Datasets:

timaeus
/

pile-dm_mathematics

Dataset card Viewer Files Files and versions Community

Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
/5, -3/5, b Let w be (-24)/(-10) + 0 + -2. Let n = 47.8 + -53. Let y = n + 5. Sort -5/6, y, w in descending order. w, y, -5/6 Let b = 2/7 - 31/84. Put -3, -0.4, b in descending order. b, -0.4, -3 Let x = -1/45405 - 13141/90537570. Let v = x + 173977/2991. Let r = -58 + v. Sort r, 5, 0. 0, r, 5 Suppose 4q + 5w + 10 = 0, -2q - w + 7 = -3q. Let l(t) = -t - 8. Let y be l(-4). Sort q, y, 2. q, y, 2 Let m = 0.07 + -5.07. Let x = 0.082 - 0.082. Sort m, x, 5 in ascending order. m, x, 5 Let i = -25 - -25. Suppose -c - 4c = i. Put c, -5, 4 in descending order. 4, c, -5 Suppose -2u - 7u = -9. Put -2, 9, u in descending order. 9, u, -2 Let v = 85 + -70. Sort 0.4, v, -2/17 in ascending order. -2/17, 0.4, v Let f be (1/(-2))/((-2)/16). Suppose 18 = fc + 2. Sort 2/11, -2, c in increasing order. -2, 2/11, c Let i(j) = -j*3 + 7j*2 - 6j. Let r be i(6). Suppose -3 + r = -s. Put 2, 4, s in descending order. 4, s, 2 Suppose 3f = -2f - 2d - 15, 0 = -2f - 2d - 6. Let g be f/108/6. Let x be -3 + ((-324)/96)/((-2)/2). Sort g, -2, x in decreasing order. x, g, -2 Let k = -2 + -2. Let y = k + 7. Let s be 3 - ((-9)/(-2) + 0). Put s, 1/4, y in descending order. y, 1/4, s Suppose -4u = 4l - 24, -3l - 5u - 12 = -36. Let p be (-5)/l - 5/15. Suppose 4y - 2 = -14. Sort p, -4, y in ascending order. -4, y, p Let j be 66/55(-5)/(-2). Sort 5, 4, j, -7 in increasing order. -7, j, 4, 5 Suppose -3 - 12 = -3u. Sort 4, 0, u, -5 in decreasing order. u, 4, 0, -5 Suppose a = -0a. Let h = 0 - a. Sort 2, h, -5 in decreasing order. 2, h, -5 Let o = -0.7 - 0.3. Let n = -0.17 + -4.83. Let b = n + 7. Put b, o, 2/3 in ascending order. o, 2/3, b Let i = -36 - -110/3. Sort i, 5, 0.2, 0 in increasing order. 0, 0.2, i, 5 Suppose -5h + 2o + 4 = -52, 12 = -4o. Suppose 2a + h = -0a. Put 2, a, -4 in decreasing order. 2, -4, a Let o = 19.1 + -18.6. Put -0.8, o, 4 in decreasing order. 4, o, -0.8 Let j(t) = 3 - 1 + 4t2 + t3 + 0t2. Let d be j(-4). Suppose i = 2f + 7, i - 4i - 4f - 29 = 0. Sort d, i, 0. i, 0, d Let p = -19.9 + 19. Let n = p + 0.5. Sort 0.1, -1/7, n in descending order. 0.1, -1/7, n Let g(z) = -z3 - z2 + 1. Let u = -7 - -8. Let h be g(u). Put -3, h, 3 in decreasing order. 3, h, -3 Let t be 57/(12/(-32)-4). Sort 3, t, 1, 4. 1, 3, 4, t Let r be ((-14)/105)/(-2 - (-23)/10). Put r, -3/7, 1 in descending order. 1, -3/7, r Suppose 2v = 2i, 0v = -v + 3i - 8. Let o be 2/v - (-18)/(-4). Put 4, -3, o in decreasing order. 4, -3, o Let s = -245 - -2207/9. Let v = -544579 + 21236287/39. Let y = -176/3 - v. Sort s, y, 0.3. y, s, 0.3 Let m(i) = i2 - 5i + 2. Let t be m(5). Let v = 11/6 - 2. Sort -0.1, t, v in descending order. t, -0.1, v Let p = 3.9 + -6.9. Sort p, 1, 4, 0.4 in decreasing order. 4, 1, 0.4, p Suppose 9y - 10y + 20 = 0. Suppose -5b + 2f - y - 8 = 0, -b - 3f + 8 = 0. Sort -5, 4, b in increasing order. -5, b, 4 Let g be 5 + -4 - (-2 + -7). Suppose 2r = -3s - g, -2s - 4 = -s + r. Put s, -4, 1 in descending order. 1, s, -4 Let h = -1 + 1. Let z = 9 - 19. Let p = z - -9. Sort h, -2, p in increasing order. -2, p, h Suppose -2z - 14 = 5z. Sort 5, z, -4, -17 in decreasing order. 5, z, -4, -17 Suppose 0t + 3t + 4o + 5 = 0, 47 = -5t + 3o. Let r(p) = p + 9. Let y be r(t). Let m = 10 - 6. Sort m, -2, y. -2, y, m Let p(s) = 13s*2 + 20s - 11. Let i(m) = 7m2 + 10m - 6. Let a(c) = 11i(c) - 6p(c). Let z be a(-10). Put z, 2, -4 in increasing order. -4, z, 2 Let w = 5 - 4. Let r = -5 + w. Sort 0, r, 2 in ascending order. r, 0, 2 Let x(i) = -6i - i2 - 3 + 0i + 0. Let n be x(-4). Let a be -1((-6)/(-21) - 26/(-7)). Sort 0, a, n in descending order. n, 0, a Let q be (-4)/(-6)(-5)/2. Let n be (-106)/(-22) + (-10)/(-55). Sort n, q, 0.1 in descending order. n, 0.1, q Let s be (-2)/6 - 31/(-3). Put 5, -2, s, -5 in descending order. s, 5, -2, -5 Suppose -4l = -g - 3, -4l - l + g = -5. Let u = 0.04 - -0.26. Let f(r) = r*3 - 5r*2 + r - 5. Let x be f(5). Put x, u, l in decreasing order. l, u, x Let f(o) = 2o + 1. Let g be f(2). Suppose -gw + 1 = 2l - 4, 4l - 2w + 26 = 0. Let v(i) = -i - 5. Let u be v(-6). Put l, u, 5 in descending order. 5, u, l Let n = 128 + -1662/13. Let u = 0.1 - 0.5. Let b = -0.06 - -0.06. Put u, n, b in ascending order. u, b, n Suppose -n - 3 = n - 3m, 4n + 2 = 2m. Suppose 2o = 3s - no + 23, s + 5o = 15. Sort 2, s, -1 in increasing order. s, -1, 2 Let p(n) = 2n*3 - 11n*2 + 7n - 6. Let q be p(5). Put 5, -33, q in decreasing order. 5, q, -33 Suppose -2d + 0 - 16 = -2x, 3d + 3x = 0. Let u be 22/4 + 2/d. Let z be 1/(-3) + (-2)/3. Put z, 4, u in increasing order. z, 4, u Let r = 27 - 27.2. Let d = -0.3 - 1.7. Sort d, 4, r in decreasing order. 4, r, d Let t be -3(-2)/(1 - 3). Suppose -p - 6 = 2p. Let m be (-1)/4 - 3/(-4). Sort t, m, p. t, p, m Let g = -47 - -42. Put 0.03, -2, g in ascending order. g, -2, 0.03 Let k = 37 - 35. Sort k, -9, -5 in descending order. k, -5, -9 Suppose -2w = 3w - 20. Suppose -3t + 14 = -h, -4t - 23 = 2h - 9t. Put w, -3, h in descending order. w, h, -3 Let z(t) = 5t. Let m be z(-1). Let q = m + 2. Sort -1/4, q, -2/3 in decreasing order. -1/4, -2/3, q Let d(p) = p. Let k(x) = -4x. Let v(q) = -10d(q) - 2k(q). Let u be v(-1). Put u, -4, 3 in descending order. 3, u, -4 Let q = 1.5 - 2.5. Sort 5/6, q, -5. -5, q, 5/6 Let v = -1.79 - 0.21. Sort v, 5, 6. v, 5, 6 Let r = 3 - 1. Suppose -6t + t + 33 = -rj, 20 = 4t. Suppose 2h - 4 = 4f, f - 1 = -4h - 2. Sort -2, j, f in increasing order. j, -2, f Let b be -3 + 7 + 14/2. Suppose -2u + 2s = s - b, -5s - 40 = -5u. Sort -3, u, 0.04. -3, 0.04, u Let c = -42 + 37. Put -4, 0, c in descending order. 0, -4, c Let a be (-8)/(-12) + (-42)/9. Put 1, -3, 0, a in increasing order. a, -3, 0, 1 Let h(y) = -y*3 - 7y*2 + 10y + 12. Let a(b) = 2b3 + 14b*2 - 20b - 24. Let t(m) = -3a(m) - 5h(m). Let j be t(-8). Put -1, 4, j in increasing order. j, -1, 4 Suppose b = 3k - 3, 5b - 4k + 4 = -0k. Put -4, 3, b in increasing order. -4, b, 3 Suppose 4h + 4 = 4l, 0l + h - 7 = -3l. Let r be (-10)/(-20) - (-2)/(-4). Sort r, 5, l in decreasing order. 5, l, r Let l be (-116)/(-36) - 31. Let y be 1 + 1 - (-7)/(-3). Sort l, -0.2, y. y, -0.2, l Suppose i - 26 = 5j + 4i, -2j - 2i - 12 = 0. Let b be 2/(-4) + 14/44. Put j, -0.3, b in decreasing order. b, -0.3, j Let a = -4 + 5.5. Let b = -1.4 + a. Put b, 2, 0.2 in ascending order. b, 0.2, 2 Let d be 39/33 - 2/2. Let t = 19 + -18. Put -1, t, d in descending order. t, d, -1 Suppose -2m - 7 + 3 = 0. Put -1, 0, m in descending order. 0, -1, m Let d = 3 - 3. Sort d, 2, -2. -2, d, 2 Let a = 83 - 86. Sort 5, a, 34. a, 5, 34 Let o = 0.23 + 1.07. Let x = o + -1.6. Put x, 4/3, -1/4 in increasing order. x, -1/4, 4/3 Let w = 185/8 - 23. Put w, 0.1, 13 in ascending order. 0.1, w, 13 Let d = 566 - 3964/7. Let m = -3/49 + 88/637. Sort d, 0, m in increasing order. d, 0, m Suppose -4y = 4f - 20, 0f + f + 3y - 9 = 0. Sort -5, f, -4, -3. -5, -4, -3, f Let o = 0.05 - -3.95. Let a = 1402 - 2753/2. Let d = a - 26. Sort o, 5, d. d, o, 5 Suppose -2v - 10 = 0, 2i = 5i - 3v - 3. Let p = 14 - -1. Suppose 0 = -0d + 5d - p. Put d, -5, i in increasing order. -5, i, d Suppose -10 = 2w, -5j - 12 + 62 = 4w. Suppose -5y + 6 = -j. Suppose -3a = -3o + 24, a = 8o - yo - 23. Put -2, -3, o in descending order. o, -2, -3 Let v = -491803/42 - -11709. Let p = 3/7 + v. Sort 0, 2/5, p. p, 0, 2/5 Suppose -4d = -2d - 2. Let a = -3 + d. Suppose -1 = -q + 2r, 0q = q + r - 1. Sort -4, a, q in ascending order. -4, a, q Suppose -4 = 6s + 8. Put -5, -3, 5, s in descending order. 5, s, -3, -5 Suppose 0 = y - 6y. Suppose 5x - x - 3u - 29 = 0, y = -5x - u + 22. Put x, -5, -3 in descending order. x, -3, -5 Let w be (35)/((-3)/(-4)). Suppose 0 = -2t + 8. Suppose -j = -4q - 5, j + 3j - w = tq. Sort 4, q, -5 in increasing order. -5, q, 4 Let h(u) = 3u2 + 2u - 2. Let w(d) = -4d2 - d + 3. Let f(q) = 3h(q) + 2w(q). Let b be f(-2). Sort -0.2, b, 4 in decreasing order. 4, -0.2, b Suppose -2s - 5b + 9 = 0, 3b + 1 = 5*s - 6. Suppose -v + s = v. Put v, -4, -2 in descending order. v, -2, -4 Let p = 0.074 + 27.926. Sort -5, p, -0.5 in descending order. p, -0.5, -5 Suppose -2 = n + 2. Suppose -4 + 0	{ "pile_set_name": "DM Mathematics" }
iple of 15? True Let i(d) = 5d2 - 3d - 4. Let b be i(4). Let t = 38 - b. Let j = -10 - t. Is 16 a factor of j? True Let r be ((-18)/(-5))/((-6)/(-60)). Suppose -4i + 4y + r = 0, 5i + 2y + 3 = 69. Is 6 a factor of i? True Suppose 0 = 2y - 0 - 18. Suppose 0q + y = 3d + 3q, -4d + 12 = -5q. Suppose a = -4k + 8, dk - 4k = -4a + 117. Is a a multiple of 15? False Suppose 0 = 3x - 7p + 3p - 33, 4x - 4p - 40 = 0. Suppose -4l + 161 = -x. Does 14 divide l? True Suppose 4 = -5s - 1. Let k be (0/((-1)/s))/2. Suppose k = m - 2m + 20. Is m a multiple of 8? False Let q = 9 + -7. Suppose 117 - 47 = 5o + 2h, -qh - 50 = -5o. Does 4 divide o? True Let c be 1/(-3) + 200/24. Suppose -c + 36 = 2m. Suppose -3o + m = -49. Is 11 a factor of o? False Suppose j - 7 + 2 = 0. Suppose 5t + 45 = 4u - 0t, -jt - 40 = -3u. Is 5 a factor of u? True Suppose j + d = 190, 6j - 938 = j - d. Is 40 a factor of j? False Let h be (1/2)/((-2)/(-8)). Is ((-12)/15 + h)15 a multiple of 16? False Let m = -20 - 20. Let p = -29 - m. Does 3 divide p? False Let a be (1/(-2))/(3/(-744)). Suppose -4r + 0r = -a. Does 15 divide r? False Suppose -3m + 622 = 2v, 5m + 5v = 3v + 1030. Is 22 a factor of m? False Let x be 1 + -1 + 21 - 0. Let k = -9 + x. Is k a multiple of 4? True Suppose -2r = -4k + 3r - 17, 8 = -4k - 4r. Let b be (-488)/(-12) + 2/k. Suppose b = -4f + 104. Does 8 divide f? True Suppose -3h + 5g = 3, -4g = 2h - 2g - 14. Let m be 30/((-2)/h2). Is 3 a factor of -4(3 + m/8)? True Let y = -10 - -52. Let p = y - 59. Let g = p - -30. Is 6 a factor of g? False Let w(m) = m - 4. Let s(d) = 2d - 4. Suppose -4 - 4 = -2q, 2y - q = 2. Let u(f) = yw(f) - 4s(f). Is u(-11) a multiple of 23? False Suppose -3i - 3 = 0, -2n - 2i + 169 = -81. Does 9 divide ((-12)/(-14))/(3/n)? True Is (5/(-2))/(3/(-134 + -4)) a multiple of 19? False Suppose 0r - 2r + 73 = v, -2v + 134 = -2r. Does 12 divide v? False Let z(l) be the first derivative of -l4/4 + 7l*3/3 - 5l*2/2 + 6l - 4. Does 4 divide z(6)? True Let d(a) = 3a2 + 10a - 5. Let j be d(-4). Let i = 6 - 4. Suppose iu = -ju + 75. Is 9 a factor of u? False Let s(u) be the second derivative of u3/3 + u2/2 - 2u. Let r be s(1). Suppose 20 = -q + rq. Does 5 divide q? True Let y(n) = n*3 + 5n + 0 - 5 + 0 - 6n2. Let f be y(5). Does 20 divide f/464/(-2)? True Suppose -6d - 4g - 164 = -9d, 4d = 5g + 219. Is d a multiple of 18? False Let i(o) = -3o*3 - 4o*2 - o + 4. Let q be (1 - 0)/((-2)/(-14)). Let a = -10 + q. Does 17 divide i(a)? False Suppose 0 = 3j - 2z + 3z - 88, 0 = -2j + 3z + 55. Suppose -3s + 0s + 423 = 0. Suppose -j + s = 4o. Is 14 a factor of o? True Suppose -5c + 18 = -2i, 3c + 3i = 2c - 10. Suppose -128 = -cg - 8. Does 19 divide g? False Suppose r - 1 = -l, -2l = -2r - r + 13. Let g(k) = 4k*r + 4k*2 - 5k + 0k - 1 - 3k3 + k2. Is g(-5) a multiple of 12? True Let r(x) = x*3 - x + 2. Does 8 divide r(3)? False Suppose -8p = -4p + 240. Let u = p - -100. Is 16 a factor of u? False Suppose -2 = 3g - 11. Suppose -2z + gq = -169, 0z - 3z - 2q = -273. Is z a multiple of 25? False Let w(n) = n3 - n2 - 1. Let q be w(2). Suppose qr - 51 = -4s + s, -2s = 4. Let c = -10 + r. Is 3 a factor of c? True Let g = 49 + -86. Let h be (183/(-9))/(4/(-12)). Let b = h + g. Is b a multiple of 8? True Suppose 2f - 125 = 5c, 2f - 6c = -3c + 115. Suppose 3l - f = 10. Is l a multiple of 17? False Let j(w) = -6. Let u(b) = -b + 13. Let n(o) = -9j(o) - 4u(o). Let k be n(-3). Is (-23)/(-5) - 4/k a multiple of 3? False Let i(p) = -2p - 9. Let h be i(-6). Let g be (-3 + h)/(4/2). Suppose g = -d - 1 + 32. Is 12 a factor of d? False Is 29 a factor of ((-3255)/6)/(-5) - 2/(-4)? False Suppose 2s - z = -0z - 14, 4z = 2s + 14. Let h(u) = 3 - 4u - 3u - u + 7u. Is h(s) a multiple of 5? True Suppose -4h - 36 = -4b, -h - 5b + 0b = -9. Let k(z) = z*2 + 4z - 8. Let p be k(h). Suppose -f - px = -2f - 10, 2f = -5x + 45. Is 5 a factor of f? True Let b(q) = 6q2 - 5q + 4. Let g be b(3). Suppose 3t - 64 = -i - i, g = t + 5i. Is t a multiple of 8? False Let y(r) = r3 - r2 - r. Let j(p) = 2p3 - 9p*2 + 3p + 8. Suppose 3b = -4c - 15, c + 9 = -5b + 1. Let h(n) = cy(n) + j(n). Is 15 a factor of h(-7)? True Suppose -4c - 3a + 4 = -5a, 13 = 3c + a. Is c a multiple of 2? False Does 9 divide (1 + 2)/(2/12)? True Let n be -3 - (-8)/(-2)-1. Does 17 divide ((-60)/8 - n)-8? True Suppose 3i - 8 = -i. Suppose 0 = -io + y + 3y + 4, -3y + 10 = 5o. Suppose -2s + 53 = 3f, of + 3s + 2 = 44. Is f a multiple of 7? False Does 31 divide (-6)/(-4)(-248)/(-6)? True Suppose 3n - 10 = n. Suppose -q + 10 = z, 5q - nz = -0q. Is q a multiple of 2? False Let u = 112 - 90. Is u a multiple of 6? False Suppose -2x - 4r = -9r + 11, -3r = -2x - 5. Let s be 3/(-12)2x. Does 6 divide 11 + 2/(s - 1)? False Let j be 1 - 21/(12/4). Is j/10 + (-386)/(-10) a multiple of 22? False Let q(f) = f + 31. Does 11 divide q(0)? False Suppose 0 = -0c - 2c + 8. Suppose 3p - 29 = -cb, 0 = 5p + 4b - 17 - 34. Is p a multiple of 4? False Let s be 35/146/5. Suppose sr - r - 14 = -2g, -2g + 3r - 1 = 0. Does 2 divide g? True Let l(t) = -t*3 + 15t*2 - 15t + 20. Does 5 divide l(14)? False Let q be (2 + 0/(-2))/(-2). Let g be 1/(5/6 + q). Let k(u) = -u. Is 5 a factor of k(g)? False Let f(c) = -c + 2. Is f(-10) a multiple of 3? True Let c(r) = -5r - 4r2 - 1 - r2 + 2 - r*3. Let z be c(-4). Suppose 0 = -zy + 97 + 63. Does 20 divide y? False Let w = -333 + 505. Is 15 a factor of w? False Let d = 3 - 1. Suppose 0 = -6l + dl - 132. Let x = l - -61. Is x a multiple of 14? True Suppose -2l + 24 = 2l. Is 29/4 + l/(-24) a multiple of 3? False Let t be (2/2)/(3/(-6)). Let m be 17t(0 - -1). Let a = m - -56. Is a a multiple of 8? False Let v = 73 - 37. Is v a multiple of 9? True Suppose -10k - 60 = -15k. Is k a multiple of 2? True Suppose 8 = f - 3w, 2f + 0w = -2w. Suppose 2l - x = 19, f = -3l + 2x + 33. Is 2 a factor of l? False Let t be 2 + 0 + 2 + -2. Let k(u) = -ut + 4u2 - 1 + 0. Is k(2) a multiple of 11? True Let i(a) = a2 + 12a - 4. Is 15 a factor of i(-15)? False Let x(k) = -30k - 3. Is 9 a factor of x(-1)? True Suppose -285 = -2b + k, 4k = -13b + 9b + 564. Is b a multiple of 56? False Let v(w) = -7w - 40. Is v(-12) a multiple of 8? False Let g(z) = -z3 + 6z*2 + 10z - 7. Is 3 a factor of g(7)? False Suppose 31 + 37 = 4a. Suppose -c + a = -14. Is 12 a factor of c? False Suppose 2p = q + 1, 2q + 0p + 2 = 5p. Let g be 1673/21 - q/3. Suppose -g = -4k - k. Does 8 divide k? True Suppose -22y = -19y - 840. Is 40 a factor of y? True Let l be ((-2)/(-3))/((-6)/(-45)). Suppose lj - 5 = 5v, -4j - 4v + 44 = -0j. Let s(r) = r3 - 5r*2 - r - 2. Does 14 divide s(j)? True Suppose 0 = 9b + 4b - 2028. Is 39 a factor of b? True Let y(z) = -z - 8. Let i be y(-8). Suppose iq - 145 = -5q. Suppose n - b - 20 = 0, q = n - 0n - 4b. Does 7 divide n? False Suppose 2r = -4c + 14, -1 + 7 = 3c + 3r. Is c a multiple of 2? False Let l(o) = o - 2. Let t(s) = s + 1. Let r(c) = 6l(c) + 6t(c). Does 21 divide r(5)? False Let c(f) = 25f + 27. Does 19 divide c(4)? False Let r be 6((-10)/(-4))/5. Suppose -3f + 53 = o, 0 = 3f - 5f + ro + 28. Does 17 divide f? True Let l(a) be the third derivative of 0 - 1/24a*4 + 2a*2 + 0a + 8/3a3. Is l(10) a multiple of 3? True Let w(z) = -z + 20. Suppose 0 = 2x - 3g - 12, -2g = -0g + 8. Does 10 divide w(x)? True Suppose u - 4t = -u - 12, 2u + 4t = 20. Let x(g) = 3g3 - 2g*2 + g + 1. Let p be x(u). Let h = p - 10. Is h a multiple of 9? True Is 18 a factor of 19 + 2111/(-22)? True Suppose -5f = 2i - 59, -2i - 2f = 3i - 200. Is i a multiple of 14? True Let h(b) = 2b2 + 5b + 6. Does 7 divide h(-5)? False Let a be (3 - 4 - -3)-1. Is 2 + (11 - a) + 0 a multiple of 15? True Is 20 - 4 - 12/(-4) a multiple of 2? False Let n(h) = 3h*3 + 3h*2 + 5h - 6. Is n(3) a multiple of 13? True Is 2 a factor of 2/(-36)-94 + (-12)/54? False Let c(d) = -d - 2. Let u be c(-4). Suppose -un - 3n = -30. Suppose nj = 2j + 32. Is j a multiple of 8? True Let h(o) = o*2 + 5	{ "pile_set_name": "DM Mathematics" }
v(-5) and z. 9 Let z(i) = i*3 - 2i. What is the least common multiple of z(2) and 20? 20 Let u(z) = -z + 3. Let i be 2/5 - 8/20. Let w be u(i). Calculate the common denominator of 95/6 and 43/20 - w/(-6). 60 Let n = -4 - -10. Let c = 17 + -1. Calculate the common denominator of 3/2 - 60/c and n. 4 What is the common denominator of (-10)/(94/(-51)) and -89/10? 30 Let l be (9/(-3))/(-3)-282691. Let j = -3107538/11 - l. Let k = j + -187. What is the common denominator of -61/9 and k? 99 Let d = -1004/129 - -67951/4902. Let j = d - -84/19. Calculate the common denominator of 17/7 and j. 14 What is the lowest common multiple of 14 and (-11)/(-22) + (9/2)/3? 14 Let q be ((-6)/9)/(4/(-66)). Suppose 2a - q = 3. Calculate the common denominator of 47/10 and 2 - (a/8 - -2). 40 Let b(g) = 2g - 3g + 1 + 0g. Let j be b(6). Let y(u) = -u - 3. Calculate the lowest common multiple of y(j) and 7. 14 Suppose m - 3 = 1, -9 = -5r + 4m. Suppose 0 = a + 2j + 41 - r, -3j + 46 = -a. Calculate the smallest common multiple of 22 and ((-2)/5)/(1/a). 176 What is the smallest common multiple of 30 and (-6)/((-66)/295) - 2/(-11)? 270 Let q = -9945 - -178891/18. Calculate the common denominator of -93/14 and q. 126 Let r = 250711/20 - 12531. Let n = -1685/728 - 11/182. What is the common denominator of r and n? 40 Suppose 5d + 45 = 2h - 7h, -h + 7 = -d. Let w = -5 + 2. Let s = w - d. Calculate the smallest common multiple of s and 5. 5 Calculate the common denominator of -29/2 and (348/(-8)1)/(-5). 10 Suppose -3c = -4u - 58, 0c + 78 = 4c - 5u. What is the smallest common multiple of 22 and c? 22 Suppose -5n + 61 - 1 = 0. Suppose t + 4t - 5 = 0. Calculate the least common multiple of n and 18 - (0 - 1 - t). 60 Let g(c) = -8c*3 + 2c*2 + 2. Let n be g(3). Let k be ((-18)/7)/(21/n). What is the smallest common multiple of (k/20)/(1/5) and 10? 30 Let q = -305917/7 - -43834. Let o = q - 9371/70. Calculate the common denominator of o and (-1)/(-4) - 2/(-4). 20 Let k be ((-1)/(-2))/((-6)/(-480)). Suppose 0 = -2c + k + 4. Calculate the least common multiple of 8 and c. 88 Let l(z) = z*2 + 7z - 1. Let r be l(-7). Let s = -11003 - -242171/22. Calculate the common denominator of s and (67/(-12)1)/r. 132 Let o(h) = 8h*2 - 11h - 3. Let a be o(8). What is the common denominator of a/(-72) - 24/(-108) and -43/2? 8 Suppose -9 = -l + 11. Calculate the least common multiple of l and 10. 20 Let s = 423/8 + -117/2. Let l = 734 + -2231/3. What is the common denominator of s and l? 24 Let l = 66 - 56. What is the least common multiple of 14 and l? 70 Let w = -16 + 32. What is the common denominator of -61/5 and (3/w)/((-6)/100)? 40 Let o(b) = -12b + 1. Let u be o(-7). Suppose 5v - u = 85. What is the lowest common multiple of v and 6? 102 Let f be (-1 - 33) + (0 - -1). What is the common denominator of (-2)/(-3) - (-64)/f and -31/8? 88 Let z = 1277 + -7693/6. Calculate the common denominator of z and 19/22. 66 What is the lowest common multiple of 45 and (100/(-30))/(1/(-18))? 180 Let h be 6987 + (-4)/(-2) + -1. Let q = -42061/6 + h. Calculate the common denominator of q and (-3)/(-12) - 82/24. 6 Let d be ((8/2)/(-4))/1667. Let u = d + -38323/30006. What is the common denominator of u and (-1)/(-4) - 54/16? 72 Let k be 2/(-4) - 196/(-8). Let f = -14 + k. Let i = f - 5. What is the least common multiple of 9 and i? 45 Calculate the least common multiple of 8 and (-1 + 2)/((-4)/(-44)). 88 Let h(m) = m*3 + 11m*2 + 8m + 7. What is the lowest common multiple of h(-10) and 2? 54 Let r(s) = -2s - 6. What is the smallest common multiple of 20 and r(-10)? 140 Let q be 6/27 - (-248)/18. Calculate the smallest common multiple of ((-2)/4)/(6/(-264)) and q/(-35)-75. 154 Let g = -690769/44 - -15697. What is the common denominator of -23/48 and g? 528 Let w(b) = -2b. Let h be w(-1). Suppose y = 5x + 28, -h = -y - 4x - 19. Let v = y - -7. Calculate the least common multiple of v and 10. 10 Find the common denominator of 1/(6/134) - 16/24 and -41/10. 30 Find the common denominator of (1172/90)/2 + 44/(-110) and -67/16. 144 Let j = 3 - -4. Let m = 9 + -4. Suppose 2p + 7 + 1 = -g, mg + 2p = 0. Calculate the lowest common multiple of g and j. 14 Let k be -1 + 4/((-3360)/9729). Let y = -16/35 - k. What is the common denominator of y and 7/4? 8 Calculate the common denominator of (-590)/50(-10)/(-12) and -17/9. 18 Let s = 4170 + -29142/7. Calculate the common denominator of 20/19 and s. 133 Suppose 2j = j. Suppose j = r + 43 - 400. What is the common denominator of (r/18)/7 + -1 and 117/10? 30 Let d = 38 - 33. What is the least common multiple of 4 and d? 20 Let z = 61 - 39. What is the lowest common multiple of z and 16? 176 Let z(o) = o - 1. Let u(q) = 4q*2 - 17q + 3 + 9q + 5. Let j(x) = u(x) + 8z(x). Calculate the least common multiple of 20 and j(1). 20 Suppose p - 10 = 2a - 0a, -p = -3a - 17. Let q(b) = -b - 4. Let t be q(3). Calculate the smallest common multiple of 1 and a/(t/10) + -2. 8 Suppose -5s - 12782 = -38617. Let p = s + 2372. Let o = p - 150897/20. Find the common denominator of o and 77/20. 20 Let w(l) be the second derivative of -l*3/6 + 11l*2/2 + 4l. Let b be w(-9). Calculate the common denominator of -49(1/b - 0) and 97/2. 20 Let f(n) = n3 - 6n*2 - 9n + 21. Calculate the smallest common multiple of f(7) and 9. 63 Let u = 8 - 6. Suppose 0 = -ur + 2. Suppose g - 2v = 5 - r, 2g + v - 23 = 0. What is the smallest common multiple of 4 and g? 20 Let c(q) = -3q + 2. Let w(r) = -7r + 5. Let p(b) = -5c(b) + 2w(b). Let u be (-2)/(-1)(-3)/(-2). Calculate the smallest common multiple of 11 and p(u). 33 Suppose 0j + j - 36 = -4v, -v = -5. Find the common denominator of 3j/18 + 0 and 73/6. 6 Suppose 113200 = -3d - 2d. Let y = -452921/20 - d. Calculate the common denominator of 2/5 - (-63)/330 and y. 220 Let j(z) = 4z + 2. Let x be j(-2). Calculate the lowest common multiple of 11 and 92/20 + x/10. 44 Let f be (1 - 2)(-3)/3. Let z(p) = p2 + 3p. Let o be z(-3). What is the common denominator of o + 134/(-16) + f and -26? 8 What is the common denominator of (-211)/(-180) + (-16)/72 and -63/10? 20 Let a = -827224/3 + 285744. Let n = a + -332293/33. Let h = n - -11551/176. Calculate the common denominator of h and 133/18. 144 Calculate the smallest common multiple of 20 and (-254)/(-14) + (-11)/77. 180 Let v = -6913 - -41629/6. Let x be 1898/(-5)(-5)/3. Let r = 3947/6 - x. What is the common denominator of r and v? 6 Let f = -6 - -2. Calculate the common denominator of 357/f14/105 and -19/10. 10 Let o be ((-8)/10)/((-2)/(-5)). Let y be ((-6)/(-4))/(o/12). Let j = -1 - y. What is the lowest common multiple of j and 2? 8 Let v = -15649/12 + 2601/2. What is the common denominator of v and -19/20? 60 Suppose 46 = 4z - 4t + t, 5z = -3t + 44. Calculate the least common multiple of 20 and z. 20 Let u = -292 + 2331/8. Calculate the common denominator of u and 113/40. 40 Suppose w = 2w - 44. Find the common denominator of (-12)/(-66) - 679/w and 2/7 - (-393)/70. 20 Let x(a) = -a2 + 8a - 4. Let v(p) be the first derivative of p*2/2 + 17p - 1. Calculate the least common multiple of x(6) and v(-9). 8 Let t be (3/(-9))/(2/(-174)). Let n = 61 - t. Let h = n - 12. What is the smallest common multiple of h and 12? 60 Let o(b) = -2b - 4. Suppose -4s + 3t = 44, s + 4s - t = -44. Calculate the lowest common multiple of 18 and o(s). 36 Let y = -1155/43 + 27. Let k = y + 3987/86. Calculate the common denominator of k and -5. 2 Suppose -6f = -10f + 4. What is the common denominator of 34/(f(-1 - 0)) and -41/3? 3 Suppose 10 = -f + 5f - 3u, -24 = -5f - 2u. Suppose 3 = -3c + 9. Calculate the least common multiple of c and f. 4 Let h = 2784385/107 + -26022. Calculate the common denominator of 77/8 and h. 856 Let o = 17/21 - 107/14. Calculate the common denominator of o and 23/8. 24 Suppose 0 = -o + 3c + 10, -3o - c = -2c - 62. What is the least common multiple of o and 36? 396 What is the least common multiple of 14 and (-207)/(-18) - ((-3)/2 + 1)? 84 Suppose 2r - 5 = r. Suppose ru + 2h = -32924, -u - 32916 = 4u - 2h. Let m = u - -92287/14. What is the common denominator of 37/8 and m? 56 Let x = 9283/42 - 656/3. Find t	{ "pile_set_name": "DM Mathematics" }
in -879 + 1889r2 - 1889r*2 + 0r*3 - 3r*3. -3r*3 - 879 Collect the terms in -38j - 718j - 451j. -1207j Collect the terms in -2u + 2u + 980u*3 - 963u*3. 17u*3 Collect the terms in -409x*2 - 534x*2 + 945x*2. 2x*2 Collect the terms in -43125581h + 2h3 + 43125581h. 2h3 Collect the terms in 5 + 204b + 228b - 339b. 93b + 5 Collect the terms in -315n*3 + 24n*3 - 76n*3. -367n*3 Collect the terms in 3 - 4 - 5 + 358370h + 6 - 358364h. 6h Collect the terms in -8732a2 + 846a*2 - 668a*2. -8554a*2 Collect the terms in -1 + 6733q*2 + 1. 6733q*2 Collect the terms in 50j - 9j + 278j + 2j3. 2j*3 + 319j Collect the terms in -15t3 + 17t*3 - 1 - 1866t + 1. 2t3 - 1866t Collect the terms in 10591x - 5205x - 5355x. 31x Collect the terms in -119 + 40654r3 + 119. 40654r*3 Collect the terms in 174u + 179u + 198u - 550u. u Collect the terms in -206j*2 + 841j*2 - 210j*2 - 211j*2 - 214j*2 - 6j*3. -6j*3 Collect the terms in 296p + 224p + 505p. 1025p Collect the terms in -14x*3 - 1264 + 635 + 629. -14x3 Collect the terms in -t2 - 22082t3 + t2. -22082t3 Collect the terms in -x3 + 25x3 - 4x*3 - 52x*3. -32x*3 Collect the terms in 161y*3 + 404y - 404y. 161y3 Collect the terms in 3058 + s3 - 3058 + 12s2 - 12s2. s3 Collect the terms in 0t + 0t + 30 - 35t3 + 6t - 2t. -35t*3 + 4t + 30 Collect the terms in -2v3 - 16v*2 + 22v*2 + 65v*2. -2v*3 + 71v*2 Collect the terms in 122y*2 + 0y + 194y2 + 0y + 12y2. 328y*2 Collect the terms in 9498n*3 - 9495n*3 + 129n*2 - 129n*2. 3n*3 Collect the terms in -1398097 + 1398097 - 4r*2 + 3r2. -r2 Collect the terms in j - 27 - 12 - 8 + 0j. j - 47 Collect the terms in -287y*3 - 230y*3 + 514y*3. -3y*3 Collect the terms in 2a*2 + 4a*3 - 2a*2 + 6a*3 - 6a*3 - 16a*3. -12a*3 Collect the terms in -108m + 35m - 104m - 110m + 26m. -261m Collect the terms in -28j2 - j2 + 14j2 + j2 + 18j*2. 4j*2 Collect the terms in -13o - 10o + 10 - 5o*2 - 4 - 6. -5o*2 - 23o Collect the terms in 15m3 - 8m*2 + 8m*2 + 594m - 594m. 15m*3 Collect the terms in -4489 - 107x*2 + 4489 - 2x + x. -107x2 - x Collect the terms in -117 - y2 + 60 + 2y2. y2 - 57 Collect the terms in -456p3 - 206p*3 - 80p*3 + 1562p*3 - 346p*3. 474p*3 Collect the terms in -1656906i*2 + 828431i*2 + 828477i*2. 2i*2 Collect the terms in -3637k - 805k + 1500k*2 - 1499k2. k2 - 4442k Collect the terms in 30r*3 - 53r*2 + 34r*2 - 20r*3 + 19r*2. 10r3 Collect the terms in 65 - r2 - 63 + 2r - 150r*2. -151r*2 + 2r + 2 Collect the terms in 1804758 - 1804758 - 56r3 + 291r*3. 235r*3 Collect the terms in -6q*3 + 179300 - 358598 + 179298. -6q*3 Collect the terms in -12p*2 - 18p*2 + 3p - 4p. -30p*2 - p Collect the terms in -1309i*2 - 1608i*2 + 292i*2 + 65i*2. -2560i*2 Collect the terms in 247275 - 12i*3 - 247275. -12i*3 Collect the terms in 7272t + 3193t - 1901t + 4758t. 13322t Collect the terms in -3596c2 - 2c*3 + 1770c*2 + 1826c*2. -2c*3 Collect the terms in -8 - 3 + 4 + 27r*2. 27r*2 - 7 Collect the terms in 73942k + 3 - 147889k + 71k*3 + 73947k. 71k3 + 3 Collect the terms in 14 - 8i*2 + 84i - 84i - 12 + 12i*2 + 9i*2. 13i*2 + 2 Collect the terms in 237i + 194i - 377i. 54i Collect the terms in -3w*3 - 62w*2 - 4w*3 + 8w3. w3 - 62w2 Collect the terms in -27672c - 27661c - 27666c + 82998c. -c Collect the terms in 3951 + 2t*3 - 1904 - 2047. 2t*3 Collect the terms in 73500z*2 - 73507z*2 + 0 + 0. -7z*2 Collect the terms in 1755520b + 4 - 4 - 1755520b + 17b*3. 17b*3 Collect the terms in -7 - p + 7 - 1015p*3 - p. -1015p*3 - 2p Collect the terms in 3z2 + 138z*3 - 3z*2 - 58z*3 - 74z*3. 6z*3 Collect the terms in 1 - 17 + 5 - 4c + 11 + 0. -4c Collect the terms in -1209o + 4363o + 2 - 4. 3154o - 2 Collect the terms in 4566c + 18 + 60c - 14 + 18. 4626c + 22 Collect the terms in -600q*2 + 1719q*3 + 600q*2. 1719q*3 Collect the terms in -240m + 26m3 - 2 - 275m - 28m. 26m*3 - 543m - 2 Collect the terms in 1392w - 1266w - 4w2 - 126w. -4w2 Collect the terms in -41u*3 - 29u*3 - 12u*3 + 11u*3 + 6u*3. -65u*3 Collect the terms in 1012x*2 + 43x*2 + 464x*2 - 182x*2 + 13x*2. 1350x*2 Collect the terms in -73005y*2 + 36490y*2 + 36504y*2. -11y*2 Collect the terms in -94993b*3 + 15b + 94994b3 - 15b. b*3 Collect the terms in 190t*3 - 265t*3 + 114t*3. 39t*3 Collect the terms in -4y*2 + 46y*2 - 53y*3 - 27y*2 - 15y*2. -53y*3 Collect the terms in -106198 + 106198 - 143p. -143p Collect the terms in -4331d - d*2 - 3 + 3 + 4331d. -d*2 Collect the terms in -350u + 1063u - 353u - 371u. -11u Collect the terms in 963x - 1912x + 952x. 3x Collect the terms in -r*3 + 95r - 34r + 2r3. r3 + 61r Collect the terms in -i - 3122 + 3122 - 2i*2 - 3i*3 + 2i*2. -3i*3 - i Collect the terms in -1530 + 6n*2 + 1543 - 4n*2. 2n*2 + 13 Collect the terms in 45178u*2 - 45178u*2 - 8u*3. -8u*3 Collect the terms in -59x - 50x + 207x - 60x - 53x. -15x Collect the terms in -62y + 69 - 30 + 59y. -3y + 39 Collect the terms in 4i2 - 10i*2 + 3 - 2 + 2. -6i*2 + 3 Collect the terms in -3 + 10i - 10i - 194721i*2 + 2 + 194722i2. i2 - 1 Collect the terms in -49i2 - 5i + 7i - 16i*2. -65i*2 + 2i Collect the terms in 5f + 4535 - 2f - 2262 - 2273. 3f Collect the terms in -3538q*2 + 7176q*2 - 3607q*2. 31q*2 Collect the terms in -258332m*2 + 0 + 2 - 2. -258332m*2 Collect the terms in 3 - 2 - 1890d + 1891d + 2d*2 - 1. 2d*2 + d Collect the terms in 110a*3 - 57a*3 - 12a - 9a - 52a3. a3 - 21a Collect the terms in 40p - 34p2 - 60 + 10p*2 - 40p. -24p2 - 60 Collect the terms in 1788793r*2 - 2r*3 - 1788793r*2. -2r*3 Collect the terms in 4r - 40r + 10r - 40r - 53r. -119r Collect the terms in -5665i*2 + 2834i*2 + 2841i*2. 10i*2 Collect the terms in 547 - 674u - 1099 + 673u + 552. -u Collect the terms in 212502115251x + 3x2 - 212502115251x. 3x2 Collect the terms in -79d*3 - 106d*3 + 167d*3. -18d*3 Collect the terms in 3q + 11q + 2q + 20q3 - 19q. 20q3 - 3q Collect the terms in -8597 + 4299 + 0b3 + 3b*3 - 22b*3 + 4296. -19b*3 - 2 Collect the terms in 9v*2 + 0v - 11v - 7v*3 + 11v. -7v3 + 9v*2 Collect the terms in 381588j*3 - 763154j*3 + 381579j*3. 13j*3 Collect the terms in 16 + 13 - 201u + 200u. -u + 29 Collect the terms in -11099 + 6u + 9u - 17u. -2u - 11099 Collect the terms in -236u - 16u + 4u + 20u. -228u Collect the terms in -15366362 + 15366362 - 9a. -9a Collect the terms in 137 - 2x - 10x + x*2 + 4x + 8x. x2 + 137 Collect the terms in -6 - 48 + 89k + 63 - 10. 89k - 1 Collect the terms in 20785u*3 - 3 - 19276u*3 + 3. 1509u*3 Collect the terms in 4661w*2 + 3701w*2 + 14116w*2 - 2339w*2. 20139w*2 Collect the terms in -21772q + 21772q + 2q2 - q2. q*2 Collect the terms in 73808g - 36913g - 36905g. -10g Collect the terms in -8125370m + 8125370m - 6m*3. -6m*3 Collect the terms in -58145w*2 + 58147w*2 + 4 - 4. 2w*2 Collect the terms in 2560z + 8z2 + 2437z + z*2 + 4z*2 - 4997z. 13z2 Collect the terms in -46f + 220f - 86f - 65f. 23f Collect the terms in 18v2 + 7v*2 + 2v*2 - 7v*2 - 133 + 2v. 20v2 + 2v - 133 Collect the terms in 1490 - 11u2 + 59u*2 + 1495 - 2985. 48u*2 Collect the terms in -280q*3 + 42191q*2 - 42191q*2 - q - 350q*3. -630q*3 - q Collect the terms in -10i*2 - 18i - 18i - 123i + 159i. -10i*2 Collect the terms in 225p - 100p + 300p + 50p. 475p Collect the terms in 814i3 - 4i - 346 + 4i. 814i*3 - 346 Collect the terms in 8v*2 + 797830 - 797830. 8v*2 Collect the terms in -8961m - 3667 + 1835 + 1832. -8961m Collect the terms in -494x + 494x + 3x*2 - 36x*3. -36x*3 + 3x*2 Collect the terms in 11q*3 + 23968q*2 - 23968q**2 +	{ "pile_set_name": "DM Mathematics" }
1, s, g Let c = 142.61 - 142. Let t = c - 0.01. Let r = t + -0.5. Sort 1, r, -2/17 in descending order. 1, r, -2/17 Let s = -3 - 4. Let u = 5 + s. Sort u, 3/7, 5. u, 3/7, 5 Suppose -w + 6w = 40. Suppose 4r - 16 - 1 = 3a, -2a + r = w. Suppose -o - 3 - 4 = -5d, 5o = 4d - 14. Put a, o, 3 in decreasing order. 3, o, a Let s(w) = -w3 + 6w2 - 5. Let m be s(6). Let h(r) = -r3 - 5r2 + r + 4. Let n be h(m). Let q(k) = -k. Let a be q(-1). Sort n, 0, a. n, 0, a Let r(o) = o + 5. Let c(i) = -i2 - 7i - 8. Let g be c(-7). Let f be r(g). Sort -2, 1, f. f, -2, 1 Let x(y) = -y*2 - 7y - 7. Let g be x(-6). Sort g, 16, -2 in ascending order. -2, g, 16 Let a = -10 + 15. Put a, -1, -6/5 in decreasing order. a, -1, -6/5 Let c = -73 - -78. Let s = 0.06 - -0.02. Sort s, c, -4 in decreasing order. c, s, -4 Let j = 0.27 + -0.27. Suppose -2y - 3y = 0. Suppose -2h = o - yo - 9, -3 = -4h + 3o. Put -4, j, h in decreasing order. h, j, -4 Let h(r) = -r*3 + 8r*2 - 8r + 6. Let o be h(7). Let w be 1 + (2 - 2) - o. Put -0.5, w, -1/10 in decreasing order. w, -1/10, -0.5 Let a(t) = -10t - 46. Let s be a(-5). Sort 2, -24, s in descending order. s, 2, -24 Let i = 0.6 - 0.4. Sort 0.02, 3/8, i in descending order. 3/8, i, 0.02 Let q = -11 + 15. Let n be (1 - 3)(-6)/q. Sort -4, n, 1/4 in decreasing order. n, 1/4, -4 Let c(o) = -o*2 + 7o - 7. Let k be c(4). Suppose -4g - 11 = 5. Put k, g, -5 in increasing order. -5, g, k Suppose 4a + 14 = 2z - 4z, 0 = 2z + a + 11. Let w = -21 + 14. Let j = -11 - w. Put j, 5, z in increasing order. z, j, 5 Let x be (-14)/24 + 3/9. Sort -1, -0.4, -2, x. -2, -1, -0.4, x Let n = 8 - 7. Sort -4, 0.1, -0.5, n in decreasing order. n, 0.1, -0.5, -4 Let h = -5 + 15. Suppose -4j + h = j. Put j, 0, -5 in descending order. j, 0, -5 Let b = 1.9 - -0.6. Let h = -3 + 6. Let l = b - h. Sort 4, l, 0.3 in increasing order. l, 0.3, 4 Suppose 2f + 3 = -3, -i + 2f = -11. Suppose -i = -2o + 3o. Sort o, -4, -2. o, -4, -2 Let x(c) = 0 + 5 + c - 4 + 2. Let u be x(-6). Let m = 0.1 + -0.1. Sort m, 1, u in descending order. 1, m, u Let d = -0.19 - -8.19. Let q = d - 11. Put -1, q, -5 in descending order. -1, q, -5 Let c be -2 + 2 + -1 + -1. Suppose 5o - 6o = 0. Let z = o - c. Sort z, 5, 3 in decreasing order. 5, 3, z Let a = -2 - -3. Let t(u) = u*2 + 10u + 3. Let j be t(-10). Sort j, 0, a. 0, a, j Let n = 0.11 + -0.01. Put 2, n, -4 in ascending order. -4, n, 2 Let r(z) = 3z3 + 2z*2 + 4z - 12. Let w(c) = 2c3 + 3c*2 + 3c - 11. Let t(n) = 3r(n) - 4w(n). Let d be t(6). Suppose d = 7p - 3p. Sort 4, p, 1. 1, p, 4 Let a(x) = 7x + 51. Let z be a(-7). Suppose 4p - w = 4 + 1, -3p + 3w = -15. Sort -4, p, z in decreasing order. z, p, -4 Let a = -89 + 88.6. Sort -4, -26, 1, a in descending order. 1, a, -4, -26 Suppose -8 = -3a - 2. Suppose z - 24 = 3z. Let g be z/(-20) + (-3)/5. Put a, g, -5 in increasing order. -5, g, a Suppose 12a - 17a - 20 = 0. Sort 14, 0, a in descending order. 14, 0, a Let p = -0.1 + 0.2. Put p, -0.3, -5 in decreasing order. p, -0.3, -5 Let w = 0.03 - 4.85. Let h = 0.18 - w. Sort h, 0, -3 in descending order. h, 0, -3 Let i = 5 - 2. Let h = -3.5 + 3. Sort i, -0.3, h in descending order. i, -0.3, h Suppose -5 - 10 = 3a. Sort -4, -1/2, a in increasing order. a, -4, -1/2 Let y = 74 + -299/4. Sort y, 0, -2/9 in ascending order. y, -2/9, 0 Let m = -16 + 23. Put -4, m, -7 in descending order. m, -4, -7 Let m = -3 + 3. Let v be (-72)/(-105) + (-2)/7. Sort v, -2, m in descending order. v, m, -2 Let g = -9 + 14. Let v = -8 - -10. Let y = 2.5 - v. Sort g, y, 2/7 in increasing order. 2/7, y, g Let f be ((-5)/(-2))/(6/(-12)). Sort f, -1, 5 in increasing order. f, -1, 5 Let q be (1/1)/(1/(-5)). Put -3, 5, q in decreasing order. 5, -3, q Let s = 2 + -3. Let m be (-9 - -8) + (-2)/(-4). Put m, 0, s in increasing order. s, m, 0 Suppose 4x = 5 + 3. Let f be 2/(-3)3(-2)/(-1). Put -1, f, x in decreasing order. x, -1, f Let g be 41/33. Let j(d) be the first derivative of d*2/2 - 6d - 2. Let i be j(g). Put -3, i, 2 in ascending order. -3, i, 2 Suppose 4 = -5m + 3m. Let a = -1 + m. Sort -1/4, -0.2, a. a, -1/4, -0.2 Let m = -2 - -3. Put 5, 0, m in descending order. 5, m, 0 Let h be (-4 + (-111)/(-27))/(2/(-6)). Put 2/11, -1, h, 4 in decreasing order. 4, 2/11, h, -1 Suppose s = 34 - 30. Sort -5, 6, -1, s in increasing order. -5, -1, s, 6 Suppose 0 = n - 2n. Let m be 2 + (n - 3) - -65. Let z = m - 125/2. Sort z, -3/7, 2/3 in descending order. z, 2/3, -3/7 Suppose 3 - 5 = -2b. Let k be (-1 + b)1-1. Put -5, 4, k in decreasing order. 4, k, -5 Let g = -189 + 1887/10. Suppose -9 = -3r - 4t, 2r = 4t - 16 + 22. Sort g, r, -1/3 in decreasing order. r, g, -1/3 Let o = -1027.055 - -1030. Let l = -0.145 - o. Let q = l - -0.09. Sort q, -1/5, -5. -5, q, -1/5 Let z be (-16)/(-20) - (1 + -1). Let v be ((-4)/(-6))/(3/9). Put 5, z, v in descending order. 5, v, z Let f = -29 - -33. Put f, -1, 3 in increasing order. -1, 3, f Let u be 4/141235/2. Let b = u + -177. Sort 0, 1, b in decreasing order. 1, 0, b Suppose 0 = 3i - 15 + 3. Let m = 20 - 18. Suppose ir - 6r = -m. Put 5, r, -4 in decreasing order. 5, r, -4 Let r = -0.06 + 0. Let b = 5.06 + r. Let i = -3 + b. Sort i, -0.5, -5. -5, -0.5, i Let u = -88 - -81. Sort 0.2, -1/6, u. u, -1/6, 0.2 Suppose -4n + 5m = -n - 10, -4 = -5n + 2m. Let s = -1 - n. Let h = s + -1. Put 2, h, 4 in decreasing order. 4, 2, h Let b = 0.3 + 0.1. Put b, 0.3, 3 in increasing order. 0.3, b, 3 Let b = -5 - -7. Suppose -3z - n = -2z, 0 = 3z + bn - 2. Put z, -1, -5 in decreasing order. z, -1, -5 Let r be 5/25 + (-14)/(-5). Suppose ra - 20 = -a. Sort 1, 0, a in ascending order. 0, 1, a Let p = 0.72 - 0.69. Sort -3/5, -0.2, p in descending order. p, -0.2, -3/5 Let h = -0.67 + 0.07. Let q = h + 5.6. Let d be 0 - (1 + 0)/1. Put q, d, 3 in descending order. q, 3, d Suppose 2c - 14 = -12. Put 2, 9, c in descending order. 9, 2, c Let l(t) be the third derivative of -t*5/60 - 5t4/24 - t3/6 - t*2. Let f be l(-4). Put 4, -1, f in decreasing order. 4, f, -1 Suppose 4f = -2c - 52, -4f - 2c - 3c - 58 = 0. Let w be 0(f/9)/4. Suppose -4z + 2u = -0u + 4, 4z - 5u + 4 = w. Put 0.1, 1/3, z in ascending order. z, 0.1, 1/3 Let q = 0.12 - 1.02. Let i = -1.1 - q. Suppose a = -a - 2j - 4, 0 = 3a + j + 6. Put a, 0.1, i in ascending order. a, i, 0.1 Let g = 0.06 - -4.94. Suppose -1 = -2y + 7. Let p = -200 + 3398/17. Put g, y, p in descending order. g, y, p Let n(l) = l + 5. Let f be n(0). Let x(o) = -o2 + 5o + 4. Let v be x(f). Suppose -4u + m = -16, 5u + m - 6m = 35. Sort 1, v, u. 1, u, v Let j = 0.24 - 0.64. Put j, -3, 5, 3 in decreasing order. 5, 3, j, -3 Let i(g) = g3 - 2g - 1. Let n be i(-2). Let p(t) = -t*2 - 4t + 8. Let q be p(-6). Let k be (-4 - -3)/(1/q). Sort -3, n, k in ascending order. n, -3, k Suppose -5o = 2r - 5, 23 = -3o + r + 3r. Sort o, 0.06, 2/7, -2. -2, o, 0.06, 2/7 Let z = 2 - 6.5. Let b = -10 + 6. Let f = b - z. Put 3, -0.2, f in ascending order. -0.2, f, 3 Let g = 18 - 30. Let v = -7 - g. Sort v, -2, 3 in descending order. v, 3, -2 Let z = 0 + 0.5. Let s = -0.37 - -0.07. Let v = 0.2 + s. Put v, 4/5, z in decreasing order. 4/5, z, v Let w be ((-1)/4)/(5/(-80)2). Sort w, 1, 18. 1, w, 18 Let a = -0.83 - 0.17. Sort 3/8, -5, a in ascending order. -5, a, 3/8 Let h = -4.7 + -0.3. Let j = -7 - -11. Let o = 0 + j. Sort o, h, -0.1. h, -0.1, o Let n = -4 + 3.6. Let f = n + 0.45. Put 1/8, f, 1/2 in descending order. 1/2, 1/8, f Let x = -1 - 0. Let f be x/2 + (-21)/(-14). Sort -1, -5, f in increasing order. -5, -1, f Let p be ((-2)/(-5))/(11/(-5)). Let u = 57.5 + -57. Put -0.3, u, p in increasing order. -0.3, p, u Suppose 0o - 4o = 0. Suppose 5y - 19 + 99 = o. Let r be (3/12)/(3/y). Sort 2, r, 3 in increasing order. r, 2, 3 Let m(d) = d*3 + 3d*2 - 4d + 4. Let p be m(-4). Suppose -p = -q - 3. Let j be ((2 - 1) + 2)/1. Put j, -4, q in decreasing order. j, q, -4 Let o(b) = b*3 - 3b*2 - b + 2. Let j be o(2). Let f be (3 - 6/(-2)) + -1. Suppose 2y + 0 + 4 = 0. Sort f, y, j in increasing order. j, y, f Let s = -64 - -131/2. Let b be (-3)/3 - (-5 - 1). Put s, -2, b in increasing order. -2, s, b Suppose 0 = 2z + 8, -2x + 5x - 3 = -3z. Suppose -3k + 4o + 16	{ "pile_set_name": "DM Mathematics" }
Let u(r) = r*3 + 15r*2 + r + 18. Let i be u(-15). Suppose ik - 86 = -23. Suppose 2c = -0m - m + 9, 0 = -3c - 3m + k. Solve 0g - 2g = c for g. -1 Let i(a) = -183a + 1481. Let s be i(8). Solve 46f = -sf for f. 0 Let q = -15090 - -15096. Solve -46 = 13p + q for p. -4 Suppose -20i - 31 + 112 + 159 = 0. Solve -4h = i + 16 for h. -7 Let a = -86 + 90. Let p be (-7 + 3 - a)-1. Let y be 0/((30/(-40))/((-2)/p)). Solve y = -o - 0 - 2 for o. -2 Let k = 15 - 6. Suppose 69u - 293u = -896. Solve 10q + u = kq for q. -4 Let v(x) be the second derivative of x4/2 + x3/3 - 13x*2/2 - 9x. Let j be v(-4). Let k be j/3(1 - 0). Solve -2p + 7p = -k for p. -5 Suppose 80u = 75u + 250. Suppose -3n + 204 = 54. Let q = n - u. Solve 0s + s = q for s. 0 Suppose -28u = -110u - 59u + 564. Solve 5l - ul = 4l for l. 0 Let r(m) = -4m - 42. Let d be r(-12). Suppose 7z - 2 = dz. Suppose -6 = -4n + 2. Solve nk + zk = 0 for k. 0 Let m = 642 + -482. Let n be 368/m - 9/30. Solve 2 = -h + nh for h. 2 Let j(b) = 8b - 506. Let t be j(72). Solve -107k + t = -72k for k. 2 Let t(z) = -163z + 40. Let g be t(0). Solve -14p = 12 - g for p. 2 Let w = -20 + 35. Suppose b - 14 = -f, -48 = -4b + 27f - 30f. Solve m + w = bm for m. 3 Let y(z) = -4z - 1. Let n be y(-7). Let v = n + -24. Let s be v((-12)/(-3) - (-1 - -4)). Solve s = -p + 7 for p. 4 Suppose n - 2m - 20 = 0, -2n + 2m = -7 - 33. Suppose 0 = 783c - 778c - n. Solve co = 5o - 3 for o. 3 Let z(h) = -h*3 - 13h*2 + 16h + 34. Let v be z(-14). Suppose 3b + 2r - 13 = 0, -9r = 4b - vr - 18. Solve -d - bd = 4 for d. -1 Suppose 0 = -4p + 6p. Suppose p = -5f - 6f + 583. Suppose fn - 78 = 47n. Solve n = -3h + 4 for h. -3 Let n(p) = -p2 - 20p + 17. Let j be n(-8). Let y = -112 + j. Solve -r + 0 - y = 0 for r. -1 Suppose 476v - 383v - 144 = 42. Let q be (1 + 0)(7 - 4). Solve -vi - 2 = -qi for i. 2 Suppose -6939x + 6950x - 22 = 0. Solve -18 = -xw - 4w for w. 3 Suppose -21k + 3151 = -3821. Solve 13y + k = 410 for y. 6 Let a(g) = -19g + 46. Let n be a(3). Let t be (3/7)/(n/(-77)). Solve -t = -6c + 7c for c. -3 Let g be 1(-4330)/22 - 8/44. Let m = g + 197. Solve m = -0b + 3b for b. 0 Suppose 670 = 84w - 590. Solve -w = 4l - 35 for l. 5 Let d(a) = a2 + 40a - 276. Let j(l) = -l*2 + 40l - 5. Let y be j(41). Let g be d(y). Solve g = 4w + 10 - 2 for w. -2 Let d be (3/(-2))/((-1)/2). Suppose 22v - 73v + 7140 = 0. Let w be (-80)/v(-8 + 1). Solve dz - 16 = -w for z. 4 Let v be (-100 + 100)/((-1)/(2/4)). Suppose v = 4c - k - 77 - 33, -2c + 64 = -5k. Solve 4t - c = -7 for t. 5 Suppose 12p + 39 = -16p + 375. Solve 42o + 60 = po for o. -2 Suppose -34 = -15f - 259. Let d be 12/(-30) - (-3 + 111/f). Solve d = k + 9 for k. 1 Let u(b) = -2b + 24. Suppose 5c - i - 49 = 0, -45 = -5c + 3i + 2i. Let p be u(c). Suppose -pt - 62 = -70. Solve -5n = -tn - 9 for n. 3 Let v = 43 + 2. Suppose -265 = -20a - v. Solve 0 = -ad + 10d + 3 for d. 3 Let u = 216 + 27. Let q be u/36 + -6 + 13/4. Solve -q = -6c - 34 for c. -5 Let g = -54 + 76. Suppose -4x - 14 = -g. Suppose 5 = 3r - 4, 0 = 4m - xr - 2. Solve i = -i + m for i. 1 Let u(s) = -2s2 - 7s - 3. Let j be u(-7). Let x = -59 - j. Let v = 19 + x. Solve -v = 4i - i for i. -4 Let v(u) = -u2 - 11u + 22. Suppose 0 = -4p - p - 65. Let o be v(p). Let z = o + 10. Solve t = -3 + z for t. 3 Let c = -2 + 4. Suppose -3b + c + 4 = 0. Let u = 1560 + -1555. Solve bt = ut for t. 0 Let t(v) = v*2 - v - 5. Let u be t(-3). Suppose -3 = -5z - 5w + u, z - 4 = w. Suppose -7f + 8 = -zf + 3r, -2f - r + 6 = 0. Solve -10 = -0p - fp for p. 2 Let f(g) = -78g + 4. Let c be f(0). Solve -4x + c = -3x for x. 4 Suppose -7a + 41 = 20. Suppose -c = 2z - 11, 6c + 39 = 10c + az. Solve -ci - 10 = -11i for i. 5 Suppose -w + 2 + 12 = 4f, f - w - 1 = 0. Suppose 0 = -p - 5n + 3n - f, -2n = -3p + 15. Solve 0 = pr - 9 - 6 for r. 5 Suppose -34g + 41g = 35. Suppose gj = -4w + 24 + 8, -j + 7 = w. Solve k = jk for k. 0 Suppose -n + 13 = 9. Suppose -3u + 23 = -nv, -2u + 5v = 3v - 12. Let j(i) = -i + 4. Let g be j(u). Solve -13 = 2c - g for c. -5 Let t(l) = -l*2 + 20l - 70. Let v(w) = w*2 - 11w + 43. Let d be v(4). Let k be t(d). Solve 5c - k = -0 for c. 1 Let c = -84 - -85. Let h be (-1c/5)/(1/(-85)). Solve 16k - hk + 5 = 0 for k. 5 Let v = -35 - 94. Let g = v - -131. Solve gp = -4p - 24 for p. -4 Let h = -108 - -165. Let o = 81 - h. Let v(f) = -f*3 + 24f*2 + 12. Let z be v(o). Solve -4t - z + 32 = 0 for t. 5 Suppose -3i + 4n = -18, -2i = -3n + 368 - 381. Solve 2h = -0h - i for h. -1 Let s be (-87)/(-29) + (-4)/4 + 6. Solve 16 = sl - 0l for l. 2 Suppose -o + 469 = -g, -5o = -g - 0o - 489. Let d = 468 + g. Solve -i = -2i + d for i. 4 Suppose 23w - 1 = 22w. Let c be w - (6/(-24) + 22/(-8)). Suppose -4v + cl + 12 = -v, 0 = 4v - 4l - 12. Solve 2 = -h - vh for h. -2 Let y be (-598)/(-16) - 30/80. Let f be (-5)/(-110)-8-11. Solve -ft + 49 = y for t. 3 Let g = -49 + 53. Suppose -10l + 16 + g = 0. Let r be 13 - (-4 - (-9 + l)). Solve x - r = -x for x. 5 Let q(u) = 2u + 6. Let g be q(-2). Let r(c) = -c + 4 + 6c + 1 - 2c. Let z be r(g). Solve 1 = -4m - z for m. -3 Suppose 15h - 922 - 53 = 0. Suppose 4x = 5c - 3c + 118, -177 = 3c + 5x. Let r = c + h. Solve -2m = -4m + r for m. 3 Let h = 11498 + -11340. Solve -hx + 159x = 0 for x. 0 Suppose -4l - 29 = -x - 3l, 190 = 5x + 4l. Let i be 66 - 0 - (-42 + x). Solve ib - 78b = -16 for b. 4 Suppose -2u - 2i - 107 = -311, 5u = 3i + 478. Let p be (4/162)/(1/202). Let b = p - u. Solve -4g = -g - b for g. 1 Suppose -2p + 0w + 20 = -5w, -4 = 4p + w. Suppose 8f - 10f + 72 = p. Let v be 14(f/(-21) - (-1 + -1)). Solve -2g = 2g - v for g. 1 Let b(o) = 5o - 25. Let x be b(7). Suppose -16 + 6 = -u. Suppose -5k = 3h - 14 - 2, 0 = k + 4h - u. Solve kp + 3p = x for p. 2 Suppose -23864 = -28j + 4192. Solve -7i - j + 953 = 0 for i. -7 Let v(o) = o + 1. Let u be v(-1). Let f(g) = -29g + 2. Let d be f(0). Suppose 3j - 8j + 6 = -k, 2j = dk - 4. Solve p + up + k = 0 for p. -4 Let m(p) = p2 + 6p - 14. Let g be m(2). Suppose 0 = -5c - 3v + 24, 1 = gv - 5. Solve 0 = -y - cy + 8 for y. 2 Let x(d) = -d*3 - 7d*2 - 9d - 8. Let h be x(-6). Let p(u) = 7u + 495. Let q be p(-65). Suppose 2r + h = 3i + 3, 5r - q = -4i. Solve k + r = -3k for k. -1 Let b be (-1)/((-21)/28) - (-76)/6. Suppose -63 - 49 = -bk. Suppose -a - a = 0. Solve -q - 3q + k = a for q. 2 Let z = 2889 - 2667. Solve zn + 32 = 230n for n. 4 Suppose 10l - 46 - 234 = 0. Suppose 0 = -7y - ly + 105. Solve -1 = -yd + 11 for d. 4 Let g(s) = -s*3 - 10s*2 - 23s + 14. Let y be g(-5). Suppose -12 - 133 = -29c. Solve -3h = -yh + c for h. 5 Suppose 50l - 46l = 47l - 13588. Solve 312r - lr - 20 = 0 for r. -5 Let t be (56/12 + -5)(1 + -25). Suppose -4z - 6 = 3d - 0d, -4d - t = -4z. Solve -3 = -v - z for v. 3 Let v(a) = 35a2 - 1054a + 120. Let l be v(30). Solve 73o - 316 - 122 = l for o. 6 Let u = -9133 - -9148. Solve 18j + uj = 0 for j. 0 Suppose -6o = 6 + 54. Let p be 13/1 + o + 3. Solve pq + 0q = -18 for q. -3 Let y = 59 - 56. Suppose 0 = yj + 3s - 2 - 7, j - 5 = s. Let f be (3 - 2)(j2 - 2). Solve -3o = -fo for o. 0 Let t be 2-1 - ((-63)/9 + -67). Suppose -22n + t = -16n. Solve v - n = -5v for v. 2 Let y be 171/12 + 5/(-20 - 0). Let h be y/(-2) + (-9 - -16). Solve -c + 8c = h for c. 0 Let z = -7608 - -7616. Solve -168m = -176m - z for m. -1 Let p = -24 - -26. Suppose 3m - pm - 4 = 0. Suppose -23b + 35 = -80. Solve -ml = -1 + b for l. -1 Let p(l) = l2 - 7l - 40. Let a be p(11). Suppose -ak - 48 = 4j, -5k = -7 + 32. Let d(u) = u2 + 7u + 5. Let i be d(j). Solve -g - 12 = -ig for g. 3 Let t = 100 - 21. Suppose -20f = -t - 41. Solve 5z + z = -f for z. -1 Suppose -153y + 165y - 3540 = 0. Let j = y - 244. Solve j = 4a + 31 for a. 5 Suppose 5k - 17k + 96 = 0. Suppose b - 27 = -kb. Solve 12 = -bh - 3 for h. -5 Let o be (-95)/((-90)/108 - 0). Solve 5j = -84 + o for j. 6 Let r(m) be the second derivative of -m4/6 - 7m*3/2 + 19m*2 - 81m. Let w be r(-12). Solve -w = g - 0 for g. -	{ "pile_set_name": "DM Mathematics" }
(f - 1)(f + 222316) Let 2k*5/3 - 58k*4/3 - 496k*3/3 - 104k*2 + 288k = 0. Calculate k. -6, -2, 0, 1, 36 Determine i so that -5i3 - 8040i*2 + 8055i + 16090 = 0. -1609, -1, 2 Let -16u4 - 212u*3 + 1884u*2 + 2612u + 532 = 0. What is u? -19, -1, -1/4, 7 Factor j*3 - 1949j*2 - 9854j + 164136. (j - 1954)(j - 7)(j + 12) Let -595x5 + 800x*4 + 9305x*3 + 8630x*2 - 3940x + 200 = 0. What is x? -2, 1/17, 2/7, 5 Determine c so that 4c2 - 2864c + 299212 = 0. 127, 589 Factor 3n3 + 117n*2 - 2856n. 3n(n - 17)(n + 56) Factor -g4/6 - 10g3/3. -g3(g + 20)/6 Find a such that -3a*4 - 13152a*3 - 366492a*2 - 2561328a = 0. -4356, -14, 0 Let 4m4/7 - 144m*3/7 + 944m*2/7 - 192m = 0. Calculate m. 0, 2, 6, 28 Find t such that -2t3/5 + 14346t*2/5 - 5149494t + 15422670 = 0. 3, 3585 Let -3y2/7 + 141y + 380988/7 = 0. What is y? -228, 557 Let -3p3 - 44427p*2 + 133308p = 0. Calculate p. -14812, 0, 3 Factor -s*3/6 + 1357s*2/6 + 5452s/3 + 3640. -(s - 1365)(s + 4)2/6 Suppose 2u*4 + 364u*3 + 4152u*2 + 12240u = 0. Calculate u. -170, -6, 0 Let 9a5 + 3354a*4 - 7892a*3 - 6378a*2 - 1125a = 0. What is a? -375, -1/3, 0, 3 What is q in 4q2 + 1308q - 68632 = 0? -373, 46 Determine d so that -5d4 - 395d*3 - 4105d*2 - 5545d + 10050 = 0. -67, -10, -3, 1 Find i, given that -3i5/4 - 333i*4/2 + 1722i*3 - 8319i*2/2 + 15291i/4 - 1218 = 0. -232, 1, 7 Determine c so that -5c4 + 120c*3 - 565c*2 + 390c + 1080 = 0. -1, 3, 4, 18 Let -4s2 - 186368s - 2170814464 = 0. What is s? -23296 Factor -y*2/3 - 6408y + 19225/3. -(y - 1)(y + 19225)/3 Factor -69s*3 + 1059s*2 - 360s. -3s(s - 15)(23s - 8) Solve -9v3/5 - 582v*2/5 + 789v/5 - 198/5 = 0. -66, 1/3, 1 Solve 4a5/5 - 1428a*4/5 - 36888a*3/5 + 119192a*2/5 - 122028a/5 + 41148/5 = 0 for a. -27, 1, 381 Find x such that -5x4 + 1560x*3 - 10635x*2 - 12200x = 0. -1, 0, 8, 305 Solve -3b4/4 + 2079b*3/4 - 23295b*2/2 + 60192b + 72360 = 0 for b. -1, 12, 670 What is n in -2n2/3 - 60578n/3 + 40388 = 0? -30291, 2 Factor -o*2/2 - 2515o - 6325225/2. -(o + 2515)*2/2 Factor 2j*2/3 - 112952j/3 - 112958. 2(j - 56479)(j + 3)/3 Let 2j5/15 + 44j*4/15 + 114j*3/5 + 372j*2/5 + 432j/5 = 0. Calculate j. -9, -6, -4, -3, 0 Determine w, given that -2w3 - 488w*2 - 15370w + 1934300 = 0. -145, 46 Factor i*4/2 + 327i*3/2 + 808i*2 + 966i. i(i + 2)(i + 3)(i + 322)/2 Factor 6g*4 - 673g*3 + 1438g*2 - 881g + 110. (g - 110)(g - 1)2(6g - 1) What is z in 5z*2 - 49790z + 149325 = 0? 3, 9955 Suppose -2b2/9 + 152b/3 - 1792/9 = 0. Calculate b. 4, 224 Factor 3v3/2 - 12495v*2 + 548691v/2 - 1507902. 3(v - 8308)(v - 11)*2/2 What is a in 36a*5 - 13062a*4 - 221831a*3/4 + 598293a*2/4 + 26054a + 1101 = 0? -6, -1/12, 2, 367 Factor 2l2 - 664868l + 55256182178. 2(l - 166217)2 What is d in 1907161d*3/10 + 22888694d*2/5 + 13258d + 48/5 = 0? -24, -2/1381 Find x such that -20x3 + 375x*2 + 500x = 0. -5/4, 0, 20 Find k, given that -22k5 + 182k*4 + 1602k*3 + 2322k*2 - 756k = 0. -3, 0, 3/11, 14 Suppose -b*4/8 - 19115b*3/4 - 364847613b*2/8 + 2559555845b/2 - 17930013409/2 = 0. Calculate b. -19129, 14 What is h in -2209h5/5 - 81451h*4/5 - 28841h*3 + 19407h*2/5 - 126h = 0? -35, -2, 0, 3/47 Factor -3t2/2 + 8192t + 5462. -(t - 5462)(3t + 2)/2 Let 5a4/2 - 165545a*3/2 + 1826899425a*2/2 - 6718726677195a/2 - 6722381138265 = 0. Calculate a. -2, 11037 Solve -3m4 + 474363m*3/4 - 533613m*2/2 - 1185849m/4 + 88938 = 0 for m. -1, 1/4, 3, 39528 Solve -48t3/7 - 2883t*2 - 2145594t/7 - 5110677/7 = 0 for t. -209, -39/16 Factor -4f3 - 328f*2 - 7388f - 45080. -4(f + 10)(f + 23)(f + 49) Let 2g*3/7 - 3812g*2/7 + 302720g - 275131200/7 = 0. Calculate g. 186, 860 Let -b*2 + 6290b + 18879 = 0. What is b? -3, 6293 Find a such that 191a4/9 + 13756a*3/9 + 77833a*2/3 - 518074a/9 - 10952/9 = 0. -37, -4/191, 2 Find m, given that -2m4/7 + 1716m*3/7 = 0. 0, 858 Factor -4q*2 + 1108q - 7560. -4(q - 270)(q - 7) Let -4h4 - 59h*3 + 1999h*2 - 496h = 0. What is h? -31, 0, 1/4, 16 Determine q so that -q*3/6 - 431q*2/3 - 11921q/6 - 20776/3 = 0. -848, -7 Factor n*3 - 816n*2 + 213204n - 17429264. (n - 326)*2(n - 164) Factor 5a2 + 3060a - 1000640. 5(a - 236)(a + 848) What is d in 2d4/21 - 22d*3/21 - 478d*2/7 + 418d/3 - 1472/21 = 0? -23, 1, 32 Factor -5o5 + 200o*4 - 1400o*3 - 39200o*2 + 686000o - 3073280. -5(o - 14)4(o + 16) Find a, given that -2a2 + 1146a + 2300 = 0. -2, 575 Suppose -u*4 - 5561u*3 - 5560u*2 = 0. What is u? -5560, -1, 0 Factor -5i*2 - 7560i - 207760. -5(i + 28)(i + 1484) Let 4b2 + 29708b - 118896 = 0. What is b? -7431, 4 Find k such that -21k5 - 9942k*4 + 35676k*3 - 47166k*2 + 27177k - 5724 = 0. -477, 4/7, 1 Suppose -r*2/2 + 869r/2 + 265581 = 0. Calculate r. -414, 1283 Suppose 3h2/2 + 18726h + 262017/2 = 0. What is h? -12477, -7 What is d in 3d3/8 - 207d*2/4 + 7353d/8 - 16107/4 = 0? 7, 13, 118 Determine y so that -24y3/5 + 393y*2/5 + 51336y/5 - 3861 = 0. -39, 3/8, 55 Suppose -2x4/5 - 598x*3/5 - 23314x*2/5 - 220754x/5 + 107916 = 0. What is x? -255, -23, 2 Determine r, given that -2r2 - 21486r + 1057616 = 0. -10792, 49 Factor r*2/5 - 29816r/5 + 222248464/5. (r - 14908)*2/5 Find n such that 3n*5/7 - 120n*4/7 - 597n*3/7 + 1290n*2 = 0. -10, 0, 7, 43 Suppose -3c*4 + 11457c*3 - 45792c*2 + 45780c = 0. Calculate c. 0, 2, 3815 Factor 3h3 + 2178h*2 + 372627h - 8347740. 3(h - 20)(h + 373)*2 Factor -2n*2/9 + 7072n/9 - 7070/9. -2(n - 3535)(n - 1)/9 Find d, given that 5d4 + 1500d*3 + 20195d*2 + 50160d + 31460 = 0. -286, -11, -2, -1 Solve 4p2 + 98436p + 2065392 = 0 for p. -24588, -21 Suppose 15i5/2 - 87i*4/4 - 39i*3/4 + 87i*2/4 + 9i/4 = 0. Calculate i. -1, -1/10, 0, 1, 3 Solve -6j4/7 + 106j*3 - 9136j*2/7 + 1816j + 5280/7 = 0. -1/3, 2, 12, 110 Factor t*3 - 65t*2 + 500t + 12500. (t - 50)(t - 25)(t + 10) Suppose -l*2/5 - 24462l/5 + 14679 = 0. Calculate l. -24465, 3 Let -5x5 + 215x*4 + 30x*3 - 1330x*2 + 1735x - 645 = 0. What is x? -3, 1, 43 Factor d*3/6 - 9d*2/2 - 224d/3 - 130. (d - 39)(d + 2)(d + 10)/6 Find p such that -p*2/10 - 46p/5 + 3744/5 = 0. -144, 52 Solve 3d4/2 + 16149d*3/2 + 10829844d*2 - 98058912d + 87220992 = 0 for d. -2696, 1, 8 Let 7h3/3 + 7221h*2 - 6190h/3 = 0. What is h? -3095, 0, 2/7 Solve t*2/5 - 12189t + 60944/5 = 0 for t. 1, 60944 Factor -2b2/11 + 300b/11 + 112. -2(b - 154)(b + 4)/11 Factor 2k2/9 - 3652k/9 + 3646/3. 2(k - 1823)(k - 3)/9 Find q, given that 3q2 + 13200q + 118557 = 0. -4391, -9 Let -s*4/5 + 5579s*3/5 - 194107s*2/5 + 371481s/5 - 182952/5 = 0. Calculate s. 1, 33, 5544 Factor 8r3 - 479r*2/6 + 595r/3 + 25/6. (r - 5)*2(48r + 1)/6 Determine r so that -r2/4 - 917r/2 - 94393/4 = 0. -1781, -53 Determine i so that 8i5/7 - 11476i*4/7 + 17180i*3/7 + 22940i*2/7 - 17188i/7 - 11464/7 = 0. -1, -1/2, 1, 2, 1433 Solve 2o2/3 - 489238o/3 - 978484/3 = 0 for o. -2, 244621 Determine k, given that -4k3 + 134384k*2 + 268780k + 134392 = 0. -1, 33598 Factor j*2/5 - 101j - 92664/5. (j - 648)(j + 143)/5 Solve 3d*2 + 634050d + 33501616875 = 0. -105675 Let -10l2/7 + 174308l/7 - 19920 = 0. Calculate l. 4/5, 17430 Factor 3j2/5 + 39297j/5. 3j(j + 13099)/5 Solve -5c3 + 1200c*2 - 7065c + 10530 = 0 for c. 3, 234 Let -4i2/3 + 3284024i/3 - 3284020/3 = 0. What is i? 1, 821005 Factor -2c3/7 + 1308c*2/7 - 3910c/7 + 372. -2(c - 651)(c - 2)(c - 1)/7 Find k such that 375k*4/7 - 60981075k*3/7 + 73176930k*2/7 - 4181532k + 3902760/7 = 0. 2/5, 162615 Let -972b4 + 2223504b*3 + 3213096b*2 + 1510640b + 228900 = 0. Calculate b. -5/9, -1/3, 2289 Determine m so that 3m3/2 + 822m*2 - 262389m/2 - 132015 = 0. -677, -1, 130 What is i in -5i4/4 - 2203i*3/4 - 245493i*2/4 - 620865i/4 + 143883/2 = 0? -219, -3, 2/5 Suppose 12t3 - t2 - 30218t + 584495 = 0. What is t? -695/12, 29 Suppose 5h4 - 85h*3 - 7160h**2 + 6400	{ "pile_set_name": "DM Mathematics" }
Suppose -3o - 4b = b - k, -2o + b = -6. Suppose 0 = -0q - oq + 2235. Is q composite? True Let m(c) = -2383c - 1656. Is m(-11) prime? False Let z = 17087 - 7436. Is z composite? True Suppose 3051650 = 58t + 21t - 2262759. Is t composite? False Let a(g) = g*2 - 5g + 6 - 2g2 - 3 - 17g*3. Let z = -3997 + 3995. Is a(z) a prime number? False Let u = 19 + -23. Let l be 0/(u/123). Suppose -8v + v + 1897 = l. Is v prime? True Suppose 6l - 10l = 64. Let q be l/(-20)(-445)/(-4)46. Suppose 0 = 7f - q - 5139. Is f a composite number? False Suppose -30 = c - 28. Is 108058/97(0 - 11/c) a prime number? False Let b = 20 + -10. Is 269/((16/b)/8) composite? True Let c(i) = -10i*3 - 8i*2 + 32i + 51. Let h be c(-34). Suppose -43n = -h - 520288. Is n prime? True Let n = 67928 + -38449. Is n a composite number? True Let m(g) be the second derivative of g7/504 - 7g*6/720 + 7g*5/120 + 2g*4/3 + 4g. Let y(n) be the third derivative of m(n). Is y(4) a prime number? True Let l be (96543/(-36))/((-1)/(-4)). Let m = l - -15448. Is m a prime number? True Let h = 756 - 1267. Let r = 2948 + h. Is r a prime number? True Is (-22)/(286/11700377)(1 + -2) composite? True Let s = 469395 - 264166. Is s a composite number? True Let m = -683826 + 1069483. Is m composite? False Let h = 97116 + -21589. Is h a composite number? False Let y(q) = -q2 - q + 24. Let n be y(4). Suppose nw + p - 6626 = 0, 2p + p = 3w - 4977. Is w composite? False Let w = 84 - 96. Let n be 51/21 - w/(-28). Suppose 0 = -nh - z + 794, -5h + 4z = -10h + 1985. Is h prime? True Let r be 862 + 8 + 8/(-2). Suppose -3z + 5i + 1027 = 0, 4z + 2i = r + 538. Suppose -33 = 4y - z. Is y a prime number? True Suppose 5n - 4n - 4v = -8, -n - 5v + 10 = 0. Let z(x) = x3 + 70. Let h be z(n). Suppose -h = -2i + 516. Is i a composite number? False Let y be ((-28)/140)/((-2)/170). Suppose 5g = -s + 241750, -3s = -yg + 15g + 96683. Is g a composite number? True Suppose 4h = -5p + 545, -4p - 4h = 183 - 615. Let t = 3090 - p. Is t a composite number? True Let n(z) = 5392z2 + 353z + 1401. Is n(-4) prime? False Let l = 701009 - 352392. Is l prime? True Suppose -11522 = -4w + 5j - 7j, 2j - 14402 = -5w. Suppose -3a = -3t - w, a + 0a = 2t + 965. Is a prime? False Let j be 2/296/(-9). Let n(f) = -9f*3 - 5f. Let h be n(j). Let r = h + -1096. Is r composite? True Let u(s) = 10066s2 - 52s - 37. Is u(6) a prime number? True Suppose 3362 = r - 4y, 7r = 4r + y + 10141. Let a = 7371 - r. Is a a prime number? True Let u(p) = 4p*3 - 6p*2 + p - 1869. Let q(v) = -13v*3 + 21v*2 - 4v + 5609. Let w(f) = -2q(f) - 7u(f). Is w(0) composite? True Let w = 481373 - 318556. Is w composite? True Suppose -6 - 4 = -5z. Suppose zv = 3v + 280. Let i = v - -435. Is i prime? False Suppose -7i + 635 + 5420 = 0. Suppose -5p = 11p - 6528. Let w = i - p. Is w a prime number? True Let f(j) = 32j3 - j2 - j + 1. Let p be f(1). Let q = p - 59. Is -6993/(36/q) composite? True Suppose 6w + 11 - 281 = 0. Let l be (w - -1) + 1 - 4. Let y = -18 + l. Is y composite? True Let h = 422769 - 232406. Is h a composite number? True Let d(w) = 12w*3 + 77w*2 + 88w + 157. Let p(f) = -7f3 - 39f*2 - 44f - 79. Let v(y) = -3d(y) - 5p(y). Is v(-37) a composite number? True Let k = 112727 + 123882. Is k composite? False Suppose 4h = 5o - 5 - 12, -4o + 28 = 4h. Suppose 3j + c = 3065, -hj + j - c + 1021 = 0. Suppose z + x = 1281, x + 251 + j = z. Is z a composite number? False Let j = -196 + 76. Let q = j + 120. Suppose 10v - 14v + 3676 = q. Is v prime? True Let z(w) = -w*3 + 5w*2 - 12. Let j(b) = 3b*3 - 15b*2 + 35. Let d(x) = 6j(x) + 17z(x). Let v be d(5). Suppose -vn + 5n + 145 = 0. Is n composite? True Let h = 1389 + -548. Is h a composite number? True Let c(f) = 13f*3 + 3f*2 + 23f - 22. Let s be (-35)/213-1. Is c(s) a prime number? False Suppose -3k - 2c = -1278197, -c - 3232422 = -5k - 1102124. Is k a composite number? False Let n be (-1 + (-3)/(-6))/(1/(-84)). Suppose 5o - 313 = n. Suppose 4f + o = 5i - 44, 115 = 5i - 2f. Is i prime? True Suppose 5k = -4u + 605896, 138k - 137k = 4u - 605872. Is u prime? False Suppose 0 = 6c + 3c - 27. Suppose -cr - 7 + 31 = 0. Is (2342/8)/(2/r) composite? False Let a = 1785 - -16214. Is a a prime number? False Suppose 15w - 178w + 352582 + 33749137 = 0. Is w a prime number? True Suppose -10g = -14g + 696. Suppose -5i - 3q + 1106 = 0, -i + q + g = -52. Let h = i + 84. Is h a prime number? True Suppose 517u - 520u = 33. Is (8247/3 - 0)/(u/(-33)) composite? True Suppose 40j - 5j = 202720. Let g = j + -2745. Is g a prime number? False Let z be 29/(-6) + 33/(-54). Let h be 184770/z - 4/(-1). Is h/(-18) - 10/(-45) composite? False Is 1268969 + (-14 - -10 - 1 - -7) composite? False Suppose -3n = -3h - 2840724, 0 = -10n + 7n + h + 2840710. Is n a composite number? False Let x = 26 - 21. Suppose -xu = -3u - 6. Is (-1262)/u(-21)/14 a prime number? True Suppose 9m = 11m - 84. Let o be (-15)/(-35) + (-3)/(m/(-20266)). Let p = -1005 + o. Is p prime? True Suppose 14v + 2i = 11v + 753, -4v + 3i + 1021 = 0. Let n = 264 - v. Is n composite? False Is ((-191606)/(-14))/(442/3094) prime? True Suppose 291i - 288i - 82863 = 0. Let s = i - 13030. Is s a prime number? True Let y(p) = p*3 + 39p*2 - 365p + 365. Is y(64) a composite number? True Let d(b) = 29b2 - 76b + 4. Let w be d(-5). Suppose -m + 4036 = w. Is m composite? False Suppose 3i - 100269 + 9681 = 0. Suppose -36c + i + 8288 = 0. Is c composite? False Let j(r) = -1333r + 165. Let c be j(-21). Let i = 42871 - c. Is i composite? False Suppose -4y - 8 = 0, 4i + 5y + 48 - 6 = 0. Let a(c) = 142c2 - 14c + 27. Is a(i) a composite number? False Suppose 28b - 31b - 3p = -190914, -2b + 127278 = 4p. Is b prime? False Suppose -242o = -246o + 16. Suppose -4d = 3z - 8d - 27307, -od + 18238 = 2z. Is z composite? False Let x be 0 + 31 + (-14 - -14). Suppose 5m = -2r + xr - 652, -2r + 1280 = 2m. Let n = -227 + r. Is n prime? False Let a(y) = 11y3 + 3y*2 - 2y + 17. Let o be a(-5). Let t = -556 - o. Let j = t + -380. Is j composite? False Let z = -47 - -49. Let i be z - (11 - 3)/(-2). Let h(t) = t*3 - 4t*2 + 2t + 3. Is h(i) composite? True Let r(c) = -11464c - 5359. Is r(-98) a prime number? True Let c(b) = -4b - 3. Let a be c(-2). Let t = 24694 + -16931. Suppose t = ag - 2372. Is g composite? False Let n(y) = 9631y*2 + 15y - 25. Is n(-3) a prime number? False Let u(w) = 33w2 + 19w - 11. Let c(y) = y + 17. Let h be c(-14). Suppose ha + 23 = -4. Is u(a) prime? False Let a(r) = -4r*2 + 6r - 43. Let o(n) be the third derivative of -3n5/20 + n4/2 - 29n*3/2 + 18n*2. Let s(l) = -5a(l) + 2o(l). Is s(20) composite? True Let f = 291077 + -191116. Is f a composite number? False Let a(l) = -2l*3 + 5l*2 - 2l + 8. Let x be 45/(-15) - (-6 + -1). Suppose -s + 4g - 7 = 0, xs + 3g = -0g - 28. Is a(s) a composite number? False Let y = 4075 - -297. Suppose -704 - 2561 = 3x + 5j, 4x + y = -2j. Let f = x + 1784. Is f a composite number? True Let t(o) = o*2 - o + 8292. Let j be t(0). Let f = 1047 - 1047. Suppose 8r - 20r + j = f. Is r a prime number? True Is (-1516)/(21/(882/(-60))) + (-1)/5 a composite number? False Is 2/10 - (2118580/250)/(4/(-60)) a prime number? False Let y(o) = 4026o*2 - 9o + 58. Is y(7) a composite number? False Let f(p) = -3p - 4 + p + p + 2p. Let u be f(1). Is (4293 - -1)u/(-6) a composite number? True Let u(z) = 44426z*2 - 9z + 4. Let q be u(2). Suppose -14c + 8c = -q. Is c prime? False Suppose 19t + 11 = 68. Let b(x) be the second derivative of 4x4/3 + x3/6 + x*2 + 2x. Is b(t) composite? False Suppose -4r = -2r + 3y + 1789, 0 = r + 3y + 887. Let b = 2115 + r. Is b prime? True Let i(m) = m*2 - 76m + 5228. Is i(63) a composite number? False Let h(p) = 4583p2 - 5p - 179. Is h(-13) composite? True Suppose -d - 5j + 22477 = -5702, -j = -5d + 140791. Is d a composite number? True Suppose 0 = -4o + 2o + 18. Let t(l) = 0l - 6l - 2l + 16 - ol. Is t(-11) prime? False Let t(h) = 2h3 - 9h*2 + 3h + 4. Let u be t(4). Suppose	{ "pile_set_name": "DM Mathematics" }
mplify (sqrt(88)/(6sqrt(44)/sqrt(4)))/((sqrt(4356) + sqrt(4356)-2)/sqrt(9)). -sqrt(2)/66 Simplify -1(-2-6-151sqrt(567))*2. -2041200 Simplify ((1sqrt(19))*2-2 - (sqrt(190)-4)/sqrt(10))3. -114 + 12sqrt(19) Simplify (-6((sqrt(132) - (sqrt(132) + -4sqrt(132))) + sqrt(132))-3)/((sqrt(48)/sqrt(72))/sqrt(2)). 540sqrt(11) Simplify (3 + -5 + sqrt(76) + 1)1. -1 + 2sqrt(19) Simplify -4(3 + (sqrt(1900) - (sqrt(1900) + 5(sqrt(1900) + 2 + sqrt(1900))) - sqrt(1900))2 + (-1sqrt(1900) + 1)*2) + -1. -927617 - 8720sqrt(19) Simplify ((6sqrt(126) + sqrt(14) + (sqrt(14) - -31sqrt(14)))/(sqrt(28)/sqrt(16) - sqrt(7) - sqrt(7) - ((sqrt(7) - (sqrt(28) - sqrt(112))) + sqrt(7))))26. 25392/121 Simplify -36(-3 + 1 + sqrt(1100)). -180sqrt(11) + 36 Simplify ((sqrt(2430) - (sqrt(2430) + sqrt(2430)-3))/(sqrt(6) - sqrt(648)/sqrt(3))-2)2. 2916/5 Simplify -1-2(((sqrt(252)/sqrt(7))/sqrt(12) + -1)2 + -1). -4sqrt(3) + 6 Simplify ((-5 + -4 + sqrt(1331) + -1 + 2)-3)2. -1584sqrt(11) + 12555 Simplify -1(sqrt(612) + -3)2-3 + -5(sqrt(612) - (sqrt(612) + sqrt(612)-4))*2 + 3. -47094 - 108sqrt(17) Simplify ((4(sqrt(190) - -4sqrt(190)))/sqrt(10))*2 - (1 + sqrt(171)4). -12sqrt(19) + 7599 Simplify (sqrt(153)/(-4sqrt(9) + sqrt(9) + sqrt(9)) + sqrt(1088)-1 + 5)2. -85sqrt(17) + 5013/4 Simplify -4(4 + 1sqrt(304) - (sqrt(304) + 1)*26)-5. -36520 - 880sqrt(19) Simplify 6(sqrt(6480) + -1 - 1-1sqrt(45))5. -30 + 1170sqrt(5) Simplify ((2(sqrt(132) + sqrt(132)-1 + sqrt(132) + sqrt(132)))/(-4sqrt(12)4)-6)*2. 99/4 Simplify ((sqrt(132)-1 - sqrt(132))/sqrt(11) - (sqrt(12) + -6(sqrt(12) + sqrt(24)/sqrt(2))))/(sqrt(486)-34). -sqrt(2)/12 Simplify -21sqrt(19) + sqrt(19)-2 + 3 + 5 - (sqrt(95) - (-6sqrt(95)1 - sqrt(95)))/(2(sqrt(45) - sqrt(5))). -6sqrt(19) + 8 Simplify (-2 + 6(-5sqrt(11) - sqrt(11))-1 + 1)2. -72sqrt(11) + 14257 Simplify (6(5-2sqrt(1584) - sqrt(1584) - (sqrt(1584) + 51sqrt(1584))))2-4. -65919744 Simplify -5(0 + 1 + sqrt(396) + (1 + sqrt(396))-5). 20 + 120sqrt(11) Simplify -5 + -3(sqrt(114)/(1sqrt(6)) - ((sqrt(19) - sqrt(95)/sqrt(5)) + 2)). -3sqrt(19) + 1 Simplify (sqrt(512) + 3)*2 + (sqrt(200) + 2)-1. 86sqrt(2) + 519 Simplify (sqrt(192)2 + sqrt(192))-1 + (-2 + -3 + sqrt(192))2. -104sqrt(3) + 217 Simplify (sqrt(1539) + -2 + 0 + 5)-64. -216sqrt(19) - 72 Simplify (5(sqrt(1008)-1 + (sqrt(112) + 0 - sqrt(7) - sqrt(7))))2 - (sqrt(252) - (3 + sqrt(252)) - sqrt(21)/sqrt(3)2). 2sqrt(7) + 17503 Simplify sqrt(7) + sqrt(28)/sqrt(4) + -5 + (sqrt(42) - (sqrt(42) - (sqrt(42)2 - sqrt(42))))/sqrt(6) - ((sqrt(7) - sqrt(28)/sqrt(4))*22 - sqrt(126)/sqrt(2)). -5 + 6sqrt(7) Simplify (sqrt(70)/(sqrt(63)/(sqrt(9)-1)))/(sqrt(8)-1-3). -sqrt(5)/6 Simplify ((sqrt(416) - (sqrt(416) - (sqrt(416)-1 + sqrt(416)))-3)/sqrt(8))/(1sqrt(12)/sqrt(3) + sqrt(24)/(sqrt(18)/sqrt(3))). 2sqrt(13) Simplify (((sqrt(190) + sqrt(190)-3-3 - sqrt(190)) + sqrt(190))/(sqrt(60)/sqrt(6)1))2. 1900 Simplify (sqrt(77) + (sqrt(77) - (sqrt(77) + sqrt(77)4-1)))/sqrt(11) + (sqrt(343) + -2)2 + (sqrt(42)/(sqrt(12)/sqrt(2)))2. -23sqrt(7) + 354 Simplify -1 + ((sqrt(500) - (sqrt(500)1 - sqrt(500)))-6)*2 + (sqrt(500) - (sqrt(500) + (2((-1 + sqrt(500) - sqrt(500)) + sqrt(500)))*2))-4. -320sqrt(5) + 26015 Simplify (sqrt(4598)-24)/(sqrt(6)/(sqrt(12)/sqrt(4)) + sqrt(2) + sqrt(32)-2). 44sqrt(19)/3 Simplify (-1(sqrt(88) + -1(sqrt(88) - sqrt(88)-2)))/(sqrt(96)/(sqrt(12) + (sqrt(24)/sqrt(2)1 - sqrt(12)))). 2sqrt(11) Simplify (sqrt(20)/(sqrt(20)/sqrt(5)) + sqrt(125)-2 + 1)2. -18sqrt(5) + 406 Simplify (sqrt(6292) + 2 + 4)*2-1. -6328 - 264sqrt(13) Simplify ((sqrt(190)/(1sqrt(10)) - sqrt(19) - (-5 + sqrt(19)-1)) + -4 + (1sqrt(209))/sqrt(11))*2. 4sqrt(19) + 77 Simplify 4 + ((-3 + 1 + sqrt(468) + sqrt(468))-5 - (-4 + -2sqrt(468)1))2. -1344sqrt(13) + 30152 Simplify 12-3sqrt(15)/sqrt(147). -6sqrt(5)/7 Simplify (sqrt(42)/(-4sqrt(6)4) - -3(-4 + sqrt(448) - sqrt(448)))4. -48 - sqrt(7)/4 Simplify ((0 + -2sqrt(200))2 - sqrt(200))5 + (4(-2 + (sqrt(200) + 0 - sqrt(200))))2. -50sqrt(2) + 4064 Simplify ((sqrt(350)1)/sqrt(7)6)/(5sqrt(160) + 3sqrt(10)-1). 6sqrt(5)/17 Simplify (sqrt(119) + -2(sqrt(119) + sqrt(119)1 + sqrt(119)) + (2-1sqrt(119) - sqrt(119)))/((sqrt(504)/(sqrt(24)/sqrt(2)))/sqrt(6)). -8sqrt(17) Simplify (1 + sqrt(2057) + sqrt(2057))-3 - sqrt(612)2-4. -18sqrt(17) - 3 Simplify 24(sqrt(13) + 3 + sqrt(52) - (sqrt(13) - (3 + sqrt(13)) - sqrt(13))-3). -48 Simplify sqrt(98) + -2 + 5 - (sqrt(384) + 1sqrt(384))/sqrt(12). -sqrt(2) + 3 Simplify -4(sqrt(1836) - (sqrt(1836) - (sqrt(1836) - (sqrt(1836) + 1sqrt(1836)))))/(sqrt(15)/(sqrt(10)/sqrt(2) + sqrt(5) + sqrt(5))). 72sqrt(17) Simplify ((sqrt(468) - 5-1sqrt(468)) + sqrt(468) + sqrt(468) - (sqrt(468) - -1(sqrt(468) + 0 + sqrt(468))) - -3-3(-3 + sqrt(468)))2. -1296sqrt(13) + 8217 Simplify ((sqrt(26)/sqrt(2)5 - (sqrt(13)-2 + -1)) + (sqrt(1872) - -1sqrt(1872)-6)*2)-4. -187204 - 28sqrt(13) Simplify ((sqrt(160)/sqrt(4))/sqrt(5) - (sqrt(8) + sqrt(8)2)-4)/((sqrt(4) - (-6sqrt(4)-2 + sqrt(4))) + sqrt(64)). -13sqrt(2)/8 Simplify -1 + (sqrt(19) - ((-1 + sqrt(304) + sqrt(304))*2 - sqrt(304))) + (2sqrt(228)-3 + sqrt(228))/sqrt(12). -1218 + 16sqrt(19) Simplify (((sqrt(65) - (sqrt(65) + (sqrt(65) - -2sqrt(65)))3) + sqrt(65))-6)/((-4sqrt(250))/sqrt(2)). -3sqrt(13) Simplify -6(sqrt(28)1 + sqrt(28) - sqrt(28))/sqrt(4) - ((sqrt(98) + sqrt(98) + (sqrt(98) - sqrt(98)-3) + sqrt(98))/sqrt(2))/sqrt(7). -13sqrt(7) Simplify (((sqrt(153) + (sqrt(153) - (sqrt(153) + sqrt(153)-1)) - sqrt(153))-4 - 5(2sqrt(153) + sqrt(153)))/(sqrt(45)/(-2sqrt(80))))*2. 392768 Simplify sqrt(35)/sqrt(45)-1 + sqrt(21)/(1sqrt(12)) + -4. -4 + sqrt(7)/6 Simplify (sqrt(2448) + -1 + -6(sqrt(17) + sqrt(425)))*2 - (3 + (61sqrt(17))2 + sqrt(1377) + -1). 39sqrt(17) + 9179 Simplify (sqrt(5) - (sqrt(5) + sqrt(5) + (sqrt(125) + 0 + sqrt(125))*2) - (0 + sqrt(405))) + (-1sqrt(125) - (1 + sqrt(5) + -5))*2. -304 - 58sqrt(5) Simplify (sqrt(784) + 2sqrt(784) + sqrt(784) + (sqrt(16) - sqrt(32)/sqrt(2)3))/(-1sqrt(968)4). -13sqrt(2)/22 Simplify (sqrt(98)1 - (sqrt(162) - (-1 + sqrt(162))2)) + 1 + (2 + sqrt(2178))2. 112sqrt(2) + 2346 Simplify ((-4 + sqrt(26)/sqrt(2) - (sqrt(65)/sqrt(5) - sqrt(13))-6) + (sqrt(13) - sqrt(65)/sqrt(45))-1)2. -8sqrt(13)/3 + 157/9 Simplify 6(0 + sqrt(171) + (3 + sqrt(171))1 + sqrt(171)). 18 + 54sqrt(19) Simplify (((3sqrt(152))/sqrt(4))/(sqrt(216)/sqrt(12)) + 0)*23. 57 Simplify ((sqrt(171)-53 - sqrt(171) - sqrt(171)) + sqrt(171) + sqrt(171))/(2sqrt(324)). -5sqrt(19)/4 Simplify (-3(sqrt(304) + -4) + 3 + sqrt(304) + 2 + sqrt(304))2. -136sqrt(19) + 593 Simplify (-4 + ((sqrt(96) - (sqrt(96) - (sqrt(96) + (sqrt(96)-2 - sqrt(96)) + sqrt(96) + sqrt(96))) - sqrt(96))6)/sqrt(12) + 5)*2. -24sqrt(2) + 289 Simplify (sqrt(17) - (sqrt(17) - sqrt(136)/sqrt(32)) - (sqrt(136)1)/sqrt(8))21 + -5sqrt(119)/(sqrt(525)/sqrt(3)). -sqrt(17) + 17/4 Simplify 3 + (-2 + (sqrt(25)/sqrt(5) + 1 - sqrt(25)/sqrt(5)-2))*2. -6sqrt(5) + 49 Simplify 5(3 + 3sqrt(5) + sqrt(5) + 3 + -4((sqrt(180))2 - sqrt(5)) + 3). -3555 + 40sqrt(5) Simplify (sqrt(567) + (2 + sqrt(567))-1 + (1(-1 + sqrt(567)) + sqrt(567) - sqrt(567)) + -3)*2. -108sqrt(7) + 603 Simplify 2(sqrt(176) + 1)2-1 - (-1 + (1 + sqrt(176))*2 + sqrt(176))-5. 44sqrt(11) + 526 Simplify ((-3sqrt(931)2 - (sqrt(931)-2 + 1)) + (sqrt(931) + 0 + -5 - sqrt(931)) + sqrt(931) + (sqrt(931) - -1sqrt(931))4)*2. -420sqrt(19) + 23311 Simplify (2sqrt(33)3 + sqrt(33) + sqrt(33))/((1sqrt(3) + sqrt(3))1) + -2. -2 + 4sqrt(11) Simplify (5 + ((1sqrt(504))/sqrt(8) - sqrt(63))/(sqrt(9) - (sqrt(9) - sqrt(54)/(sqrt(24)/sqrt(4)))))-6. -30 Simplify (sqrt(396) + sqrt(396)2)6 + 2 + 4(sqrt(11) + (sqrt(11)4)2). 112sqrt(11) + 706 Simplify (2sqrt(3456))/(1sqrt(24)/sqrt(3)). 24sqrt(3) Simplify 4((sqrt(13) - sqrt(26)/(sqrt(4)/sqrt(2))) + 3)-56. -360 Simplify (-6(sqrt(140) + sqrt(140) + sqrt(140) + sqrt(140)2))/(1sqrt(28)-2). 15sqrt(5) Simplify (sqrt(392) + -5((sqrt(392) - (sqrt(392) - (sqrt(392) + -1 + sqrt(392) + sqrt(392)))) + sqrt(39	{ "pile_set_name": "DM Mathematics" }
ked without replacement from vshovvssovvvvgvvxov? 1/114 What is prob of sequence eenn when four letters picked without replacement from {z: 4, v: 5, n: 2, e: 4, t: 2}? 1/2380 Three letters picked without replacement from {c: 2, y: 1, v: 2, n: 9}. What is prob of sequence vcy? 1/546 Two letters picked without replacement from {e: 5, q: 3}. Give prob of sequence ee. 5/14 Three letters picked without replacement from gaqagqggggqqgqqqqqg. What is prob of sequence gqq? 32/323 Two letters picked without replacement from mmvmjmymvvmvvmjm. What is prob of sequence jv? 1/24 Calculate prob of sequence nqg when three letters picked without replacement from {n: 2, g: 10, q: 3}. 2/91 Calculate prob of sequence hfz when three letters picked without replacement from zhhfhzhff. 1/21 Two letters picked without replacement from {l: 6, d: 7}. Give prob of sequence ld. 7/26 Calculate prob of sequence wrr when three letters picked without replacement from wwrrrrrrrrrrrrrrrrr. 16/171 Four letters picked without replacement from ubbudbbbbdbbdd. What is prob of sequence bubu? 2/429 What is prob of sequence dydg when four letters picked without replacement from ttyydyttytyyttttygd? 7/46512 Two letters picked without replacement from {j: 6, k: 3, z: 7, t: 1}. What is prob of sequence zj? 21/136 Four letters picked without replacement from {z: 2, c: 4, u: 1, e: 7, g: 1}. What is prob of sequence cgcu? 1/2730 Calculate prob of sequence xppf when four letters picked without replacement from {p: 6, x: 9, f: 2}. 9/952 Two letters picked without replacement from yyyyyyaaayyayyyyyy. Give prob of sequence yy. 91/153 Three letters picked without replacement from fawdkfftfttfawdftw. What is prob of sequence waa? 1/816 Two letters picked without replacement from xxxtxtdtdttt. Give prob of sequence dt. 1/11 Three letters picked without replacement from {r: 2, k: 5, g: 6, o: 1, i: 1}. What is prob of sequence rok? 1/273 What is prob of sequence sss when three letters picked without replacement from {p: 2, s: 17}? 40/57 What is prob of sequence umu when three letters picked without replacement from {r: 1, m: 3, t: 1, u: 2}? 1/35 Calculate prob of sequence ppvo when four letters picked without replacement from {p: 5, o: 3, v: 1}. 5/252 Three letters picked without replacement from bbbeerrebzbbbrrzbbeb. Give prob of sequence ebz. 2/171 What is prob of sequence mmav when four letters picked without replacement from hvphmhvpvvammpahhpv? 5/7752 Calculate prob of sequence mma when three letters picked without replacement from {c: 1, d: 1, m: 2, t: 1, u: 2, a: 1}. 1/168 Two letters picked without replacement from {d: 2, t: 3, f: 4, j: 1}. Give prob of sequence dt. 1/15 Two letters picked without replacement from ywkkywywykjywywkwk. What is prob of sequence jk? 5/306 What is prob of sequence cgp when three letters picked without replacement from pcixxzzgxgxz? 1/660 Two letters picked without replacement from {p: 9, x: 5}. Give prob of sequence pp. 36/91 What is prob of sequence dmlm when four letters picked without replacement from dddlmddlldmddllm? 1/182 Calculate prob of sequence rrrr when four letters picked without replacement from rrrrrrr. 1 What is prob of sequence ddmd when four letters picked without replacement from {d: 5, m: 3}? 3/28 Calculate prob of sequence fou when three letters picked without replacement from oklkloikkufo. 1/440 What is prob of sequence yie when three letters picked without replacement from {d: 1, e: 5, i: 1, y: 10}? 5/408 Two letters picked without replacement from huutheuhuuuu. What is prob of sequence th? 1/44 Three letters picked without replacement from {j: 2, b: 3, u: 1, d: 1}. What is prob of sequence jjb? 1/35 Calculate prob of sequence wb when two letters picked without replacement from {w: 2, f: 1, b: 8, h: 7, l: 2}. 4/95 Calculate prob of sequence vx when two letters picked without replacement from ossvzmx. 1/42 Calculate prob of sequence le when two letters picked without replacement from luuluelluuleeeeeuel. 7/57 Two letters picked without replacement from {e: 1, k: 1, i: 1, o: 1, h: 1, a: 2}. What is prob of sequence oe? 1/42 Three letters picked without replacement from qqiqiqqq. Give prob of sequence iii. 0 Two letters picked without replacement from ctnntmccncmcmncnmc. Give prob of sequence tt. 1/153 What is prob of sequence db when two letters picked without replacement from {d: 1, b: 2}? 1/3 Two letters picked without replacement from vvtlujk. What is prob of sequence vv? 1/21 Calculate prob of sequence gtwh when four letters picked without replacement from {t: 1, h: 1, e: 1, z: 2, g: 2, w: 1}. 1/840 Calculate prob of sequence ux when two letters picked without replacement from xiinniilu. 1/72 Calculate prob of sequence laxx when four letters picked without replacement from {x: 2, a: 1, r: 3, l: 1}. 1/420 Three letters picked without replacement from kknkkfkkfkgnkknnk. Give prob of sequence knn. 1/34 What is prob of sequence mhqh when four letters picked without replacement from {q: 1, m: 2, h: 7}? 1/60 What is prob of sequence jvjv when four letters picked without replacement from vjjjjvjjjjjjjjvjvjjj? 8/323 Two letters picked without replacement from {n: 1, p: 2}. What is prob of sequence np? 1/3 Calculate prob of sequence yq when two letters picked without replacement from qqqqqqqqqqqqqqqqqqy. 1/19 Three letters picked without replacement from {n: 2, o: 2, x: 6, r: 1, i: 1}. What is prob of sequence xxo? 1/22 Three letters picked without replacement from zzszzzzssrzssrzzzsz. Give prob of sequence rsz. 22/969 Four letters picked without replacement from {d: 2, u: 4}. What is prob of sequence uudd? 1/15 Two letters picked without replacement from {f: 2, m: 4}. Give prob of sequence mf. 4/15 What is prob of sequence my when two letters picked without replacement from {y: 1, r: 3, g: 2, m: 4}? 2/45 Calculate prob of sequence kbw when three letters picked without replacement from kfbwcchbw. 1/126 Three letters picked without replacement from {h: 6, g: 7, q: 4}. What is prob of sequence qhq? 3/170 Calculate prob of sequence rrr when three letters picked without replacement from rrrrrrrrrr. 1 Two letters picked without replacement from oglzgoorll. Give prob of sequence og. 1/15 Calculate prob of sequence bblx when four letters picked without replacement from {x: 1, l: 3, b: 5, a: 1}. 1/84 Four letters picked without replacement from {b: 1, k: 3, t: 1, l: 3, v: 2, j: 3}. What is prob of sequence tjlv? 3/2860 Calculate prob of sequence ccs when three letters picked without replacement from {c: 17, s: 1}. 1/18 Three letters picked without replacement from aaaataaaaaaaaaaaaa. What is prob of sequence ata? 1/18 Calculate prob of sequence bua when three letters picked without replacement from {b: 1, a: 4, u: 3}. 1/28 Three letters picked without replacement from dbcoloddd. What is prob of sequence coo? 1/252 Calculate prob of sequence pp when two letters picked without replacement from ppppppappppapppppa. 35/51 What is prob of sequence att when three letters picked without replacement from ataaataaa? 1/36 Three letters picked without replacement from {l: 5, a: 14}. Give prob of sequence lla. 140/2907 Three letters picked without replacement from {o: 3, c: 13, i: 4}. What is prob of sequence iio? 1/190 What is prob of sequence qo when two letters picked without replacement from {o: 1, b: 4, j: 1, s: 2, u: 1, q: 11}? 11/380 Four letters picked without replacement from wawawbawaaawayaaa. Give prob of sequence awba. 15/1904 Calculate prob of sequence tr when two letters picked without replacement from {t: 4, d: 3, k: 3, r: 2, w: 4, n: 2}. 4/153 What is prob of sequence ww when two letters picked without replacement from {w: 2, n: 8, b: 2}? 1/66 Four letters picked without replacement from rrwmqrqwqx. Give prob of sequence wxmw. 1/2520 Two letters picked without replacement from bbbbbybbn. What is prob of sequence yn? 1/72 Four letters picked without replacement from pstpsbtbxpbpbbtb. Give prob of sequence psbs. 1/910 Two letters picked without replacement from {l: 5, g: 2, p: 2, e: 3, w: 2, h: 2}. What is prob of sequence ew? 1/40 Two letters picked without replacement from jjezweerwhzhwz. Give prob of sequence rr. 0 What is prob of sequence ep when	{ "pile_set_name": "DM Mathematics" }
5, 3n = 3i - 15. Let p(r) = -6r + nr*2 + 5r - r*2 + 5 - 15. Calculate p(k). -10 Let q be 3/(-1)(-1)/93. Let p(j) = 29j - 3. Give p(q). 26 Let a = 283 - 248. Suppose 0 = -4f - 5k - a, 2k + 26 = 2f - 6f. Let d(p) = p3 + 5p*2 - 2p + 7. Give d(f). 17 Suppose -2u = -5z + 46, -3z - 5u + 14 = -26. Suppose 6a + z = 4a. Let f(x) = 11x + 6x*2 - 48x*3 + 2x - 5 + 49x3 - 5x - 7x. Calculate f(a). 15 Let u(q) be the third derivative of 13q*5/60 + 7q*4/4 + 7q*3/6 - 3q*2 - 4q + 5. Calculate u(-3). -2 Let v be 6(1 + (-4)/6). Let m(u) = 9u + 7. Let r(q) = -11q - 9. Let z(b) = b2 - 40. Let k be z(6). Let n(i) = kr(i) - 5m(i). Determine n(v). -1 Let d(m) = -m - 7. Let k(a) = -2a - 19. Let t(f) = -3f - 36. Let s(c) = -7k(c) + 3t(c). Let r be s(-5). Calculate d(r). -7 Suppose -30 = 3q + 5y + 37, 3q = 2y - 32. Let o(d) = -d3 - 16d*2 - 17d + 34. Give o(q). -120 Let p(g) be the second derivative of g6/360 + g5/24 + 5g4/24 - 5g3/3 + g2/2 - 73g. Let j(z) be the second derivative of p(z). Calculate j(-5). 5 Let h(v) = 4v*2 + 4v*2 - 19v + v2 - 80 + v2 - 11v2. What is h(-5)? -10 Let x be (-2)/(((-4)/(-6))/(-1)). Suppose -34 = 2l - 82. Suppose -4f + 4d = l, 7f - xd + 20 = 3f. Let z(r) = -4r - 2. Calculate z(f). 6 Suppose -341 - 89 = -126p + 40p. Let s(l) = 2l2 - l - 7. Determine s(p). 38 Let z(q) = -14q*2 - 4q - 19. Let m(d) = d*2 + 2d + 13. Let p(g) = 2m(g) + z(g). Give p(3). -101 Let x(p) be the second derivative of p5/20 + 5p4/12 + p3/3 - 3p2/2 + 2p - 797. Suppose -5n + 3i - 6 = 0, 0n + 4i = -n - 15. Determine x(n). 9 Let p(h) = 1008h - 245h - 244h - 183 - 250h - 254h. What is p(12)? -3 Let q(x) = -2x*2 - 6x - 6. Let m be q(-3). Let g(l) = 7l2 + 3l - 2. Let t(a) = a*2 + a. Let h(i) = mt(i) + g(i). Let w = -369 - -371. What is h(w)? -4 Suppose 1003n = 1008n - 15, 15 = 6x - 3n. Let z(y) = 16y - 12. Determine z(x). 52 Let j(g) = 12g - 45. Let r(q) = -q*3 - 26q*2 + 68q + 338. Let k be r(-28). Calculate j(k). -21 Suppose 5z = -392 + 167. Let q = z - -38. Let k(h) = h3 + 8h*2 + 7h. What is k(q)? 0 Let t(b) be the third derivative of b*3 + 1/24b*4 + 0b - 4 - 6b2. Give t(-6). 0 Let q(f) = -f2 + 11f + 82. Let p = 3892 - 3876. Calculate q(p). 2 Let y(k) = -4k - 63. Let b(l) = -l + 21. Let p(i) = 6b(i) + y(i). Give p(6). 3 Suppose 4g - 5h = -24, 4g - 11 = 2h - 35. Let q(b) be the second derivative of 1/2b2 - b + 0 - 1/3b*3. What is q(g)? 13 Let j(l) = -2l*3 - 9l*2 - 10l - 13. Suppose -3g = -4v, v - 22 + 17 = 2g. Let f be j(g). Let k(n) = -3 - 1 - 8 + 2n - n. Give k(f). -1 Let l(t) = -t*3 - 9t*2 - 8t + 13. Let r = -8199 + 8191. Determine l(r). 13 Let r(i) = 54i2 - 9i - 30. Let p(q) = -13q2 + 2q + 7. Let a(v) = -25p(v) - 6r(v). What is a(-6)? 17 Let u(y) = -3y + 17. Let f(a) = 3a + 13. Let m(c) = -c - 2. Let x(v) = -5f(v) - 20m(v). Let b(o) = 8u(o) + 5x(o). Give b(-10). 1 Let a(d) be the first derivative of -10d + 101 - 1/2d*2. Give a(-11). 1 Suppose -128r - 3408 = 156r. Let m(a) = -a2 - 15a - 7. Calculate m(r). 29 Let w(x) = -x*3 - 6x*2 - 2x + 6. Let g be w(-5). Let o(s) = 323s - 45. Let p(y) = -149y + 22. Let n(f) = -6o(f) - 13p(f). Calculate n(g). -7 Let l(b) = b*2 + 5b + 4. Let h be l(-4). Let q(a) = a*2 + 11a - 76. Let j(t) = t*2 + 10t - 68. Let f(n) = -12j(n) + 11q(n). Calculate f(h). -20 Let l(a) = 267a + 25a*3 - 46a*3 - 23a3 + 2 + a2 - 16a3 - 270a. Give l(1). -60 Let x(a) be the third derivative of -a6/120 + a5/30 - a*4/24 - 17a*3/6 - 12992a*2. Calculate x(-2). 1 Let z = 3652 + -3648. Let r(q) = 13q - 39. Give r(z). 13 Suppose p - 13 = -c + 3p, 3c + 16 = -5p. Suppose 0 = 28n - 30n. Let f(x) = x3 + 9 - 2x*2 - 5 + n - 3x. Calculate f(c). 4 Let h(x) = 321x + 7 + 13x*2 - 14x*2 + 318x - 632x. Determine h(5). 17 Let v(h) = 54h + 1475. Let p(g) = -136g - 3686. Let w(i) = 5p(i) + 13v(i). Give w(-34). -3 Let c(w) = 54w + 9. Let y(o) = -19o - 4. Let r(a) = -6c(a) - 17y(a). Let m(p) = p2. Let v be m(3). Calculate r(v). 5 Suppose -28r = -30r + 164. Suppose -r = -4t - 86. Let c be t(1 + 0 + 0). Let l(z) = z2 + 2z + 1. Calculate l(c). 0 Let z be 1/((-959)/161 - -6). Suppose 7 = -zp + 22p. Let t(u) = -3u. Give t(p). 21 Let m(w) = 0w*3 + 94 + 0w*3 - 15w*2 - 55w - 47w + 109w - w*3. Give m(-15). -11 Let u(q) = -4q - 2. Let m be (87/(-116))/((-21)/8)28. Let i be -6(-15)/(-21) + m/28. Give u(i). 14 Let m be -2(-5)/20-4. Let k(y) be the second derivative of -4y3 + 508y + 1. Determine k(m). 48 Let n(c) be the first derivative of c*4/4 - 2c*3 + 3c*2/2 - 6c - 844. Let j = 10 - 6. Let l = j + 2. Determine n(l). 12 Suppose -2w + w + 27 = l, 21 = w + 4l. Suppose -w = 5n - 9. Let m(g) = -g - 1. Determine m(n). 3 Let t(r) = r2 + 5r + 1. Let x be (2/(-4))/((-2)/4). Let l be (2/(-4))/(x/(-12)). Suppose -1 = -b - l. Determine t(b). 1 Let w(m) = -1 + 2 - 6 - 3m. Suppose -92q + 4c - 36 = -88q, -11 = 3q + c. Determine w(q). 10 Let u(t) = -t3 + 2t*2 + 3t + 7. Suppose 36 = 7a - 32a + 111. Determine u(a). 7 Let a(u) = -2u2 - 2u - 1. Let y(v) = -12v - 3 + 3v*2 + 9v + 8 - 4 - 3. Let p(d) = a(d) + y(d). Give p(-3). 21 Let p = 426 - 134. Let t(x) = -x*2 + 301 + 0x + x - p. Give t(-4). -11 Suppose 3i + 5y - 11 = 0, 3 = -2i - 2y + 9. Suppose -6 = -5k + 4m, k = 5k - im - 6. Let z(v) = 0 + 3vk - 2v*3 - 5 + 5. Give z(2). -4 Let s(k) = 455k - 919k + 7 + 469k. Give s(-3). -8 Let z(x) be the second derivative of -x*5/20 - 3x*4/4 - 5x3/3 - x2 + 860x. Calculate z(-7). -30 Let q(d) be the third derivative of 1/120d*5 - 6d*3 + 0 + 0d + 17d2 + 7/12d4. Let i(c) be the first derivative of q(c). Calculate i(-9). 5 Let u(f) be the first derivative of -f4/4 - 4f3/3 + 3f*2 + 7f + 1. Suppose -279b + 2006 - 3401 = 0. Calculate u(b). 2 Let l = -113 + 158. Let n be (-210)/4 + 2/4. Let w = n + l. Let h(s) = s - 9. What is h(w)? -16 Let d(c) = -24c + 8766 + 7c - 8760. Calculate d(-1). 23 Suppose 0 = -k - 1 + 2. Let z be (1 + 2 - k)2. Let y(n) be the third derivative of -n*4/12 + 638n*2. Calculate y(z). -8 Let o(s) = -4s*2 + 82s + 42. Suppose -116 = -4p - 4n, 167n + 60 = 4p + 164n. Give o(p). 0 Let j(o) = o2 + 5o + 0o2 - 6 - 14 + 10o. Let t be (-640)/(-80)(-3 + 4 - 3). Calculate j(t). -4 Let k(o) be the third derivative of -o5/30 + 25o4/24 - o3 - 227o2. Let f(t) = 4t*2 - 46t + 11. Let j(h) = 6f(h) + 11k(h). Give j(-2). 10 Let d(t) = t*3 + 3t*2 + 3t + 5. Suppose -55v + 70v = -60. Calculate d(v). -23 Suppose -t = -2s - 5, -5 = 2t + 2s - 3. Let a(z) be the second derivative of -3z5/10 - z4/12 + z3/6 - z2/2 + z. What is a(t)? -7 Let b(k) = 5k2 - 3k*2 - 3k + 1 - 3k2 - 5. Let q(f) = -f3 - 58f*2 - 4f - 235. Let c be q(-58). Calculate b(c). -4 Let a(q) = 17q3 + 6q*2 - 25q + 44. Let m(t) = 27t3 + 9t*2 - 37t + 67. Let j(u) = 8a(u) - 5m(u). Give j(-6). -1 Let q(a) = a*3 + 10a*2 + 6a - 14. Let v(b) = 5b3 + 42b*2 + 25b - 56. Let k(o) = 9q(o) - 2v(o). What is k(6)? 10 Let z be (-81 + 80)(-42 - (2 + -1)). Let j(m) = 3 + 1 + 3m*2 - zm - 4m2 + 36m. What is j(-8)? -4 Let i(f) = -f*3 - 8f*2 + 2f + 15. Suppose -895u + 923u + 127 = -69. Determine i(u). -48 Suppose -5o = 5r + 35, -r + 9 = -13o - 26. Let j(i) = -3i + 0i + 2i - 3. Calculate j(o). 0 Let k be -1 - (4/(-18) + ((-808)/(-72) - -1)). Let x(c) = 6c + 19. What is x(k)? -59 Let i(w) be the second derivative of w3/3 + 2w*2 - 6w. Let k be ((-4)/14)/((27/63)/(-3)). What is i(k)? 8 Suppose 95g + 407 = -163. Let j(q) = q3 + 5q*2 - 17q - 76. Determine j(g). -10 Let z(x) = -15x + 1. Suppose 3y - 8y + 3l = 30, -y - 2l - 6 = 0. Suppose 0b - 16 = 4b. Let c be (-45)/15b/y. Give z(c). 31 Let t(z) = -z + 8. Let y be t(6). Let m(v) = -2v + 3v*y - 8v*2 + v. Let n be (-6 - (-6 - -1))/(2/4). Give m(n). -18 Suppose -4y - 81 = -109. Let h(a) = 3a2 - 26a + 28. What is h(y)? -7 Let c(j) = j + 1. Let v(i) = 1. Let k(o) = 5c(o) - 4v(o). Let z = 0 + 14. Let q(p) = p*3 - 16p*2 + 28p + 3. Let f be q(z)	{ "pile_set_name": "DM Mathematics" }
