Molecule ChEMBL ID
stringlengths 7
13
| Smiles
stringlengths 8
834
| Standard Relation
stringclasses 6
values | Standard Value
float64 0
2.25B
| Standard Units
stringclasses 3
values | Assay Description
stringlengths 17
193
| standardized_smiles
stringlengths 8
834
| logS
float64 -11.48
2
|
---|---|---|---|---|---|---|---|
CHEMBL303100 | CC(C)(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@@H](NCc1ccc(CNC(=O)OCc2ccccc2)cc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O | '<' | 1,000 | nM | Solubility (phosphate-buffered saline, pH =7.4) | CC(C)(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@@H](NCc1ccc(CNC(=O)OCc2ccccc2)cc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O | -6 |
CHEMBL395955 | NC(=O)CN1C(=O)C(NC(=O)c2cc3cc(Cl)sc3[nH]2)Cc2ccccc21 | null | 5,200 | nM | ASTRAZENECA: Solubility in pH7.4 buffer using solid starting material using the method described in J. Assoc. Lab. Autom. 2011, 16, 276-284. Experimental range 0.10 to 1500 uM | NC(=O)CN1C(=O)C(NC(=O)c2cc3cc(Cl)sc3[nH]2)Cc2ccccc21 | -5.283997 |
CHEMBL2447997 | Cl.Cl.O=S(=O)(CCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(Cc2ccc(Cl)cc2)CC1 | '>' | 20,000 | ug.mL-1 | Aqueous solubility | Cl.Cl.O=S(=O)(CCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(Cc2ccc(Cl)cc2)CC1 | -1.469045 |
CHEMBL1203074 | CC(C)CN1CCN(C(=O)NCCCOc2ccc3[nH]c4nc(O)nc-4cc3c2)CC1.Cl | '>' | 20,000 | ug.mL-1 | Aqueous solubility | CC(C)CN1CCN(C(=O)NCCCOc2ccc3[nH]c4nc(O)nc-4cc3c2)CC1.Cl | -1.364534 |
CHEMBL1328878 | COc1ccc(CCN(C)C(=O)C2CCCN(Cc3ccc(OC)c(OC)c3)C2)cc1OC | '>' | 500,000 | nM | Solubility of compound in phosphate buffered saline buffer | COc1ccc(CCN(C)C(=O)C2CCCN(Cc3ccc(OC)c(OC)c3)C2)cc1OC | -3.30103 |
CHEMBL1202628 | Cl.N[C@@H](Cc1ccccc1)C(=O)NC1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)C1.O | '=' | 60 | ug.mL-1 | Solubility (at pH 7.4) | Cl.N[C@@H](Cc1ccccc1)C(=O)NC1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)C1.O | -3.94938 |
CHEMBL407427 | CCCOc1c(OCCCn2ccnc2)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)=O | '=' | 800 | ug.mL-1 | Water solubility at pH 6 | CCCOc1c(OCCCn2ccnc2)cc([C@@H]2CC[C@@H](c3cc(OC)c(OC)c(OC)c3)O2)cc1S(=O)(=O)CC(C)=O | -2.887007 |
CHEMBL2382401 | CC(Sc1nc(-c2ccc(Cl)cc2)c(C#N)c(=O)[nH]1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 | '=' | 58,000 | nM | Aqueous solubility of the compound in PBS buffer at pH 7.2 at 100 uM after 24 hrs | CC(Sc1nc(-c2ccc(Cl)cc2)c(C#N)c(=O)[nH]1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 | -4.236572 |
CHEMBL1645016 | Cc1ccc(C(=O)N2CCN(c3ccccn3)CC2)cc1C#Cc1ccccc1 | '=' | 1 | ug.mL-1 | Aqueous solubility of the compound | Cc1ccc(C(=O)N2CCN(c3ccccn3)CC2)cc1C#Cc1ccccc1 | -5.581471 |
CHEMBL1645008 | O=C(c1cccc(C#Cc2ccccn2)c1)N1CCN(c2ccccn2)CC1 | '=' | 51 | ug.mL-1 | Aqueous solubility of the compound | O=C(c1cccc(C#Cc2ccccn2)c1)N1CCN(c2ccccn2)CC1 | -3.858797 |
CHEMBL1645020 | COc1ccc(C(=O)N2CCN(c3ccncn3)CC2)cc1C#Cc1ccccn1 | '>' | 100 | ug.mL-1 | Aqueous solubility of the compound | COc1ccc(C(=O)N2CCN(c3ccncn3)CC2)cc1C#Cc1ccccn1 | -3.601467 |
CHEMBL1682262 | Clc1cccc2c(-c3nsc(CN4CCCC4)n3)cn(CC3CCOCC3)c12 | '<' | 1 | ug.mL-1 | Aqueous solubility of the compound at pH 7.4 | Clc1cccc2c(-c3nsc(CN4CCCC4)n3)cn(CC3CCOCC3)c12 | -5.620113 |
