = -3s. Let m = -109/5 - s. Solve 0v - mv*2 + 1/5 = 0 for v. -1, 1 Let h(i) be the first derivative of -1/24i*3 + 0i + 2 - 1/8i2. Find c such that h(c) = 0. -2, 0 Let n(u) be the second derivative of -u6/480 + u5/40 - u4/8 + u3/3 - u2/2 + u. Let l(a) be the first derivative of n(a). Factor l(x). -(x - 2)3/4 Let l(y) be the third derivative of y7/210 + y6/20 + y5/5 + y4/3 - 3y2. Let l(x) = 0. Calculate x. -2, 0 Let b(z) = -z3 + z*2 - 3z - 9. Let m(v) = -v*3 + 2v*2 - 2v - 8. Let p(l) = 3b(l) - 4m(l). Factor p(u). (u - 5)(u - 1)(u + 1) Let v = 12 + 2. Let i = v + -8. Factor 4f4 + 2/3f*5 + if + 4/3 + 32/3f2 + 28/3f*3. 2(f + 1)*4(f + 2)/3	{ "pile_set_name": "DM Mathematics" }
17. Is z prime? False Is (-1 - -33187) + 22/(-44)14 prime? True Suppose g + 4034032 = 5p - 4723956, -5254788 = -3p - g. Is p prime? False Let s(j) = -j2 - 16j - 36. Suppose -6z - 3p - 77 = -z, -p - 4 = 0. Let y be s(z). Suppose -5d + d - x = -1992, 5d - yx = 2507. Is d composite? False Let x be 30/10(-4)/16-4. Suppose -6 = -3g, 5s + 2g + 0g = 44. Is x(s/(-12) - -1) + 86 prime? False Suppose -5n + 2749 = 3h + h, 0 = 4h + 2n - 2746. Let f = 376 + -640. Let k = h + f. Is k composite? True Let b = 2124 + -1977. Let l be ((-1011)/6)/((-2)/8). Let c = l - b. Is c a prime number? False Suppose 0 = -5v - 2t + 420723, -18v + 252409 = -15v - 5t. Is v a composite number? False Suppose 2794097 = 58d - 843513 - 1037132. Is d composite? False Let i be (-1883)/(-6) - 4/(-24). Suppose 310t - it + 4444 = 0. Is t a composite number? True Let n be (2 - -1) + (3 - 666/9). Let v = n - -70. Suppose -5y = -5j - 315, vy + j = y + 71. Is y composite? False Suppose 2f = 80 - 54. Suppose fn - 17992 = -3471. Is n a prime number? True Let p = -170 + 176. Let s(d) = 62d3 - d2 - 4d + 35. Is s(p) a composite number? False Suppose -7t - 2a + 4a = -2710573, -3t + 1161693 = -4a. Is t prime? False Suppose -4n = 3p - 33, -4p + 51 = 4n + 15. Suppose -3o + n = 0, 3o + 320 = 5i - 29. Suppose -m + i = -18. Is m a prime number? True Suppose 0 = -l - 4z + 153529, 3l - 388576 = -5z + 72018. Is l composite? False Let j be 42 + -2 + -3 + 3. Suppose js + 3409 = 47s. Is s a composite number? False Let g(v) = v*3 + 9v*2 + 7v - 8. Let m be g(-8). Suppose m = r - 0r. Suppose r = -q + 34 - 8. Is q a composite number? True Let x(y) = -y2 - 10y + 16190. Let p be x(0). Suppose -4g + p = -13286. Is g composite? False Is (1 - 30/21 - 2038734/(-126)) + 3 a composite number? False Let s be 1/(35/10 - 3). Let n be s/6 + 8/3. Suppose -2k = 5p - 395, -59 + 375 = 4p - nk. Is p prime? True Let b = -77 + 181. Let q = 107 - b. Is 102/2(3 - -3) - q prime? False Let l be 551 - (-2)/((-2)/(-4)4). Suppose d - 76 = 4o - l, o = -2d + 128. Is 14/63 + o/2740 composite? True Let u(j) = 38j + 103. Let o(g) = -g2 - 188g - 513. Let n(d) = -2o(d) - 11u(d). Is n(45) composite? False Let n = 287032 - -50797. Is n a composite number? True Let n = 291574 - 114903. Is n a composite number? True Is (10(-14)/(-700))/((-1)/(-2512555)) prime? False Let t(x) = -13x - 13. Let n be t(4). Let s = 65 + n. Suppose -2q - 7a + 2a + 2813 = s, 2q - 2795 = a. Is q a prime number? True Suppose p - 1 = 3b - 9, b - 10 = 4p. Let z(v) = b - 3v + 12v + 2v. Is z(27) prime? False Let q = 410459 + -898. Is q a composite number? True Let h be 86724/14 + (-6)/(-14). Suppose -12a - h = -27a. Is a a prime number? False Suppose 0 = -23l + 10l + 52. Suppose 0g = 2g. Suppose g = lm - m - 339. Is m composite? False Let c(g) = -8g3 + 8g*2 + 21g - 32. Is c(-9) prime? False Suppose 0 = -5a + 3 + 7. Let p(k) = 440k*3 - 2k*2 + k - 3. Is p(a) a composite number? False Suppose -12j + 357130 + 1607411 = -2052711. Is j a prime number? True Let r(j) = 42j + 174. Let c be r(-4). Let x(o) = 63o*2 - 9 - 2 + 0 - 6o. Is x(c) composite? False Let n be -4 - (0 + 1 + -9). Suppose -y = -2a + ny + 754, -5y - 377 = -a. Suppose 2d - 386 = 4p, p - 577 = -5d + a. Is d a composite number? False Let y(v) = -v*3 - 15v*2 + v + 30. Let x be y(-15). Suppose 12n = xn - 17337. Is n composite? False Let t(f) = f3 + 115f*2 + 46f + 75. Is t(-37) a prime number? False Let p(u) = u*3 - 5u*2 + 5u - 4. Let o be p(5). Let q(x) = 20x2 + 11 + 4x*3 + 3x - 3x3 - 41x*2. Is q(o) prime? False Let u(n) = 541n*2 - 7n - 1. Let g be -2 + (-102)/(-27) + (-6)/(-27). Let l be (-7)/g + 1/2. Is u(l) a composite number? False Let m(u) = -u*3 + 10u*2 - 7u + 5. Let w(v) = 16v. Let z be w(-3). Let q = -41 - z. Is m(q) a composite number? False Let a(b) = -45127b - 1655. Is a(-4) a prime number? True Suppose 283f - 282f - 31236 = 0. Suppose 19i = 31i - f. Is i a composite number? True Suppose -169n + 15588 = -151n. Let i(x) = -2x - 3. Let w be i(-4). Suppose -2h + 2j + n = 0, -wj + j - 858 = -2h. Is h a prime number? False Let u(l) = 8l*2 + 5l - 291. Is u(12) prime? False Let h = -3857 - -22074. Is h a prime number? True Let o = -88 + 98. Suppose -3p - o = 2p, -2c = 3p - 9618. Suppose -2371 = -2g + 4v + v, 4g + 4v = c. Is g prime? False Let v(j) = 403j2 + 54j + 187. Is v(-20) a composite number? True Let a = 71 + -68. Let o be 7154/a - (-6 + 120/18). Suppose -o - 549 = -7w. Is w prime? True Let h = 20979 + -14476. Is h composite? True Let p(r) = -r3 - 5r*2 + 17r + 9. Let o be p(-7). Let x(g) = 10g2 + 28g - 8. Let d be x(o). Suppose -5f = -d + 141. Is f a prime number? True Let o(u) = u2 + 130u + 1653. Is o(124) a prime number? True Suppose 17h - 494406 = -5h. Suppose -27562 = -5m + h. Is m a composite number? False Let d be (-8454)/7 - (6/(-7))/(-3). Let x be 1-52342/4. Let l = d - x. Is l a composite number? False Suppose 0 = -5d - 2j + j + 15, 4d - 13 = -j. Is (-18423)/(-46)d/3 composite? True Let x(z) = z3 - 21z*2 + 17z + 19. Let h = 193 + -171. Is x(h) a prime number? True Let w = -4399 + 4408. Suppose -3x = 2x + 5, 18 = 5m + 2x. Suppose wo - 665 = mo. Is o prime? False Let f be 1/(-2) + (-4)/(-8)-13939. Let h = f + 14783. Is 4/6 - h/(-39) a composite number? True Let j = -183 - -346. Suppose 213 + j = 8n. Suppose -n - 44 = -q. Is q a prime number? False Suppose -3w = 3j - 355989, -5w + 3j - 28639 + 621930 = 0. Suppose 6s - w = -14s. Is s a composite number? True Let h = -132384 + 417698. Is h prime? False Let i = -1392 + 701. Is (-4)/612 - i a composite number? False Suppose 0 = 25u - 17417436 + 309217 - 24166956. Is u a composite number? False Let o be 807 + (-7)/((-35)/(-25)). Let p be (o - (-3 + 2))18. Suppose p - 4716 = 18n. Is n a composite number? False Suppose -6x = 2x - 24. Suppose 3q = -3a - 4590, 0 = -xq - 2a - 2292 - 2297. Let n = -958 - q. Is n a composite number? False Let v be (-1 + 10 + -10)/(3/7593). Let w = v + 26334. Is w a composite number? True Let m = 3906 - 2698. Let u = m - 453. Is u a prime number? False Let j(m) = 2m3 - 35m*2 - 26m - 24. Let o be j(19). Suppose 0 = -8z + 8979 + o. Is z a prime number? True Is 302/8305 - 2668926/(-110) prime? False Let d(r) be the second derivative of -5/2r*2 + 0 + 23/12r*4 - 1/6r*3 + 4r. Is d(10) prime? False Suppose 513 = 37c - 18c. Suppose cv + 4g - 19221 = 24v, 2g = -5v + 32021. Is v prime? False Is (9/((-27)/(-21)) - 4)/(3/100787) a prime number? True Suppose -3w = -31w + 2w + 98722. Is w a prime number? True Let r = -57 - -57. Suppose 18h - 5h = r. Suppose h = -9w + w + 22216. Is w a prime number? True Let g = 1260 - 725. Suppose 2i + g = 3045. Is i composite? True Let u(m) = -3 + 0 - 2 + 4. Let p(l) = -3l3 + 9l*2 - 36l - 16. Let n(j) = p(j) - 5u(j). Is n(-10) a prime number? False Suppose 5h - 6w = -w - 255, w = 4h + 189. Let f be h/253 - (-599168)/(-11). Is f/(-20) + 10/(-4) a composite number? True Let h = 50 + -44. Suppose -2o + h = -0o. Suppose -4t + 2069 = -ol - 10826, 5t - 16111 = -4l. Is t a composite number? True Let c(a) = 301a3 + 3a*2 + 4a + 1. Let n be c(3). Suppose 5o - n = 38128. Let s = 14298 - o. Is s composite? False Is ((-300)/(-80))/(-15)-7131561 prime? True Is 228826(-9)/(-8) + (225/60)/(-15) a composite number? True Suppose -j + 2j - 10889 = 5h, 0 = -5h + 3j - 10897. Let q = -4507 + h. Is (2/6)/((-4)/q) a prime number? True Let g = 4748 - 2505. Is g a prime number? True Let v be -3((-2)/(-1) + -3). Suppose 2z - vz + 2m = -4, 0 = -4z - 2m + 6. Suppose -463 = -zw + 1811. Is w a composite number? True Let n = 116 + -109. Suppose np + 8 - 43 = 0. Suppose -5j - 3q = -5447, pj + 2q - 5961 = -518. Is j prime? True Suppose -146981 = -q - 2y, 5q - 1469677 = -5q - y. Is q a prime number? False Let m(r) be the second derivative of 7r*5/20 + 5r*4/12 - 5r*3/3 + 15r*2/2 - 7r + 3. Is m(3) prime? False Let r(p) be the second derivative of 5p4/6 - 4p*3/3 + 5p*2/2 + 243p - 1. Let m = -9 + 18. Is r(m) prime? True Suppose -5*	{ "pile_set_name": "DM Mathematics" }
rime factors of q. 3, 71 Let f(m) = 1706m2 + 13m + 15. What are the prime factors of f(2)? 5, 1373 Let w = -61 + 52. Let y be (-423)/66/w. Suppose f - y = -2u, -u = -2u + 2f + 11. List the prime factors of u. 3, 7 Let o(f) = 19f - 24. Let i be o(-16). Let h = 563 + i. List the prime factors of h. 5, 47 Let p(s) = -s3 - 6s*2 - 7s - 2. Let h be p(-4). Let b(v) = -199v - 236. List the prime factors of b(h). 2, 479 Let d be ((-131)/(-3) - -1)/((-20)/(-570)). Let c = -887 + d. What are the prime factors of c? 2, 193 Suppose 29y - 1764 = 17y. Let j = y + -87. Let v = j - 34. What are the prime factors of v? 2, 13 Let j be 1 + 10564/(-20) + 16/(-20). List the prime factors of ((-24)/(-36))/(1054/j + 2). 2, 11 Let y(m) = 8m + 68. Let g be y(13). Let k(l) = -l*3 - 2l*2 + 3l. Let i be k(4). Let v = i + g. What are the prime factors of v? 2, 11 Suppose -3n + 6n - 18 = 0. Let x be 6(-3)/(-54) - 2/n. Suppose -4q + y = -149, x = -5q - 3y + 33 + 149. What are the prime factors of q? 37 Suppose 5h + 10 = 0, 4h = -5t + 19 + 18. Let o be (-88)/(-24) + (-6)/t. Suppose -oc + 294 = -303. List the prime factors of c. 199 Let i(t) = -7t - 23. Let v be i(-5). What are the prime factors of 267/v(4 + 20)? 2, 3, 89 Suppose -2z = f + 10, -4z + 5f - 34 = -2z. Let n(w) = 6w2 + 14w + 4. Let u(t) = -t*2 - 1. Let k(d) = n(d) + 3u(d). List the prime factors of k(z). 2, 5 Let w = -23041 - -58485. What are the prime factors of w? 2, 8861 Suppose -4 = -2o - 24. Let w = -6 - o. Suppose x = 3p - 71, wx = -0p - p + 41. What are the prime factors of p? 5 Let j = 67 + -36. Let t(f) = -8f + 18f - 13f + jf. List the prime factors of t(3). 2, 3, 7 Let i = -2152 + 1035. Let y = -122 - i. What are the prime factors of y? 5, 199 Let f(l) = 4l2 + 40l - 15. Let p be f(-17). Let d be 1518/5 + 6/15. Let o = p - d. List the prime factors of o. 157 Suppose 101u - 647853 = -13u + 183891. List the prime factors of u. 2, 3, 19 Let v(h) = 2h3 - 6h*2 - 77h + 153. What are the prime factors of v(17)? 2, 3, 17 Suppose -q = -9q + 3q. Suppose qv - 4v = -208. Suppose vh = 48h + 28. What are the prime factors of h? 7 Let q be 12/2(-2)/(-3). Suppose 5v - 1331 + 18 = 2o, 4o = -qv + 1056. List the prime factors of v. 263 Let b(d) = -16d*3 - 14d*2 + 19d + 182. List the prime factors of b(-6). 2, 5, 151 Let l = 17895 + -9306. What are the prime factors of l? 3, 7, 409 Suppose x - 5833 = -4g, -26g = 4x - 12982 - 10290. What are the prime factors of x? 5857 Let k(u) = 2u + 6. Let p = 169 - 120. Suppose p - 53 = -2h. What are the prime factors of k(h)? 2, 5 Suppose -m + g = -0g + 1, -g = 5m + 17. Let k be (30/(-7))/(m/63). Suppose -3l = -5c + 80, -5c = -l - 0l - k. What are the prime factors of c? 19 Let g = -10828 - -22788. What are the prime factors of g? 2, 5, 13, 23 Let m(k) = 1066k - 2626. Let u(x) = -15x + 37. Let z(b) = 2m(b) + 143u(b). Let o(w) = 8w + 1. Let v be o(-1). What are the prime factors of z(v)? 2, 5, 13 Suppose u = -2l + 6239 - 164, 0 = -5u - 2l + 30399. List the prime factors of u. 3, 2027 Let y = 322 - 998. What are the prime factors of (y/(-10))/((-32)/(-80))? 13 Let m = -18 + 10. Let p be (4/(-24)m)/(3/(-18)). Let a(d) = -11d + 16. What are the prime factors of a(p)? 2, 13 Let c(o) = 3o*3 - 9o*2 + 5o + 1. Let r be c(3). What are the prime factors of 584/(0 - -1) - r/(-8)? 2, 293 Let x(q) = -10q - 23. Let d(i) = 2i2 + i3 - 3 + 0i - 2i + i2 + 4. Let n be d(-4). What are the prime factors of x(n)? 47 Let u be (2 - -5) + 12/2 + -4. Let q be (-5)/((-30)/u) - 226/(-4). List the prime factors of 1 + q/(4 + -3). 59 Let t(o) = -o3 + 6o2 - 9o + 15. Let w be t(9). Let a = -126 - w. List the prime factors of a. 3, 61 Suppose 0 = -5s - 15w + 11w + 129511, -s + 25901 = w. What are the prime factors of s? 7, 3701 Let j(g) = g3 - 4g*2 + 2. Let y be j(4). Let d(v) = 6v + 12vy + 11v + v*3 - 91 + 80. List the prime factors of d(-9). 79 Let v be (-106)/(-636) + (-6766)/8(-10)/15. Let u be -4 + 4 - (-6 + 0). Suppose 0 = -un + v + 240. What are the prime factors of n? 2, 67 Let s = 167 + -140. What are the prime factors of 4701/s - (-35)/(-315)? 2, 3, 29 Let w be -22 - 4 - 2 - 7. What are the prime factors of w/20(-6 + 1 + 1)? 7 Suppose 0 = x - 20x + 6441. List the prime factors of x. 3, 113 Suppose -147l + 354324 - 150407 + 544019 = 0. List the prime factors of l. 2, 3, 53 Let o = 7490 - 2910. List the prime factors of o. 2, 5, 229 Let v = -13846 + 20312. What are the prime factors of v? 2, 53, 61 Suppose 0 = -13r - 28 + 158. Suppose -2j - 3388 = -4f - 574, 2j + r = 0. What are the prime factors of f? 701 Suppose -15i - 6408 = -3i - 76668. List the prime factors of i. 5, 1171 Let x be ((-15)/(-40)-4)/(3/(-4)). Suppose -4d = i - 1073, -xi = 4d - 5d - 2119. What are the prime factors of i? 1061 Let g = 85 + -7. Suppose 4f - 44 = -2q + g, 249 = 5q - 4f. What are the prime factors of q? 53 List the prime factors of (5376/(-9) + 5)(-14 + 3 + 2). 3, 1777 Suppose 18g - t = 19g - 15594, -2t - 62346 = -4g. What are the prime factors of g? 7, 17, 131 Let h(l) = 7l2 - 3l*3 + 103 + 4l*3 + 7l + l - 90. Let w be h(-6). Let m(k) = 48k2 + 2k - 3. What are the prime factors of m(w)? 47 Let w = 491 + -459. Suppose -wl = -20452 + 3140. What are the prime factors of l? 541 Suppose 2837n = 2842n - 66190. What are the prime factors of n? 2, 6619 Let f = 152 + -308. Let g be (-2)/(-7) - f/91. Suppose -6l + 68 = gi - l, -3l + 189 = 5i. List the prime factors of i. 3, 13 Suppose -304h + 333h - 234871 = 0. What are the prime factors of h? 7, 13, 89 Suppose 2w + g = 25, 5w - 4w - 9 = 3g. Let v = 264 + w. List the prime factors of v. 2, 3, 23 Suppose -5n + 5d + 39815 = 0, 0 = -4n - 49d + 48d + 31877. What are the prime factors of n? 2, 3, 83 What are the prime factors of (0 - 48/15)/((-38)/95) + 25874? 2, 12941 Let f = 31752 + -18931. What are the prime factors of f? 12821 Let y be -104 - (4/(-10) - (-2)/5). Let p = -100 - y. Suppose 3o = -ps + 541, 3o - 545 = -10s + 5s. What are the prime factors of o? 5, 7 Suppose 3y = 2h - 10 - 6, 4h = 4y + 20. Let v be (2 - 5)(y - -2)/(-1). List the prime factors of (-3)/v + (-956)/(-16). 2, 3, 5 Let b(l) be the second derivative of -l*5/20 + 4l*4/3 + 4l*3 - 12l*2 - 49l - 2. Let n = 44 - 27. List the prime factors of b(n). 5, 19 Let x(j) = -4j + 76. Let v be x(18). Suppose -4i - 172 = -2y, 0 = vy - 2i - 408 + 40. List the prime factors of y. 2, 47 Let f = -18613 - -40603. List the prime factors of f. 2, 3, 5, 733 Suppose -9 = -k + o + o, -k - 5o = -9. Let i be 6(2 + k/(-6))7. What are the prime factors of i(-1 + 60/9)? 7, 17 Let h be (-11494)/(-42)2/(2/3). Let b = h - 319. What are the prime factors of b? 2, 251 Let l = 174 + -171. Suppose -2n - 3m = -5n + 108, 122 = ln + 4m. What are the prime factors of n? 2, 19 Suppose -5n = 3b - 9 - 16, 4b - 5 = -n. Suppose 10k + 13 + 7 = b. List the prime factors of (32/12 + k)/((-3)/(-972)). 2, 3 Suppose 24g - 27g + 18375 = 0. Suppose 3w = 8w - g. Suppose -35s = -30s - w. What are the prime factors of s? 5, 7 What are the prime factors of ((-79443)/(-42) - (-5 + 1))(-1 + 7)? 3, 17, 223 Let u = 21570 - 5730. List the prime factors of u. 2, 3, 5, 11 Suppose -4w - 2028 = -2w - 7940. List the prime factors of w. 2, 739 Let c(p) = 74p + 15626. What are the prime factors of c(0)? 2, 13, 601 Suppose 4z = -5p + 109956 - 43780, -3p + 4z + 39712 = 0. What are the prime factors of p? 2, 3, 1103 Let u = -4 - -8. Let m(k) be the first derivative of k4/2 - 7k*3/3 + 7k*2/2 - 4k - 1790. List the prime factors of m(u). 2, 5 Let j be 2 + 1 + 0/(-5 - -1). Suppose 0x - 529 = -x + jd, -5x + 4d = -2634. What are the prime factors of x? 2, 263 Let x = -44 + 46. Suppose 0 = 4y + 8, -3l - xl - 3y + 14 = 0. What are the prime factors of (-45)/30 + 26/l? 5 List the prime factors of (-10)/(-105) - ((-4)/105)/((-80)/(-43910800)). 2, 3, 5, 17, 41 Let k be ((-1)/2 - 2)(19 + -15). Let o(h) = -59h - 19. What are the prime factors of o(k)? 571 Let s be (-13 - -1100 - -12)/(1/31). Suppose 39347 = 46*a - s. What are the prime factors of a? 2	{ "pile_set_name": "DM Mathematics" }
0 Let w(c) = c*3 + 10c*2 + 15c + 7. Let d be w(-8). Solve da - 5 = 14a for a. 5 Let n be 3/5 + 114/(-190). Solve 3m - 12 = -n for m. 4 Let t(p) = p + 12. Let x be t(-12). Let m(f) be the first derivative of f3/3 - 9f*2/2 + 4f - 4. Let k be m(9). Solve -g - k = -x for g. -4 Suppose -5i = -36 - 34. Suppose ir - 48 = 11r. Solve -rb = -11b - 25 for b. 5 Suppose 0 = 6w - w - 20. Let v(m) = 5m - 41. Let b be v(9). Suppose -5r + bq - 3 = 0, -2r = 2r - 2q. Solve -wo - 3 = r for o. -1 Let v(r) = 6r3 - r2 + r - 1. Let m be v(1). Suppose a = -mn + 23, -4a = -2n + a - 7. Solve 4 = -nw - 0w for w. -1 Suppose l = -0l + 1. Solve 5r - l = 4 for r. 1 Let l = 16 + -13. Solve lb - 1 = 2 for b. 1 Let i = -25 + 36. Let u = i + -7. Solve 0 = -ub - b - 15 for b. -3 Let m(i) = -2i - 1. Let u be m(-2). Suppose -6y + u = -27. Solve -s = -2s + y for s. 5 Let r(a) be the second derivative of 0 + 2a + 1/6a*4 - 7/6a*3 + 0a*2. Let y be r(5). Solve -y = s - 4s for s. 5 Let p(x) = -x*3 + 23x*2 - 43x + 21. Let k be p(21). Solve 11l - 5l + 30 = k for l. -5 Suppose -2g + 5c + 33 = 0, 2g + 0c - 12 = -2c. Let j = 13 - g. Suppose 0 = -2u - 23 + 23. Solve 0 = jf - uf + 16 for f. -4 Suppose -23p + 10p = -91. Solve 0t - 35 = -pt for t. 5 Suppose -26l + 995 + 331 = 0. Solve -4o = -43 + l for o. -2 Let a(d) = d*2 + 3d - 3. Let r be a(5). Suppose -t - 2q = 7, -3q + 13 - r = -3t. Suppose tz + 16 = 4z. Solve 2i - z = -2i for i. 4 Let w(i) = -2i + 2. Let t be w(0). Suppose -5n - k = -4k + 2, 0 = -tn + 5k - 16. Let x be ((-6)/(-2))/((-3)/(-2)). Solve -n = xs - 8 for s. 3 Let r be 6/(-10) + (8 - 154/35). Suppose -3k + 2i = -i - 3, rk + 1 = -i. Solve -12 = -4o - ko for o. 3 Let v(o) = -o*3 - 2o*2 + 11o - 5. Let m be v(-5). Suppose 2q - m = -5. Solve 0 = -3f + qf - 10 for f. 5 Let n be (180/21)/((8/(-7))/(-4)). Solve 0 = 16z - z - n for z. 2 Suppose -458k - 9 = -461k. Solve -kb = 39 - 42 for b. 1 Suppose -2k = -6k - 140. Let h = -33 - k. Let d be 1/(-1)(-1 + 0). Solve d = hb + 11 for b. -5 Let b be (-2 - (-5)/2)24. Suppose 24 = 20q - bq. Solve -s = -qs + 8 for s. 4 Suppose -3t - 10 + 67 = 0. Suppose g - 3k = -8k - t, 5g + 11 = -4k. Solve g - 5 = -2a for a. 2 Suppose 4z = -b + 18 + 4, z - 1 = 2b. Solve 2k - 3k = b for k. -2 Let c be (-60)/(-75) - (-116)/5. Let o be 3(-2)/c-36. Solve 7 + o = 4p for p. 4 Suppose 0i = -0i + 8i. Solve i = -3u + 8u + 5 for u. -1 Suppose 2j - 2 = -6. Let s be 0/(-2) + (-9 - j). Let c be 1/1(s - -10). Solve -x - cx = 16 for x. -4 Let b be (-1)/(-1)(-5 + (-10 - -18)). Let s be (-9)/3 - -1 - 4. Let n be (-2)/s(1 + 17). Solve -nq = -bq for q. 0 Let w be (-15)/273-3. Suppose wf - 9f = 0. Solve fk + 10 = 2k for k. 5 Suppose 20n - 3w = 24n - 74, 5w = 2n - 50. Solve 5r = r - n for r. -5 Let p(r) = -2r3 - 15r*2 - 11r - 24. Let c be p(-7). Solve 0 = -4g + 2g + c for g. 2 Let g(q) = 9q2 - 8q2 - q3 + 16q2 + q - 17. Let p be g(17). Solve m = -pm + 1 for m. 1 Suppose 0 = -29d + 21d + 104. Solve db = 9b - 12 for b. -3 Let m(g) = g*2 + g + 4. Let h be m(0). Let v be 42(-62 + 61)2/(-4). Solve -hw + 1 - v = 0 for w. -5 Let i be ((-33)/6)/(3/(-6)). Let v = i - 11. Suppose vx = 3x. Solve x = -5c - 11 - 9 for c. -4 Suppose -8 = -5f + 2. Suppose 0 = -fn + 7n - 5. Solve w - 4 = -n for w. 3 Let o(z) = 2z - 4. Let q be o(8). Suppose 0 = -4b - 16, -2y = b + 2b + q. Suppose y = -v + 6v - 20. Solve 0 = vx + x for x. 0 Let n(o) = -o + 15. Suppose -5y - 6 = -8y. Suppose 3k + 37 = 2x, -yx - 4 = 5k - 1. Let j be n(x). Solve -a + 2 - j = 0 for a. -2 Let x be ((-3)/(-2))/(3/(1 - -11)). Solve 0 = -5n + 3n + x for n. 3 Suppose 0 = 27c - 7c - 160. Suppose -3u + 8 - 23 = 0. Let o = u + c. Solve -g + 4g + o = 0 for g. -1 Suppose -5h + 3j = 12, -3h - 13j - 12 = -16j. Solve -113i + 109i + 4 = h for i. 1 Suppose -12 = -2t - 5o, 0o = -3t - 2o + 40. Let y(s) = s + 2. Let u be y(-5). Let w = u + 6. Solve -wb - b = -t for b. 4 Suppose q = 2, 7c = 8c - 3q + 6. Solve -25 = 5n - cn for n. -5 Let o = -27 - -31. Suppose 4h - 4g - 8 = 16, -g - o = 0. Solve -2 + 4 = hb for b. 1 Let r(y) = -y + 7. Let j be r(-4). Let k = j + -9. Suppose -5v - 5z = -5, 3z = v + kv - 9. Solve -vx + 0x = 8 for x. -4 Suppose -2h - 1 = -5. Let a be (170/4)/((-41)/(-82)). Let d = 85 - a. Solve -q - h + 6 = d for q. 4 Suppose 0 = -i + 5s + 1, 3i + 14s = 11s + 3. Solve -i = 2j - 9 for j. 4 Let u be 8 + 0 + -1 + -1. Let o(k) = k2 - 6k + 3. Let r be o(u). Suppose 4t - 14l + 4 = -16l, 4 = -2l. Solve t = -5n + r + 7 for n. 2 Suppose 3 - 13 = 2r. Let w = 7 + r. Suppose wa = 2 + 2. Solve -7x + ax = -25 for x. 5 Suppose 6t - 5t = 23. Let i = t - 23. Solve ih + 16 = 4h for h. 4 Let s be 78/(-195) + 92/5. Solve 3y + s - 15 = 0 for y. -1 Suppose s - 85 = 53n - 58n, -3s = -2n + 51. Solve -3 = -15q + nq for q. -1 Suppose -4g = 2r - 24, 0r - 30 = -5g - r. Let p(j) = 2j - 26. Let y be p(11). Let b be g/y + 27/18. Solve b = -5x + 2x - 3 for x. -1 Suppose -14m - 4 + 46 = 0. Solve 0 = -u - 4 + m for u. -1 Suppose -7v + 16 + 5 = 0. Solve l = 2l - v for l. 3 Suppose 4k - 5p = 62, -4k + 60 = -5p + p. Suppose 0 = -6l + k - 1. Solve -lq + 5q = 15 for q. 5 Let v be (2 - (-54)/12)/(3/36). Solve -68 = -10x - v for x. -1 Let t(h) = 2h3 - 6h*2 + 11h - 5. Let r be t(4). Let g = 73 - r. Let o = 4 - 2. Solve -20 = -gd - od for d. 5 Suppose -151z + 374 + 398 = 17. Let y = 0 - 0. Let f(n) = n3 + n2 - n + 1. Let p be f(y). Solve -zo + p = 6 for o. -1 Let i(d) = d*2 + 15d - 182. Let l be i(8). Solve 4w + lw = w for w. 0 Let j(u) = u + 7. Let b(w) = -w*2 - 8. Let o be b(0). Let k be j(o). Let l be 1/(((-3)/15)/k). Solve 2i + l = 3i for i. 5 Let g(p) = 8p*2. Let w be g(1). Suppose 20 = -4y - y, y - w = -2k. Solve -i = i - k for i. 3 Let o(i) = i2 + 2i - 13. Let f be o(4). Solve -13g + fg = 8 for g. -4 Let r be (-57)/(-15) + 3/15. Suppose 3s - 7s = -ro - 32, -o + 8 = 3s. Suppose sx = 7x. Solve x = -3h + 13 - 1 for h. 4 Let r(a) = a3 - 16a*2 - 14a - 15. Let p be r(17). Solve 11u + p = -u for u. -3 Let h be (266/(-168))/(-19) - 2/24. Let z be (-585)/(-35) - (-4)/14. Suppose 3m - 7 + 1 = 0. Solve h = -3n + m - z for n. -5 Let t = 3 - -5. Let b(m) = -m3 + 9m*2 - 10m + 19. Let r be b(t). Solve -p + 2 = r for p. -1 Let x be -8 + (-272)/(-24) - 2/(-3). Solve -xj - 12 = 8 for j. -5 Suppose 8 = -l + 2o, -2l + 3o + 7 - 18 = 0. Solve lp + 6 = 5p for p. 2 Let l = -25 + 26. Let u be 4 - (l/1 + -2). Suppose 28 = -i + 3i + 4c, -3i + uc = 13. Solve -ig + g = -15 for g. 5 Suppose v + 2 - 4 = 0. Let q be 2/(v + 0 + -1). Let o be 0/(4 + (-3)/1). Solve -i = -oi + q for i. -2 Let p = 117 - 113. Suppose -po = 8 - 24. Solve o - 3 = -m for m. -1 Suppose -2d + 15 = -5d, -d + 5 = 2h. Solve 0 = 4f - 3f - h for f. 5 Let x(v) = v*2 - 8v - 9. Let r be x(9). Suppose -3q + 0q - 5z = 22, 5q + 5z = -20. Let h = q + 1. Solve r = -hn + 4 for n. 2 Let r(d) be the third derivative of d*6/120 - 11d*5/60 + 11d*4/24 - 4d*3/3 + 15d*2. Let t be r(10). Solve -p - 5 = -t for p. -3 Let r be (11 - 6) + (-10 + -4)/(-2). Solve -ry + 23y = 0 for y. 0 Let k(a) = 7a*3 - 9a + 9. Let z be k(1). Solve -6f = -13 + z for f. 1 Let w(k) = -k2 - 15k - 4. Let q be w(-15). Let j be q/(1 - -2 - 5). Solve jn = -0n - 8 for n. -4 Let b be (8 - (-72)/(-6))/(-1). Solve 0 = 11i + 4i - bi for i. 0 Let j be (1 - 1)/(1 - -1). Let h be -2(-3)/24 - (-321)/12. Suppose 0v = -3v + 6. Solve -5d - v + h = j for d. 5 Suppose 11r - 5r - 24 = 0. Suppose -rf - 2u - 6 = u, 3f - 2 = u. Solve -3h + 8h - 15 = f for h. 3 Suppose 9 - 8 = -u. Let d be 77/(-22)(u + -1). Solve 0 = n + d - 2 for n. -5 Suppose 9 = -6d + 147. Suppose dt + 0t = 115. Solve -2 = tc + 3 for c. -1 Let v(k) = 79k*2 + 6k + 8. Let g be v(8). Suppose 4y - 2l - g = 2y, -2y = -5l - 5100. Let x be y/144 + 2/9. Solve 2 = -5b - x for b. -4 Suppose 8w - 150 = -6. Solve -9k = -15k + w for k. 3 Suppose 3n - 12 = -0n. Suppose -25 = -5j, a - 2j - j + 14 = 0. Let y be 1/a(-12 - -17). Solve -nm = -ym for m.	{ "pile_set_name": "DM Mathematics" }
syyyyyysyyyy. Give prob of sequence ssy. 65/969 Four letters picked without replacement from {c: 2, o: 11, e: 4, t: 2}. Give prob of sequence oecc. 11/11628 Two letters picked without replacement from {s: 5, t: 1, j: 3, y: 9}. What is prob of sequence tj? 1/102 Three letters picked without replacement from uyyynur. What is prob of sequence uyn? 1/35 Three letters picked without replacement from noxnnwo. What is prob of sequence nxn? 1/35 Calculate prob of sequence qpxe when four letters picked without replacement from exxqtppe. 1/210 Three letters picked without replacement from {f: 1, u: 4, h: 1, i: 3, j: 9}. Give prob of sequence ihf. 1/1632 Two letters picked without replacement from oxscaaxg. Give prob of sequence co. 1/56 What is prob of sequence em when two letters picked without replacement from {h: 1, m: 2, f: 1, r: 1, e: 2, q: 1}? 1/14 Two letters picked without replacement from {y: 1, r: 6, q: 4, g: 5}. What is prob of sequence rq? 1/10 Two letters picked without replacement from errere. What is prob of sequence rr? 1/5 Four letters picked without replacement from {g: 4, s: 7, a: 3, q: 5}. Give prob of sequence ssaq. 35/5168 Calculate prob of sequence xglj when four letters picked without replacement from {x: 4, g: 2, l: 1, j: 1, a: 1}. 1/378 Four letters picked without replacement from wpeyqywyyyw. What is prob of sequence eyqw? 1/528 Calculate prob of sequence cufi when four letters picked without replacement from {u: 3, r: 2, a: 2, c: 6, i: 6, f: 1}. 3/3230 What is prob of sequence eye when three letters picked without replacement from {e: 2, y: 2}? 1/6 Calculate prob of sequence cv when two letters picked without replacement from {v: 1, c: 2, f: 7}. 1/45 Calculate prob of sequence ikff when four letters picked without replacement from kffkffkfkfkffkffi. 9/952 Calculate prob of sequence hv when two letters picked without replacement from {v: 1, n: 9, y: 2, h: 2}. 1/91 Calculate prob of sequence cpn when three letters picked without replacement from {f: 1, p: 2, n: 6, u: 2, c: 1}. 1/110 What is prob of sequence ym when two letters picked without replacement from {m: 2, n: 1, f: 1, d: 1, y: 2}? 2/21 Two letters picked without replacement from {i: 1, n: 2, a: 4, t: 2, l: 5}. What is prob of sequence ia? 2/91 Four letters picked without replacement from mllmhhhohhhymhom. What is prob of sequence mymm? 1/1820 Four letters picked without replacement from {a: 1, y: 5, k: 1, g: 7, f: 2}. What is prob of sequence yagy? 1/312 Three letters picked without replacement from weahe. Give prob of sequence haw. 1/60 Four letters picked without replacement from xxzxxxxxxxxzzxxzxz. What is prob of sequence xxzx? 143/1224 Two letters picked without replacement from {n: 2, b: 4, q: 4, i: 1, v: 5}. Give prob of sequence ib. 1/60 What is prob of sequence uweu when four letters picked without replacement from wxexwxexexexxuxwu? 1/2380 What is prob of sequence eum when three letters picked without replacement from vueeuuemuuemv? 10/429 What is prob of sequence zm when two letters picked without replacement from {z: 3, m: 15}? 5/34 What is prob of sequence ttff when four letters picked without replacement from {t: 5, f: 3}? 1/14 What is prob of sequence ob when two letters picked without replacement from {o: 4, b: 14}? 28/153 Calculate prob of sequence yozy when four letters picked without replacement from {y: 5, u: 2, e: 2, o: 4, x: 1, z: 1}. 2/819 Calculate prob of sequence uuu when three letters picked without replacement from auuuauaauuauuuuuuuu. 364/969 What is prob of sequence hak when three letters picked without replacement from ahhhaakhhhhahaahhaa? 40/2907 Three letters picked without replacement from {p: 4, j: 1, z: 1, b: 5, m: 1, s: 1}. Give prob of sequence zmj. 1/1716 What is prob of sequence xx when two letters picked without replacement from xxxxllxx? 15/28 Three letters picked without replacement from {y: 2, s: 7, k: 2, f: 8}. What is prob of sequence syk? 14/2907 Four letters picked without replacement from {q: 3, f: 3, v: 3, r: 11}. Give prob of sequence qqfq. 1/6460 What is prob of sequence ff when two letters picked without replacement from ffffff? 1 Calculate prob of sequence nnn when three letters picked without replacement from {a: 5, n: 5}. 1/12 What is prob of sequence wwc when three letters picked without replacement from {c: 2, w: 11}? 5/39 What is prob of sequence gg when two letters picked without replacement from {e: 7, u: 1, g: 2}? 1/45 Four letters picked without replacement from {s: 8, t: 6, e: 1, m: 1, z: 2}. Give prob of sequence ezzm. 1/36720 Calculate prob of sequence ct when two letters picked without replacement from cfmccccrstss. 5/132 What is prob of sequence gw when two letters picked without replacement from {g: 1, d: 1, y: 1, w: 1, o: 1, h: 2}? 1/42 Calculate prob of sequence cnq when three letters picked without replacement from qccncnccqaqccaanc. 3/170 Calculate prob of sequence ygy when three letters picked without replacement from yyg. 1/3 What is prob of sequence nn when two letters picked without replacement from nnnnnnn? 1 Two letters picked without replacement from nnnsnnhgnhhrhsllh. What is prob of sequence sr? 1/136 What is prob of sequence jevs when four letters picked without replacement from sejeejevfjeeeeeefe? 11/24480 Three letters picked without replacement from qppqpiqqiqiqpw. Give prob of sequence wqq. 5/364 Two letters picked without replacement from dtdtfcqcy. What is prob of sequence yt? 1/36 Four letters picked without replacement from hlhlhuuhshhlhzhzh. Give prob of sequence llhl. 9/9520 Three letters picked without replacement from {k: 3, u: 17}. Give prob of sequence uuk. 34/285 Four letters picked without replacement from {w: 4, a: 14}. Give prob of sequence aaww. 91/3060 Two letters picked without replacement from {m: 1, q: 1, d: 1}. What is prob of sequence qm? 1/6 Three letters picked without replacement from {f: 5, u: 9, p: 2}. Give prob of sequence ffu. 3/56 Calculate prob of sequence sek when three letters picked without replacement from {p: 14, f: 1, k: 1, s: 2, e: 1}. 1/2907 What is prob of sequence eegg when four letters picked without replacement from geggee? 1/10 Two letters picked without replacement from xxxxhxxx. What is prob of sequence xh? 1/8 Three letters picked without replacement from fffk. Give prob of sequence fkk. 0 Calculate prob of sequence rnr when three letters picked without replacement from {k: 4, i: 2, t: 4, r: 4, n: 4, y: 1}. 8/969 Two letters picked without replacement from joozb. Give prob of sequence bz. 1/20 Three letters picked without replacement from {d: 13, o: 4, v: 3}. What is prob of sequence odv? 13/570 Two letters picked without replacement from {v: 1, c: 3, q: 3, o: 3}. What is prob of sequence vo? 1/30 What is prob of sequence ipx when three letters picked without replacement from ppxipxcpppxp? 7/440 Three letters picked without replacement from nruursukuuukunu. Give prob of sequence srk. 2/1365 What is prob of sequence fr when two letters picked without replacement from {r: 10, f: 2, j: 3}? 2/21 What is prob of sequence oo when two letters picked without replacement from ooofoooooooooc? 66/91 Three letters picked without replacement from eeebf. What is prob of sequence efe? 1/10 Three letters picked without replacement from slslll. Give prob of sequence lss. 1/15 Calculate prob of sequence bk when two letters picked without replacement from vuuubruukuubuvrvvuu. 1/171 What is prob of sequence eke when three letters picked without replacement from eoekeookkooekokok? 3/170 Two letters picked without replacement from {w: 5, o: 9}. What is prob of sequence wo? 45/182 What is prob of sequence ttrt when four letters picked without replacement from {r: 14, t: 4}? 7/1530 Three letters picked without replacement from {j: 2, d: 1, q: 2, x: 6, a: 1}. Give prob of sequence jqx. 1/55 Three letters picked without replacement from {l: 5, i: 2}. Give prob of sequence ili. 1/21 What is prob of sequence uun when three letters picked without replacement from {n: 6, u: 4, s: 3, t: 1}? 3/91 Calculate prob of sequence yaa when three letters picked without replacement from {a: 4, r: 3, y: 4, i: 3}. 2/91 Calculate prob of sequence aff when three letters picked w	{ "pile_set_name": "DM Mathematics" }