se 0m = 4m. Suppose 14 = -z + 3c, -2z + mc = 4c - 22. Determine or(i) + zn(i). i - 2 Let k be 43/(-18)-3. Let h(j) = k + 3 - 3 - j. Let y(c) = -4c + 9 - 1 + 0c. Calculate 9h(z) - 2y(z). -z + 2 Let y(k) = -3k3 - 7k*2 - 10k. Let o(s) = -s*3 - 3s*2 - 5s. Calculate -7o(t) + 3y(t). -2t3 + 5t Let a(v) be the first derivative of 5v4/2 - 16v*3/3 - 10v + 37. Let m(n) = -2n3 + 3n*2 + 2. Calculate -3a(d) - 16m(d). 2d*3 - 2 Let u(r) = -10r*3 - 5r + 5. Let f(j) = 5j3 + 3j - 3. Determine 10f(y) + 6u(y). -10y3 Let w(l) = 7l*2 - 4l + 7. Let x(i) = i*2 + 1. What is -w(v) + 6x(v)? -v*2 + 4v - 1 Let k(a) = -a. Let z(p) be the first derivative of -p*2/2 - 2. Calculate -6k(t) + 5z(t). t Let d(q) = -10q - 2. Let t(j) = 11j + 2. Suppose -n + 23 = -6o + 2o, 27 = -3o + 4n. Give ot(g) - 6d(g). 5g + 2 Let k(f) = 36 - 35 + 3f + f. Let o(v) = -v - 1. Let a(n) = 3n*2 - 1. Let u be a(1). Let y be (2 - (0 + u)) + 1. What is yk(l) + 3o(l)? l - 2 Let j = 3 - 5. Let u(g) be the third derivative of -1/3g*3 + 0g + 3g2 + 5/24g*4 + 0. Let a(s) = -4s + 2. What is ju(w) - 3a(w)? 2w - 2 Let k(t) = -3t*3 - 15t*2 + 4t + 6. Let f(p) = -3p3 - 15p*2 + 3p + 5. Give 6f(o) - 5k(o). -3o3 - 15o*2 - 2o Let t be -2 - 2/4-2. Let q(n) = -3n2 - n - 4. Let i(b) = -b2 - b - 1. Let s = -23 - -25. What is si(p) + tq(p)? p*2 - p + 2 Let n(d) = -d. Let u(b) = 5b*2 - b - 1. Let k be u(-1). Let l(c) = -c. Let p = -9 + 5. Determine kl(s) + pn(s). -s Let y(i) = 1. Let j(z) = 44z*2 - 264. Give j(g) + 264y(g). 44g2 Let f(l) = l3 + 3l - 3. Let d be 2((-17)/(-2) - 3). Suppose 9 = 2m - d. Let y(x) = -4x3 - 10x + 10. Give mf(b) + 3y(b). -2b3 Let b(c) = c2 + 2c + 7. Let y(h) = -8 - 4h + h2 - 2h*2 + 2h + 0h. Let v = 9 + -14. Calculate vy(f) - 6b(f). -f2 - 2f - 2 Let a(f) = 7f3 + 4f*2. Let d(k) = -28k*3 - 17k*2. What is -9a(l) - 2d(l)? -7l*3 - 2l*2 Let z(y) = 9y*3 + 7y*2 - 7. Suppose -6o + 11 = 53. Let b(c) = -8c3 - 6c*2 + 6. Give ob(f) - 6z(f). 2f*3 Let z(s) = -4s + 1. Let k(f) = 5f - 1. Let h be -13(13 - 12). Let j be 6 + (0 + h - -1). Determine jz(r) + 3k(r). -r + 1 Let s = -18 - -25. Let n(c) = -26c + 13c + 10c - 4. Let v(u) = 2u + 3. What is sv(i) + 5n(i)? -i + 1 Let u(m) = -m + 11. Let v be (-13)/(-3) - (-1)/(-3). Let n(p) = -v + 5 + 0 + 1. Let x = 25 - 14. Determine xn(o) - 2u(o). 2o Let j(c) = 44c - 14. Let f(a) = 9a - 3. Determine -14f(q) + 3j(q). 6q Let s(f) = 2f + 12. Let g be s(-5). Let q(n) = n - 11. Let d(i) = -1. Give gq(u) - 22d(u). 2u Let l(o) = o + 2. Let m(y) = y + 2. Suppose 0 = -7d - 25 - 10. Determine dl(j) + 6m(j). j + 2 Let c(t) = -t. Let s be c(8). Let f(p) = -5p3 - 6p*2 - 8p. Let j = 6 + -4. Let a(g) = -5g3 + g3 - 3g - 2gj + 2g*3. What is sa(x) + 3f(x)? x3 - 2x2 Let u(w) = w2 - w - 1. Let x = 46 - 49. Suppose 14 = 3z + 5. Suppose 7 = -zn + 2c + 2, 22 = 2n + 5c. Let y(v) = v2 - 3v - 1. Give ny(k) + xu(k). -2k2 + 2 Let m(d) = d2 + 5d - 5. Let v(j) = 0 + 14j + 3 - 17j. Calculate -3m(i) - 5v(i). -3i2 Let o(n) = 3n*3 + n - 8. Let j = -9 + 14. Let w(a) = -2a*3 - a + 7. Determine jw(k) + 4o(k). 2k*3 - k + 3 Suppose 946 = -2k + 936. Let s(q) = 2q2 - 5q + 1. Let i(d) = -4d2 + 9d - 2. Let r = 5 - 8. Calculate ks(a) + ri(a). 2a2 - 2a + 1 Let r(p) = -9p + 7. Let s(u) = 3u + 4. Let y(b) = -b - 1. Let n(z) = 2s(z) + 7y(z). Calculate -6n(i) + r(i). -3i + 1 Let r(j) = -j. Let h(l) = l + 1. Let o be h(-5). Suppose 4x + 3d - 19 = 0, -2x + 5d + 8 - 31 = 0. Let m(f) = -3f. Determine or(w) + xm(w). w Let p(o) = o3 - o2 - 5o + 5. Let w(j) = -j*3 + 6j - 6. Calculate -6p(q) - 5w(q). -q*3 + 6q*2 Let u(b) = -4b*2 - 5b - 2. Suppose 0 = -5t + 82 - 57. Let y(s) = -7s*2 - 9s - 3. Let p(m) = -m. Let h be p(3). Determine hy(o) + tu(o). o*2 + 2o - 1 Let n(d) = -d + 0d3 - 5d*2 - 11d*3 + 8d. Let l(i) = -6i3 - 3i*2 + 4i. Let c be 5 - (-2)/(4/(-6)). Let p be (3 - 1)/c-7. What is pl(m) + 4n(m)? -2m3 + m2 Let i(v) = v*2 + 1. Let y = 1 + 3. Let p be 2/(y1/2). Let h(o) = 3o2 + 4 + 4 - 4. Determine ph(d) - 4i(d). -d2 Let c(f) = 8f + 7. Let o(w) = w + 1. Suppose 2d + 24 = -2d. What is do(i) + c(i)? 2i + 1 Let d be (1/(-4))/(1/(-20)). Let k(i) = 3i + 9. Let f(n) = -2n - 8. Give df(b) + 4k(b). 2b - 4 Let n(c) = 3c - 2. Let r(m) = m + 1. Give -n(v) - 4r(v). -7v - 2 Let y(q) = 0q2 + 2q2 - q2. Let i be (-32)/(-18) + (-4)/(-18). Let k(z) = 0z2 - 7z*2 + 11z*2. Calculate ik(v) - 6y(v). 2v*2 Suppose -3a = 8 - 2. Let l(y) = 2y2 + 2y - 3. Let u(d) = -d*2 - d + 1. Give al(i) - 6u(i). 2i*2 + 2i Let h(d) = 3d + 8. Let i = -7 + 11. Let p(w) = -15 + 3w - w - 5w - iw. Let t(s) = 5h(s) + 3p(s). Let c(r) = 7r + 6. What is 5c(x) + 6t(x)? -x Let i(c) = -12c*3 - 15c*2. Let o(q) = -3q*2 + 2q*2 + 0q3 - q3 + 0q2. What is i(t) - 15o(t)? 3t3 Let d(x) be the third derivative of 0x + x*2 + 0 + 0x*3 - 1/24x4. Let g(w) be the second derivative of w3/6 - 2w. Calculate 3d(t) + g(t). -2t Let y(j) = 16j2 - 4. Let h(g) = -g2. Calculate -20h(v) - y(v). 4v*2 + 4 Let u = 14 + -16. Let o(x) = 135x + 55. Let p(c) = 5c + 2. Determine uo(y) + 55p(y). 5y Let j(c) = -2c - 3c - 3c2 + 2c*2 + 3c. Let d(a) = -a*2 - a. Let x(o) = 11o*2 + 15o. Let b(g) = -6d(g) - x(g). Determine -2b(l) + 9j(l). l2 Let b(f) = -3f + 5. Let c(l) be the second derivative of -l*3/3 + 2l*2 + 14l. Let h be (1 + -2)(-5 - -2). Calculate hb(a) - 4c(a). -a - 1 Let r(k) = 6k*2 + 4k. Let l(u) = -5u2 - 5u. What is 3l(h) + 4r(h)? 9h2 + h Let u(x) = -14x + 5. Let d(m) = -41m + 16. What is -2d(w) + 7u(w)? -16w + 3 Let b(n) = 7n + 45. Let v(c) = -8c - 45. Give 6b(d) + 5v(d). 2d + 45 Let g(d) = -6d - 45 + 4d3 + 39 - 6d*3. Let q(l) = 7 - 2l + 9l + 2l*3 + 0. Suppose -3h + 10 = 4s - 0, 4h + s - 22 = 0. Give hq(p) + 7g(p). -2p3 Let v(w) = -13w*2 - 13w + 30. Let k(c) = 6c2 + 6c - 15. Calculate 9k(l) + 4v(l). 2l2 + 2l - 15 Suppose 0 = 5o + 64 + 66. Let b = -13 - -19. Let x(d) = 17d*3 + 13d*2 - 17d + 13. Let s(w) = 4w3 + 3w*2 - 4w + 3. Determine bx(v) + os(v). -2v3 + 2v Let i(q) = -5q3 + 5q2 + q - 5. Let z(r) = r3 - r*2 + 1. Let w(v) = i(v) + 6z(v). Let k(l) = 4l3 - 3l*2 + 4l + 4. Calculate k(s) - 3w(s). s3 + s + 1 Let i(q) = 6q*3 - 3q*2 - 3q - 3. Let w(p) = -5p3 + 2p*2 + 2p + 2. Let u = -23 + 25. Determine ui(g) + 3w(g). -3g3 Let g(r) = -4r*2 + 2. Let j be (32/10)/(-2)5. Let u(z) = -6z2 + 3. Calculate jg(m) + 5u(m). 2m*2 - 1 Let r = -4 + 7. Let z(y) = 5 - r + 3 + 3y. Let w(g) = 1. Give -5w(s) + z(s). 3s Let o(t) = 2t3 + t - 2. Let c(v) = -4v*3 - 2v + 4. Let g(b) = b*3 - 13b*2 + 12b + 11. Let z be g(12). Give zo(r) + 6c(r). -2r3 - r + 2 Let l(u) = -u2 - 2u + 1. Let b(v) = 3v - 1. Give 3b(d) + 4l(d). -4d2 + d + 1 Let n(a) = -a3 + 5a2 - 6a. Let m(h) = h*3 - 4h*2 + 5h. Suppose 3o - 24 - 13 = 5q, -3o = 2q - 2. What is qn(k) - 6m(k)? -k3 - k2 Let j be (-6)/8 + 17/(-4) + 0. Let s be (-3)/(-12) - (-25)/(-4). Let w(v) = 7v3 - 6. Let o(i) = -6i*3 + 5. What is jw(z) + so(z)? z3 Let l(k) = 3k*3 + 5k*2 + 5k - 5. Let p(a) = 4a3 + 6a*2 + 6a - 6. Let w = 33 - 39. Calculate wl(o) + 5p(o). 2o3 Let u(h) = 5h + 8. Let j(w) = -3w + 5. Let q(x) = 4x - 6. Let d(z) = -5j(z) - 4q(z). Calculate -6d(g) - u(g). g - 2 Let c(u) = -1. Let z(k) = k + 2. Suppose 22a + 16 = 14a. Determine ac(p) + z(p). p + 4 Let h(d) = -8 - 12d + 6d + 0d. Let c(b) = -5b - 7. Let s(l) = -l*2 + l + 6. Let f be (0 - 1/2)0. Let u be s(f). Give uh(m) - 7c(m). -m + 1 Let t = -1 - -2. Let c(r) = 1 + 0r - r + r2 + 0r*2. Let k(u) = -4u2 - 7. Let f(l) = -l2 - 1. Let a(p) = 3f(p) - k(p). What is ta(v) - 2c(v)? -v2 + 2v + 2 Let y be 3 - 0 - -10 - 1. Suppose -a - y = -3a. Let m(d) = d - 5. Let r(h) = -1. Calculate ar(j) - m(j). -j - 1 Suppose -30f = -31f + 1. Let r(b) be the first derivative of	{ "pile_set_name": "DM Mathematics" }
t h be (u/10)/((-2)/(-5)). Solve hb - 3 - 3 = 0 for b. 3 Suppose 3s + 5v - v = -76, s - 4v = -4. Let f = s - -25. Suppose 4r - fr = 0. Solve c + c + 10 = r for c. -5 Suppose -4q + 11 = -5c - 10, 4c = -20. Let j be q/3-21 - -1. Solve -2o - 2 = -j for o. 3 Let h(a) = 3a*3 + 22a*2 - 23a - 30. Let n be h(-7). Solve 2q + 28q = -n for q. -6 Suppose -9 = -4j - 5b, -3j = -0j - 3b - 27. Suppose -jg - g - 672 = 0. Let y = g - -98. Solve -yp = 2p - 20 for p. 5 Let w(h) = -5h2 - 72h - 58. Let p be w(-17). Let b = p - -318. Solve br - 44r = -5 for r. 1 Let t(c) = -2c2 + 25c + 15. Let z be t(13). Suppose -zu - 2 = -8. Suppose -2i + 2 = 2s, 3 = -2i + i + us. Solve w + 0w = i for w. 0 Suppose -4x - 4288a + 184 = -4300a, -2x + 3a + 56 = 0. Let u(t) = t + 4. Let s be u(6). Solve xj - s = -60 for j. -5 Let p(g) = g*3 - 47g*2 + 397g - 986. Let d be p(37). Let w = -20 + 32. Solve wc - dc = 2 for c. -2 Suppose 2s = k - 621, 3k = 3s + 8k + 951. Let n be (-18)/63 - s/14. Solve n - 2 = 4y for y. 5 Let z(b) = -b + 28. Let f be z(3). Suppose 8a + f - 49 = 0. Solve aq - 3 + 12 = 0 for q. -3 Let z(y) = -y2 - 86y - 1520. Let x be z(-61). Solve -81 = xg - 56 for g. -5 Let p(n) = n3 + 2n*2 - 14n - 3. Let h be p(3). Let m be 1-3 - (63 - -9). Let i = m + 77. Solve ig + 9 + 1 = h for g. -5 Let x = -2713 + 3337. Solve 4z = -604 + x for z. 5 Let s be 67(176/11 + -15). Solve -4c - 51 = -s for c. 4 Suppose -x + 34 = -3o, -40x + 44x - 70 = o. Solve -xt - 10 = -11t for t. -2 Suppose 0 = -6x + 3x + 6. Suppose -5b - xf - 4 + 0 = 0, -4f = 2b + 8. Solve 3 = -bh - h for h. -3 Let k be ((174/24)/(-29))/((-1)/1532). Solve kj - 32 = 391j for j. -4 Suppose 5a - 851 = 2c - 853, -4c - 5a + 94 = 0. Solve -20x - 144 = c for x. -8 Let p(g) = 6g + 43. Let t be p(9). Let c = -95 + t. Solve cd - 7d - 25 = 0 for d. -5 Let m = -15251 - -15251. Solve m = 3b - 453 + 459 for b. -2 Let i = 4979 + -4977. Let b be (0/1)/(2/(-2)). Solve bf = -if + 6 for f. 3 Suppose 4z = 725 - 713. Solve 18k = -51 - z for k. -3 Let z = -740 - -755. Solve -zy + 145 = 14y for y. 5 Suppose -500r = -620r + 480. Let p(q) = -q*3 + 0q*3 - 1 + 4q*2 - 5q*2 - q. Let u be p(-2). Solve m + r = um for m. 1 Let d = 131 - 123. Suppose dp = 9p + 6p. Solve 0 = -pc + 3c - 15 for c. 5 Suppose 0 = 5h - 5j + 140, h + 2j = -4h - 161. Let s = -7 + h. Let w = -36 - s. Solve 0 = q - w - 0 for q. 2 Suppose 0o + 2o - 4c + 10 = 0, 0 = o + 5c - 30. Suppose -2 = -4s - 2w, 0s = -2s + w - o. Let l be (13/(-65))/(s/5). Solve -l = 2x + 1 for x. -1 Let l(s) = 8s - 27. Let p(k) = -7k + 24. Let i(f) = 4l(f) + 3p(f). Let n be i(5). Solve -10 = -3q - n for q. -3 Suppose 51 = -v + 2k - 49, 3v + 2k = -260. Suppose -390 + 132 = 3n. Let w = n - v. Solve -9 + 1 = -wi for i. 2 Let p be 0/((-7 - -2)/1). Suppose 20j - 22j - 1 = u, 4u - 2j - 16 = p. Solve -u = -t - 2t for t. 1 Suppose 0y - 8 = -3r + y, -r + 4 = y. Suppose -4l = -rl + 2q - 2, -4q = l + 6. Let v be (-1)/((-26)/(-52)(-8)/12). Solve -vj - 2j - l = 0 for j. -2 Let q be (-113)/226(-7 - 1) + 53. Solve 20o - 4 = qo for o. 4 Let o be (18/126 + 1(-5)/35)/1. Solve o = -26g + 37g + 22 for g. -2 Let j(b) = 2b*2 - b + 39. Let k be j(0). Suppose 4l + k = 5u + 742, -4u - 569 = -l. Let x be 4/(-26) - 308/u. Solve -2n = -0 + x for n. -1 Let i be 15/15 + 0(-2)/4. Suppose 4t = -88 + 436. Suppose -2d = 4y - 40, -4d + 2y + t = 27. Solve 3r = -d + i for r. -5 Let v be (-5)/(((-5)/1)/5) + -12. Let z be v + (-670)/(-45) - 2/(-18). Solve -2w + zw + 12 = 0 for w. -2 Let v(s) = s - 2. Let y be v(2). Let a = -1225 - -1230. Solve at + y = -15 for t. -3 Suppose 5 = 12o - 7o + 3x, 2o + 2x - 6 = 0. Let a be -1 + -3 + o + 11. Solve -ak = -7k - 8 for k. -4 Let u(x) = -x*3 - 8x*2 + x + 10. Let n be u(-8). Suppose nw + 7w = 18. Solve -3 = d + wd for d. -1 Let w = -1 - -5. Suppose 56 = 14h - 10h. Suppose 0 = -4v - s + h, -24 + 6 = -2v + 5s. Solve v = -wk + 3k for k. -4 Let l(m) = -118m + 11365. Let c be l(96). Solve -34k + c - 275 = 0 for k. -7 Let a(k) = -k2 + 7k + 3. Let s be a(6). Suppose 89 = 2z - 1. Let r be (1458/z)/6 - 3/(-5). Solve -r = f - s for f. 3 Let t(r) = 3r*2 + 28r - 365. Let c be t(-18). Solve 109x = cx + 36 for x. 6 Suppose -4 + 19 = -2o - 3, q + 3o + 22 = 0. Suppose 6d - 25 = d. Solve -d = -2l + q for l. 5 Suppose 224i + 216i - 407i - 14058 = 0. Solve 427c = ic - 3 for c. -3 Suppose d + 5s + 0 + 32 = 0, 0 = -5d - 4s - 76. Let h(c) = -c - 10. Let y be h(d). Suppose yj + j = 6. Solve -ji = i + 3 for i. -1 Suppose 9 = 4x - 3k, x + k + k - 5 = 0. Let g be 80/30 + (-13)/(-39). Let u(i) = i*3 + 4i*2 - 2i + 4. Let d be u(-4). Solve -d = gp - x for p. -3 Suppose -21 = -3c - k, 3c + 3k = 38 - 11. Let m(p) = -6p3 + 26p*2 - 6p - 5. Let z be m(4). Solve c + 6 = zq for q. 4 Suppose 2t + 9 = 17. Suppose p = -p + 5o + 13, 0 = -tp + o + 35. Let i be -12 + p + 7 + (1 - 1). Solve -2u - 6 - i = 0 for u. -5 Suppose 46f = -46f + 7f + 3655. Solve -25z - f = 32 for z. -3 Let g = -16449 + 16485. Solve 24 = -20a - g for a. -3 Let y(a) = -2a2 + 8a - 52. Let t be y(8). Let d = -116 - t. Solve -w + 2w + 3 = d for w. -3 Let p(o) = 12o - 9. Let a be p(4). Let i(s) = -38s2 + as*2 + 21 + 11 - 4 - 15s. Let w be i(13). Solve m + 5 = wm for m. 5 Suppose -96q + 3220 = -4q. Solve 8l = ql for l. 0 Let h = 9590 - 9565. Solve -h = -4y - y for y. 5 Let x be 6 - (-52 - (5 - 7)). Solve 70 = 42d - x for d. 3 Let a(y) = y3 - 4y*2 - 19y + 75. Let m be a(3). Solve -mc - 231 = -42c for c. 7 Let w(n) = -8n2 - 3n + 4. Let q be w(-4). Let t = 127 + q. Suppose 0d + 165 = td. Solve 0 = -2h - d + 3 for h. -4 Suppose 36v = 32v - 1292. Let z = -320 - v. Solve -5 = -zb - 2 for b. 1 Let l(b) = 1611b - 7960. Let g be l(5). Solve -g = 156m - 175m for m. 5 Let z = 10870 + -10831. Solve -7p - z = -11 for p. -4 Let p = 61 + -53. Suppose -w + 5l + 30 = 0, pl - 11l - 62 = -5w. Let n be w + 1/((-5)/25). Solve -3t + 4 + n = 0 for t. 3 Suppose 223l - 317l = -11280. Solve -9p - 156 = -l for p. -4 Let d(o) = 18o2 + 78o + 84. Let x be d(-3). Solve 44 = xr - r for r. 4 Let n be 63/9 + 16/(-4). Suppose nh - 18 + 9 = 0. Solve 3t + 0 = h for t. 1 Suppose 0 = 11s - 7s - 144. Suppose 19q - s = 10q. Solve -2 = -2n + q for n. 3 Suppose -2b + 3q + 11 = 2q, 2b + 14 = -4q. Let x = 55 + -52. Suppose xj = 0, f + 8j - 2 = 7j. Solve 0 = bs + 5 - f for s. -1 Let j(g) = g3 - 88g*2 - 12g + 1065. Let r be j(88). Solve rw - 47 - 7 = 0 for w. 6 Suppose 4x - 336 = -3v, -3v = 3x - 6x - 294. Solve -57u - 67 = v for u. -3 Let u be (-14)/42 - (-26)/6. Let h(j) = j + j - uj + 14 + j. Let t be h(8). Solve 3x = -3 - t for x. -3 Let m(l) = -l - 83. Let z be m(-11). Let t = -72 - z. Solve ti - 6 = 3i for i. -2 Let m = -15 + 58. Suppose h - 41 = 4y - 8, h + y = m. Let b = h + -36. Solve -12 = -bk + 8 for k. 4 Let w(j) = j2 - 20j + 95. Let n be w(10). Let t(x) = -2x3 - 4x*2 + 29x + 1. Let a be t(n). Solve 0 = 2p + p + a for p. -2 Let l = -4 - -4. Suppose l = -71p + 64p. Solve p = -0v - 2v + 8 for v. 4 Let q be (-4)/18 + (-44857)/279. Let n = q + 164. Solve -ng + 1 = -5 for g. 2 Let m = 31 - 11. Let y = m - 15. Suppose 0 = 4s - 5h - 25, 4s + 5h = -20 - 5. Solve sr = yr for r. 0 Let g(f) = -3f - 6f - 9 + 5f + 0f. Let d be g(-11). Let p = d + -32. Solve -px + 5x = 10 for x. 5 Suppose 5a + 23a - 2024 = 6a. Solve 0 = 14g + 78 - a for g. 1 Let r = 324 - 739. Let g = r - -430. Solve -gk + 17k - 2 = 0 for k. 1 Let o be (7/(-6)952/833)/((-2)/192). Solve -71q + 39q - o = 0 for q. -4 Let s(y) = 109y - 951. Let x(h) = -22h + 192. Let j(n) = -2s(n) - 11x(n). Let d be j(9). Solve -2p = -dp - 8 for p. -2 Suppose -54 = -2n + 5k, -2n - k = -8 - 34. Solve -19a - 16 = n for a. -2 Let k be 17/(-2)(-4)/17. Let t be 0/(3(-3)/(-9)). Suppose 3n + d = 18, t = -4n + 4d + 10 + 30. Solve nw = kw for w. 0 Let r be (-6)/(-12) - 138/(-4). Suppose -30g + 95 = r. Solve 2z - g - 2 = 0 for z. 2 Suppose 0 = -r - 3y + 56, 96y + 7 = -r + 102y. Solve 0 = rg - 26*g - 9 for	{ "pile_set_name": "DM Mathematics" }
3i + q = -5i for i. -4 Let s(q) = -7q + 117. Let y be s(16). Solve 19 - 9 = -ya for a. -2 Suppose -4h + 14 = 3o, 1 = 4o + 5h - 18. Solve -3v + 6v - o = 0 for v. 2 Let o be 3 - 0 - (-12)/1. Suppose -10v + ov = 60. Solve w - 5w = v for w. -3 Let m = 31 - 19. Suppose 0 = 2t + 2t + 4q + m, 0 = t + 2q + 6. Suppose -3s = -2z + 4, 0 = -tz - 2z + 4s + 2. Solve 3h - z = -2h for h. 1 Suppose 22q = 22 + 22. Solve -qp = 16 - 10 for p. -3 Suppose -2h = t - 11, 0 = h + 2h + 3t - 24. Suppose -ho = -166 + 154. Solve -3 = -op + 13 for p. 4 Suppose 0 = 2j + 2v - 5v - 20, 2j - 4 = -5v. Let d be (-4)/(-8)-8 + j. Solve dx - 20 = -2x for x. 4 Let m(s) = -6s + 6. Let u be m(-11). Let z be (2/12)/(4/u). Solve zk + 2k = 15 for k. 3 Let z = -7 + 11. Suppose zj + 8 = -2f, -5f + 5j - 2 + 12 = 0. Let r be (296/111)/(4/3). Solve fm - 2 = -rm for m. 1 Suppose 0 = j - 4 - 1. Suppose -6b = -jb. Suppose -y = -by. Solve y = c + 3c for c. 0 Suppose 2k = 5g + 105, 21k - 17k + 3g - 145 = 0. Solve 6u + 14u = -k for u. -2 Let t(o) = -o3 - 25o*2 - 2o - 40. Let i be t(-25). Solve 6 = -2j + i for j. 2 Suppose -o - 11 = -24. Solve 33 = 5n + o for n. 4 Let d(g) be the first derivative of -g*2 - 2. Let i be d(0). Suppose 0 = 16j - 13j - 12. Solve ir = r + j for r. -4 Let w(u) = 7u - 1. Let p be 2/1 + (1 - -3). Let b be w(p). Let z = b + -21. Solve 3n = -n + z for n. 5 Suppose -9i = -7i - 38. Suppose ip + 13 = 20p. Suppose 5f - 20 = 3t + 2, 2f - p = -3t. Solve -t = -r - 3 for r. -2 Suppose q = c - 2c + 21, 4c - 9 = -q. Let j = 40 - q. Solve 0 = 2g + 5 - j for g. 5 Suppose 3f + 21 = 5q, -4q + 6f = 11f - 39. Solve 9o + q = 7o for o. -3 Let m(u) be the second derivative of -u*5/20 - 7u*4/12 - 5u*3/6 + 5u*2 + 19u. Let x be m(-6). Suppose p = -2p + 21. Solve -xb - p - 9 = 0 for b. -4 Let h(p) = -p*3 - 6p*2 - p - 4. Let o be h(-6). Solve -c + 0 = o for c. -2 Let c be 2 + (-5 - 92/(-12))6. Solve -ct - 27 = -9t for t. -3 Suppose -g + 3n + 22 = 0, g = -2g - 2n + 11. Suppose 2a + f - g = 0, -f - 2f = a - 11. Let s be 5 - 3 - (1 - -1). Solve s = b + 3 - a for b. -1 Suppose -2j + 4j - 8 = 0. Suppose 5l - 9 - 11 = -k, 0 = l - k - 10. Suppose -2o - 4z = -20, 3z - 31 - 47 = -lo. Solve -jd + o = -2 for d. 5 Let t(h) = 8h - 31. Let b be t(6). Let s = -15 + b. Solve sg = -g for g. 0 Let k(w) = -3w + 13. Let p be k(5). Let h be (3 - 8)p1. Solve 3t - 1 = -h for t. -3 Let b(w) = w2 - 21w + 71. Let t be b(17). Solve -c - tc = 4 for c. -1 Suppose -10z - 28 + 108 = 0. Solve -10l = -zl - 4 for l. 2 Suppose 2m = 0, -17q = -16q - 3m. Solve qp - 11p - p = 0 for p. 0 Suppose 2h + k = -2h + 15, 4k = -5h + 16. Solve hn + 16 = -4 for n. -5 Suppose 0 = 5q + 10, 4p + 0q + 338 = q. Let x = p - -89. Solve -2l - 2l + x = 0 for l. 1 Let d(l) = -l*2 + 16l + 7. Let v be d(12). Suppose 3o = 3n + 10 + 11, n = 5o - v. Let p = 12 - o. Solve p = -2f + 3f + 2 for f. -2 Suppose z = -3k + 6z + 21, k - 7 = 2z. Suppose 5 + k = 4q. Suppose d = -5, -4g - qd + 25 = -0g. Solve g = c + 4c for c. 2 Let t = 753 + -751. Solve 9z + t = -25 for z. -3 Let k(d) = 2d2 - 27d + 18. Suppose 5g - 2u - 63 = 0, 0 = -2g - g - 2u + 41. Let o be k(g). Solve 6q - 1 = oq for q. 1 Suppose y - 3f + 11 = 0, 12 = 2y + 2y + 2f. Let u = -115 - -114. Let s be (-5 + y + -1)/u. Solve 5 = sa + 25 for a. -4 Let j = 49 - 136. Let a = j + 93. Solve 0 = 15z - 12z + a for z. -2 Suppose -22 + 162 = 35o. Solve oz - 6z = -0z for z. 0 Let b = -254 + 258. Solve -s = bs for s. 0 Let f be ((-684)/(-209))/(-18) + 57/11. Solve -42q - f = -43q for q. 5 Suppose 0 = -4i + 2y + 10, -2y - 15 = 5i + y. Solve -17g + 3g = i for g. 0 Let n = 7 + -5. Suppose -b - 6o = -2o + 12, 8 = 4b + no. Solve -c = -bc for c. 0 Suppose -l + 6 = -30. Suppose -t = 2t - l. Suppose -p - 2p + t = 0. Solve 4 = -pk + 8 for k. 1 Suppose -156 = 2c + 4. Let j = 84 + c. Solve jq - 11 = 1 for q. 3 Let p = -300 + 305. Solve -8y - 19 - p = 0 for y. -3 Let r(z) = 10z - 33. Let h be r(4). Let c be 2/(-3) - 44/(-3). Let p be 4/c - (-5)/h. Solve -2x - p = 3 for x. -2 Suppose -5 = 5q, -3u - 3q = -2q - 8. Solve ut - 2 = 1 for t. 1 Let m be ((4 - 3) + 1)/((-1)/(-4)). Solve -mu - 4u = -12 for u. 1 Let m(y) = -y*3 + 9y*2 - 5y - 15. Let p be m(8). Suppose h = 4z - 2 - 5, -3h + p = 3z. Solve z = -g - 1 for g. -3 Suppose 17y - 208 = -72. Solve -32 = -yi - 0 for i. 4 Suppose 35k - 135 - 215 = 0. Solve h + kh = -22 for h. -2 Let i(s) = s - 3. Let o be i(3). Let g(r) = 4r3 + r2 - 3r + 1. Let c be g(1). Suppose 0 = 5d + cy - 54, -2d + y + 17 = 2. Solve -3n + d = -on for n. 3 Suppose -13t = 2t. Solve q + q - 4 = t for q. 2 Let v(i) = -i*3 - 25i*2 + i + 34. Let x be v(-25). Let u be (-2)/((6/x)/(2/(-3))). Solve m = -1 + u for m. 1 Suppose -3g = -5g. Suppose -5h = -3n + 5, -2n + 10 = 5h + 15. Solve -2c + nc + 6 = g for c. 3 Suppose -5g = -25, 13 = 18j - 20j + 5g. Solve jp + 50 = 20 for p. -5 Let d be (-7 + 4)(-5)/3. Suppose 0 = -3o + o - c + 39, 5c = -2o + 59. Let z be 0 - 3/(-3)o. Solve -4l = z - d for l. -3 Let k = 1 - -1. Suppose 0m = 2m + 3w - 13, -km = 4w - 16. Solve -8 = -ma - 2a for a. 2 Let l = 1333 + -1326. Solve -n = -ln + 24 for n. 4 Suppose 16 = 4j - 4. Let a = 7 - j. Suppose 0 = 3t - 7 - a. Solve th = h for h. 0 Let z = -91 + 95. Suppose -2i + 3i - 19 = 0. Suppose 4b - i = 41. Solve zj + 3 = b for j. 3 Suppose -13s = 22s - 630. Solve -s + 14 = -2j for j. 2 Let x(o) = 3o - 1. Let f be x(1). Suppose -4k + 3g = -f, 9 + 1 = k + 4g. Solve 0u - ku = -2 for u. 1 Suppose 454 + 586 = 52w. Solve 8y + w = -12y for y. -1 Let m = -1959 - -1990. Solve -4j - m + 19 = 0 for j. -3 Suppose 15 = -3d + 8d. Let u be 15/(-12) - (-27)/(-36). Let g be ((-3)/u)/(12/32). Solve 2a - da - g = 0 for a. -4 Suppose -t + i + 13 = 0, 2t + 6i - 16 = 3i. Solve -4b - t - 9 = 0 for b. -5 Let i(q) = -6q - 31. Let p be i(-13). Solve po + 8 = 43o for o. -2 Let c(v) = v3 - 5v*2 + 5v - 21. Let b be c(5). Solve bh + 27 = 7 for h. -5 Let d be 2-2(-3)/4. Let z(v) = 2v*2 - 4v + 3. Let a be z(d). Solve 0j = -3j + a for j. 3 Let k = 354 + -354. Solve kt + 2t = 6 for t. 3 Let m(n) = -n*2 - 13n + 0n2 - 24 - 2n. Let o be m(-13). Solve of - 1 = 5 for f. 3 Suppose 3p - 7p = 20. Let y = 5 + p. Solve -2 = -yu - u for u. 2 Let r be ((-3)/2)/(18/(-192)). Let z = -9 + r. Let k = z + -5. Solve 0 = kp + 8 - 4 for p. -2 Suppose 4h - 8h - 12 = 0, -4t = -4h - 44. Suppose 4r = 5u - 32, 2 = 2r + t. Solve 0 = -0o + uo + 16 for o. -4 Suppose -5h = -h - 8. Suppose -5b - 4y = -0b + 18, -2y - 4 = 0. Let v be 4 - (-1 - 6/b). Solve 4q - h = v for q. 1 Let j be 56/6(-6)/4. Let m = j + 18. Suppose i + 9 = mi. Solve -it + 2t = -2 for t. 2 Let t = -124 - -133. Suppose -30 = -4c - c. Solve -t = -5r + c for r. 3 Suppose 11o + 1 = 1167. Solve oa = 111a for a. 0 Let w be -2 + (-44 + -2)-1. Suppose 5d - 149 = -w. Let l = -433 + 433. Solve -5m + d - 6 = l for m. 3 Let l = -12 - -47. Suppose 5 = -3x + l. Let t be (24/x)/((-2)/(-5)). Solve 3q + t = -0 for q. -2 Suppose t - 13 = -w + 22, 2t + 50 = 2w. Suppose wx + 12 = 32x. Suppose x = g + 1. Solve g = -3m + 14 for m. 3 Let m(u) = u3 - 7u*2 + u - 5. Suppose 2w - 21 = -3p, p + 4w - 14 = -p. Let r be m(p). Solve -2 = ri - i for i. -2 Suppose -16 = -3n + 2k, 6n = 2n + 5k + 26. Solve 76r - 72r + n = 0 for r. -1 Let f(j) = 6j - 18. Let a be f(7). Suppose 2x + x - 8 = -5m, a = 3m - 3x. Solve 3 = h - mh for h. -1 Let t = 9 - 30. Let o = t + 41. Solve o = -v + 5v for v. 5 Let j = -3143 - -3149. Solve ja = a for a. 0 Suppose 4a + 4t - 41 = -9, -28 = -3a - 4t. Solve -ao + 4 = 4 for o. 0 Let c(o) = -19o3 + o2 - 1. Let a be c(-1). Solve 4j + 7 = a for j. 3 Suppose -5r - 10j = -8j - 23, 6 = -6j. Solve 0 = rb - 6b for b. 0 Let n = 171 + -171. Let g = -2 - -14. Suppose t - 4t - 3a = g, -4a - 20 = 0. Solve z + n + t = 0 for z. -1 Let j(s) = 208s - 821. Let u be j(4). Solve -16w = 53 + u for w. -4 Suppose 221 = 11n + 34. Solve n = 3u + 11 for u. 2 Suppose 3*d = -j + 16 - 2, -	{ "pile_set_name": "DM Mathematics" }
t z(b) be the first derivative of 1/3b3 - 2 + 3b + qb2. Determine z(-4). 7 Let b be 2 - (-3)/((-9)/(-3)). Let z be b17/(-3). Let s(d) = -7d + 14. Let g(p) = -2p + 1. Let w(y) = -4g(y) + s(y). What is w(z)? 3 Let a(z) = -z + 23. Let n(r) = r*2 + 28r + 45. Let v be n(-27). Calculate a(v). 5 Let x(r) = -2 - 5 - r - 1. Let y(o) = -2o - 2. Let f be y(-6). Let k be (54/(-45))/(2/f). Determine x(k). -2 Let m be ((-1)/(12/20) - -2)3. Let y be m4(-6)/4. Let l(s) = -2s - 6. Determine l(y). 6 Let q(r) = -r3 + 7r*2 - 7r + 1. Suppose 0 = 5d + 2j - 31, -2d - 4j + 29 = 7. What is q(d)? 16 Let c be -2(-1 - (-15)/10). Let b be (3c)/((-5)/(-5)). Let j(q) be the first derivative of -q*4/4 - 4q3/3 - q2/2 + q + 3. What is j(b)? -5 Suppose 5c + c - 6 = 0. Let p(z) = -z - c - 8 + 1 + 1. Suppose -12 = -0b + 2b. What is p(b)? -1 Suppose 37 + 44 = -27u. Let w(t) = -t*3 - 5t*2 - 2t - 1. What is w(u)? -13 Let k(b) = -4b. Let j be -55/(-50)(2 - 4). Let m be j - (-5 + -1)/(32/16). Determine k(m). -8 Suppose 9 + 19 = 5y - x, 0 = -3y + 3x + 24. Let f(l) = 0 + 4l3 - 6l*2 + 5 - 8 + 3l - 3l3. Determine f(y). -13 Let p(r) = r3 + r2 + 10. Let w be p(0). Suppose -u = u - w. Let x(s) = -20s + 6s2 - s3 - 7s + 5 + 35s - 13s. What is x(u)? 5 Let y(s) be the first derivative of 2s3/3 + 11s*2/2 + 10s + 118. Determine y(-7). 31 Let n be 4/1 - 7 - -8. Let v(i) = -i*3 + 3i*2 + 14i - 11. Calculate v(n). 9 Let x(r) = r*2 + 17r + 6. Let u(j) = 2j2 + 29j + 11. Let t(d) = -3u(d) + 5x(d). Calculate t(-3). -6 Let z = -1809 - -1803. Let p(m) = -m*2 + 2m + 2. What is p(z)? -46 Let i(j) be the first derivative of -j*4/4 - 20j*3/3 - 19j*2/2 - 5j - 134. Calculate i(-19). -5 Let p(n) = -n*3 - 4n*2 + 4n - 10. Suppose -75h - 389 = -14. Give p(h). -5 Let r(c) = 5c*3 + 20c*2 - 4c - 16. Let n(f) = f*3 + 4f*2 - f - 3. Let q(j) = 11n(j) - 2r(j). What is q(-5)? -11 Let o = 326 + -316. Let n(m) = 2m - 22. Calculate n(o). -2 Suppose -5n - 21 = -12n. Let c be ((-8)/12)/(-1)n. Let o(u) = u3 - u2 - u. Determine o(c). 2 Let q(y) = -y2 - 7y + 91. Let c be q(-13). Let j(p) = p*3 - 12p*2 - 14p + 17. What is j(c)? 4 Let x(k) be the first derivative of 3k2 - 14k - 11. Let v be x(3). Let r(d) = -d + 1. Determine r(v). -3 Let f(s) = 1 - 45s2 - 41s*2 + 2s + 85s2. Calculate f(2). 1 Let o(n) = n + 48. Let b(p) = -p2 - 6p + 40. Let s be b(-10). Calculate o(s). 48 Suppose 5k = 3i - 17, -4k + 4i = 6i - 4. Let s(f) be the first derivative of f2 - f + 117. Calculate s(k). -3 Let h(k) = -k - 1. Let q = 217 - 209. What is h(q)? -9 Suppose 4u - 4d + 32 = 0, -34u = -35u - 2d + 1. Let v(s) = -s*2 + 5s + 6. Determine v(u). -44 Let b(x) = -32x2 + x + 2. Let o(i) = 3i*2 + 24i - 28. Let c be o(-9). What is b(c)? -31 Let d(y) = 2y + 29. Let p(n) = n + 14. Let m(i) = -2d(i) + 5p(i). Suppose 19 + 30 = -7q. Determine m(q). 5 Let k(o) be the third derivative of o6/120 + o4/8 - o*3/2 + 275o2. Determine k(2). 11 Let c(v) = v + 22. Let f(o) = -o3 - 13o2 + 16o + 11. Let t be f(-14). Give c(t). 5 Let x(v) be the first derivative of -v*3/3 + 11v*2/2 - 2v + 15. Calculate x(10). 8 Let s(h) be the first derivative of 5/3h3 - 2h - 1/4h4 - 9 + h2. Determine s(5). 8 Let y(v) = -v2 + 4v - 1. Let z be y(2). Let t(o) = -2o - 5o*2 + 2o2 + 1 - oz + 4o2. Suppose 19 = -n - 4d, 5n = -2d - 2 - 3. Calculate t(n). -1 Let m(h) = h*3 + 5h*2 + 6h + 5. Let y be m(-3). Let t(x) = 8 - 4 - x*2 - yx - 4. Determine t(-5). 0 Let c(p) = 2p - 4. Let a(b) = 5b - 13. Let h(x) = -3a(x) + 8c(x). Suppose 0j + 2j = -36. Let v = j + 15. Calculate h(v). 4 Let r = -1 + 4. Let w(j) be the first derivative of j*4/4 - 2j3/3 + j2 - 3j + 1. What is w(r)? 12 Let z(w) be the third derivative of -w6/120 + w5/15 + w4/12 + w3/6 + 3w*2. Determine z(4). 9 Let r(w) be the first derivative of -10w3/3 + w2/2 + w - 27. Let x = 1 + -2. Give r(x). -10 Suppose 5y - 64 = 9y. Let p = y - -20. Suppose p = -4i - 16. Let l(r) = r2 + 3r + 2. Give l(i). 12 Let u(i) = -i*2 + 2i. Suppose 3f + k + 10 = 0, 0f + 3k + 16 = -2f. What is u(f)? -8 Suppose -4u + 2 + 2 = 0, -4y - 5u = -13. Let q(p) = 0 + p3 - 4p*2 + 3 + 4p*2 - 3p. What is q(y)? 5 Let a(b) = -4b + 2. Let x(h) = 3h - 1. Let s(v) = 2a(v) + 3x(v). Let f(w) = 5w + 11. Let y(k) = f(k) - 4s(k). What is y(-7)? 0 Let z(t) be the third derivative of -t6/120 + t5/60 + t*4/6 - 462t*2. Determine z(2). 4 Let h(b) = 2b - 7. Let t(z) = -z + 4. Let d(w) = -6h(w) - 10t(w). Let l = 33 - 35. Let k = 7 + l. Calculate d(k). -8 Let h(r) be the second derivative of -r*3/2 - 11r*2/2 - 30r - 3. Give h(-9). 16 Suppose -2v + 2 = -8. Suppose -4h + v = 5r - 7, 5h = 4r - 26. Let i(p) = p3 - 2p*2 - 2p - 3. Give i(r). 21 Let f = -50 + 41. Let w(c) = -2c3 - 25c*2 - 11c - 23. Let j(h) = h*3 + 12h*2 + 5h + 11. Let a(u) = fj(u) - 4w(u). What is a(-8)? 1 Suppose -5q = 4 - 19. Suppose -qh - h = -12. Let c(m) = 3m + 8m2 - 17 + 21 - mh - 11m. Calculate c(7). -3 Let v be (2 - 0)3-1. Let x be 4/(-8)v + 2. Let a(k) = -1 + 0k + k2 + 2k - xk2. Determine a(1). -3 Let f(k) be the third derivative of 13k*4/24 - 15k*2 - 3k. What is f(-1)? -13 Let s be (0 + -3)/((-6)/14). Let d(b) = 1 - sb + 6b + b + 9b. Calculate d(-1). -8 Let b(u) = -10u3 - u2 + u + 1. Let g = -4 + 15. Suppose g - 31 = -4j. Suppose jc - 15 = -5h, -3h + 1 = -c + 8. Determine b(h). 9 Suppose h + 41 = 5g, 3g + 5h = 75 - 28. Let q(v) = v2 - 5v - 10. Determine q(g). 26 Let g(p) = -4p3 + 48p*2 + 21p - 29. Let z(m) = -m*3 + 16m*2 + 8m - 10. Let h(f) = 2g(f) - 7z(f). What is h(-15)? -3 Let o(m) = -6m2 - 4 - 15m + 5m + 7m*2. Determine o(8). -20 Let k(x) be the second derivative of 0x*4 - x + 0x*3 + 0 - 11/60x*5 - 5/2x*2. Let t(h) be the first derivative of k(h). Give t(1). -11 Let l(s) = 3s - 5s + 3s + 7 + 0. Determine l(-9). -2 Let s(y) = 32y3 - 2y*2 + y. Suppose -3 = 3t - 3l, 5t - 3l - 13 = -7l. Determine s(t). 31 Let o(y) = -y*2 + 3y + 4. Let k be -1 + -38 + 6 + -3. Let t = -33 - k. Give o(t). 4 Let b = -1969 - -1950. Let p(n) = n*3 + 20n*2 + 16n - 49. Give p(b). 8 Let v(w) = w*3 + 2w*2 - 2. Suppose 17 = 4j - 11. Suppose 0 = -5k + j + 3. Give v(k). 14 Let r(p) be the second derivative of p4/6 + p3/3 + 7p*2 - 710p. What is r(0)? 14 Suppose -5z - 26 = 4. Let b = 10 + z. Suppose 3m - 5m + 8 = -4n, -bn - 4m - 20 = 0. Let q(j) = j3 + j2 - 2j - 3. Give q(n). -15 Let m(n) be the third derivative of -n4/24 - n3/3 + 14n*2. Suppose -3l = -4 + 28. What is m(l)? 6 Let t be (-12)/(-2 + 7/((-35)/(-20))). Let p(i) = -i*2 - 7i - 7. Give p(t). -1 Let y(m) be the second derivative of 2m2 - 3m + 0 + 1/6m3. What is y(-3)? 1 Let h = 53 + -100. Let b = h + 41. Let d(z) = z + 6. Give d(b). 0 Let r = -221 + 217. Let z(g) = -3g*2 - 12g - 10. Calculate z(r). -10 Let r(n) be the second derivative of -n*3/6 - 12n*2 + 7n + 29. What is r(-9)? -15 Let g(q) be the first derivative of q*4/4 + 2q*3 + 7q*2/2 - 2q + 35. Give g(-5). -12 Suppose -2i - 2i + 4q = -20, 0 = -i - 2q + 5. Suppose -iu = -c + 34, c + 19 = -3u + 3c. Let s(g) = g3 + 6g*2 - 6g + 8. Calculate s(u). 1 Let o(n) be the third derivative of -n*5/60 - 5n*4/24 - 5n*3/6 - 14n2. What is o(-3)? 1 Let k(w) = w3 + 5w2 + 3w - 5. Suppose -10 = -2q + q. Suppose 0 = -14a + qa - 16. Determine k(a). -1 Let f(m) = 6m*3 - 9m*2 - 8m + 9. Let l(z) = -5z3 + 8z*2 + 7z - 8. Let b(s) = 4f(s) + 5l(s). Suppose 16 = v + 4q, 3q - 2q + 9 = 3v. Give b(v). 8 Let w(b) = b + 7. Suppose 4s = -12, 4s = -5a - 2 - 0. Suppose -az - 2 = -12. What is w(z)? 12 Let b(j) = -j*3 - 6j*2 - 3j + 3. Suppose -6 - 34 = 8s. Determine b(s). -7 Suppose 20 = -10z + 30. Let a(q) = -18q3 - q2 - q + 1. What is a(z)? -19 Let u(y) = y2 - 12y + 20. Suppose -4j = x - 32, 4j + 60x - 61x = 40. Calculate u(j). -7 Let d = 32 + -34. Let n be (3 + -2)d/(-2)-1. Let k(t) = 2t + 10t*2 - 3t - 3t2. What is k(n)? 8 Let b(t) = t3 - 4t*2 + 3t + 2. Let s(g) be	{ "pile_set_name": "DM Mathematics" }
180 - m*5/120 - 9m4/8 + m3/6 - 8m. Let d(c) be the second derivative of h(c). What is the tens digit of d(8)? 9 Suppose 5h + 121 = -104. Let c be 18/h - 734/(-10). Let i = -50 + c. What is the tens digit of i? 2 Suppose 32v - 65040 = 2v. What is the units digit of v? 8 What is the tens digit of 1/((-4)/8) + 5/((-15)/(-35961))? 8 Let w(p) be the third derivative of 17p4/6 + 4p*3/3 - 18p2. Let m(r) = r3 - 11r2 - 2r + 24. Let u be m(11). What is the hundreds digit of w(u)? 1 Let r be (-2)/(-8) + (-1761)/(-12). Let h be (-304)/16(-20 + 1) + (-6 - -6). Suppose c + y + h = 6c, -2c + r = -3y. What is the tens digit of c? 7 Suppose -d + p + 13 = 4, 40 = 5d - 4p. Suppose 5b = 4t + 31, -9 = db - 3t - 34. Suppose -bw = -100 - 5. What is the units digit of w? 5 Suppose 0 = 2j - 10g + 8g - 5630, 4j - 11270 = 2g. What is the thousands digit of (7 + 180/(-24))/((-1)/j)? 1 What is the units digit of (1 - (-3)/(-2))(-2 + 20206)-1? 2 Let o be (5 - 2)-11 + (6 - 9). Let f = o + 286. What is the units digit of f? 0 Let m(r) = 2r*2 - 50r + 69. Let c(l) = 25l + 159. Let s be c(-5). What is the hundreds digit of m(s)? 6 Let g = 40 + 74. Let b = g - 6. Suppose 3n - 3z = b, 2z - 25 = -3z. What is the units digit of n? 1 Let j = -647 + 204. Let k = j + 870. What is the tens digit of k? 2 Let x(i) = -5i + 9. Let j be x(-9). Let c = 368 - 368. Suppose 0 = 3n - cn - j. What is the units digit of n? 8 Suppose -20083 = -4k + 16n - 13n, -5n + 20107 = 4k. What is the tens digit of k? 2 What is the thousands digit of 20361/(-6)(-7 + 1 + 3 + 1)? 6 Suppose 264g - 274g = -21480. What is the tens digit of g? 4 Suppose 1596l - 1593l = 3a + 55020, 0 = l - 2a - 18342. What is the tens digit of l? 3 Suppose 0 = -h + 2h + h. Suppose -4j + 4s - 9s + 2021 = h, -5j - 4s + 2524 = 0. What is the hundreds digit of j? 5 Let w be 4926/34 + 34/289. Let h = w + 269. What is the tens digit of h? 1 Let h(k) = -8k3 + k2 - 2k + 2. Let g be h(1). Let l be g/(((-15)/24)/5). Let q = -29 + l. What is the units digit of q? 7 Suppose 3m = 5p + 237, -61 - 54 = 3p + 5m. Let n = 1240 + p. What is the units digit of n? 5 Suppose -4g + 24186 = -2i - 3626, 4i - 6980 = -g. What is the tens digit of g? 5 Let h(a) = -2a*2 - 5a - 2. Let r be h(-3). Let b(p) be the first derivative of -p*4/2 - 7p*3/3 - 5p*2/2 + 4p + 1696. What is the tens digit of b(r)? 0 Suppose 254k - 80638 = 231k. What is the units digit of k? 6 Suppose 26 = 4o + r, -o + 4r + 36 = 3o. Suppose 0 = -5u - 5c + 55, -4u + 2u + o = -3c. What is the tens digit of 144 + (-14)/56 + (-30)/u? 4 Suppose 2x = 3q + 12640, -3q - 41 = -47. What is the thousands digit of x? 6 Let h = 23792 + -11894. What is the hundreds digit of h? 8 Let h(f) = f3 - 6f*2 - 6f - 38. Let v be h(10). Suppose vy + 40 = 297y. What is the units digit of y/(-12)138 + 2 + -4? 0 Let r(o) = -o - 12. Let h be r(-14). Let q(w) = h - 1 + 57w + 96w - 16w. What is the units digit of q(1)? 8 Let f(g) be the third derivative of -1/120g6 + 0 - 21g*2 + 0g - 1/24g4 - 1/30g*5 - 1/6g*3. What is the units digit of f(-2)? 1 Let m be 9 + -1(17 + -8). Suppose m = 5g + f - 1045, -2f + 836 = 4g - 7f. What is the hundreds digit of g? 2 Suppose m = 2h + 3m - 616, h - m = 318. Suppose r - 4u - h = 0, 15r - 4u - 1517 = 10r. What is the tens digit of r? 0 Let v(n) = n*2 + 2n + 15. Suppose -8 = 11x - 13x. Let o = -11 + x. What is the tens digit of v(o)? 5 Let h be (-3)/(-8)4(-14928)/(-36). Let n = h - 215. What is the units digit of n? 7 Let z be (-2)/(-8) - (-14)/8. Suppose -20 = -zy - 2y. Suppose yo + 24 - 69 = 0. What is the units digit of o? 9 Let r = 2255 - 748. Suppose m - 4n = r, 2m + n - 2978 = -0m. What is the tens digit of m? 9 Let n(i) = -i*3 - 11i*2 + 17i - 55. Let t be n(-14). Suppose 126x - 130x = 28. What is the tens digit of x + 5 - (3 - t)? 9 Let u(s) = 17422s2 - 23s + 24. What is the hundreds digit of u(1)? 4 Let w(d) = 3d3 - 23d*2 + 38d - 237. What is the ten thousands digit of w(31)? 6 Suppose -14l + 8l - 12 = 0. Let u be 4/l((-36)/8 - -3). Suppose -5x = -3o + 290, 0x = -uo + 3x + 282. What is the tens digit of o? 9 Suppose 7o + 40 = 5v + 2o, 9 = -3o. Suppose 2t + 5 = vy + 4t, 2y + 22 = 4t. What is the tens digit of 178y/5(-20)/8? 8 Suppose 4p + d = 179994, 22p = 20p - 7d + 89984. What is the ten thousands digit of p? 4 Let w(l) be the first derivative of 7l*2/2 - 5l + 81. Let x(a) = 2a2 - 4a + 3. Let u be x(2). What is the tens digit of w(u)? 1 Let k(q) = -q*2 - 2q + 1. Let y be k(-3). Let n be 135/21 + (-2)/(-6). What is the units digit of n/(y/5 + 148/360)? 0 Let v(n) = -2n*2 + 24n - 5. Let x be v(12). Let c(i) = -61i + 17. What is the units digit of c(x)? 2 What is the tens digit of (42/5)/((-7)/(-3710))? 5 Let i = 191 - 762. Let l = 1000 + i. What is the units digit of l? 9 Suppose -s = 4f - 41, -s + 1 - 4 = 0. What is the units digit of 2/(-11) - (-19945)/f? 3 Let s(t) = 2t3 - t + 1. Let o(z) = 37z*3 + 4z*2 - 4z + 8. Let d(g) = -o(g) + 4s(g). What is the units digit of d(-3)? 3 Suppose -5m = -3b - 812, 4m - 3b = 92 + 560. Suppose -3j + 200 + m = 0. What is the tens digit of j? 2 Let v(q) = -q - 2. Let t be v(-2). Let y be 6/(36/110) - (7/3 + -2). Suppose t = a - 14 - y. What is the units digit of a? 2 Let y = 11425 - -4124. What is the tens digit of y? 4 Let q(j) = -6j - 7. Let t be q(-4). Let y = t - 17. Suppose h + yp = -3p + 22, 4h + 5p = 123. What is the units digit of h? 7 Let c(i) be the second derivative of i3/6 + 111i*2/2 + 4i. Let j = 202 - 202. What is the hundreds digit of c(j)? 1 Let i = 424 - -6788. What is the units digit of i? 2 Let a = -2322 + 3264. Suppose -11n + 5n + a = 0. What is the tens digit of n? 5 Let i be (-22)/(-121) - (90/11 + -2). Let x be ((-879)/i)/(2/(-4)). Let g = 479 + x. What is the units digit of g? 6 Suppose m = -h + 3661, -7h = -8h + m + 3669. What is the thousands digit of h? 3 Let h = 546 - 545. Let p(m) = -m*3 + 5m*2 + 3m - 9. Let f be p(6). What is the tens digit of (-1)/(h/4) - f? 2 Let z(y) = -5y2 - 265y + 411. Let b(u) = u*2 + 53u - 82. Let x(v) = -11b(v) - 2z(v). What is the tens digit of x(-32)? 5 Suppose -7h - 606 = -4h. Let p = -136 - h. What is the units digit of p? 6 Suppose -30 + 18 = 4z, -2a - 2z + 9164 = 0. What is the thousands digit of a? 4 Suppose 6v - 79 + 43 = 0. What is the units digit of 11630/20 + v/(-4)? 0 Suppose -2762x + 2581800 = -2662x. What is the ten thousands digit of x? 2 Let o = -88024 + 127495. What is the thousands digit of o? 9 Suppose -10q = -5q + 5h + 20, -h + 10 = -q. What is the units digit of (-189)/((-49)/q)94/(-2)? 9 Suppose 2860 = -67n + 72n. Let g = 109 + n. What is the hundreds digit of g? 6 What is the tens digit of -6817(4/(-6))/(228/18 + -12)? 1 Suppose 31q - 3264376 = -32q - 43q. What is the tens digit of q? 9 Let t(c) = -3c + 9. Let d be t(10). Let u = d + 26. Suppose ur - 100 = 5. What is the units digit of r? 1 Let d(a) = -281a - 1910. What is the thousands digit of d(-73)? 8 Let w = -492 - -495. Suppose r = wu - 3293, 3r = -u + 1120 - 39. What is the thousands digit of u? 1 Let p(s) = -s2 - 3s - 2. Let o(a) = a*2 + 8a + 10. Let c be o(-6). Let w be p(c). Suppose -3x + 6 = 18, w = -g - 5x + 28. What is the tens digit of g? 4 Suppose 0 = -5h - 28i + 25i + 125006, 5h - i - 124998 = 0. What is the ten thousands digit of h? 2 Suppose 0 = -5i + 449 - 89. Suppose i = 2q + 7q. Suppose -qj = -3j - 475. What is the units digit of j? 5 Let a = 592 + -216. What is the hundreds digit of a + (-2 + 3)/(-11)? 3 Let t = -41 - -43. Suppose -10m = -tm - 72. What is the units digit of 9912/m + 4? 6 Let y = 157 + -79. Suppose -5n + y = -22. What is the hundreds digit of (-16)/4(-725)/n? 1 What is the thousands digit of 100302/16 + 1161/72 + -16? 6 Let j = 432 - 438. What is the hundreds digit of (-23 - -38)(-64)/j? 1 Let c = 3650 + -1594. What is the units digit of c? 6 Let f(d) = 4190d2 + 54d + 86. What is the units digit of f(4)? 2 Let m = -53 - -46. Let b(n) = 9n2 - 6n - 4. What is the units digit of b(m)? 9 Let s	{ "pile_set_name": "DM Mathematics" }
2098 in descending order. 2098, 5, 0 Put -5, 2/7, 53/14, 0.01, 3/2 in descending order. 53/14, 3/2, 2/7, 0.01, -5 Sort -0.5, 0, -322, 56/5 in ascending order. -322, -0.5, 0, 56/5 Sort -4, -1, -2532, 2, 3, -5 in descending order. 3, 2, -1, -4, -5, -2532 Put -42, -3, 2, -2, -25 in decreasing order. 2, -2, -3, -25, -42 Put 4, 9831, 2/91 in descending order. 9831, 4, 2/91 Sort 1, -390, 5, -39. -390, -39, 1, 5 Sort -19169, -2, 2 in descending order. 2, -2, -19169 Sort 2, -3, -5, -27, -1 in decreasing order. 2, -1, -3, -5, -27 Sort 64, 3/5, -0.3, 0.1, -8 in descending order. 64, 3/5, 0.1, -0.3, -8 Put 2.41, 4, 0.3, 391, 0 in decreasing order. 391, 4, 2.41, 0.3, 0 Put -4/19, 3/16, 5, -2, 32 in descending order. 32, 5, 3/16, -4/19, -2 Put -3, 15, 18521 in ascending order. -3, 15, 18521 Sort 9, -119/4, -2, -4, 1/3, 4 in increasing order. -119/4, -4, -2, 1/3, 4, 9 Sort 2, 13/564, -0.4 in increasing order. -0.4, 13/564, 2 Sort 183, -6, -1 in decreasing order. 183, -1, -6 Sort 77, 31, 3, -1, -2 in ascending order. -2, -1, 3, 31, 77 Put 2, 6, 0, 171/5 in decreasing order. 171/5, 6, 2, 0 Sort 5, -5, -2, 3, 2922 in descending order. 2922, 5, 3, -2, -5 Put -9/35, -1/3, 1.7, 1/4, 0.4 in increasing order. -1/3, -9/35, 1/4, 0.4, 1.7 Put 5, 2/5, -203, 89 in decreasing order. 89, 5, 2/5, -203 Sort -4, 1/12, -2/7, -8, -5, -2. -8, -5, -4, -2, -2/7, 1/12 Put 210, 1, 8/15 in descending order. 210, 1, 8/15 Sort 2.8, 1, -924 in descending order. 2.8, 1, -924 Sort 0.0791, -6/11, 1, 0.3. -6/11, 0.0791, 0.3, 1 Sort -104/113, 0.8, 0.5 in descending order. 0.8, 0.5, -104/113 Sort -2/159, 0, 524. -2/159, 0, 524 Sort -404, -21, 3, 1, 2 in descending order. 3, 2, 1, -21, -404 Sort 2, 43, -2, -4, -15 in increasing order. -15, -4, -2, 2, 43 Sort 353537, 0, -2. -2, 0, 353537 Sort 4, 3, -98, -2, 5. -98, -2, 3, 4, 5 Put -548, -131, -2 in descending order. -2, -131, -548 Sort 1.3, -6, 5, 1/8, -2/17. -6, -2/17, 1/8, 1.3, 5 Put 5, 2, -5, 3, 60, 208 in increasing order. -5, 2, 3, 5, 60, 208 Put 35, -17, 4, -209, -2 in ascending order. -209, -17, -2, 4, 35 Sort 8023, 2/11, 2/25, 0.5 in increasing order. 2/25, 2/11, 0.5, 8023 Put -4, 0.07, -1/4, 208 in descending order. 208, 0.07, -1/4, -4 Sort 2/11, -1115, -4, -1. -1115, -4, -1, 2/11 Sort 2/9, 157476, -2 in decreasing order. 157476, 2/9, -2 Sort 1, 433, 10, 0, 5, 6 in ascending order. 0, 1, 5, 6, 10, 433 Sort 7, -29, 23, 0, -3, 1. -29, -3, 0, 1, 7, 23 Sort -0.08, -221, -0.2, -11 in ascending order. -221, -11, -0.2, -0.08 Sort 0, -5000, 5, 4, -3. -5000, -3, 0, 4, 5 Sort 11, -2, -66, -3, 4, -5 in decreasing order. 11, 4, -2, -3, -5, -66 Put 2, 3.19, -40 in descending order. 3.19, 2, -40 Put -6, -38934, -1/5 in ascending order. -38934, -6, -1/5 Put -1, 0.05, 0.3, -0.24, -1/3 in ascending order. -1, -1/3, -0.24, 0.05, 0.3 Put -12, 80, 0 in descending order. 80, 0, -12 Put 5, -0.148, 2/5, -2/5, -0.2 in descending order. 5, 2/5, -0.148, -0.2, -2/5 Sort -3, 2, 76, -264 in decreasing order. 76, 2, -3, -264 Sort 5, -17, 3086, -4 in decreasing order. 3086, 5, -4, -17 Sort 6/7, 733/2, 0.7 in decreasing order. 733/2, 6/7, 0.7 Sort -2523, 1, -4, 5. -2523, -4, 1, 5 Sort -1/6, 10024, -0.2, 0, -0.4 in decreasing order. 10024, 0, -1/6, -0.2, -0.4 Put 19, 0, 13/6, 0.5, 0.06 in descending order. 19, 13/6, 0.5, 0.06, 0 Put 14, -0.5, 3, -1/6, 13/62 in descending order. 14, 3, 13/62, -1/6, -0.5 Sort -1, -7, -88, -18 in increasing order. -88, -18, -7, -1 Sort 0, 7199, 3, 12, -5 in descending order. 7199, 12, 3, 0, -5 Sort -5/3, -2640, 194 in descending order. 194, -5/3, -2640 Put 4/13, 0.1, 1/4, -16 in increasing order. -16, 0.1, 1/4, 4/13 Put -1, 11, 8, 1, -5, -13 in increasing order. -13, -5, -1, 1, 8, 11 Sort -1, -5, 1/2, 3, 367, 0 in descending order. 367, 3, 1/2, 0, -1, -5 Sort 9, -4, 303, 13, -1. -4, -1, 9, 13, 303 Put 2/13, 5407, -84 in ascending order. -84, 2/13, 5407 Sort -39, -2, 2, 3, -5. -39, -5, -2, 2, 3 Put -463, 23, 0, 2 in increasing order. -463, 0, 2, 23 Sort 0, -174, 1, -9, 71. -174, -9, 0, 1, 71 Put 102, 2, -1405 in descending order. 102, 2, -1405 Sort -512, -3, 4, 19, -2 in decreasing order. 19, 4, -2, -3, -512 Sort -3, -157226, -8 in ascending order. -157226, -8, -3 Sort 2, 0, -2/58459 in descending order. 2, 0, -2/58459 Sort 6, 1834, 0.1, -1/2. -1/2, 0.1, 6, 1834 Put 15388, 5, -45 in decreasing order. 15388, 5, -45 Sort 6/61, -3/4, -2/9, 12 in decreasing order. 12, 6/61, -2/9, -3/4 Put -140582, -6, -5 in ascending order. -140582, -6, -5 Sort -109, 7, 7/2 in increasing order. -109, 7/2, 7 Sort 2, 3, 273908. 2, 3, 273908 Sort -5, 4, -21, 3226 in decreasing order. 3226, 4, -5, -21 Sort 17, -1, -1091 in descending order. 17, -1, -1091 Sort 14, 203, -1/10. -1/10, 14, 203 Sort -0.41, -4/3, -0.5, -0.08, 16 in decreasing order. 16, -0.08, -0.41, -0.5, -4/3 Sort -5100, -27, -5 in descending order. -5, -27, -5100 Put 22, 3, -4, 6, 1 in increasing order. -4, 1, 3, 6, 22 Put 2, -562, -71 in descending order. 2, -71, -562 Sort 6, -2, 0, 3, 8 in increasing order. -2, 0, 3, 6, 8 Put 53.6, 0.3, 2/9, 3, -4 in decreasing order. 53.6, 3, 0.3, 2/9, -4 Put -0.2, -1/23, 2.7, 2 in ascending order. -0.2, -1/23, 2, 2.7 Sort -98, -29, -5, 4, 3, 8 in increasing order. -98, -29, -5, 3, 4, 8 Put -21, -374, 3, -5 in decreasing order. 3, -5, -21, -374 Put -1, 1, -272 in decreasing order. 1, -1, -272 Sort 4/33, -0.2, -964. -964, -0.2, 4/33 Sort -96, 3, -17, 6, -5 in decreasing order. 6, 3, -5, -17, -96 Sort -2296.8, -1, -2/31 in descending order. -2/31, -1, -2296.8 Sort 5, 3, 10, -1944. -1944, 3, 5, 10 Sort 115, -5, -2.44, -0.7 in decreasing order. 115, -0.7, -2.44, -5 Sort 6/11, -17, 4, -3, -5/2, 46 in descending order. 46, 4, 6/11, -5/2, -3, -17 Sort -7, -4, -18, 34 in increasing order. -18, -7, -4, 34 Put -1, 6, 4, 12, 3 in increasing order. -1, 3, 4, 6, 12 Sort 2, 3, 1, -4, -3273, 11 in descending order. 11, 3, 2, 1, -4, -3273 Sort 11, 0, 60, 8, 1. 0, 1, 8, 11, 60 Sort -3, 15, 39, -4, 2 in decreasing order. 39, 15, 2, -3, -4 Sort 3, 4, 0, 5, 14, -5 in increasing order. -5, 0, 3, 4, 5, 14 Put -20, -3, 5482 in ascending order. -20, -3, 5482 Sort 5, -5.1, -1, 0.18, 0.5 in decreasing order. 5, 0.5, 0.18, -1, -5.1 Sort 5, 3, 999, 2 in decreasing order. 999, 5, 3, 2 Put -139, 2/11, -1374, -4 in decreasing order. 2/11, -4, -139, -1374 Put 1, -276, -111, -1, -5 in descending order. 1, -1, -5, -111, -276 Sort 2, 2/13, -22/119, -5. -5, -22/119, 2/13, 2 Put 5, -3, -8, 2302, 0, 3 in increasing order. -8, -3, 0, 3, 5, 2302 Put -3, -7, 3, 4, 1924 in decreasing order. 1924, 4, 3, -3, -7 Sort 0.2, 0, -1/2, -3, 2285 in descending order. 2285, 0.2, 0, -1/2, -3 Sort -1, 264, 3, -7, -2 in ascending order. -7, -2, -1, 3, 264 Sort -1, -123, -38, -2, 4. -123, -38, -2, -1, 4 Sort 72, 0, 1.32, 1, -3/5 in ascending order. -3/5, 0, 1, 1.32, 72 Put -4, 21, -3/4, 0.3, 1/4, 2/9 in decreasing order. 21, 0.3, 1/4, 2/9, -3/4, -4 Sort -2, -1, -194, 5 in decreasing order. 5, -1, -2, -194 Sort -2, -3, -738, 4, -1 in decreasing order. 4, -1, -2, -3, -738 Put 13, -6, 3, -22, 4, 5 in descending order. 13, 5, 4, 3, -6, -22 Put -3, -132390, 2 in decreasing order. 2, -3, -132390 Sort -468, -1/49, 0.3, 1. -468, -1/49, 0.3, 1 Sort -20, 0, 7429 in descending order. 7429, 0, -20 Put 12, 13, 1, 277 in descending order. 277, 13, 12, 1 Sort 20, 4, -116, 1. -116, 1, 4, 20 Sort -0.2, -11/3, -6, -127, 4. -127, -6, -11/3, -0.2, 4 Put -2, -42, -13, 0, 1 in descending order. 1, 0, -2, -13, -42 Put -1033, -0.3, -1, -3, -27 in descending order. -0.3, -1, -3, -27, -1033 Sort -4, 0.3, -1359574 in decreasing order. 0.3, -4, -1359574 Sort 14, 3, 680. 3, 14, 680 Sort 0.2, -74/15, -2, -19, 1/3. -19, -74/15, -2, 0.2, 1/3 Sort 24, -15, -8 in descending order. 24, -8, -15 Put 715296, -2, 3 in decreasing order. 715296, 3, -2 Sort 63/5, 1, 0, 6/7, -5 in increasing order. -5, 0, 6/7, 1, 63/5 Put 11, -6080, -1.9 in ascending order. -6080, -1.9, 11 Put -4, -1, -3, -31, -2, 203 in descending order. 203, -1, -2, -3, -4, -31 Sort -2/9, -1.1, -49, -5, -4, 1/42 in increasing order. -49, -5, -4, -1.1, -2/9, 1/42 Sort 0.5, -1.12, -42.3 in ascending order. -42.3, -1.12, 0.5 Sort -1, 48, 42, -3, 1 in descending order. 48, 42, 1, -1, -3 Sort -1676, 3, 8 in descending order. 8, 3, -1676 Sort 5, 0.2, 2/5, 1/3, -24 in ascending order. -24, 0.2	{ "pile_set_name": "DM Mathematics" }
t g(n) = -n*3 + 6n*2 + 7n + 3. Let u(h) = 17 + h*3 - 4h*3 + 11h*2 + 11h - 2h3 + 6h*3. Let q be u(-10). What is g(q)? 3 Let y be 4/(-1) - (3 - 10). Let h be y/(-9) + (-80)/(-15). Suppose -2p + 2 = v - 2, 2p = -hv + 4. Let a(s) = 6s2 - 2s - 1. Determine a(p). 19 Let m(p) = -3p - 6. Let o(g) = -10g - 17. Let f(b) = -8m(b) + 3o(b). Let a(s) = 8s - 130. Let l be a(16). Determine f(l). 9 Suppose -527b + 531b - 20 = 0. Let x(j) = 3j - 1. Calculate x(b). 14 Let i(r) = 11r2 + r - 5. Let b(q) = 11q*2 + q - 7. Let u be 2/(-3)(-4 - (2 + 0)). Let v(x) = ui(x) - 3b(x). Give v(-1). 11 Let s(h) = h*3 - 14h*2 + 13h - 1. Let j = -333 - -346. Calculate s(j). -1 Suppose 3b - 4b + 4g = -10, -4g - 4 = -4b. Let t(z) = 10z - 1. Let y(x) = -7x + 1. Let j(k) = 5t(k) + 7y(k). Calculate j(b). 0 Let b(x) = x3 - 5 + 4x*2 - 4x - 4x + x. Suppose 5i + 3z = 18, 4i - z - 17 = -6. Suppose 0 = 3r - im + 6, 2r + 2 - 7 = 5m. Determine b(r). 5 Let u(m) = 4 + 2m + 0 + 7. Let l = -2141 + 2133. Calculate u(l). -5 Let z(j) = -132 - 6j + 2j - j2 + 0j*2 + 59 + 79. Give z(-6). -6 Let q(l) be the first derivative of 1/3l*3 - 3l - 3 + l*2. Let k be 3/(-2)8/(-6). Calculate q(k). 5 Let l(p) = 12p2 + 3p + 0p - 11p*2 - 7p - 3. Let z(b) = 2b2 - 9b + 14. Let j be z(2). Determine l(j). -3 Let l(g) = -10g - 18. Let j(r) = -13r - 22. Let f(n) = -4j(n) + 5l(n). Let q = 8 + -3. Determine f(q). 8 Let f(k) = k + 17. Let u(j) = 3j3 - 25j*2 - 18j - 12. Let y be u(9). Determine f(y). 5 Let q(z) be the third derivative of -z5/60 + z4/4 + 5z3/6 - 3z*2. Let g = -9 - -12. Suppose 21 = -0c + gc. Determine q(c). -2 Let f(t) = -t2 + t. Suppose 0 = -2k + 6k - 56. Let w be (4/(-6))/(k/(-21)). Let c(z) = z3 + z2 + z - 4. Let b(u) = wc(u) - 4f(u). Calculate b(-5). 11 Let b = -20 - -22. Let q = 10 - b. Let d(k) = -k2 + 7k + 7. Give d(q). -1 Let i be ((-4)/3)/(2/(-6)). Suppose -iv - 38 = 5z, -5v + z - 64 = -z. Let a be (-57)/(-18) - (-2)/v. Let y(g) = -2g*2 + 4g. What is y(a)? -6 Let p(w) = -w*2 + 5w + 7. Let r be p(6). Let b(v) = 1 - 5v2 + r + v + 7v*2 - 3v*2. Give b(4). -10 Let w = -8 - -12. Let o(p) = -2 + 4p - 7p + wp - 3p2 + 3 + p3. Let d be ((-28)/(-21))/(2/3). Calculate o(d). -1 Let t(z) = 3z*2 + 9z - 2. Let y be t(-4). Suppose -o = 3v + 11, o = 2v + y + 4. Let c(p) = -p*3 + 3p*2 + 4p + 5. Give c(o). 5 Let m(i) be the first derivative of i5/20 + i4/4 - i*3/6 - 2i - 1. Let t(b) be the first derivative of m(b). Suppose 31j = -5 - 88. Calculate t(j). 3 Suppose -14q - 13q - 270 = 0. Let d(u) = u3 + 9u*2 - 11u - 11. Calculate d(q). -1 Let j(t) = -t*2 - 13t - 38. Let p be j(-4). Let y(l) = -l*2 - 2l. What is y(p)? 0 Let w(z) = z*2. Let c be (-5 + 0)(-6)/15. Let b be (c + 0)/2(-72)/(-24). Calculate w(b). 9 Suppose 4b = -g, 44g - b + 15 = 48g. Let s(p) be the second derivative of p4/12 - p3 + 2p2 - p. Determine s(g). -4 Let r(a) = 2a. Let n(p) = p*3 - 28p*2 + 23. Let i be n(28). Suppose 5m = -2 - i. Give r(m). -10 Let y(m) = -13m - 70. Let r(t) = 48t + 279. Let g(b) = 4r(b) + 15y(b). Give g(20). 6 Suppose 3s - 36 = 5q, 0s - q = s - 4. Let y(n) = -7n*2 + 36n - 26. Let v(k) = 4k2 - 20k + 14. Let b(t) = 5v(t) + 3y(t). Determine b(s). -1 Let g = -4 + 5. Suppose -5a + g + 4 = 0. Let m(p) = 0 + 5p - p + 0 - a. Determine m(1). 3 Suppose 3w = 5w - 12. Let v(l) = -l*2 - 12l - 9. Let g(n) = -269n2 + 4 + 138n*2 + 13n + 5 + 132n2. Let b(t) = wv(t) + 5g(t). Calculate b(-6). -3 Let b be (-2)/(-5) + (-1696)/40. Let k be (-1)/(-7) + 342/b. Let y(i) = i + 11. What is y(k)? 3 Let l(c) = 3c*2 - 5c. Let p(b) = 2b2. Let a(u) = l(u) - 2p(u). Give a(-5). 0 Let g(y) = -y3 + y2 + y + 2. Let j(w) = -24w2 + 6w - 7. Let h be j(2). Let x = 91 + h. Determine g(x). 2 Let y(f) = -f*3 + 10f*2 + f - 8. Let r be y(10). Let o(t) = rt*2 - 4t*3 + 16t + 2 + 5t3 - 13t. Give o(-2). -4 Suppose 3r + 2r + 5 = 0, -g = r + 5. Let a(o) = -o*3 - 4o*2 - 4o - 5. Let n(x) = -2x3 - 9x*2 - 9x - 10. Let l(j) = gn(j) + 7a(j). Determine l(-7). -2 Let g = -64 + 103. Let f = 40 - g. Let o(a) = -10a3 + a - 1. Determine o(f). -10 Suppose -38o - 56 = -52o. Let n(u) = -4u + 12. What is n(o)? -4 Suppose 7 = -26t + 27t. Let w(k) = 0k2 + 13 + t - 19 - k + 2k*2. What is w(-2)? 11 Suppose 14 = -4r - 6. Let d(o) = -7o2 - 12o - 7. Let j(s) = 15s2 + 25s + 15. Let p(x) = -13d(x) - 6j(x). Determine p(r). -4 Let y(g) be the first derivative of -3/8g4 + 0g + 9 + 3g2 + 1/60g*5 + 4/3g*3. Let b(z) be the second derivative of y(z). Calculate b(6). -10 Let r be -1 - (-2 - -2 - 11). Suppose 2 = -2z + r. Let p(u) = 4u2 + 10u - 8. Let a(l) = 5l2 + 11l - 10. Let s(d) = 5a(d) - 6p(d). Determine s(z). -6 Let f be (-1)/(58/10 + -6). Let z(c) be the second derivative of -5/12c4 - 12c + 1/20cf + 1/2c*2 + 0 + 1/6c*3. Give z(5). 6 Let u = 57 - 56. Let n(z) = -3 + z + u + 2 + 2. Calculate n(-6). -4 Let m(s) = 7s - 1. Let j(i) = i + 37. Let y be j(-18). Suppose -y = 14d + 5d. Calculate m(d). -8 Let m(x) = -3x + 1. Let w be (-3 + 7)/2 - -2. Suppose 4t - 4 = -4i, wt + 4 = -3i + 6. Let k be i + 2 + -7 + 0. What is m(k)? 10 Let h(a) = -a2 - 6a. Suppose -7u - 8 = -5u. What is h(u)? 8 Let a(m) be the third derivative of m8/3360 + m7/2520 + m*4/6 + 4m*3/3 + 2m*2 - 8m. Let v(z) be the second derivative of a(z). Give v(1). 3 Let f(s) be the second derivative of -5s3/6 + 14s*2 + 195s. What is f(5)? 3 Let j = -284 - -178. Let l = 102 + j. Let o(h) be the third derivative of h5/60 + h4/12 - h3/2 - h2. Calculate o(l). 5 Let i(l) be the second derivative of -l*4/12 + 2l3/3 + l2 - 14l - 3. Suppose 2o - 17 = -7. What is i(o)? -3 Let b(m) = -6m2 - 3m*2 + m + 7m2. Let v(n) = n3 - 3n2 - 3n. Let i be v(4). Suppose -5u = ij - 6, -5u - 4j + 7j = -13. Determine b(u). -6 Let t = -59 + 53. Let k(x) = 3x + 11. Let r(b) = 2b + 10. Let i(w) = 3k(w) - 4r(w). Let n(f) = 6. Let z(y) = -2i(y) - 3n(y). Give z(t). 8 Let h(l) = l - 2. Suppose 15 + 75 = 5f. Suppose -2r = f - 14. What is h(r)? -4 Suppose 0 = -0b + 5b + 5. Let l = -6 - b. Let n(g) = -g2 - 2g + 1. Let p(c) = -c*3 - 9c*2 - 10c + 1. Let d(h) = -3n(h) + p(h). Calculate d(l). -7 Let m(c) be the second derivative of c3/6 - 2c*2 - 220c. Determine m(-4). -8 Suppose 2f - f = -1. Let n(i) = 15i3 - i2 + 3 + 8 - 10. Determine n(f). -15 Suppose -1101j + 1096j = 5. Let d(p) be the second derivative of p4/4 - p3/6 - p. Calculate d(j). 4 Let o(p) = 11p + 28. Let a(v) = -18v - 43. Let t(h) = -5a(h) - 8o(h). Give t(7). 5 Let k be 1 + (11 - (-245)/(-21)). Let y(p) be the third derivative of 1/4p4 - 1/60p*5 - kp3 - p2 + 0 + 0p. Give y(3). 7 Let x be 3/(-1) + 7 - 14. Let b be x-31/6. Let m(s) = s2 - 6s + 6. Give m(b). 1 Let m(y) = y*3 + 17y*2 + 18y + 17. Suppose -30p + 33p - u + 52 = 0, 0 = -p + 3u - 28. Calculate m(p). -15 Let b(l) = -l2 - 7l - 8. Let m(k) = 2k2 + 12k + 12. Let x(i) = 8b(i) + 5m(i). Calculate x(-4). 12 Let r = 23 + -61. Let w = r + 41. Let d(n) = -2n - 4. What is d(w)? -10 Let z(q) = -2q*2 + 4q - 5. Let r(n) = -6n - 50. Let i be r(-9). Calculate z(i). -21 Let m(p) = -p2 - 2. Let b = -112 - -112. Calculate m(b). -2 Let w(g) = 6g*2 - 12g + 17. Let o(z) = 7z2 - 14z + 20. Let s(l) = 5o(l) - 6w(l). Determine s(5). -17 Let a(z) = -14z + 2. Let d(t) = -4t. Let v(w) = a(w) - 3d(w). Give v(-5). 12 Suppose k + 3h = -0k + 9, -5k + h - 19 = 0. Let z(q) be the third derivative of -q4/12 - q3/3 + 76q2. What is z(k)? 4 Let d = -215519/120 - -1796. Let q(z) be the third derivative of -1/3z*4 + 8z*2 + 1/10z*5 + 2/3z*3 - dz*6 + 0 + 0z. Give q(5). -11 Let v(h) = h*3 - 6h*2 - 7h - 8. Let j(u) = -2u2 - 7u + 37. Let d be j(-6). Give v(d). -8 Suppose 3n - 6 = -0. Suppose 2k - 2 = -g, 3k = 5k + 2g - n. Let b(h) be the second derivative of h5/20 - h4/12 + h2/2 + 71h. Give b(k). 1 Let u(o) = 4o2 - 2o - 1. Let a be u(2). Suppose -2g - 5v + 6 = -a, g = -4v + 13. Let i(f) = 8f3 + f2 - 1. Wh	{ "pile_set_name": "DM Mathematics" }
o) = pa(o) + 12d(o). Determine t(w(y)). 9y4 Let f(z) = 6z*2. Let a(m) = -4m + 3m - 10m + 0m. Calculate a(f(o)). -66o2 Let q(u) = -u2. Let z(c) = -21c - 21. Let r(i) = -10i - 10. Let f(g) = -5r(g) + 2z(g). Determine q(f(d)). -64d2 - 128d - 64 Let q(y) = y*2. Let s(v) = -19084v. Give q(s(f)). 364199056f2 Let f(b) = 5b. Let q(a) = -4a - 6. Calculate q(f(r)). -20r - 6 Let a(i) = 225 - 225 - i*2. Let m(w) = -4w. Determine a(m(h)). -16h2 Let y(o) = -o2 + 2o*2 - 2o*2. Let i(q) = -2q + 8. Suppose 0 = -5g - 2 - 3. Let f(x) = -1. Let v(a) = gi(a) - 8f(a). Calculate y(v(z)). -4z2 Let f(u) = -u3 - 4u2 - 2u + 3. Let i be f(-3). Let r(c) = ic - c + 2c. Let k(d) be the second derivative of d*4/4 + 3d. Give k(r(t)). 3t2 Let v(p) = 4p*2 - 4p*2 - 3p2. Let d(j) be the third derivative of j6/360 + j3/3 - j2. Let x(t) be the first derivative of d(t). Calculate v(x(l)). -3l4 Let j(v) = 1102v. Let s(w) = -w. Calculate j(s(n)). -1102n Let r(i) = 2i*2 - 5i. Let s(a) = -9a2 + 24a. Let t(f) = -24r(f) - 5s(f). Let b(v) = -v*2. Calculate b(t(n)). -9n4 Let l(m) be the first derivative of m2/2 + 4. Let x(d) = 13d2. Calculate l(x(c)). 13c*2 Let b(k) = -9k*2. Let z(m) = -5m. Let l(o) = o. Let c(t) = 6l(t) + z(t). What is c(b(g))? -9g*2 Let k(b) = -67b - 3. Let s(j) = 6j. Give s(k(r)). -402r - 18 Let s(c) = -5c2. Let x(p) = -2p + p*2 - p + 3p. What is s(x(l))? -5l4 Let z(w) = 877w2. Let n(x) = x2. Determine z(n(t)). 877t4 Let w(z) = 2z*2. Let i(v) = -2v - 5. Let d(r) = r + 2. Let c(j) = 5d(j) + 2i(j). Determine w(c(l)). 2l2 Let g(y) = 5y - 7. Let u(b) = 5b2. What is g(u(h))? 25h2 - 7 Let z(k) be the second derivative of k4/12 + 4k. Let m(a) = 0 + 5a + 0. What is m(z(g))? 5g2 Let u(o) = 9o*2 - 8o. Let t(n) = -2n2. Calculate u(t(w)). 36w*4 + 16w*2 Let p(q) = 10349q*2. Let c(l) = 2l*2. Determine p(c(w)). 41396w*4 Let v(q) = 11q. Let l(g) = 82g - 1. What is v(l(t))? 902t - 11 Let q(a) = -3a. Suppose 0 = 7i - 8i + 2. Let r(c) be the second derivative of 0c*3 + 0 + 0c*i - 1/12c*4 - 3c. What is q(r(p))? 3p2 Let l(w) = -w. Let f(d) = d. Suppose 3 = 5m - 7. Let g(c) = ml(c) + 3f(c). Let a(y) = 2y2. Calculate a(g(b)). 2b*2 Let y(r) = -3r. Let p(b) = -8b2 + 2b*2 - 2b*2 - 4b*2. Determine y(p(i)). 36i*2 Let g(z) be the first derivative of -4z2 - 13. Let r(s) = -s2. Calculate r(g(q)). -64q2 Let k(l) = 2l. Let z = -20 + 12. Let w(v) = 3v2 + 8v. Let d(j) = -j*2 - 3j. Let n(y) = zd(y) - 3w(y). Give n(k(x)). -4x2 Let f(x) = 2 - 3 + 1 - 12x. Let v(u) = u*2. What is v(f(g))? 144g*2 Let z(j) = -2j*2. Let q(a) = -19a*2. Give q(z(r)). -76r*4 Let t(i) = -42i*2. Let j(n) = 108n*2 + n. What is j(t(f))? 190512f*4 - 42f*2 Let k(v) = -4v*2. Let p be (5/3)/(35/42). Let i(z) = -4z*2 + 0z*p + 6z*2. What is i(k(f))? 32f*4 Let v(u) = 6u2. Let g(r) be the third derivative of -r4/12 - 27r2. Give g(v(a)). -12a*2 Let s(d) = -2d. Let n(b) = -30b2 + 18b*2 + 10b*2. Determine s(n(m)). 4m2 Let b be (-3)/(3/(-2)) - -2. Let k(f) = f2 - 3f - 2. Let y be k(b). Let p(i) = 3i + 0i - yi. Let m(c) = -3c2. What is m(p(n))? -3n*2 Let n(j) = -5j*2. Let l(u) = 53u + 16. Let s(f) = 35f + 10. Let m(r) = 5l(r) - 8s(r). Calculate n(m(w)). -1125w2 Let u(g) = -g2 + g - 1. Let z = -2 + 0. Let d(w) = -w*2 - 2w + 2. Let j(t) = zu(t) - d(t). Let n(p) = -22p + 51p - 25p. Determine n(j(y)). 12y2 Let c(d) = 2d. Let x(v) be the second derivative of v*3/3 + 11v. What is x(c(y))? 4y Let y(a) = -5a. Let r(z) = -z*3 + 5z*2 - 3z + 7. Let x be r(5). Let g = x + 11. Let d(b) = -7b - g + 3 + 9b. Determine d(y(k)). -10k Let c be (1 - -2)/((-6)/(-4)). Let j(h) = 0h*2 - 3h2 + h2 - 2hc. Let i(n) = -1. Let b(u) = -u + 3. Let v(r) = 2b(r) + 6i(r). What is j(v(g))? -16g*2 Let b(m) = 2m. Let y(q) be the second derivative of -3q + 0 + 0q*3 + 0q*2 - 1/3q*4. What is b(y(o))? -8o*2 Let b(r) = -11r. Let h(u) = 2u2 - 21 + 21. Give h(b(d)). 242d*2 Let w(v) = 59v. Let q(k) = 3k2 + 5. Give w(q(o)). 177o*2 + 295 Suppose k + 2q - 100 = 6q, -3k + 300 = -5q. Let f(y) = k - 100 + 2y. Let d(p) = 2p. Calculate f(d(x)). 4x Let z(x) be the second derivative of x*4/3 - 2x. Let g(n) be the third derivative of -n*4/6 - 2n*2. Give z(g(b)). 64b*2 Let x(q) = 1 - 1 + 4q*2. Suppose -25 = -4t + a, -10 = -t + 2t + 3a. Let k(u) = 2u + tu - 3u - 2u. Determine k(x(n)). 8n2 Let o(x) = -5x - 2. Let z(b) = 26b + 11. Let a(t) = -11o(t) - 2z(t). Let q(y) = 14y - 2. Calculate a(q(v)). 42v - 6 Let z(x) = -4x*2. Let b(t) = -7t*2 + 56t. Calculate b(z(m)). -112m4 - 224m*2 Let v(p) = 4p. Let j(l) = -219l2. Determine j(v(t)). -3504t*2 Let x(j) = -j. Let z(f) = -20f. Let s(b) = 44x(b) - 2z(b). Let i(m) = 5m. Calculate s(i(y)). -20y Let i(w) = -24w. Let l(y) = -5 + 11 - y - 6. Calculate l(i(b)). 24b Let n(s) = 2s. Let h(j) = 299j + 91. Let p(l) = 13l + 4. Let o(x) = 4h(x) - 91p(x). Calculate o(n(u)). 26u Let b(j) = -1. Let z(l) = 4l - 5. Let r(y) = -5b(y) + z(y). Let u(a) be the third derivative of -a5/30 - a2. What is r(u(p))? -8p2 Let g(i) = -2i. Let c(x) = 0x + 0x - 16x2 - 11x*2. Determine c(g(j)). -108j*2 Let c(o) = 3o. Let j(p) be the first derivative of -1/2p2 + 0p - 3. Determine j(c(m)). -3m Let g(m) be the third derivative of -7m*4/24 - 7m*2. Let a(p) = 2p*2. Calculate a(g(w)). 98w*2 Let f(n) = -2n. Let i(c) = 3c2 - 4c + 4. Let x(k) = -k*2 + k - 1. Let j(q) = 3i(q) + 12x(q). Give f(j(y)). 6y2 Let z(c) = -c2. Let o(n) = 989n2. What is z(o(j))? -978121j*4 Let i(d) = 985d + 1. Let p(w) = 4w2. Give i(p(b)). 3940b*2 + 1 Let y be ((-10)/4)/(-5)0. Let w(a) = y - 3a + 0. Let h(k) be the first derivative of -k3/3 - 11. Calculate h(w(o)). -9o*2 Let c(n) = 4n. Let j(d) = -d*2 - 114d. Give j(c(u)). -16u2 - 456u Let b(i) = 39i + 18. Let a(d) = 11d + 5. Let z(w) = 18a(w) - 5b(w). Let o = -9 + 17. Let g(r) = -19 + o + 11 + 2r. Calculate g(z(m)). 6m Let q(h) = -5h2 - 3h - 3. Let k(b) = 4b2 + 2b + 2. Let s(r) = -3k(r) - 2q(r). Let z(v) be the third derivative of v4/8 + v2. What is s(z(i))? -18i2 Let x(a) be the first derivative of a6/120 - a3 - 2. Let i(z) be the third derivative of x(z). Let s(j) = j. Give i(s(b)). 3b*2 Let x(w) = -14 - 2w*2 + 14. Let m(n) = -73n*2. Determine m(x(a)). -292a4 Let y(n) be the second derivative of n4/12 + 5n. Let o(a) = -15a. Give o(y(c)). -15c2 Let i(k) = 2k*2. Let f(b) = -743b*2. What is f(i(z))? -2972z4 Let f(v) = -v2. Let p be (8 - 6) + (-59)/30. Let t(u) be the third derivative of 0u + 0u*3 - pu*5 + 0u*4 - 3u*2 + 0. Calculate f(t(x)). -4x*4 Let p(c) = 2c. Let z(t) = -1312t + 4. Calculate z(p(u)). -2624u + 4 Let i(x) = -x. Let f(l) = -19l. Determine f(i(o)). 19o Let r(g) = g - 14. Let p(h) = 7h. Determine r(p(u)). 7u - 14 Let c(w) = 2w2. Let g(x) = 2x - 5. Let i be g(4). Let f(m) = -5m + im + m*2 + 2m. What is c(f(s))? 2s4 Let a(k) be the second derivative of 47k*3/6 - 23k. Let n(r) = -2r. Determine a(n(t)). -94t Let z(q) = -5q + 3q + 0q + 5q. Let h(r) = -8r. Calculate h(z(y)). -24y Let d(k) be the first derivative of -1 + 25k2 - 24k2 + 5. Let m(b) = -b2. Calculate d(m(f)). -2f2 Suppose q + 3n + 13 = 0, q + 5n - 2 = -25. Let i(x) = -4 + qx - 4x + 4. Let m(f) = 2f*2. Give m(i(o)). 8o*2 Let p(n) = 2n. Let d(f) be the third derivative of -f*5/30 + 7f*3/6 - 6f*2. Let y(a) be the first derivative of d(a). Determine p(y(v)). -8v Let f(h) = 35h - 3. Let q(b) = 3b. Give q(f(g)). 105g - 9 Let d(g) = 2g*2. Let r(p) = 2934p*2. Calculate d(r(m)). 17216712m*4 Let l(o) = -2o*2. Let v(h) = 60h - 35. Let w(n) = -5n + 3. Suppose 2i = 104 - 34. Let x(m) = iw(m) + 3v(m). Give x(l(u)). -10u2 Let t(q) = 7 + 5q - 6q - 7. Let u = 11 + -7. Let r(j) = 4 - u + 2j. Determine r(t(v)). -2v Let v(l) = 104l*2. Let x(k) = 13k*2. Let m(s) = 5v(s) - 39x(s). Let y(a) = 4a**2. Determine m(y(d	{ "pile_set_name": "DM Mathematics" }
ive n(m). -2 Let q(w) = -w*2 + 6w - 6. Let y = -53 - -57. Determine q(y). 2 Suppose -5v = 0, v - 4v + 20 = 4n. Let w = -37 + 38. Let j(o) = -o3. Let u(y) = -5y*3 - 4y*2 - 4y - 1. Let k(m) = wu(m) - 6j(m). Give k(n). 4 Let b be (-2)/(-4) + (-10)/4. Let q be b/(-4) - 17/(-2). Suppose 4v + q = -7. Let f(w) = -w3 - 3w*2 + 4w - 5. What is f(v)? -5 Let a(z) be the first derivative of 0z2 + 12 + z + 1/3z3. Calculate a(1). 2 Let y(l) = l2 + 3l. Let d(o) = o2 + 7o - 2. Let q be (-2)/3 + 224/(-24). Let t be d(q). Suppose -6v = v + t. Give y(v). 4 Let s(i) = 3i*3 - 7i*2 + 16i - 10. Let j(k) = -10k3 + 20k*2 - 49k + 31. Let q(w) = 2j(w) + 7s(w). Calculate q(7). -8 Let a(o) = o*2 - 10o - 4. Let d be (72/(-144))/((-1)/26). Calculate a(d). 35 Let d(w) = w*3 + 8w*2 + 6w - 6. Let q be 35(3 - 6/3). Suppose 3a + j - 18 - 77 = 0, 0 = a + 2j - q. Suppose -a = 5r + 4. Determine d(r). 1 Let i(a) = a - 1. Suppose 0 = x - 2x + 15. Let m(w) = -x + 6 + w + 9. Let p(c) = -i(c) - m(c). Calculate p(2). -3 Let s(l) = -l + 1. Suppose 0j = j - 4. Suppose jx - 16 = 8x. Let v be 0(-1 - 0) + x. Determine s(v). 5 Suppose 4y + 0 = 2l - 2, -2y + 11 = -5l. Let q(u) = -5u*2 - 4u. Give q(l). -33 Let u(h) = -2h - 8. Suppose 2a = 0, -a + 2 = -t + 4. Suppose 5k - 8 = -2v, tk = -k + 3v + 9. Suppose -p - 2l = 7 + 5, -18 = 2p + kl. Determine u(p). 4 Let t(p) = -4p - 5. Let u(r) = r*2 - 65r + 811. Let x be u(48). What is t(x)? 15 Suppose -q + 2 = -0. Let o(m) = -3m3 - m3 - 2m*q + 3m*3 + 1 + 3m - 4. Let r = 380 - 383. Determine o(r). -3 Let i(v) = -21v - 2 - 3 + 4. Suppose -563m = -3d - 567m + 5, 2d - m + 4 = 0. Give i(d). 20 Let y(b) be the third derivative of b5/60 - b4/12 - b3/6 + b2. Let n be y(2). Let s(a) = 4189a - 4191a - 4a*2 + 4a*3 - 1 + 2a*2. Determine s(n). -5 Let s(m) = -12m + 1. Let w(b) = b. Let n(c) = 2s(c) + 22w(c). Let d(p) = p. Let z(o) = -3d(o) - n(o). Let f be (-3)/1 - (-2 + -3). Calculate z(f). -4 Let s(w) = -5. Let f(t) = -2. Let r(b) = 7f(b) - 3s(b). Let u(p) = p - 8. Let i(x) = -4r(x) - u(x). Give i(0). 4 Suppose 4l = -0l - 32. Let a(z) = -9 - 4z - 2z3 - z2 - 10z - 14z + 26z. Let x(g) = -g3 - g2 - g - 6. Let y(k) = lx(k) + 5a(k). Calculate y(2). -5 Let c(v) = -2 + 2 + 129v - 127v + 4. Give c(-10). -16 Let u(x) be the second derivative of -x5/20 + 5x4/12 + x3/6 - 7x2/2 - 12x + 9. What is u(6)? -37 Let j(r) = r*3 - 2r*2 + 4r - 2. Let n = 26 + -22. Suppose 7u - 30 = 2u. Suppose -np + u = -2. Determine j(p). 6 Let o = 86 + -82. Suppose oz = -5s - 8, 5s - 3z - 2z + 35 = 0. Let i(w) = -w*2 - 5w - 5. What is i(s)? -1 Let y(m) be the second derivative of 9m + 13/2m*2 - 1/6m*3 + 0. What is y(6)? 7 Let a(y) = 2y*2 - 37y + 17. Let d(v) = -v*2 + 17v - 7. Let f(m) = 4a(m) + 9d(m). Suppose -11 = -3j - 4c, -2j - 4c = -6j + 24. Give f(j). 5 Suppose -5g = -22 + 2. Let f be -3(g + -3 + -2). Let a(l) be the first derivative of -l4/4 + 4l3/3 + l2 + l + 2. Give a(f). 16 Suppose -28b + 248 = -59b. Let w(p) = -p*2 - 6p + 7. Determine w(b). -9 Let s(p) = 3p + 1. Let q = -10 - -13. Suppose 0 = -3t - 2i + 11, -t + 8 = qt - 4i. Determine s(t). 10 Let r(v) = -v2 + 11v - 24. Let m = -991 - -998. What is r(m)? 4 Let w(n) = -2n + 3. Let d be ((-20)/5 + -3)/(-1). Let h(g) = g + 9. Let p be h(-4). Suppose -d = -4x + p. What is w(x)? -3 Let z(l) = -8l + 9. Let n(f) = 33f - 42. Let r(g) = 2n(g) + 9z(g). What is r(0)? -3 Let q be -2 + (2 - 0) - -1. Let v(a) = 4a - 1. Let w be 1/6 + -334/(-72). Let u(t) = -t - 1. Let r(f) = wu(f) - v(f). What is r(q)? -7 Let r(t) = -t3 + 2t*2 + 9t*2 + t - 2t - 6t2. Give r(2). 10 Let s(r) be the first derivative of -r4/4 - 2r3 + r2/2 + 5r - 129. Calculate s(-4). -31 Let g(j) = 3j - 32. Let z(s) = 2s2 + 25s - 5. Let v be z(-13). Calculate g(v). -8 Let j be 24/4 - 3 - -11. Suppose -4t - o = -0o - 9, j = 5t + 4o. Let z(p) = 2p + 3p - 2p. Give z(t). 6 Suppose 105 + 165 = -9r. Let f be 3/(-3(-5)/r). Let q(c) = -c3 - 8c*2 - 9c - 1. Give q(f). -19 Let l(y) be the third derivative of y*4/24 + 5y*3/6 - 6y2. Let t = 55 + -59. Give l(t). 1 Let o(y) be the second derivative of y7/840 + y5/120 + y4/12 - 4y3/3 + 11y. Let g(b) be the second derivative of o(b). Determine g(2). 12 Suppose -5n + 2n + 5j - 1 = 0, 4j = -3n - 37. Let d(g) = g + 4. Give d(n). -3 Let l be -4 + (-15)/(1 - 4). Let q(s) = -21s*2 - 1. Give q(l). -22 Let l(b) = -39 + 19 - 34 - b + 42. Let n = 0 + -5. What is l(n)? -7 Let t be 4(30/(-4) + 7). Let p(a) = a*2 + 4a + 4. Give p(t). 0 Let h(o) = 2o2 + 19o - 28. Let m be h(-11). Let t(n) = n*3 - 6n*2 + 7n - 2. Calculate t(m). 8 Let x(p) = -p*3 - 5p*2 - 4p - 4. Let i = -1 + 11. Let l be ((-3)/(-5))/((-2)/i). Determine x(l). -10 Let h be 4/(-6) - (-336)/18. Let q = 20 - h. Let w(l) = l*2 - 3l. Give w(q). -2 Let t(w) = w*3 + 24w*2 - 53w - 22. Let k be t(-26). Let m(c) be the third derivative of c*5/60 - 5c4/24 - c3/2 + 3c2. Give m(k). -7 Let i(o) = 2o*2 - o - 11. Let g(b) = 4b*2 - b - 20. Let l(h) = 4g(h) - 7i(h). Determine l(2). 11 Let g(a) = -2a - 4. Let w(u) = -u*2 + 12u + 3. Let c be w(12). Suppose 4 = 2n - 2. Suppose nq + c = -6. What is g(q)? 2 Let l = -26 - -73. Suppose 1 = -8v - l. Let n(y) = -y - 5. Determine n(v). 1 Let k be (-6)/(-21)(-7)/(-4)0. Suppose y + 5f + 30 = 0, k = -y + 4f - 0 + 15. Let x(a) = a3 + 4a*2 - 3a + 4. What is x(y)? -6 Let d(q) = 4q - 15. Let h be d(7). Suppose 4z = g + h, -z - 2z = -3g - 12. Let x(b) = -b - 4 - b2 + z + b. Determine x(-2). -5 Let w(o) = o2 + 4o - 12. Let a be w(-6). Suppose 5v + av - 10 = 0. Suppose -vj + 3h + 24 = 0, 2 = j + h - 0. Let b(k) = -k2 + 7k + 8. Give b(j). 14 Let s(z) = 3 + 6z - 13z + z*2 - 5 + 6. Determine s(7). 4 Let x be 2 - (2/(-6))/((-3)/(-117)). Suppose -6w = -xw - 18. Let q(a) = -4a. Give q(w). 8 Let c(a) = 11a + 3 + 6242a*3 - 3a*2 - 6243a*3 + 10a. Calculate c(-6). -15 Let d(t) be the first derivative of t*4/12 + 2t3/3 - t2/2 + 3t + 12. Let o(n) be the first derivative of d(n). Calculate o(-3). -4 Let n(l) be the third derivative of -l6/60 - l5/60 - l3/2 - 33l*2. Determine n(-2). 9 Let u be (3 + -4)/(9/45). Let v(t) = -7t - 32. What is v(u)? 3 Let p(a) = -4a - 16. Let h(d) = -8d - 27. Let j(k) = 3h(k) - 5p(k). Determine j(-4). 15 Suppose 2c = h + 12, -3h + c = 6c + 80. Let k = h + 22. Let o(y) = 2 - 7y + 2y3 + 4y3 + y3 - 5yk - 6y*3. What is o(6)? -4 Let z(g) = 17g - 17. Let i(p) = 13p - 17. Let q(v) = -5i(v) + 4z(v). Give q(-6). -1 Let s(u) = u3 + 5u*2 + 3u. Let y be -3 + (30/(-27) - (-4)/36). Give s(y). 4 Let r be (-4)/8-26 - 8. Let v(l) be the second derivative of l5/20 - 5l4/12 + l3/2 - 5l2/2 + l. What is v(r)? 10 Suppose 43 - 13 = -5h. Let n = -56 + 63. Let y(p) = -2p + 0p + 4p - 6p*2 + 0p + n - p3. Calculate y(h). -5 Let j = -128 - -123. Let g(y) = -y2 - 7y + 3. What is g(j)? 13 Let m = 1145 - 1153. Let r(o) = 2o*2 + 10o - 2. Determine r(m). 46 Let i(m) = -24m + 3. Let u(s) = 11s - 2. Let c(a) = 6i(a) + 13u(a). What is c(-4)? -4 Suppose 2m + 0 = -4v + 26, -m + 2v - 3 = 0. Let g(y) = -268 + 136 - my + 132. What is g(1)? -5 Let k(d) = 4d3 + d2 - 5d + 1. Let h(c) = 3c3 + 2c*2 - 5c + 1. Let j(x) = -5h(x) + 4k(x). Suppose -429r = -432r + 15. Calculate j(r). -1 Let y = -35 - -11. Let f be 2 + 0 + 1 + y. Let n be (-70)/f3/(-2). Let i(r) = 2r - 6. Calculate i(n). -16 Let o(q) = q3 - q2 + q - 1. Let d(b) = b*2 - b + 1. Suppose -4w + 3 = -1. Let m(l) = wo(l) - d(l). Calculate m(3). 13 Suppose -9 = -5n + 2v + 9, 4n + 5v + 12 = 0. Let o(g) = 10g - 2. What is o(n)? 18 Let q(y) = -y*2 + 6y - 2. Let c(o) = o*2 - 7o + 2. Let f(l) = -2c(l) - 3q(l). Let j(z) = 2z - 3. Let t be j(3). Give f(t). -1 Let m(s) = -s. Suppose -3q - 3a - 7 = 5, -a = -q. Let t be m(q). Suppose -21 = -td - d. Let o(z) = -z + 2. What is o(d)? -5 Let u be (-9)/7 - 4/(-14). Let j(x) be the first derivative of -x*2 - 4 + 2x + 4x - 5x - 7. Give j(u). 3 Let v(c) = -4c - 2 - c3 + 0c	{ "pile_set_name": "DM Mathematics" }
. Let s = 0 + j. Put s, -0.1, d in descending order. -0.1, s, d Let d(r) = -2r2 + r - 9. Let z be d(0). Let n(m) = m2 + 9m - 1. Let p be n(z). Put p, 3, -4, 2 in ascending order. -4, p, 2, 3 Let g = -18 - -22. Let q = 15 - g. Let s(f) = f*2 + 7f + 4. Let m be s(-7). Put q, m, -2 in decreasing order. q, m, -2 Let m be 60/8((-136)/(-24) - 5). Let r(l) = 6l + l*2 - 4 + 7 - 2. Let d be r(-5). Sort m, 0, d in increasing order. d, 0, m Let o = -20.7 - -52.7. Put -4, 5, o, -5 in increasing order. -5, -4, 5, o Suppose -4l - 5 = -5n, 2n = -6l + 8l + 2. Suppose -2 = -k - l. Let r = 1 - -2. Put 4, r, k in decreasing order. 4, r, k Let d = 91/3 + -30. Put 5, -1/4, d, 1/2 in decreasing order. 5, 1/2, d, -1/4 Let y(b) = b*2 - 3b + 2. Let f(n) = -2n + 31. Let i be f(13). Let r be y(i). Sort -4, r, 0 in decreasing order. r, 0, -4 Suppose -3t + 3d - 6d = 0, -2t = -3d - 20. Put 0, 3, t in increasing order. 0, 3, t Let p be (-60)/(-12) + (-3 - 1). Sort p, -1, 5 in ascending order. -1, p, 5 Let z = -2.04 - -8. Let w = -6 + z. Let c = 1.04 + w. Put -0.3, 9, c in ascending order. -0.3, c, 9 Let t(b) = -b*3 - 7b*2 + 3b + 7. Let w(g) = -2g3 - 13g*2 + 6g + 13. Let x(q) = -11t(q) + 6w(q). Let h be x(-3). Sort 0, 0.5, h. 0, 0.5, h Let m be (-6 + 0)/(2/4 - -1). Let r = 12 - 7. Sort r, 0.3, m. m, 0.3, r Let c be (-1)/1513 - (-58)/290. Sort c, -21, 6. -21, c, 6 Let b(v) = -8v - 84. Let w be b(-11). Sort 0, -86, w, -5 in descending order. w, 0, -5, -86 Let v(w) = 15w - 2. Let o be v(0). Sort o, -4, 3, 2. -4, o, 2, 3 Let i be 35/(-20) + (-3)/(-4). Let d be (-10 - -6) + (-4)/i. Sort 4, 3, 5, d in descending order. 5, 4, 3, d Let a = 30 + -26. Suppose 5z - 4s - 31 = 0, -23 = -z - 3z + 5s. Let u = z - 9. Put a, -5, u in descending order. a, u, -5 Let h(v) = 2v + 3v2 - 3v + 2v2. Let w be h(1). Put 5, w, -18 in descending order. 5, w, -18 Let d be -8 - (-28 - 9)/(-1). Sort d, -3, 2. d, -3, 2 Suppose -3l - 7 = n, -4 = -5l + l - 4n. Suppose -5r - 1 = -4u, 4r - 1 = 4u + 3. Let z = -4 - u. Put 1, z, l in ascending order. l, 1, z Let r(t) = -2t + 10. Let p be r(7). Let m be 4 + (-5)/3 - (9 + 69/(-9)). Sort -3, m, -1, p in descending order. m, -1, -3, p Let q be (-5)/3 - 3381/(-2277). Put 5, -46, q in decreasing order. 5, q, -46 Let l = 2.7 - -0.4. Let m = l + -2.9. Put m, -0.3, 4/5 in ascending order. -0.3, m, 4/5 Let h(i) = i3 - 5i*2 - 8i + 14. Let v be h(6). Let r be 1/v - (-75)/30. Put 5, -5, r in decreasing order. 5, r, -5 Let q(a) = -5a3 - 20a*2 - 16a - 37. Let z be q(-3). Put -1, z, -5 in decreasing order. -1, -5, z Let m(v) = v*2 - 15v - 122. Let c be m(-6). Put -159, 2, c in descending order. c, 2, -159 Let g = 1244 + -1244.4. Let r = 1/66 + -35/132. Sort 0, g, -0.1, r. g, r, -0.1, 0 Let h = -1.9669 + -0.0331. Put 3/4, -13.1, h in decreasing order. 3/4, h, -13.1 Suppose -2u - 60 = 3r, 2r = 2u - r + 72. Let l = u - -33. Sort -1, l, -3 in ascending order. -3, -1, l Suppose 13v - 12v - 3 = 0. Sort 16, 1, v. 1, v, 16 Let d = -55 + -4. Let o = 57 + d. Put 0, o, -5, -1 in decreasing order. 0, -1, o, -5 Let u = 6.17 - 1.93. Let k = 0.24 - u. Put 0.02, k, -2 in decreasing order. 0.02, -2, k Let o be (24/180)/((-24)/(-30)). Put -0.8, o, -2 in decreasing order. o, -0.8, -2 Let b = 26 + -35. Let p = -8 - b. Let y = p - 1.2. Sort y, -1/6, 1 in descending order. 1, -1/6, y Let z = -1401 - -1400.5. Put 6, z, -4 in ascending order. -4, z, 6 Let a = 13.3 - 22.6. Let d = a - 0.7. Let v = -7 - d. Put v, 2/15, -1 in decreasing order. v, 2/15, -1 Let c(p) = 57p - 455. Let r be c(8). Put -2, 9, r, -1 in decreasing order. 9, r, -1, -2 Let z(t) = -2t + 5. Let a be (-4)/18 + (-10)/(-45). Let i be z(a). Let c be (2/(-4))/(2/(-12)). Sort c, i, 4 in descending order. i, 4, c Suppose r - 2m - 1 = 0, -13 = -6r + r + 2m. Suppose q + 2 = 2v - 0, 0 = rv - 3q - 3. Put -5, v, 5, 4 in ascending order. -5, v, 4, 5 Let o(q) = 6q + 29. Let k be o(-5). Sort 18, k, 1 in decreasing order. 18, 1, k Let y = -203 + 204. Sort 2/9, -7, y in decreasing order. y, 2/9, -7 Suppose -3n + 0r - 10 = -4r, -4r - 2 = 3n. Let h(j) = -j*2 + 6j + 31. Let q be h(9). Sort n, q, 0. n, 0, q Let j = -3 + 5. Let o = j + 4. Let d be (-1)/o(-12 + 10). Sort d, -2/9, 2/3 in decreasing order. 2/3, d, -2/9 Suppose 0y = -4y + 24. Suppose 0 = a - 0a - y. Put a, -2, -3 in ascending order. -3, -2, a Suppose 0 = -11s + 14s - 108. Let y be -6(4/s)/((-1)/(-6)). Sort y, 0, -1 in increasing order. y, -1, 0 Let b = 271/516 - 14/129. Let a = 1/4 - b. Suppose 0n - 5n = -35. Put n, 4, a in decreasing order. n, 4, a Suppose 10u + 27 = u. Let i(b) = b*3 + 12b*2 + b + 8. Let c be i(-12). Suppose -6y + y - 10 = 0. Put y, c, u in decreasing order. y, u, c Suppose 5r + 3k = 4k - 15, 5r + 15 = -3k. Let t = 35 + -31. Sort -1, t, r. r, -1, t Suppose 442 = 8w + 434. Suppose 52 = -6l + 2l. Sort w, l, 5 in ascending order. l, w, 5 Let l = 1/16 + -37/80. Let j = -248 + 253.08. Let y = j + -0.08. Sort l, -2, y. -2, l, y Let k(s) = -s - 12. Let w be k(-9). Let i = -27 + 29. Put -4, i, 0, w in decreasing order. i, 0, w, -4 Let a be (-48)/(-160)5/9. Put a, -1/7, -2/11, 3 in ascending order. -2/11, -1/7, a, 3 Let i = -146 + 1165/8. Sort 9/2, i, -4 in ascending order. -4, i, 9/2 Let z = 236.9 - 237. Sort -5, z, -1/6, -2 in decreasing order. z, -1/6, -2, -5 Suppose 2u = -5k + 13, -3k = 2u - 0u - 11. Let f be (1 + -2)/(2/6). Let o be -6 - (-6 + -12) - 7. Sort o, k, f. f, k, o Let l = 65.23 + -8.23. Sort l, 0, 4/7 in increasing order. 0, 4/7, l Let m = 2 + -2. Suppose s - 2 + 6 = m. Suppose -4f - 3 - 7 = 2a, 5a = 2f - 13. Sort 1, s, a in descending order. 1, a, s Let w(p) = 2p + 9. Let s be (-4)/18-3 - (-84)/(-18). Let x be w(s). Sort x, 4, 0, -2. -2, 0, x, 4 Let d be (27/6 - 5)-1. Put 3, d, 0, -5 in decreasing order. 3, d, 0, -5 Suppose -4k + 129k + 375 = 0. Suppose -n - 3i = 9, 3i = -12 + 3. Suppose b + 4o + 25 = n, -2o = -3b - 5 - 0. Sort 3, k, b in increasing order. b, k, 3 Let b = -433 + 432. Put -7, 0, 5, b in increasing order. -7, b, 0, 5 Let i = 3.1 + -3.6. Let w = -3.5 + i. Sort 1/5, 4, w in increasing order. w, 1/5, 4 Let i be -11 + (8 - (-1184)/392). Put -3, -0.02, i in decreasing order. i, -0.02, -3 Let z = -387 + 2711/7. Sort -1/7, 4, z in ascending order. -1/7, z, 4 Let r = 0.32 + 15.68. Let y = r - 16.03. Let g = y + 0.03. Put 7, g, -0.4 in descending order. 7, g, -0.4 Let s be -14/8-2. Let i = s - 3. Put 5, 3, i in descending order. 5, 3, i Let g be ((-10)/(-8))/(89 - 84). Suppose -2y + y - 2s - 3 = 0, 0 = -4y + 2s + 8. Let j be (-4)/8 + y/(-4). Sort j, 7, g in increasing order. j, g, 7 Let c(g) = g*3 + 12g*2 + 19g - 10. Let t be c(-10). Sort -5, t, 10 in increasing order. -5, t, 10 Suppose -6 = 3w - 12. Let b = -0.04 - -0.44. Sort 3/10, w, b. 3/10, b, w Let h be -1 + 9/54 + 25/(-6). Put 0, -4, h, 1 in increasing order. h, -4, 0, 1 Let j be (28/(-16))/((-2)/120). Let l be j/(-200) + 2/16. Let x(n) = 2n - 9. Let q be x(7). Put q, l, -0.1 in increasing order. l, -0.1, q Suppose -84 = 2o - 92. Sort o, 9, 5, 1 in increasing order. 1, o, 5, 9 Suppose 0 = -3o - 3c - 9, -2c = -11o + 8o + 11. Suppose -2t = 7 - 1. Put t, o, 3 in descending order. 3, o, t Let t = -17 - -19. Suppose -2n = 2x + x - 10, 0 = x + tn - 10. Suppose 4q + q - 10 = x. Sort 4/3, -3/2, q in decreasing order. q, 4/3, -3/2 Suppose 17 = -2d - 171. Let c be d/(-10) + 4/(-10). Let k = c + -6. Sort -2, 5, k in descending order. 5, k, -2 Suppose 5j - 3j - 26 = -4v, 5j = -v + 29. Let o(n) = 4n - 5. Let f be o(1). Sort 5, f, v. f, v, 5 Suppose -4b = 3h + 49, -3h + 31 = -4b - 0b. Let x be (-8)/315/b. Suppose -24 = -4d - x. Sort d, 2, -3 in descending order. d, 2, -3 Suppose 3d + 0 - 6 = 0. Suppose db = 5 - 11. Let x = -100 + 95. Sort 5, b, x in decreasing order. 5, b, x Let n be -4 - (-16)/(5 + -5 + 2). Put 0, -1, -5, n in increasing order. -5, -1, 0, n Let y = -2.826 - -4.826. Let n = -4 + -1. Put -1.2, -4, y, n in decreasing order. y, -1.2, -4, n Suppose 0 = 4f - 3f - 3. Suppose -2t = -3j + 32, 0 = 7j - 2j - 4t - 50. Sort -4, f, j, -5 in increasing order. -5, -4, f, j Let a(u) = -4u - 27. Let b be a(-5). Let w = 2 - 5. Sort b,	{ "pile_set_name": "DM Mathematics" }
-40)/12(-12)/10. What is the remainder when 41 is divided by ((-14)/s)/((-5)/30)? 20 Let i(s) be the first derivative of 1/4s4 - s2 + 2 - 2/3s3 - 3s. What is the remainder when i(4) is divided by 12? 9 Suppose -p + 3 = 6. Let v(q) = -q*3 - 2q*2 + q - 1. Let o be v(p). Let f = o + 57. Calculate the remainder when f is divided by 16. 14 Let o(c) = -5c - 4. Let v be 12/(-54) - 25/9. Let u(p) = 3p2 - 3p - 4. Calculate the remainder when u(v) is divided by o(-3). 10 Let q = 7 + -4. Suppose qs - 6s = -6. Let x = s - -1. What is the remainder when 7 is divided by x? 1 Suppose -d = q + 28, 6d = 2q + d + 21. Let c(p) = -p*2 - 6p - 1. Let r be c(5). Let b = q - r. Calculate the remainder when b is divided by 9. 6 Suppose 4y = -2v + 62, -4y - 204 + 32 = -4v. What is the remainder when v is divided by 2((-18)/(-2) - 2)? 11 Let x(q) = 2q - 7. Let c be x(5). Suppose 8 = 2f, 0f = -4w - cf + 140. Calculate the remainder when w is divided by 11. 10 Suppose -6o = -o. Suppose 2p - 17 = -m, o = 3m - 6m - 3p + 57. What is the remainder when 60 is divided by m? 18 Let l = 69 + -45. Calculate the remainder when l is divided by 13. 11 Let q = -36 - -61. Calculate the remainder when q is divided by 13. 12 Let s = -66 - -111. Suppose p = -2p + s. Suppose -2k = -10, -2y = -y - k - 23. What is the remainder when y is divided by p? 13 Let o = 21 + -13. Let q(n) = n*2 - n + 5. Calculate the remainder when o is divided by q(0). 3 Let p = -246 - -271. Let f = 0 - 1. Calculate the remainder when p is divided by f + 3(-20)/(-6). 7 Calculate the remainder when (93/9)/(44/48) is divided by 16. 15 Let r = -6 + 19. What is the remainder when 24 is divided by r? 11 Let s = -16 + 18. Suppose o = -4w + 26, -3o = -w - 2w - 3. Calculate the remainder when o is divided by s. 0 Let b = 11 - 9. Let o = 9 - b. Let l = 13 + 7. Calculate the remainder when l is divided by o. 6 Let j be 2 - (2 - (0 - -2)). Suppose jf = 0, 5f = -2p + 82 - 12. What is the remainder when p is divided by 18? 17 Suppose 43 = 5j + 8. Let y = 13 - 9. Calculate the remainder when j is divided by y. 3 Let z(j) = j*2 + 8j + 10. Calculate the remainder when 56 is divided by z(-9). 18 Let w = -4 + 39. Suppose -2z + z = -12. What is the remainder when w is divided by z? 11 Let j be (-6)/(-5)40/6. Suppose 70 = jh - h. Calculate the remainder when h is divided by 7. 3 Let n = 34 - 17. Let j be 93(3 - 2). What is the remainder when n is divided by j/2(-4)/(-6)? 8 Suppose -3x + 0z = -5z - 24, -3x - 5z = -24. Calculate the remainder when -31(-1 - (3 + -3))/1 is divided by x. 7 Let z = -70 + 76. Calculate the remainder when 33 is divided by z. 3 Let l = 19 - -145. What is the remainder when l is divided by 33? 32 Let t = 13 + -3. Suppose 2d + 2 + 0 = 0. Calculate the remainder when d/(-5) - 376/(-20) is divided by t. 9 Let m be (6/(-4))/(15/(-40)). Suppose 2v - mv = -8. What is the remainder when 11 is divided by v? 3 Let t = 1 - -4. Suppose -2l - tm = 9, -5l + m = 4m - 6. Calculate the remainder when 11 is divided by l. 2 Suppose -4i = -3o - 5i + 12, 5o - 20 = 2i. Calculate the remainder when 9 is divided by o. 1 Let d = 27 + -8. What is the remainder when d is divided by 10? 9 Suppose -1 = -5d + 29. What is the remainder when d is divided by 2? 0 Calculate the remainder when 550/33 - (-4)/(-6) is divided by 10. 6 Suppose -162 = -5l + 3h, -5h + 50 = 3l - 54. Suppose -3d - 10 = -64. What is the remainder when l is divided by d? 15 Suppose -4f - 8 = -72. Suppose -5l - 5i - 19 = -4l, l + 13 = -3i. Let g(u) = -9u - 6. What is the remainder when g(l) is divided by f? 14 Let z(h) = 0 + 5 - h + 3. Let l be z(6). Suppose 4 = lq - 6. What is the remainder when 8 is divided by q? 3 Suppose -4k - 2b = -6, 6 = -2k + 3b - 3. Let i(c) = 3 + 7c + 7c2 + 0 + c3 + kc. Calculate the remainder when 34 is divided by i(-5). 16 Let f(k) = k*3 + 4k*2 + 3k + 6. Let b be 1/((-2)/4) + -1. Calculate the remainder when 10 is divided by f(b). 4 Let t(l) = l*3 - 2l*2 - 4l + 3. Let d be t(3). Suppose -3p + dp + 114 = 3a, -3p = 4a - 148. Calculate the remainder when a is divided by 18. 16 Let s(x) = -1. Let v(i) = i - 4. Let k(p) = -5s(p) - v(p). Let g(y) = y - 4. Let m be g(4). What is the remainder when 26 is divided by k(m)? 8 Suppose -4s + 5 = 3f + 17, f + 4 = -3s. Suppose m - 3 = -sm. What is the remainder when 8 is divided by m? 2 Let j(o) = o*3 + 5o*2 + 4o + 3. Let u be j(-3). Suppose 4s - us + 140 = 0. What is the remainder when s is divided by 15? 13 Suppose -6k = -9k + 96. Suppose 3f + 3x - 63 = 0, -4f + 26 = -2f - 2x. Calculate the remainder when k is divided by f. 15 Let d = 5 - 4. Suppose -2s - d = -7. Calculate the remainder when 5 is divided by s. 2 Let v = -37 - -43. Calculate the remainder when 20 is divided by v. 2 Let y = -8 + 12. Suppose -3j + 169 = 2c, -yc - c = 20. What is the remainder when j is divided by 30? 29 Let q be 23/(3 + 0). Let s(g) = 1 - 6g + 3g*q + 0 - 5. Calculate the remainder when s(5) is divided by 14. 13 Suppose 7d + 5o = 4d + 205, 4d + 2o = 292. Let q = 97 + d. Suppose y - 5y = 4f - q, 4f - 137 = 3y. What is the remainder when f is divided by 13? 12 Let y(o) = -o + 34. What is the remainder when 55 is divided by y(6)? 27 Suppose 2h = -8h + 70. Let d be (14 - 4)2/4. Suppose df - f = 44. What is the remainder when f is divided by h? 4 Let b(u) be the first derivative of u*3 - 5u*2/2 - 7u - 4. What is the remainder when b(5) is divided by 15? 13 Suppose 6s - 24 - 12 = 0. What is the remainder when 9 is divided by s? 3 Suppose 4q + 620 = 5m, 6m = m - 5q + 665. What is the remainder when m is divided by 13? 11 Suppose 3a - 132 = -a. Let z(y) = -y2 + y + 9. What is the remainder when a is divided by z(0)? 6 Let t(f) = f3 - 12f2 - 10f - 12. What is the remainder when t(13) is divided by 14? 13 Let r = 64 + -57. What is the remainder when 76 is divided by r? 6 Let u be (-296)/(-12)13. Let j = -51 + u. Calculate the remainder when j is divided by 12. 11 Let i(c) = -c - 6. Let k(z) = 4z + 2. Let u be k(-2). Let q be i(u). Calculate the remainder when 25 is divided by (-1)/(q + (-3)/39). 12 Let j(w) = -107w - 1. Let c be j(-1). Let x be (-4)/(-6) + 2/6. Calculate the remainder when 35 is divided by c/6 + x/3. 17 Let l(i) = -i*2. Let m(a) = 4a*2 - 5a + 1. Let p(n) = -3l(n) - m(n). Calculate the remainder when p(3) is divided by 3. 2 Let b(i) = 2i3 + i2 - 2i + 1. Let v be b(1). Suppose vh = -2h + 4. Calculate the remainder when 50 is divided by (-52)/(-1)h/2. 24 Let z be 2/((-248)/122 + 2). Let q = 95 + z. Calculate the remainder when q is divided by (-2 - -4)/((-1)/(-6)). 10 Suppose -23 = -5f - 8. Suppose -2s = 3q - 70, 0 = 2s - fs + 5. Suppose -w + 33 = 2w. What is the remainder when q is divided by w? 9 Let r = -48 - -68. Calculate the remainder when 77 is divided by r. 17 Let g = 3 + -1. Suppose 0 = l + 5o + 8, o = go + 3. What is the remainder when 12 is divided by l? 5 Suppose 3l - 88 = 2. What is the remainder when 117 is divided by l? 27 Let k(z) = 3z*2 + 33z + 27. Let r(f) = f*2 + 11f + 9. Let p(b) = -6k(b) + 17r(b). Calculate the remainder when p(-4) is divided by 10. 9 Suppose -v = -2p + 3p - 66, 3v - 3p = 228. Let r = v + -43. What is the remainder when r is divided by 10? 8 Suppose -f = f + 10. Let j(o) = o + 8. Let h be j(f). Suppose -2 + 3 = d + hr, 3d - 3 = -r. What is the remainder when d is divided by 1? 0 Suppose 4 + 4 = -4g. What is the remainder when 16 is divided by g/((-22)/18 - -1)? 7 Suppose -4u - 3j - 23 = 0, -u = -0u + 4j + 22. What is the remainder when 29 is divided by 10/(u/(-3)1)? 14 Suppose 0 = -i + 4k + 15, 2k - 42 = -4i - 0k. What is the remainder when 54 is divided by i? 10 Suppose 2f - 3f - 7 = 0. Let h(a) be the first derivative of -3a2/2 + 7a + 1. What is the remainder when h(f) is divided by 10? 8 Let n be ((1 - -3)3)/2. Suppose nl = l + 85. Calculate the remainder when 48 is divided by l. 14 Suppose -3w - 24 = -4b - 2w, -2b = 2w - 22. Suppose 33 = 2s - 19. Calculate the remainder when s is divided by b. 5 Let y(b) = 4b2 + 50b - 9. What is the remainder	{ "pile_set_name": "DM Mathematics" }
cement from kkovvkvvkbvkrkk. 1/15 Three letters picked without replacement from llxflzlzxjnnzzzl. What is prob of picking 1 x and 2 z? 1/28 Calculate prob of picking 2 r and 1 t when three letters picked without replacement from trtrlrt. 9/35 Two letters picked without replacement from mmnumdndmmnd. Give prob of picking 1 u and 1 d. 1/22 Calculate prob of picking 1 b and 1 k when two letters picked without replacement from {w: 2, k: 1, e: 1, g: 2, b: 1}. 1/21 Two letters picked without replacement from {l: 7}. What is prob of picking 2 l? 1 What is prob of picking 1 q and 1 t when two letters picked without replacement from tqtqqqqqqq? 16/45 Four letters picked without replacement from {q: 3, d: 4, g: 2, v: 1, p: 2}. What is prob of picking 1 v, 1 q, and 2 g? 1/165 What is prob of picking 1 i and 1 o when two letters picked without replacement from {a: 2, s: 2, i: 1, d: 2, o: 1}? 1/28 Two letters picked without replacement from {u: 1, k: 1, j: 2, y: 10}. Give prob of picking 1 k and 1 y. 10/91 Two letters picked without replacement from rawmz. Give prob of picking 1 r and 1 w. 1/10 Calculate prob of picking 1 b and 2 e when three letters picked without replacement from {i: 4, b: 2, d: 4, e: 9, n: 1}. 6/95 Four letters picked without replacement from {o: 4, s: 1, t: 3, n: 2, j: 1}. Give prob of picking 2 n, 1 t, and 1 o. 2/55 Two letters picked without replacement from gqqgk. Give prob of picking 2 g. 1/10 Two letters picked without replacement from {p: 1, s: 1, r: 1, i: 9, e: 5}. Give prob of picking 2 i. 9/34 Two letters picked without replacement from lllg. What is prob of picking 1 g and 1 l? 1/2 Calculate prob of picking 1 i and 1 q when two letters picked without replacement from qiqiii. 8/15 Three letters picked without replacement from {g: 3, n: 13}. What is prob of picking 1 g and 2 n? 117/280 Two letters picked without replacement from {r: 9, i: 1, f: 9}. Give prob of picking 2 r. 4/19 What is prob of picking 1 w and 1 t when two letters picked without replacement from {f: 8, e: 2, t: 3, w: 6}? 2/19 Four letters picked without replacement from {v: 2, r: 3}. Give prob of picking 4 r. 0 Four letters picked without replacement from wdewwnwddeww. What is prob of picking 1 e, 1 w, and 2 d? 4/55 Two letters picked without replacement from {z: 1, u: 7, t: 2, e: 2}. Give prob of picking 1 e and 1 t. 2/33 Two letters picked without replacement from {v: 2, h: 9}. Give prob of picking 2 v. 1/55 What is prob of picking 2 m when two letters picked without replacement from {i: 1, m: 2}? 1/3 Four letters picked without replacement from hhvfhvvhvhhvvhhvvvvv. Give prob of picking 2 h and 2 v. 308/969 What is prob of picking 2 z and 1 t when three letters picked without replacement from tmtffzmfzmmmm? 1/143 Calculate prob of picking 2 j and 1 q when three letters picked without replacement from {w: 1, s: 4, j: 4, q: 6}. 36/455 Two letters picked without replacement from ddodoo. What is prob of picking 2 o? 1/5 Calculate prob of picking 2 j, 1 x, and 1 w when four letters picked without replacement from jawayxygxaxxjxa. 1/273 What is prob of picking 1 u and 1 y when two letters picked without replacement from {p: 1, v: 9, u: 1, y: 2}? 1/39 Three letters picked without replacement from zssznzbbbzzbs. What is prob of picking 2 s and 1 n? 3/286 Three letters picked without replacement from {l: 3, a: 6, t: 2, j: 1}. Give prob of picking 1 a, 1 l, and 1 t. 9/55 Two letters picked without replacement from {c: 2, x: 9, v: 3, g: 2, p: 1}. What is prob of picking 1 g and 1 c? 1/34 Two letters picked without replacement from eeseghhcheehe. Give prob of picking 1 c and 1 h. 2/39 What is prob of picking 1 u, 1 c, and 2 r when four letters picked without replacement from {c: 6, u: 1, a: 3, r: 6, y: 2}? 1/34 Four letters picked without replacement from {w: 4, s: 1, u: 3, y: 6}. Give prob of picking 4 w. 1/1001 What is prob of picking 1 j and 2 l when three letters picked without replacement from {l: 5, j: 2}? 4/7 Four letters picked without replacement from uasuusss. Give prob of picking 3 u and 1 a. 1/70 What is prob of picking 1 o, 1 u, and 1 r when three letters picked without replacement from uouooouxrxuaourxruu? 35/323 Two letters picked without replacement from {x: 2, y: 1, n: 2, f: 1, o: 1, t: 1}. What is prob of picking 1 x and 1 o? 1/14 Calculate prob of picking 1 f and 1 i when two letters picked without replacement from {f: 5, r: 4, i: 2}. 2/11 Two letters picked without replacement from aausuunaujuj. What is prob of picking 2 j? 1/66 Four letters picked without replacement from hphhnhhypnnhhnhphnyy. What is prob of picking 3 n and 1 y? 2/323 What is prob of picking 1 x and 1 w when two letters picked without replacement from {w: 8, x: 3}? 24/55 Three letters picked without replacement from {f: 5, z: 1, c: 4, b: 6}. Give prob of picking 1 z, 1 f, and 1 b. 3/56 What is prob of picking 4 h when four letters picked without replacement from hhahah? 1/15 What is prob of picking 2 x, 1 h, and 1 w when four letters picked without replacement from {r: 1, x: 6, w: 5, s: 1, t: 2, h: 1}? 15/364 Calculate prob of picking 1 r and 1 u when two letters picked without replacement from iouzrwu. 2/21 Two letters picked without replacement from zgzg. Give prob of picking 2 z. 1/6 What is prob of picking 1 n and 1 s when two letters picked without replacement from apisnsng? 1/7 Calculate prob of picking 3 y when three letters picked without replacement from {n: 2, i: 12, y: 5}. 10/969 Calculate prob of picking 1 o and 2 v when three letters picked without replacement from {j: 3, v: 6, x: 2, t: 4, o: 3}. 15/272 What is prob of picking 1 r, 1 z, and 2 k when four letters picked without replacement from rrzkkkkz? 12/35 Two letters picked without replacement from hxxehjehwwhwwkxwwwx. Give prob of picking 1 e and 1 k. 2/171 Calculate prob of picking 2 o when two letters picked without replacement from {o: 11, y: 1}. 5/6 Three letters picked without replacement from dlddlldwddldlld. Give prob of picking 1 w and 2 d. 4/65 Four letters picked without replacement from rrrrrrrrr. Give prob of picking 4 r. 1 Two letters picked without replacement from qqqiysqqysqq. What is prob of picking 1 y and 1 s? 2/33 Three letters picked without replacement from {p: 3, r: 6, q: 2, u: 1, x: 3, j: 5}. What is prob of picking 3 x? 1/1140 What is prob of picking 1 g and 1 p when two letters picked without replacement from ppgpggggpgpgpppggpp? 10/19 Two letters picked without replacement from {d: 5, x: 2}. What is prob of picking 1 x and 1 d? 10/21 What is prob of picking 1 l and 1 a when two letters picked without replacement from {s: 5, m: 1, l: 3, d: 1, a: 4, e: 1}? 4/35 What is prob of picking 4 f when four letters picked without replacement from ffff? 1 Two letters picked without replacement from {x: 5, k: 4, u: 5}. What is prob of picking 2 x? 10/91 Calculate prob of picking 1 s and 1 f when two letters picked without replacement from {t: 4, s: 1, o: 7, f: 3, a: 3}. 1/51 Three letters picked without replacement from fssssf. Give prob of picking 1 s and 2 f. 1/5 Calculate prob of picking 2 z when two letters picked without replacement from yznzcnn. 1/21 Four letters picked without replacement from wwwwwdddwwwwwddwww. Give prob of picking 3 w and 1 d. 143/306 Two letters picked without replacement from {i: 3, v: 2, z: 2, g: 1, e: 1, l: 3}. Give prob of picking 1 z and 1 e. 1/33 Three letters picked without replacement from poho. Give prob of picking 1 p and 2 o. 1/4 Two letters picked without replacement from eeeeererrererrre. Give prob of picking 1 e and 1 r. 21/40 Three letters picked without replacement from {w: 2, f: 7, e: 1, p: 4, s: 3, l: 1}. What is prob of picking 1 e and 2 p? 1/136 Calculate prob of picking 3 k when three letters picked without replacement from {s: 11, k: 3}. 1/364 What is prob of picking 1 h and 1 y when two letters picked without replacement from {t: 6, h: 2, o: 3, n: 3, y: 2, u: 2}? 4/153 What is prob of picking 2 c when two letters picked without replacement from vzzzciilijiizvc? 1/105 Four letters picked without replacement from {e: 2, b: 1, w: 6, u: 6, p: 2}. What is prob of picking 2 w and 2 e? 3/476 What is prob of picking 1 u and 1 t when two letters picked w	{ "pile_set_name": "DM Mathematics" }