CHEMBL312006 | NS(=O)(=O)c1cc2c(s1)SC(CC(=O)O)C(=O)N2 | '=' | 2,400 | ug.mL-1 | Solubility in pH 5.2 buffer | NS(=O)(=O)c1cc2c(s1)SC(CC(=O)O)C(=O)N2 | -2.10885 |
CHEMBL9 | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)cc21 | '=' | 200 | ug.mL-1 | Solubility in phosphate buffer (0.1 M) at 25 degree centigrade(pH 7.4) | CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCNCC3)cc21 | -3.203218 |
CHEMBL3126271 | CC(=O)NC[C@H]1CN(c2ccc(OC[C@@H](O)CNc3ccncc3)c(F)c2)C(=O)O1 | '=' | 17,724,000 | nM | Aqueous solubility of the compound by HPLC analysis | CC(=O)NC[C@H]1CN(c2ccc(OC[C@@H](O)CNc3ccncc3)c(F)c2)C(=O)O1 | -1.751438 |
CHEMBL1669632 | COc1cccc(NC(=O)c2ccc(S(=O)(=O)N3CC(C)CC(C)C3)c(F)c2)c1 | '<' | 1 | ug.mL-1 | Aqueous solubility of the compound | COc1cccc(NC(=O)c2ccc(S(=O)(=O)N3CC(C)CC(C)C3)c(F)c2)c1 | -5.623772 |
CHEMBL84974 | CCCN(CCC)c1c(C)nc(-c2c(C)cc(C)cc2OC)n(CCF)c1=O | '<' | 0.1 | ug.mL-1 | Solubility (pH 7.4) | CCCN(CCC)c1c(C)nc(-c2c(C)cc(C)cc2OC)n(CCF)c1=O | -6.590524 |
CHEMBL81717 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(=N)N)[C@H]1NC(C)=O | '=' | 26,000,000 | nM | Solubility of the compound in phosphate buffer saline at pH 9.0 after 20 mins by HPLC analysis | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(=N)N)[C@H]1NC(C)=O | -1.585027 |
CHEMBL3120197 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(C)=N)[C@H]1NC(C)=O | '>' | 50,000,000 | nM | Solubility of the compound in phosphate buffer saline at pH 9.0 after 20 mins by HPLC analysis | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(C)=N)[C@H]1NC(C)=O | -1.30103 |
CHEMBL545756 | Cl.NS(=O)(=O)c1cc(C(=O)c2ccc(CN3CCOCC3)cc2)cs1 | '=' | 12,100 | ug.mL-1 | Solubility measured in water | Cl.NS(=O)(=O)c1cc(C(=O)c2ccc(CN3CCOCC3)cc2)cs1 | -1.522439 |
CHEMBL265560 | CCCC[C@H](O[C@@H](Cc1ccccc1)C(=O)N1CCC(OCOC)CC1)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)C[C@H](NC(=O)OCCN(C)C)C(C)C | '=' | 385 | ug.mL-1 | Aqueous solubility at a pH of 7.4. | CCCC[C@H](O[C@@H](Cc1ccccc1)C(=O)N1CCC(OCOC)CC1)C(=O)N[C@@H](CC1CCCCC1)[C@@H](O)C[C@H](NC(=O)OCCN(C)C)C(C)C | -3.287878 |
CHEMBL112418 | CCOC(=O)N1CCC(S(=O)(=O)CCCCOc2ccc3[nH]c4nc(O)nc-4cc3c2)CC1 | '<' | 1,000 | ug.mL-1 | Aqueous solubility | CCOC(=O)N1CCC(S(=O)(=O)CCCCOc2ccc3[nH]c4nc(O)nc-4cc3c2)CC1 | -2.678113 |
CHEMBL541341 | CN1CCN(Cc2ccc(C(=O)c3csc(S(N)(=O)=O)c3)cc2)CC1.Cl | '=' | 5,000 | ug.mL-1 | Solubility measured in water | CN1CCN(Cc2ccc(C(=O)c3csc(S(N)(=O)=O)c3)cc2)CC1.Cl | -1.92009 |
CHEMBL1630820 | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(-c3ccc(OC(F)(F)F)cc3)nn1)C2 | '=' | 31 | ug.mL-1 | Solubility of the compound in water at pH 1.0 by HPLC | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(-c3ccc(OC(F)(F)F)cc3)nn1)C2 | -4.149452 |
CHEMBL78490 | CC(=O)O[C@@]12COC1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)c4ccco4)C(C)(C)C)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | '=' | 22 | ug.mL-1 | Aqueous solubility was determined | CC(=O)O[C@@]12COC1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)c4ccco4)C(C)(C)C)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]12)C3(C)C | -4.550702 |