7. Let x = l - p. Is x a multiple of 5? False Let l(h) = -3h2 + 18h2 + h3 - 11 - 3h + 2h. Let x be l(-15). Suppose -5p + 76 = -0p - 4o, -32 = -xp - 4o. Is p a multiple of 6? True Suppose -2v + 4n = 2v - 3748, 3n + 3 = 0. Let w = -856 + 858. Suppose wy + v = 15y. Is 6 a factor of y? True Let u be (70/8 - 2) + 8/32. Let f = -4 - u. Let g(i) = i3 + 13i*2 + 16i - 1. Is g(f) a multiple of 13? True Let p(k) = k*2 - 15k - 152. Let u be p(22). Let z(g) = g3 - g2 - 3g + 1. Let n be z(2). Is 4 a factor of (-6)/n1 + u? True Let v(d) be the third derivative of -d*5/60 + 5d*4/6 - 16d*3/3 + 54d2. Is v(14) a multiple of 4? True Let x = -10308 + 14037. Is x a multiple of 13? False Let o = -13571 - -21407. Does 64 divide o? False Let s(l) = -l2 - 11l - 14. Let x(i) = -i2 - 11i - 15. Let z(m) = 6s(m) - 7x(m). Let a be z(-9). Suppose 0 = -2u - au + 210. Is u a multiple of 6? True Let w(z) = 4z + 48. Suppose 5y - 402 = -22. Let o = y - 63. Is w(o) a multiple of 25? True Suppose -6s + 674 - 116 = 0. Suppose 20 + s = o. Is 7 a factor of o? False Let u = 328 - 299. Suppose ul - 24l - 450 = 0. Is 30 a factor of l? True Suppose 0 = 2l + 8, -h + l - 1 = -5. Suppose 0r - 5j - 8 = -r, 3r + 4j + 52 = h. Let s(y) = y*3 + 11y*2 - 12y + 12. Is s(r) a multiple of 12? True Let d = -20 + 24. Suppose dz - 1187 = -s, -12s - 874 = -3z - 16s. Is z a multiple of 15? False Let l be ((-12)/(-14))/(66/308). Suppose 0 = w, 2128 = lt + 29w - 34w. Is t a multiple of 28? True Suppose 5x + 0x = 35. Let d(k) = -4k*2 + 13k + 5k - 10k - k*3 + 11k2 - 6. Does 11 divide d(x)? False Let p(r) = r3 - 2r2 - r + 3. Let i be p(3). Suppose -ib - 10 = 35. Let u(w) = -13w + 1. Is u(b) a multiple of 13? False Let f(d) = -d2 + 20d - 13. Let i be f(19). Let c be (-86)/i9(-5)/(-15). Let g = 110 + c. Is g a multiple of 20? False Let w = -152 - -432. Suppose -16j + 12j + w = 0. Is 22 a factor of j? False Suppose -2h + 4a - a - 25 = 0, -2a = -5h - 79. Let c(v) = -14 - 6 + v*2 + 9v + 5v + 1. Is 6 a factor of c(h)? False Let k(h) = -2h + 20h2 + 11h + 5 - 12h2. Let f be k(-3). Suppose -4v - 11 = -p + f, -5 = -v. Does 27 divide p? True Let d(v) = 4v3 - 15v*2 + 7v. Let t(m) = -m3 + m2 - 1. Let k(a) = d(a) + 5t(a). Let u be k(-11). Let g = u - -13. Is 23 a factor of g? False Let q = -202 + 204. Suppose 3c - qo - 1328 = 0, -371 = -3c - 5o + 971. Is c a multiple of 42? False Let h(w) = w3 - 4w*2 + 8w - 7. Let c be h(5). Suppose 0 = -0b - b + 4t - 6, 4b + 5t = -3. Let s = c + b. Is s a multiple of 14? True Suppose -5n = -4n - 29. Suppose -5q = -10q - 4l + n, 4q - 2l - 44 = 0. Suppose c + 0 = q. Is 9 a factor of c? True Let j(q) = -q3 + 23q*2 + 97q - 1688. Does 39 divide j(19)? True Let h be -1 + 32 + (-2)/42. Let m be 32/(-6)(-225)/h. Does 28 divide 3170/m + ((-3)/4)/3? False Let l(q) = -6q + 150. Let p be l(25). Suppose 4m - 16 = p, -8m + 764 = 2b - 5m. Is 94 a factor of b? True Let r = -144 - -148. Is r/(-2) - -1584/4 a multiple of 29? False Let k(z) = -3z - 5. Suppose -r - 150 = -6r. Suppose 2j - j - 2l + 19 = 0, -2j + 2l = r. Does 3 divide k(j)? False Let d be 180 + 0 + 0 - 0. Suppose 10956b = 10954b + 54. Suppose bo - 25o = d. Is o a multiple of 28? False Suppose -25c = -36c + 17801 + 4837. Is c a multiple of 49? True Let y be (88/12 + 4)/((-2)/(-3)). Suppose j + y = 81. Suppose 48k = 52k - j. Does 4 divide k? True Suppose -16a - 180 = -21a. Suppose 0 = -3i + 156 - a. Let l = i - 8. Is 16 a factor of l? True Suppose -385l - 57960 = -405l. Is 42 a factor of l? True Suppose -2p + 3m = -2, -5 = -0p - 3p + 5m. Let s(d) = -d*3 + 4d*2 + 10d + 7. Does 14 divide s(p)? True Let s(q) = 52 - 36 - 28 + 2q2 + 2q. Let k be s(3). Let n(p) = 3p - 14. Is 13 a factor of n(k)? False Let x be (1/2)/(3/30). Let i(f) = f3 + 14f*2 - 35f - 28. Let w be i(-16). Suppose -xr + 155 = -w. Is r a multiple of 7? True Let r = 3467 - -2121. Is 53 a factor of r? False Suppose 3c - 29328 = 109o - 106o, -3o + 39146 = 4c. Is c a multiple of 134? True Let u(x) be the third derivative of x*4/6 + 11x*3/6 + 32x*2. Is u(11) a multiple of 11? True Let w = 25933 + -15180. Is 11 a factor of w? False Suppose 4g = 3 + 13. Let f be g/2 + (7 + -4 - 0). Is -255(13/f + -3) a multiple of 10? True Let d(j) = j*2 + 7j - 15. Let a be d(-9). Suppose -1145 = ay - 5b - 6064, b + 3291 = 2y. Does 14 divide y? False Let p = -431 + 665. Is ((-1)/(-5)p)/((-12)/(-60)) a multiple of 26? True Let h(z) be the first derivative of z6/120 - z5/10 + z*4/8 - 2z*3/3 + 5z*2 + 6. Let g(i) be the second derivative of h(i). Does 7 divide g(6)? True Suppose -5l - 110 = -70, -3l = 7w - 287592. Does 32 divide w? True Let f = -5043 + 9171. Is 8 a factor of f? True Let a = -189 - -299. Let d be (-2)/(a/56 - (5 - 3)). Suppose g + d = 5g. Is g a multiple of 3? False Let w(x) = 47x*2 - 106x + 1408. Does 17 divide w(13)? True Suppose 4n = 2n - 2, -8 = q + 3n. Let b = q + 109. Is b a multiple of 13? True Suppose -2x - 442 = 2k, -2k - 5x - 491 = -55. Let s = k - -614. Suppose 2m = 4d - m - s, m = d - 99. Is 15 a factor of d? False Does 8 divide (2 + (-4)/((-48)/4917))/(78/832)? True Let k(n) = -1652n - 3227. Does 23 divide k(-4)? True Let f = 13048 + -5008. Does 67 divide f? True Is 14892(704/33)/32 a multiple of 146? True Let a(k) = -345k - 12905. Does 13 divide a(-102)? False Let p be 42/(-8) - 15/(-12). Let w = -24 - -45. Let k = w + p. Is 5 a factor of k? False Let t = 467 - 465. Suppose 0 = v - 4w - 126, 3v - tv = -2w + 138. Is 2 a factor of v? True Let o(t) = -3t + 4t + 11t2 + 9 - 2t*2 + 8t*2 + t. Does 46 divide o(-7)? True Suppose -5w = v + 13, 6w - 5 = -4v + 5w. Suppose 0 = -6m + 7m - 3i - 766, -3i + 1523 = vm. Does 22 divide m? False Suppose -27x = -29x + 80. Let n = 0 + x. Is n a multiple of 20? True Let p(v) = v*3 - 2v*2 - 13v + 32. Let o be p(5). Suppose 5226 = -os + 27066. Is 40 a factor of s? True Does 171 divide (789 - 0)/((-4)/((-1908)/27))? False Suppose -27 + 15 = -4f. Suppose 0v - 3v - fc = -153, -4c + 20 = 0. Is v a multiple of 3? False Suppose -3o = -5h + 285, 157 = 2h + h + o. Suppose 2z = 30 + h. Is z a multiple of 7? True Suppose 0k = -k - 15. Let y = -13 - k. Suppose yg = 8g - 102. Is g a multiple of 13? False Suppose -28x = -25x. Suppose 0 = -4n + 5y + 139, 3n + 2y - 133 = -xy. Let o = -25 + n. Is 3 a factor of o? False Let m = 3168 - 1296. Is m a multiple of 26? True Let x(l) = 7l + 2 - 82l*2 + 215l*2 - 4l. Is 12 a factor of x(-1)? True Let n(r) = 82r2 + 2r + 9. Let p(u) = -u*3 - 19u*2 - 34u - 2. Let m be p(-17). Is n(m) a multiple of 37? True Let c(k) = k*2 - 2k - 33. Let o be c(7). Suppose -5r + 8j - 3j = -565, 458 = 4r - oj. Is 4 a factor of r? True Let g(u) = -11u*2 - 3u - 15. Let q(b) = -12b2 - b - 14. Let i(c) = -4g(c) + 3q(c). Does 14 divide i(-4)? False Let f be ((-16)/(-5))/((-2)/(-5)). Let l(c) be the second derivative of c4/6 - 11c*3/6 + 19c*2/2 - 14c. Does 10 divide l(f)? False Let a(f) = -4f + 9. Let o(d) = -d - 1. Let c(b) = -a(b) + 3o(b). Let n be c(15). Suppose ng - 5w = 150, 2g + 3w - 84 = w. Is 15 a factor of g? True Let m(p) = 51p - 181. Let f be m(22). Suppose -fo = -935o - 3354. Is 38 a factor of o? False Let d(y) = 4y + 1. Let z(p) = -2p - 1. Let t(o) = 4d(o) + 10z(o). Let v be t(-1). Let b(f) = 2f*2 + f + 4. Does 10 divide b(v)? True Let v = 4260 - 520. Is 151 a factor of v? False Suppose 5s - 8980 = 5n, 2s = 5n - 603 + 4183. Does 49 divide s? False Suppose 12t - 8t = 2216. Let v = t + -797. Let s = -125 - v. Does 12 divide s? False Let f(j) = -546j + 1085. Does 22 divide f(-99)? False Let p(z) = z*2 - 22z + 69. Let j be p(19). Is 17 a factor of j/((8/(-24))/(340/(-18)))? True Suppose 5x + x - 72 = 0. Suppose 0 = -xu - 7 + 31. Suppose n = up - 73, 6p + n = 2p + 131. Is 8 a factor of p? False Let v be 0/(-4 - -5) + (-2)/(-1). Suppose 0 = 2c + 3d - 877, 3d + 31 = vc - 840. Suppose -6k = -2r - 2k + 442, 2r - c = 5k. Is 44 a factor of r? False Let n = -338 + 347. Let q be 36/8 - 2/(-4). Suppos	{ "pile_set_name": "DM Mathematics" }
ve 0 = 2y - 2i - 180 + 126, -158y + i = -160y - 27 for y. 0 Solve -2u + 2586 - 2528 = -2b, -106u + 108u = -4b - 92 for b. -25 Solve -l - 5c + 38 = 0, 99 + 111 = 5l + 35c - 50 for l. 3 Solve 9i + 15 = 5l + 50, -115680i + 115677i = -2l - 11 for i. 5 Solve -5 = 2m - 4m - 4s - 31, s + 10s = 7s - 16 for m. -5 Solve 148r - 145r - 4s + 13 + 41 = 0, 3s = -r + 34 for r. -2 Solve -5v - 4x + 143 = 0, -29v - 20x = -11v - 25x - 573 for v. 31 Solve -70 = 4i - 2j, 79726i - 4j = 79729i + 80 for i. -20 Solve -l + 196 - 381 + 235 = 4c, -4c + 230 = 7l for c. 5 Solve -7095n - 7103n = -14200n + 2o + 130, 69 = n + 3o for n. 66 Solve -5n = -4h - 195 + 286, n = -3h + 54 for n. -3 Solve -357t - 15 = -2w - 358t, -3t + 33 = 3w for w. 4 Solve 2d + 77 = -23p, 193d - 188d = -p - 249 for p. 1 Solve -52n = -53n + 16u + 94, -n - 2n + 10u + 64 = -2n for n. 14 Solve t - 3y - 12 = -2y, -4y - 174 = -6t - 12t for t. 9 Solve -4p + 2t - 16 = 0, -5p = -213953t + 213954t - 36 for p. 4 Solve 24k - 3w + 131 = -7w - 370 - 227, -28 = k - w for k. -30 Solve 0 = 5v + 5s - 2s + 17, -3v + 5s + 117 - 66 = 0 for v. 2 Solve -17t + 13t - 3o - 125 = 0, 0 = 4o - 4 for t. -32 Solve -225 = 445z - 490z, -4g = 4z - 112 for g. 23 Solve 3f - 100w + 38 = -52w - 44w, 29f + 25 = -5w + 7 for f. -2 Solve 6c + 572d - 24 = c + 570d + 5, 10c - 12c + d + 8 = 0 for c. 5 Solve -4f - 5 = 4v + v, -6f + 2f - 102v + 32 = -f - 134v for f. 0 Solve -2k - 62 = n, 5k + 61n + 3942 - 3670 = 0 for k. -30 Solve 2t = -3o - 1021 + 1042, 2o + 3t - 17 = 7 for o. 3 Solve -308d + 22k = -303d - 1305, -2d = 2k + 126 for d. -3 Solve 32l - 24l - 5w - 113 = 0, 4w = -4l + 24 for l. 11 Solve -3k + 18t + 5t - 19t = 67, -3k - 266t + 4253 = 0 for k. -1 Solve 5 - 2 = -0r - r, 125u = 10u - 48r + 50r + 1731 for u. 15 Solve -215s = 5g - 213s + 55, 4g - 2s = -44 for g. -11 Solve -3o + 3a - 123 = 0, -1730265 = -2o - 4a - 1730089 for o. 2 Solve 4q - 20 = 4b, 2q - 65 = 85b - 186 + 712 for b. -7 Solve -h = -18i + 268, -23i - h + 77 = -18i for i. 15 Solve -3c - 9 = 2f, f - c - 290 + 180 = -127 for f. -12 Solve 37f - 2a - 7 + 17 = 112, f + a + 12 = 0 for f. 2 Solve 5h + 3g + 103 = 0, 27597g + 53 = 5h + 27594g for h. -5 Solve -b = 3w + 6446 - 6476, -30 = -3w + 23b for w. 10 Solve -2w + 333 = -4w + 4u + 123, 2u = 4w + 120 for w. -5 Solve 1261f = t + 1262f, 2f = 2t for t. 0 Solve -5q + 165 = 2n, -4n - 25159 + 25060 = -3q for q. 33 Solve -3q - 15 = 3g, 0 = -0g + 4g - q - 2097347 + 2097362 for g. -4 Solve 3p + 7 = 105b - 53b - 57b, 31 = 3b - 7p for b. 1 Solve 3m - 5577 = 4s - 5454, -180 = -4m for s. 3 Solve 4n + 4484 = 5m + 4588, 4m + 5n - 89 = -0n for m. -4 Solve -51r - 2y - 47 = -56r + 2y, -3r + 46 = 5y + 151 for r. -5 Solve 3j - 1524 = -66q - 1677, 3q - 3j = -192 for q. -5 Solve -40u + 27r = -21u + 489, -5r = -r - 64 for u. -3 Solve -k = -4u - 16, -30u - 138 = -22k + 42k - 23k for k. -4 Solve 32f = -27f + 55f + 3v - 70, 8f + 138 = 3v - 8 for f. -19 Solve 15 = 5p - 4w, -6p - 25411w + 25416w = -18 for p. 3 Solve -4941n + 15 = -4943n + 3m, -2n - 2m = -20 for n. 3 Solve y + 27 = 0, -27y + 25y + 2 = -4a + 16 + 32 for a. -2 Solve -5w + 3x = 86 - 72 + 58, 0 = -8w - 5x + 169 for w. 3 Solve -6 - 11 = -13n - 5m, -167m = 4n - 170m + 22 for n. -1 Solve 4 = 34b - 5c - 190, 0 = -5c - 330 for b. -4 Solve 0 = 2h + 8, -2947 - 2700 = 340x - 1298x + 5h - 1795 for x. 4 Solve -130y - 62 = -128y - 4n - 82, 26 = 2y - n for y. 14 Solve 45v + 126 + 5 = -c, 2c - 989v = -987v + 106 for c. 49 Solve 17 = -d + 4d + 2m, -1689 = 2d - 5m - 1713 for d. 7 Solve -37f + 61 = -35f - 7r, -3f + 54 = 2r for f. 20 Solve 0 = -3j - 4p - 64, 0p - 9 = 2p + 2 + 27 for j. 4 Solve 7u - 6 = 2p, 16u - 208 = 2p - 184 for u. 2 Solve -15217949j - 4r = -15217950j + 52, -2j + 5r + 92 = 0 for j. 36 Solve -4s - g + 6107 = 6082, 0 = 77s + 3g - 205 for s. 2 Solve 81185y - 110 = 81095y + 8d - 9d, 2y + 38 = 2d for y. 1 Solve 35930j - 35925j = -4b - 120, 2b = -4j - 90 for b. -5 Solve 4p - 1693r + 1688r = -2p - 0p - 70, 2r + 42 = 5p + 5r for p. 0 Solve -11m + 3m - 55 = q, -17m = 15m - 43m + 6m + 3q + 49 for m. -4 Solve -g = -8o - 24, 5g + 64 - 4 = 4o for g. -16 Solve 323z - 323z + 3r = 12, -3z - 4r - 12 + 26 = -2r for z. 2 Solve 5v + 5m = -18 - 17, -15v + 269m - 33 = -12v + 274m for v. -1 Solve -3b + 164 = -w, -5w + 4122b + 3314 = 4185b for w. -5 Solve 5v - 54 = -d, -12v - 75d - 243 = -78d for v. -3 Solve 4x = -n + 98, -4x - 1137965n + 1137970n = -110 for x. 25 Solve -4j + 11k = -1224710 + 1224682, 0 = -5j + 5k for j. -4 Solve 253x + 42 = 4z + 254x + 29, 2z = -5x - 25 for z. 5 Solve -40 = 5b, -41b + 167 = -c + 490 for c. -5 Solve 3w - 3r + 13r + 192 = 5r - 18r + 74, 6r = -12 for w. -24 Solve -3d + 0u + 3u + 0u - 17 = 4, 15u - 28 = 4d + 48u for d. -7 Solve 26b + 4 = 23b - y, 8b - 191y = -195y - 16 for b. 0 Solve -56 = -2b - 3b - v, b + 347v - 15 = 343v for b. 11 Solve 95 = -2d + 5f + 16, -3f + 51 = 91d - 94d for d. -2 Solve -8p - 208 = -6t + p - p, -2p - 288 + 96 = -5t for t. 40 Solve 42t = 34t - 100t - h + 214, 4h + 8 = 0 for t. 2 Solve 0 = -2c + 2b + 22, -18 + 4 = 2c + 3b - 2b for c. -1 Solve -17i = -16i + 7x + x + 56, -4i + 21 = -3x for i. 0 Solve 4q + 2y = 600 - 592, -58 = -29q - 3y for q. 2 Solve 6117u - 5b = 6118u - 25, 2u = 6b - 46 for u. -5 Solve p - s - 1 = -3s - 36, 23s = 24s + 18 for p. 1 Solve -34c + 68c - 184 = 49w + 32c, 2c = -12 for w. -4 Solve 0 = 3o + 4d + 94, -4o + 395d - 219d - 124 = 180d for o. -30 Solve -4f + 341z = 345z - 8, 1 = -4f + 5z for f. 1 Solve 4y - 3g + 75 = 0, -26835y + 113 = -26836y + 4g for y. 3 Solve -80 = 2s, -23544p - 6s = -23552p + 232 for p. -1 Solve 4h - 2h = -2k + 15h - 78, 0 = -k + 5h - 30 for k. 0 Solve -3h - 275 = 84y - 635, 5y - 3h + 4 = 0 for y. 4 Solve -4k + 927g - 932g = -2k + 51, -5g = -18k - 209 for k. -13 Solve -15 = -5o, -42t + 80o - 264 = 62o for t. -5 Solve -3o + 21 = 2v + 2o, -11v + 4o + 4o + 105 = 19v + 13o for v. 3 Solve -6q + 0 = 12, 18n - 22q - 22q - 28 = 23q - 71q for n. 2 Solve -32s + 7s = -15v - 340, 5s - 1639v - 38 = -0s - 1641v for s. 10 Solve 28z + 33h + 24h = -11z + 60h + 318, -5z - 4h = -32 for z. 8 Solve 11081 = 3j - 2r + 11143, 5j + r = -86 for j. -18 Solve -s + 2s - 3q = -11, -4q = -367s + 196s + 200s + 137 for s. -5 Solve 0 = -2x - 4u - 32, -283852u = -3x - 283847u + 18 for x. -4 Solve 11f + 2 = 13f, u = 6u - 6f + 2f - 141 for u. 29 Solve 12i + 2t + t - 69 = 0, 7t - 1 = 4i for i. 5 Solve -4x - 72 + 161 - 97 = m, 0 = 13x + 4m + 26 for x. -2 Solve -2y + 10 = -b, -6097 + 6102 = 4b + 7y for b. -4 Solve 2g - 57 = 3g, 4y + 1330g - 1326g = -220 for y. 2 Solve y = 14c - 11c - 22, c - 32 - 2 = 7y for c. 6 Solve -9p = -5u - 7p + 36, u = 2u + u + 5p - 26 for u. 8 Solve 570c - 2n = 258c + 317c - 6, 39c - 163 = n for c. 4 Solve 98l + 4z = -118, 3l - 4z - 3858 = -3841 for l. -1 Solve -49b - 63b = -88b + 3u + 45, 2b + 4u = -30 for b. -1 Solve -358w - 16 = 371w - 725w - 2m, -36 = -24w + m for w. 2 Solve -5j + 0s + 3s = -69, -4s = -2857j + 2862j + 57 for j. 3 Solve 0 = -2z - 3k - 68, 5z + 12k = 172 - 432 for z. -4 Solve -4u + g - 8 = -34, -279 + 271 = -0g - 4g for u. 7 Solve u - 333i = -329i + 15, 3u + 3i + 2 + 28 = 0 for u. -5 Solve 70 = -2a - 46j + 50j, 7j - j = -a + 22 + 103 for a. 5 Solve 36g = 37g + 3x + 5, -11g + 14 = -5x + 31 for g. -2 Solve -3f + 8m = 23, 4m - 13925 + 13906 = -f for f. 3 Solve 2u = 3m - 4 - 31, -1033u + 1028u = 5m - 50 for u. -1 Solve -26q - 4u - 112609 + 113099 = 0, 3u + 3 = 0 for q. 19 Solve 0 = 2a + 6244 - 6240, 0a - a - 6 = -4v for v. 1 Solve 122 = -3h + 79c, -364h + 3c = -367h + 42 for h. 12 Solve 2n = 3i + 9, -49n - 27i + 126 = -44n for n. 9 Solve 0 = -5l - 31n + 35n + 7 - 36, 40n - 25 = -2l - l for l. -5 Solve 5s + 572 = 2p + 725, 4p + 0p - 190 = -	{ "pile_set_name": "DM Mathematics" }
c) -0.101 (d) 0.1 (e) -3 c Which is the closest to -1/4? (a) 0.028 (b) -2/2137 (c) 418 b What is the closest to 0 in -1040, -0.1, -137, 2, 0.4? -0.1 What is the closest to 0.3 in -30, 17, 277? 17 Which is the nearest to -79? (a) -0.7 (b) 0.03 (c) -1/1549 a What is the closest to -24 in 2/91, -5.3, 107? -5.3 What is the nearest to 0.3 in -348, -1/5835, 5/6? -1/5835 What is the closest to -12 in 0.5, -0.2, -372, -6/7, 4/3? -6/7 Which is the nearest to 2? (a) -3 (b) -32414 (c) 1/4 (d) -6 c Which is the closest to 0.1? (a) 24.2014 (b) -1/2 (c) 23/4 b Which is the closest to -14? (a) 0.07 (b) -544 (c) -2/33 c Which is the closest to 4? (a) 0.5 (b) -5 (c) -1/33 (d) -21594 a Which is the closest to -1/3? (a) -3 (b) -0.3 (c) 4 (d) 2368 (e) -4/7 b Which is the closest to 1? (a) 0.04 (b) -0.2 (c) -230 (d) -1/2 (e) -0.0093 a What is the nearest to 21 in 3/4, 2, -1985, -1, -2/3? 2 What is the nearest to 1 in -5/6, -1/6, -0.5, -281737.2? -1/6 What is the closest to -2/5 in -1/3, 12, 0.3, 105, -145? -1/3 Which is the closest to -123/29? (a) -2 (b) 1 (c) 45/13 a What is the nearest to -393 in 65, 6/7, 4/11? 4/11 What is the nearest to 1/4 in -0.67, -2, 2/9, -111.02? 2/9 Which is the nearest to -91? (a) 76/3 (b) 0.1 (c) -21 (d) 3/2 c What is the closest to 1 in -1/4, 0.05, 0, -2/97, 1/228? 0.05 What is the closest to -2/11 in 89, 0.4, -1, 489, -0.05? -0.05 Which is the closest to 1774? (a) 88 (b) -7 (c) -5 (d) 4 a What is the closest to -22 in -4, -1/4637, -1.17? -4 Which is the closest to -39? (a) 0 (b) 0.4 (c) -2913 (d) 2/11 a What is the closest to 1/2 in -7852, 0, -2/41? 0 Which is the nearest to -1? (a) -3.1 (b) -2/9 (c) -172 (d) -5 (e) -77 b Which is the closest to 0.1? (a) 0.3 (b) 152664 (c) -0.2 (d) -3 (e) -2/7 a Which is the nearest to 1952.8? (a) -3/5 (b) 0 (c) -1/42 (d) 8 d What is the nearest to -0.1 in 3, -383950, 0.1? 0.1 Which is the closest to 0.1? (a) -535 (b) 248 (c) 2.03 c Which is the closest to -0.1? (a) -1.98 (b) -3.23 (c) 17 (d) 4 (e) -1/5 e Which is the closest to -4? (a) 0.01 (b) 3.4 (c) 1 (d) 3096/7 (e) -2/3 (f) 0.4 e Which is the closest to -1? (a) 9/2 (b) -7/4 (c) -1/8 (d) 1/4 (e) 0.28 b Which is the closest to -0.59? (a) -1543 (b) 1/8 (c) 16 b Which is the nearest to 0.01? (a) 13564 (b) -1286 (c) 0.5 c Which is the nearest to 0? (a) -2/15 (b) -2/11 (c) -15 (d) 1991 (e) -1 a Which is the closest to -2/7? (a) -5 (b) -341 (c) -3/2 (d) -1 (e) -65 d What is the closest to 2 in 1, -0.1, -4/958493, -4/9, -5? 1 Which is the closest to 3/5? (a) 3 (b) -0.0754 (c) 3.27 (d) -1/9 b Which is the nearest to 12? (a) 0 (b) 278 (c) -235 a Which is the closest to -2/309? (a) -1/7 (b) -2 (c) 36 (d) -5 a Which is the nearest to -141/13? (a) 193 (b) -5/141 (c) 0.4 b Which is the closest to 2/207? (a) -5/227 (b) -10 (c) 0.5 a Which is the closest to -4? (a) 2 (b) 10467 (c) -0.02 c Which is the nearest to -0.03? (a) 47 (b) -0.16 (c) -17.6 (d) 3/5 b Which is the nearest to 76? (a) 5 (b) -1/2 (c) -0.3741 (d) -15 a What is the nearest to 1 in -427, 3/8, -0.1, -1/2, 1/8, 2/19? 3/8 What is the closest to 12.1 in 0, -4, 0.06, 0.2, 0.1, 1.4? 1.4 Which is the nearest to 2? (a) 479 (b) -1141/13 (c) -1 (d) 2 d Which is the closest to 0.01? (a) -823 (b) 635 (c) -0.02 c What is the nearest to 0.1 in 174310/7, -1/6, -1? -1/6 What is the nearest to -324 in -4.45, -2/27, -2/13? -4.45 Which is the nearest to -0.1? (a) 0.116 (b) -0.12 (c) -61 (d) 4 (e) 3 b Which is the nearest to -0.083? (a) 2 (b) 0.4 (c) 4 (d) -1.99 (e) -7 b Which is the closest to 1? (a) 0.02 (b) -41 (c) 0.03 (d) 2/9 (e) -327 d Which is the nearest to 5/346? (a) 1/2 (b) -0.2 (c) 110.5 b Which is the nearest to -7? (a) -1/6 (b) -148/3 (c) 2 (d) 2/3 (e) 2/2279 a What is the closest to 1/4 in 28462, 4, 1, 8? 1 Which is the nearest to 0? (a) -0.04 (b) -13/6 (c) 2/5 (d) 96568 (e) 0.2 a Which is the closest to -1/60? (a) 2/9 (b) 0 (c) -1/2 (d) 116 b Which is the closest to -1.17? (a) -1/4 (b) 45 (c) 171 a What is the nearest to 3/182 in 5/6, 178, 4, 2, 0? 0 What is the closest to 0.2 in 49143/19, 3/7, 71? 3/7 Which is the nearest to 0.12? (a) 3 (b) 93/25 (c) -28 a What is the nearest to -2/3 in -2/13, -41/6, 5, 3/7, 4, -0.2? -0.2 What is the closest to -1/8 in 2/3, -3/5, 7, 0.291? 0.291 Which is the nearest to -5? (a) -8 (b) 0.0468 (c) -0.14 a Which is the nearest to -1/3? (a) 3 (b) 1.3 (c) -0.1 (d) 0.8 (e) 1120 c What is the nearest to 6/19 in -5, 0, -126, 3, -6? 0 Which is the closest to 0.41? (a) 0.1 (b) -2/33 (c) 0.009 (d) -8 (e) -2 a Which is the nearest to -746518? (a) -4/7 (b) 2 (c) -8/3 (d) -2/5 c What is the closest to -7 in -0.2, -42854, 0, -3? -3 What is the closest to -3/5587 in -4, 3, 5, 1, -5/9? -5/9 What is the nearest to -1.2 in 7, 9/103, 47, 0.4, 3/2? 9/103 What is the nearest to 0.1 in -1, -2, -1/5, -44, -16, -0.4? -1/5 What is the nearest to -2/3 in -477, 17, -1.1, -11, 5? -1.1 What is the closest to 0.013 in 3, -0.23632, -0.2? -0.2 Which is the closest to -2/3? (a) -462 (b) -0.3 (c) 248 (d) 2 b Which is the closest to -10? (a) 2/9 (b) 0.5 (c) 3/4 (d) -3 (e) -895 (f) -14/5 d Which is the closest to -295? (a) -29 (b) 0 (c) 6 a Which is the nearest to 22/15? (a) -3 (b) -522 (c) -5 a What is the closest to 1 in 5/2, -4, 60, 252, -1? 5/2 Which is the closest to -0.2? (a) -3/7 (b) 20496 (c) 0.02 (d) 32 c Which is the closest to 895/12? (a) 1 (b) -3584 (c) 0.3 a What is the closest to 125 in -59, 5/17, 0.51? 0.51 What is the closest to 66 in 1/65, -882, -4? 1/65 What is the nearest to -333 in 0.2, 0, -18084, -0.1, -1/4? -1/4 Which is the closest to 16/9? (a) 33 (b) -0.5 (c) 0.5 (d) 1 (e) -2/3 d What is the closest to -0.1 in 3/7, -3, 3, -3037, 38? 3/7 Which is the closest to 8? (a) 2/7 (b) 2/13 (c) -0.106 (d) 26.1 (e) 0.052 (f) -0.3 a What is the nearest to 5/143301 in 0.3, -5, -0.5, -1, -4/7? 0.3 Which is the nearest to -2/5? (a) 474 (b) 24 (c) 1 c What is the closest to 1/5 in 3/25, -7, -105, 4? 3/25 What is the closest to 0.1 in -4, -18, 45, -5, -2? -2 What is the closest to -56 in 0.2, 199.34, 1, 2/11? 2/11 What is the nearest to 0.1 in 884, 0.187, 4, -2, 2/15? 2/15 Which is the closest to 1? (a) -101508691 (b) -5 (c) -4/5 c What is the closest to 1/43 in 8464, 1/4, -0.323? 1/4 What is the closest to -2 in 125.47, -3, -2/15, 4/33, 0? -3 Which is the closest to -4.5? (a) 3/5 (b) -0.5 (c) 40/7 (d) -8/11 d Which is the nearest to -1/2? (a) -2/7 (b) -3/7 (c) 0.15 (d) 1 (e) -0.218 b What is the closest to 6 in 1, 7, -5, 4, -196/13? 7 Which is the closest to 0? (a) 274 (b) -6 (c) 50 b Which is the nearest to -1? (a) 753053 (b) -1/2 (c) -2 b Which is the closest to 0? (a) -2 (b) 224136 (c) -77 (d) -0.2 d What is the nearest to 3 in 696, -0.05, -1, 3/16, -5, -2/7? 3/16 What is the closest to -1 in 0.6, -882.7, 22.1? 0.6 Which is the nearest to 49.29? (a) -2/955 (b) 2/13 (c) -1 b Which is the closest to -2? (a) 3 (b) -1 (c) 78150 b Which is the nearest to -0.1? (a) -501 (b) -1/48 (c) -10 (d) -15 b What is the closest to 28 in -2179, -3, 35? 35 What is the nearest to -11 in -1, -62, -0.2, 45.5, -1/4, 5? -1 What is the closest to -5 in 0.5, 2, 0.1, 0.2, 23/21? 0.1 Which is the closest to -7441? (a) 2/11 (b) -57 (c) 1 b Which is the nearest to -0.37? (a) -2/5 (b) 1 (c) -1997 (d) 0 (e) 0.3 (f) 0.06 a Which is the nearest to 2/3? (a) 1 (b) 0.786 (c) 1.1 b Which is the nearest to -129/4? (a) -1/14 (b) -1/83 (c) -5 c What is the closest to -0.1 in -29, 0.3, -1, 1/8, -135979? 1/8 What is the closest to -0.1 in 3, -4, -257, -2/5, -24? -2/5 Which is the closest to -1? (a) -1/37 (b) 4 (c) -4/3 (d) 2/2027 c Which is the nearest to 0? (a) -7.707 (b) -1 (c) 1/2 (d) 5 c Which is the nearest to 2/61? (a) 22 (b) 2913 (c) -2 c Which is the nearest to -2? (a) -1/19 (b) 2/13 (c) 2 (d) 51904 a What is the closest to 54645 in 2/9, 18/17, 13? 13 Which is the nearest to -8? (a) -0.2 (b) -68430 (c) -1/4 c What is the nearest to -44 in 0, 0.07, -24/13, 2/13, 2? -24/13 Which is the closest to 1/5? (a) 0.4 (b) -4 (c) 4 (d) -2/23 (e) -5	{ "pile_set_name": "DM Mathematics" }
4 + 16. Suppose 5i = -4v + 27, -3v + g = 3i - 6. Suppose 2t + vt = 105. Is t a composite number? True Suppose -4s = -4q, -q = -2q + 5s - 8. Suppose -92 = 4x - qa, -x - 12 = -a + 13. Let y = x - -44. Is y a composite number? False Let m(p) = p*2 - 2p + 2. Suppose -3v - 8 - 7 = 0. Is m(v) prime? True Is (2262/(-6))/((-2)/2) a composite number? True Suppose 35 = -2z - 3z. Let l be (z - -5) + (-2)/(-2). Is (58/l)/((-4)/6) a prime number? False Let p(h) = -58h + 3. Let t be p(4). Let n(j) = 80j + 4. Let y be n(4). Let k = t + y. Is k composite? True Let g(v) = -v2 + 4v + 1. Let i be g(5). Is (-9)/(-3) + (-544)/i a prime number? True Let k(z) = z*2 + 5z + 2. Let m be k(-5). Suppose 2l = -3j + 879, -2j - l + 1167 = mj. Is j a composite number? True Let y = 1746 - 883. Is y a composite number? False Let v(h) = -164h - 11. Is v(-2) prime? True Is 16350/54 - 2/(-9) a prime number? False Let o(c) = 2c*2 - 15c + 8. Is o(10) prime? False Let x = 511 + -252. Is x composite? True Suppose -4w + 11w - 27139 = 0. Is w a prime number? True Let z be ((-297)/12)/(3/(-36)). Suppose 0 = l + 4u - 109, u + z = 3l + 3u. Let f = -44 + l. Is f a prime number? True Suppose 0a + 3a - 315 = -2k, -5a + 525 = 3k. Suppose 7l - 4l - a = 0. Is l composite? True Let a(g) = 250g + 9. Is a(5) a prime number? True Let a(r) = r - 6. Let g be a(8). Is (g/(-2) + 0)-19 a prime number? True Let s be -237 + (-2)/60. Let v = s - -382. Is v composite? True Suppose p - 14 = -0u - 2u, -4p + u = -20. Is p prime? False Let v(i) = i*3 - 6i*2 - i + 8. Let s be v(6). Suppose j = -sj + 15. Suppose -388 = -jq + 7. Is q composite? False Suppose 0s = -2s - 5r + 21, 0 = -3s + 2r - 16. Is 616/63 - s/9 a composite number? True Suppose 0 = -c - m + 269, -4c + 1068 = 3m - m. Suppose -5s - 343 = 3d, 0 = -5d + 5s - 240 - c. Let x = -69 - d. Is x prime? True Suppose -10 = -2x + 2. Suppose 5c - x - 24 = 0. Suppose 3q - cq + 30 = 0. Is q a composite number? True Let m be (-3)/(0 - 3) - 0. Is 1/(m/((-170)/(-2))) a composite number? True Let h(n) = n*3 + 5n*2 - n - 6. Let i be h(-5). Let o be (-10)/(-2) + -2 + 25. Is (-4 - i)o/(-6) composite? True Suppose -879 + 64 = -5v. Is v a prime number? True Let l be (-1 + 0)(-2 + 27). Let r = 34 - l. Is r prime? True Suppose 0k = 4k - 8. Suppose 62 = 3s - 5v, v + kv - 102 = -4s. Let z = s - -7. Is z a composite number? False Let z(c) = -4c3 - 2c*2 + c - 1. Let m = 1 - 3. Let f be z(m). Is (-4)/14 - (-1665)/f a prime number? True Suppose 4b = r - 4r + 1784, b - 445 = -r. Is b prime? True Let k(r) = 10r*3 - 2r*2 - 1. Let g = -9 - -12. Is k(g) a composite number? False Let a be (4 + 1)/(5 + -4). Suppose -3c - 12 = 0, 7x = 3x - ac + 64. Is x composite? True Let f(l) = l. Let v be f(-6). Let u(i) = 7i - i*2 + 7 - 3i2 - i3 + 0i2. Is u(v) a composite number? False Suppose 1295 = 5y + 2t, 4t - 1033 = -4y + 3t. Is y a composite number? False Let x(f) = -f*2 - 113. Let d be x(0). Let w = d - -182. Is w a composite number? True Let o(s) = 177s + 6. Is o(3) a prime number? False Suppose -4n = -2h + 2, 10h - 4n = 5h + 17. Suppose 0 = -3s - g + 486, -hg - 398 = -4s + 269. Is s a prime number? True Let p(x) be the third derivative of 0 - 1/6x3 - 1/12x*4 + 0x + 5/24x6 + x2 + 1/30x*5. Is p(2) prime? False Suppose -d = -5b - 27 - 12, 4d + 3b - 41 = 0. Suppose 0 = 4g - d - 6. Suppose q + gu - 10 = -0q, 4q - 2u - 150 = 0. Is q a prime number? False Let c(i) = i2 - 5i + 7. Suppose -2x = d - 15, -18 = -5d + 4d - 5x. Is c(d) composite? True Let b(a) = a*2 + a + 5. Let r be b(0). Suppose rh - 4c - 695 = -0h, 0 = -c + 5. Suppose -2f + f + h = 0. Is f composite? True Suppose -3o + 636 = o. Is o a prime number? False Let t(o) = 3o3 - 5o*2 - 5o + 1. Let f(q) = -q3 - q2 + 2q2 + 2q*3. Let a(x) = 4f(x) - t(x). Is a(-8) composite? False Let c(j) = 14j2 - 2j - 5. Suppose -2b - 2f + 18 = 0, -b - 3b = f - 21. Is c(b) a composite number? False Let m = 508 - 223. Suppose -3r = -4f + f + 285, 0 = 3f + r - m. Is f a composite number? True Suppose -3s = -y - 291, -5s + 0y - 3y + 485 = 0. Is s composite? False Let x = 7 - 4. Suppose 0 = 3k + x - 174. Is k a composite number? True Suppose -o - 3 = 3. Is ((-2)/(-6))/(o/(-666)) a composite number? False Let y be (1/3)/(6/7362). Suppose -5o + b + 2033 = 0, o + b + 0b - y = 0. Is o a composite number? True Suppose -4q + 780 = 196. Suppose z = -z + q. Let a = 104 - z. Is a a prime number? True Suppose -1 = 4x - 3x. Is 13/(x/(-15)3) composite? True Let f = -11 - -1378. Suppose -7t = -f - 180. Is t a composite number? True Let c(g) be the first derivative of g3/3 - g2/2 + 109g + 5. Is c(0) prime? True Suppose 0 - 5 = 5p. Suppose 309 - 39 = g. Is p/(-5) - g/(-25) composite? False Suppose 3 = 4i + 4s - 1, -3i = -2s - 18. Is (0 - -166)2/i a prime number? True Is 4/(-6 + 2)-2939 a prime number? True Suppose 3v - 4v + 5 = 0. Suppose vx - 91 = 4x. Is x prime? False Let r = 626 + 9. Is r a composite number? True Suppose -3m + 4851 = 4y, 5m = -3y + 1606 + 6490. Is m composite? False Is (2 - (0 - -3)) + 240 a composite number? False Suppose 12337 = 6f - 737. Is f composite? False Let a(j) = j2 + j + 15. Let r(f) = f3 - f2. Let z be r(0). Let m be a(z). Let i = m - 9. Is i a prime number? False Suppose -10v + 6305 = -5v. Is v composite? True Let j be 2-25(-28)/(-8). Let b = j - -808. Is b prime? False Suppose 4y - 3y + 692 = 0. Is y/(-10) - (-1)/(-5) prime? False Let c be ((-16)/(-3))/((-2)/15). Let t be 0 + 2 - c/1. Suppose -4a + a + t = 0. Is a a prime number? False Is ((-4)/12)/(-22/6948) prime? False Suppose u - 254 = -u. Is u prime? True Let h = 1828 - 751. Is h a prime number? False Let c = 2 - 2. Suppose 3v = -r + 79, c = 2v + 2r - 5r - 49. Is v a prime number? False Let m(n) = 8n - 1. Let u(i) = -3i2 - i - 6. Let l(p) = -2p*2 - 3. Let h(j) = -5l(j) + 3u(j). Let b be h(-2). Is m(b) a composite number? True Let g(p) = -p3 + 6p*2 + 8p - 2. Let u be g(7). Suppose 32 = -uq + 597. Is q a composite number? False Let z(l) = -l2 - 8l - 9. Let v be z(-6). Suppose -124 - 47 = -vc. Is c prime? False Suppose 0 = 3m - 8m + 1130. Suppose -w + 3o = 3w - 201, -4w - 2o + m = 0. Suppose 0 = -5g - f + w + 48, 3f - 33 = -2g. Is g a composite number? True Suppose 3k - 4385 = -2k. Is k composite? False Let d(h) be the third derivative of h6/120 - h4/24 + 23h3/6 - 3h*2. Is d(0) a prime number? True Suppose 2m + 0 = 6. Suppose ma + 2 = 14. Suppose 5u - k - 67 = 65, 2u - 60 = ak. Is u prime? False Let i(w) be the second derivative of -w5/10 - w4/2 + 7w3/6 + 3w*2/2 + w. Is i(-6) prime? False Suppose -5g + 27 = h, -5g + 2g + 6 = 0. Suppose 0 = 2d - 6, 0 = -b - 0d - d + h. Is b prime? False Let a(k) = -2k2 - 3k. Let h be a(-2). Is (483/(-6))/(h/4) a composite number? True Let z be 0(-2)/42. Suppose 0 = p - zp - 2. Let j(x) = 2x3 - x2 + x + 1. Is j(p) a composite number? True Let v(u) = 11u2 + u + 9. Is v(-7) a composite number? False Suppose 5t + 744 = 2p, -297 = 2t - 0p - p. Let b = 239 + t. Is b composite? False Is ((-13)/3 - -4)-1623 a prime number? True Suppose 0 = 5m - 5y - 15, 0 = -3m + 5y + 3 + 16. Let b be m/2-2 + 2. Suppose 0 = bf - 2p - 16, 0 = 5f - 3p + p - 18. Is f composite? False Suppose 5i = 3i + 126. Is 1593/i + 4/(-14) a composite number? True Suppose -2g + 3u - 58 = 0, -2u = -3g - 90 - 2. Let q = 10 + g. Is 4012/44 - (-4)/q a prime number? False Let l be -6 + 5 + 51. Is 47 + -1(2 - l) prime? False Is 1/(-6) - 943/(-6) a prime number? True Let h(v) = -58v - 243v + 8v. Is h(-1) composite? False Let g = 1 - -1. Suppose f = -5c + 1575, 0f - gf = c - 324. Is c a composite number? True Let u = -43 - -96. Is u composite? False Suppose 5u + 4o - 60 = -o, u - 2o - 9 = 0. Suppose 4m - 7t - u = -2t, m + 3t - 24 = 0. Suppose 0 = j - m - 26. Is j a composite number? True Is (-97)/(-2 + (-3)/(-2)) prime? False Let r = -111 - -113. Let g(d) = d**2 - d - 14. Let p be g(0). Is (1477/p)/((-1)/r) a composite number? False Let q(m) = m + 1. Let b be q(6). Suppose -	{ "pile_set_name": "DM Mathematics" }
- -1. Sort 4, a, 29 in decreasing order. 29, 4, a Suppose 10 = -5p, 5s + 5p = p - 43. Suppose 2m = -0m. Suppose -v + 58t - 57t = 0, -1 = t. Put v, m, s in increasing order. s, v, m Let c = -4 - -10. Suppose co + i - 10 = o, o + 4i = -17. Sort 0.7, -0.3, o, -2/11. -0.3, -2/11, 0.7, o Suppose f + 5l + 10 = 0, 0l + 5l + 10 = 0. Let k be 16 - ((5 - 7) + (-6)/(-2)). Let r(w) = -w*3 + 14w*2 + 14w + 10. Let d be r(k). Sort f, -1, d. d, -1, f Let z = 47.9 + -58. Let x = z + 10. Let d = -1 + -1. Sort d, 1/7, x in increasing order. d, x, 1/7 Suppose -q = -4 + 3. Suppose 0 = -15a - q + 61. Sort a, 1, -6 in increasing order. -6, 1, a Suppose 3y - y = 6. Suppose yw + 0w = 18. Suppose -wu + 15 = -u. Sort u, 5, 4 in descending order. 5, 4, u Let c = -82/3 + 27. Let x = 2.92 + 0.08. Put 2, c, x in descending order. x, 2, c Let c = 78/5 - 232/15. Sort 0, -7, -0.5, c in ascending order. -7, -0.5, 0, c Suppose -2j - 28 = -4n, -5j + 2n - 12 = 18. Let k be ((-15)/(j + 7))/(-1). Sort -4, -2, k. -4, -2, k Suppose 2 = 68d - 67d. Put 3, d, 6, 22 in decreasing order. 22, 6, 3, d Suppose 2v = -0v + 54. Let o be 190/(-45) - (-6)/v. Sort -3, 16, o. o, -3, 16 Let p = -0.3 - 0.7. Let k = 68/3 - 23. Sort p, k, -13 in increasing order. -13, p, k Let l = -80.1 + 79.94. Sort 0, 1/3, l in descending order. 1/3, 0, l Let w = -88.61 + 88.9. Sort -0.19, w, -5/6 in decreasing order. w, -0.19, -5/6 Let u = -38 - -29.5. Let o = u - -9. Suppose 0 = -4w + 6 + 10. Put w, 0.3, o in ascending order. 0.3, o, w Let q = -3 - -8. Suppose 42 - 7 = -7u. Sort q, 3, 0, u in decreasing order. q, 3, 0, u Let q = -2442 - -2439. Put -4, q, -13, -5 in descending order. q, -4, -5, -13 Let h = 2.27 + -4.27. Sort 1/2, 2, h, 1/5 in increasing order. h, 1/5, 1/2, 2 Suppose 125 = 4z - k, 0 = -z - 0z - 3k + 15. Suppose 8d - 2d = -z. Put 0, d, -1 in ascending order. d, -1, 0 Let v(r) = r*2 - r - 4 + 2 + 18 - 11r. Let j be v(11). Sort 0.4, 1, -6, j. -6, 0.4, 1, j Let s = -3.3 - -3.4. Let v = s - 0.7. Let b = 0.04 + -5.04. Sort 0, v, b in descending order. 0, v, b Let t = 5.6 + -6.6. Put -0.3, t, 2/3 in decreasing order. 2/3, -0.3, t Let a be (-37 + 32)/(5/(-2)). Sort -2, 62, a in decreasing order. 62, a, -2 Let a = -0.1155 + -4.8845. Let o = 6 + -3. Let m = o - 2.6. Put -2, m, a in decreasing order. m, -2, a Let m = -45 - -45.1. Let v = -4.069 - -0.069. Sort -3, 1, m, v. v, -3, m, 1 Let v = -1.959 + -0.041. Put 1/2, -0.02, v, -2/17 in ascending order. v, -2/17, -0.02, 1/2 Let o = 2.4 + -0.4. Let p(z) = 6z3 + 3z*2 - 3z - 1. Let v be p(1). Suppose vf = 2f - 12. Sort f, o, 1/2 in decreasing order. o, 1/2, f Let b = 6.4 - 10.4. Let o = -85/7 - -178/21. Put -0.4, b, o in decreasing order. -0.4, o, b Let z be (4 - (-35)/(-7)) + (-2)/(-1). Sort z, -17, 0, -5 in increasing order. -17, -5, 0, z Let x = -309 - -309. Sort 0.069, x, 5 in increasing order. x, 0.069, 5 Let z(c) = -c*3 + 2c*2 + c + 4. Let h be z(3). Let k = 2165 + -2162. Put -4, k, h, 2 in decreasing order. k, 2, h, -4 Suppose 7 = 5g - 4x - 10, -5x = 5g - 35. Let s be -231/(-2). Sort s, -1, -4, g. -4, -1, s, g Suppose y + 3n + 10 = -0n, 0 = 5y - 2n - 18. Let m = y + -54. Let d be 0 - (1 - m/(-44)). Put d, 4, -2 in decreasing order. 4, d, -2 Let m = -34.1 + 33.1. Let l = 7 - 12. Sort l, 3/4, m, -2/3 in ascending order. l, m, -2/3, 3/4 Let v(k) = -15k - 89. Let x be v(-6). Sort 2, x, -9, 3 in descending order. 3, 2, x, -9 Let f be 44/5(-180)/72. Sort -5/3, f, 0.3 in decreasing order. 0.3, -5/3, f Suppose -q - j = -5j - 3, -2q + 2j + 6 = 0. Let d be 1(0/1)/(4 - 2). Sort q, 5, d in ascending order. d, q, 5 Suppose -41 = 4l - 41. Put -2, -15, l, -4 in decreasing order. l, -2, -4, -15 Let v = 34 - 32. Let m(j) = j*2 + 5j + 7. Let g be m(-3). Put -7, v, g in decreasing order. v, g, -7 Let k be 8/(-2) - (-1 - -1). Let q be 42(-3)/(-33) - k/22. Sort q, -17, 5 in ascending order. -17, q, 5 Suppose -2k = 2s - s + 4, 3k + 7 = -s. Put k, -4, -4.3, -3/2 in increasing order. -4.3, -4, k, -3/2 Suppose 0 = -5x + 2x + 6. Suppose 0 = xb - j - 11, -15 = -4b - 6j + j. Let c be 4/235/(-14). Put -2, c, b in descending order. b, -2, c Let z = 307 + -305. Sort -27, -1, z, -3 in decreasing order. z, -1, -3, -27 Let m = -283 - -283.01. Put -5, m, -0.3 in descending order. m, -0.3, -5 Let h = 3.03 - 0.03. Let f = -11.2 + 8.2. Sort f, h, -2/19 in ascending order. f, -2/19, h Let s = 20 + -11. Let j(d) = -d*2 + 8d + 3. Let k be j(s). Let o(y) = 3y + 15. Let t be o(k). Put 1/6, -2/5, t in decreasing order. 1/6, -2/5, t Suppose -16s - 77 = -9s. Sort 0, 2, s in descending order. 2, 0, s Let r be -4 + ((-54)/(-6))/(-9). Put r, 15, -2 in decreasing order. 15, -2, r Let c be 30/(-35)7/(-2). Let q be 5 + ((-510)/35)/c. Let w = 7 + -6.7. Put 4, q, w in increasing order. q, w, 4 Let m = 13 - 21. Let g = -8 - m. Let b(r) = r*2 + r - 3. Let x be b(g). Sort 3/7, 5, x in decreasing order. 5, 3/7, x Let n = -546 + 546. Let z(o) = 5o3 + o2 + o. Let p be z(-1). Put n, 5, p in increasing order. p, n, 5 Let f be (1490/18 - -2) + 10/45. Let x = -89 + f. Put 1, 4, x in ascending order. x, 1, 4 Let w(i) = 4i - 6. Let g be w(8). Suppose -9q + 10q = g. Let b = q - 28. Sort -5, -1, b. -5, b, -1 Let w(i) = -4i*2 - 127i + 10. Let g be w(-31). Sort 4, -3, g in increasing order. -3, 4, g Suppose 20 = l + s, -3l - 2s + 7s + 44 = 0. Put 2, 3, 1, l in descending order. l, 3, 2, 1 Suppose -4t = 3k - 8 + 43, k + 17 = -4t. Sort k, -1, 1 in decreasing order. 1, -1, k Suppose 4b + 6 = -6. Let o be 2/(0 - -2)2. Let j = -5702 - -5707. Sort b, o, j in decreasing order. j, o, b Let x = 0.3 - 0.25. Let m = -3.2668 + 0.2668. Sort -5, x, m in descending order. x, m, -5 Let w(o) = -3o - 33. Let k be w(-12). Let c be 1((-40)/(-15) - k). Put 8, c, -3 in descending order. 8, c, -3 Let l be (12/15)/(2/10). Sort 0.7, l, 1/6, 1. 1/6, 0.7, 1, l Let r be ((-4)/(7 + -9))/(8/(-20)). Put -1, r, 0, 1 in ascending order. r, -1, 0, 1 Let p be (04/12)/(9/(-3)). Sort p, 32, -1. -1, p, 32 Let d = -271.94 + 276. Let r = d - 0.06. Let q = 3.8 - r. Put 0.4, q, 2 in decreasing order. 2, 0.4, q Suppose -22w - 15w = -33w. Sort w, 5, 2 in decreasing order. 5, 2, w Suppose 36h = 33h - 12. Suppose 5p - 2u + 15 = 0, 3u - 3 = -2p + 2u. Sort 0, p, h in ascending order. h, p, 0 Let m be (6-1)/(11 - 1). Sort -2/3, -5, m, 0.05. -5, -2/3, m, 0.05 Suppose -20 = -5y + y. Let j be 5 + -2 - -1 - 4. Let p be -6 + 2 + j/5. Put y, p, -5 in descending order. y, p, -5 Let a = 316 + -101. Put a, 3, -0.1, 4 in ascending order. -0.1, 3, 4, a Suppose 0 = -3f - 3r - 33, 0f + f - 19 = 5r. Sort 1, -3, f. f, -3, 1 Let s be (5 - (1 - 1)) + 0. Let q = -56 - -57. Sort q, s, 7. q, s, 7 Let a(b) = 17b + 97. Let i be a(-6). Suppose -3l + g + 0 = 9, 5l - 2g + 14 = 0. Sort i, 8, l in decreasing order. 8, l, i Let f = 49 - 32. Put -4, f, -1, 0 in increasing order. -4, -1, 0, f Let s = -0.133 + 0.063. Let l = -0.17 - s. Put -0.3, -2/5, l, 5 in ascending order. -2/5, -0.3, l, 5 Let b = -1297/7 - -185. Let i = -2 + 4. Put -1, i, -0.5, b in increasing order. -1, -0.5, b, i Let r = 1254.73 + -1260. Let s = 5 + r. Sort -0.2, s, -1 in increasing order. -1, s, -0.2 Let b be (((-24)/(-10))/3)/(110/(-25)). Sort -3/4, 1/10, b. -3/4, b, 1/10 Let j = 9 - 35/4. Put -2/15, -6/11, j in descending order. j, -2/15, -6/11 Let u(b) = b - 21. Let o be u(17). Let s(r) = -r2 - 4r - 2. Suppose 5m + 24 = 9. Let v be s(m). Put 3, o, v in ascending order. o, v, 3 Let u(s) be the third derivative of 5s*4/24 + 71s*3/6 + 40s*2. Let b be u(-14). Sort b, 5, -1, -7 in decreasing order. 5, b, -1, -7 Suppose 8c + 8 - 16 = 0. Suppose -c = 7i - 8i. Let r be (-1)/(-2) - (-6)/(-8). Put i, r, -2/5 in ascending order. -2/5, r, i Suppose 22a + 20 = 26a. Suppose f = ah + 11, -f - 1 = h + 6. Sort 4, -1, f in decreasing order. 4, -1, f Suppose 0 = -6g + 8g + 4. Let v(t) = -27t3 - t2. Let w be v(1). Let z be 4/(-6) - w/6. Sort g, 2, z in increasing order. g, 2, z Let n be (-16)/(-128)2/1. Let j be ((-2)/(-5))/((-1)/((-10)/(-2))). Sort 3, -3, n, j. -3, j, n, 3 Suppose -24 = -17h + 5h. Sort -2, 5, -3, h in descending order. 5, h, -2, -3 Let q be 1/(-2) + (-21)/(-6). Suppose 4z = 2	{ "pile_set_name": "DM Mathematics" }