-4/13) Simplify ((u(u(-7)u)/u)/(u/(u/(u/((u*(5/6)u)/u)))))14 assuming u is positive. u(-259/3) Simplify ((v(-1))(6/17))28 assuming v is positive. v(-168/17) Simplify (m*(-1/18)/m)/((m/(mm*(1/13)))/m)(m/m8)/m(-2/25) assuming m is positive. m*(-40357/5850) Simplify (qq*(-2/3)qq)(2/7)/(q(-3)/q(-2/17)) assuming q is positive. q(181/51) Simplify (m/(mm(-3)))/(m(12/11)/m) assuming m is positive. m(32/11) Simplify (l0ll)*(17/3)/(l(l*(-2)l)/ll/l(-5)l) assuming l is positive. l(16/3) Simplify l/(l(7/6)/l)(lll(1/27)/l)/l assuming l is positive. l(47/54) Simplify (q/q0q)(-43)/(q/(q/(q(-2)q)))29 assuming q is positive. q(-57) Simplify w(-3)/(w4w) assuming w is positive. w(-8) Simplify (j/j17)/j(-2) assuming j is positive. j(-14) Simplify f*(2/13)(ff(-1/2))/f(f3)(-4/7) assuming f is positive. f(-375/182) Simplify (w/w29)/(w/(w/(w/w*23w))) assuming w is positive. w*(-7) Simplify (z/((zzzz*5/zzzzzzz)/z)z/(z/(z/((z/z(1/9))/z))))/(z/(z/z1))(-28) assuming z is positive. z(163/9) Simplify n*1n*(-4)/n((nn0)/nn)(-2/25) assuming n is positive. n(-102/25) Simplify (y*14/(((yy(10/3))/y)/y))17 assuming y is positive. y(595/3) Simplify c(-3/7)c(-6/7) assuming c is positive. c(-9/7) Simplify (y6/y(-1/5))/(y(1/2))(-30) assuming y is positive. y(106/5) Simplify (c/c(-2/5))(1/2)/(c/(c(2/7)/c))(-27) assuming c is positive. c(3289/70) Simplify (oo*24)/oo/o(1/14) assuming o is positive. o(349/14) Simplify ((gg/(gg*(-3)g))/(g/(g(-5)/g)))(13/8) assuming g is positive. g*(-13/2) Simplify bbb(2/7)b*(4/9)(bb(-10))/(b(9/4)b) assuming b is positive. b(-2399/252) Simplify ((q(-10)/q)/q)/(q/q22) assuming q is positive. q9 Simplify ((w9/w)/w)(2/141) assuming w is positive. w(14/141) Simplify (c11cc/(c*(-5/3)/c)c)/((cc(c/(((c*1/c)/c)/c))/cccc)/cc(1/5)) assuming c is positive. c(157/15) Simplify nn*5nn(6/7) assuming n is positive. n(55/7) Simplify (qq(-1))34/(q*(-6)q(-2/9)) assuming q is positive. q(56/9) Simplify ((mm(-11)m)/mmm)(1/12) assuming m is positive. m(-2/3) Simplify (y(-3))(1/32) assuming y is positive. y(-3/32) Simplify (q/(q/(q1/q)))(1/15)/(q/(q5qq)q/(qqq/(qq*(-7/4)qq))) assuming q is positive. q(27/4) Simplify (d(3/7)/d)/d(6/5) assuming d is positive. d(-62/35) Simplify (z(31/2)/z)/(z33/zz) assuming z is positive. z*(-37/2) Simplify ((yy*(-2/7)/yy)8)3 assuming y is positive. y(120/7) Simplify l(-4/13)(l/(l(l*8l)/l))/l assuming l is positive. l*(-121/13) Simplify (((j/(j/((((jj13/j)/j)/j)/j)))/j)/j(2/23))18 assuming j is positive. j(3690/23) Simplify g(3/8)/(g(-1/11)/g) assuming g is positive. g(129/88) Simplify ((q/((q/(q/q(-3/7)))/qq))/(q/((q(q/((qq/(q/(qqq4qqqq)))/q))/q)/q)))/(q(2/3)q/(q*(-5)q)) assuming q is positive. q(-320/21) Simplify ((f(2/17)/f)/ff(-1))(2/23) assuming f is positive. f(-98/391) Simplify g(-9)gg/(g9g)g(-4/9)/((gg(g(-1/3)/g)/g)/g) assuming g is positive. g(-145/9) Simplify (s(3/5)/sss(-1/8))(-46) assuming s is positive. s(-437/20) Simplify (d(-7))(-12) assuming d is positive. d84 Simplify (l/l(6/5))(-15/2) assuming l is positive. l(3/2) Simplify (p(-15)pp/(p/p(6/7)))(2/31) assuming p is positive. p(-184/217) Simplify (h1)(14/3) assuming h is positive. h(14/3) Simplify (hh*0hh)(-2/25)(hh(-3/4))/h(-3) assuming h is positive. h(301/100) Simplify (((o(-1)/o)/o)(8/7))(-31) assuming o is positive. o(744/7) Simplify (o0oo)(-45)/((oo*(-6/13))/(o/(oo*(4/13)o)oo)) assuming o is positive. o(-1168/13) Simplify (o/(((o(-16)o)/o)/o))/ooo(oo/(o/(o(-4/17)o))oo)/o assuming o is positive. o(370/17) Simplify (b(3/5)b9)/(b/(b(2/3)/b)b/b(-4/9)) assuming b is positive. b(307/45) Simplify x*(-11)xx(-17) assuming x is positive. x(-27) Simplify z/(z(z*1/z)/zzz)z*(-2)((z/((z*6z)/z))/z)/((z/z(-2/17))/z) assuming z is positive. z(-155/17) Simplify ((y*4y)/y(-3))(3/7) assuming y is positive. y*(24/7) Simplify ((ii*8)/((ii*5i)/i))/(i(i/(i/(i5i)))/ii(3/2)/i) assuming i is positive. i(-7/2) Simplify i(-6/7)i*2(i(i/i3)/i)/(i/((i6/i)/iii)) assuming i is positive. i(29/7) Simplify ((((n(-2)/n)/n)/nn)(-4/9))(1/34) assuming n is positive. n(8/153) Simplify (c(-7)/(c/((cc/(c(-2/19)cc))/c)))/((cc(-2))/(c(-5/3)c)) assuming c is positive. c(-488/57) Simplify (q14)6 assuming q is positive. q84 Simplify (u0)(-34)/(u/u(-2/7)u)(1/40) assuming u is positive. u(-2/35) Simplify (i/i0)(30/11)/((i/i4)/(i/i(-5))) assuming i is positive. i(129/11) Simplify (t(-11)/t)/(t(((tt*20t)/t)/t)/t) assuming t is positive. t(-32) Simplify (s(-8)/ss)(8/11) assuming s is positive. s(-64/11) Simplify ((q/(((q/q(-7))/q)/qq))/qq(q*(2/7)q)/q)/(q/(q*(-1/11)/q)q/q(-3/7)) assuming q is positive. q(-711/77) Simplify (f(-1))(2/5)(ff(1/3)/f)45 assuming f is positive. f(73/5) Simplify n(-11)/nn/(n/n(-31))n assuming n is positive. n(-42) Simplify (h(-1)h)(-25/2)(h*1h)(-28/5) assuming h is positive. h(-56/5) Simplify (y(-3/2))(-25)yy*(2/15)((yy(-6))/y)/y assuming y is positive. y(949/30) Simplify ((z(-1/5)/z)/((z/(z(-11)z))/z))7 assuming z is positive. z(-392/5) Simplify ((qq0)(-25/2))(1/21) assuming q is positive. q(-25/42) Simplify (t/(tt0))0(t(-2/7))(9/11) assuming t is positive. t(-18/77) Simplify ((i/i(-2)i)/ii)14(ii(-1)i)(-10/3) assuming i is positive. i(158/3) Simplify ((mm(mm(-6))/mm)/m)(-44) assuming m is positive. m176 Simplify ((f/(f*(-3)/f))/fff/(f/f(1/2)))/(f4/(((f/(f/f(1/14)))/f)/f)) assuming f is positive. f(-3/7) Simplify yy/(y*(1/8)/y)(y/y*(1/5))/yy/(yy(7/2)y)yy(-4) assuming y is positive. y(-193/40) Simplify (d/(dd/d(-2)))/(d/(d(2/5)/d))(d(d0d)/d)(-4/5) assuming d is positive. d(-27/5) Simplify (aa(-7/5))/aa*(-24)/aaa assuming a is positive. a(-122/5) Simplify (f4ff/(f/f1))/((f/f(-1/5))/f(f*(2/19)ff)/ff) assuming f is positive. f(351/95) Simplify (k(-7/3)kk(-3))(-7/12) assuming k is positive. k(91/36) Simplify (u(-1)/u(-5))37 assuming u is positive. u148 Simplify t20/t(2/13) assuming t is positive. t(258/13) Simplify (((ll/(l/(l(4/5)/l)))/l)(-25/6))(-14/5) assuming l is positive. l(-7/3) Simplify v11/(v(-2/5)/v)v*(1/4)vv((vvv/v*(3/2))/vv)/v assuming v is positive. v*(303/20) Simplify (pp*10)/pp(-3/17)/p assuming p is positive. p(150/17) Simplify ((i(-2/13))(-2/9))(1/33) assuming i is positive. i(4/3861) Simplify (q/(q0/q))(-40)(q1q)/(q/q*4q) assuming q is positive. q(-76) Simplify j/j16jj*9jj assuming j is positive. j(-3) Simplify w/(w(2/47)w)w(3/5)w assuming w is positive. w*(366/235) Simplify (oo/(o(o(-6)/o)/oo))/(o/(o*(-2/19)o))(o/o(2/9))/ooo5 assuming o is positive. o(2338/171) Simplify ((q/(qq(-4/5)))/(q(-2/11)q))/(q(2/7)q/q1) assuming q is positive. q(-117/385) Simplify w*(-12/11)ww/w17 assuming w is positive. w(-177/11) Simplify ((qq1)/q)6q(-2)qq(-3/4) assuming q is positive. q(17/4) Simplify (w(-4/7))(13/2) assuming w is positive. w(-26/7) Simplify (rr*(4/19))/rr(-35)/r assuming r is positive. r(-680/19) Simplify (dddd/(d(-5)/dd)dd/(d/(dd(4/9)d)))(-27) assuming d is positive. d(-336) Simplify (q*(-3/2)q)/(q*(-18)q) assuming q is positive. q(33/2) Simplify (v/(v/(v20v))v)(-25/3) assuming v is positive. v(-550/3) Simplify ((q/q(1/2))(-48))(-42) assuming q is positive. q1008 Simplify ((r/(r/(r/(r*(8/7)/rrr))))/r)(-25) assuming r is positive. r(375/7) Simplify c(-3/7)ccc/((cc(-15)c)/c) assuming c is positive. c(116/7) Simplify (((m/m2m)/m)(-8))(-17) assuming m is positive. m(-136) Simplify x/((x/x(-2/9))/x)x*1x*(-2)xx	{ "pile_set_name": "DM Mathematics" }
9. Give f(24). -11 Let g(i) = 7i2 + 338i + 82. What is g(-48)? -14 Let a(n) = -23n2 + 5n + 4. Give a(-1). -24 Let c(o) = 49o + 18. Calculate c(-2). -80 Let f(o) = -43o*3 - 224o*2 - 49o - 24. Determine f(-5). -4 Let d(x) = -x*3 + 2x*2 + 20x - 23. What is d(-6)? 145 Let g(w) = -69w3 + 5w*2 - 7w + 4. Determine g(1). -67 Let m(b) = -b*3 - 103b*2 - 827b + 1782. What is m(-94)? -4 Let a(l) = -262l - 26. Calculate a(1). -288 Let k(j) = 17j*2 - 56j - 252. Calculate k(6). 24 Let l(o) = 371o + 4824. What is l(-13)? 1 Let d(u) = -u2 - 20u - 10. Give d(-20). -10 Let q(i) = i*3 + 11i*2 - 14i - 6. Determine q(-12). 18 Let f(r) = -r*3 + 10r*2 + 1419r + 19. Give f(-33). 19 Let i(z) = -7z2 - 40z + 93. Calculate i(-8). -35 Let v(z) = z*3 - 9z*2 + 3z - 5. Calculate v(5). -90 Let k(c) = 13c2 - 90c + 77. Determine k(6). 5 Let x(l) = -l + 21. Give x(34). -13 Let t(o) = 343o - 2536. What is t(7)? -135 Let z(s) = -2s*3 - 2s*2 + 5s + 8. Determine z(-3). 29 Let l(y) = y*3 - 6y*2 + 8y - 11. Give l(3). -14 Let x(j) = -6j2 - 36j - 148. Determine x(-4). -100 Let k(j) = -160j + 11045. What is k(69)? 5 Let b(h) = -h2 - 7h + 29. What is b(6)? -49 Let v(g) = -55g + 691. What is v(14)? -79 Let x(j) = -2j + 73. Give x(71). -69 Let o(t) = -24t2 - 491t - 48. Calculate o(-20). 172 Let a(f) = 12f2 - 49f - 268. What is a(7)? -23 Let k(q) = -19q + 227. Determine k(27). -286 Let k(x) = 43x + 1851. Give k(-43). 2 Let b(u) = u*3 + 4u*2 - 115u - 608. What is b(-6)? 10 Let q(y) = 91y + 2905. Give q(-32). -7 Let c(x) = -8x + 59. What is c(8)? -5 Let m(z) = 7z + 144. What is m(6)? 186 Let b(s) = s3 + 67s*2 - 131s + 478. What is b(-69)? -5 Let o(i) = i*3 + 3i*2 - 73i - 12. Calculate o(0). -12 Let w(u) = u*2 - 8u - 29. What is w(16)? 99 Let v(f) = -18f2 - 37f + 68. Give v(3). -205 Let l(s) = -5s + 61. What is l(-5)? 86 Let w(j) = 2j*2 + 2871j + 17149. What is w(-6)? -5 Let y(o) = 5o2 + 44o + 49. Determine y(-8). 17 Let j(f) = 12f2 + 209f + 98. Give j(-17). 13 Let i(f) = -92f2 - 20055f + 202. What is i(-218)? -16 Let t(v) = -3936v - 2. Calculate t(0). -2 Let k(w) = -20w*2 - 806w - 197. What is k(-40)? 43 Let a(o) = -2o3 - 8o*2 + 42o + 152. What is a(-5)? -8 Let t(q) = 5q2 + 101q + 75. Calculate t(-15). -315 Let v(w) = 122w - 657. Determine v(5). -47 Let l(b) = -9b + 32. What is l(5)? -13 Let j(v) = 29v + 222. Calculate j(-12). -126 Let i(g) = g3 + g2 - 24g - 73. Give i(-4). -25 Let l(f) = f*2 - 47f + 183. Calculate l(43). 11 Let v(c) = -8c2 - 86c + 130. Calculate v(-12). 10 Let l(z) = -1256z + 6285. What is l(5)? 5 Let j(t) = 389t - 3908. What is j(10)? -18 Let p(o) = 67o2 + 5o - 7. Give p(1). 65 Let n(q) = -21q3 - 81q*2 + 14q + 10. Calculate n(-4). 2 Let w(z) = z*2 - 43z + 337. Calculate w(10). 7 Let c(g) = 242g2 - 31g + 60. What is c(2)? 966 Let u(w) = -30w - 1. What is u(4)? -121 Let w(u) = -6117u + 12242. What is w(2)? 8 Let r(o) = -96o + 626. Calculate r(7). -46 Let t(q) = 10q*2 - 96q + 24. What is t(9)? -30 Let u(j) = -2j2 + 50j + 295. Calculate u(-5). -5 Let x(p) = -17p + 34. Give x(-7). 153 Let h(t) = -3t*2 - 34t + 170. Determine h(-19). -267 Let x(p) = -53p + 496. Give x(10). -34 Let f(w) = w3 - 13w - 23. Calculate f(-2). -5 Let t(u) = -u*3 + 5u*2 + 10u + 118. Calculate t(8). 6 Let t(d) = 3d3 - 177d*2 - 7d + 356. Calculate t(59). -57 Let o(h) = -2630h - 23675. Determine o(-9). -5 Let f(x) = 8x*2 - 30x + 1. What is f(1)? -21 Let f(w) = -83w + 826. Determine f(9). 79 Let d(z) = -329z - 1243. Give d(-4). 73 Let u(s) = 262s - 1532. Give u(6). 40 Let y(w) = -387w - 5165. Give y(-13). -134 Let q(b) = -b*2 + 74b - 693. What is q(11)? 0 Let i(v) = v*3 - 21v*2 - 352v + 13. Give i(-11). 13 Let j(k) = 832k2 + 3331k + 5. Calculate j(-4). -7 Let q(n) = -n*2 - 580n - 53113. Give q(-114). 11 Let v(b) = -b*3 - 13b*2 + 89b + 665. Calculate v(-6). -121 Let k(a) = -3a2 + 325a - 2221. Give k(101). 1 Let i(u) = -14u2 + 61u + 63. Determine i(-1). -12 Let j(v) = v*3 - 63v*2 + 63v + 36. What is j(62)? 98 Let u(r) = -53r + 24. Determine u(3). -135 Let k(n) = n2 + 29n - 61. What is k(-28)? -89 Let f(x) = -x*3 - 7x*2 + 4x - 5. Calculate f(-6). -65 Let w(u) = -11u2 + 11u - 15. Calculate w(3). -81 Let h(f) = 23f + 35. What is h(-5)? -80 Let v(z) = 7z*2 - 19z - 1. Calculate v(7). 209 Let p(s) = 36s + 2760. Calculate p(-77). -12 Let r(o) = o3 + 28o*2 - 66o - 191. Calculate r(-30). -11 Let h(w) = w*2 - 6w + 12. What is h(2)? 4 Let o(f) = 2f3 + 140f2 - 190. Give o(-70). -190 Let f(v) = v2 + 345v + 4318. Calculate f(-13). 2 Let n(j) = -j3 - 122j*2 + 193j + 8619. Determine n(-123). 9 Let k(g) = -g*2 + 33g - 314. Give k(13). -54 Let w(l) = 107l + 4133. What is w(-40)? -147 Let l(i) = -2i*2 - 95i - 61. Calculate l(-47). -14 Let x(w) = -w*3 - 7w*2 - 5w + 18. What is x(-7)? 53 Let l(m) = -5m2 - 23m - 33. Calculate l(-14). -691 Let o(l) = 27l2 - 785l + 106. Determine o(29). 48 Let i(u) = -374u - 2969. Determine i(-8). 23 Let p(b) = 3b*3 - 98b*2 + 59b + 40. Determine p(32). -120 Let d(c) = 67c2 + 930c - 118. Calculate d(-14). -6 Let v(x) = 24x3 - 3x + 14. Determine v(-2). -172 Let c(g) = g*3 - 5g*2 - 70g + 77. Calculate c(11). 33 Let w(m) = m*2 + 12m - 61. Calculate w(-11). -72 Let x(a) = a*3 + 18a*2 + 14a - 19. Determine x(-17). 32 Let i(p) = p*3 + 60p*2 + 4p + 137. Determine i(-60). -103 Let z(c) = 3c3 - 3c*2 - 14c + 42. Determine z(5). 272 Let b(v) = -4v2 + 16v + 339. Determine b(-14). -669 Let a(w) = -2w3 + 46w*2 - 65w - 22. What is a(21)? 377 Let h(t) = -2t2 - 22t - 31. Give h(-22). -515 Let m(y) = y*3 + 62y*2 - 62y - 466. Determine m(-63). -529 Let u(q) = 5q + 130. Calculate u(47). 365 Let f(u) = 29u + 2189. What is f(-76)? -15 Let n(s) = -15s3 + 958s*2 + 131s - 205. Determine n(64). -13 Let t(m) = m*3 + 22m*2 + 25m - 1. Give t(-21). -85 Let z(l) = 2l3 - 18l*2 - 32l + 290. What is z(8)? -94 Let n(y) = 98y + 945. Calculate n(-9). 63 Let v(j) = 88j - 2161. Determine v(24). -49 Let l(h) = 3h2 - 175h + 557. Determine l(55). 7 Let o(y) = -2y3 - 250y*2 + 73y + 9118. Calculate o(-125). -7 Let i(v) = -16v2 - 520v + 105. Calculate i(-33). -159 Let h(o) = 117o + 401. Calculate h(-4). -67 Let h(t) = 2954t + 56129. What is h(-19)? 3 Let z(w) = 9w2 + 5w - 1. Determine z(-7). 405 Let v(o) = o + 27. What is v(23)? 50 Let c(x) = -361x - 34646. What is c(-96)? 10 Let u(i) = 35i*3 + 10i*2 + i - 8. What is u(-1)? -34 Let x(g) = -457g - 112407. Determine x(-246). 15 Let v(d) = -161d - 805. Calculate v(-5). 0 Let s(k) = -k + 43. What is s(16)? 27 Let x(y) = -30y + 414. Give x(11). 84 Let a(j) = -118j - 1895. Determine a(-16). -7 Let m(d) = 7d*2 + 139d + 246. Give m(-2). -4 Let d(u) = -5u3 - 105u*2 + u + 44. Give d(-21). 23 Let u(y) = -10y*3 - 2429y*2 + 246y + 725. Determine u(-243). -4 Let q(k) = -k*3 + 70k*2 + 73k - 150. Give q(71). -8 Let o(q) = q*2 - 2q - 112. What is o(11)? -13 Let b(u) = -11u - 750. Give b(-70). 20 Let w(d) = -198d*2 - 58d - 56. Give w(-1). -196 Let l(c) = -96c - 3612. What is l(-37)? -60 Let w(x) = x3 - 78x*2 + 740x - 227. Calculate w(67). -26 Let a(g) = -5g2 - 120g - 217. Determine a(-22). 3 Let w(v) = -17v2 - 178v - 180. What is w(-1)? -19 Let o(b) = 6b2 - 2b - 20. Calculate o(5). 120 Let q(t) = -t*3 + 21t*2 + 112t - 311. Calculate q(25). -11 Let i(m) = m*2 + 119m + 468. Give i(-115). 8 Let t(f) = -f*3 - 94f*2 - 838f + 168. Determine t(-84). 0 Let r(y) = -26y + 2262. Calculate r(63). 624 Let z(w) = 100w + 621. Give z(-6). 21 Let u(c) = 2c2 + 22c + 13. Calculate u(-20). 373 Let o(s) = s - 94. Calculate o(-11). -105 Let z(c) = -c + 101. What is z(-11)? 112 Let p(k) = -k*3 - 64k*2 - 5k - 297. What is p(-64)? 23 Let w(i) = i*3 - 121i*2 - 253i + 861. Calculate w(123). 0 Let n(k) = 78k - 1402. Give n(18). 2 Let r(w) = 8w*3 - 234w*2 + 58w + 5. Give r(29). 5 Let c(j) = 29j + 159. What is c(-7)? -44 Let u(t) = -10t*3 - 16t*2 + 548t + 564. What is u(-1)? 10 Let	{ "pile_set_name": "DM Mathematics" }
. Determine v(-47). -3 Let d(r) = -9r + 580. Give d(63). 13 Let f(p) = -p2 - 265p + 2183. Give f(8). -1 Let c(x) = 10x3 + 34x*2 - 67x + 15. Determine c(2). 97 Let l(j) = -4342j + 221450. Determine l(51). 8 Let w(x) = -252x - 32760. Give w(-130). 0 Let u(t) = -t*3 - 2t*2 - 33t - 99. Calculate u(-3). 9 Let p(m) = -36m2 - 3019m + 106. Determine p(-84). -314 Let q(x) = -x*3 - 109x*2 + 235x + 1404. Determine q(-111). -39 Let m(u) = -120u + 1523. What is m(13)? -37 Let g(n) = -175n - 1028. Give g(-6). 22 Let s(p) = 2p2 - 38p - 67. What is s(13)? -223 Let s(n) = 2n3 - 15n*2 - 44n + 328. What is s(8)? 40 Let l(w) = w*3 - 20w*2 + 39w - 23. Determine l(18). 31 Let p(r) = -330r - 1323. Determine p(-4). -3 Let m(j) = 85j + 9648. Give m(-113). 43 Let w(m) = -m*2 - 6m - 73. Give w(-10). -113 Let k(n) = n*3 - 10n*2 + 9n + 16. Give k(8). -40 Let n(k) = -4k2 + 177k - 1195. Calculate n(7). -152 Let x(b) = -70b2 - 32b - 25. Calculate x(-1). -63 Let w(z) = 33z3 + 10z*2 + 54z - 62. What is w(1)? 35 Let x(v) = 115v + 1743. What is x(-16)? -97 Let t(w) = -22w*3 - 4w*2 - 70w - 67. Give t(-1). 21 Let f(g) = -g*3 + 20g*2 + 2g + 66. Determine f(20). 106 Let b(f) = 8f + 837. What is b(-109)? -35 Let o(f) = -f3 + 20f*2 - 81f - 24. What is o(14)? 18 Let o(s) = s*2 + 7314s + 94907. Determine o(-13). -6 Let d(f) = 3f2 + 44f - 106. Calculate d(-16). -42 Let t(r) = -r*3 + 40r*2 - 281r + 64. Give t(31). 2 Let h(g) = -372g - 2923. Calculate h(-8). 53 Let x(h) = -21h + 28. What is x(7)? -119 Let s(g) = 27g + 896. Calculate s(-32). 32 Let g(f) = -f3 - 12f*2 - 26f + 12. Calculate g(-10). 72 Let c(w) = w*3 - 23w*2 - 61w + 906. Determine c(24). 18 Let r(i) = -i*3 - 58i*2 + 57i + 100. What is r(-59)? 218 Let o(u) = -10u2 + 37u + 8. Determine o(4). -4 Let m(w) = 101w - 38. Calculate m(3). 265 Let i(n) = 131n*2 - 293n + 56. What is i(2)? -6 Let h(v) = -v*3 + 11v*2 + 34v + 12. Determine h(-4). 116 Let h(k) = k*3 + 8k*2 + 13k + 8. Give h(-7). -34 Let u(l) = -13l3 + 35l*2 - 12l + 13. Calculate u(2). 25 Let a(o) = -2o2 - 11o + 99. Determine a(11). -264 Let d(r) = -r*3 + 8r2 - 4. What is d(6)? 68 Let g(t) = -t2 + 824t - 40150. Calculate g(52). -6 Let m(n) = -237n - 2371. Calculate m(-10). -1 Let c(w) = 48w2 - 313w - 159. Calculate c(7). 2 Let b(n) = 110n + 493. Determine b(-4). 53 Let g(q) = -q2 - 72q - 1094. Determine g(-22). 6 Let s(p) = 2p3 + 14p*2 - 48p - 39. Calculate s(-9). 69 Let f(w) = -45w2 + 401w + 36. Give f(9). 0 Let l(r) = -23r3 + 69r*2 - 148r + 460. Give l(3). 16 Let f(s) = 9s2 + 74s + 138. Determine f(-5). -7 Let m(p) = 4p2 - 49p + 9. What is m(12)? -3 Let r(f) = 1102f - 2181. Calculate r(2). 23 Let g(v) = -128v - 463. Calculate g(-4). 49 Let c(j) = 5j2 + 324j + 230. Calculate c(-64). -26 Let i(z) = z*3 + 153z*2 + 165z + 1960. What is i(-152)? -16 Let q(h) = 4h2 + 46h - 635. Determine q(8). -11 Let s(z) = -5573z - 11155. Determine s(-2). -9 Let t(k) = 17k + 575. Calculate t(-30). 65 Let x(z) = -24z + 189. What is x(10)? -51 Let g(p) = -91p + 4194. Give g(47). -83 Let s(u) = u*2 - 11u - 677. Calculate s(-21). -5 Let b(r) = -3r2 + 10r + 73. Calculate b(-7). -144 Let a(b) = 2b3 - 11b*2 + 39b - 373. What is a(8)? 259 Let f(v) = -v*3 + 56v*2 + 577v - 79. Give f(-9). -7 Let d(x) = 3x3 + 14x*2 + 21x - 4. What is d(-5)? -134 Let h(i) = -28i + 55. Give h(4). -57 Let w(p) = 2p - 17. Determine w(-26). -69 Let g(d) = -15734d + 4. Calculate g(0). 4 Let g(o) = -15o - 541. Give g(-44). 119 Let d(a) = 3a3 - 7a*2 - 12a + 8. Calculate d(-3). -100 Let h(x) = 16x + 863. Give h(-39). 239 Let y(g) = 20g*2 + 445g + 145. What is y(-22)? 35 Let k(t) = 32t - 125. Determine k(5). 35 Let g(i) = -i2 - 2i + 21. Calculate g(3). 6 Let p(d) = d*3 - 7d*2 - 8d + 1. Give p(9). 91 Let b(d) = -20d2 - 97d + 257. Give b(2). -17 Let v(x) = 50x + 4. Give v(4). 204 Let r(m) = -719m - 7910. What is r(-11)? -1 Let v(m) = 3m2 - 35m + 48. Give v(9). -24 Let r(o) = o*2 + 11o - 94. Determine r(6). 8 Let h(m) = -2m2 - 142m - 36. What is h(-70)? 104 Let z(c) = -39c3 - 5c*2 + 15c - 12. Calculate z(1). -41 Let b(u) = -u*3 - 74u*2 - 215u - 88. What is b(-71)? 54 Let w(c) = -20c + 200. What is w(0)? 200 Let d(o) = 4o*2 - 11o + 20. Determine d(3). 23 Let t(u) = -76u + 35. What is t(1)? -41 Let f(g) = 31g*2 - 431g + 45. Give f(14). 87 Let b(c) = -c*2 + 244c + 1686. Determine b(-7). -71 Let c(m) = -87m + 61. What is c(12)? -983 Let g(u) = 3u*2 - 65u - 115. Determine g(23). -23 Let j(v) = 16v2 - v - 3. What is j(2)? 59 Let k(h) = 22h + 211. What is k(-17)? -163 Let o(c) = -6c2 + 18c - 33. Determine o(2). -21 Let x(a) = -2a3 - 32a*2 - 13a - 14. Give x(-15). -269 Let h(j) = -105j + 649. What is h(7)? -86 Let r(t) = 68t - 788. Calculate r(11). -40 Let r(m) = -m*2 - 561m - 14415. Give r(-27). 3 Let x(k) = k*2 - 520k + 2569. Give x(5). -6 Let u(p) = -27p - 26. Determine u(-1). 1 Let a(x) = -321x + 328. Give a(1). 7 Let r(u) = -48u + 191. Calculate r(13). -433 Let c(j) = 369j - 40592. What is c(110)? -2 Let k(t) = t*3 + 30t*2 - 62t + 17. Give k(-32). -47 Let p(c) = -c*3 - 11c*2 - 11c - 50. Determine p(-8). -154 Let c(l) = l*2 - 164l - 6493. Calculate c(-33). 8 Let s(i) = -435i + 878. Calculate s(2). 8 Let q(w) = -354w - 3723. Calculate q(-10). -183 Let h(u) = 17u - 29. Calculate h(13). 192 Let g(a) = 7a*2 - 27a + 133. Determine g(8). 365 Let y(r) = -r*2 + 62r + 164. Determine y(56). 500 Let x(g) = 6g2 + 10g - 19. Give x(5). 181 Let x(f) = 20f - 379. What is x(19)? 1 Let w(d) = 398d*2 - 1201d + 3. Determine w(3). -18 Let p(w) = w*3 - 31w*2 + 11w - 336. Calculate p(31). 5 Let o(q) = -12q3 + 10q*2 - 30q + 32. What is o(2)? -84 Let c(x) = 18x2 - 194x + 3. Calculate c(10). -137 Let u(g) = -g*2 - 34g + 69. Determine u(-9). 294 Let h(t) = 25t + 2. Give h(-2). -48 Let c(l) = -7l*2 + 113l + 119. What is c(18)? -115 Let f(g) = -g*3 + 45g*2 - 348g - 68. Calculate f(35). 2 Let j(z) = -3z2 - 48z - 81. Give j(-13). 36 Let g(x) = -17x + 58. What is g(-12)? 262 Let m(p) = 922p + 15733. What is m(-17)? 59 Let l(g) = -9g2 - 7g - 20. Calculate l(-2). -42 Let h(f) = -56f + 67. Determine h(0). 67 Let u(m) = -m3 - 60m*2 - 18m - 1441. Determine u(-60). -361 Let u(g) = -10g - 99. What is u(-11)? 11 Let c(m) = -m3 + 47m*2 - 417m - 50. Give c(12). -14 Let c(l) = -l*3 + 46l*2 + 82l - 1683. What is c(47)? -38 Let f(q) = 409q + 28615. What is f(-70)? -15 Let k(h) = 3h*3 + 6h*2 - 16h + 77. Calculate k(-7). -546 Let m(v) = -8v3 + 120v*2 - 3v + 37. What is m(15)? -8 Let p(g) = 12g2 - 5g - 5. Determine p(-3). 118 Let q(o) = -188o + 68. Calculate q(2). -308 Let p(w) = -2w*3 - 52w*2 + 10w + 207. Calculate p(-26). -53 Let b(w) = w*3 + 10w*2 + 49w + 140. What is b(-6)? -10 Let k(n) = 40n2 - 11n + 12. What is k(1)? 41 Let n(i) = -5i - 236. What is n(-47)? -1 Let w(r) = 138r - 2. Calculate w(1). 136 Let x(n) = -2n2 - n + 321. Calculate x(-14). -57 Let v(c) = -175c - 890. Calculate v(-5). -15 Let m(p) = -22p + 10. What is m(1)? -12 Let p(l) = -163l + 3626. Determine p(22). 40 Let o(d) = 30d2 + 181d + 19. Determine o(-6). 13 Let d(h) = h*3 - 37h*2 + 72h - 73. Give d(35). -3 Let x(g) = -g*2 + 18g - 87. What is x(8)? -7 Let o(n) = 5n - 687. Give o(67). -352 Let o(u) = -u2 - 32u - 255. What is o(-18)? -3 Let h(z) = -2z2 + 290z - 1119. Give h(141). 9 Let r(g) = g*2 - 60g - 121. Give r(-2). 3 Let p(y) = 7086y + 99205. Determine p(-14). 1 Let q(j) = j2 + 58j + 714. Determine q(-15). 69 Let c(r) = -r*3 + 12r*2 - 2r + 11. Determine c(6). 215 Let z(y) = -243y3 + y2 - 2y - 3. Calculate z(-1). 243 Let b(g) = -14g + 54. Calculate b(0). 54 Let v(z) = z3 - 20z*2 - 11z - 6. What is v(21)? 204 Let k(s) = 2s3 - 19s*2 + 10s - 41. Calculate k(9). -32 Let r(g) = -11g + 146. Calculate r(12). 14 Let b(y) = -y3 + 3y*2 + 29y - 52. Calculate b(-5). 3 Let v(q) = q*2 + 25q + 42. Determine v(-25). 42 Let v(h) = h*2 + 27h + 172. Give v(-8). 20 Let	{ "pile_set_name": "DM Mathematics" }
r? 557 What is the cube root of 3588430926 to the nearest integer? 1531 What is the fourth root of 177564194 to the nearest integer? 115 What is 14809809 to the power of 1/5, to the nearest integer? 27 What is the third root of 5017540376 to the nearest integer? 1712 What is the third root of 61896961 to the nearest integer? 396 What is the square root of 272853892 to the nearest integer? 16518 What is the ninth root of 53541323 to the nearest integer? 7 What is 4452708939 to the power of 1/10, to the nearest integer? 9 What is the seventh root of 1166284166 to the nearest integer? 20 What is 401656692 to the power of 1/2, to the nearest integer? 20041 What is the square root of 2458097646 to the nearest integer? 49579 What is the cube root of 610163328 to the nearest integer? 848 What is 310799483 to the power of 1/5, to the nearest integer? 50 What is the ninth root of 563614124 to the nearest integer? 9 What is the cube root of 519128495 to the nearest integer? 804 What is the seventh root of 2380967029 to the nearest integer? 22 What is the square root of 244583397 to the nearest integer? 15639 What is 3096327 to the power of 1/3, to the nearest integer? 146 What is the cube root of 79035616 to the nearest integer? 429 What is the third root of 1049635837 to the nearest integer? 1016 What is 1030891078 to the power of 1/6, to the nearest integer? 32 What is 40965734 to the power of 1/2, to the nearest integer? 6400 What is 722334987 to the power of 1/4, to the nearest integer? 164 What is the tenth root of 194619351 to the nearest integer? 7 What is 1047564181 to the power of 1/2, to the nearest integer? 32366 What is the fourth root of 80181096 to the nearest integer? 95 What is 183728098 to the power of 1/3, to the nearest integer? 568 What is the fourth root of 22285346 to the nearest integer? 69 What is the sixth root of 1718038382 to the nearest integer? 35 What is the fifth root of 1105282006 to the nearest integer? 64 What is the square root of 57605104 to the nearest integer? 7590 What is the cube root of 1968123 to the nearest integer? 125 What is 90261373 to the power of 1/7, to the nearest integer? 14 What is 137719043 to the power of 1/3, to the nearest integer? 516 What is the third root of 117438635 to the nearest integer? 490 What is the eighth root of 15194513 to the nearest integer? 8 What is the seventh root of 578988032 to the nearest integer? 18 What is the square root of 79665638 to the nearest integer? 8926 What is 3060234001 to the power of 1/2, to the nearest integer? 55319 What is the cube root of 4670073324 to the nearest integer? 1672 What is the cube root of 1501948933 to the nearest integer? 1145 What is 19771403 to the power of 1/7, to the nearest integer? 11 What is the third root of 1832354327 to the nearest integer? 1224 What is 82032459 to the power of 1/2, to the nearest integer? 9057 What is the ninth root of 2174648058 to the nearest integer? 11 What is the third root of 1386496223 to the nearest integer? 1115 What is the fourth root of 1428331464 to the nearest integer? 194 What is the cube root of 34855738 to the nearest integer? 327 What is the fifth root of 127175783 to the nearest integer? 42 What is the cube root of 51458422 to the nearest integer? 372 What is the cube root of 78636685 to the nearest integer? 428 What is the eighth root of 492511061 to the nearest integer? 12 What is 418426258 to the power of 1/3, to the nearest integer? 748 What is the third root of 823159013 to the nearest integer? 937 What is 188809833 to the power of 1/6, to the nearest integer? 24 What is the cube root of 15546648 to the nearest integer? 250 What is the fourth root of 993650273 to the nearest integer? 178 What is the square root of 28836344 to the nearest integer? 5370 What is the square root of 49881700 to the nearest integer? 7063 What is 1995484495 to the power of 1/9, to the nearest integer? 11 What is the ninth root of 770298535 to the nearest integer? 10 What is 16572982 to the power of 1/2, to the nearest integer? 4071 What is 470886797 to the power of 1/3, to the nearest integer? 778 What is 2876002143 to the power of 1/4, to the nearest integer? 232 What is the third root of 549162970 to the nearest integer? 819 What is 1637593768 to the power of 1/2, to the nearest integer? 40467 What is the cube root of 352514053 to the nearest integer? 706 What is 2784705249 to the power of 1/2, to the nearest integer? 52770 What is 1415356421 to the power of 1/3, to the nearest integer? 1123 What is 255984694 to the power of 1/3, to the nearest integer? 635 What is 510677051 to the power of 1/3, to the nearest integer? 799 What is 70866175 to the power of 1/2, to the nearest integer? 8418 What is 300596707 to the power of 1/6, to the nearest integer? 26 What is the third root of 1672292220 to the nearest integer? 1187 What is 5693436688 to the power of 1/9, to the nearest integer? 12 What is the cube root of 729476206 to the nearest integer? 900 What is the third root of 31114726 to the nearest integer? 315 What is the ninth root of 186238079 to the nearest integer? 8 What is the square root of 78301870 to the nearest integer? 8849 What is the fifth root of 33474565 to the nearest integer? 32 What is 100230360 to the power of 1/10, to the nearest integer? 6 What is 8928030230 to the power of 1/3, to the nearest integer? 2075 What is 46094606 to the power of 1/8, to the nearest integer? 9 What is 785756257 to the power of 1/3, to the nearest integer? 923 What is the fourth root of 74663282 to the nearest integer? 93 What is the cube root of 3741285163 to the nearest integer? 1552 What is 292119688 to the power of 1/4, to the nearest integer? 131 What is 3004393490 to the power of 1/2, to the nearest integer? 54812 What is the third root of 19328655 to the nearest integer? 268 What is 271991689 to the power of 1/5, to the nearest integer? 49 What is the fourth root of 4385243851 to the nearest integer? 257 What is the ninth root of 151791595 to the nearest integer? 8 What is the fourth root of 85034074 to the nearest integer? 96 What is 46985913 to the power of 1/2, to the nearest integer? 6855 What is 245264850 to the power of 1/2, to the nearest integer? 15661 What is the tenth root of 219728306 to the nearest integer? 7 What is 1527611312 to the power of 1/2, to the nearest integer? 39085 What is 45233935 to the power of 1/3, to the nearest integer? 356 What is 46512880 to the power of 1/2, to the nearest integer? 6820 What is the square root of 895813990 to the nearest integer? 29930 What is the square root of 27174389 to the nearest integer? 5213 What is 113325829 to the power of 1/2, to the nearest integer? 10645 What is 546255913 to the power of 1/2, to the nearest integer? 23372 What is the seventh root of 1287898 to the nearest integer? 7 What is 2704221915 to the power of 1/3, to the nearest integer? 1393 What is 2687075525 to the power of 1/3, to the nearest integer? 1390 What is 78923460 to the power of 1/3, to the nearest integer? 429 What is 36889782 to the power of 1/2, to the nearest integer? 6074 What is the square root of 90482876 to the nearest integer? 9512 What is the ninth root of 11343476 to the nearest integer? 6 What is the ninth root of 37556176 to the nearest integer? 7 What is the third root of 562085495 to the nearest integer? 825 What is the sixth root of 2415818916 to the nearest integer? 37 What is 46162805 to the power of 1/5, to the nearest integer? 34 What is the square root of 588520451 to the nearest integer? 24259 What is the fourth root of 355132037 to the nearest integer? 137 What is 2375075618 to the power of 1/3, to the nearest integer? 1334 What is the fifth root of 23910630 to the nearest integer? 30 What is 1434345298 to the power of 1/8, to the nearest integer? 14 What is the seventh root of 53382009 to the nearest integer? 13 What is 276971228 to the power of 1/5, to the nearest integer? 49 What is 379290844 to the power of 1/3, to the nearest integer? 724 What is the square root of 56418088 to the nearest integer? 7511 What is 148685854 to the power of 1/3, to the nearest integer? 530 What is the third root of 53171128 to the nearest integer? 376 What is the squa	{ "pile_set_name": "DM Mathematics" }
24z Let r(c) = -c2 + 2c - 2. Let u(p) = 3p2 - 5p + 5. Let x(w) = -5r(w) - 2u(w). Let f(n) be the first derivative of n*2 + 1. Determine x(f(g)). -4g*2 Let o be (((-6)/(-9))/(-2))/(-10). Let y(n) be the third derivative of 0n*4 + 0n*3 + 0 + 0n - 2n2 + on*5. Let z(c) = c. Determine z(y(s)). 2s*2 Let y(i) = 2i. Let h(q) = -602q2. What is y(h(x))? -1204x*2 Let l(m) = 4m*2. Let i(q) = 1011q. Determine i(l(p)). 4044p2 Let f be (-3 - -1)/(10/(-20)). Let d(p) = fp*2 + 2p*2 - 5p*2 + 0p*2. Let b(y) = 3y*2 - 5y*2 + 0y*2. Give b(d(v)). -2v*4 Let s = -18 + 18. Let c(a) be the third derivative of 0 + 0a*4 + 2a*2 + 0a + sa3 - 1/20a*5. Let n(q) = 2q*2. Give c(n(f)). -12f*4 Let z(j) = -j. Let b(k) = 27k + 15. Determine z(b(p)). -27p - 15 Let r(p) be the first derivative of -p2 - 1. Let o(g) be the third derivative of g4/12 + 5g*2. Determine r(o(y)). -4y Let h(t) = 15t. Let q(v) = -v + 2188 - 2188. Determine q(h(w)). -15w Let z(k) = k*2. Let t(o) = -18o*2 + 2. Give z(t(v)). 324v*4 - 72v*2 + 4 Let k(j) = -5j + 4. Let z(n) = n - 1. Let p(d) = -k(d) - 4z(d). Let b(f) = -3f*2. Calculate p(b(y)). -3y*2 Suppose -3s + 4 + 5 = 0. Let t(m) = s - 3 - m + 2m. Let b(x) = -1. Let h(r) = -r + 1. Let q(u) = 4b(u) + 4h(u). Calculate q(t(f)). -4f Let p(m) = -2m. Suppose 0 = -k + 7 - 5. Let b(z) = kz + 0z - 6z. Calculate p(b(r)). 8r Let g(u) be the third derivative of u5/60 - 21u*2. Let c(d) = -17d*2. Determine g(c(q)). 289q4 Let o(k) = k2. Let b(t) = 2t - 7t - 3t + 11t. What is b(o(h))? 3h2 Let d(k) be the third derivative of -k5/60 - 7k*2. Let b(x) be the second derivative of 2x*3/3 + x. What is b(d(f))? -4f*2 Suppose -3 + 15 = -2g. Let a be (-4)/g(-7 + 10). Let j(r) = -3r*a + 7r*2 - 2r*2. Let y(x) = -4x*2. What is y(j(p))? -16p*4 Let r(n) = 2n. Let u(s) = -2s. Let p(t) = 2t - 4. Let f be p(4). Let j(q) = fu(q) + 5r(q). Let v(l) = -2l. Calculate j(v(w)). -4w Let w(h) = 2h. Let t(r) = -r. Let j(o) = 2o. Let k(y) = j(y) + 4t(y). Calculate k(w(b)). -4b Let z(k) = -892k. Let m(d) = d2. What is m(z(l))? 795664l*2 Let x(s) be the first derivative of 2s*3/3 + 1. Let b(l) be the third derivative of 0 - 1/12l*4 + 0l - 2l2 + 0l*3. Calculate b(x(r)). -4r*2 Let w(l) = -7l - 6. Let v(j) = j + 1. Let d(a) = -6v(a) - w(a). Suppose -q - 2b = 0, 7 = -q + 2q - 5b. Let i(t) = -qt2 - 2 + 2 + 0. Give i(d(k)). -2k*2 Let f(v) = 43v*2. Let k(m) = -5m*2. What is f(k(x))? 1075x*4 Let g(l) be the second derivative of -5l*4/12 + 25l. Let r(i) be the second derivative of -i*4/12 + 2i. Calculate r(g(v)). -25v4 Let a(f) be the third derivative of f5/60 + 15f*2. Let y(t) = 28t. What is a(y(i))? 784i2 Let a(z) = -4z - 5. Let q(y) = -15y - 21. Let g(w) = 21a(w) - 5q(w). Let h(u) = -2u. Calculate g(h(i)). 18i Let y(a) = a2 - 34a. Let h(o) = -o. Give h(y(g)). -g*2 + 34g Let l(s) = -s - 3. Let f be l(-5). Let r(k) = k*2 - 2k + fk. Let a(h) be the third derivative of -h5/60 + 10h2. Determine r(a(d)). d4 Let f(q) = -3q2. Suppose 2j + 10 = -2u + 6u, -4u - j - 5 = 0. Let r(o) = 5o - o + uo. Give f(r(k)). -48k*2 Let z(a) = 2a*2. Let h(b) = 18b*2 + 2b. Calculate z(h(n)). 648n4 + 144n*3 + 8n2 Let c(j) be the third derivative of -j4/8 - 27j2. Let p(x) be the second derivative of -x3/3 + x. Give c(p(f)). 6f Let u(x) = -61x - 2. Let l(n) = 2n*2. Determine l(u(a)). 7442a*2 + 488a + 8 Let x(j) be the third derivative of 2j5/15 - j2. Let g(i) = -16i + 22. Let w(d) = -3d + 4. Let m(p) = 6g(p) - 33w(p). Calculate x(m(k)). 72k*2 Let h(v) = -1069v. Let k(g) = 2g2. Determine h(k(u)). -2138u2 Let c(n) = n. Let m(i) be the first derivative of i2/2 - 10. Give c(m(k)). k Let o(v) = -2v. Let s(r) = -12290r*2. What is s(o(f))? -49160f*2 Let o(l) = -3l + 4. Let z(i) = i + 6. Calculate o(z(a)). -3a - 14 Let n(g) = 2g*2. Let f(u) = -984u - 1. Determine f(n(r)). -1968r2 - 1 Let l(o) = 4o*2. Let f = -25 - -17. Let r = f - -11. Let a(m) = 6m2 + m2 - 3m2 - rm*2. What is a(l(h))? 16h*4 Let a(i) = -7i + 5i - i. Let p(c) = -6c*2. Determine a(p(o)). 18o2 Let z(l) = l2 + 2l2 - 2l*2. Let n = 5 - 2. Let d(h) = -nh + 6h - 2h. Give d(z(u)). u*2 Let m(n) = 1. Let g be (-1)/((-1)/3) - 0. Let l(s) = s + 3. Let w(x) = gm(x) - l(x). Let t(q) = 7 + 2q2 - 7 - 3q2. Calculate w(t(r)). r2 Let n(g) = g*2 - 3g - 7. Let i be n(5). Let d(f) = if - 6f + 0f. Let l(h) = -6h*2 + 5h. Let s(q) = -q*2 + q. Let w(o) = -l(o) + 5s(o). Give d(w(b)). -3b2 Let h(k) = -6k*2. Let i(x) = -394x*2 + 2. Calculate h(i(f)). -931416f*4 + 9456f*2 - 24 Let s(m) = 6m. Let d(p) = 2p2 - 153p + 153p. Give d(s(h)). 72h*2 Let b(x) = -x. Let p(r) = -r + 2r + 2r - 5r. Calculate b(p(g)). 2g Let j(t) be the first derivative of -t5/60 + t2 - 1. Let l(o) be the second derivative of j(o). Let x(z) = -z. Calculate x(l(b)). b2 Let f(w) = -w2. Let o(i) = i - 5. Let d be o(7). Let c(a) = -a2 + 4 + d - 6. What is f(c(m))? -m4 Let c(o) = 85o. Let i(a) = -18a2 + 2a. Calculate i(c(p)). -130050p2 + 170p Suppose 0 = -5d + 2g - 5g + 4, 2d + 8 = 2g. Let l = 5 + d. Let s(c) = -l + 4 - 3c*2. Let a(b) = -2b*2. Calculate a(s(i)). -18i*4 Let d be 2/(-11) - 24/(-11). Let n(c) = 5c*2 - 6c*d + 4c*2. Let u(i) = 3i. What is n(u(h))? 27h2 Let z(u) = -7u. Let j(h) be the third derivative of -h*5/60 + 8h*2. Give j(z(f)). -49f*2 Let y(u) = -4u2. Let q(o) be the second derivative of o5/120 + o*3/2 + o. Let k(l) be the second derivative of q(l). Calculate y(k(c)). -4c*2 Suppose -2u = -u. Let k(s) = us - s - 9s + 6s. Let v(d) = -4d. Calculate k(v(w)). 16w Let h(l) = 6l. Let n(u) = -2 - 2 + 4 - u. Let y be n(-1). Let q(p) = 1 - 2 + y + p. What is h(q(i))? 6i Let q(l) = 4l*2. Let k(s) = 2926s*2. Give k(q(w)). 46816w*4 Let u(k) = -4028k. Let z(o) = -2o2. What is z(u(t))? -32449568t2 Let r(u) be the third derivative of -u6/720 - u*4/24 + 2u2. Let v(q) be the second derivative of r(q). Let y(x) = x2. Give v(y(t)). -t*2 Let v(h) be the first derivative of 2h2 + 1. Let x(k) be the first derivative of k3/3 - 2. Calculate x(v(g)). 16g2 Let u(g) = 7g + 5. Let q(b) be the third derivative of 1/3b3 + 0b + 0 + 3b2 + 1/8b*4. Let r(p) = 5q(p) - 2u(p). Let n(c) = 6c. Calculate r(n(l)). 6l Let f(s) be the first derivative of -2s*3/3 + 1. Let a(v) be the second derivative of -2v*4/3 - 6v. Calculate a(f(k)). -32k4 Let d(s) = 2s. Let h(t) = 2206t. Give h(d(c)). 4412c Let a(c) = 2c2. Let h(u) = 2u - 655. Determine h(a(f)). 4f2 - 655 Let o(b) = -2b - 9. Let z(v) = -15v2. What is z(o(t))? -60t*2 - 540t - 1215 Let a(g) = -4g2 + 5g2 + g2. Let p = 3 + -10. Let w(z) = 4z - 7. Let j(y) = 2y - 3. Let q(u) = pj(u) + 3w(u). Give a(q(m)). 8m2 Let j(k) = -4k*2. Let u be ((-14)/6 + 3)/1. Let g(h) be the first derivative of 1 - uh*3 + 0h*2 + 0h. Give j(g(z)). -16z4 Let j(s) = -4s*2. Let l(b) = -80b*2 + 2. Give l(j(i)). -1280i*4 + 2 Let n(k) = 30k2. Let q(b) be the second derivative of b4/12 - b + 1. Determine n(q(c)). 30c4 Let v(h) = -2h. Let d(b) be the first derivative of b5/30 + b3 - 4. Let c(t) be the third derivative of d(t). Determine c(v(l)). -8l Let t(n) = -3n - 2 + 2 + n. Let w(d) be the second derivative of d*3/6 + d. What is w(t(a))? -2a Let a(o) be the first derivative of o*3/6 + 2o - 5. Let t(m) be the first derivative of a(m). Let l(x) = 6x. Determine t(l(p)). 6p Let v(o) = -2o2 + 12o + 6. Let i(f) = 2f + 1. Let j(y) = -6i(y) + v(y). Let d(k) = 26k. Calculate j(d(a)). -1352a*2 Let f(l) = 4l*2 + 24. Let u(q) = 31q. Give u(f(k)). 124k2 + 744 Let h(l) = 2l. Let u(d) = -3930d - 2. Determine u(h(z)). -7860z - 2 Let j(q) = -37q + 33q + 1 - 1. Let f(k) be the first derivative of -2k3/3 + 1. Calculate f(j(x)). -32x*2 Let n(s) = -2s - 2. Let f(o) = -2. Let q(a) = -2f(a) + 2n(a). Let v(b) = 7b2. Let j(i) = i2. Let x(p) = -5j(p) + v(p). Calculate x(q(k)). 32k2 Let j(v) = 21v**2 +	{ "pile_set_name": "DM Mathematics" }
+ 8. Let a be r(-2). Let s be 144 + 2 + -1 + a. Suppose 4o = 2b - 444, s = 2b - 3o - 300. What is the hundreds digit of b? 2 Suppose t + 2482 = 2n, 3728 = 3n + 3t - 7t. Suppose 0 = -9z - n + 7585. What is the units digit of z? 5 Let s(w) = w2 - 9w. Let a be s(9). Suppose 2x + 6y = 2y + 174, -3x - 4y + 263 = a. What is the units digit of x? 9 Let s(f) = 64f*2 + 17f - 93. What is the tens digit of s(16)? 6 Let m be 4107/3 + 8/2 + -2. Suppose 1119 = 5a - m. What is the hundreds digit of a? 4 Let n = -1121 - -1704. Let o = n - 258. What is the units digit of o? 5 Let k = 10569 + 29701. What is the ten thousands digit of k? 4 Let z(w) = -w3 + 6w*2 + 3w - 17. Let a be z(6). Let l(b) = 107b3 - 3b*2 + 4b. What is the units digit of l(a)? 8 Let b = 172 - 169. Suppose ba + 252 = 7a. What is the units digit of a? 3 Let r(t) = -t*3 - 15 + 23 - 8 + 4t*2 + 2t. Let i be r(4). Suppose -n = -i - 63. What is the tens digit of n? 7 Let c(t) = 348t2 - 8t + 22. What is the hundreds digit of c(3)? 1 Let c(m) = -21 + 57 - 6 - 54m + 104. What is the units digit of c(-19)? 0 Suppose t = 4t + 7t - 4t. Let v(b) = b3 - b2 + b + 894. Let i be v(0). Suppose 9j - i - 330 = t. What is the units digit of j? 6 Let i = 727 + 777. Let c = i - 420. What is the units digit of c? 4 Let q(t) = -t3 + 3t + 3. Let f be q(-2). Suppose -3p - 2p = 5w - 1590, 4p - fw = 1254. What is the tens digit of p? 1 Let x be ((-25)/7 - -4)/((-3)/(-63)). Let h(f) be the second derivative of -f4/6 + 11f*3/3 - 10f*2 - 2f. What is the tens digit of h(x)? 1 Let d = -130 - -134. Suppose -w + 5o + 92 = do, -4o = 8. What is the tens digit of w? 9 Suppose -3r + 4746 = -5f - 5216, -4f = -r + 3323. What is the hundreds digit of r? 3 Let q be (-1044)/810/15. What is the units digit of (-3 - (-33)/15) + q/(-15)? 5 Let g(f) = -f - 3. Let o(a) = -2a - 4. Let i(c) = 3g(c) - 2o(c). Let z be i(5). What is the tens digit of (-2 - -99) + 1/((-2)/z)? 9 Let c be (-13)/(-3) + 9/(-27). Suppose -10a + 5a = -ci + 2631, 5a = -4i + 2641. What is the tens digit of i? 5 What is the ten thousands digit of (-19 - -18)12/30 - (-174157)/5? 3 Let u = -1545 - -2204. Suppose u = -8m - 341. Let t = m - -260. What is the units digit of t? 5 What is the units digit of (-1 - 11/(-9)) + (-4771)/(-117) + 26? 7 Let c(h) be the first derivative of -h3/3 - 14h*2 - 42h - 95. What is the units digit of c(-11)? 5 Let n(b) = b*3 - 2b*2 + b - 3. Suppose -z - 8 = 5y, y = 1 - 3. Let r be n(z). Let m(o) = 81o2 - 1. What is the units digit of m(r)? 0 Let z = -17885 + 26083. What is the tens digit of z? 9 Let w(u) = -u + 5. Let l be w(1). What is the units digit of (-888)/6-2 + l? 0 What is the thousands digit of 1186 + (17 - 12) - -61? 1 Let m = 84798 + -37271. What is the tens digit of m? 2 Suppose -29570 = -51c + 28774. What is the tens digit of c? 4 Let w(a) = -157a - 470. What is the tens digit of w(-26)? 1 Suppose -1966319 + 6905199 = 80m. What is the thousands digit of m? 1 Suppose 0 = 18k + 4k - 22. Suppose 0 = q + 4 + k, -d + 3q = -830. What is the tens digit of d? 1 Suppose 5y + 9504 = -4u, -3u + 3y - 3111 = 3990. Let v = -1391 - u. What is the units digit of v? 0 Suppose 40m = 171451 + 451429. What is the tens digit of m? 7 Suppose -4k + 3k = -5. Suppose 0g + 5q - 520 = -kg, -2g = -3q - 233. Let r = g + -46. What is the units digit of r? 3 Let g = -13 + 17. Suppose -3w - i - 3 - 3 = 0, 2w = gi - 18. Let o = w + 23. What is the units digit of o? 0 Suppose -5m + 186 = 2w + 1, 225 = 3w - 3m. Suppose w + 37 = r. What is the hundreds digit of r? 1 Let l(i) = i*2 + 3i + 5. Let u be l(0). Suppose -uo - 11 = 39. What is the hundreds digit of -2 + 5/(o/(-326))? 1 Suppose 6y + 4z = 2y - 16, 2z = 3y - 8. Suppose y = 3t - 3a + 6a - 429, -4a = -4. What is the hundreds digit of (1/4 - 10/(-8))t? 2 Let g(c) = c3 + 40c*2 - 26c + 5. What is the thousands digit of g(-35)? 7 Let p(s) = -12s + 6s2 + 17 - 49 + 37 + s3. What is the tens digit of p(-6)? 7 Suppose 0 = 9x - 14 - 22. Suppose -xu + 5q + 203 = 0, -265 + 5 = -5u + 5q. What is the units digit of u? 7 Suppose 0 = -2l + 8, -2t - 5l + 39 = -121. Suppose 0 = -4g + t - 14. What is the units digit of g? 4 Suppose -5386092 = -257l + 3168410. What is the units digit of l? 6 Let o(s) = 6s2 + 3s + 1. Let r(g) be the first derivative of -3g2 - 9g + 19. Let p be r(-2). What is the tens digit of o(p)? 6 Suppose -y + 17 = 5c, -y = 3y + 2c - 50. What is the tens digit of y + -7 + 1 + 383? 8 Let r = 891 + 4501. What is the thousands digit of r? 5 Suppose -166v - 12458 = -b - 162v, v - 12438 = -b. What is the tens digit of b? 4 What is the hundreds digit of (2/2)/(23/80362)? 4 Let m = -488 - -486. Let t(c) = 197c*2 - 13c - 21. What is the tens digit of t(m)? 9 Suppose 5d - 21l - 64973 = -19l, -5d - 4l = -64979. What is the units digit of d? 5 Suppose d = -2k - 3k, 0 = -5d. Suppose 2s = -0s + 4z + 156, k = -4s - 3z + 312. Let l = s - 70. What is the units digit of l? 8 Suppose 155r + 108478 = 25542 + 901956. What is the tens digit of r? 8 Suppose 1949 = 29v - 2575. Let b = 568 + v. What is the tens digit of b? 2 Let i(l) = -l2 + l - 1. Let v(r) = -3r*2 - 18. Let k(c) = -4i(c) + v(c). Let o be k(-7). Suppose 5u = 57 + o. What is the tens digit of u? 2 Suppose 0 = 37r - 6r - 379440. Suppose -2798x - r = -2807x. What is the tens digit of x? 6 Let r(v) be the second derivative of 3/4v*4 - 1/20v*5 + 13v + 0 + 7/6v3 - 2v*2. What is the units digit of r(8)? 6 Suppose -2420 = -5v - p + 1302, 5p = -3v + 2220. Let r = -161 + v. What is the tens digit of r? 8 Let n = -64 + 73. Suppose a = 2a - n. What is the tens digit of (-2)/(-2)(-14 + a - -196)? 9 Let t = 503 - -387. Let x = 1628 - t. What is the units digit of x? 8 Let l(j) = 2 + 2j + 3 - 3j*2 - 5 + 2. Let x be l(-2). Let a(r) = -r - 10. What is the units digit of a(x)? 4 Suppose 35q - 32304 = 32q - 4a, 2q - 21528 = -4a. What is the ten thousands digit of q? 1 Let n be (0 - 1) + (-8)/(16/550). Let h = 430 + n. Let f = -115 + h. What is the units digit of f? 9 Suppose 24j + 1212 - 4212 = 0. Let i = 397 - j. What is the hundreds digit of i? 2 Let y(k) = k2 - k + 1. Let m(g) = 6g*2 + 2g + 16. Let r(s) = -m(s) + 5y(s). Let j be r(-9). Let n = j + 64. What is the tens digit of n? 3 Let z(u) = u2 + 6u - 5 + 6u - 11 - 10. What is the hundreds digit of z(23)? 7 Suppose 0 = -5t + 137 + 48. Let g = -32 + t. Suppose -6i + gi = -84. What is the units digit of i? 4 Suppose -3p + w = -w - 13, -3p + 4w = -17. Suppose -3i - 4o - 28 = 0, po = -2i - 3i - 54. Let f(g) = -2g - 8. What is the tens digit of f(i)? 1 Let p(k) = 3k - 61. Let j be p(0). Let l = j + 58. Let r(g) = -4g3 + 2g*2 - 4g. What is the hundreds digit of r(l)? 1 Let k be (10/(-30))/(7/25347). Let w = 2581 + k. What is the hundreds digit of w? 3 Suppose -4w = -3u + 5u - 1292, -1296 = -2u - 5w. Suppose 102 = 10k - u. What is the tens digit of k? 7 What is the ten thousands digit of (-66)/(-11) + -21 - -19251? 1 Let p(h) = h*2 + 2h - 3. Let c be p(-4). Suppose 0 = cj - w - 5004, -3w = -0j + j - 988. What is the hundreds digit of j? 0 Let z be (2/4 - 1)/(4/(-9128)). Let b = 2546 - z. What is the tens digit of b? 0 Let f(j) = -j3 - 29j*2 - 55j - 3. Let v be f(-27). What is the tens digit of (-234(-6)/v)/(1/2)? 1 Suppose -4u - 3j = 2154, 5u - 3u - 2j + 1070 = 0. Let b = 1028 + u. What is the units digit of b? 1 Suppose j + m + 3m = 15, 4j = m + 9. Let f be (-1)/(9/j)-3. What is the units digit of 2/(f - 0) + 25 + 17? 4 Let m(a) = 6809a*2 - 232a - 232. What is the units digit of m(-1)? 9 Let q be 1/((-1)/6) - -837. Suppose -f + y + q = -0y, -8 = 4y. What is the hundreds digit of f? 8 Suppose -4c = -3s - 4048, -1705 = s + c - 351. Let z be 2/122 - s/(-24). What is the units digit of 4/14 + (-5024)/z? 0 Let x(j) = -9 - 8j + 125 + 18j + 12j. What is the tens digit of x(24)? 4 What is the units digit of (-4)/(-7) - (-124704)/63? 0 Suppose -3c - 2b + 135 = 0, 5c = -2b - 2*b + 225. Let p = -32 + c. Suppose q = p + 66. What is the tens digit of q? 7 Let l(m)	{ "pile_set_name": "DM Mathematics" }
ve -2u + 3 = -f - 4, 1 = -f for u. 3 Solve -4c + 10 = -5b - 10, 3c + 5b = -20 for c. 0 Solve j + 3n = -0n - 4, 5j - 4n - 18 = 0 for j. 2 Solve 0 = -4t - 3b - 1, -t - 306 = -2b - 292 for t. -4 Solve -4g - 16 = -4y, 2g + 11 = 4y - 7 for g. 1 Solve 3j + 2d + 0d = 2, 0 = -5j + d + 25 for j. 4 Solve 2j + 8 = -4x - 0j, -5x = -5j + 10 for x. -2 Solve -3t + 17 = 2l + 2t, -2l - 13 = -5t for l. 1 Solve 0 = -3q + 5c - 25, c + c = 4q + 10 for q. 0 Solve 2f - 25 = 5t + 6f, 0 = -3t + f - 15 for t. -5 Solve -485 = -b + 2j - 474, -3j = 18 for b. -1 Solve -5q = -4z + 1, -2z + 1 = -3z + q for z. -6 Solve 4i = 3o + 15, 2o - 3i = -16 + 5 for o. -1 Solve -t + 4 = 0, 4g - 4 = 6g - 2t for g. 2 Solve -4w + 5b - 23 = 4b, 0 = 5w - b + 28 for w. -5 Solve 9k + 25 = 12k + 5j, 0 = 2k + 4j - 20 for k. 0 Solve 6 = -5j - 4m + 11, -m + 2 = 2j for j. 1 Solve 4z - 15 = -a, -4z - 3a - 12 + 33 = 0 for z. 3 Solve 0 = 2n + 6, -13 = -o + 2o + 5n for o. 2 Solve 2q + 0 - 8 = 4m, -2q + m = -8 for q. 4 Solve 72h = 2m + 71h - 11, -4h = -3m + 24 for m. 4 Solve 5v = -25, 0 = 5b - 3b + 2v for b. 5 Solve 5r + 20 = -5z, 57r = 60r - z + 16 for r. -5 Solve -5b - 8c = -5c - 15, -3c = 4b - 15 for b. 0 Solve 0 = 2f, -5f + 3 = -0j + 3j for j. 1 Solve 0 = -5j - 0j + 2s + 21, 5j + 5s = 0 for j. 3 Solve -q + 2q - 2 = h, -3h = -q + 6 for q. 0 Solve -3 = -z - 3s + 9, 5s - 20 = 0 for z. 0 Solve 5q + 3t = -40, -38q + 37q - 4t - 25 = 0 for q. -5 Solve 0u + u = 2, -2v - 2u + 6 = 0 for v. 1 Solve 0 = c - 4o + 10, 0 = -c - o + 6o - 12 for c. -2 Solve -2 = -2j, -s - 2s + 1 = -2j for s. 1 Solve -10 = 5l, -l = 4t - 4l + 14 for t. -5 Solve 5g + 11 = -2o, -3g + 4 = -3o - 2 for g. -1 Solve 0 = 4k - 4m - 12, -5k + 24 = 3m + 1 for k. 4 Solve u = -t, 2u + 46t - 43t = -4 for u. 4 Solve -2q + 4y + 9 = 3, -2q + 5y + 9 = 0 for q. -3 Solve -4h - 12 = -r, -3r + 5h - h + 20 = 0 for r. 4 Solve 2h - l = -2h + 15, 0 = l - 1 for h. 4 Solve -b - 46 = -5g - 32, -5b - 5g = -20 for b. 1 Solve -2d - 52 = -3w - 64, -2w = -2d + 8 for d. 0 Solve -182s + 3 = -5a - 185s, -8a - 4s = 4 for a. 0 Solve -d - 5g + 105 - 102 = 0, 0 = -3d + 5g + 9 for d. 3 Solve 2b - 4t - 64 = -82, 21 = -b + 5t for b. -1 Solve 5p = -5h - 10, 4h - 31 + 23 = 4p for h. 0 Solve 5d = y + 8, -y - 2y - 4d = -14 for y. 2 Solve 3x = i + 11, -3i - x + 7 = 20 for i. -5 Solve -5j - 23 = 4y, -5y - 3j - 33 = -14 for y. -2 Solve -v + 0v - 5 = -5c, -c = 2v - 12 for v. 5 Solve -4x = 5i - 8, 0 = 11x - 14x - 3i + 6 for x. 2 Solve 3c + 4 = w - 4, -4w = -3c - 14 for c. -2 Solve -m - 11 = 2i, -4i + 3 = -2m + 13 for i. -4 Solve 2j = 0, -3b + 15 = -0b + 3j for b. 5 Solve -9k + 6k - 19 = -4w, 0 = 2k - 5w + 15 for k. -5 Solve 3a - 4 = 4w, 5w - 1 + 3 = 3a for w. 2 Solve -3x + 74v - 22 = 70v, -3x - 4v + 10 = 0 for x. -2 Solve -x - 4k - 18 = 0, 4x - 1 = -5k - 18 for x. 2 Solve 0 = 3d - 15, -z - 15 = 2d - 28 for z. 3 Solve -4s - 3c - 9 + 30 = 0, -s = 3c - 12 for s. 3 Solve -5z + 5k = 9k - 17, 2k = -z + 1 for z. 5 Solve 42q - 40q + 10 = i, -13 = -q - 4i for q. -3 Solve -4s + 1 - 9 = 4a, -5a = s + 10 for a. -2 Solve -6 = -2h - 14, 3y = -5h - 20 for y. 0 Solve 0 = g - 2, -4z + 5z = -g - 1 for z. -3 Solve 4s - 5m - 22 = 0, 100s + 8 = 104s + 2m for s. 3 Solve -3g + 4c + 13 = -0c, 4c = -g - 17 for g. -1 Solve o = -4f + 5, -o + 4f - 7 = -4o for o. 1 Solve -16o + 14o - 6 = -3q, 16 = -o - 5q for o. -6 Solve -24w + 25w = -5u + 22, -3u + 27 = -4w for w. -3 Solve 2i + 40d + 9 = 35d, 3d - 1 = 2i for i. -2 Solve -5 + 0 = -3w - 2o, 4o - 5 = -w for w. 1 Solve 2i - 5u + 13 = 3i, 4u + 1 = 3i for i. 3 Solve 2t = 19h - 18h - 14, -2h = 3t + 7 for h. 4 Solve 5p - 2h - 8 = 0, -3h = 4p - 5h - 8 for p. 0 Solve 0 = 2y - 3f - 8, -4f + 8 - 20 = -4y for y. 1 Solve -16 = -4b - m + 4m, 4b - 5m - 16 = 0 for b. 4 Solve 2z + 4 = 4z, -12 = -2g - 5z for g. 1 Solve 0 = -5h - 3v + 25, 10h - 10 = 8h + 4v for h. 5 Solve -2c - 6 = 2t, 4 + 18 = t - 4c for t. 2 Solve 2k + 3s = -13, -31s - 21 = 3k - 26s for k. -2 Solve -1 = -2k + 3j, -7 = -3k - 2j + 14 for k. 5 Solve 4s + 3x = -13, -4s - 9 = x - 2 for s. -1 Solve s + 3 + 1 = -5z, -5 = -5s for z. -1 Solve 7u = 2u + 15, 2f - 4u + 6 = 0 for f. 3 Solve 0v + 4v - 21 = -5s, -2v + 3 = -5s for s. 1 Solve -i + 18 = 20, 0 = 2t - 3i - 10 for t. 2 Solve -s = -3l - 11, 29 = 5s + 3l + 10 for s. 5 Solve -3z + 27 = -4z - 5h, -5h = -z + 23 for z. -2 Solve -15 = -t - 3i, 10t = 8t + 3i - 6 for t. 3 Solve -14 = 2w + 4q, -2w + 18 - 5 = -5q for w. -1 Solve -13l + 14l = 0, -5v + 4l = -15 for v. 3 Solve 0 = -3m + 5m + 4, -5s + 5m = 0 for s. -2 Solve -5o - 5h = 15, -16o - 17 = -17o + 4h for o. 1 Solve -19 = 3j + 2v, 3j = -v - 0 - 17 for j. -5 Solve 13j - 18 = 15j + 2s, 36 = -2j - 5s for j. -3 Solve -3d - 16j + 18j - 5 = 0, -2d + 3j - 10 = 0 for d. 1 Solve -k - 8 = -3h, -5h - 2k = -8h + 10 for h. 2 Solve 46d - 6 = -f + 41d, 2d = 0 for f. 6 Solve 0 = -o - 5u - 10, 3o - 6 = 8o + 3u for o. 0 Solve 0 = -5b + 15 - 5, 2b = -l + 5 for l. 1 Solve 4o - 15 + 0 = -n, 0 = 3n - 3o + 15 for n. -1 Solve -3v = 3p + 24, -6p - 8 = -v - 3p for v. -4 Solve 0t - 4t = -4r - 16, 2r = -2 for t. 3 Solve 3f - 4f - 3a - 10 = 0, -2 = -2f + 5a for f. -4 Solve v = 4x + 17, -3x - 2v = -2x + 11 for x. -5 Solve -3w = -5j - 4 + 14, -w - 3j + 6 = 0 for w. 0 Solve -3y - 4f = -7, 3f - 19 = 22y - 27y for y. 5 Solve -3 = -a, -4a + 8 = g - 2 for g. -2 Solve 5w = 4c - 42 + 49, 3c - 6 = 0 for w. 3 Solve -3b = -3k + 2b + 7, -k + 2b = -2 for k. 4 Solve -5z = 2g - 10, -9 = 3z - 4g + 11 for z. 0 Solve 2p - 1 = -j, 4j - 7 = -p - 24 for j. -5 Solve 0 = -2x - 4n + 12, 5n = 7x - 2x for x. 2 Solve 3h - 5q = 0, 0 = -9h + 8h + 3q + 4 for h. -5 Solve -2j = 4q - 1 - 11, j + 6 = 4q for q. 2 Solve 13s = 8s + 2w - 9, -w + 7 = -5s for s. -1 Solve 2 = p + 2z, 4p - z = 6p - 1 for p. 0 Solve -2c = 5i - 14, 34 - 27 = i - c for i. 4 Solve 0 = -3f + k - 11, -29 = 2f - 2k - 3k for f. -2 Solve -4p = -2j - 10, -7 - 8 = -5j for p. 4 Solve 2x = 3m - x + 12, -m = -4x + 16 for m. 0 Solve -4s + 19i - 18i = -4, 4i = -3s - 16 for s. 0 Solve -5o + 1 = 2h, 3o + o = -2h for h. -2 Solve -2p = 3u - 1, 0 = -5p + 4u + 47 - 10 for p. 5 Solve 19u + v = 16u + 2, -2u - 4v + 8 = 0 for u. 0 Solve -5t = 4v + 28, -v + 14 = -19t + 15t for v. -2 Solve -4v + 2h - 10 = 0, 4v + 0h - 5h - 5 = 0 for v. -5 Solve 4 = 9b - 13b + 3r, 5 = -5b + 2r for b. -1 Solve 3b = -12, -8b - 24 = 2l - 3b for l. -2 Solve 4w + 26 + 7 = 5f, 3w + 31 = 5f for w. -2 Solve d - 3p = 0, 5d + 3p - 2p = 0 for d. 0 Solve -738j + 733j + 2p = 2, 3j + 18 = -3p for j. -2 Solve 5o + y + 5 = 0, 0 = 3o + 3y + 12 + 3 for o. 0 Solve 0 = -4u + 8, 23 = -29j + 32j + 4u for j. 5 Solve -3a + 6 = 3x, 13 = 17x - 15x - a for x. 5 Solve -3n - 2 = -4q - q, -5n = 2q - 7 for q. 1 Solve -5a = 2p + 8, 0p + 2a + 12 = -3p for p. -4 Solve 2l + 4i - 12 = 0, -4l + 2i + 27 - 43 = 0 for l. -2 Solve -2f - i = 0, f + 2i - 2 = -f for f. -1 Solve -4f - 4v + 6v = -10, 5 = 5f - v for f. 0 Solve -37 = 5f - 3j, 0 = 3f - 2f + j + 1 for f. -5 Solve 3w - 4f + 24 = -3, 3f = -4w - 11 for w. -5 Solve -4y + 6 = -2a, -3y = -2a - 18 + 12 for y. 0 Solve -7v + c + 20 = -12v, 5v - 5c + 20 = 0 for v. -4 Solve -5r + 5c + 2 + 28 = 0, -3c - 12 = 0 for r. 2 Solve -4q + 4n + 128 = 112, -3n - 15 = -4q for q. 3 Solve 5d = -2b + 16, -2d - d = -4b - 20 for b. -2 Solve r = 2u + 6, -13u + 8u = -r + 21 for r. -4 Solve -2y - u = -2, 0 + 12 = 3u for y. -1 Solve -3h - 2o = -o - 10, -4h + 4o = -8 for h. 3 Solve 2f - 8 = 0, 2l + f - 8 = -4 for l. 0 Solve -7o = -6o - 3v + 4, o - 2v + 2 = 0 for o. 2 Solve -3t - 3f = 21, -t - 2f - 11 = -0t for t. -3 Solve -3h = -2u + 4, -71h + 74h + 10 = -4u for u. -1 Solve 3y - 23 = 2i, -40 + 25 = -3y for i. -4 Solve -4m + 3i + 4 = 0, 12 - 13 = -m + i for m. 1 Solve -5z + 2s = -2, 2z + 5*s + 3 = -2 f	{ "pile_set_name": "DM Mathematics" }
). Suppose 74 = -vo + 23. Sort o, 2, g in increasing order. o, g, 2 Let y = 6732 - 6733. Put y, -235, -2 in decreasing order. y, -2, -235 Suppose 13r - 80 = -7 - 8. Let x = -40 + 21. Let h = x - -22. Put h, 2, 1, r in decreasing order. r, h, 2, 1 Let h = -422.1 - -430.1. Sort 2/5, 45, h in ascending order. 2/5, h, 45 Suppose -4t = -t + 13t. Suppose 12c = 3c - 18. Suppose -15 = 2a - 7a. Sort c, a, t, -4 in decreasing order. a, t, c, -4 Let i = 1356 - 1322. Put 2, 0, i in decreasing order. i, 2, 0 Let p = -133.691 - 0.309. Let h = -145.6 - p. Let c = -12 - h. Sort 0.02, 1, c, -1/5 in ascending order. c, -1/5, 0.02, 1 Let x = -232 - -237. Let v be (-9 - -4) + 5 + x. Sort -7, -2, v, 2. -7, -2, 2, v Let r = -0.11 - -0.1. Let d = 197 + -372. Let o = 174 + d. Sort r, 4, o. o, r, 4 Suppose 0 = -4b - b. Suppose b = -s + o, -8 = -s - o - 4. Let f = -11598 - -11602. Put s, f, -6 in decreasing order. f, s, -6 Let u be (0/3)/(-5 - (8 + -11)). Put u, -55/4, -1/5, -3 in decreasing order. u, -1/5, -3, -55/4 Let f = 243 - 244.3. Let g = -3.8 - -3. Let v = g - f. Put v, 3/16, 2 in ascending order. 3/16, v, 2 Suppose 0 = 8y - 82 - 46. Let d be (-372)/y + (-16)/(-64). Let u(p) = p2 + p + 5. Let g be u(0). Sort 1, g, d in increasing order. d, 1, g Let t = -270 - -367. Let i = -102 + t. Let k(f) = -f3 - 2f2 - 3f - 1. Let b be k(-2). Sort b, i, 1, 0 in descending order. b, 1, 0, i Suppose -d + 5d = 12, 15 = -3y + 5d. Let q(l) = l3 - 7l*2 - 6l - 1. Let t be q(8). Suppose 3g - 6g - t = y. Put -4, 5, g in descending order. 5, -4, g Let u = -17.5 + 14. Let g = -3 - u. Let p = 2867 - 2868. Sort g, -1/5, p in decreasing order. g, -1/5, p Let t = -0.1657 - -0.1657. Let k = 1527.6 - 1528. Let g = -0.1 - -1.1. Put -0.3, k, g, t in increasing order. k, -0.3, t, g Let y(q) = -q*3 - q - 2. Let b(w) = -5w*3 + 14w*2 - 38w - 17. Let z(t) = b(t) - 6y(t). Let i be z(-16). Sort i, 91, -1, -2. i, -2, -1, 91 Suppose -11w = -7w + 3272. Let r = -69 - w. Let i = r + -8245/11. Put -1, 4, i in decreasing order. 4, i, -1 Let f be 4/(60/9) - 24/120. Sort -1/2, 2/7, -4, f in increasing order. -4, -1/2, 2/7, f Suppose s + 2l = -4, -3s - 3l = -5s - 29. Let g be 54/s + 1 + 4. Let w = 150.7 + -151. Sort g, w, -3, 2 in increasing order. -3, g, w, 2 Let a be 14 + -11 + (-2)/(-2). Let y be (-14)/2(a + -3). Let v = 121/436 - 3/109. Sort v, y, 0 in decreasing order. v, 0, y Let n = -665/5797 + -1/341. Let u = -5066/5 - -1120. Let q = 107 - u. Sort q, 2, n. n, q, 2 Let t = -128/5 + 25. Let v = 32.4 - -197.6. Let n = v + -233. Put n, t, -2 in descending order. t, -2, n Let g be (-103/3)/(-2). Suppose 0 = 5u - g - 20. Suppose 5n + 27 = -2s + us, 0 = n - 5s + 23. Put n, -1, 0 in decreasing order. 0, -1, n Suppose 0 = 2r - 6, -r + 0 + 1 = 2h. Suppose 3a + 9 = -3. Let n be a/(-5)(-3)/((-42)/35). Sort n, 5, h. h, n, 5 Let d = -76/3 + 25. Suppose -4p - 4g - 20 = -8p, -2g - 19 = -3p. Let u be (p - 4) + 1 - 3. Sort -3, u, 0.3, d in decreasing order. u, 0.3, d, -3 Suppose 0 = -0b - 5b - 5. Let i(d) = -d3 + 42d*2 + 46d - 123. Let v be i(43). Suppose -v = -6m - 0. Sort 5, b, m. b, m, 5 Let k = -18.19 - -18. Let c = k - -5.19. Let x = 12.3 + -1.3. Sort -0.5, c, x. -0.5, c, x Let v = 1 + -0.95. Sort 0.1, v, 25 in decreasing order. 25, 0.1, v Let s = 39045 + -39045.4. Let v(u) = 13u + 1. Let n be v(4). Let c = 266/5 - n. Put c, 3, s in descending order. 3, c, s Suppose -20v + 17v + 146 = w, -3w - 79 = -2v. Sort -5, v, 18 in decreasing order. v, 18, -5 Suppose 5q + 0t + 2t + 1567 = 0, 5t = 5q + 1560. Let d = -627/2 - q. Sort -5, -3, 18, d. -5, -3, d, 18 Let b = -1739/1158 + 1/579. Put 22/3, b, 4 in increasing order. b, 4, 22/3 Let b(d) = -22d*2 + 281d + 83. Let j be b(13). Put -3, j, 0, -23 in decreasing order. j, 0, -3, -23 Let n be (1 + -1)-426/208. Sort 3, n, 45, -5 in descending order. 45, 3, n, -5 Let p = -160/24321 - 2/201. Let d = p + 1337/363. Put 4, -3, d in increasing order. -3, d, 4 Let u = -256 + 253. Let t be 8/2 + 9/(-3) + 2. Sort 0, -6, u, t. -6, u, 0, t Let y be (6 - (-50)/(-8))12 + 1. Let x be ((-15)/45)/(-2 - (-124)/60). Suppose -1 = -5i - 6. Put x, 6, i, y in decreasing order. 6, i, y, x Suppose -a + w = -14, 5w = -2a + w + 46. Suppose 8c + 7 = -a. Let h be c1 - (10 + -11). Sort 2, h, -7. -7, h, 2 Let j be 4/14 + 23/(-7). Let c(s) = -s*2 - s - 1. Let m(p) = 3p*2 + 26p + 18. Let f(b) = -5c(b) - m(b). Let d be f(11). Put d, -5, j, 5 in ascending order. -5, j, d, 5 Let f = -43 - -47. Suppose fn = 2n - 6n. Suppose 253 = -4y + 273. Sort y, n, -6 in decreasing order. y, n, -6 Let k be (-11)/(-9) + (3 - 4). Let w = 337 + -337. Let f = 0.2 + -0.7. Sort w, f, k, -3/5 in decreasing order. k, w, f, -3/5 Let q be (1/(-7))/((-19)/190-25). Put q, 2, -2 in increasing order. -2, q, 2 Let m be 12/(-10) + 2295/(-255) + 116/5. Suppose 2f + 8 = -2f. Put -4, m, f in ascending order. -4, f, m Let a = -9939 + 9917. Put a, 1, 53 in decreasing order. 53, 1, a Let f(q) = 2q3 - 2q*2 - 11q + 6. Let r be f(8). Let x be (-10)/6 - r/(-462). Let p(h) = h*2 - 5h - 1. Let d be p(5). Sort d, x, -0.4 in ascending order. d, -0.4, x Suppose -175 = 16a - 19 + 500. Sort -1, 5, a, -5. a, -5, -1, 5 Let m = 383.1 + -383. Let w(r) = -r2 - 18r - 33. Let i be w(-15). Sort m, i, 0.5 in decreasing order. i, 0.5, m Let f(t) = -3t - 16. Let p be f(-6). Let m be (-1)/(-2)p0. Let x be ((-154)/80 - -2) + 228/(-1140). Sort -3, m, 0.3, x in increasing order. -3, x, m, 0.3 Suppose -10 = -28n + 30n. Suppose -2 = 18c + 52. Sort 4, c, 5, n in descending order. 5, 4, c, n Suppose -4w + 72 = 8n, 0 = 3w - 7w + n + 99. Put -5, 1, 2, 21, w in decreasing order. w, 21, 2, 1, -5 Let x = -186 - -181. Let b(i) = -i*3 - 2i*2 + 14i + 29. Let q be b(-3). Sort q, 5, x, -1 in increasing order. x, q, -1, 5 Let m = -0.68 + 1.46. Let g = 1.78 - m. Put -7, 0.2, g, 0 in descending order. g, 0.2, 0, -7 Let q(m) = -m*2 + 4m - 5. Let t be q(3). Let s be (9/((-36)/(-8)))/t. Suppose 28 = -4u + 4k, 7 = -4u + k - 4k. Sort s, -5, u in decreasing order. s, u, -5 Let w = 3.3 + -2.2. Let g = -33409/6 + 5568. Sort g, -5, -0.5, w in decreasing order. w, g, -0.5, -5 Let v(y) = -216y + 1296. Let q be v(6). Put -5, 6, q, -34 in increasing order. -34, -5, q, 6 Let i be -1 - 5(-4 + 3). Let h = -48 - -71. Suppose -j + s + 17 = 5s, -j = -is + h. Sort 1/3, j, 4, -5 in ascending order. -5, j, 1/3, 4 Let m(c) = -c*2 + 5c + 5. Let j be m(5). Let a(x) = -x*3 - 19x*2 - 2x + 2x3 - 3 + 23x*2. Let l be a(-3). Put l, 0, -5, j in decreasing order. l, j, 0, -5 Let d = -10 + 7. Let i be ((-12)/(-47))/(-6) + 3574/47. Sort d, i, -1. d, -1, i Suppose 3g = -4k + 18, 0g - 13 = g - 5k. Suppose 66z - 78 + 540 = 0. Sort z, g, -2/7 in decreasing order. g, -2/7, z Suppose 0x - 8 = -2x. Let t be 4452/336 - 33/4. Sort -149, x, t in ascending order. -149, x, t Let z(b) = -3b - 7. Let v be z(5). Let x = -29 - v. Suppose 2d = -0d + 5y + 1, -9 = 5d - y. Sort x, -1, 2, d. x, d, -1, 2 Let d = -2116 - -2111. Sort d, -0.2, -16 in descending order. -0.2, d, -16 Let o = -3.8 - -4.2. Suppose -2r - 23 = -s - 3r, 0 = -5s - 2r + 112. Let x be (-7)/(-3) + -24 + s. Sort 3, o, x, -1 in decreasing order. 3, o, x, -1 Let o be 408/1990 + 4/(-20). Let l be 8 + (78/(-65))/((-4)/(-40)). Sort -2/15, o, l in descending order. o, -2/15, l Let s(u) = -3u*2 - 105u - 917. Let t be s(-17). Suppose 3j + 0l + 4 = 4l, -l + 1 = -2j. Suppose 4p + p - 25 = j. Put t, p, -5, 3 in descending order. p, 3, t, -5 Let c = -0.0257 - 23.8743. Let f = -24.3 - c. Sort f, -10/7, 1, -1/7 in ascending order. -10/7, f, -1/7, 1 Let n(b) = -433b - 18187. Let o be n(-42). Let t(r) = -r - 3. Let z be t(-4). Put o, z, -9, -2 in decreasing order. z, o, -2, -9 Let r = 2 + -1.6. Let v = 0 + r. Let z be (-4)/((40/(-6))/(-10)). Put z, v, 2/15 in descending order. v, 2/15, z Let d = 2/51 - -32/51. Let w(u) = 5u3 - 2u*2 - 4u + 5. Suppose -2x + 5 = -2y + 17, 0 = -5x - 25. Let b be w(y). Sort d, b, 2/19 in increasing order. 2/19, d, b Let f = 43.79 + -43.78. Put -2/17, 10, 3, f in decreasing order. 10, 3, f, -2/17 Let n = -0.46 - -0.06. Let h = 20025 + -20028. Sort h, n, 3. h, n, 3 Suppose 2p - 3*p = 131	{ "pile_set_name": "DM Mathematics" }
, -11725? -11730 What is next in -201, -365, -497, -597, -665, -701, -705? -677 What comes next: -3071, -3095, -3127, -3167, -3215? -3271 What comes next: 2134, 2301, 2462, 2617, 2766? 2909 What comes next: -40, 683, 2634, 6425, 12668? 21975 What comes next: -72877, -72866, -72849, -72826, -72797, -72762, -72721? -72674 What comes next: -10239, -40964, -92173, -163866, -256043, -368704, -501849? -655478 What is next in -675, -2238, -3801? -5364 What comes next: -1490, -1756, -2022? -2288 What is next in 288190, 576376, 864562? 1152748 What is next in -531, -1121, -1783, -2523, -3347, -4261? -5271 What is the next term in 355, 1180, 2491, 4276, 6523, 9220, 12355? 15916 What is next in -2413, -4101, -5789, -7477, -9165? -10853 What is the next term in 3878, 7751, 11624, 15503, 19394, 23303, 27236, 31199? 35198 What is the next term in -119, -995, -3361, -7955, -15515? -26779 What is the next term in -136, -114, -60, 44, 216? 474 What is next in -42342, -42336, -42328, -42318, -42306, -42292? -42276 What comes next: -1440110, -2880219, -4320328, -5760437, -7200546? -8640655 What is the next term in 200, 718, 1236, 1754, 2272, 2790? 3308 What is the next term in 195, 291, 353, 363, 303, 155, -99? -477 What is the next term in -115, -129, -127, -103, -51, 35, 161? 333 What is the next term in -288, -488, -692, -900, -1112, -1328, -1548? -1772 What is the next term in 3923, 3915, 3903, 3887, 3867, 3843? 3815 What comes next: -22672, -45339, -68000, -90655, -113304? -135947 What is next in 250, 685, 1306, 2113, 3106, 4285? 5650 What is next in 129, 193, 297, 441? 625 What is next in 26833, 53662, 80491, 107320? 134149 What is next in -13000, -13008, -13016? -13024 What is the next term in -1305, -1855, -2391, -2913? -3421 What comes next: 112, 296, 546, 856, 1220, 1632? 2086 What comes next: 4042, 3794, 3546, 3298, 3050? 2802 What comes next: 9480, 9458, 9436, 9414? 9392 What is next in -5587, -11189, -16793, -22399, -28007, -33617? -39229 What comes next: -421, -585, -749, -913, -1077? -1241 What comes next: 13211, 13221, 13231, 13241? 13251 What comes next: 75, 320, 729, 1308, 2063, 3000, 4125, 5444? 6963 What is the next term in 760, 668, 514, 298? 20 What is next in -6042, -24217, -54516, -96945, -151510, -218217, -297072? -388081 What is the next term in 2712, 5459, 8206, 10953, 13700, 16447? 19194 What comes next: 65478, 130956, 196434? 261912 What comes next: -4782, -4817, -4852? -4887 What is next in -21, -37, -55, -75? -97 What is next in 2001, 1874, 1661, 1362? 977 What is the next term in -3932, -3968, -4004, -4040, -4076, -4112? -4148 What is the next term in -6375639, -12751277, -19126915, -25502553, -31878191? -38253829 What is next in 4389, 8664, 12939, 17214, 21489, 25764? 30039 What comes next: -1188, -2241, -3294, -4353, -5424, -6513, -7626, -8769? -9948 What comes next: -243087, -486174, -729261, -972348, -1215435, -1458522? -1701609 What is next in 1331, 1308, 1253, 1160, 1023, 836, 593? 288 What is the next term in -2345, -2355, -2363, -2369, -2373, -2375, -2375? -2373 What is the next term in -18944, -75869, -170744, -303569, -474344, -683069? -929744 What comes next: 5907, 11813, 17719, 23625, 29531, 35437? 41343 What comes next: 339220, 678439, 1017658, 1356877, 1696096, 2035315? 2374534 What is next in 1342, 2518, 3534, 4384, 5062, 5562? 5878 What is next in 790, 910, 1036, 1174, 1330, 1510, 1720? 1966 What is the next term in 14570, 15511, 17086, 19301, 22162, 25675, 29846, 34681? 40186 What is next in 451, 1252, 2591, 4468? 6883 What comes next: 72, 103, 134? 165 What is next in -11297, -11306, -11301, -11276, -11225, -11142? -11021 What is next in 12, -29, -118, -267, -488, -793? -1194 What comes next: -74028, -74021, -74014, -74007, -74000, -73993? -73986 What is next in 20617, 41249, 61881, 82513? 103145 What comes next: 118, 229, 502, 1021, 1870, 3133? 4894 What comes next: -4275, -8611, -12945, -17277, -21607, -25935, -30261? -34585 What is the next term in -537, -525, -497, -453, -393? -317 What is the next term in 301, 860, 1671, 2728, 4025? 5556 What is next in -34420, -34417, -34410, -34399, -34384, -34365? -34342 What is the next term in -2210, -2303, -2396, -2489, -2582? -2675 What comes next: -10314, -10307, -10294, -10275, -10250, -10219, -10182? -10139 What is next in 1641, 5420, 11717, 20532? 31865 What is next in 32147, 32155, 32163, 32171, 32179? 32187 What is the next term in 335, 431, 593, 821? 1115 What is next in -17418345, -17418346, -17418347, -17418348, -17418349, -17418350? -17418351 What is next in 4368, 8754, 13140, 17526? 21912 What is the next term in -1, 40, 149, 344, 643? 1064 What is next in 19, -195, -549, -1043, -1677? -2451 What is next in 67, -236, -539, -842, -1145, -1448? -1751 What is the next term in -297, -202, 57, 564, 1403, 2658? 4413 What is next in 929, 3715, 8371, 14903, 23317, 33619, 45815? 59911 What is next in -58592, -117172, -175752, -234332, -292912? -351492 What is next in 466, 71, -586, -1505, -2686, -4129? -5834 What is next in -66937, -66942, -66949, -66958? -66969 What comes next: 127, 185, 233, 271, 299, 317? 325 What comes next: -15284, -15283, -15284, -15287? -15292 What comes next: -299, -611, -921, -1229, -1535, -1839, -2141? -2441 What is the next term in 68960, 68968, 68974, 68978, 68980, 68980, 68978? 68974 What is the next term in -550, -511, -346, 11, 626? 1565 What is the next term in -1185286, -1185285, -1185284, -1185283, -1185282? -1185281 What is the next term in -21201, -42220, -63237, -84252, -105265, -126276, -147285? -168292 What is next in 6115, 6162, 6209? 6256 What is the next term in 74933, 74956, 74979, 75002? 75025 What is the next term in -27905, -55812, -83717, -111620, -139521? -167420 What is next in -430807, -430808, -430809? -430810 What comes next: -192, -364, -512, -624, -688? -692 What is next in 299, 311, 323? 335 What is the next term in -53, 6, 101, 250, 471, 782? 1201 What is the next term in -195, -374, -523, -624, -659, -610, -459? -188 What is the next term in -1881, -7664, -17297, -30774, -48089, -69236, -94209? -123002 What is next in -1349, -2337, -3983, -6287, -9249? -12869 What comes next: 460, 717, 698, 265, -720, -2395? -4898 What is the next term in -507, -1087, -1739, -2469, -3283? -4187 What comes next: -1392905, -1392904, -1392903, -1392902, -1392901, -1392900? -1392899 What is next in -45699, -45689, -45663, -45615, -45539, -45429, -45279, -45083? -44835 What is next in -479, -1914, -4309, -7664? -11979 What comes next: 952, 1036, 1184, 1402, 1696, 2072? 2536 What comes next: -355, -397, -439, -481, -523? -565 What is next in 1823, 1821, 1827, 1847, 1887, 1953, 2051? 2187 What is the next term in 23242, 23339, 23434, 23527, 23618, 23707? 23794 What is next in -1496735, -1496737, -1496739, -1496741, -1496743, -1496745? -1496747 What is the next term in 445, 566, 689, 814? 941 What is next in -440, -1709, -3820, -6773, -10568, -15205? -20684 What is the next term in 106257, 212517, 318777, 425037, 531297, 637557? 743817 What comes next: 12621, 12613, 12605, 12597, 12589? 12581 What is the next term in 39300, 78583, 117864, 157143, 196420? 235695 What is next in 450, 452, 450, 444, 434, 420? 402 What is the next term in -617, -1228, -1833, -2432, -3025? -3612 What comes next: -34, 163, 492, 953? 1546 What is the next term in 2900, 2866, 2774, 2594, 2296? 1850 What comes next: -3261, -6547, -9847, -13167, -16513? -19891 What comes next: 18394, 36764, 55138, 73516, 91898, 110284? 128674 What is the next term in 4414, 12207, 19986, 27745, 35478? 43179 What is the next term in -1017, -1952, -2887? -3822 What is the next term in 127, 450, 987, 1738? 2703 What comes next: -3101, -3095, -3077, -3041, -2981, -2891, -2765, -2597? -2381 What is next in -2125, -4852, -7579, -10306, -13033, -15760? -18487 What comes next: 926, 1120, 1350, 1616, 1918? 2256 What is the next term in 29578, 118299, 266168, 473185, 739350, 1064663, 1449124? 1892733 What is next in 2072, 2065, 2058? 2051 What comes next: -127, -149, -129, -43, 133, 423, 851? 1441 What comes next: -3000, -2906, -2748, -2526, -2240, -1890? -1476 What is the next term in -1355, -3545, -6555, -10379, -15011? -20445 What is next in 16, 219, 622, 1225, 2028? 3031 What is	{ "pile_set_name": "DM Mathematics" }
0. Let u = 12 + t. Let p(d) = d3 - d2 - d - 3. Give p(u). -3 Let h(n) = -n*3 + 10n*2 - 9n - 10. Let j be 42 - 38/(-24). Calculate h(j). -10 Let u be (892/28 - -4) + 1/7. Let g be 24/u - 20/(-6). Let v(w) = w*3 - 3w*2 - 4w - 1. What is v(g)? -1 Let y be 130/35 + 6/21. Let b(t) = t + 2. What is b(y)? 6 Let z(q) = -q2 - q - 1. Let c(h) = -h3 + 5h2 + 2h + 7. Let d = 10 + -8. Let i(y) = dz(y) + c(y). Calculate i(4). -11 Let c be (0 - -1)/((-1)/3). Let m(o) be the first derivative of 16 + o - 1/2o*2. Give m(c). 4 Let a(r) = -r - 1. Let n be (-1 - 28/(-4)) + -3. Suppose 0 = -nq - 4g - 19, 5g + 14 = -2q + 2g. What is a(q)? 0 Let k(t) = t2 + t - 9. Let y(b) = -b2 + 9. Let z(v) = -6k(v) - 5y(v). Suppose 0 = 5w - 3u + 44, -86 = 5w + 3u - 20u. Give z(w). 2 Let o(i) = 3i3 + i2 - 3i - 2. Let g(x) = 2x*3 - 3x - 2. Let z(p) = 5g(p) - 4o(p). Suppose -k + 13 = -3y, 2k - 17 = 3y - 0y. Give z(y). 25 Let m(l) = -425l2 + l + 7l + 426l2 + 2. Give m(-6). -10 Suppose -1 = 5l + 3x, -7 = 5l + 5x - 2. Let r(g) = 2g*3 - l + 4g*3 - 11g*3 + 2g*2. Give r(-1). 6 Suppose 0 = 3t - 8t - 10. Let i(r) = -2r - 3. Let u(f) = f*2 - 6f - 11. Let l(z) = -7i(z) + 2u(z). Give l(t). 3 Let c(r) = -r - 7. Let t(k) = 2k + 13. Let b(h) = 5c(h) + 3t(h). Let q be 168/(-30) - 4/10. Let x(d) = d3 + 5d*2 - 5d. Let j be x(q). Determine b(j). -2 Let l(w) be the first derivative of 3w2/2 + 2. Let s(v) = -v. Let c(m) = 2l(m) + 5s(m). Suppose -2 = 5o + 8. What is c(o)? -2 Let i(d) = 6d3 - d2 - d - 1. Let c(l) = -38l*2 - l - 4l + 37l2. Let m be c(-4). Suppose h + m = -3h. Calculate i(h). -7 Let o(n) = -n*3 + 4n*2 + n - 2. Let j be (-1778)/(-42)(-1 + 4). Let b = 129 - j. Give o(b). 8 Let c(v) be the second derivative of -v*3/6 - 11v*2/2 - 16v. Let n be c(-9). Let m(o) = 3o2 - o - 2. Give m(n). 12 Let b(q) = -2q + 3. Let i(v) = -5v + 11. Let g(j) = 8b(j) - 3i(j). What is g(-11)? 2 Let f(g) = -2g*2 + 9g - 15. Let z(j) = -j*2 + 5j - 8. Let n = 70 + -74. Let m(t) = nf(t) + 9z(t). Give m(8). -4 Let j(u) = 3u2 - 7u + 3. Let k(w) = -15w + 198. Let i be k(13). Give j(i). 9 Suppose -3i + 3a = 6, a + 20 = 5a. Let c(t) = -t*3 + 6t - 6. What is c(i)? -15 Suppose o - 16 = 4l, o + l - 4 = 2l. Let g be o/(0 - (0 - -2)). Let s(q) = q - 2. Let h(b) = -6b + 10. Let i(n) = -2h(n) - 11s(n). What is i(g)? 2 Let u = -160 - -154. Let p(q) = q3 + 6q*2 + 6q + 3. Calculate p(u). -33 Let z be (6/4)/(2/(-4)). Let v(c) be the third derivative of -c5/60 - c4/24 + c*3/6 + 3c*2. Calculate v(z). -5 Let k(d) = -26d - 31. Let t(v) = -9v - 11. Let n(r) = -6k(r) + 17t(r). Suppose 4 = z + z. Determine n(z). 5 Let n(s) = -s - 6. Suppose -5c = -p + 6090, 4p + 957 = 4c + 5829. Let t be c/77 + 4/(-22). Let a = -21 - t. Determine n(a). -1 Let r be 0 + 980/126 - 2/(-9). Let b(m) = 3m - 7. Let p(l) = 1. Let q(c) = 5c - 7. Let n(h) = 3p(h) - q(h). Let x(i) = rb(i) + 5n(i). Determine x(-7). 1 Suppose 3g - 4d + 0d = -24, 3d = -3g - 24. Let t(f) = f*3 + 8f2 + 1. Determine t(g). 1 Let f(c) = c2 - c + 1. Let v(r) = -r*2 + r. Let b(p) = -2f(p) - 3v(p). Determine b(7). 40 Let x be (0 + 60)60/240. Let d(m) = -m*2 + 15m - 2. Calculate d(x). -2 Let n(h) = h*2 + h - 1. Suppose 0 = 7w + 2196 - 2210. Give n(w). 5 Let b(c) = -3c3 + 3c + 2. Suppose 574 + 86 = -6p. Let g = -112 - p. Calculate b(g). 20 Let g(b) = -b + 132 + 138 - 268. Give g(-11). 13 Let p = 1692 - 1699. Let y(s) = -3s + 8. Let k(r) = 4r - 9. Let d(x) = 4k(x) + 5y(x). Determine d(p). -3 Let m(j) = -j3 - 13j*2 - 4j + 72. Let c be m(-12). Let f(x) = 2x + 39. What is f(c)? -9 Let i(h) be the second derivative of h4/6 - 2h*3/3 - 148h. Suppose 0 = -2z - 5w - 2, 0 = -5z + z + 4w - 32. Let c be (2/(-3))/(z/27). Calculate i(c). 6 Suppose a + 3 = 4f, -3f = 9a - 8a - 11. Let k(j) = j*3 - 7j*2 + 10j + 1. Calculate k(a). 1 Let b(n) = -7n - 28 + n2 + 0n*2 + 33 - 6n. What is b(13)? 5 Let v(y) be the first derivative of -7 - 5/2y2 + 0y - 1/3y3. Suppose 0m = 4k + 4m + 20, 23 = -3k + 5m. Determine v(k). -6 Let z be 2 + (-18)/12 + (-43)/(-2). Suppose -5g + g + 92 = 0. Let o(a) = -za*3 - 2 + a + 0a + ga3. Give o(0). -2 Let n(y) = 4y*3 - 42y*2 - 86y + 5. Let k(i) = -i*3 + 14i*2 + 28i - 2. Let u(f) = 7k(f) + 2n(f). Determine u(-12). -4 Let m = 2 - 1. Suppose 0 = -2w - m - 1. Let h(z) be the second derivative of -z4/12 + z3/6 + z + 3. Determine h(w). -2 Let j(k) = -k3 - 4k*2 - 8k - 9. Suppose -38v - 14 = -31v. Determine j(v). -1 Let f(z) be the third derivative of z5/60 - z4/6 + z*3 + 9z*2 + 4z. Calculate f(5). 11 Let u(y) = -3y + 6 + y3 - 3y*2 - 1 + 4y - 2y. Let k be 1/((-4 + 11)/28). Calculate u(k). 17 Let v = -1 - -4. Let c(f) be the second derivative of 0 - 1/2f*2 - 1/4f*4 - 23f + 1/2f3 + 1/20f5. Calculate c(v). 8 Let v(o) = o3 + 6o2 - 2o - 7. Suppose -127j + 170j = -301. Give v(j). -42 Let s(w) = 3w3 + w2 - w + 1. Let a(l) = 2l*3 - l + 1. Let g(z) = -a(z) + s(z). Calculate g(0). 0 Let r(o) = 3o2 - o - 1. Let h be r(-1). Let v(j) = -8 + 10 - h + j2 - 2j. Suppose 0 = 2w - 4x - 1 - 5, w + 4x - 3 = 0. What is v(w)? 2 Let p(d) be the first derivative of d*3/3 - 11d*2/2 + 11d + 97. Give p(8). -13 Let r be (-4 - -8) + 1 + 1. Let g(y) = 2y3 - 2y + 7y2 - 6y - 6 + 8 - 3y3. Calculate g(r). -10 Let m(c) be the first derivative of 2/3c*3 - 2c*2 - 3c - 1. Determine m(4). 13 Let c(q) be the third derivative of -q6/120 + q5/60 - q*4/24 + 7q*3/3 - 7q*2 + 16. Give c(0). 14 Let u(b) = 0 + b - 2b + 5 + 5b. Suppose -l - 5o - 17 + 28 = 0, 9 = 3o. Give u(l). -11 Suppose 2h - 28 - 12 = 0. Suppose h = 3d + d. Suppose 5o + 3j + j + 22 = 0, 32 = -do + j. Let p(v) = v*3 + 7v*2 + 5v - 3. Determine p(o). 3 Suppose 179g = 128g. Let i(y) be the third derivative of 1/24y4 + gy - 11/6y3 - 8y2 + 0. Give i(7). -4 Let q(k) = k3 - k - 1. Suppose 0 = 3w + 3d + 6 + 3, -2w + 6 = -2d. Calculate q(w). -1 Let i(c) be the third derivative of -c*4/8 - 5c*3/6 + 93c2 - c. Give i(-9). 22 Let n = -16 + 22. Let c(j) be the third derivative of j4/8 - 3j3/2 - 5j*2 - 4j. Give c(n). 9 Let n(f) = -f - 5. Let s(m) = -4m - 25 + 33 + 15 + 33. Let r be s(13). Calculate n(r). -9 Let z(i) = -i3 + i + 2. Let t = -25 + 28. Suppose 4o - 12 = tv, 0o - 15 = -4v - 5o. Determine z(v). 2 Let v(u) = -u*2 + 9u - 9. Let g be 16/(-6)(-6)/(-2). Suppose 2i + 4 = -0. Let o = i - g. What is v(o)? 9 Let d(l) be the third derivative of -l6/120 - l5/30 - l4/12 - l3/6 + 249l2. Give d(0). -1 Let i(g) = 6g - 9g2 + 21 - 17 + 10g*2. Calculate i(-4). -4 Let w(x) = -2x - 14. Let a(m) = -m - 7. Let z(b) = -5a(b) + 2w(b). Let v be -3 + (3 + -10)/(-1). Suppose -7g = -vg. What is z(g)? 7 Suppose -9 = 3j + 5l, 3j - l = l + 12. Suppose js = 5s - 15. Suppose 0 = 4t - sd + 23, 1 = -t + 2d - 7. Let n(h) = 4h + 2. Determine n(t). -6 Let s(m) be the first derivative of m3/3 - 3m*2 - 7m - 4. Let d(a) be the first derivative of s(a). What is d(4)? 2 Let h = 11 + -10. Let a(v) = 7v - 3. Let r be a(h). Let o(q) = -q2 + q + 4. What is o(r)? -8 Let d(y) = -y2 - 12y - 10. Suppose 4x = 2o, 5x = -o + 2x - 20. Calculate d(o). 22 Let y(g) = g3 + g2 - 2g + 1. Let i = -77 + 80. Let r be 24/20 - (i + -2)/5. Give y(r). 1 Let x(h) be the third derivative of h6/120 - h5/12 - h4/4 - h3 - 149h2. Give x(6). -6 Let r(b) = b3 + 2b2 - 1. Let m be r(-1). Let y(v) = v3 + v2 - 2v + 4. Let w be y(m). Let x(l) = -l*3 + 3l*2 + 5l. What is x(w)? 4 Let z(l) = -l - 6. Let s be 36/(-342) + ((-390)/(-95) - 0). Calculate z(s). -10 Let d(u) be the third derivative of -1/2u3 + 0u + 0 + 1/60u5 - u2 - 1/6u4. Calculate d(4). -3 Let q(y) = y3 + y*2 - 6y - 4. Suppose 0 = -z - 4, 4p = 4z - 5z - 24. What is q(p)? -74 Let u(j) = -2 - 9j + 2j3 - j3 + 5j*2 + 6 + 3j. Suppose 5i - 12 = -42. Calculate u(i). 4 Let q(f) = f + 108f*3 + 108f*3 - 212f*3 + 1 + 1 + 3f*2. Calculate q(-2). -20 Let z(i) = -2 - 5 - 3 + 10 + 1 + 2i + 16i*2. Give z(-1). 15 Let	{ "pile_set_name": "DM Mathematics" }
9 Suppose 0 - 50 = -10l. Suppose lp - 2d = 291, -2p + 58 + 70 = 5d. Calculate the remainder when p is divided by 10. 9 Let g be 22/33 - 4/6. Suppose g = -57r + 42r + 360. Let c = -5 - -10. What is the remainder when r is divided by c? 4 Let a(j) = j - 16. Let d be a(21). Suppose 15w + dw - 320 = 0. Calculate the remainder when 49 is divided by w. 1 Let s = -294 - -460. Suppose t + 3t = -3u + s, 162 = 4t + u. What is the remainder when 98 is divided by t? 18 Suppose 0 = 6s + 9 - 39. Suppose 0 = -8z + 61 - s. Suppose -zl = -8l + 16. Calculate the remainder when 62 is divided by l. 14 Suppose -14 = y - 2y + 3v, 0 = 3y + 3v + 6. Suppose -yi - 84 - 48 = 0. Let a = -59 - i. What is the remainder when 17 is divided by a? 3 What is the remainder when (-80 + 84)/(6/333) is divided by 213? 9 Suppose -2x + 7x + 4s = 131, -3s + 35 = x. Suppose -1294y + 1297y = 4t + 414, -712 = -5y + 3t. What is the remainder when y is divided by x? 8 Let g(r) = -5r + 1. Let y be g(8). Calculate the remainder when 18((-17)/(-3) + -4) is divided by (-3)/(-6)(-7 - y). 14 Suppose -2w + 14 = 2v, -2w + 4v = v + 6. Suppose -4a = -3a - 206. Let x = a - 189. Calculate the remainder when x is divided by w. 2 Let k(a) = -295a + 1214. What is the remainder when 1913 is divided by k(4)? 9 Suppose -9t - 1442 = 4147. Let y = t - -667. What is the remainder when (681/6)/((-2)/(-4)) is divided by y? 43 Let p(h) = -1691h - 35. Calculate the remainder when p(-2) is divided by 108. 107 Suppose -5t + 2y + 363 + 0 = 0, 2t - 2y - 150 = 0. Calculate the remainder when t is divided by ((-3)/6)/((-16)/800). 21 Let m(x) = 2x3 + 13x*2 - 65x - 397. What is the remainder when 133 is divided by m(-6)? 17 Suppose 4y - 1320 = 4u, 4y - 2u - 1148 - 172 = 0. Suppose 5t - 82 = -n, -4n - n - 5t = -y. What is the remainder when 492 is divided by n? 58 Let m = -14 - -23. Let h(k) = -k3 + 9k*2 + 2k - 2. What is the remainder when 2490/58 + (-150)/(-2175) is divided by h(m)? 11 What is the remainder when 1867 is divided by (-273)/(-13) + (-14 - -19)? 21 Suppose -2a + 410 = -5l, 25l = 22l. Let o(h) = 53h2 + 3h - 3. What is the remainder when a is divided by o(1)? 46 Suppose 0 = -q + 5o + 156, 55q - 53q = -2o + 384. Calculate the remainder when q is divided by 16. 10 Let a(v) = -5v - 98. Let h be a(-20). Suppose -2t = -hx - 26 - 10, x + 3 = 0. What is the remainder when 22 + (0 + 2 - 4) is divided by t? 5 What is the remainder when 30094 is divided by (-92)/(-6) + ((-168)/36)/(-7)? 14 Let v(r) = 2 - 3r*2 + 6r + 2r2 + 5r*2. Calculate the remainder when v(-4) is divided by 18/4(-2)/(-1). 6 Let w = -18679 + 18699. Calculate the remainder when 535 is divided by w. 15 Let l = -7330 + 7340. What is the remainder when 3815 is divided by l? 5 Suppose 300v + 14763 + 164210 = 821573. Calculate the remainder when v is divided by 306. 0 Let o(j) = -16j*2 + 4j + 15j2 + 17 + 2j. Let m be o(8). Let q(w) = 150w3 + 3w*2 - 3w + 1. What is the remainder when q(m) is divided by 38? 37 Let p(k) = -415k - 1232. Let h = 82 + -28. Let y = -4 + h. What is the remainder when y is divided by p(-3)? 11 Suppose -2l - 5 = -23. Suppose -4i - 4 = -6i. Suppose -3n + 24 - 9 = 4c, 4n + 2 = ic. What is the remainder when l is divided by c? 0 Let v be 8/(-12)4(-9)/12. Let b(g) = 9g3 + 4g*2 - 7. What is the remainder when b(v) is divided by 42? 39 Let w = 226 - 181. What is the remainder when w/26/9 is divided by 6? 3 Let d = 1197 + -480. Calculate the remainder when d is divided by 33. 24 Suppose -497 = 5f - l, 0 = -3f + l - 143 - 154. Let y = f - 93. Let x = -112 - y. What is the remainder when x is divided by 14? 11 Suppose 68m + 6080 = 49m. Let o = m - -412. Calculate the remainder when o is divided by 11. 4 Let p(w) = -w*2 - 13w - 9. Suppose -4c + 1 = -3c. What is the remainder when -12 - -12 - (c - 51/1) is divided by p(-11)? 11 Suppose -6l = -8l + 262. Let o = -103 + l. Calculate the remainder when 444 is divided by o. 24 Suppose 8 = -19w + 23w, -6n - 3w = -12198. What is the remainder when n is divided by 9? 7 Suppose -6o = -4o - 70. Let k(y) be the third derivative of 19y5/60 + y4/8 - y3/6 + 44y*2 + y. What is the remainder when k(-2) is divided by o? 34 Suppose 3z + z - 8 = 0, -t + 951 = 5z. What is the remainder when t is divided by 86? 81 What is the remainder when 460 is divided by (-2)/(-10) - -12(-342)/(-30)? 49 Suppose -2r - 3a - 11 = -5, -6 = 3a. Suppose -7x - 146 = -3b - 3x, r = -b + x + 49. What is the remainder when 247 is divided by b? 47 What is the remainder when -80544/(-10 + 2) is divided by 19? 18 Suppose -3n - 150 = -2h, h = 3n + 17 + 55. What is the remainder when 262 is divided by h? 28 Suppose -427 = -2x + 255. Let h = 188 - x. What is the remainder when (-3)/2h2/3 is divided by 31? 29 Suppose -15 = -14q + 9q. Suppose k + 25 = 4x, k + qk = -3x - 5. Calculate the remainder when (156/10 - -1) + 15/(-25) is divided by x. 1 Let n(t) = -t*2 + 26t + 331. Let x be n(33). What is the remainder when -510/x-142 is divided by 5? 1 What is the remainder when 3443 is divided by 2/(-6)(-6)/(-4)(243 - 269)? 11 Let s = -137 + 142. Suppose -2m - 2 = 0, sm = 3t - 6 - 50. Calculate the remainder when 28 is divided by t. 11 Let j(b) = -10b*3 - 176b*2 - 11b + 110. What is the remainder when j(-19) is divided by 84? 81 Let k be (-9 - -4)-1583/30. Suppose 4f = v + k, 0 = 5f + 4v - 37 - 46. Calculate the remainder when 71 is divided by f. 14 Calculate the remainder when 2632 is divided by (1/3)/(2/402) - (43 + -42). 58 Let u = -424 - -431. What is the remainder when (-2861)/(-7) + 58/u + -8 is divided by 41? 40 Suppose -3u - 3 + 0 = -3j, 0 = -5j - u - 1. Suppose 6l + jl + 72 = 0. Let x = l + 54. Calculate the remainder when x is divided by 9. 6 Let o(d) be the second derivative of -1/20d5 + 3/2d*4 + d + 13 + 15d*2 - 8/3d*3. Calculate the remainder when 328 is divided by o(17). 46 Let j(r) = 8r - 36. Let u be j(5). Suppose 2n + 2n - 946 = 3k, n + uk = 246. Suppose 18y - n = 11y. Calculate the remainder when y is divided by 12. 10 Suppose 25a = -4z + 27a + 500, 3z - 389 = 5a. Calculate the remainder when z is divided by 34. 21 Let b = 535 - 433. Calculate the remainder when (-658)/(-12) + 17/b is divided by 32. 23 Suppose -z + 11 = 3r - 0, 4z - r = 31. Suppose -7v + 225 = -286. Suppose -g - 3s + 12 = -5, -3g + v = -2s. What is the remainder when g is divided by z? 7 Suppose -4n + 707 = -2z + 3z, -2z - 366 = -2n. Calculate the remainder when n is divided by (14/7)/(-1(-4)/94). 37 Let c = -3 - -10. Suppose 182i + 43i + 3588 - 35763 = 0. What is the remainder when i is divided by c? 3 What is the remainder when 111/(-74)(-3098)/3 is divided by 504? 37 Let s = -829 - -1417. Calculate the remainder when s is divided by 102. 78 What is the remainder when (0 + 111)/((-9)/(-6)) is divided by (-10)/(-6)(-10 - -34)? 34 Suppose 569 - 47 = 58t. Calculate the remainder when 235 is divided by t. 1 Suppose -2w - w + 123 = 5h, 4w = 2h - 70. Suppose -9s = -h - 63. What is the remainder when 167 is divided by s? 7 Let b(i) = 11i + 15. Let q be b(5). Let h(s) = 2s2 + 10s. What is the remainder when (q/(-21))/(2/(-66)) is divided by h(-7)? 26 Let p(x) = 7x + 4. Suppose -55k + 68 + 542 = 6k. What is the remainder when p(5) is divided by k? 9 Calculate the remainder when 1482 is divided by (0 - (-1)/2)12 - -160. 154 Suppose 4k - 4f = 376, 0 = 3k + 5f - 365 + 51. Calculate the remainder when k is divided by 0 + ((-336)/(-33) - 12/66). 8 Suppose 0 = -5w + 31 - 46. Let j(x) = 2x*2 - 3x - 13. Calculate the remainder when 54 is divided by j(w). 12 Let i = 536533 - 536495. Let f(j) = j*2 + j + 2. What is the remainder when i is divided by f(-2)? 2 Let a = 4867 - 4811. Calculate the remainder when 556 is divided by a. 52 Let p = 69 - 73. Let g = p - -317. What is the remainder when g/8 + 2/(-16) is divided by 20? 19 Let l = -102 + 102. Suppose -7d + 10d - 120 = l. Let y = -20 + d. Calculate the remainder when y is divided by 8. 4 Let r(g) = -g3 - 4g*2 + 2g + 13. Let z be r(-4). What is the remainder when ((-207)/(-27) -	{ "pile_set_name": "DM Mathematics" }