CHEMBL420225 | CCCN(CCC)c1c(C)nc(-c2c(C)cc(C)cc2C)n(CCN2CCCC2)c1=O | '=' | 25.2 | ug.mL-1 | Solubility (pH 7.4) | CCCN(CCC)c1c(C)nc(-c2c(C)cc(C)cc2C)n(CCN2CCCC2)c1=O | -4.226613 |
CHEMBL1202609 | C[C@H](N)C(=O)N[C@H]1CCN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C1.Cl.O | '=' | 18,000 | ug.mL-1 | Aqueous solubility | C[C@H](N)C(=O)N[C@H]1CCN(c2c(F)c(N)c3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C1.Cl.O | -1.434841 |
CHEMBL19661 | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2noc(C)c2Cl)c(C)c1CC#N | '=' | 70,000 | ug.mL-1 | Compound was evaluated for the aqueous solubility (AS) in mg/mL (Measured in 0.2 M phosphate buffer of pH 7.4) | Cc1cc(C)c(NC(=O)c2sccc2S(=O)(=O)Nc2noc(C)c2Cl)c(C)c1CC#N | -0.835222 |
CHEMBL3613679 | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c(CN5CCOCCOCCOCCOCC5)c(O)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C | '=' | 1,600 | ug.mL-1 | Solubility of the compound in water at pH 7 | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c(CN5CCOCCOCCOCCOCC5)c(O)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C | -2.763928 |
CHEMBL1202625 | Cl.NCC(=O)NC1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C1.O | '=' | 33,000 | ug.mL-1 | Aqueous solubility | Cl.NCC(=O)NC1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C1.O | -1.14506 |
CHEMBL295572 | NC(=O)CC[C@H](N)C(=O)NC1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)C1 | '=' | 50 | ug.mL-1 | Aqueous solubility | NC(=O)CC[C@H](N)C(=O)NC1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)C1 | -3.964228 |
CHEMBL218650 | C[C@]1(COc2ccc(N3CCC(Oc4ccc(OC(F)(F)F)cc4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 | '=' | 0.31 | ug.mL-1 | Aqueous solubility of compound at pH7 for 4 hrs by HPLC analysis | C[C@]1(COc2ccc(N3CCC(Oc4ccc(OC(F)(F)F)cc4)CC3)cc2)Cn2cc([N+](=O)[O-])nc2O1 | -6.236579 |
CHEMBL1949834 | O=C(CN1CCCC(c2ccccc2)(c2ccccc2)C1=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 | '<' | 25,000 | nM | Aqueous solubility of the compound at pH 7 | O=C(CN1CCCC(c2ccccc2)(c2ccccc2)C1=O)N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 | -4.60206 |
CHEMBL2112249 | CC[C@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccc3ccccc3c2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2c[nH]cn2)NC(=O)[C@@H]2CCCCN2C(=O)[C@H]2CCCCN2C1=O | '=' | 1,500 | ug.mL-1 | Aqueous solubility was determined | CC[C@H](C)[C@@H]1NC(=O)[C@@H](Cc2ccc3ccccc3c2)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2c[nH]cn2)NC(=O)[C@@H]2CCCCN2C(=O)[C@H]2CCCCN2C1=O | -2.708672 |
CHEMBL109450 | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@H]1NCc2ccc(cc2)OCCOCCOCCOCCNC(=O)[C@H](C(C)C)NC1=O | '=' | 5,000 | nM | Aqueous solubility in phosphate buffer of pH 7.4 | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)[C@H]1NCc2ccc(cc2)OCCOCCOCCOCCNC(=O)[C@H](C(C)C)NC1=O | -5.30103 |
CHEMBL347788 | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CC(Nc2ccccc2C(=O)c2cccc(N)c2)C(=O)O)cc1 | '=' | 525 | ug.mL-1 | Solubility in phosphate buffer at pH 7.4. | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CC(Nc2ccccc2C(=O)c2cccc(N)c2)C(=O)O)cc1 | -3.029297 |
CHEMBL3092753 | NC(N)=NC(=O)c1ccc2c(c1)Cc1ccccc1-2 | '<' | 1 | ug.mL-1 | Aqueous solubility of the compound in second liquid of Japanese pharmacopoeia at pH 6.8 after 20 hrs by liquid chromatographic analysis | NC(N)=NC(=O)c1ccc2c(c1)Cc1ccccc1-2 | -5.400173 |