Calculate the remainder when 93 is divided by 59. 34 What is the remainder when 779 is divided by 223? 110 What is the remainder when 1862 is divided by 16? 6 What is the remainder when 813 is divided by 24? 21 What is the remainder when 164 is divided by 85? 79 What is the remainder when 412 is divided by 13? 9 Calculate the remainder when 52 is divided by 9. 7 Calculate the remainder when 352 is divided by 138. 76 What is the remainder when 187 is divided by 107? 80 What is the remainder when 15193 is divided by 15? 13 What is the remainder when 17373 is divided by 181? 178 Calculate the remainder when 319 is divided by 80. 79 Calculate the remainder when 839 is divided by 169. 163 What is the remainder when 62 is divided by 24? 14 Calculate the remainder when 150 is divided by 47. 9 What is the remainder when 548 is divided by 24? 20 Calculate the remainder when 763 is divided by 96. 91 What is the remainder when 181 is divided by 6? 1 What is the remainder when 327 is divided by 101? 24 What is the remainder when 890 is divided by 295? 5 What is the remainder when 123 is divided by 36? 15 Calculate the remainder when 111 is divided by 29. 24 What is the remainder when 21179 is divided by 89? 86 Calculate the remainder when 6494 is divided by 11. 4 What is the remainder when 751 is divided by 83? 4 Calculate the remainder when 148 is divided by 4. 0 What is the remainder when 1427 is divided by 1427? 0 What is the remainder when 402 is divided by 101? 99 Calculate the remainder when 3092 is divided by 110. 12 Calculate the remainder when 1348 is divided by 18. 16 Calculate the remainder when 2728 is divided by 18. 10 Calculate the remainder when 11530 is divided by 124. 122 What is the remainder when 655 is divided by 66? 61 Calculate the remainder when 311 is divided by 45. 41 What is the remainder when 307 is divided by 157? 150 What is the remainder when 657 is divided by 62? 37 Calculate the remainder when 440 is divided by 17. 15 Calculate the remainder when 287 is divided by 42. 35 Calculate the remainder when 8885 is divided by 6. 5 What is the remainder when 148 is divided by 143? 5 Calculate the remainder when 458 is divided by 42. 38 What is the remainder when 3459 is divided by 689? 14 What is the remainder when 231 is divided by 72? 15 What is the remainder when 16399 is divided by 21? 19 What is the remainder when 755 is divided by 9? 8 What is the remainder when 26 is divided by 2? 0 Calculate the remainder when 230 is divided by 78. 74 What is the remainder when 131 is divided by 40? 11 What is the remainder when 430 is divided by 109? 103 What is the remainder when 121 is divided by 41? 39 Calculate the remainder when 441 is divided by 64. 57 Calculate the remainder when 270 is divided by 97. 76 What is the remainder when 805 is divided by 15? 10 What is the remainder when 239 is divided by 12? 11 Calculate the remainder when 1222 is divided by 41. 33 Calculate the remainder when 5711 is divided by 51. 50 What is the remainder when 474 is divided by 119? 117 Calculate the remainder when 151 is divided by 7. 4 Calculate the remainder when 8092 is divided by 19. 17 Calculate the remainder when 275 is divided by 40. 35 Calculate the remainder when 388 is divided by 219. 169 Calculate the remainder when 276 is divided by 93. 90 Calculate the remainder when 262 is divided by 53. 50 Calculate the remainder when 253 is divided by 56. 29 What is the remainder when 113 is divided by 35? 8 What is the remainder when 181 is divided by 15? 1 What is the remainder when 277 is divided by 80? 37 Calculate the remainder when 668 is divided by 25. 18 What is the remainder when 296 is divided by 279? 17 Calculate the remainder when 7188 is divided by 141. 138 What is the remainder when 128 is divided by 120? 8 What is the remainder when 117 is divided by 76? 41 What is the remainder when 190 is divided by 8? 6 What is the remainder when 110 is divided by 40? 30 Calculate the remainder when 791 is divided by 15. 11 Calculate the remainder when 365 is divided by 170. 25 Calculate the remainder when 4013 is divided by 55. 53 Calculate the remainder when 185 is divided by 45. 5 What is the remainder when 135 is divided by 19? 2 Calculate the remainder when 251 is divided by 11. 9 Calculate the remainder when 134 is divided by 58. 18 Calculate the remainder when 31 is divided by 13. 5 What is the remainder when 249 is divided by 36? 33 What is the remainder when 595 is divided by 212? 171 What is the remainder when 4886 is divided by 326? 322 What is the remainder when 847 is divided by 37? 33 What is the remainder when 2 is divided by 1? 0 Calculate the remainder when 258 is divided by 47. 23 What is the remainder when 312 is divided by 20? 12 Calculate the remainder when 147 is divided by 55. 37 Calculate the remainder when 3036 is divided by 95. 91 Calculate the remainder when 588 is divided by 288. 12 What is the remainder when 1518 is divided by 126? 6 What is the remainder when 174 is divided by 25? 24 Calculate the remainder when 295 is divided by 72. 7 Calculate the remainder when 14 is divided by 7. 0 What is the remainder when 1275 is divided by 4? 3 What is the remainder when 96 is divided by 14? 12 Calculate the remainder when 4360 is divided by 168. 160 Calculate the remainder when 476 is divided by 121. 113 What is the remainder when 452 is divided by 110? 12 What is the remainder when 503 is divided by 165? 8 What is the remainder when 4469 is divided by 194? 7 Calculate the remainder when 2038 is divided by 76. 62 Calculate the remainder when 284 is divided by 22. 20 What is the remainder when 296 is divided by 11? 10 What is the remainder when 354 is divided by 139? 76 Calculate the remainder when 285 is divided by 48. 45 What is the remainder when 532 is divided by 9? 1 What is the remainder when 235 is divided by 59? 58 What is the remainder when 132 is divided by 15? 12 Calculate the remainder when 271 is divided by 71. 58 Calculate the remainder when 1300 is divided by 62. 60 Calculate the remainder when 572 is divided by 36. 32 Calculate the remainder when 237 is divided by 49. 41 What is the remainder when 1523 is divided by 51? 44 Calculate the remainder when 151 is divided by 7. 4 What is the remainder when 2668 is divided by 167? 163 Calculate the remainder when 796 is divided by 40. 36 What is the remainder when 95 is divided by 35? 25 Calculate the remainder when 80 is divided by 25. 5 What is the remainder when 5473 is divided by 25? 23 Calculate the remainder when 43 is divided by 1. 0 Calculate the remainder when 6219 is divided by 249. 243 Calculate the remainder when 530 is divided by 59. 58 Calculate the remainder when 1138 is divided by 71. 2 What is the remainder when 3597 is divided by 24? 21 Calculate the remainder when 596 is divided by 593. 3 What is the remainder when 292 is divided by 21? 19 Calculate the remainder when 296 is divided by 23. 20 Calculate the remainder when 115 is divided by 67. 48 What is the remainder when 991 is divided by 16? 15 Calculate the remainder when 166 is divided by 44. 34 What is the remainder when 353 is divided by 51? 47 What is the remainder when 391 is divided by 80? 71 Calculate the remainder when 2262 is divided by 72. 30 What is the remainder when 1472 is divided by 41? 37 What is the remainder when 171 is divided by 80? 11 Calculate the remainder when 786 is divided by 288. 210 What is the remainder when 24650 is divided by 33? 32 Calculate the remainder when 118 is divided by 17. 16 What is the remainder when 4422 is divided by 295? 292 What is the remainder when 5950 is divided by 48? 46 Calculate the remainder when 681 is divided by 257. 167 What is the remainder when 942 is divided by 25? 17 Calculate the remainder when 1143 is divided by 377. 12 Calculate the remainder when 95 is divided by 9. 5 Calculate the remainder when 2157 is divided by 707. 36 Calculate the remainder when 12010 is divided by 156. 154 What is the remainder when 280 is divided by 47? 45 What is the remainder when 2652 is divided by 31? 17 Calculate the remainder when 134 is divided by 70. 64 What is the remainder when 17 is divided by 10? 7 Calculate the remainder when 238 is divided by	{ "pile_set_name": "DM Mathematics" }
meters in nanometers? 503150900000000 How many millimeters are there in thirteen fifths of a centimeter? 26 How many millimeters are there in 1/5 of a centimeter? 2 What is 1554.807s in milliseconds? 1554807 Convert 5.469159 grams to tonnes. 0.000005469159 What is 0.8837876nm in micrometers? 0.0008837876 Convert 58843.15 milligrams to nanograms. 58843150000 Convert 39794.52mg to kilograms. 0.03979452 What is 3/10 of a meter in centimeters? 30 How many meters are there in fourty-nine fifths of a kilometer? 9800 What is 6/25 of a hour in seconds? 864 How many meters are there in 42/5 of a kilometer? 8400 What is 846.7983mg in micrograms? 846798.3 What is 1/4 of a week in hours? 42 What is 279.86031 months in millennia? 0.0233216925 What is twenty-eight thirds of a century in months? 11200 How many minutes are there in 9.854571 hours? 591.27426 Convert 74.71183 decades to millennia. 0.7471183 Convert 774.9589 decades to millennia. 7.749589 What is 676.9015mm in kilometers? 0.0006769015 How many litres are there in 0.7909752ml? 0.0007909752 How many micrometers are there in twenty-seven quarters of a centimeter? 67500 Convert 863066.8 litres to millilitres. 863066800 What is seven halves of a century in years? 350 What is 716768.2 years in decades? 71676.82 How many grams are there in ninety-one halves of a kilogram? 45500 Convert 205.2687l to millilitres. 205268.7 What is twenty-nine fifths of a kilogram in grams? 5800 What is 1/10 of a litre in millilitres? 100 How many minutes are there in 1/18 of a week? 560 How many months are there in 271.2692 millennia? 3255230.4 What is 12/25 of a litre in millilitres? 480 Convert 0.568598 hours to seconds. 2046.9528 How many minutes are there in 5/6 of a hour? 50 How many tonnes are there in 393.7505 kilograms? 0.3937505 How many nanograms are there in 3/40 of a milligram? 75000 What is thirty-three tenths of a century in years? 330 What is one twentieth of a kilogram in grams? 50 Convert 6716.64 months to years. 559.72 What is 9.723682 centuries in decades? 97.23682 What is five eighths of a millennium in months? 7500 Convert 0.144597 micrometers to centimeters. 0.0000144597 How many meters are there in 1343.47km? 1343470 Convert 7650.09 micrograms to kilograms. 0.00000765009 Convert 4947072.2 days to weeks. 706724.6 How many nanograms are there in 56319.01 kilograms? 56319010000000000 How many years are there in thirteen fifths of a decade? 26 What is eleven halves of a meter in millimeters? 5500 Convert 467.8853 litres to millilitres. 467885.3 Convert 12687.798s to minutes. 211.4633 What is 0.7724113 nanograms in micrograms? 0.0007724113 What is 208.2963 kilometers in micrometers? 208296300000 What is 29/5 of a century in years? 580 How many milliseconds are there in seven sixths of a minute? 70000 What is 23/6 of a week in hours? 644 How many micrograms are there in 0.1090266kg? 109026600 What is one tenth of a millimeter in nanometers? 100000 How many millimeters are there in 33/5 of a meter? 6600 How many millilitres are there in one tenth of a litre? 100 How many nanograms are there in one fifth of a microgram? 200 What is 3/8 of a millisecond in microseconds? 375 Convert 1346.3001 seconds to minutes. 22.438335 How many millilitres are there in 43.608l? 43608 How many millimeters are there in 6/5 of a meter? 1200 Convert 106.49625 months to years. 8.8746875 What is 119.58l in millilitres? 119580 What is 1/10 of a century in decades? 1 How many micrograms are there in 6/25 of a milligram? 240 How many minutes are there in 29/3 of a day? 13920 Convert 206712.9 millennia to years. 206712900 Convert 89.229l to millilitres. 89229 How many litres are there in 0.5643 millilitres? 0.0005643 How many milligrams are there in 64552.55 tonnes? 64552550000000 What is 3/25 of a litre in millilitres? 120 Convert 46062.12s to minutes. 767.702 What is 8.950685 decades in millennia? 0.08950685 What is six fifths of a meter in millimeters? 1200 How many millimeters are there in 27/2 of a meter? 13500 Convert 52.97679 meters to centimeters. 5297.679 How many nanograms are there in 71095.53 kilograms? 71095530000000000 What is one tenth of a meter in millimeters? 100 How many grams are there in 3/8 of a kilogram? 375 How many millilitres are there in 29/2 of a litre? 14500 How many microseconds are there in twenty-six fifths of a millisecond? 5200 Convert 82482.87ug to nanograms. 82482870 How many micrometers are there in 3/5 of a millimeter? 600 What is 6/25 of a meter in centimeters? 24 What is 871.291 millilitres in litres? 0.871291 How many millimeters are there in twenty-six fifths of a centimeter? 52 How many millilitres are there in one quarter of a litre? 250 How many micrometers are there in 25/4 of a centimeter? 62500 How many grams are there in 3/50 of a tonne? 60000 How many centuries are there in 126.612 millennia? 1266.12 Convert 78363.6 nanometers to centimeters. 0.00783636 What is 3/10 of a decade in months? 36 Convert 29316.89 decades to months. 3518026.8 How many millilitres are there in 95598.48 litres? 95598480 What is 1/64 of a gram in micrograms? 15625 What is 78292.78 millilitres in litres? 78.29278 What is 18/5 of a kilometer in meters? 3600 What is 25/9 of a week in minutes? 28000 How many months are there in 3296.758 centuries? 3956109.6 Convert 0.489028l to millilitres. 489.028 Convert 80368.81 litres to millilitres. 80368810 How many millilitres are there in five eighths of a litre? 625 What is 72.22967cm in nanometers? 722296700 Convert 20501.02 millilitres to litres. 20.50102 What is 13/8 of a millisecond in microseconds? 1625 How many nanoseconds are there in twenty-nine halves of a microsecond? 14500 What is 48.60143 centuries in decades? 486.0143 What is 5.872893 months in millennia? 0.00048940775 Convert 6550.896 centuries to millennia. 655.0896 How many millilitres are there in 54/5 of a litre? 10800 How many millilitres are there in 5/8 of a litre? 625 How many litres are there in 9.515694ml? 0.009515694 What is 8057.209 nanometers in millimeters? 0.008057209 How many minutes are there in twenty-three thirds of a week? 77280 How many litres are there in 0.446181ml? 0.000446181 How many years are there in 25.462545 months? 2.12187875 How many months are there in 1/4 of a millennium? 3000 How many millennia are there in 0.9441671 decades? 0.009441671 Convert 9937.598 weeks to milliseconds. 6010259270400 What is 3/10 of a hour in seconds? 1080 What is three tenths of a century in years? 30 How many kilometers are there in 261.4363mm? 0.0002614363 How many minutes are there in two fifteenths of a week? 1344 How many millilitres are there in one fifth of a litre? 200 What is fourty-five quarters of a millennium in years? 11250 How many weeks are there in 10271.9757 hours? 61.1427125 How many millimeters are there in 31/5 of a centimeter? 62 How many hours are there in 7/8 of a week? 147 How many millilitres are there in 25/2 of a litre? 12500 How many months are there in 33.16621 millennia? 397994.52 How many hours are there in 31/6 of a day? 124 How many micrometers are there in one sixteenth of a centimeter? 625 Convert 20786.37 weeks to seconds. 12571596576 How many millilitres are there in 2973.498l? 2973498 How many tonnes are there in 7852.689kg? 7.852689 Convert 0.4080038ml to litres. 0.0004080038 How many micrograms are there in 85.75823 grams? 85758230 What is 3/10 of a decade in months? 36 Convert 99.31273 hours to nanoseconds. 357525828000000 Convert 924434.4 months to centuries. 770.362 How many centimeters are there in 263.4773 nanometers? 0.00002634773 What is five quarters of a litre in millilitres? 1250 What is 3644.074 litres in millilitres? 3644074 Convert 1808.21151 minutes to weeks. 0.1793860625 How many weeks are there in 40563.768 days? 5794.824 What is 0.6578838 hours in milliseconds? 2368381.68 What is 861.9582 decades in millennia? 8.619582 How many milligrams are there in 21/2 of a gram? 10500 How many kilograms are there in 3/8 of a tonne? 375 How many grams are there in 0.8727184 nanograms? 0.0000000008727184 How many grams are there in 9/10 of a kilogram? 900 What is 5.517789 centuries in millennia? 0.5517789 What is five eighths of a litre in millilitre	{ "pile_set_name": "DM Mathematics" }
(a) - 4z(a). Calculate n(m). 3 Let u be 14/3 + (-10)/(-30). Suppose -5i - 2y = -uy, 5y = 5i. Let d(k) = -2k + 3k + ik - 3. Calculate d(6). 3 Let s be -4 - (-1 + (3 - 3)). Let j(g) be the first derivative of -g4/4 - g3/3 + g2/2 - 2g + 22. Determine j(s). 13 Let v(y) = 2y - 3. Suppose -6n - 7 = -31. Suppose -14 = 3m + 5c, -24 = -9m + 5m + nc. Calculate v(m). 1 Suppose 3d - 12 - 3 = 0. Let y(a) = 7 + a - da + 39a*2 - 38a*2 - 3a. Calculate y(5). -3 Let j(t) = t*3 + 4t*2 + 3t - 3. Let k = 26 - 13. Suppose -14d - 4 = -kd. Determine j(d). -15 Let z(t) be the third derivative of -t6/120 + t5/15 + 7t4/12 - 3t*3/2 - 163t2. Determine z(6). 3 Let k be (-5229)/830 - 3/(-10). Let h(c) = -c3 - 7c2 - c - 8. What is h(k)? -38 Suppose -4y + q + 40 = 0, 6q = -5y + q + 75. Let n(j) = y + j - 8 + 0j - 6. Give n(6). 3 Suppose -9g - 25 = 20. Let b(y) = 8y + 10. Let d(u) = -9u - 11. Let x(s) = gb(s) - 4d(s). Give x(-7). 22 Suppose -46 = -108p + 85p. Let n(y) = -y*2 - 3 + 5y + 5y - 6y. Determine n(p). 1 Suppose 2f - 8 = -4. Suppose -4n - 1 = fl - 3l, -l = -3n. Let y(q) = 13q. Give y(n). -13 Let h = 4 - 7. Let j(z) = -3z2 - 4z + 5. Let i(g) = -8g2 - 10g + 14. Let x(b) = -4i(b) + 11j(b). What is x(h)? 2 Suppose 9d - d = 16. Suppose 4t = -dt - 42. Let f(k) = k2 + 5k - 8. Calculate f(t). 6 Let p be 178/6 - (-1)/3. Suppose 4a = -a - p. Let m(s) be the first derivative of s3/3 + 3s*2/2 - 5s + 1. Determine m(a). 13 Suppose 0 = 5p - 38 + 18. Let i(k) = 22k - 1 + k*2 + p - 19k. Determine i(-4). 7 Let t(x) = x*2 + 8x + 9. Let v(p) = -2p + 4. Let w be v(-3). Let k(l) be the first derivative of -3l*2/2 + 23l - 4. Let i be k(w). Determine t(i). 2 Let o(x) = -2 + 9 + 2 + x. Let v(u) = -2u - 8. Let g(k) = -5o(k) - 6v(k). What is g(-2)? -11 Let o(f) = 29f + 20. Let a(c) be the third derivative of -5c4/12 - 7c*3/6 - 7c*2. Let z(j) = -17a(j) - 6o(j). Give z(1). -5 Suppose 4p - a + 34 = -0a, 24 = -4p - 4a. Let h(v) = -v - 4. Let c(t) = 2t + 11. Let w(r) = ph(r) - 3c(r). What is w(-6)? -13 Let x(f) = -4 - 47f + 3 + 46f. Calculate x(6). -7 Let t(f) = -4f2 + 8f - 6. Let n be t(0). Let d(l) = l2 - 13. Determine d(n). 23 Let z be 150/18 + 3 + 1/(-3). Let d(c) = c2 - 10c + 9. Calculate d(z). 20 Let x(v) = 5v - 2. Let z(s) = -2s. Let g(h) = -2x(h) - 6z(h). Calculate g(9). 22 Let x(s) = s - 8. Let v be x(14). Let w(o) = -5o3 + o2 + 6o + 3. Let d(r) = 6r*3 - 6r - 2. Let f(t) = vd(t) + 7w(t). What is f(-6)? 9 Let v(r) = 7r - 27. Let m be v(13). Suppose 7n + m - 15 = 0. Let q be 21(-6 - n). Let x(u) = u. Give x(q). 2 Let r(c) = -c + 14. Suppose -3m - 70 = 5p, -4m + p - 22 - 56 = 0. Let y be ((-6)/(-2))/(m/(-8) - 2). Calculate r(y). 8 Let r(z) = -z - 32324z*2 + 2z - 4z3 + 2 + 32322z2. Determine r(-2). 24 Let p(j) = j2 + 7j - 7. Let m(f) = f3 - 13f*2 - 15f + 14. Let s be m(14). Let x be (s + 1)-6 + -1. What is p(x)? -7 Let r(t) be the first derivative of -t3/3 + t2/2 - t - 10. Let f(s) = -16s*2 + 3s - 2. Let g(y) = -f(y) + 3r(y). What is g(-1)? 12 Let o = -15 - -12. Let r be (2 - 1)/(o/(-21)). Let z(w) = w3 + 2w - 2w - 7w*2 + w. Give z(r). 7 Let c = -1 - -6. Let i(l) = -777 + 1599 - l - 815. Determine i(c). 2 Let n(t) = -3t*2 - 3t - 1. Let i(c) = 2c + 2. Let p = -7 - -5. Let w be i(p). Calculate n(w). -7 Suppose 2r = -4n - 66, -r = 2n - 4n - 31. Let c(w) = w2 + 15w - 9. Give c(n). 7 Let w = -50 - -56. Let l(d) = -2d + 1. Give l(w). -11 Let c(u) = 11u*2 + 5u - u*3 + 0u*3 - 7u2 - 7. Give c(5). -7 Let p(b) be the first derivative of b4/4 + 7b3/3 - 7b + 40. Determine p(-7). -7 Let r(d) be the second derivative of -d*3/3 - 2d*2 + 2d + 51. Give r(-4). 4 Let o be (-112/12)/((-2)/(-6)). Let s(r) = r + 6. Calculate s(o). 3 Let b be 5(6/10 - 0). Let t(k) = 9k + k2 - 2 + 0 + b + 3. What is t(-4)? -16 Let w(p) = -p2 - p + 1. Let l(t) = 7t*2 + t - 4. Let z(d) = -l(d) - 5w(d). Let n = 5 - 2. Let g = 0 + n. Give z(g). -7 Let m = -1008 + 1010. Suppose 5o + 1 = 11. Let p(u) = 1 + u - 2um + u2 - ou2. Determine p(2). -9 Let p = 10/113 - -83/339. Let u(l) be the first derivative of pl3 - 4 + l2 + 3l. What is u(-3)? 6 Suppose -11q = -7q + 728. Let o be 2/10 + q/35. Let a(w) = 7w*2 + 7w + 13. Let x(n) = 4n2 + 3n + 7. Let b(v) = 3a(v) - 5x(v). What is b(o)? -1 Let z(f) = 2f + 1. Let u(x) = x2 + 8x + 3. Let k(n) = -2u(n) + 9z(n). Suppose -15 = -5d - 3m, m + 0 + 6 = 2d. Give k(d). -9 Let g(b) = b2 - 3b - 4. Suppose u = 9 + 51. Let w = -57 + u. Calculate g(w). -4 Let q(c) be the second derivative of -c*3/6 - 5c*2/2 + 9c + 3. Give q(0). -5 Let g(x) = -4x3 + 5x*2 + 22x - 9. Let d(i) = i3 - i2 - 5i + 2. Let h(f) = -9d(f) - 2g(f). Calculate h(1). -1 Let m(t) = 2t*2 + 3t + 4. Let s(a) = -2a2 - 2a - 4. Let q(r) = 3m(r) + 2s(r). Determine q(-4). 16 Let u(y) be the second derivative of -y7/840 + y6/72 - 7y5/120 + 5y*4/24 - 11y*3/6 - 5y. Let p(l) be the second derivative of u(l). Determine p(4). -7 Let y(r) = -r*2 - 16r + 29. Let a(v) = v*2 - 40v + 186. Let q be a(6). Calculate y(q). -7 Let o(h) = -h - 7. Let w(g) = -54g - 24. Let s be w(-9). Let m be 3/(-5) + s/(-105). What is o(m)? -2 Let c(n) = n2 + 9n - 3. Suppose 99 = 4b - 3k, b + 2b - k - 68 = 0. Let w = 23 - b. Let t(o) = o2 + o. Let m(s) = wt(s) - c(s). Calculate m(6). -3 Let c(a) = a*2 + 11a + 7. Let n be c(-9). Suppose -3b - 11 = 10. Let q = n - b. Let w(t) = -2t + 5. Determine w(q). 13 Let d(x) = 3x + 1. Let i(k) = -4k. Let j(r) = 6d(r) + 5i(r). Let n be j(4). Let z(v) = -2v3 + 0v + 3v2 + 3v*3 - 2v - 2. Calculate z(n). 6 Let z(d) = -d*3 + 6d + 7. Let c(o) = -o*2 + 1. Let l(j) = -5c(j) + z(j). Let p be l(6). Let w(m) = 3mp + 3m - 2m2 - 25 + 19. Determine w(-5). 4 Let i(a) = -3a - 6. Suppose -5s + 2s = 3y, -y = 5s. Suppose y = -4h - h - 20. Calculate i(h). 6 Let h(w) = w2 - 7w - 69. Let r be h(-5). Let a(z) = z*2 + 11z - 10. Determine a(r). -28 Let n(f) = -f*2 + 7f + 23. Let y = -4 - -14. Let q be n(y). Let m(b) = b + 7. Determine m(q). 0 Let u(k) = k*3 - 2k*2 + k + 3. Let v = -378 - -381. Determine u(v). 15 Let f(a) = 3a - 21. Let p(d) = d - 10. Suppose 0 = 3k + n + 6, 0 + 2 = -k + 5n. Let c(l) = kf(l) + 5p(l). Calculate c(-9). 1 Suppose 0 = 2n + 4b, -4b + 8b = 4n - 12. Let u(h) = 9h - h*n + 4 + 1 - 4h - 3. Determine u(4). 6 Let c(r) = -615r + 1241r - 607r. What is c(-1)? -19 Let c(g) = -4g - 3. Let h(u) = -8u - 7. Let d(k) = -13c(k) + 6h(k). Suppose 0 = 2r + 5p - 2, 4r + 8p + 6 = 3p. Let v = r - -8. Give d(v). 13 Let l(t) be the third derivative of -t6/120 - t5/12 + 7t4/24 + 5t3/6 - t2. Let p = 153 - 159. Calculate l(p). -1 Let a(w) be the second derivative of w*4/12 + 11w*3/6 - 3w*2 - 100w - 2. Give a(-11). -6 Let r(f) = -f*3 - 5f*2 + 8f + 18. Let p = 708 + -714. Determine r(p). 6 Let b(m) be the third derivative of 16m2 - 7/6m*3 + 0m + 1/24m4 + 0. Suppose -2r = -0r. Give b(r). -7 Let k(n) be the second derivative of n3/3 + 5n*2 - 12n + 2. Calculate k(-11). -12 Let s be 2/(-4)(-4 - 0). Let k(m) = -7 - 4m + 5 - 1 + m*s. Let i = -3 - -1. What is k(i)? 9 Suppose -9n - 4 = -11n. Suppose nt - 9 = -15. Let w(c) = 4c - 13c + 5c - 4 + c. Calculate w(t). 5 Suppose -2g - 18 = g. Let n(a) = -a*3 - 6a*2 + 2a + 5. Calculate n(g). -7 Let p(g) be the first derivative of g*4/4 - 10g*3/3 - 4g*2 - 5g + 337. Calculate p(11). 28 Let y(t) be the third derivative of -t6/120 + t5/15 + t*4/4 - 7t3/6 - t2 + 18. Determine y(5). -2 Let b be (0 - 1)(-44)/4. Let g = 3 - b. Let y(z) = 4z + z*2 + 12 + 8z - 4z - 13. Give y(g). -1 Let c(t) be the third derivative of -7/6t*3 + 1/24t*4 - t + 0 + 3t*2. Give c(9). 2 Let t(q) = 0 - 6q*2 - 6q + q*3 - 1 - 5. Suppose -20l + 14l + 78 = 0. Suppose 5w + 9 = 2n, -w - l + 42 = 4n. Calculate t(n). 1 Suppose 27z - 23z - 8 = 0. Suppose 4p + 3 = -3o, -4o + 12 = -2o - zp. Let c(b) = -b3 + 3b*2 + 4b - 4. Calculate c(o). 8 Let q(b) = -11b - 4. Let n(f) = -2f - 1. Let c(s) = 20*n(s) -	{ "pile_set_name": "DM Mathematics" }
41. Calculate 7a(k) - 6o(k). -4k2 + k - 35 Let v(n) = 4n - 1. Let o(y) = -6y2 - 25y + 4. Determine -o(d) - 5v(d). 6d*2 + 5d + 1 Let p be ((-1329)/6)/((12/16)/(-3)). Let a(s) = 6s2 - 888 + p + 0s*2 + 5s. Let g(h) = 7h2 + 6h - 2. Calculate -6a(d) + 5g(d). -d*2 + 2 Let t(c) = 2c*2 + 6c + 1. Let g(j) = 9j2 + 12j - 319. Determine -g(a) + 3t(a). -3a*2 + 6a + 322 Let r(k) = -5120k3 - 7k*2 + 7k - 16. Let f(l) = 3414l3 + 5l*2 - 5l + 11. What is 7f(o) + 5r(o)? -1702o3 - 3 Let u(q) = 2494q + 11. Let w(k) = -1250k - 5. Determine 4u(c) + 9w(c). -1274c - 1 Let x(h) = h*3 - 223h*2 - 5h - 12. Let d(w) = w*3 - 223w*2 - 6w - 14. Determine -4d(q) + 5x(q). q*3 - 223q*2 - q - 4 Let s(a) = -8a - 48. Suppose -l + 87149 - 87160 = 0. Let m(t) = 15t + 96. Determine ls(b) - 6m(b). -2b - 48 Suppose 2a = -5t - 7, -3t + 0 - 9 = 0. Let d(g) = -7g - 6. Let b(z) be the third derivative of z*4/4 + 5z*3/6 + 3484z*2. What is ad(o) + 5b(o)? 2o + 1 Let k be 295/(-20) - (115/(-20) + 6) - -8. Let s(l) = 61l2 - 2l + 11. Let m(i) = -30i2 + i - 5. Determine km(q) - 3s(q). 27q*2 - q + 2 Let b(y) be the second derivative of 2y*5 + 7y*4/6 - 7y*3/3 + 136y - 7. Let k(j) = 8j3 + 3j*2 - 3j. Determine -3b(f) + 14k(f). -8f3 Let o(m) = 9m*2 + 3. Let k(t) = 16t*2 - 1853. Give k(c) - 2o(c). -2c2 - 1859 Let d(b) = -15b + 37. Let i(o) = 10o + 45. Let m(k) = 28k + 117. Let l(g) = -8i(g) + 3m(g). Give 2d(u) + 9l(u). 6u - 7 Let i(y) be the third derivative of -y5/10 - y4/24 + 3y*3/2 + 14y*2 - 4y - 2. Let c(d) = 3d2 - 5. Determine -5c(p) - 3i(p). 3p*2 + 3p - 2 Let o(p) = p. Let h(g) be the first derivative of 23g2/2 + 893. Determine 3h(r) - 21o(r). 48r Let b = -42 - -50. Let r(y) = -2 - 5y + 0y + 6 - b. Let d(p) = -4p - 3. Give -7d(i) + 6r(i). -2i - 3 Suppose 0 = o - 41 - 47 + 95. Let y(h) = h - 4. Let s(j) = -3j + 3j + 6j - 15. Let m(x) = 13x - 31. Let v(r) = 2m(r) - 5s(r). Give oy(q) - 2v(q). q + 2 Let j(d) = 25d2 - d + 22. Let p(y) = 36y*2 - 2y + 17. Let s(h) = 3j(h) - 2p(h). Let m(r) = -r*2 + 1. What is 5m(q) + s(q)? -2q2 + q + 37 Let r(n) = -81754515n*3 + 32346n*2 + 129384n. Let u(g) = -80881g3 + 32g*2 + 128g. Determine -16r(f) + 16173u(f). -16173f3 Let k(r) = 77r*2 - 7r + 162. Let j(s) = -90s2 + 6s - 163. Calculate 6j(w) + 7k(w). -w*2 - 13w + 156 Let n(g) = g - 3. Let u(c) = 599c2 - 7c + 22. What is -7n(m) - u(m)? -599m*2 - 1 Let i(r) = -6r - 14. Let g(w) = -1688w - 56. Give 3g(l) - 12i(l). -4992l Let z(b) = 711b3 + 5b*2 + 2b - 10. Let y(x) = 712x3 + 6x*2 + 3x - 12. What is -5y(m) + 6z(m)? 706m3 - 3m Let c(o) = 2o3 + 18o2 - 18. Let p(j) = j2 - 1. Suppose 0 = -4b + 11b - 14. Suppose -49t - bl = -45t, t - 2l - 10 = 0. Calculate tc(w) - 36p(w). 4w3 Let d(o) = -7o2 - o + 2. Let x(q) = q2 + q - 7. Let u(m) = -4m2 + 3m - 20. Let k(j) = -u(j) + 3x(j). Calculate -2d(l) - 3k(l). -7l*2 + 2l - 1 Let p(u) be the first derivative of 2u2 - 5u - 23732. Let h(s) = -s*3 + 3s*2 + 2s + 5. Let v be h(4). Let a(x) = -x. What is va(t) - p(t)? -t + 5 Let n(d) = -3d - 40. Let r be n(-16). Suppose -84 = -13x - rx. Let g(t) = 20t - 17. Let z(m) = 7m - 6. Give xg(o) - 11z(o). 3o - 2 Let a = 3670 - 3668. Let z(w) = w + 8. Let t be z(-6). Let k(r) = -5r*a + 3r2 + rt. Let y(n) = -7n2 + 2n + 1. Determine 6k(p) - y(p). p2 - 2p - 1 Let p = -9 - -10. Suppose 51k + 17 = 35k - 47. Let r(x) = -x*2. Let a(l) = -10l*2. Give kr(y) + pa(y). -6y*2 Let g(q) = 49q*2. Let p be (-3)/(-2) + (-117)/(-18) + -31. Let s(y) = 98y2. Calculate pg(f) - 3s(f). -49f*2 Let u(h) = 3h + 2. Let k(a) = 331a2 - 21a - 12. Calculate k(l) + 6u(l). 331l*2 - 3l Let f(z) = -3z2 - z - 9. Let i(v) = 33v*2 - 7v - 28. Let y(n) = 6n2 - n - 3. Let h(j) = -i(j) + 6y(j). Determine -7f(t) - 6h(t). 3t2 + t + 3 Let d(o) = -9o*2 - 2o + 2. Let m = -839 + 835. Let a(q) = 441q2 + 99q - 99. Give ma(s) - 198d(s). 18s2 Let c = -2 + 6. Suppose 0 = 3a - 5j - 125 + 133, j = -a. Let m(x) = 1 + x2 - 3x*2 - x + 3x*2. Let q(w) = 8w*2 - 5w + 4. Calculate aq(f) + cm(f). -4f2 + f Let a(f) = -478f*3 + 9f + 7. Let z(v) = -239v3 + 4v + 3. Give -3a(b) + 7z(b). -239b3 + b Let o(m) = -27m + 3166. Let k(i) = 75i - 9504. Determine 4k(x) + 11o(x). 3x - 3190 Let m be ((-13)/(-2) - 0)2. Let y(p) = -4p*2 + 6p + 7. Let o(g) = -92229293g2 + 92229284g*2 + 2 + 13g + 12. Give my(l) - 6o(l). 2l2 + 7 Let m(h) = 4h*3 + 2550h*2 - 7h + 17. Let r(p) = -3p3 - 1699p*2 + 5p - 12. Calculate 5m(i) + 7r(i). -i*3 + 857i*2 + 1 Let i(d) = 3d*2 - d + 2. Let c(r) = 65r*2 + 2r - 13. What is -c(p) - 3i(p)? -74p*2 + p + 7 Let j(q) = -3q3 - q2 - 4q. Suppose 0 = -17m + 12m - 20. Let x be m/(-2) + (-6)/(10/(-5)). Let o(w) = -3w3 - w2 - 5w. Give xj(k) - 4o(k). -3k3 - k2 Let z(m) = 5m - 2. Let i be 1/((-3)/122). Let y(p) be the second derivative of -p*3 + 3p*2/2 + p - 131. Let l be 1/1 - 12/3. What is iy(r) + lz(r)? -3r Let v(g) = -293496130 + 293496130 + g. Let n be (-6)/((2 + -1)/(-1)). Let a(r) = 2r3 + 9r. Determine nv(u) - a(u). -2u*3 - 3u Let p(g) be the third derivative of g5/12 - g4/6 - g*3 - 3g2. Let t(m) = -m2 + m + 1. Suppose -5f + 16 = 3s + 18, f + 1 = 0. Give sp(h) + 4t(h). h2 - 2 Let q(o) = -o2 - o. Suppose -7w + 382 - 53 = 0. Let g be -5 - (-4 + w) - -4. Let f(m) = 55m*2 + 44m. Determine gq(v) - f(v). -11v*2 Let a(s) = -2s*2 - 14s - 5. Let z(f) = f*2 + 5f + 2. Let u(q) = 3q + 42. Let o be u(-9). Suppose 3r = o, -22 = 4i + 2r - 0. Give iz(n) - 3a(n). -2n2 + 2n - 1 Suppose 2b + 21 = 3t, -3t - 3b = -0t - 36. Let f(m) = 2 - t + 6. Let h(s) = s + 4. What is 6f(v) + h(v)? v - 2 Let i(u) = 19u - 215. Let v be i(14). Let j = 46 - v. Let s(k) = -3k*2 + 5k. Let r(w) = 4w2 - 8w. Give jr(p) - 8s(p). 4p2 Let y be (2/4)/((-1)/(-10)). Let u be ((-2)/(-2))/((-490)/(-40) + -12). Let h(d) = 91d - u + 6 - 3 - 93d. Let f(t) = 2t + 1. Give yf(c) + 6h(c). -2c - 1 Let n(v) = -14v + 95. Let d(i) = -27i - 24. Let t(y) = 8y - 2. Let o(h) = -d(h) - 4t(h). Give -4n(x) + 11o(x). x - 28 Let l(a) = 1201a + a*2 - 1202a + 0 - a2 - a3 - 1. Let q(d) = -90d3 - 105d - 105. Give 210l(u) - 2q(u). -30u3 Let w(k) = 5k. Let a(i) = 5i. Suppose -3y = -16 - 5. Suppose 842v = 439v - 2418. Determine va(g) + yw(g). 5g Let p(z) = 481z - 957. Let g be p(2). Let w(n) = -4n - 22. Let v(r) = 5r + 21. Calculate gv(j) + 6w(j). j - 27 Let i(p) = 3p3 + 233p*2 - 36p - 1. Let b(g) = 5g3 + 468g*2 - 63g - 2. What is -4b(h) + 7i(h)? h*3 - 241h*2 + 1 Let w(a) = -2a*3 + 4a*2 + 4a + 11. Let s(l) = l3 - l2 - l - 1. Let z(f) = -58f - 924. Let d be z(-16). Calculate ds(c) + w(c). 2c3 + 7 Suppose 344m - 354m = 8630. Let i = m - -905. Let y(c) = 161c*2 - 42. Let o(d) = -19d*2 + 5. Give io(k) + 5y(k). 7k*2 Let y(m) = -8m*2 - 4. Let z be (-2)/(18/15)(-49 + 21 + 31). Let d(p) be the first derivative of -7p3/3 - 5p + 1. Give zy(h) + 4d(h). 12h2 Let p(x) = -36x + 14. Suppose 21j = -17j + 117 - 3. Let u(k) = 7k - 3. Determine jp(c) + 14u(c). -10c Let a(d) = d*2 - 3d + 6. Suppose 5c = 86g - 83g - 22, g = -2c - 22. Let q(y) = -y*2 + 2y - 5. Determine gq(z) - 5a(z). z*2 + 3z Let g(y) = 32y - 823. Let x(m) = -6m + 165. Determine -2g(t) - 11x(t). 2t - 169 Let u(n) = -n2 + 17n + 22. Let m be u(18). Suppose 2w + mw = 30. Let g(f) = 5f. Let d(q) = 16q + 16q + 12q + 1 - 53q. Calculate wg(k) + 3d(k). -2k + 3 Let i = 634 + -632. Let m(n) = -1 + 6n - 17n + 4n + 4n + in. Let q(x) be the third derivative of x4/24 - 2x3/3 + x2. Give -2m(t) + q(t). 3t - 2 Let s(k) = 7k + 3. Suppose -8 = c - 2n - 25, 4c - 4n - 60 = 0. Let o(r) = 11r - 138. Let j be o(c). Let t(q) = q + 1. Give jt(p) - s(p). -2p + 2 Let r(c) = 19c + 21. Let v(o) = 9o + 14. What is -6r(q) + 13v(q)? 3q + 56 Suppose 32u = -35u - 194 + 596. Let k(f) = f**2 - f. Let g	{ "pile_set_name": "DM Mathematics" }