6 - -278) + (3 + 4 - (4 - 2)) -23 Evaluate 9 - (-14 + -2 - (5 + -8)). 22 What is 132 + -143 + (-2 - 0) + -2? -15 Evaluate -18 + (-1 - 7) + -23 + 28 + 11. -10 2 - ((-4 - -5) + (0 - -10 - 5)) -4 What is 5 - (-1 + 7 + -11 + 17)? -7 What is the value of 8 - 1 - (0 - (0 + -6))? 1 What is (-6 - (0 - 7 - (-15 + 13))) + 16? 15 Evaluate (5 - -7) + (4 - -2) + -3 + -26. -11 What is 24 - (-34 - (-30 + -3))? 25 What is 8 - (-4 - (17 + -15))? 14 Calculate 7 + 0 - (-2 - -2 - (-28 + 23)). 2 What is -23 - (-25 - 2 - -23)? -19 What is the value of (0 - (0 - 7)) + (19 - (-5 + 19))? 12 Calculate 1 - (-3 + 12 - 7) - 8. -9 What is the value of -1 + (13 - 0) + (8 - 7 - 1)? 12 Evaluate -2 + -24 + 19 + -8. -15 Evaluate (-9 - (-10 + -26)) + -12. 15 What is (0 - (-1 + 3 + -6 + 6)) + 4? 2 Calculate -35 + (40 + -4 - 14). -13 What is the value of -7 - ((-2 + 2 - 1) + -8) - 5? -3 What is 16 - 24 - (1 + 2)? -11 What is (1 - 5 - (-10 + 2)) + (-3 - 1)? 0 Calculate 21 - (26 + -1 + -19). 15 -16 + (-2 - (-3 - -1)) - (6 - 16) -6 -25 + 0 + 14 - (-1 - -16) -26 What is the value of -1 - (-1 - 7 - -7 - 5) - 1? 4 What is the value of (-4 - (9 + 5 + -10) - 3) + -18? -29 Calculate (8 + 3 + -1 + 9 - 9) + 2. 12 What is -26 - (-14 + (-6 + -1 - -10))? -15 -22 + 1 + (35 - 35) -21 Calculate 21 - 5 - (-22 + 44). -6 What is (15 - (-14 + 29) - 3) + 18? 15 Calculate (12 + -6 - (-8 - -30)) + 9. -7 2 + (6 - 5) - -5 - 18 - -3 -7 What is the value of (-206 - -177) + -1 + (-1 - -2)? -29 Calculate -20 - (-35 - -57) - (-12 + 3). -33 Evaluate (-375 - -396) + (-50 - 2). -31 Evaluate 28 - (39 + 6 + -31). 14 Evaluate -1 + -23 + (6 - (-6 - -17 - 11)). -18 Evaluate (12 + 2 - 2) + -691 + 665. -14 What is the value of (-5 - 8 - -10) + -9? -12 -16 + (8 - -4 - -13 - 13) -4 What is (0 - -2) + 3 - (1 - (-11 - 4))? -11 Evaluate 18 - (-4 + -1 + 27 + -8 + -14). 18 -10 + (21 - -28 - 5) 34 Calculate -12 + (-13 - -1 - -16). -8 What is -35 + -25 + 41 - -25? 6 -11 + (-4 + 3 - 6) - -5 -13 Calculate 0 + 0 + -3 + -18 + 9. -12 (8 - 6) + -8 + (9 - 3) + -21 -21 Calculate (3 - ((13 - 16) + -19)) + (-1 - 4). 20 (-98 - -95 - (5 - 1)) + 12 5 What is -8 - -3 - (83 + -81)? -7 What is the value of -16 - ((2 - 3) + -1 + (-134 - -136))? -16 What is the value of 11 + -1 - (-3 + 0 + (-22 - -18))? 17 Evaluate (-7 - 1) + (141 - 136) - -4. 1 Calculate (6676 - 6646) + (-1 - 11) + 0. 18 What is -9 - (5 - 10) - (-4 - 8)? 8 Calculate (5 + -4 + -1 - 1) + (-4 - -6). 1 -3 - -1 - (1 - 14 - (342 - 325)) 28 -8 + (-28 - -14) - -10 -12 What is the value of 1 + 1 + (-79 + 79 - (-1 - 3))? 6 6 - -7 - (22 + -6 + 0) -3 What is 18 + (0 - 5) + (-32 - -31)? 12 Calculate -23 + 9 + -2 + 13. -3 What is the value of -20 - ((4 - (12 - 5)) + 14)? -31 Evaluate 200 + -173 + -36 + 1. -8 Calculate (-4 + 10 - -3) + -5 + -5 - 1. -2 Evaluate 11 - ((-3 + -1 - -7) + -5). 13 Evaluate (11 - -25) + 2 + (7 - 23). 22 What is -58 + (32 - -32) - (-3 + 2 - 7)? 14 What is 27 - (-4 + (-13 + 19 - -2))? 23 (1 - -5) + 1 + (0 - (-63 + 81)) -11 -26 + -3 + 27 - (1 + -1 + 5) -7 What is -7 + (1 - -13) - (15 - -11)? -19 Calculate 0 - (-3 + -4 + (-10 - -8)) - 2. 7 Calculate -10 + (0 + (-16 - -38) - -7). 19 Calculate -12 + (-10 - -5 - 8) - (0 + 0). -25 What is the value of (5 - -2 - 5) + (3 - 10) + 4? -1 -1 + -3 + 9 + (6 - 11) - 0 0 What is 4 + -20 + 4 + (6 - (2 - 1))? -7 What is -27 + 2 - (0 + -14 + 7 + 2)? -20 0 + -10 - (-1 - 24) 15 -1 + 3 - -5 - (1 + 11) - 12 -17 What is 0 - -10 - (-423 + 445)? -12 What is -12 + 11 - -11 - 2? 8 -29 - (-23 + -5) - (0 + (1 - 2)) 0 What is the value of -10 + 10 + -1 + 2 + -8 + 4? -3 Calculate -1 + (6 - 3) + -4 + 6 + 4. 8 Evaluate (1 + -3 + -2 - (-53 - -53)) + 6. 2 What is (1 + -2 - 2) + (23 - 93 - -77)? 4 Evaluate 4 + 21 + -3 + -36. -14 0 + 4 - (4 + 25 - 14) -11 6 - 4 - ((2 - (13 + -3)) + -2) 12 -19 + 7 + (0 - -10) -2 What is the value of (-1 - 9) + (5 - (53 + -24 + -38))? 4 What is the value of -3 - (6 + (9 - 1)) - (1 + 0)? -18 -10 + 0 + 19 + -21 -12 Evaluate (-17 - -21) + (-18 - -1). -13 Evaluate (-2 + -3 - (-4 + (6 - 0))) + 22. 15 Evaluate (0 - 5) + 4 + 37 - (-2 - -4). 34 5 + -2 + 52 + -48 + (0 - 16) -9 Calculate 8 + -34 - (5 - 24). -7 Calculate 10 + (-42 + 47 - (-6 + 20)). 1 What is the value of -13 + -2 + (4 + -2 + 1 - 2)? -14 What is the value of (49 - 31) + (-60 - -54 - (-9 - 0))? 21 Calculate -10 - (-13 - (2 + 9)). 14 Evaluate 96 + -72 + (5 - -1). 30 What is the value of -1 + 8 - (-36 + 10 + 51)? -18 (-1 - -1 - 4) + (-76 - (-49 - 37)) 6 What is the value of -401 - -399 - (-1 - 4)? 3 Calculate -2 + (-8 - (14 - 27)). 3 -31 + 13 + 22 + 7 11 Evaluate 4 - (-3 + 4) - (72 + -77). 8 What is -7 + (0 - -9) + -7 + -2? -7 What is 41 + -34 + -1 + -14? -8 What is the value of -1 + 0 - (26 - (23 - 9)) - -7? -6 Calculate -7 - (2 + -5 - 5) - 14. -13 13 + (-1 - 2) + -18 -8 -45 - -49 - (8 + -25) 21 Evaluate 1 + 4 + -30 + -3 + 9. -19 Calculate (-5 - -25) + (-8 - -10). 22 Evaluate 2 + 31 + 2 + 76 + -93. 18 What is the value of 8 + -11 + (16 - 7) + -4? 2 What is the value of 19 - ((-2 + 3 + -9 - -13) + -7)? 21 (21 - 26 - -12) + -2 + -1 4 Calculate (-2 + 0 - -4) + (-2 - -10) + -10. 0 What is (7 - -1 - 1) + 7 - 9? 5 (4 + -9 + 1 - 5) + 10 1 What is 176 + -179 + 18 + -1 + -26? -12 What is the value of 6 + -4 - (-7 + 6)? 3 Calculate 11 + -3 + -48 + 55 + -1 + -2. 12 1 - -5 - (-71 + 90) -13 4533 - 4565 - (-2 - (-2 + 0) - 6) -26 Calculate -33 + 104 + -33 - (-2 - -18). 22 What is (-2 - -4) + -6 + 0 - (4 + -8)? 0 Calculate (53 - 52) + (0 - 15) + 11. -3 Evaluate -60 - -104 - (8 + 29). 7 What is 5 - (0 - (5 + -10 + 11))? 11 What is the value of 0 + 0 + 31 + -34 + (-3 - -8)? 2 What is the value of 13 - 23 - (2 + -12)? 0 Calculate (-34 + 33 - (9 - (4 - 0))) + 0. -6 Evaluate -1 - (-3 + (5 + -2 - (-29 - -22))). -8 What is 3 + 3 + -8 - (10 + 5 - -4)? -21 What is (-3 - (4 + 1 + -2)) + -14 + 6? -14 Evaluate 8 - (3 - 8 - 10). 23 What is 197 - 207 - (1 + 4)? -15 Calculate 4 + (1 - 2) + (5 - 12) - -22. 18 Calculate 0 - -19 - (-44 - -66 - 11). 8 -16 - (11 + -30 - 22) 25 Evaluate (-2 - -43) + -315 + 293. 19 Evaluate -18 + (27 - -5) + -5. 9 What is the value of -3 - (14 + -69 + 23)? 29 Calculate 1 - -4 - (-36 + 42). -1 Evaluate 17 + -15 + (8 - 3). 7 -2 + 0 + (-11 + 4 - -7) + -1 -3 Calculate 3 - 21 - 10 - (-3 + -8 + 2). -19 What is -16 + (-9 - (-60 + 49))? -14 Evaluate -28 - (-1 - (30 + 21)). 24 (32 - 19) + -4 + -1 + -1 + -21 -14 54 - (7 - (-8 + -19)) 20 18 + -15 + 0 + -5 + -2 - 2 -6 Calculate -16 + 22 + 27 + -22. 11 (3 + -35 - -9) + 30 7 -11 + (-7 - -17) + 8 7 Evaluate 10 + -1 + (95 - 89). 15 Calculate -13 - ((-1 - (4 + -12)) + -13 - 1). -6 Evaluate -36 - -57 - ((8 - 10) + 2 + 0). 21 What is 5 - (3 - (14 - (-20 + 7 + 5)))? 24 0 + 12 - (27 + -16 + 0) 1 Calculate 22 + -12 + 10 + -26. -6 What is 7 + -2 + (-19 - -11)? -3 What is the value of -10 - (8 + 7 - 14) - (-43 + 0)? 32 Evaluate -10 + (-1 - 0) + 1 - -17. 7 What is the value of 3 + -19 + 26 + 8? 18 What is the value of (-25 - -22) + 0 + -2 + 0? -5 What is the value of -20 - (-23 + -7) - 12? -2 What is (8 - 13) + (4 - (-6 - -2)) + -6? -3 What is the value of 39 + -59 - (-8 + -4)? -8 What is 3 + 11 - (29 + -4 + -17)? 6 What is 5 - 1 - (13 - (9 + -2))? -2 What is 20 - ((-10 - -16) + 2)? 12 Calculate 381 + -394 - ((-4 - -2 - -4) + -3). -12 Evaluate (13 - 2 - 0) + -20. -9 Calculate -10 + (-10 - -3 - (48 - 89)). 24 What is the value of (16 - (-7 - -30)) + -12? -19 Calculate -1 + (6 - (2 - 2)) + (-50 - -53). 8 0 - -6 - 3 - (-104 - -93) 14 What is the value of (-9 - -8) + 3 - ((11 - 2) + -7)? 0 Calculate -14 + 44 - (-10 + 22). 18 What is the value of -23 - (18 + (2 - 58))? 15 Calculate -3 + 27 + 0 + (-4 - (10 + -6)). 16 What is 26 + ((7 - 8) + 4 - 14)? 15 Evaluate 6 - (-8 - -19) - (22 + -35). 8 Evaluate (1 - -6) + 0 - (-1 + -6). 14 (1 + 8 + -1 - (-166 + 171)) + -3 0 What is the value of -58 + 10 + 16 - -49? 17 Calculate 6 + 17 + -10 + -16. -3 What is the value of (-22 - -18) + (-2 - -2) + 3? -1 Calculate (-18 - -32) + -4 + 2 - -7. 19 Calculate (-8 - -2 - (-12 + 7)) + 13. 12 Evaluate -17 + 24 + (-1 - 3) + 5 - 5. 3 What is the value of 2 + -8 - (-2 - -31 - 17)? -18 1 + (12 - -1) + -13 + -3 + 11 9 What is the value of (-41 - -24) + (-2 - -12)? -7 Calculate 2 + 3 + (19 - 4). 20 What is the value of 2 - -2 - (29 - (-23 - -42))? -6 4 + 1 + 3 - (-15 + 29 - 0) -6	{ "pile_set_name": "DM Mathematics" }
)(m2 + 3m5 - m2). -8m5 Expand -3p*4 + 2p*4 - 6p*4 + (p - 3p + p)(2p*3 - 2p3 + p3) - p4 + p4 - 3p4. -11p*4 Expand (-1 - 2 + 1)(-1 + 0 + 0)(-z5 - 4z*5 + 3z*5). -4z*5 Expand (-3 + 2 + 3)(0j4 + 4j4 - j4) - 22j4 + 22j*4 - 15j*4. -9j*4 Expand -2b*4 + 0b4 + b4 + (b*2 - 2b3 - b2)(b - 2b + 3b) + 0b - b*4 + 0b + 12b4 - 14b*3 + 14b*3 + 2b*4 + 2 - 2. 8b*4 Expand 4 + 3q - 4 + (0 + 0 + q)(-3 + 6 - 1) - q + 2 - 2 + 4q - q - 4q. 3q Expand 2y3 - y3 - 2y*3 + (-2y + 3y - 5y)(2y*2 - 5y2 - y2). 15y3 Expand (4q - 3 - 1 + 1)(-3q + 0q + 4q). 4q2 - 3q Expand (2z3 + 4z*2 - 4z*2)(-1 - 6z + 1) - 4z*4 + 3z*4 + 2z*4. -11z*4 Expand (213a - 213a + 11a*2)(6a - 2a - 3a). 11a*3 Expand 3n*2 + 2n*2 - 3n*2 + (-2n*2 + 2n*2 + 2n*2)(3 - 7 + 3) + (-28 + 28 - 3n)(4 - 3 - 3)(n - 6n + 0n). -30n*2 Expand (1 + 2r*3 - 1)(r*2 - 4r*2 + 5r*2) + 3r5 + r2 + 2r5 - 2r*5. 7r5 + r2 Expand a + a*2 - a + 107a - 107a - 23a*2 + (-1 - 2a + 1)(3a + a - 3a). -24a*2 Expand (-1 + 0 - 1)(-6 - 7 + 4)(-5s + 5s - s). -18s Expand (136d - 154d + 79d)(2d4 + 3d*4 - 3d*4). 122d*5 Expand (-1 + 1 - 5)(-4s + 2 + s - 3)(-3 + 3 - s). -15s2 - 5s Expand (-34a - 34a + 68a + 198a*2)(3 - 3 + 1). 198a2 Expand (11 - 11 + 16g)(0 + 2 - 1)((-3g + 3g + g)(-2 + 4 + 0) + 2g - g + 0g). 48g2 Expand (2 - 2 + t2)(2 - 3 + 2) + 4t*2 + 6 - 6 - 2 + 0t2 - t2 + 1. 4t2 - 1 Expand (s2 + s2 + 0s*2)(-8s2 + 10s*2 + 12s*2). 28s*4 Expand (-4f - 29f + 11f)(-3f*4 + 5f4 - f4). -22f5 Expand -j4 + j4 + 4j*4 + (2j*3 - 3j3 - j3)(-j + 2j + j) - j4 - j4 - 4j4. -6j*4 Expand 3u + 69 - 74 - 5u + (5u - u - 2u)(-2 + 0 + 0). -6u - 5 Expand (3 - 5 - 3 - 1 + 1 - 2 + (3 + 3 - 4)(4 - 5 + 3))(2a3 - a2 + a*2). -6a*3 Expand (2y*2 - 2y2 + y2)(4 + 17 - 1). 20y*2 Expand (-38y + 4y2 + 3 + 40y - 2)(2y*3 + 2 - 2). 8y*5 + 4y*4 + 2y*3 Expand (-4 + 4 - 2y)(y2 - 3 + 3) + 12y*3 - 22y*2 + 22y*2. 10y3 Expand (-b2 + 2 - 2)(4b + 2b - 5b) - 2b3 - b3 + 5b3. b3 Expand (2l - 3l + 0l)(-4l2 + l2 + 4l*2) + 2l*3 - 2l + 2l - 4l*3 - 7l*3 + 3l*3. -7l*3 Expand (4m + m - 7m + m + 2m - 4m + (m - 4m + 2m)(-2 - 2 + 5))(2 + 1 - 2). -4m Expand (-75x + 10x*2 + 75x)(-5x + 5x - x)(5 - 2 + 0). -30x3 Expand (-v + 0v - v)((2 - 2 + 2)(-1 + 4 - 1) + 2 + 5 - 4). -14v Expand (4d - 4d - d)(1 - 1 + 2d)(-9 + 6 - 10 - d*2). 2d*4 + 26d*2 Expand (5 + 0 - 3)(9m - 9m + 11m + 2). 22m + 4 Expand (0 - 7 - 2 - 1)(-x + 4x - x). -20x Expand (35o - 384 + 384)(-3o*3 - 2o*4 + 3o*3). -70o*5 Expand q - 3q + 4q + (-6q + 3q + 2q)(1 + 2 - 4) - 2q - 1 + 1 + 17q - 2q - 7q + (2 - 1 + 1)(-2q - 2q + 2q) + 6q + 8q - 7q. 12q Expand (-4p*2 + 4p*2 + 8p*2)(-2 + 0 + 0). -16p2 Expand (-5z2 + z2 + 2z2)(0z3 - 5z*3 + 3z*3) + (-2z + 3z + z)(-5z4 + 14 - 14). -6z*5 Expand (2k + 0k + 0k)(-2k - 3k + 4k) + (2k - k + k)(-k + 2k - 3k) + 6k2 - 2k2 - k2. -3k2 Expand (1 - 2 + 0)(-2t + 1 - 1) + (-2 + 2 - 3t)(-7 + 11 + 6). -28t Expand (0 - 1 - 1)(n + 0n - 3n)(n + n + 0n)(7n - 42 + 42). 56n*3 Expand (-2k - 6k2 + 2k)(0 + 0 - 2k*3) + (0k - k*2 + 0k)(4k3 + k3 - 6k3). 13k*5 Expand (3d4 - d4 - 2d + 3d3 - d4)(-d - 2d + 2d). -d5 - 3d*4 + 2d*2 Expand (0z + z - 3z)((4 - 1 - 2)(0 - 1 - 2) + 3 - 4 + 0)(4z - z - z). 16z*2 Expand (-22b - 28b + 12b)(2b + 2b - 3b). -38b2 Expand (-2 + 3 - 2r*2 + 4r*2 - 14r)(-r2 + 5r*2 - 3r*2). 2r*4 - 14r3 + r2 Expand (10h - 16 + 14 - 4h)(1 + 1 + 1). 18h - 6 Expand (-4p + 2p + 0p)((5 - 2 - 2)(4 + 1 - 3) + 2 + 1 - 2)(-p + 2 - 2). 6p2 Expand (4v + 3v - 12v)(6 - 1 - 2). -15v Expand (-2y - 1 + 1)(-2 + 6 - 2) + 41y - 521 + 521. 37y Expand (-56 + 7g2 + 56)(-3 + 0 + 1)(-2g2 + g2 + 3g2). -28g*4 Expand (-2 + 4 - 1 + (2 - 1 + 1)(1 + 3 - 3) - 2 + 2 + 2)(i - 1 + 2 - 3). 5i - 10 Expand (1 + h - 1 + (0 + 2 + 0)(-h + 2h - 2h))(h + 6h + h). -8h*2 Expand 3l*4 + 2l*5 + 0l5 - l4 + (l*2 + 0l + 0l)(0l - 3l*3 + 0l). -l*5 + 2l*4 Expand (-191a*4 + 191a*4 + 4a5 - a3)(0 + 2 - 3). -4a5 + a3 Expand (4c - 2c + 4c)(-3c2 + 5c*2 + 0c*2 + 3c). 12c3 + 18c*2 Expand (2 + 0 + 0)(-2c - 3c + 3c) + 19c + 12 - 12. 15c Expand (-3 + 6 - 1)(4l5 + l5 - 2l*5) + (-l - 3 + 3)(l4 - l4 - 2l4) + 4l5 - l5 - 2l5. 9l*5 Expand ((6 - 3 - 2)(3q - 8q - 3q) - 2 + 2q + 2)(-4q*3 - 3q*3 + 5q3) + q4 + 0q4 + 0q*4. 13q*4 Expand (3 - 1 - 1 - 2 + 2 - 1 + (7 - 2 - 3)(0 + 1 + 0) + 4 + 1 - 4 + 0 - 1 + 0 - 1 - 1 + 3)((-5f + 5f - 2f)(3 - 1 - 1) + 0f - 4f + 3f). -9f Expand (3 + d - 3)(4d + 0d - 2 + 2d). 6d*2 - 2d Expand (2j3 + 0j*3 - 3j*3)(-3j2 - j2 + 2j2) + (j3 + j3 + j3)(-2j*2 + 5j2 - j2) - 4j2 + j2 + 2j5 + j2. 10j5 - 2j*2 Expand 14 - 14 + 5b*3 - b + b + 2b*3 + (-1 - 2 + 2)(-b2 + b2 - b3) + b3 - b3 - b3 - b*3 + 4b3 - b3. 9b3 Expand (-2 + 2 - 1)(-3 - 2i + 3) - 5 + 5 + i - 1 + 1 + 2i + 4 - 2i - 4 - 1 - i + 1 + (0 + 0 + 1)(3 - 3 - 3i) + 0i + i - 2i. -2i Expand (-4i5 - 2i*5 + 4i*5)(14 - 21 + 16). -18i5 Expand 6y*2 + 10 - 10 + (7 - 1 + 0)(6y2 - 4y*2 + 0y*2). 18y*2 Expand (-35 + 3a*2 + 35)(0a + 3a - a) - 2a3 + a3 - a3. 4a3 Expand z3 - z3 + z4 + 2z2 - 2z*2 + 3z*4 + (0z*3 + 2z*3 + 0z*3)(5z - z - 3z) - z*4 + 4z - 4z. 5z*4 Expand (-1 - 5m + 2 - 13m + (-m + 4m - 2m)(3 - 5 + 3))(-1 + 1 + m2). -17m3 + m2 Expand (0x + 3x + x)(0 + 4 - 2) + (0 - 2 + 0)(2x - 3x - 2x) + 2x - x + 0x. 15x Expand (-3u2 - u2 + 5u*2)(-18 - 11 + 12) + 1 - 1 - 2u2 + (-2 + 2u + 2)(-6u + 5u - u). -23u*2 Expand -k - k + 4k + (-2 - 3 + 2)(3k - 2k + 0k). -k Expand (-2p - p + p)(2 - 3 + 3)(-11p + 13 - 13). 44p2 Expand (2c + 0c + 0c)(-5c*4 - 8c*4 + 3c*4 - 2c*4 + 2c*4 + 2c*4 + (2 - 2 - c)(-c2 - c3 + c*2)). -14c*5 Expand (2 + 2x - 2)(-5 + 2 + 1)(16x2 - 8x*2 + 10x*2). -72x*3 Expand (3f - 2f + 2f)(-f - 3 + 3) + f2 - 1 + 1 + 1 - 1 - 3f*2. -5f*2 Expand (56z*2 - 56z*2 + 23z*3)(3z2 + z2 - 2z2 + z - z - z2 + (2 + 2z - 2)(5z + z - 4z) + 6z2 - 2z*2 - 3z*2 + 2z - 2z + 2z*2). 184z5 Expand (t2 + 0t2 + 4t*2)(-3 - 3 + 4) + (2 + 2 - 5)(1 - 1 - t2) - 3t*2 + 4t*2 + 0t*2 - 2t + 2t2 + 2t - 3t2 + 4t*2 - 2t*2. -7t*2 Expand 7w2 - 12 + 12 - w2 + 0w + 0w + (-4w + 0w + 5w)(-3 + 3 - 2w) - 3w*2 - 2w*2 + 2 + 4w*2. 3w*2 + 2 Expand (3 - o - 3)(5o4 - o4 - 5o*4) + 5o*5 + 0o5 + o5. 7o5 Expand (-3 + 4 - 3)(3j - 4j - 3j)(-5j + 3j + j)(3 + 1 - 1). -24j*2 Expand (-3q + 2q + 2q)(-2q + 1 - 1) + (3q - q - 4q)(4q - 2q - q) - 1 + 8q*2 - 9q*2 + 0. -5q*2 - 1 Expand (-4i*3 + 3i*3 - 2i*3)(i*2 - 7i*2 + 3i2) + (i3 - 2i3 + 3i*3)(5i - 4i - 3i)(2i - 4i + 3i). 5i*5 Expand (0k + 4 - 2k - 5)(224 + 19k - 224). -38k*2 - 19k Expand (6h2 - h + 2 - 2h*2 - 7h*2)(-2 + 4 - 4). 6h2 + 2h - 4 Expand (0o + o - 4o)(2 - 5 + 1)(0 + 0 + 2o). 12o*2 Expand (-4r*2 + 4r2 - 2 - r2)(4r - 3 + 3 + (-1 - 3 + 2)(-r - r + r)). -6r*3 - 12r Expand ((-2 + 5 - 1)(3 - 2 - 2) + 2 + 0 - 3 + 5 - 3 + 0 - 6 + 3 + 5 + (0 - 2 + 4)(1 - 4 + 2) - 4 - 1 + 6 - 3 + 0 + 2 + 1 + 0 - 2)(12k + 13k - 14k). -22k Expand (-2i + i - i)(i3 - i3 + i3) - 4i + 4i - i4 - 3i4 + i4 + i4 - i4 - 2i3 + 0i*4 + 3i*3. -5i4 + i3 Expand (7q2 + 0q*2 - 3q*2 + 0q2 + q2 + q*2 + (5q - q - 3q)(-4q - 2q + 5q))(3 - 4q - 3)(4 - 1 - 1). -40q3 Expand (-73n*2 - 9n*2 + 8n*2)(3 + 2 - 3). -148n2 Expand (-4o + 3 - 3)(0o*2 - 7o*2 - 3o + 5o2). 8o*3 + 12o*2 Expand -3d*5 + 16 - 16 + 2d*5 + 0	{ "pile_set_name": "DM Mathematics" }
82174 - 2782174. What is v rounded to the nearest 1000000? -1000000 Let l = 0.309 - 130.309. Let v = 2.14 - 124.44. Let n = l - v. Round n to zero dps. -8 Let p = 10 - 8. Suppose -pl = -l - 130000. Round l to the nearest one hundred thousand. 100000 Let n = 18 - 18.095. What is n rounded to two dps? -0.1 Let v = 8 + -7.948. Let u = v + -0.05114. Round u to four dps. 0.0009 Let b = -286.9999718 - -287. What is b rounded to six dps? 0.000028 Suppose 0 = -4g - 2 + 10. Suppose 5v - 2p + 205004 = 0, -gv + 2p + 122996 = -5v. What is v rounded to the nearest ten thousand? -40000 Let m = 0.076999437 + -0.077. What is m rounded to seven dps? -0.0000006 Let y = 0.5 - 0.56. Let h = 0.13 + y. Round h to one decimal place. 0.1 Let u = -2771.055 - -2791. Let l = 20 - u. Round l to two decimal places. 0.06 Let h = 36 - 35.9998. Round h to 4 decimal places. 0.0002 Let z = 0.1413721 + -0.1413. Round z to five decimal places. 0.00007 Let u(i) = 759997i + 9. Let v be u(3). Round v to the nearest 100000. 2300000 Suppose 0 = -i + 43 - 7. Suppose 0 = n + 3, -i = m - 0n + 3n. What is m rounded to the nearest 10? -30 Suppose o - 2p - 2p = 456, p = 2o - 884. What is o rounded to the nearest 100? 400 Let d = 44201.9 + -37921.692. Let i = 6275.208007 - d. Let j = -5 - i. Round j to 6 decimal places. -0.000007 Let b = 226 - 223.512. Let n = -0.148 + b. What is n rounded to one dp? 2.3 Let c(y) = 38y + 2. Let k be c(2). Let g be 2 - -2(-1)/(-2). Suppose gu = -0u - k. What is u rounded to the nearest ten? -30 Let l(v) = v2 - 2v + 2900. Let w(s) = -2s2 + 3s - 2900. Let z(x) = -3l(x) - 2w(x). Let o be z(0). Round o to the nearest one thousand. -3000 Let h = 13907 + -3707. Round h to the nearest one thousand. 10000 Let j = 113.99 - 113. Let a = j - 0.5. Let b = 0.48999969 - a. What is b rounded to 7 dps? -0.0000003 Let i be 23/8 + (-6)/(-48). Suppose -il - z - 16199995 = 0, 0 = l + l + 3z + 10799985. Round l to the nearest 1000000. -5000000 Let z = -0.2118 + 24.1518. Let q = z + -24. Round q to one dp. -0.1 Let v = 43 + -46.8. Let a = v - -3.838. What is a rounded to two dps? 0.04 Let r = -0.4 + 0.56. What is r rounded to 1 dp? 0.2 Let y = -3793237 - -1893237. Round y to the nearest 1000000. -2000000 Let d = 2650974.829921 - 2650973. Let i = -1.83 + d. What is i rounded to five dps? -0.00008 Let b = 318.2 - 231. What is b rounded to the nearest ten? 90 Let k = 1030511756 + -1031594501.00034. Let i = k + 1082736. Let x = -9 - i. Round x to four decimal places. 0.0003 Let r = 0.89 + -0.8843. Round r to 3 dps. 0.006 Let i = 0.0312 - 0.03. Let a = 0 + i. What is a rounded to 3 dps? 0.001 Let r(v) = v*2 - 7v - 6. Let w be r(8). Suppose u = 4, -2q = wq - 4u + 2960016. What is q rounded to the nearest one hundred thousand? -700000 Let l = 18 + -24.6. Let c = l + 8. Let z = -0.7 - c. What is z rounded to 0 dps? -2 Let f = 747 + -1617. What is f rounded to the nearest one hundred? -900 Let t = 13387230861508.000054 - 13387206663539. Let b = t + -24197949. Let g = b + -20. Round g to 5 decimal places. 0.00005 Let l be (2 + -2 - 0)/(-2). Suppose lk + k = -627931. Let f = k - -97931. What is f rounded to the nearest 100000? -500000 Let s = -20.99974 - -21. Round s to 4 decimal places. 0.0003 Let b = 4.4 - 10. What is b rounded to the nearest integer? -6 Let o = 0.08 - 4.08. Let k = -3.9945 - o. Round k to 3 dps. 0.006 Let m(t) = -t - 3. Let d be m(-5). Suppose 2g - 1 = -du + 11, -u + 15 = 4g. Suppose -5o = -3o + 5n - 89, -5n - 171 = -go. Round o to the nearest 10. 50 Let d be 5496-1 + -6 + 2. Round d to the nearest 1000. -6000 Let d = 0.298 + -0.24. Round d to 2 dps. 0.06 Let j be (-2)/6 - (-1828622)/6. Let a = j - -55230. What is a rounded to the nearest 100000? 400000 Suppose 4u - 9 - 11 = 0. Suppose -uv - 2n - 496 = 0, -2n + 504 = -4v - v. Round v to the nearest one hundred. -100 Let m(d) = -83d3 + 11d*2 + 13d + 9. Let t be m(10). Let l = 134761 + t. Round l to the nearest ten thousand. 50000 Let w = 9.5 + -6. Round w to the nearest integer. 4 Let o = -48 - -45.96. Let a = -2 + 4. Let p = o + a. What is p rounded to 2 decimal places? -0.04 Let p(i) = i*2 - 5i - 3. Let j be p(5). Let f be ((-8)/j)/((-5)/750). Let l = f + 230. What is l rounded to the nearest 100? -200 Let x = -7 - -12. Suppose 90 = -xr + 310. Let j = -100 + r. What is j rounded to the nearest 10? -60 Let d be (1996 + 4)(-452)/8. Round d to the nearest ten thousand. -110000 Let c(b) = 14999b - 3. Let n be c(-3). What is n rounded to the nearest ten thousand? -50000 Let i = 194136 - 95617. Let f = i + -216519. What is f rounded to the nearest 10000? -120000 Let a be (7 - (-3)/(-1))-1. Let x be a/((-24)/(-591))2. Round x to the nearest ten. -200 Let d = 8225.59 + -8271. Let j = 45 + d. Let h = -0.409961 - j. Round h to five dps. 0.00004 Let j(x) = -5x + 3500000. Let z be j(0). What is z rounded to the nearest 1000000? 4000000 Let o = 0.430044 + -0.43. What is o rounded to 5 dps? 0.00004 Let t = 7.4000085 - 7.4. Round t to 6 dps. 0.000009 Let m be 6 + -36/9. Suppose -1800000 = i + mi. Round i to the nearest 100000. -400000 Let p(r) = r*3 - 16r*2 + 31r - 7. Let b be p(13). Round b to the nearest 10. -110 Let c = -4.1245945 - -2.7245942. Let w = -1.4 - c. Round w to 6 dps. 0 Let d = -952121 + 472121. Round d to the nearest 100000. -500000 Let w = -4 - -1. Let q = -3 - w. Let n = q - -0.07. What is n rounded to 1 decimal place? 0.1 Let x = -485 - 265. Round x to the nearest 100. -800 Let x = -131 - -130.999999. Round x to five dps. 0 Let f = 14 - 14.00000018. Round f to 7 decimal places. -0.0000002 Let t = -40 + 39.905. Round t to 2 dps. -0.1 Suppose -d + 0d + 27995 = 0. Suppose -m = -2r - 2m - d, 0 = r + m + 13995. Round r to the nearest 10000. -10000 Let k = 0.019 + 0.115. What is k rounded to two dps? 0.13 Let x be (-38)/(-14) + (-4)/(-14). Suppose 0 = -v + x, p - 3v - 189 + 48 = 0. Round p to the nearest 100. 200 Let k = -221.46574 + 2.55874. Let l = 219 + k. What is l rounded to two dps? 0.09 Let z = 7 - 6.9985. Round z to three dps. 0.002 Let s = 1.6 - 2.25. Round s to 1 decimal place. -0.7 Let y = 5214.081 + -9.081. Let v = 5256.62 - y. Let o = v + -51. What is o rounded to one dp? 0.6 Let y(h) = 1213h + 9. Let k be y(7). Round k to the nearest 1000. 9000 Let h = -56.2 + 66. Let p = 1.8 - h. Let t = -8.00006 - p. Round t to 4 dps. -0.0001 Let o = 23.57 + -22. Let l = o - 0.07. Let k = l - 1.50036. Round k to four decimal places. -0.0004 Let o = 12.3 - 12.87. Let n = o + -0.04. Round n to 1 decimal place. -0.6 Suppose -p = i - 210001, -463641 = -2p + 5i - 43646. Suppose -7k = -8k + p. What is k rounded to the nearest one hundred thousand? 200000 Let z = 0.969852 - 0.97. What is z rounded to 5 decimal places? -0.00015 Let b = 0.08 - 6.08. Let x = b - -6.032. What is x rounded to 2 dps? 0.03 Let d(k) = 4k - 3. Let x be d(2). Suppose i + 720000 = xi. Round i to the nearest one hundred thousand. 200000 Let d = -9 - 2. Let o(q) = -412q*2 + 12q - 16. Let g be o(d). Round g to the nearest one hundred thousand. -100000 Suppose a = -0a - 3034. Let n = a - -1514. What is n rounded to the nearest 100? -1500 Let c = -9387.23 - -9340. Let x = c + 48. Round x to 1 decimal place. 0.8 Let b be (25 + 0)-100(-2652)/13. Round b to the nearest 100000. 500000 Let a = -58.401 + 59. Round a to two decimal places. 0.6 Let q = 6 - 6.42. What is q rounded to one dp? -0.4 Let p(y) = -1227y - 5. Let t be ((-1 - -2) + -8)/(-1). Let m be p(t). Let d = m + 4194. What is d rounded to the nearest 1000? -4000 Suppose 0 = -w + 5a + 3379985, 0 = 3a - 4a + 3. Round w to the nearest 100000. 3400000 Let u be -1 - 6/(-10) - (-299996)/(-10). What is u rounded to the nearest 100000? 0 Let m = -38.19823 + 38.2. Round m to four decimal places. 0.0018 Let y = 5 - 1. Suppose s - 6s - 2c + 3994 = 0, -yc = 5s - 3988. Suppose -s = -m + 5m. What is m rounded to the nearest 1000? 0 Suppose -48890 = -3n - 5f, f = -2n - 2f + 32594. What is n rounded to the nearest one thousand? 16000 Let b = 99 + -98.99882. What is b rounded to 4 dps? 0.0012 Let v = 90692 - 53692. Round v to the nearest 10000. 40000 Let v = 223279.7 - 223278.7000002. Let o = v - 1. Round o to 6 dps. 0 Le	{ "pile_set_name": "DM Mathematics" }
8234 = j. What is the tens digit of x? 5 Let y(x) = x*3 - 9x*2 + 12x - 20. Let w be y(8). Let a be 3/(13/w + (-7)/21). Suppose 0 = -3v - 0v + 5p + 568, a = 4p. What is the tens digit of v? 9 Let i(h) = -h*3 - 15h*2 - 21 + 17h - 7h2 + 9h*2. Let n be i(-14). What is the tens digit of (n/12 - -4)-28? 3 Suppose -36o = -1480 - 83552. Let z = -1184 + o. What is the units digit of z? 8 What is the tens digit of ((-239226)/(-18))/(17(-3)/(-153))? 7 Let h = 2483 + -1869. What is the tens digit of h? 1 Let y(r) = 2r3 - 3r*2 - 8r + 51. Let s be (-1)/(-7 + (-192)/(-28)). What is the units digit of y(s)? 4 Suppose -x = 40x - 158629. What is the thousands digit of x? 3 Let b(h) = h3 + 44h*2 - 53h - 29. Let a = -356 + 311. What is the hundreds digit of b(a)? 3 Let g(o) = -4o3 + 3o*2 + 20o + 11. What is the units digit of g(-12)? 5 Suppose -833930 + 4605387 = 59f. What is the tens digit of f? 2 Let d = -450 + 153. What is the tens digit of (-4)/18 - 11/(d/3624)? 3 Suppose -20118 = -3y + 2j, -3j + 26841 = 4y - 0y. What is the thousands digit of y? 6 Let m = 96 - 31. Suppose 5o + 20 = m. Suppose os = 222 + 1830. What is the units digit of s? 8 Let n be 38/10 + (-1)/(-5) + 1814. Suppose -32g + n = -29g. Suppose g + 490 = 4l. What is the hundreds digit of l? 2 Let z = 266 + -262. What is the tens digit of 10120/(-11)-1 + (z - 0)? 2 Suppose -j - 4x = -4326, -2877 = -j + 5x + 1485. What is the thousands digit of j? 4 Let q = -89 - -8013. Suppose 3z - 17z = -q. What is the hundreds digit of z? 5 Let k(u) = u*3 - 6u*2 - 22 + 7 + 136u - 133u. Let j be k(6). Let h(v) = 8v*3 - 2v*2 - 6v. What is the units digit of h(j)? 0 Let i = 19815 - 5123. What is the units digit of i? 2 Let l(p) = -p*3 - 7p*2 - 10p - 8. Let h be l(-9). Let z = 326 - h. What is the tens digit of z? 8 Suppose 58i + 260623 = 708847. What is the thousands digit of i? 7 Suppose 3g - 85 = 5k, 4k - 3g = -8g - 68. Let l be 9/(-21) - k/7. Suppose -30 - 40 = -lj. What is the units digit of j? 5 Let c(q) = q + 0 + 127q*2 + 4 + 0 - 3. What is the hundreds digit of c(1)? 1 Suppose 4u + 12 = 8u. Let b be (-12)/(-7) - 8/(-28). Suppose l = -bx - 3, -ul = -2l + 4x + 7. What is the units digit of l? 1 Suppose 2c - 3190 = -5m, 0 = -c + 2m + 1953 - 358. What is the thousands digit of c? 1 Suppose -10651 - 2373 = -c - 325. What is the units digit of c? 9 Let u(i) be the second derivative of -59/3i3 - 5i*2 + 0 - 11i. What is the tens digit of u(-2)? 2 Let j be 84/(-36) + (0 + 1)/3. What is the units digit of (j18/(-16))/(2/304)? 2 Let k be (-107)/7 - 34/(-119). What is the units digit of (-11)/55 + (-3)/k276? 5 Suppose -2g + 5m = -10996, -27439 = -38g + 33g + 4m. What is the tens digit of g? 8 Suppose 0 = 5q - 5s - 70, 4q + 2s - s = 36. Suppose -2968 = -qu + 3132. What is the tens digit of u? 1 Suppose 134044 - 447840 = -145x + 2022589. What is the hundreds digit of x? 1 Let g(l) = -529l + 1030. What is the units digit of g(-9)? 1 Suppose -8l + 117752 = 4o, 5o + 73634 = 5l + o. What is the hundreds digit of l? 7 Let r(p) = -p*3 - 3p*2 - 5p - 4. Let w be (-16)/9 - 4/18. Let c be r(w). Suppose -cm + 47 = -0m + x, 4x + 137 = 5m. What is the units digit of m? 5 Let m be 1(18 + 1) + (-20 - -22). Suppose 5w = -m + 141. What is the hundreds digit of 16/w + 1064/6? 1 Let w(f) = -f*2 + 11f + 39. Let o be w(12). Suppose -2d + os + 134 = 23s, 5d + 5s = 335. What is the units digit of d? 7 Suppose -96 = -3z - 5r, 2z - 2r = 41 + 39. Let s = 35 - z. What is the tens digit of (-103)/s + (-51)/(-34)? 5 Let v = 78424 - 45647. What is the ten thousands digit of v? 3 Let l = -15413 - -26691. What is the units digit of l? 8 What is the thousands digit of 3/13 - 1695780/(-585)? 2 Let t be (1 + -2)(-5 + 0). Suppose 5a = 6w - 30, -127 = -4a - 151. Suppose wb - 170 = -tb. What is the tens digit of b? 3 Suppose 3u - 12886 = -m - 4u, -5u = -4m + 51676. What is the units digit of m? 4 Suppose 11d + 505 = 6d. Let l = -99 - d. Suppose -93 = -f + 2v + 2v, -lv = -3f + 269. What is the units digit of f? 9 Suppose -4v - 17 = 3j, -13 = 2j + 5v + 10. What is the units digit of j + (10 - 4) - -1? 8 Suppose 0 = -3m - 3u + 4760 + 4465, m - 3081 = -4u. Let p = m + -1314. What is the tens digit of p? 5 What is the hundreds digit of 4145 - ((-3)/((-9)/1))/(34/(-204))? 1 Suppose 2h = 4v - 36528, 13468 + 13938 = 3v - 4h. What is the hundreds digit of v? 1 Suppose 5f - 56 - 184 = 0. Suppose 16x = 17x - f. Let u = 114 - x. What is the units digit of u? 6 Let f(d) = -10d*2 + 4d + 83. Let p be f(-7). What is the hundreds digit of (51/(-17))/(3/p)? 4 Suppose 0 = 142i - 16i + 55i - 5374252. What is the thousands digit of i? 9 Suppose -10l = -2l + 2056. Let g = 1029 + l. What is the tens digit of g? 7 What is the hundreds digit of 155/(-124) - 1061140/(-16)? 3 Let b be (-72)/1087/((-7)/120). Let q = -73 + b. What is the units digit of q? 7 Let h(b) = -b*2 + 15b - 5. Let c be h(12). Let n(r) = r*2 - 17r - 19. What is the tens digit of n(c)? 1 Suppose 2q = u - 3u + 6008, -9007 = -3q + 2u. What is the hundreds digit of q? 0 What is the units digit of (-3(-7)/(-14))/(9/(-2400))? 0 Let r(d) be the third derivative of d5/60 - d4/24 - d3 - 34d*2. Let b be r(-3). Suppose 10g - b = 7g. What is the units digit of g? 2 What is the units digit of 3/(-81)-3 - (-17 - (-1394090)/(-90))? 7 Suppose -13120 + 55038 = 14g - 60142. What is the hundreds digit of g? 2 Let y = 30 + -18. Let r be (1 + -1)/(4/(y/3)). Suppose ra + 2a - 5g - 279 = 0, a - 135 = g. What is the hundreds digit of a? 1 Let k(j) = -7j + 20 + j - 6 + 11 + 9j*2. Let q be k(-7). Suppose 9u - 5u = q. What is the tens digit of u? 2 Let w(v) = 199v + 51. Let i be w(4). Suppose 23x = 34x - i. What is the units digit of x? 7 Suppose -d + 11 = 6. Suppose 2c - 2395 = -dz, -3c + 5978 = 2c + 3z. Suppose q = 6q - c. What is the tens digit of q? 3 Suppose 9p - 77987 = 147524 - 24181. What is the hundreds digit of p? 3 Let s be 1(5 + -4 + 3 + -1). Suppose 418 = -f - h, -f + sh - 401 + 3 = 0. Let l = f + 690. What is the tens digit of l? 7 Suppose -5m + 9346 = -15974. What is the units digit of m? 4 Let z(m) = -675m - 401. What is the tens digit of z(-24)? 9 Let b = -76 - -80. Suppose bz = -5c + 4c + 287, -607 = -2c + 3z. What is the units digit of c? 9 Suppose -4b = 4p - 14164, 0p - 7076 = -2b - 4p. Let m be b/68 + 2/(-17). Suppose 15k + m = 487. What is the tens digit of k? 2 Suppose y - 3l + 6 = 0, 3y + 5l - 10 = -0l. Suppose 84 = n - yn. Suppose 18 = -u + n. What is the units digit of u? 6 Suppose 0z - 5 = 3r - 2z, 3r + 5z - 23 = 0. What is the tens digit of -1(r/3)/((-13)/14313)? 6 Let r be (-14)/8 + 2 + (-629)/148. What is the units digit of (166(-1)/r)/(5/10)? 3 Suppose 3h - 1 - 5 = -3z, -5z - 60 = -5h. Let g = h + 145. What is the tens digit of g? 5 Let u be (-55)/15 - 4/(-6). Let y be 84/(-147)(21/2)/u. Suppose 172 + 198 = yr. What is the units digit of r? 5 Let l = 13366 - 3669. What is the thousands digit of l? 9 Suppose 0 = 201n - 138673 - 1893327 + 342193. What is the hundreds digit of n? 4 Suppose 10g = -g - 2695. Let v = 443 + g. Let n = v + -96. What is the tens digit of n? 0 Let a(x) = 198x3 + 3x*2 + 5x - 21. What is the thousands digit of a(2)? 1 Let t = -49 - -51. Suppose -td = -3d + 4. Suppose 0 = i + 5r - 93, 0r + 334 = di + r. What is the tens digit of i? 8 Suppose 15r - 469314 = -2t, -9t = -4r - 14t + 125137. What is the units digit of r? 8 Let j = -5687 - -8509. What is the hundreds digit of j? 8 Suppose 0 = 50p - 16p + 22p - 1361136. What is the units digit of p? 6 Let b = -2732 - -5487. Suppose 5z = -5u + b, -70z + 69z - 5u + 551 = 0. What is the tens digit of z? 5 Let o(s) = 54s - 50. Let m be o(-3). Let f = m + 1246. What is the thousands digit of f? 1 Suppose 3u + 15h = 19h + 1477, 3u = 3h + 1473. Suppose 0 = -2b + 10, 6b - 9b - u = -2l. What is the units digit of l? 1 Let i = -10107 - -11256. What is the hundreds digit of i? 1 Suppose 0 = 2u + 4x - 6, -2u + 3 = x - 6. Suppose uf + 5k - 1130 = 0, 6f = 4*f - k + 450. What i	{ "pile_set_name": "DM Mathematics" }
e of 211m2nv - 25m*2n + 2m2 - nv - 647v wrt n. 211m*2v - 25m2 - v What is the second derivative of 137o*2v + 2o2 - 2o - 91v wrt o? 274v + 4 What is the second derivative of -184r2 + 143r + 1 wrt r? -368 Find the third derivative of 889a3 - 1677a*2 wrt a. 5334 Find the third derivative of -99d*5 + 118d*2 wrt d. -5940d2 Find the first derivative of -k4 - 69k2 + 35. -4k*3 - 138k What is the second derivative of 3qy*2z + 21qyz2 + 3qz + 6q + 9y2z*2 - 2y*2 wrt z? 42qy + 18y*2 What is the third derivative of -146u*3v + 32u2 + 2v wrt u? -876v What is the third derivative of 2sx3 + 46sx2 - sx - 21x3 + x2 wrt x? 12s - 126 What is the first derivative of -46qt*2 + 7qt - 23q + 5 wrt t? -92qt + 7q Find the third derivative of 4772p*3 - 218p*2 - 19p. 28632 What is the third derivative of 50l5t2 - l5t + l2t*2 + 27lt2 wrt l? 3000l*2t*2 - 60l*2t What is the first derivative of -2k2 - 116k - 1683? -4k - 116 What is the second derivative of -13r*2tu + 40r*2u + rtu - 3ru + 5tu - 11t wrt r? -26tu + 80u What is the third derivative of 210r5 + 133r*2 - r? 12600r2 What is the third derivative of h4k3 - 28h*4k + 7h4 - 442h*2k*3 + 2h*2 wrt h? 24hk3 - 672hk + 168h Find the third derivative of -i*6 - 8i*4p*2 + 2i*4 - 2i*2 + 78ip2 wrt i. -120i*3 - 192ip2 + 48i What is the second derivative of -589d3x*2 + 7d*3 - dx*2 - dx - 2x2 + 33x wrt x? -1178d3 - 2d - 4 Find the second derivative of -121a5 + 68a. -2420a3 What is the third derivative of -2h*3w*3x*3 - 859h*3w*2x*3 + 4h*3wx2 - 2h*3w + 2h2w*3 + 12w*2 wrt x? -12h*3w*3 - 5154h*3w*2 Differentiate -14232r*3v - 81r3 - r2v*2 + 1 with respect to v. -14232r*3 - 2r*2v What is the second derivative of -16066f2 + 153f wrt f? -32132 What is the second derivative of 4f2o*2r + 243f2o*2 - 2f*2o - o*2r - 2o2 - 3136or wrt o? 8f*2r + 486f2 - 2r - 4 Find the third derivative of 110q3 - 221q*2. 660 What is the third derivative of 65b*2kz3 - b2kz + b2z*3 + 2bkz*2 - 6bk - kz*3 - 3z*3 + 65z*2 wrt z? 390b*2k + 6b2 - 6k - 18 Find the second derivative of -1748y2 + 1359y. -3496 Find the second derivative of 404q2 + q + 44 wrt q. 808 What is the second derivative of 440az5 + 11az2 - 2az + 44a + 11z wrt z? 8800az3 + 22a Find the second derivative of -19n2w*2 + 20n*2 + 18n - 3w2 - 3w wrt n. -38w2 + 40 Find the second derivative of 6i*2o*3q*2 + 34i*2o*2 - 2i*2 + 5io3q*2 - 2io2q + 896iq*2 wrt i. 12o*3q*2 + 68o*2 - 4 Differentiate -5537m*4 + 15211. -22148m*3 What is the second derivative of -2cy2 + 2cy - c - y4 + 52y*2 - 382y wrt y? -4c - 12y*2 + 104 Find the third derivative of 18695g3 - g2 - 4621. 112170 Find the third derivative of -2n4q*2 - 740n*4 - 24n*2q*2 - 2nq2 + 7q*2 wrt n. -48nq2 - 17760n Differentiate 3h2 + 17h + 227 with respect to h. 6h + 17 Find the second derivative of 5tw3 + 6tw + 2t - 16w4 + 12w wrt w. 30tw - 192w2 What is the second derivative of -1061k*3z*5 - 7800k*3z wrt z? -21220k3z*3 What is the second derivative of 35x*2z*3 - 3x*2z - 13xz*4 + 187xz wrt z? 210x*2z - 156xz*2 Find the second derivative of 7a*4j - 4a2j + 2a - 31j + 1 wrt a. 84a2j - 8j What is the second derivative of 2m*5 - 15343m*4 + 2m - 20411 wrt m? 40m3 - 184116m*2 What is the first derivative of 2136h*3x*4 - 14h3 + h2x4 - 7h*2 + h wrt x? 8544h*3x*3 + 4h*2x*3 Find the first derivative of 169z*2 + 1603 wrt z. 338z What is the third derivative of 167o5 + 75o*2? 10020o*2 What is the third derivative of 1020w*5 + 161w*2 wrt w? 61200w*2 What is the second derivative of -15s*3u4 + s3u + 11su5 + 14su + 1 wrt u? -180s*3u*2 + 220su3 What is the derivative of 2g*3 - 298g*2 - 341 wrt g? 6g*2 - 596g Differentiate 5o4su - 86o*2s*3u + s*3u + 12su wrt o. 20o3su - 172os3u Find the third derivative of 3l5 + 65l*4 + 1325l*2. 180l*2 + 1560l Differentiate -17q3 - 2q*2 + 954 wrt q. -51q*2 - 4q What is the second derivative of -7276i5 + 5351i? -145520i3 What is the first derivative of -274a*3 - 550 wrt a? -822a*2 Find the second derivative of -812k*2s*2 - 9k*2 + ks + s wrt s. -1624k2 Differentiate 3739y*3 + 2359. 11217y*2 Find the third derivative of 8383b*6 - 2b*2 - 97 wrt b. 1005960b*3 Find the first derivative of 2959cg + 2883g wrt c. 2959g What is the second derivative of -593x*3 - 681x? -3558x Differentiate -42cm + 4c - 2m + 53 with respect to m. -42c - 2 Find the second derivative of 4j2nv2 - 2j*2v*2 + 57j*2 - 2jnv*2 - 117jnv + 2jv*2 wrt j. 8nv2 - 4v*2 + 114 Find the third derivative of -9q6 - q5 + 304q2 wrt q. -1080q*3 - 60q*2 Find the first derivative of -1411m - 570. -1411 Find the third derivative of -4578s4 + 10609s*2 wrt s. -109872s What is the third derivative of n*6 + 63n*5 - 32n*3 + 9n*2 - 1214 wrt n? 120n*3 + 3780n*2 - 192 Find the second derivative of -125i*3x*2 - 4i3 - i2lx2 + i2lx + ix2 - 56l wrt x. -250i3 - 2i*2l + 2i What is the third derivative of -2r*3z + 44r3 - 240r*2z wrt r? -12z + 264 What is the second derivative of 2m*3v*2w - 3m3vw2 + 21m*3w - m*2v*2w - 28m2w*2 - 2mv3w*2 + 2v*3w wrt w? -6m3v - 56m2 - 4mv3 What is the second derivative of 2l*3 + 62l*2 + 108l? 12l + 124 What is the derivative of k4t - 5042k3t + 15t - 272 wrt k? 4k*3t - 15126k2t Find the third derivative of -2dm*2q*3 + 114dm2q*2 + 5dq - 164m*2q*4 wrt q. -12dm2 - 3936m*2q What is the third derivative of -10f6 - 21f*4 + 174f*2? -1200f*3 - 504f What is the third derivative of 8845l5 + 252l*2 + 11l wrt l? 530700l2 Find the third derivative of -65s*6 + 2s*2 + 5s. -7800s3 What is the derivative of -8g*2j*3 - 97gj3 + 1534j*3 wrt g? -16gj3 - 97j*3 What is the second derivative of 22967q*2 - 817q + 8 wrt q? 45934 Find the second derivative of 215n2p*3t*3 + 2n*2pt3 + 2n*2 + 3np3t*3 - 4np2t - 2nt*2 - 5p*3t*3 wrt n. 430p*3t*3 + 4pt3 + 4 Find the first derivative of -5025v*2z*4 + 2v*2 - 1657 wrt z. -20100v*2z*3 Differentiate 9c*2m*2 - 294c*2 - 16cm2 wrt m. 18c*2m - 32cm Find the second derivative of 2w3 + 14304w*2 + 2438w + 2 wrt w. 12w + 28608 What is the third derivative of -393r*3 - 449r*2 - 2r wrt r? -2358 What is the third derivative of 8390q6 - 141q*2 - 2q wrt q? 1006800q3 Find the third derivative of -98c*4 + 4c*2 - 12c wrt c. -2352c What is the first derivative of -21608k*2y - 49k2 + 138 wrt y? -21608k*2 Find the third derivative of 39bmr*3 - 8bmr - br3 - 6mr3 - 4mr2 - 23m + 2r3 wrt r. 234bm - 6b - 36m + 12 Find the third derivative of 24a*2l*3r*3 + 3a*2l*3 - 84a*2 + al*2r + ar2 - l3r*3 wrt r. 144a*2l*3 - 6l*3 Differentiate -3130a*3j - 4824j with respect to a. -9390a*2j What is the derivative of 376ak - 36k + 25 wrt a? 376k Find the second derivative of 3600f3 + 25f - 24 wrt f. 21600f What is the second derivative of 5487i*3 - 170i - 11 wrt i? 32922i What is the second derivative of 57d*2i*2 - 29d*2 + 167di2 + 6i wrt i? 114d2 + 334d Find the second derivative of -376c5 + c - 41 wrt c. -7520c3 What is the second derivative of -l2n2 + 2l*2n - 127ln*4 - 18n wrt n? -2l2 - 1524ln2 Differentiate 4cn3s - 16cn*2 - 338cs + n2s wrt n. 12cn*2s - 32cn + 2ns Find the first derivative of -7s4x - 343s4 - 7838x wrt s. -28s3x - 1372s3 What is the second derivative of -260s*3w*2 - 2s*3 + 8sw + 2s wrt w? -520s3 What is the derivative of 886m	{ "pile_set_name": "DM Mathematics" }
letters picked without replacement from nnnpppn? 4/35 Two letters picked without replacement from ppwyj. What is prob of sequence wp? 1/10 Calculate prob of sequence bf when two letters picked without replacement from vfkbvvvfbkvfvkssbk. 1/34 Calculate prob of sequence ui when two letters picked without replacement from {z: 5, m: 2, u: 1, i: 1}. 1/72 Four letters picked without replacement from cxcxxxmttxtxz. What is prob of sequence tmct? 1/1430 Calculate prob of sequence nnn when three letters picked without replacement from nnnn. 1 Four letters picked without replacement from unzzbb. What is prob of sequence bbnu? 1/180 Calculate prob of sequence wn when two letters picked without replacement from wwwllwlllllllwlln. 5/272 Three letters picked without replacement from {f: 1, j: 1, d: 2}. Give prob of sequence jdf. 1/12 What is prob of sequence cww when three letters picked without replacement from ccwvvwywvvyywvvccy? 1/102 Calculate prob of sequence ea when two letters picked without replacement from eeaeaennaaaae. 5/26 Calculate prob of sequence mweb when four letters picked without replacement from ebeffefweewwowme. 1/1820 What is prob of sequence zw when two letters picked without replacement from wzwrp? 1/10 Three letters picked without replacement from {f: 2, o: 1, s: 1, g: 2, x: 1}. What is prob of sequence fsf? 1/105 Calculate prob of sequence qj when two letters picked without replacement from qqkkkjkjkajaaqqqqkj. 4/57 Calculate prob of sequence yiq when three letters picked without replacement from {i: 6, r: 3, y: 2, f: 2, q: 4}. 1/85 Calculate prob of sequence wi when two letters picked without replacement from iigywww. 1/7 Calculate prob of sequence zzon when four letters picked without replacement from {z: 11, v: 4, j: 1, n: 1, o: 2}. 55/23256 Three letters picked without replacement from bbbbbbbbbbbbgbbbgbb. What is prob of sequence bbg? 16/171 Three letters picked without replacement from zosbzpksp. Give prob of sequence osp. 1/126 Calculate prob of sequence weu when three letters picked without replacement from npwenjwpunun. 1/330 Calculate prob of sequence yj when two letters picked without replacement from yjjjyjjjjjjyjjjyjjj. 10/57 Four letters picked without replacement from yyyyhyyyyyyy. What is prob of sequence yyyy? 2/3 What is prob of sequence aa when two letters picked without replacement from {e: 8, a: 3}? 3/55 Calculate prob of sequence rllr when four letters picked without replacement from {r: 6, l: 12}. 11/204 Three letters picked without replacement from dcdhbchlp. What is prob of sequence ldh? 1/126 What is prob of sequence xdxx when four letters picked without replacement from dxxxxxxxxxxxx? 1/13 Four letters picked without replacement from nkpkp. Give prob of sequence kpkp. 1/30 Two letters picked without replacement from vvhsmmr. What is prob of sequence ms? 1/21 Calculate prob of sequence lww when three letters picked without replacement from wlw. 1/3 Calculate prob of sequence ss when two letters picked without replacement from oosns. 1/10 Four letters picked without replacement from {g: 4, z: 2}. What is prob of sequence gzgg? 2/15 Calculate prob of sequence lxxa when four letters picked without replacement from {l: 2, n: 3, t: 4, a: 2, x: 2, c: 3}. 1/5460 What is prob of sequence rrr when three letters picked without replacement from nnrnxnnynrnnrryn? 1/140 Two letters picked without replacement from uugttatgititgiugtaa. Give prob of sequence tt. 5/57 What is prob of sequence kk when two letters picked without replacement from vvwkkviwvn? 1/45 Calculate prob of sequence jejj when four letters picked without replacement from ejeeeeeejeejje. 10/1001 Calculate prob of sequence jj when two letters picked without replacement from jjjwjjwjjjjjwjwjwj. 26/51 What is prob of sequence vy when two letters picked without replacement from {s: 1, v: 2, k: 1, y: 4}? 1/7 What is prob of sequence adaa when four letters picked without replacement from daaaaaada? 5/36 What is prob of sequence ooh when three letters picked without replacement from {o: 7, h: 1, u: 4, s: 1, b: 2, d: 4}? 7/969 Calculate prob of sequence wuww when four letters picked without replacement from {u: 7, w: 1}. 0 What is prob of sequence jkxa when four letters picked without replacement from exlxjelklea? 1/3960 Three letters picked without replacement from {h: 1, x: 2, y: 4, s: 1, g: 2}. What is prob of sequence hsg? 1/360 What is prob of sequence mv when two letters picked without replacement from {p: 2, o: 1, u: 6, m: 1, v: 2}? 1/66 What is prob of sequence mv when two letters picked without replacement from {z: 5, q: 4, v: 1, m: 1}? 1/110 Two letters picked without replacement from {s: 7, g: 7}. What is prob of sequence gg? 3/13 Calculate prob of sequence ymkd when four letters picked without replacement from {q: 5, k: 1, i: 1, y: 1, m: 1, d: 3}. 1/3960 Three letters picked without replacement from {k: 7, d: 9}. What is prob of sequence kkk? 1/16 Calculate prob of sequence nn when two letters picked without replacement from {m: 2, n: 5}. 10/21 What is prob of sequence rru when three letters picked without replacement from rhrfkrufhffku? 1/143 Three letters picked without replacement from {r: 3, g: 1}. Give prob of sequence grg. 0 Calculate prob of sequence ju when two letters picked without replacement from {w: 7, u: 4, j: 7}. 14/153 What is prob of sequence uquz when four letters picked without replacement from uuuuzyuququyzuyu? 3/455 What is prob of sequence nix when three letters picked without replacement from {c: 5, i: 1, n: 3, x: 5, d: 1}? 1/182 Calculate prob of sequence icl when three letters picked without replacement from lwczi. 1/60 Calculate prob of sequence dddd when four letters picked without replacement from {v: 8, n: 1, d: 4}. 1/715 Three letters picked without replacement from {q: 11, u: 3, d: 2, x: 3}. What is prob of sequence xqd? 11/969 What is prob of sequence yr when two letters picked without replacement from ezrerrerryeryr? 1/13 Calculate prob of sequence uvuv when four letters picked without replacement from uuuuuvuv. 1/28 Four letters picked without replacement from umccmmmuccuuuc. What is prob of sequence ummu? 10/1001 What is prob of sequence ttst when four letters picked without replacement from ttttsxtxxdsdsxt? 1/91 What is prob of sequence rg when two letters picked without replacement from rrrrgggrgr? 4/15 Two letters picked without replacement from lozzf. Give prob of sequence of. 1/20 Four letters picked without replacement from {j: 1, c: 1, p: 3, s: 1, n: 1}. Give prob of sequence psnp. 1/140 Four letters picked without replacement from {x: 4, f: 2, e: 3}. What is prob of sequence xfxx? 1/63 Four letters picked without replacement from {g: 1, n: 1, h: 13}. Give prob of sequence hhhg. 11/210 Three letters picked without replacement from xgggvggvxxxxxvxxxxgv. Give prob of sequence vvg. 1/95 Calculate prob of sequence wwi when three letters picked without replacement from {y: 5, i: 8, w: 2, k: 4}. 8/2907 Two letters picked without replacement from {x: 7, k: 2, v: 2, y: 7}. Give prob of sequence vy. 7/153 Calculate prob of sequence mm when two letters picked without replacement from rmmvj. 1/10 Two letters picked without replacement from {b: 4, m: 2, y: 3, v: 3, w: 6}. Give prob of sequence mw. 2/51 What is prob of sequence lj when two letters picked without replacement from luuljljjujl? 8/55 Four letters picked without replacement from ccccttccctc. Give prob of sequence cttt. 1/165 Four letters picked without replacement from nknininddd. Give prob of sequence nkdi. 1/210 What is prob of sequence nnj when three letters picked without replacement from {o: 3, n: 7, j: 2}? 7/110 Four letters picked without replacement from bbbbb. Give prob of sequence bbbb. 1 Calculate prob of sequence lkkm when four letters picked without replacement from kkkfllkkmkkmlm. 9/572 What is prob of sequence aiy when three letters picked without replacement from {a: 2, y: 2, i: 5}? 5/126 Four letters picked without replacement from {s: 3, v: 5, o: 6, l: 2, b: 3, e: 1}. What is prob of sequence bssl? 1/3230 Three letters picked without replacement from {l: 2, v: 3}. What is prob of sequence llv? 1/10 Two letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
nits digit of (70/(-20))/(w/78)? 3 Let y be (-12 + 4)(-2 - -1). Let i be (-2 - (-2 - y/(-4))) + 5. Suppose -il = 101 - 386. What is the tens digit of l? 9 Suppose 15125 = -2r + 5k + 93689, 0 = -k - 8. What is the thousands digit of r? 9 Let k = -860 + 28658. What is the hundreds digit of k? 7 Suppose 6c + 17714 = 2o, 26607 = -47o + 50o + 3c. What is the hundreds digit of o? 8 Suppose 19c + 5m + 86651 = 23c, 25 = 5m. What is the ten thousands digit of c? 2 Let k be (-241(-2 + 0))/412. Suppose -100a + 106a - k = 0. What is the hundreds digit of a? 2 Let c(t) = -7t. Let i(l) = 342l + 51. Let g(s) = 6c(s) + i(s). What is the units digit of g(6)? 1 Suppose 4j - 4642 - 10278 = 0. What is the hundreds digit of j? 7 Let a = -1575 - -1064. Let b = a + 1988. What is the hundreds digit of b? 4 What is the units digit of 57/21 - (-14)/49 - (-28734)/3? 1 Let m be -3 + 232/(-60) + (-4)/30. Let k be 2/m - (345/21)/(-5). Suppose -3r + 108 = p + 4, -2p + 103 = kr. What is the tens digit of r? 3 Let a = 21376 - -11572. What is the hundreds digit of a? 9 Suppose -3w + 8558 = 2i, 367w + 2i + 14290 = 372w. What is the tens digit of w? 5 Suppose -4i - 6 = c, -11i = -6i + 15. Let d be (10/c)/((-5)/(-126)). Let p = 127 - d. What is the units digit of p? 5 Let k(a) = -2a3 - 46a*2 - 60a - 39. What is the tens digit of k(-38)? 6 Let i(d) = -13d2 - 21d - 134. Let q be i(-6). Let z = 784 - q. What is the units digit of z? 0 Suppose 0 = -31p + 11p - 13300. What is the units digit of (19/(p/240))/((-2)/14)? 8 Suppose -2j + 5j + 1005 = t, -678 = 2j + 2t. What is the hundreds digit of (35/(-2))/(-4(-6)/j)? 2 Let o(i) = -20 - i2 + 14 - 7i + 5i2. Let x be (-2)/(-2) - 0 - (9 + -4). What is the tens digit of o(x)? 8 Suppose -65l = 253l - 6112596. What is the ten thousands digit of l? 1 Let i = 1181 + 1230. What is the hundreds digit of i? 4 Let p(b) = -527b + 9934. What is the hundreds digit of p(-62)? 6 Let u(t) = 479t + 1220. What is the tens digit of u(8)? 5 Let b(t) = -124t + 2362. Let u be b(19). Suppose -608 = z - 5z. Suppose -z = -o - 0o + 5y, -u = -3y. What is the units digit of o? 2 Let b be (-22)/(-6) + 16/(-24). Suppose 5s + 3j - 191 = 0, -103 = -bs - 0j + 4j. Let y = 84 - s. What is the tens digit of y? 4 Let w(y) = -y3 + 10y*2 + 28y - 40. Let l be w(12). Suppose 5a - 330 = -5f, 0f + l = 4f. What is the units digit of a? 4 Suppose p - 4b - 6515 = 0, -p = -23b + 27b - 6563. What is the hundreds digit of p? 5 Suppose -7t - 8575 = -3c, 0 = -2c - 7t + 10t + 5715. What is the hundreds digit of c? 8 Suppose 7l + 166 = 5l - 2y, 3y + 6 = 0. Let s = -81 - l. Suppose -28 = -3r - 4u, s = 3r - 3u - 17 - 4. What is the units digit of r? 8 Let m(d) = d*3 - 6d*2 - 13d. Let c be m(10). Suppose -cv + 280 = -263v. What is the tens digit of v? 4 Let g be ((-928)/20 + -3)-5. Suppose -48 + g = q. Suppose 200 = 3k + 4j - 387, k + 2j = q. What is the units digit of k? 9 Let k(b) = 11b2 + 15b + 17. Let i = -309 + 306. What is the tens digit of k(i)? 7 Suppose 5t = -5u, 6 = 5u - 19t + 21t. What is the units digit of ((-36)/(-20)u)/(8/260)? 7 Suppose -3m + 2y + 185 = 0, -2y = 3m - 147 - 34. Let q(v) = -v*3 - 3v*2 + 3v + 1. Let f be q(-4). Suppose -399 - m = -fc. What is the tens digit of c? 9 Let d(m) = 208m*2 + 83m - 114. What is the tens digit of d(11)? 6 Suppose 9u = 5u - 4. Let f = 5 + u. Suppose -fw + 392 = 3w. What is the units digit of w? 6 Suppose -2321 = -5p - 4g + 10, -g + 2319 = 5p. Suppose -11d + p = -10d. What is the hundreds digit of d? 4 Suppose 4n + 20 = 0, 4k + 2n - 5 - 1 = 0. Let s(c) = 40c2 - 11. What is the units digit of s(k)? 9 Let x(j) = -43j + 62. Suppose l + 130 = -9l. What is the units digit of x(l)? 1 Suppose -5x - 3c + 2845 = 0, -3x + 3c - 6c + 1707 = 0. What is the tens digit of x? 6 Suppose 7r - 28 = -0. Suppose 3a = -5g + 2759, 5g + 1112 = 7g + ra. What is the hundreds digit of g? 5 Let k(x) = -x - 2. Let h be -5 + -5 + 11 - -2. Let m be k(h). What is the units digit of (-1)/(-4)m-136? 0 Let r(o) = -17 + 2o + 5o - 4o - 15. What is the units digit of r(11)? 1 Let b = -156 - -334. Suppose -m = -2m - z + 184, m - b = 2z. What is the tens digit of m? 8 Let m(p) = 4p*2 - 27p - 9. Let s be m(14). Let l = -128 + s. What is the units digit of l? 9 What is the hundreds digit of (-7)/(91/118820)3/(-4)? 8 Suppose -253z = 104109 - 455133 - 173445. What is the units digit of z? 3 Let c(v) = 3115v2 - 3v - 11. What is the hundreds digit of c(-2)? 4 Let a(v) = 9321v + 773. What is the units digit of a(1)? 4 Suppose 28 = -2k + 4s, 43 = -2k - 0k - s. What is the tens digit of (2512/k)/(2/(-5))? 1 Suppose -6a = -4a + 48a - 436750. What is the hundreds digit of a? 7 Suppose -28i + 163296 = 15i - i. What is the thousands digit of i? 3 Suppose 0 = 4g + 3t - 8, -5g - 2t = t - 10. Suppose -j - 5 = k, 0 = -2k + 5j + 13 - g. What is the tens digit of k + 3/(15/965)? 9 Let p be (-34)/513411/(-6). Let q = p - 275. What is the hundreds digit of q? 1 Let b(h) = 6350h3 + h2 + 8h - 10. What is the hundreds digit of b(1)? 3 Let l(b) be the third derivative of -b4/8 + 5b3/6 - b2. Let f(u) = -u*3 - 6u*2 + 5u + 12. Let r be f(-2). What is the units digit of l(r)? 7 Let z = -51506 + 73059. What is the units digit of z? 3 Let d = 14387 - 6529. What is the tens digit of d? 5 Let l(h) = -h*3 - 8h*2 - 8h + 6. Let u be l(-5). Let c = 20 - u. Suppose m + c = -2p + 314, -p = -4m - 137. What is the tens digit of p? 3 Suppose -2y = -160 + 22. Let i = y + 36. Suppose 0 = u + i - 267. What is the hundreds digit of u? 1 Let y be ((-12)/14)/(36/(-336)). Let v(x) = 6x*2 - 17x + 44. What is the units digit of v(y)? 2 Let y = 72 - 57. Suppose 4q = -i - i - 6, -5q - y = 0. Suppose 370 = iw - 11. What is the tens digit of w? 2 Suppose -18 = -5y + 2. Suppose 0 = -s + y + 1. Suppose -80 = -sr - 5n, 4r - 50 = r - n. What is the units digit of r? 7 Let c = -8 + 19. Suppose 9f - cf = -3222. Suppose 9q = 360 + f. What is the tens digit of q? 1 Let b(v) = 182v + 445. What is the tens digit of b(0)? 4 Suppose -191h + 177h + 556892 = 0. What is the units digit of h? 8 Let i(y) = -y2 + 21y + 2. Let a be i(11). Let p be (a/(-3))/(10/(-165)). Suppose 4h + 338 = 4d - 158, 5d = h + p. What is the tens digit of d? 2 Suppose -127625 - 360748 = -66k + 1133445. What is the tens digit of k? 7 Suppose -3j = -3s - 42612, -7j - 2s - 42616 = -10j. What is the tens digit of j? 0 Let l(h) = 196h + 945. What is the units digit of l(7)? 7 Suppose 353724 = 25l + 91824. What is the ten thousands digit of l? 1 Let n be 70/6 - -2(-1)/(-6). Suppose 4u = -3a + u + 15, 2a + 4u = n. Let c(o) = -o*3 + 5o*2 + 2o + 2. What is the units digit of c(a)? 6 Let k be (-1)/(0 - (-1)/(-5)). Let l be (-1)/((-3)/(-3)) + 20/k. What is the tens digit of ((-10384)/66)/(l/((-18)/4))? 3 Suppose 0 = -2q - 680 + 2838. What is the hundreds digit of q? 0 Let o = -328 + 330. What is the hundreds digit of ((1533 - 2) + -5)/o? 7 What is the ten thousands digit of (6/(-9) + (-1191)/(-45))2785? 7 Suppose -3u = u - 552. Suppose 2c = 5c - u. Let t = c + -42. What is the units digit of t? 4 What is the ten thousands digit of (1422/231)/((-3)/(-90603))? 4 Let n = -11350 + 21376. What is the hundreds digit of n? 0 Suppose 0l - l = -114. Let p(m) = -64m - 724. Let h be p(-10). Let g = l + h. What is the tens digit of g? 3 Suppose -7f + 56f = -48f + 1648224. What is the units digit of f? 2 Suppose -140i + 139i - 3x + 21776 = 0, 5x + 108980 = 5i. What is the thousands digit of i? 1 Let k = 34 + -37. Let o be ((-162)/10)/k + 8/(-20). Suppose ou = -3c - 0u + 473, -4c = -3u - 592. What is the tens digit of c? 5 Suppose m = -4r - 4, -8 - 4 = r + 3m. Suppose -2g = 4i, -5g + r = 2i + 16. What is the units digit of (-48 + i)/((-150)/35 + 4)? 1 Suppose -2m = 0, 2w - 2m - 10420 = -346. What is the hundreds digit of w? 0 Suppose 2500 = -352c + 351c. What is the hundreds digit of ((-1)/((-2)/c))/((-44)/22)? 6 Suppose 20 = 3q + 5. Suppose -684 = -2g - 4n, qn = -2g - 0g + 683. Let p = g - 150. What is the tens	{ "pile_set_name": "DM Mathematics" }
4)/n)/n(-1/6) assuming n is positive. n(14207/120) Simplify ((l/l*(-2/7))/(ll/(l/l*2)l))/(((l(-2/15)/l)/l)/(l6/l))(l(-1/8)l(-4)/l)/((l/l(-2))/(ll/(ll/(l(-2/3)/l)))) assuming l is positive. l(-4513/840) Simplify (l*(2/5)/l)/(lll/(ll*1l))l2llll(1/2)lll*(-2)lll*(-3)l*(2/3)/llll(-5) assuming l is positive. l(17/30) Simplify (((vv(-4/5)v)/v)/v(-1/4))(1/13)/(vv(-2/7)vvvvv*(-6)/vvv/(v(1/9)vvvv)vv/(v(v*(1/10)v)/v)) assuming v is positive. v(11569/3276) Simplify (j(-2/21)jj(9/5))(-50)(j(-5)j(-2))/(j(-2/17)j(1/5)j) assuming j is positive. j(-255827/1785) Simplify o(4/5)/o*(-4)o/o*(-6/5)o/o*(-1)((((o(o/(o(-1/3)/o))/o)/oo)/o)/o(1/10))(-31) assuming o is positive. o(-877/30) Simplify (w(-6/11)/wwwww*3)/((w(w/w*(-1))/w)/www(-7)/ww)w(-1)w/(w*(3/7)w)w7/(w(-2)w) assuming w is positive. w(1234/77) Simplify (w(-1))*(-2/13)(w*(-3/2)w)/w(w/(ww*(3/5)/w))/w(w/w*(3/7)w(-2/9))(-8) assuming w is positive. w(-38819/8190) Simplify q5q(1/4)/q((qq(2/19))/q)/q(-6/5)((q0/q)/q)25/(((q*(1/6)q)/q)/q((q/(qqq/q4qqq))/qq)/q) assuming q is positive. q(-47437/1140) Simplify (rr*(-4)rr/(r/(rr/(r(1/2)/r))))(-35)(r(1/7)rr(-2/7))(2/25) assuming r is positive. r(-6101/350) Simplify ((ss*12/ss)/(s/s(7/2)))47(s/s0s)(1/41)/(s(-2/7)/s)(2/17) assuming s is positive. s(7110655/9758) Simplify (j*12/jj(-13)/j)(3/26)/((j2)28/(((j/(((j*4j)/jj)/j))/j)/j(-2/13))) assuming j is positive. j(-1565/26) Simplify (((v/(v(vv(-3)/v)/v))/v)/(v(-5)/v))19/((v/(v/(vv/v*(2/3)v)))*23v*(-8)v7) assuming v is positive. v(355/3) Simplify (t/(t/t*(2/5))t(-2/7))(-19)(t/t1t/(t/(t/(t/(t/t*7)))))/((t/(t(tt5t)/t))/t(1/12)) assuming t is positive. t(-877/420) Simplify (yy/y(3/8)y(-1))36((y(-6)/y)/(y/(y/((y/((y(1/8)y)/y))/y))))9 assuming y is positive. y(-315/8) Simplify ((n(1/4))0/(n*9n*(-1/4)))/(((nn*3)/n)/((nn/((nn(1/6)/n)/n))/n)(n*(-5)n)/n(-4/5)) assuming n is positive. n(-403/60) Simplify (((q*(-1)q)/q)29/(q(-1/2))(1/8))/(q(3/7)q(-3)(q/q(-1))(-11)) assuming q is positive. q*(-489/112) Simplify ((y/(y(y/(yy1)y)/y))/(y(-2/7)/y))33(yy*1y)*(1/24)/(yy(y/y5)/yy(-4)) assuming y is positive. y(4623/56) Simplify ((g/(g(g(-29/2)gg)/g))/(g(6/17)/g)g*(-41)g(1/50))(4/3) assuming g is positive. g(-45616/1275) Simplify ((n(-12)/nn)(-16/5)n(1/6)/n(-1/3))21 assuming n is positive. n(8169/10) Simplify ((rrrr(-15)r)/r)*(4/11)(rr(-3/4)/r)/r(10/3) assuming r is positive. r(-1115/132) Simplify (((x/((x(x/(x/x*(5/6)x))/x)/x))/x(-1/22))/(x(-3/7)x/(xx(2/11))))(-20) assuming x is positive. x(-13040/231) Simplify ((w1)(-21))18/((w*(-3)ww)/(ww(ww*5)/www)w/(w(w(w*(-2/3)/w)/w)/w)w/(w*7/ww)) assuming w is positive. w(-1094/3) Simplify (((l(-5/3)l)/l)/ll*(-4)l/(ll(-5))ll/(l(5/2)/ll))/((ll(-1/2))43)(6/17) assuming l is positive. l(-995/102) Simplify (((hhh(-12))/h)/h)(-35)/(h/h(3/5)h/(hhh*46/hh)) assuming h is positive. h(2333/5) Simplify ((c(-26)c(-1/6))/(ccc(4/5)c)25)(-17/2) assuming c is positive. c*(12359/12) Simplify (cc/c*(-9)cc/(cccc/c*(1/3)c)c)/((c(-1/4)/c)/c(3/7))((c*0c)(-4/3))(2/7) assuming c is positive. c(893/84) Simplify (s(-1/4)s(-2/3))32/((s(-1/8)/s)/ss*(-2/11)s)(-19/3) assuming s is positive. s(-9929/264) Simplify (f*(1/26)/(f/(f/(ff*(-13/3)f)))f(-27)f28)(1/6) assuming f is positive. f(263/468) Simplify (((g(-1))*(-2/9)g(gg*5/g)/gg(4/3)/g)20)(-4/19) assuming g is positive. g(-4000/171) Simplify ((r*0r)22/(r(-1/4)/(r*(-3)r)))/(r*1/rr*6rr3/rr*1rr) assuming r is positive. r(33/4) Simplify (k7k*17/kkk(-3/5)kkk/(k*17/kk))8 assuming k is positive. k(376/5) Simplify ((a9/(a(-3/2)/a))/(((aa(-1/4)/a)/a)/a(-3/5)))/((a(1/3))(-1/6))(6/25) assuming a is positive. a(3649/300) Simplify (mm/m*(-5/8)m*(-1/8)(mmmm(2/5)/mmm)(-1/2))(-9/4) assuming m is positive. m(-27/40) Simplify ((z(-19)zz)(-5)z*(-42)z19)(-8) assuming z is positive. z(-496) Simplify (w(-5/6)/(w/w(-11)))(1/19)((w(4/9)w)/w(2/9))(-29) assuming w is positive. w(-12353/342) Simplify ((u(-2)/u*(-6/11))/(uu*6uu/u2))/((u(1/2))(-15)/(u1)(-23)) assuming u is positive. u(-527/22) Simplify (((o/(oo*0)oo(-1/6))/(o0/(((o(2/3)/o)/oo)/o)))(-44))49 assuming o is positive. o1078 Simplify ((p11p)/p(-1/7))(-2/59)/((p(-2/19)p*(-2/9)p)/(((((p*6pp)/pp)/p)/p)/(p(p/((pp/(p/(p/(pp2)p)))/p)pp)/p))) assuming p is positive. p*(64681/70623) Simplify (pp*(-6)ppp*0p*(-2/3)p/(p(p(1/4)/p)/pp))/((pp/(p/(p/(p(2/9)/p))))/(p/((p(-2/7)/p)/p)))(-4/19) assuming p is positive. p(-14477/4788) Simplify (p6p)/(pp/(((p(pp(-3/5))/p)/p)/p))p(-5)/(p/p(3/8))p/p(-1/6)p*(2/7)/p(p(-1/4))(-30) assuming p is positive. p(4811/840) Simplify ((w3w/w(-1/10))/((w/(w/w(-2/5)))/w4))24 assuming w is positive. w204 Simplify (c(-1)ccc3)(-29)((c(4/5)/c)/(c/(c/(((c(-1/2)/c)/c)/c))))(-1/11) assuming c is positive. c(-1163/10) Simplify (jj*5j/(j(5/4)/j))(-6)/(j/j*7j(-1/6))(-20) assuming j is positive. j*(-983/6) Simplify (((vv*13)/vvv)/vv(-10/7))(-38)(v/(vv(-2)))(-1)vv*3v(-8) assuming v is positive. v(-3386/7) Simplify (n(-8))(-2/9)/(nn(-19)nn1n) assuming n is positive. n(151/9) Simplify ((z/((z3z)/z))/zz/(z*(2/25)z))/(z(4/5)/z(1/7))(z(2/5)/(zzzz/z(-1)))/(z(4/5)/z(-4)) assuming z is positive. z(-2299/175) Simplify (i/i*(3/4)i*(1/4)(i/(i/(i/i(-5))))/(i/i6))/((i/(i/i(3/4)))/i(-2))41 assuming i is positive. i(-405/4) Simplify (y*30((yy/(y6/y))/y)/yy/((yy(-2/29))/y)yy(-1/2))(-12/11) assuming y is positive. y(-9246/319) Simplify ((r(-1)/r)23/((r/(rrrr*5/rr)r)/(r(-1/3)r)))/((r*(3/4)rr(-2))/(r/r(-1/2))(-1/9)) assuming r is positive. r(-157/4) Simplify (z12zz(-18)/zzzz(11/4)/z18)1 assuming z is positive. z(-77/4) Simplify ((y12)(-7/3)(y/((y/y(-18))/y))(-45))(1/12) assuming y is positive. y(737/12) Simplify ((g(-20)g)/(g*(1/13)/g))/(g/(g/((gg*(1/12)gg)/g))(g*(-43)gg)/gg) assuming g is positive. g*(3251/156) Simplify (qq*(3/5)/qq/((q/(q(q/q(-10)q)/qq))/q)qq25qqqq11)(3/7) assuming q is positive. q(117/5) Simplify (((v/v(-3))/v(v/v(1/4))/v)/((v(7/6)/v)/(v(-2/11)/v)))40 assuming v is positive. v(1850/33) Simplify ((n(2/7))(-16/3))(-6)/((nn6n(-2))/(n(3/8)/((n/(nn1))/n))) assuming n is positive. n(365/56) Simplify (g(2/3))(-43)(g(1/4))(-13/5)((g(1/3)/g)(-25))(2/37) assuming g is positive. g(-63083/2220) Simplify (d(-39)d)*(-28)(dd23)(-1) assuming d is positive. d1040 Simplify ((q/(q/(qq/q(-6))))/q(4/7)(q/(qq((q(2/7)q)/q)/q))(12/5))/((q2/q*(-3/4))/((qq*3)/((q/(qq*(2/15))q)/q))) assuming q is positive. q*(3413/420) Simplify (((h/(h((h*(-1/3)h)/h)/h))/h)*7(h*(-1/3)hh)(-9/8))(-1) assuming h is positive. h(-11/24) Simplify ((n1)(-36)n*7nn(2/7))/((n(-2/21)n)/n*0(n0)(-42)) assuming n is positive. n(-601/21) Simplify (y(2/9)y(-1)y)*(-37)(((y/y*(-1))/y)/(yy*(2/9)y))/(y/((y(y(-2)/y)/yy)/y))(1/47) assuming y is positive. y(-4031/423) Simplify (((q/q*12)/qqq17)/(q(-1/3))(4/3))21 assuming q is positive. q(406/3) Simplify (t/(t/(t/(t(-2/7)/t)))tt5)(-1/35)((t/(t/(tt/(t(-2/7)t))))/t)(-24)/(t0/t(-1/3)) assuming t is positive. t(-5459/735) Simplify ((d(3/7))33/(d(dd/(d*1/d)d)/d)(-44))(-21) assuming d is positive. d*(-3069) Simplify (((mm/((mm(-1/17))/m))/m)(-47)/(m(-2/5)/m)(-21/5))(-1/6) assuming m is positive. m(7883/850) Simplify ((n/n(2/11)nn(8/5)n(1/19)/(((n(1/3)*n	{ "pile_set_name": "DM Mathematics" }
Simplify (-2sqrt(180) - sqrt(180))2 + ((3sqrt(220))/sqrt(11))*2 + sqrt(20) - (-5 + -5((1 + sqrt(320))-3)2). 722sqrt(5) + 16250 Simplify -3(sqrt(175) - sqrt(175)4-1) + (2-5((sqrt(175) - sqrt(175)3) + sqrt(175)))*2 + 4. -75sqrt(7) + 17504 Simplify (((sqrt(330)-1 + sqrt(330))-4 - sqrt(330))/(-4sqrt(40)))/((sqrt(22) + (sqrt(22) - (-2sqrt(110))/sqrt(5)))/(1sqrt(2)3)). 3sqrt(3)/32 Simplify -6-2(-2 + (sqrt(363) - (sqrt(363) - (sqrt(363) - -3sqrt(363)))) + 5(0 + sqrt(3) + 4)). 216 + 588sqrt(3) Simplify (546(sqrt(1782) - sqrt(1782)1))/(((sqrt(264)1)/sqrt(11))/sqrt(12) + -2(sqrt(10)/(sqrt(20)/sqrt(4)) - sqrt(2))). 0 Simplify (sqrt(18) - 1sqrt(36)/sqrt(2))/(sqrt(600) + (sqrt(600) - 1sqrt(600))) - (sqrt(33)/(sqrt(11) + sqrt(99)) + 4 + sqrt(21)/(sqrt(700)2)). -4 - 3sqrt(3)/10 Simplify ((sqrt(76)3 + sqrt(76))2-2 + -4 + ((sqrt(76) + 0)*2 + 0 - 4(1 + sqrt(76))))-1. 8sqrt(19) + 2364 Simplify (-4(-2 + sqrt(44)/sqrt(4) - (-4 + sqrt(11) + -1)) + 4(sqrt(99) - (-5 + sqrt(99) + 0 + sqrt(99))))*2. -192sqrt(11) + 1648 Simplify ((sqrt(4320) - -2sqrt(4320)4)-5)/(2(sqrt(4840) + sqrt(4840) + -1sqrt(4840))). -135sqrt(3)/11 Simplify (6(-1 + 2(2 + -2sqrt(1216) + sqrt(1216) - sqrt(1216)) + -2sqrt(1216)-1-5))*25. -120960sqrt(19) + 42902100 Simplify -1 + 2 + 1 + -3 + ((sqrt(3400)2 - sqrt(34))/sqrt(2))*2 + 2. 6138 Simplify (3 + (sqrt(26) - (sqrt(1274) + sqrt(1274)-2))/(sqrt(2) + -1sqrt(128)) + 3 + -5)2. -16sqrt(13)/7 + 881/49 Simplify (51sqrt(110)-1-4)/((2sqrt(320))/(((sqrt(72) - sqrt(8)) + sqrt(8))/sqrt(4))). 15sqrt(11)/2 Simplify -4((1 + sqrt(1331) + 1)2 - ((-2 + sqrt(1331) + 2)2 + sqrt(1331) - sqrt(1331))) + 2 + 0. -176sqrt(11) - 14 Simplify (sqrt(84)/sqrt(768) + (sqrt(77)-5 + sqrt(77))/sqrt(11) + sqrt(7) + (sqrt(112) - sqrt(7)) + 1 + 3sqrt(7)2)2. 49sqrt(7)/4 + 16871/64 Simplify (5(sqrt(2448) + -2 + 0 + sqrt(2448)) + -4-2sqrt(2448) + sqrt(2448) + sqrt(2448) + -5 + sqrt(2448)-2 + sqrt(2448))*2-32. -5303718 + 41040sqrt(17) Simplify 5(sqrt(450) + (2(0 + sqrt(450)) - sqrt(450)) + 5 - ((sqrt(150)/sqrt(12) - sqrt(50))2 + (sqrt(200) - (sqrt(200) + -1)2))). 1935/2 Simplify 1(1sqrt(1872) + 2 + sqrt(1872))*2 - (sqrt(52)/sqrt(4) + -5 - -4(sqrt(91)/sqrt(7) + sqrt(13) + sqrt(13)))*2. 226sqrt(13) + 5270 Simplify 3 + (1 + ((-5sqrt(325) + sqrt(325))2 - sqrt(325)) - (-5sqrt(325)2)2) + 4. -27292 - 5sqrt(13) Simplify 1 + -3(-5 + 0 + (-4sqrt(297)/sqrt(9))/(sqrt(162)/sqrt(6))). 4sqrt(11) + 16 Simplify (-2 + 0 + (-1 + sqrt(180) - sqrt(180)) + -5 + (sqrt(385)/sqrt(112))/(sqrt(121)/sqrt(176)))2. -16sqrt(5) + 69 Simplify 0 + ((sqrt(768) + 5(4 + sqrt(768)) - ((sqrt(768) + 0)3 + sqrt(768))) + 1)*2. 1344sqrt(3) + 3513 Simplify (4((sqrt(1274) - (sqrt(1274) - sqrt(1274)-35)) + sqrt(1274)))/((sqrt(900)-2)/sqrt(2)). 196sqrt(13)/15 Simplify ((((sqrt(252)-1 + 2)5 - (-1 + (sqrt(252) + 0 - sqrt(252))1)) + -5)3)2. -3240sqrt(7) + 57024 Simplify 2(5((2 + 5sqrt(128)-1 + -4)-2 + 0))2. 32000sqrt(2) + 640800 Simplify ((sqrt(396)-4)/(sqrt(324)/sqrt(9)) + (6sqrt(198))/((-1sqrt(10) - sqrt(10))/sqrt(5)))2. 1859 Simplify (sqrt(30)/(sqrt(27) - sqrt(3)))/(sqrt(6)/(sqrt(9)/sqrt(3))) - (sqrt(15)/(sqrt(108) - (sqrt(108) - -1sqrt(108)) - sqrt(108))1)2. -5/144 + sqrt(5)/2 Simplify (sqrt(156) + 1sqrt(156)2 - ((-1sqrt(156) + sqrt(156))6 - sqrt(156)))/(sqrt(144)/(sqrt(432)-5 + sqrt(12) - sqrt(12))). -120sqrt(13) Simplify ((-1sqrt(132)-3 + sqrt(132))/((-2sqrt(33))/sqrt(3)))/((-1sqrt(384) + (sqrt(6) - sqrt(6)-1-5))-2). -sqrt(2)/12 Simplify 4(4(-1 + 1sqrt(11)) + (sqrt(77) - 3(sqrt(77) + sqrt(77)1 + sqrt(77) + sqrt(77)))/sqrt(7))66. -1008sqrt(11) - 576 Simplify (-2(4 + sqrt(22)/sqrt(2)-6) - -2((sqrt(44))25 + -2)) + -1. 12sqrt(11) + 427 Simplify ((-551sqrt(150))/(1sqrt(300)6 + sqrt(300) + sqrt(300) + -5-2sqrt(300)) + 0)*2. 625/648 Simplify ((((sqrt(264) + 31sqrt(264) - sqrt(264)) + sqrt(264))/(sqrt(8) + (4sqrt(72) - sqrt(8) - sqrt(8))))/(-62sqrt(1100)))*2. 1/36300 Simplify ((3sqrt(750) - 3(sqrt(30) + sqrt(750)))/(2sqrt(150) - 2sqrt(24)))2 + 2. 13/4 Simplify ((sqrt(357) - (sqrt(357) + sqrt(357)-2)4)/(-1sqrt(7)-4))/(11sqrt(3) + 3sqrt(432)). 5sqrt(17)/148 Simplify (2sqrt(3168)-2 + sqrt(3168) - sqrt(3168))/((sqrt(216)/sqrt(12) - sqrt(2)) + 3(sqrt(2) + sqrt(4)/sqrt(2) + sqrt(2))) + -4 + 4. -48sqrt(11)/11 Simplify ((-1 + ((sqrt(99) - (sqrt(99) + (sqrt(99) - (sqrt(99) + -1) - sqrt(99))))-2 + sqrt(99) + sqrt(99) - (1 + sqrt(44) - (sqrt(11) + 1 + 2))))-2)2 + 1. -24sqrt(11) + 81 Simplify (sqrt(1715) - (sqrt(1715) - sqrt(1715)1-2) - -43sqrt(35)-1)/(sqrt(567)3 + (sqrt(56)/(sqrt(16)/sqrt(2)) - 3sqrt(28))). -13sqrt(5)/11 Simplify ((sqrt(7) + sqrt(70)/sqrt(40) - (5 + 2sqrt(7)))2 + (-2sqrt(112)3)2)2. 10sqrt(7) + 16235/2 Simplify -6(-4 + sqrt(20) + ((sqrt(500))*2 - sqrt(20)) - sqrt(20)) - 4sqrt(30)/(-2sqrt(6))-1. -2976 + 10sqrt(5) Simplify ((-4 + -3sqrt(288)-1 - (3 + (-1 + sqrt(288) - sqrt(288)) + 4))6)*2. -25920sqrt(2) + 96912 Simplify 3((sqrt(1575)1)/(-6sqrt(45)/sqrt(5)) - ((sqrt(154)/sqrt(11))/sqrt(2) + sqrt(7) - ((sqrt(28))2 + sqrt(7) + -3))). -11sqrt(7)/2 + 75 Simplify -4 + (4-1sqrt(34) + sqrt(102)/sqrt(12))/(sqrt(18)/(sqrt(9)2 + sqrt(9)) - sqrt(10)/(-1sqrt(5))). -21sqrt(17)/8 - 4 Simplify -2(sqrt(240)/sqrt(4)1 - sqrt(60))/sqrt(12)-3 + (-5(-1(sqrt(320) + sqrt(320)1) + 1 + sqrt(320) + 1))2. -800sqrt(5) + 8100 Simplify ((sqrt(120) - (sqrt(120) - sqrt(120)-1-5))/(1sqrt(4)3))/(-52sqrt(360)-5). sqrt(3)/180 Simplify (-12sqrt(70)36)/((sqrt(90) - (-1(sqrt(90) + sqrt(90) + sqrt(90)2) - sqrt(90)))/(sqrt(576) - sqrt(9))). -42sqrt(7) Simplify (3(3 + sqrt(612) + (sqrt(612) + -1)5 + 2) + 5)4. 20 + 432sqrt(17) Simplify 3 + -5(24(sqrt(1008) + 1 + sqrt(1008) + -5) + 2 + -3sqrt(1008) + sqrt(1008) + 6(-2 + sqrt(1008)))2. -2024817 + 100800sqrt(7) Simplify (sqrt(80)/sqrt(4)-4 - (sqrt(20) - 1sqrt(20)4 - sqrt(20)))/((sqrt(144) - sqrt(144)2) + 1(sqrt(4) - sqrt(40)/sqrt(10))). 0 Simplify (-4(sqrt(121) + -2sqrt(121))-2)/(-3(sqrt(99) - sqrt(99)3))-6. 8sqrt(11)/3 Simplify ((4(sqrt(85) + (-2sqrt(85) - sqrt(85))) - sqrt(85))-51)/(sqrt(45)/sqrt(144) + -5(sqrt(5) - sqrt(35)/sqrt(7))). 180sqrt(17) Simplify (-3 + -3 + (-4 + 0 + sqrt(300) - (3 + sqrt(300)-1)) + 5)2 + 5. -320sqrt(3) + 1269 Simplify ((sqrt(1980) + sqrt(1980) + sqrt(1980)-2 + sqrt(1980))4)/(sqrt(99) - 6sqrt(99)-5 - sqrt(99)). 4sqrt(5)/15 Simplify ((sqrt(242)3 - sqrt(242))35 + sqrt(16)/(sqrt(8) + 4sqrt(88)/sqrt(11) + sqrt(8)) + -5)2 + -1. -9905sqrt(2)/3 + 3924793/18 Simplify (-3 + 3(5(sqrt(432) + 1) + 2 - (sqrt(300) + (sqrt(300)-2 + 1 - sqrt(300)) + 0)))2. 7200sqrt(3) + 173025 Simplify 5 + -5 + (3 + 5-2sqrt(50) + (sqrt(800) - (sqrt(800) + sqrt(800) + sqrt(800)2 + sqrt(800) - sqrt(800) - sqrt(800))))2. -540sqrt(2) + 16209 Simplify ((1sqrt(75)3-5 + (-5 + sqrt(3)1 - (1 + sqrt(192))))-5)2. 24600sqrt(3) + 505200 Simplify (0 + sqrt(500) + -2)3 - ((sqrt(1280) + sqrt(20))2 + sqrt(35)/(sqrt(343) - sqrt(7))). -1626 + 179sqrt(5)/6 Simplify (-4(sqrt(99) - sqrt(99)5) - sqrt(99) - 5sqrt(99)5)/((sqrt(90) + -2sqrt(90)-5)/(sqrt(10) + (-1sqrt(10) - sqrt(10))3)). 50sqrt(11)/11 Simplify (-3 + 2 + (-4(sqrt(264) - (sqrt(264)-5 - sqrt(264))))/(sqrt(6) + (sqrt(6) - (sqrt(54)/sqrt(9)6 + sqrt(6) - sqrt(6)))))*2. -28sqrt(11) + 2157 Simplify ((sqrt(17) - (3 + sqrt(17))) + 2 - sqrt(102)/sqrt(6)6)1 + 3 + -2sqrt(2448) + -5 + sqrt(612). -24sqrt(17) - 3 Simplify (0 + -4(-6(5 + sqrt(475)) + sqrt(475) + 2)-6)2. 806400sqrt(19) + 7291584 Simplify ((sqrt(2448) - ((sqrt(2448)-3 - sqrt(2448)) + sqrt(2448) + sqrt(2448)))-3 + 3sqrt(2448)-1)*2 - ((sqrt(2448) - (3 + -2sqrt(2448))*2) + 3 + 5). -156sqrt(17) + 362305 Simplify (-4(sqrt(720) + (sqrt(720) - 2(1sqrt(720) + sqrt(720)))))/((3sqrt(8640) + sqrt(8640) + sqrt(8640))/(sqrt(150)3)). 12sqrt(2) Simplify (sqrt(2816)-1 + sqrt(132)/sqrt(3)1)/(32sqrt(400)2). -7sqrt(11)/120 Simplify 3(-4((sqrt(567) + -4)5 - 4sqrt(567)-3))2-1. -7884624 + 293760sqrt(7) Simplify (sqrt(1666) + (sqrt(1666) - 4sqrt(1666) - sqrt(1666)	{ "pile_set_name": "DM Mathematics" }
5f + 10l - 8l = -21. Let b(t) = -10t*2 - 465t - 5290. Let p(r) = -5r2 - 233r - 2645. Let w(q) = fb(q) + 5p(q). Factor w(y). 5(y + 23)2 Determine w, given that -25/4w*2 + 70w - 5/4w3 + 75 = 0. -10, -1, 6 Let s(n) be the second derivative of -n5/60 - 7n*4/36 + 23n*3/6 - 39n*2/2 - 2221n. What is h in s(h) = 0? -13, 3 Suppose 3g - 265o + 267o = -18, -g - 58 = 5o. Solve 8y + 8/5y*4 - 28/5y*g - 2/5y*5 - 16/5 - 2/5y3 = 0 for y. -2, 1, 2 Let p(r) be the second derivative of r5/15 - 20r4/3 + 122r*3 - 980r*2/3 + 5r + 36. Find g, given that p(g) = 0. 1, 10, 49 Let q be (4 + -1)/(1/(-1)). Let b be 5/q-3 - 3/1. Factor -2x*b + 0x*2 + 11x - 8x - x2. -3x(x - 1) Let b(p) be the first derivative of -p7/2100 + p5/300 + 130p*3/3 + 127. Let g(d) be the third derivative of b(d). Find c such that g(c) = 0. -1, 0, 1 Let a(o) be the second derivative of 1/5o*5 - 1458o*2 + 9o + 162o3 + 4 - 9o*4. Determine x so that a(x) = 0. 9 Let m = 621 + -601. Factor -58l + 24 + m - 2l2 - 44. -2l(l + 29) Let x(f) be the first derivative of f4/96 - 17f*3/24 + 33f*2/16 + 252f - 171. Let j(o) be the first derivative of x(o). Factor j(h). (h - 33)(h - 1)/8 Let t(l) be the second derivative of l9/11340 - l8/840 + l7/210 - l4/6 + 3l - 22. Let z(o) be the third derivative of t(o). Factor z(h). 4h2(h - 3)*2/3 Let p(y) be the third derivative of 0y - 4/3y3 - 1 + y2 + 0y*4 + 1/30y*5. Factor p(b). 2(b - 2)(b + 2) Factor 29/5l*3 + 42/5l*2 + 0l + 1/5l5 - 12/5l4 + 0. l2(l - 7)(l - 6)(l + 1)/5 Let i(v) = -6v + 39. Let m be i(5). Suppose mk - 25 = 11. Determine r so that 0r*2 + 3/2r*k + 0r*3 + 0r + 0 = 0. 0 Let k(d) be the second derivative of -d*7/84 + 34d6/5 + d5/20 - 34d4 - d3/12 + 102d*2 - 5775d. Determine w so that k(w) = 0. -1, 1, 408 Let h(v) be the third derivative of -v*8/420 - 97v*7/525 - 1199v*6/300 - 88v*5/25 + 48v*4/5 + 1035v*2. Solve h(d) = 0 for d. -24, -1, 0, 1/2 Let y(v) = 136v*2 + 12v + 1. Let k be y(1). Suppose 64h = kh - 170. Solve 1/2rh - 4 + 7/2r = 0. -8, 1 Let l(i) = 4i4 + 64i*3 - 225i*2 + 236i - 79. Let c be 5/10(2 - (2 + 2)). Let j(w) = -w4 - w3 + w + 1. Let o(d) = cl(d) + j(d). Factor o(y). -5(y - 1)3(y + 16) Suppose 460m + 166m - 147m = -273m. Let 14/5y3 + 2y + m + 22/5y2 + 2/5y*4 = 0. What is y? -5, -1, 0 Let p = -61 + 61. Suppose 2g = -pg - 6, 0 = -4b - 3g + 7. Factor 10 + 2x*2 + bx - 7 - 2x - 3x*2. -(x - 3)(x + 1) Let y(f) be the first derivative of f6/120 + f5/5 - 9f4/8 + 5f*3/3 - 4f - 107. Let p(s) be the third derivative of y(s). Determine b so that p(b) = 0. -9, 1 Let g be (24327/119)/9 + -21. Factor -32/7v - 12/7v*2 + g. -4(v + 3)(3v - 1)/7 Let j(p) be the second derivative of -29p5/90 + 1016p*4/27 - 140p*3/27 - 5p - 122. Solve j(s) = 0. 0, 2/29, 70 Let r(q) = -6q3 - 38q*2 + 288q - 652. Let t(p) = -2p3 + p2 - 3. Let d(u) = 2r(u) - 8t(u). Factor d(o). 4(o - 8)*2(o - 5) Let a(x) be the first derivative of -x4/30 - x3/5 + 4x2/5 + 48x - 57. Let g(m) be the first derivative of a(m). Factor g(i). -2(i - 1)(i + 4)/5 Factor 0 + 12l3 + 2l*4 - 2/3l*5 + 0l*2 + 0l. -2l3(l - 6)(l + 3)/3 Let p(k) = k4 - 2k3 - k2 - 3k + 1. Let l(n) = -32n*4 + 84n*3 + 372n*2 + 556n + 108. Let g(u) = -l(u) - 20p(u). Factor g(z). 4(z - 8)(z + 2)2(3z + 1) Factor -1202/3v*2 + 1/3v*4 + 236/3v*3 + 723 + 244v. (v - 3)*2(v + 1)(v + 241)/3 Factor -2v*3 + 0v + 0 - 3v2 - 1/4v4. -v2(v + 2)(v + 6)/4 Suppose 26n - 13 = 39. Factor 72u - 4u4 - 40u*3 + 133u*n - 67u*2 - 94u*2. -4u(u - 1)(u + 2)(u + 9) Let y be 21(-3)/(-9) - 2. Suppose -k = -yk + 24. Factor ki*2 + 3 - 4 - 2i + 3 - 6i. 2(i - 1)(3i - 1) Let h(i) be the first derivative of 140i3/3 - 156i*2 + 64i + 235. Factor h(j). 4(j - 2)(35j - 8) Suppose 136f = 141f + l - 17, 2l = -2f + 18. Factor 1/6j*f - 5/6j + 1/6j3 + 1/2. (j - 1)2(j + 3)/6 Let u(r) = 7r5 - 8r*4 + 59r*3 + 36r*2 - 5r + 5. Let f(p) = 2p5 - p4 + 7p*3 - p + 1. Let q(k) = -5f(k) + u(k). Solve q(b) = 0 for b. -2, 0, 3 Let k(a) be the first derivative of -a*4 + 320a3/3 + 2165. Determine l so that k(l) = 0. 0, 80 Let g(d) be the third derivative of d7/1890 - 11d6/90 + 73d*5/10 + 253d*4/2 + 1587d*3/2 + 873d*2 - 1. Determine o so that g(o) = 0. -3, 69 Let f = -54 + 64. Suppose 0 = 9g - 4g - f. Factor -2c*4 + 8c*3 - 3c*2 - 3c*g + 2c*2 - 8c + 6. -2(c - 3)(c - 1)*2(c + 1) Suppose 1 = 3o - z, -36o - 4z + 18 = -37o. Let f(m) be the first derivative of 0m + 0mo - 5 - m4 - 8/3m3. Factor f(w). -4w*2(w + 2) Factor -5l5 + 332l + 190l4 - 1985l*3 + 1742l*2 + 1678l*2 - 1952l. -5l(l - 18)*2(l - 1)*2 Suppose 3i = -4p + 126, -113 = -3p - 5i - 13. Suppose p + 946c - 5c3 - 1940c + 929c + 40c*2 = 0. Calculate c. 1, 6 Let y be ((-750)/40)/(((-57)/(-26724))/(-1)). Let b = y + -8787. Suppose -b - 26/19x*2 - 2/19x*3 - 96/19x = 0. What is x? -6, -1 Let c(t) be the second derivative of 35t4/6 - 15t*3/2 + 594t + 1. Suppose c(z) = 0. Calculate z. 0, 9/14 Let n(t) = 6t - 3. Let h(m) = 18m - 14. Let q(a) = -4h(a) + 14n(a). Let x be q(-1). What is v in 5/3v + x - 1/3v*2 = 0? -1, 6 Let l(h) be the second derivative of -25h*7/21 - 23h*6 - 567h*5/5 - 45h*4 + 621h*3 - 729h*2 + 6h + 155. Find n such that l(n) = 0. -9, -3, 3/5 Let i(s) be the first derivative of 3s5/10 + 39s*4/8 + 24s*3 + 27s*2 - 4524. Find a, given that i(a) = 0. -6, -1, 0 Let r(t) be the first derivative of 5t8/336 + t7/14 + t6/8 + t5/12 - 71t2 + 12. Let f(j) be the second derivative of r(j). What is a in f(a) = 0? -1, 0 Let x(m) be the third derivative of m5/120 - 9m*4/2 + 972m*3 + 53m*2 - 11m. Factor x(s). (s - 108)*2/2 Let u(g) be the second derivative of -5g*7/21 - 29g*6/6 + 15g*5/4 - 5117g. Solve u(r) = 0 for r. -15, 0, 1/2 Let h be (8 + 30/(-4))0. Let k(m) be the first derivative of 2/25m*5 + hm - 4/5m2 - 8/15m*3 - 1 + 1/10m*4. Factor k(n). 2n(n - 2)(n + 1)(n + 2)/5 Let x = 412100/7 - 58870. Factor -xz - 8/7z3 - 32/7z*2 + 50/7. -2(z - 1)(2z + 5)*2/7 Determine h, given that -292/11h - 170/11h2 - 16/11h*3 - 138/11 = 0. -69/8, -1 Let s(m) = 28m - 253. Let h be s(9). Let y(r) = -26r - 23. Let x be y(h). Factor 3/4a*x + 0a*2 - 9/4a - 3/2. 3(a - 2)(a + 1)*2/4 Let t = -5251 - -5253. What is m in 0m*t - 5/2m*3 + 5/2m - 5/4m4 + 5/4 = 0? -1, 1 Let c(f) be the third derivative of -5f*3 + 1/12f*5 + 0 + 2f - 5/24f4 - 56f*2. Factor c(t). 5(t - 3)(t + 2) Let o = 206 - 176. Factor -oh + 67h + 5h*3 - 7h + 25h2. 5h(h + 2)(h + 3) Let w(g) be the third derivative of -8g6/15 + 232g*5/15 - 1121g*4/6 + 3610g*3/3 + 2378g*2. Factor w(v). -4(v - 5)(4v - 19)2 Let o(d) be the first derivative of -d3/8 + 3d2 + 51d/8 - 1518. Factor o(s). -3(s - 17)(s + 1)/8 Let a(s) be the third derivative of 0 + 2/3s4 + 32/3s*3 + 0s + 71s2 + 1/60s*5. Find u, given that a(u) = 0. -8 Let s = -6152 + 295297/48. Let f(x) be the second derivative of -1/4x*2 + 1/8x*3 + 3x + 0 - sx4. Factor f(y). -(y - 2)(y - 1)/4 Let n be ((-250)/35 - -7)-7. Suppose -4r + 4 = 2g, n = -g + 5r + 10. Factor -2/9q + 0 + 2/9q*g - 2/3q*3 + 2/3q*2. 2q(q - 1)3/9 Let d(b) be the third derivative of 0 + 0b + 1/42b7 + 0b*4 + 91b*2 - 1/12b*6 + 0b*3 - 1/4b*5. Find r such that d(r) = 0. -1, 0, 3 Let k = 245/6 + -115/3. Let f(m) be the first derivative of m + km*2 + 4/3m*3 + 19. Solve f(p) = 0. -1, -1/4 Let d = 8664 + -8668. Let q(k) = 5k*3 + 8k*2 + 13k + 6. Let s(h) = 7h2 + 3h + 3h3 + h + 9h + 6. Let y(i) = ds(i) + 3q(i). Factor y(n). (n - 3)(n + 1)(3n + 2) Let s(c) = 6c*4 - 480c*3 - 929c*2 - 457c + 21. Let w(m) = 2m4 - 240m*3 - 465m*2 - 229m + 9. Let p(j) = -3s(j) + 7w(j). Factor p(h). -4h(h + 1)*2(h + 58) Let g(a) be the third derivative of -1/3a3 - 1/20a*5 + 1/210a*7 - 5/24a*4 + 0a + 0 + 168a2 + 1/120a*	{ "pile_set_name": "DM Mathematics" }
4k + 938k + 130k2. -47k*2 + 942k Collect the terms in -467887w2 + 467887w*2 + 719w*3. 719w*3 Collect the terms in -28969y*3 + 156 + 14486y*3 + 14499y*3 - 78 - 78. 16y*3 Collect the terms in -37 - 2l + 4088l2 + 36 + 2l. 4088l2 - 1 Collect the terms in -1586v*2 - 1781v*2 + 2966v*2. -401v*2 Collect the terms in 26 + 13w*2 - 47 + 62 - 2w*2 - 41. 11w*2 Collect the terms in 303r + 539r - 4r + 81r. 919r Collect the terms in 19p - 121p*2 + 454p*2 - 103p*2 - 19p. 230p2 Collect the terms in -2v*2 - 5 - v + v - 4v*2 + 9v. -6v2 + 9v - 5 Collect the terms in -2664490x2 + 5329036x*2 - 2664479x*2. 67x*2 Collect the terms in -8363z*3 + 3 - 3 + 16584z*3 - 8393z*3. -172z*3 Collect the terms in -12076 + 6666 - 105s*2 + 5410. -105s*2 Collect the terms in 20q + 4q2 - 71q + 107q - 73q. 4q2 - 17q Collect the terms in 44 - 634m - 24 - 399m - 22 - 1373m. -2406m - 2 Collect the terms in -23405 + 46610 - 23364 - c. -c - 159 Collect the terms in -4265307d2 + 18195596d*2 + 5521581d*2. 19451870d*2 Collect the terms in 12 + 10 - 38 + 2616g + 10. 2616g - 6 Collect the terms in 100840a*2 - 50721a*2 - 50101a*2. 18a*2 Collect the terms in 1280648c*3 - 2 + 2 - 7c*2 - 1280841c*3 + 7c*2. -193c*3 Collect the terms in 5658d + 3d2 + 7d*2 + 12d*2 - 20d*2 - 8d*2. -6d*2 + 5658d Collect the terms in 7c3 + 227c*3 - 5c - 117c3 - 43c*3. 74c*3 - 5c Collect the terms in 77792a3 - 153771a*3 + 75993a*3. 14a*3 Collect the terms in 18467430l - 4 + 2 - 18467431l - 5. -l - 7 Collect the terms in -815 + 1618 - 442s*3 - 803 + 161s*3. -281s*3 Collect the terms in -3o*2 + 27o - 11o - 2o + 0o + 3o. -3o2 + 17o Collect the terms in 70v2 + 130v*2 + 90v2 + v3 + 107v2 - 293v*2 + 5v*3. 6v*3 + 104v*2 Collect the terms in 53 - 370l - 23 + 124l + 32 + 65. -246l + 127 Collect the terms in 1057643323t + 0 - 528821664t - 528821657t - 3 + 3. 2t Collect the terms in -26 - 14017s + 2 + 19 + 20. -14017s + 15 Collect the terms in 1350m - 157 - 158 + 479 - 164 - 272m. 1078m Collect the terms in -119v + 237v + 106451v*3 - 118v. 106451v3 Collect the terms in -552n*2 - 1156n*2 - 396n*2. -2104n*2 Collect the terms in 172932 - 172932 + 22t + 12t - 36t. -2t Collect the terms in -a2 - 3 + 3947a*3 + 3 - 140a - 3. 3947a3 - a2 - 140a - 3 Collect the terms in -4g - 40g + 4g - 10721 + 10735. -40g + 14 Collect the terms in -226 + 3p2 + 69 + 219 + 86. 3p*2 + 148 Collect the terms in -10v + 430469 - 430469 + 11v. v Collect the terms in -y + 1637767y*2 - 1637760y*2 + y. 7y*2 Collect the terms in 11089j - 8j2 + 2j*2 + 2j*2 + 4j*2 + 19j*2. 19j*2 + 11089j Collect the terms in 1248 + 1264 - 6244q - 2512. -6244q Collect the terms in 25926j2 + 25929j*2 - 77786j*2 + 25934j*2. 3j*2 Collect the terms in 5512u*2 - 11177u*2 + 5672u*2. 7u*2 Collect the terms in 252v*3 - 68v*3 - 67v*3 - 66v*3 + 1 - 68v*3. -17v*3 + 1 Collect the terms in -37s*3 - 3s*2 - 7s - 176s3 + 19s*3. -194s*3 - 3s*2 - 7s Collect the terms in 1857b2 - 44b*3 + 1855b*2 + 1849b*2 - 5561b*2. -44b*3 Collect the terms in -3q*2 + 13481428q - 26962729q + 13481301q. -3q2 Collect the terms in -2630032i*2 + 190246i*2 + 182435i*2. -2257351i*2 Collect the terms in -12 + 418c - 23 - 12 - 15 + 63. 418c + 1 Collect the terms in 170846i*3 - 1104i*2 + 1104i*2. 170846i*3 Collect the terms in 1413 - 1625 + 3p*3 + 5820. 3p*3 + 5608 Collect the terms in 16o*2 - 33o - 31o2 + 5o*2 + 11o*2 + 31o. o*2 - 2o Collect the terms in -211u - 35 - 212u - 262u + 1121u - 219u - 215u. 2u - 35 Collect the terms in 37 + 35 - 88 - 37m*2 + 2m*2 - 4m. -35m2 - 4m - 16 Collect the terms in -419494601v2 - 332v*3 + 419494601v*2. -332v*3 Collect the terms in -604t*3 + 2t*2 - 2t*2 - 2599t*3 - 605t*3 - 759t*3. -4567t*3 Collect the terms in -9078 - 3k + 3020 + 3k + 3020 + 2k*2 + 3029. 2k*2 - 9 Collect the terms in -76 + 16126372a + 76. 16126372a Collect the terms in 5r + 2r3 + 86r - 139r + 48r + 15r3. 17r3 Collect the terms in -v3 + 5v3 - 45315 + 0v3 - v3 + 2v2 - 14v. 3v3 + 2v*2 - 14v - 45315 Collect the terms in -474p2 - 518p - 556p + p3 + 474p2. p3 - 1074p Collect the terms in -1307717 - 14r*2 - 3r*3 + 1307717 + 14r*2. -3r*3 Collect the terms in -34w - 26w - 27w - 24w - 26w + 187w - 27w. 23w Collect the terms in -74 + 32 + 39 + 193f - 331f + 272f. 134f - 3 Collect the terms in 16652k + 3k2 + k2 - 55300k - k*2. 3k*2 - 38648k Collect the terms in -9614t + 48061t - 38441t. 6t Collect the terms in -1406b + 1409b - 441 + 0b2 + 4b*2. 4b*2 + 3b - 441 Collect the terms in -39m3 + 23530m*2 - 7815m*2 - 7819m*2 - 7896m*2. -39m*3 Collect the terms in -2198z - 2171z - 905 + 6537z + 905 - 2166z. 2z Collect the terms in -581d + 3580d + 972d. 3971d Collect the terms in -13283653m3 + 13283652m*3 + 966m - 966m. -m3 Collect the terms in -826 - 1523 + 14a + 2349. 14a Collect the terms in 183793p*2 + 222369p*2 - 406154p*2. 8p*2 Collect the terms in -176687 + 530048 - 176681 + 7s + 5s - 2s - 176680. 10s Collect the terms in -124 - 21j*2 + 271 - 147 + 1115j - 555j - 560j. -21j2 Collect the terms in 8p + 26p - 100 - 20p - 32p + 16p - 35. -2p - 135 Collect the terms in 2 - 2028b + 1972b - 70b - 5260b - 3544b. -8930b + 2 Collect the terms in 12504l + 12496l - l2 + 0l*2 + 2l*2 + 12481l - 37481l. l2 Collect the terms in -1213k - 10740 + 10740. -1213k Collect the terms in -2270v - 2197v - 2268v - 2260v + 8998v. 3v Collect the terms in -5g - 39 - 9g - 48g + 67g. 5g - 39 Collect the terms in 54g + 55g + 9g + 40g - 29g + 24g. 153g Collect the terms in -20 - 12 - 800t*3 + 43 - 20 - 1053t*3. -1853t*3 - 9 Collect the terms in -162f*2 - 1 - 16f + 5f3 + 16f - 417f2. 5f*3 - 579f*2 - 1 Collect the terms in 1 + 15 + 33o - 11o - 11 + 7o*3. 7o*3 + 22o + 5 Collect the terms in 2 + 9263836u + 0 - 5. 9263836u - 3 Collect the terms in 75199i2 + 75029i*2 - 150207i*2. 21i*2 Collect the terms in -235m*2 - 181m2 - m2 + 420m2. 3m*2 Collect the terms in -3166 + 6335 - 3169 - 1493x*3 + 584x*3 + 7073x*3. 6164x*3 Collect the terms in 3 - 24 + 5 + 16 - 8c + 1. -8c + 1 Collect the terms in -3x*3 - 790903558 + 1581807102 - 790903544. -3x*3 Collect the terms in -477o*3 - 199o*3 - 28o*3 - 33o*3. -737o*3 Collect the terms in 95r*3 + 405875 - 405875. 95r*3 Collect the terms in -7h - 5h + 3 + 18 - 17h - 1 - 19. -29h + 1 Collect the terms in -67n - 714 + 202 + 88n - 404 + 22n. 43n - 916 Collect the terms in 234424471c*2 - 117212235c*2 - 117212242c*2 + c - c. -6c*2 Collect the terms in 353812d + 353799d - 1061436d + 353815d. -10d Collect the terms in -168 + 2h2 - 135 + 131 - 25. 2h*2 - 197 Collect the terms in -2566418b - 885521b + 1091332b - 3106551b. -5467158b Collect the terms in -6a2 - 4a*2 + 5a*2 + 1178399a. -5a2 + 1178399a Collect the terms in -69 + 382 - 177 + 6h3 + 10h*3 - 66 - 70. 16h*3 Collect the terms in -320313q*2 + 106695q*2 + 106633q*2 + 106626q*2. -359q*2 Collect the terms in 60c + 57c + 74c - 2355c + 663c + 646c. -855c Collect the terms in 523668w + 1 - 523668w - 41w3. -41w*3 + 1 Collect the terms in 64n - 303n - 2 - 9 + 61n + 64n + 57n + 56n. -n - 11 Collect the terms in 170 - 25j*2 - 18j*2 - 158. -43j*2 + 12 Collect the terms in -4m - 61m3 + 62m*3 + 1 + 2m - 755m2 - 49973m2. m3 - 50728m2 - 2m + 1 Collect the terms in 3446r3 - 3368r*3 - 191r*2 + 95r*2 + 98r*2. 78r*3 + 2r*2 Collect the terms in 18066l*3 + 376 - 370 - 18041l*3. 25l*3 + 6 Collect the terms in 5819p - 2847p - 2972p + 301p2. 301p*2 Collect the terms in 3y + 2 - 5y + 21 - 49 - y. -3y - 26 Collect the terms in 121j + 2667659j*3 - 121j - 2667668j3. -9j**3 Collect the terms	{ "pile_set_name": "DM Mathematics" }
)/(-1)10/m. Suppose -6a + 3a + 2v + 30 = 0, -2v - 50 = -5a. What is the greatest common factor of r and a? 10 Suppose 2d + 0c + 3c = 12, -17 = -d + 4c. Let y = -4 + 9. Suppose yv - 405 = 3x, -4x + 324 = 3v + v. What is the highest common factor of d and v? 9 Let s(m) = -m*3 + 15m*2 + 12m - 24. Let l be s(15). Calculate the highest common factor of 12 and l. 12 Suppose -27m + 2z + 16 = -25m, -4m + 2z = -28. Calculate the highest common factor of m and 678. 6 Suppose -3l + 29 = 5. Let m be l/(-20) + 27/5. What is the highest common divisor of 45 and m? 5 Let s(y) be the first derivative of y*3/3 + 4y*2 + 14y + 1. Let q be s(-6). Let p be (1/(-3))/(q/(-6)). What is the greatest common factor of p and 3? 1 Let d be (-94)/(-7) + -6 + (-39)/(-7). Suppose x + 348 = dx. What is the highest common divisor of x and 116? 29 Suppose 4p + 541 = 4o + 3p, 4o - 5p = 529. Calculate the highest common factor of o and 238. 34 Let x be 4/(-2) + 1 - -29. Suppose -4a = -2d + 3d - 59, -3a = d - 45. What is the greatest common factor of a and x? 14 Suppose -12 = -4l, 0 = -2p + 3p + 3l - 75. What is the greatest common factor of 726 and p? 66 Let l(t) = t*3 - 6t*2 + 5t + 10. Let q(x) = -x*3 - 6x*2 + 5x - 9. Let r be q(-7). Let i be l(r). Calculate the highest common divisor of 15 and i. 5 Suppose l = -4p + 24, -2l + 21p - 23p + 66 = 0. What is the highest common factor of l and 288? 36 Suppose 1489 = 3d + 1225. What is the highest common divisor of d and 616? 88 Suppose 9 + 2 = d. Suppose 3k = -23 + 386. Calculate the highest common divisor of d and k. 11 Suppose -4z = -4h - 100, -99 = -23z + 19z + 3h. Calculate the highest common factor of z and 184. 8 Let u(c) = -15c + 395. Let k be u(10). What is the highest common divisor of k and 35? 35 Suppose -35 = -s + u - 6, 0 = -5s - u + 121. What is the highest common divisor of s and 325? 25 Let t be (53 - 2) + (6 - 8). Let a = 74 - t. What is the highest common divisor of a and 50? 25 Let h be 2 - -7((-2064)/(-14))/4. Suppose -8k = 12k - h. What is the greatest common factor of 286 and k? 13 Let j(d) = d*2 + 15d - 20. Let u be j(-16). Let z be (-6 - (0 - u))18/(-15). What is the greatest common factor of z and 20? 4 Suppose -2p + 104 = 4k - 5p, 0 = -2k + 5p + 38. Suppose -3j - 24 = 27. Let s = k + j. What is the highest common divisor of 18 and s? 6 Let r(v) = v3 + 6v*2 + 5v - 2. Let w be r(-5). Let a = 0 - w. Suppose -ab + 50 = -b. Calculate the greatest common divisor of 10 and b. 10 Suppose 5g - 105 = -5b, -3g + 95 = 3b + 2b. Let a(x) = x + 8. Let w be a(-6). What is the highest common factor of w and b? 2 Let k be 4/(8/4)16. Let f = k - 23. What is the highest common factor of 99 and f? 9 Let d be ((-18)/24)/((-2)/(-16)). Let s(h) = h2 + 4h + 2. Let c be s(d). What is the greatest common factor of c and 14? 14 Let x(h) = h*3 + 16h*2 - 15h + 49. Let l be x(-17). Suppose -19 = 5s - 169. What is the greatest common factor of l and s? 15 Let z = 263 - 214. What is the greatest common factor of z and 7? 7 Let m = -99 + 358. Calculate the greatest common divisor of m and 7. 7 Let d(m) = m2 + 2m - 4. Let i be d(-3). Let y = i + 7. Suppose 4s - 47 = z, -2s + 22 = -yz + 4z. What is the greatest common factor of s and 12? 12 Suppose 0 = 2j + 34s - 31s - 783, 0 = 5j + s - 1925. What is the greatest common factor of j and 6? 6 Let x = 1 + -2. Let a be x - (-1)/(2 - 177/89). What is the greatest common divisor of 11 and a? 11 Suppose 25g = 16g + 216. Let t(m) = -3m + 6. Let l be t(-6). What is the greatest common divisor of l and g? 24 Let o = -12 + 32. Let y = -9 + o. Let l = -103 - -136. Calculate the greatest common divisor of l and y. 11 Let o(i) = -4i*2 + 2i*3 - 3i3 + i2. Let d be o(-3). Suppose -t - 4 + 79 = d. Calculate the highest common factor of t and 50. 25 Suppose -51u - 2499 = -58u. Calculate the highest common factor of u and 21. 21 Suppose 0 = 3z - a - 44, -2z = -13a + 9a - 36. What is the greatest common divisor of z and 14? 14 Suppose 2r - 3 = 5. Suppose 4h - 3y = -0y, h = 5y. Let f = h + r. Calculate the highest common divisor of f and 20. 4 Suppose 0 = -30g + 37g - 294. Calculate the greatest common factor of g and 266. 14 Suppose -1074 = -34j + 3516. Calculate the greatest common factor of j and 81. 27 Let r be 6/211. Let b(c) = -4 - 1 - 2c + cr + 4c*2 + 0c*3 + 2c2. Let l be b(-6). Calculate the highest common factor of l and 21. 7 Let q(w) = -w3 - 4w2 - 2w - 6. Let i be q(-4). Suppose -iu - 4 = -4u. Let f be u + 15 - (-2 - -1). What is the greatest common divisor of 72 and f? 18 Suppose 0 = -2g + 21 + 49. Let n be 357/(-34)2/(-3). Calculate the greatest common divisor of g and n. 7 Let x(m) = -m*3 - 17m*2 - 49m - 13. Let u be x(-14). Calculate the greatest common factor of u and 17. 17 Let m = -4 + 10. Let x be (-12)/(-36) + 214/m. Let i be ((-1)/(-2))/(1/x). What is the highest common divisor of i and 2? 2 Let q = 25 - 25. Suppose 0 = -qz + 4z - 12. Suppose -zg + 364 = 34. Calculate the greatest common divisor of g and 44. 22 Let l be 408/9 - 24/72. What is the greatest common divisor of 81 and l? 9 Suppose 3a - 5c - 235 = 0, -2a - a = 5c - 215. Suppose 0 = 3k - 160 - 8. Let w = k - 26. Calculate the greatest common factor of a and w. 15 Let c = 96 - -8. Calculate the highest common divisor of c and 13. 13 Let k = 129 - 72. Let a = k + -52. Let n = 50 - 35. Calculate the greatest common divisor of a and n. 5 Let u(l) = 2l2 + 10l + 21. Let t be u(-5). What is the highest common divisor of 30 and t? 3 Let z(l) = l*3 + 12l*2 - 5l - 17. Let u be z(-12). Suppose 3y - u + 10 = 0. Let t = 28 - 6. What is the highest common factor of t and y? 11 Let h = -206 + 582. Suppose 2z - 3z + 84 = -2m, -5z - m + h = 0. What is the greatest common factor of z and 19? 19 Let l = -156 - -170. What is the highest common divisor of 301 and l? 7 Let a be 21/(-28) - 5/4. Let u be (a + 2 - 0) + 8. Let r(h) = h3 - 2h*2 + 2h - 3. Let n be r(2). Calculate the greatest common factor of u and n. 1 Let q be (0/2 - 1)2. Let w = -2 - q. Suppose 3y - 551 + 23 = w. Calculate the highest common factor of y and 16. 16 Let s(c) be the second derivative of -10c3 + 6c*2 + 42c - 2. Let w = -7 - -3. Let f be s(w). Calculate the highest common divisor of 36 and f. 36 Let b = -1028 - -1055. What is the greatest common divisor of 117 and b? 9 Suppose 45c - 55c + 7680 = 0. What is the highest common factor of 36 and c? 12 Suppose 2s = 2z - 3z - 116, 2s - z = -116. Suppose -g = 2, c - 4g - 43 = -3g. Let w = c - s. Calculate the highest common divisor of 9 and w. 9 Let w be (-604)/(-24) + (-13)/78. Calculate the highest common divisor of 625 and w. 25 Suppose 34 = -2k + 66. Suppose 5g - d - k = 2, d = -5g + 22. What is the highest common divisor of 4 and g? 4 Let w = 469 - 466. Calculate the highest common factor of 753 and w. 3 Let m = -275 + 295. Calculate the highest common divisor of 100 and m. 20 Suppose -7 + 26 = s - 5u, -2s + 4u + 26 = 0. Suppose m - 3 = v - s, 0 = -4v + m + 30. Calculate the greatest common divisor of 32 and v. 8 Let a = 178 - 148. Calculate the greatest common divisor of 25 and a. 5 Let t be 3 - (-4 + -23 - -3). Let h = t - 21. Suppose -7w + hw + 102 = 0. Calculate the highest common divisor of 34 and w. 34 Let s(f) be the second derivative of -7/2f*2 - 3f + 0 - 4/3f3. Let y be s(-2). What is the highest common factor of y and 6? 3 Let h(s) = 3 - 4s*3 - 2s*3 + 0s*3 + 5s*3. Let m be h(4). Let p = 99 + m. Calculate the highest common divisor of p and 57. 19 Suppose 4m + 5g - 9 = 155, -5m = -4g - 164. Let h = 22 - 18. What is the highest common factor of m and h? 4 Let m = -106 + 214. Calculate the highest common factor of 162 and m. 54 Suppose 5b + 5a = 225, 2b + 5a - 49 = 56. What is the highest common divisor of 8 and b? 8 Let z be (-7715)/(-7) + (-15)/105. Calculate the greatest common factor of z and 19. 19 Let o be ((-5)/(10/(-6)))/(-1) - -6. Calculate the greatest common divisor of o and 31. 1 Suppose 4p - 456 - 1404 = 0. Calculate the highest common factor of 45 and p. 15 Suppose 0 = -6i + 22	{ "pile_set_name": "DM Mathematics" }