CHEMBL1836073 | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OC/C=C/c1ccc(OC(F)(F)F)cc1)C2 | '=' | 1.5 | ug.mL-1 | Aqueous solubility of the compound in water at pH 7 by HPLC analysis | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OC/C=C/c1ccc(OC(F)(F)F)cc1)C2 | -5.409705 |
CHEMBL227875 | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(OC(F)(F)F)cc1)C2 | '=' | 19 | ug.mL-1 | Aqueous solubility of the compound in water at pH 7 by HPLC analysis | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCc1ccc(OC(F)(F)F)cc1)C2 | -4.276655 |
CHEMBL1817715 | O=C(c1cccc(Cl)c1)n1c(=S)[nH]c2ccccc21 | '=' | 400,000 | nM | Aqueous solubility of the compound in water | O=C(c1cccc(Cl)c1)n1c(=S)[nH]c2ccccc21 | -3.39794 |
CHEMBL1817721 | CCCCCCCCCCCCCCCC(=O)n1c(=S)oc2ccccc21 | '=' | 63,000 | nM | Aqueous solubility of the compound in water | CCCCCCCCCCCCCCCC(=O)n1c(=S)oc2ccccc21 | -4.200659 |
CHEMBL1817731 | CCCCCC(=O)n1c(=O)oc2ccccc21 | '=' | 150,000 | nM | Aqueous solubility of the compound in water | CCCCCC(=O)n1c(=O)oc2ccccc21 | -3.823909 |
CHEMBL3604426 | COc1ccnc(-c2nnc3n2C[C@H](C)N(C(=O)c2cccc(Cl)c2Cl)C3)c1 | '=' | 260,000 | nM | Solubility in pH 7 solution | COc1ccnc(-c2nnc3n2C[C@H](C)N(C(=O)c2cccc(Cl)c2Cl)C3)c1 | -3.585027 |
CHEMBL1836066 | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCCCc1ccc(OC(F)(F)F)cc1)C2 | '=' | 11 | ug.mL-1 | Aqueous solubility of the compound in water at pH 7 by HPLC analysis | O=[N+]([O-])c1cn2c(n1)OC[C@@H](OCCCc1ccc(OC(F)(F)F)cc1)C2 | -4.546671 |
CHEMBL3628976 | CCN(CC)c1ccc(C=C2CC(=Cc3ccc(N(CCOCCOCCOCCOC)CCOCCOCCOCCOC)cc3)C2)cc1 | '=' | 1,800 | ug.mL-1 | Solubility of the compound in PBS | CCN(CC)c1ccc(C=C2CC(=Cc3ccc(N(CCOCCOCCOCCOC)CCOCCOCCOCCOC)cc3)C2)cc1 | -2.589169 |
CHEMBL568430 | CNC(=O)c1ccc(-c2ccc(C(=O)N[C@H](C(=O)NC)C3CCCCC3)o2)cc1 | '=' | 17 | ug.mL-1 | Solubility of compound at pH 7.4 by high throughput screening | CNC(=O)c1ccc(-c2ccc(C(=O)N[C@H](C(=O)NC)C3CCCCC3)o2)cc1 | -4.368861 |
CHEMBL528694 | Cc1cccnc1Nc1nc(-c2ccccn2)cs1 | '=' | 10,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 incubated for 2 hrs at room temperature by UV spectrometry method | Cc1cccnc1Nc1nc(-c2ccccn2)cs1 | -5 |
CHEMBL572056 | CC[C@]1(C)C[C@@H](OC(=O)NC(=O)c2ccc(OP(=O)([O-])[O-])cc2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@@H]32)[C@@H](C)[C@@H]1O.[Na+].[Na+] | '=' | 96,800 | ug.mL-1 | Aqueous solubility of the compound | CC[C@]1(C)C[C@@H](OC(=O)NC(=O)c2ccc(OP(=O)([O-])[O-])cc2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@@H]32)[C@@H](C)[C@@H]1O.[Na+].[Na+] | -0.799144 |
CHEMBL3634035 | CCC(F)(F)Cc1c[nH]c2ccccc12 | '=' | 182,000 | nM | Aqueous solubility of the compound at pH 6.5 | CCC(F)(F)Cc1c[nH]c2ccccc12 | -3.739929 |
CHEMBL476339 | Cc1ccnc(Nc2nc(-c3ccccn3)cs2)c1 | '>' | 100,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 incubated for 2 hrs at room temperature by UV spectrometry method | Cc1ccnc(Nc2nc(-c3ccccn3)cs2)c1 | -4 |
CHEMBL3623310 | FC(F)(F)c1ccc(-c2csc(Nc3ccc(Cl)cn3)n2)nc1 | '<' | 10,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 incubated for 2 hrs at room temperature by UV spectrometry method | FC(F)(F)c1ccc(-c2csc(Nc3ccc(Cl)cn3)n2)nc1 | -5 |