(3 + 1 - 1)(4 - 3 - 4) in the form i + sr and give s. -18 Express (-4 - 2 + 1)(-31y - 39y + 12y) as gy + v and give v. 0 Rearrange -6q*3 - 14q*3 - 147 + 146 to vq + lq3 + xq*2 + k and give k. -1 Rearrange -33s + 65 + 35s - 1 to bs + y and give b. 2 Rearrange c + 0c3 - 15 + c3 - c3 - c3 to the form qc*2 + tc*3 + xc + z and give x. 1 Rearrange 6j2 - 45 + 18j*2 + 45 to q + aj*2 + yj and give a. 24 Rearrange (4 - 3 - 3)(-1 + 3 + 0)(-2a + 2a + 2a3) to ya*2 + ha*3 + z + wa and give h. -8 Rearrange -3 + 4 + 6s + 2s*2 - 5s - s*3 to the form ls + v + ds3 + hs*2 and give v. 1 Rearrange (-q + 0q + 0q)(4q - 2q - 3q) - 10q*2 + 26 - 26 to the form nq*2 + fq + k and give n. -9 Express (2 - 2 + v + (0v - 3v + v)(0 + 1 + 1) - 3 + v + 3 + 1 - v - 1 - 3v + 2v - v)(-3v - 10v + v) as u + tv + cv*2 and give c. 60 Express k - 2 - 6k*3 + 2k3 + k3 + 0k3 in the form wk*3 + x + jk*2 + rk and give r. 1 Express -8h - 116 + 116 as fh + z and give f. -8 Express 14q - 15q + 0q3 + 5q*3 as wq + dq2 + p + jq*3 and give j. 5 Rearrange -3024f*2 + 80 + 3026f*2 - 6 to the form bf*2 + af + s and give b. 2 Express -3h2 + 0h3 + h3 + 3h3 - 2h*3 in the form yh*3 + f + zh*2 + mh and give y. 2 Rearrange (t + 0t + 0t)(12 - 54 - 13) to the form l + st and give s. -55 Express (-3 + 0 + 0)(5 - 4 + 1)(-1 + 1 - 8s)(2 - 2s - 2) in the form w + fs*2 + rs and give f. -96 Express 1 - 1 + o3 + (-o2 - 2o2 + 4o*2)(2o + o + 0o) in the form ko3 + a + jo*2 + ro and give j. 0 Express 10p4 + 0 + 3 - 4 - 2p - 11p4 - p2 + 3p*3 as k + sp*3 + wp*2 + qp*4 + xp and give k. -1 Rearrange -z - z + 3z + (0 - 3 + 4)(-4z + 0z - 3z) to the form tz + j and give t. -6 Rearrange -34u3 + 0 - 2 - u4 + u2 + 7u + 34u3 to zu*2 + lu*3 + j + fu*4 + du and give f. -1 Express -42x2 - 1 + 1 + 28x*3 + 44x*2 as c + lx + mx2 + ix*3 and give c. 0 Rearrange 2g*2 - 6g*2 + 4g - 3g2 + 8g*2 to wg*2 + k + fg and give f. 4 Express ((-7 - 2 + 1)(i - 2i - i) + (-3 + 2 + 0)(-4i + 6i + 0i))(1 - 1 + 2i*3) in the form si*2 + qi + ai4 + pi*3 + j and give p. 0 Express -6m*3 + 8m*2 - 13m*2 + 6m*2 + 2m + m3 - m4 in the form fm3 + w + vm*2 + om + xm4 and give v. 1 Rearrange -67d*4 + 2d2 + d3 + 122d4 - 2d - 69d4 to the form nd*4 + g + yd*2 + bd*3 + kd and give n. -14 Rearrange 2p + 0p + 0p - 3p to the form wp + l and give w. -1 Express -k + 3k - 22k - 15k in the form t + bk and give b. -35 Express (2y - 2y3 - 2y)(6y - 2y + 2y + (5 - 1 - 3)(-y - 2y + 2y) + 5y + 5y - y) in the form py*4 + cy + g + ay3 + zy*2 and give c. 0 Rearrange 9g + 14g - 386 + 386 to pg + f and give p. 23 Rearrange (-3b + 3b - 3b)(-19 + 27 + 53)(3b - 2b + b) to the form mb*2 + t + zb and give m. -366 Express 19 + 3 + 3a - 26 as t + ja and give t. -4 Express (-d*4 - 1 + 1)(2 + 2 - 5) - 79d3 + 23d*4 + 79d*3 in the form ad + md3 + sd*4 + bd*2 + x and give b. 0 Rearrange (2l*2 - 3 + 3)(-74l2 + 0 + 114l*2 + 2) to the form ul*2 + il*4 + z + cl + ql3 and give u. 4 Rearrange 0 + 0 + o + (-1 - 2o + 1)(-2 + 4 + 0) + 3o + o + 2o to the form g + bo and give b. 3 Express (-3 + 4 - 3)(3 - 2 + 2)(-j4 + j4 - j*4) in the form wj*3 + lj*4 + kj + q + dj2 and give l. 6 Rearrange (-2c - 2c + 2c)(-2c*2 + 133 - 129 - 2c + 0c)(2c - 2c + c) to the form pc2 + wc + sc4 + zc*3 + o and give o. 0 Rearrange -30 + 17 - 60 + m to the form k + im and give k. -73 Express (-2m - m + m)(1 + 6m2 - 9 + 2) as tm + lm3 + vm*2 + z and give l. -12 Rearrange (0 - 2 - 2 + (4 + 0 - 3)(0 - 3 + 0))(2u*3 - 3u*3 + 0u*3) to the form nu*2 + hu + i + vu3 and give v. 7 Rearrange (-3 - 1 + 1)(-3y - 4y + 5y) - y - 2y + y + (1 - 2 + 0)(0y - 3y + y) to the form py + j and give p. 6 Express 4 - 4 + 50r + 23r as hr + l and give h. 73 Rearrange -6 - 8u*2 + 5 + 6u*4 - 4u*4 to s + tu*3 + du*2 + zu*4 + ru and give r. 0 Express (2 - 2 + 1)((-4 + 4 + c)(c*2 - 5c2 + c2) - 2c3 + 2c*3 - 3c*3) in the form qc + rc3 + l + wc*2 and give l. 0 Express (-7y*2 - 3y*3 - 3y*2 + 4y*3)(-y + 4y - y) in the form zy + j + dy2 + gy*4 + wy*3 and give w. -20 Express -1 + 4o + 1 + (-4o + 5o + o)(1 - 1 - 1) as ho + v and give h. 2 Rearrange -2z4 - 4z + z2 - 7 + 17 - 8 + z2 to az3 + sz*4 + qz + w + hz2 and give q. -4 Express 20w4 + w3 + 11w - 4w*2 + 1 - 14w - 22w4 in the form qw*4 + sw + yw2 + m + nw*3 and give q. -2 Express 0r*3 - 1 - 3 + 3r2 + r3 + 6 as hr2 + c + tr + gr3 and give g. 1 Rearrange (-6u + 4u - 3u)(1 + 2 - 4 + (1 + 2 - 4)(1 + 2 - 4) + 3 - 5 + 3) to the form j + gu and give j. 0 Rearrange -1196h*3 + 1196h*3 - 3 - 5h - 2h4 to the form zh + k + vh3 + oh*2 + nh*4 and give o. 0 Express (-3 - 2c + 3)(-c - c - c)(3 - 5 + 3) as vc2 + hc + x and give v. 6 Rearrange (2h + 3h - 4h)(28 - 16 - 14)(3 - 5 + 0) to f + qh and give q. 4 Express (0d - d - d)(-1 - 3 + 3)(-11d*2 + 82 - 82) in the form ud*3 + rd + a + yd2 and give u. -22 Express (d + 4d - 2d)(1 + 2 - 1) + 0d + 2d + 0d as ud + s and give u. 8 Express 10 - p*2 - 10 + (4p - 3p - 3p)(2p + 0p - 3p) - 2p + 2p + 2p2 as sp + z + kp2 and give k. 3 Rearrange (-5g + 5g - g)(2 - 2 - g) + 0 - 6 + 4 - 3g + g2 to the form ag*2 + w + ig and give w. -2 Express 7b - 18b - 16b as kb + x and give k. -27 Rearrange -1 + 0b2 + 6b*2 - 4b*2 + 3b*2 to the form wb + a + vb2 and give a. -1 Rearrange 21v + 15v2 - 14v*2 - 4v to av2 + f + tv and give a. 1 Rearrange (-1 + 2 + 3)(4y*2 + 0y*2 + 0y*2) to the form dy + hy2 + n and give h. 16 Rearrange 2s*3 + 4s*4 + 3s*4 + 2s - 3s to the form ms*2 + bs + us4 + js*3 + z and give u. 7 Rearrange 47h*4 + 48h*4 - 22h*4 + (4h - 2h2 - 4h)(4h*2 - 3h2 + h2) to i + vh + nh*4 + uh*2 + mh*3 and give n. 69 Express 71k*2 + 2k*2 + 9k*2 in the form jk + v + tk2 and give j. 0 Rearrange (z + 9z + 6z)(-5 - 1 - 4) to the form a + bz and give b. -160 Rearrange -10b + 10b - b2 to the form zb + wb2 + t and give z. 0 Express -2m2 + m2 - 8m + 82m + m*3 as fm*3 + i + lm*2 + tm and give f. 1 Express 33w2 - 63w*2 + 32w*2 in the form dw*2 + xw + v and give v. 0 Rearrange 0k + 3k - 4k + (1 - 3 - 1)(-2k + 3 - 3) + 7 - 7 - 4k to the form nk + z and give n. 1 Express (-3z + 4z + 0z)(15 + 33 - 12) in the form iz + a and give i. 36 Express 2w4 + 1 + 2w*3 - 2w*3 - 6w + 7w + 4w*2 as fw*4 + q + kw + xw3 + aw*2 and give f. 2 Rearrange ((5 - 2 - 1)(2 - 1 + 0) + 17 - 2 + 0)(-2o - 6o + 5o) to the form m + qo and give q. -51 Rearrange 0b*3 - 3b + 2b2 + 0b3 - b3 to the form mb3 + z + ab*2 + hb and give m. -1 Rearrange 6z2 - z2 + 5z - 2z3 - 49 + 51 to gz*3 + hz*2 + w + nz and give w. 2 Rearrange j + 3j3 - 3 - j3 + 0 + j4 + 1 to zj + oj3 + rj*4 + pj*2 + w and give o. 2 Rearrange (5n*3 - 2n*3 + 4n*3)(-1 + 2 - 2) - 3n3 + 2n*3 + 0n*3 to the form in*3 + o + bn + cn2 and give c. 0 Express 3 - 2y - 3y - y3 - 1 + 0y*3 in the form uy + ay3 + ry*2 + w and give w. 2 Rearrange (4 - 1 - 2)(-3w - 4w + 4w)(-7 + 0 - 1)(-5w + 2w + w) to the form pw*2 + b + sw and give p. -48 Rearrange 26z - 24z + 28z + 42z to a + jz and give j. 72 Express -2 + f2 - 8f*2 - 3f*2 + 3f*2 as cf + pf2 + z and give p. -7 Rearrange 2u*3 + 0u*3 - 5u*3 + 4u*3 + 0u*3 - 7u*3 + (3u - u*2 - 3u)(5u - 5u - 2u) + 4 - 4 - u*3 to du*3 + zu + ou2 + g and give d. -5 Express q2 + 5q*2 - 2q*3 + 0q*3 in the form fq*2 + b + wq + lq3 and give w. 0 Express -5k + 11k4 - 3k4 - k4 + 1 - 9k4 as ik*3 + xk*4 + a + nk + lk2 and give a. 1 Rearrange -2i + 6i - i + ((4 + 1 - 6)(0 - 3 + 4) - 1 + 2 - 3 + 1 + 0 + 1 - 2 + 2 - 2)(-20i + 30i - 11i) to y	{ "pile_set_name": "DM Mathematics" }
))/(yy2) assuming y is positive. y(-491/56) Simplify ((p(-10)p)*(-1/2)(pp/(pp(pp*(-16/3))/p))/ppp/(p(2/13)p))(-21/8) assuming p is positive. p(-5285/208) Simplify (y*(6/13)/yyy)45y*10y32 assuming y is positive. y(1401/13) Simplify t/(t*(1/2)tt)t*(-1/7)t(t6t)/((t/t*(-5)t)/t)(((t(((tt9)/t)/tt)/t)/t)/(tt/t(-2/19)))(-6) assuming t is positive. t(-9313/266) Simplify (w(2/9)/(w/w(3/5)w)(w/(w/((ww/w*14)/w)))/(w/(ww9)))(-26) assuming w is positive. w*(6058/45) Simplify (bb/(b/b*(7/4))b)/bbb*6b(-9)/((b/(b/(b/b(3/7)b)))/b)((b*5b)/bb(-1/7))/(b0/bbb(-2/27)bb) assuming b is positive. b(2351/756) Simplify (((nn/n(-5/4))(9/10))(14/3))(2/23) assuming n is positive. n(273/230) Simplify ((z(-1))(-1))(-23)/((z/(z/(zzz(z(2/3)z)/z)))/(zzz*2zz)(z1)(-1/6)) assuming z is positive. z*(-41/2) Simplify (o(oo1)/o)(-1/29)/(o/o3o*3)((o(o/o(-9)o)/o)/o(-3/8))/((o(2/29)/o)/o4) assuming o is positive. o(3535/232) Simplify (((ww/((w/(www/w(1/2)))/w))/w)23((ww(-1))/w)21)/((w(-2/5)wwww)42/((ww/w*(2/5)w)/w)(-4/7)) assuming w is positive. w(-6483/70) Simplify ((((g/(g*(-12)/g))/g)/gg/((g/(g*(-11/5)g)gg)/g)g)/((g/g(3/5))/(g/g(2/7))))(-14) assuming g is positive. g(-778/5) Simplify ((v/v(2/9)v)7)(-30)/((v1)(17/6))(-1) assuming v is positive. v(-741/2) Simplify (((ss(-1))/s)/s)(-11/4)(sss*(-1)ss)16(s*(-1)s/(s/s4))(-1/18) assuming s is positive. s*(160/3) Simplify (((yy*4y)(-22/9))(-48))(-1/35) assuming y is positive. y(-704/35) Simplify (v11/v(-2/55)v(v/v*16)/vvv(1/4))(2/59) assuming v is positive. v(-597/6490) Simplify (s(3/19)/(ss*(-7/5)s)((s(-14)s)/s)/(s/(s*(-3/4)s)))(-6) assuming s is positive. s(17319/190) Simplify ((c*(3/8)c*(-2/7))/((cc3)/c(-3)))/((c1)(-6/25)((c/(ccc6/c)c)/c)/c(-2)) assuming c is positive. c(-3739/1400) Simplify (u(-1/4)/((u13uu)/u)u/(uu/u*7u)uu(-2))(-1/7) assuming u is positive. u(41/28) Simplify (d(1/4)d)/((dd*(-1/5))/d)(d*0d)*(11/6)(dd(-2/7))/((((d/(d/d(1/4)))/d)/d)/d)(dd(-3))/(d/(d/d(1/2))d) assuming d is positive. d*(341/105) Simplify (((ss*(-3)s)/s*(-2))/(ss/(s/(s*(-2)/s))s*(1/11)))/((s(s*0/s)/ss)30/(((s(1/6)s)/s)/s1)) assuming s is positive. s(137/66) Simplify (m/(m/(m/(m/(mmm/(mm*1)m)))))(-2/41)/(m0)*49(m(1/3))(4/7)(((m/(m/m(-1/4)))/m)/m)27 assuming m is positive. m(-208903/3444) Simplify (((v/(vv*(18/11)/v))/v)/v)/(vv*(-1/17)v)(v(3/10)/v)(-17) assuming v is positive. v(13693/1870) Simplify (n(-42))(-3)/(nn/(nn/n(-1))nn(-28)) assuming n is positive. n154 Simplify (((a(-1/2)/a(-5))(-2/43))(5/7))(6/13) assuming a is positive. a(-270/3913) Simplify ((p(1/7))(-1/3)p*(-5)pp/(pp*(2/7))pp)(-47) assuming p is positive. p(329/3) Simplify (f/(f(3/2)f)f(-1/6)f/f*(-1/5)f3)/((f/f(-6)f)/(f/f1f))(1/36) assuming f is positive. f(421/180) Simplify ((f/f*(-21))/fff(2/25)/fff(-34)/(f/f36))9 assuming f is positive. f(5193/25) Simplify (s1/ss((s(-2/39)/s)/s)/sss(-1/10)/(s(s/(s/(s(-30)/s)))/s))(3/5) assuming s is positive. s(11641/650) Simplify (p(-2)pp/(pp4/p))48p*6/(p/(pp*(-3))p)(pp/(p(pp/((pp/(p0/p))/p)p)/ppp)p)/(p/p(-1/13)p) assuming p is positive. p*(-2497/13) Simplify (((((kk*(-1/3))/kk)/k)/kk)46/(k1)(-19))/((k/((kk/((k/k*13k)/k))/k)k)/k(-2))(-21) assuming k is positive. k(-556/3) Simplify ((aa*(-1/4)aa/a(-7))/((aa(2/3))/(a(6/5)/a)))/(a(-1)/a(-1/6)(aa(1/4))/((a(2/15)/a)/a)) assuming a is positive. a6 Simplify ((q(2/5))(20/11)/(q(1/5)/q(q/q5)/q))/((((qqq(-1/2)q)/qq)/(q/q(-6)))/(q0q/q(-4/9))) assuming q is positive. q(12347/990) Simplify ((q(-2/3))(6/5))(3/11)/((((q/q(2/5)q)/q)/(qq(-2)))/(q(-1/2))42) assuming q is positive. q(-251/11) Simplify (((i*(-2)/iii/(ii/i*(-5/2))ii)22)(7/10))(-38) assuming i is positive. i(10241/5) Simplify (d(2/9)/(dd/d(-11)))45/(ddd/(dd(-1/2))dd(-1)(dd/(d2d))(34/7)) assuming d is positive. d(-8017/14) Simplify (g*(-18)g/g*(-18)g(g(g/(ggg*(-2/23)/gg))/g)/((g/(g/g(3/11)))/g))25 assuming g is positive. g(11475/253) Simplify ((((o/o(1/3))/o)/o)(1/11))(-4/17)(o(-8)/oo/o*7o)/(o/(o/o1))(1/13) assuming o is positive. o*(-102455/7293) Simplify (vvv(-7)vv(-1/10)/vv)*(-1/19)(vv/v(4/9)v/v*6v)/(vv(-2/7)/v)(4/5) assuming v is positive. v(-23941/11970) Simplify ((x/(x(-2/3)x))(-13))(-4/7)(x(-2/5)x*(-1/3))/(xxx/(x/(((x/(xx*(2/7))xx)/x)/x))(x/(x/(x1/x)))/x) assuming x is positive. x(368/105) Simplify (i*(1/2)i/(ii/i(1/3)))(-1/41)/(i/(ii*(2/11)i)iiii/(i*(-2/15)/ii)i)(-8/9) assuming i is positive. i(428207/121770) Simplify ((k4)23k*(-2)k(-5/7))17 assuming k is positive. k*(10625/7) Simplify (yy(-1))(2/125)yy*6/yy*(-3/8)(y1/y(-4))/((y/y(-1/4))/y)(2/17) assuming y is positive. y(1441/136) Simplify ((d(-2/9))*(1/4)/((d/(dd/(d((d/((d(1/12)d)/dd)d)/d)/dd)))/d13))7 assuming d is positive. d(3283/36) Simplify ((o(1/2)oo)/o(1/5)(o*7/ooo)/(o/((o(-7)o)/o)))/(((oo1)/o)(-5/9)(oo(3/4))/(o/o(1/9))) assuming o is positive. o(359/180) Simplify (c(2/9))(4/3)/(c1/((((c/(c/((c(-26)/c)/c)))/cc)/c)/c)) assuming c is positive. c(-829/27) Simplify (p/(p(7/4)p))/(p/(pp*(-7/3)))pp(-13/3)pp/p(-2/49)pp assuming p is positive. p(-1985/588) Simplify (o(2/23)/(o(-1)/o))(-43)(o(-1))30(o/o(2/5)o)(-1/6) assuming o is positive. o(-41402/345) Simplify (l(l/l2)/l)(1/4)/(l/l(2/23)l((lll(2/7))/l)/l)((l(-2/5))(-22))(-1/5) assuming l is positive. l(-67761/16100) Simplify (a(-6)/a(-6/7))/(aa(-7)/aaa(-4/7)a)(a(-4/7)/(aa(-3/5)))33 assuming a is positive. a(-1107/35) Simplify (w(-3/8))*(11/4)w*(4/25)w*(-2/21)w assuming w is positive. w*(563/16800) Simplify (r/(rr(-2/3)))42(r(r((r/(r4r))/rr)/rrr)/r)/rr/(r/r*(-2))(rr/r0)7/(rr*(-3/8)r(-4)) assuming r is positive. r(323/8) Simplify ((i(i/(i(-19/6)/i)i)/iiii)/ii*(-6/7)/ii)/(ii(-8))(-1/16) assuming i is positive. i(2309/336) Simplify ((k(2/5))(-46)k/k*(6/5)k(1/9))/(((k(-3)k)/(k/k1))/((k/(k/k(-3)))/(k/((k/(kk5))/k)))) assuming k is positive. k(-1192/45) Simplify (q*(-10)q*5qqq)(-17/4)/(q(-2/3)qq/q*(-2/21)q/(qq(1/8))q5) assuming q is positive. q(123/56) Simplify (((l*(-3/7)l)/ll)/((ll*(7/4))/l)l*(-2)lll*6)/(l/((l/(l((l*(4/9)ll)/l)/l))/l)l(2/15))(4/15) assuming l is positive. l(78133/18900) Simplify (m(2/5))*(-2/7)(m*(-1)/m)/(m/(mm*(1/5)))(m/(mm(-2/5)))5(m/(mm/m(-2/7)))/mmm(2/9) assuming m is positive. m(-44/45) Simplify (x/x(3/11)x/(xxxx(-3/2)x))*(-29)((xxx/(x/(x/(x/(x/(x/x*(-1)x)))))xxx)(-14))(2/23) assuming x is positive. x(9491/506) Simplify ((l/(l/l(-2/17))l)*(-44)(l*40l)/(l/l*22l))39 assuming l is positive. l(14703/17) Simplify ((ww(-1/6)w)/w(-2/7))(-4/35)(w(1/2)/(w4/www))(-4/9) assuming w is positive. w(1292/735) Simplify ((ss*2s/(ss5))/((s/(s(s/(ss(-3/5))s)/sss))/(s*1s)))/(((s*(-1/4)s)/s)(1/2)/(s(2/7)s(-1))) assuming s is positive. s(563/280) Simplify (i(-40)/ii*35)/(ii(-41))(-2/71) assuming i is positive. i(-506/71) Simplify ((((n(-28)/n)/((n/(n/(n/((nn(-12)/nn)/n)))n)/n))(11/3))(3/4))27 assuming n is positive. n(-6237/2) Simplify (zzzz*(13/3)z/(z/(z*(-3/11)z))(z24z)(-2/27))(-18/11) assuming z is positive. z(-3688/363) Simplify (((y1y(2/11))(-2/69))47)(-1/9) assuming y is positive. y(1222/6831) Simplify ((w/(w0/w)w)(2/169))(2/17)(w/(w(-3/7)/w)w/w(-1/4))0 assuming w is positive. w*(12/2873) Simplify ((ww*(-1)w)(8/9))(-2/25)/(((w/w(-3/2))/w)(2/67))**(-2/1	{ "pile_set_name": "DM Mathematics" }
undred thousand? 7600000 What is 0.000663226 rounded to five dps? 0.00066 What is 27322.11 rounded to the nearest 100? 27300 What is 0.000005235795 rounded to six decimal places? 0.000005 Round -0.00979843 to five dps. -0.0098 What is -2771 rounded to the nearest one hundred? -2800 Round 0.00001342121 to 5 dps. 0.00001 What is 0.00007253541 rounded to 6 decimal places? 0.000073 Round 43325.48 to the nearest 10. 43330 Round 0.000002470153 to 5 decimal places. 0 What is 0.01011499 rounded to 4 decimal places? 0.0101 Round -0.099594 to 3 dps. -0.1 What is -36135800 rounded to the nearest 1000000? -36000000 What is 0.00009834299 rounded to 6 dps? 0.000098 What is 0.0000013859338 rounded to seven decimal places? 0.0000014 Round -88590.95 to the nearest one thousand. -89000 Round -0.123078 to 1 dp. -0.1 What is 238373.3 rounded to the nearest ten thousand? 240000 Round 0.02532 to two dps. 0.03 What is -0.0000126284 rounded to seven dps? -0.0000126 Round -0.0231491 to four decimal places. -0.0231 Round 200.8462 to the nearest integer. 201 What is -54321.2 rounded to the nearest one hundred? -54300 What is -689500 rounded to the nearest one million? -1000000 Round 40743805 to the nearest one hundred thousand. 40700000 What is -0.0020552239 rounded to five dps? -0.00206 What is 0.16433121 rounded to two decimal places? 0.16 What is -0.00775071 rounded to 3 decimal places? -0.008 What is 73.811284 rounded to the nearest 10? 70 Round -1.520025 to two dps. -1.52 What is -25957.2 rounded to the nearest one hundred? -26000 Round -187600.8 to the nearest 1000. -188000 Round 0.003756116 to 4 decimal places. 0.0038 Round 0.00004113609 to 5 decimal places. 0.00004 Round 0.00052689335 to six dps. 0.000527 Round -3067295 to the nearest 100000. -3100000 What is 0.0000033766 rounded to 5 decimal places? 0 Round 628922.3 to the nearest one thousand. 629000 What is 0.002015265 rounded to 6 dps? 0.002015 What is -0.00698272 rounded to 3 decimal places? -0.007 What is -19910800 rounded to the nearest one hundred thousand? -19900000 Round -9.10684 to one decimal place. -9.1 Round -0.122007 to 1 decimal place. -0.1 Round -0.28515155 to 3 dps. -0.285 What is 360179000 rounded to the nearest one million? 360000000 Round -0.0001652554 to 5 decimal places. -0.00017 What is -0.051796769 rounded to 3 decimal places? -0.052 Round -104.265734 to zero decimal places. -104 Round 136.6 to the nearest 10. 140 Round 0.3039553 to one dp. 0.3 What is 2408945000 rounded to the nearest one million? 2409000000 Round -13030.63 to the nearest 1000. -13000 Round -4.7145 to two decimal places. -4.71 What is 0.002260888 rounded to five decimal places? 0.00226 Round 5.34584 to 1 decimal place. 5.3 Round 9.1389 to zero dps. 9 Round -19.610265 to 0 decimal places. -20 What is -0.002171046 rounded to six dps? -0.002171 What is -0.01733357 rounded to five dps? -0.01733 What is -0.009055564 rounded to 4 decimal places? -0.0091 Round -0.0008039573 to five decimal places. -0.0008 What is 6402.89 rounded to the nearest 100? 6400 Round 0.03069 to 4 dps. 0.0307 Round 321.23 to the nearest 100. 300 What is -0.0983979 rounded to three dps? -0.098 What is 3560.688 rounded to the nearest 10? 3560 Round -0.13731147 to four dps. -0.1373 What is -0.005174779 rounded to 6 dps? -0.005175 What is 791.996 rounded to the nearest integer? 792 Round 0.06975274 to four dps. 0.0698 What is 5194030 rounded to the nearest 100000? 5200000 Round -266681.16 to the nearest one hundred. -266700 What is 28466.2 rounded to the nearest one thousand? 28000 Round -0.00002321063 to 5 decimal places. -0.00002 Round 2135.289 to the nearest 10. 2140 What is 8288.89 rounded to the nearest 100? 8300 Round 1274.049 to the nearest integer. 1274 What is -0.03263279 rounded to one dp? 0 Round -0.1776079 to 3 decimal places. -0.178 Round 5443124.3 to the nearest one million. 5000000 Round 31.07207 to the nearest integer. 31 Round 0.343307 to one dp. 0.3 What is 0.000698573 rounded to 5 decimal places? 0.0007 What is -12483.35 rounded to the nearest 10? -12480 Round -12239.95 to the nearest 10. -12240 What is 0.0000090368 rounded to 6 dps? 0.000009 Round 22.88946 to zero decimal places. 23 What is 0.00164676 rounded to four dps? 0.0016 Round 0.103348 to three dps. 0.103 Round 0.8300477 to two dps. 0.83 What is 0.0000341654 rounded to five dps? 0.00003 What is -0.00600631 rounded to 5 decimal places? -0.00601 Round -0.00008405476 to 5 decimal places. -0.00008 What is 0.33142909 rounded to 3 dps? 0.331 What is 0.796232 rounded to one dp? 0.8 Round -0.134156 to 2 decimal places. -0.13 What is 0.13589712 rounded to 3 dps? 0.136 What is -0.000164585 rounded to four decimal places? -0.0002 What is 0.0028036735 rounded to 6 decimal places? 0.002804 What is 449.747 rounded to the nearest 100? 400 Round 0.0000013489484 to seven decimal places. 0.0000013 Round 505.8797 to 1 decimal place. 505.9 Round 9.90516 to 1 dp. 9.9 Round 0.0210526 to three dps. 0.021 What is -0.000101961 rounded to seven dps? -0.000102 What is -1.0138795 rounded to three dps? -1.014 What is 71544.204 rounded to the nearest one hundred? 71500 Round -30246370 to the nearest 10000. -30250000 Round -0.00031357 to 3 decimal places. 0 What is 56937300 rounded to the nearest 1000000? 57000000 What is 115936.851 rounded to the nearest ten? 115940 What is -0.00000158836 rounded to 6 dps? -0.000002 Round 46.636841 to 1 decimal place. 46.6 What is -218589500 rounded to the nearest 1000000? -219000000 Round -7.4861 to the nearest integer. -7 Round 3.380734 to two dps. 3.38 What is 0.0000271933 rounded to six decimal places? 0.000027 What is -14.24277 rounded to 0 decimal places? -14 What is 0.003232777 rounded to six decimal places? 0.003233 Round 0.000037384023 to seven dps. 0.0000374 Round -115972200 to the nearest 1000000. -116000000 Round -0.003663589 to 5 dps. -0.00366 Round -939.8083 to the nearest one hundred. -900 Round -0.001061221 to 4 dps. -0.0011 What is -121808 rounded to the nearest ten thousand? -120000 What is -0.00006614043 rounded to 7 decimal places? -0.0000661 What is -92846.9 rounded to the nearest one hundred? -92800 What is -565.234 rounded to the nearest one thousand? -1000 What is 0.00026797852 rounded to seven decimal places? 0.000268 What is -714460 rounded to the nearest 1000000? -1000000 Round 0.000023855883 to 6 dps. 0.000024 Round -3736508 to the nearest one million. -4000000 Round 0.01177511 to 4 dps. 0.0118 Round 18349000 to the nearest 1000000. 18000000 Round 0.0157216 to five decimal places. 0.01572 What is -15258490 rounded to the nearest 10000? -15260000 What is -53193570 rounded to the nearest one hundred thousand? -53200000 Round 118.962 to the nearest integer. 119 What is -0.0000005409989 rounded to 7 decimal places? -0.0000005 Round 149538.5 to the nearest one hundred. 149500 What is 0.05216929 rounded to two dps? 0.05 Round -0.251391 to 2 dps. -0.25 What is 0.581969 rounded to 2 decimal places? 0.58 What is 17713996 rounded to the nearest 1000? 17714000 What is 255.63 rounded to the nearest ten? 260 What is 0.11224227 rounded to 3 dps? 0.112 Round 0.000103045 to 6 dps. 0.000103 What is 6.29149 rounded to 2 dps? 6.29 Round -2.132334 to 3 decimal places. -2.132 What is 0.00009232702 rounded to five decimal places? 0.00009 What is -6.22266 rounded to zero dps? -6 What is 884717.1 rounded to the nearest 100000? 900000 Round 13988.99 to the nearest one hundred. 14000 Round 0.0630604 to 4 dps. 0.0631 Round -14.880951 to 1 dp. -14.9 What is 0.000005335962 rounded to seven decimal places? 0.0000053 Round -2.336551 to 1 dp. -2.3 What is -122.267 rounded to the nearest 10? -120 Round -7813341 to the nearest one million. -8000000 What is 0.00002261823 rounded to six decimal places? 0.000023 What is -1339.37 rounded to the nearest 1000? -1000 Round -761.542 to the nearest 100. -800 Round 0.0043653 to 3 decimal places. 0.004 Round -18.7037 to the nearest ten. -20 Round -43.48204 to 2 dps. -43.48 What is 0.0000005452102 rounded to seven decimal places? 0.0000005 Round -21.3886 to 0 decimal places. -21 Round -27.9399 to the nearest ten. -30 What is 0.010192026 rounded to three dps? 0.01 Round -0.005905718 to 5 dps. -0.00591 What is 0.000169287 rounded to 5 deci	{ "pile_set_name": "DM Mathematics" }
pose q - p = s. What is the smallest common multiple of 24 and q? 24 Let f = 3744758107/52 + -72012218. Let i = f + -9437/4. Find the common denominator of ((-16)/84)/((-2)/102-2) and i. 182 Let q = -74 + 92. Calculate the smallest common multiple of 8 and q. 72 Suppose -5o = -t - 26, 4o + 2t = -3t + 44. Suppose 0 = u - 4u + 72. What is the lowest common multiple of u and o? 24 Let u(x) = 2x + 12. Let q be u(-9). Let b be 3/2(0 - q). What is the common denominator of (-6)/b + 113/(-6) and 23/10? 10 Let i = 21 + -12. Let u = 1219 - 8514/7. What is the common denominator of u and 202/60 + 3/i? 70 Let h be 1 - (-4 + 2300/454). Let x = 13033/5448 - h. What is the common denominator of x and 61/18? 72 Let i(a) = 2 - 7 + 6 + 35a3 - a - a2. Let c be i(1). Suppose -c = -f - 5y, -2f - f = -2y - 17. What is the lowest common multiple of f and 3? 9 Let c = 13672 + -287057/21. Let l = -11051/3 + 99410/27. Find the common denominator of c and l. 189 Suppose -51d + 135 = -46d. What is the smallest common multiple of d - 1/(-2 + 10/6) and 18? 90 Let o = -42113 + 2021339/48. Calculate the common denominator of -85/24 and o. 48 Let t be 1(-6)/180. Suppose -4w - 3m + 69 = t, -w = 4w + m - 78. Calculate the lowest common multiple of 24 and w. 120 Let r be 4/62151/10. Let s = 143 - r. Calculate the common denominator of 85/(-18) - (-3)/6 and s. 45 What is the smallest common multiple of (42/(-4))/((-2)/4) and 42((-120)/42)/(-10)? 84 Let o be 1127/23 - (-2)/((-4)/2). Suppose -a = -3c + 35, 3c = -c + 2a + o. Calculate the lowest common multiple of c and 15. 165 Let p = 53 + -49. Find the common denominator of ((-6)/p)/(61/(-73) + 1) and 7/19. 152 What is the common denominator of (-2)/(-4)21/5 and (-619)/(-44) + (424/(-88) - -5)? 20 Let c be 1(0 + -1) + 8175/(-3). Let o = c + 90019/33. What is the common denominator of -47/21 and o? 231 Suppose -5z = -2i + 54 + 44, -i + 4 = 0. Let n = 34 + z. What is the least common multiple of n and 16? 16 Suppose -2y - o + 22 = 2o, -14 = -2y + o. What is the lowest common multiple of (-10 - 26/(-2)) + 6 and y? 72 Suppose 3r = 4r - 2. Suppose -39 = -3u + 4i, 3u = -6i + i + 12. Suppose u = rq - 11. Calculate the smallest common multiple of 4 and q. 20 Suppose -8504 = 5w - 9w. Let k = -1246 + w. Calculate the common denominator of 31/18 and 3812/k - (-4)/(-22). 180 Calculate the common denominator of (-4)/16 + (-214)/(-144) and 73/64. 576 Let i = -10651/4 - -2685. Calculate the common denominator of i and 41/6. 12 Suppose -3y = 3h - 2h - 73, 0 = y - 3. What is the smallest common multiple of h and 64? 64 Let n = -72 + 67. What is the least common multiple of (2/4)/(n/(-480)) and 28? 336 Suppose -2 + 18 = 2i. Suppose 4r - ir + 32 = 0. What is the smallest common multiple of 10 and r? 40 Suppose -3o + 4 = -7o, 4q + 5o = 79. Calculate the smallest common multiple of q and 45/36/10. 63 What is the least common multiple of 22/55(-3 - -68) and 130? 130 Let p = 6443/70 - 92. Calculate the common denominator of 0 - (0 + 62/(-24)) and p. 420 What is the common denominator of (12/(-16))/((-234)/(-516)) and (-2)/4(-305)/(-50)? 260 Let a(u) = -u3 + 39u*2 + 44u - 159. Calculate the least common multiple of 1 and a(40). 1 Let k = -108517/14706 + -8/817. Calculate the common denominator of k and 3 + (-33)/(-8) + (15 - 700/40). 72 Let a be -4 - -3 - (-2 - (-1149)/(-621)). Let y = a + -155/23. Find the common denominator of 58/27 and y. 27 Let d = 2206 + -809. Let v = 2/1753 - 27001481/19283. Let x = v + d. Find the common denominator of 13/7 and x. 77 Let z = -116 + 114. What is the common denominator of -71/2 and (-5)/(-60)(z - 3)? 12 Suppose -3f + f + 16 = 0. Suppose -42 = -3n + 21. Let p = n - 11. Calculate the least common multiple of p and f. 40 Suppose 6d + 1303 + 371 = 0. Let g = 1157/4 + d. What is the common denominator of -47/9 and g? 36 Let q = 8 - 7. Let c(m) = 8m - 2. Let o = 65 + -63. Calculate the least common multiple of c(q) and o. 6 Let u = -1/44 + 1871/44. Let r be -20662(-1 - 0)/2. Let c = r + -165363/16. What is the common denominator of u and c? 16 Let h be (8/(-2) + 2)/(-1). Find the common denominator of 1/(22/(-20))1 and (-3)/h2 - 28. 11 Suppose -3p + 2t = 0, -4 = -4t + 8. Suppose 17 = u - 0u - pl, 0 = 2u - l - 43. Find the common denominator of -109/22 and (-3 - (-284)/96)u. 264 Let x = -524545/18 + 29149. Let s = -294 + 1143/4. What is the common denominator of s and x? 36 Let z = 401689/440 + -10070/11. What is the common denominator of z and -19/15? 120 Suppose -3x - x - 16 = 0. What is the lowest common multiple of x(-8)/(-176) + 312/22 and 22? 154 Let w(c) be the first derivative of -c2 + 21c + 31. Calculate the least common multiple of 6 and w(-6). 66 What is the least common multiple of 6 and (-24)/(-21)(19 - -9)? 96 Let y = 11454 - 5782. Let p = y + -45437/8. Calculate the common denominator of ((-4)/(-1))/2 + (-47)/(-12) and p. 24 Let k = 17 - 16. What is the common denominator of 2/5 and (-61k)/((-54)/6)? 45 Let h(b) = b - 9. Let x be h(5). Let g be 614339/(-1210) - x/(-22). Let o = g + 506. Find the common denominator of 59/3 and o. 30 Let a = -12 + 22. What is the common denominator of (a/24)/((-3)/(-42)) and ((-10)/(-12))/(2/(-4))? 6 Let b = 800 + -768. Calculate the least common multiple of b and 290. 4640 Let y(q) = 6q - 6. Suppose 5d - 5j = 25, -2d + 9j = 4j - 13. Let v be y(d). Find the common denominator of (149/v)/((-4)/4) and -3/20. 180 Let r = 4/25241 - -2649377/5855912. Calculate the common denominator of r and 87/22. 2552 Let n = -53849/12 - -4493. Find the common denominator of (4/22)/(3312/19228) and n. 36 Let j = 1345 - 1233. Calculate the lowest common multiple of j and 80. 560 Let z = -1813041946467/2924 + 620055401. Let n be 729/(-1462) + 1/2. Let c = n - z. Calculate the common denominator of -67/8 and c. 8 Let z(l) = l*3 + 13l*2 + 28l + 5. Calculate the smallest common multiple of 91 and z(-9). 1001 What is the least common multiple of 15 + (4 + 0 - 9) and 253? 2530 Suppose 1 = -14v + 85. What is the common denominator of 26 and (-202(-3)/18)/((-88)/v)? 44 Let d = 2/6629 + 921383/159096. Calculate the common denominator of 41/66 and d. 264 Let i = 158645/22 + -7207. Let s be (3 - 3566/(-456))-2. Let f = 104/19 + s. What is the common denominator of i and f? 66 Let g be -4((-8)/(-1))/(-4). Suppose -gp + 10 = -3p. Find the common denominator of 35/907 - p and 11/20. 180 Suppose 4f + 4 + 4 = 0. What is the common denominator of -8/21 and -1 + f - 1290/(-315)? 21 Suppose 0 = -16n - 635 + 651. Suppose 0 = d - 6 + 4. Calculate the lowest common multiple of n and d. 2 Let c = 16980 - 50867/3. Let o = 56 - 96. Calculate the common denominator of o and c. 3 Let k = 127 + -124. Suppose 5g = -4w + 46, -10w = kg - 6w - 34. Calculate the lowest common multiple of 33 and g. 66 Suppose 5 - 11 = -b. What is the common denominator of 85/66 and b/8 + 34/20? 660 Let u = -83 + 55. Let v = -18 - u. Let t(p) = -8p - 2. Calculate the least common multiple of t(-2) and v. 70 Let p be 0 - 3 - -3 - -33. Suppose -5q + 3v - 28 = 0, v + p = -4q - 3. Find the common denominator of 19/6 and ((-6)/(-6))/(q/101). 24 Let q(s) = -s + 55. Calculate the smallest common multiple of 5 and q(20). 35 Let g = 350050799654648/22867 - 15308120861. Let x = 3/1759 - g. Find the common denominator of -59/8 and x. 104 Let d(h) = 5h - 56. Calculate the smallest common multiple of d(16) and 36. 72 Suppose 0 = -4u + 82 + 2. What is the least common multiple of (-720)/(-28) + 1 + (-10)/(-35) and u? 189 Suppose 0 = -4l - 3g + 2g + 17, 27 = 3l - 4g. Suppose 0f = -lf + 110. What is the least common multiple of 66 and f? 66 Let h = 16 - 12. What is the lowest common multiple of 2/(-1) - (-4 - 2) and -3 + (0 - h) + 8? 4 Let u be (-2)/(-4)4 + 0. What is the lowest common multiple of u/16 - 79/(-8) and 33? 330 Let n be (-1)/(-2)(-1 - -3 - 2). Suppose 4b - 4y - 16 = 0, n = -0b + 3b - 4y - 12. Calculate the least common multiple of b and 18. 36 Let m = 198 - 222. What is the common denominator of (-46)/(-4) + 0 + 1 and m? 2 Let k = -283/12 - -47/6. Calculate the common denominator of (-312)/(-21)*1/(-2) and k. 28 Let l =	{ "pile_set_name": "DM Mathematics" }
alue in -0.1, -24, 0, 0.1, 17, 1, 25? 1 What is the second smallest value in 1, -1/1373, 4925? 1 What is the fifth smallest value in 28, -1, 3, 4/5, -0.26982, -0.2? 3 What is the third biggest value in 13, -8, 27/7, 1.66? 1.66 What is the second smallest value in -9, 2, -0.531, -0.1, 0.7, -3/5? -3/5 Which is the third biggest value? (a) 11/19 (b) 562 (c) -28 c What is the second biggest value in 1/7, 2/1249, -5, -937? 2/1249 What is the third smallest value in -0.039, -1/3, -4, -11, -2/31, -0.3, -2/7? -1/3 What is the fourth smallest value in -21, -122, -1, -17, 2/5, 0.1? -1 Which is the third smallest value? (a) 0 (b) 3 (c) 6 (d) 3/8915 (e) 25 b Which is the third biggest value? (a) -44/5 (b) 485 (c) -2/5 (d) 6 c Which is the smallest value? (a) 2 (b) -148 (c) -8589 (d) 5 c Which is the fourth biggest value? (a) -0.3 (b) -4334 (c) -2/3 (d) -977/7 (e) -1/3 d What is the sixth biggest value in -2, 178.5, 4, 0.0835, 3, -0.5, 5? -0.5 Which is the biggest value? (a) -0.2 (b) 5/6 (c) 2513 (d) -1.3 c Which is the third smallest value? (a) -3 (b) 2 (c) -0.32715 (d) 0.07 (e) -1/8 e What is the fourth biggest value in -0.06, 0.2, -10/59, 4/5, 365? -0.06 Which is the third biggest value? (a) -32/25 (b) -4/9 (c) -0.04 a Which is the fifth biggest value? (a) 46 (b) -1/4 (c) 7 (d) 19 (e) 2/9 (f) 0.2 f Which is the second smallest value? (a) 3 (b) -3 (c) 90546575/4 a What is the third smallest value in 1/3, 13, 2/7, 5/2, -8949? 1/3 What is the biggest value in 644, -1/3, -5, -2/7, -4/9, -0.3, -3? 644 What is the third biggest value in 8/11, -3, -43402? -43402 What is the third smallest value in 3567/7, 4, -4/27, -1/11? 4 What is the biggest value in 0.11, 234, 130? 234 What is the second smallest value in 33, -3/7, 1/540805, 0.4, -5, -0.4? -3/7 Which is the fifth smallest value? (a) -1 (b) -0.1 (c) 2 (d) 0.2 (e) -2/13 (f) -31/7 (g) 0.35 d What is the second smallest value in -3, 2/11, -2/25719, -0.5, -25, 4? -3 Which is the sixth biggest value? (a) -2/55 (b) -309 (c) -0.2 (d) 1/5 (e) 0 (f) 0.4 (g) -1 g What is the biggest value in 27548.9, 2, 0.081? 27548.9 Which is the fifth biggest value? (a) 337 (b) -0.2 (c) 5081 (d) 2/11 (e) -3 e Which is the fourth smallest value? (a) 1 (b) -2 (c) 1.4 (d) -397454 c What is the second smallest value in -24, -1/6, 0.89459? -1/6 What is the sixth biggest value in -2/7, 14, 0, -3, 585, 85? -3 What is the fifth biggest value in 5, -1.54, -5, -1, 0.08, 3, 0.014? -1 What is the smallest value in 9, 11, 2/3, 36/23? 2/3 What is the fifth smallest value in -0.14, -0.3, -0.2, 33763, -5, -3? -0.14 Which is the biggest value? (a) 0.19 (b) 0.032 (c) -0.3 (d) -14/19 (e) 0.5 e What is the second smallest value in 0.1, -1/23364, 1/3? 0.1 What is the sixth biggest value in -5, 0.09, 17, 3, -4, 0.8, 2? -4 Which is the third smallest value? (a) 4.45 (b) 1/6 (c) 1101.9 c What is the fourth smallest value in 0, 0.5, 2/29917203, 1? 1 Which is the third biggest value? (a) 58 (b) 4409460 (c) 0.2 c What is the fourth smallest value in 1339, 0, 3, -2, 130? 130 Which is the second smallest value? (a) -123 (b) 4 (c) -0.4 (d) 6/7 (e) 7 (f) 2425 c What is the second biggest value in -4, 2/3, 1, -15, -0.4, -2.11, 17? 1 Which is the third biggest value? (a) -1/5 (b) 107115 (c) 40 a Which is the biggest value? (a) -5 (b) 2044269 (c) -8 b Which is the fourth biggest value? (a) 12/11 (b) -1.87 (c) 2/13 (d) -3/49 b Which is the sixth biggest value? (a) 0.5 (b) -8 (c) -2 (d) 209 (e) 1 (f) 0.2 b What is the third biggest value in -3, -10218, 0.01, 1/2? -3 Which is the second biggest value? (a) 2762 (b) 483 (c) 24 b What is the smallest value in -13.3, 3/5, 0, 16761? -13.3 Which is the second smallest value? (a) 2/9 (b) 0.4 (c) 1515 (d) -415.94 a What is the fourth biggest value in 0.1, -1, 0.4, -11/89, 77, -9, 0.3? 0.1 What is the fifth smallest value in 0.4, 290/11, 10/11, -2.39, -2/9? 290/11 What is the fifth smallest value in -31.1, 2/7, -1/8, 0.5, -1166, -3, 1? 2/7 What is the third smallest value in -0.1, -5/2, -159.4488, 2? -0.1 Which is the biggest value? (a) 2 (b) -0.4 (c) 31 (d) -1/3 (e) -0.54 (f) -217 c What is the sixth smallest value in 0.3, -1/152, -18, -5, -0.5, 3/2, -0.0017? 0.3 Which is the third biggest value? (a) 0.028 (b) -2/9 (c) 1/8 (d) 0.8 (e) 1 (f) 2/51 (g) 1/7 g What is the second smallest value in 4, -1, 3, 17071521? 3 What is the smallest value in -1, -3, -0.055, 2/5, 2, 15/34? -3 Which is the third biggest value? (a) 2 (b) -10 (c) -1413 (d) 91 b Which is the fourth biggest value? (a) -22 (b) 16683 (c) 1 (d) -2/9 (e) 5/4 (f) -1/3 d What is the third smallest value in 1, 149, -15358? 149 What is the third biggest value in 3, 0.121076, -9, -0.4, -0.3, -4? -0.3 What is the second biggest value in -159/47, -1.3, -16? -159/47 Which is the fourth smallest value? (a) -5 (b) -2 (c) 3540/19 (d) 1.3 c What is the third smallest value in -8/47, -6, -0.3, 8, 9? -8/47 Which is the biggest value? (a) -3.85 (b) -0.3 (c) 0.5 (d) 101 (e) -1 (f) 55 d Which is the fifth smallest value? (a) -1/3 (b) 0.5 (c) -1 (d) -4 (e) 0.06 (f) 4570 (g) 4 b Which is the fifth smallest value? (a) 3 (b) -0.5 (c) 0 (d) -0.32 (e) 8 (f) -67 a Which is the second smallest value? (a) 57 (b) -42 (c) -21 (d) 0.3 (e) 7 (f) 0.4 (g) -1 c What is the fourth smallest value in 1, -3, -114, 0.02, -3/115? 0.02 What is the biggest value in 5, -8, 2/13, -26, -2/7, 1/4, -3? 5 Which is the second smallest value? (a) -336 (b) -1 (c) -0.5 (d) 5/3 (e) -2 (f) 3 (g) -0.4 e What is the fifth smallest value in 16, -4/5, 0.3, 3770/37, 6? 3770/37 Which is the fourth smallest value? (a) -3 (b) -1/7 (c) -243 (d) -149 (e) 0.6 (f) -0.5 f What is the fifth biggest value in 0, 6/59, -147, 3, 1/5, 0.3? 0 What is the sixth biggest value in -0.059, 3/4, 4, 14, -2/9, 8, -2? -2/9 Which is the third biggest value? (a) 24 (b) 1.2 (c) -1 (d) 0.4 (e) 4 (f) 2/13 (g) 0.7 b What is the third biggest value in -179/11, 2/5, -9, 0.9? -9 What is the second biggest value in 0.5, -4, 4, 2/17, -3/2479, 2/3? 2/3 What is the fifth smallest value in -0.4, -11, 3738, -8/3, -0.1? 3738 Which is the fourth smallest value? (a) -2/27 (b) 8 (c) -11 (d) -0.1 (e) -0.18 (f) -1/2 d What is the fifth smallest value in -0.1, -0.103, 1, -1, -2, 7/19, 3/4? 7/19 What is the third smallest value in -5/6, 7/2, 0.0251, -6, 1? 0.0251 What is the biggest value in -2, 19.4, -39, -0.2, 0.4? 19.4 What is the smallest value in -17378, -1, -6, 0.9, 16? -17378 What is the fifth smallest value in 4, -1/3, 0.04, 1/617, 4.5? 4.5 Which is the second biggest value? (a) 3984 (b) 159 (c) 22/9 b What is the sixth smallest value in -2/5, 9, 2.42, 2/31, -3/2, -1/9? 9 What is the third biggest value in 2/5, -0.1, 0.3, 51816, 2/9? 0.3 What is the fourth smallest value in 4, 57, -0.87, 1? 57 Which is the smallest value? (a) 5 (b) -3/42748 (c) -0.8 c Which is the second biggest value? (a) -3/448 (b) 5 (c) -6 (d) -0.5 (e) -193 a Which is the second biggest value? (a) 0.076 (b) 3881 (c) 0.8 c What is the second smallest value in 0.7, 5/3, -44/14389? 0.7 Which is the fifth smallest value? (a) 4 (b) 0.3 (c) -124.5 (d) 3 (e) -2/15 (f) 6201/7 a Which is the biggest value? (a) -6.16 (b) 0.6 (c) 456 (d) 2/7 (e) -1 c Which is the fourth biggest value? (a) 0 (b) -30 (c) 3 (d) 1043 (e) 2/3 a Which is the third biggest value? (a) 1569221 (b) 2/11 (c) 4 b What is the second biggest value in -0.0323, 3/2, -0.31, 0.1, 0? 0.1 What is the third smallest value in -3, 18, 2021579? 2021579 Which is the third biggest value? (a) -2140/20459 (b) -1/6 (c) 1/4 b What is the second biggest value in 5, -271, 0.01, -1/4, 12, 2, 0? 5 What is the sixth smallest value in -1, -15, 22, -2, 1, 3/35, 0? 1 Which is the fifth biggest value? (a) 0.23 (b) 0 (c) 5 (d) 0.5 (e) -17 (f) -7.8 f Which is the biggest value? (a) 1 (b) 16 (c) 37/16 (d) 200 (e) -1 d What is the sixth biggest value in -29/4, -1/2, -0.1, -5, 2/5, 9/5? -29/4 What is the fifth smallest value in -28, 3, 2, -1616, 8, 4? 4 Which is the biggest value? (a) 110 (b) -185/4 (c) -891 a Which is the smalles	{ "pile_set_name": "DM Mathematics" }