a + 7. Let l(v) = -v - 10. Let m be l(-4). Let p(k) = 4k - 13. Give mp(t) - 11z(t). -2t + 1 Let w(i) = -2i*2 + 2. Let m(o) = -3o*2 + 2. Let a = -21 + 30. Let k = -14 + a. Give kw(t) + 4m(t). -2t*2 - 2 Let i(k) = -4k + 3k + 3 + k + 4k. Let v(w) = -10w - 17. Let h(c) = 5c + 8. Let r(y) = -9h(y) - 4v(y). Give -7i(b) - 6r(b). 2b + 3 Let u(z) = -9z*2 - 2z. Let n(q) = -117q2 - 27q. Calculate 2n(g) - 27u(g). 9g2 Let i(h) = -2h*2 - 3h + 3. Let n = 0 - 4. Suppose -g = -2g. Let q(f) = 4f - 4 + gf2 + 0 + 2f*2. Determine ni(j) - 3q(j). 2j*2 Let x(i) = 26i*2 - 4i - 20i2 + 5i*3 + 6i. Let l be ((-9)/2)/(2/(-4)). Let q = -5 + l. Let v(y) = -y3 - y2 - y. Calculate qv(s) + x(s). s3 + 2s*2 - 2s Let g(p) = -9p2 + 7p + 2. Let r be (1-6)/(3 + -4). Let n be (-2)/r - 22/6. Let c be (2/(-2))/(n/28). Let i(w) = 8w*2 - 6w - 2. Give ci(s) + 6g(s). 2s2 - 2 Let d(l) = -2l*3 - 5l*2 - 5l - 5. Let p = -12 + 6. Let j(h) = h - 1. Let a be j(p). Let x(u) = -3u3 - 7u*2 - 7u - 7. Determine ad(m) + 5x(m). -m*3 Let f(h) = 5h2 + 6. Let n(t) = -t2 - 1. Determine -2f(x) - 11n(x). x*2 - 1 Suppose -m + 9 - 7 = 0. Let n(a) = -4a - 1. Let r(g) = 3g. Give mn(w) + 3r(w). w - 2 Let f(c) = c3 - c2 + c + 1. Let o(s) = 7s*3 - 4s*2 + 6s + 7. What is 4f(j) - o(j)? -3j*3 - 2j - 3 Let i(d) = 9d2 - 3d + 6. Suppose 0 = 4s - 3s - 3. Let x(u) = 5u2 - 2u + 3. What is si(q) - 5x(q)? 2q2 + q + 3 Let l(g) = -14g - 6. Let j(a) = -11a + 16. Let h(t) = -10t + 13. Let o(q) = 6h(q) - 5j(q). Suppose -2u - 28 = -6. Calculate uo(i) + 4l(i). -i - 2 Let j(z) = 2z - 5. Let p be 132/(-20) - (-2)/(-5). Let v = p + 3. Let a(f) = -f + 2. What is vj(d) - 9a(d)? d + 2 Let g(w) be the first derivative of -w*4/4 - 4w3/3 + w2 + 5. Let c(p) = -p*3 - 2p*2 + p. Calculate -7c(z) + 4g(z). 3z*3 - 2z*2 + z Let l(h) = 15h*3 - 11h*2 + 13h + 17. Suppose 0 = q - 2q - 1, 27 = 4n - 3q. Let f(d) = -7d*3 + 5d*2 - 6d - 8. Determine nl(z) + 13f(z). -z3 - z2 - 2 Let g = -49 + 47. Let u(y) = -4 + 13y2 - 2y + 2y. Let v(k) = 3k*2 - 1. Give gu(q) + 9v(q). q2 - 1 Let n be 60/27 - 2/9. Let u(y) = -3y*n + 9y*2 + 0y - 5y. Let i(m) be the third derivative of m5/12 - m4/6 + 2m*2. Give 5i(w) - 4u(w). w2 Suppose -2m - 1 + 3 = -s, -2s - 2 = -3m. Let w(u) = -3u2 + u - 2. Let r(i) = -13i*2 + 5i - 9. Determine mr(t) - 9w(t). t*2 + t Let k(m) = -1. Let r = 7 + -13. Let o be (4 + r)/(2/(-122)). Suppose -5v - 3i = -o, -v + 0v + 6 = -4i. Let p(y) = -y - 11. Give vk(n) - 2p(n). 2n Let j(r) = -5r2 + 3r + 3. Let p(c) = 4c2 - 4c - 2. Determine -2j(l) - 3p(l). -2l2 + 6l Suppose 3c - 24 = -c. Let b(g) = 0g - g + 14 + g - cg. Let v(x) = 4x - 9. Give 5b(m) + 8v(m). 2m - 2 Let u(v) = 6v + 0v - 5v - 1. Let h(d) be the first derivative of -d*2/2 + 1. Suppose -2y = 2g + 10, -2y = y - 4g - 6. Give yh(c) - u(c). c + 1 Let f(g) = 8g2 - 6g - 6. Let k(c) be the second derivative of 3c4/4 - 7c*3/6 - 7c*2/2 + 6c. What is 7f(t) - 6k(t)? 2t2 Let y(o) = 9o*2 - 3. Let l(m) = -1. Calculate -l(h) + y(h). 9h2 - 2 Let b(t) = t2 + 2. Let k(f) = 82f2 - 1 - 2 - 83f*2. Calculate -7b(n) - 5k(n). -2n2 + 1 Let l(q) = -q - 1. Let y(g) = -g2 - g - 1. Let v(j) = 4j2 + 2j - 2. Let o(a) = -v(a) - 5y(a). Give -4l(r) - o(r). -r*2 + r - 3 Let t(i) = 24i - 1. Let a(b) = 25b - 1. What is -4a(n) + 3t(n)? -28n + 1 Let g(f) = 8f2 + 6f + 6. Let j(p) = -p*3 + 4p*2 + 6p + 1. Let u be j(5). Let l(d) = 17d2 + 13d + 13. Determine ul(y) - 13g(y). -2y2 Let h(y) = 3y*2 + 7y - 2. Let b(v) = 2 + 0 - 2v2 - 1 - 4v. Give 5b(s) + 3h(s). -s*2 + s - 1 Let r(k) = -13k + 4. Let s(t) = 12t - 3. What is 5r(a) + 6s(a)? 7a + 2 Let k(r) = -26r3 - 10r*2 - 16r. Let d(f) = -5f3 - 2f*2 - 3f. Let j = 10 - 8. Let u = j - -14. What is ud(g) - 3k(g)? -2g3 - 2g*2 Let u(f) = 3f*2 + 2f - 4. Let o(y) = -7y2 - 5y + 9. Let s(z) = z*3 - 13z*2 - 2z + 31. Let a be s(13). Calculate au(q) + 2o(q). q*2 - 2 Let y(w) = 5w + 3. Let d(c) = 29c + 17. Calculate 6d(p) - 34y(p). 4p Let c(n) = -4n + 4. Let l(y) = y - 1. What is -c(h) - 3l(h)? h - 1 Let q be 27/(-4) + 15/20. Let z(j) be the second derivative of 11j3/6 - j2 - j. Let w(v) = -5v + 1. Give qz(o) - 13w(o). -o - 1 Let k(y) = 513y2 + 95y. Let w(h) = -16h2 - 3h. Give -3k(i) - 95w(i). -19i2 Let m(u) = 5u*3 - 3u*2 + 1. Let i(b) = -2b - 2. Let l be i(-3). Let a be 10/(-4) + (-3)/6. Let j(v) = 6v3 - 4v*2 + 1. Give aj(s) + lm(s). 2s*3 + 1 Suppose p + 17 = 4p - 5u, -p - u - 5 = 0. Let w(s) = s - 1. Let m(q) be the second derivative of q3/2 - q2 + 13q. Give pm(v) + 2w(v). -v Suppose -4l + 2l - 6 = 0. Let x be ((-11)/(-3))/(l/(-9)). Let j(b) = 9b2 - 2b - 4. Let a(h) = 5h2 - h - 2. Give xa(w) - 6j(w). w2 + w + 2 Let q(c) = -8c - 5. Let o be ((-6)/4)/(-3)14. Suppose 14 = -0a + 2a. Let p(r) = -2 - a + 3 - 9r. Give oq(h) - 6p(h). -2h + 1 Suppose 0 = 3d + 6 - 30. Let i(w) = 14w2 + 8w - 8. Let c(a) = 5a2 + 3a - 3. Give dc(u) - 3i(u). -2u2 Let k(j) be the third derivative of 0 + 0j + 0j3 - j2 + 1/4j*4. Let s(v) = -4v - 6v + 3v. What is -5k(i) - 4s(i)? -2i Let t(s) = 4s - 2. Let j be t(1). Let p(c) = 1 + 2c + 2c - 6c3 - 6c*2 + 5c*j. Let b(v) = 13v*3 + 2v*2 - 9v - 2. What is 4b(y) + 9p(y)? -2y3 - y2 + 1 Let t(m) = -m + 6. Let y(a) = 2a*3 + 19a*2 - 9a + 11. Let p be y(-10). Let i(f) = 1. What is pt(q) - 6i(q)? -q Let x(b) = b*2 + 5b - 5. Let y(n) be the second derivative of n3/6 - n2/2 + 2n. Let s be (0 + -1 + 7)/1. Suppose 5z = 1 - s. Give zx(w) + 5y(w). -w2 Let j(m) = -m3 + 5m2 - 4m + 2. Let a be j(3). Let v(k) = -ak2 + 6k*2 + 4 - 2k + 5k. Let p(z) = -4 + 5 - 2z + 3z - z2. What is 3p(c) - v(c)? -c*2 - 1 Let o(y) = 17y*3 - 5y*2 - 6y - 6. Let j(f) = -50f3 + 14f*2 + 17f + 17. Determine 6j(i) + 17o(i). -11i3 - i2 Let y(h) = 35h3 - h2 - h - 1. Let z be y(-1). Let k be (2/3)/((-8)/z). Let g(p) = 2p. Let l(t) = -3t. Give kl(r) + 4g(r). -r Let g(j) = -j*3 - 9j*2 + 8j - 14. Let k be g(-10). Let u(h) = kh + 7 - 3h + 5h + 5h. Let x(i) = -7i - 4. Calculate -6u(o) - 11x(o). -o + 2 Let o(n) = 2n*2 - 2n - 7. Let i(a) = -16a2 + 16a + 26. Let x(h) = -3h2 + 3h + 5. Let q(s) = -2i(s) + 11x(s). Determine 6o(k) + 14q(k). -2k2 + 2k Let n(d) = -16d + 6. Let l(t) = 15t - 5. Determine -7l(q) - 6n(q). -9q - 1 Let a(d) = d + 1. Let z(t) = t2 - 4t + 3. Determine 2a(h) + z(h). h2 - 2h + 5 Let q be 1 + 0/(-3 + 1). Let b be (-1)/q(1 + 0). Suppose -5z - 7 = 8, -4 = f + 2z. Let y(m) = 2. Let u(g) = g2 + 1. What is by(c) + fu(c)? 2c*2 Let z(d) = 6d*2 - 5d + 2. Let c(j) = 12j2 - 11j + 4. Determine -4c(t) + 9z(t). 6t2 - t + 2 Let a be ((-6)/(-27))/(7/63). Let p(t) be the first derivative of 5/2t*a - 2 + 4t. Let q(d) = 4d + 3. Calculate -2p(h) + 3q(h). 2h + 1 Let m = 11 + -28. Let g = m + 19. Let s(k) = -k*2 + 11k - 11. Let z(x) = 2x - 2. Give gs(b) - 11z(b). -2b*2 Let u(n) = -4n*3 + 4n*2 - 5n + 9. Let w(k) = -10k3 + 10k*2 - 12k + 22. Determine 12u(q) - 5w(q). 2q3 - 2q*2 - 2 Suppose 0 = -c - 0c + 10. Suppose -b = b - c. Let t(x) = x*2 + bx + x*3 - 3x - 3x3. Let f(z) = -z2. Calculate 2f(m) + t(m). -2m3 - m2 + 2m Let f be (12 - 8)/((-4)/6). Let b(x) = -5x3 - 6. Let v(h) = 6h3 + 7. Let t(j) = j2 - 5j + 2. Let o be t(3). Let m = -11 - o. Calculate fv(i) + mb(i). -i3 Let j(a) = -a. Suppose -5h = -4x - 20, 0h + 2x = -2h - 10. Suppose d + 4t + 14 = 0, h = d - 5t - 18 - 13. Let m(i) = 3i. Determine dj(n) + 3m(n). 3n Let o(r) = r*3 - 2r*2 + 2r + 2. Let t(s) be the first derivative of 3s4/4 - 5s*3/3 + 5s*2/2 + 4s - 22. Give 5o(i) - 2t(i). -i*3 + 2 Let y(m) = -2m + 4. Let q(i) = 3i - 7. Let v be (-2)/((2/2)/(-5)). Suppose 0 = a - 4. Suppose g + 18 = ag. What is gq(o) + vy(o)? -2o - 2 Let r(a) = 13a + 8. Let s(h) = 3h + 2. Calculate -2r(t) + 9*s(t). t + 2 Let a	{ "pile_set_name": "DM Mathematics" }
Solve -160m + 2618 = -6m for m. 17 Solve 52w - 1391 + 351 = 0 for w. 20 Solve -174z - 714 = 16z + 616 for z. -7 Solve 477l + 817 + 160 = 23 for l. -2 Solve 209l + 1547 = 141l + 159l for l. 17 Solve -182t + 52t - 834 = 9t for t. -6 Solve -16d + 3 + 3 = -22d for d. -1 Solve -482982k = -482971k - 352 for k. 32 Solve -21b - 893b - 417 + 9557 = 0 for b. 10 Solve 24y + 7577 - 7961 = 0 for y. 16 Solve -351 + 138 = 17i - 111 for i. -6 Solve -57 - 131 = 85h + 152 for h. -4 Solve -314j + 299j + 30 = 0 for j. 2 Solve 19u = -2u - 28 + 238 for u. 10 Solve 0 = 13w + 39w - 468 for w. 9 Solve 9974n - 21 - 83 = 9966n for n. 13 Solve 171 + 99 = 18f for f. 15 Solve 4515r + 330 = 4504r for r. -30 Solve -168g - 665 = -41g + 478 for g. -9 Solve 100r - 843 - 1301 = -744 for r. 14 Solve -93z - 208 + 529 = 228 for z. 1 Solve -13i + 44622 - 44882 = 0 for i. -20 Solve -1339 = 342x + 2765 for x. -12 Solve 1933 - 909 = 256l for l. 4 Solve 1456849 - 1457189 = 17b for b. -20 Solve -82j - 107j + 1672 = -37j for j. 11 Solve -42p - 12p - 731 = -11p for p. -17 Solve 70z + 16z + 352 = -2z for z. -4 Solve -5q + 1279 - 1314 = 0 for q. -7 Solve 93n + 168 = 82 - 286 for n. -4 Solve 512 = 134v - 1281 - 753 for v. 19 Solve -13k = 12k - 102 - 148 for k. 10 Solve 10x + 223 - 353 = 0 for x. 13 Solve -41x - 1274 = 9x - x for x. -26 Solve -29w - 4w - 231 = 0 for w. -7 Solve 10553 = 40n + 9833 for n. 18 Solve 7l + 3l + 125 = 35l for l. 5 Solve 462w = 406w + 448 for w. 8 Solve 0 = 13327m - 13279m - 144 for m. 3 Solve -376 - 196 = -52q for q. 11 Solve -35j - 100 - 115 = -5 for j. -6 Solve 30 = -25v + 255 for v. 9 Solve 6u + 1332 = 3u + 1314 for u. -6 Solve 693 = 58z + 5z for z. 11 Solve 95j + 250 + 222 + 383 = 0 for j. -9 Solve -44b - 226b = -51b + 6570 for b. -30 Solve 13z + 16 - 56 = 21z for z. -5 Solve 27u + 8 + 8 = 124 for u. 4 Solve 0 = -2n - 113n + 133 - 363 for n. -2 Solve 0 = -h - 24046 + 24054 for h. 8 Solve 267y - 533y - 75 = -269y for y. 25 Solve 0 = -2620u + 2642u - 374 for u. 17 Solve -129p - 346 - 389 = -24p for p. -7 Solve 38h - 46h = -95h - 435 for h. -5 Solve 51 = -13n + 44 - 45 for n. -4 Solve 3q - 15 = -72 + 18 for q. -13 Solve 14 + 3 + 7 = -6q for q. -4 Solve -182 = 58s + 31s - 1428 for s. 14 Solve 171r + 5489 = -328r for r. -11 Solve -46b = -862b - 8851 - 22157 for b. -38 Solve -126w - 128w = 6446 + 158 for w. -26 Solve 11x = -13x - 7x + 31 for x. 1 Solve -1388 = -154j + 2351 - 505 for j. 21 Solve -32v - 377 = 19v - 38v for v. -29 Solve 58t = 624 + 14 for t. 11 Solve 36l + 272 = 2l for l. -8 Solve 1696i - 396 = 1678i for i. 22 Solve 20y - 120 - 118 = 37y for y. -14 Solve 41h - 685 - 381 = 0 for h. 26 Solve -188 = -77j + j - 492 for j. -4 Solve -56m + 177 = 569 for m. -7 Solve -9 = -12a + 11a - 2 for a. 7 Solve 37j - 131 - 152 = 87 for j. 10 Solve -84j - 15j - 780 = 606 for j. -14 Solve 144 = 74k - 34k - 64k for k. -6 Solve -1392 = 86k + 930 for k. -27 Solve -517i = 157i + 10110 for i. -15 Solve -29f - 797 = -1406 for f. 21 Solve 539 - 598 = 59w for w. -1 Solve -145 = -13h - 25 + 49 for h. 13 Solve -7u - 118 - 21 = -20 for u. -17 Solve 77g + 120g + 35g = -2088 for g. -9 Solve 43k - 101k + 2090 = 151k for k. 10 Solve -79k - 37 - 1069 = 0 for k. -14 Solve 104 + 68 = 32s + 11s for s. 4 Solve -18b + 49b + 24 = 23b for b. -3 Solve 2317i - 2962i = -18705 for i. 29 Solve -y - 22y + 0y = -161 for y. 7 Solve -123o + 2037 = -26o for o. 21 Solve 39 = 36j + 449 + 166 for j. -16 Solve 17i - 14 - 59 = 29 for i. 6 Solve -355i + 136i = -177i + 336 for i. -8 Solve -22r - 2r - 96 = 0 for r. -4 Solve 630s - 579s = 612 for s. 12 Solve -51v - 110v + 30v = 3930 for v. -30 Solve 244h - 46 = 221h for h. 2 Solve 67q = 4q + 1303 - 547 for q. 12 Solve 22j + 21j = -15j + 116 for j. 2 Solve -3i = 26i - 0i - 58 for i. 2 Solve -21b - 8b = 4b + 198 for b. -6 Solve 305u - 423 + 175 - 362 = 0 for u. 2 Solve -89v + 5 + 7 - 12 = 0 for v. 0 Solve 6h + 300 - 80 = -38h for h. -5 Solve -126c + 2608 + 2610 = 682 for c. 36 Solve -63z + 224 - 708 = 272 for z. -12 Solve -387l + 410l - 299 = 0 for l. 13 Solve 27r + 1507 = 1237 for r. -10 Solve 3k = -327 + 333 for k. 2 Solve -56p + 1011 = 283 for p. 13 Solve 55j - 2316 = -138j for j. 12 Solve -4r = 7268 - 7304 for r. 9 Solve -194z - 2319 = -961 for z. -7 Solve -42k + 595 = -2k - 5k for k. 17 Solve -116w + 305 = 2505 + 352 for w. -22 Solve -261t = -32t + 4681 + 815 for t. -24 Solve -316y + 21y - 6321 = 6y for y. -21 Solve 2522 - 2189 = 37c for c. 9 Solve -7503i + 7574i - 1491 = 0 for i. 21 Solve -366g = -781g + 383g + 448 for g. 14 Solve 13x - 16x - 56 = -7x for x. 14 Solve 20h - 57 = 10 - 7 for h. 3 Solve -19c - 153c = 17c for c. 0 Solve -16b = 44b + 660 for b. -11 Solve 260 = 4726n - 4674n for n. 5 Solve 52h - 42929 = -43657 for h. -14 Solve -90k - 2716 = -284k for k. 14 Solve -453o + 951 = -136o for o. 3 Solve 12m = 340 - 268 for m. 6 Solve -12j = 5j + 88 + 48 for j. -8 Solve -8w - 24 + 11 = 35 for w. -6 Solve 341r - 298r = -43 for r. -1 Solve -44w - 550 = -506 for w. -1 Solve -5v + 4v - 3v = -72 for v. 18 Solve 0 = 2428n - 2773n + 8280 for n. 24 Solve 845u = 802u + 473 for u. 11 Solve 140p - 246p - 1075 + 227 = 0 for p. -8 Solve -51d = -7763 + 8222 for d. -9 Solve -311p = 277p - 624p + 720 for p. 20 Solve 0 = 14q + 1017 - 1115 for q. 7 Solve -64h = 17h + 648 for h. -8 Solve 42j + 164 + 85 = -213 for j. -11 Solve 201z - 4293 = -72 for z. 21 Solve 362b - 7187 = 1139 for b. 23 Solve -2g - 609 + 597 = 0 for g. -6 Solve -189l = 32l - 1 + 2432 for l. -11 Solve 21502u = 21512u - 50 for u. 5 Solve -130t - 308t = 253 + 8507 for t. -20 Solve 1206 - 709 = 50a - 1103 for a. 32 Solve 60 = 425p - 437p for p. -5 Solve -37p = 13p - 75p + 850 for p. 34 Solve 40t = 13t for t. 0 Solve 592v + 1124 - 2139 = 1945 for v. 5 Solve 1133y + 1532 = -734 for y. -2 Solve -443 + 302 = -47f for f. 3 Solve 11y = 3y - 279 + 231 for y. -6 Solve -4o + 139o = 1485 for o. 11 Solve -6216 = 1340r - 1172r for r. -37 Solve -329 = -11103v + 11150v for v. -7 Solve 374 + 19 = -46i - 113 for i. -11 Solve -110s + 260 + 190 = -60s for s. 9 Solve -8z - 217 = -201 for z. -2 Solve 21m - 28m + 12 = 26 for m. -2 Solve -136m = 147m + 20m - 606 for m. 2 Solve 33v - 17v - 33v - 306 = 0 for v. -18 Solve -129 - 1131 = 105b for b. -12 Solve 139p = -356p + 6435 for p. 13 Solve -257 - 240 = -147q + 91 for q. 4 Solve -45g + 858 - 272 + 809 = 0 for g. 31 Solve -100k - 28k - 2560 = 0 for k. -20 Solve 41q = 56q - 135 for q. 9 Solve 23053 = -170c + 17103 for c. -35 Solve 830 = -6x + 926 for x. 16 Solve 285d - 450 - 1356 = -16d for d. 6 Solve -3508 = -414v + 8912 for v. 30 Solve o = 107o + 151o - 1799 for o. 7 Solve -65w + 351 = 97 - 981 for w. 19 Solve 67h + 293 + 739 = -19h for h. -12 Solve 1555v + 19899 + 23641 = 0 for v. -28 Solve -28m - 2856 = 131m + 45m for m. -14 Solve 1494u = 1515u - 294 for u. 14 Solve 11h - 155018 = -155172 for h. -14 Solve 1824 = 16m + 2144 for m. -20 Solve 20w + 231 = -w for w. -11 Solve 17 = -436z + 10 + 7 for z. 0 Solve -803 + 628 = 25s for s. -7 Solve -100c + 681 = -419 for c. 11 Solve 71b - 2834 + 917 = 0 for b. 27 Solve -200m + 5626 = 12026 for m. -32 Solve -432 - 322 = 58y for y. -13 Solve -1941 = -29k - 1564 for k. 13 Solve 5i = -16i - 213 + 45 for i. -8 Solve 2430 = -13027k + 13117k for k. 27 Solve -1497k + 1215 = -1254k for k. 5 Solve 983w + 956w + 60109 = 0 for w. -31 Solve 34 = 30m - 626 for m. 22 Solve 6239 = d + 6256 for d. -17 Solve 141r + 176 = 185r for r. 4 Solve -2937 + 795 = 297k + 9k for k. -7 Solve -260 = 400y + 2540 for y. -7 Solve 0 = -14n + 75n + 96 - 1011 for n. 15 Solve 1284 = -455s - 408 - 11048 for s. -28 Solve -9v = 7v + 48 for v. -3 Solve -195246 = 15c - 195186 for c. -4 Solve -33k - 440 + 21 - 208 = 0 for k. -19 Solve 0 = -6q - 133q + 8q + 1048 for q. 8 Solve 9f + 15 = 29 + 22 for f. 4 Solve -359o - 256o = -3440 - 8860 for o. 20 Solve 313 = -64x - 403x - 2956 for x. -7 Solve -92r = 350 + 239 - 37 for r. -6 Solve -46*x =	{ "pile_set_name": "DM Mathematics" }
540 = 5b + 9k - 10k. Let c = b + 3537/5. What is the second smallest value in -16, w, c? w Let y = -280.9 + 268. What is the second biggest value in 1, y, 0.5? 0.5 Suppose -5k - 37 + 74 = 2h, 0 = 4k + 12. Let w = -0.2 + -0.8. What is the second biggest value in 4, h, w? 4 Let m = 9.1795 + -0.1795. Let s = -10.08 + 10. Let w = 0.58 + s. Which is the fourth smallest value? (a) 0 (b) w (c) m (d) -2/13 c Let w(q) be the third derivative of 11q4/24 + 10q*3/3 - 111q*2. Let k be w(-2). Let z be (-2)/(-3) - 46/42. What is the smallest value in k, -1, z, -4? -4 Let i be 38/(-90) + 19/((-1539)/(-18)). Let k = 55 + -13. Let s = k + -45. What is the fourth biggest value in -0.05, i, -2, s? s Let z = 22.98 + -18. Let y = z - 9.98. Which is the second biggest value? (a) -35 (b) y (c) 2 (d) -4 d Let m = 329 + -347. Let i = -22 - m. Let n = 3 - 2.8. What is the second smallest value in 4, n, 2/7, i? n Let f(k) = 19k*2 - 3. Let d be f(1). Let s = 39 - 115/3. Which is the second biggest value? (a) d (b) s (c) -2 b Let k = -4.92 - -5. Let a = 2.7585 - 2.9585. What is the third smallest value in -6, k, a? k Let r = -3176 + 3185. Let l = 2.94 - -0.06. Let y = 2.5 - l. Which is the second smallest value? (a) -1 (b) r (c) y c Suppose -27r - 32r = -52r - 28. Which is the biggest value? (a) r (b) 10/11 (c) -100 a Let s(h) = -2h3 + 12h*2 - 20h - 11. Suppose 0 = 175x - 178x + 18. Let o be s(x). What is the third biggest value in 2, o, 0.4? o Let w be 1/(-6)15(-16)/(-40). Which is the third smallest value? (a) 0.5 (b) -3/5 (c) -0.4 (d) -3 (e) w c Let j = 1.31 - 0.11. Let z = j + -8.2. Let p = -7337 - -7337.5. Which is the third smallest value? (a) z (b) 0 (c) p c Let r = -5945 + 5940. What is the third smallest value in -3, 0.23, r, 3? 0.23 Let l be (-2)/(-7)(-812)/3132. Which is the second smallest value? (a) l (b) 5 (c) -0.01 c Suppose -234 = 42y - 48y. Suppose -5z = -18z + y. Let f = -439/3 - -145. What is the third biggest value in -4, z, f? -4 Let t = -15/434 + -3427/1302. Let y = 4/15 - 3/5. What is the biggest value in 2, y, t, 0.2? 2 Let z = 2311 + -2316. Which is the second biggest value? (a) z (b) -9 (c) -7 c Let y = 2 - 2.3. Suppose -5t - 2u + 1998 = 0, -3t + 8t - 1997 = -3u. Let q = 403 - t. What is the second biggest value in q, -4, y, 10? q Let a = 8327 + -308100/37. What is the fourth biggest value in 2, a, 0.5, 3? a Let w = -696.8 - -837. Let d = -140 + w. Let t = -5.1 + 0.1. What is the fourth smallest value in 0, -4, d, t? d Suppose -26 = -4j - 6. Let o be (12/9)/(-2) - (-10)/24. Let t = 1/1588 + -993/794. Which is the second smallest value? (a) t (b) j (c) o (d) -1 d Let m(x) = x*3 - 6x*2 - 4x + 22. Let d be m(6). Let k = 74.1 + -84. Let q = -2.1 + k. Which is the second smallest value? (a) q (b) -0.3 (c) d c Let t = 1.982 + 0.018. Let i = -51.2552 + 0.0952. Let q = i + 51. What is the smallest value in t, q, 0, -0.1? q Let y = 0.4 + 0.1. Suppose 1743t - 45 = 1738t - 4u, -u - 2 = -12t. Which is the biggest value? (a) -2 (b) t (c) y (d) 3 d Let s = -39.9343 - 0.0657. What is the second smallest value in -9, 5, s? -9 Let n = 7.5 - 8. Let h = 35 - 313/9. Suppose -2q + 12 = 3q + 3t, 2q = t - 4. Which is the fourth smallest value? (a) -1/5 (b) n (c) q (d) h d Let s = -5189/3 - -1731. Which is the biggest value? (a) 1.5 (b) 6/5 (c) 5 (d) s c Let b = -8070 + 8067. Let q be 4/6(0 + -3). What is the second biggest value in -0.4, q, 5/4, b? -0.4 Let x = -58 + -48. Let o = 106.3 + x. What is the second smallest value in 2/3, o, 4? 2/3 Let a = -55 - -36. Let r = -490 + 493. What is the smallest value in a, r, -1, -2/9? a Let g = 422 - 426.55. Let h = g + -0.45. What is the second smallest value in 7, -0.5, h, 4? -0.5 Suppose 0 = -3w + 5t + 20, 18 = 3w - 0w - 3t. Let z be 280/25 - 270/27. Which is the smallest value? (a) w (b) z (c) -5 c Suppose -5d - j - 1 = 0, -2d - 8 = 4j - 22. Let g be d - 2 - (-1 - 33). Which is the biggest value? (a) g (b) -0.5 (c) -2 a Let p = 2.1 + -2. Let t = 95.4 - 96.1. Which is the smallest value? (a) 5/3 (b) t (c) p b Let u = -1 - -5. Suppose -4 = -538j + 536j. Let k be (-8)/5 + (-3 - j)/(-5). Which is the fourth biggest value? (a) 0.1 (b) u (c) k (d) 4/7 c Let m be (0 - (-6)/(-8))(-2160)/405. What is the fifth biggest value in m, -19, 5, 3, -0.4? -19 Let r = 0.3 + -0.3. Let s(n) = n*2 + 1973n + 19632. Let c be s(-10). What is the smallest value in 0.03, r, c? r Let t = 4 + -3.9. Let l be (-3 + 16/8)((-4 - -10) + -8). Let y = 4 - 9. Which is the smallest value? (a) y (b) t (c) l a Let s = -0.08592 - -4.08592. What is the biggest value in s, -97, 0.3, -3, -0.07? s Let q(j) = 5j*2 - 49j - 608. Let x be q(18). Which is the third smallest value? (a) x (b) 2/11 (c) -0.4 (d) -0.3 (e) 4/5 b Let m be (-1)/5 + 480/25. Let v(k) = k*2 - 22k + 53. Let t be v(m). Which is the biggest value? (a) 3/5 (b) 2/11 (c) -35 (d) t a Let v be (-36)/(-77) + 20/(-70). Let u be 1 - 14 - -16 - 4. Which is the third biggest value? (a) v (b) u (c) 10 b Let d = -281/28 + 39/4. Let u be (3/21)/((-2)/7). Which is the second smallest value? (a) u (b) -42 (c) d a Let s be 0 + (-3)/7 - (-399)/588. Which is the second biggest value? (a) -0.02 (b) -4 (c) s (d) 2/3 c Let l = -312 + 477. Let x = -164.9 + l. Let t = 28 - 51. Which is the smallest value? (a) x (b) -1/9 (c) t c Let m be (-24)/(-66)40/(-48)3. Which is the biggest value? (a) 0.2 (b) m (c) 5/11 c Let x = -10 + 12. Suppose -z = -d - 1, xz - 5d - 5 = 7z. Let q = -13.7 + 16.7. Which is the biggest value? (a) z (b) 4/3 (c) q c Let z = 0 - 0.1. Let d = 908.08 + -908.98. Which is the smallest value? (a) d (b) z (c) 0 a Let s be (7/6)/(-7)(-20)/15. What is the third smallest value in -1/143, 1/5, s? s Let c = 1/1330 - -164917/3990. Let a = c + -2114/51. What is the biggest value in -2/27, a, 5/6? 5/6 Let l = 0.2 + -0.2. Suppose -124o - 21 = -248o + 131o. Let c = 0.3 + -1.3. What is the second smallest value in l, o, c? c Let z = 7014 + -6985. Which is the third biggest value? (a) -0.5 (b) z (c) 0 (d) -5 (e) 2 c Let z(c) = c2 + 6c + 1. Let x be z(-4). Let k = 4 + x. Let i = 11311 + -11306. What is the biggest value in i, 1, 3/8, k? i Let p be 9 - (0 + -6 + 7). Suppose pw = 39w - 124. Which is the third smallest value? (a) w (b) 7 (c) 1/4 b Let a = -17.8 - -16. Let c = 2009 + -2007. Let l = a + c. What is the second biggest value in l, 5, -1? l Let n = 417/5 - 83. Suppose -317 - 789 = 7v. Let h = 631/4 + v. Which is the biggest value? (a) h (b) n (c) 0.5 c Let h = -2.2 - -2. Let w be 4/(-42)(-3 + 17 - 17). Which is the fourth smallest value? (a) 0.4 (b) w (c) h (d) 5 d Let z = 43515.2 + -43515. What is the fourth biggest value in 0.1, 7/8, z, -1? -1 Let f = -9.1 + 40.9. Let y = 30.7 - f. What is the second smallest value in y, -2/15, 3? -2/15 Let m = 31 + -10. Let p = m + -24. Let h = -7.8 + 7.4. Which is the biggest value? (a) h (b) p (c) 3 c Let n be 4/(((-66)/8)/(9/(-144)-6)). What is the third biggest value in -45, -3, n, -1/12? -3 Let n = 4055 - 16221/4. What is the second biggest value in -35, 0, n, -8? n Let w = -129 - -126. Let n be 15w/36-4. Let o be ((-3)/(-78))/((-2)/4). Which is the smallest value? (a) o (b) 1 (c) 0.5 (d) n a Let f be 4 + -7 - 2121/(-6). Let x = -351 + f. Which is the biggest value? (a) -0.4 (b) 1 (c) x (d) -1 b Let p = -35.41 + 0.41. Let k = -446.6 + 412. Let q = k - p. Which is the second smallest value? (a) -3 (b) q (c) 3 b Let j be 2/8(-4)/9. Let g = 40.51 - 1.51. What is the fourth biggest value in 3, g, j, -4? -4 Let k = -1042442/5355 + 2/5355. Let c = -193 - k. Suppose -m + 3w = -1, 16 = -3m + 2*w - 2. What is the second biggest value in m, -1/2, c? -1/2 Let t = 22857 + -22857. What is the biggest value in t, -2/7, -486/5? t Let o = -489 + 586. Let r = -97.2 + o. Which is the second biggest value? (a) r (b) 0.39 (c) 0 c Let z = 25466 - 25465.2. Let t = -13 + 11. What is the second biggest value in z, 0.3, t, -4? 0.3 Let i = 1.48 - 0.18. Let w be (-8)/(-60) + (782/255)/(-23). Let n be (-2)/(-56) - 1/(-4). What is the third biggest value in w, i, n, 1/2? n Suppose -	{ "pile_set_name": "DM Mathematics" }
(r) be the third derivative of r*2 + 0 + 0r + 1/24r4 - 1/3r*o + 1/60r*5. What is u in f(u) = 0? -2, 1 Suppose 7y = 4 + 10. Suppose -2n = -yb - 10 - 12, -4n + 2b + 42 = 0. Factor -12a3 + 2a*4 + n + 16a*2 + 12a - 11 - 17. 2(a - 3)2(a - 1)(a + 1) Let y = 3440/3 + -24071/21. Let f(t) be the first derivative of 6/7t*2 - 3/14t*4 + 3/35t*5 + 12/7t - yt3 + 18. Factor f(m). 3(m - 2)*2(m + 1)*2/7 Find d, given that -40/3d*4 - 2314/9d*3 - 40000/9 - 15764/9d*2 - 2/9d*5 - 4800d = 0. -25, -4, -2 Suppose 2g = -y - 1213, g + 828 - 227 = 5y. Let t = -334 - g. Find a, given that -ta2 + 180a*3 - 32 + 176a - 160a2 + 120a*2 = 0. 2/5, 2/3 Let c(n) = 2573n - 43741. Let t be c(17). Solve 4/7j3 - 16/7j*2 + t - 12j = 0 for j. -3, 0, 7 Let v(y) = -8y2 - 18y - 10. Let m(g) = 9g2 + 19g + 10. Let b(a) = -12a + 1 + 5a - 2a2 + 0. Let t be b(-4). Let p(d) = tm(d) - 4v(d). Factor p(q). 5(q + 1)(q + 2) Factor 0 + 25/3d*4 + 78d*3 + 1/3d*5 + 324d*2 + 504d. d(d + 6)3(d + 7)/3 Let b(o) be the first derivative of -o8/420 + o7/60 + 31o6/1440 + o5/120 - 4o*3/3 + o - 74. Let l(m) be the third derivative of b(m). Factor l(a). -a(a - 4)(4a + 1)*2/4 Let f(a) be the third derivative of 5/9a*3 - 1/90a*5 + 26a*2 + 0 - 1/9a*4 + a. Factor f(o). -2(o - 1)(o + 5)/3 Let l(a) be the first derivative of a6/270 - 29a*5/270 + 13a*4/108 + 14a*3/27 - 19a*2/2 - 2. Let q(j) be the second derivative of l(j). Factor q(h). 2(h - 14)(h - 1)(2h + 1)/9 Let v(z) be the second derivative of z5/10 - 635z*4/6 + 99847z*3/3 + 305283z*2 + 1732z + 2. Suppose v(g) = 0. What is g? -3, 319 Let s be 4/5 - (748/85 + -10). Solve 0 - 50/13y + 2/13y*5 + 20/13y*s - 20/13y*4 + 48/13y*3 = 0 for y. -1, 0, 1, 5 Let w = -148 + -27. Let k be ((-280)/w)/((-18)/(-5)). Let k - 2/9q*2 + 2/9q = 0. Calculate q. -1, 2 Let s(v) be the second derivative of 3v5/20 + 403v*4/4 + 39991v*3/2 - 370881v*2/2 + 1847v + 1. Factor s(c). 3(c - 3)(c + 203)*2 Let t be ((-114)/12)/((-2)/(-4)). Let m = 23 + t. Factor -2d*m + 6d2 - d4 + 703d3 - 706d*3. -3d*2(d - 1)(d + 2) Suppose 101w = -28w - 126w + 4845. Let u(v) be the first derivative of w + 4/19v - 2/57v*3 + 1/19v2. Solve u(i) = 0. -1, 2 Let k(y) be the third derivative of -y8/2520 + y7/1260 + y6/108 + y*5/60 - 67y*3/6 + 85y*2. Let s(o) be the first derivative of k(o). Factor s(i). -2i(i - 3)(i + 1)2/3 Let m(p) be the third derivative of p5/300 - 23p4/12 - 232p*3/15 + 2241p*2. Factor m(n). (n - 232)(n + 2)/5 Let p = 2132/425 - 11099/2975. Factor pu + 3/7u*4 + 12/7 - 9/7u*3 - 15/7u*2. 3(u - 4)(u - 1)(u + 1)*2/7 What is b in 33b*3 + 1721b - b*3 - 41231b*2 + 3b4 + b4 - 529b - 576 + 40579b*2 = 0? -18, 1, 8 Let q(j) = 4j*3 + 15j*2 - j + 13. Let z be q(-4). Let x be z(-40)/12 + 4. What is f in -4/3f + x - 2/3f*4 + 4/3f*3 + 0f*2 = 0? -1, 1 Let o(i) be the first derivative of 34/5i*2 - 177 - 9/20i*4 - 4/3i*3 + 16/5i. Suppose o(h) = 0. Calculate h. -4, -2/9, 2 Find o such that -2960o2 - 52555o + 1730491 - 230797o - 303627o + 154879o - 5o*3 + 45589 = 0. -298, 4 Let v be (-3)/(7/301-3). Find u, given that vu2 - 5u*3 - 9u + 39u2 - 88u*2 + 4u3 = 0. -3, 0 Let y(w) be the third derivative of w8/504 + 4w7/315 + w6/36 + w5/45 - 1094w*2. Factor y(d). 2d*2(d + 1)*2(d + 2)/3 Let n(f) be the first derivative of f*7/231 - 3f5/110 - f4/33 - 112f + 98. Let v(c) be the first derivative of n(c). Solve v(u) = 0 for u. -1, 0, 2 Let w be (-8)/(-28)7(-18)/(-324)27. Factor 0 + 10/17i - 8/17i*2 - 2/17i*w. -2i(i - 1)(i + 5)/17 Let l(j) = 2j2 + 12j + 2. Let f(u) = -3u2 - 28u - 9. Let w(s) = 2f(s) + 5l(s). Suppose w(c) = 0. Calculate c. -2, 1 Let d = -1069455 - -1069457. Let 14s3 - 14s + 3/4sd - 3 + 9/4s*4 = 0. Calculate s. -6, -1, -2/9, 1 Suppose 2/13b*3 + 788/13b*2 + 78400/13b + 153664/13 = 0. What is b? -196, -2 Let j(z) be the third derivative of 2z2 + 4z*3 + 79/240z*6 + 19/30z*5 + 0 - 25z - 49/12z4 - 1/60z*7. What is o in j(o) = 0? -2, 2/7, 1, 12 Let q(h) be the first derivative of 1083h*4/16 + 57h*3/2 + 27h2/8 - 2006. Solve q(k) = 0. -3/19, 0 Let o(q) be the third derivative of q6/300 - q*5/25 + 2q*4/15 + 300q*2. Factor o(v). 2v(v - 4)(v - 2)/5 Factor -106a - 57a - 496 + 31 + 20a2 + 768a. 5(a + 31)(4a - 3) Let j(v) = 3v*4 - 33v*3 - 53v*2 + 82v + 64. Let o(x) = -2x4 + 17x*3 + 27x*2 - 38x - 31. Let y(m) = -3j(m) - 7o(m). Find g such that y(g) = 0. -1, 1, 5 Let l(k) = -126 + k*2 + 159 - 2k - 27k. Let c be l(28). Solve 0x*2 + 0 + 8/3x*3 + 2/3x*c + 0x + 8/3x4 = 0. -2, 0 Factor 2/5r*3 + 166/5r + 24 + 48/5r2. 2(r + 1)(r + 3)(r + 20)/5 Let -27y + 1/4y*5 + 0 - 9y*2 + 5/2y*4 + 21/4y*3 = 0. Calculate y. -6, -3, 0, 2 Let y = -730 - -735. Let j be 2/4-1(-1)/y. Factor 1/10h*3 - 1/10h*4 + 0h + 1/10h2 + 0 - jh5. -h2(h - 1)(h + 1)*2/10 Let m(b) = 12b*2 + 14b + 10. Suppose -5i + 3 = 2w - 34, 2w = i + 7. Let o(k) = 4k*2 + 4k + 3. Let z(j) = wm(j) - 20o(j). Factor z(t). -4t(2t - 1) Let w(r) be the third derivative of 1/18r*4 + 0 + 0r*3 + 57r*2 + 1/45r*5 + 0r. Factor w(l). 4l(l + 1)/3 Let f(y) be the first derivative of y*4/21 - 4y*3/7 + 16y*2/7 + 188y - 296. Let k(v) be the first derivative of f(v). Solve k(m) = 0 for m. 2, 4 Let f be (2 - 0)/(-2)2807/(-7). Solve -fn - 19 + 113n - 17 + 5n*2 - 82n - 339 = 0 for n. -1, 75 Let k = 66 + -74. Let v be (-1)/(-8) - (k - 244/(-32)). Factor 5/4u - v + 1/4u3 - u2. (u - 2)(u - 1)2/4 Determine l, given that -98/3l*2 + 116/3l - 40/3 + l*4 + 19/3l*3 = 0. -10, 2/3, 1, 2 Suppose 21698 = -12b + 21734. Let x(j) be the first derivative of 12j + 14 + 1/9j*b + 2j2. Factor x(i). (i + 6)2/3 Determine s so that 159s + 510 + 7s2 + s2 + 2s2 - 5s*2 - 44s = 0. -17, -6 Let i(j) be the first derivative of 14j5/5 + 79j*4/2 - 866j*3/3 - 655j*2 - 300j - 7934. Find c, given that i(c) = 0. -15, -1, -2/7, 5 Let g(u) be the first derivative of 3u4/22 - 376u*3/33 + 303u*2/11 + 244u/11 + 1353. Determine w so that g(w) = 0. -1/3, 2, 61 Let y(f) be the third derivative of f*5/135 - 253f*4/54 + 500f*3/9 - 4795f*2. Factor y(g). 4(g - 250)(g - 3)/9 Let l(n) be the first derivative of -n5/30 - n4/9 + n3/9 + 2n*2/3 + 14n + 67. Let d(k) be the first derivative of l(k). Factor d(c). -2(c - 1)(c + 1)(c + 2)/3 Let f(m) = -6m - 13. Suppose -9 = -g - 15. Let k be f(g). Determine u so that -ku - u3 + 47u + 4u2 - 28u = 0. 0, 2 Suppose -9s + 8s - 2a = 10, 3a + 15 = 0. Let t(o) be the second derivative of -2o + s + 1/4o*4 + 0o*2 + 3/2o*3. Factor t(u). 3u(u + 3) Find v such that -2/5v*4 + 8/5v*2 + 0 - 1/5v*5 - 12/5v + 7/5v3 = 0. -3, -2, 0, 1, 2 Let t(x) be the second derivative of -x6/15 + 53x*5/20 - 25x*4/12 - 13x*3/3 - 6590x. Factor t(b). -b(b - 26)(b - 1)(2b + 1) Let j(y) be the first derivative of -y*4/28 + 15y*3/14 + 24y*2/7 - 91y + 293. Let r(c) be the first derivative of j(c). Factor r(t). -3(t - 16)(t + 1)/7 Let r(p) be the second derivative of 64p + 9/5p*3 + 0 - 1/35p*7 - 12/25p*5 - 3/5p*4 + 6/25p*6 + 0p*2. Solve r(s) = 0. -1, 0, 1, 3 Let t(g) be the third derivative of 5g + 1/5g6 - 2/105g7 - g4 - 7/15g5 + 0 + 2g*2 + 16/3g*3. Let t(c) = 0. What is c? -1, 1, 2, 4 Let g = -822/6245 - -664/1249. Find t, given that 1/5t*5 + 12/5t*2 - gt*3 - 8/5t + 0 - 3/5t4 = 0. -2, 0, 1, 2 Let s be ((-57520)/71900)/(1 - (-11)/(-5)). Find a such that 0 - 2/3a*4 + 7/3a*3 - a - sa*2 = 0. -1/2, 0, 1, 3 Let f(z) = -17z*2 + 2437z - 249509. Let x(d) = 25d2 - 3656d + 374272. Let c(j) = 16f(j) + 11x(j). Factor c(y). 3(y - 204)2 Let m(v) = 9v*4 - 36v*3 - 356v*2 - 215v - 30. Let y(b) = -18b4 + 73b*3 + 711b*2 + 432b + 62. Let x(s) = -5m(s) - 3y(s). Factor x(r). (r - 9)(r + 4)(3r + 1)2 Factor 420n*4 - 45 - 417n*4 - 84n + 10n3 - 19n*2 + 2n*3 - 6n*2 - 5n*2. 3(n - 3)*(n + 1)	{ "pile_set_name": "DM Mathematics" }
give f. -25 Rearrange (4n2 - 14n*3 - 3n*2 + 4n*3)(n + n + 0n) to the form hn*4 + mn + xn2 + t + zn*3 and give z. 2 Rearrange -123f*2 + 123f*2 + 1 - 2f*3 to the form pf + qf3 + df*2 + s and give q. -2 Express 14l - 4l2 - 14l + 2l2 - 16 in the form b + ml*2 + kl and give b. -16 Rearrange -7 + 3s2 + 3 + 7 to the form r + us + ls2 and give u. 0 Express -45m + 5m + m as ym + d and give y. -39 Express (3a - 3a + a*2)(3a + 0a - 5a) + (0a*2 + 5a*2 - 2a*2)(0a + 0a + 2a) + 4 - 4 - 3a*3 as ia*3 + n + pa*2 + qa and give i. 1 Rearrange -106u2 + 50u*2 - 12u + 57u2 to iu + s + wu2 and give i. -12 Rearrange (2 - 2 + 2i)(i2 + 3i*2 - 2i*2) + (-i + 4i - 2i)(3i2 + 4i*2 - 5i*2) to xi*3 + qi + gi2 + u and give u. 0 Express -b2 - 3 + 13b*2 - 3b*2 as g + rb*2 + pb and give g. -3 Rearrange 2 + 8 - 6b + 4b - 4 to h + rb and give h. 6 Rearrange -5j*2 - 4j*3 - 18 + 19 + 2j*2 to d + wj + uj2 + vj*3 and give w. 0 Rearrange -27p*3 + 22p*3 + 13p*3 + (2p2 + p2 - p*2)(p - 4p + p) to w + vp*2 + np + up3 and give u. 4 Rearrange 0 - 2 + 10l + 2 to the form j + vl and give v. 10 Rearrange (-4 + 1 - 1)(-l*2 + 0l - 9l - l2) + 0l*2 + 3l*2 - 2l*2 to y + bl + ml2 and give m. 9 Express 7v*3 + 31v*2 - 3v*3 - 3v*3 in the form tv*3 + mv*2 + wv + j and give j. 0 Rearrange -2t - 2t*3 - 2t*3 + 9t*3 to the form qt*2 + at + bt3 + p and give b. 5 Express -30 + 30 + k as h + fk and give f. 1 Express -46 + 25 + 21 + 46c in the form fc + s and give f. 46 Rearrange (-24u + 44u*3 + 42u*3 - 82u*3)(2u - u + 0u) to su4 + c + tu + mu2 + wu3 and give s. 4 Rearrange -j3 - 3j3 + 3j*3 + 2j*3 + 0j3 - j3 + (3 - j*3 - 3)(-10 - 8 - 5) to the form gj2 + sj + rj3 + q and give r. 23 Rearrange (-q + 0q + 0q)((7 - 4 - 2)(3 - 5 + 1) - 2 - 4 + 0) to cq + k and give c. 7 Express -b*3 + 3b*3 + 3b - 2b4 + b2 - 2b*4 - b as tb*2 + rb*4 + ab*3 + cb + z and give t. 1 Rearrange g*2 - 4g2 + g2 + (g - 3 + 3)(-28g + 84g + 8g) to the form ug + og*2 + a and give o. 62 Express -3k2 - k2 + 0 + 2k2 + 30 as fk + b + ak2 and give a. -2 Rearrange (0 + 88 + 6 - 3z)(z3 - 3z*3 + 0z*3) to the form uz + lz2 + v + nz*3 + az*4 and give a. 6 Rearrange (3r*2 + 3 - 3)(-3r2 + 7r*2 - 3r*2) + 3r4 - r3 + r*3 + 4r - 4r - 5r*4 to the form hr*4 + wr*2 + i + jr + mr3 and give h. 1 Rearrange 2c*3 + 18c*4 - 3 + 1 - 16c*4 - 9c*2 + 2c*2 to the form ac + mc3 + y + zc*4 + vc*2 and give v. -7 Express 27h*2 - 29h*2 + 12h*3 - 1 - 14h*3 as a + ch + fh3 + oh*2 and give f. -2 Express -44h - 120h + 8h as kh + t and give k. -156 Express (-2 - 1 + 1)(v + 2v - 5v)(290 - 290 + 53v) in the form s + bv2 + tv and give b. 212 Express (13 - 3 - 2)(-2x - 1 + 1)(-3 + 11 + 0) in the form v + mx and give m. -128 Express -2176 + 2176 - 64a in the form f + pa and give p. -64 Rearrange (-3y2 + 2y*2 + 4y*2)(-1 + 4 - 4)(-4 + 4 - 1) to the form o + by + qy2 and give b. 0 Rearrange -x2 + 3x + 5x2 + 11x*2 - 2x*2 to qx + a + fx2 and give q. 3 Rearrange -11i3 - 24 + i3 + 23 + 2i to the form f + di*3 + xi + ji2 and give f. -1 Express 11n - 12n + 19n as d + gn and give g. 18 Rearrange 256f - 54f2 - 256f to cf + d + xf*2 and give d. 0 Express -2 + 2 + 21m + 55m2 - 57m*2 as l + am*2 + qm and give q. 21 Rearrange (0u - u2 + 0u)(15u*2 - 128 + 128 - u) to the form iu*3 + gu*2 + ju + au4 + c and give a. -15 Rearrange 489 - 489 + 25t to f + at and give a. 25 Rearrange (-t2 + 0t*2 + 3t*2)(-t*2 - 1588t + 804t + 844t) to the form qt4 + ut*2 + r + yt*3 + dt and give q. -2 Rearrange -2j + 19 - 15 - 2j*4 + 4j to pj + xj*4 + v + qj*3 + tj*2 and give p. 2 Rearrange -2 - 2b3 - b4 - 15b2 - 7b + 6b2 + 3 + 6b*2 to the form hb + vb3 + jb*2 + d + tb*4 and give d. 1 Express 0s + s + s - 5 + 5 - 3s + (0 - 2s + 0)(5 - 5 - 2) + (-1 - 5 + 2)(4s - 4s - 2s) + 2s + 4s - 5s as x + ps and give p. 12 Rearrange 2y*3 + 925y*2 - 925y*2 + 4y - 4 + 2y4 to cy*2 + py*3 + z + fy*4 + dy and give f. 2 Express (i - 3i3 - i)(5 + 2i - 5)(-5 + 5 - 5) in the form ki + j + ti*2 + qi*3 + bi*4 and give b. 30 Express (-50 + 117 - 30)(3 + 2p - 3) - 2p + 0 + 0 + 4p - p + 0p + (-2 - 1 + 5)(-5 + p + 5) in the form a + rp and give r. 77 Express (c + 2c - 2c)(-12 - 13 + 27)(2 - 1 - 2) in the form ac + r and give a. -2 Rearrange -24v*2 + 11v*2 + 11v*2 to l + ov*2 + rv and give o. -2 Rearrange -4 + 7w3 - 1 - 9w*3 to zw*2 + xw + iw3 + u and give u. -5 Express -t + t3 + t3 - 34 + 38 as ct + yt3 + kt*2 + v and give y. 2 Express -21g*2 - 3g*2 + 2g*2 as ig*2 + bg + w and give b. 0 Rearrange 6m2 + 2m*2 + 5m3 - m3 to vm2 + z + sm*3 + lm and give v. 8 Express (24 - 20 + x + 13)(2 - 3 + 3) in the form j + dx and give j. 34 Rearrange -7w2 - 6w*2 + 4w*2 + 2 to hw + n + zw2 and give n. 2 Rearrange 13b*2 - 12b*2 - 2b - 7 + 0 to i + nb + zb*2 and give n. -2 Express (0f + 4f - f + 3)(0f3 + f3 - 3f*3) + (2f*2 - 2f*2 - 4f*2)(-2f - 3f*2 + 2f) as uf4 + mf*2 + sf + vf3 + y and give u. 6 Rearrange -45 + 27d - 31 - 28d to zd + h and give h. -76 Express (197 - 197 + 2n)(-3 - 2n + 3) as on + zn2 + s and give z. -4 Rearrange 6c2 - c2 + 8c2 + 15c*2 to qc + vc2 + y and give v. 28 Express -z2 + 10z*3 - z - 9z*3 + 0z*2 in the form vz + tz3 + rz*2 + g and give v. -1 Express (6 - 1 - 2 + (1 - 1 - 1)(-5 + 4 - 1) - 4 - 1 + 6)(6d - 27 + 27) in the form l + od and give o. 36 Rearrange 4y*2 - 14 - 16 + 48 - 15 to s + ty + iy2 and give t. 0 Rearrange -21y*2 + 62y*2 - 23y*2 to the form jy*2 + dy + n and give j. 18 Rearrange (-60z + 8z*2 - 6z*2 + 0z*2)(-3 + 1 + 0) to the form g + sz + bz*2 and give s. 120 Rearrange (421 - 211 - 210 + 58i)(3i*2 - 6i2 + i2) to z + ci2 + vi + ui3 and give u. -116 Express -12u + 8u + 11 + 7u + (-1 + 1 + 2)(0u + u - 4u) as fu + a and give f. -3 Rearrange 3u + u2 + 9u*2 - 4u + 6u2 to the form au + b + ku2 and give a. -1 Express -134 + 3w + 17w3 + 134 - w as jw*2 + kw + f + lw3 and give k. 2 Express 10 - 7g*2 - 33g*2 + 9g*2 - 9 as jg*2 + z + qg and give j. -31 Express 2w + 0w + 0w + (0 + 1 + 0)(-w + 0w - w) + w - w - 2w + 0w + 0w - w + 3w + 3w - 5w as r + uw and give u. -2 Express -50q - 49q + 34q as lq + v and give l. -65 Rearrange 0 + v2 + 0 + v2 - 2v2 - 2v*2 + (2v + 2v - 3v)(-3v + v + v) to the form tv2 + rv + q and give t. -3 Rearrange (-83k2 - 46k*2 + 15k*2)(3 + 0 - 5) to ok + zk*2 + p and give z. 228 Express (-3 + 1 + 0)(z3 - z3 + z*3)(0 + 1 + 0)(-2 + 5z + 2) as gz + xz*2 + i + wz*4 + lz*3 and give w. -10 Express 9y*2 - 10y2 + 3 - y3 + 3y2 + (3y + 0y - 2y)(4y*2 - 3y*2 - 3y*2) in the form dy*3 + n + ry + vy2 and give v. 2 Express (-4f + 3f - 2f)(-1 + 0 - 1 + f) as pf + u + yf2 and give y. -3 Express a4 + 5a*3 - 6a + a*3 + 0a*3 + 7a in the form ua4 + la*3 + na + ba2 + i and give l. 6 Rearrange -2k*2 - 2k*3 + 3k - 3k - 4 + 3 to the form mk + ck2 + l + gk*3 and give c. -2 Rearrange 62l*2 - 33l*2 - 2l3 - l4 - 31l2 to the form ql*3 + g + vl*4 + cl*2 + jl and give v. -1 Rearrange 68k - 60k + 0 + 1 + (-3k - k + 5k)(0 + 0 - 2) to qk + i and give q. 6 Express p - 8p + p as up + d and give u. -6 Rearrange -1 + 203v - 5v*2 - 203v to the form wv2 + q + lv and give w. -5 Rearrange -4y + 0y - 7y - 3y to the form cy + a and give c. -14 Express (-3 + 2 + 0)(148 - 13f - 148) as nf + w and give w. 0 Express (7l2 + 6l*2 - 6l*2)(24 - 15 - 21) + (-l + 4l - 5l)(l + 4l - 4l) as ml*2 + kl + d and give d. 0 Rearrange -8b3 - 5b*3 + 6b*3 - 2b*2 to sb + lb3 + vb*2 + q and give v. -2 Express (-29r*	{ "pile_set_name": "DM Mathematics" }
j3 + j2 + 2 Let a(c) = 2c + 2. Let n(q) = q - 1 + 1 + 1. Suppose -3j - j = 8, 2b + 4 = 2j. Let g(h) = -h*2 - 5h + 2. Let o be g(b). Calculate on(t) - 2a(t). 2t + 2 Let y(l) = -2l*3 + 2l*2 - 9. Let q(i) = 5 + 15i2 + i3 + i*2 - 17i*2. What is -11q(f) - 6y(f)? f3 - f2 - 1 Let q(t) = -2t*3 - 4t*2 + 2t. Let s(x) = -11x2 + 9x - 18x + 9x - 6x3 + 6x. Calculate -11q(u) + 4s(u). -2u3 + 2u Let t(d) = -62d - 5. Let w(l) = 61l + 4. Determine 4t(k) + 5w(k). 57k Let y(n) = 3n*2 - 41 + 4n*2 + 38 - 3n. Let u(h) = -8h2 + 4h + 4. Give -3u(p) - 4y(p). -4p2 Let f(j) = -4 + 1 + 4 - 2. Let o = -4 - -6. Let c(u) = -4u*2 + 2 + 2u + 2uo + u2. Calculate -c(i) - 4f(i). i*2 - 2i + 2 Let i(k) = -k*3 + 3k2 + k + 46. Let s(x) = x2 + x. Calculate -i(n) + 3s(n). n3 + 2n - 46 Let f(u) = -3u3 + 3u*2 - 4u. Let q(g) = 2g3 - 4g*2 + 5g - 1. Determine -5f(n) - 4q(n). 7n3 + n2 + 4 Let c = 4 + -2. Let w = 5 - c. Let p(f) = 6f*2 - 3f*2 + 2 + 0f*3 + wf + 2f3. Let t(j) = -6j*3 - 8j*2 - 8j - 5. Determine 8p(h) + 3t(h). -2h3 + 1 Let l(n) = -2n*3 - n + 6. Let w(a) = 3a*3 + a - 7. Give 5l(o) + 4w(o). 2o*3 - o + 2 Let t(q) = 5q*2 - 4q - 5. Let h(f) = -8f2 - f + 8. Let n(r) = -23r*2 - 2r + 23. Let p(v) = -11h(v) + 4n(v). What is -3p(u) - 2t(u)? 2u2 - u - 2 Let z(n) = 3n + 3. Let u(q) = -3q - 4. Calculate -4u(w) - 5z(w). -3w + 1 Let j(q) = -q*2 + 3q. Let m(s) = -2s2 + 23s. Let h(u) = -u*2 + 11u. Let g(l) = 13h(l) - 6m(l). Let d = -4 + 1. Determine dg(x) + 5j(x). -2x2 Let k(w) = -5w*2 + 10w + 15. Let l(s) = -s*2 + 2s + 3. Determine -2k(o) + 11l(o). -o*2 + 2o + 3 Let u(m) = 2m2 + 4m - 2. Let j(d) = -d*3 + 2d*2 + 3d - 2. Determine -4j(k) + 3u(k). 4k3 - 2k*2 + 2 Let m(z) = z + 5. Let w be (12/(-10))/(6/(-20)). Suppose -u + 4o - 2 = 5o, 0 = -u + wo + 18. Let q(k) = -1. Give um(y) + 9q(y). 2y + 1 Suppose -3c - 2c - 10 = 0. Let w = 10 + c. Let d = 1 - -2. Let o(y) = -5y3 + y2. Let u(q) = 14q3 - 2q*2. Calculate du(s) + wo(s). 2s*3 + 2s*2 Let k(q) = -3q*2 - q + 1. Let v be k(2). Let b(p) = 3p*3 + 6p. Let x(u) = -6u3 - 13u. Determine vb(d) - 6x(d). -3d3 Let s(x) = 7x. Let v(u) = -6u. Let a = -5 + 9. Suppose -k + ak = -12. Determine kv(t) - 3s(t). 3t Let i(q) be the second derivative of q3/2 + q2 - 7q. Let f(w) = 7w + 5. Give -2f(a) + 5i(a). a Let l(g) = -16 + 5g*2 + 0g2 + g2. Let w(c) = -1 + 4c2 - 6c2 + 4 + c2. Give 2l(s) + 11w(s). s*2 + 1 Let i = -1 + 2. Let r(b) = 3b*2 - b + 1. Let a = 9 + -7. Let y(z) = z + 0z2 + za - 2z2. Calculate ir(x) + 2y(x). x2 + x + 1 Suppose -4a = 2t + t + 11, -2a + t = -7. Let g(c) be the third derivative of -c*3/6 + 2c*2. Let i(o) = 2o + 4. Determine ai(b) + 2g(b). 2b + 2 Let g(p) = p + 2p - 4p + 1. Let q be (-7)/(-3) + 2/(-6). Let j be (-12)/(-10) + q/(-10). Let w(n) = -7n + 8. Calculate jw(d) - 6g(d). -d + 2 Let h be 51/18 + (-6)/(-36). Let g(t) = -t + 3. Let o(w) = 2w - 4. Determine hg(l) + 2o(l). l + 1 Let q(j) = 0j - 1 + 4 + 2j. Let b(h) = -4h - 7. Let n(g) = 8g + 14. Let i(t) = -13b(t) - 6n(t). Determine 2i(d) - 5q(d). -2d - 1 Let l be ((-10)/(-15))/((-2)/9). Let t be l20/(-12)-1. Let z(h) = -3h + 9h + 8h - 6. Let k(f) = -9f + 4. Give tz(j) - 8k(j). 2j - 2 Let y(k) = -16k*3 - 5k*2. Let a(m) = -104m*3 - 32m*2. Determine 5a(p) - 32y(p). -8p*3 Suppose 2g + 15 = -b + g, 0 = b + 2g + 19. Let z(l) = -20l*2 + 11l. Let q(w) = -7w2 + 4w. Calculate bq(r) + 4z(r). -3r2 Let i(t) = 2t + 5. Let w(n) = 1. Suppose -2r + 5r = -15. Let z = -2 - r. Suppose -zg + 0g - 15 = 0. Determine gw(h) + i(h). 2h Let x = -19 - -41. Let j(w) = -w*2 + 3w - 3. Let v(h) = -4h2 + 11h - 11. Determine xj(a) - 6v(a). 2a2 Let c = -5 - 8. Suppose -2u = -14 - 0. Let v = -13 + u. Let r(i) = 8i3 - 5i + 1. Let x(g) = -17g3 + 11g - 2. What is cr(q) + vx(q)? -2q3 - q - 1 Let s(m) = -2m + 1. Let d(f) = 6 + 2 - 9 - f + 2. Let g be 3/(2 - (2 + -1)). Let z be ((-10)/(-4))/((-1)/2). Give gs(b) + zd(b). -b - 2 Let h(o) be the second derivative of -o*3/6 + 4o. Let f(x) = 2x2 - 7x - 1. Suppose -6t + 4 = -2t. Calculate tf(c) - 6h(c). 2c2 - c - 1 Let d = -14 + 15. Let m(z) = -3z - 3. Let x(b) = -b. What is dm(j) - x(j)? -2j - 3 Suppose 24 = z + 3z. Let i(k) = 2k*3 + 11k - 2. Let m(g) = -3g3 - 6g - 1. Let w(h) = -h*3 - 1. Let y(b) = -m(b) + 2w(b). Calculate zi(r) - 11y(r). r*3 - 1 Let t(g) = -g - 4. Suppose 3f = f + 34. Suppose 5m = 3y - 23, -2y - 2m + f + 9 = 0. Let k(l) = yl - 10l + 5 - 2. Give -4k(v) - 3t(v). -v Let a(i) = i - 1. Let u(k) = k*3 + 9k - 9. Determine 18a(r) - 2u(r). -2r3 Let l(o) = o - 3o - 1 - 8o. Suppose -3g + 3w = -21, 0 = -g - w - 2 - 1. Let h(b) = b. What is gl(y) + 18h(y)? -2y - 2 Let g(l) = -3l + 4 - l + l. Let h(d) = 12d - 15. Give 15g(f) + 4h(f). 3f Let k(u) = u - 1. Let c(i) = -5i + 8. Let a(f) = -5f + 7. Let y(g) = 4a(g) - 3c(g). Let z be ((-4)/(-5))/(4/10). Determine zy(n) + 9k(n). -n - 1 Let k(v) = -13v*2 - 9v - 9. Let z(j) = -3j2 - 2j - 2. Calculate -4k(m) + 18z(m). -2m2 Suppose 0 = 6i - i + 20. Let q(w) = -w + 1. Let d(b) be the third derivative of 0 + 2b2 + 0b + 1/12b4 - 1/6b*3. Give iq(x) - 3d(x). -2x - 1 Suppose -3c + p = -45, -9 + 3 = 2p. Let h(i) = i - 6 + 4i + c. Let t(a) be the third derivative of -3a*4/8 - 5a3/2 - a2. What is -11h(d) - 6t(d)? -d + 2 Let m(g) = -3g2 - 5g - 1. Let q(x) = -x*2 - 1. Calculate m(b) - q(b). -2b*2 - 5b Let o(b) = -b3 + b2 - 1. Let p(c) = 3c3 + 2. Let x be ((-6)/4)/((-21)/28). Suppose 0 = -g - 2 + 3. Give gp(l) + xo(l). l3 + 2l*2 Let q = -22 + 18. Let v(d) = 3d*3 + 4d2 + 4. Let f(w) = -w3 - w*2 - 1. Calculate qf(g) - v(g). g*3 Let i(c) = -5c - 4. Let v(l) = l*3 + 5l*2 + 3l - 3. Let s be v(-3). Let a(h) = 3h - sh - 5 - 4h + h. Calculate 3a(w) - 4i(w). 2w + 1 Let f(g) = -5g3 + 13g*2 + 9g - 9. Suppose i - 3i = 36. Let o(v) = 3v*3 - 3v3 - v3 - 2 + 3v2 + 2v. What is io(z) + 4f(z)? -2z3 - 2z*2 Let m(h) = -14h*2 + 11h + 9. Let x(b) = 5b2 - 4b - 3. Determine -6m(f) - 17x(f). -f*2 + 2f - 3 Let b(m) = m. Let q(f) = -f - 1. What is 6b(w) + q(w)? 5w - 1 Let h(g) = 8g3 - 4g*2 - 2g + 10. Let t(v) = -v*3 - 1. What is h(i) + 10t(i)? -2i3 - 4i*2 - 2i Let v(j) = 4j + 101. Let n(f) = -f. What is -6n(t) - v(t)? 2t - 101 Suppose 5 = -27y + 32y. Let r(o) = o - 1. Let x(g) = 6g - 10. What is yx(k) - 5r(k)? k - 5 Let g(k) = 9k3 + 3k. Let j(n) = 14n3 + 5n. Determine -8g(y) + 5j(y). -2y3 + y Let r(u) = -u2 - 10u - 5. Let o(c) = -c*2 - 9c - 4. Calculate 5o(p) - 4r(p). -p*2 - 5p Let p(r) = 2r + 2. Let c be 2/6 + 72/27. Let y(m) = -m. Determine cy(s) + p(s). -s + 2 Let r(i) = 14i - 2. Let m(d) be the first derivative of d2/2 + 3. Let h be 6/4(-9 + 1). Calculate hm(y) + r(y). 2y - 2 Let r(p) be the second derivative of -p4/3 + p3/6 + 7p2/2 - p. Let k(i) be the third derivative of -i5/60 + i3/6 - i2. Give 6k(d) - r(d). -2d2 - d - 1 Let t(q) = q2 - 5q - 1. Let j be t(6). Let b(f) = -6f - 5. Let m(d) = 5d + 4. Let g(n) = 14n + 11. Let a(s) = 2g(s) - 7m(s). What is jb(w) - 4a(w)? -2w - 1 Let p(q) = 5q + 2. Let n(s) = -19s - 9. What is 2n(f) + 9p(f)? 7f Let a(l) be the first derivative of -2/3l*3 + 0l - 7/24l4 - 1 - l2. Let b(o) be the second derivative of a(o). Let x(v) = 3v + 2. Give 2b(h) + 5x(h). h + 2 Let g(m) = 14m2 + 84m. Let v(q) = 5q2 + 28q. Give 3g(k) - 8v(k). 2k2 + 28k Let v = 13 + -7. Let w(z) = 2 + 5 - v + 16z. Let h(f) = f2 + 6f - 9. Let c be h(-7). Let j(u) = 3u. Give cw(o) + 11j(o). o - 2 Let n(q) = -18q. Let s(i) = -i. Determine -n(y) - s(y). 19y Let c(k) = -k + 9. Let o(h) = -h + 8. Calculate -2c(u) + 3o(u). -u + 6 Let q(k) = -8k*3 + 3k + 3. Let f(o) = -15o3 + 5o + 5. Determine -3f(x) + 5q(x). 5x3 Let m(v) = 27v*2 + 9. Let b(s) = 7s*2 + 2. Calculate 9b(q) - 2m(q). 9q*2 Let w(u) = -2u**	{ "pile_set_name": "DM Mathematics" }
75, 5, -0.4, -4 Sort 4, 105, -3, 0, 609 in increasing order. -3, 0, 4, 105, 609 Sort -2/5, 4, 1950, 0.4 in decreasing order. 1950, 4, 0.4, -2/5 Put -412, -2/5, -4, -18, -0.3 in increasing order. -412, -18, -4, -2/5, -0.3 Sort 1/59, 0.84, -0.1, 0.3 in ascending order. -0.1, 1/59, 0.3, 0.84 Put 18/53, -5, 2/2147, -0.4 in decreasing order. 18/53, 2/2147, -0.4, -5 Sort 0, -10, 7, 10. -10, 0, 7, 10 Put 0.24, 49, -0.01 in ascending order. -0.01, 0.24, 49 Sort -0.07, -0.4, -55, -2/19 in increasing order. -55, -0.4, -2/19, -0.07 Put -0.4, -3, -4, -216, -336 in descending order. -0.4, -3, -4, -216, -336 Put 10730, -4, -1 in ascending order. -4, -1, 10730 Sort 1, 40, -134, 4 in descending order. 40, 4, 1, -134 Sort -2/337, 0.5, 2/5, 198. -2/337, 2/5, 0.5, 198 Put -5, 1/3, 0.04, -0.52 in ascending order. -5, -0.52, 0.04, 1/3 Sort 22.4, 1, -1/11, -4, -0.2. -4, -0.2, -1/11, 1, 22.4 Put -12, -2, -1, -383, 3 in descending order. 3, -1, -2, -12, -383 Sort 2, 8, -222, 0 in increasing order. -222, 0, 2, 8 Sort 922, 2/5, -2/87, 2/9, 5 in descending order. 922, 5, 2/5, 2/9, -2/87 Put -2/55, 3, -1/310, -2 in descending order. 3, -1/310, -2/55, -2 Sort 9152, 4, 5, -4 in ascending order. -4, 4, 5, 9152 Sort 4, -17, 62 in descending order. 62, 4, -17 Sort -117, 6, -96 in increasing order. -117, -96, 6 Sort 1, 0, -1228, 3. -1228, 0, 1, 3 Sort 727, -1, 5, 1, 0 in decreasing order. 727, 5, 1, 0, -1 Sort 1.3, 2.16, -0.2, 0.23, 0.3. -0.2, 0.23, 0.3, 1.3, 2.16 Sort -2989, -44, 5 in increasing order. -2989, -44, 5 Sort 1, 7072, 5. 1, 5, 7072 Put 0.2, 0.168, 2/13, -1 in ascending order. -1, 2/13, 0.168, 0.2 Put -27713, 1, 4/3 in ascending order. -27713, 1, 4/3 Put 2, -4, 102, -6, -1, -8 in descending order. 102, 2, -1, -4, -6, -8 Sort 1/3, -7/3, 1003 in decreasing order. 1003, 1/3, -7/3 Put 41, 116, 3, 11 in decreasing order. 116, 41, 11, 3 Sort 121915, 1, -4, -5 in descending order. 121915, 1, -4, -5 Put -1, 10, -3, 15071, 1 in descending order. 15071, 10, 1, -1, -3 Sort 0, -1004, -424 in decreasing order. 0, -424, -1004 Sort -0.4, -0.05, 97. -0.4, -0.05, 97 Sort -2, 129.2, 6, -2.2, -0.1 in descending order. 129.2, 6, -0.1, -2, -2.2 Sort 0, -13.3, 54 in decreasing order. 54, 0, -13.3 Sort 0, -3, 7, -2, 54, -8. -8, -3, -2, 0, 7, 54 Put -16, 51, 0.6 in decreasing order. 51, 0.6, -16 Sort -4, -2, -3, 1, 12. -4, -3, -2, 1, 12 Put 2/3, 127, -0.07, 2/45 in decreasing order. 127, 2/3, 2/45, -0.07 Sort 1446, 4, -13 in descending order. 1446, 4, -13 Sort 0.0256, 2, 0.4, 11, 8 in descending order. 11, 8, 2, 0.4, 0.0256 Put 10131, -2, 26 in decreasing order. 10131, 26, -2 Sort -5, -0.3, 0, -1, -2/257, 0.3 in descending order. 0.3, 0, -2/257, -0.3, -1, -5 Sort -635, 16, 0, 4. -635, 0, 4, 16 Sort -3, -1, -13, 6, 0, -8 in ascending order. -13, -8, -3, -1, 0, 6 Sort -27, 28, -2, 4 in descending order. 28, 4, -2, -27 Sort -0.2, 98, -2/9, -0.4, 3. -0.4, -2/9, -0.2, 3, 98 Sort -4/3, 338, -0.1, 1337, 0.4 in decreasing order. 1337, 338, 0.4, -0.1, -4/3 Put 2418, 0.4, -3, 15 in ascending order. -3, 0.4, 15, 2418 Sort 49, -28, -757 in increasing order. -757, -28, 49 Sort 0.3, -0.075, 1/38, -4 in ascending order. -4, -0.075, 1/38, 0.3 Put -12045, -1, -3 in decreasing order. -1, -3, -12045 Put -5, -15, 2, 66, -2 in decreasing order. 66, 2, -2, -5, -15 Put -1, 5, 1, 6, 5056 in descending order. 5056, 6, 5, 1, -1 Put -2, 1, 4, 2, 151662 in descending order. 151662, 4, 2, 1, -2 Sort -45, -673, 0. -673, -45, 0 Sort 17/16, -2, -7/2. -7/2, -2, 17/16 Sort -1, -25, 2, 25, -2, -4 in decreasing order. 25, 2, -1, -2, -4, -25 Sort 0.1, 1/2, -2/5, 64/1099. -2/5, 64/1099, 0.1, 1/2 Sort -1, 2.3, -86, 0.4, 0, 13 in ascending order. -86, -1, 0, 0.4, 2.3, 13 Put 11, 3, -4, -7, 2, -5 in ascending order. -7, -5, -4, 2, 3, 11 Put 6, -2, -4, -5, -7, 0 in decreasing order. 6, 0, -2, -4, -5, -7 Sort 5, 3, -3, 1, 22 in ascending order. -3, 1, 3, 5, 22 Sort 6, -153, -15 in increasing order. -153, -15, 6 Sort -0.02, -14, 1/12, -5 in descending order. 1/12, -0.02, -5, -14 Sort -5, 4, 0.01644. -5, 0.01644, 4 Sort -1, -4, 4, 2, 2125 in increasing order. -4, -1, 2, 4, 2125 Sort 2, -54, 4, -20, 110 in descending order. 110, 4, 2, -20, -54 Put 2885, -123, -1 in decreasing order. 2885, -1, -123 Sort 121, -2/11, 0.4, 0, -4.739 in descending order. 121, 0.4, 0, -2/11, -4.739 Sort -1, -390, 33 in descending order. 33, -1, -390 Put -26/5, 1, 0, -2 in descending order. 1, 0, -2, -26/5 Sort 3, -2, -5, 184, -33 in ascending order. -33, -5, -2, 3, 184 Sort 5/4, 2, 2/17, 7098, 27, -5 in decreasing order. 7098, 27, 2, 5/4, 2/17, -5 Sort 5, 13, -0.11, 4, 2, -4 in decreasing order. 13, 5, 4, 2, -0.11, -4 Sort -43, -11, 2, 1, 3 in ascending order. -43, -11, 1, 2, 3 Sort 2, 0.4, 761, 3, -1/8. -1/8, 0.4, 2, 3, 761 Sort -67, -1, 2, 3, -5, -7 in descending order. 3, 2, -1, -5, -7, -67 Put -0.4, -2, -1.3 in descending order. -0.4, -1.3, -2 Put -1584, -1, 7 in decreasing order. 7, -1, -1584 Sort 26, -3, -2, 9, 4 in decreasing order. 26, 9, 4, -2, -3 Sort 1, -6.9, 132.2, 2/5, 0.5, 3. -6.9, 2/5, 0.5, 1, 3, 132.2 Sort 1, -90, 0, -2, 7 in increasing order. -90, -2, 0, 1, 7 Put -9/2, -0.067, -0.2, 3/7, 0.3 in decreasing order. 3/7, 0.3, -0.067, -0.2, -9/2 Sort 23.9, 0.2, -1 in increasing order. -1, 0.2, 23.9 Sort -1, -0.2, -2/3, 1/8, 3741 in decreasing order. 3741, 1/8, -0.2, -2/3, -1 Sort 5, -1, -3, 0, -181 in descending order. 5, 0, -1, -3, -181 Put -3/8, 0.223, 0.4, -0.15, -3/4 in descending order. 0.4, 0.223, -0.15, -3/8, -3/4 Put -5, 105, 222 in ascending order. -5, 105, 222 Sort 3, 4, 599, 21 in decreasing order. 599, 21, 4, 3 Put -2/13, -178, 4, -4, 2/7 in decreasing order. 4, 2/7, -2/13, -4, -178 Put 2545, 2, 25 in descending order. 2545, 25, 2 Sort 0, -5, -3, 35 in increasing order. -5, -3, 0, 35 Put 4/5, -4, 2, 6, -2, -6 in decreasing order. 6, 2, 4/5, -2, -4, -6 Sort 0.11, -34, 2/7, -595, 3 in ascending order. -595, -34, 0.11, 2/7, 3 Sort -10, 4, 7, -1, -6. -10, -6, -1, 4, 7 Sort 1.9, -16, 17 in increasing order. -16, 1.9, 17 Put 142, 4, 30, -5 in increasing order. -5, 4, 30, 142 Put 1, 4, -4, -1, -2, 0 in decreasing order. 4, 1, 0, -1, -2, -4 Put -7, 0.4, -2/9, -0.5, 868 in decreasing order. 868, 0.4, -2/9, -0.5, -7 Sort 9, 346, -41, -1. -41, -1, 9, 346 Put -2, 2, -128461 in ascending order. -128461, -2, 2 Sort 0.1, -6, 100 in descending order. 100, 0.1, -6 Sort -83, -2/11, -132. -132, -83, -2/11 Sort -67, 0, -1, -2 in decreasing order. 0, -1, -2, -67 Put 6, -1199.6, 3 in decreasing order. 6, 3, -1199.6 Put -5, 6, 10, -1, 2 in descending order. 10, 6, 2, -1, -5 Put 4, -15, -3, 30 in ascending order. -15, -3, 4, 30 Sort 0, 19, 4, 1340. 0, 4, 19, 1340 Sort -6, -0.4, 6, 2, 0.3, -3. -6, -3, -0.4, 0.3, 2, 6 Sort 6, 24, -4, 13 in descending order. 24, 13, 6, -4 Sort -2, 27, -4, 1407, -3, 5 in ascending order. -4, -3, -2, 5, 27, 1407 Sort -2, 73, 2, -3, 0, -5 in descending order. 73, 2, 0, -2, -3, -5 Sort -403, 0.4, 0.1, 18.58 in descending order. 18.58, 0.4, 0.1, -403 Put -4/3, -0.2, 0.2, 1/29, 6, 0.01 in decreasing order. 6, 0.2, 1/29, 0.01, -0.2, -4/3 Sort 2/3, -42, 0.039. -42, 0.039, 2/3 Sort 4, -8, -5, 1499. -8, -5, 4, 1499 Sort -4, -14, -102, -6, 4, -3 in decreasing order. 4, -3, -4, -6, -14, -102 Put 1, 27, 0.1, 2/7, -1/102, 5 in ascending order. -1/102, 0.1, 2/7, 1, 5, 27 Sort 7/5, -1/5, -11, 1/5, -4/5 in ascending order. -11, -4/5, -1/5, 1/5, 7/5 Sort 4, 19, -1, 3, -42 in decreasing order. 19, 4, 3, -1, -42 Put -2, 16, 1692 in ascending order. -2, 16, 1692 Sort -1/7, 24, 3/7, 1/2 in ascending order. -1/7, 3/7, 1/2, 24 Sort 1, 26, -156, -3 in decreasing order. 26, 1, -3, -156 Sort -6273, 1, 4, 10. -6273, 1, 4, 10 Sort -21, -5, 9063, -2 in decreasing order. 9063, -2, -5, -21 Sort 2, -66, -2169. -2169, -66, 2 Put 9916, -1/13, -1 in ascending order. -1, -1/13, 9916 Sort 3, -2, -5, 2, 4, -60 in descending order. 4, 3, 2, -2, -5, -60 Sort -4, 1043, 17 in decreasing order. 1043, 17, -4 Put 3, -3, 4, -871 in decreasing order. 4, 3, -3, -871 Sort 12, -0.2, -26/7, -58. -58, -26/7, -0.2, 12 Sort -106.5, -4/5, 1/4, -1.63 in decreasing order. 1/4, -4/5, -1.63, -106.5 Sort 0.4, -0.3, -0.6, 0, 60, -2/7. -0.6, -0.3, -2/7, 0, 0.4, 60 Sort 4, -2, -18643 in increasing order. -18643, -2, 4 Put -1764, 18, 3 in descending order. 18, 3, -1764 Sort -6, 2, 361	{ "pile_set_name": "DM Mathematics" }
prime factors of q. 7, 29 Suppose 2m = -2i + 21100, -3m + 9516 = 4i - 32679. What are the prime factors of i? 3, 5, 19, 37 Suppose 2r - 14 = -f, -11r = -3f - 6r - 13. List the prime factors of (4 - 6)/(f/(-302)). 151 Let i = 44 + -53. Let r = -7 - i. Suppose -4h = -f + 47, 0f + h - 130 = -rf. List the prime factors of f. 3, 7 Suppose 5x = -3f + 19, 3 = 4x + 3f - 11. Suppose 3l = l + xv + 1730, -5l + 4v = -4291. List the prime factors of l. 3, 5, 19 Suppose 88021 + 340094 = -595t + 610t. What are the prime factors of t? 28541 Let n(q) = -q3 - q2 - 71q + 244. List the prime factors of n(-32). 2, 3, 5, 571 Let f(g) = -31g + 44. Let s = 250 + -256. List the prime factors of f(s). 2, 5, 23 Let m(g) = 101g - 5405. List the prime factors of m(70). 3, 5, 37 Let q = 109 + -89. Suppose 6v - qv = -1260. What are the prime factors of v? 2, 3, 5 Let c(m) = -2489m3 - 2m*2 - 73m - 142. What are the prime factors of c(-2)? 2, 3, 7, 79 Let b(l) = -13l - 18. Let a be b(-3). Let z be (a/6)/7412. Let k = -119 + z. What are the prime factors of k? 3, 29 Let y = 268 + -273. Let x(g) = -3g2 - 22g. List the prime factors of x(y). 5, 7 Suppose u - 84 = -u. Let s = -39 + u. Suppose sk + 16 = 4k. What are the prime factors of k? 2 Let a = 47 - 49. Let f be -14390 + 16/(-7 + 3). List the prime factors of f/(-52) + a/4. 2, 3, 7 Let u(p) = 6p*2 - 54p + 33. What are the prime factors of u(-11)? 3, 11, 41 Let r(p) = p*3 - 16p*2 + 26p + 17. Let n = 20 - 5. Let g be r(n). Suppose -5y + 3y + g = 0. What are the prime factors of y? 7, 13 Suppose 5k - 2160 = -21j + 19j, -2j = 2k - 858. Let m = k + 100. What are the prime factors of m? 2, 3, 89 Suppose -2w - 836g + 838g + 14614 = 0, 0 = 2w - g - 14618. What are the prime factors of w? 3, 2437 Let h be (3/4)/((-10)/(-120)). Let l(n) = -53 - n + hn + 2n. What are the prime factors of l(6)? 7 Let j(i) = 7 - 6 - 22 + 5i. Let w be j(5). Suppose 10 = -2v - 0v, v = wn - 385. What are the prime factors of n? 5, 19 What are the prime factors of -14272/(-357)(74250/(-8))/(-5)? 2, 3, 5, 11 Let n be -48((-4)/22 - (-39)/33). Suppose 5s + 5f = 55, 2s - f - f = 18. Let h = s - n. What are the prime factors of h? 2, 29 Let w(l) = -35l*3 - 2l*2 + 34l + 82. What are the prime factors of w(-3)? 907 Let y = -368 - -1478. Suppose 3d - 2x - y = 0, 2d + 3x + 0x = 753. List the prime factors of d. 2, 3, 31 Suppose -2q = 5j - 10, 0 = -2q + 3j - 6. Let r be 2/2-1q. Suppose 2a + 32 + 23 = 5k, r = 3a - 15. List the prime factors of k. 13 Suppose -20840 + 170202 = 23h. List the prime factors of h. 2, 17, 191 Let n = -13523 - -19466. What are the prime factors of n? 3, 7, 283 Suppose -r = -4j - 13433, -5j = 39 - 34. List the prime factors of r. 13, 1033 Let y = 231 - 227. Suppose yk = k + 2454. What are the prime factors of k? 2, 409 Let m(z) = -520z - 1592. What are the prime factors of m(-64)? 2, 17, 233 Let z(v) = -v3 - 12v*2 + 2v - 5. Let k be z(-9). Let w be 3/(2/49/(-21)). List the prime factors of k/w14. 2, 19 Let x(a) be the first derivative of -a4/4 - a3/3 + a2 + 7a + 64. What are the prime factors of x(-2)? 7 Suppose -5d + 10 = -0. Let n(h) = -h3 - 16 + 89h*d - 20h + 93h2 - 192h2. What are the prime factors of n(-10)? 2, 23 Let u(c) be the second derivative of c5/20 + 5c4/6 + 13c*3/6 + 11c*2 + 8c. Let l be u(-9). List the prime factors of l/(-21)474/4. 79 Let y be (8/((-32)/(-6)))/((-6)/(-556)). Suppose 1693 = 2t + y. Suppose t = 4r + 181. What are the prime factors of r? 149 Suppose -41x = -31x - 1220. Suppose -f = -253 - x. What are the prime factors of f? 3, 5 Suppose 5p + 714 = -5h - 481, -2p = -h - 242. Let y = h + 344. What are the prime factors of y? 2, 13 Let x(b) = -32b - 16 - 45b + 91b - 37b. List the prime factors of x(-30). 2, 337 Suppose -12 = -2f - 4o, 4f + 0 = 3o + 2. Suppose -320 = g - 3g + fk, -4g + 638 = -5k. Suppose 9w = 10w - g. What are the prime factors of w? 2, 3 Let m(r) = -33r + 56. Let s be (-2)/10-4 - (-6216)/(-370). What are the prime factors of m(s)? 2, 73 Let r = 294 - 162. Let q = r + -124. What are the prime factors of q? 2 Let v(s) = 94s3 - 6s*2 - 5s + 7. Let d be v(3). Suppose -1460 = -3r + d. List the prime factors of r. 2, 41 Suppose 5p - 4o = 44, -8o = p - 11o. Suppose 2y = -py + 16156. List the prime factors of y. 2, 577 Suppose 4w - 13 + 967 = 3g, 4g + 8w = 1192. What are the prime factors of g? 2, 5, 31 Let q = -2354 + 13060. List the prime factors of q. 2, 53, 101 Suppose -254 = 8y + 258. Let d = y - -104. What are the prime factors of d? 2, 5 Suppose 5w = 5d + 55, 0w - 5d = -w + 7. Let n(h) = 2 + 1 + 13h + 4 - w. What are the prime factors of n(12)? 151 Suppose -11y = -10y - 4b - 5104, 5y = 3b + 25384. List the prime factors of y. 2, 317 Suppose -2t - 33950 = -k, -2k + 2t + 27824 + 40076 = 0. List the prime factors of k. 2, 5, 7, 97 Let u(h) = h2 + 7h - 37. Suppose -2d = -0 - 10. Let y be -15-5((-16)/d + 3). List the prime factors of u(y). 83 Suppose 3t - 9t = 13t. Suppose -17j - 3510 = -21j + 2m, -4j - 4m + 3504 = t. What are the prime factors of j? 877 Let f(s) = s3 + 9s*2 + 3s - 5. Let c = -6 - 2. Let b be f(c). Suppose 2p = x - 2p + 1, x = -5p + b. List the prime factors of x. 3, 5 Let z(y) be the first derivative of y2/2 - y + 26. Let h be z(3). Suppose 11i = hi + 2250. List the prime factors of i. 2, 5 Suppose -3z + 2q = 8, -2z + 3q - 5q = -8. Suppose -7g + 588 = -3g. Suppose z = -5j + 23 + g. List the prime factors of j. 2, 17 Let q(u) = -4u - 15. Let m be q(-5). Suppose 0 = mk + 4n + 1701, -3k - 1031 = -0k + 5n. Let x = -202 - k. List the prime factors of x. 3, 5 Let p = 99 - -43. Let t = -130 + p. Suppose -5s - 4q = -167, -ts + 2q + 144 = -8s. What are the prime factors of s? 5, 7 Let l(n) = 2n3 - 7n*2 - 8n. Let o be l(6). Let j(c) = 5c2 + 148c + 353. Let u be j(-27). Suppose -ug + 50 = -o. List the prime factors of g. 7, 13 Let p(b) = 131 - 33b - 26b - b3 + b2 + 58b. What are the prime factors of p(0)? 131 Let w = 10586 + -3700. What are the prime factors of w? 2, 11, 313 Let q(i) = 68i - 272. Suppose 5b + 3u - 126 = 0, -2b - 3u = -2u - 50. List the prime factors of q(b). 2, 5, 17 Let n be 3(4 - (-7)/(-3)). Suppose -ns - k = -0s - 825, -3s + k + 503 = 0. Suppose 3l - s = -5f, -3l = -3f - 221 + 47. List the prime factors of l. 3, 19 Let l(z) = 280z - 1105. List the prime factors of l(14). 5, 563 Let q be 1748/(-23)2/(-4). Suppose 0 = 12l - ql + 2704. List the prime factors of l. 2, 13 Let x be (-14)/84 - 10009(-2)/12. Suppose 0 = -27w + 33w - x. What are the prime factors of w? 2, 139 Let m = 127 + -124. Suppose 2c - mv - 8 = 0, 9 = c + 5v - 4v. Let w(s) = 6s*2 - 6s + 18. List the prime factors of w(c). 2, 3, 5 Let l(x) = -4x2 + 2x - 8. Let d be l(-2). List the prime factors of -216(77/d - -1). 2, 3, 7 Let n(z) = 82z*2 + 13z - 210. List the prime factors of n(7). 7, 557 Suppose 5k - 28 = -3. Let i(a) = 2a*3 - 8a*2 + 5a - 10. Let n be i(k). Suppose -p + b + n = 0, -2p + b - 29 + 158 = 0. What are the prime factors of p? 2 Let s = 8105 + 1838. List the prime factors of s. 61, 163 Suppose 102724 = 4r - 32k + 7k, -5k = -2r + 51332. What are the prime factors of r? 2, 3, 1069 Suppose -y - 4 = -5o + 27, o - 4y = 10. Let k(z) = -9z + 10. Let t be k(o). Let s = 79 + t. List the prime factors of s. 5, 7 Let f(w) = -16w - 8. Let j be f(-4). Let l = j - 54. Let t(v) = 22v2 - 6v + 3. List the prime factors of t(l). 79 Suppose -w = -8w - 56. Let f be (-2)/12148/w. Suppose 3x = f + 234. What are the prime factors of x? 257 Let u(q) = 29q + 290. Let k be u(-10). Suppose c - 3y + 12 = k, 15c + 4y - 23 = 14c. List the prime factors of c. 3 Let c = 16141 - 9199. What are the prime factors of c? 2, 3, 13, 89 Let c(o) = -5o2 + 3o*3 - 4o*3 + 11 + 0o + 4o + 3o. Let a be c(-6). List the prime factors of 1/a - 164/(-5). 3, 11 Let t = 330 - 164. Let b = t - 157. What are the prime factors of b? 3 Let s = 384 - -151. Let a = 342 + s. What are the prime factors of a? 877 Suppose 3*u = -u + 152. Suppo	{ "pile_set_name": "DM Mathematics" }
terms in -t + 7t + 3t + 0t. 9t Collect the terms in -2j + 242451 - 242451 + 0j. -2j Collect the terms in 31h - 51h + 11h. -9h Collect the terms in 2 - 2 + 3o*2 + 12o*2. 15o2 Collect the terms in -k3 - 10k3 + 16k*3 - 12k*3. -7k*3 Collect the terms in 2t + 0t - 4t + 627. -2t + 627 Collect the terms in -2j - 28j3 - 268j*3 + 0j + 3j. -296j*3 + j Collect the terms in 2u + 6u + 0u - 3u - 12. 5u - 12 Collect the terms in -11c3 + 10c*2 + 5c*3 - 10c*2. -6c*3 Collect the terms in 175m*3 + 178m*3 - 92m*3 - 18m*3. 243m*3 Collect the terms in 19945 + 13a*2 - 19945. 13a*2 Collect the terms in h - 888 - 5h + 888. -4h Collect the terms in -3v*3 - 1303356 + 1303356. -3v*3 Collect the terms in 138 - 14 - 41 - 2b*2. -2b*2 + 83 Collect the terms in 47h - 11h - 17h - 21h. -2h Collect the terms in 16n2 + 30n*2 - 35n*2. 11n*2 Collect the terms in -3o - 23 - 3o + 6o + o3. o3 - 23 Collect the terms in -4s + 4s + 804s3 - 807s*3. -3s*3 Collect the terms in 45h*2 + 42h*2 - 81h*2. 6h*2 Collect the terms in -6k*2 + 11k*2 - 4k*2 - 3k*2. -2k*2 Collect the terms in -4o - 63 + 125 - 62. -4o Collect the terms in -21n*3 + 10n*3 + 15n*3 + 5n*3 + 4n*3. 13n*3 Collect the terms in -w - 7w + 88 + 18w - 3w. 7w + 88 Collect the terms in 0n + 0n + 6n*2 - 2n*2. 4n*2 Collect the terms in -42x - 2x2 + 42x. -2x2 Collect the terms in 7 - 1 - 6 - 14a. -14a Collect the terms in -25f*2 + 7f*2 + 7f*2 + 5f*2. -6f*2 Collect the terms in -75g - 2 + 2 + 40g + 28g. -7g Collect the terms in -j + 16j - 5j - 9j. j Collect the terms in -3 - 42372b + 42362b + 3. -10b Collect the terms in -6h*3 - 13h*3 - 17h*3 - 4h*3. -40h*3 Collect the terms in -170i*2 - 242i*2 + 403i*2. -9i*2 Collect the terms in -2c*2 + 0c*2 + 30c - 30c. -2c*2 Collect the terms in -17k + 17k - 41k2 - k3. -k*3 - 41k*2 Collect the terms in 13c*3 - 6 + 6. 13c*3 Collect the terms in 9d*3 - 16d*3 + 10d*3. 3d*3 Collect the terms in 408g*2 - 203g*2 - 204g2. g2 Collect the terms in -38u2 + 13u*2 + 10u*2 + 14u2. -u2 Collect the terms in -46 + 144 - 51 - 7v - 47. -7v Collect the terms in -v + v - 130v2 + 138v*2. 8v*2 Collect the terms in 5 + i + 2i + 4 - 1. 3i + 8 Collect the terms in 82439 - 82439 - 5w*2. -5w2 Collect the terms in 643 + g3 - 643. g*3 Collect the terms in 17o + 21o3 - 17o. 21o3 Collect the terms in 2m*2 + 7 + 30 + 28 - 65. 2m*2 Collect the terms in 8v + 4v - 112 - 2v + 112. 10v Collect the terms in 304j*3 + 51j*3 + 41j*3. 396j*3 Collect the terms in 21t*3 + 13t*3 + 0t*3 - 5t*3. 29t*3 Collect the terms in -4v*2 - 8v2 + v2. -11v2 Collect the terms in -5f*3 - 3f*3 + 6f*3 + 0f*3. -2f*3 Collect the terms in -1507s*2 + 129s*3 + 1507s*2. 129s*3 Collect the terms in -1853o*3 + 2o - 2o + 1851o*3. -2o3 Collect the terms in -6 + 7 - h3 - 1. -h*3 Collect the terms in -3v*3 - 2v*3 + 9v*3. 4v*3 Collect the terms in -6g - 7 + 7 + g + g. -4g Collect the terms in -67v + 214v + 91v. 238v Collect the terms in -25p - 26p - 31p. -82p Collect the terms in -6n - 4n + n + 2n. -7n Collect the terms in 6v + 4v + 4v - 16v. -2v Collect the terms in -i - 3299i2 + 5i + 3302i2 - 4i. 3i2 Collect the terms in -5y2 - y2 + 5y2 + y2 - 2y*2. -2y*2 Collect the terms in -10k*2 + 5k*2 + 6k2. k2 Collect the terms in -37t + 70t - 34t. -t Collect the terms in -3m + 870 - 870. -3m Collect the terms in 14t*3 - 4t*2 + 5t*3 - 4t*2 + 0t*2. 19t*3 - 8t*2 Collect the terms in 66g - 7g2 - 2 - 66g. -7g2 - 2 Collect the terms in -52y + 14 - 14. -52y Collect the terms in -15 + 17z - 17 + 31. 17z - 1 Collect the terms in 30 + 2o*2 - 5 - 58 + 33. 2o*2 Collect the terms in 8u*2 - 4u*2 + 0u*2 - 6u*2. -2u*2 Collect the terms in -82u + 6 - 6. -82u Collect the terms in 1532o + 1531o - 44o*2 - 3063o. -44o2 Collect the terms in -6 + 11o*3 + 9 - 3. 11o*3 Collect the terms in -2 - 5 - 1 - 8o + 1. -8o - 7 Collect the terms in 8t*3 - 5t*3 + 85t*2 - 78t*2. 3t*3 + 7t*2 Collect the terms in -24233 + 24233 + q + 0q. q Collect the terms in 0s2 - 4s*2 + 6s*2. 2s*2 Collect the terms in 9g*2 - 41g*2 - 29g*2 + 0 - 2. -61g*2 - 2 Collect the terms in 2s*3 - 12s*3 - 3s*3. -13s*3 Collect the terms in 1437 + 1429 + 0r*2 - 2r*2 - 2866. -2r*2 Collect the terms in 0w + 35w3 + 0w. 35w3 Collect the terms in -8z3 + z3 + 4z3 + 4z3 + z3. 2z3 Collect the terms in -43i*2 + 43i*2 - 9 + 3i*3. 3i*3 - 9 Collect the terms in 7o*2 - 3o*2 + 4o*2 - 3o*2. 5o*2 Collect the terms in 6f - 26f3 - f - 5f. -26f3 Collect the terms in 60r*3 + 59r*3 - 155r*3 + 45r*3. 9r*3 Collect the terms in -1 + 24w + 31 + 3 + 3w. 27w + 33 Collect the terms in -21v - 7 - 10 + 13v. -8v - 17 Collect the terms in -4p + p - 2p + 2p. -3p Collect the terms in 24w - 55w + 27w. -4w Collect the terms in -2 + 2h*2 - 27h*2 + 0h*2 - 10h*2. -35h*2 - 2 Collect the terms in 3 - 10 - 6p + 7. -6p Collect the terms in -30459d + 30459d + 14d*2. 14d*2 Collect the terms in -10k*2 - 8k*2 - 15k*2 + 31k*2. -2k*2 Collect the terms in -1783v - 1783v + 3563v. -3v Collect the terms in -2 + 0 - 4s*3 + 2. -4s*3 Collect the terms in -5x + 1 - 1 + 2x. -3x Collect the terms in m - 3m - 16m*3 - 3m + 19m3. 3m*3 - 5m Collect the terms in -199 + 98 + 17d + 101. 17d Collect the terms in -4a + 264680 - 264680. -4a Collect the terms in 277n - 194n + 278n. 361n Collect the terms in 224k - 63 + 63. 224k Collect the terms in -17g - 23g + 87g - 22g - 26g. -g Collect the terms in -11326 + 11326 - 2k - 4k. -6k Collect the terms in -176k3 - 19k + 19k + 178k*3. 2k*3 Collect the terms in 2t + 11t - 15t. -2t Collect the terms in 24q*2 - 14q*2 - 17q*2. -7q*2 Collect the terms in -21n + 4 + 41n - 4. 20n Collect the terms in -126g - 6g*2 + 2g*2 + 118g. -4g2 - 8g Collect the terms in 7l2 + 5l*2 - 3l*2 + 0l*2. 9l*2 Collect the terms in -2016 + 2016 - 3u. -3u Collect the terms in 20m - 8m - 3m - 4m - 6m. -m Collect the terms in -38 + 4a - 34 + 72. 4a Collect the terms in -45 + 115 - 52 + 3g - 18. 3g Collect the terms in -4h2 - 5h*2 - 5h*2 + 34h*2. 20h2 Collect the terms in -u3 - 88277u2 + 88277u2. -u3 Collect the terms in -3u - 3 + 3u + 3u - 2u. u - 3 Collect the terms in 7 + 1 - w3 - 8. -w3 Collect the terms in 11i2 - 2i - 10i2 + 30i*2. 31i*2 - 2i Collect the terms in 1 + 3 - 545n - 4. -545n Collect the terms in -1478 + 1478 + 3i2. 3i*2 Collect the terms in 85k*3 - 84k*3 + 2k - 2k. k3 Collect the terms in 16b*3 + 16 - 35b*3 - 18. -19b*3 - 2 Collect the terms in -6 + 17 + 6 - 11o. -11o + 17 Collect the terms in -v2 + 0v2 + 20 + 10 - 10. -v2 + 20 Collect the terms in 0 + 2 - 14o2 + 0 - 30o*2. -44o*2 + 2 Collect the terms in -118t + 159t - 72t. -31t Collect the terms in -3f*2 + 2964 - 2964. -3f*2 Collect the terms in 209c - 419c + 212c. 2c Collect the terms in -1155y*2 - 1177y*2 + 2330y*2. -2y*2 Collect the terms in 9r*2 - 8r*2 + 2r*2 - 2r*2 - 3r*2. -2r*2 Collect the terms in -234x*3 + 250x*3 - 151x*3. -135x*3 Collect the terms in -14f + 29f - 18f*2 - 15f. -18f2 Collect the terms in 42s*3 - 5 - 20s*3 + 2. 22s*3 - 3 Collect the terms in -89 + 41 + 47 + 7a. 7a - 1 Collect the terms in -84w + 39w + 47w. 2w Collect the terms in 339800034 - 339800034 + b2. b2 Collect the terms in 3o*2 - 5o*3 - 7o2 - o2. -5o3 - 5o*2 Collect the terms in -116s*2 - 108s*2 + 225s2. s2 Collect the terms in 4 - 5 + 4 - 7 - 233u3. -233u*3 - 4 Collect the terms in 926o - 1854o + 929o. o Collect the terms in 31a3 - a + a - 6a*3. 25a*3 Collect the terms in 5a - 5a + 9a*2. 9a*2 Collect the terms in -27s + 8s + 20s + 14s. 15s Collect the terms in 62*g	{ "pile_set_name": "DM Mathematics" }
a(h) = -h*3 - 11h*2 - 14h - 2. Determine a(-10). 38 Let l(f) = -f*2 + 10f + 4. Calculate l(8). 20 Let j(r) = 49r + 838. Determine j(-17). 5 Let c(k) = k3 + 4k*2 - 9k - 3. What is c(-7)? -87 Let h(q) = 5q2 - 6. Give h(4). 74 Let v(u) = -u3 + 13u*2 + 4u - 40. Calculate v(13). 12 Let l(q) = 2q2 + 6q - 6. What is l(-6)? 30 Let z(h) = -h*2 + 13h - 2. Calculate z(13). -2 Let h(t) = -t + 25. Determine h(19). 6 Let t(s) = s*3 + 6s*2 - 4s + 9. What is t(-7)? -12 Let f(r) = -3r + 5. What is f(3)? -4 Let i(d) = -d3 + 25d*2 + 49d - 6. What is i(-2)? 4 Let b(k) = -2k + 9. Determine b(0). 9 Let j(q) = q2 - 20q - 306. Determine j(-10). -6 Let y(u) = 3u2 - 15u. Calculate y(5). 0 Let t(n) = -13n + 8. What is t(4)? -44 Let b(d) = -3d*2 + 14d + 3. What is b(6)? -21 Let v(t) = -t*3 + 5t*2 - t + 5. Calculate v(5). 0 Let y(b) = 10b - 26. Determine y(7). 44 Let r(j) = -j*2 - 6j + 4. Determine r(-4). 12 Let b(g) = 2g3 + 21g*2 + 51g - 1. Give b(-6). 17 Let a(d) = 7d + 18. Give a(4). 46 Let m(q) = -4q + 1. Give m(-6). 25 Let m(q) = -q*3 - 9q2 - 2. What is m(-9)? -2 Let b(a) = -a3 + a*2 + a - 18. What is b(0)? -18 Let c(m) = -11m - 25. Calculate c(9). -124 Let l(d) = -4d + 4. Determine l(5). -16 Let h(m) = m3 + 13m*2 + 11m - 12. Determine h(-12). 0 Let n(t) = 27t - 30. Calculate n(4). 78 Let q(v) = -v3 + 5v*2 + 7v - 6. Determine q(5). 29 Let i(t) = t - 47. What is i(16)? -31 Let x(g) = -2g2 - g + 3. Determine x(-4). -25 Let v(r) = 3r + 18. What is v(-10)? -12 Let j(y) = -2y2 - 12y + 20. Determine j(-8). -12 Let v(u) = u*3 - 29u*2 - 62u + 4. Give v(31). 4 Let q(v) = 8v + 128. Give q(-17). -8 Let s(h) = h3 + 6h*2 + 5h + 43. What is s(-7)? -41 Let a(d) = d*3 + 3d*2 - 2d - 6. Determine a(-4). -14 Let s(k) = -k*3 - 6k*2 + 17k + 2. Give s(-8). -6 Let i(s) = s*2 - 4s + 6. What is i(4)? 6 Let t(n) = -2n3 + 36n*2 - 34n + 19. What is t(17)? 19 Let n(q) = q*3 - 13q*2 + 24q - 28. Determine n(11). -6 Let l(q) = 5q + 15. What is l(7)? 50 Let p(t) = -3t*3 + 36t*2 - 3t + 26. Give p(12). -10 Let v(j) = -2j3 - 37j*2 + 22j + 55. Determine v(-19). -2 Let m(o) = -o*2 - 2o + 3. Give m(-3). 0 Let x(d) = 80d - 314. Calculate x(4). 6 Let v(n) = -2n*2 - 25n + 18. Calculate v(-13). 5 Let h(y) = 8y2 - 4y + 3. Give h(2). 27 Let i(l) = l + 20. Give i(13). 33 Let o(p) = p*3 + 2p2 + p + 16. Calculate o(0). 16 Let h(u) = u3 - 3u2 - 9u - 5. What is h(5)? 0 Let g(x) = 7x - 78. Determine g(12). 6 Let c(j) = -2j + 13. Give c(8). -3 Let o(c) = -c - 15. Calculate o(-6). -9 Let a(y) = -y3 + y2 + 1. What is a(-3)? 37 Let v(s) = s*3 - 16s*2 - 3s + 13. What is v(16)? -35 Let g(z) = z*2 + 2z - 43. What is g(0)? -43 Let j(d) = 3d2 - 3d - 9. Give j(5). 51 Let i(z) = 6z2 - 54z - 41. Give i(10). 19 Let m(p) = 6p - 1. Give m(5). 29 Let w(y) = -5y - 30. Determine w(-7). 5 Let t(x) = 92x - 1475. Give t(16). -3 Let g(x) = x3 + 6x*2 - 9x - 2. Calculate g(-7). 12 Let i(y) = -y*2 - 11y + 50. Determine i(-14). 8 Let u(h) = -7h2 + 2h. What is u(1)? -5 Let u(x) = -x*3 - 23x*2 - x - 22. Determine u(-23). 1 Let k(i) = 7i*3 + 3i*2 - 2i - 1. Calculate k(1). 7 Let h(m) = -2m3 + 13m*2 - 8m + 1. Calculate h(6). -11 Let y(h) = 2h2 + 27h + 8. What is y(-13)? -5 Let n(j) = 4j2 + 5j - 3. What is n(1)? 6 Let p(d) = d*2 + 14d + 42. Give p(-9). -3 Let t(q) = -q*2 + 4q. Give t(7). -21 Let u(p) = p*2 - 11p - 29. Calculate u(14). 13 Let v(c) = c*2 - 4c + 9. What is v(3)? 6 Let g(h) = -h*3 + 5h*2 - 6h + 3. Calculate g(5). -27 Let s(l) = -11l + 183. Calculate s(17). -4 Let b(v) = -3v*2 - 6v + 4. What is b(-3)? -5 Let r(t) = -t*2 - 9t + 28. Calculate r(8). -108 Let l(d) = d*3 - 8d*2 - 3d + 4. What is l(8)? -20 Let b(q) = -2q3 - 88q*2 - 87q - 51. Give b(-43). -8 Let m(f) = 4f2 - 2f - 3. What is m(3)? 27 Let j(h) = h*3 + 7h*2 + h - 23. Determine j(-6). 7 Let w(b) = 27b*3 - 2b*2 - 4b - 2. What is w(-1)? -27 Let b(m) = m*2 - 5m - 16. Give b(11). 50 Let i(s) = 2s + 19. What is i(19)? 57 Let y(v) = v2 - 7v - 4. Calculate y(7). -4 Let m(q) = -16q + 7. Give m(1). -9 Let h(u) = 16u3 - u2 - 3u - 1. Give h(-1). -15 Let n(i) = i3 + 2i*2 - 10i - 6. Give n(-4). 2 Let j(t) = -t*3 - 12t*2 + 10t - 45. Determine j(-13). -6 Let j(t) = t*2 - 1. Determine j(-5). 24 Let d(w) = -5w + 10. Determine d(5). -15 Let q(l) = -l*2 + 24l + 48. Determine q(26). -4 Let v(f) = -2f2 - 13f + 25. Calculate v(-8). 1 Let n(j) = -2j3 - j2 + j - 3. What is n(2)? -21 Let q(x) = x3 + 9x*2 + 3x - 19. Give q(-9). -46 Let q(f) = -2f3 + 21f*2 - 5f - 5. Calculate q(10). 45 Let q(f) = 9f + 23. What is q(-7)? -40 Let c(p) = -p2 + p + 3. Give c(5). -17 Let b(w) = w3 - w + 6. Calculate b(0). 6 Let v(d) = -8d - 21. What is v(10)? -101 Let c(d) = -16d3 + 2d2 - d - 3. Determine c(2). -125 Let k(l) = -l3 + 21l2 + l - 20. Determine k(21). 1 Let j(h) = h - 15. Give j(-16). -31 Let p(y) = -4y*2 + 3y - 3. Calculate p(2). -13 Let o(q) = -2q2 - 9q. What is o(-4)? 4 Let v(c) = 5c + 67. Calculate v(-10). 17 Let c(x) = -2x - 12. Determine c(-5). -2 Let q(f) = -4f - 2. Give q(-3). 10 Let c(z) = 3z*2 - 3z - 1. Calculate c(-1). 5 Let f(g) = -2g + 23. What is f(8)? 7 Let r(x) = -x2 + 10x. Calculate r(4). 24 Let x(l) = -l*3 - 9l*2 + 3l + 12. Give x(-9). -15 Let v(f) = -52f3 - f2 - 5f - 4. What is v(-1)? 52 Let u(x) = -x*3 - 3x*2 + 5x + 6. What is u(-5)? 31 Let j(h) = 2h3 - 5h*2 - 5. Calculate j(3). 4 Let v(a) = -6a + 78. Calculate v(14). -6 Let p(u) = 2u - 19. Give p(10). 1 Let f(u) = -u3 - 8u*2 - 9u - 2. Calculate f(-7). 12 Let t(p) = -p*3 + 22p*2 + 25p - 47. Calculate t(23). -1 Let k(u) = 7u2 - 95u - 96. Calculate k(-1). 6 Let t(y) = 14y - 82. Calculate t(5). -12 Let q(m) = -22m - 26. Determine q(-2). 18 Let k(z) = z*2 + 13z + 34. What is k(-9)? -2 Let t(z) = 2z3 - 12z2 + z + 1. Determine t(6). 7 Let f(d) = -d3 - 4d2 - d - 4. Give f(-4). 0 Let z(p) = -p3 + 10p*2 + 25p + 1. Give z(12). 13 Let p(g) = g*2 + 2g - 4. Give p(4). 20 Let p(w) = 9w - 7. Give p(6). 47 Let s(z) = z3 + 3z*2 - 13z - 6. What is s(-5)? 9 Let a(l) = l*2 - 16l + 21. Determine a(14). -7 Let g(o) = -o*2 - 6. What is g(-6)? -42 Let x(v) = -10v*3 - 2v2 - v + 1. Give x(-1). 10 Let v(o) = -o2 - 5o - 10. Give v(-3). -4 Let g(l) = -l2 - 5l - 4. Determine g(-9). -40 Let l(m) = -m*2 + 3m - 17. Determine l(5). -27 Let j(k) = -42k - 533. Calculate j(-13). 13 Let w(l) = 10l + 39. Give w(-4). -1 Let a(d) = -d*2 - 10d - 2. Give a(-8). 14 Let f(c) = c*3 + 9c*2 + 10c + 19. Determine f(-8). 3 Let j(o) = 3o + 36. Calculate j(-13). -3 Let c(y) = y2 - 17y - 116. Determine c(23). 22 Let s(u) = -3u2 + 32u - 43. Determine s(8). 21 Let h(r) = 2r2 + 19r - 87. Calculate h(4). 21 Let h(w) = 4w3 + w2 - 5w + 5. Calculate h(1). 5 Let a(k) = -k*2 + 8k - 21. Determine a(4). -5 Let l(r) = -r*3 + 18r*2 + 20r - 44. Calculate l(19). -25 Let n(y) = -22y - 48. What is n(-3)? 18 Let b(i) = i3 - 6i*2 + 5i - 4. What is b(5)? -4 Let a(f) = -f*3 - 9f*2 - 8f + 5. What is a(-8)? 5 Let u(v) = 2v + 16. Give u(-11). -6 Let l(o) = 6o + 26. What is l(-6)? -10 Let x(v) = v*2 - 9v + 11. Give x(8). 3 Let m(g) = 19g - 18. Determine m(1). 1 Let m(g) = g3 + 2g*2 - 4g - 4. Give m(-2). 4 Let k(y) = -y*2 + 2y - 2. Calculate k(-3). -17 Let t(h) = -h*3 - 4h*2 - 5h - 4. Give t(-2). -2 Let b(g) = -5g + 48. Calculate b(5). 23 Let m(n) = 3n + 3. Determine m(-6). -15 Let o(j) = -j*2 + 18j + 5. Give o(11). 82 Let j(v) = -v*2 - v - 3. Determine j(-3). -9 Let q(p) = 3p + 50. Give q(-9). 23 Let u(m) = -5m2 - 5m - 1. Give u(0). -1 Let b(r) = -r3 - r2 + 3r - 6. Calculate b(0). -6 Let m(v) = 2v + 47. Calculate m(-22). 3 Let i(k) = 11k3 + k - 2. What is i(1)? 10 Let m(w) = -2w*3 + 3w - 4. Give m(-3). 41 Let o(i) = -i*3 - 6i*2 - 6i - 17. Calculate o(-4). -25 Let h(i) = -66i2 - 16i - 1. Determine h(-1). -51 Let z(a) = -8a2 - 15a - 7. Give z(-1). 0 Let s(l) = l*2 + 8l - 9. Determine s(-8). -9 Let a(w) = -w**2 + 1. What is a(5)?	{ "pile_set_name": "DM Mathematics" }
60))/((4 - 2)/20). Suppose -fl + 25 + 479 = 0. What is the remainder when 277 is divided by l? 25 Let i(z) = -z3 + 6z*2 - 10z + 8. Let n be i(3). Suppose 2l - ny = 49, 3y = 3l - 50 - 10. What is the remainder when 67 is divided by l? 16 Let y = 60 + 126. Calculate the remainder when y is divided by 39 + 13/(39/24). 45 Let b = 31 + -63. Calculate the remainder when 21 + -24 - (b + 1) is divided by (-2 + -1)/(14/((-1694)/33)). 6 Suppose -51a + 90a + 59a = 2156. Calculate the remainder when 4001 is divided by a. 19 Let y = -119 - -307. Let d = y + -155. Calculate the remainder when 261 is divided by d. 30 Let u(a) = 2a*3 - 3a*2 + 2a + 405. Let q be u(0). Let v = -385 + q. Calculate the remainder when v is divided by 4/18 + 212/18. 8 Let q(t) = -t*2 + 6t + 32. Let y = 45 + -21. Suppose -5g = 5m - 20, -2m + 5 + y = -5g. What is the remainder when q(7) is divided by m? 4 Suppose 3b + 205j = 201j + 1159, -8 = 4j. Calculate the remainder when b is divided by 76. 9 Suppose -35615 = -43s - 75s + 33s. What is the remainder when s is divided by 97? 31 Let h = -357 + -37. Let w = h + 437. Calculate the remainder when 147 is divided by w. 18 What is the remainder when 568 is divided by 14/665-5 + (-3120)/(-38)? 76 Suppose 538a = 519a + 418. Calculate the remainder when 2/(-1 + 3) + 100 is divided by a. 13 Suppose 3336b - 3328b - 152 = 0. Suppose -n - n = 2x - 120, 4x - n - 225 = 0. Calculate the remainder when x is divided by b. 0 Let m(q) = 113q - 3. Suppose c - 1 = 6c + 2x, -3x = 3c + 6. Let h be m(c). Suppose 2w - 456 = -h. Calculate the remainder when w is divided by 25. 23 Suppose -4q = -2f + 4f + 88, -5q - 3f = 108. Let g = q + 104. Calculate the remainder when g is divided by 23. 11 Let y(u) = -u2 + 31u + 31. Suppose 19v + 122 = 21v. What is the remainder when y(25) is divided by v? 59 Suppose -1376 = -5t - 3t. Calculate the remainder when t is divided by (-6)/(-10) + (-11176)/(-440). 16 Let k(s) be the first derivative of s*3 + 15s*2/2 + 10s + 69. What is the remainder when 28 is divided by k(-5)? 8 Let p be 10((-2)/(-4) - (-15 + 15)). Suppose pc = 188 - 68. Suppose -h = h - c. Calculate the remainder when 31 is divided by h. 7 Let d = 15 + -9. Suppose -2c = 3s + 35, c + 14 + d = -4s. What is the remainder when 57 is divided by (c/(-10))/(12/90)? 9 Let g be (0 - -4)(-5)/(-4). Suppose 0 = -0m - gm, 5m - 351 = -3h. Suppose -54i - 2561 = -397i + 11159. Calculate the remainder when h is divided by i. 37 What is the remainder when (-2)/11 + ((-12519)/52)/((-121)/176) is divided by 8? 6 Let j = -1084 + 1110. What is the remainder when 309 is divided by j? 23 Let c = 15828 - 10397. What is the remainder when c is divided by 22? 19 Suppose 0 = 2c - 12 + 6, -5t = -c - 22. What is the remainder when 6157 is divided by t? 2 Suppose -6y + 2z + 14 = -4y, 2y - 3z - 10 = 0. Let s(u) = 27u - 2. Calculate the remainder when s(2) is divided by y. 8 Let w(c) = 18c + 8. Let a = -7 - -9. Let d be w(a). Suppose -t + d = -44. Calculate the remainder when t is divided by 18. 16 Let o = -91 + 96. Suppose -4h + 252 = oh. Calculate the remainder when 80 is divided by h. 24 Suppose -5o = 2n + 2n - 20, 3n = -3o + 15. Suppose 0 = 2q - 5i - 103, 19 = q - ni - 45. What is the remainder when q is divided by 14? 11 Suppose 12 = -9p + 3p. Suppose 5x - 41 = 54. Calculate the remainder when (111/p)/(-3)2 is divided by x. 18 Let x = -24 - -22. Let s(u) = -5u - 10. Let r be s(x). Suppose -2b = -5y - 48, 5b = y - ry + 166. Calculate the remainder when 129 is divided by b. 27 Let a(z) = 8z + 2. Suppose w + 3j + 12 = 3, 2w = -2j - 14. Calculate the remainder when (-4 - -11 - 4)(-200)/w is divided by a(4). 32 Let n(m) = 65m + 2700. What is the remainder when 3008 is divided by n(-41)? 33 Let f = -11 - -8. Let l = -56 + 52. Calculate the remainder when 8/f(l - 205/20) is divided by 21. 17 Let v = 12460 - 12298. What is the remainder when v is divided by 59? 44 Let t(d) = d2 + 3d - 718. What is the remainder when 322 is divided by t(-31)? 22 Let m(l) = -l*2 + 3l + 18. Let i be m(5). Suppose h + 553 = ih. Let t = 32 - 23. Calculate the remainder when h is divided by t. 7 Let s be (15/(-10))/(((-21)/30)/(-7)). Let v(j) = -j3 - 17j*2 - 32j - 18. Suppose -3d - 2d + 35 = 0. What is the remainder when v(s) is divided by d? 5 Calculate the remainder when (-18328)/(-237) + 22/6 is divided by 8. 1 Let v(o) = 3o3 - 136o*2 - 223o + 16. What is the remainder when v(47) is divided by 188? 16 Calculate the remainder when 873 is divided by -9 + -5 + 228/4 + 8. 6 Let t(o) = -7o3 + o2 - 100o - 100. What is the remainder when t(-1) is divided by (2 - -3) + 3-1? 0 Suppose -3j - 2p - 50 = 0, 18 + 74 = -5j + p. What is the remainder when 26((-22)/(-14) + (-3)/(-7)) is divided by j/(2 - (8 + -4))? 7 Suppose 51 + 5 = -8r. Suppose -n - 4j = -44, 5j - j = 12. What is the remainder when 38(2 - (r/2 - -3)) is divided by n? 31 Let h(q) = -5q - 7. Suppose -29v + 41 + 2540 = 0. Calculate the remainder when v is divided by h(-6). 20 Suppose 3t + 48c - 44c + 80 = 0, -5t + 5c = 110. Let r be (-33)/4 + (-1)/(-4). Let q = r - t. Calculate the remainder when 41 is divided by q. 9 Let d(x) = 37x2 + 215x + 1. Suppose 0 = 4y - 3z + 6 + 9, y - 20 = -4z. Let n = 16 - y. Calculate the remainder when d(-6) is divided by n. 11 Suppose 0 = 4d + 2v - 62, 5d + 86 - 163 = -3v. Suppose -23t + 1088 = -1672. Calculate the remainder when t is divided by d. 8 Let i be (14/(-28))/((-3)/24). Suppose 0 = 5r - id - 43, 3r + 5d = 3d + 39. What is the remainder when r is divided by ((-4)/6)/(6/(-45))? 1 Suppose -p + 5y + 375 = -499, -25 = -5y. What is the remainder when p is divided by 22? 19 Let j(x) = -141x*3 + 9x*2 - 23x - 30. What is the remainder when j(-1) is divided by 38? 29 Suppose 124 = 3f + m, -37f + 39f + 5m = 87. Calculate the remainder when 4877 is divided by f. 39 Let i(g) = -927g2 - 7439g - 14. Calculate the remainder when 172 is divided by i(-8). 2 Suppose -j + 5s + 1219 = 0, 5s - 129 + 2537 = 2j. Calculate the remainder when j is divided by 590. 9 Let v(s) be the second derivative of -41s - 1/6s3 + 4s*2 + 0. What is the remainder when v(-4) is divided by 8? 4 Let c(f) be the second derivative of 1/12f*4 + 0 + 1/6f*3 + 5f*2 - 14f. Calculate the remainder when c(-8) is divided by 35. 31 Suppose 4452 = 36g - 31g - t, -3g - 4t + 2685 = 0. Calculate the remainder when g is divided by 296. 3 Let l(i) = 5i + 345. Let y(v) = -v + 29. What is the remainder when y(0) is divided by l(-65)? 9 Let o = 41 + -95. Let q = 30 + o. Let n = 49 + q. What is the remainder when 48 is divided by n? 23 Let m(f) = -28f. What is the remainder when m(-6) is divided by ((-2034)/(-72) - 7)/((-10)/(-16))? 32 Let n(m) = 2m2 - 487m - 5419. Suppose -d - 248 = -5d. Calculate the remainder when n(-11) is divided by d. 56 Suppose 5y = 4s + 161, 5y - 24s - 165 = -19s. What is the remainder when y is divided by 13? 3 Suppose -4p - 5s + 1396 = -1693, -p = 4s - 786. Suppose 6d = 794 + p. What is the remainder when d is divided by 11? 7 Let p be 3((-10)/(-15))/(4/6). Suppose r + pf + 3 - 2 = 0, -2r + 14 = -2f. Suppose rv = 217 + 13. What is the remainder when v is divided by 12? 10 Let t(s) = -8s + 331. Calculate the remainder when 6369 is divided by t(30). 90 Let o be 1 + (7/14)/((-4)/16). Calculate the remainder when (o - 4) + -4 + 4 + 347 is divided by 49. 48 Suppose -3a = 2a + 3d - 50, 3a - 30 = 5d. Suppose 0 = -2k - 44 + a. Let g = 27 + k. What is the remainder when g is divided by 5? 0 Suppose -t - 2u = -122, -3u + 129 = t - 0u. Calculate the remainder when 108 is divided by t. 0 Let x be (-16)/(-3) - 12/9. Suppose 2q = -0q + x. Suppose -2i = -3s - 53, qi - 2s + s - 43 = 0. What is the remainder when i is divided by 10? 9 Suppose 0 = 4t - 71 - 73. Suppose -3121 = -28b + 1492 + 1351. Calculate the remainder when b is divided by t. 33 Let y(f) = -23f - 678. What is the remainder when 124 is divided by y(-30)? 4 Let u be 146/(-30) + 5 + 17/(-15). Calculate the remainder when 461 is divided by u(1 - -7)(54 + -56). 13 Suppose -6*c	{ "pile_set_name": "DM Mathematics" }