CHEMBL3623316 | CCOc1ccc(-c2nc(Nc3ccc(Cl)cn3)sc2Cl)nc1 | '<' | 10,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 incubated for 2 hrs at room temperature by UV spectrometry method | CCOc1ccc(-c2nc(Nc3ccc(Cl)cn3)sc2Cl)nc1 | -5 |
CHEMBL3623320 | Clc1ccc(Nc2nc(-c3ncccn3)c(Cl)s2)nc1 | '<' | 10,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 incubated for 2 hrs at room temperature by UV spectrometry method | Clc1ccc(Nc2nc(-c3ncccn3)c(Cl)s2)nc1 | -5 |
CHEMBL3623321 | Clc1ccc(Nc2nc(-c3cnccn3)cs2)nc1 | '<' | 10,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 incubated for 2 hrs at room temperature by UV spectrometry method | Clc1ccc(Nc2nc(-c3cnccn3)cs2)nc1 | -5 |
CHEMBL3623322 | Clc1ccc(Nc2nc(-c3cnccn3)c(Cl)s2)nc1 | '<' | 10,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 incubated for 2 hrs at room temperature by UV spectrometry method | Clc1ccc(Nc2nc(-c3cnccn3)c(Cl)s2)nc1 | -5 |
CHEMBL577301 | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)COC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(C)C)C(C)C)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@H](C(=O)NCC(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)O)[C@@H](C)CC)C(C)C)C(C)C)C(C)C)[C@@H](C)CC | '=' | 14,500 | ug.mL-1 | Solubility in water by HPLC | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)COC(=O)CNC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(C)C)C(C)C)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@H](C(=O)NCC(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)O)[C@@H](C)CC)C(C)C)C(C)C)C(C)C)[C@@H](C)CC | -2.49311 |
CHEMBL2204077 | CCN(CC)Cc1c(O)c(O)c(O)c2c(=O)cc(-c3ccc(O)cc3)oc12 | '=' | 7,710 | nM | Solubility of the compound in water by UV-visible spectrophotometry | CCN(CC)Cc1c(O)c(O)c(O)c2c(=O)cc(-c3ccc(O)cc3)oc12 | -5.112946 |
CHEMBL55415 | O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(O)c(O)c12 | '=' | 6,950 | nM | Solubility of the compound in water by UV-visible spectrophotometry | O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(O)c(O)c12 | -5.158015 |
CHEMBL4211262 | CCCCn1c2ccccc2c2cc(CNCCCCCNCc3cc4c5ccccc5n(CCCC)c4c(C(C)C)n3)nc(C(C)C)c21.Cl | '>' | 10,000 | ug.mL-1 | Solubility of the compound in water | CCCCn1c2ccccc2c2cc(CNCCCCCNCc3cc4c5ccccc5n(CCCC)c4c(C(C)C)n3)nc(C(C)C)c21.Cl | -1.84226 |
CHEMBL1202632 | C[C@H](N)C(=O)N[C@@H]1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C1.Cl.O | '=' | 29,000 | ug.mL-1 | Aqueous solubility | C[C@H](N)C(=O)N[C@@H]1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2F)C1.Cl.O | -1.214197 |
CHEMBL3740500 | CC(C)[C@]12O[C@H]1[C@@H]1O[C@]13[C@]1(O[C@H]1C[C@H]1C4=C(CC[C@@]13C)C(=O)OC4)[C@@H]2OCOP(=O)([O-])[O-].[Na+].[Na+] | '=' | 61,000 | ug.mL-1 | Aqueous solubility of the compound in Tris buffer at pH 7.4 at room temperature by HPLC analysis | CC(C)[C@]12O[C@H]1[C@@H]1O[C@]13[C@]1(O[C@H]1C[C@H]1C4=C(CC[C@@]13C)C(=O)OC4)[C@@H]2OCOP(=O)([O-])[O-].[Na+].[Na+] | -0.92595 |
CHEMBL578579 | CC1(CC(=O)NCc2ccc(N3CCOCC3)cc2)CC2(CCCCC2)OO1 | '>' | 49 | ug.mL-1 | Aqueous solubility in phosphate buffered saline at 25 mM at pH 7.4 after 16 to 24 hrs | CC1(CC(=O)NCc2ccc(N3CCOCC3)cc2)CC2(CCCCC2)OO1 | -3.899204 |