-9)/378). 3/4 Evaluate (252/(-6))/6 - -13. 6 4((-4)/(-18) - 132/108) -4 What is ((-45)/25)/((-21)/70)? 6 Calculate (-1)/2(-120)/(-15). -4 What is the value of 3/(-45)40/(-8)? 1/3 Calculate 4/22 + (96/(-110))/(-4). 2/5 Evaluate (-44)/(-77)6/12. 2/7 -4 + (-7)/14-10 1 What is the value of (-2)/(-1) - (9/(-3))/1? 5 58/(-87)(1 - 4) 2 Evaluate (-330)/360 - (-1)/4. -2/3 Evaluate 1 + (-5 - 0)/(-4 + 8). -1/4 What is (252/(-294))/(30/21)? -3/5 (-7 + (-57)/(-6))/(-1) -5/2 Calculate (693/112 + -6)/((-6)/4). -1/8 Evaluate (-33)/(-220) - 15/20. -3/5 Evaluate 13/(-35) + (-8 - (-60)/7). 1/5 Calculate -8 + (-505)/(-30) - (4 - -4). 5/6 Calculate ((-555)/40)/37(-4)/(-2). -3/4 What is the value of ((-45)/(-21) + -2)/((-18)/(-63))? 1/2 5/189-3 + 2/9 1/7 Evaluate (-37)/(-222) - 3/12. -1/12 Calculate (-10)/4 + 1/((-2)/(-3)). -1 (4 + -4 + -1)1 -1 Calculate (-3950)/2800 + (-27)/(-21). -1/8 What is the value of (-22)/(-66)1/((-2)/(-6))? 1 Evaluate -5 + 51/7 + -5 + 3. 2/7 What is 2 - (-35)/(-15) - (-1)/2? 1/6 What is ((-250)/(-60))/(-5) + 3/(-18)? -1 Calculate ((-324)/135)/(4/10). -6 Calculate 0/(((-60)/(-50))/((-2)/(-5))). 0 Evaluate (-21)/5 - (-8)/2. -1/5 What is the value of (1 + 0)/(7/(7 - 28))? -3 Calculate 6 + (3 - 5) - 0. 4 ((-18)/(-15))/((-91)/1953) -6/7 (6 + -12)/(-5 + (-5 - -11)) -6 Evaluate (-1 - 3) + (1 - (4 + -3)). -4 Evaluate 10/(-20)2/15. -1/15 Evaluate 5(-2 + -8)/60. -5/6 Evaluate (-51)/42 + 18/(-63). -3/2 What is the value of (252/(-32))/7 + 0 + 1? -1/8 Calculate 8/(-18) + (-2009)/(-369) + -8. -3 (-3)/12 - (1 - (-3)/(-2)) 1/4 Evaluate 10/(-14) + (-12)/42. -1 Evaluate (-2)/19 + 1066/741. 4/3 What is the value of 14/(-2)6/(-63)? 2/3 What is (84/196)/(3/2)? 2/7 352/(-3520) - (78/20 + 0) -4 What is the value of (-3 - (-24)/9) + 15/72? -1/8 What is (-120)/(-33) + (-12)/(-33)? 4 What is (-3)/(-4)(-19)/((-19)/4)? 3 What is (12/10)/((-58)/145)? -3 What is 29/(-8) - (-9 - -5)? 3/8 Evaluate 22/(-10) - 3/(-15). -2 Evaluate 3 + 2 - (-4 + 3)-2. 3 9(-3)/(-216)-6 -3/4 9/(-85)3 + 33/165 -2/17 What is the value of (2/(-3))/(154/99)? -3/7 Evaluate -3 + 1/238/19. -2 Calculate (9 + -15)((-425)/30)/17. 5 Calculate (-3 - 75/(-21)) + (-8)/14. 0 Evaluate -3(-6)/(-4)102/(-1071). 3/7 What is 2-2 + (-25)/(225/(-18))? -2 (0 + -15)4/968 -5 What is the value of (15/12)/5 - (-7)/196? 2/7 Evaluate 12/20 - 4/((-60)/(-69)). -4 What is (-13)/221(7 + -5)? -2/17 Evaluate (12/(-5) - -3) + (-40)/(-100). 1 4/34 + 3 + 1145/(-340) -1/4 Calculate (-4 + 90/27)(-6)/46. 2/23 (-285)/(-76) + (-2)/(-8) 4 What is -10 - ((-4 - -7) + -6)? -7 What is the value of (-54 - -60) + (0 - (-2 - -6))? 2 Evaluate (-10 - -7) + 0 + 6. 3 What is -1(-1)/(-1) - (-99)/121? -2/11 Calculate ((-2)/(-8))/((-1)/(-2)). 1/2 Calculate 6/4 + (-1)/2. 1 Evaluate 0 + 4 + (-490)/105. -2/3 (-1 - (-39)/(-12)) + (1 - -3) -1/4 What is the value of 72 + -66 - (-1 + (-1)/(-1))? 6 What is 2/147 - 15/13? -2/13 What is (2/(-76))/(36/(-144))? 2/19 What is the value of (-4 - 125/(-15) - 3)-3? -4 Calculate (1/2)/(((-1365)/10)/(-21)). 1/13 What is the value of (1974/198 - 10)(7 - 1)? -2/11 (6/(-3))/((-2)/4 - 0) 4 Evaluate (16/4)/4(10 + -17). -7 What is 20/70 + -4(-75)/(-70)? -4 What is 15(3 + 32/(-12)) + -3? 2 (5/(-15))/1 - (-4)/4 2/3 What is -2 - (-18 - -3)(-4)/(-42)? -4/7 What is the value of -3((-40)/(-150))/(46/5)? -2/23 (207/345)/(18/25) 5/6 Evaluate ((-145)/87)/(2/(-6)). 5 (-42)/16 + 3 - (-38)/(-16) -2 Evaluate 1/((56/3)/(-7)). -3/8 What is the value of (15/(-4) - -3)/((-204)/136)? 1/2 Calculate 96/(-36)(-3)/18. 4/9 What is 2/3(-9)/30? -1/5 Calculate (-5)/((-5)/(-2)-1). 2 What is ((-71)/71)/(1/5)? -5 Calculate 8/45 - (-8 - (-168)/20). -2/9 Calculate ((-406)/(-49) - 4) + (-4)/14. 4 Calculate 4 + 1/(-4 - -3). 3 Calculate (-27)/(-180)8/12. 1/10 (-4)/6(-30)/(-130) -2/13 ((-2)/41)/(-57 - -58) -1/2 (-7)/284/1 -1 Evaluate 8/(-12) - (-1)/(-3). -1 What is the value of (30/315)/(6/(-14))? -2/9 Calculate 582/(-66) + 4 + 5. 2/11 -2 + (21/168)/(1/15) -1/8 What is the value of (5 + (5 - 11))31? -3 (-1)/3 + (3 - 6/(-18)) 3 What is the value of (33/(-495))/((-1)/6)? 2/5 What is 9/6(-6)/(-12)? 3/4 What is the value of (-14 + 265/20)/2? -3/8 What is -20 + 18 + 1 + (-3 - -4)? 0 Evaluate ((-2)/(-6))/(((-108)/8)/9). -2/9 Calculate (10/210)/(4/(-48)). -4/7 What is -5 - ((-747)/51)/3? -2/17 Calculate -5 + (-8)/(6/(-3)). -1 What is the value of ((-4)/(-12)-1)/(2/12)? -2 What is the value of (-13)/(-5) - -4(-15)/20? -2/5 What is the value of (-1890)/(-300) + (-12)/40? 6 What is (250/35 - 7)-7? -1 Evaluate 7/(56/46) + 3/(-4). 5 Calculate (2/4)/((-5)/(-10)). 1 Calculate ((-54)/36)/((-6)/(-4)). -1 (5/3)/(-5 - -4)-3 5 Calculate 192/240(2 - 2 - 2). -8/5 6/14 + 655/(-231) -1 What is 280/40 + 0 + -6? 1 Evaluate (6/(-4) - 1)(-6)/5. 3 What is (92/207)/(1 - 14/(-6))? 2/15 What is the value of (8/16)/((-242)/40 - -6)? -10 (-25)/40 - 5/40 -3/4 (-2 - 3 - 1) + 5 -1 Evaluate (1 + 56/(-24))3. -4 What is (3 + 13/(-4))-8? 2 What is 9/(-12)(-136)/1938? 1/19 Calculate 96/(-176) - ((-46)/44 - 0). 1/2 What is the value of -2 + (-19)/((-684)/80)? 2/9 Calculate -2(-1)/16 + (-1305)/(-8120). 2/7 Evaluate -9 + (-5)/(180/(-316)). -2/9 Calculate 104/(-88) - (2 - 3). -2/11 What is 2/(-18)(-30)/2012? 2 Calculate 2/(-4) + (-12)/9620. -3 Evaluate ((-42)/(-4))/(((-21)/2)/(-7)). 7 Evaluate ((-10)/(-45))/(-5 - (-119)/21). 1/3 (-3 + 1 - -3)16/88 2/11 Evaluate ((16/(-20))/4)/((-1)/2). 2/5 What is the value of (-216)/(-396) - 98/(-22)? 5 What is (19/(399/14))/(1/(-6))? -4 Evaluate 4 - (0 - 172/(-20)) - -4. -3/5 (1(5 - 4))/(2 + -1) 1 Calculate (-5 + 8/8)5/5. -4 Calculate ((-343)/(-35) - 2) + (-4)/5. 7 Evaluate (1(-14 - -14))/(-3). 0 What is 6 + (1 - (12 + -10))? 5 Calculate -2 + (-5)/(-3) - (-2040)/(-306). -7 What is -4 - (-63)/15 - (-2)/10? 2/5 Calculate (-1251)/278 - (-6)/4. -3 Calculate -4 - (-20)/(10/2). 0 21/(-6) - (-4 + 36/8) -4 What is the value of (-1 - 0)/((-11)/(-44)16)? -1/4 What is the value of -1 + ((-6)/4 - (-9 + 7))? -1/2 Evaluate (1/(-10))/(3 + (-18)/5). 1/6 Calculate ((3 - 2) + -3)/((-2)/4). 4 Calculate (-19)/((-3420)/(-1236)) - (0 + -7). 2/15 (1/(-7))/((-6)/(-72)-4) 3/7 (1/(-12))/(29/87) -1/4 (21/14)/(6/(-8)) - 0 -2 6 + ((-480)/220)/(6/16) 2/11 Evaluate (1/3)/((-2)/(-18)). 3 What is 0 + 4 + 1(-7)/1? -3 Calculate 10/(-6)(-27 - -24) - 11. -6 What is (15/18 + -1)-9? 3/2 Evaluate -2(28/(-8) + 1). 5 What is the value of (-10)/(-75) + (-132)/90? -4/3 Evaluate -33((-292)/(-72) + -4). -1/2 What is (-56)/(-18) - (16 - 13)? 1/9 What is (1(-4 - -1))/((-12)/(-8))? -2 2 - 4 - ((-77)/(-2))/(-11) 3/2 Calculate 1 + (-80)/96 + 38/(-84). -2/7 Evaluate (-2 - 477/(-234))/((-2)/24). -6/13 Evaluate (-18)/2870/60. -3/4 What is the value of (-2)/((-21)/(-3) + 4)? -2/11 Evaluate (-5)/(-6) + (-2117)/1752. -3/8 What is (8/5 + -1)/((-6)/(-4))? 2/5 84/8 + 15/(-6) 8 Evaluate 15/(-9)(-24)/(-20). -2 What is the value of (5/(-4))/((-640)/1024)? 2 -9 + ((-1)/(-2))/(10/40) -7 What is the value of 16/36(305/40 - 8)? -1/6 What is (-198)/(-84) - 5/(-35)? 5/2 What is (-144)/12010/21? -4/7 (25/10)/(105/84) 2 0 - ((-56)/2)/(-4) -7 Calculate (-3)/5 + ((-1666)/(-70))/(-7). -4 Calculate (2 + (5 + -8 - -1))/(-1). 0 ((-1)/5)/(12/(-20)) 1/3 (-140)/(-105) + 25/(-12) -3/4 Evaluate (3/2)/(35/(-10) + 4). 3 Evaluate 270/(-65) + 16/4. -2/13 (-2)/10 - 338/(-65) 5 Calculate ((-5)/15)/(5/3603). -8 Calculate 0 - (-34)/(-8) - (-450)/90. 3/4 Calculate (42/(-39) + 1)624/(-48). 1 What is the value of ((-8)/6 - -1)3? -1 Evaluate -7 - (-2 - 104)(-1)/(-16). -3/8 Evaluate (-5)/324/(-420). 2/21 Calculate 2/10 + 6419/655. 10 What is the value of -11 + -13 + 26 - 4? -2 Evaluate (-63)/(-56)4 + 0 + -3. 3/2 What is the value of 3/(0 - 1) + (-23)/(-9)? -4/9 Calculate (-4)/(-15) - 12/(-30). 2/3 What is 0 - (-7 - 2)/(-9)? -1 (-27)/631/3 -1/7 What is (-4)/6(-1)/(-11)3? -2/11 What is the value of (-2)/64/6? -2/9 What is (3 - 81/36)/((-21)/(-8))? 2/7 Evaluate 9 - 9 - (-6 - -2)/(-4). -1 What is the value of (-6)/(-2)42/(-63) + 5? 3 ((-6)/(-12))/(10/4 - 2) 1 What is 4(-8)/(-40)-5? -4 Evaluate ((-6)/825-10)/(6/(-15)). -2/11 What is the value of (5/45)/(2/(-6))? -1/3 Evaluate 4/(-30)*(-9 + 8 + -5). 4/5 (28/(-98))/((-4 - -3)/(-7)) -2 Calculate ((-51)/(-68))/(3/8). 2 What	{ "pile_set_name": "DM Mathematics" }
758, -19685000? -34015614 What is the next term in 176630, 349873, 523118, 696365, 869614, 1042865, 1216118? 1389373 What comes next: 5792, 23270, 52402, 93188, 145628, 209722, 285470? 372872 What is the next term in -2446, -2945, -3208, -3115, -2546, -1381, 500? 3217 What comes next: 58242, 58668, 59094, 59520, 59946, 60372? 60798 What is next in -4225, -4198, -4121, -3964, -3697, -3290, -2713, -1936? -929 What is next in -2423, -11648, -27651, -50432, -79991, -116328, -159443? -209336 What is next in 2745123, 5490229, 8235335, 10980441, 13725547? 16470653 What comes next: -593264, -1186517, -1779770, -2373023, -2966276? -3559529 What is the next term in -77138805, -77138806, -77138807, -77138808? -77138809 What comes next: -7302, -9281, -12602, -17283, -23342, -30797, -39666, -49967? -61718 What is the next term in -621665996, -1243331990, -1864997984, -2486663978, -3108329972, -3729995966? -4351661960 What is the next term in 2110, 11002, 25822, 46570? 73246 What comes next: 7743, 8284, 8845, 9438, 10075? 10768 What is next in 252935709, 252935708, 252935707, 252935706, 252935705, 252935704? 252935703 What comes next: 27858, 31143, 34428, 37713? 40998 What is next in -20280, -20514, -20748, -20982, -21216, -21450? -21684 What is next in 2878064, 2878059, 2878050, 2878037, 2878020, 2877999? 2877974 What is the next term in -315200, -315033, -314866, -314699, -314532? -314365 What comes next: -6071, -24538, -55387, -98618, -154231, -222226, -302603? -395362 What is next in 926084, 1852280, 2778476, 3704672, 4630868, 5557064? 6483260 What is next in 168, 963, 3038, 7029, 13572, 23303? 36858 What is the next term in -26145781, -26145771, -26145761, -26145751, -26145741? -26145731 What is next in -78272, -312219, -702128, -1248005, -1949856? -2807687 What is next in -145148, -1161192, -3919026, -9289544, -18143640? -31352208 What comes next: -96619, -773838, -2612011, -6191614, -12093123? -20897014 What is next in 537, 609, 693, 789, 897, 1017, 1149? 1293 What is next in -1067549841, -2135099683, -3202649525? -4270199367 What is next in -944, -1330, -1874, -2576? -3436 What is the next term in 710320, 710343, 710350, 710335, 710292, 710215? 710098 What is the next term in 18462, 36546, 54630, 72714, 90798, 108882? 126966 What is the next term in -2449945, -2449943, -2449931, -2449903, -2449853, -2449775? -2449663 What is the next term in -5622428, -11244859, -16867290? -22489721 What comes next: 17613, 17847, 18077, 18303, 18525, 18743? 18957 What is the next term in -5296, -21110, -47462, -84352, -131780? -189746 What comes next: 5, -478, -1425, -2836, -4711, -7050? -9853 What comes next: -44484, -88641, -132798? -176955 What is next in -15462, -31556, -47650, -63744, -79838? -95932 What is the next term in -25969, -51839, -77709, -103579? -129449 What is the next term in -2505214, -5010401, -7515562, -10020685, -12525758, -15030769, -17535706, -20040557? -22545310 What comes next: 206641, 206603, 206565? 206527 What is the next term in 287324, 287528, 287866, 288338, 288944, 289684? 290558 What comes next: 35654, 142438, 320408, 569564, 889906, 1281434? 1744148 What is the next term in 90644, 90763, 90902, 91067, 91264? 91499 What is next in 1383451, 1383452, 1383453, 1383454, 1383455, 1383456? 1383457 What is next in 10345, 10431, 10627, 10969, 11493? 12235 What is the next term in -526, -1036, -1488, -1858, -2122, -2256? -2236 What is the next term in -15130, -30201, -45248, -60271, -75270? -90245 What comes next: -466, -1123, -1766, -2395? -3010 What is next in 398069, 796136, 1194203, 1592270, 1990337? 2388404 What comes next: -18857, -37625, -56371, -75083, -93749, -112357, -130895? -149351 What is next in 542, 1196, 2134, 3530, 5558, 8392? 12206 What is next in -200322, -403162, -606002, -808842? -1011682 What is next in -3358, -13504, -30442, -54172, -84694, -122008, -166114? -217012 What is the next term in -12130, -97226, -328272, -778264, -1520198, -2627070, -4171876? -6227612 What is next in -89803, -89941, -90075, -90205, -90331? -90453 What is next in 137354, 137254, 137154, 137054, 136954? 136854 What comes next: -1927984, -3855966, -5783948, -7711930, -9639912, -11567894? -13495876 What is the next term in -420639, -1682529, -3785673, -6730071? -10515723 What is the next term in -5836758, -5836754, -5836750, -5836746, -5836742? -5836738 What is next in -5714, -11200, -16282, -20780, -24514? -27304 What is the next term in 90912362, 90912359, 90912356? 90912353 What is the next term in 59559, 59920, 60521, 61362? 62443 What comes next: -36642019, -73284034, -109926049, -146568064, -183210079, -219852094? -256494109 What comes next: -2126896, -4253743, -6380590, -8507437? -10634284 What is next in 19516, 39021, 58516, 78001, 97476, 116941, 136396? 155841 What comes next: 47764, 67396, 87028, 106660, 126292? 145924 What is next in -57571, -57565, -57559, -57553? -57547 What comes next: -18871790, -37743556, -56615322, -75487088, -94358854? -113230620 What is next in -1817237, -1817229, -1817207, -1817165, -1817097, -1816997, -1816859, -1816677? -1816445 What is next in 2285, 2781, 3499, 4349, 5241, 6085, 6791? 7269 What comes next: 260, 1066, 2444, 4394? 6916 What is the next term in 10146346, 10146349, 10146352, 10146355? 10146358 What is next in 165629, 165667, 165703, 165737, 165769, 165799, 165827? 165853 What is the next term in -26131, -26040, -25801, -25342, -24591? -23476 What comes next: 5998, 11628, 17266, 22912, 28566? 34228 What is the next term in 867, 948, 1037, 1128, 1215, 1292? 1353 What is the next term in 38766, 70439, 102112? 133785 What is next in 13994, 111537, 376168, 891431, 1740870, 3008029? 4776452 What comes next: 1641, 6584, 14815, 26334, 41141? 59236 What is next in 3557, 21178, 50531, 91610, 144409, 208922, 285143? 373066 What is the next term in 1142271, 2284544, 3426817, 4569090, 5711363? 6853636 What is the next term in -15769, -14464, -10927, -4042, 7307, 24236, 47861? 79298 What is the next term in 5258446, 5258262, 5258078? 5257894 What comes next: -378, -887, -1540, -2349, -3326, -4483, -5832? -7385 What comes next: -72022, -144889, -217756? -290623 What is next in 5234, 5304, 5386, 5480? 5586 What is the next term in -1496, -3098, -4924, -7088, -9704? -12886 What is next in -115827, -926393, -3126449, -7410741, -14474015, -25011017? -39716493 What is the next term in 2929, 8098, 15509, 25156, 37033, 51134? 67453 What is next in -2981117, -11924453, -26830013, -47697797, -74527805, -107320037? -146074493 What comes next: -1099723, -2200282, -3300841, -4401400, -5501959? -6602518 What is the next term in -66441443, -66441442, -66441441, -66441440, -66441439, -66441438? -66441437 What comes next: -568044, -568168, -568292, -568416, -568540, -568664? -568788 What comes next: 4259, 19790, 45639, 81806? 128291 What comes next: 14873916, 29747824, 44621732, 59495640? 74369548 What is the next term in -5681125, -5681137, -5681149, -5681161, -5681173? -5681185 What comes next: -979, -3372, -7345, -12904, -20055, -28804, -39157? -51120 What comes next: 3815, 6848, 9097, 10562, 11243? 11140 What is the next term in -23435, -23350, -23267, -23186, -23107, -23030? -22955 What is the next term in -4596, -2514, -432, 1650, 3732? 5814 What comes next: 420666, 419245, 417824? 416403 What is next in 961370, 962794, 964220, 965648, 967078, 968510, 969944? 971380 What is next in -25664708, -25664701, -25664690, -25664675? -25664656 What is the next term in 184235, 367783, 551331? 734879 What comes next: 8605774, 17211548, 25817322, 34423096, 43028870, 51634644? 60240418 What comes next: -184, -7, 516, 1559, 3296? 5901 What is the next term in 245206179, 490412363, 735618547? 980824731 What is next in 282468, 282517, 282566, 282615, 282664, 282713? 282762 What comes next: -73703193, -73703205, -73703229, -73703271, -73703337, -73703433, -73703565, -73703739? -73703961 What is next in -145609608, -145609607, -145609606? -145609605 What is next in 180592, 180372, 180146, 179908, 179652, 179372, 179062, 178716? 178328 What is the next term in 220578, 441052, 661426, 881700, 1101874? 1321948 What comes next: -1470, -888, -292, 318? 942 What comes next: -13696, -13777, -13886, -14023, -14188, -14381, -14602? -14851	{ "pile_set_name": "DM Mathematics" }
u = -1167.03 + 1167.53. Sort a, -0.5, u in increasing order. -0.5, u, a Suppose 0 = -x + 2 + 1. Let k be 2/27 - 30192/2997. Sort x, k, -2, -4 in descending order. x, -2, -4, k Let q = 4.59 + -6.8. Let u = 2.307 + q. Let r = u - -0.003. Sort 5, r, 39 in decreasing order. 39, 5, r Let y = -23506748651/2132 - -11025679. Let b = -3/164 - y. Sort -1/2, 2, b. -1/2, b, 2 Let b be 2/2 - 4 - 1. Let s(w) = -4w - 9. Let c be s(-6). Let m(d) = 34d*2 + 25d + 2. Let t be m(0). Sort b, t, c. b, t, c Suppose 12 = -4j - 2m - 0m, 0 = -j + 2m + 7. Suppose -195r = -203r - 200. Sort 2, r, j in descending order. 2, j, r Let o be (-13 + 9 - -6) + (8 - 5). Put o, -4, 203, -1 in ascending order. -4, -1, o, 203 Let j(w) = w*3 + 40w*2 + 69w - 271. Let b be j(-38). Suppose 277 + 115 = -4x. Sort x, 4, -1, b in descending order. 4, -1, b, x Let s = 0.07909 - 0.03909. Put -0.01, s, -5 in decreasing order. s, -0.01, -5 Suppose 4q - 311 + 319 = 0. Suppose -2a + 11 - 2 = w, -w = a - 12. Let u be (-50)/w(-6)/(-5). Put q, -9, u in decreasing order. q, u, -9 Let p = -1 - -6. Let q = p + -2. Suppose -5i - 31 = 3v - i, 3v - 4i - 1 = 0. Put v, -1, -4, q in ascending order. v, -4, -1, q Let n be ((-4)/(-391))/(942/8007). Let h = -5.366 - 0.034. Let c = -5 - h. Sort c, -0.1, 2/9, n in decreasing order. c, 2/9, n, -0.1 Suppose 3f = -3o, -2o - 12 = o - f. Let c be 2/(-6)(-36)/12. Sort o, -53, c, 2 in ascending order. -53, o, c, 2 Let j(t) = t*2 + 112t - 471. Let k be j(4). Put k, 295, -5, 0 in ascending order. k, -5, 0, 295 Let n = -1 - -1. Suppose 13s + 13 - 299 = 0. Let j be 371/77 - (-4)/s. Put n, 2, j in descending order. j, 2, n Suppose -u + 4i = 1 + 11, -4i + 28 = -5u. Let o = -23 + 23. Suppose 3t - 6t + 2p + 27 = o, -3p - 18 = -2t. Sort t, 3, u. u, 3, t Suppose 0 = 51b - 35b. Suppose 7t + 5 = 2t. Suppose 4u = n + 21, -5u - 2n + 19 = -17. Put u, t, 4, b in decreasing order. u, 4, b, t Let b(g) = -g*2 + 8g - 12. Suppose -3v = 3h - 12, 4h + 4v = 2h + 6. Let z be b(h). Let t be 16/24 + (-8)/3. Sort -14, z, t. -14, t, z Let h = 71 + -72. Let i be (-664)/2493/2. Sort h, i, -8 in increasing order. -8, i, h Let a = 187.98 - 188. Let p = 1.42 - 3.4. Let g = a + p. Put -3, g, -4, -0.4 in increasing order. -4, -3, g, -0.4 Suppose -5l = -12k + 16k, 3k - 4l = -31. Sort -4, k, -9, -2, 2. -9, k, -4, -2, 2 Let c(z) = -24z + 6. Let n be c(2). Let u = n - -17. Let d be ((-3)/4)/(41/(-164)). Sort d, -5, u, -2 in increasing order. u, -5, -2, d Let y = -56 - -55. Let t = -483 + 476. Put 3, t, y, -4 in ascending order. t, -4, y, 3 Suppose 9t - 4t = 5f, 12 = 4f. Suppose -b - 20 = 3r, 6b - b + tr = -40. Put -3, 4, b in decreasing order. 4, -3, b Suppose -23z + 0 + 159 = -117. Sort -4, -143, z in decreasing order. z, -4, -143 Let h be 7/3(2 + 1). Let r = 5 - h. Suppose -2249 + 2265 = 16u. Sort 2, r, u. r, u, 2 Let u = -3 - -3.2. Let i be ((-4)/26 - 410/(-130)) + (-32)/4. Sort -3, 0.4, i, u in decreasing order. 0.4, u, -3, i Let i be (-1 + 5 - 2)/((-512)/(-768)). Sort -52, i, -5, -11, -1 in descending order. i, -1, -5, -11, -52 Let i be (12 + -3)/(-9)16/88. Put 4, 2, -1/4, -0.04, i in ascending order. -1/4, i, -0.04, 2, 4 Let w = -178 - -190. Sort 2/7, -4, 0.4, -2, w in descending order. w, 0.4, 2/7, -2, -4 Let j(i) = -i2 - 7i - 10. Let l be j(-6). Let m(t) = -5t3 + 137t*2 - 57t + 75. Let h be m(27). Sort 9, -1, l, h in ascending order. h, l, -1, 9 Suppose -562d - 10304 = -564d. Let a be (d/1284)/(-2) - -2. Put 5/4, a, -1 in descending order. 5/4, a, -1 Suppose -35p + 280p - 10535 = 0. Suppose -2u + 1 = n, 0n + 3n = 3u + 21. Sort -1, p, u in ascending order. u, -1, p Suppose -6o = -0o + 6o. Suppose 0 = -8k - 8 - 32. Put 1, k, -4, o in increasing order. k, -4, o, 1 Suppose -p = 3r + 13, -4p - p = r - 5. Suppose -pz - 6 = 2t, 2z + z = 5t + 23. Sort -24, z, 0 in increasing order. -24, 0, z Suppose 5k - 14 = -4h, -6 = 3h - 9h. Sort -122, k, 0 in descending order. k, 0, -122 Let k be (-27)/(1782/(-572))3. Sort k, 1/6, 73, -4. -4, 1/6, k, 73 Let f be (-24560)/48(-6)/10. Suppose 5c + 325 = -5n, -4n + 54 + f = -5c. Sort c, -5, 2. c, -5, 2 Let w = 212 + -200. Let s(y) = 5y - 59. Let z be s(w). Put z, 2, -0.2, 4 in increasing order. -0.2, z, 2, 4 Let z = 0.0454 - 55.1454. Let n = z - -54.1. Sort 5, 2/3, 0.5, n in ascending order. n, 0.5, 2/3, 5 Let a be 440/561 + (-4)/590/612. Sort -5, -62/45, a in descending order. a, -62/45, -5 Suppose 0 = -3z + 2z + f + 2, 2z = -2f. Let y = -77 + 77. Let j be y - (-28)/42(-1 - 2). Put 0, j, -3, z in decreasing order. z, 0, j, -3 Let w = 9933 - 9932.7. Sort -4, w, -0.028, 0.5, 3 in decreasing order. 3, 0.5, w, -0.028, -4 Let u = 1 - 1. Let y = -86804 - -86800. Sort 4, y, u in increasing order. y, u, 4 Let b be 2/(3 + (-4 - -2)). Let p be b/(-3) - 2292/(-36). Let v = 62 - p. Sort v, -3, -5 in increasing order. -5, -3, v Let x(q) = -42q + 198. Let s be x(4). Let i be (-100)/s3/2. Let r = -0.1 + 0.14. Sort 0.3, i, 4/7, r in ascending order. i, r, 0.3, 4/7 Suppose 3268a + 205 = 3227a. Sort 15, 0, 4, a, -3 in descending order. 15, 4, 0, -3, a Let l = 597 + -597.3. Let h = 0.57 - -1.43. Put l, -1, h, -0.2 in descending order. h, -0.2, l, -1 Let z be -1(0/(-2) + 0). Let k be (-10)/(-6)(45/10)/((-60)/24). Put k, z, -6 in descending order. z, k, -6 Suppose -f - 4i = -8, 27i - 23i + 40 = 5f. Sort -2, f, 1.6. -2, 1.6, f Let j = -3.89 + 0.37. Let f = 4.52 + j. Sort 0.2, -2, f in descending order. f, 0.2, -2 Let n be -24(3/7)/((-39)/(-273)). Let h be 0/((-8)/(n/(-27))). Put h, 4, -4 in decreasing order. 4, h, -4 Let v = -315 + 290. Let x = 24.444 + 0.056. Let m = x + v. Put -0.4, 0.4, m, -3 in descending order. 0.4, -0.4, m, -3 Let m be (10 - (6 - -5))(-8)/(-28). Let c = 18 - 16. Put m, 0, c in descending order. c, 0, m Let k be 2/(-3)(-351)/(-26). Let m be (k/(-6))/(6/(-8)). Let a be m + (-14)/(-6) + -1. Put 0.1, -8, a in descending order. 0.1, a, -8 Let n(a) = a - 4. Let y(r) = 32r - 559. Let u(d) = 4n(d) - y(d). Let x be u(18). Let w be ((-6)/(-4) - 1)-2. Sort x, w, -5 in decreasing order. x, w, -5 Let j = -3692 + 3693. Put -28, -5, 3, j, 0 in decreasing order. 3, j, 0, -5, -28 Let m = 1825 + -1825. Let i be (0 + -2)/((-4)/2). Let l = i + m. Put 13, l, 2 in descending order. 13, 2, l Let u = -3439 - -3440. Sort -80, -4, 4, u, -5 in ascending order. -80, -5, -4, u, 4 Suppose 0 = 1234f - 1250f - 80. Put f, 76, 2/11 in increasing order. f, 2/11, 76 Let w = -7.06 + 0.06. Let n = w - -7.2. Suppose -1 = u - 5x - 32, 2u + 29 = -3x. Sort u, -2/9, 3, n in ascending order. u, -2/9, n, 3 Let j = -2.2 - -0.2. Let i = -3 + j. Let x = -38.406 - -39.706. Sort x, i, -0.2 in decreasing order. x, -0.2, i Let c = -77 - -55.2. Let f = c + 21.4. Put f, 3.8, -3 in increasing order. -3, f, 3.8 Let x be (6/(-27))/(-1)(-2 - -5). Let p = 36 + -22. Let v be p/18 + (-1 - 0). Sort v, 0.13, x, -2/13. v, -2/13, 0.13, x Let g = 220 + -220.2. Let m be (20 - (-1 + 0)) + -2. Let q = -21.3 + 21.4. Sort q, m, g in descending order. m, q, g Let q = 23.7 + -23.3. Suppose 5j - 4 = -4m - 12, -2j + 5m - 23 = 0. Let v = 87/7 + -943/77. Put 0.5, q, j, v in decreasing order. 0.5, q, v, j Let y be (-6)/(-15) - 44/10. Suppose 0 = 7t - 95 - 17. Suppose 29s = 25s + t. Put y, -1, s in decreasing order. s, -1, y Let l = 320 - 318. Let y(w) = w*3 + 22w*2 + 41w + 15. Let q be y(-20). Sort q, -3, 3, l. q, -3, l, 3 Suppose 7o = -5o - 492. Let i = -33 - o. Suppose -4d - i = 5q, q + 5d = -5 + 16. Sort -3/4, 2, q, 3. q, -3/4, 2, 3 Suppose 3r - 114 = 462. Suppose -13y - r = -17y. Suppose -5b + 68 - y = 0. Sort b, 0, 3 in descending order. b, 3, 0 Suppose -c - 2j = -595, 4c + 151j = 148j + 2340. Sort c, 2, -4, 0 in increasing order. -4, 0, 2, c Let d = -6197 - -18590/3. Put d, 19, 0.5, 0.11 in descending order. 19, 0.5, 0.11, d Let s = 2 + -4. Let c = -518 - -522. Suppose 4k + c = 3l + 14, 0 = -4k + 5l + 14. Sort s, 4, k, 0. s, 0, k, 4 Suppose -138b - 74b = 0. Sort 6, b, -63. -63, b, 6 Let a = -4.08 + 0.08. Let m = 143 + 14. Let d = -160 + m. Put d, a, 2/17 in increasing order. a, d, 2/17 Suppose 8286g - 48 = 8274*g. Put -0.8, g, 3.5 in decreasing order. g, 3.5, -0.8 Let m = 61257	{ "pile_set_name": "DM Mathematics" }
y 2(sqrt(72) + (sqrt(72) - (sqrt(72) + sqrt(72)-2 + 3))*2 - sqrt(72)) - (1(1 + sqrt(72)))*2-5. -84sqrt(2) + 959 Simplify (6(1 + (sqrt(204) + 1sqrt(204))/sqrt(12) + 1sqrt(68) + sqrt(68) + -2))*2. -432sqrt(17) + 22068 Simplify 0 + (4 + sqrt(128) + 1)*2 + (5(1 + sqrt(128)) - sqrt(128)) + sqrt(128). 158 + 120sqrt(2) Simplify ((sqrt(21) - (3sqrt(84))/sqrt(4))/(sqrt(3) + sqrt(33)/(sqrt(44)/sqrt(4)) - sqrt(3)) + -5)*2. 20sqrt(7) + 53 Simplify (6(sqrt(192) - (sqrt(192) + 0)))2 + sqrt(192) + (sqrt(192) + -1(0 + sqrt(192)))*2 + (sqrt(144)/(-2sqrt(6)))/sqrt(8) + -3. -3 + 15sqrt(3)/2 Simplify (((sqrt(216) - (sqrt(216)-2 + sqrt(216) + sqrt(216)))-6)/((sqrt(8) + sqrt(8) + sqrt(48)/sqrt(6))-3))*2. 12 Simplify (4(2 + (-3(sqrt(512) - 1sqrt(512)) - -2(2 + sqrt(512)))))2. 6144sqrt(2) + 33344 Simplify (-5 + -1 + sqrt(832) + sqrt(832) + 1 + 1 + 3(sqrt(832) - (-4 + 1sqrt(832))))*2. 256sqrt(13) + 3392 Simplify ((1(sqrt(70) + (sqrt(70)-3 - sqrt(70)) + sqrt(70)))/sqrt(7))/((-2sqrt(60)5 + sqrt(60))/sqrt(12)). 2sqrt(2)/9 Simplify ((sqrt(4500) - -2sqrt(4500))4)/(4-6(sqrt(9) + 3sqrt(9))). -5sqrt(5)/4 Simplify (-5(sqrt(153) - (sqrt(153) + sqrt(153) + sqrt(153) + 5sqrt(153))) - sqrt(153))/(((sqrt(9) - sqrt(9)-1) + sqrt(9))-6). -17sqrt(17)/9 Simplify (-4 + sqrt(2) + (sqrt(2) - (4 + sqrt(2)2 - sqrt(2))) + 1 + (sqrt(2) - (sqrt(128) + -1)))2. 72sqrt(2) + 108 Simplify (-2 + 6sqrt(343)-1 + sqrt(343) + -2 + -5 + -2)*2. 770sqrt(7) + 8696 Simplify (sqrt(136) + ((sqrt(136) - (sqrt(136) - sqrt(136)-2))-5 - sqrt(136)) + sqrt(136) + 1sqrt(136)1)/(-1sqrt(288)2 + sqrt(288)). -2sqrt(17) Simplify (-4 + (sqrt(52)/((sqrt(36) - sqrt(4))2) - sqrt(104)/(sqrt(8) - sqrt(32)4))2)1. -1563/784 Simplify ((sqrt(768) + sqrt(768) + 1 + 5 - sqrt(768)) + sqrt(768) + 3(sqrt(768) + 2 - sqrt(768)))2. 768sqrt(3) + 3216 Simplify (4sqrt(153)-4)/(3sqrt(1089) - sqrt(1089)). -8sqrt(17)/11 Simplify (1(-5 + sqrt(275)1 + 1))*2-4. -1164 + 160sqrt(11) Simplify 3 + ((sqrt(1872)-4 - sqrt(1872))-1 + -2sqrt(1872)-2)2. 151635 Simplify (4 + sqrt(960)/(-1sqrt(192)))*2. -8sqrt(5) + 21 Simplify (sqrt(3000) + sqrt(3000)-1)/(-6(sqrt(10) + sqrt(490)) - sqrt(10)). 0 Simplify (4 + sqrt(13)-15 - -5sqrt(117)-3)*2. -400sqrt(13) + 32516 Simplify (sqrt(1000) - (sqrt(1000) - sqrt(1000)2))/(sqrt(20)/sqrt(10)4). 5sqrt(5) Simplify 3 + -1-2(sqrt(11) - (-1 + sqrt(11))2)1-4. -24sqrt(11) + 99 Simplify (sqrt(252) + 2 - ((sqrt(448)3 - sqrt(448)) + 3))2. 20sqrt(7) + 701 Simplify (sqrt(847) + -2)3 + sqrt(847) + -5 + -2sqrt(847) + -3. -14 + 22sqrt(7) Simplify ((-2 + (sqrt(112) + -1)-1 + -3)-3)2. 288sqrt(7) + 1152 Simplify -1 + -1(3 + (sqrt(6)/sqrt(2) + 1 + sqrt(3) - sqrt(3)14)2 + -2). -15 + 4sqrt(3) Simplify (((sqrt(520) + sqrt(520)-4 + sqrt(520))-2)/sqrt(10))*23. 2496 Simplify (2sqrt(44)1 + -1 + sqrt(396))*2-1. -1101 + 20sqrt(11) Simplify 4 + -1 + 5(sqrt(17) + -1 + sqrt(17)) + sqrt(17) + -5(sqrt(1700) - (-1 + sqrt(1700))). -7 + 11sqrt(17) Simplify ((sqrt(320) - (-1 + 1sqrt(320))) + (sqrt(320) + -3sqrt(320))-1)2. 32sqrt(5) + 1281 Simplify (-3 + sqrt(363)2-1 + -2)*2 + -1. 220sqrt(3) + 1476 Simplify ((sqrt(110)/(sqrt(5)-1) - (sqrt(550)2 - sqrt(22)))/(-1sqrt(8)4))*2. 275/16 Simplify (0 + 2 + sqrt(891) + -5 + (sqrt(891) + 0 + sqrt(891) - sqrt(891)) + (sqrt(891) + -1)6 + 3)*2. -864sqrt(11) + 57060 Simplify ((sqrt(20)/(sqrt(6)/sqrt(3)))/(sqrt(405)-5 + sqrt(5)))2. 1/968 Simplify (2(2sqrt(78)/(sqrt(24)/sqrt(4)) + -5(sqrt(637) - -2sqrt(637))))2. 551668 Simplify sqrt(44)/(sqrt(12)/sqrt(3)-2) - (-4(2 + sqrt(11))2 + 4). 31sqrt(11)/2 + 56 Simplify (sqrt(275) + -1)5 + -1(sqrt(275) + -1)*2 + (-3(-1 + sqrt(275)) + sqrt(275) + (2 + -2sqrt(275) - sqrt(275)))2. -215sqrt(11) + 6619 Simplify ((sqrt(1008) - (sqrt(1008) + 2)) + -5 + 2 + sqrt(1008) + 1 + 2)*2. -48sqrt(7) + 1012 Simplify 6(5 + (-1(-4 + sqrt(50) + sqrt(50)) - sqrt(250)/(-1sqrt(5)))). -30sqrt(2) + 54 Simplify (51sqrt(5200))/(-3sqrt(4)1-5). 10sqrt(13)/3 Simplify -4 + (-3 + (sqrt(833) - (sqrt(833) + 0)) + -1 - (4 + 3 + (sqrt(833) - -1sqrt(833)))2). -3389 - 196sqrt(17) Simplify (-3sqrt(448))2 + (1 + sqrt(1008)1)*2. 24sqrt(7) + 5041 Simplify (-3 + ((sqrt(3024)-2)/((sqrt(175) - (-4sqrt(175) + sqrt(175))) + sqrt(7)))*2)-1. -45/49 Simplify (-6(sqrt(204) - sqrt(204)1))/(sqrt(300)-6). 0 Simplify ((sqrt(11) - 5sqrt(44)/sqrt(4))5 + 5 + sqrt(176)-4)*2. -360sqrt(11) + 14281 Simplify (1((1sqrt(1872)-2 - -3(-1 + sqrt(1872))) + 0))*2. -72sqrt(13) + 1881 Simplify (((sqrt(38) - sqrt(190)/sqrt(5)5 - sqrt(38)) + sqrt(38))/(sqrt(10)/(3sqrt(5)) - sqrt(2))-5)2. 17100 Simplify (-4(sqrt(448) + (sqrt(448) - 4sqrt(448)))-4 + -1)*2. 512sqrt(7) + 458753 Simplify 0 + ((-6-1((sqrt(91) - 1sqrt(91)) + sqrt(91)))/(2sqrt(448)-1))2. 117/64 Simplify -4 + sqrt(153) + (-4 + sqrt(153))2 - sqrt(153) - (sqrt(153) + -6(sqrt(153) + (3 + sqrt(153))*2 + sqrt(153))). 117sqrt(17) + 1137 Simplify (-4(sqrt(65)4 + sqrt(65)))/(sqrt(45)3). -20sqrt(13)/9 Simplify ((1 + sqrt(605))3)2 - (2-2sqrt(605))2. -4226 + 198sqrt(5) Simplify (sqrt(792)35)/(-3sqrt(4)/sqrt(2) + (-1sqrt(24))/sqrt(12)). -45sqrt(11)/2 Simplify (1 + ((sqrt(128) + sqrt(128) + 0)-1 + -5 + -2)*2)-1. -562 - 224sqrt(2) Simplify ((sqrt(275) + sqrt(275)1)/sqrt(5))/sqrt(176)-5. -5sqrt(5)/2 Simplify ((sqrt(600)1)/sqrt(12) + sqrt(16)/(sqrt(200)5))*2. 31752/625 Simplify (3(0 + sqrt(245) - (sqrt(5) + sqrt(45)-5 - sqrt(5))))2 + (((sqrt(180)-2 - sqrt(180)) + 5)2)2. -720sqrt(5) + 28360 Simplify sqrt(22)/sqrt(176)-4 - (sqrt(98) + 0)-6. 41sqrt(2) Simplify (-52sqrt(133) - -1sqrt(133)2)/(6(sqrt(112) + sqrt(112) + sqrt(112)-1)). -sqrt(19)/3 Simplify -4 + (0 + (sqrt(832) - (2 + sqrt(832))2) - (sqrt(832) + -2sqrt(832)-1)). -840 - 48sqrt(13) Simplify (sqrt(112) + sqrt(112) + (-1(sqrt(112) + 0 + sqrt(112) + sqrt(112)))2)-6 - (-3sqrt(315))/(sqrt(320) + (-1sqrt(320) - sqrt(320))). -6048 - 393sqrt(7)/8 Simplify (((5sqrt(114))/sqrt(3))/(5sqrt(98)))2. 19/49 Simplify ((sqrt(168) + (sqrt(168)3 - sqrt(168)) + sqrt(168))/sqrt(8)-4)/(-1(sqrt(504)/sqrt(8) - sqrt(7))). 8sqrt(3) Simplify -1(13sqrt(117))/(sqrt(900)2). -3sqrt(13)/20 Simplify 4((-1 + sqrt(704) + sqrt(704))2 - ((sqrt(77)/(sqrt(7)-1))2 + sqrt(121)/(sqrt(11)-2))). -52 + 130sqrt(11) Simplify (sqrt(117)-24)/(sqrt(72)/sqrt(32)) + -3. -16sqrt(13) - 3 Simplify ((1-3(-1sqrt(30) + sqrt(30) - sqrt(30)))/(sqrt(72)/sqrt(108)-3) + -5)*2. 30sqrt(5) + 70 Simplify -4 + (3(sqrt(95) - sqrt(95)3))/(sqrt(10)/(sqrt(2)-1)). -4 + 6sqrt(19) Simplify 6(-3(sqrt(272) - (sqrt(272) + 0 - sqrt(272))*2) + 0 + (sqrt(272)1 - sqrt(272))). -72sqrt(17) Simplify (sqrt(44) - -1sqrt(44)6 - -2sqrt(4400))/(-3-1sqrt(4)-1). -9sqrt(11) Simplify ((sqrt(60)2)/sqrt(10))/(sqrt(288) - (sqrt(288) + (-4sqrt(288) - sqrt(288))) - sqrt(2)). 2sqrt(3)/59 Simplify -2 + sqrt(4)/(1sqrt(2)) + 5sqrt(24)/(sqrt(12) + -4sqrt(12)). -2 - 2sqrt(2)/3 Simplify 1((sqrt(119) - (sqrt(119)-6 + sqrt(119)))/sqrt(7))2-3-6 + 0. 11016 Simplify (6sqrt(21)/(sqrt(3) + sqrt(33)/(sqrt(66)/sqrt(6))))*25. 315 Simplify sqrt(143)/(sqrt(1331)2) + (3(sqrt(117) - (sqrt(117)1 - sqrt(117))))/sqrt(9). 67sqrt(13)/22 Simplify (-4(sqrt(1573)-2 + 5 + (-1 + sqrt(1573))-3 + 2))2-3. -1892400 + 52800sqrt(13) Simplify (sqrt(1700) + 1(sqrt(1700) + sqrt(1700)-1) + sqrt(1700) + sqrt(1700) + -1sqrt(1700) + sqrt(1700) + -1)*2 + 0. -60sqrt(17) + 15301 Simplify (-1(sqrt(68) + 4(1 + sqrt(68))))*2 - 6((sqrt(68) + sqrt(68)-2)2 + 0). 80sqrt(17) + 1308 Simplify (0 + (sqrt(5) + -2)-1 - (-5 + (sqrt(5) - -4sqrt(25)/sqrt(5))))*2. -84sqrt(5) + 229 Simplify (sqrt(500)2-3 - (0 + sqrt(500) + -1))*2 + ((sqrt(80) - sqrt(80)2) + sqrt(15)/(sqrt(3)-2))2-5. -140sqrt(5) + 95979/4 Simplify (((3sqrt(1375) - sqrt(1375)) + sqrt(1375))-1)/(-2(sqrt(5) - ((sqrt(220)/sqrt(4))/sqrt(11) + sqrt(5)))). -15sqrt(11)/2 Simplify (((sqrt(3240) - sqrt(3240)2) + sqrt(3240))-4)/((sqrt(40) + (1sqrt(40) + sqrt(40))-6 + sqrt(40) + sqrt(40))/sqrt(5)). 0 Simplify (3(-2 + (sqrt(1900) - (sqrt(1900) + (1 + sqrt(1900)	{ "pile_set_name": "DM Mathematics" }