- o4 + o4 - o*5 + (4o*2 + 2o*2 - 5o*2)(-o*3 + 2o - 2o). 1097o*5 Expand (0l + 4l + l)((1 - 1 + 3)(0l + 3l + 7l) + 3l - 2l - 3l). 140l*2 Expand -2k*3 - 17k + 17k + (3k*2 - 4k*2 + 4k*2)(3k - 4k + 2k) + 9k - 10k + k3 + 6 - 43k*2 + 42k*2 + (4 - 4 + 4)(3k2 - k3 - 3k*2). -2k3 - k2 - k + 6 Expand (2 + 2 + 1)(2 - 5 + 0)(-124s - 183s - 97s). 6060s Expand ((-3m - 2m + 2m)(-2 + 4 - 4 + (-4 + 3 + 0)(13 + 6 - 5)) + 2m - 3m + 0m)(2 - 4 - 1)(1 + 1 - 6). 564m Expand ((-1 + 3 + 1)(-3 + 0 - 1) - 26 - 97 + 530 + 577)(s + 0s - 2s). -972s Expand (5g + 0g - g + (3g - 11g - 8g)(1 - 4 - 4))(-3g + 0 + 0) + (-2g - g + g)(5g + g - 4g) + 2g2 + 2g*2 - 6g2 + g2 - 3g2 + 4g*2. -352g*2 Expand (-1 - 18 - 21)(27 - 20 - 18 + 2i2 + 3i*2 - 3i2 + i2 + (-3 + 0 + 4)(-2i*2 + 0 + 0) - 4i2 + i2 + i*2). 40i*2 + 440 Expand (15u*4 + 13u*4 - 20u*4)(0u + 0u - 2u) + u2 + u - 31u*2 + 3u*5 + 0u. -13u5 - 30u*2 + u Expand (0 - 1 + 0)(2w + 0w + w) + 268 + 28w - 268 - w - w + 3w - w + 5w + 0w. 30w Expand (4 + 62d*3 - 9233d*2 + 9233d*2)(-11 + 11 + d). 62d4 + 4d Expand (-20f2 + 105 + 21f*2 + 410)((-3 + 5 - 1)(f - 5f + 3f) + (8f + 0f + f)(-3 - 2 + 6)). 8f3 + 4120f Expand (7p - 1 + 3 - 9p)(-628 + 5436 + 616). -10848p + 10848 Expand (-3 + 3 + 2)(4d - 2d + d)((d*2 + 0d + 0d)(-5 + 5 - d*2) + 11d*4 + 3d*4 - 3d*4). 60d5 Expand (h5 - 2h5 + 3h*5)(-202 - 1752 - 4577) + (-3h2 + 3h2 + h4)(-1 + 1 + 2h). -13060h5 Expand (-2u + 2u + 2u)(0 - 2 + 0) - 5u - u + 4u + 17u - 13u - 63u + (2 + 3 - 3)(4u - 3u + u) + 2u - u + 0u. -60u Expand (6 - 16 - 4)(4u + 3u - 5u) + (2 - 2 - 2u)(4 - 10 + 11) + (-3 - 2u + 3)(3 - 1 - 1)(-1 + 1 - 4). -30u Expand (-b*2 + b - b + (0b*2 + 2b2 - b2)(0 - 3 + 1))(-2 - 1712287b2 + 3528b*3 + 1712287b*2). -10584b*5 + 6b*2 Expand (-3 - 20 - 4)(2 - 4 - f + 3f) + (21 + 23 - 10)(-f + 0f + 3f). 14f + 54 Expand (13 + 2 - 14 - 2x)(0 - 1 + 2)(-4x + 5x + 0x)(-1 - 10 + 3). 16x2 - 8x Expand (292b4 + 178b*4 - 139b*4)(1 + 2 - 1)(7 + 9 + 9). 16550b*4 Expand (0 + 2u + 0 + (206u - 413u + 193u)(-6 - 8 + 5))(6 + 9 - 4). 1408u Expand (4d - d + 0d)(605 + 325 - 4)(1 - 2d - 1). -5556d*2 Expand (-3 + 4 + 1)(-5y + 5y + 2y3 - 40700y*2 + 40700y*2 + 181y3 + y3 - y*3 - 2y*3 + (-1 + 1 - 2y*3)(2 - 4 + 0)). 370y3 Expand (-9x*3 + 21x*4 + 9x*3)(2 - 2x - 2)(0 - 5 - 2). 294x5 Expand (-1 + 0 + 2 + (2 + 1 - 2)(2 - 3 - 1))(8 - 6 - 15)(-2 + r + 2 + (-2 + 6 - 3)(2r - 2r + 2r) - 4 + r + 4 - 3r + 3r + 2r + 2r + 8r + 2r). 234r Expand (-30126 - 253k + 30126 - 4k + 4k - 2k + k + 1 - 1 + (-1 + 4 - 4)(-2 + 2 - 2k))(-3k3 + 3k*4 + 3k*3). -756k*5 Expand ((14463m - 14463m - 126m*2)(-3m + 2m + 0m) + 4m*3 - 2m*3 - 3m*3)(-3m + 1 - 1). -375m*4 Expand 2f*5 - 10f*3 + 4f*5 + 5f*3 - 2f*3 + 2f*3 + 3f5 + (0 + 0 + f5)(-2 + 3 - 3) + f5 - 64f + 64f. 8f*5 - 5f*3 Expand (0t - t + 2t)(5 + 2t - 5) - t2 - 3t2 + t2 + (0 - 14t - 6 + 7)(-9t - 11t + 10t) + 3t*2 + t + t - 4t*2. 138t*2 - 8t Expand -83y5 - 45y*5 - 100y*5 + (5 - 5 - 2y)(-2y*4 + 3 - 3) + (2y - y + 0y)(-y*4 - 3y*4 + 2y*4). -226y*5 Expand (-8 - 20 - 24)(o + 2o - 2o) + 3o + 4 - o - 2 + (2 + 0 + 0)(-3o - 14o - o). -86o + 2 Expand (-4q*2 + 2q*2 + 0q*2)(3q + q3 - 3q) - 404q5 - 515q*5 + 21q*5. -900q*5 Expand 2d*3 - 235 + 233 - 15d - d3 - d2 + (17 - 17 - 6d2)(d + 2d - 4d). 7d3 - d2 - 15d - 2 Expand (-3s + 0s + 4s)(7 - 4 + 0) - 13s - 3s + 7s. -6s Expand (0i2 + 12i*3 + 0i*2)(-19 - 905i2 + 51 - 32). -10860i*5 Expand 352i*4 - 216i*4 + 541i4 + (0 + 0 - i2)(2i*2 - 5i2 + i2) + 0i4 + 3i4 - i4 + 3i3 - 3i*3 - 2i*4. 679i*4 Expand (-44w + 44w - 27w*2)(-9w + 10 - 10). 243w*3 Expand 34 - 8q - 34 - 9 - q + 9 + (-4 + 2 + 3)(3 - 2q - 3). -11q Expand (28g*3 - 4g + 4g)((1 - 1 + 2g)(0g - 3g + 2g) - 130 - 30g*2 + 130). -896g*5 Expand (-12s + 0s - 11s)(-2s*2 + 4s*4 - 24s + 24s) - 5s2 + s2 + 6s5 + 6s*2. -86s*5 + 46s*3 + 2s*2 Expand 23i*4 - 244 + 126 + 119 + (0i*2 + 3i*2 + 2i*2)(1 - 1 - 2i2) + (4i*3 - 3i3 + i3)(-1 - i + 1) - i4 + 2i*4 + 0i*4. 12i*4 + 1 Expand -3a*2 + 6a*2 - 2a2 + (a2 - a + a)(-1 + 1 + 2) - 2a*2 - 3a + 3a + 2 + 0a + 88155a2 - 5a - 88162a2. -6a*2 - 5a + 2 Expand -10l4 + 1 + 15l*2 - 24116l + 24116l - l4 + 3l4 - l4 + (-l + l*4 + l)(-1 - 1 + 0). -11l4 + 15l*2 + 1 Expand (-1 - 2 + 1)(1 - 4 + 0)(6357y2 - y3 + 3552y2 - 2 - 2789y*2). -6y*3 + 42720y*2 - 12 Expand (-1 + 0 + 2)(-2l + 2 - 2)(0l + 0l + 8l + 2l - 3 + 3 - 1 - 2l + 1 + (0l - l + 3l)(-3 - 1 + 3) - 23l + 62 - 62). 34l*2 Expand (3 + 1 - 5)(41807 - 6939g - 20897 - 20910). 6939g Expand (-4262o2 + 1698o*2 + 1489o*2 + 0 + 0 + 2o*2 + (3 - o - 3)(2o - 2 + 2) - 2o*2 + 4o2 - o2)(3o3 + o2 - o*2). -3222o*5 Expand (-2 - 1 + 1)(-4s + 5s + 2s)(874s - 329s*3 - 874s). 1974s4 Expand ((6j*2 - 3j*2 + 0j*2)(4j - 4j - 2j) - 2j*3 - 2j*3 + 15j3 + (j2 + j2 - j2)(-2j - j + j))(-3j + j - 6j). -24j*4 Expand (1 - 1 + 3j)(332 + 42j - 332) + 10j + 1 - 44j*2 + 9j + 42j2. 124j*2 + 19j + 1 Expand 8v4 + 2v4 - v4 + (-32v2 - 84v*2 - 85v*2)(5v - 2v - 2v)(0v - 3v + 5v). -393v*4 Expand 154w*2 - 262w + 262w + 15w*2 - 9w*2 + 2w*2 + 0w*2 + 0w*2 + 2w*2 + (0w - 2w + w)(w - 2w - w). 166w*2 Expand (n + 0n + n)(3 + 1 - 5) - 5 + 5 - 2n - 47n + 3n + 3n + (3 + 2 - 4)(-3n - 2n + 2n) + 19n - 4n + 48n. 15n Expand (318w*2 - 273w*2 + 429w*2)(3w - 4w + 0w). -474w*3 Expand r + 0r - 3r + (r + r - r)(400 - 188 - 128) + (3 - 4 + 2)(2r - 2r + 3r)(-3 + 1 + 3). 85r Expand -3v3 + 3v*3 - 2v*4 - 4v*4 - 5v*4 + 2v*4 + (2v + 3v - 3v)(-v3 - 4v + 4v) + 6v - v - 2v4 + 0v. -13v4 + 5v Expand -21m4 - 2m*4 - 20m4 + m4 + m2 - m2 - m3 + m3 - 11m4 - m2 + m2 + 2m4 + (m3 + m3 - m3)(1 - 1 + m). -50m*4 Expand (0t + 7t - 3t)(-14t + 164t + 865t). 4060t2 Expand (13 + 21 + 3)(27 - 162 - 42)(-2a2 - a2 + 4a2). -6549a*2 Expand -13k*4 + 13k4 - k3 - 6k5 - 30771k*2 - 38k*5 + 30771k*2 - 3 + (2k + 2k - 2k)(-2k*4 + 1 - 1). -48k5 - k3 - 3 Expand -24z + 64z + 32z + (2 - 3 + 2)(-162z - 148z + 323z + 11). 85z + 11 Expand 2l5 - l5 + 0l*5 + (2l*4 - 5l + 5l)(2l - l + 3l)(-1410 - 1349 + 621). -17103l*5 Expand 5293g + 1093g + 488g + 0g + 0g + 2g + (-g - 4 + 4)(-3 + 6 - 4). 6877g Expand (277t + 320t - 492t)(-2 - 4 + 0) - 4t + 3 - 3. -634t Expand (4c*2 + 0c2 + c2)(0c + 2c3 + 0c) - 17c5 + 35c*5 - 9c5 + (c3 - c3 - c4)(3c - 2c - 2c). 20c5 Expand (-2g*2 + 4g2 - g2)(g - 4 + 4) + 3g + g*3 - 3g + (5 - 1 - 7)(-4g*3 - 6g*3 + 0g*3). 32g*3 Expand (-51g + 103g + 57g)(-264 + 22g + 264). 2398g2 Expand (1471 - 46d - 1471)(175 + 67 - 85 + 6 + 124). -13202d Expand (-130u + 42u - 304u)(-2u + 0u + 3u). -392u*2 Expand (0r*2 + 0r2 + r3 + (-3r2 + 2r*2 + 2r*2)(r - 3r + 4r))(2r + 2 - 2)(-2 - 2 - 1)(-32 - 1 + 95)(3 - 2 - 3). 3720r*4 Expand (2 + 0 + 1)(-284 + 33h + 284) + (5h - 3h - 3h - 3)(0 + 2 - 3). 100h + 3 Expand (-8d2 + 71d - 71d)(-57d - 6296 + 6296) - d - d3 - d3 - d. 454d*3 - 2d Expand -23j + 13j*3 + 2081 - 2071 - 10j*3 + (-12 - 7j + 12)(-4j2 - j2 + 3j2). 17j*3 - 23j + 10 Expand -985w - 876w + 1546w + (-2w + 0w + 0w)(4 + 0 - 5) + 0w + 4w - 3w + 4w - w - w. -310w Expand 3w4 + w4 - 2w*4 - 12w*4 - 17w + 4w2 + 17w + (-8 + 0 + 0)(-3w*4 + 3w*4 - 2w*4). 6w*4 + 4w*2 Expand (-4z*2 + 4z*2 + 3z*2 + (2z + z - 5z)(-3 + 3 - 2z))(-1 + 7z2 + 10z*2 - 21z*2)(853 + 28z - 853)(1 - 5 +	{ "pile_set_name": "DM Mathematics" }
94)/(-14) + 1695/(-2373)? 6 What is (-19)/(1520/(-110)) + 6/(-16)? 1 3/(-4)120/(-54)6 10 What is 2355/(-1413)6/(-7)? 10/7 Evaluate (2/(-6) + -4)/((-6)/(-18)). -13 What is (3 + 40/(-2))(-1 - 0)? 17 Calculate 950/1575 - (-40)/(-45). -2/7 Evaluate (2/126)/(26/674) - (-4257)/(-9933). -2/117 Calculate 4/(-7) + (-71550)/(-9450). 7 What is 1302/(-1674)(-3)/35? 1/15 Evaluate ((-23850)/(-10335))/(14/13). 15/7 Evaluate ((-45)/(-54))/(17/102). 5 What is the value of -115/55161? -16 What is the value of 1/(-13) + (-9108)/(-203918)? -1/31 Evaluate (13/4)/(1/(-8) - (-173)/(-1384)). -13 (-264)/(-154)(-7)/22 -6/11 What is -142115/(-4410) - 7? -2/7 What is the value of (-7 - 660/(-90))/(-1 - 23/(-36))? -12/13 Evaluate -48 - (-816)/18 - 22/3. -10 Calculate (619837/(-380))/(-101) + -16. 3/20 Evaluate (-28)/(-49) + (16/21 - 0). 4/3 Evaluate 52896/38570(-3)/(36/(-15)). 12/7 What is the value of ((-2493)/1385)/((-27)/(-5))? -1/3 2/42 - (6/(-4) - (-2616)/2016) 1/4 Calculate (0 - -1)/((-21)/84). -4 What is the value of (3/18)/((-23)/(-92))? 2/3 What is ((-6)/(-3))/(((-1152)/162)/32)? -9 (1120/62 - 8) + (-10)/155 10 What is the value of (12/(-792))/(-7 + (-58)/(-8))? -2/33 ((-104)/520)/(-3 + (-1022)/(-340)) -34 What is the value of (-104004)/(-130005)((-66)/(-184) + 2/(-8))? 2/23 Evaluate 24/(-4) + 366/60. 1/10 Evaluate (-610)/61(-8)/(-112). -5/7 Calculate ((-21)/518)/(9 - 390/40). 2/37 Calculate -6(10 + (-392)/48 - 1). -5 What is the value of ((-9)/1305)/(26/(-455))16/(-28)? -2/29 Evaluate (-30)/(-6) - (-5 + 14)-1. 14 What is the value of (24/(-18))/((-4)/18) - (-2145)/(-351)? -1/9 What is the value of 16895/(-59950) + 2/20? -2/11 What is the value of (7/(-18))/(311/(-1866))? 7/3 ((4/35)/((171/90)/(-19)))/(-2) 4/7 Evaluate -5(0 - -1)(-13 + 14). -5 Evaluate 12/(-8) - (-14)/(1680/225). 3/8 Calculate (-2 + -3 + 11 + -4)/((-26)/(-4)). 4/13 Evaluate 2 - (-3 - (10 - (6 - 4))). 13 Evaluate 2/62(-42 + 2185/38). 1/2 Calculate (-171)/(4788/(-224))(4 + 1). 40 8(18 + (-4 - 15)) -8 Calculate -29 - -26 - (636/36 - (-3)/9). -21 250/(-225)144/(-32) 5 What is (3 - (-912)/(-312))2? 2/13 -8 + 976/(-36)(-15)/50 2/15 What is the value of (-1050)/(-50) - (-5 - (5 - 15))? 16 Calculate 8/(-12) + -3403/(-234). 9/2 (-88)/330(2 - (-116)/(-16)) 7/5 (-37 - -36) + ((-4)/2 - -2) -1 What is the value of (-1)/4(1176 + -1175)? -1/4 (-2 + 4)/2 + (-460)/38 + 11 -2/19 What is (-756)/(-324) - (-68)/(-6)? -9 Evaluate 38/252 - (-34)/(-153). -1/14 What is the value of -12(-5)/(-70)(-196)/252? 2/3 (-484)/(-32) - (15 - 18) - (-3)/(-24) 18 What is the value of 58 + -16 + (-2691)/65? 3/5 Evaluate (-81)/12 + 195/(-104)30/(-75). -6 What is (-12)/((198/12)/11)? -8 What is 20/6 + 4 - (2 + (7 - 3))? 4/3 What is the value of (220/(-99))/(-10) - (275/(-99) - -1)? 2 (-1 + 25/5)(63/36)/(-1) -7 Calculate (-606)/909 - 31/(-24). 5/8 (-1057)/5256 + -6 + 18 -2/25 Calculate (34/419919)/(-2 + 6). 1/26 What is (-1 - -1) + (2485/1540 - 4/11)? 5/4 What is the value of -6 + 0 - (13 - 25)? 6 What is -46 + 34 + (8 - (-40)/12)? -2/3 1090/(-327)(-24)/(-10) -8 What is 242/4295538/284? 11 What is 2012/(-20) + (-8)/4? -14 Calculate ((-600)/80)/(1 - (-14)/(-24)). -18 What is the value of (15/(-4))/((1 + 49)/200)? -15 Evaluate (-1 + -11)/(6/(-33) - (-336)/154). -6 Calculate (110/(-25) - -5)/(-167 + 182). 1/25 Evaluate 31 + -41 - (-2 - 96/14). -8/7 What is 22 + 11 + -18 + -26? -11 What is -14 + 64/(-352) + (-1184)/(-99)? -20/9 Calculate 3 - 475/136 - (540/96 + -6). -2/17 What is (-2)/14(18/(-2) - 0/26)? 9/7 What is the value of ((-6)/(-33))/(4 + 1 + 1 + -9)? -2/33 20 + (-26 - 23)/7 13 Evaluate -33 - (-73488)/2184 - (75/21 - 3). 1/13 What is the value of ((-180)/2970)/(112/44)? -1/42 Evaluate ((-1)/(75/6))/(4 + 16/(-5)). -1/10 What is ((-52)/8)/(((-1260)/(-24))/15)? -13/7 2 - 5(-6)/(-15) - 912/48 -19 What is (-9)/(-5)1/15(-1625)/(-260)? 3/4 What is (-42)/35(31/93 - (-38)/6)? -8 Evaluate 858/(-77) + (-2 - -13). -1/7 Calculate (48/(-56))/(152/(-266)). 3/2 52/39022/(-24) -1/45 What is the value of (36 - 10192/168)/((-4)/(-6))? -37 What is the value of (-2)/(-10)(91 - 90)(-1 + -3)? -4/5 Evaluate (13/((-1872)/80)-3)/((-2)/(-6)). 5 Evaluate -11 - 660/99((-88)/(-16) - 4). -21 37/((-6216)/(-16))(4 - 1) 2/7 47 - 1 - (34 - 55 - -36) 31 What is the value of 4816/368 - (2/(-8) + (-1519)/(-4508))? 13 What is the value of ((-7)/10)/7(10 + 8/(-1))? -1/5 Calculate (-135)/216 + 6/16. -1/4 What is the value of (-6)/(-9)(10 - 1892/188)? -2/47 17/1758/(-1131) -2/39 What is the value of -16(-10)/(-40)-1? 4 What is the value of 637/(-98) - (-230)/40? -3/4 What is (68/(-15 - 2))/50? -2/25 What is ((-6)/(-16) - (-854)/112)(16 - 13)? 24 Calculate (12/(-3) + (-32)/(-7))(-25)/150. -2/21 Evaluate 10/(-35) + 338/(-105) + 6. 16/5 Calculate 405/(-243) - 2156/(-66). 31 1438/1212 + 3396/(-171498) 7/6 Calculate 7/(-49)21/(-12). 1/4 Calculate (-253)/(-12539/588). 23 (68/(-136))/(1098/156 - 7) -13 What is 4 - 1 - (-34)/(-136)-64? 19 What is (-1128)/235 - 2047/(-115)? 13 What is the value of (96/(-1216))/((8 - 4)/16)? -6/19 What is the value of (54378/288)/19 + (-2)/(-32)? 10 Calculate (-12338)/(-1990) - (-57)/(-15). 12/5 What is (-20280)/(-10647)48/(-20)? -32/7 What is the value of (-42)/(-10) + ((-574)/70)/41? 4 Calculate (((-1)/(-8))/(26/52))/(3/(-36)). -3 Calculate 63/153(45/(-140))/(-9)8. 2/17 What is the value of (-10)/(-4)4/3417? 5 ((-9)/((-351)/(-39)))/((1/3)/1) -3 What is the value of (52/20 - 4)(5 - 80/4)? 21 What is the value of (-1)/(-5) - 186/(-45) - 4/12? 4 What is ((-175)/400)/(14/224)? -7 Evaluate (22 - (-917)/(-42))/((-1)/5) + 1. 1/6 Evaluate (1/1)/(95/437(-12)/(-60)). 23 What is (-8)/4 - 240/(-110)? 2/11 What is the value of 1312/(-32) - (-72)/3? -17 What is (132/(-198))/((-1010)/255 - -4)? -17 Evaluate ((836/20)/(-11) + 4)/(2/80). 8 -130 + 120 + (10 - 5) -5 What is (-36)/(-13)-5 + (4 - 162/39)? -14 Evaluate (8/2)/(1574/(-5509)). -14 What is the value of (-9)/12(45 + -35 + -8)? -3/2 What is the value of (0 - 10/2)/(-4 - -7)? -5/3 What is (-30 - -28)9/6? -3 3681/(-4908)64/6 -8 What is (-54)/6 - (-25 - 35/(-5))? 9 What is (66/24 + -2)19/(152/96)? 9 Calculate (0 + -54)/((-4)/26 - (-4648)/2158). -27 What is the value of (-8)/301580/(-474)? 8/9 (-11)/(-616)-126 + (-11 - -3) -1/4 Evaluate 6/3367 - ((-426)/48 + 3). 6 What is ((-3)/(-7) - 3)/(96/448)? -12 Calculate 1349/(-1045) - (2 - (-128)/(-40)). -1/11 What is 59/7 - (-280)/(-196) - (-2 - -7)? 2 Evaluate 74/(-27) - (-4)/(-36)-24. -2/27 Evaluate (-5)/(-4) + (3388/(-112) - -14). -15 Calculate (-3)/(-4) + (-968)/1376. 2/43 What is (2392/897)/(20/6)? 4/5 Calculate (8/(-10))/((-5)/75). 12 Evaluate (72/(-2754)17)/(2/(-45)). 10 What is the value of 30562/(-2065) + 1/(-5)? -15 What is 12/2 + 12934/(-2007)? -4/9 11(-516)/132 + 10 -33 (8 - 10/(-10)) + (1 - -3) 13 What is 3/((-27)/(-6) - 32/(-64))? 3/5 Calculate (79/316)/((-1)/(2 - 142)). 35 What is (20 - -1)(-13 + 12)? -21 Evaluate (-1 - (-63)/77) + 1190/(-1925). -4/5 What is 8/(-20) - (-10 + (-6276)/(-660))? 1/11 (49/(-28))/(4/(-16)) 7 What is the value of (-2092)/2615 + (-18)/(-10)? 1 (-4)/62(102 + 18655/(-182)) 1/31 Calculate ((7/791)/((-9)/27))/(12/8). -2/113 What is (-2)/49 + (-1944)/392 + -9? -14 Calculate -4(-1 + 0) + -13 + -3 + 13. 1 (2/((-78)/30 + 3))/((-92)/460) -25 ((-2)/(-5))/((-6)/(-5)) + (-339)/791 -2/21 Evaluate ((-3)/(-4))/((-4800)/(-1280)). 1/5 What is ((-1440)/84)/(-5) - 6? -18/7 Evaluate -6 - (56/(-24))/(-34/36). -13 Calculate ((-470)/(-40) - 9)/((-45)/36). -11/5 Calculate ((-28)/(-2))/(-2) - 3/18-22. -10/3 Evaluate (-8)/3-31400/(-400). -28 What is 2/(-6) - (-11)/(264/80)? 3 What is (5 - -6) + 57/(-6) + 10/(-4)? -1 What is (-434)/620(-9)/21? 3/10 What is 1527/1215 - 13/3? -4 What is 16/(-3)(-132)/(-836)38? -32 What is the value of -3 + 4640/665 + (-4)/(-14)? 1/19 Calculate (9/((-567)/(-6)))/((-77)/21 - -4). 2/7 What is the value of 204/(-30) + (21 - 13 - 2)? -4/5 Calculate (6/8)/((-981)/872)(-30)/(-4). -5 What is -3 + 1 - (-2 + 0) - 134/(-1675)? 2/25 Evaluate ((-3)/(-15))/(506/(-33) + 15). -3/5 What is the value of 334/26 + 390/2535? 13 (-21302)/266275 - (2/7 - 7128/350) 20 Calculate (0 - 8/(-68)) + 2075/42330. 1/6 11((10/1 - 3) + -6) 11 (-27)/(-18) + 17 - 4/8	{ "pile_set_name": "DM Mathematics" }
u(d). -6 Let h(y) = 4y - 1. Let w(i) = 4i - 1. Suppose 3b - 4 = 11. Let p(a) = bh(a) - 6w(a). What is p(-2)? 9 Let v(g) be the second derivative of g3/6 - 3g*2 + 3g. Determine v(5). -1 Suppose -4v + 3v = -2. Let c(y) = -y3 - y. Determine c(v). -10 Let r(q) be the third derivative of q8/6720 + q7/420 + q6/144 - q5/20 + q4/24 - 4q2. Let v(c) be the second derivative of r(c). Calculate v(-5). -6 Suppose 3 = 4i + 2x - 3, 10 = 4i - 2x. Let k be -2 - (i - 2) - -6. Let m(f) = -k - 2f + 5f - 2f. What is m(5)? 1 Let k(r) be the second derivative of -r5/120 + r4/6 - 4r3/3 - r. Let q(c) be the second derivative of k(c). Give q(5). -1 Let p be (12/10)/((-12)/(-40)). Let k(r) = -p + 2r*2 - 2r - r + 5. Give k(2). 3 Suppose -2o + 10 = -14. Suppose 0d + 3d = -o. Let g = -2 - d. Let y(a) = -a2 - a + 1. Calculate y(g). -5 Let h(j) be the first derivative of -j4/4 - j2/2 + 2j - 25. What is h(0)? 2 Suppose 0 = -v - 0 - 5. Let t = v - -10. Suppose -tr = -3j - 3 - 3, -5j = -5r + 10. Let n(q) = -q3 - q2 - q - 3. Calculate n(r). -3 Let l(c) = -c - 13. Let b(m) be the second derivative of -m3/6 + m2/2 + m. Let j be b(2). Let w be (j - -3)/((-8)/28). What is l(w)? -6 Suppose 38 = -4m - 3w + 11, 7 = -4m + w. Let u(g) be the second derivative of -g4/6 - g3/3 + 2g*2 + 8g. Determine u(m). -8 Let c(h) be the first derivative of h*2 + 4h + 13. Calculate c(-5). -6 Let s = -101 - -94. Let n(f) = 3f2 - 5 - 7f - 3f2 - f2. Give n(s). -5 Let n(d) = -4d + 5d2 + 10d - 4d2. Determine n(-7). 7 Let f(a) = -5a - 1. Let g be f(-4). Suppose g + 1 = 2i. Let k = 14 - i. Let s(j) = j2 - 2j - 2. Give s(k). 6 Let a(r) = -r + 1. Let f(s) = 4s. Let g be f(4). Suppose -5p - 4 - g = 0. Let b = p - -7. Determine a(b). -2 Suppose -9 = f + 3j, 0 = -3f + 4j + 31 - 6. Let q(a) be the second derivative of -1/6a*f + 0 + 2a + 0a2. Give q(0). 0 Suppose 3w = 4l + w + 10, -4l - 19 = w. Let m(c) = -c*3 - 6c*2 - 5c. Determine m(l). -12 Let u(f) = -f3 + f2 + f - 11. Suppose 12 = -4l - p + 5p, -12 = 2l - 4p. What is u(l)? -11 Let s(j) = 14j - 10. Let n(a) = -a + 1. Let v(d) = 10n(d) + s(d). Determine v(-3). -12 Let d(r) be the first derivative of r*2/2 - 3r + 2. Suppose 4s - 3 = 9. Suppose -7m = -3m - sk - 6, 0 = m + 5k - 13. What is d(m)? 0 Let m(d) = -20d - 16d + 7 + 32d - d*2. Give m(-5). 2 Let k = -1 - -3. Let j = 0 + k. Let c(v) = -4 + j + 4 - 7 - v. Determine c(-6). 1 Let y(a) be the first derivative of -2a*3/3 + 2a*2 - 3a - 2. Let c(l) = 3l - 2l + 6 - 2l + 2. Let h be c(6). Give y(h). -3 Let q = 2 - 0. Let r = q + 0. Let g be 7 - (-2)/r-2. Let w(n) = -n + 9. Determine w(g). 4 Let l be 0(3 + (2 - 4)). Let o = 1 + l. Let n(j) be the third derivative of j5/60 - j3/6 + 3j*2. Give n(o). 0 Let v = 12 - 13. Let n(p) = 6p3 + p. Give n(v). -7 Let q(u) be the first derivative of u4/4 + 5u3/3 + 3u*2/2 + u + 1. Let f be ((-4)/(-10))/((-2)/20). Determine q(f). 5 Let s(l) = 2l*2 + 3l + 1. Let d(x) be the third derivative of 0x - 1/60x*5 - 5/12x*4 - 3x*2 + 4/3x*3 + 0. Let y be d(-11). Give s(y). 10 Suppose g - 5g + 12 = 0. Let f(m) = 7m - 4m*2 + 5 - 3m + gm2. Let p be (-4)/3(-9)/3. Determine f(p). 5 Let p(r) = -4r + 5. Let n(h) = 5h - 6. Let g(i) = 5n(i) + 6p(i). Let x be g(5). Suppose xa - 2 = 5t - 12, 8 = 4t + 4a. Let d(c) = 2c + 1. What is d(t)? 5 Let a = 5 + -1. Suppose -21p - a = -20p. Let s(m) = 2m + 3. Give s(p). -5 Let t be 4 + (3 - 2)-1. Suppose 0 = g + u, 0 = 5g + 3u + 1 - 7. Let s(l) = -5l - 1 + gl - tl. What is s(-1)? 4 Let u(o) = o*3 + 7o*2 - 3. Let p be u(-7). Let c(g) = 3g*2 + 4g + 2. What is c(p)? 17 Let h(n) = -n*2 - 5n. Let u be (-2)/(-11) - 60/(-33). Let c(m) = 4m2 + 21m. Let y(j) = uc(j) + 9h(j). Determine y(-2). 2 Let c be ((-9)/(-12))/((-12)/(-32)). Let v(f) be the first derivative of -cf2 + 4/3f*3 + 1 + 1/4f*4 + 4f. Calculate v(-5). -1 Let q = -14 + 16. Let x(l) = 2l2 - 2l - 1. Determine x(q). 3 Let g = 3 - 8. Let l(x) = -3x + 2. Let i(t) = -1. Let n(d) = -7d. Let b(m) = 5i(m) - n(m). Let k(s) = -2b(s) - 5l(s). Calculate k(g). -5 Suppose -5c + 3y = 0, -2c + 4c = -y. Let h(a) = a - 7. What is h(c)? -7 Let i(g) be the first derivative of g4/4 + g3 + g2 + 3g - 9. What is i(-2)? 3 Let j be (-1 - 26/4)(-40)/(-50). Let m(b) = -b2 - 4b - 5. Give m(j). -17 Let k(b) be the third derivative of b6/60 + b5/30 + b4/12 + b3/6 - 4b2. What is k(-1)? -1 Let x(c) = 15c*2 - 14c*2 + 130c - 1 - 129c. Give x(1). 1 Let d(s) = 2s3 - s. Let w(r) = r2 - 18r + 2. Let f be w(18). What is d(f)? 14 Let o(u) = -9u + 7 - 69u2 + 143u*2 - 73u2. Determine o(6). -11 Let u(z) be the second derivative of -z6/720 + z5/60 - z4/4 - 2z. Let i(c) be the third derivative of u(c). Calculate i(-3). 5 Let l(t) = -t + 1. Suppose 4y - 2 - 18 = 0. What is l(y)? -4 Let f be (-3 - (0 - 2))-3. Let p(d) = 4d*3 - 5d - fd3 + 3d - 3d2. Suppose -3n = 3u - u - 9, 3u - 12 = -3n. Calculate p(u). -6 Let c(r) = r2 - 4r - 3. Let w be c(5). Let p(u) = 6u. What is p(w)? 12 Let x(w) = -w2 + 6w + 2. Let r be (-3)/((-3)/122). Let p be x(r). Let v be p-1 - (-1 + 2). Let s(c) = -c*3 - 2c*2 + c - 4. Determine s(v). 2 Let g(f) = -6f + 1. Let v = 40 + -41. Determine g(v). 7 Let z(q) = -q*3 + 5q*2 - 4q - 2. Let k = -11 - -15. Calculate z(k). -2 Let n(j) = -5j3 - 4j*2 + 9j + 2. Let d(q) = 113q3 + 2 - q - 2 - 112q*3. Let p(z) = 4d(z) + n(z). Suppose -r + 4r = -15. Determine p(r). 2 Let j(t) be the first derivative of 13t3/3 + t2/2 + 3. Give j(1). 14 Let q(p) be the second derivative of p4/12 + p3/3 + p*2/2 + p. Let b be -5 + -2(3 - 4). Calculate q(b). 4 Let i(v) = -v*2 - v + 7. Let f be i(-3). Let p(y) = 10y. Give p(f). 10 Let l(h) = -3h - 1 + 5 - 2. Let w(p) = -p3 + 3p*2 + 9p + 3. Let n be w(5). Calculate l(n). 8 Let j(q) be the third derivative of -3q2 - 1/6q*3 - 1/60q*5 + 7/120q*6 + 0 + 0q + 1/24q4. Calculate j(1). 6 Let f(p) = -p3 + 4p*2 + 6p + 1. Let a(j) = -j*2 - 5j - 7 + 6j + 7j. Let w be a(6). Suppose 2b = -3v - 5, wv = -3b + 2v. Determine f(b). 6 Let f(p) = 4p - 8. Let w(r) = 7r - 15. Let a(u) = 5f(u) - 3w(u). Suppose 0 = 4s + 4 + 8. Let v be (-1 - 0)(s + -2). What is a(v)? 0 Let c = -74 - -76. Let y(q) be the first derivative of q + 1/2qc - 1. What is y(-2)? -1 Let u = 14 - 17. Let d(s) = -s3. Let r(z) = 3z3 - 4z*2 - 3z + 3. Let i(y) = -4d(y) - r(y). Calculate i(u). -3 Let c(f) be the first derivative of f4/4 - f3/3 - f - 2. Let y(v) = -2v*3 + 3v*2 + 4v + 2. Let g = -39 - -38. Let p(x) = gc(x) - y(x). Determine p(3). -4 Let a(w) = -5w - 1. Let f be 3 - 6/(-9)-3. Suppose 0 = s + 2, 4s + 0 + 8 = 5m. Let i = m + f. Give a(i). -6 Let j(q) = 2q - 8. Let m be (-21)/(-2)(10/15 + 0). What is j(m)? 6 Let x be (2/14)/(12/84). Let p(a) be the third derivative of 3a4/8 + a3/6 - a2. Give p(x). 10 Let y(k) be the third derivative of -k4/24 + k*3/2 + 25k*2. Suppose 0 = -4v + 2d - 24, -v - 3d - 2 = -3. Determine y(v). 8 Let d(v) be the second derivative of v7/2520 - v6/144 + v5/40 - v4/6 + 2v. Let t(i) be the third derivative of d(i). Calculate t(2). -3 Let k(p) = p3 + 9p*2 - 4p*2 - 4p*3 - 8 - 4p*3 - 10p. Let n(y) = -10y3 + 8y*2 - 15y - 12. Let z(r) = -7k(r) + 5n(r). Determine z(4). -8 Let c(z) = z*2 - 6z + 1. Let w be (10 - 0)/(12/6). Calculate c(w). -4 Let j(t) = -18t3 - t2 - 2t - 1. Suppose -2g + 3w - 8 = 0, 0 = -g + 3w - 7. Calculate j(g). 18 Suppose t = 4o - 16, 3t = 2t - o + 9. Suppose -4g = -2i - 3g + 12, g + 24 = 5i. Let w(m) = -m + im - tm. Calculate w(5). -5 Suppose 3m = -2m - 120. Let k be 460/(-8)m/10. Let s be k/(-42) - (-4)/14. Let t(w) = -w. Calculate t(s). 3 Let m(x) = 2 - 5 + x + 1. Give m(-3). -5 Suppose 0 = 3z + 2w + 2 + 7, z - 3w = 8. Let q(p) = -3p + 1. Let o(n) = -2n + 1. Let j(b) = 3o(b) - 4q(b). Give j(z). -7 Let i(z) = -7z2 + 1. Let m(n) be the third derivative of n4/12 - 7n*3/6 - 4n2. Let r be m(3). Determine i(r). -6 Let s(c) be the third derivative of -c6	{ "pile_set_name": "DM Mathematics" }
+ co + 6 = 0. List the prime factors of (-4 - o)/((-1)/5). 5 Let y(u) = 13u + 25. List the prime factors of y(11). 2, 3, 7 Let f be 14 - (2/(-2) + 1). Suppose m + 2p - f = -3p, 0 = -p. List the prime factors of m. 2, 7 Let s(k) = 2k2 + 4k + 3. Let o be s(-2). Suppose 5b + c + oc - 75 = 0, 1 = -b - 4c. What are the prime factors of b? 19 Let w = 46 - 13. What are the prime factors of w? 3, 11 Let o(k) = -k3 + 4k*2 + 4k + 3. Let z be o(6). List the prime factors of 345/27 - 10/z. 13 What are the prime factors of 5/15(-234)/(-3)? 2, 13 Suppose 0z - 12 = -3z. Let b be (8 - 2)/(6/z). Suppose 3g + 3o - 32 = o, bo + 46 = 5g. What are the prime factors of g? 2, 5 Suppose g = -3t + 6, -t = 3g + 2g + 12. What are the prime factors of (-1 + t)/(4/76)? 2, 19 Let l = 1 - -2. Suppose lb = -b. Suppose -3h = 5f + 2h, b = -5h - 15. List the prime factors of f. 3 What are the prime factors of 0 + 4/(-2 - -4)? 2 Suppose f = 2f - 16. Suppose 5w = 5l, 0w - 4w + f = 4l. List the prime factors of w/(-7) - 90/(-21). 2 Let y be (20/(-25))/((-2)/5). Suppose 2n = 14 + y. List the prime factors of n. 2 Suppose y + 34 = 5g + 4y, -g = -4y + 7. Suppose 5p - 250 - g = 0. Suppose 4n - p = 1. What are the prime factors of n? 13 Let h(g) = -5g - 3. What are the prime factors of h(-6)? 3 Let l(h) = -16h2 - 16h + 26. Let f(y) = -3y2 - 3y + 5. Let d(v) = -11f(v) + 2l(v). What are the prime factors of d(-5)? 17 Let h = -3 - -4. Let t be -3(h - 15/9). Suppose 4q = -ty + 42, -1 = -q + 2y + 7. List the prime factors of q. 2, 5 Suppose -2z = -t + 5t - 278, t + 3z - 57 = 0. What are the prime factors of t? 2, 3 Let z be (0 + 174/2)1. Suppose 37 = 2v - 5y, -2v + 5y = -4v + z. What are the prime factors of v? 31 Let d(u) = u2 + 13u + 14. Let s be d(-12). Let i(j) = -5js - 3j*3 - 5j - 2j3 + 1 + 6j*3 + 1. List the prime factors of i(6). 2 Let p(a) = -a + 6. Let s(g) = -g + 5. Let i be s(10). What are the prime factors of p(i)? 11 Suppose -2g = 3g - 75. Suppose 3u = 4u + 4a - 10, 0 = -u + 5a - 26. Let i = u + g. List the prime factors of i. 3 Let x(z) = z2 - 8z - 1. Let j be x(8). Let i(v) = -26v3 + 2v + 2. List the prime factors of i(j). 2, 13 List the prime factors of 0 + (-404)/(-8) + 2/(-4). 2, 5 Let b(k) = k*2 - 4k - 2. Let m be -1 + -1 - (1 - 6). Let z be b(m). List the prime factors of z/((0 + 1)/(-1)). 5 Let y = 20 + -11. Let k = y + 8. List the prime factors of k. 17 Let w = 8 - 3. Let a(z) = -wz - 3z + 11 + 10z2 - 3z + z*3 + 0z. What are the prime factors of a(-11)? 11 Suppose 3o + 4 - 13 = 0. Suppose -oi + 6 = -21. What are the prime factors of i? 3 Suppose 12 = -2h - 5i, -2i - 3i - 28 = -2h. Let y(k) = 0 - k3 + k + 5k*2 - 2 - 2k. What are the prime factors of y(h)? 2, 5 Let q(d) = -d*2 + 6d - 4. Let j be (3/2)/((-5)/(-10)). List the prime factors of q(j). 5 Let v = -7 - -10. Suppose -35 = -vy - 2y. Let j = 17 - y. List the prime factors of j. 2, 5 Let h be -2 - (0 + -1 - -1). Let k be 32/2 - (h + 4). Let d = k - 4. What are the prime factors of d? 2, 5 Let v = -29 + 17. Suppose 0o = 2o. Let y = o - v. What are the prime factors of y? 2, 3 Let m = -72 + 110. What are the prime factors of m? 2, 19 Suppose j + 1 - 5 = 0. Suppose 21 + 39 = jf. What are the prime factors of f? 3, 5 Let v(w) be the first derivative of w4/2 - 2w*3/3 - 3w*2/2 - 4w + 2. Let c be v(3). Let t = -13 + c. What are the prime factors of t? 2, 5 Let v(t) = -t*3 - 4t*2 - 2t. Let s be v(-5). Let x = -19 + s. What are the prime factors of x? 2 List the prime factors of 3/9 - (-2276)/12. 2, 5, 19 Let u = -207 - -350. List the prime factors of u. 11, 13 List the prime factors of (-116)/(-6)9/6. 29 Let c(h) = 8h*2 - 2h2 + h2 + 3h - 1. Let g be c(2). Suppose q + 0o = -o + 12, 5q - g = 4o. List the prime factors of q. 3 Let g = 6 - 11. Let h = -2 - g. Suppose -hf - 7 = -52. What are the prime factors of f? 3, 5 Let b(y) = -9y. Let i be b(-2). List the prime factors of i/63 + (-192)/(-14). 2, 7 Let b(z) = -z*3 + 6z*2 - 6z + 3. Let d be b(5). Let f = 0 + d. List the prime factors of f/(0 + 1 + -2). 2 Suppose 32 + 31 = l. Suppose -5b + 72 = -l. What are the prime factors of b? 3 Let p be 5 - 6/(2 - 0). Suppose 3x - f + pf = 52, 4x - 61 = -3f. What are the prime factors of x? 19 Suppose 0 = -4g + 502 + 614. List the prime factors of g. 3, 31 Suppose 45 = v + 5d, 4v - 92 = -5d + 73. Suppose -5 - v = 3b. What are the prime factors of (b/10)/((-3)/32)? 2 Let y be (-1)/(-2)-6 - 6. Let v = y - -15. What are the prime factors of v? 2, 3 Suppose -4u - p + 68 = -0p, -40 = -3u + 2p. Suppose -r + u = -34. Suppose 0f = -5f + r. What are the prime factors of f? 2, 5 Let j = -33 + 58. What are the prime factors of j? 5 Suppose a + 1 - 35 = 0. List the prime factors of a. 2, 17 Let w(o) = -5o - 4. Let s be w(-4). Suppose 3k + 4 = 2u, 0 = 2k - 4u - 0u + s. List the prime factors of k. 2 List the prime factors of (-772)/(-16) + (-1)/4. 2, 3 Suppose 0 = -4j - 4m - m + 194, -4j + 5m + 214 = 0. What are the prime factors of j? 3, 17 Suppose 0 = -2z - 21 + 115. What are the prime factors of z? 47 Let b be (2 + (-2 - -1))0. Suppose b = d - 4 - 10. What are the prime factors of d/6 + (-6)/(-9)? 3 Let c be 82/(-1 - 4/4). Let q = 68 + c. List the prime factors of q. 3 Let p = 112 + 109. List the prime factors of p. 13, 17 What are the prime factors of 123 + 20 - (-1 - (-2 - -3))? 5, 29 Suppose 13 = 3m + 55. Let b = -6 - m. Suppose -5q + b = -3q. List the prime factors of q. 2 Suppose -19 = -2l + 5. List the prime factors of l. 2, 3 Let p(z) be the third derivative of 5z*4/3 + 3z*2. Let f(g) = 13g. Let j(s) = -7f(s) + 2p(s). List the prime factors of j(-1). 11 Let t = 17 - 13. Suppose -to + 17 = -43. List the prime factors of o. 3, 5 Let s be 1 - (-37)/(-2)-2. Let l = s + -26. What are the prime factors of l? 2, 3 Let m(p) = 8p2 + 5p - 1. List the prime factors of m(2). 41 Let k(v) = -11v. Suppose 0 = 2f + 5w - 18, -w = -3 + 1. Suppose 0 = 4j + 8 - f. What are the prime factors of k(j)? 11 Let j = 8 - 8. Suppose 0 = -ja - 4a + 164. Let g = a - 29. What are the prime factors of g? 2, 3 Let n = 7 + 29. Let p be ((-2)/(-2) - 1)/(-2). Suppose 0 = 3x, 2s + ps - 4x = n. List the prime factors of s. 2, 3 Let w(t) = t*3 - 7t*2 - 1. Let r be w(7). List the prime factors of 3/((-1)/(r/1)). 3 Let j = -81 - -154. Let x = j - 51. List the prime factors of x. 2, 11 Let p be (4/(-2))/(-2 + 1). Let b = 3 - p. Suppose b - 24 = -w - 5f, -2f - 22 = -2w. What are the prime factors of w? 13 Suppose -2i + 4 = 5h, h + 3h + 8 = 4i. Suppose -k + 5k + 12 = h. Let t = 20 + k. What are the prime factors of t? 17 List the prime factors of -1((-8)/(-4 + 8) + -193). 3, 5, 13 Let y = -14 + 0. Let o = 28 + y. List the prime factors of o. 2, 7 Let i = 3 + -1. Let w = 7 + i. What are the prime factors of w? 3 Let w be 4 - (0 - (0 - 1)). Let x(g) = 4g3 - 3g*w + 2g*2 + 5g*2 + 9 + 4g. List the prime factors of x(-6). 3, 7 Let c(v) = -3v + 9 + 0v + 4v + 0v. Suppose 0a - 5h = a - 21, 0 = -2a + 2h - 18. What are the prime factors of c(a)? 5 Let r(v) = 8v + 14. List the prime factors of r(16). 2, 71 List the prime factors of ((-18)/(-8))/((-4)/(-32)). 2, 3 Let u = 64 + 293. What are the prime factors of u? 3, 7, 17 Let m(w) = w3 - w + 5. Let k be m(0). Suppose -ka - 5c + c + 22 = 0, -a - 3c = 0. Let v = a - 3. What are the prime factors of v? 3 Suppose 3d + 4i - 220 = -0i, 4i = -4d + 292. What are the prime factors of d? 2, 3 Suppose 1 + 35 = 3n. Suppose z + n = 3z. List the prime factors of z. 2, 3 Suppose -2m = -4m. Suppose m = 3w + 6 + 3. Let d = w + 23. What are the prime factors of d? 2, 5 What are the prime factors of (-1)/2-367 - 1/2? 3, 61 Suppose 3d - 43 = 17. Suppose 0 = u + 3u - d. Suppose 5k + 25 = h, -5h + 35 = -2h - uk. What are the prime factors of h? 5 Suppose -4w = -2y + 82, -2w - 53 = 5y + 6. Let a = 36 + w. What are the prime factors of a? 2, 7 Let u = -4 + 1. List the prime factors of (1 - (7 + u))-2. 2, 3 Let o be (-6)/21 - 205/(-7). Let s be -43/(-12)o. Let d = 43 - s. What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
t t(l) = -2l2 + 8. Let z(b) = 3q(b) - 5t(b). Differentiate z(u) wrt u. -4u Let i(b) = -19b5 - 8b*4 + 8b*2 + 6b. Let h(l) = -6l5 - 3l*4 + 3l*2 + 2l. Let t(c) = -8h(c) + 3i(c). Find the second derivative of t(z) wrt z. -180z3 Suppose 8i - 3i = -5p + 10, i - p - 2 = 0. Let s(o) be the first derivative of -o*i + 0o - 2/3o3 - 2. What is the second derivative of s(b) wrt b? -4 Let h(v) be the second derivative of v9/1512 + v6/360 + v3/6 - v. Let k(f) be the second derivative of h(f). What is the third derivative of k(r) wrt r? 120r*2 Let q(w) = 29w*5 + 3w. Let a(u) = 14u5 + u. Let t(h) = -5a(h) + 3q(h). Find the second derivative of t(v) wrt v. 340v*3 What is the second derivative of -4k*4 - 5k + 6k - 2k*4 wrt k? -72k*2 Suppose 5d + 0 = 20. Suppose 33 - 5 = da + 3c, 5a = 5c. Differentiate -4 - at + 3t + 3 with respect to t. -1 Let n(o) = -20o2 + 11o. Let i(c) = 20c2 - 11c. Let p(r) = 4i(r) + 3n(r). Find the second derivative of p(f) wrt f. 40 Find the first derivative of 4 - 3 + 6 - 6x2 wrt x. -12x Let d(u) be the second derivative of u10/7560 - u7/504 + u*4/3 + 7u. Let k(o) be the third derivative of d(o). Find the third derivative of k(g) wrt g. 240g2 What is the third derivative of o3 - 21o3 + o3 - o2 wrt o? -114 What is the second derivative of -d2 - 11d + 19d - 4d2 wrt d? -10 Let z(h) be the second derivative of -h8/2240 + h7/504 - h4/4 + h. Let f(q) be the third derivative of z(q). What is the third derivative of f(l) wrt l? -18 Let p(n) be the first derivative of 2n*2 + 7n - 9. What is the first derivative of p(u) wrt u? 4 Let p(u) be the third derivative of -23u6/120 + 11u*4/8 - 2u*2. Find the second derivative of p(c) wrt c. -138c Let u(s) be the third derivative of -s9/3024 + s5/20 + s*4/6 + 4s*2. Let m(v) be the second derivative of u(v). Find the first derivative of m(g) wrt g. -20g*3 What is the first derivative of -5z*2 + 17z*2 - 3 + 8 wrt z? 24z Find the second derivative of m - 6m + 20m*5 - 2m wrt m. 400m3 Let d(v) be the third derivative of 5v9/168 + v5/30 - 11v3/6 + 6v*2 + 7v. What is the third derivative of d(h) wrt h? 1800h3 Let t(a) = 2a*2 + 2a - 5. Let r(c) = c*2 - c + 1. Let b(o) = 5r(o) + t(o). What is the second derivative of b(k) wrt k? 14 Let t(y) = 2y2 - 3y. Let l be t(2). Differentiate -4 + 7a4 + 23a*l - 23a*2 wrt a. 28a*3 Let i be 1 - -3 - 10/5. Suppose 0 = 2v - v + 4k + 13, -5v + 7 = ik. What is the derivative of -5 + 2g4 + v - g4 wrt g? 4g3 Suppose 3y - 52 = -4. What is the second derivative of -y + 16 + o - 3o5 wrt o? -60o*3 Let o(c) be the second derivative of 1/7c*7 + 0c*2 + 0 + c - 1/6c*3 + 0c*5 + 0c*4 + 0c*6. What is the second derivative of o(h) wrt h? 120h*3 Let m(i) = 4i - 6. Let d(x) = 12x - 19. Let f(b) = -4d(b) + 14m(b). Differentiate f(p) wrt p. 8 Suppose -17 + 2 = -5g - r, 9 = 3g + 5r. Let l(y) be the second derivative of 2y + 0 - y2 - 1/6y*4 + 0y*g. Find the first derivative of l(p) wrt p. -4p Let v(o) be the third derivative of 11o7/105 + o4/6 - 20o*2. What is the second derivative of v(l) wrt l? 264l*2 Let u(l) = -8l*4 + 10l*2 + 4l - 4. Let v(f) = 8f4 - 11f*2 - 3f + 3. Let p(x) = 3u(x) + 4v(x). What is the third derivative of p(a) wrt a? 192a Let j = 4 - 2. Let v(g) = g3 + 4g*2 - 5g + 4. Let k be v(-5). What is the second derivative of -2p4 + kp - jp + 0p*4 wrt p? -24p*2 Suppose -2 = -2a - 2r - 4, -a = -3r - 11. Differentiate -2 + aw3 - 7 - 2w3 + w3 wrt w. 3w2 Let t(w) = w2 + w + 1. Let z(x) = 21x*3 + 6x*2 - 5x + 6. Let f(a) = -6t(a) + z(a). Find the second derivative of f(j) wrt j. 126j Let b(f) be the third derivative of f6/60 + f5/20 + 17f2. What is the third derivative of b(n) wrt n? 12 Let f(k) be the second derivative of k4/3 - k3/6 + k2/2 - 4k. Let h be f(1). Differentiate 4 + 4c + 4c - hc wrt c. 4 Let f(v) be the second derivative of -1/3v*3 + 0 - 3/2v*2 - v. Differentiate f(j) wrt j. -2 Let y be ((-3)/2)/((-27)/36). Find the first derivative of 3 - 3q - q*y + 3q wrt q. -2q Let s(a) be the first derivative of 46a*5/5 + 40a - 34. What is the derivative of s(d) wrt d? 184d3 Let y(c) = 61c*5 + 13c*3 - 101c*2. Let r(s) = 31s*5 + 6s*3 - 50s*2. Let b(m) = -13r(m) + 6y(m). Find the third derivative of b(v) wrt v. -2220v*2 Let t(k) be the first derivative of -16k*3/3 + 5k - 17. What is the first derivative of t(r) wrt r? -32r What is the third derivative of m - 6m*2 - m - 109m*3 + 118m*3 wrt m? 54 Let u(i) be the second derivative of 19i*4/12 + 4i*3/3 + 11i. What is the second derivative of u(q) wrt q? 38 Let c(l) be the second derivative of 0l2 + 0l*5 + 0 + 0l*3 + 5/12l*4 + 4l - 1/10l6. What is the third derivative of c(a) wrt a? -72a Let v(l) = -2l - 5. Let i be v(-5). Suppose iu - 2 = 23. What is the third derivative of -2j5 - j2 + j6 + 2j*u wrt j? 120j*3 Suppose -55 = -k - 4k. Find the third derivative of 3o2 + ko*4 - 5o*4 - 2o*5 - 6o*4 wrt o. -120o*2 Let b(v) be the first derivative of 6v5/5 + v3/3 + 1. Find the third derivative of b(m) wrt m. 144m Differentiate -3 + 4w - 11 - 1 - w with respect to w. 3 Let f = 54 - 28. Let w be 4/f - 72/(-39). Find the second derivative of -2y + 2y - wy3 - y + 0y*3 wrt y. -12y What is the derivative of -9 - 9q2 + 9q*2 + 33 + 7q*4 wrt q? 28q*3 Let x(g) be the first derivative of -7g*5/5 - 8g + 3. Find the first derivative of x(p) wrt p. -28p3 Suppose -2v - v = -12. Suppose vd + d = 10. Find the second derivative of -3t + dt3 - t4 + 0t*3 - 2t*3 wrt t. -12t*2 Let t = 5 - 2. Let y(a) = 7a*3 + 4a + 4. Let u(l) = -6l3 + l2 - 3l - 3. Let j(v) = ty(v) + 4u(v). What is the third derivative of j(x) wrt x? -18 Let s(f) be the second derivative of f*5/5 - 3f*2/2 - 10f. Find the first derivative of s(x) wrt x. 12x2 What is the second derivative of 11g*3 + 0g - 3g3 + 2g wrt g? 48g Let n(k) = -k3 + 2k*2 + 4k. Let j be n(3). What is the second derivative of h - jh5 - h - h + 2h*5 wrt h? -20h*3 Suppose -12 = -4n + 2n. Differentiate 2 - 8u + nu + 0u wrt u. -2 Suppose -2s = u, s - 17 = 4u + 1. What is the third derivative of s - 2a5 - a2 + 2a*2 - 2 wrt a? -120a*2 Let r(n) be the first derivative of -1/2n*2 + 2 + 2n. What is the derivative of r(a) wrt a? -1 Let i(s) = -19s2 + 16s. Let z(q) = -39q2 + 32q. Let v(j) = -7i(j) + 3z(j). What is the second derivative of v(o) wrt o? 32 Let r(l) = l5 + l4 - l*2 - l. Let n(x) = -39x*5 - 6x*4 + 37x*2 + 6x. Let g(a) = n(a) + 6r(a). What is the third derivative of g(o) wrt o? -1980o*2 Let a be (-2 - -2)/(-10 - -8). Let l(d) be the second derivative of d + 0 - 1/10d*5 + 0d*2 + ad*4 - 2/3d*3. Find the second derivative of l(p) wrt p. -12p Let j(b) be the second derivative of -9b8/56 + 7b*4/12 + 5b. Find the third derivative of j(q) wrt q. -1080q3 Suppose -5c - w + 61 = 0, 0 = -2c - w + 13 + 9. Suppose 0 = -2o - 3z + c, o - 8 = -z - z. Find the second derivative of -od*5 + 0d*5 + 0d + 3d wrt d. -40d*3 Let d = 6 + -1. Let r(a) = 3a*2 + 4. Let q(c) = 4c*2 + 6. Let y(v) = dq(v) - 8r(v). Differentiate y(x) wrt x. -8x What is the third derivative of 709f4 + 5f - 3f2 - 56f*6 - 709f*4 wrt f? -6720f*3 Let c(a) = 2a*3 + 0a2 - a3 - 1 - a*2 + 2a*2. Let g(b) = 3b3 + b2 - 2. Let t(w) = 2c(w) - g(w). What is the third derivative of t(z) wrt z? -6 Let k(j) be the first derivative of -2j*3 - 4j2 + 4. Find the second derivative of k(t) wrt t. -12 Let h(g) = -g3 + g*2 + 1. Let l(p) = -4p*3 - 2p*2 - p - 2. Let i = 8 + -6. Let r(s) = ih(s) + l(s). What is the second derivative of r(y) wrt y? -36y Let d be (2/(-4))/((-1)/(-6)). Let t(m) = 4m*2 + 11. Let w(k) = -4k*2 - 10. Let h(s) = dw(s) - 2t(s). Differentiate h(y) with respect to y. 8y What is the second derivative of -2d2 + 6d*2 + 11d - 58 + 58 wrt d? 8 Let l be 3/(-2)(-24)/9. Differentiate -6 + 0b - l*b + 2 with r	{ "pile_set_name": "DM Mathematics" }
bebqb. What is prob of sequence qr? 1/40 Three letters picked without replacement from {f: 1, p: 6, s: 1, n: 7}. Give prob of sequence pfn. 1/65 Calculate prob of sequence ww when two letters picked without replacement from wknwtbwkbtwnk. 1/13 Two letters picked without replacement from {v: 2, d: 1}. What is prob of sequence vv? 1/3 Two letters picked without replacement from aanna. Give prob of sequence na. 3/10 Two letters picked without replacement from {k: 1, q: 1, u: 1, m: 2, z: 1, w: 1}. Give prob of sequence uu. 0 Calculate prob of sequence ptte when four letters picked without replacement from ppptetppppppppptppep. 1/646 What is prob of sequence iinn when four letters picked without replacement from {n: 2, y: 7, i: 3, j: 8}? 1/9690 What is prob of sequence vr when two letters picked without replacement from {q: 10, t: 5, r: 3, v: 2}? 3/190 Two letters picked without replacement from {u: 3, b: 11, e: 3, m: 3}. Give prob of sequence ue. 9/380 What is prob of sequence demd when four letters picked without replacement from {d: 3, e: 7, m: 4}? 1/143 What is prob of sequence aa when two letters picked without replacement from caiiiaiaaci? 6/55 What is prob of sequence lvqv when four letters picked without replacement from {l: 4, v: 3, q: 9}? 9/1820 Calculate prob of sequence yku when three letters picked without replacement from kkkkhukukuhy. 3/220 Three letters picked without replacement from {t: 1, y: 1, l: 3, j: 1, n: 4, d: 2}. Give prob of sequence nny. 1/110 What is prob of sequence enam when four letters picked without replacement from nmafe? 1/120 Calculate prob of sequence yrz when three letters picked without replacement from {n: 1, r: 1, z: 3, y: 2, d: 4, o: 4}. 1/455 Two letters picked without replacement from {z: 2, m: 1, l: 1, u: 2, b: 1, c: 1}. What is prob of sequence mb? 1/56 Four letters picked without replacement from fkwkkkkwwkwwfwffk. What is prob of sequence ffwf? 3/1190 Two letters picked without replacement from dmmmyypympmqpqpyygyy. What is prob of sequence gm? 1/76 Three letters picked without replacement from vycy. Give prob of sequence yvc. 1/12 Calculate prob of sequence vvbh when four letters picked without replacement from bhbvvbbh. 1/105 Three letters picked without replacement from xyyyyyyxxyyyxyyxydyy. What is prob of sequence xdx? 1/342 What is prob of sequence tjj when three letters picked without replacement from jathjttttatoooh? 2/455 What is prob of sequence jjju when four letters picked without replacement from {h: 1, r: 3, j: 3, i: 3, d: 2, u: 1}? 1/2860 What is prob of sequence re when two letters picked without replacement from eoerrooee? 1/9 Calculate prob of sequence qqnq when four letters picked without replacement from {i: 2, q: 3, n: 4, a: 1}. 1/210 Calculate prob of sequence hryx when four letters picked without replacement from yxerh. 1/120 Three letters picked without replacement from xjzgpgz. Give prob of sequence zjx. 1/105 Two letters picked without replacement from {m: 2, b: 5, w: 3}. Give prob of sequence bb. 2/9 What is prob of sequence ozo when three letters picked without replacement from zzozzzzzzzoz? 1/66 Four letters picked without replacement from ppiiipdnndiid. Give prob of sequence diip. 3/286 Three letters picked without replacement from hhj. What is prob of sequence hjh? 1/3 Three letters picked without replacement from nneeee. Give prob of sequence nee. 1/5 Three letters picked without replacement from sljsssilw. Give prob of sequence lil. 1/252 Three letters picked without replacement from sbbbbbbsbsssssbssbs. What is prob of sequence ssb? 45/323 Three letters picked without replacement from uduuuduuuuuuuuuuuuu. What is prob of sequence uuu? 40/57 Two letters picked without replacement from zzoozzzozzzzzzozzzzo. What is prob of sequence zz? 21/38 Two letters picked without replacement from {a: 3, v: 1, m: 4}. What is prob of sequence mm? 3/14 Two letters picked without replacement from {m: 2, o: 4}. What is prob of sequence mm? 1/15 Two letters picked without replacement from {c: 2, g: 2, l: 1}. Give prob of sequence cl. 1/10 Two letters picked without replacement from {e: 1, s: 12}. Give prob of sequence ss. 11/13 Calculate prob of sequence bl when two letters picked without replacement from {l: 4, f: 4, s: 1, v: 2, t: 1, b: 2}. 4/91 What is prob of sequence zzoo when four letters picked without replacement from oozooz? 1/15 Four letters picked without replacement from qzdhhqrhddhzhkkzkddd. Give prob of sequence kzqk. 1/3230 Two letters picked without replacement from {z: 1, l: 1, c: 2, d: 10, g: 4}. Give prob of sequence zc. 1/153 Two letters picked without replacement from {p: 1, w: 1, i: 1, u: 2}. Give prob of sequence pi. 1/20 Two letters picked without replacement from jaj. Give prob of sequence aj. 1/3 Two letters picked without replacement from stthhssphpstpss. What is prob of sequence ss? 1/7 What is prob of sequence vnnv when four letters picked without replacement from {n: 2, v: 2}? 1/6 Calculate prob of sequence tt when two letters picked without replacement from tttxppxptxx. 6/55 Three letters picked without replacement from {o: 11, k: 1, q: 3}. What is prob of sequence koo? 11/273 Calculate prob of sequence eee when three letters picked without replacement from jeejkee. 4/35 Four letters picked without replacement from sglclgzgcgsgczzl. What is prob of sequence zlzc? 9/7280 Three letters picked without replacement from {f: 3, s: 4, v: 4}. What is prob of sequence fvs? 8/165 What is prob of sequence kqbb when four letters picked without replacement from bmembmmbbkmxqbmmkkem? 1/1938 Four letters picked without replacement from ddededeeeedddded. Give prob of sequence dddd. 9/130 Two letters picked without replacement from utptqllruupu. What is prob of sequence tq? 1/66 Three letters picked without replacement from {w: 5, t: 13}. What is prob of sequence www? 5/408 Two letters picked without replacement from {l: 3, e: 9, j: 4}. Give prob of sequence ll. 1/40 Calculate prob of sequence rri when three letters picked without replacement from rrrrrrri. 1/8 What is prob of sequence ccm when three letters picked without replacement from {c: 14, m: 5}? 455/2907 Calculate prob of sequence ad when two letters picked without replacement from {l: 5, s: 5, d: 3, e: 1, a: 5}. 5/114 Four letters picked without replacement from {x: 2, v: 1, k: 7, a: 2, u: 7}. What is prob of sequence uxkx? 49/46512 What is prob of sequence nuw when three letters picked without replacement from {u: 4, n: 2, w: 5}? 4/99 Four letters picked without replacement from {z: 7, f: 12}. Give prob of sequence zzzf. 35/1292 Two letters picked without replacement from {m: 2, l: 7, f: 4}. What is prob of sequence fl? 7/39 What is prob of sequence kxx when three letters picked without replacement from {n: 1, k: 4, v: 1, x: 2, z: 2}? 1/90 Two letters picked without replacement from {b: 6, c: 3, o: 2, v: 8}. What is prob of sequence cv? 4/57 Four letters picked without replacement from {x: 1, j: 4, n: 1, a: 1, m: 2}. Give prob of sequence majj. 1/126 Calculate prob of sequence hq when two letters picked without replacement from dcdchhpchhdhcqd. 1/42 Two letters picked without replacement from qqllqqq. Give prob of sequence qq. 10/21 Calculate prob of sequence nw when two letters picked without replacement from {n: 7, w: 1}. 1/8 Calculate prob of sequence zpz when three letters picked without replacement from {p: 1, l: 1, z: 5, q: 11, g: 2}. 1/342 What is prob of sequence vx when two letters picked without replacement from vnovvonvvxxexvn? 3/35 What is prob of sequence osj when three letters picked without replacement from {o: 4, j: 2, s: 1, e: 9}? 1/420 Three letters picked without replacement from {e: 1, s: 4, z: 3, t: 5}. What is prob of sequence stt? 20/429 What is prob of sequence yyzz when four letters picked without replacement from {l: 1, y: 11, z: 6}? 55/1224 Three letters picked without replacement from zuu. What is prob of sequence zuu? 1/3 Calculate prob of sequence byx when three letters picked without replacement from idxdsybidyi. 1/495 Two letters picked without replacement from {w: 2, y: 1}. What is prob of sequence ww? 1/3 What is prob of sequence jii when three letters picked without replace	{ "pile_set_name": "DM Mathematics" }
of a millennium? 100 What is three fifths of a litre in millilitres? 600 How many minutes are there in eleven quarters of a hour? 165 Convert 5709.363 millilitres to litres. 5.709363 How many nanograms are there in 32/5 of a microgram? 6400 What is 8.710534 days in minutes? 12543.16896 What is 64942.722 seconds in hours? 18.039645 Convert 13.1666 litres to millilitres. 13166.6 How many months are there in 0.5345849 decades? 64.150188 How many microseconds are there in 3/10 of a millisecond? 300 What is 4654.192 seconds in nanoseconds? 4654192000000 What is 57/2 of a litre in millilitres? 28500 How many nanograms are there in 11/2 of a microgram? 5500 Convert 433.455l to millilitres. 433455 Convert 0.3178502 millennia to decades. 31.78502 What is 1/5 of a minute in seconds? 12 What is 5.14328 kilograms in milligrams? 5143280 What is 5/4 of a century in months? 1500 What is one quarter of a second in milliseconds? 250 What is 5/6 of a millennium in months? 10000 What is thirteen fifths of a litre in millilitres? 2600 What is five sixths of a hour in seconds? 3000 Convert 535755.1 centuries to decades. 5357551 What is four sevenths of a week in minutes? 5760 How many millilitres are there in 2/125 of a litre? 16 Convert 456265.1m to centimeters. 45626510 How many nanograms are there in nineteen quarters of a microgram? 4750 How many millilitres are there in 3/25 of a litre? 120 What is 7/4 of a kilometer in meters? 1750 What is three eighths of a milligram in micrograms? 375 What is 76132.2g in kilograms? 76.1322 What is 84.6477513 microseconds in weeks? 0.00000000013995990625 How many millimeters are there in 74/5 of a centimeter? 148 What is 1.214797um in kilometers? 0.000000001214797 How many milligrams are there in 6935.345t? 6935345000000 How many meters are there in 85625.7um? 0.0856257 What is 1/10 of a kilometer in meters? 100 What is 3/5 of a litre in millilitres? 600 How many years are there in 1/10 of a millennium? 100 Convert 5.880939 months to centuries. 0.0049007825 What is 1/30 of a day in seconds? 2880 What is 1903.419mm in nanometers? 1903419000 What is 2.33531 micrometers in millimeters? 0.00233531 How many millilitres are there in 25/2 of a litre? 12500 Convert 12858.91 kilograms to grams. 12858910 What is 61.36519 millennia in centuries? 613.6519 What is 16/15 of a decade in months? 128 What is 2.416597 weeks in hours? 405.988296 How many kilograms are there in 0.7273247ug? 0.0000000007273247 Convert 83768.21t to nanograms. 83768210000000000000 How many millimeters are there in 17/10 of a meter? 1700 What is thirteen fifths of a litre in millilitres? 2600 How many seconds are there in 77/3 of a minute? 1540 Convert 48.53067l to millilitres. 48530.67 How many months are there in 831.0369 millennia? 9972442.8 How many kilometers are there in 0.7423814nm? 0.0000000000007423814 What is 291.8754s in minutes? 4.86459 What is 1/9 of a day in seconds? 9600 How many nanoseconds are there in one twentieth of a microsecond? 50 How many nanoseconds are there in 806.7432s? 806743200000 Convert 143.2376568 microseconds to weeks. 0.00000000023683475 How many millilitres are there in 21/8 of a litre? 2625 How many millimeters are there in eleven halves of a meter? 5500 How many nanograms are there in 3/10 of a microgram? 300 What is fifty-nine thirds of a day in minutes? 28320 Convert 254.7581 litres to millilitres. 254758.1 What is 6/25 of a milligram in micrograms? 240 What is 178.6577 decades in centuries? 17.86577 How many months are there in 3/40 of a century? 90 How many micrograms are there in 2.733t? 2733000000000 How many millilitres are there in 45.23876 litres? 45238.76 How many months are there in 11/4 of a century? 3300 How many months are there in 212.7297 centuries? 255275.64 What is 0.4963165us in seconds? 0.0000004963165 What is 55.41038t in kilograms? 55410.38 What is 73690.29 years in decades? 7369.029 How many millilitres are there in 51248.45l? 51248450 Convert 463208.9 decades to centuries. 46320.89 How many millilitres are there in 1/5 of a litre? 200 What is 715868.1 months in decades? 5965.5675 How many micrograms are there in one quarter of a milligram? 250 How many years are there in fourty-two fifths of a millennium? 8400 How many centuries are there in 3.283611 months? 0.0027363425 How many micrometers are there in three eighths of a millimeter? 375 How many meters are there in twenty-seven fifths of a kilometer? 5400 What is 0.054179 hours in milliseconds? 195044.4 How many grams are there in ninety-one quarters of a kilogram? 22750 How many millilitres are there in three fifths of a litre? 600 How many nanoseconds are there in fourty-six fifths of a microsecond? 9200 How many nanograms are there in 4236.493 milligrams? 4236493000 What is 1/10 of a minute in milliseconds? 6000 How many millilitres are there in one quarter of a litre? 250 What is 0.3622638 decades in centuries? 0.03622638 What is 40.9005576 minutes in weeks? 0.004057595 How many litres are there in 4.26454 millilitres? 0.00426454 What is 367523.3 minutes in seconds? 22051398 Convert 9.805091 centimeters to millimeters. 98.05091 What is 11/4 of a millennium in years? 2750 How many kilometers are there in 86.29981nm? 0.00000000008629981 Convert 80.51546l to millilitres. 80515.46 How many millilitres are there in 61.08175l? 61081.75 How many months are there in fifty-one eighths of a century? 7650 Convert 2.531891ml to litres. 0.002531891 How many microseconds are there in 962.2156 minutes? 57732936000 What is eleven halves of a millennium in months? 66000 How many nanoseconds are there in 458409.6 hours? 1650274560000000000 What is 3/5 of a minute in seconds? 36 How many centimeters are there in 8003.374nm? 0.0008003374 What is three tenths of a century in years? 30 How many weeks are there in 1312.27047 milliseconds? 0.000002169759375 What is twenty-six fifths of a second in milliseconds? 5200 How many months are there in 27.82512 years? 333.90144 What is 967.496 centuries in millennia? 96.7496 What is thirteen eighths of a microgram in nanograms? 1625 How many millilitres are there in 19/4 of a litre? 4750 What is 0.9195263ml in litres? 0.0009195263 How many millimeters are there in thirteen fifths of a centimeter? 26 What is 3/25 of a kilogram in grams? 120 What is 53/5 of a milligram in micrograms? 10600 How many centimeters are there in 25/2 of a meter? 1250 How many micrograms are there in 1/64 of a gram? 15625 What is twenty-nine fifths of a litre in millilitres? 5800 Convert 43.10249 nanoseconds to microseconds. 0.04310249 How many months are there in 27/5 of a decade? 648 What is 112774.2 micrometers in centimeters? 11.27742 How many nanograms are there in 19/4 of a microgram? 4750 How many seconds are there in eleven quarters of a minute? 165 How many millimeters are there in 0.7728234 centimeters? 7.728234 How many seconds are there in 61/2 of a minute? 1830 How many months are there in 1/4 of a century? 300 What is 33/5 of a litre in millilitres? 6600 What is 0.2779289kg in milligrams? 277928.9 What is one sixth of a hour in seconds? 600 How many micrograms are there in fifteen quarters of a milligram? 3750 How many milligrams are there in 38731.43 grams? 38731430 Convert 3.346201us to seconds. 0.000003346201 What is 2/125 of a litre in millilitres? 16 How many micrograms are there in 983092.6mg? 983092600 How many millennia are there in 6.647635 years? 0.006647635 How many millilitres are there in 1/10 of a litre? 100 What is fourty-eight fifths of a centimeter in millimeters? 96 What is 11/2 of a gram in milligrams? 5500 How many micrometers are there in 31/5 of a centimeter? 62000 What is 7318.783ns in microseconds? 7.318783 Convert 8.578529km to centimeters. 857852.9 What is 0.1885414 centuries in years? 18.85414 What is 66.85279 decades in months? 8022.3348 Convert 634708.305 seconds to weeks. 1.0494515625 Convert 35965.4 microseconds to seconds. 0.0359654 How many milliseconds are there in 6/25 of a minute? 14400 What is 7/3 of a day in hours? 56 Convert 375068.5 decades to centuries. 37506.85 How many millimeters are there in one twentieth of a meter? 50 How many micrometers are there in three eighths of a millimeter? 375 Co	{ "pile_set_name": "DM Mathematics" }
et j(k) = 5k2 - 3k + 0 + k*2 - 3 - 4k*3. Let c(y) = rj(y) + 3v(y). Factor c(t). -t2(t - 3) Let r be 128 + (-5 - (-30)/2). Let y be r/(-23) + (6 - 0). Factor 0 + yp - 2/3p*4 - 2p*2 - 8/3p*3. -2p*2(p + 1)(p + 3)/3 Let d(v) be the second derivative of -v6/15 + 6v*5/5 - 25v*4/3 + 28v*3 - 45v*2 - v + 1605. Factor d(l). -2(l - 5)(l - 3)2(l - 1) Let i(m) = -m*3 + 11m*2 + 18m - 68. Let z be i(12). Suppose 300v2 + 350v*2 + 50v*3 - 785v*2 - 5v*z + 90v = 0. What is v? 0, 1, 3, 6 Let x(u) = -60u2 + 43208u - 38880008. Let n(l) = 22l2 - 14403l + 12960003. Let r(s) = 8n(s) + 3x(s). Factor r(c). -4(c - 1800)2 Let y(x) = 7x*3 - 45x*2 - 7x. Let k(v) = 20v3 - 134v*2 - 28v. Let m(s) = -5k(s) + 14y(s). Find r such that m(r) = 0. -1, 0, 21 Suppose -u + 3 = k + 2, -2k + 2 = 3u. Let w be (29 + -1)1k. Let 696x5 + 4x*2 - 716x*5 - 10x - 12x4 + 8x*2 + 2x + wx3 = 0. What is x? -1, 0, 2/5, 1 Let z(n) be the second derivative of -n4/18 - 17n*3/9 - 52n*2/3 - 2114n. Determine y, given that z(y) = 0. -13, -4 Let h be 3/(-6)(90/(-36) + 1). Let j(k) be the second derivative of -hk*2 - 21k - 5/24k3 + 0 + 1/80k*5 + 1/24k*4. Factor j(i). (i - 2)(i + 1)(i + 3)/4 Suppose -2s = 2c + 2, 7c - 2c - 2s - 2 = 0. Let t(p) be the first derivative of -3/25p5 - 13 + cp + 1/5p3 + 3/10p*2 - 3/20p*4. Factor t(g). -3g(g - 1)(g + 1)*2/5 Let z(b) be the first derivative of 0b*2 + 4/51b*3 - 2/17b - 186 + 0b4 - 2/85b5. What is m in z(m) = 0? -1, 1 Let p(r) be the first derivative of r4/8 + 16r3/3 + 285r*2/4 + 225r - 10979. What is d in p(d) = 0? -15, -2 Let d(h) be the second derivative of 0h2 - 2h*3 - 27h - 17/16h4 + 0 - 3/80h*5. Determine a so that d(a) = 0. -16, -1, 0 Let u(w) = 14w*3 - 93w*2 + 366w - 607. Let h(f) = -15f3 + 95f*2 - 365f + 605. Let i(x) = -9h(x) - 10u(x). Factor i(n). -5(n - 5)3 Let y(i) be the first derivative of -9i*4/4 - 233i*3/2 - 1767i*2 - 5415i/2 - 22. What is k in y(k) = 0? -19, -5/6 Let z(h) = -h3 - h2 + h. Let l be (-6)/822/(-33)-12. Let b(k) = 7k3 + 21k*2 - 6k. Let u(y) = lz(y) - b(y). Factor u(f). -f2(f + 15) Suppose 0 = 2957o - 2938o - 57. Let 1/5po + 2/5 + p + 4/5p*2 = 0. Calculate p. -2, -1 Suppose -74 + 1024 = 2z. Let v = -471 + z. Find q such that 5/3q2 - 7/3q*5 - 5/3q*v + 0 - 2/3q + 3q3 = 0. -1, 0, 2/7, 1 Let y(o) be the second derivative of -o5/30 + 21o*4/2 - 2813o*3/3 - 47045o*2/3 + 3871o. Factor y(l). -2(l - 97)2(l + 5)/3 Let d be ((-250)/(-200))/(90/96). Factor 10/3v2 + 8/3v*3 - dv - 2. 2(v + 1)2(4v - 3)/3 Let y be 21/(-16) + (796898/3344 + -28 - 24). Factor -2/11p2 - y - 128/11p. -2(p + 32)2/11 Let s(r) be the second derivative of -7/10r*4 - 144/5r*2 - 162r + 3/100r5 + 0 + 32/5r*3. Determine i, given that s(i) = 0. 4, 6 Let w be (-38285)/57 + (15/(-9))/5. Let c = 4724/7 + w. Factor -8/7 + cy + 12/7y2. 4(y + 2)(3y - 1)/7 Let b(t) be the second derivative of t*5/5 + 25t*4/3 + 8t*3 - 576t*2 + t + 453. Let b(i) = 0. Calculate i. -24, -4, 3 Let n(y) = 5y*2 - 1183y + 59537. Let p be n(164). Let l = -32 - -65/2. Factor -2k + 0 - lk*p - 3k*4 - 6k*2 - 13/2k*3. -k(k + 1)*2(k + 2)*2/2 Factor -43q*2 - 54q*2 + 544 - 110 + 99q*2 - 436q. 2(q - 217)(q - 1) Let z(g) be the second derivative of -g*6/90 - 13g*5/15 - 92g*4/9 - 352g*3/9 - 69g + 5. Suppose z(t) = 0. Calculate t. -44, -4, 0 Let d be (((-1275)/12)/(-25))/((-10)/(10400/(-110))). What is t in -50/11t3 + 282/11t*2 + 2/11t*4 - 676/11 + dt = 0? -2, 1, 13 Suppose -18 + 282 = 4t. Suppose 25j - t = -8j. Suppose -2/15i*4 + 0 + 0i*3 + 2/15i*j + 0i = 0. Calculate i. -1, 0, 1 Let u = 7578/413 + -1032/59. Let x be (-1)/(1/4-2). What is k in -uk*4 - 16/7k*3 - 2k*x - 4/7k + 0 = 0? -1, -2/3, 0 Let k be 2/(3522/(-1764) + 2). Factor -k - 13h3 + 29h*3 + 672h - 87h2 - 13h*3. 3(h - 14)*2(h - 1) Let n(q) be the third derivative of q*6/40 + 11q*5/20 + 5q*4/2 - 16q*3 + 1347q*2. Suppose n(i) = 0. Calculate i. -8, -4, 1 Suppose -2x = 5 - 11. Suppose -15 = -3m + 2g, 6 = -2m + xg + 21. Factor 3/4q - 1/2 + 0q*2 - 1/4qm. -(q - 1)2(q + 2)/4 Suppose -13 = 4c - 21. Factor 3z5 - 25z + 13z + 5z + 10z - 12z*c - 12z*4 + 18z*3. 3z(z - 1)4 Let u be (91/(-77))/(128/(-176)). Let r(n) be the first derivative of -un*2 + 3/2n - 1/16n4 + 2/3n*3 - 24. Factor r(v). -(v - 6)(v - 1)*2/4 Suppose 5b = -2j - 1453, 5j + 3374 + 299 = b. Let i = j - -738. Factor -2p2 - i - 1/4p*3 - 5p. -(p + 2)*2(p + 4)/4 Let u(i) be the first derivative of 14/13i2 + 2/39i*3 + 0i + 35. Find l, given that u(l) = 0. -14, 0 Let u(p) be the second derivative of p7/1890 - p6/30 + 17p5/90 + 23p*4/12 + 60p. Let y(x) be the third derivative of u(x). Factor y(m). 4(m - 17)(m - 1)/3 Let a be 41 - -66/9. Let n = a + -30. Factor 4h + 4h2 - 7h - 2 - 14 + nh. 4(h - 1)(h + 4) Let t(a) = -a. Let l(d) = 5d*2 - 6d - 20. Let y(v) = -v*2 + 3v + 44. Let q be y(0). Suppose -4s = q - 68. Let i(h) = st(h) - l(h). Factor i(g). -5(g - 2)(g + 2) Determine w so that 38829w + 40373w - 1050w3 + 1052w*3 - 796w*2 = 0. 0, 199 Let q be 12/4214/602. Let i(z) be the second derivative of -11z + 2/15z3 + 0z*2 + 0 + 33/100z*5 + 1/3z*4 + qz*6 + 2/105z*7. Factor i(p). p(p + 2)*2(2p + 1)2/5 Let n = -46 - -50. Factor -2x*4 + 57x*5 + 0x*n - 55x*5. 2x*4(x - 1) Suppose 882d2 - 4310d + 2/5d4 + 7100 - 314/5d*3 = 0. Calculate d. 5, 142 Let z(c) be the first derivative of -1/8c*4 - 4/9c*3 - 7/12c*2 - 1/3c - 20. Factor z(v). -(v + 1)*2(3v + 2)/6 Let a be (8265/(-60610))/(8/(-66)). Find i such that -87/8i*2 + 57/8i + 39/8i3 - a = 0. 3/13, 1 Let j(d) be the second derivative of 88d + 0 + 5/48d4 - 1/20d*5 - 1/12d*3 + 1/120d*6 + 0d*2. Suppose j(c) = 0. What is c? 0, 1, 2 Factor 13k - 18k2 - 20k + 3k. -2k(9k + 2) Let g = -387119/30 - -12904. Let b(a) be the second derivative of 4/9a4 + 13/9a*3 + ga*5 - 7a + 0 + 2a2. Factor b(m). 2(m + 1)*2(m + 6)/3 Let o(j) be the second derivative of -j6/200 - j5/20 - 3j4/20 + 29j*2 + 126j. Let c(n) be the first derivative of o(n). Factor c(h). -3h(h + 2)(h + 3)/5 Suppose -16u + 17u - 194 = 0. Suppose u = -r + 204. Factor 5/2i*2 + 10 + ri. 5(i + 2)2/2 Let j be (2/(-2))/((-14)/4). Let w = 2018139 + -2018136. Factor -2/7a*2 + 0a - 2/7aw + 0 + ja*4 + 2/7a*5. 2a*2(a - 1)(a + 1)2/7 Factor 3i*3 - 25i*2 - 252666 + 252666 + 66i - 44i2. 3i(i - 22)(i - 1) Factor -102g2 - 7g*3 - 22g*2 + 29g*2 - 545g*2 + 2g*3 - 1875g. -5g(g + 3)(g + 125) Let c(a) be the second derivative of a4/96 + 23a*3/24 - 1071a*2/16 + 9582a. Let c(t) = 0. What is t? -63, 17 What is m in 117/7m + 34 - 1/7m*2 = 0? -2, 119 Find x such that -54x*2 - 3/4x*5 + 1/2x*4 + 81/4x*3 + 0 + 27x = 0. -6, 0, 2/3, 3 Let x be (-17172)/306 + (-4)/(-34). Let s be (60/45)/((x/12)/(-1)). Let -10/7o + 8/7 + so*2 = 0. What is o? 1, 4 Solve 5/2m + 0 + 3m2 + 1/2m3 = 0. -5, -1, 0 Let c(p) be the second derivative of p6/6 - 21p5 + 415p*4/12 + 9243p. What is l in c(l) = 0? 0, 1, 83 Let f be (4/8)/(-25 + 46). Let t(o) be the second derivative of 5/21o3 + 0 + 6/7o*2 + 19o - fo4. Let t(h) = 0. What is h? -1, 6 Let q be ((-300)/24 - -13)8. Let v(y) be the second derivative of -5/12yq + 5/6y*3 + 0 - 13y + 5y2. Factor v(i). -5(i - 2)(i + 1) Let x(d) be the second derivative of d4/66 - 256d*3/33 + 255d*2/11 - 1551d. Factor x(q). 2(q - 255)(q - 1)/11 Suppose -40s - 45s + 44s = 0. Let a(m) be the second derivative of sm*2 + 0 - 1/3m*3 + 1/3m*4 - 1/40m*5 + 21m - 1/20m6. Factor a(k). -k(k - 1)(k + 2)(3k - 2)/2 Let k(x) be the first derivative of 9x*4/4 + 628x*3/3 + 481x*2/2 - 138x - 352. Solve k(y) = 0 for y. -69, -1, 2/9 Determine m, given that -21m2 - 96 - 3/4m*3 + 93m = 0. -32, 2 Determine x, given that -1/4x4 - 1/2x*3 + 0x*2 + 1/4 + 1/2x = 0. -1, 1 Suppose 9*l - 4	{ "pile_set_name": "DM Mathematics" }
-z*5/15 - 6z*2. Let g(r) be the third derivative of 5r4/8 + r2 - 40r. Determine g(t(n)). -60n*2 Let f(a) = -4a - 7a + 9a. Let y(c) = 3532 - c*2 - 3c*2 - 3542 + 2c*2. What is y(f(v))? -8v*2 - 10 Let t(z) = 3z*2 + 3. Let k(c) = -1. Let j(d) = 3k(d) + t(d). Let p(r) = 33r2 + 24r*2 - 53r*2. Determine p(j(v)). 36v*4 Suppose 0 = 88a - 91a. Let s(u) be the second derivative of -1/3u*3 - 5u + 0u2 + a. Let z(j) = -6j. What is s(z(l))? 12l Let v(k) be the second derivative of -7k*3/6 + 281k. Let q(l) = 12l2. Calculate q(v(j)). 588j*2 Let g(l) = -113l*2 + 63l*2 - 1 + 1 + 54l*2. Let x(w) = 9w*2. Give x(g(i)). 144i*4 Suppose 6j = 20 - 8. Let k(y) = 0y2 + 9y*j - 11y*2. Let p(d) = 11d. Determine p(k(z)). -22z2 Let m(s) = 192s*2. Let c(n) = 4410n. Calculate m(c(i)). 3734035200i2 Let d(n) = 327n*2 - 5n - 13. Let k(q) = -2q. What is k(d(z))? -654z*2 + 10z + 26 Let l(h) = 0 + 112701h + 0 - 112699h. Let r(c) be the third derivative of -c5/60 + c2. What is r(l(y))? -4y2 Let d(o) = 18o. Let k(l) = -53848l. Give k(d(b)). -969264b Let r(d) = 7d. Let k(h) = 22h + 8h - 20h. Calculate k(r(t)). 70t Let x(o) = -11o*2. Let p(t) = -3t + 18t - 3t - 13t. Calculate p(x(s)). 11s*2 Let x = 18 - 7. Let i(y) = xy*2 + 13y*2 - 4y*2. Let n(q) = -3q. Calculate n(i(d)). -60d2 Let w(g) = 762g*2. Let k(l) = 2l - 2. What is w(k(h))? 3048h2 - 6096h + 3048 Let x(y) = 101y2. Let h(n) = 16n*2 + 2. Determine x(h(d)). 25856d*4 + 6464d*2 + 404 Let d = 145 - 96. Let x(a) = -51 + 100 - d - a. Let r(l) = -12l*2. Calculate r(x(t)). -12t*2 Let d(b) be the second derivative of -3/2b*2 - 1/3b*3 - 38b + 0. Let w(f) = f*2. Calculate w(d(m)). 4m*2 + 12m + 9 Let h(o) = 1089o + 132o - o*2 - 2124o. Let v(q) = -q. Determine h(v(z)). -z*2 + 903z Let o(l) = l. Suppose 5f + 5y - 195 = -0f, 0 = f - 2y - 51. Let n(v) = 2v - v - fv*2 - v. Determine n(o(p)). -43p*2 Let t(q) = 2q2. Let p(f) be the first derivative of -f5/10 + 20f3/3 - 15. Let i(j) be the third derivative of p(j). What is t(i(d))? 288d*2 Let h(x) = -17x. Let c(y) be the second derivative of 0 - 1/6y3 + 0y*2 + 3y. What is c(h(j))? 17j Let i(v) = v2 - 26. Let h(q) = -q2 + 2q + 1. Let n(c) = -3c2 + 8c + 4. Let r(s) = -4h(s) + n(s). Determine r(i(p)). p4 - 52p*2 + 676 Let o(j) = 212j. Let q(w) = -121w. Let t(k) = 4o(k) + 7q(k). Let a(m) = m - 4 + 4. Determine t(a(d)). d Let p(u) = -30u - 12. Let a(y) = -12y - 5. Let x(v) = 12a(v) - 5p(v). Let l(i) = 2i*2. Give x(l(q)). 12q*2 Let v be -2(-9)/24(-12 + 16). Let s(x) be the second derivative of 0x*v + 0 - 1/6x*4 + 0x*2 + x. Let c(i) = -2i*2. Calculate s(c(r)). -8r*4 Let k(h) = -3h. Let n(p) = -416p + 16. Let v(y) = -3y + 1. Let u(j) = -n(j) + 16v(j). Determine k(u(s)). -1104s Let x(i) = -22i. Let g(r) be the second derivative of r4/12 + 19r*2/2 - 13r. Let o(c) be the first derivative of g(c). Give o(x(n)). -44n Let x(o) = -o2 + 2o - 1. Let g(l) = 2l2 - 8l + 4. Let b(c) = g(c) + 4x(c). Let m(a) = 4a - 5. Determine b(m(t)). -32t2 + 80t - 50 Let l(o) = -54 + 22 + 32 + 23o2. Let c(k) = -20k. Calculate l(c(t)). 9200t2 Let k(q) = -8170q. Let b(j) = -5j. Determine k(b(x)). 40850x Let j(g) = -7g2. Let f(i) be the second derivative of i4/12 + 48i. Calculate j(f(l)). -7l4 Let c(u) = 2u + 3. Let t(d) = 20687d. Give t(c(h)). 41374h + 62061 Let q(u) = -10u2 - 6u*2 - 8u*2 + 22u*2. Let w(x) be the first derivative of 4x*2 - 10. Calculate w(q(y)). -16y2 Let l(v) be the third derivative of -v5/60 - 34v2 + 2. Let t(y) = 185y. Calculate l(t(w)). -34225w2 Let v(l) = -29l*2. Let p(q) = -5q*2 - 6q - 166. Determine p(v(a)). -4205a4 + 174a*2 - 166 Let p(d) = -6d. Let f(i) = 6i2 + 568. What is p(f(s))? -36s*2 - 3408 Let n(p) = 22p + 20. Let b(y) = -3y - 3. Let r(l) = -20b(l) - 3n(l). Let i(o) = 15o. What is i(r(q))? -90q Let z(d) = 376d. Let o(n) = -78n. Determine z(o(f)). -29328f Let y(i) = -170889i. Let h(l) = -8l. Determine y(h(s)). 1367112s Let t(u) be the third derivative of 2u*5/3 - 41u*2 - 1. Let d(w) = 4w + 3. Let v(p) = 3p + 2. Let r(x) = 2d(x) - 3v(x). What is t(r(f))? 40f*2 Let u(l) = -15l*2. Let c(m) = 32m*2 - 3m. Let w(d) = 6d2 - d. Let g(b) = c(b) - 3w(b). Give g(u(r)). 3150r4 Let l(t) = 101t - 172t + 100t. Let b(f) = 3f2. Calculate b(l(i)). 2523i*2 Let s(r) = 182r*3 - 3r + 3. Let u be s(1). Let t(d) = -182d - d2 + ud. Let k(v) = -3v2. Give t(k(h)). -9h*4 Let w(s) = 133s*2 - 2. Let a(h) = -87h + 1. Calculate w(a(t)). 1006677t2 - 23142t + 131 Let s(i) be the second derivative of -i*7/630 - 7i*4/6 - 16i. Let u(g) be the third derivative of s(g). Let m(f) = -5f. Determine u(m(c)). -100c2 Let c(m) be the third derivative of m5/12 + 3m2. Let b(n) be the third derivative of n5/20 + 3n*2 + n. Calculate b(c(u)). 75u*4 Let s(c) be the first derivative of 3c*2/2 - 66. Let d(i) = 5i. Give d(s(o)). 15o Let f(h) = 4h. Let r(c) = 8c - 22. Let m(t) = -t + 3. Let a(l) = -35m(l) - 5r(l). Calculate a(f(z)). -20z + 5 Let t(k) = 8k + 3. Let j(h) = -8h - 4. Let m(f) = 3j(f) + 4t(f). Suppose -2x - 57 = -365. Let r(q) = -51q + xq - 49q - 55q. Calculate r(m(w)). -8w Let h(j) = -17j. Let i(d) = -1882d. Calculate h(i(k)). 31994k Let c(k) be the second derivative of -k5/30 - 19k*2/2 + 17k. Let x(y) be the first derivative of c(y). Let f(i) = 3i + 0i + 3i. What is x(f(j))? -72j*2 Let d(f) = 0f + 0f - 5f + 2f. Let y(p) = -5p. Let t(c) = -5c. Let w(s) = 3t(s) - 2y(s). What is w(d(k))? 15k Let q(u) = u - 21. Let b(d) = 7. Let h(i) = -3b(i) - q(i). Let a(z) = -z - 881. Give a(h(t)). t - 881 Let g(m) be the third derivative of 11m5/30 - m2. Let s(i) = -10i. Let d(p) = -3p. Let k(n) = -7d(n) + 2s(n). Give k(g(l)). 22l2 Suppose -4m + w - 2w + 65 = 0, -3m + 40 = -w. Let j = -13 + m. Let k(x) = -2x + 4x*j + 2x - 5x2. Let c(t) = 5t. Determine c(k(g)). -5g2 Let l(v) = 3v + 0v - 7v + 18v - 15v. Let g(f) = 99f. Let k(u) = -14u. Let j(c) = 3g(c) + 22k(c). What is l(j(h))? 11h Let v(p) = -40p. Let u(a) = -12068a. Determine v(u(m)). 482720m Suppose -8 = 78n - 82n. Let z(s) = 2sn - 11 - 4 + 15. Let f(l) = -9l*2. Calculate f(z(m)). -36m*4 Let d(r) be the third derivative of 2r*5/15 + 46r*2. Let k(z) = 2z + 11z - 22z. Calculate d(k(x)). 648x2 Let d(t) = -2t*2. Let c(r) = -2r - 2. Let f be c(-2). Let w(i) = i - i - 4i + fi. Calculate w(d(n)). 4n2 Let t(r) = 2r*2 - 16. Let g(j) = -570j*2. Calculate t(g(d)). 649800d*4 - 16 Let z(c) = -3c*2. Let b(s) = -s + 4. Let a be b(3). Let k be 0 + (-9)/(-3)a. Let w(y) = y*2 + 5y*2 + ky*2 - 4y*2. Give z(w(i)). -75i*4 Suppose -t + 12 = 2f, 4t + 1 = 3f - 6. Let x(a) = -18at - 7a*2 + 2a*2 + 0a*2. Let j(h) = 2h*2. Give j(x(c)). 1058c*4 Suppose 9 - 9 = -9q. Let m(p) be the third derivative of 1/60p5 + q + 5p*2 + 0p*3 + 0p*4 + 0p. Let n(o) = 4o2. What is n(m(u))? 4u*4 Let k(i) = 156 - 156 - 2i*2. Let t(r) = 4r*2. Give t(k(f)). 16f*4 Let g(t) = -13t - 6. Let d(o) = -285o - 133. Let l(z) = -6d(z) + 133g(z). Let y(n) be the first derivative of 3n*2/2 - 71. Give y(l(i)). -57i Let l(c) = -6c2. Let g(w) = -3w - 921. Give g(l(i)). 18i2 - 921 Let x(u) be the third derivative of u4/12 - 974u2. Let r(l) be the second derivative of l3/3 + l. Give r(x(o)). 4o Let l(z) = 16z2 - 1. Let i(r) be the third derivative of -r5/30 - 41r2 + 2. Give l(i(x)). 64x*4 - 1 Let o(q) = -5q*2 + 3q + 12. Let s(d) = -d*2 + d + 2. Let n(y) = -o(y) + 6s(y). Let u(r) = r. Determine u(n(t)). -t*2 + 3t Suppose 4l + 2h = 2l - 4, 0 = 4l - 4h - 24. Let a(f) = f2 - f2 + 4f*l - 3f*2. Let t(n) = -5n. Calculate a(t(d)). 25d2 Let c(z) = -15z*2. Let m(a) = 27171a*2 - 3. Give m(c(i)). 6113475i*4 - 3 Let l(z) = -2z. Let w(x) = 11 + 2x + 0 - 4x + x - 3. Determine w(l(m)). 2m + 8 Let v = 16 - 10. Let p(o) = 13o*2 + 6o - vo + 0o. Let b(u) be the first derivative of u**2 +	{ "pile_set_name": "DM Mathematics" }
15 + 43197t - 1015 - 43191t. 6t Collect the terms in -3 + 132r - 35r2 - 26r*2 + 1 - 218r*2 - 131r. -279r2 + r - 2 Collect the terms in 8v - 3419 + 1126 + 2289. 8v - 4 Collect the terms in 299833g - 358g2 - 299833g. -358g2 Collect the terms in 24137x*2 - 94055x*2 - 84681x*2 - 74815x*2 + 11429x*2. -217985x*2 Collect the terms in 2992 + 2998 - 8996 + 3006 + 722l. 722l Collect the terms in 22139067664 - 22139067664 + 5y. 5y Collect the terms in -7d*3 + 3 + 33d*3 + 1 + 22d*3 - 6 + 7d*3. 55d*3 - 2 Collect the terms in 190c*2 + 57c*2 - 203c*2 - 45c2. -c2 Collect the terms in -103d + 2d*2 + 395d - 61d - 75d - 77d - 79d. 2d2 Collect the terms in 483p*3 + 67 + 64 + 60 + 295p*3 - 193. 778p*3 - 2 Collect the terms in -731c*2 + 5179c*2 + 1094c*2 + 31c - 33c. 5542c*2 - 2c Collect the terms in -46 + 5f3 - 30f*2 + 69f*2 + 28 - 39f*2. 5f*3 - 18 Collect the terms in -1140c*2 + 1867c*2 + 1509c*2. 2236c*2 Collect the terms in -1635 + 1647 - 2y2 - y2 - 15y2. -18y*2 + 12 Collect the terms in 6450r*2 + 6443r*2 + 4475r*2 - 17372r*2. -4r*2 Collect the terms in 899n - 536n - 154 - 3574n. -3211n - 154 Collect the terms in -1575f*2 + 36f*3 + 808f*2 + 765f*2. 36f*3 - 2f*2 Collect the terms in -1395o*3 + 567o*3 + 565o*3. -263o*3 Collect the terms in -1821y*3 + 3012y*3 - 1224y*3 - 3y + 2y + y. -33y*3 Collect the terms in -68388q*3 - 2 + 34221q*3 + 34215q*3 + 3 - 1. 48q*3 Collect the terms in 298w + 2 - 120w - 118w - 118w + 65w. 7w + 2 Collect the terms in 3o + 1803o2 + 1785o*2 + 1794o*2 - 3o - 5434o2. -52o*2 Collect the terms in -139m*3 + 134m*3 + 273m*3. 268m*3 Collect the terms in 2043f*3 - 3623f*3 - 4445f*3. -6025f*3 Collect the terms in 2p*2 - 321 - 2p + 1247 + 251 + 616 + 274. 2p2 - 2p + 2067 Collect the terms in 3a + 3 + 10a*2 - 5 + 178a*3 - 8a + 2a. 178a*3 + 10a*2 - 3a - 2 Collect the terms in 42c - 4c - 9c - 18c*2 - 18c. -18c2 + 11c Collect the terms in 70y3 + 23553427244 - 23553427244. 70y*3 Collect the terms in 11t - 5856 - 2t + 7410 - 4t*2. -4t*2 + 9t + 1554 Collect the terms in 717i2 - 363i*2 - 56i*3 - 261i*3 - 354i*2. -317i*3 Collect the terms in 130m*2 + 224m*2 - 2m*2 - 70m*2. 282m*2 Collect the terms in -68 + 68 + 16k*2 - 35k*2 - 53k*2 + 74k*2. 2k*2 Collect the terms in 451753r*2 + 3 + 3 - 3r*3 - 6. -3r*3 + 451753r*2 Collect the terms in -81 - 910m - 80 - 83 - 221 + 461. -910m - 4 Collect the terms in 8 - 76 + 30 + 6s*3 - 4s*3. 2s*3 - 38 Collect the terms in -2 + 9 - 3 - 10 - 6 + 9757y. 9757y - 12 Collect the terms in 318 - 314 - 68b - 43b3 + 68b. -43b3 + 4 Collect the terms in -4 + 2552z - 6z2 + 511z + 4z2 + 4. -2z*2 + 3063z Collect the terms in -26872r + 68849r - 112578r - 182660r. -253261r Collect the terms in -2004601l*2 + 2004599l*2 + 18 - 18. -2l*2 Collect the terms in -99716o*3 - 99707o*3 - 99678o*3 + 299095o*3. -6o*3 Collect the terms in 23396q + 89907q - 6687q. 106616q Collect the terms in -182577g*2 + 91297g*2 - 19g*3 + 91280g*2. -19g*3 Collect the terms in 3s*2 - 109s - 11s2 - 2s*2 - 111. -10s*2 - 109s - 111 Collect the terms in 8v + 10725 + 10898 + 17v - 21614. 25v + 9 Collect the terms in -173j*3 + 143j*2 - 13j*2 + 0j*2 - 115j*2. -173j*3 + 15j*2 Collect the terms in 213752f - 105607f - 108167f. -22f Collect the terms in -497g - 146g - 305g + 131g - 501g. -1318g Collect the terms in -346568s + 346568s + 767s*2. 767s*2 Collect the terms in 3i - 238i + 131i + 118i. 14i Collect the terms in 1296a2 + 554735459 - 554735459. 1296a*2 Collect the terms in -249 - 254 + 981 - 245 - 233 - 895g. -895g Collect the terms in -23304 - 23314 - 13o*2 + 69828 - 23210 - 14o*2. -27o*2 Collect the terms in -168j + 42 + 103 + 442j - 181 + 46. 274j + 10 Collect the terms in -133x + 69x - 13x + 74x. -3x Collect the terms in 3n - 4n - 14275n*2 + 14245n*2. -30n*2 - n Collect the terms in 170d - 5 - 517d + 44d + 2 - 418d. -721d - 3 Collect the terms in -677i - 683i - 681i + 2741i - 693i. 7i Collect the terms in -8 + 13 - 468j3 - 1 - 4. -468j*3 Collect the terms in 1362981w*2 - 668799w*2 - 1 + 979444w*2 + 1. 1673626w*2 Collect the terms in -2346 - 31v*2 + 773 + 773 + 800 + 2v. -31v2 + 2v Collect the terms in -508w - 237w - 237w + 1209w - 236w. -9w Collect the terms in -18g2 - 120g - 8g2 + 155g + 174g - 5g*2. -31g*2 + 209g Collect the terms in -24z3 - 1298954 + 16z*3 - 33z*3 - 1298957 + 2597910. -41z*3 - 1 Collect the terms in -125813270c*2 + 251626548c*2 - 125813272c*2. 6c*2 Collect the terms in -z - 10z + z - 20z + z - 15656 + 15657 + 2z. -27z + 1 Collect the terms in 21009o + 1336o - 77201o - 55693o. -110549o Collect the terms in -58c + 3c*2 - 16c - 61c + 265c - 4c2. -c2 + 130c Collect the terms in -10878v + 37243v + 33892v. 60257v Collect the terms in -720231981q2 + 720231981q*2 - 6q*3. -6q*3 Collect the terms in -76219f*2 - 76146f*2 + 152575f*2. 210f*2 Collect the terms in 75224842 - 75224842 - 32i*3. -32i*3 Collect the terms in -65670z + 698964z + 1042212z. 1675506z Collect the terms in 264y*3 + 2804651y*2 - 2804651y*2. 264y*3 Collect the terms in 1 - 3 + 90i - 1 - 2 + 3. 90i - 2 Collect the terms in -4644i*2 - 2i*3 + 9538i*2 - 4636i*2. -2i*3 + 258i*2 Collect the terms in 128y*3 + 2y*2 - 541y*3 + 140y*3 + 51y + 140y3 + 135y*3. 2y*3 + 2y*2 + 51y Collect the terms in -75039h2 - 73613h*2 - 4 + 148670h*2. 18h*2 - 4 Collect the terms in 1218 - 51n*2 + 101n*2 - 4n*3 - 50n*2 + 1176 - 2289. -4n*3 + 105 Collect the terms in -14 + 833u*3 + 813u*3 - 2465u*3 + 14 + 820u3. u3 Collect the terms in -138 + 454 - 21i - 143 - 173. -21i Collect the terms in u + 2389 - 2u + 7u - 1888. 6u + 501 Collect the terms in 226865820u + u*2 - 226865820u. u*2 Collect the terms in -33 - 32 + 117 - 24 - 28 + 1299420z - 1299418z. 2z Collect the terms in 251 - 222733a3 - 251 + 44210a*3. -178523a*3 Collect the terms in 70p - 480p + 324p + 70p. -16p Collect the terms in -7 + 4 - 48912m2 + 48717m*2 + 2 + 1. -195m*2 Collect the terms in 128837514 + 6437m*3 - 128837514. 6437m*3 Collect the terms in -653u + 8771 + 12698 - 1773 + 655u. 2u + 19696 Collect the terms in -6n2 - 4572 + 340n - 340n + 4572 - 2n*2. -8n*2 Collect the terms in -65 - 13560l*2 - 3031l*2 - 18 + 85 - 23132l*2. -39723l*2 + 2 Collect the terms in -42713n2 - n3 + 42713n2 + 2152. -n3 + 2152 Collect the terms in 262138609166a - 262138609166a - 2a*2. -2a*2 Collect the terms in -6r*3 + 3523216625r*2 - 3523216625r*2. -6r*3 Collect the terms in 676r - 184r2 - 191r - 294r - 191r. -184r2 Collect the terms in -54v*2 + 178v*2 - 36v*2 - 43v*2 - 28242v*3 - 45v*2. -28242v*3 Collect the terms in -56o + 95o - 51o + 33o. 21o Collect the terms in 8d - 6372 + 19d*2 - 8d - 17559. 19d2 - 23931 Collect the terms in -1180i*2 - 1278i*2 + 2389i*2 - 2i*3. -2i*3 - 69i*2 Collect the terms in -19v - 12846v2 + 9v + 2v3 + 5v. 2v3 - 12846v*2 - 5v Collect the terms in 6125577 - 6125577 + 71k. 71k Collect the terms in 33z2 - 88z - 55z - 18z + 7z2. 40z*2 - 161z Collect the terms in 4148n2 - 3246n*2 - 1184n*2. -282n*2 Collect the terms in -243628 + 243628 - 146t + 146t - 2767t*2. -2767t*2 Collect the terms in 1351o + 1380o - 5427o + 1351o + 1348o. 3o Collect the terms in -22763b*2 - 3 - 4b - 22764b2 + 3 + 45389b*2. -138b*2 - 4b Collect the terms in 2g2 - 2g*2 - 3913828g*3 + 3913791g*3. -37g*3 Collect the terms in -284x - 2x2 + 207x + 224x. -2x*2 + 147x Collect the terms in 100o2 - 397o*2 + 200o*2 + 104o*2. 7o*2 Collect the terms in -594 - 340 - 4x - 877. -4x - 1811 Collect the terms in z3 - 26z - 27z - 1267 + 101z - 25z - 24z. z**3 - z - 1267	{ "pile_set_name": "DM Mathematics" }
2 - o*3 - 4o*2 + 2o*2 + 4. Does 8 divide i(-7)? False Suppose 0 = -u + 2. Let q be (u/(-2))/((-1)/79). Let o = q - 55. Is 15 a factor of o? False Let f = -43 - -89. Is f a multiple of 8? False Let a = -62 + 36. Let c = 40 + a. Is c a multiple of 9? False Is 30 a factor of ((-2)/(-9) - 176/(-18))12? True Let o = -6 + 4. Let u = 9 + o. Does 4 divide u? False Suppose -5j = -11 - 4. Suppose -5q = -jr - 16, 6r + 14 = 2q + r. Suppose 3l = -7 - q, 4l = 5n - 82. Is 5 a factor of n? False Suppose 4x - 6x + 104 = 0. Is x a multiple of 13? True Let u(y) = -y*3 + 9y*2 + 9y + 12. Let v be u(10). Suppose -12 = -2k - 2g, k + vk - g = 10. Is k a multiple of 2? True Suppose -4k + 2p - p = -14, -3k + 2 = -5p. Let r(j) = -2j + 6j2 - j3 - 2 - 4 + 1. Does 14 divide r(k)? False Let d(l) = 5l*2 - 2l - 3. Let c be d(3). Let j be (3/(-6))/(2/c). Is 9/(-4)(j - -1) a multiple of 12? False Let b(n) = 23n*2 - 2n + 1. Let s = -4 - -5. Does 11 divide b(s)? True Let i be 04/16 - -3. Suppose -2y + iy = -5c + 17, y + 2c - 11 = 0. Is 7 a factor of y? True Is 4/(4/41) + 3 a multiple of 11? True Let h be (-7)/2 + 3/(-6). Does 7 divide ((-10)/(-3))/(h/(-18))? False Is (0 - 5)8856/(-120) a multiple of 41? True Suppose 2c = 5l - 96, -4l + 0 = 3c - 63. Is l a multiple of 6? True Suppose 2h = -4x + 16, h - x - 8 = 2x. Let l = h + 20. Is l a multiple of 28? True Let m(c) = -c3 - 3. Let s be m(0). Let b = s + 10. Is b a multiple of 7? True Suppose -7 = -c + 41. Suppose 4i - 2d + c = -4d, 0 = -4d - 16. Is ((-4)/i)/(6/120) a multiple of 8? True Suppose -u = -0u. Let c(j) = j + 21. Is c(u) a multiple of 7? True Let s(o) = -o - 4. Let f be s(-2). Does 5 divide (10/(-6))/(f/6)? True Let j be 22/1 - 2. Let c be 1(34 + j + -1). Suppose -73 = -4y + c. Is y a multiple of 14? False Let q = -97 - -173. Is q a multiple of 5? False Suppose -i + 3b = -1, 4 = 3i + 5b - 13. Suppose -8 = 3l + i. Let u = 12 - l. Does 8 divide u? True Let h be -2 + 5 + 39/(-1). Let w = h + 52. Does 8 divide w? True Let d(i) = -9i - 28. Does 4 divide d(-8)? True Let h = -8 + 18. Let l(n) = -6n + 0n + hn + 2 - 8n. Is l(-2) a multiple of 10? True Let g(i) = 102i2 + 2i - 1. Does 23 divide g(1)? False Let y be (-3)/(((-12)/(-5))/(-4)). Suppose 5o + 87 = 5v - 108, 39 = v - yo. Does 13 divide v? True Let h be (2/3)/(4/(-42)). Let o(m) = -m2 + m + 1. Let b(q) = -2q*2 - 4q - 2. Let t(r) = -b(r) + o(r). Is 9 a factor of t(h)? False Is 5 a factor of 128/13 + (-2)/(-13)? True Let d(a) = a*3 - 8a*2 + 12a + 5. Is 8 a factor of d(7)? True Let f(c) be the first derivative of 11c2/2 - c - 4. Suppose -o + 4o - 3 = 0. Is 10 a factor of f(o)? True Suppose 4l - 3p = 2l + 58, 38 = l + 3p. Let s = l + -4. Is 7 a factor of s? True Suppose 5s - 9 = 6. Suppose -2c - 3k = -7c, sc = -3k + 24. Is c a multiple of 3? True Let y be 1/(-2)2 - -3. Suppose -39 = -4u + 5p, u = yp - p + 9. Is 5 a factor of u? False Let p = -7 - 4. Let v = p + 18. Is v a multiple of 3? False Let i be 2/7 - (-38)/14. Suppose -m + i = -1, -4u + 264 = 2m. Is 6 a factor of (9/(-6))/((-6)/u)? False Suppose 2v + 3z = 4 + 65, 2v - 2z = 84. Is 9 a factor of v? False Let d be 93 - (3 + 0 + 0). Suppose 5z - 3b = -6b + d, 5b = -z + 40. Does 6 divide z? False Suppose -4x + 16 = 4p - 48, 3p = 2x - 37. Suppose 2i - 13 - x = 0. Is i a multiple of 5? True Let p = 352 - 214. Suppose 4w - p - 42 = 0. Is 18 a factor of w? False Let h = 11 - -19. Is 10 a factor of h? True Suppose 0m + 5 = m. Suppose mc - 220 - 162 = -2t, 2t = 3c - 226. Is c a multiple of 19? True Suppose -5c + c - 22 = -i, -15 = 5i + 5c. Suppose 0 = -is + 6s - 108. Is 8 a factor of s? False Suppose -19t + 432 = -15t. Does 18 divide t? True Suppose 760 = 4s - 600. Suppose -s = -7h + 2h. Suppose -w + 23 = -i, -5w - 2i = -w - h. Does 19 divide w? True Let x be (-2 + (-15)/(-6))46. Let d(t) = -t*3 - 5t*2 + 3. Let z be d(-3). Let c = x + z. Does 5 divide c? False Let n = 10 + -5. Let t be (n/(-15))/((-2)/(-6)). Is t((-33)/3 - -2) a multiple of 5? False Suppose 2q + 2q + 2x = 30, 5x = -3q + 5. Suppose -q - 10 = 5y + 5d, -3d = 4y + 13. Is 3/(-6)-74 + y a multiple of 18? True Let w = 71 + -33. Suppose 5f + 13 = 3j + w, -2j = f - 5. Suppose d = -j + 2. Is d a multiple of 2? True Let p(s) = -2s - 1. Let r be p(1). Is 8 - 2(r - -2) a multiple of 4? False Let g = 70 - 26. Is g/(7/((-7)/(-2))) a multiple of 10? False Let u(f) = 2f*2 + 7f. Let o = 9 - 14. Is 15 a factor of u(o)? True Suppose -5t - 12 = 4v + 5, -v - t = 3. Suppose -vr + 270 = 3r. Does 18 divide r? True Let x(j) = 2j + 8. Let z be x(11). Let r = -47 + z. Let b = 4 - r. Is b a multiple of 11? False Let c(i) = -3 + 2i*2 + 2 - 4i*2 - 2i. Let l be c(3). Let r = 56 + l. Does 12 divide r? False Let x(r) = 2r3 - 4r*2 + 3r - 6. Is x(3) a multiple of 21? True Let y = 2 - 0. Suppose -yv = v. Let z = v + 13. Is z a multiple of 9? False Let q be ((-33)/(-6))/((-4)/(-8)). Suppose -q = -5x + 34. Is x a multiple of 7? False Let y(t) = 6t3 - 3t2 + t. Is y(2) a multiple of 38? True Let g = -32 - -123. Let m = g + -31. Is 20 a factor of m? True Let v(p) = -p2 + 5p + 6. Let d be v(6). Suppose d = 4z + 8, -z + 4 - 1 = j. Suppose j = -a, 3a - 2 - 1 = -2w. Does 9 divide w? True Let t(c) = c*3 - 2c*2 + c + 7. Let h be t(5). Suppose -r + h = 2r. Suppose u = -3s + r, -2s = -2u + 59 - 9. Is 13 a factor of u? True Let y = 0 - -8. Let x = 18 - y. Is 4 a factor of x? False Let x be (-4)/(1-21). Suppose 0 = 3g - xg + 4i - 83, 4g - 257 = -i. Let t = -29 + g. Is 12 a factor of t? False Let u = 43 + -21. Let w = 37 - u. Is 9 a factor of w? False Suppose -m + 2 + 34 = 0. Is 9 a factor of m? True Suppose 3h - 28 = 2h. Does 7 divide h? True Let o = 6 - 8. Let u(w) = 3w*2 + 5w - 1. Let y(n) = -n*2 - n. Let j(c) = -u(c) - 5y(c). Is j(o) a multiple of 5? False Let v(a) = a*2 - 5a - 16. Is 38 a factor of v(14)? False Let b = 52 + -12. Does 10 divide b? True Let h(t) = t - 1. Let z be h(6). Suppose 2k + za - 52 = 31, 47 = k - 3a. Is k a multiple of 13? False Let w be -4 + 1 + (4 - 1). Does 9 divide 3 + (-33)/(-3 - w)? False Let n = 29 - 42. Let c(j) = -4j*2 - 3j - 1. Let o be c(-3). Let x = n - o. Is x a multiple of 15? True Let y be 4(-5 + 1 + 0). Suppose -30 = -3t - 4p + 56, -5p - 94 = -4t. Let m = y + t. Is 5 a factor of m? True Is (2 - 8/2 - -6) + 15 a multiple of 19? True Let q(l) = -3l*3 + 4l*2 + 2. Let w be q(3). Suppose 0 = v + 29 - 9. Let n = v - w. Is 12 a factor of n? False Suppose -3n = -2l - 11, 4n - 5n - 4l - 1 = 0. Does 3 divide (7/2)/(n/6)? False Let k(t) = -t*3 + 6t*2 - 4t - 2. Let o be k(5). Let v = o + 0. Does 13 divide 80/v - 6/9? True Is ((-132)/16)/3-8 a multiple of 7? False Let r(w) = -w + 2. Let u be r(2). Suppose -3d = -p - p + 9, 0 = 4p - 2d - 6. Suppose uk - 2k + 26 = p. Is 9 a factor of k? False Let u = 2 - 10. Is ((-45)/12)/(2/u) a multiple of 9? False Let r be 7 + (-2 - (1 + -1)). Suppose -3 = 2l - rl. Does 5 divide -1 + (l - -1) - -15? False Suppose 2c - 3c + 5 = 0. Suppose -ca + 30 = -2a. Is 3 a factor of a? False Let o = -34 - -54. Does 12 divide o? False Let f = -5 - -8. Suppose 0 = fa - 32 - 19. Is 16 a factor of a? False Suppose -3d - 4o - 164 = -8d, 0 = 2o + 2. Does 8 divide d? True Let v = 7 + 12. Suppose z + 5 = 0, -3o + v = -o - z. Is 7 a factor of o? True Let d(w) = w*3 + 8w*2 + 6w. Is 18 a factor of d(-6)? True Is 90/75(-130)/(-4) a multiple of 13? True Suppose -284 = -5d + 166. Suppose 3m - d = -2m. Is m a multiple of 13? False Suppose 48 = -4p + 156. Is 2 a factor of p? False Let z be (-3)/(-4)(-96)/(-6). Let d = z + -5. Does 7 divide d? True Suppose -x = -9 + 5. Is 2 a factor of x? True Is 6 a factor of (-5)/2(-4)/1? False Let m(v) be the first derivative of -6v - 3/2v2 - 3. Is m(-7) a multiple of 5? True Let z = -40 - -22. Let a = z + 24. Is 6 a factor of a? True Suppose 56 = 4t - 5c, -2c + c + 4 = 0. Is 11 a factor of t? False Let a(o) = o*2 + 5o - 12. Does 12 divide a(-9)? True Let u = 11 + 15. Let r = u - 18. Is r even? True Let j(n) = n*3 - 8n*2 + 10n - 3. Let p be j(7). Let m = 66 - p. Is	{ "pile_set_name": "DM Mathematics" }
j(h)? 4 Let t = -2306 + 4247. What is the tens digit of t? 4 Suppose 3d + y = 519, -d - 3d - 2y = -690. What is the hundreds digit of d - (4 + -5 + 2)? 1 Let p(a) = -a3 + 4a*2 + 6a - 4. Suppose f - d = -4d + 35, 0 = 3f - 4d - 40. Suppose f = 6n - n. What is the units digit of p(n)? 0 Suppose -13z - 5z = -918. Suppose -39 = -5s + 2k + 24, -k = 5s - z. What is the tens digit of s? 1 Suppose 40 - 36 = 2o. Suppose 0 = 16c - oc - 2016. What is the tens digit of c? 4 Suppose 7z + 21 = 4z. Let h(p) = 2p2 - 3p - 2. What is the units digit of h(z)? 7 Let n be (16/20)/((-19)/5 - -4). What is the tens digit of ((-127)/(-4) - 1)n? 2 Suppose 5r - 146 = -4q, -2r + 3r = 3q + 33. Suppose 0 = -2c - r + 58. What is the units digit of c? 4 Let z be 11(-2 + 7 + -4). Let g = 78 - z. Suppose q - 4q + 152 = 5o, -2o + g = -5q. What is the tens digit of o? 3 Let r(z) = -2 + 9 + 3z2 - 49z + 0 - 2. What is the tens digit of r(19)? 5 Suppose -8v + 2 = 34. What is the units digit of -4 - (v/14 + 9558/(-63))? 8 Let i = -13 + 18. Suppose -ir + 6r - 159 = 0. What is the hundreds digit of r? 1 Let l = -283 + 926. Let w = l - 385. What is the units digit of w? 8 Suppose -4z + 5 = 3l, 60 - 20 = 4z - 4l. Let m(g) = -z - 2g - g*2 + 1 - 1 - 7g. What is the units digit of m(-8)? 3 What is the units digit of 8/530/12 + 1217? 1 Suppose -5o + 32 = 2. Suppose -8u + 120 = -ou. What is the units digit of u? 0 Let c(j) = 85j3 + 2j*2 - 2j + 2. Let z be c(1). What is the tens digit of 11542/z + (-2)/(-6)? 3 Suppose -4z - 4s = -356, -7s + 94 = z - 5s. What is the units digit of z? 4 Suppose 2h = 5h + 60. What is the units digit of 16/h(-190)/4? 8 Let g(d) = 4d*2 - 2d + 56. What is the units digit of g(-8)? 8 Let u(v) = -7v - 4. Let z(k) = 15k + 9. Let p be 1 - (-3)/(3 + 0). Let q(b) = pz(b) + 5u(b). What is the units digit of q(-2)? 8 Suppose 116 = -i + 687. What is the tens digit of i? 7 Let q(m) be the second derivative of 16m3/3 - 3m*2 + 14m. What is the tens digit of q(2)? 5 Let w(k) = 2k2 - 2k - 1. Let u be w(-1). Let g(y) = -y*2 + 5y - 2. Let v be g(u). Suppose 12 = vo - 8. What is the units digit of o? 5 Let i = -15 + 17. Suppose -5f - iw = -126, 0f = f - 4w - 34. What is the tens digit of f? 2 Suppose 5t = -5h - 30, -t = 2h + h + 20. What is the tens digit of (23 + -1)/(h - -8)? 2 Suppose 10v = 11v - 1008. Suppose v = -10j + 19j. What is the units digit of j? 2 What is the hundreds digit of 7 + 7/(14/1724)? 8 Suppose 2k = z + 4832, -z + 4965 = 3k - 2283. What is the thousands digit of k? 2 Let v(b) = 78b - 4. Let t be v(1). Let j = t - 34. What is the units digit of j? 0 Let o be (-3 + 3)(-1)/(-2). Suppose v - 2u - 89 = 2u, v - 3u - 88 = o. What is the tens digit of v? 8 Suppose -4t + 7t - 740 = -5q, -q + 246 = t. What is the tens digit of t? 4 Let i = -44 + 181. Suppose -6k + 569 = i. Suppose -2a - k = -7a + n, -4a + n = -58. What is the units digit of a? 4 Let j(r) = 10r - 5. Let l be j(1). Suppose f - 868 = -5n, ln - 4f = 419 + 434. What is the units digit of n? 3 Let n(g) = -7g3 - 3g. Let d be n(-4). What is the hundreds digit of 3 - 0 - (-6)/(24/d)? 1 Let x be ((-167)/4 + 0)/(10/(-40)). Suppose 2a + 5b = -189 + 527, -2b + x = a. What is the hundreds digit of a? 1 Let a(x) = -3x + 12. Let c be a(-9). Let w be c - (-2 - (-3 + 0)). Suppose -3v + 5v - w = 0. What is the units digit of v? 9 Let t(a) = a*3 - 15a*2 - 2a + 29. Let w be t(15). Let g(k) = 17k2 - k + 19k*2 + 2k*2 + 1. What is the units digit of g(w)? 0 Let o be (-8)/3(7 - 4). Let u(t) = -t*3 - 7t*2 + 4t - 6. Let j be u(o). Let r = 40 - j. What is the tens digit of r? 1 Let f be 498/15 - 1/5. Suppose 0 = 9v - 14 - 13. Suppose 0c = -2c - z + 19, -vz + f = 4c. What is the tens digit of c? 1 Let k = 8 - 13. Let x = k - -6. What is the tens digit of (17/(-3))/(x/(-3))? 1 Suppose 0 = -654c + 658c - 20572. What is the units digit of c? 3 Suppose 3900 = -9z + 975. Let h = 458 + z. What is the hundreds digit of h? 1 Let i(a) = -a*3 - 2a*2 + 9. Let x be 6/(7/(42/(-9))). What is the units digit of i(x)? 1 Let r(m) = -3m*2 + 1 + 4 - 5m*3 + 4m*3 + 3m + m. Let l be r(-4). Suppose 0 = -0x - lx + 140. What is the units digit of x? 8 Let p(a) = -2a + 31. Let h be p(-5). Let l = -13 + h. What is the tens digit of l? 2 Let d = 100 - 85. What is the tens digit of 159/4 - (360/32)/d? 3 Let h = 4 + -6. Let g = -49 + 48. What is the units digit of ((-354)/(-12))/(g/h)? 9 Let v be (2/(-1))/((-1)/8). Let o = v + -7. Let x(u) = -u2 + 9u + 8. What is the units digit of x(o)? 8 Let w(k) = 5k2 - 4k + 3. Let d(h) = -h*2 - 1. Let b(g) = 6d(g) + w(g). Let y be b(-2). Let n = 5 - y. What is the units digit of n? 4 Let z(h) = -3h3 - 16h*2 + 6h + 13. Suppose o = 2v + 10 + 7, -29 = 5v + 2o. What is the hundreds digit of z(v)? 2 Let u(c) = c3 - 20c*2 - 2c + 39. What is the units digit of u(21)? 8 What is the units digit of (-20085)/618(124/(-1))/2? 5 What is the units digit of (495/2)/((-30)/(-80))? 0 Let w = 525 + -302. What is the units digit of w? 3 Suppose 36 = 4j + 4i, 5j - 38 - 2 = -4i. Let u be ((-8)/5)/(j/(-10)). Suppose 3o + 2l - 65 = ul, -4o = 4l - 100. What is the tens digit of o? 2 Let o be (1437/9 - 3)/((-2)/(-6)). Suppose 2z = o + 18. What is the tens digit of z? 4 Suppose -5v = 4w - 0w - 863, 4v - 864 = -4w. What is the units digit of w? 7 Let n be -3 + (-12)/(-4) - -4. What is the tens digit of (6/n)/(3/82)? 4 Let j(r) = r*2 - 2r + 3. Let s be j(3). Let y(u) = 12u - 27. What is the tens digit of y(s)? 4 Suppose -2c = 3d - 1111 - 463, 0 = 2c - 3d - 1574. What is the hundreds digit of c? 7 Let r(t) = 2t + 19. Let m = 18 + -18. Let c be (m4/8)/(-2). What is the tens digit of r(c)? 1 Let n(h) be the first derivative of 3h4/2 - h3/3 - 12h - 7. Let m(r) be the first derivative of n(r). What is the tens digit of m(1)? 1 Suppose 0 = 4x + 2w - 10926, 5x - 13675 = -4w + 5w. What is the thousands digit of x? 2 Let a = 5 + -2. Suppose ak - 104 - 86 = h, k - 3h - 58 = 0. What is the units digit of k? 4 Suppose 5y - 343 - 512 = 0. Let p = y - 31. Suppose 4h - p = h + 5b, 5b - 140 = -4h. What is the tens digit of h? 4 Suppose 4w + h - 3 = -0h, 2w - 3h - 19 = 0. What is the units digit of 612/8 + 3/w? 8 Suppose -3j = -3p + 1077, j - 1092 = -3p - j. What is the tens digit of p? 6 Let o = -3450 - -5860. What is the tens digit of o? 1 Let f(g) = -2g2 + g. Let r be f(0). Suppose 2u + 496 + 672 = r. What is the tens digit of u/(-10) - (-16)/(-40)? 5 What is the hundreds digit of 4((-39)/12 - -3) + 533? 5 Suppose 107j - 272134 = 165924. What is the tens digit of j? 9 Suppose 3i - 7053 = -2685. Let t be (9/6)/((-6)/i). What is the tens digit of t/(-16) - (-9)/(-12)? 2 Let z = 1822 - 445. What is the hundreds digit of z? 3 Suppose -7m = 76 - 3478. What is the units digit of m? 6 Let i = 3518 - 2179. What is the units digit of i? 9 Let c(i) = -i + 1. Let g be c(0). What is the tens digit of 32 + 1 + (0 - (g - -1))? 3 Let o be ((-2)/104)/((-208)/(-520)). Let y(n) = -47n - 29. Let x(f) = -31f - 19. Let p(s) = 8x(s) - 5y(s). What is the units digit of p(o)? 9 Suppose -53825 = -9b - 11138. What is the tens digit of b? 4 Let s(h) = 12 - 2h2 - 9 - 4h + 0 + 11h. What is the units digit of s(3)? 6 Let n be 2/(-4)(-98 - 0). Let r = n + 11. What is the units digit of r? 0 Suppose 4d - 67 = d + 2w, -d - 5w - 6 = 0. Suppose -4a - 3 = -d. What is the units digit of (a/(-6))/((-22)/957)? 9 Let l = -19 - -24. Let t be ((-4)/l)/(4/(-20)). Let x(c) = 12c - 8. What is the tens digit of x(t)? 4 Let l = 276 - 183. What is the units digit of l? 3 Let t = 1729 + -778. What is the units digit of t? 1 Suppose 5o - 35d - 2952 = -34d, d - 588 = -o. What is the tens digit of o? 9 Suppose -2s - 2g = 1 + 19, s - 5g = -16. Let l = s + 19. What is the units digit of l? 8 Let d = 574 + -193. What is the tens digit of d? 8 Suppose 0 = -v - 5, 0 = 5k + 7v - 2v + 650. Let s = -11 - k. What is the hundreds digit of s? 1 Let q(t) = -2t3 + 47t*2 - 41t + 33. What is the tens digit of q(21)? 7 Let c(i) = i. Let r be c(-6). Let p(	{ "pile_set_name": "DM Mathematics" }