CHEMBL570015 | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4cccc(C(=O)N(C)C)c4)cc23)c1 | '=' | 5 | ug.mL-1 | Aqueous solubility at pH 6.4 | COc1cccc(Nc2c(C(N)=O)cnc3c(C)cc(S(=O)(=O)c4cccc(C(=O)N(C)C)c4)cc23)c1 | -5.015858 |
CHEMBL218954 | O=C(CCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2)N[C@@H](Cc1ccc(O)cc1)C(=O)O | '>' | 500,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 | O=C(CCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2)N[C@@H](Cc1ccc(O)cc1)C(=O)O | -3.30103 |
CHEMBL220028 | O=C(O)CC[C@H](NC(=O)CCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)O | '>' | 500,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 | O=C(O)CC[C@H](NC(=O)CCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)O | -3.30103 |
CHEMBL387165 | O=C(O)C[C@H](NC(=O)CCCNC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)O | '>' | 500,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 | O=C(O)C[C@H](NC(=O)CCCNC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)O | -3.30103 |
CHEMBL382794 | CCN(C(=O)c1ccncc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 | '=' | 59,800 | nM | Solubility in PBS at pH 7.4 | CCN(C(=O)c1ccncc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 | -4.223299 |
CHEMBL480558 | CCC(CC)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 | '=' | 6,700 | ug.mL-1 | Solubility in Phosal PG50/Tween-80/water | CCC(CC)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 | -1.667879 |
CHEMBL205672 | Fc1ccc(Nc2cc(-c3ccnc(Nc4ccc(F)cc4)c3)ccn2)cc1 | '<' | 100 | nM | Solubility in phosphate buffer at pH 7.4 | Fc1ccc(Nc2cc(-c3ccnc(Nc4ccc(F)cc4)c3)ccn2)cc1 | -7 |
CHEMBL1668874 | CSc1ccc(OCc2nc(Cl)c([N+](=O)[O-])n2C)cc1 | '=' | 17,100 | nM | Aqueous solubility of the compound at pH 1.5 at 25 degC | CSc1ccc(OCc2nc(Cl)c([N+](=O)[O-])n2C)cc1 | -4.767004 |
CHEMBL1668881 | Cn1c([N+](=O)[O-])cnc1COc1ccnc(N2CCNCC2)c1 | '=' | 3,500 | nM | Aqueous solubility of the compound at pH 7.5 at 25 degC | Cn1c([N+](=O)[O-])cnc1COc1ccnc(N2CCNCC2)c1 | -5.455932 |
CHEMBL1668882 | CSc1ccc(OCc2ncc(Cl)n2C)cc1 | '=' | 8,700 | nM | Aqueous solubility of the compound at pH 7.5 at 25 degC | CSc1ccc(OCc2ncc(Cl)n2C)cc1 | -5.060481 |
CHEMBL1668240 | O=C(N[C@H]1CC[C@H](C(=O)O)CC1)[C@H](C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2cc(F)c(F)cc21 | '=' | 395 | ug.mL-1 | Solubility of the compound in 0.05 M phosphate buffer at pH 6.5 | O=C(N[C@H]1CC[C@H](C(=O)O)CC1)[C@H](C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2cc(F)c(F)cc21 | -3.127691 |
CHEMBL204593 | Cc1cc(S(=O)(=O)N[C@@H](C(=O)NO)C2CCOCC2)ccc1F | '=' | 2,500 | ug.mL-1 | Solubility in water | Cc1cc(S(=O)(=O)N[C@@H](C(=O)NO)C2CCOCC2)ccc1F | -2.141613 |
CHEMBL1922188 | Cc1cn(CC(=O)N(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NC[C@H](C)N(CC(=O)N[C@@H](CCCCN)C(N)=O)C(=O)Cn2cc(C)c(=O)[nH]c2=O)C(=O)Cn2ccc(N)nc2=O)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2ccc(N)nc2=O)[C@@H](C)CNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(C(=O)Cn2cc(C)c(=O)[nH]c2=O)[C@@H](C)CNC(=O)CN(CCN)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)c(=O)[nH]c1=O | '>' | 500,000 | nM | Solubility of the compound in water | Cc1cn(CC(=O)N(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NC[C@H](C)N(CC(=O)N[C@@H](CCCCN)C(N)=O)C(=O)Cn2cc(C)c(=O)[nH]c2=O)C(=O)Cn2ccc(N)nc2=O)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2ccc(N)nc2=O)[C@@H](C)CNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(C(=O)Cn2cc(C)c(=O)[nH]c2=O)[C@@H](C)CNC(=O)CN(CCN)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)c(=O)[nH]c1=O | -3.30103 |