. -1, 0, 1 Suppose 0 = 218t - 238t + 40. Suppose 4/9m + 2/9 + 2/9mt = 0. Calculate m. -1 Let f(q) be the third derivative of -q8/3360 + q*7/84 - 23q*6/400 + 67q*5/600 - 11q*4/120 - 5q*2 + 13. Suppose f(h) = 0. Calculate h. 0, 1, 22 Suppose l - 692 = -3s + 2l, 2s = -2l + 464. Suppose 5y + 86 - s = 0. Determine g so that 14g2 - yg*2 - 6g*3 - 2g*4 + 11g2 = 0. -2, -1, 0 Let s(m) = -m3 - 2m2 - m + 3. Let d be s(-2). Factor -5 - 2t*4 + 5t*2 - dt*3 + 5 + 5t - 3t4. -5t(t - 1)(t + 1)2 Let v(z) be the first derivative of z4/8 + 11z3/6 - 25z*2/4 + 13z/2 - 259. Determine l so that v(l) = 0. -13, 1 Let l be (7 - 5) + 2 + -2. Suppose -4o + 3o = -l. Let 0n3 - n2 - 2n*3 + 7n*o - 4n = 0. What is n? 0, 1, 2 Let w(c) = c*2 + 6c + 8. Let p be w(-5). Factor -s + s*3 - 2 - 3s*4 + 0s + s4 + s4 + ps2. -(s - 2)(s - 1)(s + 1)2 Solve 18/5x - 2/5x2 + 0 = 0 for x. 0, 9 Let p(u) be the first derivative of 3u*4 - 10 - 52/3u*3 + 26u*2 - 12u. Find k such that p(k) = 0. 1/3, 1, 3 Suppose -4o + 2o + 3m = -19, -5m - 25 = 0. Suppose b = -3x + 11, 13 = -0b + ob + 3x. Let 4/7 + 10/7v2 - bv = 0. What is v? 2/5, 1 Suppose -k = -3h + 1, 2k + 5h + 1 = k. Let b be (1/(-12))/k + (-3)/(-12). Factor 1/3c*4 + 0 + 0c - bc2 + 0c3. c2(c - 1)(c + 1)/3 Factor 0 + 88/3g + 40/3g*2 - 2/3g*3. -2g(g - 22)(g + 2)/3 Let i(k) be the third derivative of k*6/120 - 7k4/24 + k3 + 14k2. Factor i(g). (g - 2)(g - 1)(g + 3) Let o(s) be the first derivative of -s4/16 + 3s*3/2 - 33s*2/8 + 4s + 357. Let o(n) = 0. What is n? 1, 16 Factor -8/5y3 + 0 + 2/15y*4 + 196/15y + 14/5y2. 2y(y - 7)2(y + 2)/15 Let d(a) be the second derivative of a6/120 - a5/15 + a*4/8 + 13a*2/2 + 21a. Let v(h) be the first derivative of d(h). Find y such that v(y) = 0. 0, 1, 3 Suppose -4l + 56 = 4s + 16, -3s - 34 = -5l. Suppose j + l = 5j. Factor -3o2 + o2 + 2o4 + 2o*3 - 3o*3 + 3o*3 - jo. 2o(o - 1)(o + 1)2 Suppose -5063 + 1157 = -7h. Let f be (-2)/12 - h/(-108). Factor 0r2 - 1/7r*f + 2/7r*3 + 0r + 0 + 1/7r4. -r3(r - 2)(r + 1)/7 Let x(k) be the second derivative of k6/30 + 2k*5/5 + 17k*4/12 + 5k*3/3 + 65k. Determine d so that x(d) = 0. -5, -2, -1, 0 Suppose -28c + 25c = -4y + 11, -4c + 5y - 13 = 0. Let 0 + 16/7x*2 + 6/7x*c - 6/7x = 0. Calculate x. -3, 0, 1/3 Let p(k) be the second derivative of -k*4/6 - 530k*3/3 - 70225k*2 + 963k. Factor p(h). -2(h + 265)2 Let s = 12224 - 281146/23. Factor -8/23m + sm3 - 2/23m*4 + 0m*2 + 0. -2m(m - 2)2(m + 1)/23 Let f be 1 - 11/(1452/108). Determine k so that fk4 - 2/11k*5 - 4/11k*2 + 4/11k*3 + 2/11 - 2/11k = 0. -1, 1 Let o = -72 + 78. Solve -3v3 - 33v*2 - 24v + ov + 12v*2 = 0. -6, -1, 0 Let j = -27 + 29. Let p be -2 + 1 + 0 + (-14)/(-10). Find s such that 3/5s + 1/5sj + p = 0. -2, -1 Let x(v) be the third derivative of v7/350 - v5/100 - 79v*2 + 2v. Find g such that x(g) = 0. -1, 0, 1 Let d(t) be the second derivative of -t*4/18 + 2t3/9 - t2/3 + 30t - 2. Factor d(a). -2(a - 1)2/3 Let o(i) be the first derivative of i6/6 + 2i5 - 3i*4/4 - 32i*3/3 - 10i*2 - 138. Find c, given that o(c) = 0. -10, -1, 0, 2 Let p = -4761 - -4761. Let -3/4v*4 - 3v + p - 15/4v3 - 6v*2 = 0. What is v? -2, -1, 0 Let m(k) be the second derivative of 16/5k*2 + 2/5k*4 + 2k*3 - k + 0 - 1/25k*5. Suppose m(r) = 0. Calculate r. -1, 8 Let g be (1/2)/(4/(28/(-5))). Let q = 83/90 + g. Find t, given that q + 2/9t*2 - 4/9t = 0. 1 Factor -a*2 + 12a*3 + 65 + 20a + 105a - 17a*3 + 40a*2 + 16a*2. -5(a - 13)(a + 1)2 Let l(b) be the first derivative of 1/3b*3 + 4 + 1/8b*4 - 1/20b*5 - 1/4b*2 - 3/4b. Suppose l(f) = 0. What is f? -1, 1, 3 What is p in 0p + 2p*3 + 0 + 2/3p*4 + 4/3p2 = 0? -2, -1, 0 Let l(w) be the third derivative of -w9/37800 + w*7/1575 - 7w*4/24 + 3w*2. Let f(v) be the second derivative of l(v). Factor f(a). -2a*2(a - 2)(a + 2)/5 Let w(a) be the first derivative of a5/15 + 5a4/36 + a3/18 + 17a + 16. Let o(r) be the first derivative of w(r). What is t in o(t) = 0? -1, -1/4, 0 Let c(i) be the first derivative of -i6/780 + i5/390 + 8i*2 - 16. Let p(j) be the second derivative of c(j). Let p(h) = 0. Calculate h. 0, 1 Let m(i) be the third derivative of -22i*5/75 + 3i4/4 - i3/15 - 48i2 - 4. What is c in m(c) = 0? 1/44, 1 Let j be (2/(-15)-18 + -2)/(140/100). Find i, given that -4/7i + 2/7 + ji2 = 0. 1 Let p(n) be the third derivative of n9/272160 + n8/10080 + n7/945 + 2n6/405 - n5/2 + 28n*2. Let q(u) be the third derivative of p(u). Factor q(i). 2(i + 1)(i + 4)2/9 Let k(j) be the second derivative of -j7/126 + j5/30 - j3/18 - 6j. Let k(d) = 0. What is d? -1, 0, 1 Let l(y) be the second derivative of 3/20y6 + 27/80y*5 + 1/56y*7 - 27y + 0y2 + 0y*3 + 0 + 0y*4. What is w in l(w) = 0? -3, 0 Factor 72/19 - 104/19j + 2/19j3 + 30/19j*2. 2(j - 2)(j - 1)(j + 18)/19 Let c(t) be the second derivative of t6/75 + t5/2 + 4t4/5 + t - 10. Suppose c(m) = 0. Calculate m. -24, -1, 0 Let t(r) be the third derivative of r7/35 - r6/24 - 53r*5/60 + 15r*4/8 - 3r*3/2 + 101r*2. Let t(n) = 0. What is n? -3, 1/3, 1/2, 3 Let r(x) be the second derivative of -8x - 1/48x4 + 0x*2 - 1/160x*5 + 0 + 0x3. Factor r(v). -v2(v + 2)/8 Factor -52s + 9462s2 - 1 - 9464s*2 + 55. -2(s - 1)(s + 27) Determine r, given that -32r*2 + 311r - 623r + 56 + 332r + 4r3 = 0. -1, 2, 7 Let q(x) be the first derivative of x7/210 - x6/30 - 8x*3/3 - 3. Let k(v) be the third derivative of q(v). Factor k(m). 4m*2(m - 3) Suppose -5j + 0 = 40. Let s = -4 - j. What is c in 4/9c*2 + 2/9 + 2/3c - 4/9c3 - 2/9c*5 - 2/3c*s = 0? -1, 1 Let h be (12/(-6))/(1(-2)/(-24)). Let u be 10/(-8) - h/12. Factor un3 + 81/4 + 27/4n*2 + 81/4n. 3(n + 3)3/4 Let g(c) be the third derivative of 2c*7/105 + 4c*6/15 - 8c*5/15 - 16c*4 + 96c3 - c2 + 23. Suppose g(f) = 0. Calculate f. -6, 2 Let j(y) be the first derivative of y*4/7 - 24y*3/7 + 30y*2/7 + 136y/7 + 11. Determine s so that j(s) = 0. -1, 2, 17 Let r(b) be the third derivative of -9b6/80 + 13b5/40 - b4/4 + 190b2. Solve r(d) = 0. 0, 4/9, 1 Let k(w) be the first derivative of -w6/3600 + 5w3 + 4. Let x(z) be the third derivative of k(z). Factor x(r). -r2/10 Let q(y) be the second derivative of y7/17640 - y6/5040 + 5y4/6 + 11y. Let u(m) be the third derivative of q(m). Factor u(d). d(d - 1)/7 Let v(u) = -4u*2 - 40u - 88. Let x(y) = 2y2 + y. Let m(l) = v(l) + 4x(l). Let m(s) = 0. What is s? -2, 11 Let d = 125 + -123. Suppose 2s = 5s, u = -3s. Solve 2/5f*d + 4/5f*3 + 2/5f*4 + 0 + uf = 0 for f. -1, 0 Let k = -29 + 31. Factor -212yk + 5y - 9 + 211y2 - 11y. -(y + 3)2 Let c(i) be the second derivative of -i5/100 + 21i4/20 - 341i*3/10 + 961i*2/10 + 13i - 14. Factor c(n). -(n - 31)*2(n - 1)/5 Let u(r) be the third derivative of r*5/60 + 11r*4/2 + 726r*3 - 377r*2. Solve u(y) = 0 for y. -66 Let b(v) be the second derivative of -1/3v*3 + 8v - 1/12v4 - 1/2v2 + 0. Factor b(s). -(s + 1)2 Let d(y) = -y3 + y2 + 5. Let h be d(0). Suppose 0 = hn - 0n - 4n. Factor -2/5c*2 - 2/5c + n. -2c(c + 1)/5 Let j = -47 - -49. Suppose -s - 3p = -2p + j, 5p + 20 = 0. Factor -1/3 + 0l*s + 2/3l - 2/3l3 + 1/3l4. (l - 1)3(l + 1)/3 Let g(k) be the third derivative of -k7/1365 + k5/390 + 152k*2. Factor g(v). -2v*2(v - 1)(v + 1)/13 Find p, given that 56p + 2/5p3 + 52/5p*2 - 784/5 = 0. -14, 2 Solve 3b + 51b2 + b - 50b*2 + 2b = 0 for b. -6, 0 Suppose -5g - 21 = 4s, -5s = -s + 16. Let r = -1/3 - g. Factor 1/3m*4 + 1/3 - 1/3m + 2/3m3 - 1/3m*5 - rm2. -(m - 1)3(m + 1)2/3 Let x(w) be the first derivative of -w3/3 + w2/2 + 30w + 101. Determine f so that x(f) = 0. -5, 6 Suppose m + 7w - 4w + 2 = 0, w = 3m - 14. Suppose 4l + m = 6l. Find b, given that 0b + lb + 4b + 2 - 8b2 = 0. -1/4, 1 Let g(f) = -f3 - f2 - 4f. Let b(z)	{ "pile_set_name": "DM Mathematics" }
s of a micrometer in nanometers? 1200 How many centimeters are there in 7/4 of a meter? 175 What is 1/4 of a microgram in nanograms? 250 How many centuries are there in 15.33881 millennia? 153.3881 How many months are there in 4/3 of a millennium? 16000 Convert 3.838534ug to nanograms. 3838.534 Convert 77.52721 millennia to centuries. 775.2721 What is 0.2951064 millilitres in litres? 0.0002951064 What is five eighths of a litre in millilitres? 625 How many micrometers are there in 150.0524m? 150052400 How many nanoseconds are there in 3/8 of a microsecond? 375 What is 7.55727 seconds in microseconds? 7557270 How many millilitres are there in thirty-seven fifths of a litre? 7400 How many micrometers are there in five quarters of a millimeter? 1250 What is 45/8 of a day in hours? 135 Convert 2.076021 months to years. 0.17300175 What is 616.2601 kilometers in millimeters? 616260100 Convert 453.2227 centuries to decades. 4532.227 What is eleven eighths of a gram in milligrams? 1375 How many litres are there in 9.576034ml? 0.009576034 What is 3.497775 nanograms in grams? 0.000000003497775 Convert 8.75645 nanometers to meters. 0.00000000875645 How many millilitres are there in 3/5 of a litre? 600 Convert 961.0168l to millilitres. 961016.8 What is seventeen quarters of a litre in millilitres? 4250 How many millilitres are there in twenty-one quarters of a litre? 5250 Convert 3485.997 millennia to centuries. 34859.97 Convert 0.412283 weeks to days. 2.885981 How many micrometers are there in 25464.3cm? 254643000 What is twenty-six fifths of a litre in millilitres? 5200 What is thirty-four fifths of a millennium in months? 81600 Convert 615754.6ug to kilograms. 0.0006157546 Convert 999.0049 nanometers to micrometers. 0.9990049 What is 6.898482 centuries in decades? 68.98482 How many tonnes are there in 262.6464ng? 0.0000000000002626464 Convert 728678.7 millimeters to kilometers. 0.7286787 What is 5.70674 nanoseconds in milliseconds? 0.00000570674 How many hours are there in 8486863.2 milliseconds? 2.357462 Convert 54.64599um to meters. 0.00005464599 How many meters are there in 33647.9cm? 336.479 How many kilograms are there in 2.852734 tonnes? 2852.734 Convert 0.7728297 hours to minutes. 46.369782 Convert 7639.834 tonnes to micrograms. 7639834000000000 How many kilograms are there in fourty-nine fifths of a tonne? 9800 How many milligrams are there in 2921.179g? 2921179 How many micrometers are there in 1/4 of a centimeter? 2500 What is 5598097.2 seconds in hours? 1555.027 What is 407141.4mm in kilometers? 0.4071414 What is 52.49029 centimeters in meters? 0.5249029 How many days are there in 95.27943 weeks? 666.95601 How many litres are there in 3217.678ml? 3.217678 Convert 0.6976007kg to milligrams. 697600.7 How many millilitres are there in eleven quarters of a litre? 2750 What is twenty-one halves of a litre in millilitres? 10500 How many nanograms are there in 7/2 of a microgram? 3500 How many kilometers are there in 2937.675 micrometers? 0.000002937675 What is three eighths of a millisecond in microseconds? 375 How many micrometers are there in twenty-one eighths of a centimeter? 26250 How many millilitres are there in 4831.872l? 4831872 How many kilograms are there in 5/8 of a tonne? 625 What is 0.3954782 centuries in decades? 3.954782 How many decades are there in eleven halves of a century? 55 Convert 16366.97 millilitres to litres. 16.36697 How many hours are there in 66570.894 milliseconds? 0.018491915 How many milligrams are there in 11/8 of a gram? 1375 How many micrometers are there in 442611.6 nanometers? 442.6116 What is 0.3833249ug in nanograms? 383.3249 How many centimeters are there in 8169.206 micrometers? 0.8169206 How many centimeters are there in three tenths of a kilometer? 30000 What is two ninths of a hour in seconds? 800 What is 745602.354ms in weeks? 0.001232808125 How many minutes are there in eleven halves of a week? 55440 What is 18866261.61 seconds in weeks? 31.194215625 How many milliseconds are there in 7127.107 hours? 25657585200 How many nanograms are there in one tenth of a milligram? 100000 What is six fifths of a gram in milligrams? 1200 How many millilitres are there in 27/2 of a litre? 13500 Convert 5.947441nm to millimeters. 0.000005947441 How many minutes are there in 273244.35 seconds? 4554.0725 How many meters are there in 1/4 of a kilometer? 250 What is seventeen halves of a millennium in decades? 850 What is 64556.268 days in weeks? 9222.324 How many years are there in 6/5 of a decade? 12 Convert 0.7432977t to nanograms. 743297700000000 What is 1/20 of a century in months? 60 How many years are there in fifty-seven fifths of a decade? 114 What is 21666.26 days in weeks? 3095.18 How many millimeters are there in one quarter of a meter? 250 What is two ninths of a week in minutes? 2240 What is 1994.657 grams in micrograms? 1994657000 How many milliseconds are there in 32/5 of a second? 6400 What is 2268.49 nanograms in kilograms? 0.00000000226849 Convert 2.5246197 months to centuries. 0.00210384975 What is 1351.72395 nanoseconds in days? 0.000000000015644953125 What is sixty-one halves of a century in months? 36600 What is 0.7512395l in millilitres? 751.2395 How many nanograms are there in 21.30457mg? 21304570 What is eighteen fifths of a millennium in years? 3600 What is 57/2 of a litre in millilitres? 28500 What is fourty-nine quarters of a microgram in nanograms? 12250 Convert 7898.683 millennia to years. 7898683 Convert 616.0176 nanometers to kilometers. 0.0000000006160176 How many millilitres are there in 8655.875l? 8655875 What is 3/40 of a century in months? 90 What is twenty-five eighths of a millimeter in micrometers? 3125 Convert 277.073ng to tonnes. 0.000000000000277073 What is 11/2 of a litre in millilitres? 5500 What is 0.4563232 centuries in decades? 4.563232 How many millilitres are there in seventeen quarters of a litre? 4250 Convert 82.1139ug to kilograms. 0.0000000821139 What is seven eighths of a gram in milligrams? 875 How many decades are there in 79538.57 centuries? 795385.7 Convert 1869519.69 nanoseconds to days. 0.000000021637959375 Convert 953156.6 minutes to microseconds. 57189396000000 How many millilitres are there in 13/5 of a litre? 2600 What is 45.39512ml in litres? 0.04539512 How many micrometers are there in three fifths of a centimeter? 6000 What is four sevenths of a week in minutes? 5760 What is 55843.911ms in days? 0.0006463415625 Convert 588.7964ml to litres. 0.5887964 How many kilograms are there in 18/5 of a tonne? 3600 What is 26060.26cm in millimeters? 260602.6 How many millimeters are there in twenty-one fifths of a centimeter? 42 What is 1.7957571 months in years? 0.149646425 How many nanometers are there in one tenth of a micrometer? 100 How many days are there in 11224696.5ms? 0.12991546875 Convert 656.956 hours to milliseconds. 2365041600 How many millimeters are there in 32/5 of a meter? 6400 What is 4.7392 hours in seconds? 17061.12 What is eleven halves of a litre in millilitres? 5500 Convert 79363.04 nanoseconds to microseconds. 79.36304 How many micrograms are there in one tenth of a milligram? 100 How many nanoseconds are there in 7.986983 microseconds? 7986.983 What is 6/25 of a millimeter in micrometers? 240 Convert 17886.35 weeks to nanoseconds. 10817664480000000000 What is 5623.716cm in micrometers? 56237160 How many meters are there in three tenths of a kilometer? 300 What is twenty-nine fifths of a gram in milligrams? 5800 How many minutes are there in 1327.4418 microseconds? 0.00002212403 Convert 775490.6ml to litres. 775.4906 What is 0.0038512 millennia in months? 46.2144 How many months are there in 0.8077557 decades? 96.930684 What is 2505.62s in microseconds? 2505620000 How many micrograms are there in 77928.54t? 77928540000000000 How many millilitres are there in twenty-five quarters of a litre? 6250 What is 21/2 of a litre in millilitres? 10500 Convert 108.3591 months to millennia. 0.009029925 How many hours are there in nineteen quarters of a day? 114 Convert 0.2062664t to grams. 206266.4 What is thirty-four fifths of a kilogram in grams? 6800 What is 7/3 of a year in months? 28 How many milliseconds are there in 48.86834 seconds? 48868.3	{ "pile_set_name": "DM Mathematics" }
(0u + 0u - u)(-5 + 5 - 1) + 4u + 0u - 2u)(-u - u + 3u). 8u2 Expand (3v - 2v + 0v)(0v + 3v - v) + 0v*2 - 4v*2 + 3v2 + v2 + v2 - v2 + (-v + v - v*2)(7 + 3 - 4). -4v2 Expand (-5 + 5 - 3d)(-1 + 0 + 3). -6d Expand 2a2 + 2a*2 - 5a*2 + 2a2 + a2 - a2 + a2 - 2a2 + 0a*2 + (-1 - a + 1)(a - 2a + 3a) + 2a - a2 - 2a + a + a*2 - 6a*2 + 3a*2. -5a2 + a Expand b3 - 2b3 + 3b*3 + 4b3 - b3 - 5b3 - 4 - b3 + 4 + (-5 - 2b + 5)(-4b2 - b2 + 3b2) + 2b*2 - 2b*3 - 2b2. b3 Expand (11p + 11p - 20p)(-3 + 1 + 3). 2p Expand (-2 + 2 + q2 + (4q*2 + 3q*2 - 6q*2)(-2 - 1 + 1))(q - 4q + 5q)(4 + 0 - 6). 4q3 Expand (-3k + 4k - 4k)(-1 - 1 - 8). 30k Expand -w + w + 2w3 + (1 - 17 - 2)((-3 + 3 - 2w)(-3w2 - 4w*2 + 5w*2) + 1 - 2w*3 - 1). -34w*3 Expand (1 + 1 - 6)(-q*3 + 2q*3 + 2q3) - q3 + 0q3 - q3 - 2q + 2q - 2q*3 + (q + 3q - 5q)(2q2 + 0 + 0) - q3 + 2q3 + q3. -16q3 Expand (0m - 2m2 + 0m)(m3 + 2m*3 - 8m*3 - 3m*3 + 0m*3 + 2m*3 - 3m + m*3 + 3m + (-m*3 - 3m*3 + 3m*3)(-3 - 2 + 3)) + 4 + 2m5 - 4. 8m*5 Expand g - 5g + 3g + (3g - g + 0g)(-2 + 1 + 0) + 3g + 2 - 2 - 4g - 3g + 4g + 5 - g - 5. -4g Expand -2o2 - o5 + 2o2 + (-2o*5 + 0o*2 + 0o*2)(4 - 3 - 3) - 4o5 + o5 + o5 - 3o*5 + 99o*2 - 99o*2. -2o*5 Expand (-2k - 1 + 1)(64k*2 - 162 + 162). -128k*3 Expand 2 - 19v*2 - 2 + (-2v - 4v + 4v)(-2v + 0v + 4v). -23v2 Expand (-2n*2 - 2n2 + n2)(-15n*3 - 9n*3 + 11n3) + n5 + 0n4 + 0n*4. 40n*5 Expand (3w - 4w - 2w)(8 + 2 - 1). -27w Expand (3q + q3 - 3q)(204q - 90q + 163q + 92q). 369q*4 Expand (-l - l + 0l)(3l - 3l - l3)(-3l + l + 6l) - 2 - l*5 + 2. 7l*5 Expand (3 + 3 - 4)(3b2 - 2b*2 + 0b*2) - 2b*2 + 3 - 3 + (-2b + 4b - 4b)(3b + 0b - 2b) - 2b2 + 2b*2 - 2b*2. -4b*2 Expand (1 + 2 - 1)(-16y2 + 38y - 38y). -32y*2 Expand 3b*5 + 0b5 - b5 + (-2b2 + 1 - 1)(2b3 - 3b*3 + 3b*3) + (39b*5 - 21b*5 + 36b*5)(-2 + 5 - 2). 52b5 Expand 0n - 7 + 5 + 4n + (1 + 4 - 3)(4n - n - 2n). 6n - 2 Expand (-4 + 2j*2 + 4)(-1 - 8j3 - 11 + 6j*3). -4j*5 - 24j*2 Expand (3y*3 + 3y*3 - 4y*3)(2 - 11 - 7) + 3y3 - 2y*3 + 0y*3. -31y*3 Expand -3b*4 - 12b*4 - 4b*4 + (3b3 + b3 - 6b3 + (-3b*3 + 2b*3 + 0b*3)(-2 + 1 + 0))(-1 + 1 + b). -20b4 Expand v5 + 0v2 + 0v*2 + 6v*2 + 5v*5 - 6v2 + (v5 - 4v5 + v5)(-1 + 0 + 0) + 2v4 + v5 - 2v*4. 9v*5 Expand (3 - 3 - 6i)(0 + 0 + 2i). -12i2 Expand (4a - 4a + 2a)(-6 - 6a + 6 + 2). -12a2 + 4a Expand -g2 + g2 - 2g4 + (g3 - 1 + 1)(-2 - 4 + 4)(1 + 2g - 1). -6g4 Expand (4 - 4 + d2)(-7d + 11d - 8d). -4d*3 Expand (2h*2 - 3h*2 + 3h*2)(-4h2 + 6h*2 + 13h*2). 30h*4 Expand -2o*2 - 1 + 1 + (0o + 3o - 5o)(-o - o + 3o) - 3o2 - 1 + 1. -7o*2 Expand (-108m + 21m2 + 108m)(5 - 1 - 6) - 2m - m*2 + 2m. -43m2 Expand -5 + 5 - 3s*2 + (-3s + 3s - 2s)(-4s - 4s + 4s). 5s2 Expand (9 + 9q*2 - 9)(-2q2 - 2q + 3q2 - 3q*2). -18q*4 - 18q*3 Expand (-2f*3 + 0f*3 + 3f*3)(f + 2 - 2)(-f + 1 - 1). -f5 Expand (11o - 11o - 11o*2)(-5 - 4o3 + 5). 44o5 Expand c3 - 2c3 + 0c*3 + 6c3 - c3 - 3c3 + (5c - 2c - 4c)(-2c*2 - 4c + 4c) + (2c*2 - 2c2 + c2)(0c + 0c + c) + 3c*3 + 1 - 1. 7c3 Expand (u2 - 2u + 2u)(19u - 46u + 8u). -19u3 Expand (q + 0q + q)(0 + 0 - 3)(-3 + 3 + 1 + (-1 + 1 - 2)(-3 + 5 - 1) - 2 + 7 - 2). -12q Expand (y*2 + 0y*2 - 2y*2)(-2y + 5y - y) + 0y3 - 2y3 - y3 + (-y + 2 - 2)(2y*2 - 4y*2 + 4y*2) - 3y*3 + 2y*2 - 2y*2. -10y*3 Expand (4j*3 - 4j*3 + 2j*3)(1 + 0 + 6) + (0 - 3 + 5)(4 + j3 - 4). 16j*3 Expand (22 - 18 + 18 + (5 - 3 - 3)(0 + 2 + 0))(-n - 2n + n). -40n Expand (0 - 2 - 2)(-5 + 5 - 7 + b). -4b + 28 Expand (2 + 2 - 3)(0 - 2 + 4)(-5c + 3c - c) + (0 - c + 0)(2 + 1 - 2) + 2c + c + 0c. -4c Expand 4p*3 - 3p*3 + 0p*3 + (2 + 2 - 2)(p3 + p3 + 0p3) + 2 - 2 + p3 - 2p3 - p3 + 2p3 - 5p*3 + 0p3 + p3. p*3 Expand (-7w*2 + 51w*2 + 12w*2)(-2w2 - 3w*2 + 6w2) + (w3 - w*3 + 2w*3)(2w + w - 5w). 52w4 Expand (-p - 3 + 3)(-4p - 2p + p). 5p2 Expand (-2 - 3g + 2)(g3 - g3 + 3g*3) - 11g*4 + 3g*4 - 2g*4. -19g*4 Expand (-23 - 4f + 23)(4f - 5f - f3 - 7f*4 + 0f). 28f5 + 4f*4 + 4f*2 Expand (3z + z - 5z)(2 - 2 + z) - 5z2 + 14 - 14. -6z*2 Expand 2r*3 + 0r*3 + 5r*3 + (2 - 4 + 0)(-3r + 3r - 2r3) - 2r*3 + 1 - 1 - 5r2 + r3 + 5r2. 10r*3 Expand (-1 + 3s*2 + 1)(-2s + 2 - 2)(2s - 16s - 3s). 102s*4 Expand (1 + 3 - 1 + (0 - 2 + 0)(-6 + 3 + 2) + 2 - 3 - 2 + (0 - 3 + 1)(-1 + 0 + 3))(4 - 4 + 2v2). -4v*2 Expand (3k + k*3 - 3k)(-4k*2 + 2k2 + k2) + 8k - 2k*5 - 8k. -3k5 Expand (-p2 - 7p*2 + 4p*2)((p - 3p + 0p)(5 - 5 - 2) - p + 4p + 0p). -28p3 Expand (-l3 - 2l3 - 7l*3)(3l - 2l - 8l). 70l*4 Expand 25t*5 - 117t*2 + 117t*2 + (-3t*3 + 2t*3 + 0t*3)(t*2 + 3t*2 - 5t*2). 26t*5 Expand 4h*3 + 20h*3 - 4h3 + (h3 + h*3 - 7h*3)(-2 + 0 + 4). 10h3 Expand m - 6m*3 + m - m + (-2m*3 - 4m*3 + 5m*3)(-1 - 6 + 4). -3m3 + m Expand (3w*4 - 3w4 + w4)(1 - 1 + 3) + 2w4 - w4 - 3w4 + (-3w*3 + 2w*3 + 2w*3)(w + w - w). 2w4 Expand (-11 + 15 - 2m + 0m)(-3m2 + 0m*2 + 0m*2 + 4 - 4 - 2m*2 + (3m - 7m + 2m)(-6m + 0m + 4m)). 2m3 - 4m*2 Expand 1 - 1 - 5f + (1 - 3 + 4)(4 - 4 + 2f) + f - 3f + 0f + 2f + 2f - 3f + 3 - 3 - 2f. -4f Expand (-6c + 0 - 3 + 2)(-1 + 1 - 1)(-3c + 4c - 3c). -12c*2 - 2c Expand (-2 - 1 - 1)(0 + 0 + 3g*3). -12g*3 Expand (1 - 3i*2 - 1)(i2 + i2 - 1 + 4i3 - i3). -9i*5 - 6i*4 + 3i*2 Expand -4t*5 + 3t*5 + 2t*5 + (0t + 2t - t)(4t4 + t4 - 4t*4) + 10t*3 - 10t*3 - 12t*5. -10t*5 Expand (-3b - 1 + 1)(-b2 - b2 + 3b2) + b3 + 19 - 19. -2b3 Expand (-7g - 4g3 + 7g)(-3g + 2g - 4g). 20g4 Expand (-39n + 47n + 47n)(-2n - n*3 + 2n + n). -55n4 + 55n2 Expand t3 + 4t3 - 4t*3 - 8t*2 + 7t*2 - 115t*3 + 0t*2 + 2t*3 - 4 + 4 + (-6 + 3 + 2)(2t3 - 3t*3 + 2t*3). -113t3 - t2 Expand ((7y - 4y - 2y)(-y - 1 + 1) + 4y2 + y2 - 3y*2 - 4y + 2y2 + 4y)(-31y*2 - 23y*2 + 13y*2). -123y4 Expand (-m2 + 0m2 - 2 + 4)(3 - 5 - 3)(-2m + 0m + 0m). -10m3 + 20m Expand (-3 + 6 + 2)(-22x - 4 + 24x - 5) + 3x + 4x - 5x. 12x - 45 Expand (1 + 2 - 2)(q + 4 - 4) + (-q + 0q + 0q)(5 - 1 - 1). -2q Expand (17w2 - 3 - 19w*2 - 2)(-2 + 4 - 1). -2w2 - 5 Expand (t - 3t + 4t)(-2 - 4 + 8)(1 - 3 - 2)(-3 + 1 + 0). 32t Expand (-54k + 64 - 64)(1 + 2 - 1). -108k Expand (2 + 0 + 0)(9a*2 + 2a*2 - 3a2) - a2 + 2a2 - 2a*2 + (5a - 3a + 0a)(4 + a - 4). 17a*2 Expand (1 - 1 + 1)(2w2 - 2w2 - w3) - 6w3 - 2w3 - w3 + (-2w2 + w2 - w2)(-w + w + 2w) - 3w*2 + 2w*3 + 3w*2. -12w*3 Expand (3v - 3v - 2v)(2v2 - 1 + 1 - 2 + v2 + 2 + (1 - 5 + 3)(2 - 6v*2 - 2)). -18v*3 Expand (2d*3 + 0d*3 + 0d*3 + (3 - 3 + d)(d2 + d2 - 3d2) - 8d*3 - 213d*2 + 213d*2 + (d - 3d + d)(d + 2d*2 - d))(-1 + 1 - 2). 18d3 Expand (-8c + 2c - 2c)(6c + 7c - 2c)(-1 - 4 + 3). 176c*2 Expand (-7d*3 - 5d*3 + 3d*3)(6 - 2 - 2) + 2d2 - 3d*3 - 2d*2. -21d*3 Expand 0w*5 + 4w*5 - 3w*5 + (-4w + 3w + 2w)(-2w4 - w4 + w*4) - 2w5 - w5 + w*5. -3w*5 Expand ((2 - 5 + 2)(0i + 2i + 3i) - 7i + i + 2i)(-2 + 2 - 3). 27i Expand (-2 + 2 + 1)(-x - 5x2 + x)(-5x + 3x + 0x). 10x*3 Expand (1 - 5 + 2)(8k - 8k + 52k2)(-3k + 2k - k). 208k3 Expand ((0 + 4 - 3)(-5 + 4 + 2) - 1 + 0 + 0 + 5 - 5 - 2 - 2 + 3 + 0)(-h - 9h + h)(-3h + h + 0h). -18h*2 Expand (-4 + 22 + 14)(3s - s - s + (0 - 3 + 1)(3s - 3s + s)). -32s Expand (-4d - d**2 +	{ "pile_set_name": "DM Mathematics" }
f + 20f + 6f - 6471. 34f - 6471 Collect the terms in 2u + 163 + 438 + 53 - 909. 2u - 255 Collect the terms in 0a - 22a + 8a + 9a + 40a. 35a Collect the terms in 43q + 570q + 64q + 281q + 149q. 1107q Collect the terms in 2053 + 206k*2 - 366k*2 + 162k*2. 2k*2 + 2053 Collect the terms in -19 - 2862g + 28 - 9. -2862g Collect the terms in 662r + 2r3 - 215r - 239r - 208r. 2r3 Collect the terms in 23i - 324473 - 325861 + 650334. 23i Collect the terms in -3627982a + 3627982a - 5a*3. -5a*3 Collect the terms in 1010920i*3 - 2021835i*3 + 1010941i*3. 26i*3 Collect the terms in -11h*3 - 2494 - 2496 - 50h + 4988 + 250h. -11h*3 + 200h - 2 Collect the terms in -2723k3 - 3533k*2 - 2722k*3 - 2733k*3 + 3533k*2 + 8181k*3. 3k*3 Collect the terms in 2j*3 - 68882j*2 + 8j*3 + 68882j*2. 10j*3 Collect the terms in -9 + 9 - 100l - 150l - 3l - 350l. -603l Collect the terms in -47p2 - 356677p + 356677p. -47p*2 Collect the terms in 13292j - 320j + 22948j. 35920j Collect the terms in 31k + 55k - 1 - 104k + 1 + 7k. -11k Collect the terms in -92x + 1288138806 - 1288138806. -92x Collect the terms in -12879i + 9 + 6388i + 6355i. -136i + 9 Collect the terms in 816c2 + 1662872 - 1662872. 816c*2 Collect the terms in 4888i*3 + 67610i - 135220i + 67610i + 9250i3. 14138i*3 Collect the terms in -23264 - 5d*3 + 3d + 22923 - 5d3. -10d*3 + 3d - 341 Collect the terms in 1 - 1 - 1192956l3 + 1193071l*3 - 2l. 115l3 - 2l Collect the terms in 269f + 964f*3 - 958f*3 - 340f. 6f3 - 71f Collect the terms in k - 62317859 - 275k3 + 62317859. -275k*3 + k Collect the terms in -28699y*2 + 55319y*2 - 27955y*2. -1335y*2 Collect the terms in 15541p*3 - 2 - 3661p*3 + 2. 11880p*3 Collect the terms in r - 28212 - 6018 + 19r + 176893. 20r + 142663 Collect the terms in 16w*3 - 9w*3 + 223719w - 223719w. 7w*3 Collect the terms in -2m*2 - 175793575m + 175793575m. -2m*2 Collect the terms in 20p*2 + 3p + 7p2 - 4p + p - 25p2. 2p*2 Collect the terms in -44h*3 + 45 - 40h*3 + 2h - 5h. -84h*3 - 3h + 45 Collect the terms in -10959a2 + 3a + 5306a2 - 7a + 5652a2 + 4a. -a2 Collect the terms in -i3 - 83907i2 + 83929i2 - i3 + 0i3. -2i*3 + 22i*2 Collect the terms in 4q*3 - 10q*3 - 33q*3 - 5717 + 5717. -39q*3 Collect the terms in 78 + 29h*2 - 227h + 113h + 95h. 29h2 - 19h + 78 Collect the terms in 6141u + 6366u + 6679u. 19186u Collect the terms in 123q3 - 612q*3 + 2 + 65q*3 + 123q*3 + 142q*3 + 118q*3. -41q*3 + 2 Collect the terms in -m - 571 - 572 - 424 - 581 + 2148. -m Collect the terms in -78 - 4w + 1 + 3 - 52 - 86. -4w - 212 Collect the terms in 652v + 5 - 91v2 + 1 - 2. -91v*2 + 652v + 4 Collect the terms in 21294 - 43969 + 22676 + 2w2. 2w*2 + 1 Collect the terms in -1457x + 493x - 1097x. -2061x Collect the terms in 1733v*2 + 1732v*2 - 3466v2 - 70117. -v2 - 70117 Collect the terms in 3414f3 - 14823f*3 + 959f*3 - 26517f*3. -36967f*3 Collect the terms in -30z*2 + 29131 - 1325z*2 - 275z*2 - 29131. -1630z*2 Collect the terms in 15037 + 627176j - 15037 - 627181j. -5j Collect the terms in -125252 + 250491 - 125239 - a*2 - 6a*2. -7a*2 Collect the terms in 1036k - 2k2 - 970k + k*3 - 66k. k*3 - 2k*2 Collect the terms in 134o*2 - 13o*2 - 13o*2 - 44o*2 - 25o*2 - 25o*2. 14o*2 Collect the terms in 3874z + 23828z - 27699z. 3z Collect the terms in -34 - 10h + 117 - 36 + 32h - 46. 22h + 1 Collect the terms in 191n2 - 27n*2 - 4n*2 + 893. 160n*2 + 893 Collect the terms in -20g - 22g + 97g - 18g - 38g - 20g. -21g Collect the terms in 3621h3 + 3622h*3 + 2456h*2 - 7244h*3 - 2456h2. -h3 Collect the terms in 8854 + 1126045y - 8854. 1126045y Collect the terms in 48r - 21r - 264r3 - 10r - 20r. -264r*3 - 3r Collect the terms in -112 + 0z3 - 147z*2 - 110 + 3z*3 - 115 + 337. 3z*3 - 147z*2 Collect the terms in 7c*2 - 38c*2 + 5c*2 + 6c*2 + 4c*2 + 6c*2 + 8c*2. -2c*2 Collect the terms in -36344 + 12114 + 12122 + 14c*2 + 12108. 14c*2 Collect the terms in -221502u + 69338u - 139634u. -291798u Collect the terms in -43 - 4f*3 - 2f*3 + 3f*3 + 31564f - 31564f + 25. -3f*3 - 18 Collect the terms in 1565m + 664m2 + 7 - 1566m + 367m2. 1031m*2 - m + 7 Collect the terms in -1408259h*3 - 1408238h*3 + 2816500h*3. 3h*3 Collect the terms in 8791q + 32170q - 50 + 48. 40961q - 2 Collect the terms in -2r + 4539481591r*2 - 4539481766r*2 + 2r. -175r2 Collect the terms in 119z*2 - 126z + 151z - 25z - 47z2 - 71z2. z2 Collect the terms in -3568b + 3180b - 7087b. -7475b Collect the terms in 1076t2 - 268t*2 - 262t*2 - 274t*2 - 267t*2. 5t*2 Collect the terms in 905 + 3009 + 9626 - 4z*2 - 2671. -4z*2 + 10869 Collect the terms in -886s*2 + 9s + 2557s2 - 4s + 2051s2. 3722s*2 + 5s Collect the terms in 2610r2 - 3r - 12r + 10r - 2631r2 + 5r. -21r2 Collect the terms in -4774s + 3253s + 1520s. -s Collect the terms in 6520 + 20808d - 6527 - 3674d. 17134d - 7 Collect the terms in 0m + 97059 - 2m - 97955. -2m - 896 Collect the terms in -40q - 6 + 6 + 1 - 31q*2 + 40q - 598q3. -598q*3 - 31q*2 + 1 Collect the terms in 911o + 440o + 13 - 1297o. 54o + 13 Collect the terms in -123j*2 + 55 - 26 + 2j - 27 - 252j2. -375j*2 + 2j + 2 Collect the terms in 40 - 5v - 395 + 285. -5v - 70 Collect the terms in -27 + 795 + 64p - 9p - 53p. 2p + 768 Collect the terms in -433p - 377p + 2 - 2 - 441p + 1365p. 114p Collect the terms in -23d*3 + 73739167d - 73739156d + 5d*3. -18d*3 + 11d Collect the terms in -2595r3 + 17213r*3 + 1027r*3. 15645r*3 Collect the terms in 315 - 50 - 46 - 47 - 49 - 123 - 12q*3. -12q*3 Collect the terms in -131 + 255 + 324 + 220g. 220g + 448 Collect the terms in 312 - 521 + 3a*2 + 1347a - 1349a - 4a2 - 824. -a2 - 2a - 1033 Collect the terms in 1411z - 97 - 89 + 186 - 60z - 1346z. 5z Collect the terms in -119c*2 + 45c*2 - 298c*3 - 313c*3 + 604c*3. -7c*3 - 74c*2 Collect the terms in 105 + 13386o + 126 - 231. 13386o Collect the terms in -1885q*2 + 1003q*2 + 883q2. q2 Collect the terms in 466453 + 466451 + 466450 - 1399354 + 3a2. 3a*2 Collect the terms in -79z*2 - 138z*3 + 334z*2 - 166z*2. -138z*3 + 89z*2 Collect the terms in 8z + 32z + 21 + 19z - 22z + 25z. 62z + 21 Collect the terms in -131d*2 + 168d*2 - 213d*2 - 110d*2 - 153d*2. -439d*2 Collect the terms in 36313403x*3 - 36313440x*3 + 40x*2 - 38x*2. -37x*3 + 2x*2 Collect the terms in 59589841 - 29794917 - 3r - 29794924. -3r Collect the terms in 73974k*2 - 37990k*2 - 35978k*2. 6k*2 Collect the terms in 1351l*2 + 1359l*2 - 5422l*2 + 1346l*2 + 1367l2 - 66. l2 - 66 Collect the terms in 80x - 331x + 64x + 182x. -5x Collect the terms in -144 - 64x + 240 - 96. -64x Collect the terms in -4887 - 4855 + 0x*2 + 2x*2 - 4850 + 14672. 2x*2 + 80 Collect the terms in 9m - 9 - 3492m2 + 9 - 34m + 12m. -3492m*2 - 13m Collect the terms in 76 - 7a - 76 - 67407a*2 + 7a + 33710a2 + 33703a*2. 6a*2 Collect the terms in -r + 25 - 31 + 21 + 12 - 41 + 14. -r Collect the terms in -1057833 + 1057833 - 6450k. -6450k Collect the terms in 11936r - 12018 + 12018. 11936r Collect the terms in -1623n*3 - 1622n*3 - 1609n*3 - 1623n*3 + 6483n*3. 6n*3 Collect the terms in 2u + 4788450759 + 0u - 4788450739. 2u + 20 Collect the terms in 94k - 198 + 623 - 10924. 94k - 10499 Collect the terms in -4842138a - 1815992a - 26141180a + 2446272a. -30353038a Collect the terms in -17f*2 + 10858f - 5588f - 5273f. -17f2 - 3f Collect the terms in 40 + 27 + 35 - 18 + 15z - 83. 15z + 1 Collect the terms in 502m - 152m - 148m + 9m*2 - 202m + 18m2. 27m*2 Collect the terms in -389p*2 + 685p*2 + 705p*2. 1001p*2 Collect the terms in -8970 - 89s*2 + 26899 - 8960 + 95s*2 - 8969. 6s**2 Collect the terms in	{ "pile_set_name": "DM Mathematics" }
-3r - 7, -3g = r - 16. What is the biggest value in -2, q, r? q Suppose 0 = -2h - 31 + 41. Which is the fourth biggest value? (a) h (b) 0.4 (c) -1/4 (d) 1/2 c Let h = 0.2 - 0.3. Let i = h - -0.5. Let s = 4/51 + -11/68. Which is the third biggest value? (a) -0.5 (b) s (c) i a Let v = 0.12 + -5.12. Let i = 69/4 + -347/20. Which is the second smallest value? (a) -2/11 (b) i (c) v a Let g = 0.06 - -0.08. Let m = g + -0.1. Let u = 2.96 + m. Which is the biggest value? (a) 1 (b) u (c) 0.1 b Let m = -0.5 + 0.3. Let i(t) = -t + 5. Let o be i(6). Let w be -1o/(3/(-3)). What is the third smallest value in w, 0.3, m? 0.3 Let o = -0.031 + 0.131. Let i be (2/(-4))/((-7)/8). What is the third biggest value in i, 1, o? o Let k = -10.8 + 10. Let d = -6.4 + 6. Let m = k - d. Which is the third smallest value? (a) m (b) -4 (c) -1/2 a Let q = 7.8 + -13.7. Let t = -6 - q. Which is the second smallest value? (a) -2/7 (b) t (c) -1/4 c Suppose -3g - 4 = -3x + g, -5x = -g - 1. Which is the biggest value? (a) 5 (b) 0.2 (c) x a Let x = 128/595 + 6/85. Let m be (2/6)/((-4)/18). Which is the third biggest value? (a) x (b) m (c) 1 b Let q = -1.9 + -0.1. Which is the biggest value? (a) 1 (b) 2/5 (c) q a Let l = 0.14 + -0.16. Let s = 0.08 - l. Which is the second biggest value? (a) s (b) -2/5 (c) -5 b Let o = -0.03 + -7.77. Let a = 7 + o. Let d = -1 - a. What is the second biggest value in 6/11, d, 2? 6/11 Let u = -7 - -7.07. Let j = u - -1.93. What is the smallest value in j, 1, 1/15? 1/15 Let v = -6.5 - 10.4. Let i = -17 - v. Which is the third biggest value? (a) -1/4 (b) -1 (c) i b Let d = -0.1 + 0. Let u = 0.6 + d. Let y = 1 - u. Which is the second biggest value? (a) y (b) -5 (c) 0 c Let d = 4 + -4.1. Which is the third smallest value? (a) -9 (b) 4 (c) d b Suppose -5w + 2y + 14 = 0, 3w + 2 = -3y - y. Let f be (w/5)/(-7 + 5). Which is the third smallest value? (a) 3 (b) 2 (c) f a Let o = 8 - 13. Let n be (1 + 0)/(10/o). What is the smallest value in 0, n, 4? n Let s be (1/(-2))/(1/(-6)). What is the third smallest value in -3/5, 4, s? 4 Let o = 1.06 + -0.06. Let s = 5 - o. Let d = -2 + s. Which is the second biggest value? (a) d (b) 0.2 (c) -1/3 b Suppose -s - 1 = -3. Suppose 6 + s = -4l. Which is the smallest value? (a) l (b) -0.4 (c) -0.1 a Let u = 1799.17 - 1808. Let m = u - 0.17. Let l = m - -9. Which is the third biggest value? (a) 2/9 (b) l (c) 2 b Let m = 12.6 - 18.5. Let v = 6 + m. Let h = -0.05 + 0.35. What is the biggest value in 0.4, h, v? 0.4 Suppose -8 = -3s + s. Suppose -4b + s + 4 = 0. Let i = 18 + -55/3. What is the second smallest value in b, i, -5? i Let o = -7 + 5. Let t = o + 2.4. Let m = 6 + -6.4. What is the third smallest value in t, m, 1? 1 Let q = 35 - 30. Let c = 9 + -3. What is the second biggest value in c, q, 0.4? q Let t = -495 - -492. Let f = -16.3 + 17. Which is the second smallest value? (a) f (b) t (c) -0.5 c Let k = 235 + -2113/9. Let u be 34/14 - (3 - 1). Which is the biggest value? (a) k (b) 0.1 (c) u c Let m = -36 - -41. Which is the third biggest value? (a) 4 (b) -2 (c) -5 (d) m b Suppose -1 = -m - 4. Which is the third smallest value? (a) 0 (b) m (c) 3/2 c Let g be ((-19)/(-33))/(4/(-12)). Let x = 139/55 + g. Let j = 1 - -1. Which is the third smallest value? (a) j (b) x (c) -4/5 a Suppose 5p - 7 = 3o, -5o + 0o - 18 = -2p. Which is the biggest value? (a) p (b) -2/3 (c) 0.03 c Let x = 3.9 + -4. Let g = 57.2 - 57. Which is the third smallest value? (a) x (b) 4 (c) g b Let u be ((-140)/16)/(-5) + -1. What is the second biggest value in u, 0.3, -2/9? 0.3 Let f be (-2)/(-5) + 8/(-70). Let b = -0.1 - -0.17. Let r = b - 3.07. What is the smallest value in 2/5, f, r? r Let d be 6/5 + 10/25. What is the third smallest value in -2/13, d, -0.2? d Let h be (-2 + 0)(-7)/133. Which is the third smallest value? (a) h (b) 0.2 (c) -4 b Let w(y) = y*3 + 0 - 15y*2 + 10y*2 - 3y + 4y - 1. Let u be w(5). What is the third smallest value in u, 2/11, -3? u Let n be (-40)/36 - 4/(-6). Let r = -0.03 - 3.97. What is the second smallest value in -0.2, r, n? n Let t(s) = -s2 - 5s + 3. Let h be t(-6). Let v = -133 - -129. What is the second biggest value in -4/5, v, h? h Let t(y) = 0y + y2 + 5 + 0y + 6y. Let i be t(-4). What is the smallest value in 0.4, -1/7, i? i Let u = -0.3 - -0.24. Let b = 0.16 + u. What is the third smallest value in -1, b, 1? 1 Let t = -55 + 58. Which is the third biggest value? (a) t (b) 5 (c) 2 c Let x = 7 - 6.8. Let u = -15.21 - -10.3. Let d = -0.09 + u. Which is the third smallest value? (a) -0.2 (b) d (c) x c Let d = -10.3 - -0.1. Let c = d - 2.8. What is the second smallest value in -4, -0.4, c? -4 Let l = 0.1 - 0.4. Let k = -0.7 - l. Let t = -105/2 - -739/14. Which is the third biggest value? (a) t (b) -1/6 (c) k c Let c = -0.1 - -0.16. Let g = c + 0.04. What is the third biggest value in -2/7, g, -3/5? -3/5 Suppose 0 = -4r - r. Suppose r = 4a + 14 - 2. Let u(y) = -y - 4. Let j be u(a). What is the second smallest value in j, 0.3, 2? 0.3 Suppose 4o - b = 17, b + 2 = -4o + 9. Let j be 81/4 + o/(-12). Let c be 5/(-19)(-8)/j. What is the smallest value in -0.3, -4, c? -4 Let m = -0.8 + 0.6. Let o = -20/91 + 1/13. Which is the second biggest value? (a) o (b) -0.1 (c) m a Let g = 118.47 + -118. Let t = -0.046 + 0.116. Let r = g - t. Which is the third biggest value? (a) 5 (b) r (c) -0.1 c Let z = -17/10 - -9/5. Which is the third biggest value? (a) z (b) -1/5 (c) -2 (d) 0.3 b Let d be 0/2 - ((-12)/8 - -2). Let l(n) = 8n - 2. Let z be l(4). Let k be 4/10 + (-17)/z. Which is the third smallest value? (a) d (b) -1/4 (c) k c Let w = 0.1 - 0.2. Let s = -470 + 470. Let a = -0.6 - -0.1. What is the second biggest value in s, w, a? w Let q be 6/27 + 20/(-171). Let n = 0.8 - -4.2. What is the second biggest value in 0.5, n, q? 0.5 Let r = -0.54 - -0.04. Let x = r - -0.4. What is the smallest value in 0.4, x, 0.3? x Let i(l) = 0 + l - 1 + 0. Let h be i(4). Which is the smallest value? (a) h (b) 4 (c) 2/17 c Let t = 9.98 - -0.02. Let z = 6 - t. What is the third biggest value in -0.3, 3, z? z Suppose -5m + 6m = -4. Which is the biggest value? (a) 2/21 (b) 0.2 (c) m (d) -2/19 b Suppose 41 + 4 = -9y. What is the fourth smallest value in -1/4, -0.4, 0, y? 0 Let j = -1.05 + 4.81. Let s = -0.24 - j. What is the biggest value in s, -1.4, -5? -1.4 Let z = -30 + 4. Let j = z + 28. Let g = 0 - -0.1. Which is the third biggest value? (a) g (b) -0.1 (c) j b Let r = -95 + 96. What is the third biggest value in 3/5, -3/5, r? -3/5 Let a = 0.2 + -0.1. Let n = -5.9 - a. Let q = 10 + n. What is the third biggest value in -4, q, 1/6? -4 Let k = -109/5 - -21. Let x = -0.4 + 0.1. Which is the second smallest value? (a) k (b) -2 (c) x a Suppose 0 = -3d - 2v - 13, 0d - 19 = -d + 4v. Let f = -11 + 25. Let l be (2/f)/((-2)/(-4)). Which is the third smallest value? (a) d (b) l (c) 0 b Let y = 70 - 70.2. Which is the smallest value? (a) 4 (b) y (c) -6 (d) -3/7 c Suppose 4o = 6o - 8o. Which is the second smallest value? (a) 5 (b) o (c) 2 c Suppose -5b - 244 = x, 2x = -0x - b - 443. Let i = x - -2849/13. What is the third biggest value in 1, -0.4, i? -0.4 Let f be 3/2 - 166/4. Let n be (f/(-150))/(12/(-10)). Which is the third smallest value? (a) n (b) 3 (c) 5 c Let t = 0 + -2. What is the second smallest value in t, 0.12, 0.5? 0.12 Let l = 4.3 - 1.3. What is the smallest value in l, 1, -3? -3 Let d = -0.06 + -1.94. Suppose 5q - 6 = 4. Suppose 2z - 8 = p + 3p, -5z + qp = -4. Which is the smallest value? (a) d (b) 2/3 (c) z a Let d = 3.8 - 3. Let y = -0.4 + d. Let b = 0.1 - -0.9. What is the third biggest value in y, b, 4? y Let u = 2584/7 - 369. Let h = 1 + -1. Which is the third biggest value? (a) 0.4 (b) h (c) u b Let p be (-1)/(-3) + (-133)/285. Which is the biggest value? (a) 0 (b) p (c) 1 c Let y = 123.8 - 124. Suppose -15 = -2i + 5. Let n = -6 + i. Which is the second smallest value? (a) -1/4 (b) n (c) y c Let d = -0.14 + -7.86. What is the biggest value in 2, d, 1/4? 2 Let f = -0.93 - -1. Let r = -0.07 + f. Which is the second biggest value? (a) r (b) -2 (c) 1 a Le	{ "pile_set_name": "DM Mathematics" }