t x = n + -14. What is the second derivative of -k3 + k3 + 21k4 - xk - 17k4 wrt k? 48k*2 Let x(z) be the second derivative of -1919z*6/30 + 319z*3/6 - 11z*2/2 - 5259z. What is the second derivative of x(q) wrt q? -23028q2 Suppose 5c - 50 = 3i, 1 + 11 = c - i. Find the second derivative of -x3 + 3128 - 4x*4 - 22x - 3126 - cx3 wrt x. -48x*2 - 48x Let u(t) = t3 - t2 + 5t + 2. Let g(r) = 582r*3 - 3r*2 + 15r - 2466. Let y(w) = 4g(w) - 12u(w). Differentiate y(h) with respect to h. 6948h2 Let g = 18 + -16. Let k be (-2)/10 - ((-1132)/10 - 2). What is the first derivative of 60u + 55u + 20u*g + 22 - ku wrt u? 40u Let b(n) be the second derivative of n6/30 - 217n*5/4 + 355n*3 - 3945n. What is the second derivative of b(w) wrt w? 12w2 - 6510w Suppose -78 = -4o - 98. Let i be (o1)/(45/(-54)). Find the third derivative of -46g4 - 18g*2 + 46g4 - gi wrt g. -120g3 Let n(i) be the second derivative of -10 + 0i*4 + 0i*5 + 2i + 23/2i2 - 1/6i*3 - 7/3i*6. Find the second derivative of n(k) wrt k. -840k2 Let c(s) = -s2 + 2s + 12. Let j be c(0). Suppose 0h + k = 2h - j, -h - 5 = 5k. What is the third derivative of -2z + 0z + 2z + 2z*2 - 12z*h wrt z? -720z*2 Let j(r) be the first derivative of -49/3r*6 - 52 + 0r*4 + 0r*3 - 1/2r*2 + 0r*5 + 15r. Find the second derivative of j(u) wrt u. -1960u3 Find the second derivative of 258v + 50v4 - 59v4 - v3 + 11v4 + 637v2 + v3 wrt v. 24v2 + 1274 Let z(g) = -g2 + 5g + 28. Let l be z(8). Find the second derivative of -10m4 + 2m - 3ml + 52m*2 + 15m*4 - 4m*4 + 11 wrt m. -24m*2 + 104 Find the second derivative of -1691r*4 + 3962r*3 - 3962r*3 + 615r wrt r. -20292r2 Let t be (4 + 1)(-2)/(-5). Suppose -60 = -tx - 38. What is the derivative of -8 + xu*3 + 0 - 3 wrt u? 33u*2 Let v(m) = 3m*2 + 53m - 12. Let y be v(-20). What is the second derivative of -yp3 - 102p*3 - 437 + 321 - 4p + 3p wrt p? -1380p Let z(s) be the third derivative of -11s8/24 - s7/70 - s5/30 + 5s*4/24 - 34s*3/3 + 124s*2 - 2s + 2. What is the third derivative of z(i) wrt i? -9240i2 - 72i Let p(x) be the third derivative of -52x7/35 - x6/60 + 89x*3/3 + 761x*2. What is the derivative of p(j) wrt j? -1248j*3 - 6j*2 Let b(z) be the first derivative of 4z*6/3 + 51z*4/4 - 2673z*2/2 + 2z - 424. What is the second derivative of b(i) wrt i? 160i3 + 306i Differentiate 272d3 + 32d*3 + 669d*3 - 865 + 639d*3 - 10d*3 with respect to d. 4806d*2 Find the first derivative of 1568324i*2 - 9i - 7663 + 9i - 1569128i*2 wrt i. -1608i Let q(s) be the third derivative of 5593s5/60 + 12737s*3/6 - 8361s*2. Find the first derivative of q(r) wrt r. 11186r Let u(m) = -1445m - 477. Let d(w) = 1446w + 474. Let f(x) = 4d(x) + 3u(x). What is the first derivative of f(o) wrt o? 1449 Let j(v) = 4v3 - 3v*2 + 2v + 1. Let g be j(1). Let l = -32 - -35. What is the second derivative of gr3 + 8r - 22r + 12r*l wrt r? 96r What is the first derivative of 1071 - 6592 - 2742 - 5764 + 3615c3 + 513c*3 wrt c? 12384c*2 Let j(n) be the third derivative of -271n*7/10 - 827n*4/8 + 4401n*2. Find the second derivative of j(t) wrt t. -68292t*2 Let t(y) = -238y*2 - 236y*2 + 1 + 472y*2. Let b(v) = 7v*3 + 4v*2 - 38v - 2. Let g(i) = -b(i) - 2t(i). What is the second derivative of g(n) wrt n? -42n Suppose 0 = -j + 2j - 30. Let r be (-2 + -1)329/(-7) - 8. Find the third derivative of -27x2 - r + 133 - jx*3 wrt x. -180 Find the third derivative of 12v*2 + 17 + 2v + 20 + 24 + 10v2 - 3415v*5 - 84 wrt v. -204900v*2 Find the third derivative of -50 + 7292o*4 + 7426o*4 + 3o - 3o5 - 14083o*4 + 299 - 2o*2 wrt o. -180o*2 + 15240o Let h(a) = -1345a - 460. Let x(m) = 1347m + 447. Let v(w) = 7h(w) + 6x(w). Find the first derivative of v(d) wrt d. -1333 Let a(o) be the first derivative of -31o6/60 + 33o*4/8 + 2o*3/3 - 47o*2/2 + 21. Let n(b) be the third derivative of a(b). Differentiate n(w) wrt w. -372w What is the first derivative of 127p2 - 61p*2 - 18p + 1231 - 73p2 - 61p - 19p wrt p? -14p - 98 Let l(b) be the first derivative of b*7/7 - 1277b5/5 - b3/3 + 1947b + 2936. Find the third derivative of l(x) wrt x. 120x*3 - 30648x Let k(w) = 56w3 - 20w*2 + 7w - 1617. Let m(c) = 55c3 - 18c*2 + 6c - 1616. Let f(r) = 6k(r) - 7m(r). Differentiate f(i) wrt i. -147i2 + 12i Find the second derivative of -1406 + 6448k4 - 5k - 3265k4 - 3317k*4 + 3k wrt k. -1608k2 Let l(t) be the first derivative of 913t*5/5 - 16t3/3 + t2/2 - 3804. Find the third derivative of l(y) wrt y. 21912y Let a = 700 - 696. Find the second derivative of -2 + 64k*a - 8k - 19k4 - 198k*4 - 164k*4 - 3k wrt k. -3804k2 What is the derivative of 435 - 569x + 387 - 209 + 7x3 + 27x*3 - 28x*3 wrt x? 18x*2 - 569 Let r(n) = 2n*3 - n - 1. Let q(z) = 11z*3 - 708z*2 - 5z + 2064. Let f(w) = -q(w) + 4r(w). What is the second derivative of f(h) wrt h? -18h + 1416 Let g(c) be the first derivative of -570c7/7 - 652c*3/3 + 3c*2/2 + 2186. What is the third derivative of g(z) wrt z? -68400z*3 Let v(j) be the third derivative of -41/6j*3 - 10j*2 - 1/210j*7 + 0j + 0j6 + 8 + 0j*4 - 1/60j*5. Find the third derivative of v(q) wrt q. -24q Find the third derivative of 0l2 - 4l*2 + 2l*4 - 4369l*3 + 3882l*3 + 0l*2 - 37l wrt l. 48l - 2922 Let g(y) be the third derivative of y8/112 - 2y7/15 - y6/60 + y5/30 + y4/24 - 1870y3/3 - 223y*2. Find the third derivative of g(x) wrt x. 180x*2 - 672x - 12 Let j(b) = 68b3 + 4b*2 - 10b - 1175. Let t(z) = -66z3 - 5z*2 + 13z + 1178. Let x(o) = 5j(o) + 4t(o). Differentiate x(y) with respect to y. 228y2 + 2 Let i(w) be the third derivative of 3w7/10 + w6/40 + 998w3/3 + 1772w*2. What is the first derivative of i(y) wrt y? 252y*3 + 9y*2 Suppose -10h - 15h = -675. What is the third derivative of 86i*3 + 82i - hi3 - 163i + 101i3 - 2i*2 + 84i wrt i? 960 Let w be 9/(-6)84/(-18). What is the third derivative of 20b*3 + wb*3 - 9b*2 - 24b*2 - 27b*2 wrt b? 162 Let c(g) = 2g - 3. Let t be c(2). Let n(x) = -22x + 135. Let f be n(6). What is the first derivative of 3 - t - fm*4 + 6m*4 + 2 wrt m? 12m*3 Let v = 366 - 360. Find the third derivative of 86x*2 + 31x*4 - 10x*v - 25x*4 + 16 - 16 wrt x. -1200x*3 + 144x Let g(u) = -171u5 - 306u*2 - 30. Let r(f) = -3f5 + f2 + 2. Let b(m) = -4g(m) - 60r(m). What is the third derivative of b(z) wrt z? 51840z2 Let q(b) be the first derivative of 19b6 + b4/2 + 6b3 + 2b*2 + 5b - 11521. What is the third derivative of q(i) wrt i? 6840i2 + 12 Let j(m) be the second derivative of 761m*3/3 - 1718m*2 - 313m. Differentiate j(t) wrt t. 1522 Let q = 189 - 6. What is the first derivative of 34 + qv - 33v - 142 + 68 wrt v? 150 What is the derivative of -1162 - 373 - 1326n + 2050 wrt n? -1326 Let q(b) = -4b + 3. Suppose 10 = 4a + f - 6f, 2a + f + 2 = 0. Let y be q(a). What is the second derivative of 6s*3 + 3s - 2s + 6s*y + 4s wrt s? 72s Let y(j) be the second derivative of 143j*4/4 + 7j*3/6 + 171j*2/2 - 1697j + 1. Find the second derivative of y(q) wrt q. 858 Let q(u) = 11728u3 - 201u*2 - 21u - 6. Let f(y) = -2y2 + 3. Let t(x) = 2f(x) + q(x). Find the third derivative of t(g) wrt g. 70368 Let i(o) = o + 6. Let y = -8 - -13. Let m be i(y). Find the third derivative of -31d6 - 9d*2 + md*6 - 10d*6 - 23d*2 wrt d. -3600d*3 Let k be -64/1818/(-8). Let c be (-3)/k-771/1. What is the first derivative of -149 + c + 40w + 77 wrt w? 40 Suppose -5l + 224 - 149 = 0. Find the second derivative of -10k*5 - 31k - lk4 + 67k + 12k5 wrt k. 40k*3 - 180k*2 Let g(a) be the first derivative of 2578a*3/3 + 333a*2 + 2606. Find the second derivative of g(k) wrt k. 5156 Let a(d) be the first derivative of 48d*5/5 + 2d*4 - 3d*2/2 - 463d - 724. What is the second derivative of a(r) wrt r? 576r2 + 48r What is the	{ "pile_set_name": "DM Mathematics" }
e remainder when 168 is divided by 52? 12 Calculate the remainder when 53 is divided by 10. 3 Calculate the remainder when 290 is divided by 20. 10 Calculate the remainder when 154 is divided by 32. 26 What is the remainder when 1106 is divided by 1070? 36 What is the remainder when 422 is divided by 366? 56 Calculate the remainder when 71 is divided by 61. 10 What is the remainder when 358 is divided by 41? 30 Calculate the remainder when 216 is divided by 151. 65 Calculate the remainder when 138 is divided by 10. 8 What is the remainder when 580 is divided by 117? 112 Calculate the remainder when 576 is divided by 287. 2 Calculate the remainder when 3593 is divided by 62. 59 What is the remainder when 205 is divided by 96? 13 Calculate the remainder when 1339 is divided by 432. 43 Calculate the remainder when 70 is divided by 16. 6 Calculate the remainder when 2789 is divided by 126. 17 What is the remainder when 275 is divided by 134? 7 Calculate the remainder when 2110 is divided by 33. 31 Calculate the remainder when 415 is divided by 126. 37 Calculate the remainder when 143 is divided by 49. 45 What is the remainder when 256 is divided by 128? 0 What is the remainder when 1026 is divided by 87? 69 Calculate the remainder when 922 is divided by 92. 2 What is the remainder when 89 is divided by 75? 14 Calculate the remainder when 223 is divided by 15. 13 What is the remainder when 395 is divided by 196? 3 Calculate the remainder when 191 is divided by 67. 57 Calculate the remainder when 3376 is divided by 147. 142 What is the remainder when 70 is divided by 24? 22 What is the remainder when 55 is divided by 18? 1 Calculate the remainder when 661 is divided by 284. 93 What is the remainder when 56 is divided by 17? 5 Calculate the remainder when 804 is divided by 34. 22 What is the remainder when 1675 is divided by 15? 10 Calculate the remainder when 16 is divided by 11. 5 What is the remainder when 662 is divided by 60? 2 Calculate the remainder when 152 is divided by 13. 9 What is the remainder when 121 is divided by 52? 17 What is the remainder when 1048 is divided by 18? 4 What is the remainder when 525 is divided by 24? 21 What is the remainder when 971 is divided by 164? 151 What is the remainder when 474 is divided by 161? 152 What is the remainder when 55 is divided by 28? 27 Calculate the remainder when 562 is divided by 94. 92 Calculate the remainder when 83 is divided by 24. 11 Calculate the remainder when 153 is divided by 38. 1 What is the remainder when 638 is divided by 317? 4 Calculate the remainder when 174 is divided by 111. 63 What is the remainder when 199 is divided by 34? 29 Calculate the remainder when 580 is divided by 6. 4 What is the remainder when 13 is divided by 5? 3 What is the remainder when 44 is divided by 10? 4 Calculate the remainder when 637 is divided by 61. 27 What is the remainder when 122 is divided by 84? 38 Calculate the remainder when 287 is divided by 6. 5 What is the remainder when 730 is divided by 148? 138 What is the remainder when 87 is divided by 43? 1 Calculate the remainder when 1169 is divided by 78. 77 What is the remainder when 57 is divided by 25? 7 Calculate the remainder when 1398 is divided by 26. 20 What is the remainder when 166 is divided by 30? 16 Calculate the remainder when 370 is divided by 77. 62 Calculate the remainder when 366 is divided by 29. 18 What is the remainder when 647 is divided by 36? 35 Calculate the remainder when 100 is divided by 47. 6 What is the remainder when 280 is divided by 273? 7 What is the remainder when 158 is divided by 61? 36 Calculate the remainder when 1214 is divided by 123. 107 What is the remainder when 812 is divided by 70? 42 Calculate the remainder when 131 is divided by 33. 32 Calculate the remainder when 64 is divided by 11. 9 What is the remainder when 147 is divided by 4? 3 Calculate the remainder when 122 is divided by 55. 12 What is the remainder when 691 is divided by 11? 9 What is the remainder when 1091 is divided by 13? 12 Calculate the remainder when 27 is divided by 15. 12 Calculate the remainder when 753 is divided by 69. 63 What is the remainder when 2746 is divided by 131? 126 What is the remainder when 217 is divided by 215? 2 What is the remainder when 173 is divided by 25? 23 What is the remainder when 373 is divided by 90? 13 What is the remainder when 160 is divided by 19? 8 What is the remainder when 66 is divided by 12? 6 Calculate the remainder when 1775 is divided by 47. 36 What is the remainder when 202 is divided by 51? 49 What is the remainder when 1152 is divided by 114? 12 Calculate the remainder when 648 is divided by 13. 11 Calculate the remainder when 32870 is divided by 56. 54 What is the remainder when 13694 is divided by 214? 212 Calculate the remainder when 117 is divided by 3. 0 What is the remainder when 264 is divided by 139? 125 What is the remainder when 97 is divided by 15? 7 What is the remainder when 176 is divided by 113? 63 Calculate the remainder when 357 is divided by 33. 27 What is the remainder when 25 is divided by 4? 1 Calculate the remainder when 1707 is divided by 555. 42 What is the remainder when 373 is divided by 25? 23 Calculate the remainder when 319 is divided by 108. 103 Calculate the remainder when 369 is divided by 37. 36 What is the remainder when 319 is divided by 80? 79 Calculate the remainder when 889 is divided by 181. 165 Calculate the remainder when 46 is divided by 5. 1 Calculate the remainder when 21423 is divided by 16. 15 Calculate the remainder when 49 is divided by 10. 9 Calculate the remainder when 2627 is divided by 18. 17 What is the remainder when 19 is divided by 6? 1 Calculate the remainder when 98 is divided by 17. 13 What is the remainder when 419 is divided by 111? 86 What is the remainder when 403 is divided by 398? 5 What is the remainder when 465 is divided by 73? 27 Calculate the remainder when 397 is divided by 50. 47 Calculate the remainder when 195 is divided by 100. 95 Calculate the remainder when 231 is divided by 26. 23 What is the remainder when 163 is divided by 28? 23 What is the remainder when 63 is divided by 13? 11 Calculate the remainder when 95 is divided by 41. 13 What is the remainder when 370 is divided by 118? 16 Calculate the remainder when 2738 is divided by 10. 8 Calculate the remainder when 258 is divided by 9. 6 Calculate the remainder when 603 is divided by 31. 14 Calculate the remainder when 316 is divided by 69. 40 What is the remainder when 72 is divided by 15? 12 Calculate the remainder when 558 is divided by 84. 54 Calculate the remainder when 5 is divided by 5. 0 Calculate the remainder when 39 is divided by 11. 6 What is the remainder when 82 is divided by 24? 10 What is the remainder when 69 is divided by 2? 1 Calculate the remainder when 1736 is divided by 22. 20 Calculate the remainder when 325 is divided by 93. 46 Calculate the remainder when 1230 is divided by 98. 54 Calculate the remainder when 108 is divided by 22. 20 Calculate the remainder when 846 is divided by 478. 368 What is the remainder when 4759 is divided by 49? 6 What is the remainder when 111 is divided by 29? 24 What is the remainder when 995 is divided by 21? 8 Calculate the remainder when 325 is divided by 4. 1 What is the remainder when 4861 is divided by 1611? 28 What is the remainder when 656 is divided by 173? 137 Calculate the remainder when 106 is divided by 31. 13 Calculate the remainder when 34 is divided by 3. 1 What is the remainder when 549 is divided by 23? 20 Calculate the remainder when 623 is divided by 16. 15 Calculate the remainder when 105 is divided by 28. 21 What is the remainder when 277 is divided by 2? 1 Calculate the remainder when 478 is divided by 120. 118 What is the remainder when 334 is divided by 68? 62 Calculate the remainder when 507 is divided by 212. 83 What is the remainder when 50819 is divided by 21? 20 Calculate the remainder when 436 is divided by 111. 103 Calculate the remainder when 96 is divided by 33. 30 Calculate the remainder when 647 is divided by 214. 5 Calculate the remainder when 1085 is divided by 32. 29 What is the remainder when 216 is divided by 54? 0 Calculate the remainder when 2964 is divi	{ "pile_set_name": "DM Mathematics" }
= -v - 2. What is the tens digit of h(v)? 1 Let p(z) = -z*2 - 6z - 5. Let s be p(-5). Let c be 3(-1 + 2) + 0. Suppose -4d + 29 + c = s. What is the units digit of d? 8 Suppose 5m - 28 - 17 = 0. Suppose 13f - mf - 208 = 0. What is the tens digit of f? 5 Let z(o) = -1 + 1 - o. What is the units digit of z(-7)? 7 Let n = -64 + 109. What is the tens digit of n? 4 Let p = -4 - 1. What is the units digit of (15/p)/((-1)/9)? 7 Let n(b) = 5b*2 + 3b. Let l(j) = 4j. Let m(u) = 3u - 1. Let q(x) = 2l(x) - 3m(x). Let z be q(5). What is the units digit of n(z)? 4 Let z(i) = i*2 + 3i - 1. Let b be z(4). Let t be 23b/(-6). Let c = -19 - t. What is the units digit of c? 8 Suppose 2d - 4d = 0. Suppose -5q + 80 = -dt + 2t, -2t + 10 = 0. What is the tens digit of q? 1 Let z = -75 + 126. What is the tens digit of z? 5 Suppose -4u + 2b = -2b - 172, -3u = 4b - 101. What is the tens digit of u? 3 Let o(g) = g3 + g + 1. Let y(b) = 6b*3 - 9b*2 + 11b - 1. Let i(m) = 5o(m) - y(m). Let s be i(8). Suppose s - 6 = 4t. What is the units digit of t? 4 What is the tens digit of 12 - (2 + -4 - -3)? 1 Let s(u) = -3u2 - 9u - 4. Let f be s(-7). Let q = -52 - f. What is the tens digit of q? 3 Suppose -18 = -2f - 3c, 0c = 2f - 3c + 6. What is the units digit of f? 3 Let o(s) = 7s - 1. Let d be o(1). Let r(u) = -u*3 + 6u*2 + 2u - 5. Let b be r(d). Suppose 0 = -bc + 2c + 45. What is the units digit of c? 9 Let n(g) = g*3 - 5g*2 + 8g - 5. Suppose 3s - 30 = 3q, -5q = -2s - 0s + 35. What is the units digit of n(s)? 5 Suppose -2v = -7v - 15. Let t be (v2)/(6/(-9)). Suppose -3k - 3 + t = 0. What is the units digit of k? 2 Let s = 140 + -78. What is the units digit of s? 2 Let y(s) = s3 - 5s*2 - 4s - 4. Let l = 13 + -9. Suppose 32 = 5f - w, -14 = -lf + 4w - 9w. What is the units digit of y(f)? 8 Suppose n - 5p + 2p + 31 = 0, 2p + 71 = -3n. Let g = 35 + n. What is the tens digit of g? 1 Let c = -17 - -48. What is the tens digit of c? 3 Let m(a) = -a*2 + 6a + 1. Let p be m(3). What is the tens digit of 476/20 - (-2)/p? 2 Let x = 15 - 12. What is the tens digit of 0 + (20 - -3) - x? 2 Suppose 0 = -2n + 6, 0n - n - 481 = -4w. What is the tens digit of w? 2 Suppose 3m - 477 = -4d + 481, 2m - 4 = 0. What is the hundreds digit of d? 2 Let r = 19 - 5. What is the tens digit of r? 1 Suppose -4u = -7 - 21. Suppose ud = 2d + 145. Let m = d - 16. What is the units digit of m? 3 Suppose -5y + 21 - 6 = 0. Suppose 0 - y = -x. Suppose 0 = xc - 0c - 30. What is the tens digit of c? 1 Let u = -11 - -14. Suppose -2k = -uk + 5. Suppose -2x - 11 - 15 = -4t, kx = 5t - 40. What is the units digit of t? 5 Suppose 0 = 5y, -6 = -n + 4y + 185. What is the tens digit of n? 9 Let u be (5 + -11)(-2)/4. Suppose 126 = -un + 21. What is the units digit of n/(-20) - (-2)/8? 2 Suppose 321 + 94 = 5t. What is the tens digit of t? 8 Let p(h) = 5h - 2h2 + 4h*2 + 2 + 2. Let t be p(-6). Suppose 4a - 2 - t = 0. What is the tens digit of a? 1 Suppose -200 = -4a + 4o, 2o = o - 4. What is the tens digit of a? 4 Let m(c) = 7c*2 + 3c - 5. What is the units digit of m(2)? 9 Let g be (-1)/(-4) + 63/4. Suppose -2z + 2 - g = 0. What is the units digit of 4/(-14) - 37/z? 5 Suppose 6 = 2c - 4i, -c - 4i = -5i - 4. Let l(v) = v + 6. What is the units digit of l(c)? 1 Suppose 3v - 7 = h + 4h, 23 = 5v + 3h. Suppose -j - vt - 32 = -2j, -j = -5t - 28. What is the units digit of j? 8 Let r(j) = 6j3 - j2 + j - 1. Let h = 3 - 9. Let q be ((-3)/((-9)/h))/(-2). What is the units digit of r(q)? 5 Suppose h + 34 = 3k + 3h, 5k - 55 = -5h. Suppose 0 = y - j - 2j - k, -4y + j + 26 = 0. What is the units digit of y? 6 Let t = -24 + 14. What is the units digit of ((-4)/t)/(11/1265)? 6 Let r(u) = u - 7. Let j be r(0). Suppose 0 = 2t - 4b + 16, -5b - 13 = 5t - 6b. Let a = t - j. What is the units digit of a? 5 Let s(h) = 8h + 1 - h2 + 15 + 4h - 1. What is the units digit of s(11)? 6 Suppose 0f = -4f + 192. Suppose 5 - 53 = 4g - y, 3y + f = -4g. Let o = g - -25. What is the tens digit of o? 1 Suppose -16l + 12l + 284 = 0. What is the tens digit of l? 7 What is the tens digit of 268/8 + (-1)/(-2)? 3 Let u(a) = 3a + 3. Let k be u(5). Suppose -c - 5f = k, c + 4f + 13 = -0f. What is the units digit of c? 7 Suppose 0 = 3g + 3 - 0. Let j be 6(1 + (-3 - g)). What is the tens digit of (9/j)/(3/(-20))? 1 What is the units digit of (29 - 6)-2(-1 + -3)? 4 Let i = -22 + 45. Suppose -i = -2d + 5c, -3c = 2d + 3 - 2. Suppose -5t - dl - 3 + 1 = 0, 5l = -2t - 11. What is the units digit of t? 2 Suppose -11 = -3u + 34. Suppose 8z - 3z = u. What is the units digit of z? 3 Suppose -2d + 28 + 28 = 0. What is the tens digit of d? 2 Suppose 1 = -2y + 7, 2s - 303 = -5y. What is the tens digit of s? 4 Suppose 39 + 381 = 6c. What is the units digit of c? 0 Let m(c) = -6c + 8c - 1 + 16. What is the units digit of m(11)? 7 Let u be ((-4)/(-10))/((-7)/(-35)). Suppose -45 = -3s + 15. Suppose -ul = 3w - 7, 5w = -l + 4l - s. What is the units digit of l? 5 Let n(j) = -j3 + j2 + j. Let k be n(2). Let o be (k/4)/((-2)/44). Suppose 2x - o = -5y, 3x = 2y + 4x - 5. What is the units digit of y? 1 Let g(f) = -4f - 3 + 6 - 1 - 4. What is the tens digit of g(-4)? 1 Suppose q = -3p + 49, 5p - 50 = -3q + 77. Let o = -25 + 5. Let g = q + o. What is the units digit of g? 4 Let s = 0 - -2. Suppose o - 1 = s. What is the units digit of o? 3 Suppose h - 4h + 132 = 0. What is the tens digit of h? 4 Let x(l) = l*3 + 8l*2 - 5l - 4. Let f be x(-8). Suppose -5n + f = -3n. What is the tens digit of n? 1 Suppose j - 2l - 1 = 4, -4l = j + 1. Suppose 9 = 2s + j. Suppose 0f = -sf + 12. What is the units digit of f? 4 Let s(k) = -405k*3 + 2k + 2. What is the hundreds digit of s(-1)? 4 Let v = 3 + 9. What is the tens digit of v? 1 Let n = 50 - 31. Suppose -5r + n + 166 = 0. What is the tens digit of r? 3 Let i = -146 - -260. What is the tens digit of i? 1 What is the hundreds digit of -4 + 22/(4/((-28)/(-1)))? 1 Let c(b) = 2b*3 - 5b*2 + b + 7. Let j be c(5). Suppose -3s - 14 = -j. Suppose -2i = -10, -4i + 9i = -2a + s. What is the units digit of a? 8 Suppose 0 = 5a + 4x - 72, 90 - 12 = 5a + x. What is the units digit of a? 6 What is the tens digit of 4/22 + (-7130)/(-110)? 6 Let a = 3 + -4. Let o be -2 + 5 + (a - 0). What is the units digit of (-2 + -1 + o)-1? 1 Let o = 14 - 13. What is the units digit of 48/2 + 3o? 7 Let b(s) = 7s3 - s2 + s - 1. Let m be 2 - (-1 - -4) - -4. Let n = m + -2. What is the units digit of b(n)? 6 Let q(v) = 13v2 - v - 2. What is the units digit of q(-2)? 2 Let y be 8/8 - 1-1. Suppose 2l + 4g = 20, yg + g = l + 15. Let f = 9 - l. What is the units digit of f? 9 Let w(z) = -7z - z2 + 13 - 14 + z. What is the units digit of w(-5)? 4 Let v(d) = d2 + 3d + 6. Let g be v(-3). Suppose -4b + 84 = -5y + y, b + 2y = g. What is the units digit of b? 6 Let m = 16 + -7. Let n be (-25)/(-3) + (-3)/m. Suppose 4k - 5s - n = -s, -5k = -3s - 12. What is the units digit of k? 3 Suppose -3d - 28 = -5c, -d - c = 2 + 2. Let o(w) = -2w - 9. What is the units digit of o(d)? 3 Let w(k) = 6k*2 - 4k - 11. What is the tens digit of w(7)? 5 Let v be (18/(-3))/(2/(-3)). What is the units digit of 2/v - (-122)/18? 7 What is the units digit of (-164)/(-6) + (7 - (-114)/(-18))? 8 Let f(v) = v + 21. What is the units digit of f(16)? 7 Suppose -3 = -2z + 3. What is the units digit of z? 3 Let z = -117 + 81. Suppose -580 = 2i + 3i. What is the units digit of i/z + (-2)/9? 3 Let v = 0 + 13. Suppose -4c + 3g = -2g - v, -5 = 5g. Suppose -l + 7 = -0l - 3p, 0 = -cp. What is the units digit of l? 7 Let y(v) = -2v3 - v2 + v + 1. Let k be y(-1). Let o be -1 + (k - -2) + 1. What is the units digit of 8/12 + 28/o? 0 Suppose c + 29 = 316. What is the units digit of c? 7 Suppose -8d + 4d + 4s = -244, -5s - 15 = 0. What is the tens digit of d? 5 Let v(i) = -i2 - 17i - 13. What is the tens digit of v(-14)? 2 Suppose 4b - 20 = 16. Let y be (1 + 1)/40. Let k = b - y. What is the units digit of k? 9 Let z = -9 - -17. Let c = 6 - z. What is the units digit of	{ "pile_set_name": "DM Mathematics" }
plify (n/n22)(-1/13) assuming n is positive. n*(21/13) Simplify (f/((f((ff(-2))/f)/fff)/fff)f*(-2/13))/(ff0)(20/9) assuming f is positive. f(-278/117) Simplify l29l(4/5) assuming l is positive. l(149/5) Simplify h(-9/5)((hh(-1/46))/h)/h assuming h is positive. h(-649/230) Simplify (jj/(j/(j/(j*(-2/9)/jj)j)j))(-1/16) assuming j is positive. j(-5/36) Simplify (yyy*3y)(-6/5) assuming y is positive. y(-36/5) Simplify ((u(-3))(-50))(30/13) assuming u is positive. u(4500/13) Simplify (oo(1/6)o)/o(-26) assuming o is positive. o(169/6) Simplify (o/(oo(8/3)))/oo/(o/o*(2/7)o)(((o/(o0/o))/o)/o)40 assuming o is positive. o(-92/21) Simplify (q27)(-21) assuming q is positive. q(-567) Simplify (w2w)(-18)/((((w(-1/9)w)/w)/w)/ww/(w/(w/(w*(2/13)/w))w)w) assuming w is positive. w(-6287/117) Simplify (vv(1/16))(-7/9) assuming v is positive. v*(-119/144) Simplify ((mm*1)/mm)/(m/(mm(-1)/m)m)m(2/9)(m/((mm/(mm*2)m)/m))/m assuming m is positive. m(2/9) Simplify (w/w(-2/35)w)/ww(-5/4) assuming w is positive. w(-27/140) Simplify (l*(-6)/ll*(1/15)l)8 assuming l is positive. l(-712/15) Simplify (t(tt*(-3/10)t)/t)/(t/(t/(t/(t*(1/21)t)))t) assuming t is positive. t(157/210) Simplify z15((z*14zz)/z)/z assuming z is positive. z29 Simplify ((b(1/2)/b)/b)/b(12/17) assuming b is positive. b(-75/34) Simplify (mm*(-4)m)/mm(-23) assuming m is positive. m(-26) Simplify y(1/3)y29 assuming y is positive. y(88/3) Simplify (d(-2/9)/d(-3/4))/(d/(d/(d/(d*(-2/11)dd)))d(-3)) assuming d is positive. d(1721/396) Simplify (i*(2/21)i)/i5 assuming i is positive. i(-82/21) Simplify a*(-3)a/(aa(-5))(a/a(-4))/(a(-5)a) assuming a is positive. a11 Simplify ((o(-7)oo)/o)(14/15) assuming o is positive. o(-28/5) Simplify ((iii(-6)/i)/(((i(i/(i/((i/(i*3i))/i)))/i)/i)/i))24 assuming i is positive. i24 Simplify (a*(-4)/(aa/(aa/(a/a(2/7)a))))(-44) assuming a is positive. a(1760/7) Simplify rr37rr(2/5)/r assuming r is positive. r(192/5) Simplify ((n(n/n*(1/3))/n)/nn/n*(-4/5)n)(-16) assuming n is positive. n(-592/15) Simplify (w/w*0)/www(-8/3)/w assuming w is positive. w(-8/3) Simplify g(3/8)ggg(7/4) assuming g is positive. g(33/8) Simplify (h/h*8hhhh7)(-1/45) assuming h is positive. h(-1/15) Simplify u/(uuu/(u/(u(2/15)u))u)u/u*(-1/4)((uu5/u)/u)/(u(-5)/uu) assuming u is positive. u(427/60) Simplify (z(8/7)(((z/z(-9))/z)/z)/zzz)(-47) assuming z is positive. z(-3337/7) Simplify (l15/l)(2/69) assuming l is positive. l(28/69) Simplify (ww(-5))(-4) assuming w is positive. w*16 Simplify (kkk/k(-1/2)kk)(-45)/(k(1/2)/(k6/k)) assuming k is positive. k(-243) Simplify l(-2/15)lll3 assuming l is positive. l(73/15) Simplify (v(-1/8)/v(-2/7))/(v/(v/(v/v*(-2/3))v))2 assuming v is positive. v(-197/168) Simplify bb/b(-10)b*9(b*(2/3)b)/(b*(-7)/bb) assuming b is positive. b*(89/3) Simplify (((t/(tt*(2/7)))/tt)/t)*(-7/6)((t*(-1)t)/ttt)(19/4) assuming t is positive. t(25/4) Simplify (c*(2/9)c(3/4))/(c(5/6)/(c(cc(-8))/c)) assuming c is positive. c(-247/36) Simplify (gg(-6/7))(-1/18) assuming g is positive. g(-1/126) Simplify w(2/67)/((w/w9)/w) assuming w is positive. w(605/67) Simplify c(-27)/c(1/2) assuming c is positive. c(-55/2) Simplify x(-2)x/x*(-4)x(-2/15)/(x(1/3)/x) assuming x is positive. x*(53/15) Simplify ((k(k((k/(k/(k(2/7)k))k)/kkkk)/kk)/k)/k)/k(-6)(kkk/(k*(2/7)/k))/(kk(2/5)) assuming k is positive. k(63/5) Simplify j/(j*6jjj)j(6/13) assuming j is positive. j(-98/13) Simplify (n9n/(((nn/(n/n(-9)n)n)/n)/n))/((n/(n(-3)/nnn))/(n/(n7/n))) assuming n is positive. n12 Simplify ((pp(-3/4))/p)(3/11)(p2/p)(-8/19) assuming p is positive. p(-523/836) Simplify (zz(5/4))/(z/z(-1/30)) assuming z is positive. z*(73/60) Simplify ((ss/s2)28)23 assuming s is positive. 1 Simplify ((((s(-1)/s)/s)/s)/((s/(s/(s*(-1/4)/s))s)/s))(-4) assuming s is positive. s11 Simplify (i*(-7)/i)/(i((ii(1/6))/i)/i)i*(-11)i10 assuming i is positive. i(-55/6) Simplify (a0)(-2/35)/(a/(a/(a/((a*0a)/a)))a)(-29) assuming a is positive. a58 Simplify o(-6/5)((oooo(-4)ooo)/o)/o assuming o is positive. o(-6/5) Simplify (d(4/9))5 assuming d is positive. d(20/9) Simplify b*(-20)b1 assuming b is positive. b(-19) Simplify (vv(-1)/vv)/(v/(v/v*(-2)))(v(-1))(-42) assuming v is positive. v44 Simplify (k(1/17))(-9/8) assuming k is positive. k(-9/136) Simplify u*(-1)uu((uu19u)/uu)/u assuming u is positive. u21 Simplify x(-3/4)xxxx(-2)(x(-2))(-10) assuming x is positive. x*(81/4) Simplify (h/(h/(hh/(h*(-6)/h)h)))(-10/17) assuming h is positive. h(-100/17) Simplify (z(-2/9)/(z/(z(2/29)/z)))(-11/5) assuming z is positive. z(6182/1305) Simplify (((p(pp*(-2/7))/p)/p)/(((pp(p/(pp*(-6)))/ppp)/p)/p))(-19) assuming p is positive. p(969/7) Simplify ((s(2/27)s)/s)/(s/(((s/s*4ss)/s)/s)) assuming s is positive. s(-106/27) Simplify ((t(1/4))(2/3))(-8/7) assuming t is positive. t(-4/21) Simplify q(-2/3)/(((qq/(q/((q/q*(-3/5))/qq)))/q)/q) assuming q is positive. q*(-19/15) Simplify (gg17)(-13/5) assuming g is positive. g(-234/5) Simplify ((t/t(-1/9))/(t/(tt(-5)t)))(-21) assuming t is positive. t(182/3) Simplify (r(-8)/(r(1/5)r))14 assuming r is positive. r(-644/5) Simplify ((a(-3/2))(-2/35))(2/57) assuming a is positive. a(2/665) Simplify b(-5)/bb15 assuming b is positive. b9 Simplify ii(-1/25)ii/(i(-21)/i) assuming i is positive. i(624/25) Simplify (f(-1/2)f(2/5))(-1/3) assuming f is positive. f*(1/30) Simplify ((gg(-4))/g)(-34) assuming g is positive. g136 Simplify t(1/6)/tt/(((tt*(-1))/t)/ttt)t6/t(-2/11) assuming t is positive. t(419/66) Simplify ((q9q)/((q/q(-1/6))/q))/(q(-2/7)q)30 assuming q is positive. q(-487/42) Simplify (bbb/b*(-12))/(b/(b/(bb/b*(2/13)b))) assuming b is positive. b(158/13) Simplify o10/oo/(oo*(-6))(oo(-2/5)oo)/(o/(o/o(2/19)o)o) assuming o is positive. o(1662/95) Simplify ((n(-1)/n)(-23))(3/14) assuming n is positive. n(69/7) Simplify (i(-3))47 assuming i is positive. i(-141) Simplify ((h(1/4))(2/133))5 assuming h is positive. h(5/266) Simplify ((f1/ff)/f)*(-2/45)/(f/(ff/(f*1ff)fff))12 assuming f is positive. f12 Simplify u((u/(u/(u/((uu*8u)/u))u))/u)/uu(-11) assuming u is positive. u(-21) Simplify ((k(-5/2)/k)/k)/k(1/44) assuming k is positive. k(-199/44) Simplify (u/u3u7)/(u(-1/2))(5/9) assuming u is positive. u(95/18) Simplify ((hh*(2/27)hhhh)/(h/h(-15)))47 assuming h is positive. h(-13865/27) Simplify ((w(ww/(w/((ww/(w/(w/(w*(-7/3)/w))))/w)))/ww)/www*(6/7)/ww)(-2/115) assuming w is positive. w(-302/2415) Simplify (g(2/7))(2/23)/(((g*(7/3)/g)/g)/ggg7) assuming g is positive. g(-3530/483) Simplify a(2/83)a(-10) assuming a is positive. a(-828/83) Simplify m*(1/15)m(-1/6) assuming m is positive. m(-1/10) Simplify h*(2/21)/(hh(-2/5)/h) assuming h is positive. h(52/105) Simplify (i/(ii(-5)))/(ii*(-3/2)/i)(i0)(-11/8) assuming i is positive. i(13/2) Simplify (k7kkk)/((k(-13)/k)/k) assuming k is positive. k25 Simplify (iiii/(i*(-14)/ii)i)/(i(-15)/i) assuming i is positive. i35 Simplify u(-2/3)u/u(-12) assuming u is positive. u(37/3) Simplify (i(-6)/i(1/10))/(i(1/2)/i)(2/49) assuming i is positive. i(-2979/490) Simplify i(9/5)i3/i assuming i is positive. i(19/5) Simplify (b/(bb(-1/2)))24b(-7)/(b4/bb) assuming b is positive. b Simplify (r/r0)(-39)/((r/(rr1))/(r(-2/9)r)) assuming r is positive. r(-335/9) Simplify c(4/5)/c*(-2/7)((c*0cc)/c)(1/3) assuming c is positive. c(149/105) Simplify nn*10(nn(-4/7)n)/n assuming n	{ "pile_set_name": "DM Mathematics" }
closest to -1/7? (a) 0 (b) -11 (c) 4 (d) 0.1 a What is the closest to -1/5 in 10, 2, -13, -0.2? -0.2 Which is the nearest to 1? (a) 0.2 (b) -2 (c) 5 (d) 1650 a What is the closest to 0 in 1, -4, 28, 10, 3? 1 Which is the closest to -160? (a) 2 (b) -0.1 (c) 5 (d) -5 (e) -2/13 d What is the nearest to 5/4 in 2/15, 1, 3, 4/9, 0.1? 1 What is the nearest to 164 in -24, -1, 4/3? 4/3 What is the nearest to -2 in 2, -0.143, -1/4, -5? -1/4 Which is the nearest to 4? (a) 5 (b) 0.5 (c) 10 (d) 0.3 (e) -13.6 a Which is the nearest to -39/5? (a) 3 (b) -2/9 (c) -0.18 (d) 1 b Which is the nearest to -54? (a) 0.03 (b) 4 (c) 119 (d) 0.3 a What is the closest to -1/3 in -2, -144/13, 0.08, -1/5? -1/5 What is the nearest to -0.1 in 1, 1/3, 1005, -1, 3/5? 1/3 What is the closest to 0 in 8, 5, -891? 5 Which is the closest to -0.71? (a) 3 (b) -9/5 (c) 3.02 b What is the nearest to 0 in 6, -1/4, -4, -0.20316? -0.20316 Which is the nearest to -2/5? (a) 5 (b) -0.5 (c) -1.54 (d) -0.1 (e) -0.28 b What is the nearest to -5 in -25, 1, -30? 1 What is the nearest to -1/3 in -2/5, -11, -2, 4/145? -2/5 Which is the closest to -0.1? (a) 2 (b) -5 (c) -2/9 (d) -1.91 c What is the closest to 2 in 1, -5, -10/763, -2/9, 0.2? 1 What is the closest to -0.19 in 1/2, 2/11, -6, 5, -1/13? -1/13 Which is the closest to -1? (a) 0.2 (b) 11.77 (c) 22 a What is the nearest to -8/87 in 3/2, 0.4, 1/3, 0.02? 0.02 What is the nearest to -1/2 in -8, -1195, 4.6? 4.6 What is the nearest to -15 in 0.5, 4, -13, 3, -0.2? -13 Which is the nearest to -2? (a) -66 (b) 7 (c) 3 (d) -1 (e) 5 d Which is the closest to 3/5? (a) 0.1 (b) 13267 (c) 3 a Which is the nearest to 3? (a) -0.5 (b) 105 (c) 4 (d) 1 c What is the closest to 10 in -7, 0.3, 17/14, -0.2? 17/14 Which is the nearest to -631713? (a) 2/5 (b) -0.1 (c) 0.1 b Which is the nearest to 0.07? (a) 37 (b) -8/7 (c) -0.5 c What is the closest to 3 in -6, 2/7, 6, -0.71? 2/7 Which is the nearest to 1/7? (a) 12 (b) 0.1 (c) 1 (d) 6 (e) -2.4 b Which is the closest to 0.2? (a) -1.3 (b) 119 (c) 0.5 (d) -2/9 c Which is the nearest to -1/4? (a) 0.12 (b) 0.4 (c) -10 (d) 6/11 a What is the nearest to 0.1 in 1.4, 0.3, -141, -2/313, -0.4? -2/313 Which is the nearest to -2/7? (a) -358 (b) 0.2 (c) 3/86 c Which is the closest to 2/41? (a) -2/11 (b) -5 (c) -0.4 (d) 2 (e) -303.8 a What is the closest to -1 in 16, 61, 5, -128/3, -1/3? -1/3 Which is the nearest to 5? (a) -0.6 (b) 103 (c) -14 a Which is the nearest to -36? (a) 127.6 (b) 3 (c) 1/4 (d) 5 c What is the nearest to 0.1 in 2, 0, -3, 1/4, 2/4513? 2/4513 What is the closest to 0 in 1/521, 1, 6? 1/521 Which is the nearest to -1? (a) 5 (b) -1/25404 (c) -2/7 (d) -4 (e) 4 c What is the nearest to 0.28 in 9, -20, -2/3? -2/3 What is the nearest to -1 in 1.7, 1, -2, 17, -0.4? -0.4 Which is the nearest to -2? (a) 2/7 (b) 4 (c) -1623 a What is the nearest to -2 in 4, -0.5, 0.3, 5, 277/6? -0.5 Which is the nearest to -0.1? (a) 0.1 (b) -207 (c) 12 (d) 0.3 (e) -10 a What is the closest to 1 in -5, -1, -1/13, -1/32, -4? -1/32 What is the closest to 1 in -1, -3, -79069, -0.3? -0.3 Which is the closest to -1? (a) -4 (b) 1/6 (c) -1 c Which is the closest to 1? (a) 819 (b) 4 (c) -1/3 c Which is the closest to -4? (a) 22 (b) -0.4 (c) 0.1 (d) 2/7 b Which is the closest to -233/6? (a) -12/5 (b) -2 (c) -0.2 a What is the closest to -8 in -1/2, -5/3, -1/11? -5/3 Which is the nearest to -2? (a) 3 (b) 2/13 (c) -193.6 (d) -3/2 d Which is the closest to 1? (a) -2/241 (b) 0 (c) 3 (d) -2/51 b What is the nearest to 10 in -3, 65, -0.5, -0.1? -0.1 Which is the nearest to 0.2? (a) 0.5 (b) 2 (c) 767 a What is the closest to -285/4 in -1, -1/6, 48/7? -1 Which is the closest to 41? (a) -1 (b) 2 (c) 227 b Which is the nearest to -2/9? (a) -2/9 (b) -0.004 (c) -4 (d) -3/4 a Which is the closest to 0.2? (a) 0.1 (b) 5 (c) 25 (d) 13.7 a What is the nearest to 22 in 3, -0.4, 0? 3 Which is the nearest to 3/2? (a) 2/3 (b) -0.5 (c) -1996 a Which is the nearest to -0.1? (a) 2 (b) 18268 (c) 2/21 c What is the closest to -1 in -0.4, -7.5, -47, -3? -0.4 Which is the closest to 0.01? (a) 269 (b) -0.11 (c) -0.4 (d) 5 b Which is the nearest to 1? (a) 29 (b) -13 (c) -0.3 (d) 0 d Which is the nearest to 1/10? (a) -3/4 (b) 0.054 (c) 3/7 b Which is the nearest to -1? (a) 3 (b) -2681 (c) 11 (d) 1/8 d What is the closest to 64 in -4, 3/5, -0.066? 3/5 What is the closest to 4 in -2, -1, 0.2, 223, 0.3? 0.3 What is the nearest to 0 in 2582, 37/7, 1? 1 Which is the closest to 2/5? (a) 5/12 (b) 4 (c) -10 (d) -2 a What is the closest to -2/3 in -0.4, 0, -3777/14, 0.4, 2/3? -0.4 Which is the nearest to 30? (a) -1 (b) 0.1 (c) 2/67 b What is the nearest to -2/3 in -0.3, 0, -2, -74.48, -0.2? -0.3 Which is the nearest to -0.37? (a) -3/2 (b) -7 (c) -13/2 (d) 0.1 d Which is the nearest to -10? (a) 0.4 (b) -3 (c) 3 (d) 235 b Which is the nearest to -1? (a) -1437 (b) 5 (c) 3/10 c Which is the nearest to 3? (a) -1/4 (b) 0.3 (c) -2/7 (d) 5 (e) -2 d What is the nearest to 0.3 in -1/9, -235, 0.3, -2/11, -1/3? 0.3 Which is the nearest to 654? (a) 0.7 (b) 0.4 (c) -0.2 (d) 0 a What is the nearest to -713 in 3, -0.2, -0.4? -0.4 What is the nearest to -77 in 2/5, -85, 4, -1/2? -85 Which is the closest to 1? (a) 31 (b) 1/3 (c) 327 (d) 4 b What is the nearest to -0.2 in 0.2, -23/121, 3? -23/121 Which is the closest to 1/3? (a) 5 (b) 0.1088 (c) 0.2 (d) -2 c Which is the nearest to 1/18? (a) -1.55 (b) -1/6 (c) -5 (d) -0.03 d Which is the closest to -2? (a) 2/19 (b) 1/69 (c) 21/13 (d) -16 b Which is the closest to 3? (a) 620 (b) -0.2 (c) -28 (d) -5 b Which is the nearest to -1? (a) -0.01 (b) -1/14 (c) 2/5 b What is the nearest to 9893/7 in -1, 3, 0.5? 3 What is the nearest to -1/4 in 0.2, 0.3, -688? 0.2 What is the closest to 91 in -2/9, 6, -0.2, -4/9? 6 What is the closest to 0.1 in -5, 0.1, -6, -2.99? 0.1 Which is the nearest to -1? (a) -2/3 (b) 78 (c) -1/11 (d) 0 a What is the closest to 302 in 0.3, 2, 0.4, -0.5, 1? 2 Which is the closest to 2/13? (a) 364 (b) -1 (c) -0.4 (d) 3 (e) -2 c What is the nearest to -94/5 in 5, 0.2, 0.31? 0.2 What is the nearest to 5 in 20, 0, 1, -0.3, 4? 4 Which is the closest to 0? (a) 0 (b) 30 (c) -1 a Which is the closest to -2/15? (a) 1/2 (b) -2/7 (c) -0.02 c What is the nearest to -0.029 in 2/23, -43, 0.4? 2/23 What is the closest to -6 in 18.5, 1, -5, -2/11, 16? -5 Which is the nearest to 1/2? (a) -13 (b) 35 (c) 1 (d) 173 c What is the closest to -344 in 4/3, 6/19, 8? 6/19 What is the nearest to -3/11 in 2.4, -3.4, -2/3? -2/3 What is the nearest to 0 in -2/3, 12, -6/569? -6/569 Which is the closest to -7? (a) 489 (b) -1/2 (c) -4/5 (d) -3 d What is the closest to 0 in -4, 234, -14.6? -4 What is the nearest to -0.1 in -0.1, -0.04, -2.1, -5, -4? -0.1 What is the closest to 1/2 in 36/11, 9, -18/7? 36/11 What is the closest to 1 in -1104, -2, 2/7, 3/2? 3/2 Which is the nearest to 2? (a) 0.1 (b) -0.3 (c) -3 (d) -241 a What is the closest to 4 in -2, 100.6, -1/5, -3, 2? 2 Which is the nearest to 6? (a) -0.1 (b) 0.67 (c) 1/7 b What is the nearest to 0.5 in 0.11, 0, -2, 50? 0.11 What is the closest to 24/13 in 4/15, 6.5, 1/4? 4/15 Which is the closest to -1? (a) -95/7 (b) -0.4 (c) -0.08 b Which is the nearest to 2/17? (a) 2/9 (b) 2/19 (c) -0.05 (d) 0.5 b What is the nearest to 2/7 in -10, 54, 282? -10 What is the nearest to 104 in 2/3, -25, -4, 2/9, -0.2? 2/3 Which is the closest to -0.1? (a) -2 (b) 3/7 (c) -3 (d) 315.5 b Which is the closest to 0.2? (a) -36 (b) -0.1 (c) 2/7 (d) 0 c What is the closest to 3/5 in -1, -5, -46? -1 What is the nearest to -2/117 in 148, 0.04, 2? 0.04 What is the nearest to 4 in 19, -474, 3? 3 Which is the nearest to 0? (a) 45 (b) 3 (c) 790 (d) -3/7 d Which is the closest to -7/3? (a) 2/9 (b) -5652 (c) -2/5 c What is the nearest to 0.1 in 0.2, 0.3, -3108, 8? 0.2 Which is the closest to -4? (a) -4/7 (b) 1/44 (c) -711 a What is the nearest to 695 in 1/3, 0.2, 1/19, 3/13? 1/3 What is the closest to 0 in 23, -13.9, 1/7, 0.3? 1/7 What is the nearest to 617/5 in 1, 5, 75? 75 Which is the closest	{ "pile_set_name": "DM Mathematics" }
t*(-1/4)tt)/t)/t)))/(t5t(-2)))/(((t/t(2/9)t)/((tt1)/t))/(t(5/6)/t(-2))) assuming t is positive. t(209/36) Simplify ((k/(k*4k))/(k/(kk/(k/((k/k(-6))/k)))))/((k(2/7)k)/kk(k/(k*(1/4)k))/kk)(kk(-2))23(kkk*(1/4)/kkk)25 assuming k is positive. k(829/14) Simplify (i2)(-37)/(i(-1/3))(-29)((i/i*(-2/9))/ii)*(-3/13)(i*1i)(-2/55) assuming i is positive. i(-180226/2145) Simplify ((((z*(-2/7)/zzzz)/z)/zzzzz21)/(z25z(2/23)z))(12/11) assuming z is positive. z(-4584/1771) Simplify (g*(-1/2)g)/(g*(-6)/g)(g/(g*0ggg)g)(-28)(g/(g/(g/(g*(-2)/gg)))g(-5))/(g(-3)/gg(-1)) assuming g is positive. g(77/2) Simplify y/(y/y*(-3/7))y*(-6)(y/(yy2)y)/y(y(1/2)y)/y((yyyy(-3/7)/y)/(y/y5))/(y*3y/y2) assuming y is positive. y(-61/14) Simplify ((n*(-2/63)n(n/(n/(n/(n/n(-5/4)))))/nnn)/(n11n22))(-11/4) assuming n is positive. n(89485/1008) Simplify o(-1)o(-4)ooo(o(-2/5)/o)/o(ooo/(o/o*(-1/7)))/o(o(-6)/(o/o(-2/17)))17 assuming o is positive. o(-4359/35) Simplify ((h/(h/(hh(-2))))(2/7))(15/8)/((h(-1/2))29(h/h*(-2/17))/((h(h/h*7h)/h)/h)) assuming h is positive. h*(3259/476) Simplify ((gg*(-1/3)/gg)(-15)/(g(-10)/(gg(-9)g)))(-38) assuming g is positive. g266 Simplify ((y(1/30)/y9)41)(-1) assuming y is positive. y*(11029/30) Simplify ((rr/r*5)/rr*(-1/8)r*(-2/7)/rr(-1/5))/((r(-2/3)/r)/r*(-3)(r/(r(-1)/r))36) assuming r is positive. r*(-96553/840) Simplify ((tt1)(-26))(-1/6)/(((t(-2/9)/t)/(t*0t))/(tt(-1))40) assuming t is positive. t(98/9) Simplify k7/(k5/k)k*(-1/4)(kk(-2))/k((k(-4/9)/k)/k(-3/2))/((k(k2k)/k)/kk(2/13)/kk) assuming k is positive. k(-631/468) Simplify ((p(-6)p)/p0(pp0)(1/18))/(p/p2ppp*(4/3)pp(pp1p)(-7/3)) assuming p is positive. p(-41/18) Simplify (g*5g(2/15))/(g/(g/(g(2/7)/g)))*(-7)(g*3g(-5/4))/(g(-2)gg(1/4)) assuming g is positive. g(79/30) Simplify ((((p(p/p(-33))/p)/p)/p)/p)(-2/15)(p/(p/p(16/3)))(1/71) assuming p is positive. p*(-4322/1065) Simplify (uu/(u*(2/5)u)(u/u(-3/7)u)/uu(-3/5)uuu/(u*(-13)/u)uuuu)50 assuming u is positive. u(7850/7) Simplify (((n8/(nn*(1/10)nn))/(n(-1/6)/n8))(-8))(-44) assuming n is positive. n(68992/15) Simplify (k/(kk/(kkkk/(kkk/k(-6)k))kkk)k/k*(1/11)(k/(k(-37)/k))(-10/3))41 assuming k is positive. k(-62730/11) Simplify (m/m*(1/8)m/(m*(-4)/mmm))/(m(-3)/(m/m(-2/7)))mmm*1m*(-3)(m1)(2/49) assuming m is positive. m(3607/392) Simplify (f(-7)/f)*(-1/2)f*(-25)ff/(f(-8/5)/f) assuming f is positive. f(-82/5) Simplify ((zzz(-6))/(z/((zz1)/z)))(1/28)(z(-2/5))49z*0zzz8 assuming z is positive. z(-341/35) Simplify (t/t*5(t*0/t)/tt*(-1)t(1/2))/((t/(t/t(-2/7)))/t*(-5/3)(t/(tt(1/3)))(-6/5)) assuming t is positive. t(-1739/210) Simplify p/p2p/(p/(p*(2/15)/pp)p)p*6/(p(p*3/p)/p)ppp/p*(-1)(p/p*(1/3))/p(p/p1)/(p(4/9)p) assuming p is positive. p(196/45) Simplify (oo*(-2)o*3o*(-4/9)o/o*(3/8))/(((o/(((o/(oo*(-1))o)/o)/o))/o)*(-44)(o/o(-1))(-24)) assuming o is positive. o*(3613/72) Simplify (((uu*5/uu)/uu(-1))/(u(3/5)/(u(1/9)/u)))/((u(2/7))(-36/7)(uu(-1/10)/u)/(u/(u/(u(u*(2/9)/uuuu)/u)))) assuming u is positive. u*(1853/294) Simplify ((k(k/(k*(1/5)/k))/k)/(k/(kk/(kk(-14))))k*(7/2)/kkk0k)5 assuming k is positive. k(203/2) Simplify (((r/((rr(-5)/r)/r))/r(2/19)rr/(r/(rr*(2/5)))r(-2/5))(1/18))(1/5) assuming r is positive. r(169/1710) Simplify (m*(-2/9)m*(-1/8)mm)(2/45)(m(((mm*(-4))/m)/m)/mm)/(mm(-5))(m(4/5)/m)/m2 assuming m is positive. m(-689/324) Simplify (l(2/3))*(-3/32)/(lll0)(21/4)(l(1/7)/l)/l(1/6)(l/l(-1/4))/(l(1/6)l) assuming l is positive. l(-3865/336) Simplify ((z(2/3)/(z/z*5))/((zzz/(z/(z/z(1/6))z))/(z*(-3/8)zz)))(-34) assuming z is positive. z(-1819/12) Simplify (z(-8/7)/(z(-5)z))*(-13/6)((zz/((zz/(z*(-2)/z))/zz))/zz)/z(2/13)(z0)(7/5) assuming z is positive. z(-2551/273) Simplify q19qqqqqq*(-12/13)q(q(-1/6))15 assuming q is positive. q(561/26) Simplify (a(-18/13)/(aa(5/16)))/(a/(a(-4/9)a))(-2/61) assuming a is positive. a(-306325/114192) Simplify ((w/w15)(11/4)/((w/(w/((ww*(-2/23)w)/ww)))/(w/(w(-34)w))))(41/4) assuming w is positive. w(-12095/184) Simplify (((aaa/(a*3a))/a)*(-14/11)aaaaa(a/(a/a(1/4)))/aa/(a/(a(3/4)/a)))26 assuming a is positive. a(1872/11) Simplify ((j(-5)/((j(4/3)/j)/j))/(j3j/j0))/(((j/(j(4/3)j))/(jj(-4)))/((j/j(5/3))/(j/j(-3)))) assuming j is positive. j(-44/3) Simplify t2/tt*(-2)tt(-7/4)t/(t*(3/10)t)(t(-9)t*(-2/7))/((t/(tttttt/((t/((t*(1/6)/t)/t))/t)t))/t(2/19)) assuming t is positive. t(-56369/7980) Simplify (((y/y(2/13))/y(4/3))/(yy(3/5)y(y(1/2)/y)/y))/(y(2/5)y*(2/3)((y/y*(1/4))/yy)(3/5)) assuming y is positive. y(-807/260) Simplify (i/(iii*(-2/5)ii)ii(3/7)i)*(1/10)/((ii(-6)/i)/i(-1/2))(10/7) assuming i is positive. i(196/25) Simplify ((o*(-3)o)*46/(o/(oo(-2/15)))(-1/7))8 assuming o is positive. o(-77264/105) Simplify (c/c*(-5)c(7/2)/c)(-22)/(c(-1)/(c7cc)c(1/11)/((cc/c(5/2))/c)) assuming c is positive. c(-3929/22) Simplify ((z/z*(1/3))/zz/z*(-1)(zz/(z/(zzz(-1)z))z)(-7))/((z(2/5))(-2/23)/((zzz(1/2)z)/z)(25/4)) assuming z is positive. z(-29459/2760) Simplify ((mm3)/mm2)/((m/m1)/m)*21(m(mm*8/m)/mm*(1/3)m)(2/15) assuming m is positive. m(1226/45) Simplify ((f/(f*22f))13/(f(2/43)f)(1/26))17 assuming f is positive. f(-5436481/1118) Simplify (w4/ww)/ww4w/(w*(2/11)/w)w*2(w/((w*(2/5)w)/ww))/w(2/9)(w*(-1/2)/ww)49 assuming w is positive. w(-14161/990) Simplify (((h9)25)(-6/23))0 assuming h is positive. 1 Simplify (i*(3/7)/(ii*(2/13))i(1/3)/(i(-8)/i))/((((ii1)/iii)/(i(-1/3)/i))/(i/(i/(ii*0)i))39) assuming i is positive. i(389/91) Simplify ((hhh*(-4/3)hh(-3)h)/((h*0h)/h)39)/((h(-1))*(3/4)h(-2)/(h/h(2/3))) assuming h is positive. h*(11/4) Simplify (dd*7d(d4d)/dd(1/8)dd4)/((((dd/d(-3/2))/d)/(d(1/10)d))/(d0)20) assuming d is positive. d(669/40) Simplify ((ll*20ll5/ll)(-49))(-40) assuming l is positive. l52920 Simplify (c/((c(5/4)/ccc)/c)ccccc9)/(((c(-5/12)/c)/c)/((cc(-33/2))/c)) assuming c is positive. c(-4/3) Simplify (l*(-39)/(ll/(l/l*(20/9))ll))/(l(-1/3)l(-27)) assuming l is positive. l(-152/9) Simplify (l(-6)/(l/l(-6)))/(l(3/4)/((l/(l/(l/(l/l2))))/ll))(l0)(-15)/(l(-1))(-4/3) assuming l is positive. l*(-157/12) Simplify ((yy/(yy(-29)))/y)12/((y/(y/(yy/(y/(yy/y(-8)))y)))/(yy/(y(-34)y))) assuming y is positive. y*371 Simplify (((ss8)/(s/s(-26)))/(ss1)15)39 assuming s is positive. s(-1872) Simplify ((f5/f)(2/23)f/(f(ff*(1/16))/f)f*(1/15)f)(-40) assuming f is positive. f(-7463/138) Simplify ((y*0/(yy(-6/11)))/(y(-1/2)/yyy/(yy3)y))/((y*0yy)(-16)/(y(2/3)/y)(-5/3)) assuming y is positive. y(6851/198) Simplify ((o/o22)/o(o*(12/7)o)/o)/((o/o*(-13))/oo/o12) assuming o is positive. o(-156/7) Simplify (d(5/3)/d(1/2))/(d/(d/d0))(5/12)((d/(d/d(-1/3)))/d)(1/4)/(ddd(1/3)d5) assuming d is positive. d(-13/2) Simplify ((vv(-1/2)/vv)(2/7))(7/6)((v/((v/v(-5))/v))/v(1/6))/(v2/(v(-3)v)) assuming v is positive. v(-8) Simplify ((m(-1/2)/(mm(-1/2)mmm))/(((m/(m(mm(4/7))/m))/m)/m(-3)))/((mm(-2/3)m)/m*(-3/4)m(-2)/(m(1/7)mm)) assuming m is positive. m(-283/84) Simplify ((x(2/7))*13xx(-2/17)x*(-6)/xx)/(xx(-6)x*4x)(-5/9) assuming x is positive. x(-167/119) Simplify ((qq/(q5/q)q5)/(q(2/7)(q(-5)q)/q))/(q*(1/6)(qq/(qqq/(q/q(-6/7))qq)q)/q)**(3/32) assuming q is	{ "pile_set_name": "DM Mathematics" }
b? 2/5 Calculate prob of picking 1 b and 1 f when two letters picked without replacement from {f: 1, b: 7, a: 3, o: 6}. 7/136 Two letters picked without replacement from rqllqqlqqllqrrlrq. What is prob of picking 2 r? 3/68 Four letters picked without replacement from {f: 3, c: 5, s: 3, u: 5, y: 2}. What is prob of picking 1 s, 1 c, 1 f, and 1 y? 1/34 Calculate prob of picking 2 z and 1 y when three letters picked without replacement from {u: 1, v: 3, p: 6, y: 3, z: 3}. 9/560 Four letters picked without replacement from eeeeggeg. Give prob of picking 2 e and 2 g. 3/7 What is prob of picking 1 c and 2 y when three letters picked without replacement from cojgoyjyobj? 1/165 Four letters picked without replacement from {i: 7, h: 1, k: 4, n: 1, d: 1, z: 5}. What is prob of picking 1 n, 1 i, 1 z, and 1 d? 35/3876 Four letters picked without replacement from fmmofqowoofttf. What is prob of picking 1 o, 1 t, and 2 q? 0 Three letters picked without replacement from edeedd. What is prob of picking 2 e and 1 d? 9/20 Calculate prob of picking 1 r, 1 e, and 1 n when three letters picked without replacement from nxxxexrerexexr. 3/91 What is prob of picking 1 a, 1 x, and 2 k when four letters picked without replacement from {k: 8, a: 1, x: 6, w: 2, m: 1}? 14/255 Four letters picked without replacement from ebebebeeeeoeeoeee. Give prob of picking 3 b and 1 e. 3/595 Two letters picked without replacement from yyyyzzyyyyyy. Give prob of picking 1 y and 1 z. 10/33 Two letters picked without replacement from {y: 1, k: 1, a: 1, d: 1, q: 6, u: 1}. Give prob of picking 1 q and 1 a. 6/55 Four letters picked without replacement from {f: 11, v: 5}. What is prob of picking 4 f? 33/182 Calculate prob of picking 1 o and 1 t when two letters picked without replacement from ttqottotyqttoto. 32/105 Two letters picked without replacement from {c: 1, b: 4, j: 2, o: 1, r: 1}. What is prob of picking 1 r and 1 o? 1/36 Calculate prob of picking 2 y and 2 n when four letters picked without replacement from yynyyynynyyyynyyny. 13/51 Three letters picked without replacement from {y: 1, x: 1, t: 1, r: 2, f: 1, e: 1}. Give prob of picking 1 e, 1 f, and 1 r. 2/35 What is prob of picking 2 b and 2 g when four letters picked without replacement from {k: 4, m: 2, g: 2, b: 2}? 1/210 What is prob of picking 1 n and 2 j when three letters picked without replacement from jhnhnehjeejnj? 9/143 Calculate prob of picking 1 h and 2 l when three letters picked without replacement from hhlllhooooohlooooooo. 2/95 Four letters picked without replacement from auuxaaaaauuau. What is prob of picking 3 u and 1 a? 14/143 Three letters picked without replacement from soogiuiygygigyos. Give prob of picking 1 i, 1 g, and 1 u. 3/140 What is prob of picking 2 y when two letters picked without replacement from ssssssyys? 1/36 What is prob of picking 2 v, 1 j, and 1 f when four letters picked without replacement from {j: 4, v: 6, f: 4}? 240/1001 What is prob of picking 1 s and 1 f when two letters picked without replacement from {r: 2, a: 5, j: 1, s: 4, t: 2, f: 1}? 4/105 Four letters picked without replacement from sllqqt. What is prob of picking 1 t, 1 q, and 2 l? 2/15 What is prob of picking 1 g and 1 r when two letters picked without replacement from grgggrrrggrgggggrgg? 26/57 Three letters picked without replacement from {d: 1, w: 5, f: 14}. Give prob of picking 3 f. 91/285 Four letters picked without replacement from lvkvkvzutktu. What is prob of picking 4 u? 0 What is prob of picking 2 b when two letters picked without replacement from {b: 3, n: 6, a: 8}? 3/136 Calculate prob of picking 1 d, 1 q, and 1 r when three letters picked without replacement from dccqqccrl. 1/42 Three letters picked without replacement from vxgvmm. Give prob of picking 1 x and 2 m. 1/20 Calculate prob of picking 2 w, 1 s, and 1 m when four letters picked without replacement from {k: 1, w: 5, s: 2, f: 1, n: 3, m: 1}. 4/143 Three letters picked without replacement from {l: 3, r: 5, d: 1, w: 1, n: 3}. What is prob of picking 1 l, 1 d, and 1 w? 3/286 What is prob of picking 2 s, 1 x, and 1 o when four letters picked without replacement from {x: 7, o: 2, s: 2}? 7/165 Calculate prob of picking 2 t when two letters picked without replacement from hthhthh. 1/21 Calculate prob of picking 1 g and 2 x when three letters picked without replacement from bmxxwbgbwbbwxxbgw. 3/170 Calculate prob of picking 3 a and 1 k when four letters picked without replacement from apaaaaaakakkaaaaaaaa. 112/323 Calculate prob of picking 1 x and 2 k when three letters picked without replacement from kxkxxkkxkxkkxkkxkxxx. 15/38 What is prob of picking 2 d when two letters picked without replacement from {x: 4, n: 3, d: 2}? 1/36 Calculate prob of picking 2 i, 1 m, and 1 g when four letters picked without replacement from gnfnnmcccimmmimim. 9/1190 Three letters picked without replacement from vvjvjjjjvv. Give prob of picking 3 j. 1/12 Four letters picked without replacement from zzzzszusu. Give prob of picking 1 u, 1 s, and 2 z. 20/63 Four letters picked without replacement from {j: 2, r: 10}. What is prob of picking 3 r and 1 j? 16/33 Calculate prob of picking 3 z and 1 j when four letters picked without replacement from {z: 3, e: 1, j: 2, l: 1}. 2/35 Three letters picked without replacement from {q: 2, a: 2, c: 2, h: 3, x: 4, b: 2}. Give prob of picking 1 h, 1 x, and 1 q. 24/455 Two letters picked without replacement from {w: 1, e: 1, o: 1, p: 4, l: 1}. What is prob of picking 1 p and 1 l? 1/7 Calculate prob of picking 1 o and 2 v when three letters picked without replacement from {v: 4, u: 2, o: 1, w: 4}. 2/55 Four letters picked without replacement from {a: 14, b: 1, n: 1, r: 2, y: 1}. Give prob of picking 1 n and 3 a. 91/969 Four letters picked without replacement from bywywbyyyyqwt. What is prob of picking 1 y, 2 b, and 1 t? 6/715 Calculate prob of picking 1 v and 1 e when two letters picked without replacement from {e: 2, v: 4}. 8/15 Four letters picked without replacement from {n: 2, h: 4, b: 1, t: 2}. Give prob of picking 2 h and 2 t. 1/21 Calculate prob of picking 1 r, 1 k, and 1 z when three letters picked without replacement from {h: 6, z: 3, b: 1, r: 3, k: 1}. 9/364 Four letters picked without replacement from nensvhie. Give prob of picking 2 n, 1 s, and 1 e. 1/35 What is prob of picking 1 w, 1 o, and 1 a when three letters picked without replacement from {a: 3, w: 3, o: 2, q: 1, f: 1, y: 1}? 6/55 Two letters picked without replacement from {i: 2, m: 1, s: 2, l: 1, p: 1}. Give prob of picking 1 s and 1 i. 4/21 Calculate prob of picking 4 c when four letters picked without replacement from czzczzczczz. 1/330 Two letters picked without replacement from {o: 1, q: 1, c: 1, z: 2, w: 2, y: 2}. Give prob of picking 1 w and 1 q. 1/18 What is prob of picking 1 m and 1 k when two letters picked without replacement from {k: 1, m: 3}? 1/2 Two letters picked without replacement from vvlnzz. What is prob of picking 1 z and 1 v? 4/15 Two letters picked without replacement from rxouuxauuu. What is prob of picking 1 u and 1 x? 2/9 What is prob of picking 1 h and 3 t when four letters picked without replacement from {t: 4, x: 2, h: 10}? 2/91 What is prob of picking 1 f, 1 i, and 2 l when four letters picked without replacement from {r: 1, i: 3, p: 2, q: 1, l: 3, f: 3}? 27/715 Four letters picked without replacement from vvvvawavw. Give prob of picking 4 v. 5/126 Four letters picked without replacement from {d: 5, f: 13}. What is prob of picking 2 f and 2 d? 13/51 Calculate prob of picking 1 d and 1 g when two letters picked without replacement from {x: 2, p: 1, w: 2, d: 1, g: 1, a: 1}. 1/28 What is prob of picking 1 a and 2 t when three letters picked without replacement from {a: 2, t: 5}? 4/7 What is prob of picking 1 k, 1 z, and 1 b when three letters picked without replacement from fxxxzikkixixxkzkib? 1/102 What is prob of picking 4 b when four letters picked without replacement from bbbmbbbbbbbbbbb? 11/15 What is prob of picking 2 r when two letters picked without replacement from mmrqrqrr? 3/14 Calculate prob of picking 2 b and 1 m when three letters picked without replacement from vtttbbppmbppbvmvttbp. 1/57 What is prob of picking 2 u and 2 e when four letters	{ "pile_set_name": "DM Mathematics" }
11g2. Let b(h) be the first derivative of r(h). Give q(b(y)). 3200y*4 Let b(q) = 2363q. Let r(u) = 87u2 + 3. Let a(p) = -115p*2 - 4. Let t(g) = -3a(g) - 4r(g). Determine b(t(m)). -7089m*2 Let u(n) = -11524n*2. Let d(l) = 873l. Calculate u(d(f)). -8782774596f2 Let l(f) be the first derivative of 7f*2 - 3f - 7. Let x be l(1). Let m(p) = 5p - xp + p + 0p. Let u(q) = 3q*2. Calculate m(u(s)). -15s*2 Let j(z) = -8175z*2 + 1618. Let u(c) = 2c. Give u(j(i)). -16350i2 + 3236 Let t(j) be the first derivative of 13j*2/2 + 7. Let i(h) be the first derivative of 0h + 0h2 + 2/3h*3 - 5. Give i(t(l)). 338l*2 Suppose -5u - 4c = -18, 2u + 7c = 6c + 6. Let i(v) be the second derivative of 1/6v4 + 0v*3 + 7v + 0vu + 0. Let l(z) = 25z. What is l(i(a))? 50a2 Let s(n) = -3022738n*2. Let r(k) = 3k. Determine s(r(v)). -27204642v2 Let p be 3 + (24 - (-5 - -1)). Let u(f) = pf*2 - 62f*2 - 20f*2 - 50f2. Let q(x) = -x2. Calculate q(u(i)). -10201i4 Let s(x) = -5x*2 + 908460x. Let z(m) = -2m2. What is s(z(t))? -20t*4 - 1816920t2 Let x(b) be the third derivative of -b5/120 + b*4/2 + 19b*3/3 + 31b*2. Let w(i) be the first derivative of x(i). Let u(m) = 3m. Determine w(u(d)). -3d + 12 Let l(w) = 14 - 10 - 3 - 1 + w. Let u(r) = -724r*2 + 1. Give u(l(d)). -724d*2 + 1 Let k(x) = -22x*2. Suppose 0 = 2i + 2h - 104, -3i = -h + 2h - 146. Let r(b) = -ib + 4b2 - 41b + 88b. Determine r(k(m)). 1936m*4 Let q(s) = -3 + 3 + s. Let a(r) = 810r - 16. Let j(c) = -1417c + 31. Let f(i) = -7a(i) - 4j(i). Calculate f(q(x)). -2x - 12 Let u = -2849 - -2852. Let k(z) be the first derivative of 0z2 - 7 + 0z - 1/3zu. Let c(m) = 2m. Calculate c(k(y)). -2y2 Let h(j) be the first derivative of 527j*2 - 51 - 534j2 + 17. Let f(z) be the second derivative of -z4/6 - z. Determine h(f(a)). 28a2 Let c(d) = 1182954d*2. Let i(z) = 19z. What is i(c(o))? 22476126o2 Let s(h) = 3h. Let r = -166 + 170. Let l(u) = ru - 21 + 21. Determine l(s(g)). 12g Let i(d) = 2d - 23. Let p(g) = 316g + 306. Calculate p(i(q)). 632q - 6962 Let l(b) be the third derivative of b4/12 + 1669b*2. Let i(h) = -343h*2. Calculate l(i(n)). -686n*2 Suppose 4l - 33 = 2p - 55, -3p - 7 = 2l. Let b(g) = -4 - 1 + g2 + 9 + 15 - p. Let a(o) = -o2. Calculate b(a(t)). t4 + 18 Let f(k) = 190k + 150k - 375k. Let r(o) = -2o2 + 0o*2 + 4o*2. Give f(r(w)). -70w*2 Let g(s) = -12s - 64. Let t(b) = -8b - 40. Let p(w) = 5g(w) - 8t(w). Let n(x) = -955x*2. Calculate p(n(c)). -3820c*2 Let i(x) = -16x*2. Let s(t) = -49t. Let p(g) = 48g. Let r(h) = 4p(h) + 3s(h). Calculate i(r(u)). -32400u2 Let l(n) = n + 13. Let h(d) = -d3 - 9d2 - 11d - 97. Let c be h(-9). Let j(x) = -776x - cx*2 + 776x. Determine l(j(w)). -2w2 + 13 Suppose 39g - 34g = 215. Let b = g - 34. Let u(x) = 1 - 1 + bx*2 - 11x*2. Let s(o) = -o. Determine u(s(y)). -2y2 Let k(y) be the first derivative of -y3/3 - 759. Let u(i) = 11i + 32. What is u(k(w))? -11w*2 + 32 Let r(a) = -32a. Let y(p) = -344988p2. Calculate r(y(q)). 11039616q*2 Let j(z) = 22z - 7. Let b(g) = -28g2 - 5g + 4. Determine j(b(t)). -616t2 - 110t + 81 Let r(h) be the first derivative of 1 + 77 - 5h2 - h2 + 2h*2. Let j(a) = 3a. Determine r(j(v)). -24v Let m(v) = -189v + 101v + 86v. Let b(l) be the first derivative of -122l3/3 + 16. Calculate m(b(r)). 244r*2 Let s(y) = 347959856y. Let b(i) = 2i2. What is s(b(l))? 695919712l*2 Let i(z) = 3z. Suppose 4960 = -0u + 2u. Suppose -175 - 43 = -35b - 74b. Let h(s) = -2480 - bs + u. Determine i(h(m)). -6m Let s(q) = -3 + 9302q2 - 4391q*2 + 3 - 4296q*2. Let u(f) = 7f. Give u(s(j)). 4305j2 Let v(s) be the first derivative of -64s*3/3 + 9. Let r(c) = -42c + 72. Let x(w) = -12w + 20. Let h(j) = 5r(j) - 18x(j). Give h(v(g)). -384g2 Let i(l) be the first derivative of l3/3 + 1274. Let h(x) = -x - 87. Give i(h(g)). g*2 + 174g + 7569 Let q(k) = 151886k2. Let a(i) = 462i. What is q(a(u))? 32419155384u2 Let a(n) = -1554n. Let v(l) = 7 - 5 - 2 - 139l2 + 135l*2. What is a(v(w))? 6216w*2 Let l(f) = -639610f. Let a(g) = g + 22. What is l(a(r))? -639610r - 14071420 Let c(s) be the first derivative of -13s*2/2 - 2380. Let l(j) = 7j*2 + 3 - 3. Give l(c(x)). 1183x*2 Let s(x) = -3x. Let q(n) = 17n + 2955. Calculate s(q(o)). -51o - 8865 Let r(o) = 19119o2 - 55 + 55 - 19120o2. Let p(z) = z2 + 125z - 2. Calculate p(r(d)). d4 - 125d*2 - 2 Suppose 0 = 11f - 75 + 9. Let a(y) = -9y + 11y + fy + 2y*2 + 13y. Let z(o) = -2o2. Determine z(a(p)). -8p*4 - 168p*3 - 882p2 Let g(a) = -a2. Let n be 6 - (4(-15)/20 + 7). Let h(y) = 50 + 795y*n - 178 - 797y*2. Determine h(g(t)). -2t*4 - 128 Suppose m = 5m - 8. Let k be (m + -8)/(2/6-3). Let q(i) = 10i - ki + i - 3i. Let v(n) = 13n2. What is v(q(s))? 52s*2 Let s(p) = 20p - 6. Let c(w) = -17w + 5. Let g(y) = 6c(y) + 5s(y). Let z(d) = -4d*2 - 6. Calculate z(g(o)). -16o*2 - 6 Let d(y) = -20y - 44. Let o(n) = 13n + 31. Let p(a) = -7d(a) - 10o(a). Let f(q) = -9q + 2q + 4q. What is f(p(r))? -30r + 6 Let x(i) = 2i*2. Let f = -50 + 43. Let c be -1 - (f + -6 + 3). Let v(m) = -m - cm + 0m - m. What is v(x(a))? -22a*2 Let i(d) = -64700455d + 25d2 + 64700455d. Let v(r) = r*2 - 92r. What is v(i(q))? 625q4 - 2300q*2 Let a(m) = -526 + 271 + 2340m + 255. Let g(f) = -f. Calculate a(g(u)). -2340u Let h(z) = -49z*2 + 36z + 36. Let l(b) = -139b2 + 107b + 102. Let y(k) = 17h(k) - 6l(k). Let w(u) = -72u. Calculate y(w(v)). 5184v*2 + 2160v Let a = -100 - -102. Let i(g) = -40g2 + 93g*2 - 34ga. Let t(z) = -z2. Give i(t(u)). 19u4 Let c(f) = -3234845f. Let p(d) = -6d2. Determine c(p(g)). 19409070g*2 Let l(p) = -107p. Let v(d) = -62 + 62 + 32d2 + d - 33d*2. What is l(v(s))? 107s*2 - 107s Let i(r) be the second derivative of 0r4 + 0r*2 - 1/60r5 + r3 + 0 - 23r. Let v(x) be the second derivative of i(x). Let m(t) = -18t. Give v(m(p)). 36p Let x(b) = -2b - 6b - 17b. Let t be 54/(-405) + (-317)/(-15). Let c(q) = -17 + 2q2 - t - 21 + 59. What is x(c(v))? -50v*2 Suppose -14j + 3 + 39 = 0. Let k(m) = 2512 + jm + 11m - 2512. Let a(o) = -3o. Give a(k(x)). -42x Let s(y) = y*2. Let u(o) = 3o - 3o + 1749o*2 - 1261 + 1261. Give u(s(x)). 1749x*4 Let s(p) = 16p. Let j = 113 - 66. Let t = j + -45. Let f(n) = -7n + tn + 2n + 5n. Determine f(s(r)). 32r Let c(b) = 222b - 115b + 883b + 2510b. Let r(w) = -2w*2. What is c(r(h))? -7000h*2 Let l(c) = -9c. Let d(s) = -50s - 49s + 108s + 5335 - 5335. Give l(d(i)). -81i Let h(d) = -4d2. Let r = 9 + -15. Let o(k) = -k - 3 + 32 - 28. Let y(a) = -3a*2 + 6a - 6. Let b(c) = ro(c) - y(c). Determine h(b(z)). -36z*4 Let i(j) = 123j*2 - 10j + 8j + 439j*2 - 1 + j - 50j*2. Let u(x) = x. Calculate i(u(f)). 512f*2 - f - 1 Let a(v) = 3v*2 - 5v. Let i = 452 - 176. Let z(w) = 281w2 - 556w*2 + iw*2. Determine z(a(t)). 9t*4 - 30t*3 + 25t2 Let x(i) = -i2. Let o = 16 - 13. Suppose 3m = 8m - 5l - 35, 0 = m - ol - 5. Let k(q) = mq2 + 3q*2 - 12q2 - q2. Determine k(x(t)). -2t4 Let s(o) be the third derivative of 19o7/5040 - o5/15 - o*4/24 - 60o*2. Let g(z) be the third derivative of s(z). Let r(i) = -2i*2. Give g(r(h)). -38h*2 Let o(p) = -4p. Let s be (-19)/(741/(-72)) - (-2)/13. Let l(n) = -3n - sn + n - 9n. Determine o(l(y)). 52y Let h(t) = 3t. Let r(k) = -3853762k. What is r(h(u))? -11561286u Suppose 2u + 72 = 82. Let k(g) = 4g2 + 50g. Let w(y) = -2y2 - 26y. Let m(v) = uw(v) + 3k(v). Let f(c) = c. What is m(f(d))? 2d2 + 20d Let b(x) = -2254x. Let r(v) be the first derivative of 2v*2 + 2093. Calculate r(b(d)). -9016d Let a(l) be the second derivative of 203l4/12 + 25l*3/6 + l - 309. Let g(w) = w. What is g(a(y))? 203y*2 + 25y Let m(v) = v - 4. Let f(i) = i - 5. Let z(u) = 4f(u) - 5m(u). Let o(w) be the third derivative of 25w4/4 + 18w*2 - 16w. Calculate o(z(b)). -150b Let l(k) = -4k. Let b(n) = 20037461*n. Dete	{ "pile_set_name": "DM Mathematics" }
hat is k? 0, 2, 35 Determine r so that 3r3/4 - 33r*2/4 + 93r/4 - 63/4 = 0. 1, 3, 7 Let -3r4/11 - 58r*3/11 - 316r*2/11 - 342r/11 - 81/11 = 0. What is r? -9, -1, -1/3 Let -2g5/7 - 10g*4/7 + 12g3/7 = 0. Calculate g. -6, 0, 1 Factor c2 - c - 6. (c - 3)(c + 2) Determine y, given that 6y*4 - 44y*3 - 2y*2 + 104y + 56 = 0. -1, -2/3, 2, 7 What is d in 2d5/13 + 10d*4/13 + 18d*3/13 + 14d*2/13 + 4d/13 = 0? -2, -1, 0 Solve 5q3/2 + 825q*2/2 + 3235q/2 + 2415/2 = 0 for q. -161, -3, -1 Factor -21q3/8 + 11q*2/4 - q/8. -q(q - 1)(21q - 1)/8 Factor 9z3 - 1893z*2 - 1265z - 211. (z - 211)(3z + 1)*2 Find a, given that 16a*2 - 9676a - 2420 = 0. -1/4, 605 Suppose -3v4/4 + 21v*3/4 + 57v*2/4 - 21v/4 - 27/2 = 0. What is v? -2, -1, 1, 9 Factor -21f3 + 150f*2 - 333f + 216. -3(f - 3)2(7f - 8) Let -r2 - 696r - 1388 = 0. What is r? -694, -2 Factor -i*2/6 - 89i/3 - 176/3. -(i + 2)(i + 176)/6 Solve -5k*3 - 45k*2 - 30k + 80 = 0. -8, -2, 1 Factor -5b3 + 15b*2 - 15b + 5. -5(b - 1)3 Solve 4r*2 + 492r + 488 = 0 for r. -122, -1 Factor -4x4/3 - 4x*3/3 + 4x*2/3 + 4x/3. -4x(x - 1)(x + 1)2/3 What is k in 2k*4/9 - 22k*3/9 + 22k*2/9 + 118k/9 + 8 = 0? -1, 4, 9 Factor -2d4 + 8d*3 + 74d*2 - 80d. -2d(d - 8)(d - 1)(d + 5) Factor 5z2 + 990z + 1960. 5(z + 2)(z + 196) Solve 10n5 - 176n*4 + 728n*3 + 500n*2 - 738n - 324 = 0. -1, -2/5, 1, 9 Factor y*3 - 3y*2 - 10y + 24. (y - 4)(y - 2)(y + 3) Suppose 3f5/2 + 33f*4/2 + 141f*3/2 + 291f*2/2 + 144f + 54 = 0. Calculate f. -3, -2, -1 Factor 4w2 - 12896w + 10394176. 4(w - 1612)2 Factor -a2/6 + 55a/3 - 107/2. -(a - 107)(a - 3)/6 Determine g so that -6g*4/13 + 316g*3/13 - 1778g*2/13 - 2836g/13 - 736/13 = 0. -1, -1/3, 8, 46 Factor -31v2/3 + 800v/3 + 52. -(v - 26)(31v + 6)/3 Let 5k4/4 + 35k*3/4 + 55k*2/4 - 35k/4 - 15 = 0. What is k? -4, -3, -1, 1 What is d in 14d5/13 - 990d*4/13 + 4448d*3/13 - 6096d*2/13 + 1568d/13 + 1056/13 = 0? -2/7, 1, 2, 66 Solve 3z4 + 327z*3/4 + 69z*2/4 - 327z/4 - 81/4 = 0 for z. -27, -1, -1/4, 1 Solve 2s2 + 4712s + 2775368 = 0 for s. -1178 Find t such that -t*2 + 869t - 868 = 0. 1, 868 Suppose 2s2 - 448s + 1760 = 0. Calculate s. 4, 220 Find h such that 3h4/10 + 19h*3/10 - 3h*2/5 - 38h/5 - 12/5 = 0. -6, -2, -1/3, 2 Determine c, given that 2c5/17 - 2c*3 - 72c*2/17 - 40c/17 = 0. -2, -1, 0, 5 Factor 5h4 + 15h*3 - 20h*2 - 60h. 5h(h - 2)(h + 2)(h + 3) Determine o so that 3o3 + 153o*2 - 27o - 1377 = 0. -51, -3, 3 Let 34p5/9 - 26p*4 + 278p*3/9 + 274p*2/9 - 104p/3 - 40/9 = 0. What is p? -1, -2/17, 1, 2, 5 Determine x, given that -8x4/9 - 28x*3/9 - 16x*2/9 + 28x/9 + 8/3 = 0. -2, -3/2, -1, 1 Factor 5u2/6 + 5u/2 - 90. 5(u - 9)(u + 12)/6 Factor -4q2 + 152q + 156. -4(q - 39)(q + 1) Factor 43j5/3 + 2j4/3. j4(43j + 2)/3 Suppose 2k3 - 48k*2 - 102k - 52 = 0. Calculate k. -1, 26 Suppose -z*3/2 + 29z*2/4 + 47z/4 + 4 = 0. What is z? -1, -1/2, 16 Factor -x*4/2 + 13x*3/2 + 19x*2/2 - 73x/2 + 21. -(x - 14)(x - 1)2(x + 3)/2 Factor h*2 - 18h + 81. (h - 9)2 Let -r3/7 - 5r2/7 - r - 3/7 = 0. Calculate r. -3, -1 Find x, given that -x3/4 + 7x/4 + 3/2 = 0. -2, -1, 3 Determine v so that -3v5/7 + 33v*4/7 - 129v*3/7 + 207v*2/7 - 108v/7 = 0. 0, 1, 3, 4 Factor y*5 + 9y*4 + 18y*3 - 4y*2 - 24y. y(y - 1)(y + 2)*2(y + 6) Factor -2a4 + 36a*3 - 194a*2 + 288a - 128. -2(a - 8)2(a - 1)2 Factor -s4 - 3s3 + 418s2. -s2(s - 19)(s + 22) Factor j*4/2 + 19j*3 + 180j*2 + 413j - 1225/2. (j - 1)(j + 7)2(j + 25)/2 What is k in 7k2/8 - 101k/2 - 29/2 = 0? -2/7, 58 Determine a so that 5a4 + 4590a*3 + 1048805a*2 - 2111400a + 1058000 = 0. -460, 1 Let -2h4 + 888h*3/5 - 1572h*2/5 + 104h + 174/5 = 0. Calculate h. -1/5, 1, 87 Determine m so that -3m3 - 93m*2 + 3m + 93 = 0. -31, -1, 1 Let 25o4 - 160o*3 - 1740o*2 + 720o = 0. Calculate o. -6, 0, 2/5, 12 Solve 3z5/4 - 15z*4/2 + 15z*3 + 15z*2/2 - 63z/4 = 0 for z. -1, 0, 1, 3, 7 Let -n*4 + 20n*3 - 150n*2 + 500n - 625 = 0. Calculate n. 5 Suppose 3v4/2 - 9v*3 - 12v*2 + 9v + 21/2 = 0. What is v? -1, 1, 7 Find l, given that -4l2 + 2888l - 2884 = 0. 1, 721 Suppose 98v5/3 + 1960v*4/3 - 4222v*3/3 + 1996v*2/3 + 344v/3 - 176/3 = 0. What is v? -22, -2/7, 2/7, 1 Determine v so that v*5/2 + 19v*4/8 - 33v*3/8 - 109v*2/8 + 149v/8 - 15/4 = 0. -5, -3, 1/4, 1, 2 Solve p*3/6 - 5p*2/6 - p = 0. -1, 0, 6 Find m such that -9m*3/2 - 242m*2 + 558m - 112 = 0. -56, 2/9, 2 Solve h*3/10 - 219h*2/10 = 0 for h. 0, 219 Let -5f*4 + 105f*3 + 360f*2 + 20f - 480 = 0. Calculate f. -2, 1, 24 Solve 27o5/2 - 81o*4/2 + 27o*3/2 + 77o*2/2 - 25o + 4 = 0. -1, 1/3, 4/3, 2 Find k such that 5k2 + 5225k - 15720 = 0. -1048, 3 Find c such that 3c2/7 - 54c/7 + 96/7 = 0. 2, 16 Find l, given that -l*2 - 934l - 218089 = 0. -467 Factor 7n4 + 2n*3 - 28n*2 - 8n. n(n - 2)(n + 2)(7n + 2) Factor 3a4/5 - 42a*3/5 + 171a*2/5 - 108a/5 - 324/5. 3(a - 6)2(a - 3)(a + 1)/5 Determine j so that 25j*3/8 + 3055j*2/8 - 307j + 123/2 = 0. -123, 2/5 Find n such that 3n4 + 225n*3 + 1269n*2 + 1863n = 0. -69, -3, 0 Suppose x*3 - 18x*2 + 45x = 0. What is x? 0, 3, 15 Solve 8y4/5 + 14y*3/5 + 4y*2/5 - 2y/5 = 0. -1, 0, 1/4 Solve -2d4/9 - 38d*3/9 - 190d*2/9 - 274d/9 - 40/3 = 0. -12, -5, -1 Find u, given that 4u2 - 564u + 560 = 0. 1, 140 Factor -u*3 + 34u*2/3 - 65u/3 + 6. -(u - 9)(u - 2)(3u - 1)/3 Factor 3j*3 + 561j*2 - 1143j - 1701. 3(j - 3)(j + 1)(j + 189) Factor 3c*4 - 12c*3. 3c*3(c - 4) What is h in h*2 + 65h + 64 = 0? -64, -1 Determine c, given that 25c5 + 70c*4 - 536c*3 - 464c*2 + 4048c - 3872 = 0. -22/5, 2 Solve b*4 + 28b*3 + 173b*2 + 266b + 120 = 0. -20, -6, -1 Factor -2o2/25 - 46o/25 + 48/25. -2(o - 1)(o + 24)/25 What is j in 3j5/2 - 3j*3 + 3j/2 = 0? -1, 0, 1 What is d in d*3 - 124d*2 - 125d = 0? -1, 0, 125 Find r such that 36r4 - 80r*3 - 1028r*2 - 1280r + 336 = 0. -3, -2, 2/9, 7 Determine q, given that 2q4/7 - 146q*3/7 - 300q2/7 = 0. -2, 0, 75 Factor u3/7 - 6u2 - 283u/7 - 240/7. (u - 48)(u + 1)(u + 5)/7 Factor -3m3/5 + 321m*2/5 + 3m/5 - 321/5. -3(m - 107)(m - 1)(m + 1)/5 Solve -3n*5/4 - 33n*4/4 - 36n*3 - 78n*2 - 84n - 36 = 0. -3, -2 Find z such that 14z5/9 + 290z*4/9 - 350z*3/3 + 1270z*2/9 - 620z/9 + 32/3 = 0. -24, 2/7, 1 Solve -3j4 - 72j*3 + 3j*2 + 72j = 0. -24, -1, 0, 1 Factor 3i4/2 + 9i*3 - 36i*2 + 39i - 27/2. 3(i - 1)3(i + 9)/2 Let -3d5 - 17d*4 - 37d*3 - 39d*2 - 20d - 4 = 0. What is d? -2, -1, -2/3 Determine g so that -5g3/6 - 1055g*2/6 + 5g/6 + 1055/6 = 0. -211, -1, 1 Suppose 18r2/7 + 3588r/7 + 178802/7 = 0. What is r? -299/3 Let -22o5/5 + 246o*4/5 - 638o*3/5 + 658o*2/5 - 276o/5 + 32/5 = 0. Calculate o. 2/11, 1, 8 Factor -8z3/3 + 2z*2 + 6z + 4/3. -2(z - 2)(z + 1)(4z + 1)/3 Suppose 8c5/7 + 398c*4/7 + 4484c*3/7 - 11546c*2/7 + 1144c - 1352/7 = 0. Calculate c. -26, 1/4, 1 Factor -z*2/8 - 121z/8 + 112. -(z - 7)(z + 128)/8 Determine c so that 75c*5 + 545c*4 - 430c*3 + 80c*2 = 0. -8, 0, 1/3, 2/5 Let 4d*4 - 8d*3 - 4d*2 + 8d = 0. What is d? -1, 0, 1, 2 Suppose -g*3/8 - 29g*2/4 + 119g/8 - 15/2 = 0. Calculate g. -60, 1 Find d, given that 64d3/3 + 1376d*2/3 + 676d/3 + 28 = 0. -21, -1/4 Factor -5i2/3 - 75i + 2120/3. -5(i - 8)(i + 53)/3 Factor -26n2/5 - 1096n/5 - 168/5. -2(n + 42)(13n + 2)/5 Factor 2r*3/19 - 42r*2/19 + 78r/19 - 2. 2(r - 19)(r - 1)*2/19 Factor 5y*3 - 4495y*2 + 4490y. 5y(y - 898)(y - 1) Suppose b5/2 + 9b*4/2 + 29b*3/2 + 39b*2/2 + 9b = 0. What is b? -3, -2, -1, 0 Factor -p*3/2 + 4p2. -p2(p - 8)/2 Determine i, given that 132i*5 + 32i*4 - 224i*3 - 24i*2 + 92i - 8 = 0. -1, 1/11, 2/3, 1 What is x in 30x4 + 164x*3 - 654x*2 - 356x + 96 = 0? -8, -2/3, 1/5, 3 Find f, given that -3f2/5 + 216f/5 = 0. 0,	{ "pile_set_name": "DM Mathematics" }
18 Let q(n) = -n*3 + 7n*2 + 6n - 5. Suppose 11y = 16y - 25. Let u be q(y). Calculate the highest common factor of 25 and u. 25 Suppose -3v - 38 = 1. Let f = v + 28. Suppose 8d + 105 = fd. What is the highest common divisor of d and 30? 15 Let b be 285 + 4 + (-14 - -21). What is the highest common factor of b and 3108? 148 Let l(o) = 23o*2 + 143o + 1172. Let p be l(-9). What is the greatest common divisor of 276 and p? 92 Let g be ((-112)/(-252) - (-22)/(-9)) + 0. Let l be (-2)/(-4) + g/((-4)/71). Calculate the greatest common factor of 126 and l. 18 Suppose 830 + 87 = -7l. Let f = -66 - l. What is the greatest common factor of 39 and f? 13 Suppose -2g + 3096 = c, 5c + 327g - 324g - 15522 = 0. What is the highest common factor of 592 and c? 148 Let u be (-243)/(-5) - (-171)/(-285). Calculate the highest common factor of u and 352. 16 Let s = 172 + -48. Suppose 0 = -4x + 3w + 396, 3w = 86x - 95x + 813. Calculate the highest common divisor of x and s. 31 Let j be 24(0 - -76)150/30. Calculate the greatest common divisor of j and 95. 95 Let w(p) = 2p2 + 6p - 8. Suppose 0 = -4x - 2i + 54, -1 = -i + 2. Let z = x + -17. Let y be w(z). Calculate the highest common divisor of 60 and y. 12 Let h(a) = -a*2 + 41a - 133. Let x be h(14). Calculate the greatest common divisor of 455 and x. 35 Let n = 7036 - 7012. Calculate the greatest common factor of 132 and n. 12 Let d(v) = -3v3 + 4v*2 + 3v + 4. Let c(x) = x + 14. Let l be c(-17). Let f be d(l). Let y = f + -27. Calculate the highest common divisor of 17 and y. 17 Let t = -113 + 113. Suppose t = -2y + 3v + 83, 0 = -y - 13v + 11v + 24. What is the highest common divisor of 2 and y? 2 Let y = 60 - -230. Let m = -101 - -111. What is the highest common divisor of y and m? 10 Let m(n) = -n*3 + 25n*2 - 144n + 24. Let g be m(15). Let d be (14/4)/(g/39672). What is the greatest common divisor of d and 42? 42 Let k be (1 + 1)/((-8)/(-17901)) + 217/(-868). What is the highest common divisor of 75 and k? 25 Let l = 821 - 820. Let y = -22 - -38. What is the greatest common divisor of y and l? 1 Let l = -47 - -54. Let c be (1 + -8)-2100/8. Calculate the highest common factor of l and c. 7 Suppose -4f + 1812 = -4t, -12f + 2t = -14f + 914. Let a = f - 453. Calculate the greatest common divisor of a and 70. 2 Suppose -5s - 3d - 432 = -9s, -5d = 0. Calculate the highest common divisor of 2322 and s. 54 Let j(a) = -177a - 7705. Let l be j(-45). Calculate the highest common divisor of 2340 and l. 260 Suppose 39h - 380 = 13h + 36. What is the greatest common factor of 1 and h? 1 Let h = -3251 - -3332. Calculate the highest common divisor of 126 and h. 9 Suppose -73 = -3p - 2k, -2p - k - 21 = -3p. Suppose -4s = -ps + 171. Calculate the greatest common divisor of 4 and s. 1 Let s(d) = 36d - 53. Let a be s(8). Suppose -163 + 53 = -22v. Calculate the highest common factor of a and v. 5 Let l be ((-4)/8)/((-2)/48) + -7. Suppose k - 2q - 89 = -0k, -273 = -3k + 4q. Calculate the highest common divisor of l and k. 5 Let r = 4739 - 4579. Calculate the greatest common divisor of r and 2070. 10 Let x(f) be the third derivative of -3f3 - 21f*2 + 1/4f*4 + 0f + 0. Let y be x(7). Calculate the highest common factor of 18 and y. 6 Suppose -10 = -4s + 6. Let o(l) = -6 + 363l*3 - 559l*3 + 195l*3 + 5l*2. Let y be o(s). What is the greatest common divisor of 25 and y? 5 Let s = 9264 + -9203. What is the greatest common divisor of s and 183? 61 Suppose z + 6 = 0, 0 = -31g + 29g + 4z + 36. Calculate the greatest common factor of 6414 and g. 6 Let o(s) = -1296s - 1297s + 2588s + 107. Let v be o(10). Let a be 55/3 + 2/3. Calculate the greatest common factor of a and v. 19 Let n be (7 + -1 + 39/(-9))/(3/711). Calculate the greatest common factor of n and 948. 79 Let v = 70 + -47. Let t be (-900)/153 - -6 - (-5)/(-170)-778. Calculate the greatest common divisor of v and t. 23 Suppose 0 = -43g + 75 + 742. What is the highest common factor of 31 and g? 1 Suppose 0 = 3p - 131 - 16. Let d(v) = v*3 - 35v*2 + 312v - 18. Let n be d(17). What is the greatest common factor of p and n? 7 Let d(k) = 145k2 + k. Let y be d(-1). Let u = -3045 - -3141. What is the highest common factor of u and y? 48 Suppose -23n + 85 = -299 - 53. Calculate the highest common divisor of 5168 and n. 19 Let g be (0 + 11554)/(1/3060). Calculate the highest common divisor of 371 and g. 53 Let c(q) = 2q*2 - 20q - 4. Let o be c(12). Suppose 0 = -13b + 47 + o. Suppose -k + bk = 264. Calculate the greatest common factor of k and 4. 4 Let h(a) = -25a3 - 5a*2 + 8a + 15. Let b be h(-3). Calculate the greatest common factor of 276 and b. 69 Let c = 372 - 391. Let z be (c/(-57))/((-4)/(-1020)). Calculate the highest common divisor of 221 and z. 17 Suppose 5c + 2185 = -5o + 2o, 0 = -3o - 15. Suppose 5f - 4f = -298. Let i = f - c. What is the greatest common factor of 34 and i? 34 Let x(p) = p*2 - 13p - 99. Let a be x(18). Let i be 93(-6 - 57/a). Let m = 39 - 8. What is the greatest common factor of m and i? 31 Let d = -277 - -584. Let v = d - 299. Calculate the highest common divisor of v and 6. 2 Let q = 307 + -304. Suppose 0 = -m - 2r + 6r + 103, -2m + 195 = qr. What is the highest common divisor of 22 and m? 11 Let q be ((-3)/4)/(63/(-2352)). Calculate the highest common factor of 875 and q. 7 Let a be 13580 + 21 - (-2 - (-5)/(-3 + -2)). Calculate the greatest common factor of 76 and a. 76 Let c(y) = 147y*2 + 1752y + 10. Let v be c(-12). Calculate the highest common factor of 49 and v. 7 Let c = -18 - -32. Suppose -5x + c = -86. Suppose 94 = 2j - 2f, 0 = 4j + 18f - 14f - 212. Calculate the greatest common factor of x and j. 10 Let n be 22/4 - 3/(-6). Suppose -h + nh = 50. Let o = -7991 + 8071. Calculate the greatest common factor of h and o. 10 Let s(j) = -24j + 8. Let t be s(-3). Let v be 1010/12 + 12/(-72). Suppose 2n = -n + 4r + v, 4n = -r + 131. Calculate the greatest common divisor of n and t. 16 Let k = -64 + 67. Suppose -22q + ko = -23q + 116, 3q - 336 = -3o. Calculate the highest common factor of q and 30. 10 Let f be 81/(-2) - 25/(-50). Let x be (-410)/f(4 + 0). What is the greatest common factor of x and 328? 41 Suppose 812 = 14r - 5348. Suppose r = 9s - 20s. Let d = -16 - s. Calculate the greatest common divisor of d and 72. 24 Suppose 27g = 17 + 901. Calculate the highest common divisor of g and 238. 34 Let f be (-260)/8 - 2/4. Let a be f/12 + 3 + 782/8. Suppose 110 = 103r - ar. What is the highest common factor of 77 and r? 11 Suppose -3k = -24k + 19320. Let d = 1453 - k. Calculate the greatest common factor of d and 13. 13 Let a be -3 + (-6 + 81 - -4). Suppose -2x + 11 = 3. What is the greatest common divisor of x and a? 4 Let m = -180 - -183. Suppose 2p + 2p = g, g = mp + 1. Calculate the greatest common factor of 9 and p. 1 Suppose 0 = 3q - s - 1 - 10, -5s = 2q + 21. Suppose 0 = -qd + 1 + 23. Suppose -dm - 252 = -13m. Calculate the highest common factor of 28 and m. 28 Let o(p) = 18p + 936. Let h be o(-51). Calculate the highest common divisor of h and 477. 9 Let i be (-2 - (0 - -1))(18 - 19). Let s be (-10)/((i - 144/(-76)) + -5). What is the greatest common divisor of s and 380? 95 Let a(y) = y3 - 2y*2 - y - 4. Let z be a(3). Let f be (-2 - (1 - z)) + 5. Suppose -14b + 4b = -40. Calculate the greatest common factor of f and b. 4 Suppose 4m - 754 = -2p, 3p - 196 = -2m + 179. Let w be (-1)/((-4)/16) + -27. Let b = w - -44. Calculate the highest common divisor of b and m. 21 Let m = 7691 - 5754. Calculate the highest common divisor of 13 and m. 13 Suppose -13 = 4z - 17. Let x be (z + 1)/((-8)/(-12)). Suppose -4g + xa = -159, -2a + 106 = 4g - 28. Calculate the greatest common divisor of 54 and g. 18 Suppose -2d - 10 = -v + 3, 2d = -8. Suppose -10 + 660 = vr. What is the greatest common factor of 26 and r? 26 Let n(u) = 342u + 171. Let i be n(-15). Let a be (-3)/(-8) + i/(-152). Calculate the highest common divisor of a and 11. 11 Suppose -2d + 973 = -3r - 32, 0 = -5d - 3r + 2544. Calculate the highest common divisor of 52 and d. 13 Suppose 11y - 33y + 704 = 0. Let o(b) = -b**3 + 32	{ "pile_set_name": "DM Mathematics" }
duct of 0.01 and -5? -0.05 What is the product of -1.608 and -0.3? 0.4824 Multiply -0.06 and -62. 3.72 What is 0.25 times 0.049? 0.01225 Work out 7 * 92.6. 648.2 -67-5 335 Calculate 490.06. 2.94 -0.92 * 0.3 -0.276 554-0.4 -221.6 What is the product of -1 and 57? -57 Work out -0.12 0.13. -0.0156 Multiply -47 and 1.29. -60.63 Calculate -0.4-0.051. 0.0204 0.033 -0.7 -0.0231 What is the product of 0.05 and -62? -3.1 Product of -1.3 and 7. -9.1 What is the product of 2877 and 3? 8631 Calculate -5056. -3030 Work out 2 -177. -354 Product of 1.1 and 0.45. 0.495 Work out 0.2 * -413.3. -82.66 Product of 7 and 7.4. 51.8 416 * -5 -2080 12 * 55 660 -12.7 times 0.32 -4.064 What is the product of -1.8 and 8.7? -15.66 0 times -0.732 0 -0.071 * 25 -1.775 Work out 1.2 * 46. 55.2 What is 7.03 times 0.3? 2.109 0.26 * 1.7 0.442 -2 * 0.014 -0.028 -50 * 1 -50 What is the product of -2 and -957? 1914 Multiply 0.1122 and -3. -0.3366 What is 16930 times 1? 16930 Product of 6 and 0.183. 1.098 -1.7 times -27 45.9 What is the product of -0.86 and -0.09? 0.0774 Work out 1553 * -4. -6212 0.6-183 -109.8 What is -3 times -0.075? 0.225 What is 3 times 0.8? 2.4 0 times 2.03 0 What is the product of -9 and 140? -1260 8 0.227 1.816 What is the product of -286 and -0.04? 11.44 -21-0.15 3.15 What is the product of 0.5 and 0.054? 0.027 What is 0.004 times -0.056? -0.000224 Product of -2.051 and -1. 2.051 Product of 0.082 and -9. -0.738 What is the product of 0.01721 and -0.2? -0.003442 Product of 0.455 and 36. 16.38 -5 times 17.56 -87.8 -180 -0.12 21.6 -9.04 * -4 36.16 Multiply 3 and -2024. -6072 Calculate 17434. 7378 Multiply 1 and 2. 2 -400.5 -20 Multiply -0.546 and 0.4. -0.2184 Calculate 0.415. 6 What is the product of 6.87 and 0.2? 1.374 Product of 10 and 27. 270 Product of -0.3 and -0.102. 0.0306 Calculate -0.16-0.05. 0.008 What is the product of 0.1 and 50? 5 Product of 0.26404 and 5. 1.3202 Work out 397 * -0.5. -198.5 -5.2 * -0.07 0.364 Product of -4 and 200. -800 1 * 1211 1211 0.03 * -0.022 -0.00066 Product of -6 and -0.62. 3.72 What is the product of -8 and -308? 2464 What is 1.75 times 0.5? 0.875 Work out 2.9 * 0.5. 1.45 Multiply 1 and 0.34. 0.34 -4 times 0.6 -2.4 -0.00314-5 0.0157 Product of -0.1 and 2352. -235.2 Calculate -12827. -3456 -174 * 0.02 -3.48 Work out -0.17 * 1.3. -0.221 Work out 0.5 * -14.4. -7.2 Multiply -0.2 and -12.9. 2.58 -0.1 * -124 12.4 Product of 8 and -0.203. -1.624 What is 0.0667 times 0.1? 0.00667 -0.061.827 -0.10962 Multiply -0.03 and 11. -0.33 Product of -0.5 and 189. -94.5 -117.7-0.12 14.124 1.31 * 0 0 Multiply 0.3 and 0.0685. 0.02055 0.081 times 57 4.617 Work out 230 * 11. 2530 Calculate 510.05. 2.55 Product of -5.821 and 0.3. -1.7463 50.1419 0.7095 Calculate -19600.5. -980 Multiply 0.11 and 0.11. 0.0121 Work out -2898 4. -11592 Work out -0.2 * 55. -11 Work out 0.246 * -16. -3.936 Calculate 0.025-0.3. -0.0075 2 times -3020 -6040 -0.1-1.35 0.135 -0.15 times 0.6 -0.09 What is 0.3 times 0.1959? 0.05877 What is -0.318 times 11? -3.498 Work out 6 * -88. -528 4 times -17.63 -70.52 Multiply 0.4 and -55.8. -22.32 -0.4203 times -0.3 0.12609 Work out 31 * 0.98. 30.38 36-0.05 -1.8 Calculate 0.51722. 861 0.039 * 16 0.624 -272.8 times -0.5 136.4 What is 4 times -288? -1152 Calculate 3680.2. 73.6 5-0.0383 -0.1915 -8.44 -33.6 What is the product of -1 and -2926? 2926 -0.0027 times -2 0.0054 Multiply -0.4 and -0.016. 0.0064 -26063 -12126 -1.8-277 498.6 3.54.3 15.05 What is the product of 0.4 and 21? 8.4 Calculate 0.28311. 3.113 What is the product of -2 and 300? -600 Product of 80 and 44. 3520 -6.1 3 -18.3 Product of 0.2 and 1533. 306.6 Calculate 0.1-6384. -638.4 What is -28 times -0.11? 3.08 Work out -0.5 -1.505. 0.7525 Product of -1 and -28. 28 What is -0.08 times 0.0254? -0.002032 Work out 0.192 * 0.14. 0.02688 Product of -8 and 5. -40 306 * -0.01 -3.06 8 times 0.0283 0.2264 What is -3 times -0.077? 0.231 6 times -164 -984 Work out -0.2 * -0.465. 0.093 Calculate 2-45. -90 -0.4 -91.2 36.48 What is 3074 times -1? -3074 What is the product of -5 and 14.9? -74.5 Product of -0.1311 and 10. -1.311 Multiply -431.4 and -2. 862.8 What is the product of -26.3 and -0.2? 5.26 What is 0.2 times 272.7? 54.54 What is -6.9692 times 0.2? -1.39384 What is the product of -30 and -0.43? 12.9 0.2654 times 5 1.327 Calculate 0.41596. 638.4 Product of 41.4 and 0.6. 24.84 12114-0.2 -2422.8 -0.0234 * 2 -0.0468 Calculate 0.006183. 1.098 Multiply -10 and -0.02. 0.2 Calculate 0.0108-2. -0.0216 Work out -73 * 10. -730 Product of 0.5 and -0.0381. -0.01905 What is the product of 50.3 and -4? -201.2 Work out 0.5 * -495. -247.5 Work out -12.43 * -0.5. 6.215 Multiply -0.0572 and -5. 0.286 Product of 0.0266 and 0.07. 0.001862 Multiply -1 and -0.2. 0.2 -1.37 * -0.2 0.274 Work out -298 * 4. -1192 What is 2 times -95? -190 -176 -102 Work out 0.3 3.54. 1.062 What is 4 times 1164? 4656 1 * 1060 1060 Product of 7 and -0.061. -0.427 Calculate 50.7. 3.5 Calculate -0.11713. -1.521 What is the product of -0.5 and 1312? -656 Work out 103 * 0.7. 72.1 What is -16.1 times -2? 32.2 What is the product of 1.4 and -6? -8.4 What is 4.2 times 0.8? 3.36 198215 99105 -4-137.1 548.4 -0.87734 -3.5092 -12 7.8 -93.6 Multiply 0.2 and -0.0482. -0.00964 Product of 0.1062 and 4. 0.4248 Calculate 0.0768. 0.608 What is the product of -9.7 and -88? 853.6 What is the product of 0.3 and 76? 22.8 Multiply 93 and 2. 186 What is -0.1 times -1252? 125.2 Work out 876 -0.11. -96.36 Work out 0.3 * -0.0624. -0.01872 Work out -0.04 * -663. 26.52 2 times 13.1 26.2 What is the product of -0.05138 and -2? 0.10276 What is 2.627 times -5? -13.135 Calculate 0.099-0.5. -0.0495 -141 -4 564 Multiply 155 and 2. 310 What is the product of -4 and 30? -120 0 * -1.07 0 -4 times -16 64 0.01-23.1 -0.231 -121 -13 1573 Calculate -0.2-6.15. 1.23 Multiply -3 and 1215. -3645 What is -0.38249 times 4? -1.52996 -0.063699 times 0 0 0.5 45 22.5 Work out -3 * -2.519. 7.557 What is -2.4 times -12.7? 30.48 What is the product of 6 and 6.8? 40.8 -7 times 0.6 -4.2 What is 4 times 0.27? 1.08 What is the product of -0.6 and 0.0024? -0.00144 Work out 31 * 0. 0 Calculate 40.02. 0.08 What is -0.84 times 279? -234.36 6.24 times -0.2 -1.248 0.03-87.3 -2.619 Work out -191 * 0.2. -38.2 Product of -48 and 0.3. -14.4 Calculate 0.241. 8.2 Calculate -41.56. -6.24 Calculate -0.54.6. -2.3 Calculate 3.301-4. -13.204 Multiply -3 and 0.518. -1.554 -0.1 times -118 11.8 What is the product of -10 and -0.02? 0.2 What is -1.503 times -0.4? 0.6012 What is the product of -0.1225 and -0.18? 0.02205 0.4 * -57 -22.8 What is -263 times -10? 2630 Work out -0.1 * 0.9. -0.09 Calculate 20.326. 0.652 -12.8 -2 25.6 Calculate -496.4. -313.6 Product of -0.4 and 53.4. -21.36 Work out 0.042 163. 6.846 Work out 0.357 * -0.4. -0.1428 Calculate 0.210.7. 2.14 24132 4826 -1.41.49 -2.086 Multiply -0.9 and 5. -4.5 Multiply -0.2 and 225. -45 -4 -1916 7664 Work out 3.7 * -11. -40.7 Multiply -11 and -0.01. 0.11 Calculate 1-36. -36 Product of -0.119 and 3. -0.357 What is -242 times -0.4? 96.8 -11.8 -0.5 5.9 -0.4 times 958 -383.2 Calculate -756.35. -3781.5 4.718 0.3 1.4154 What is 0.08 times 157? 12.56 Multiply -176 and -3. 528 Multiply -0.4 and 0.35. -0.14 0.1-5 -0.5 766 times -3 -2298 Calculate 56211. 6182 -0.18326 -58.68 0 times 6.56 0 0.173 0.08 0.01384 Product of -4 and 0.4348. -1.7392 What is the product of 0.6 and 21.3? 12.78 Work out 1 * -0.32. -0.32 Work out 1 * -18. -18 What is the product of 5 and -186? -930 Work out -795 * 5. -3975 Calculate -2087-0.01. 20.87 Multiply 70 and -12. -840 Product of -242 and 0.4. -96.8 Product of 0.01 and 9.2. 0.092 5340.5 267 188 times 0.1 18.8 What is the product of -0.1184 and -0.4? 0.04736 9 times -7 -63 Product of 3 and -33. -99 What is the product of 6 and -66? -396 Multiply -0.2125 and 8. -1.7 Calculate 101.60.5. 50.8 Calculate -4.13-0.1. 0.413 Calculate -0.2-400. 80 Work out -0.2 -0.00475. 0.00095 Work out -0.3 * -633. 189.9 What is the product of 1136 and -11? -12496 What is the product of -0.1 and -1.78? 0.178 What is the product of 5 and 341? 1705 What is the product of 0.5 and 75? 37.5 00.0789 0 Calculate 3-40. -120 0.9 * -2.9 -2.61 0.02 times 2	{ "pile_set_name": "DM Mathematics" }