CHEMBL1922189 | Cc1cn(CC(=O)N(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NC[C@@H](C)N(CC(=O)N[C@H](CCCCN)C(N)=O)C(=O)Cn2cc(C)c(=O)[nH]c2=O)C(=O)Cn2ccc(N)nc2=O)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2ccc(N)nc2=O)[C@H](C)CNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(C(=O)Cn2cc(C)c(=O)[nH]c2=O)[C@H](C)CNC(=O)CN(CCN)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)c(=O)[nH]c1=O | '>' | 500,000 | nM | Solubility of the compound in water | Cc1cn(CC(=O)N(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NCCN(CC(=O)NC[C@@H](C)N(CC(=O)N[C@H](CCCCN)C(N)=O)C(=O)Cn2cc(C)c(=O)[nH]c2=O)C(=O)Cn2ccc(N)nc2=O)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2ccc(N)nc2=O)[C@H](C)CNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(CCNC(=O)CN(C(=O)Cn2cc(C)c(=O)[nH]c2=O)[C@H](C)CNC(=O)CN(CCN)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)C(=O)Cn2cnc3c(=O)[nH]c(N)nc32)C(=O)Cn2cnc3c(N)ncnc32)c(=O)[nH]c1=O | -3.30103 |
CHEMBL1091534 | O=C1/C(=C/c2c[nH]c3ccc(Cl)cc23)Oc2cc(O)cc(O)c21 | '=' | 1 | ug.mL-1 | Aqueous solubility at pH 7.4 | O=C1/C(=C/c2c[nH]c3ccc(Cl)cc23)Oc2cc(O)cc(O)c21 | -5.515507 |
CHEMBL1088834 | Cc1[nH]c2ccc(Br)cc2c1/C=C1\Oc2cc(O)cc(O)c2C1=O | '=' | 1 | ug.mL-1 | Aqueous solubility at pH 7.4 | Cc1[nH]c2ccc(Br)cc2c1/C=C1\Oc2cc(O)cc(O)c2C1=O | -5.586813 |
CHEMBL1091864 | O=C1/C(=C/c2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)Oc2cc(O)cc(O)c21 | '=' | 1 | ug.mL-1 | Aqueous solubility at pH 7.4 | O=C1/C(=C/c2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)Oc2cc(O)cc(O)c21 | -5.606189 |
CHEMBL1089653 | COc1ccc2c(c1)c(/C=C1\Oc3cc(O)cc(O)c3C1=O)c(C)n2C | '=' | 1 | ug.mL-1 | Aqueous solubility at pH 7.4 | COc1ccc2c(c1)c(/C=C1\Oc3cc(O)cc(O)c3C1=O)c(C)n2C | -5.54575 |
CHEMBL1089823 | COc1ccc2c(c1)c(/C=C1\Oc3cc(O)cc(O)c3C1=O)c(C)n2CCN1CCOCC1 | '=' | 6 | ug.mL-1 | Aqueous solubility at pH 7.4 | COc1ccc2c(c1)c(/C=C1\Oc3cc(O)cc(O)c3C1=O)c(C)n2CCN1CCOCC1 | -4.875535 |
CHEMBL242459 | O=C(NC12CC3CC(CC(C3)C1)C2)N[C@H]1CC[C@H](Oc2ccc(C(=O)O)cc2)CC1 | '>' | 500,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 | O=C(NC12CC3CC(CC(C3)C1)C2)N[C@H]1CC[C@H](Oc2ccc(C(=O)O)cc2)CC1 | -3.30103 |
CHEMBL243124 | O=C(NC12CC3CC(CC(C3)C1)C2)N[C@H]1CC[C@H](OCc2c(Cl)cccc2Cl)CC1 | '=' | 31,000 | nM | Solubility in sodium phosphate buffer at pH 7.4 | O=C(NC12CC3CC(CC(C3)C1)C2)N[C@H]1CC[C@H](OCc2c(Cl)cccc2Cl)CC1 | -4.508638 |
CHEMBL1079590 | CC(C)Cn1cnc(-c2ccccc2)c1-c1nc2c(N)ncnc2s1 | '=' | 70,000 | nM | Aqueous solubility at pH 7 | CC(C)Cn1cnc(-c2ccccc2)c1-c1nc2c(N)ncnc2s1 | -4.154902 |
CHEMBL1203035 | Cl.O=S(=O)(CCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(CCc2ccccc2)CC1 | '<' | 10,000 | ug.mL-1 | Aqueous solubility | Cl.O=S(=O)(CCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(CCc2ccccc2)CC1 | -1.725966 |
CHEMBL1203063 | CCC(CC)CN1CCN(C(=O)NCCCOc2ccc3[nH]c4nc(O)nc-4cc3c2)CC1.Cl | '>' | 20,000 | ug.mL-1 | Aqueous solubility | CCC(CC)CN1CCN(C(=O)NCCCOc2ccc3[nH]c4nc(O)nc-4cc3c2)CC1.Cl | -1.390083 |