h = 0.239826 + d. What is h rounded to 5 dps? -0.00017 Let b be -2(-1)/(-16) - (-48833208)/(-576). What is b rounded to the nearest one thousand? -85000 Let a = 0.11 - 5.53. Let r = a + 0.12. Round r to 0 dps. -5 Let v = 274.181 - 272.6. What is v rounded to the nearest integer? 2 Suppose -2f - 1034 = -7f + b, -1039 = -5f - 4b. Round f to the nearest 100. 200 Let c = 6.4590394 - 3.759042. Let m = -2.7 + c. Round m to 6 decimal places. -0.000003 Let o = 198 - 209.98. Let a = o - -11.98000493. Round a to seven dps. 0.0000049 Let d = 31.0292 - 32.74. Let m = d - -1.74. What is m rounded to 2 dps? 0.03 Let q = 25425.85 + -25424.130193. Let h = q - 1.72. What is h rounded to 5 decimal places? -0.00019 Let b = 1.053 - 34.053. Let s = 163006.199955 - 162973.2. Let f = b + s. Round f to five decimal places. -0.00005 Let g = -67.5 + 67.50000381. What is g rounded to seven decimal places? 0.0000038 Let z(f) = -f2 - 12f - 10. Let m be z(-10). Suppose 0 = -mr - 6r. Round r to seven dps. 0 Suppose -5f = -3o + 11 + 6, -o + 5f = 11. Suppose 0 = 3b - 62 + o. What is b rounded to the nearest 100? 0 Let u(f) = -f*3 + 8f*2 + 11f - 10. Let d = -8 + 17. Let c be u(d). Let y(o) = -5o + 5. Let n be y(c). Round n to the nearest 10. -40 Let a = 285.1 - 308. Round a to the nearest integer. -23 Let y(k) = -46749k*2 + 12k + 13. Let l(w) = 140246w2 - 35w - 38. Let g(a) = 4l(a) + 11y(a). Let j be g(-13). What is j rounded to the nearest 1000000? 8000000 Let j = 9.4 + -9.242. Let b = 0.712 + j. Let w = 10.67 - b. Round w to the nearest integer. 10 Let c = 34 + -59. Let o = -20 - c. Let y = -4.999972 + o. What is y rounded to 5 dps? 0.00003 Let p = 195359.543914822 - -1.508185178. Let k = p - 195410.05210058. Let z = k - -49. Round z to seven dps. -0.0000006 Let w = 0.2684 + 44.6936. Let h = 9.7 - -35.3. Let o = h - w. What is o rounded to 2 dps? 0.04 Let n(a) = -a*3 + 19a*2 - 46a - 13. Let d be n(16). Let q(u) = u*3 - 19u*2 - 26u - 10. Let w be q(d). What is w rounded to the nearest 100? -500 Let o = -70.06 + 12.51. Let l = o + 62. Let u = l - 2.26. Round u to 1 decimal place. 2.2 Let l = 387 - 365.7. Let i = l - -2.7. Let h = -23.997 + i. What is h rounded to two decimal places? 0 Let c be 1 - -2 - 4 - -3. Suppose 2692 = cu - 89308. What is u rounded to the nearest one thousand? 46000 Let j = -1.06 - -1.06000396. Round j to six dps. 0.000004 Let h = -42.9 - -45. Let u = -8 - -7.8. Let f = u - h. Round f to the nearest integer. -2 Let w = -3.192 + -0.048. Let b = 0.36 - w. Round b to 0 dps. 4 Let h = -140240.023 + 140211.0229995. Let w = 29 + h. What is w rounded to seven dps? -0.0000005 Let b = -31 + 19. Let h(j) = -j2 - 12j - 2. Let r be h(b). Let n be 148004 + (-2 - r/(-1)). What is n rounded to the nearest ten thousand? 150000 Let o = -252.00895 - -252. What is o rounded to three decimal places? -0.009 Let i(t) = 4t - 31. Let h be i(7). Let y(s) = 0 + 1332818s - 3 + 467181s. Let q be y(h). What is q rounded to the nearest 1000000? -5000000 Let p = -127.63 + -8.07. Round p to the nearest ten. -140 Let o = -4.3 - -4.299796. What is o rounded to 5 dps? -0.0002 Let n = -236992 - -236803.971. Let f = 0.029 + n. Let u = f - -188.0194. What is u rounded to three dps? 0.019 Let u be ((-8989602)/(-2))/(3/(-16)-4). Let z = -9106932 - u. What is z rounded to the nearest 1000000? -15000000 Let q = -4 - -7. Let n = q - 2.5. Let f = -0.4999904 + n. What is f rounded to six dps? 0.00001 Suppose f = -4a + 8120, 32431 = 5f + 3a - 8237. Suppose 0 = 4s + f + 744. Round s to the nearest 100. -2200 Let m(n) be the first derivative of -32n3/3 + 7n*2/2 - 11n + 11. Let y be m(-6). Let i = -535 - y. What is i rounded to the nearest one hundred? 700 Let k = -14564 - -14642.9953. Let o = k + -79. Round o to three decimal places. -0.005 Let o = -15080.0217 + 15092. Let l = 11.92 - o. Round l to two dps. -0.06 Let t = 47.2 - 0.2. Let p = 48.9 - t. Let w = p + -1.90055. What is w rounded to 4 dps? -0.0006 Suppose 4q + 2b + 193 = -3b, 3q + 147 = -3b. Let v = 124 + q. Suppose -15 = 3i + 3t + v, 2t = -i - 28. Round i to the nearest one hundred. 0 Let v(w) = 81839957w + 43. Let n be v(1). Round n to the nearest 1000000. 82000000 Let y = 1.03 - -43.97. Let x = y - 44.9999966. What is x rounded to 6 decimal places? 0.000003 Let h = 0.668 + 0.002. Let l = 275 - 275.612. Let f = h + l. Round f to 2 dps. 0.06 Suppose 4f + 2t = -0t + 380850, 0 = -3f + 3t + 285633. Suppose 44788 = 2i - f. Round i to the nearest one hundred thousand. 100000 Suppose 0 = 17p - 8p - 10p. Suppose -16i + 14i + 2064000 = p. Round i to the nearest 100000. 1000000 Let p = -14933 - -42542. Suppose -p = -3m + 4d - d, -m - 5d = -9227. Suppose m = -2j - 1793. Round j to the nearest one thousand. -6000 Let o = 170.65 + -167. What is o rounded to 1 dp? 3.7 Let p(q) = 18q3 - 10q*2 + 12q - 20. Suppose 4m - 41 = v, -5m = 2v - 36 + 1. Let f be p(m). Round f to the nearest one thousand. 12000 Let l = -0.858 + 0.858000879. Round l to 7 dps. 0.0000009 Let b = -9.165 + 14.5. Round b to 1 decimal place. 5.3 Suppose 4 = -s + 3s. Let a be (-44)/12 - s/6. Let r = 13 + a. Round r to the nearest 10. 10 Let x = -0.163 + 0.162998199. What is x rounded to seven dps? -0.0000018 Let a = 1715 - 1672.84. Let j = a + -45. Let f = -2.840173 - j. What is f rounded to five decimal places? -0.00017 Let n = -1411.0617 + 1411. Round n to two dps. -0.06 Let y(v) = v*2 - v - 7. Let r be y(-4). Suppose -3k + r - 1 = 0. Suppose -s + 487996 = kc, -c + 4s - 2s + 122008 = 0. Round c to the nearest ten thousand. 120000 Suppose n + 3z = -22, -3z - 32 = 3n - n. Let u(p) = p*2 + 8p - 12. Let l be u(n). Suppose -g + 154000 = -lg. Round g to the nearest 10000. -20000 Let o = -33 + 26. Let w = o - -7.0000002. Round w to 6 dps. 0 Let i be 768000/((-20)/25(-3)/78). Suppose 0 = -8p + 2p - i. What is p rounded to the nearest 100000? -4200000 Let t = 0.3 - 0.342. Let z = -13394.041943 + 13394. Let o = t - z. Round o to five dps. -0.00006 Let q = 593256854 + -593257466.000706. Let m = q + 612. Round m to four dps. -0.0007 Let k = -15307426.0758 + 15285952.5. Let t = -21430.6 - k. Let o = t + -43. Round o to 3 decimal places. -0.024 Let v = 1.6 - 6.1. Let x = v - -4.49999911. What is x rounded to seven dps? -0.0000009 Let t = -1395.5353 + 1396. What is t rounded to 1 decimal place? 0.5 Let m = -455984.99915 + 455886. Let t = m - -99. Round t to 4 dps. 0.0009 Let g = 469 + -468.999999327. What is g rounded to seven dps? 0.0000007 Let b = -41 + 24. Let g = b + 18.7. Let a = g - 1. What is a rounded to the nearest integer? 1 Let m be ((-23362500)/49)/(1 + (-452)/448). What is m rounded to the nearest one million? 53000000 Suppose -3t = -t - 18. Let z = -10 + t. Let l be -41997 - 1 - z - 3. Round l to the nearest ten thousand. -40000 Let z = 5230.008 - 5248. Let p = z + 18. Round p to two dps. 0.01 Let p = 117 + -117.015. Let r = 10.3 + -4.515. Let k = p - r. Round k to the nearest integer. -6 Suppose -4s = 2v - 4v - 10, 4s - 4v = 0. Suppose 2r + 3h = 6r - 439, 0 = sr - 2h - 554. Round r to the nearest 10. 110 Suppose 5g + 11 = 2y, 0g = 3y - g - 10. Suppose -4k - 5v = -535985, 2 = -yv - 7. Round k to the nearest 10000. 130000 Let p = 991362 - 1693368. Let x be 6/45 - p/(-45). Round x to the nearest one thousand. -16000 Let p = -1022 + 1021.9923. What is p rounded to three decimal places? -0.008 Let l = 0.02787 - 0.0375. Round l to 3 dps. -0.01 Let l = 241 + -240.9999572. Round l to 6 dps. 0.000043 Let k(z) = -89z - 4. Let n be k(-4). Suppose -3m + 2h - n = 0, 2h = 4m + 243 + 229. Round m to the nearest 10. -120 Let x = -173 + 156.7. Let b = -31.9 - x. Round b to 0 dps. -16 Let s = 0.0544 + -0.054399298. Round s to seven dps. 0.0000007 Let l(d) = 22 + 6d - 30 - 1978d - 1364d. Let t be l(-3). Round t to the nearest 10000. 10000 Let w = -129218.36777 + 129219. Let p = w - 0.11753. Let o = -0.52 + p. Round o to three dps. -0.005 Let t = -473.08131041 + 886.0813122. Let n = 413 - t. Round n to 6 dps. -0.000002 Let f = 0.25 - 5.4. Let z = f + 0.15. Let o = z + 4.99999972. Round o to 7 decimal places. -0.0000003 Let z be 9702/8 + (-1)/(-4). Let h(x) = 739*x + 74. Let i	{ "pile_set_name": "DM Mathematics" }
(-14)? 19 Let x = 0 - -2. Let p(o) = 22o + 1. Let k be p(x). Suppose 4s - 3 = 4m - 63, 5m - k = -5s. List the prime factors of m. 2, 3 What are the prime factors of 171 + (14/21)/((-1)/(-3))? 173 Let w(f) = 4f*2 - f. Let s be w(-1). Suppose -sz - 7 = 3. List the prime factors of -5 + 5 + (0 - z). 2 Suppose 12n = 2n + 1310. What are the prime factors of n? 131 Suppose l + 0 = -7. Let b = l + 11. List the prime factors of b. 2 Suppose 0 = 5b - 5i - 225, -i = -4b - 2i + 185. What are the prime factors of b? 2, 23 Suppose -22 = -6s + 3s - g, 0 = g + 5. What are the prime factors of s? 3 Let l(v) = -v*3 - 12v*2 - 9v + 19. What are the prime factors of l(-13)? 5, 61 Suppose -2o - 4x + 18 = 0, -3 = 5o - 4x - 6. Suppose -h = oh - 12. What are the prime factors of h? 3 Let c(d) = -d - 10. Let a be c(-7). What are the prime factors of (16/4)/((-2)/a)? 2, 3 Let m(a) = a3 + 10a*2 - 14a - 5. List the prime factors of m(-11). 2, 7 Suppose -4k = -9k - 2u + 7, -8 = 4k + 5u. What are the prime factors of 2/k - 910/(-39)? 2, 3 Suppose 50 = 4g - 14. Let x be (-4)/6 - g/(-6). Suppose xt - 1 = 3. List the prime factors of t. 2 Suppose -4 - 7 = -f. Suppose 35 - f = 2k. List the prime factors of k. 2, 3 Suppose 3t - 52 = 2t. Suppose -w + 120 = 4x + w, t = 2x - w. List the prime factors of x. 2, 7 Suppose 0 = -u + 5u - 32. List the prime factors of u. 2 Suppose 6n - 28 = 20. List the prime factors of n. 2 Let x be (0 - 8/3)3. Suppose 10 = -2g + 3c, 4g + 4c = 2c + 12. Let o = g - x. List the prime factors of o. 3 Let t(z) be the third derivative of -z6/40 + z4/24 - 2z2. What are the prime factors of t(-2)? 2, 11 Suppose 8s + 320 = 3s. Let a = 92 + s. List the prime factors of a. 2, 7 Let b = 325 - 225. List the prime factors of b. 2, 5 Let y(h) = -h. Let k be y(-5). Suppose -j = -5i - 8, -2j - 21 = -4j + ki. List the prime factors of j. 13 Suppose 9y = 13y - 820. What are the prime factors of y? 5, 41 Let i be (-4)/10(-6 - -1). Suppose in = -n + 45. What are the prime factors of n? 3, 5 Let f = 13 + -13. Suppose 2o = 8, 0 = -fc - 2c - 4o + 36. List the prime factors of c. 2, 5 Let r = 22 + -16. List the prime factors of r. 2, 3 Let a = 3 + 11. Suppose -5u + 3n = 4n - a, 4u - 5n = 17. List the prime factors of u. 3 Let f(n) = n + 9. Let b = 8 + -13. List the prime factors of f(b). 2 Suppose -3f = 3k - 9, 12 = 4k + f - 4f. Suppose -3q = -5u - 2q + 82, 3u + kq = 60. List the prime factors of u. 17 Let x(o) = -5o + 9o + o2 + 6o - 3. Let t be x(-9). Let z = 23 + t. List the prime factors of z. 11 Let p(f) = -f*3 + 4f*2 - f. Let d be p(3). Suppose c = -c + d. What are the prime factors of c? 3 Let k be 4/24 + 74/(-12). Let z = -17 - k. Let p = -8 - z. What are the prime factors of p? 3 Let x(d) = 2d*3 - 8d*2 + 4d + 27. What are the prime factors of x(6)? 3, 5, 13 Suppose -5l + 15 = 5. Suppose -2i - li = 8. What are the prime factors of (10 - i - 2) + 1? 11 Suppose -2y = -5h - 75, 5y - h = 3y + 79. List the prime factors of y. 2, 5 Let l = -97 - -173. List the prime factors of l. 2, 19 Suppose 0y - 4i + 12 = 3y, 3i = -2y + 9. Let o be 1/(-3)(y + 3). What are the prime factors of ((-7)/(-2))/(o/(-2))? 7 Suppose 0q = -2v + 4q - 10, -11 = -v - 2q. What are the prime factors of 9((-24)/9 + v)? 3 Let k = 6 - 4. Suppose 2o + kp - 6p = -6, o + p = -15. List the prime factors of -3 - (-3 + 1 + o). 2, 5 Suppose -1 = -a + 5t, -2 + 0 = t. Let f = -3 - a. What are the prime factors of f? 2, 3 Let u be 13 - (-1380)/10. Suppose 2b + u = 5b. What are the prime factors of b? 47 Suppose 35 = 4j - 5a, 2 - 25 = -2j - 3a. List the prime factors of j - (3/3)/(-1). 11 Let y = -33 + 23. List the prime factors of (-3)/2y/5. 3 Suppose -4p + 2s + 110 = p, 0 = 3p + s - 77. What are the prime factors of p? 2, 3 Suppose -4w + 2o = -4, -2o - 12 = o. Let i = w + 7. List the prime factors of i. 2, 3 Let n(t) = 2t - 4. Let a be n(4). Suppose -aj + 5o = -75, -2o = 3j + 2j - 135. Suppose -2y - 3y = -j. What are the prime factors of y? 5 Suppose -h = 4h - 30. Let b(t) = t - 4. Let u be b(h). Suppose -y + uy = 9. What are the prime factors of y? 3 Suppose z + 4h = 3z - 52, 2z - 2h - 44 = 0. What are the prime factors of z? 2, 3 Suppose -5z - 10 = 0, 0z = -n + 2z + 4. Let l = 2 - 1. Suppose -2y + 4j + 10 = n, -2j = -3y + 22 + l. What are the prime factors of y? 3 Let j = 10 - 7. Let w = 0 + j. Suppose 4c - 17 = wz + 2z, 3c + z - 8 = 0. What are the prime factors of c? 3 Let q = 335 - 154. What are the prime factors of q? 181 Let g be 0/(1 - 6/2). Suppose c - 2l + l + 3 = 0, 4l - 22 = -c. Suppose -2s - cq + 2 = g, 5s + q = 2q + 35. What are the prime factors of s? 2, 3 Suppose 5s + 0 - 10 = 0. Let z = s + 3. Suppose -14 = -2t - 4p, -p = -zt - 5p + 29. List the prime factors of t. 5 Suppose -6q = -q + 50. Let d = -2 - q. List the prime factors of d. 2 Let j be (-2)/3 - (-1358)/21. Let q = -30 + j. What are the prime factors of q? 2, 17 Suppose 3o + 4v + 176 = 6o, -20 = -5v. List the prime factors of o. 2 Let q = 13 + 43. What are the prime factors of q? 2, 7 Let a(i) = i2 - 4. What are the prime factors of a(4)? 2, 3 Let k be (-28)/(-3) + 7/(-21). Let n(l) = l3 - 10l*2 + 9l + 13. List the prime factors of n(k). 13 Suppose -176 = -3t - 5k, -2t - k + 18 + 97 = 0. List the prime factors of t. 3, 19 List the prime factors of 1(-213)/(3 + -6). 71 Let m = 21 + -9. What are the prime factors of m? 2, 3 Let c = 21 + 20. Suppose b = -4w + 2, -c = -4b - w - 4w. What are the prime factors of b? 2, 7 Let i = 62 - 37. What are the prime factors of i? 5 Let c(n) be the second derivative of -n4/12 - n3/6 + 4n*2 + 2n. Let t be c(0). Let u = -6 + t. List the prime factors of u. 2 Suppose -t - 4f + 80 = 0, 2t + 3f + 32 = 187. Suppose -4d - 32 + 115 = -5v, 0 = -3d + v + t. List the prime factors of d. 3 What are the prime factors of (-2 - 11)(3 - 4)? 13 Let j(m) = m2 + m - 3. Let u be j(0). Let t(b) = b2 + 3b - 3. Let p be t(-4). Let d = p - u. List the prime factors of d. 2 Let v(q) = 10q2 + 1. Let p be v(-1). Suppose 2r - 3r + p = 3s, 0 = -s - 5r + 13. Suppose sw + w - 20 = 0. List the prime factors of w. 5 Let i(q) = -q - 4. Let u be i(-9). Suppose a = u - 1. Let t(l) = l - 2. List the prime factors of t(a). 2 Let v(t) = t2 - 1. Let i(n) = n2 + 2n + 8. Let q(h) = -i(h) + 2v(h). What are the prime factors of q(-5)? 5 Suppose -36 = -3i + 6. Let y = -6 + i. Suppose y = 5q - 32. List the prime factors of q. 2 Suppose -2j + 12 - 2 = 0. Suppose 10 = -0o + jo. List the prime factors of o. 2 Let p be (76/8 + 2)6. Let l = -35 + p. What are the prime factors of l? 2, 17 Let d(x) = -6 + x*2 + 3 + 2 - 14x3. Let m be d(1). List the prime factors of (-5 + 4)/(2/m). 7 Let y(z) be the second derivative of z4/12 - 11z3/6 + 5z*2 - 4z. What are the prime factors of y(11)? 2, 5 Suppose -3n = 0, 2n = 3a + 4n - 120. Suppose -z - 5m + 2 + 6 = 0, 3m + a = 5z. List the prime factors of z. 2 Let m(u) = 14u + 15. Let c be m(-9). Let z = -61 - c. What are the prime factors of z? 2, 5 Suppose -w - 8 = -5w. List the prime factors of w. 2 Suppose 0 = -5y + m - 9, -2y + 5y - 4m = -19. Let w(i) = -3i - 3i - 1 - i. What are the prime factors of w(y)? 2, 3 Let r(g) be the third derivative of 0 + 0g + 3/8g4 + 0g*3 + 3g*2. List the prime factors of r(1). 3 Let c(h) = -30h - 6. List the prime factors of c(-2). 2, 3 Let z = 2 + 0. Suppose u = -zu. Suppose -5d = -m - 8 - u, 3d = -3m + 30. List the prime factors of m. 7 Suppose 0i + 288 = 8i. List the prime factors of i. 2, 3 Let j be -4 - (-4)/4106. Suppose 2c + c = j. What are the prime factors of c? 2, 17 Suppose 0t = -3k + t + 3, 0 = 5t. List the prime factors of k/(2/4)3. 2, 3 Let g = 161 + -81. What are the prime factors of g? 2, 5 Let j(i) = -11i + 1. List the prime factors of j(-8). 89 Let x be ((2/1)/2)/1. Let s(n) = 31n - 1. Let r be s(x). List the prime factors of r/9 - 2/6. 3 Let y = 7 + -8. Let l be 1 - (-5 + (-1 - y)). Let w(f) = -f*3 + 5f*2 + 9f - 6. List the prime factors of w(l). 2, 3 Let b(j) = -j*2 - 8j - 11. What are	{ "pile_set_name": "DM Mathematics" }
k = -368 + a. Is k smaller than -240? True Suppose -f - 600 = -3i + 2f, -3f = -i + 202. Suppose -t - 191 + i = 0. Let w(z) = -z3 - 10z*2 + z + 10. Let m be w(-10). Are t and m nonequal? True Suppose 5x = 2c - 64, 6c - 141 = c + 3x. Let m(a) = 63a*2 - c + 2a + 5a - 64a*2 + 6a. Let s be m(11). Which is greater: -19/3 or s? s Let i = 59 + -46. Let l be -14 + i - (-2063)/504. Let v = l + -28/9. Which is bigger: -1 or v? v Suppose 0 = 8s - 6 - 34. Suppose 2p - 8 = 2a, -p + sa = -4p - 28. Which is smaller: p or 2/25? p Suppose -z = -4n + 2n + 8, 0 = -7n + 21. Does z = 44? False Let i(w) = -99w - 15. Let j be i(-3). Let o be (-2 + j/132)-12. Which is bigger: -2 or o? o Let x be (-5)/4 - 3555/(-1580). Let m = 704/29455 + -2/215. Is x less than m? False Let v = -4421.9 + 4422. Let l be (-2)/(-1(-13)/(-6)). Does l = v? False Let j = -0.05 + 8.05. Let c = j - 5. Let g = -2.8 + c. Which is smaller: g or -1.2? -1.2 Let v = 0.478 + -0.536. Let g = v + 0.438. Which is smaller: g or 0.02? 0.02 Let b be (-4 + 9585/2397)/(-1). Suppose -3n = -w - 5, -5n + 15 = -13n - 3w. Is n >= b? False Let k = 12/354383 - -183918057/198454480. Let m = 3/112 - k. Suppose p = -p. Which is greater: m or p? p Suppose 8451 = -15x - 17574. Let q = -6833/4 - x. Suppose 0 = -4z + 3g + 106, 48 = -4z + 2g + 156. Which is bigger: z or q? z Let b be (1168/112 - 10) + 64/14 + 35. Is 66 at least as big as b? True Let u = -11537/5 + 57846/25. Is u <= 5? False Let g be (-9)/(-6)(-12)/54-12. Suppose -l - gy = 9, 43 = 5l + 4y + 8. Which is smaller: 2 or l? 2 Let f(j) = 14j*2 - 6j - 44. Let i be f(8). Let k = -854 + i. Suppose -g = -3g - 2a - 98, 2g + 3a = -98. Which is greater: k or g? g Let l be (39/(-38) - -1)(-932)/(-1398). Which is bigger: l or 29? 29 Let z be (-348 + -3)/((-93)/217). Is z > 829? False Let l(g) = g3 - 20g*2 - 24g + 907. Let s be l(19). Which is smaller: s or 620/7? 620/7 Let q be ((-3)/(-6))/(34/68) + (-9 - -1). Which is bigger: q or -70/11? -70/11 Let p(c) = -37c - 11. Let q(z) = -18z - 6. Let d(y) = 4p(y) - 7q(y). Let s be d(-3). Let u be (41 - 40)/(1/((-2)/s)). Do u and 1 have different values? True Let p = 1882 - 1798. Which is greater: p or 335/4? p Let l(k) = 2k2 + 7k + 12. Let c be l(-14). Let t be 175/(-210) - 3694/(-12). Which is greater: t or c? t Suppose j = -2j + 3. Let o(z) = -z3 - 6z2 + z + 3. Let r be o(-6). Let x(p) = -p3 - 10p2 - 26p - 13. Let g be x(r). Which is smaller: j or g? j Suppose -59v = 126v + 370. Let d be 2/(-4) - (-27)/6. Let h be (-1)/dv1650/33. Are 25 and h equal? True Let w be 39/(-20) + (-1806)/1032. Suppose 2y + z + 3 = -4z, -3y - 11 = z. Is y at most w? True Let s be ((-7392)/(-200) - 9)/(6/(-30)). Is -141 smaller than s? True Let u = -35356 + 26327. Which is smaller: -9028 or u? u Let d = -41 - -49. Let u be (14/d + -1)/((-5)/(-5)). Suppose -2t = -3t, -4t = -4r + 4. Are u and r non-equal? True Let y be 4((-102)/(-72) + (-145)/87). Is -1/13421 <= y? False Suppose 4m - 139 = 29. Let f be (2114/m - 6)/(1/6). Is f less than 266? False Let r be (45915(-15)/214245 - (-4)/18) + 3. Which is smaller: 0.09 or r? r Let m be 48/95 + 1 + 56/(-40). Which is smaller: m or -3/8? -3/8 Let o be -2 - ((-4)/8)/(2/(-28)). Let f be o + (-3)/(5/(-5)). Let n be (-2)/(-2) + (-1)/(8/f). Which is greater: 3 or n? 3 Let u be (-108)/(-30) - 6/10. Suppose a + 7c - uc = 21, 5c = 20. Let b(t) = t3 - 6t*2 + 4t - 1. Let p be b(a). Which is smaller: -4 or p? p Let o = -5521298 + 966231183/175. Let s = o + -163/7. Let p(b) = -40b2 - 179b - 77. Let m be p(-4). Which is greater: s or m? s Let c = 216 + -97. Suppose 115q = cq + 836. Is q at least -208? False Let i = 170 + -846/5. Let j = 10 + -3. Let v = -7.1 + j. Which is smaller: v or i? v Suppose -383y = -385y + 5a + 602, -2a + 941 = 3y. Which is greater: y or 2798/9? y Let p be -6(-1)/16 - 18/((-216)/3). Is 0 at most as big as p? True Let h(t) = 3t - 3t + 2t. Let c be h(-1). Let x(o) = -8o + 178. Let g be x(23). Which is bigger: g or c? c Let m = -3455286 + 117506307/34. Let d = 782 - m. Which is smaller: 0 or d? 0 Let v = 463 + -469. Let l be -41/14 + v/(-168). Is l >= -126/5? True Let j = 62 - -17. Suppose 71 + j = 5m. Let n be 15/(-12) - (-500)/16. Is n at least as big as m? True Let h(i) = -i*3 - 15i*2 + 48i + 16. Let x be h(-18). Do x and 373/3 have different values? True Let i = -0.6939 - 62.3061. Which is smaller: 14 or i? i Let x = 339.7 + -49.7. Let k = 309 - x. Is 0.6 not equal to k? True Let k(l) = 3l + 55. Let n be k(-18). Is n at most as big as 114? True Let j = 130 + -121.9. Let t = -5963 - -5963. Is j >= t? True Suppose 55v + 1416 = 675 + 686. Let y be 1 + 40/43 - 2. Which is bigger: v or y? y Suppose -15 = 3t + 2t. Let a be -10 - (6/t + -1). Let k be ((-1)/6)/((-135)/(-5994)). Is k not equal to a? True Suppose -5t - 2 = 2d + 7, 2t + 4d + 10 = 0. Which is smaller: -11/452 or t? t Let a be -11 - 4/80-217. Do a and 0.12 have the same value? False Suppose 3a + a + 8 = 0. Let x be (6 - 8)1/a. Let p be ((-3)/8)/(11 + -8). Which is greater: p or x? x Suppose 192k - 1161 = 92k + 97k. Is 381 > k? False Suppose 6k - k + o = -166070, 4o = -4k - 132840. Is k at least -33215? True Suppose 8 = -3p - 5n, -73 + 53 = -p + 4n. Which is smaller: p or 201/56? 201/56 Suppose 38r = 36r. Suppose y - 5d = -3, r = 2d - 4 + 2. Let m(p) = -p*3 + 3p*2 - 4p. Let z be m(y). Which is greater: -3 or z? -3 Let r = 15284 + -15286. Which is bigger: 3383 or r? 3383 Suppose 0k + 3z = k - 36, k - 29 = -4z. Suppose -l - k - 54 = -5j, -2l = -j + 21. Let a = j - 32. Which is smaller: a or -17? -17 Let w = 8.39 + -8.38. Which is greater: 6.4 or w? 6.4 Let s = 25.744 + -25.644. Is s >= -30964? True Let v = 733/89 + -2110/267. Let l = -73 + 67.2. Let o = l + 7. Which is smaller: o or v? v Let x = -36.869 + -0.131. Let b = x + 46. Which is smaller: b or -2/9? -2/9 Let o = -322 - -314. Let v(u) = u2 + 33u + 197. Let y be v(o). Is -11/7 at most y? False Let o = -2517 + 2521.564. Let h = o - -0.036. Let f = h + -5.1. Is f at most as big as 6? True Let d = -7 + 11. Suppose 4g + dq + 4 = -0, -7 = -3g + 2q. Suppose 4n + 3v = -25, n - v = -1 - 0. Which is greater: n or g? g Let b = 96 - 85. Suppose 336 = bn + 116. Suppose -5m + 5t = -6m + 42, -5t + n = 0. Is 19 greater than m? False Suppose 3d - 24 - 57 = k, 5k = d - 41. Suppose 54 = -4n - d. Suppose -1066u + 1061u = 100. Is n <= u? True Suppose 1322 = -19z + 467. Suppose 353 = 5i - 4y, 2i + 3i = -2y + 371. Suppose 0x = -x + h - 49, -3h - i = 2x. Which is greater: x or z? x Let k(b) be the second derivative of b3/3 + 24b*2 + 48b. Let j be k(-21). Which is bigger: -12 or j? j Let z be (-2 - -5 - 3) + 2. Let t be (0 + (-2)/6)/(4/36). Let u be (4 - (-27)/t)/(-6). Which is greater: z or u? z Suppose -22c = -366c + 1277960. Is 18576/5 <= c? False Let l = -867 - -404. Let o = l - -498. Does o = 169/5? False Let k = 1095.605 - 1107. Let x = k + 0.495. Which is smaller: -1 or x? x Let q = -79 - -18. Let m = q + 60.26. Let r = 9.74 + m. Is -2/3 less than or equal to r? True Suppose -6t = 3 - 9. Let v be 15148/(-2640) + 6 + 4/(-16). Which is smaller: v or t? v Let h = -208 - -209.13. Let s = h + -1.73. Which is bigger: -0.1 or s? -0.1 Suppose -185y + 54y + 6288 = 0. Is y < 532/11? True Suppose 3c - 26c = 9568. Let j be (1 + -21)c/64. Is j != 0? True Suppose 30q + 48481 = -65309. Is -3 smaller than q? False Let h(a) = 131a + 263. Let y be h(-2). Let o be (-2)/(-4) + 233290/(-1290500). Let x = 2/2581 + o. Is y at most x? False Let z be 46/(-10) + (-4)/10. Let c(n) = -n + 13. Let x be c(11). Suppose 3r + 6 = xp, -3r + 14 = -p + 23. Which is smaller: z or r? z Let z be (((-17020)/(-272))/5)/(-28). Let j = 16/119 + z. Suppose v = 4r + 11, 5v + 4r + 11 = -6. Which is smaller: j or v? v Let i(u) be the first derivative of -3u2 - 2u - 26. Let y be i(0). Let t be 8/32 - ((-3)/4 + y). Which is bigger: -6 or t? t Let k(j) = -j*2 - 16j - 12. Let c(h) = h*2 + 14h + 11. Let s(l) = -4c(l) - 3k(l). Let a be s(-1). Which is bigger: -10 or a? a Let c = -965162/15 - -64318. Which is greater: 1 or c? 1 Let r = -81170/3 + 2	{ "pile_set_name": "DM Mathematics" }
1.12. What is the second smallest value in -3/4, 2, g? g Suppose 5l - 3d - 5 = 5, -5l - 2d + 35 = 0. What is the third biggest value in -0.4, l, 0.5, 2? 0.5 Let t(u) = 2u2 - 10u + 8. Let s be t(4). Let x = -10 - -14. Which is the third smallest value? (a) s (b) -2 (c) x c Let u = -348 - -709. Which is the second biggest value? (a) 2/7 (b) -0.1 (c) u a Let z be (-5)/1(-6)/36. Let i = -0.65 + 0.3. Let w = i + -0.05. What is the third smallest value in -0.2, z, w? z Let t = -17 + 52. Let s = 30 - t. What is the smallest value in 18, s, 0.3? s Let x = 88 + -46. Let z = 51 - x. Which is the second smallest value? (a) 2/13 (b) -5 (c) z a Let a = 25.63 + -25.42. What is the second biggest value in a, 2, 0.07? a Let o = 476 - 476.4. Which is the second smallest value? (a) o (b) -2/9 (c) 2 (d) -99 a Let o = -8 + 6. Let v = 15 - 16. Let d = 0.9 + v. Which is the smallest value? (a) o (b) -2/15 (c) d a Let q = -10.93 - -11. Let n = -0.07 + q. Let t = 2.52 - 9.52. Which is the biggest value? (a) n (b) -0.1 (c) t a Suppose -7 = -2s + 11. Which is the third smallest value? (a) s (b) -4 (c) -0.5 (d) -3 c Suppose 3h + 11 = -2s, -h + s + 0 = 2. Let g = -12 + 22. Let b = g + -5. What is the third biggest value in b, -2/15, h? h Let n be 3/9 - 16/(-6). Let t be 2/(-10)n/(-3). What is the second biggest value in 2, -3, 3/2, t? 3/2 Let o = -1.051 + 7.051. What is the biggest value in 0, -4, o? o Let l = 0.09 - 0.29. Let r be 4/(-2 + (3 - 2)). Let o be 4/14 - r/(-63). Which is the biggest value? (a) l (b) -5 (c) o c Let p = -0.7 - -5.7. Let o be (-4)/(-14) - (-67)/(-14). Let l = o + 5. Which is the second smallest value? (a) -2/9 (b) p (c) l c Let n = 2/247 + -1006/2223. Let t = -0.4 - -0.2. Let q = t - -0.1. What is the second smallest value in q, -3, n? n Let d = -60.5 + 61. Which is the second smallest value? (a) -0.2 (b) d (c) 16.3 b Let c = -154 + 157. What is the second smallest value in c, -3/2, -3? -3/2 Let s = -0.209 + -0.291. Let q be (-20)/186/(-4). What is the biggest value in s, 2, q? 2 Let u = -8.6 - -11.6. Which is the third biggest value? (a) -4.7 (b) u (c) -0.5 a Let t = 15.18 - 13.18. Which is the third biggest value? (a) 4 (b) t (c) 0.26 (d) -4 c Let j = -20 + 19.4. Let f = 1 + -0.8. Let s = 0.1 - f. Which is the second biggest value? (a) j (b) s (c) 0.1 b Let u = -1/53 + -2806/159. Let j = u + 18. Which is the third biggest value? (a) -6/7 (b) 0 (c) j (d) 2/9 b Let w = -1 - -0.9. Suppose 2j = -4z - z + 24, 6 = 3z. Suppose jy - 8y = -2. Which is the third smallest value? (a) w (b) y (c) -0.5 b Suppose -i = -3w - 9, 15 = -i + w - 6w. Let c = 0.72 + 2.28. Let o = -1 + -2. What is the third smallest value in o, i, c? c Let d = -1.1 - -0.69. Let p = -0.4 - d. Let w = p - -3.99. Which is the second biggest value? (a) 0.3 (b) -0.3 (c) w a Let h be 5/((-10)/12)864/6480. Which is the second biggest value? (a) -1 (b) 1/6 (c) -0.1 (d) h c Suppose 3p + 4f + 8 + 0 = 0, 2p + 5 = -3f. Let z = 2 + -1.7. What is the smallest value in 2/7, p, 0.5, z? p Let g(h) = h*3 + 4h*2 - 1. Let o be (-4)/6 + 12/(-9) + 0. Let i be g(o). Let v = 0.1 - -0.3. Which is the third smallest value? (a) i (b) v (c) -5/2 a Suppose 0 = 2w + 3 - 11. Let g = -20.6 + 20.2. What is the fourth biggest value in 0, w, -0.5, g? -0.5 Let v = 95 + -153. Let r = 57.5 + v. Let s = 78 + -391/5. Which is the second biggest value? (a) s (b) r (c) 3/5 a Suppose -4l = -5x + 2062 + 1213, -4l = 5x + 3285. Let v be 5 + (l/32)/5. Which is the fourth smallest value? (a) 2/7 (b) 0.1 (c) v (d) 2/17 a Let m(b) = -36b - 5. Let l be m(0). What is the second biggest value in 1, 0.4, -10, l? 0.4 Let w = -637.1 + 637. What is the second biggest value in 0.04, -3, w? w Let p = -1.2 + 1.54. Let l = 0.14 - p. Which is the biggest value? (a) l (b) 2/31 (c) 5 c Let h = -656 + 653. Let f = -0.4 + 0.3. What is the biggest value in -9, f, h? f Let c = -0.4 - -0.3. Suppose 3p = 2m, 4m + 3p = -180 + 144. What is the third smallest value in -1, m, c? c Let q = -32.4 + 30.4. Let o = 3.7 - -0.3. What is the second smallest value in 3/5, q, o? 3/5 Let u = 14.4 + -14.1. Which is the fourth smallest value? (a) 0.11 (b) -2/19 (c) u (d) -2/7 c Suppose -j = -2l + l - 432, 2j + 4l = 864. Let u = j - 3892/9. What is the second biggest value in 0.3, 0, 4, u? 0.3 Let n = -340.5 + 340. Which is the second smallest value? (a) 4 (b) n (c) 97 (d) -5 b Let u be -10(-1)/2 - 3. Let z = u + -6. Let d be 4/(-4) - (-2)/4. What is the third smallest value in d, z, -5? d Let j = -0.0494 + -0.2506. Which is the biggest value? (a) 25/6 (b) j (c) 0.5 a Let j = -36.41 - -36. Let d = -3.89 - -4. Let y = j + d. Which is the biggest value? (a) y (b) -2 (c) -3 a Let v = -71307289/1467732 - 2/122311. Let i = -148/3 - v. What is the second biggest value in 2/5, i, 1/2? 2/5 Suppose 6w - 2t = 7w - 8, -3w - t = -14. Which is the second smallest value? (a) -2/9 (b) 2/5 (c) 2 (d) w b Let v = -65.7 - -70.7. Which is the second smallest value? (a) v (b) -7 (c) 2 (d) -0.5 d Let w = 30 + -28. Suppose -u = -2u - w. Suppose -2n = -2a + 8, 2n + 6 + 12 = 4a. What is the third smallest value in n, 0.2, u? n Suppose -230 = 5q + 2z, -6q - z + 92 = -8q. Let i be q/45 - (-12)/54. Which is the fourth smallest value? (a) -1 (b) i (c) -0.5 (d) -0.01 d Let h = 112.1 - 112. What is the smallest value in -1/22, 0.5, 2, h? -1/22 Let x = -14 - -9. Let z = 0.018 - 0.018. Which is the second biggest value? (a) x (b) 3/8 (c) z c Let y = -686.4 + 687. Which is the smallest value? (a) 5/6 (b) 4/7 (c) y b Let z = 0 - -0.2. Let k = -182 + 181.3. Let n = k + z. What is the second smallest value in n, -0.3, 0.3? -0.3 Let h = 3 + -2.97. Let f = -63 + 61.9. Let b = f - 1.9. What is the second biggest value in h, b, 0.3? h Let v = 55 + -45.5. Let p = -9 + v. What is the second biggest value in p, -12, 4? p Let s(m) = -m*3 - 13m*2 - 13m - 11. Let h be s(-12). What is the third smallest value in h, -0.01, 1/11? h Let f(m) = -m + 1. Let j be f(2). Let l be (-1 - j/3)(-3)/(-3). Which is the fourth smallest value? (a) 0.5 (b) l (c) 0 (d) 11 d Let m be 1/9-443 - 2/(-9). Let w be 28/m(-7)/101. Which is the fourth smallest value? (a) -1/2 (b) w (c) -17 (d) 2 d Let y = -0.02 - 0.34. Let u = -13.64 + y. Let t = u - -14.3. What is the second biggest value in 3, t, 9? 3 Let z be (-45)/(-189)12/10. Let w = 0.98 + 0.02. What is the third biggest value in w, z, -4, -0.4? -0.4 Let p = -946 + 1095. What is the third biggest value in 2/13, p, -3? -3 Let f = 638 - 637.8. Which is the biggest value? (a) -2 (b) -5 (c) -4/7 (d) f d Let x(p) = -6p*2 - p - 1. Let l be x(-1). Suppose -14w + 12 = -20w. Which is the fourth biggest value? (a) 1/2 (b) 2 (c) w (d) l d Let q = 813 - 883.8. Let g = 80 + q. Let l = 9 - g. What is the biggest value in 2/7, l, 3/4? 3/4 Let r be 2(8 - (2 + -4)). Let t = -20 + 4. Let a be r/t - 3/(-12). What is the second biggest value in a, -1/2, 0.2? -1/2 Let o = 0.24 - 0.13. Let m = 6.89 + o. Let g = -2.38 + 2.38. Which is the third biggest value? (a) m (b) g (c) -0.5 c Let b = 167 - 27. Let g = 154 - b. What is the second smallest value in g, 1/2, -0.2? 1/2 Let f = 129 - 128.5. Let z = -0.44 + 3.44. What is the third smallest value in z, -1/6, f? z Let z = -6.3 + 8. What is the third biggest value in -3, 0.4, z, 1? 0.4 Let v(l) = -10l3 + 91l*2 - 12l + 31. Let i be v(9). Let o be -2 + 2 - -11. Which is the smallest value? (a) i (b) o (c) -0.4 c Let q = 111 + -553/5. Let z = 279 + -275. What is the second biggest value in z, -11, q, -0.4? q Let x = 4.9 - 5.46. Let n = x - -0.96. Which is the second smallest value? (a) -4 (b) n (c) 0 (d) -4/7 d Let b(a) = -3a - 16. Suppose 0 = 4*f + 12 + 4. Let n be b(f). What is the fourth smallest value in -5, n, -1/4, -3? -1/4 Let j = -23.3 - 3.7. Let w = -18 - j. Let g = -5 + w. What is the third smallest value in -2, -2/13, g? g Let h = 1/82 - -121/164. Let x = -55 - -83. Let w = x - 26. Which is the second smallest value? (a) h (b) -4 (c) w a Let w = -15/8 - -61/24. Let m = 0.1 - 0.2. Let p be (-76)/20 + 0 - -3. What is the third biggest value in p, w	{ "pile_set_name": "DM Mathematics" }