CHEMBL1203061 | Cl.O=C(NCCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(N2CCC(Cc3ccccc3)CC2)CC1 | '<' | 200 | ug.mL-1 | Aqueous solubility | Cl.O=C(NCCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(N2CCC(Cc3ccccc3)CC2)CC1 | -3.462498 |
CHEMBL545057 | CCN(CC)Cc1cc(S(=O)(=O)c2csc(S(N)(=O)=O)c2)ccc1O.Cl | '=' | 13,900 | ug.mL-1 | Solubility (pH 7.4, 25 degree C) | CCN(CC)Cc1cc(S(=O)(=O)c2csc(S(N)(=O)=O)c2)ccc1O.Cl | -1.50142 |
CHEMBL419608 | O=C(Cc1ccc2[nH]c(-c3ccc(Br)s3)nc2c1)Nc1ccc(-n2ccccc2=O)cc1 | '<' | 10 | ug.mL-1 | Solubility in pH 7.0 phosphate buffer | O=C(Cc1ccc2[nH]c(-c3ccc(Br)s3)nc2c1)Nc1ccc(-n2ccccc2=O)cc1 | -4.703633 |
CHEMBL1689043 | CCCCc1nn2c(c1C(=O)NC(CC)(CC)c1ccc(C)cc1)NC(c1ccccc1)CC2(C)C.Cl | '=' | 0.45 | ug.mL-1 | Aqueous solubility of the compound at pH 1.2 by HPLC | CCCCc1nn2c(c1C(=O)NC(CC)(CC)c1ccc(C)cc1)NC(c1ccccc1)CC2(C)C.Cl | -6.065426 |
CHEMBL3545252 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@H]21)C3(C)C.O.O.O | '=' | 6 | ug.mL-1 | Aqueous solubility was determined; range 5-6 | CC(=O)O[C@@]12CO[C@@H]1C[C@H](O)[C@@]1(C)C(=O)[C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)c4ccccc4)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@H]21)C3(C)C.O.O.O | -5.157323 |
CHEMBL333747 | NS(=O)(=O)c1cc(S(=O)(=O)c2ccc(O)cc2)co1 | '=' | 2,300 | ug.mL-1 | Solubility (pH 7.4, 25 degree C) | NS(=O)(=O)c1cc(S(=O)(=O)c2ccc(O)cc2)co1 | -2.120169 |
CHEMBL1203075 | Cl.O=S(=O)(CCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(c2nc3ccccc3s2)CC1 | '=' | 1,000 | ug.mL-1 | Aqueous solubility | Cl.O=S(=O)(CCCOc1ccc2[nH]c3nc(O)nc-3cc2c1)N1CCN(c2nc3ccccc3s2)CC1 | -2.749032 |
CHEMBL1203046 | Cl.Oc1nc2cc3cc(OCCCc4nnnn4C4CCNCC4)ccc3[nH]c-2n1 | '>' | 20,000 | ug.mL-1 | Aqueous solubility | Cl.Oc1nc2cc3cc(OCCCc4nnnn4C4CCNCC4)ccc3[nH]c-2n1 | -1.333346 |
CHEMBL1933794 | Oc1c2c(nn1-c1ccccn1)CCc1cc(Br)ccc1-2 | '=' | 5 | ug.mL-1 | Solubility of compound in phosphate buffered saline at pH 7.4 | Oc1c2c(nn1-c1ccccn1)CCc1cc(Br)ccc1-2 | -4.835305 |
CHEMBL556498 | O=C(O)c1ccc(OC/C=C\Cn2c(=O)c3ccccc3n(C(c3ccccc3)c3ccccc3)c2=O)cc1 | '=' | 37 | ug.mL-1 | Aqueous solubility after 18 hrs at pH 7.4 | O=C(O)c1ccc(OC/C=C\Cn2c(=O)c3ccccc3n(C(c3ccccc3)c3ccccc3)c2=O)cc1 | -4.146605 |
CHEMBL560929 | O=C(O)c1ccc(OC/C=C\Cn2c(=O)c3ccc(Cl)cc3n(C(c3ccccc3)c3ccccc3)c2=O)cc1 | '=' | 51 | ug.mL-1 | Aqueous solubility after 18 hrs at pH 7.4 | O=C(O)c1ccc(OC/C=C\Cn2c(=O)c3ccc(Cl)cc3n(C(c3ccccc3)c3ccccc3)c2=O)cc1 | -4.035166 |
CHEMBL3734861 | Cc1cc(-c2cc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3s2)cnc1N1CCOCC1 | '<' | 1,000 | nM | Aqueous solubility of compound | Cc1cc(-c2cc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3s2)cnc1N1CCOCC1 | -6 |
CHEMBL539697 | CCCCCCOC(=O)NC(=N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 | '=' | 0.3 | ug.mL-1 | Aqueous solubility of the compound at pH 9.0 | CCCCCCOC(=O)NC(=N)c1ccc(NCc2nc3cc(C(=O)N(CCC(=O)OCC)c4ccccn4)ccc3n2C)cc1 | -6.320663 |
CHEMBL3740823 | O=C(O)C[C@H]1CC[C@H](c2ccc(C(=O)Nc3nc(Cc4ccccc4)no3)cc2)CC1 | '=' | 41,000 | nM | Solubility of compound in phosphate buffer at 2 mg for 20 hrs at pH 7.4 by UPLC analysis | O=C(O)C[C@H]1CC[C@H](c2ccc(C(=O)Nc3nc(Cc4ccccc4)no3)cc2)CC1 | -4.387216 |