/49 - 78/91. Let x = 13 + -9. Suppose -xd + 120 = -0d. Calculate the greatest common divisor of d and n. 6 Suppose 1257 = -136u + 1801. Calculate the highest common divisor of 14828 and u. 4 Let w = 248 - 28. Let x(a) = -a + 15. Let r be x(-5). What is the highest common divisor of w and r? 20 Let s(t) = 3t*2 + 1. Let w = -80 + 81. Let c be s(w). Suppose -4n + 4v + 200 = 0, -cn + 110 = -2n - 4v. Calculate the greatest common factor of n and 15. 15 Let g(y) = -152y - 2678. Let b be g(-18). What is the highest common factor of 2146 and b? 58 Suppose 6s = -6481 + 6535. Calculate the greatest common factor of 2961 and s. 9 Suppose -66j = 55j - 348480. What is the greatest common divisor of 15 and j? 15 Let f = 2431 - 2260. Let b = 52 - -347. What is the highest common divisor of b and f? 57 Let r = -6138 - -6319. What is the highest common divisor of 8 and r? 1 Let y be (6/9)/(5/30). Suppose yu - 6u + 3u = 0. Suppose -s + 5i - 11 = u, 2s - 4i + 0 = -4. What is the highest common divisor of 8 and s? 4 Suppose -3x + d = -145, 30d + 52 = x + 26d. Calculate the highest common factor of x and 321. 3 Let d(h) = -h2 + 278h - 1094. Let b be d(4). Let u = -254 + 358. Suppose -3o = -2i - u, o - 33 = -bi + 7. What is the highest common factor of 3 and o? 3 Let w be ((-1844)/(-10)1)/(-4 + 2526/630). What is the highest common factor of 42 and w? 42 Let p be (102/9)/(4/6). What is the highest common factor of p and 2125? 17 Let f be 165 - (0 - 3 - -4)/((-2)/(-4)). What is the greatest common factor of f and 12877? 163 Let u be (80/(-6))/(3/(-9)). Let y(p) = 3679p - 22064. Let j be y(6). What is the highest common factor of u and j? 10 Suppose 0 = -11912y + 11913y - 221. Calculate the highest common factor of y and 170. 17 Let m(a) = -34 - 3a - a*2 - 17a + 68. Let p be m(-18). What is the greatest common divisor of 56 and p? 14 Let k(l) = 36l - 106. Let m be k(17). Let t = m - 387. Let x be (4/(-6))/(2/(-51)). What is the greatest common divisor of x and t? 17 Let w(p) = 1378p - 4119. Let j be w(3). Calculate the greatest common factor of 3165 and j. 15 Let y be (3 + -5)/(42 - 32) - 162/(-10). What is the highest common divisor of y and 14? 2 Let x be 3/12 + (67100/16)/25. What is the greatest common factor of x and 768? 24 Suppose 5952 = -27h + 59h. Suppose -13a = -h - 1218. What is the highest common factor of 135 and a? 27 Let c(o) = -23o + 11o - 249 - 19o + 0o + 140. Let a be c(-6). What is the highest common divisor of 49 and a? 7 Let u be 2 - (-4 + 1 - 3). Let k(d) = -d2 - 42d + 51. Let s be k(-41). Calculate the greatest common factor of s and u. 4 Suppose -5d - t = -432, -4d - t + 332 = -13. Let f be 696/(-16)3/(27/(-6)). Calculate the highest common factor of f and d. 29 Let y = 71268 + -70817. Let j(p) = -5p - 4. Let b be j(-3). Calculate the highest common divisor of b and y. 11 Suppose -5c = -3o + 8o - 185, -3c + 75 = 2o. Let j = o - -27. Calculate the highest common divisor of 84 and j. 21 Let x = -9562 + 19165. What is the highest common divisor of x and 99? 99 Let i = -608 - -665. Calculate the highest common factor of 627 and i. 57 Let m be (-47000)/(-280) + (-4 + 2)/(-14). Calculate the highest common divisor of m and 108. 12 Suppose 12w - 186624 = -6w - 174w. Calculate the greatest common factor of w and 63. 9 Let m(g) = 1289g3 - 2g*2 + 1. Let u be m(1). Suppose 932o - 7831 = 3967 + 47937 - 7543. What is the greatest common factor of o and u? 56 Suppose -o = -3 + 6. Let r = 2 - o. Suppose 0 = -587a + 10671 + 21614. What is the highest common factor of r and a? 5 Let s be ((-28)/(-98))/(10/2170). Calculate the highest common divisor of 6758 and s. 62 Let z(o) = 2o*2 - 13o. Let b be z(12). Let v(l) = -2l2 - 187l - 389. Let t be v(-91). What is the highest common factor of t and b? 66 Let k = -2872 - -4339. Suppose -1393 = -11j + k. Calculate the greatest common divisor of 104 and j. 52 Let f = -8884 - -9343. Calculate the greatest common factor of 135 and f. 27 Let c(l) = 3l3 + l2 - l. Let d be c(1). Suppose -du + 6 + 21 = 0. Suppose 2x - 72 = x. Calculate the highest common factor of u and x. 9 Suppose -2v - w = -15402, 3v + 2w - 23404 + 298 = 0. Calculate the greatest common divisor of v and 6. 6 Let l = -51 - -95. Let c = l + -38. Let a be (4/6 - c/(-18)) + 17. What is the greatest common factor of a and 9? 9 Suppose 0 = -17v + 21v + 19v. Suppose 4c = -5x - 24 - 20, -28 = 4x + 5c. Let q be (x + -7)/(0 - v - 1). Calculate the greatest common factor of q and 95. 19 Let s be 6971(-84)/(-21). Calculate the greatest common factor of 68 and s. 68 Suppose -h = -4p + 7, 11p = 2h + 6p + 5. Let m be 54/h160/24. Let j = m - 63. What is the highest common divisor of j and 9? 9 Suppose -3k + 120 = 4z, 3z = -5k + 126 + 63. Let r = -24445 - -24465. What is the highest common factor of r and k? 4 Suppose -1142 = -5m - 0g + g, 1148 = 5m - 4g. Suppose -w - 73 = -m. Suppose -3i = 2i - w. Calculate the highest common factor of i and 124. 31 Let v(f) = 3f - 7. Let m be v(-6). Let h = m + 40. Suppose 1911d = 1934d - 230. Calculate the highest common factor of h and d. 5 Let o(b) = -b*3 + 16b*2 + 53b - 146. Let y be o(16). What is the highest common factor of y and 54? 54 Let n(p) be the second derivative of p*3/2 - 21p*2 - 2p. Let u = -1866 + 1890. Let o be n(u). Calculate the greatest common divisor of 10 and o. 10 Let b(y) = -35y + 10. Let f(k) = -18k + 4k - 59k*2 - 4 + 58k*2. Let q be f(-14). Let z be b(q). What is the highest common factor of 30 and z? 30 Let s(y) = y + 42. Let r be s(-2). Suppose -42k = -rk - 50. Calculate the greatest common factor of k and 20. 5 Let z be (-480)/(-60) + 02/(-4). Calculate the greatest common factor of z and 14. 2 Let y(p) be the second derivative of 5p5/2 + p4/6 - p3/6 - p2 - 16p - 3. Let z be y(1). Calculate the highest common factor of 21 and z. 7 Let p be 39/2 + (5/10 - 0). Let x be 2/(-3)57/2. Let a = x + p. Calculate the highest common divisor of 1 and a. 1 Let m(a) = 438a + 3591. Let l be m(-8). Calculate the greatest common factor of 34104 and l. 87 Let m(t) = t*2 - 18t - 29. Let w be m(20). Suppose -37p + j + 261 = -33p, 4p = -3j + 273. What is the greatest common divisor of p and w? 11 Let r = 206 - -19. Let s = r + -202. What is the greatest common factor of s and 23? 23 Let q(x) = -x*2 + 27x - 48. Let r be q(24). Let g = -113 + 121. Calculate the highest common factor of r and g. 8 Let p be (-2)/(-2)(5 - (4 - -1)). Let g(o) = -o3 - o2 + 4o + 110. Let a be g(p). Calculate the greatest common divisor of 44 and a. 22 Let c(j) = 92j - 208. Let i be c(5). Calculate the greatest common divisor of 609 and i. 21 Let b(m) = m3 + 38m*2 + 101m - 48. Let o be b(-35). What is the greatest common divisor of o and 8? 4 Let t be (-1 - -5)/(475/(-80) - -6). Let u = t + -62. Suppose 0 = -w + up + 12, 2p - p = 3w - 51. Calculate the greatest common factor of 2 and w. 2 Let o(y) = 57 + 55 - 112 - 6y. Suppose 4p + 5 = -3. Let r be o(p). What is the highest common factor of 84 and r? 12 Let a be ((1 + -4)/3)/((-2)/8). Suppose m - 4 = -5s + 27, -a = -2s. Suppose -m - 15 = -3l. Calculate the greatest common factor of l and 192. 12 Let u(h) = 2h2 - 8h - 19. Let g be u(6). Suppose 0 = -o + gy + 301, -2o + 2y + 36 = -550. What is the greatest common divisor of 97 and o? 97 Suppose -4m + 312 = 3z, 3m + 77 = 5z - 385. Suppose 0k + 48 = 2k. What is the greatest common divisor of z and k? 24 Let n = -741 - -897. Suppose -n = 61v - 87v. What is the highest common factor of v and 6? 6 Let c(b) = 5b - 19. Let s be c(7). Let j be ((-9)/6)/((-6)/s). Let t be 0/((-8)/2)1 - -28. Calculate the highest common factor of j and t. 4 Suppose a - 162 = -36. Suppose 70 = -f + 2z, -3f + 2z + 146 = -5f. Let q = f - -90. What is the highest common divisor of a and q? 18 Let b(i) = 36i - 603. Let l be b(22). Calculate the greatest common divisor of l and 729. 27 Suppose 0 = -5259n + 5285n - 286. What is the greatest common divisor of n and 117? 1 Let q be 255/(-50) + 5 + (-632346)/(-260). What is the highest common factor of q and 104? 8 Suppose 5f + h - 5h - 183 =	{ "pile_set_name": "DM Mathematics" }
ve of d*3fv - 3d*3f - 2d3v*3 + 14d*2f - dv3 + 2fv2 wrt d. 6fv - 18f - 12v3 What is the second derivative of 3a*3 - 16a*2 - 79a? 18a - 32 Find the third derivative of -157b*6 + 2b*5 + 292b*2. -18840b*3 + 120b*2 Differentiate -113gt3 - gt*2 + 316t3 - t2 wrt g. -113t3 - t2 What is the third derivative of 3c*3j*2o*3z - 8c3j*2 + 2c*2o*2 - 7cj2 - jz - 2o3z wrt c? 18j2o*3z - 48j2 What is the second derivative of 10d*5 + 33d*4 + 50d + 4 wrt d? 200d3 + 396d*2 What is the first derivative of 2jt2 + 1024j + 151t2 wrt t? 4jt + 302t Find the first derivative of -oz2 + 211oz + 3o + 1044z2 wrt o. -z2 + 211z + 3 Find the third derivative of 29i4 - 3i*3t + 338i2t wrt i. 696i - 18t Find the second derivative of -aj2m - 2aj*2q - ajm*2q + 10ajm2 - 3ajm - 2a - 25j*2m*2q + 10jmq wrt j. -2am - 4aq - 50m*2q What is the first derivative of 153d2k + 72d2 wrt k? 153d*2 What is the second derivative of -14440b*5 + 20649b? -288800b3 What is the third derivative of -836i*2y*3 - 1045i*2y*2 - 2iy3 wrt y? -5016i*2 - 12i Find the first derivative of 304w3 - 61. 912w*2 Find the second derivative of 808d*3j2 + d2j2 - dj*2 - 4d + 106j2 wrt d. 4848dj2 + 2j*2 What is the third derivative of -64dv5 + 15dv2 + 7v*2 wrt v? -3840dv2 What is the third derivative of -b6 - 36b*5 - 3b*2 + 13 wrt b? -120b*3 - 2160b*2 Differentiate 2042n*3q*2 - 2885n*3 + 2q*3 wrt q. 4084n*3q + 6q2 What is the second derivative of -316n*2 - 13n + 2? -632 What is the second derivative of -18992p2u*2 - 192p*2u + pu - 5p wrt u? -37984p2 Find the second derivative of -218f*3l*2n*2 + 105f*3ln2 - f3n*2 + 10f*2l*2n*2 - fln2 + 3l wrt l. -436f3n*2 + 20f*2n2 Differentiate -k3 + 162k2 + 342 wrt k. -3k*2 + 324k Find the first derivative of 881r2 + 825 wrt r. 1762r What is the second derivative of 392n2q*2 + 5nq2 + 2nq - 7q wrt n? 784q2 What is the first derivative of -2722i*2y + 18350i2 wrt y? -2722i2 Differentiate -g2 + 1596g + 5655. -2g + 1596 What is the second derivative of 17185v2 + 7935v - 2? 34370 Differentiate 8173c3 + 5619 with respect to c. 24519c*2 Find the first derivative of -193o + 1114 wrt o. -193 Find the second derivative of -4b2h + b*2n3 + b2n2p - 5bhn2 - 2bhp + bn3 - bnp - 7h wrt b. -8h + 2n*3 + 2n*2p Find the first derivative of 14885o2 - 15234. 29770o What is the derivative of 2h3q - 12h2q3 - h2q - 18q*3 - 16 wrt h? 6h*2q - 24hq*3 - 2hq Find the second derivative of 456o5 - o2 + o - 276 wrt o. 9120o3 - 2 Differentiate s3z - 96s2z3 - s2z + 259z*3 - 7z wrt s. 3s2z - 192sz*3 - 2sz What is the derivative of -hy*4 - 78hy2 - 13h - 5 wrt y? -4hy*3 - 156hy Find the first derivative of mow3 - mo - 2mw*3 + 3m - 61ow*3 - 16w*3 wrt o. mw*3 - m - 61w*3 What is the third derivative of 193t*6 - 3t*4 + 324t*2 wrt t? 23160t*3 - 72t Find the second derivative of -3399y3 + 1791y wrt y. -20394y Differentiate -467r + 861 wrt r. -467 What is the second derivative of 192k2 + 3k + 56 wrt k? 384 What is the derivative of 23i3rz2 - 9i*3 + 39i*2rz2 - 4i*2 + 9iz2 wrt r? 23i*3z*2 + 39i*2z*2 Find the third derivative of 19j*6 - 555j*2 wrt j. 2280j*3 Differentiate 336u*2 - 247 with respect to u. 672u What is the first derivative of -313c4 + 4c*3q + 3069q wrt c? -1252c*3 + 12c*2q Differentiate 355y - 345. 355 Find the second derivative of 1703c*5 - 4c - 119 wrt c. 34060c3 What is the third derivative of -37bhn*3 - 4bhn*2 - 5bh - 3bn6 + 2bn2 - 53bn - 13hn3 wrt n? -222bh - 360bn3 - 78h Differentiate -q*3y - 27q3 + 46q*2y + 24y - 23 wrt q. -3q*2y - 81q2 + 92qy What is the second derivative of -7786d*5 + 16d + 54? -155720d3 Differentiate 3az - 177a + 53z - 4 with respect to z. 3a + 53 Find the third derivative of -2g4ht + 370g*4t + 5g3p + 865g2h - g*2t + 3g2 - gp wrt g. -48ght + 8880gt + 30p Find the second derivative of -148d5 - 2d*2 + 2d + 87 wrt d. -2960d3 - 4 Find the second derivative of -2ad2 - 2ad - 2a + d*5 + 36d*2 + 78d wrt d. -4a + 20d3 + 72 Differentiate -c3hn2 - c3 + 1402c2n*2 - 882hn2 wrt h. -c3n*2 - 882n*2 Find the second derivative of -7o*2rx - 66o*2r - 3orx - 2rx - 898x wrt o. -14rx - 132r What is the derivative of 5s*2u4 + s2u - 86s2 - u4 wrt u? 20s2u3 + s2 - 4u3 Find the third derivative of 39j*2n*2q*3 - 5j*2n*2q2 - j2n2 + 2jn2q*2 + 4jn2q wrt q. 234j2n*2 What is the second derivative of -254i*3x*2 + 3i*3 + 35x wrt x? -508i3 Find the second derivative of 2i*3my3 - 89i*2m*3y - 10im*2y*3 + 2iy3 + 4iy - 2m*3y wrt i. 12imy3 - 178m*3y What is the third derivative of -20h2k*3 - 4h*2k*2 - 197hk2 + 42k*3 wrt k? -120h*2 + 252 Find the second derivative of -273r*3 - 23r + 3. -1638r What is the second derivative of -d3l*2 - 16d*3l + 4d2l + 6d2 - 65dl2 + dl wrt l? -2d3 - 130d Differentiate 233f2 - 543. 466f Find the third derivative of -y*4 - 2586y*3 + 14y*2 + 18. -24y - 15516 What is the derivative of 10mq + 18m + 680q wrt m? 10q + 18 What is the third derivative of -3g*4h + 4g4 + 3g*3h - g*2h - 70g2 wrt g? -72gh + 96g + 18h Find the second derivative of -40h*2ly3 - 4h*2ly2 + h2ly - 2hl + hy*3 - 29hy - 3ly + 2y wrt h. -80ly*3 - 8ly2 + 2ly Find the first derivative of -3c*3j + 22cj - 1138j wrt c. -9c*2j + 22j Differentiate 20q*3s*3 - 13q*3s - 422s3 wrt q. 60q*2s*3 - 39q*2s What is the third derivative of 2457r3y*3 + 89r*2y - 10ry*3 wrt r? 14742y*3 What is the second derivative of 1362o*4 + 3038o? 16344o2 What is the third derivative of 61g*5 + 2g*2 - 144g? 3660g2 What is the derivative of 980u - 2633? 980 Find the third derivative of 28w4 + 13w*3z + 2w2z + w*2 + 161wz wrt w. 672w + 78z Find the first derivative of 1077u*4 - 338 wrt u. 4308u*3 What is the second derivative of -35x*3 + 8x*2 - 154x - 2 wrt x? -210x + 16 What is the third derivative of -846m3 - m2 - 976? -5076 Find the third derivative of -13j4 + 2j*3 - 201j*2 wrt j. -312j + 12 What is the third derivative of 37a2n*5 + 4a*2n*4 + 6a*2n*2 - 17n*2 wrt n? 2220a*2n*2 + 96a*2n Find the third derivative of 20c4 - 2c*3pr2 + 8c*3r*3 - 3c*2 + 2cpr*3 - cpr - 5p wrt c. 480c - 12pr2 + 48r*3 What is the second derivative of -2cgt*2y + 3cgt2 - cgty + 2cgt + 3cgy - 2209ct*2 + gy - 12g + 14ty wrt t? -4cgy + 6cg - 4418c Find the second derivative of -324d*2i*2 - 7d*2 + 2di - 4d + 9i4 + 28i wrt i. -648d2 + 108i*2 What is the third derivative of -467c*6f + 3c2 - 3cf + 2c + 5 wrt c? -56040c3f Find the third derivative of -14444h3 + 41h*2 + 151h wrt h. -86664 Find the first derivative of 31j3 + 165 wrt j. 93j*2 Differentiate 108s*3 - 115. 324s*2 What is the third derivative of 288j*3v*3y2 + j3vy*3 + 346j*2v*3y3 - j2v3y - j*2vy wrt j? 1728v*3y*2 + 6vy3 Find the second derivative of -730g*2 + 249g wrt g. -1460 What is the derivative of -18739u + 22073 wrt u? -18739 Differentiate 2l*4z*2 + 149l*2z*3 + 60z*3 + 5z*2 with respect to l. 8l*3z*2 + 298lz3 Find the second derivative of -237d*2k*2 - 2dk2 - 136d wrt d. -474k2 What is the derivative of -4ru2v + 9ru*2 - 5rv + u2v + 5u - 15v wrt r? -4u2v + 9u2 - 5v Differentiate 3k3m + k*3p - 82k2m*2p - 13k2m*2 - 6km2 - 2kmp2 wrt p. k3 - 82k2m*2 - 4kmp Find the third derivative of -70b*3	{ "pile_set_name": "DM Mathematics" }
.3 a Let h(w) = -w*3 + 6w*2 + 4w - 20. Suppose -24y + 15y + 54 = 0. Let u be h(y). Which is the nearest to -0.1? (a) 0.3 (b) u (c) 3 a Let u = 18.5 + 4.5. Let v = u - 23.3. Which is the nearest to -2/5? (a) v (b) -5 (c) 3 a Suppose 605 = 11a - 220. Let b = a - 80. What is the closest to 0 in b, -1/11, -3/5? -1/11 Let a be -5 + ((-1)/6)/((-3)/81). What is the closest to -2 in 27/7, 2, 0.1, a? a Let d = 3.9 + 0.1. Let x be (-3 - 7 - 2) + 8. What is the nearest to 1 in -3, x, d? d Let g be -26/72-4. What is the nearest to 1 in g, 0, -21? g Let l = -85/649 - 3/59. Which is the nearest to -0.2? (a) 0 (b) 2 (c) 0.1 (d) l d Let k = 99.5 + -99.8. Let j = -0.03 - 1.97. Which is the nearest to 1/3? (a) k (b) 4 (c) j a Let s = 942 + -935. What is the closest to -0.2 in -1/7, s, 0.4, -5? -1/7 Let b = -2 + 2.3. Let h = 53/2 + -155/6. Let y = 25 - 26. What is the closest to y in h, b, -1/4? -1/4 Let w = 67/65 - 3/13. Let b = 18 - 31. Let a = -13.5 - b. What is the nearest to 1 in w, a, 3/4? w Let z be (2/(-6))/(14/21246). Let y = z + 505. Let u = 80 - 76. Which is the closest to -1? (a) u (b) y (c) 2/3 b Let q = -71.1 + 72. Let g = 0.046 + 2.854. Let j = q - g. Which is the closest to 0.1? (a) j (b) -1/8 (c) 1/4 c Let w = -43/8 + 285/56. Let f = 790/3 - 264. Which is the nearest to w? (a) -1 (b) f (c) 0.3 b Let f = -0.6 - -0.3. Let v = -123.5 + 129.5. Which is the nearest to v? (a) 5 (b) f (c) -3 a Let s = 27 + -63. Let h = s + 35. Which is the closest to h? (a) 22 (b) 2/15 (c) -5 b Let m = 2909/11652 - -1/2913. Let n be 1 + -1(1 + 1). What is the closest to n in 2, m, 3? m Let q = -2651 + 55673/21. What is the nearest to -2 in q, -1, 2/11, 5? -1 Let n = 25 + -24.6. Suppose 2x = 9x - 7. Let k = 35 - 211/6. What is the nearest to x in -5, k, n? n Let z = -25.0682 - -0.0682. Which is the closest to z? (a) 5 (b) -3 (c) 2/7 (d) -2 b Let t be ((-3)/(-2))/(28 + -32). Which is the closest to -1? (a) -6 (b) -1/4 (c) t c Suppose 0 = -d - 20d + 21. Which is the closest to -1? (a) 2/7 (b) -0.04 (c) d b Let n = 25 - 42. Let h = n + 16.6. Let f = -4.6 + h. What is the closest to 2/7 in -3, f, 4? -3 Let n = -6.1 + 2.2. What is the nearest to n in -1/3, 1/5, -0.5, -0.3? -0.5 Let x = 124 + -122. Let v be (-5 - 80/(-14))x/(-5). Suppose h = 4i - 19, 6 = i + 2. Which is the nearest to 1? (a) 8 (b) v (c) h b Let d = -0.11 - -0.31. Let z(f) = -f3 + 10f*2 - 9f - 1. Let t(l) = l*2 - 5l - 5. Let r be t(-2). Let b be z(r). What is the nearest to 1 in b, -22, d? d Let y = -23566 + 23571. Suppose 54 = -2d - d. Let r be 6/21 + d/14. Which is the nearest to r? (a) 0.5 (b) 2/9 (c) y b Let x = -56 + 3. Let c be (x/18 - (-3 + 0))-8. What is the nearest to 0 in -3/4, -2/3, c? c Let q be 6/(-2) + (-120492)/(-38692). Let p = -2/569 - q. What is the nearest to -1/4 in 3/7, 0.3, p? p Let y = -163/2 + 80. Let z = -0.38 - 0.02. Which is the closest to -2? (a) 4/9 (b) y (c) z b Let b = 37 + -32. Suppose -1 - 4 = by. What is the closest to y in -5, -2, 0.3? -2 Let d = 6.13 - 0.13. Let v = -12 + d. Let q = -10 - v. Which is the nearest to q? (a) -2 (b) 1 (c) 0.4 a Let y = -5.2 - -4.9. Let k(s) = -s2 - 7s - 6. Let f be k(-5). Which is the nearest to 3? (a) 0 (b) y (c) f c Let k = -31 - -27. Let f = 8.05 + -0.05. What is the closest to 1 in k, 4, f? 4 Let b = 2.3 - -2.7. Let l = 8 - 5. What is the nearest to -3 in 2/17, l, b? 2/17 Let o = 103/9 + -35/3. Which is the closest to 6? (a) o (b) -4 (c) 1/3 (d) -2/3 c Let u be (-288)/132 + 1 + 1. Let o(j) = 3j - 2. Let v be (0 - 1)/(1/(-2)). Let p be o(v). What is the nearest to -1 in u, p, 0.3? u Suppose 0 = -3u + k + 51, 3u - 4k = -12 + 72. Suppose 3z = -4 + u. What is the nearest to -1/4 in 5, -5, z? z Let g = 1230 + -1232. What is the closest to -0.2 in -1, g, 0.1, 6? 0.1 Let p = 0.013 + -0.01. Let n = p - -0.017. Which is the closest to -0.1? (a) 2 (b) n (c) -5 b Let r = -165 - -165.79. Let h = r + -3.79. Which is the nearest to 0.1? (a) 0.05 (b) -2 (c) h a Let o = -43 + 44. Let s = 0.5 - 0.6. Let w = 7 + -3. What is the closest to o in s, w, -5? s Let g = -0.0269 - -0.1269. Which is the closest to -4? (a) g (b) -1/5 (c) -2 c Let m(j) = j2 - 1 + 4 + 1 - 2 + 8j. Let x be m(-8). Let v be 1/((-1)/1)-3. Which is the nearest to x? (a) 1/5 (b) v (c) 2/21 b Let r = -63 + 58. Let d = r + 9. Which is the nearest to 1? (a) 0.02 (b) d (c) 5 a Let q = -9.24 + 9. Let x = 0.16 - q. What is the closest to x in 0, -2, -0.3? 0 Let j = -893 - -893. Which is the closest to j? (a) -3/4 (b) -67 (c) -2/7 c Let n = 24 + -24.1. Let g = 1/238 - -9/170. Let r = 6/7 - g. What is the nearest to n in r, -5, 5? r Let r be -1 - ((-1 - -3) + -3). Suppose -2c - 3 + 1 = r. What is the closest to 1/3 in -1/7, c, 0.1? 0.1 Let q = -104.66 + 105. Which is the closest to q? (a) -5 (b) 1/6 (c) -4 (d) 2 b Let d = -279 + 274. Let x be 2 - (-33)/(-36)2. Let s = 0 - -0.1. What is the nearest to s in x, 1, d? x Suppose m + 98 = -0j + j, 2m - j + 192 = 0. Let q = -97 - m. What is the nearest to -5 in -2/5, q, 1? q Let r = -2504 - -2502. Which is the closest to 1? (a) 45 (b) r (c) -4 b Let b = -9.9 - -11.9. Let r(m) = m3 - 3m + 2. Let i = -12 + 14. Let s be r(i). What is the nearest to 2/5 in b, s, -0.1? -0.1 Let s = 263 + -265. Which is the nearest to s? (a) -0.4 (b) -2 (c) 3/4 (d) 0.04 b Let t = 10 - -19. Let m = t - 38. Which is the closest to m? (a) 3 (b) -5 (c) 5/2 b Let h be (-50)/(-250) + (168/15)/4. Which is the closest to -0.1? (a) 156 (b) -0.1 (c) h b Let s = -424.9 - -425. Which is the nearest to 2/5? (a) -1/6 (b) -6 (c) s (d) -25 c Let i = 8 - -1. Let o = 0.3096 - 0.8096. What is the closest to 2/7 in o, i, -2/7? -2/7 Let s = -0.159 - 2.841. What is the nearest to 2/3 in s, 376, 2, -4? 2 Let w = -163 - -166. Which is the closest to w? (a) -0.5 (b) 5 (c) 2/9 b Let r be (-6231)/1023 + 16. Which is the closest to 0.2? (a) -4 (b) r (c) -5 (d) 0.4 d Let r = 6 + -61/10. Let s = -2.83 - 0.17. Which is the nearest to -0.2? (a) 1/7 (b) r (c) s b Let i = -0.27 + -4.53. Let s = i + -0.2. Suppose 0 = -4h - 2y + 2, 0 = -h + y + 6 - 7. What is the nearest to h in 3, s, 0? 0 Let m = -221/3 - -73. Let y = 421/5 - 84. What is the nearest to m in 1, 0.4, y? y Let r = -1 + 0.5. Suppose 5b + 7 - 2 = 0, 4x + 2b - 5346 = 0. Let k be 1/(-4) - (7 - x/196). What is the closest to 1 in k, r, 5? k Let j = 44.6 + -43.6. Let w = 2 - 9. Let n = w - -10. What is the closest to -1 in n, j, -1? -1 Let k = -0.011 + -0.989. Suppose 5c + 14 = -6. Let w be 1 + -1 + c/(-8). What is the closest to w in 0.5, k, 2/15? 0.5 Suppose y + 3k + 5 = -8, -4y - k - 8 = 0. Let u be y + (-9)/(-6) + -1. Let d = 0.71 + 0.29. Which is the nearest to d? (a) u (b) 3 (c) -2 a Let z = 1248 + -1253. Which is the nearest to 0.1? (a) 7 (b) -0.5 (c) z (d) -3 b Let a = -0.66 - -54.66. Let f = a + -70.3. Let u = f - -16. What is the closest to u in -2, 3, 4? -2 Let w = 0.35 - -0.05. Let b be (-3)/(-14) + (-2)/4. Let p = 0.1371 + -0.1371. What is the closest to 1 in b, p, w? w Let z = 127 + -129. What is the nearest to z in 5, 0.1, -2/9? -2/9 Let m = -4142/3 + 1380. What is the nearest to -1/4 in -2/11, 92, m? -2/11 Let a(b) = -2b + 2. Let o be a(-3). Suppose 0g = g + o. Let c be g/(-20)15/(-27). What is the nearest to -2/5 in 0.1, 2, c? c Let u be (-15)/(-2)(-7)/(-490). Let d = u - -9/14. What is the closest to d in -4, -2/7, 4? -2/7 Let l = -94 + 108. Which is the closest to l? (a) 0.3 (b) 3 (c) 11 c Let u = -0.6 - -0.2. Let n = -0.7 - u. Let t = -42.9 - -42.8. Which is the nearest to 2? (a) -4 (b) t (c) n b Let l = 1.1542 + -0.1542. Which is the closest to l? (a) 91 (b) -0.07 (c) -0.1 b Let f = -32 - -35. Let h = 30 + -28. Which is the closest to 2/3? (a) f (b) -1/9 (c) h b Let h = -14 - -40/3. Let o be 10/(-5) - (-4)/6. What is the nearest to h in o, 1, 0.02? o Suppose -5n + 3q + 72 - 446 = 0, -2q = n + 67. Let m = n - -44. What is the nearest to 0 in -3, -0.5, m? -0.5 Let x = 119 - 119.5. Let g = 122 - 483/4. Which is the nearest to x? (a) -2/15 (b) g (c) -4/7 c Let k = -129/4 - -33. Let o = 8.5 + -9. Which is the nearest to 0.8? (a) 3 (b) o (c) k c Let	{ "pile_set_name": "DM Mathematics" }
- 11 + 124n3. 266n*3 Collect the terms in 127 - 5b*2 - 37 - 40 - 50. -5b*2 Collect the terms in -114y - 55y + 161y. -8y Collect the terms in 3b*2 - 16b*2 + 41b*2. 28b*2 Collect the terms in 60o*2 - 8 - 8o + 8o - 62o*2. -2o*2 - 8 Collect the terms in -2m + 30 + 4m + m - 7 - 6m. -3m + 23 Collect the terms in 1 - 4 - 6391m + 2 + 3. -6391m + 2 Collect the terms in 158v - 127v - 2v*3 - 155v. -2v3 - 124v Collect the terms in 473f3 - 191229f + 191229f. 473f*3 Collect the terms in 25 + 2i - 27 + i + 4i. 7i - 2 Collect the terms in 7o + 12961 - 12961 - 22o. -15o Collect the terms in 9q - 6q - q2 - 2q + 3q - 28q*2. -29q*2 + 4q Collect the terms in 48 + 4c3 + 8c*3 - 11c3. c3 + 48 Collect the terms in -119w2 - 11169 + 11169. -119w*2 Collect the terms in -2185069 + 2185069 - 12i*2. -12i*2 Collect the terms in 14145u + 5815u - 2406u. 17554u Collect the terms in 11 - 8 + 19v - 3 - 16v - 4v. -v Collect the terms in -2d + 219d*3 + 2d - 1169d3. -950d*3 Collect the terms in -253z*3 - 113z*3 + 373z*3. 7z*3 Collect the terms in -2k - 100 + 3470 + 2999. -2k + 6369 Collect the terms in -15853x + 31611x - x2 - 15758x. -x*2 Collect the terms in 17q*3 - 13q*3 + 122q*3 - 13q*3 - 32q*3. 81q*3 Collect the terms in -65788v - 65789v - 65785v - 3v3 + 197362v. -3v3 Collect the terms in -4 - 560r*2 + 4 + 573r*2. 13r*2 Collect the terms in -571r*2 - 3r*3 + 1184r*2 + 3r - 613r2 - 4r. -3r3 - r Collect the terms in 2183h + 7331h3 + 608h*3 - 2183h. 7939h3 Collect the terms in 13 + 16 - 28b*2 - 32. -28b*2 - 3 Collect the terms in -8282 + 8282 - 301b. -301b Collect the terms in -68061v + 59v2 + 68061v. 59v2 Collect the terms in 1 - 4 + 1 - 40283f. -40283f - 2 Collect the terms in -66c*2 - 63c*2 - 63c*2 + 195c*2 - 71 + 71. 3c*2 Collect the terms in 35782u*2 - 1 + 1 - 35783u2. -u2 Collect the terms in -20m + 2m*3 - 6m - 19m + 45m. 2m3 Collect the terms in -1 + 4i*2 - 13i*3 + 22i*3 + 19i*3 + 21i*3. 49i*3 + 4i*2 - 1 Collect the terms in 16f - 16f + 48941f*2. 48941f*2 Collect the terms in -3l*2 - 1158l - 2l2 + 1172l. -5l2 + 14l Collect the terms in -320 + 137 + 194 + s2. s2 + 11 Collect the terms in 4554g - 9645g + 5094g. 3g Collect the terms in -618z3 - z2 - 612z*3 + 1212z*3. -18z3 - z2 Collect the terms in 7 - 115698b - 3 - 4. -115698b Collect the terms in -2x3 - 2200x - 2266x + 6663x - 2197x. -2x*3 Collect the terms in 7r*3 - 936 - 7r*2 + 936. 7r*3 - 7r*2 Collect the terms in 1418003b*3 - 708992b*3 - 708983b*3. 28b3 Collect the terms in t2 + 8 - 23 + 3t - 3t. t*2 - 15 Collect the terms in 1074o + 344o + 772o. 2190o Collect the terms in 21 - 7 - 14 - 527s. -527s Collect the terms in 6919p*3 - 1 - 6939p*3 + 1. -20p*3 Collect the terms in -2392q*3 - 2169q*3 - 97q*3. -4658q*3 Collect the terms in 9c*3 - 4137754c + 14 - 14 + 4137754c. 9c*3 Collect the terms in 146o - 369o + 1 - 1 + 100o + 126o. 3o Collect the terms in -233a2 + 220a*2 - 1193 + 1193. -13a*2 Collect the terms in 115y*2 - 88y*2 - 80y*2. -53y*2 Collect the terms in -3y*2 - 4y*2 - 3891y3 + y2 + 3949y3 + 6y*2. 58y*3 Collect the terms in -556w*3 - 4w*3 - 590w*3. -1150w*3 Collect the terms in 180b - 63b - 42b. 75b Collect the terms in -89n*3 + 33n*3 + 108n*3. 52n*3 Collect the terms in -160m - 11 + 45m - 13. -115m - 24 Collect the terms in -513 - 518 + 1568 - b - 537. -b Collect the terms in 3p + 206 - 65 - 4p + 339. -p + 480 Collect the terms in 67j + 71j - 142j. -4j Collect the terms in -99p - 1 - 6p*2 - 1 - 520p. -6p2 - 619p - 2 Collect the terms in -32u - 26u + 4u - 49u - 31u. -134u Collect the terms in -162m2 - 3 + 4 - 163m*2 + 317m*2. -8m*2 + 1 Collect the terms in -149 - 5095k + 149. -5095k Collect the terms in 67198259 - 67198259 - k3. -k3 Collect the terms in 2a + 4261a2 - 2a - 397a2. 3864a*2 Collect the terms in -293k - k*2 + 51k - 706k. -k2 - 948k Collect the terms in -1835z2 - 1770z*2 + 5476z*2 - 1848z*2. 23z*2 Collect the terms in -2 + 685n*2 + 1324n*2 + 2. 2009n*2 Collect the terms in -302g*2 + 4g - 1 + 69g2 + 130g*2 - 1246g*2. -1349g*2 + 4g - 1 Collect the terms in 22p2 - 686234p + 686234p + 79p*2. 101p*2 Collect the terms in 31 - 41q*2 + 3 - 34. -41q*2 Collect the terms in 34695u - 69407u + 34681u. -31u Collect the terms in -4s - 14s2 - 3s + 6s2 - 19s*2. -27s*2 - 7s Collect the terms in -238r2 + 237r*2 + 141r - 141r. -r2 Collect the terms in -241m - 5934m3 + 241m. -5934m3 Collect the terms in -359086290c + 359086290c - 2c*2. -2c*2 Collect the terms in -24q*3 + 12q*3 + 3 - 18 + 1. -12q*3 - 14 Collect the terms in 1191 + 146b - 2400 + 1211. 146b + 2 Collect the terms in -33i*2 + 3i*3 + 9i2 - i2 - 59i2. 3i*3 - 84i*2 Collect the terms in 43h*3 + 0 - 761h*3 + 0. -718h3 Collect the terms in 536 + 517 - r3 + 516 - 1536 + 0r3. -r3 + 33 Collect the terms in -15v*3 + 5v + 3v3 + 166v. -12v3 + 171v Collect the terms in 4n - 6n - 54 + 394 + 827. -2n + 1167 Collect the terms in -79191 - 45l + 31l + 79191. -14l Collect the terms in -530p2 + 511p*2 + 7p*2 + 13p2. p2 Collect the terms in 44j - 78j - 8j. -42j Collect the terms in 1 - 11j3 - 58368j*2 + 58368j*2. -11j*3 + 1 Collect the terms in -47 - 80j - 66j + 153j. 7j - 47 Collect the terms in 265 - 546 - 39589s + 39590s + 281. s Collect the terms in 6m - 59m - 12m. -65m Collect the terms in 34k*2 + 14k + 0k2 - 14k - 30k2 - 2k*2. 2k*2 Collect the terms in -65b - b*2 - 47857 + 65b + 47857. -b*2 Collect the terms in 462x*3 + 54x*3 + 106x*3. 622x*3 Collect the terms in -12419d*2 + 184d - 184d - 5801d*2. -18220d*2 Collect the terms in -1 + 1609719m - 1609715m + 4 - 2 - 1. 4m Collect the terms in -4595 + 188y2 + 2301 + 2292. 188y*2 - 2 Collect the terms in -5197v*3 - 42635v*3 - 6083v*3. -53915v*3 Collect the terms in 304r*2 + 6 - 6 - 304r*2 + 175r*3. 175r3 Collect the terms in h3 + 2230902h2 - 2230902h2. h3 Collect the terms in 6833r2 + 6792r*2 - 13472r*2. 153r*2 Collect the terms in -7b*2 + 88b*2 + 8b*3 - 29b*3. -21b*3 + 81b*2 Collect the terms in -115d*3 - 9d*2 - 80d*3 + 9d*2 - 22d*3. -217d*3 Collect the terms in 2f*2 - 62838769885 + 62838769885. 2f*2 Collect the terms in -21 + 21 + 5674m. 5674m Collect the terms in -368 - j - 167 + 535. -j Collect the terms in -14p*2 - 2p*3 - 31p*2 + 55p*2 - 10p*2 + p. -2p*3 + p Collect the terms in -2640i*3 - 6i*2 - 4 + 4 + 2638i*3. -2i*3 - 6i*2 Collect the terms in -6426q*2 + 12852q*2 - 6416q*2. 10q*2 Collect the terms in -90l - 86l - 91l - 85l + 351l. -l Collect the terms in -288h2 + 0 + 0 - 588h*3 + 97h*2. -588h*3 - 191h*2 Collect the terms in 80 + 3 + 180x - 83. 180x Collect the terms in 1293 + 0o*3 + 2o*3 + 2o + 1362. 2o3 + 2o + 2655 Collect the terms in 32r2 - 1 - 69r*2 + 30r*2 + 15r*2 - 3. 8r*2 - 4 Collect the terms in 1234 + 1361 - 2595 + 21q*3. 21q*3 Collect the terms in 2918817240p*2 - 7p*3 - 2918817240p*2. -7p*3 Collect the terms in -100d*3 - 141d*3 + 71d*3. -170d*3 Collect the terms in r + 2r + 19 - 8r + 3r. -2r + 19 Collect the terms in 2845p*3 + 1721p*3 - 4578p*3. -12p*3 Collect the terms in -4 - 85a - 4 + 232a + 9. 147a + 1 Collect the terms in -6d3 - 76590d + 76590d. -6d*3 Collect the terms in -29 - 30 + 3y*3 + 126 - 39 - 30 - 4y3. -y3 - 2 Collect the terms in 3 - 18d - 588d*2 + 18d. -588d2 + 3 Collect the terms in -27o*2 - 4o*3 - 1272o*2 + 1299o*2. -4o*3 Collect the terms in 2617m*3 - 2616m3 + 8 - 8. m3 Collect the terms in -1365q - 1361q + 4084q - 1362q. -4q Collect the terms in -19329i - 872i - 48467i - 69190i. -137858i Collect the terms in 5t + 0t + 6t - 7t. 4*t Collect	{ "pile_set_name": "DM Mathematics" }
/1020 What is prob of picking 1 c, 1 a, and 1 i when three letters picked without replacement from ciaccjic? 1/7 Calculate prob of picking 1 u and 1 d when two letters picked without replacement from uxhjxdjhbjh. 1/55 Four letters picked without replacement from {t: 4, n: 2, l: 4}. What is prob of picking 4 t? 1/210 Two letters picked without replacement from {g: 1, y: 10, l: 2, n: 1}. Give prob of picking 1 y and 1 n. 10/91 Two letters picked without replacement from lhaluhclahalayl. What is prob of picking 1 h and 1 l? 1/7 Two letters picked without replacement from wnofjfnfno. Give prob of picking 1 o and 1 f. 2/15 What is prob of picking 2 d when two letters picked without replacement from ddddddrdr? 7/12 What is prob of picking 4 j when four letters picked without replacement from {z: 1, o: 3, j: 11}? 22/91 What is prob of picking 1 r, 1 g, and 2 e when four letters picked without replacement from ergmsesm? 1/70 What is prob of picking 3 z when three letters picked without replacement from zzzbbzbbbb? 1/30 What is prob of picking 1 f and 1 q when two letters picked without replacement from ywfwveqy? 1/28 Four letters picked without replacement from huhhhhuhh. Give prob of picking 4 h. 5/18 What is prob of picking 1 o and 1 s when two letters picked without replacement from yuyuoouysu? 2/45 What is prob of picking 2 g and 2 a when four letters picked without replacement from {g: 6, a: 2, t: 2, w: 3, o: 2}? 1/91 Two letters picked without replacement from gfogotfofsoftootsfrs. Give prob of picking 1 o and 1 t. 9/95 Calculate prob of picking 1 u and 1 r when two letters picked without replacement from cmwucmurmc. 2/45 Two letters picked without replacement from eppepepppeeee. Give prob of picking 2 e. 7/26 Three letters picked without replacement from {d: 18, b: 1}. What is prob of picking 3 d? 16/19 What is prob of picking 1 e and 1 s when two letters picked without replacement from {b: 3, w: 2, e: 2, s: 2}? 1/9 Three letters picked without replacement from rreerrr. Give prob of picking 3 r. 2/7 Two letters picked without replacement from uuuuuuuuujj. What is prob of picking 2 j? 1/55 Three letters picked without replacement from {r: 1, k: 3, a: 3, b: 2, c: 1}. Give prob of picking 2 b and 1 a. 1/40 What is prob of picking 2 m, 1 n, and 1 z when four letters picked without replacement from nmnaanbznbmnr? 1/143 Calculate prob of picking 1 y and 1 i when two letters picked without replacement from {i: 1, y: 7}. 1/4 Four letters picked without replacement from hkhhhbzkhhhhzkb. Give prob of picking 1 b and 3 h. 16/195 Calculate prob of picking 2 l when two letters picked without replacement from ppllp. 1/10 Four letters picked without replacement from {f: 12, s: 6}. Give prob of picking 3 s and 1 f. 4/51 Calculate prob of picking 2 y when two letters picked without replacement from lollyylld. 1/36 Calculate prob of picking 2 l and 2 f when four letters picked without replacement from {f: 3, l: 8}. 14/55 What is prob of picking 4 b when four letters picked without replacement from {l: 4, b: 10}? 30/143 What is prob of picking 2 u when two letters picked without replacement from uvuvvnvvvunu? 1/11 What is prob of picking 2 n when two letters picked without replacement from {n: 6, k: 1, g: 3, s: 5}? 1/7 What is prob of picking 1 f and 1 n when two letters picked without replacement from wvfwkne? 1/21 Calculate prob of picking 2 t when two letters picked without replacement from {c: 1, t: 3}. 1/2 What is prob of picking 1 e and 1 f when two letters picked without replacement from hefeemh? 1/7 Three letters picked without replacement from rhhrhhrhhhrrrrhrhrh. What is prob of picking 3 r? 28/323 What is prob of picking 2 f, 1 v, and 1 y when four letters picked without replacement from fbvfy? 1/5 Three letters picked without replacement from mfmmfmmfmmffffmmfffm. What is prob of picking 3 m? 2/19 Two letters picked without replacement from {m: 3, n: 4}. What is prob of picking 2 m? 1/7 Two letters picked without replacement from iinniin. Give prob of picking 1 n and 1 i. 4/7 Calculate prob of picking 3 e when three letters picked without replacement from {d: 9, e: 9}. 7/68 What is prob of picking 2 y and 2 z when four letters picked without replacement from zygggyzyygz? 3/55 What is prob of picking 4 k when four letters picked without replacement from {k: 16, g: 2}? 91/153 Three letters picked without replacement from jxxnhox. Give prob of picking 1 x, 1 h, and 1 n. 3/35 What is prob of picking 1 b and 1 y when two letters picked without replacement from {f: 1, n: 1, h: 1, y: 1, b: 1}? 1/10 What is prob of picking 3 l and 1 s when four letters picked without replacement from {l: 7, j: 6, s: 2}? 2/39 What is prob of picking 4 x when four letters picked without replacement from xxmxxmxxmmmmxmxmmx? 7/170 Four letters picked without replacement from {r: 7, v: 6, j: 1, o: 6}. Give prob of picking 2 r, 1 v, and 1 j. 42/1615 Three letters picked without replacement from bbabbbbbbabbbaababzb. Give prob of picking 2 z and 1 b. 0 Four letters picked without replacement from {d: 4, n: 1, r: 6, x: 4, k: 2}. What is prob of picking 1 x, 2 d, and 1 k? 12/595 Two letters picked without replacement from {f: 4, j: 2, h: 4, s: 3, w: 3, b: 2}. What is prob of picking 1 j and 1 b? 4/153 Four letters picked without replacement from {n: 6, f: 11, s: 1, c: 1}. Give prob of picking 1 s, 2 n, and 1 f. 55/1292 Calculate prob of picking 3 x when three letters picked without replacement from bxggbxxx. 1/14 Two letters picked without replacement from {n: 1, r: 2, t: 1, b: 2, q: 1, g: 1}. What is prob of picking 1 t and 1 g? 1/28 Two letters picked without replacement from hhhhhhhhh. Give prob of picking 2 h. 1 Two letters picked without replacement from {l: 1, r: 2, j: 1, x: 2}. What is prob of picking 2 x? 1/15 Two letters picked without replacement from {g: 1, c: 3, r: 1, a: 1, u: 1}. Give prob of picking 1 g and 1 r. 1/21 Three letters picked without replacement from {r: 2, n: 1, c: 5, u: 5, z: 3}. Give prob of picking 2 c and 1 z. 3/56 Two letters picked without replacement from {t: 1, r: 2, x: 1, a: 1, v: 1, m: 1}. What is prob of picking 1 x and 1 a? 1/21 Two letters picked without replacement from {c: 2, t: 1}. Give prob of picking 1 t and 1 c. 2/3 What is prob of picking 1 k and 1 j when two letters picked without replacement from {k: 5, j: 3, e: 8}? 1/8 What is prob of picking 1 g, 1 h, and 1 f when three letters picked without replacement from hggfxhhxgxh? 4/55 Two letters picked without replacement from {t: 1, x: 3, g: 1, l: 5, p: 3, w: 1}. What is prob of picking 1 x and 1 t? 3/91 Calculate prob of picking 2 o when two letters picked without replacement from oooooooooodo. 5/6 Three letters picked without replacement from pllllvppdd. Give prob of picking 2 d and 1 l. 1/30 Calculate prob of picking 1 c, 1 m, and 1 p when three letters picked without replacement from {k: 2, m: 1, p: 1, s: 1, z: 1, c: 2}. 1/28 What is prob of picking 1 m and 1 t when two letters picked without replacement from {m: 2, t: 3}? 3/5 What is prob of picking 1 j and 2 z when three letters picked without replacement from {j: 5, z: 3, t: 3, d: 2}? 15/286 Four letters picked without replacement from thahrahqtrhhxaahaqhh. Give prob of picking 1 q, 1 x, and 2 t. 2/4845 Three letters picked without replacement from ddhccdphdddhdxkph. Give prob of picking 1 c and 2 h. 3/170 Two letters picked without replacement from {f: 3, x: 9, m: 2, u: 2}. Give prob of picking 2 x. 3/10 Two letters picked without replacement from {n: 2, r: 5, b: 2}. Give prob of picking 1 b and 1 r. 5/18 What is prob of picking 1 q, 1 t, and 1 z when three letters picked without replacement from ztgmqmrz? 1/28 Two letters picked without replacement from zxlzlxlxxlxxxmlmxl. What is prob of picking 2 l? 5/51 Calculate prob of picking 2 a when two letters picked without replacement from aaohobohaaoaaoj. 1/7 Four letters picked without replacement from anyxzxa. What is prob of picking 2 x, 1 n, and 1 a? 2/35 Three letters picked without replacement from zzgggggzzg. What is prob of picking 3 g? 1/6 Three letters picked without replacement from rcuuy. What is prob of picking 2 r and 1 u? 0 Calculate prob of picking 2 u and 1 e when	{ "pile_set_name": "DM Mathematics" }