- 490h What is the first derivative of 45777318f*4 - 29101583? 183109272f*3 What is the first derivative of -5t*4 + 313476t*2 - 11263668 wrt t? -20t*3 + 626952t Differentiate -715460476f + 578065591 wrt f. -715460476 Find the second derivative of 231168849z*2 - 246485515z wrt z. 462337698 Find the second derivative of 92056162m2w2 + m2w - 7m*2 + 2mw - 2w + 1 wrt w. 184112324m2 What is the second derivative of 39218621x*2 - 172343x - 161? 78437242 What is the second derivative of 4o3 - 2204489o*2q - 2oq - 39o + 748q - 24 wrt o? 24o - 4408978q What is the second derivative of -43610276p2 + 390478p - 31 wrt p? -87220552 Differentiate -646743015v4 - 495904513 with respect to v. -2586972060v*3 Find the third derivative of -4j*6 - 3617451j*5 - 7937j*2 + 521j + 1 wrt j. -480j3 - 217047060j*2 What is the derivative of 98147451j*4 - 28466658 wrt j? 392589804j*3 Find the third derivative of -72299x*5 - 8x*4 + 9x*3 + 65046432x*2. -4337940x*2 - 192x + 54 What is the second derivative of -1999447i2w*2 - 6i*2w - iwy - 45iw - 148i + 3w*2y + wy wrt w? -3998894i*2 + 6y Differentiate 348l3 - 86l*2 - 457l + 266386659 with respect to l. 1044l2 - 172l - 457 What is the third derivative of -1684026c3h + 13c3 + c2h - 61c2 + 592c + h wrt c? -10104156h + 78 What is the second derivative of -22m*2n*2 - 186m*2n - 23549m2 - 2299mn2 - 26n*2 wrt n? -44m*2 - 4598m - 52 Find the third derivative of 23113211y5 + 118724430y*2 wrt y. 1386792660y*2 What is the derivative of -4435217f*4 + 11f*3 - 436376931 wrt f? -17740868f*3 + 33f*2 What is the third derivative of 988782x*3 - 3013097x*2? 5932692 Find the second derivative of -1527xy3 + 12xyz*2 + 6xz - 974162y*3z*2 + 2y*3z - 84yz wrt z. 24xy - 1948324y3 What is the third derivative of 3394535s*3 + 5012595s*2 wrt s? 20367210 What is the second derivative of 25224963r*3 - 54594r - 19? 151349778r What is the third derivative of 216313204s*4 + 167494s*2 - 68? 5191516896s Find the third derivative of 4n3x*3 + 35n*3x2 - n3x - 12n*3 - 2n*2x*3 - 416245nx3 - 2nx2 - 12 wrt x. 24n*3 - 12n*2 - 2497470n Find the second derivative of 70619566q2 - 81q + 627079. 141239132 Find the first derivative of 13936925l + 28991679. 13936925 What is the derivative of -2j*3 - 8810979j*2 - 2j - 3254271? -6j2 - 17621958j - 2 Find the second derivative of 2807117i3q*3 - 14iq3 + 1100i - 2q3 - 5q*2 wrt i. 16842702iq3 What is the third derivative of 324198596k*4 + 406k*2 - 179120? 7780766304k Find the third derivative of 112377h5t*2 + 12h*4t*2 - 44h*2t + 2ht*2 - 57221t*2 wrt h. 6742620h*2t*2 + 288ht2 What is the third derivative of -80899540r*6 + 55r*2 + 17971? -9707944800r*3 Find the second derivative of -1143568i*2o*2u - 2i2u - 121io*2 - 233iou - iu - 8o*2 - 2u wrt i. -2287136o2u - 4u What is the second derivative of 2937s*4 - 118s*3 + 15095461s wrt s? 35244s2 - 708s What is the second derivative of -7920b3w*5 - 9b*3 - 4b*2w + 157bw*3 + 800bw + 12 wrt w? -158400b*3w*3 + 942bw Find the third derivative of -11630g*6 + 5815g*3 + 941410666g*2. -1395600g*3 + 34890 Find the third derivative of -171325512z*4 + 1290z*2 + 1415z + 3 wrt z. -4111812288z What is the third derivative of -7665365g*5 + 7067642g*2 - 3 wrt g? -459921900g*2 Find the second derivative of 25843647z*2 - 28587704z. 51687294 Differentiate -5bpy - 4bp - by - 239b + 37py - 31p + 187y + 8 wrt p. -5by - 4b + 37y - 31 What is the third derivative of 15372354c*4 - 39983857c*2? 368936496c Find the third derivative of -270948945c3 + c2 + 3c + 52234492 wrt c. -1625693670 Find the third derivative of 7813987y5 + 6y*4 - 405y*2 - 7051y wrt y. 468839220y2 + 144y What is the third derivative of -335792553f4 - 3543125f*2 + 46f wrt f? -8059021272f What is the derivative of -ns*2 - 3ns - 41512818n - 67879s2 - 7s wrt s? -2ns - 3n - 135758s - 7 What is the derivative of 28220u2 + 1320u + 13548222? 56440u + 1320 What is the derivative of 292839i*2 + 33i + 25783148 wrt i? 585678i + 33 Find the third derivative of 4086ils*3 - 2708il - 3is3 - is*2 - 3is - ls*3 + 13ls2 + 20s*3 wrt s. 24516il - 18i - 6l + 120 Differentiate 40100212t + 18551139. 40100212 Find the second derivative of -2118c4 + c3 - 92c*2 + 247202887c wrt c. -25416c2 + 6c - 184 Find the second derivative of 4427p2z*3 + 1782p*2 - 17pz3 - 7373pz2 - pz - z*3 wrt p. 8854z*3 + 3564 Find the third derivative of 17296k*5x + 4205k3x + 336121356k2x wrt k. 1037760k2x + 25230x Find the third derivative of -158695053v*3 - 49v*2 + 328v + 230. -952170318 What is the first derivative of -1142934p2t + 192502p2 + 2pt + 5p wrt t? -1142934p2 + 2p Differentiate -tu3 - 25639223tuy*2 + 2u*3y*2 + 18480u*2y + 20uy*2 - uy + 2y2 - 11y wrt t. -u*3 - 25639223uy2 Differentiate -29446562w - 17980415 with respect to w. -29446562 Find the third derivative of -1629x4 + 9482x*3 + 198x*2 - 65781x + 1. -39096x + 56892 Find the third derivative of -545153p*3 + 2p*2 + 2p - 2858752 wrt p. -3270918 What is the first derivative of -23c2 + 3500ci3 - 31cl3 + i3l*2 - 2il + 4l*3 + 14107l wrt c? -46c + 3500i*3 - 31l*3 Find the first derivative of 815466bl2 - 739561l*2 + 2l wrt b. 815466l2 Differentiate 3fs - 2225fz + 436sz + 6730113s wrt z. -2225f + 436s What is the third derivative of 139x4 + 1375675x*3 + 1035x*2 + 44x + 145? 3336x + 8254050 What is the third derivative of 2ax4 - 4ax3 + 19ax2 - 3035a + x*4 - 103825x*3 + 7x wrt x? 48ax - 24a + 24x - 622950 What is the second derivative of 17362515h2p*4 + 226967h*2p - 17h2 wrt p? 208350180h*2p*2 Differentiate -2b*2q - 6b2 + 2bq - 721b - 19224441q with respect to b. -4bq - 12b + 2q - 721 What is the third derivative of 10152503d*6z*2 - 5d*4z + 48517519d2z*2 - 2d*2 wrt d? 1218300360d*3z*2 - 120dz What is the second derivative of -331809r*5 - 8r*3 - 16r - 541060 wrt r? -6636180r3 - 48r What is the derivative of -289375351u + 22227151 wrt u? -289375351 What is the third derivative of -107027263g*3 - 156463867g*2 wrt g? -642163578 Differentiate -17353659p*4 + 6815419 with respect to p. -69414636p*3 Find the third derivative of -670180j*5 - 2j*3 + 11j*2 - 39980j - 10. -40210800j2 - 12 What is the third derivative of -17205187d*5 - 22505349d*2? -1032311220d*2 What is the third derivative of 70480ac3k + 2ac*3 - 268ac2 + ack - ac - 10ak - 506c3k + 6c2 - 11 wrt c? 422880ak + 12a - 3036k Find the third derivative of -354028649p*3 - 189087302p*2 + 1. -2124171894 What is the second derivative of -19235893j*2 + 1387j + 3841 wrt j? -38471786 What is the third derivative of -270813014ar*4 - ar - 532a + 829r*2 - 2r wrt r? -6499512336ar Find the second derivative of -67091972rz*4 - 274rz - 622r - z + 12 wrt z. -805103664rz*2 Find the third derivative of -493901fl3 - 226fl + 12l*3 + 798l*2 wrt l. -2963406f + 72 What is the second derivative of -15042666c2 + 24604895c - 1? -30085332 Find the third derivative of -38605837jn*3 + 14jn2 + 102829jn + n2 wrt n. -231635022j Differentiate 93671373dm*2s - 28347dm*2 + 871d wrt s. 93671373dm*2 Find the second derivative of -29527406y*3 - 10588523y wrt y. -177164436y What is the second derivative of -3f*5 + 12577630f*2 + 476051088f wrt f? -60f3 + 25155260 What is the derivative of -633863cj + 166590530c - 18j wrt j? -633863c - 18 Find the second derivative of -667567k2 - 383207k + 14. -1335134 What is the second derivative of -121286113r3 - 3r + 9349787 wrt r? -727716678r What is the derivative of -35062560d*4 - 9518383? -140250240d*3 Find the third derivative of -27233427o**3 + 124153	{ "pile_set_name": "DM Mathematics" }
5:12 AM and 1:52 PM? 520 What is 657 minutes before 5:04 AM? 6:07 PM What is 549 minutes after 5:04 AM? 2:13 PM How many minutes are there between 1:40 PM and 6:49 PM? 309 How many minutes are there between 5:29 PM and 10:03 PM? 274 How many minutes are there between 11:53 AM and 7:01 PM? 428 How many minutes are there between 3:08 AM and 11:58 AM? 530 What is 535 minutes after 2:05 PM? 11:00 PM How many minutes are there between 7:36 AM and 7:03 PM? 687 How many minutes are there between 7:42 AM and 3:28 PM? 466 What is 155 minutes after 1:11 AM? 3:46 AM What is 35 minutes after 6:15 AM? 6:50 AM What is 360 minutes before 7:50 AM? 1:50 AM What is 128 minutes after 9:43 PM? 11:51 PM What is 137 minutes after 12:29 PM? 2:46 PM How many minutes are there between 4:58 PM and 4:29 AM? 691 What is 318 minutes before 12:35 PM? 7:17 AM How many minutes are there between 3:40 PM and 9:54 PM? 374 How many minutes are there between 3:07 PM and 2:35 AM? 688 What is 448 minutes after 3:41 AM? 11:09 AM What is 249 minutes after 7:26 AM? 11:35 AM How many minutes are there between 8:13 AM and 3:52 PM? 459 What is 624 minutes before 1:24 AM? 3:00 PM What is 665 minutes after 10:07 AM? 9:12 PM What is 203 minutes before 7:42 PM? 4:19 PM How many minutes are there between 12:02 PM and 12:38 PM? 36 What is 408 minutes before 8:03 PM? 1:15 PM What is 155 minutes before 4:50 PM? 2:15 PM How many minutes are there between 12:56 PM and 1:47 PM? 51 How many minutes are there between 1:11 AM and 12:42 PM? 691 How many minutes are there between 9:38 AM and 11:46 AM? 128 How many minutes are there between 7:37 AM and 3:14 PM? 457 How many minutes are there between 8:13 AM and 4:14 PM? 481 What is 274 minutes before 12:18 PM? 7:44 AM What is 145 minutes after 4:51 PM? 7:16 PM What is 710 minutes before 11:43 AM? 11:53 PM How many minutes are there between 11:46 PM and 6:28 AM? 402 How many minutes are there between 5:41 AM and 6:31 AM? 50 How many minutes are there between 5:17 PM and 1:05 AM? 468 What is 618 minutes before 11:33 AM? 1:15 AM How many minutes are there between 2:39 PM and 7:03 PM? 264 How many minutes are there between 12:46 AM and 12:08 PM? 682 What is 194 minutes after 9:38 AM? 12:52 PM How many minutes are there between 8:58 AM and 6:45 PM? 587 How many minutes are there between 11:57 AM and 4:46 PM? 289 How many minutes are there between 8:22 AM and 1:46 PM? 324 What is 401 minutes after 2:29 PM? 9:10 PM What is 117 minutes after 5:55 AM? 7:52 AM How many minutes are there between 5:07 PM and 5:02 AM? 715 How many minutes are there between 4:43 PM and 3:07 AM? 624 What is 459 minutes after 4:17 PM? 11:56 PM How many minutes are there between 3:44 AM and 6:24 AM? 160 How many minutes are there between 3:45 AM and 11:28 AM? 463 How many minutes are there between 6:26 AM and 4:50 PM? 624 What is 60 minutes after 5:08 PM? 6:08 PM What is 596 minutes before 9:35 PM? 11:39 AM How many minutes are there between 10:24 PM and 1:48 AM? 204 How many minutes are there between 1:11 AM and 11:50 AM? 639 What is 90 minutes after 7:08 AM? 8:38 AM How many minutes are there between 3:20 PM and 11:44 PM? 504 How many minutes are there between 1:33 AM and 11:14 AM? 581 How many minutes are there between 2:52 AM and 5:02 AM? 130 How many minutes are there between 2:38 AM and 12:58 PM? 620 What is 675 minutes before 4:41 PM? 5:26 AM How many minutes are there between 10:35 AM and 1:21 PM? 166 What is 568 minutes before 7:12 AM? 9:44 PM How many minutes are there between 12:16 AM and 10:00 AM? 584 How many minutes are there between 7:59 PM and 11:36 PM? 217 How many minutes are there between 5:11 PM and 10:34 PM? 323 How many minutes are there between 3:02 PM and 11:15 PM? 493 How many minutes are there between 7:57 PM and 1:22 AM? 325 What is 402 minutes after 5:58 PM? 12:40 AM What is 331 minutes before 4:48 PM? 11:17 AM How many minutes are there between 12:58 AM and 11:59 AM? 661 How many minutes are there between 7:43 PM and 6:35 AM? 652 What is 204 minutes after 4:27 PM? 7:51 PM How many minutes are there between 10:36 AM and 10:22 PM? 706 How many minutes are there between 11:16 AM and 11:11 PM? 715 How many minutes are there between 3:29 AM and 8:46 AM? 317 How many minutes are there between 11:27 PM and 6:25 AM? 418 How many minutes are there between 2:13 PM and 4:32 PM? 139 How many minutes are there between 5:13 AM and 12:13 PM? 420 How many minutes are there between 6:26 AM and 1:00 PM? 394 What is 155 minutes after 8:20 PM? 10:55 PM How many minutes are there between 11:25 PM and 8:17 AM? 532 How many minutes are there between 3:04 PM and 4:48 PM? 104 What is 679 minutes before 2:28 AM? 3:09 PM How many minutes are there between 7:18 AM and 12:23 PM? 305 What is 482 minutes before 5:12 PM? 9:10 AM What is 564 minutes after 12:39 AM? 10:03 AM What is 639 minutes before 2:50 PM? 4:11 AM How many minutes are there between 5:35 AM and 4:21 PM? 646 How many minutes are there between 4:54 PM and 6:57 PM? 123 How many minutes are there between 1:17 PM and 8:56 PM? 459 What is 634 minutes before 5:20 PM? 6:46 AM How many minutes are there between 9:29 AM and 2:38 PM? 309 How many minutes are there between 3:46 AM and 7:41 AM? 235 What is 646 minutes before 3:47 PM? 5:01 AM How many minutes are there between 8:18 AM and 7:15 PM? 657 What is 202 minutes after 3:40 PM? 7:02 PM What is 170 minutes before 8:33 AM? 5:43 AM How many minutes are there between 9:08 AM and 11:15 AM? 127 What is 309 minutes before 8:53 AM? 3:44 AM How many minutes are there between 8:25 PM and 8:20 AM? 715 What is 97 minutes after 6:14 PM? 7:51 PM What is 110 minutes before 7:11 AM? 5:21 AM How many minutes are there between 9:34 PM and 6:33 AM? 539 How many minutes are there between 6:22 AM and 11:42 AM? 320 How many minutes are there between 5:22 PM and 3:09 AM? 587 How many minutes are there between 10:35 PM and 4:35 AM? 360 What is 318 minutes before 10:21 PM? 5:03 PM What is 244 minutes before 8:21 AM? 4:17 AM What is 457 minutes after 7:34 PM? 3:11 AM How many minutes are there between 8:46 AM and 9:27 AM? 41 How many minutes are there between 5:17 PM and 8:09 PM? 172 How many minutes are there between 9:52 AM and 6:13 PM? 501 How many minutes are there between 1:38 AM and 6:27 AM? 289 What is 195 minutes before 6:57 AM? 3:42 AM What is 573 minutes before 1:51 AM? 4:18 PM How many minutes are there between 4:21 PM and 4:10 AM? 709 How many minutes are there between 6:53 PM and 9:17 PM? 144 What is 126 minutes before 5:54 PM? 3:48 PM How many minutes are there between 1:03 AM and 8:53 AM? 470 What is 372 minutes after 4:06 AM? 10:18 AM What is 564 minutes before 2:26 PM? 5:02 AM What is 82 minutes after 10:59 AM? 12:21 PM How many minutes are there between 2:21 PM and 4:27 PM? 126 What is 260 minutes before 10:33 PM? 6:13 PM What is 175 minutes before 2:07 AM? 11:12 PM What is 274 minutes after 6:59 PM? 11:33 PM How many minutes are there between 6:32 PM and 10:43 PM? 251 What is 581 minutes after 6:57 AM? 4:38 PM How many minutes are there between 4:58 PM and 7:27 PM? 149 How many minutes are there between 6:24 AM and 9:29 AM? 185 How many minutes are there between 6:50 PM and 9:15 PM? 145 What is 591 minutes after 7:56 PM? 5:47 AM How many minutes are there between 3:35 PM and 2:05 AM? 630 How many minutes are there between 1:37 PM and 8:22 PM? 405 How many minutes are there between 7:34 PM and 7:29 AM? 715 What is 318 minutes after 4:00 PM? 9:18 PM How many minutes are there between 12:52 PM and 9:26 PM? 514 What is 142 minutes after 11:27 PM? 1:49 AM How many minutes are there between 10:03 AM and 10:44 AM? 41 What is 292 minutes after 12:26 AM? 5:18 AM How many minutes are there between 11:12 AM and 12:14 PM? 62 How many minutes are there between 2:34 PM and 4:24 PM? 110 What is 385 minutes after 2:45 PM? 9:10 PM How many minutes are there between 8:12 AM and 2:12 PM? 360 How many minutes are there between 3:33 AM and 7:16 AM? 223 What is 173 minutes after 7:10 AM? 10:03 AM How many minutes are there between 6:52 PM and 6:19 AM? 687 How many minutes are there between 1:53 PM and 4:49 PM? 176 How many minutes are there between 7:22 AM and 6:22 PM? 660 How many minutes are there b	{ "pile_set_name": "DM Mathematics" }
f - 1293732 = 0. -33, -9, -1 Factor x*2/5 - x/5 - 12/5. (x - 4)(x + 3)/5 Find i, given that 5i5 - 70i*4 + 360i*3 - 880i*2 + 1040i - 480 = 0. 2, 6 Factor 3n4 + 39n*3 + 141n*2 + 177n + 72. 3(n + 1)2(n + 3)(n + 8) Factor 290z*2/9 + 32z/3 - 8/9. 2(5z + 2)(29z - 2)/9 Let 2t3 - 34t*2 + 120t = 0. Calculate t. 0, 5, 12 Solve j*4/5 + 13j*3/5 - 34j*2/5 - 116j + 120 = 0 for j. -10, 1, 6 Solve 4v4/5 - 2v*3 - 462v*2/5 - 212v - 416/5 = 0. -8, -2, -1/2, 13 What is r in 2r2 - 3380r + 6752 = 0? 2, 1688 Determine o, given that 3o4 - 7o3 - o2 + 7o - 2 = 0. -1, 1/3, 1, 2 Suppose l3 - 74l*2 - 77l + 150 = 0. What is l? -2, 1, 75 Factor l*3/2 - 5l*2 - 43l/2 + 26. (l - 13)(l - 1)(l + 4)/2 Factor -2j3/9 + 446j*2/9 + 2j/9 - 446/9. -2(j - 223)(j - 1)(j + 1)/9 Factor 4z*2 - 26584z + 44169316. 4(z - 3323)2 Determine f so that -f5/2 - 11f*4/2 + 5f*3/2 + 487f*2/2 + 1060f + 1400 = 0. -5, -4, 7 Suppose 2c4/7 + 2c*3 + 8c*2/7 - 24c/7 = 0. What is c? -6, -2, 0, 1 Factor 2g2/13 + 5576g/13 + 3886472/13. 2(g + 1394)2/13 Factor 3b*3/4 - 3b*2/2 - 3b/4 + 3/2. 3(b - 2)(b - 1)(b + 1)/4 Factor 2j*3/5 + 16j*2/5 - 8j/5 - 64/5. 2(j - 2)(j + 2)(j + 8)/5 Factor 4b*2/5 - 3208b/5 - 3212/5. 4(b - 803)(b + 1)/5 Suppose 2r3 + 4r*2 = 0. What is r? -2, 0 Factor 2v*3/13 + 610v*2/13 + 2416v/13 + 2408/13. 2(v + 2)2(v + 301)/13 Factor -3w4 - 45w*3 - 27w*2 + 201w - 126. -3(w - 1)2(w + 3)(w + 14) Factor -2w*4/11 + 12w*3/11 + 14w*2/11. -2w*2(w - 7)(w + 1)/11 Factor -o2 + 9. -(o - 3)(o + 3) Factor -20l3/3 + 5l*2/3 + 80l/3 - 20/3. -5(l - 2)(l + 2)(4l - 1)/3 Solve -6x4 + 68x*3 - 82x*2 + 20x = 0. 0, 1/3, 1, 10 Solve -6b5/7 - 30b*4/7 = 0 for b. -5, 0 Factor -2w*4/9 - 56w*3/9 - 524w*2/9 - 616w/3 - 242. -2(w + 3)2(w + 11)*2/9 Determine d, given that 12d*4 - 116d*3 - 48d*2 + 80d = 0. -1, 0, 2/3, 10 Factor -2l2/5 - 14l + 72/5. -2(l - 1)(l + 36)/5 Solve -6o2/5 + 84o/5 + 18 = 0 for o. -1, 15 Determine r so that 2r5 + 2r*4 - 30r*3 - 18r*2 + 108r = 0. -3, 0, 2, 3 Find c, given that -2c5/7 + 24c*4/7 + 152c*3/7 - 1436c*2/7 - 4950c/7 - 484 = 0. -7, -2, -1, 11 Determine u, given that 8u4 + 27u*3 + 9u*2 - 32u - 12 = 0. -2, -3/8, 1 Factor 2q5 - 250q*4 + 10580q*3 - 158260q*2 + 285770q - 137842. 2(q - 41)3(q - 1)*2 Determine a, given that 6a*4 + 237a*3 + 558a*2 + 105a - 222 = 0. -37, -2, -1, 1/2 Suppose 10u3/3 + 24u*2 + 14u/3 = 0. Calculate u. -7, -1/5, 0 Solve -4x4 + 72x*3 - 132x*2 + 64x = 0 for x. 0, 1, 16 Solve 72n4/13 - 264n*3/13 - 238n*2/13 + 1156n/13 = 0 for n. -2, 0, 17/6 Factor -2v3/11 - 1254v*2 - 2882946v - 2209297618. -2(v + 2299)3/11 Determine v, given that -2v*2/9 + 190v/9 = 0. 0, 95 Solve j*3/2 - 53j*2 = 0 for j. 0, 106 Let -2t*3 - 42t*2 + 92t = 0. Calculate t. -23, 0, 2 Factor 2l5 - 414l*4 + 28564l*3 - 656604l*2 - 28566l + 657018. 2(l - 69)3(l - 1)(l + 1) Find z, given that 2z*4/7 - 2z*3 - 42z*2 + 490z - 1372 = 0. -14, 7 Factor -4m2 - 80m + 84. -4(m - 1)(m + 21) Determine c so that -2c2 - 2212c - 2210 = 0. -1105, -1 Find m, given that m*3 - 37m*2 + 323m + 361 = 0. -1, 19 Factor 3n2 - 5094n + 2162403. 3(n - 849)2 Find r such that -r5/8 - 9r4/8 - r3 = 0. -8, -1, 0 Solve -d*2/4 + 293d/2 - 85849/4 = 0. 293 What is u in 2u3/7 - 16u*2/7 + 2u = 0? 0, 1, 7 Factor -c*4 - 3c*3 + 9c*2 + 27c. -c(c - 3)(c + 3)*2 Factor -2j*5 - 58j*4 - 108j*3. -2j*3(j + 2)(j + 27) Factor -c2/4 + 183c/4 - 91/2. -(c - 182)(c - 1)/4 Suppose -w4/8 - 11w*3/4 + 23w*2/8 = 0. Calculate w. -23, 0, 1 Find c, given that 2c*5/11 - 24c*3/11 - 4c*2/11 + 54c/11 + 36/11 = 0. -3, -1, 2, 3 Let -12x4 - 14x*3 + 58x*2 - 26x - 6 = 0. What is x? -3, -1/6, 1 Factor -2m3/5 + 368m*2/5 + 742m/5 + 372/5. -2(m - 186)(m + 1)*2/5 What is x in -11x*2 - 38x = 0? -38/11, 0 Find m such that -4m5 - 84m*4 - 684m*3 - 2700m*2 - 5184m - 3888 = 0. -6, -3 Determine a so that -10a5 + 44a*4 + 34a*3 - 20a*2 = 0. -1, 0, 2/5, 5 Factor 5p*2 + 21195p + 21190. 5(p + 1)(p + 4238) Factor -3c5 + 9c*4 + 45c*3 + 51c*2 + 18c. -3c(c - 6)(c + 1)3 Factor p2 - 31p. p(p - 31) Factor 2z*2/9 + 33680z/9 + 141792800/9. 2(z + 8420)2/9 Factor -2n*3/13 - 12n*2/13 - 10n/13 + 24/13. -2(n - 1)(n + 3)(n + 4)/13 Solve 4j*3 - 196j*2 + 736j - 720 = 0. 2, 45 Factor -1014m3/7 - 1079m*2/7 - 176m/7 + 64/7. -(6m - 1)(13m + 8)2/7 Factor -3k*4/5 - 33k*3/5 - 108k*2/5 - 108k/5. -3k(k + 2)(k + 3)(k + 6)/5 Factor -2a2 - 4a + 16. -2(a - 2)(a + 4) Factor 2o2/17 + 15340o/17 + 29414450/17. 2(o + 3835)2/17 Factor 4z*3 + 40z*2 - 44z. 4z(z - 1)(z + 11) Let 3y*2/5 + 3y - 42/5 = 0. What is y? -7, 2 Solve -4d2 - 628d + 632 = 0 for d. -158, 1 Factor -3z3/2 - 3591z*2/2 - 1079973z/2 - 3207681/2. -3(z + 3)(z + 597)2/2 Factor x3/2 - 2x2 - 91x/2 + 245. (x - 7)*2(x + 10)/2 Factor 2x2/5 + 2034x/5 - 4076/5. 2(x - 2)(x + 1019)/5 Determine x, given that x*3 - 13x*2 - 4x + 52 = 0. -2, 2, 13 Solve 108d2/7 - 1980d/7 + 9075/7 = 0. 55/6 Factor 5l3/6 - 55l*2/6. 5l*2(l - 11)/6 Solve s*4 + 5s*3 - 22s*2 - 56s = 0. -7, -2, 0, 4 Factor 3f4 + 3f*3 - 30f*2 + 24f. 3f(f - 2)(f - 1)(f + 4) Determine p, given that -2p5/3 + 5p4/6 - p3/6 = 0. 0, 1/4, 1 Factor -3q5 - 18q*4 - 27q*3 - 12q*2. -3q*2(q + 1)*2(q + 4) Solve -u*2/3 + 721u + 2164/3 = 0. -1, 2164 Determine s so that 2s5/7 + 44s*4/7 + 176s*3/7 + 92s*2/7 - 178s/7 - 136/7 = 0. -17, -4, -1, 1 Factor 12716i3 - 9792i*2 + 2460i - 200. 4(11i - 2)(17i - 5)*2 Solve -108a*5 - 1404a*4 - 5112a*3 - 6800a*2 - 3808a - 768 = 0 for a. -8, -3, -2/3 Factor -2s2/7 - 62s/7 - 60/7. -2(s + 1)(s + 30)/7 Factor 2r5/17 - 4r*4/17 + 4r*2/17 - 2r/17. 2r(r - 1)*3(r + 1)/17 Solve -3o2 + 165o + 342 = 0 for o. -2, 57 Determine m so that -2m3/5 - 244m*2/15 - 394m/15 - 52/5 = 0. -39, -1, -2/3 Let 4l4 + 24l*3 + 28l*2 - 24l - 32 = 0. What is l? -4, -2, -1, 1 Factor -2i4 - 12i*3 - 24i*2 - 16i. -2i(i + 2)*3 Factor -4u*2 - 1680u + 5076. -4(u - 3)(u + 423) Find o such that 2o5 + 130o*4 - 540o*3 + 820o*2 - 550o + 138 = 0. -69, 1 Determine g, given that -2g3/7 - 382g*2/7 - 18430g/7 - 18050/7 = 0. -95, -1 Find b such that -b4 - b3 + 7b2 + b - 6 = 0. -3, -1, 1, 2 Factor 2x*2 + 80x + 800. 2(x + 20)2 Factor 8a*4 - 52a*3 + 60a*2 + 4a - 20. 4(a - 5)(a - 1)*2(2a + 1) Factor -3m*2 + 36m + 135. -3(m - 15)(m + 3) Solve -4y4 - 580y*3 + 1172y*2 - 588y = 0. -147, 0, 1 Factor 9522t3 + 37536t*2 - 2200t + 32. 2(t + 4)(69t - 2)2 Solve 2d*5/5 + 2d*4/5 - 6d*3/5 - 2d*2/5 + 4d/5 = 0. -2, -1, 0, 1 Factor -4j5 + 436j*3 + 2672j*2 + 5568j + 3328. -4(j - 13)(j + 1)(j + 4)3 Factor -2h*4/3 - 2564h*3/3 - 821762h*2/3. -2h*2(h + 641)2/3 Factor -n3/6 + 135n2/2 - 18225n/2 + 820125/2. -(n - 135)*3/6 What is t in -2t*2 + 32t - 30 = 0? 1, 15 Factor z*2/8 - 233z - 933/2. (z - 1866)(z + 2)/8 Suppose 6n*5/11 - 34n*4/11 + 68n*3/11 - 56n*2/11 + 16n/11 = 0. What is n? 0, 2/3, 1, 2 Determine w so that -2w3 - 44w*2 - 306w - 648 = 0. -9, -4 Find r, given that 14r2 + 60r - 50 = 0. -5, 5/7 Factor 2g4 + 22g*3 + 84g*2 + 128g + 64. 2(g + 1)(g + 2)(g + 4)2 Solve 5u*2 + 100u + 255 = 0 for u. -17, -3 Factor -4s3 - 1004s*2. -4s*2(s + 251) Suppose h*2/2 + 19h/2 + 9 = 0. What is h? -18, -1 Suppose k*3 + 5k*2 - 6k = 0. Calculate k. -6, 0, 1 Let -4h4 + 16h*3 + 2328h*2 + 17264h - 19604 = 0. What is h? -13, 1, 29 Suppose -3b2 + 18b + 48 = 0. Calculate b. -2, 8 Let 4t2/7 - 512t/7 + 16384/7 = 0. What is t? 64 Factor -f*2/2 - 2f - 3/2. -(f + 1)(f + 3)/2 Factor -12c*3 + 824c*2 + 284c - 552. -4(c - 69)(c + 1)(3c - 2) Factor 2f2/15 + 4928f/5 + 9106944/5. 2(f + 3696)2/15 Factor o2/4 - 3737o/4 + 934. (o - 3736)*(o - 1)/4 Fact	{ "pile_set_name": "DM Mathematics" }
(-61 - -65)? -92 Calculate (-9 + 9 - -4) + 2 + -5 - (-71 + 57). 15 Evaluate 2 - 3 - ((-15 + 38 + 19 - 2) + -23). -18 What is the value of 1 + -4 + (14 + -9 - -34) + 87 + -97? 26 What is 48 + (-7 - ((-11 - -2) + (0 - 7))) - -1? 58 (-19 - -46) + -25 + (36 - 1) + -5 + 4 36 Evaluate 28 + 34 + (6 - 88). -20 (-50 + -7 - -8) + -44 + (16 - 1) -78 (1 - -106) + (2 - (50 - 36) - 5) 90 What is 0 + 2 - (-1 + -39 + 18 + 52)? -28 What is -74 - (-51 - 108 - -67)? 18 Calculate 13 - (424 + -345 - (-3 - (5 - 1))) - -1. -72 Evaluate 24 + 17 + (-66 + 25 - 6). -6 What is (-8 - -4) + -10 - (-11 - (-3 + 3)) - -26? 23 Calculate (21 - (-8 - -26)) + 1 + 7 + 8. 19 Calculate -29 - -49 - -55 - 28. 47 What is the value of -2 - 2 - -14 - (-71 + (14 - -67))? 0 Calculate 31 - (14 + -14 + (6 - -12)) - (2 + 29). -18 What is -35 - (14 + (-9 + -6 + 5 - -4))? -43 4 + 0 + -22 + 75 + -17 40 -21 - (161 - (20 - -84)) -78 What is the value of -35 + -90 + 121 - (-6 - (1 - 3) - 41)? 41 Calculate (-30 - 5) + 23 + -34 + 2. -44 What is the value of -6 + (-95 - (9 - (9 + 9 + -7 + -3)))? -102 9 - (17 - (-10 + 12)) - (8 + -13 - -9) -10 Evaluate (-66 - 240 - -362) + 1 + -12. 45 -3 - -39 - (-3810 - -3907) -61 Evaluate (49 - 57) + (-36 - -51) + (9 - 2). 14 What is the value of -21 - (-2 + -16 - (8 - (18 + 2)))? -15 What is the value of (16 - (-25 - -18) - -46) + 5 + -26? 48 6 - (-95 + -19 + 9 + 6 - (41 + -51)) 95 What is -66 - (23 + (-10 - 10)) - -18? -51 What is the value of -14 - (59 + 41 + -16 + -49)? -49 What is (2 - 2) + (-6 - 9) + 33 + (11 - 29)? 0 Evaluate 46 + -7 + (38 - 38). 39 Calculate -135 + 57 + (-8 + 9 - (-22 - -3)). -58 What is (-148 - -140) + -37 + -4 + 10? -39 What is -131 + 30 + -31 + (17 - -12)? -103 Evaluate -4 + -13 + 6 - (-58 + 13 + -15). 49 What is (-10 - (-18 + 3 + -18)) + -15? 8 Evaluate -11 + 9 + 73 + -12. 59 Calculate 3 + 2 - (67 - (21 + 33)). -8 What is (6 - 8) + (8 - 9) + 38 + -11? 24 What is -1 + -14 + 25 + -8 + -9? -7 What is the value of (-12 - -27) + -14 + (-34 - -30)? -3 Calculate 2 + -9 + (30 + -17 - (4 - (3 - 10))). -5 Calculate (-2 - (0 - -12)) + (-11 - (61 + -37 - 61)). 12 (-60 - (5 - (15 + -5))) + 115 + -108 -48 (969 - 975) + 0 + 7 + 104 105 What is 13 + (17 - 112 - -7)? -75 What is 2 - ((27 + -13 + (1 - 1) - -86) + 14)? -112 Calculate -55 + (8 + 18 - 22) + -4 + 3. -52 Evaluate 189 + -194 + (-16 - -11) + 82. 72 Calculate (0 - 98) + (698 - 641). -41 What is 86 + -49 + (-7 - 0) + (16 - 23)? 23 Evaluate (4 + -1 - (5 + -11 + 20)) + 12 + 46. 47 Calculate 0 + -39 + (-17 - (37 + -46)) + 14 - -15. -18 What is the value of -2 - 1 - (122 + -167 - -80)? -38 What is 17 + (9 - 14) + -18 + -69 + -5 + 5? -75 29 + (-92 - -10 - -116) 63 Evaluate 43 - (69 + -7) - 65. -84 Evaluate (-4 - (9 - 4)) + (66 - 63 - (2 + -72)). 64 Evaluate -2 + 35 + 665 + -734. -36 Calculate 10923 + -10891 + -2 + (2 - 144). -112 Calculate 47 + -1 + (-9610 - -9670). 106 91 + -67 - (19 - 3) 8 Calculate -51 + (3 - (-13 + 18 + 1 - -14)). -68 Calculate -24 - (-65 - -11) - (-33 - 21). 84 Calculate 31 + -18 - (112 + 17 + -30) - (0 - -2). -88 What is the value of 3 + 72 + (-30 - 114)? -69 Calculate 62 + -199 + (-112 - -210). -39 -83 + 51 - (-118 + 75) 11 (-39 - -70) + 9 - 72 -32 What is the value of 43 - (1 + -1) - (2299 + -2322)? 66 Evaluate -7 + (-3 - (0 + (-6 - -3))) + 13. 6 What is the value of -25 + 13 + -10 - (-4 - (8 - 5))? -15 What is the value of (-37 - 29 - -59) + 52? 45 Calculate -21 + (221 - 229) + 2 + 27. 0 Calculate 30 - 0 - (-41 + (60 - 30) + (6 - -3)). 32 Evaluate -1 + -13 - ((-172 - -145) + 51). -38 What is 2 + 15 + (21 - 0) + -33 + -45? -40 12 + 4 + -9 - (-24 + -10 - 0) 41 What is the value of 1 - 32 - 4 - (-11 - -7)? -31 Calculate 5 + (-2 - -3) - (-23 - ((38 - 60) + -7)). 0 Evaluate 109 + 60 + -114 - 93. -38 Calculate 9 + -17 + -4 + (1 - (2 - 43)). 30 -89 - 0 - (4 + (3 - (7 - -2))) - 0 -87 What is the value of (-2 - 31) + -1751 + 1694? -90 What is the value of (-9 - (14 + 10 + -24)) + -54? -63 What is the value of 23 + (-70 - -48) - 39? -38 Evaluate -24 + -3 + (147 + -135 - (1 - -16)). -32 -27 - (-24 - (17 + (-30 - 0))) -16 Calculate (-47 - -20 - 36) + 22 - -30. -11 What is 46 + -18 + -40 + 22 + -3 + -20? -13 Calculate -37 + 41 - 26 - 52. -74 What is the value of (14 - (32 + -32)) + (0 - 15) + 107 - -1? 107 -4 + (-65 - (-15 - -58)) -112 What is the value of -15 - (-9 - (23 - -8)) - 15? 10 Calculate 3 + (-69 - 14 - -8). -72 40 - (26 + -51) - ((21 - 4) + (-2 - 2)) 52 Calculate 13 - (-2 - -41) - (14 + -5) - -7. -28 Calculate -118 - (-42 + -17 + -1). -58 What is the value of (-25 - (-11 + -1)) + (-10 - -11) - -27 - -24? 39 What is -11 + ((25 - 13) + -13 - -7) - -57? 52 -4 + 18 - 16 - 9 -11 Calculate -49 + 9 - (200 + -240). 0 Evaluate 1 + 1 - 7 - ((8 - (10 - 2)) + 2). -7 Evaluate -22 + 34 + 75 + (5 - -1) - (-2 - 4). 99 What is the value of 88 + (9 + (5 + -10 + 5 - 15) - -13)? 95 What is the value of -50 - (-54 + (-43 - -23))? 24 What is 574 + -519 - (50 + -1)? 6 Evaluate 199 - 149 - (16 - (5 - 16)). 23 What is (-30 - (-6 - -17)) + 73? 32 Evaluate -714 + 726 + (4 - 26). -10 Evaluate -220 + 342 + -86 - (-8 - 0). 44 Evaluate -43 + -10 - -25 - (-84 - -15). 41 What is (36 - 1 - -3) + (5 - (-2 + 0))? 45 What is 17 - (-5 + 18 + -26) - (8 + 0)? 22 What is -99 - (5 - 92) - 21? -33 Calculate -1 + (4 - 16) + (31 - 9 - 36). -27 Evaluate 11 + -2 + (-10 - (-31 - (-22 - 4))) - 52. -48 (-36 - (-21 - (-6 + (10 - 14)))) + 2 -23 Evaluate 0 + 2 + (1 - 2 - (-85 - -95)) - -44. 35 11 - (-64 + (14 - (6 + -7))) - -3 63 Evaluate (-9 - -8) + -11 - -4 - -1. -7 Calculate 68 + (-6 - -27) + -78. 11 Evaluate 88 + -1 - (43 - 20 - (11 - -5 - -1)). 81 Calculate -20 + (19 - 13) + (-20 - (-22 - -25)). -37 What is 1 + -2 + -68 + 58 + -9 + -3 - 2? -25 What is the value of 24 + (88 - 61 - 27)? 24 Evaluate 1 - (-5 - (-5 + (-12 + 21 - 4) - 1)). 5 What is -2 + (0 - 13) + (-35 - (-38 - -15))? -27 5 - (-4 - -11) - (-2 + 1) -1 Evaluate -19 + 13 + (12 + -27 - 6). -27 Calculate (-1 - (0 + (-6 - -4))) + 77 + -78. 0 What is -4 - (40 + -58 + 19 - (-2 + 5 - 13))? -15 9 - (-909 + 890 + -1 + 0 + 9) 20 (0 - -47) + (-25 - (-14 + (11 - 25))) 50 What is (4 - 185) + (-5472 - -5528)? -125 (2 - 4 - -11) + 47 + (5 - (6 + 6)) 49 What is 1 - 29 - (1188 + -1182)? -34 -5 + 16 - 21 - (-2 - (-48 - -4)) -52 Evaluate 7 + -18 + (8 - 3 - 5) + (34 - 21). 2 Calculate -13 + -31 + (-18 - -21) - -20. -21 What is ((13 - 8) + 61 - -13) + (0 - 1)? 78 What is -97 + (-6 - (-4 + -4)) + (-4 - 13)? -112 -2 + (-12 - -9) + 7 + 9 + 32 43 What is the value of 10 + 4 + 418 + -511? -79 Evaluate -43 - (-15 - -74 - 77). -25 Evaluate -284 - -300 - (-1 - -32) - -58. 43 Calculate (66 - 72) + (47 + -6 - 7). 28 Evaluate (1 - -48) + (1306 - 1327). 28 Evaluate (2070 - 2183) + 1 + 96. -16 What is the value of 51 - (-13 + (-30 - -33) + -2 + 13)? 50 What is (-12 - (4 + (32 - 54))) + -77? -71 Calculate (63 + -32 - 48) + 10 - (42 + -1). -48 36 - (34 + -23 - -54) -29 Evaluate 2 + 50 - (5 + 2 + (3 + -15 - -6)). 51 Calculate 11 + (7 - -1 - (-18 + 27)) + 39 - -7. 56 What is the value of 1 + (0 - -79) + (35 - 61) + (14 - -4)? 72 What is -122 + 1 - (5568 - 5618)? -71 What is the value of (4 - (4 - (9 - 7) - -3)) + 45? 44 Evaluate 2 - (19 + -29 - -55). -43 Calculate -464 + 491 - (22 - 16). 21 What is 107 - (-5 - (7 - 9) - ((5 - 1) + -16))? 98 Evaluate 7 - ((-6 - 2) + 64 + 77 + 6). -132 Calculate (7556 - 7607) + 98 + 1. 48 Evaluate (12 + -15 + 40 - (8 + 6)) + 9. 32 (-22 + -13 - -13) + -16 -38 What is the value of 10 + (86 - (-16 + 54))? 58 Calculate -304 - -263 - (-7 - (-4 - 1)). -39 -63 - 1 - -76 - 40 -28 Calculate 6 - ((-10 - 2) + 27) - (-12 + (0 - 3)). 6 Evaluate (19 - (54 + 14)) + 0 - (-1 + -2 + -9). -37 What is (32 - -1) + (-731 - -804)? 106 What is (-6 + 33 - (-2 + 10)) + -1? 18 Calculate 169 + -100 - -1 - (-16 + -1 + -2). 89 Calculate 3 + 1 + -16 + 4 - ((5 - -1) + -14). 0 What is the value of (-194 - (-26 - 198)) + 2 + -108? -76 -23 - (5 + 12 - 7 - 78) 45 What is the value of (-22 - (-7 + -4) - -55) + (-5 - 0 - -5)? 44 What is 15 - (55 - 19 - 7 - -18)? -32 Calculate 2 + (8 - (5 + -4) - (-36 + (-11 - -44))). 12 What is -75 + (-22 + (3 - -33) - 45)? -106 (110 - 116) + -20 - 6 -32 (-27 - -45 - 34) + 4 + -38 -50 What is -51 + 7 - (-19 - 59) - 148? -114 88 - 41 - (-54 + 93) 8 51 + (-25 - -44 - 17) +	{ "pile_set_name": "DM Mathematics" }
e prime factors of 3963. 3, 1321 What are the prime factors of 1229? 1229 What are the prime factors of 57075? 3, 5, 761 What are the prime factors of 38328? 2, 3, 1597 What are the prime factors of 24656? 2, 23, 67 List the prime factors of 13554. 2, 3, 251 What are the prime factors of 20033? 13, 23, 67 List the prime factors of 18804. 2, 3, 1567 List the prime factors of 12417. 3, 4139 What are the prime factors of 12377? 12377 List the prime factors of 5156. 2, 1289 List the prime factors of 5245. 5, 1049 What are the prime factors of 3469? 3469 What are the prime factors of 4860? 2, 3, 5 What are the prime factors of 4155? 3, 5, 277 What are the prime factors of 2837? 2837 What are the prime factors of 23663? 23663 List the prime factors of 2589. 3, 863 List the prime factors of 13903. 13903 List the prime factors of 1579. 1579 List the prime factors of 5526. 2, 3, 307 What are the prime factors of 476? 2, 7, 17 List the prime factors of 391. 17, 23 What are the prime factors of 54833? 54833 List the prime factors of 2482. 2, 17, 73 List the prime factors of 214. 2, 107 List the prime factors of 2426. 2, 1213 What are the prime factors of 141778? 2, 7, 13, 19, 41 List the prime factors of 4124. 2, 1031 List the prime factors of 1216. 2, 19 What are the prime factors of 30065? 5, 7, 859 List the prime factors of 250. 2, 5 What are the prime factors of 604? 2, 151 List the prime factors of 144427. 144427 What are the prime factors of 6400? 2, 5 List the prime factors of 5345. 5, 1069 What are the prime factors of 925? 5, 37 What are the prime factors of 113838? 2, 3, 18973 List the prime factors of 61025. 5, 2441 What are the prime factors of 139408? 2, 8713 List the prime factors of 164783. 367, 449 What are the prime factors of 76515? 3, 5, 5101 List the prime factors of 47607. 3, 7, 2267 List the prime factors of 176. 2, 11 What are the prime factors of 3665? 5, 733 What are the prime factors of 7025? 5, 281 List the prime factors of 8815. 5, 41, 43 List the prime factors of 61264. 2, 7, 547 List the prime factors of 19701. 3, 11, 199 What are the prime factors of 3103? 29, 107 What are the prime factors of 9517? 31, 307 What are the prime factors of 2782? 2, 13, 107 What are the prime factors of 1396? 2, 349 List the prime factors of 308. 2, 7, 11 What are the prime factors of 2561? 13, 197 List the prime factors of 31720. 2, 5, 13, 61 What are the prime factors of 5730? 2, 3, 5, 191 List the prime factors of 7357. 7, 1051 List the prime factors of 2636. 2, 659 List the prime factors of 1142. 2, 571 What are the prime factors of 46019? 17, 2707 What are the prime factors of 4891? 67, 73 List the prime factors of 1815. 3, 5, 11 List the prime factors of 6597. 3, 733 What are the prime factors of 8916? 2, 3, 743 List the prime factors of 60046. 2, 7, 4289 List the prime factors of 1810. 2, 5, 181 List the prime factors of 83889. 3, 13, 239 List the prime factors of 28271. 17, 1663 What are the prime factors of 767? 13, 59 What are the prime factors of 343? 7 What are the prime factors of 387? 3, 43 List the prime factors of 327. 3, 109 List the prime factors of 1039. 1039 What are the prime factors of 1324? 2, 331 List the prime factors of 305. 5, 61 List the prime factors of 70155. 3, 5, 1559 What are the prime factors of 20185? 5, 11, 367 What are the prime factors of 826? 2, 7, 59 What are the prime factors of 14244? 2, 3, 1187 List the prime factors of 70095. 3, 5, 4673 List the prime factors of 31209. 3, 101, 103 What are the prime factors of 1203? 3, 401 List the prime factors of 15847. 13, 23, 53 What are the prime factors of 311? 311 What are the prime factors of 1760? 2, 5, 11 List the prime factors of 25325. 5, 1013 What are the prime factors of 7070? 2, 5, 7, 101 What are the prime factors of 70443? 3, 2609 What are the prime factors of 18244? 2, 4561 List the prime factors of 1906. 2, 953 List the prime factors of 11015. 5, 2203 List the prime factors of 5803. 7, 829 What are the prime factors of 7401? 3, 2467 List the prime factors of 2930. 2, 5, 293 What are the prime factors of 1851? 3, 617 List the prime factors of 43480. 2, 5, 1087 List the prime factors of 3058. 2, 11, 139 List the prime factors of 1371. 3, 457 What are the prime factors of 924? 2, 3, 7, 11 What are the prime factors of 912? 2, 3, 19 What are the prime factors of 25167? 3, 8389 List the prime factors of 9739. 9739 List the prime factors of 25695. 3, 5, 571 List the prime factors of 842. 2, 421 What are the prime factors of 1052? 2, 263 List the prime factors of 603. 3, 67 List the prime factors of 528. 2, 3, 11 What are the prime factors of 118? 2, 59 List the prime factors of 29359. 11, 17, 157 List the prime factors of 17448. 2, 3, 727 What are the prime factors of 257? 257 What are the prime factors of 18774? 2, 3, 7, 149 What are the prime factors of 916? 2, 229 What are the prime factors of 10211? 10211 List the prime factors of 6843. 3, 2281 List the prime factors of 8309. 7, 1187 List the prime factors of 265. 5, 53 What are the prime factors of 9589? 43, 223 What are the prime factors of 11462? 2, 11, 521 List the prime factors of 76981. 23, 3347 List the prime factors of 14283. 3, 23 What are the prime factors of 589? 19, 31 List the prime factors of 151026. 2, 3, 25171 What are the prime factors of 2188? 2, 547 What are the prime factors of 20795? 5, 4159 What are the prime factors of 1019? 1019 List the prime factors of 111509. 111509 List the prime factors of 6423. 3, 2141 List the prime factors of 1745. 5, 349 What are the prime factors of 6410? 2, 5, 641 What are the prime factors of 3322? 2, 11, 151 List the prime factors of 10541. 83, 127 What are the prime factors of 2710? 2, 5, 271 What are the prime factors of 31773? 3, 7, 17, 89 What are the prime factors of 1593? 3, 59 List the prime factors of 4507. 4507 What are the prime factors of 1439? 1439 What are the prime factors of 1017? 3, 113 List the prime factors of 1521. 3, 13 List the prime factors of 501. 3, 167 What are the prime factors of 24122? 2, 7, 1723 What are the prime factors of 41599? 17, 2447 List the prime factors of 5841. 3, 11, 59 What are the prime factors of 45823? 45823 List the prime factors of 2295. 3, 5, 17 List the prime factors of 3222. 2, 3, 179 What are the prime factors of 4672? 2, 73 What are the prime factors of 3770? 2, 5, 13, 29 List the prime factors of 935. 5, 11, 17 List the prime factors of 13082. 2, 31, 211 List the prime factors of 5974. 2, 29, 103 What are the prime factors of 24592? 2, 29, 53 List the prime factors of 15211. 7, 41, 53 List the prime factors of 1854. 2, 3, 103 What are the prime factors of 427? 7, 61 List the prime factors of 2335. 5, 467 What are the prime factors of 1051? 1051 What are the prime factors of 1257? 3, 419 List the prime factors of 495. 3, 5, 11 List the prime factors of 113415. 3, 5, 7561 What are the prime factors of 1548? 2, 3, 43 List the prime factors of 1035. 3, 5, 23 What are the prime factors of 7257? 3, 41, 59 What are the prime factors of 166? 2, 83 List the prime factors of 909. 3, 101 List the prime factors of 32712. 2, 3, 29, 47 List the prime factors of 2274. 2, 3, 379 List the prime factors of 9318. 2, 3, 1553 What are the prime factors of 9612? 2, 3, 89 What are the prime factors of 1369? 37 What are the prime factors of 100? 2, 5 What are the prime factors of 1999? 1999 List the prime factors of 25648. 2, 7, 229 List the prime factors of 3032. 2, 379 What are the prime factors of 11688? 2, 3, 487 What are the prime factors of 8? 2 List the prime factors of 2171. 13, 167 List the prime factors of 389. 389 List the prime factors of 19787. 47, 421 What are the prime factors of 627? 3, 11, 19 What are the prime factors of 103? 103 List the prime factors of 35828. 2, 13, 53 What are the prime factors of 804? 2, 3, 67 List the prime factors of 14652. 2, 3, 11, 37 What are the prime factors of 820? 2, 5, 41 What are the prime factors of 12925? 5, 11, 47 List the prime factors of 1094. 2, 547 What are the prime factors of 106606? 2, 151, 353 What are the prime factors of 735? 3, 5, 7 List the prime factors of 486. 2, 3 What are the prime factors of 90758? 2, 23, 1973 What are the prime factors of 20134	{ "pile_set_name": "DM Mathematics" }
What is the least common multiple of 702 and 11? 7722 Calculate the least common multiple of 441 and 49. 441 Calculate the common denominator of 7/16 and 125/18. 144 What is the common denominator of -99/14 and 41/15008? 15008 Calculate the smallest common multiple of 18 and 182. 1638 What is the lowest common multiple of 22 and 150? 1650 Calculate the lowest common multiple of 4 and 920. 920 Find the common denominator of 65/184 and -55/32. 736 What is the lowest common multiple of 336 and 84? 336 Find the common denominator of 139/12 and -137/744. 744 Find the common denominator of 81/110 and -133/1020. 11220 What is the common denominator of 33/2 and 29/15? 30 Calculate the lowest common multiple of 135 and 924. 41580 Calculate the common denominator of 67/216 and -107/270. 1080 What is the smallest common multiple of 225 and 3? 225 What is the lowest common multiple of 136 and 51? 408 Find the common denominator of 103/336 and 41/54. 3024 What is the least common multiple of 6 and 189? 378 What is the least common multiple of 10 and 14? 70 Calculate the smallest common multiple of 15 and 21. 105 Find the common denominator of 149/2034 and 113/48. 16272 Find the common denominator of 49/628 and 7/6. 1884 Calculate the smallest common multiple of 104 and 1688. 21944 Find the common denominator of 44/21 and -65/144. 1008 Find the common denominator of -11/15 and 59/150. 150 Find the common denominator of 73/432 and 145/972. 3888 Find the common denominator of -13/768 and -91/18. 2304 Calculate the lowest common multiple of 16 and 1056. 1056 What is the lowest common multiple of 472 and 32? 1888 What is the common denominator of -19/33 and -7/198? 198 What is the common denominator of 113/50 and 76/3? 150 What is the least common multiple of 64 and 8? 64 Find the common denominator of 95/34 and -25/4. 68 Calculate the common denominator of 7/44 and 127/12. 132 What is the smallest common multiple of 50 and 38? 950 What is the smallest common multiple of 160 and 400? 800 What is the common denominator of -27/130 and -65/6? 390 Find the common denominator of 29/8 and 17/4. 8 Calculate the common denominator of -50/219 and -21/5. 1095 What is the common denominator of 17/8885 and -54/5? 8885 What is the common denominator of -44/5 and 57/124? 620 Calculate the least common multiple of 12791 and 4. 51164 Calculate the common denominator of -39/2497 and -31. 2497 Find the common denominator of -59/1584 and 97/2112. 6336 Calculate the common denominator of 97/58 and 83/188. 5452 Calculate the common denominator of -29/6490 and 29/4720. 51920 Calculate the common denominator of 31/26 and 117/1232. 16016 What is the common denominator of 71/2058 and -101/6? 2058 Find the common denominator of 109/24 and -37/4416. 4416 Calculate the smallest common multiple of 8 and 748. 1496 Calculate the common denominator of 55/68 and 31/28. 476 Find the common denominator of -103/315 and -117/140. 1260 Find the common denominator of -145/2832 and 22/27. 25488 Calculate the common denominator of 9/4 and 41/88. 88 Calculate the common denominator of -67/2604 and -25/1116. 7812 What is the common denominator of 49/116 and -83/12? 348 What is the common denominator of -32/7 and 101/218? 1526 What is the lowest common multiple of 220 and 45? 1980 What is the least common multiple of 522 and 14? 3654 What is the common denominator of -125/24 and 97/48? 48 Calculate the common denominator of -35/114 and -91/1968. 37392 What is the common denominator of 119/522 and 37/30? 2610 Calculate the least common multiple of 5910 and 4. 11820 What is the lowest common multiple of 80 and 90? 720 Calculate the common denominator of 67/2 and 21/3508. 3508 What is the lowest common multiple of 3 and 172? 516 Calculate the common denominator of 79/60 and -33/830. 4980 What is the lowest common multiple of 13388 and 16? 53552 Calculate the smallest common multiple of 20 and 24. 120 Calculate the lowest common multiple of 2726 and 6. 8178 Find the common denominator of -57/319 and -31/261. 2871 Calculate the smallest common multiple of 492 and 984. 984 Calculate the common denominator of 85/3108 and -97/4884. 34188 What is the least common multiple of 123 and 246? 246 Calculate the smallest common multiple of 25 and 25. 25 What is the common denominator of 50/3 and -31/478? 1434 Find the common denominator of 64/15 and -103/105. 105 Calculate the lowest common multiple of 304 and 4. 304 Calculate the common denominator of -13/24 and 7/153. 1224 What is the common denominator of -43/552 and 143/2832? 65136 Calculate the common denominator of 52/33 and -20/33. 33 Calculate the least common multiple of 104 and 332. 8632 Calculate the common denominator of 27/40 and 12/55. 440 Calculate the least common multiple of 12 and 4780. 14340 Calculate the common denominator of 11/2 and -103/344. 344 Calculate the smallest common multiple of 884 and 32. 7072 Find the common denominator of -47/88 and 47/88. 88 Calculate the common denominator of 121/120 and -31/108. 1080 What is the common denominator of 121/40 and -71/150? 600 What is the common denominator of 44/75 and 7/30? 150 Find the common denominator of -163/7140 and -47/680. 14280 What is the common denominator of 99/100 and -43/40? 200 Find the common denominator of -109/6 and 127/462. 462 Calculate the smallest common multiple of 162 and 612. 5508 What is the least common multiple of 198 and 1584? 1584 What is the least common multiple of 420 and 462? 4620 Calculate the lowest common multiple of 40 and 32. 160 What is the least common multiple of 30 and 215? 1290 Calculate the least common multiple of 3186 and 738. 130626 Calculate the lowest common multiple of 6 and 260. 780 What is the common denominator of 15/14 and 69/206? 1442 Calculate the lowest common multiple of 180 and 60. 180 Calculate the least common multiple of 1050 and 700. 2100 Find the common denominator of -69/50 and 69/3170. 15850 Calculate the least common multiple of 18 and 10890. 10890 Calculate the lowest common multiple of 114 and 836. 2508 Find the common denominator of 40/141 and 151/288. 13536 What is the common denominator of 95/4 and 33/934? 1868 Find the common denominator of 63/832 and 39/4. 832 What is the common denominator of 8/3251 and -46/3? 9753 Find the common denominator of -22/2205 and 69/1715. 15435 Calculate the smallest common multiple of 1480 and 592. 2960 What is the least common multiple of 1 and 3? 3 Find the common denominator of -29/24 and 101/5542. 66504 Find the common denominator of -69/280 and -67/52. 3640 Find the common denominator of -27/13 and -57/104. 104 Calculate the least common multiple of 24 and 8934. 35736 Calculate the common denominator of -127/66 and -91/498. 5478 Calculate the least common multiple of 150 and 675. 1350 Find the common denominator of -5/56 and -16/147. 1176 Calculate the smallest common multiple of 2 and 113. 226 What is the lowest common multiple of 656 and 656? 656 Find the common denominator of 37/10 and 35/2764. 13820 Calculate the common denominator of -86/15 and -38/381. 1905 What is the common denominator of -97/244 and -3/8? 488 What is the smallest common multiple of 406 and 1682? 11774 What is the least common multiple of 35 and 63? 315 Calculate the lowest common multiple of 2 and 48. 48 What is the smallest common multiple of 312 and 468? 936 What is the smallest common multiple of 252 and 72? 504 Calculate the smallest common multiple of 209 and 63. 13167 What is the common denominator of -33/3560 and -65/356? 3560 Find the common denominator of -47/76 and -31/475. 1900 Calculate the least common multiple of 5 and 65. 65 What is the common denominator of 39/20 and -22/15? 60 Find the common denominator of 11/16 and -47/434. 3472 Calculate the common denominator of -7/156 and 53/18. 468 Calculate the lowest common multiple of 30 and 5120. 15360 What is the least common multiple of 25 and 50? 50 What is the common denominator of -13/93 and -97/72? 2232 Find the common denominator of 37/21 and 79/2604. 2604 Find the common denominator of -24/35 and -79/8. 280 Calculate the lowest common multiple of 30 and 20. 60 Calculate the smallest common multiple of 48 and 80. 240 Calculate the least common	{ "pile_set_name": "DM Mathematics" }
). k(k - 3)(k - 1)(k + 1) Let l(g) = -g2. Let w(v) = -v3 + 3v*2 + 5v + 2 - 5v2 + 0 + 2v*3. Let b(a) = 6l(a) - w(a). Factor b(y). -(y + 1)*2(y + 2) Determine j, given that -9/2j4 + 0 + 5/2j*2 - 1/2j - 3/2j3 = 0. -1, 0, 1/3 Let y(b) be the second derivative of 0 + 2/3b*3 + 3b + 1/60b5 + b2 + 1/6b4. Let u(c) be the first derivative of y(c). Suppose u(x) = 0. Calculate x. -2 Let g(t) be the second derivative of t7/840 - t6/80 + t5/20 + t*4/4 + 5t. Let d(c) be the third derivative of g(c). Suppose d(f) = 0. Calculate f. 1, 2 Suppose -32n + 10 = -27n. Suppose 2/11u + 0 - 8/11u*3 - 6/11un = 0. Calculate u. -1, 0, 1/4 Let d(q) = -q4 - q3. Let u(j) = -j4 - 3j3 - 2j*2. Let p(v) = 10d(v) - 5u(v). Factor p(h). -5h*2(h - 2)(h + 1) Suppose 16 = 2n + 3z, -3n - 3z = -8n + 19. Let m(v) = v*2 - v. Let h be m(2). Factor -5w + 6wh - 8 - 2w*3 + nw. -2(w - 2)2(w + 1) Determine c so that 1/2c3 + 0 + c + 3/2c*2 = 0. -2, -1, 0 Let m = -1031 + 2065/2. Find i, given that 0i + 0i2 - mi*4 + 0 + 0i*3 = 0. 0 Suppose 24y - 9 = 21y. Let h = -2 + 2. Factor 0 - 4/3q*y + 0q - 14/3q4 + hq*2. -2q*3(7q + 2)/3 Let u(a) be the second derivative of -a4/18 + a3/9 - 6a. Factor u(z). -2z(z - 1)/3 Factor 2j4 + 4/3 - 6j - 22/3j3 + 10j*2. 2(j - 1)*3(3j - 2)/3 Let j(x) = 51x*3 + 72x*2 - 50x + 10. Let v(c) = 103c3 + 145c*2 - 99c + 21. Let q(f) = -10j(f) + 4v(f). Factor q(k). -2(k + 2)(7k - 2)2 Let n(o) = -9o*2 - 4o + 5. Let u(c) = c*2 + c - 1. Let m(w) = -5n(w) - 40u(w). Factor m(j). 5(j - 3)(j - 1) Let z be 0/(16/(-4) - -3). Let u(n) be the third derivative of -1/1008n*8 + 0n + 0n6 - 1/630n*7 + 0 + 0n*3 + 0n*5 + zn*4 - 2n2. Factor u(i). -i4(i + 1)/3 Let a(s) be the second derivative of -4/135s*6 + 1/189s*7 - 5s - 2/27s4 + 1/27s*3 + 1/15s*5 + 0 + 0s*2. Factor a(m). 2m(m - 1)4/9 Let h(x) be the second derivative of -x4/54 - 5x*3/27 - 2x*2/3 + 33x. Factor h(v). -2(v + 2)(v + 3)/9 Let y(b) be the third derivative of -b6/420 - b5/210 - 17b2. What is v in y(v) = 0? -1, 0 Let q = -4 - -7. Determine p, given that p - 6p*2 + 3p - 4p3 + 6p*q = 0. 0, 1, 2 Let l be (-13)/((-715)/10) + 5/(-88). Let 0 + 1/8f*3 + 0f - lf2 = 0. Calculate f. 0, 1 Let b(s) be the third derivative of 0s + 4s2 + 1/360s*6 + 1/6s*4 - 1/6s*3 + 0 - 1/30s5. Let c(i) be the first derivative of b(i). Factor c(p). (p - 2)2 Let y(k) = -3k2 + 9k + 14. Let r be y(4). Suppose 2/7f4 + 2/7 + 8/7f*3 + 12/7f*r + 8/7f = 0. Calculate f. -1 Let j = -27 + 30. Factor 0a2 - 6/5a + 2/5aj + 4/5. 2(a - 1)*2(a + 2)/5 Let s(g) be the third derivative of -10g8/63 + 32g7/315 + g6/12 - 17g5/180 + g4/36 - 63g2. Solve s(x) = 0 for x. -1/2, 0, 1/4, 2/5 Let g(n) be the third derivative of n6/48 + n5/40 - n4/24 + 7n2. Solve g(k) = 0 for k. -1, 0, 2/5 Let b(v) be the second derivative of 1/6v*4 + 1/3v*3 + 0 - 2v - 2v2. Factor b(l). 2(l - 1)(l + 2) Find d, given that 2d*3 + 4d*2 + 35 - 4d - 47 - 6d = 0. -3, -1, 2 Let m(c) be the first derivative of 2/9c*2 + 2/27c*3 + 4 + 2/9c. Determine r, given that m(r) = 0. -1 Let f = 9 + -7. Factor 5 - 4 + f + 3o2 - 6o. 3(o - 1)2 Factor -48x - 12x - 32 - 12x*3 + 2x*2 + 102x*2. -4(x - 8)(x - 1)(3x + 1) Let n(g) = -5g*4 + 4g*2 + 3g - 5. Let k be (0 + -8)2/2. Let z(x) = -14x*4 + 12x*2 + 8x - 14. Let v(c) = kn(c) + 3z(c). Find a such that v(a) = 0. -1, 1 Let a(i) = -3i3 - 53i*4 + 27i*2 - 12i*3 + 26i*4 + 3 + 18i. Let s(t) = -t3 - t2. Let b(f) = a(f) + 3s(f). What is h in b(h) = 0? -1, -1/3, 1 Let w(t) be the third derivative of -t7/105 - t6/15 + 17t*2. Factor w(i). -2i*3(i + 4) Suppose -6n + 3n - 4k - 24 = 0, -n + 2 = -2k. Let u(f) = -f. Let t be u(n). Find p such that -pt - p3 + 2p5 - 3p*5 + 3p*4 = 0. 0, 1 Factor 16/7 - 24/7a + 12/7a2 - 2/7a*3. -2(a - 2)*3/7 Solve -4/7g*4 + 1/7g*5 + 4/7g*2 + 0 - 4/7g + 3/7g3 = 0. -1, 0, 1, 2 Let s = -472/5 - -98. Let 56/5c - sc5 - 38/5c*3 + 16/5 - 12c*4 + 44/5c2 = 0. What is c? -2, -1, -2/3, 1 Let d(u) be the first derivative of u7/7 - 2u6/15 - 2u5/5 + u4/3 + u3/3 - u - 3. Let x(c) be the first derivative of d(c). What is k in x(k) = 0? -1, -1/3, 0, 1 Let w(k) be the first derivative of -k4/7 - 2k3/7 - k2/7 + 3. Find g such that w(g) = 0. -1, -1/2, 0 Let 12b*4 + 57b*5 - 18b*3 + 8b*2 + 4b*4 - 2b*3 - 61b5 = 0. Calculate b. 0, 1, 2 Let s(o) be the second derivative of -o9/4536 - o8/2520 + o7/1260 + o6/540 - o3/6 + 4o. Let q(j) be the second derivative of s(j). Factor q(k). -2k*2(k - 1)(k + 1)2/3 Suppose 0m - 8 = -4m. Suppose 1 - 72k + k*4 - mk*2 + 72k = 0. Calculate k. -1, 1 Let y(f) = 2f2 + 3f - 9. Let a be 8(0 - 4/8). Let m(b) = -2b*2 - 2b + 8. Let u(v) = ay(v) - 5m(v). Find o such that u(o) = 0. -1, 2 Find r such that 0r4 + 0 + 3/2r*3 + 0r + r*2 - 1/2r*5 = 0. -1, 0, 2 Suppose 2r*2 - 2r*5 + 2r*3 + 7r3 - r5 - 8r2 = 0. What is r? -2, 0, 1 Let a = -39 + 69. Suppose -3y = -0y - a. Factor 4j - 4j2 - 4j*4 - yj*3 - 4j. -2j2(j + 2)(2j + 1) Let b(t) = -t*2. Let s be b(1). Let h be s - (-5)/((-5)/(-3)). Suppose hk*4 - 2k*4 + 2k*5 + 2k*3 + 4k*4 = 0. Calculate k. -1, 0 Let -2w*4 - 183 - 5w*3 + 0w*2 + 175 + 0w*2 + 4w + 10w2 + w5 = 0. What is w? -2, -1, 1, 2 Let g(t) be the second derivative of t5/40 - t3/4 + t2/2 - 14t. Find s, given that g(s) = 0. -2, 1 Let c(a) = -2a4 - a2 + 3. Let h(p) = 2p*4 + 2p*2 - 4. Suppose -3o + 4o = -6. Let d(g) = oc(g) - 5h(g). Factor d(z). 2(z - 1)*2(z + 1)2 Let q(f) be the second derivative of f4/4 - f*3/2 + 2f. Solve q(a) = 0. 0, 1 Let t = 2 - -5. Factor 1 + 2 + 3o3 - 4o - 3o2 - 6o*3 + to. -3(o - 1)(o + 1)*2 Let j(n) be the third derivative of 0n*4 + 1/60n*6 + 0 + 1/105n*7 - 3n*2 + 0n*3 + 0n + 0n5. Let j(f) = 0. What is f? -1, 0 Let c(t) be the third derivative of t9/90720 - t8/15120 - t7/7560 + t6/540 - t5/10 + 6t*2. Let p(g) be the third derivative of c(g). Factor p(z). 2(z - 2)(z - 1)(z + 1)/3 Let t be 3/703684/(-9). Let d = t - -134/7. Suppose -8/5r - d - 2/5r2 = 0. What is r? -2 Suppose 0 = 6n - 218 + 206. Let y + 0yn - 1/2y4 - y3 + 1/2 = 0. What is y? -1, 1 Let b = -14 - -17. Let f(p) = -3p3 + 3p*2 - 9p - 5. Let h(a) = -2a3 + 2a*2 - 5a - 3. Let u(q) = bf(q) - 5h(q). Let u(n) = 0. Calculate n. -1, 0, 2 Suppose -4y = -3y - 19. Let m = 23 - y. What is r in 1/2 + 12r3 + 11r*2 + 9/2r*4 + mr = 0? -1, -1/3 Factor 1/2s - 1/2s*3 - 1/2s*2 + 1/2. -(s - 1)(s + 1)*2/2 Suppose 0 = 4r - 3u - 5 + 1, 0 = -5r - 5u + 5. Suppose -3j*2 - 2 + 0 + 4 + r = 0. Calculate j. -1, 1 Let f be -12 - 8749/(-4368). Let a(g) be the third derivative of -1/60g5 + 0g + 0g4 - 1/70g*7 + fg*8 + 1/40g*6 + 0g3 + 0 - g2. Factor a(s). s*2(s - 1)*3 Factor 0w + 3/4w2 + 0. 3w*2/4 Let y(d) be the second derivative of -5d*5/16 + 5d*4/8 + 3d3/2 + d2 - 18d. Factor y(i). -(i - 2)(5i + 2)2/4 Factor -1/7 - 3/7p + 4/7p2. (p - 1)(4p + 1)/7 Let z(l) be the first derivative of l6/330 + l5/110 + l4/132 - 2l*2 - 2. Let k(r) be the second derivative of z(r). Let k(d) = 0. What is d? -1, -1/2, 0 Let r = 15 - 17. Let l be (-5)/((-90)/(-32)) - r. Solve 2/9 - lj*2 + 0j = 0. -1, 1 Let h(z) be the first derivative of -50z5 - 140z*3 + 68z*2 - 16z + 275/2z4 + 2. Find q, given that h(q) = 0. 2/5, 1 Let v(d) be the first derivative of d5/90 + d4/27 + d3/27 - d - 2. Let c(a) be the first derivative of v(a). Factor c(m). 2m(m + 1)2/9 Let c(r) = -2r - 16. Let n be c(-9). Let s(q) be the first derivative of 3 - q - 3q4 - 4/5q*5 - 3q*n - 13/3q3. Factor s(j). -(j + 1)2(2j + 1)*2 Solve 2k + 0k + 8k*2 + k - 36 - 2k*3 + 3k = 0. -2, 3 Let t(r) = -9r2 - 14r + 10. Let m(j) = 36j2 + 57j - 39. Let u(o) = -2m(o) - 9t(o). Determine x so that u(x) = 0. -2, 2/3 Suppose x - 4 = -1. Factor k*	{ "pile_set_name": "DM Mathematics" }
ivisor of c and 110? 22 Let m = 78 + 26. Let h = m - 94. Calculate the greatest common divisor of h and 50. 10 Suppose l - 658 = -3z, z + 10l - 5l = 210. Calculate the greatest common factor of 20 and z. 20 Let m(r) = -17r + 34. Let d be m(-6). What is the highest common divisor of d and 24? 8 Let o(d) = -5d2 - 4d - 13. Let u be o(-15). Let s = u - -1519. Calculate the highest common divisor of s and 49. 49 Let r(v) = 30v - 168. Let n be r(6). What is the greatest common divisor of n and 78? 6 Suppose 9x = 4x + 10. Suppose 4a + r - 2r - 36 = 0, 28 = 2a - 3r. Calculate the highest common factor of x and a. 2 Let o(t) = -36t3 - t2 - t. Let g be o(-1). Suppose 139m + 180 = 141m. Calculate the greatest common divisor of m and g. 18 Let h = 0 - -42. Suppose 3x - 188 = b, -3x + 5b - 129 = -313. Calculate the greatest common factor of x and h. 21 Suppose -2h = 5w - 44, 4w = -2h + 1 + 45. Let p(v) = -5v + 2v + h + 3v - v. Let z be p(12). Calculate the highest common factor of 30 and z. 15 Let k be (-4 - -1 - -3)/(-4). Suppose -100 = -5d + 2j, k = -3d + 5j + 72 + 7. What is the greatest common divisor of 36 and d? 18 Let l = -40 + 44. Suppose lk = 2k + 104. Let p(o) = -o*3 - 6o*2 - 2o + 1. Let m be p(-6). Calculate the greatest common factor of m and k. 13 Let z be (-4 + -24)/(2/(-28)). Calculate the greatest common factor of 49 and z. 49 Suppose 0 = 40n - 21n - 114. Calculate the highest common divisor of n and 27. 3 Let f be 30 - 1 - ((-54)/(-9) - 10). Let m = 38 + -27. Calculate the highest common factor of f and m. 11 Suppose 27j = 25j + 6. Suppose -j + 59 = y. What is the highest common factor of y and 7? 7 Let y(g) = g*2 - 2g - 40. Let p be y(13). Let h = -91 + p. What is the highest common factor of 36 and h? 12 Let s be (-24)/(-144) + 62/(-12). Let m be 1(2/1 - -2). Let l be 10 - (s - (m + -8)). What is the greatest common divisor of l and 77? 11 Let z(w) = w3 + 27w*2 + 18w - 1. Let m be z(-26). Let j = 302 - m. What is the greatest common factor of j and 38? 19 Suppose 5 - 3 = -y. Let v be (10/(-15))/(y/12). Suppose 365 = vt + 5p, -t + 51 = p - 39. What is the highest common factor of t and 34? 17 Let w = -2 - -42. Calculate the highest common divisor of w and 280. 40 Let p(h) = 31h + 62. Let i be p(13). Calculate the greatest common divisor of 15 and i. 15 Suppose 0v + 5v = -3d + 85, 0 = v - 4d + 6. Suppose -43976 = -19i - 43444. What is the greatest common factor of i and v? 14 Suppose 3l + 2u - 424 = -l, 3u + 414 = 4l. Calculate the highest common factor of l and 270. 15 Let j = -31 - -32. Let i be j-1 + (-220)/(-10). Calculate the greatest common divisor of i and 14. 7 Let g be (-2)/(-15) + (-20)/150. Suppose g = -0p - 3p + 9. Suppose -j = pj - 300. Calculate the greatest common divisor of 25 and j. 25 Let c be ((-1)/(-1))/(1/9). Suppose -69 = -3o + 3v + 6, -5v + 10 = 0. What is the highest common factor of o and c? 9 Suppose 0 = -2f - 4f - 78. Let c = f + 32. What is the greatest common factor of c and 19? 19 Suppose 2f - l + 4l - 14 = 0, -l + 2 = 0. Suppose fn - 10 = 2r - 0, 9 = 3r. What is the greatest common factor of 1 and n? 1 Suppose -27i = -30i, 600 = 4r + i. Calculate the highest common factor of 4 and r. 2 Let g = 129 + 22. Let z = g - 95. What is the greatest common factor of 28 and z? 28 Let d = -254 - -744. Suppose -m = -6m + d. What is the highest common divisor of 14 and m? 14 Let w(v) = -v*3 - 50v*2 - 401v + 13. Let u be w(-10). Suppose -s + 828 = 3s. Calculate the highest common divisor of u and s. 23 Suppose -4g - 5x + 40 = -34, -3g + 58 = 5x. Calculate the highest common divisor of g and 160. 16 Suppose -5 = p, 2y - 81 = 6p - 3p. Let v = -23 - -25. Let i be (v/6)/((-18)/(-162)). What is the greatest common factor of y and i? 3 Let x(v) = 26v + 148. Let f be x(-3). What is the highest common divisor of 4200 and f? 70 Let t = -251 - -275. Calculate the greatest common factor of t and 6. 6 Suppose 0 = -l + 53d - 49d + 1400, 0 = 2l - 3d - 2810. What is the greatest common divisor of l and 44? 44 Let a(k) = 2k*2 + 11k + 9. Suppose -21m + 15m - 54 = 0. Let q be a(m). What is the greatest common divisor of q and 9? 9 Suppose -y = 3z - 13, 4z + 1 = -3. Let w(v) = 2v - 1. Let a be w(5). Let i = a - 5. Calculate the highest common divisor of y and i. 4 Let m be (-7)/(-4) + (-168)/(-32). Let k(l) = l + 49. Let a be k(0). Calculate the greatest common divisor of a and m. 7 Suppose -5p + 53 = -7. Let o(v) = -v*3 + 12v*2 + 16v - 11. Let w be o(13). Let h = 46 - w. Calculate the greatest common divisor of p and h. 6 Let j be 130/14 - 4/14. Let l = 213 + -150. What is the highest common factor of l and j? 9 Let u(a) = -7a - 16. Let k = -14 + 10. Let y be u(k). Let o(x) = -x3 - 3x*2 - x + 1. Let i be o(-3). Calculate the greatest common factor of i and y. 4 Let g be 604/(-10) - 2/(-5). Let l = 48 - g. What is the greatest common divisor of 12 and l? 12 Suppose 12 = 5b + 2. Suppose 5n = i + 109, 13i - 111 = -5n + 12i. What is the highest common divisor of n and b? 2 Let v = -205 - -214. Suppose 3x + 2x = 10. Suppose -xt = -6t + 396. Calculate the highest common divisor of v and t. 9 Suppose 0 = 2d - 3k - 30, 5d - 4k - 13 = 48. Let l = 11 + d. What is the highest common factor of 8 and l? 4 Let b(f) = -f + 22. Let u be b(11). Suppose 30y - 33y = -132. Calculate the highest common divisor of u and y. 11 Let m = 204 - 120. Calculate the greatest common divisor of 24 and m. 12 Let y(x) = -x*3 + 9x*2 + 9x + 18. Let t be y(8). Suppose -3b - 14 = -4b. What is the highest common factor of b and t? 14 Suppose 5v - 3f - 1380 = 0, -v + 253 = -f + 5f. What is the highest common factor of v and 39? 39 Let m be (0 + -33)/(-15 + (-792)/(-55)). Suppose 3p - 22 = -7. What is the highest common divisor of m and p? 5 Let n be (6 + -7)(-5 + 0). Let o be (-4224)/(-198) - (2 + (-2)/3). Calculate the greatest common divisor of o and n. 5 Let n = -165 + 216. What is the greatest common divisor of 153 and n? 51 Let i be (-1911)/528/(-3). Let a = i + -42. Let y be 581/a - 3/8. What is the greatest common factor of 5 and y? 5 Let k = 8 - 5. Suppose 2y + 5w - 22 = 0, -3y + 88 - 17 = -2w. Calculate the highest common factor of y and k. 3 Suppose -476 = 8g - 10g + 4v, 4g = -5v + 926. What is the greatest common divisor of 312 and g? 78 Let x = -14 - -222. Let f = -91 + x. Let l = f + -37. What is the highest common factor of l and 16? 16 Suppose -1496 = -15p - 2p. What is the highest common factor of 33 and p? 11 Suppose -2r - 5q = -34, r + q - 16 + 2 = 0. Let i be 168((-15)/(-6) + -2). Calculate the highest common divisor of i and r. 12 Let s be -1(1 - 0)6. Let d be ((-11)/(-2))/(s/(-12)). Suppose -q + 2q = d. What is the greatest common factor of q and 44? 11 Suppose -4i - 5j = -1922 - 1765, -3j + 4599 = 5i. What is the greatest common factor of 54 and i? 54 Let l(g) = -32g - 280. Let k be l(-9). What is the greatest common divisor of 720 and k? 8 Suppose 0 = 3f + 2f - 20. Suppose -4 = -2g - fd, 3g - 20 = 2d + 18. Suppose 3p = 2p + g. Calculate the greatest common factor of 2 and p. 2 Let v be (2/(-17) - 10868/2992)-20. Calculate the greatest common divisor of v and 60. 15 Let t = 10 - 5. Let d be 4/(-18) + (-9380)/(-90) + -3 - 6. Calculate the highest common divisor of t and d. 5 Let w be (-3)/(4 - (3 + 2)). Suppose wy - 133 = 182. Suppose -d + 17 + 18 = 0. Calculate the greatest common factor of y and d. 35 Let m = -16 + 9. Let b = -14 + m. Let s = b + 29. Calculate the greatest common divisor of s and 72. 8 Suppose 212 = -9f - 337. Let a = -30 - f. Calculate the highest common factor of 341 and a. 31 Let t = 278 - 254. What is the highest common factor of 18 and t? 6 Let p = 50 - 76. Let b = 34 + p. What is the greatest common divisor of 32 and b? 8 Let m(a) = a3 - a2 + a + 20. Let c be m(0). Let i be (6(-5)/3)/((-2)/3). Calculate the highest common divisor of c and i. 5 Let t = 29 - 20. Suppose 0 = 2j + 27 + 17. Let d be j/(-99) + 691/t. What is the highest common divisor of 11 and d? 11 Let w(i) = -2i*3 + 19i*2 + 14i - 26. Let j be w(10). Calculate the highest common fa	{ "pile_set_name": "DM Mathematics" }
/8. Let w = r + 13. Calculate the remainder when z(2) is divided by w. 1 Let o = -28 - -47. What is the remainder when 56 is divided by o? 18 Let j = -39 + 70. What is the remainder when 121 is divided by j? 28 Suppose 0a = -5a + 20, 0 = -4l + 4a + 16. Calculate the remainder when 21 is divided by l. 5 Let o be ((-10)/(-4))/((-16)/(-32)). Let b = o - -1. Calculate the remainder when 22 is divided by b. 4 Let l(t) = t*2 - 8t + 4. Let b be 4/(-10) + (-57)/(-5). Suppose 3o - b = -q + 11, -2q + 3o = -53. Calculate the remainder when q is divided by l(9). 12 Let c(k) = 0 - 6 - 17k + 8. What is the remainder when c(-1) is divided by 10? 9 Suppose 0u - s = -4u + 98, 4s = -u + 33. Calculate the remainder when 72 is divided by u. 22 Let g(b) = -b2 - 5b - 2. Let i be g(-4). Suppose -ij - j = -201. Calculate the remainder when j is divided by 23. 21 Let h(q) = -q3 - 10q*2 - 8q + 8. What is the remainder when h(-10) is divided by 45? 43 Let s(b) = b + 49. Calculate the remainder when s(9) is divided by 15. 13 Let t(h) = -h*3 + 16h*2 + 17h - 12. Let r be t(17). Let j = -4 - r. Calculate the remainder when 23 is divided by j. 7 Suppose a - 13 = 6. Suppose 51 + 241 = 5u - 4g, 2g - 50 = -u. What is the remainder when u is divided by a? 18 Let m be 36/(-10)(-475)/38. Suppose 0 = 5w + 4i - 58, -2w - i - m = -5w. What is the remainder when 26 is divided by w? 12 Suppose 2m = 16 + 52. Let i = 69 + -9. Suppose i = 8f - 3f. What is the remainder when m is divided by f? 10 Suppose 3l - 4t - 118 + 40 = 0, -5l + 122 = -4t. Calculate the remainder when l is divided by 12. 10 Let l(d) = d2 - d + 25. Calculate the remainder when 73 is divided by l(0). 23 Suppose 0 = -5i + a + 111 + 88, i + 4a - 44 = 0. Calculate the remainder when i is divided by 7. 5 Let u = -47 - -86. Suppose 0 = -6m + 3m + 42. Calculate the remainder when u is divided by m. 11 Suppose -3g - g = -20. Suppose 2x - 3 = 23. What is the remainder when x is divided by g? 3 Let b = 127 + -190. Let i = b - -115. What is the remainder when i is divided by 14? 10 What is the remainder when 7 - -81 - (2 + 0) is divided by 11? 9 Let t(j) = j2 - 3j - 2. Let w be t(4). Suppose wc + 3d + 2 = 42, 3d = 4c - 62. Calculate the remainder when 33 is divided by c. 16 Suppose -6p + 106 = -86. Calculate the remainder when 93 is divided by p. 29 Let b(n) = 66n*2. Let d = 11 + -10. Calculate the remainder when b(d) is divided by 23. 20 Let k(p) = 60p - 2. Calculate the remainder when k(3) is divided by 15. 13 Let z be (-1 - -1)3/6. Let k = z - 0. Suppose k = 5h - 12 + 2. What is the remainder when 4 is divided by h? 0 Let y = 23 - 16. What is the remainder when 25 is divided by y? 4 Suppose 8g - 156 = 164. Calculate the remainder when g is divided by 11. 7 Let w = -3 + 2. Let r(x) = x2 + 7x + 9. What is the remainder when (4 - -2) + 2 + w is divided by r(-6)? 1 Let v(l) = 14l + 3. Calculate the remainder when 64 is divided by v(1). 13 Suppose -2t - t - 2h = 2, 2t - 3h - 3 = 0. Suppose q = 4m - 11, -2m - 3q + 1 - 6 = t. What is the remainder when 9 + 1(-12)/3 is divided by m? 1 Let m(f) = 9f3 + f2 + f - 1. Let b be m(1). What is the remainder when b15/(-12)-4 is divided by 13? 11 Suppose 3k = k. Suppose k = y - 6y + 30. Suppose 0 = -2v - y + 34. Calculate the remainder when 27 is divided by v. 13 Let x(k) = -k3 + 6k*2 - 3k - 5. What is the remainder when x(4) is divided by 8? 7 Let r(y) = 16y3 + y2 - y. Suppose 0 + 9 = 3x. Suppose 80 = 2v - 4z, 0 = 3v - 8z + xz - 123. What is the remainder when v is divided by r(1)? 14 Let u(l) = 51l*2 - 2l + 2. Calculate the remainder when u(2) is divided by 34. 32 Suppose 3c + 66 = 5c + 3n, -2c + 5n + 50 = 0. Calculate the remainder when 55 is divided by c. 25 Let i = -4 - -8. Let k = -9 + 5. Let l = 10 + k. Calculate the remainder when l is divided by i. 2 Let y = 71 + -25. Calculate the remainder when 227 is divided by y. 43 Let d be (-102)/(-5) + (-4)/10. Let u(w) = w2 + 10w - 6. Let y be u(-11). Suppose y = -n + d. What is the remainder when 28 is divided by n? 13 Let f(h) = h*2 - h + 4. Let o be f(4). Suppose 2v + 2 = o. What is the remainder when 12 is divided by v? 5 Suppose 3i + 5 = 4i. Let u = i + 6. Calculate the remainder when 43 is divided by u. 10 What is the remainder when 13 is divided by (-6 - 0 - -5)/((-2)/4)? 1 Calculate the remainder when (-181)/(4/(-2) + 1) is divided by 46. 43 Let j = 22 + -16. Calculate the remainder when 16 is divided by j. 4 Let n(p) = -p*3 + 10p*2 + 3. Let r be n(10). Suppose -k + 3c - c = -64, rc + 195 = 3k. What is the remainder when k is divided by 17? 15 Suppose -6p + 2p = -84. Let j(s) = 2s - 15. Let k be j(10). Calculate the remainder when p is divided by 10/k - (0 + -4). 3 Let v(i) = i3 + 2i + 15. Let x(p) = 2p + 1. Let j be x(-2). What is the remainder when ((-172)/(-6))/((-2)/j) is divided by v(0)? 13 Suppose 0 = m - 2m + 10. Let k = m + -3. Let o = 46 + k. What is the remainder when o is divided by 18? 17 Let i(l) = 72l + 4. Calculate the remainder when i(2) is divided by 38. 34 Suppose z + 50 = -5v, -25 = -z + 6z. Let p(t) = -t3 - 3t*2 - 14. Calculate the remainder when p(-5) is divided by 1 + (4v)/(-2). 17 Let b = 63 + 19. Calculate the remainder when b is divided by 17. 14 Suppose -4k = -k + 4t - 4, 2k - 6 = -t. Suppose 5w + 4h - 31 = -0h, -8 = kw - 5h. Suppose 4n = -0n + 20. What is the remainder when n is divided by w? 2 Let z = -4 + 38. What is the remainder when z is divided by 18? 16 Calculate the remainder when 33 is divided by 132/8 - (-1)/2. 16 Let m(s) = -3s + 3. Let o be m(-5). Suppose o = 4z - 114. Suppose 3l + 0l = z. What is the remainder when 21 is divided by l? 10 Let j = -21 + 34. Calculate the remainder when ((-2)/14)/1 + (-1040)/(-28) is divided by j. 11 Suppose -10 = x - 3x, -l = x - 5. Suppose l = -n + 4n. Suppose 2p = -np + 90. What is the remainder when p is divided by 23? 22 Let t(x) = 3x - 6. Let y(q) = 2q*2 + 4q + 1. Let s(p) = -p*2 + 8p - 3. Let n be s(8). What is the remainder when t(6) is divided by y(n)? 5 Let w(k) = -k - 12. Let l be w(-14). Let d(s) = 19s - 1. What is the remainder when d(l) is divided by 19? 18 Calculate the remainder when (32/(-20))/(0 - (-4)/(-10)) is divided by 3. 1 Suppose 3c + 2f - 22 - 14 = 0, -30 = -3c - 4f. Let d(n) = -19n. Let g be d(-3). Let u = g + -17. Calculate the remainder when u is divided by c. 12 Let y(t) = -2t + 2. Let h be (-9)/(-6)(2 - 0). Suppose -hv = -4v + 37. What is the remainder when v is divided by y(-4)? 7 Let d(g) = -3g - 3. Let y be d(-6). Let b = 59 + -38. Suppose 2h - 46 = -3a - b, -a - 4h = -y. What is the remainder when a is divided by 4? 3 Let c(g) = -4g - 6. Let d(z) = -9z2 + 1. Let n be d(-1). What is the remainder when c(n) is divided by 9? 8 Let t(r) = -r3 - 3r2 - 4r + 5. Let j(f) = f*2 + f + 1. Let h(q) = -4j(q) + t(q). What is the remainder when 38 is divided by h(-6)? 12 Suppose -5b = -z - 312, -3z + 324 = -b + 6b. What is the remainder when b is divided by 13? 11 Let w(g) = -g3 + 3g*2 + 5g. Let o(f) = -f*3 + 12f*2 + 2f - 22. Calculate the remainder when w(4) is divided by o(12). 0 Let i be (-70)/15(-6)/4. Suppose j + i = 27. Calculate the remainder when 57 is divided by j. 17 Suppose 2w + 6 = -2y - 6, w - 4y + 6 = 0. Let o be (-45)/(-12)(w - -2). Let c = -11 - o. What is the remainder when 10 is divided by c? 2 Let z be 26 + 1 + (1 - 3). Let i = -16 + z. Calculate the remainder when 1/(-1)-16 - 1 is divided by i. 6 Let v(y) = y3 - y2 - 2y - 3. Let r(u) = -u2 - 7u - 1. Let h be r(-6). Suppose -2f + 29 = -h. Calculate the remainder when f is divided by v(3). 8 Let u = -1 - -1. Suppose -5n + d + 81 = 16, u = 3n - 5d - 39. What is the remainder when n is divided by 5? 3 Let p(q) = q*2 - 7q + 5. Let n be p(7). Suppose m = 3i - 1, -n = -5i + 3m - 2m. What is the remainder when 3 is divided by i? 1 Suppose 6 = 4q - 3q. What is the remainder when 26 is divided by q? 2 Let h be 0 - (3 - 6)/3. What is the remainder when 28 is divided by 4 - -3 - -3h? 8 Suppose 4r - 26 = 2q, -4r - 5q + q = 4. Suppose 3j - r*a - 28 = -7, 0 = 5	{ "pile_set_name": "DM Mathematics" }
nd give o. 824 Rearrange -10n4 + 3n*4 - 2n*2 - 3n*3 - 23n*4 to the form ln*2 + on*4 + g + cn + vn3 and give o. -30 Express 16s*3 + 4s*2 - 1 - 7s*2 + 2s - 15s3 as is + ws3 + u + ps*2 and give i. 2 Express (-4u - 2 + 0u + u)(-57u2 - 2 + 14u*2 - 7u*2 + 2u) as a + fu3 + wu*2 + ju and give w. 94 Express (-5d2 - d2 + 5d*2)(32524d + 3 - 3 - 37420d) in the form pd3 + f + wd + zd2 and give f. 0 Express -1144a + 568a + 577a - 156 + (-3a + 5a + a)(0 - 2 + 0) as ka + j and give j. -156 Express 25l2 + 13l - 8l2 - 4l*3 - 3l*2 as cl + u + il2 + ml*3 and give m. -4 Rearrange (-3a + 3 - 3)(-2a - a + 2a) + 18a*2 + 30a*2 - 33a*2 to ga + b + qa2 and give q. 18 Express (91 - 79 + 111)(11x + 17x + 0x) in the form lx + k and give l. 3444 Express 2n - 7n + 2n + (-8n + 26n - 8n)(-4 - 2 + 2)(-1 + 0 + 3) as u + gn and give g. -83 Rearrange (688 - 1002 + 707)(1 - 1 + x*3) to the form i + tx*2 + nx + zx3 and give z. 393 Rearrange 2i + 2 + 13i2 - 30i*2 + 45i + 23i2 to ji + b + li2 and give b. 2 Express (0 + 0 + j + (-2 + 6j + 2)(-1 + 2 - 2))(-j*2 + 17j*2 - 3j*2) as wj + y + aj2 + rj*3 and give r. -65 Rearrange 4j - 5j + 2j + (-6 + 6 + 11j)(6 - 5 + 14) to mj + v and give m. 166 Rearrange 5243 + 228m - 5243 to rm + p and give r. 228 Express 2q*2 - 3 + 3 + (0 + 1 - 2)(2q2 + q2 - 2q*2) + (824 - 824 + 558q)(0 + 0 + 2q) as f + nq + tq*2 and give t. 1117 Express -7p + 4 + 0 + 5p - 3p + 0p + 13p + (-1 + 1 - 2)(-1 + 1 - p) - p - 2p + 2p in the form ap + m and give a. 9 Rearrange 2p - p4 - 30p*2 - 2 + 2p*3 + 12 + 31p*2 to ap*3 + kp + j + tp2 + hp*4 and give j. 10 Express -2l - 134l2 + 135l*2 - 16 - 41l*3 + 16 in the form j + pl*3 + yl + zl2 and give z. 1 Rearrange 67 + 72 + 7j2 + j3 + 0j4 - 145 + 2j*4 to the form nj*2 + pj + t + lj3 + hj*4 and give l. 1 Express (-1 + 0 - 1)(-854 + 2r - 4r + 3r3 + 820) in the form br*2 + pr*3 + q + kr and give k. 4 Rearrange ((-o - o*2 + o)(0 - 5 + 3) - 3o2 + 0o*2 + 2o*2)(-2o2 + 10o*2 - 2o*2) to do*2 + u + wo*4 + jo*3 + no and give w. 6 Express -3 + 0 - 16o + o3 + 13o + 33o2 + 0o*3 - 34o*2 in the form no*3 + z + to*2 + go and give t. -1 Express 4s2 - 2984s*4 + 5s*3 + 11s + 2982s4 - 2s as is4 + as*2 + v + us + hs3 and give i. -2 Express 2g + g + 0 + 15 - 33 - 75 in the form yg + k and give k. -93 Express 849w + 0 - 551w + 0 as h + kw and give k. 298 Rearrange a*3 + 1 + 21600a*2 - 21598a*2 - 2a - 138a4 + 2a to ra4 + fa*2 + pa + z + wa3 and give w. 1 Express (5o - 2o - 4o)(-37o + 46o + 75o)(-7o + 2 - 2) as y + po2 + mo*3 + qo and give m. 588 Express 26x - 3 - 26x + 2x2 + 11x*3 + 62x*3 - 16x*3 as ix*2 + yx + jx3 + v and give i. 2 Rearrange -67a - 9a4 + 6a*2 + 65a - 3a3 + 2a*3 to o + xa*2 + za + ia4 + va*3 and give v. -1 Express 4 + 0 - 815m*2 + 191m*2 - 1 - 5 as xm + c + lm2 and give c. -2 Express -c - 3 - 9 + 15 - 2c*4 + 2c*2 - 6c*3 in the form lc*4 + ic*3 + o + wc + hc2 and give l. -2 Express 3k*2 - 10k3 - k2 + 11k3 + 6k - 8 - 7k as h + mk*2 + lk*3 + pk and give m. 2 Express 0n3 - n3 + 0n*3 + (505n + 7030 - 7030)(-2n*2 - 3n*2 + 3n*2) as b + zn*3 + fn + mn2 and give z. -1011 Express -391 - 3s2 - 361 + 733 + s + s2 in the form fs2 + xs + v and give f. -2 Rearrange -5 + 5 + o*3 + (2o*2 + 2o - 2o)(-998o - 2631 + 2631)(-2 + 0 + 4) to the form to + do*2 + m + co*3 and give c. -3991 Rearrange (-k + 2k + k)(k3 - 3k*2 + 3k*2) + (5k*4 + 33k*2 - 33k*2)(-5 + 10 - 9) to c + xk + nk*3 + hk*2 + ak*4 and give a. -18 Rearrange -327u - 6 + 163u + 166u + u*2 - 2u*4 to lu*3 + zu*2 + mu*4 + i + du and give z. 1 Rearrange (-2 - 3 - 5)((4 - 3 + 2)(-2w - 2w + w) + 23 - 23 - 13w + (-2 + 3 - 2)(0 + 2w + 0)) to aw + f and give f. 0 Express 13 + 12 - 2m - 26 - 11m*3 + 2m*4 - 2m*2 + 0m*2 in the form om*2 + x + zm*4 + im + rm3 and give o. -2 Express 3u - 3u + 2u*2 - 14 - 53 - 371 in the form d + su*2 + pu and give d. -438 Express -13v2 - 149v*2 - 30v*2 + 6v2 - v2 - 4v2 - 4v2 + v2 + v2 + (v2 + 3 - 3)(-4 + 4 - 2) in the form tv*2 + cv + r and give c. 0 Express 4474o2 + 97o*3 - 4474o*2 + (-5o3 + o3 + 3o3)(5 - 1 - 2) + 0o - 2o*3 + 0o in the form ao3 + to*2 + go + j and give a. 93 Rearrange 4 + 4h4 - h2 - 16h*3 - 21h*3 - 2h + 39h3 to n + mh*4 + zh*3 + rh + xh2 and give n. 4 Express -d2 + 4361d3 - d2 - 4454d3 in the form sd*3 + id + od2 + x and give s. -93 Express (-a - 2a*3 + a)(2a + 1 - 1) - 56565a*3 + 15a*4 + 11a*4 + 56566a*3 + 9a*2 as ya*4 + qa + da2 + l + na*3 and give n. 1 Rearrange 94p - 10p + 30p to the form b + wp and give w. 114 Express -34 - 54 + z + 12 - 12 in the form r + jz and give j. 1 Express (-6u + 3u*3 - 9u + 13u)(-2081 + 2081 - 85u) in the form bu + mu3 + gu*4 + s + iu*2 and give i. 170 Rearrange 3d*3 + 12d*3 - 90d - 14d3 - 1 - 2d*2 to nd*2 + xd*3 + ld + t and give l. -90 Rearrange -2d3 + d3 - 2d*3 + (2 + d - 2)(d - 2d2 - d) + 63d*3 - 1566d + 1566d to sd*2 + hd + rd3 + v and give r. 58 Express (2 + 2 - 2)(2 - 2 + 1)(c + 0c + 56177 - 55970) as r + tc and give r. 414 Express (2 - 2 - 2j)(4 - 5 - 1) + 2j + 5j - 5j - j + 0 + 0 in the form wj + m and give m. 0 Express 48l - 36l - 11l + 62l as r + tl and give t. 63 Rearrange (171 - 61 + 47)(4i - 3i + 2i + i - 3 + 3 + (-1 - 2 + 2)(0 + 2i + 0)) to the form m + ai and give a. 314 Rearrange (2a + 2a - 3a)(21 - 8 + 11)(14 + 11 + 10) to ja + x and give j. 840 Express (1 + 2 - 2)(-36 + 13x + 36)(4 + 4x - 4)(0 + 4x + 0) as ox*2 + vx*3 + h + sx and give v. 208 Express 17 + 265h - 2162h*2 - 17 - 265h as dh2 + yh + u and give d. -2162 Express -2160f4 - 21 - 3f2 - f2 + 4f2 + 2162f4 + f3 as n + tf2 + xf*4 + yf*3 + qf and give y. 1 Express 2w - 3w - 7w + (-6 + 4 + 3)(18w - 49w + 17w) - 4w + w + 2w as a + bw and give b. -23 Express 8 - 11d3 + 2d*3 + 6d + 23d + 7d*3 - 2 as fd + gd3 + w + sd*2 and give s. 0 Express 7f - 18f2 - 85f*2 - 58f*2 as cf*2 + u + tf and give c. -161 Rearrange 9 + 0 - 11 + 4 - 62o to y + wo and give w. -62 Rearrange -18g2 + 16g*2 - 538 - 2g*4 - 393 + 366 to the form cg*2 + ag + fg3 + jg*4 + q and give c. -2 Rearrange -123o + 2219o + 616o to the form no + b and give n. 2712 Rearrange -6r*4 + 5948 + 3r - r2 + r3 - 5r - 5953 to the form dr*3 + zr + yr4 + hr*2 + x and give x. -5 Rearrange -4 - 40724w + 7 + 41068w + 2w + 0w + 0w - 2 - 2w + 2 + (4w - 2w + 0w)(1 - 3 + 0) to the form pw + i and give i. 3 Express -2349u4 + 18u3 + u2 - 1 + 2346u4 - u2 in the form j + gu*4 + pu*3 + iu + hu2 and give j. -1 Express 2c - 4c + 20c*3 - 1321c*2 + 1320c*2 + (0c + 3c2 + 0c)(-3c + 6c - c) in the form rc*2 + q + mc + dc3 and give m. -2 Rearrange -248l + 1 - 1 - 243l - 281l to the form fl + i and give f. -772 Express 0o + 5o - 4o + o + 4o - 4o + (-8o - o + 2o)(2 + 0 - 1) + 2 + 2o + 0o + 0 as po + g and give g. 2 Express (-1 + 2 - 2)(-83 + 144 + 308l - 62) in the form c + yl and give c. 1 Express -g4 + 0g*4 + 5g*4 + (2 + 7 - 3)(7g4 + g - 2g*4 - 9g*2 - 7g*4) in the form zg*4 + xg*3 + ag + qg2 + r and give a. 6 Rearrange -1 - 3j*3 + 1 + 2j*2 - 2j*2 - 2j*3 + (0j*2 + 2j*2 - 16j*2)(0 + 0 - j) - j3 + j3 - 2j3 to cj + n + dj3 + lj*2 and give d. 7 Express (-3 + 5 - 4)(-2p4 + 2p*3 - 2p*3) - 11p*4 - 8p*2 + 19p*2 + 9p*4 as t + wp*4 + mp*2 + op + jp3 and give w. 2 Rearrange 7g - 7g + 0g*2 - 3g - 2g2 + 10g*3 + 15g*3 to the form t + lg*2 + ig + mg3 and give l. -2 Express -15a + 1 + 43a - a2 + 38a - 13a as p + ya + wa*2 and give p. 1 Express 275	{ "pile_set_name": "DM Mathematics" }
788i for i. 4 Solve -8b - 3v + 19 = -7b, -2v + 30 = 5b for b. 4 Solve -4t + 21s = 20s, 0t + 4s = -2t for t. 0 Solve 11w = u + 39, 20 = -4w + 5u + 11 for w. 4 Solve 7c - 5x - 15 = 0, 5x - 7 = c + 8 for c. 5 Solve 0 = -n + 2u - 1, -41u - 21 = -5n - 44u for n. 3 Solve 38x + 3i + 68 = 43x, -60 = -5x + 5i for x. 16 Solve -4 = y, 102d - 105d + 5 = -2y for d. -1 Solve 30j - 2b = 104, 2b = -128j + 127j + 20 for j. 4 Solve 10 = 5y - 5x, y + 3071x + 4 = 3066x for y. 1 Solve -5p = -3x - 24, 23p - 9 = 4x + 24p for x. -3 Solve 24907j = 24903j + 3u - 46, -3j + 4u - 38 = 0 for j. -10 Solve -495t = -2i - 496t - 27, -51 = 3i + 2t for i. -3 Solve u + 5c + 22 = 0, 28 = -10u - 204c + 202c for u. -2 Solve -2c - 4k = 38, 5c = -4k + 260 - 331 for c. -11 Solve 0 = 2l + o - 1, -54l - 22 = -58l + 2o for l. 3 Solve j - 5 = -4, 5j - 33 = 14v for v. -2 Solve -1 = -u, 5c - 91 = 4u - 105 for c. -2 Solve -10 = -5b + 329p - 334p, -8b = 3p + 19 for b. -5 Solve 3c = 2v + 32, 2v + 40 = 4c - 0 for c. 8 Solve c + 631b + 14 = 626b, 3b + 14 = -2c for c. -4 Solve 4y - 4k + 8 = 0, -k - 270 = -3y - 266 for y. 3 Solve -5a = 5m - 30, 379m + 3a - 38 = 381m for m. -4 Solve -h + 6 = 4t, -h + 77t = 72t + 21 for h. -6 Solve 4n + 4s - 8 = 0, 2s - 25 = 16433n - 16438n for n. 7 Solve 3z - 4d = -33, -4z + 96 - 138 = -5d for z. -3 Solve c = -6s - 15, -36s + 40s + 12 = 0 for c. 3 Solve 21p = 5s + 19p + 2, -p = 5s + 14 for s. -2 Solve 72 = 4b + 126 - 70, 5w = -5b for w. -4 Solve 169n - 2j = 167n - 3j + 10, -3j - 42 = -12n for n. 4 Solve 3j + 4y = 61, 82y - 86y = -76 for j. -5 Solve x - 19 = 6g - 46, 2x = -2g + 16 for x. 3 Solve 4a - 2 + 4 = 2w - 2, -2 = -w + 33a for w. 2 Solve o - 26 = -18337g + 18332g, 3g + 2o - 17 = 0 for g. 5 Solve -64s + 35 = 5r, -r + 3s - 57 = -64 for r. 7 Solve 2z + 16 = -3s, -7s + 10s = 4z - 4 for z. -2 Solve -2l + 39 = j + 31, -4j + 18 = l for l. 2 Solve 3c - 3z = -21, 5z = 73c - 78c - 5 for c. -4 Solve 25 = -6j + j, 46w + j = 48w - 9 for w. 2 Solve -3h + 9s = -33, 141s = -2h + 142s + 12 for h. 5 Solve -107o + 98 = -25c - 108o, 4c + 8 = -4o for c. -4 Solve 22i = -5h + 24i + 20, -3h + 12 = 3i for h. 4 Solve 12u + 7u = 24u + h - 21, -4h = -19u + 72 for u. 4 Solve 5x - 4z = 33, 3x = 153z - 154z + 13 for x. 5 Solve -2x + 5q + 20 = 0, x + 4q = -426 + 410 for x. 0 Solve -3n = 2r - 24, 3r = -2n + 248 - 217 for r. 9 Solve -223l - 62 = 50p - 227l, 4p = -4l + 8 for p. -1 Solve 4j = -5p - 16, -122 = -5j - 142 for p. 0 Solve 3d - n = 11, 40553d - 16 = 40555d + 4n for d. 2 Solve 1211m - 1209m - 26 = -2f, 2m - 32 = -5f for m. 11 Solve -2v - y = -2, 38v + 236 = -5y + 330 for v. 3 Solve -2t = 8, 2p + t - 124 = 35t for p. -6 Solve 42 = -g + 5m + 58, -4g = -3m + 4 for g. -4 Solve 5h = 15, 0 = -2226y + 2220y + 5h - 15 for y. 0 Solve -5g - 31 = -2p, 26 = -5g - p + 4 for g. -5 Solve 16 = b - 3l, b = 168l - 170l - 9 for b. 1 Solve -c = -5j + 30, 35 = -5c - 245j + 247j for c. -5 Solve 4p = -4, o = -2p - 149 + 161 for o. 14 Solve 21 = c + 5n, 482c + 54 = 466c - 2n for c. -4 Solve -z - 242n = -241n + 6, -5z - 4n = 30 for z. -6 Solve 100h = 88h + 5a - 5, -a = -1 for h. 0 Solve -3q - 33 = -6w, 854275w + 12 = 3q + 854278w for q. -1 Solve 4i = 4p + 4, p = -1278i + 1281i + 3 for i. -2 Solve -822y + 821y - 5 = 3f, 39 = 3f - 3y for f. 2 Solve -3o + 3 = v - 0, 1 = 46o - 47o for v. 6 Solve -5s + 4k + 4 = 0, -17s = -20s + 2k + 4 for s. 4 Solve 276j - 14 = -6q + 275j, -2j = 20 for q. 4 Solve -2r + 56q - 59q - 23 = 0, 0 = 4r + 5q + 41 for r. -4 Solve -p + 2598 = 2f + 2582, -f + 20 = 2p for f. 4 Solve -3b - 34r = -30r - 31, 2r + 2 = 2b for b. 5 Solve 530g = 2l + 533g - 3, 3l = 4g + 13 for l. 3 Solve -6c - 3l - 15 = 0, 5c - 30 = 2l - 65 for c. -5 Solve 0 = 29k - 3l - 50, 3l = -2k - 9 - 10 for k. 1 Solve -20 = o - 674z + 677z, -4o - 3z - 35 = 0 for o. -5 Solve -41a + 39a = 2i - 2, 3i = 37a - 77 for i. -1 Solve 5k = -25, 9w - 18 = -14w + 21w + 2k for w. 4 Solve -28q = b - 30q + 2, 6 = 2b + q for b. 2 Solve -3r + 5b = -55, 2r + 213b - 211b + 22 = 0 for r. 0 Solve 2n = -15a + 10a + 51, 6n + a + 1 = 0 for n. -2 Solve 1 = 4g - 0g + w, -4g = -w + 1 for g. 0 Solve v = 5k + 3, -5v - k - 55701 = -55716 for v. 3 Solve -3p + 72054 = t + 72040, 0 = -t - 4p + 19 for t. -1 Solve 36 = 10o + 2t, 5o = -5t - 130 + 140 for o. 4 Solve -4k + 3871 - 3864 = -3v, -4v + 5k = 8 for v. 3 Solve -15 = 2h + 3l, -h + 64 = 3l + 76 for h. -3 Solve 5j + 401 = -5a + 376, -4j - 2a = 14 for j. -2 Solve -5t + 11 = -w, 5t - 98 = 4w - 54 for t. 0 Solve -3j + 4 + 2 = 3t, -70 = -34t - t - 3j for t. 2 Solve -4g + 22 = 5o, 0 = 5g + o + 8275 - 8271 for g. -2 Solve -2s = -4 - 2, 77w + 3s - 5s - 296 = 2s for w. 4 Solve 48 = -4b + z, b = -692z + 689z + 1 for b. -11 Solve -7w = -5c + 122, 0 = 4c - 32w + 22w - 80 for c. 30 Solve 1 = -3g + x - 18, -x - 29 = 5g for g. -6 Solve -5t + 45 = -5a, -206t + 208t = -5a - 10 for a. -4 Solve 21z = 19z + 4u - 40, 36 = 3z + 6u for z. -4 Solve -94c = -98c + 6w - 16, -5c - 4w - 43 = 0 for c. -7 Solve 18g + 108 = -5n - 147, -2n = -5g - 81 for g. -15 Solve 0 = -2z + 4l - 4, -3z + 148l - 145l = -6 for z. 6 Solve 48v - v = -v - o - 247, -4v + 4o = -8 for v. -5 Solve 3f = 5c - 22, 667 = -5c - f + 693 for c. 5 Solve 405z - 14 = -i + 402z, 0 = -7i - 4z + 13 for i. -1 Solve 0 = -39d + 36d - 6, 2d = -3w - 10 for w. -2 Solve -4n + 63 - 11 = 2r, -22n + 322 = 2r for n. 15 Solve 5p + 7h + 8 = 3h, 2p - 17h = -15h - 14 for p. -4 Solve -f = -0 - 1, -3f + 13 = 2h + 2f for h. 4 Solve -4o + 8 = -2r, 3r - 291 + 293 = o for r. 0 Solve 16g + 70 = -3u + 19, -5g - 19 = 4u for u. -1 Solve 0 = 2s - 4, 0 = -5z - 133s + 138s for z. 2 Solve -15 = 5y - 5m, 3y - 25 = 8y + 5m for y. -4 Solve 5i + 17 = 4q, q - 4i + 60 - 78 = 0 for q. -2 Solve 181o - 18 = k + 178o, 3o = 12 for k. -6 Solve -j + 3w - 2781 = -2784, -5j + 15 = 4w for j. 3 Solve -4c - 4g + 4 = 0, 2c - 123 + 130 = g for c. -2 Solve s + 6 = -3i, 95 = 4i + 3s + 98 for i. -3 Solve 29 = -2p - 3u, -4p - 6u + 32 + 63 = -17u for p. -1 Solve -2x + 258y - 253y - 19 = 0, -5x = 4y - 2 for x. -2 Solve -5j + 12541 - 12543 = 2m, -4m + 22 = -3j for m. 4 Solve 0 = 2m + 2n - 6, -22973m + 2 = -22970m - 4n for m. 2 Solve 499y - 2s - 18 = 504y, -5y + 3s + 2 = 0 for y. -2 Solve 0 = 21w - 3m + 48, -90w = -89w + 5m + 100 for w. -5 Solve -154y - 3f + 32 = -158y, -f + 29 = -3y for y. -11 Solve -3j + 13 = -4k + 14, -5j + 3 = -2k for j. 1 Solve -a = 4x - 21, 127a + 12 = 2x + 129a for x. 5 Solve 4p + 7u = 43 - 13, u - 6 = -8 for p. 11 Solve 102 = -1429y + 1425y - 5p, 4p + 69 = y for y. -3 Solve 0 = -4k - 5x - 36, 0k + 4k + 3x = -28 for k. -4 Solve -2y - 4 = -2m, -205100y + 205095y = -2m + 13 for y. -3 Solve 5d + 10 - 15 = 0, -5j = -d - 19 for j. 4 Solve 5394 = 5s + 5434, 32 = -2g - 5s for g. 4 Solve -z - h = -15, -153h = 3z - 157h + 67 for z. -1 Solve -k = 2s + 16, 40s + 29 = 39s - 4k for s. -5 Solve -115j = -9z - 110j - 62, 3z = -j - 2 for z. -3 Solve 0 = i - a, -3i - 126a = 3i - 3i - 123a - 12 for i. 2 Solve z - 2z + 66 = 7w, 2z - 3w = -38 for z. -4 Solve -5i - 7a = -14, 15 = -4i - 3a + 34 for i. 7 Solve 0 = 2x + 5f - 47, -13x + 5f + 69 + 199 = 0 for x. 21 Solve n - 7 = -p, -106 = 2p - 2n - 112 for p. 5 Solve 0 = 2r + l - 14, -1831r + 1830r + 15 = l for r. -1 Solve -3n - 5f = -16, 3n - 2f - 3f = -34 for n. -3 Solve -5f + 59 = 6k, -5158k = -5154k + f - 9 for k. -1 Solve 7f + 4v + 43 = 23, 0 = -f + 3v - 10 for f. -4 Solve -5v = 6h - 6h - 5, 60 = -5h - 5v for h. -13 Solve -2d = -2w + 6, 0 = 27d - 28d - 18w + 111 for d. 3 Solve 4d = -5p + 2, -9 = -7p + 7p - 3d for p. -2 Solve -4i - 1 = 3b, 547604 = -5i + 2b + 547643 for i. 5 Solve 0 = -3v - 4j + 21, -679v + 70 = -674v - 5j for v. 11 Solve 3j + j + 36 = -3k, -46 = 5j + 4k for j. -6 Solve 0 = 4s - 4*w + 28, 0 =	{ "pile_set_name": "DM Mathematics" }
0 Which is the closest to 7? (a) -1.282 (b) -2/3 (c) -1 (d) -2/21 d Which is the nearest to -4/9? (a) -2/13 (b) 5 (c) -4925 (d) -4 (e) -0.2 e What is the closest to 1 in -69, 3, -5, 12, 0.4? 0.4 Which is the closest to 58? (a) -10 (b) 4 (c) -1/5 b Which is the closest to -0.79? (a) 320 (b) 0.2 (c) -0.3 c What is the nearest to 1067 in 2, -2, 1/10, -0.1, -2/21? 2 Which is the nearest to 0.221? (a) -2/17 (b) -2 (c) 3/4 a What is the nearest to -1/3 in 14, -5/4, -4/21? -4/21 What is the closest to -0.2 in -0.3, -49/3, -1/7, -3, -2? -1/7 Which is the closest to 0.1? (a) -3 (b) 2509/2 (c) 4 a Which is the nearest to -0.1? (a) 1 (b) -5 (c) -6 (d) 21/340 (e) 2/5 d What is the nearest to -2 in 26921, -4, 8? -4 Which is the nearest to -2? (a) -208 (b) 1 (c) 65 (d) -1/3 d What is the closest to -0.95 in -13, 1/9, -2? -2 Which is the nearest to 2? (a) -4/7 (b) 1/2 (c) 0.9 (d) -0.41 c What is the nearest to 43/5 in -0.5, -0.2, -4/3? -0.2 What is the nearest to 19 in -3/35, -5, 3, -1, -3? 3 What is the closest to 0.06 in -2/19, -0.5, 5, -4/7, 1/4? -2/19 Which is the nearest to 12? (a) -5 (b) -40.5 (c) 5 c Which is the nearest to -6/5? (a) -1/9 (b) 36 (c) 3 a Which is the nearest to -1? (a) -31.3 (b) -82 (c) 8 (d) -4 d What is the nearest to 1 in -3, -1, 112, 21? -1 Which is the closest to 70? (a) -6 (b) 1/5 (c) -2 (d) 5 (e) 0.4 d What is the closest to 122 in 3/7, 3, -1, -5? 3 What is the closest to -1/66 in -1/324, -5, -3? -1/324 Which is the nearest to 2? (a) 8/3 (b) 744 (c) -39 a Which is the nearest to -2? (a) -17 (b) -0.1 (c) -116 b Which is the nearest to 1/3? (a) 1/2 (b) -8 (c) -96/7 a What is the nearest to 0 in 33, 0.2, 1, 0, -4/3? 0 What is the closest to -1/4 in 528/19, 4, -2/9, 2, -0.4? -2/9 What is the nearest to 6 in -3/2, 1/3, 6/5, -4? 6/5 Which is the nearest to -3? (a) 2 (b) -3 (c) -2 b Which is the closest to -2/3? (a) -3 (b) 4/7 (c) 0.7645 (d) 6/5 b Which is the closest to 135? (a) 2/3 (b) 5 (c) 52 (d) -3/7 c What is the nearest to -92 in -0.5, 14, 1, -133? -133 What is the closest to 0.064 in -25, -4, -1? -1 What is the closest to 0.1 in -1/12, 4, -4, 3/7? -1/12 Which is the closest to 0? (a) -1/3 (b) -5 (c) -28637 (d) -2 a Which is the closest to -2/5? (a) -2/51 (b) -3/11 (c) -4 b What is the closest to -2 in -2, 2, -8/7, 9/16, -2/11? -2 What is the closest to -0.1 in 1481, -4/5, 2/11, 1? 2/11 Which is the closest to -1? (a) 1199 (b) -0.5 (c) 2/3 (d) 13 b Which is the nearest to 3? (a) -13 (b) 4 (c) 2/5 (d) 30 (e) 8 b Which is the closest to -0.2? (a) -30 (b) 0 (c) 4/5 (d) 4/7 (e) 2/5 b Which is the nearest to -4? (a) -0.427 (b) -2/3 (c) 4/3 b What is the closest to -11702 in 0.2, -2, 40? -2 What is the nearest to -3/8 in -5680, 0.5, 0.04? 0.04 Which is the nearest to 323? (a) 24 (b) -0.3 (c) 2 a Which is the nearest to -6? (a) 1/3 (b) -3/2 (c) 3/7 (d) 27 b Which is the nearest to -2/5? (a) 0.5 (b) -3 (c) 0.2 (d) 0.11 (e) -231 d Which is the closest to 0.1? (a) 0.08 (b) -0.4 (c) -3 (d) -22 (e) -11.2 a Which is the closest to 1/14? (a) 5 (b) -7/31 (c) 0.1 (d) -2 (e) 0.06 e Which is the nearest to 2/5? (a) 2/5 (b) -0.06 (c) 1/11 (d) 42/13 a Which is the nearest to 9/14? (a) 1/3 (b) 0.15 (c) -1/3 a What is the nearest to -0.032 in -1/3, -1.1, -29? -1/3 Which is the closest to 1.97? (a) -2/3 (b) 2/9 (c) 1/73 (d) -0.1 b What is the nearest to 0 in 0.5, -346/97, 12? 0.5 Which is the nearest to 6/5? (a) 2/5 (b) -5 (c) 6844 a What is the nearest to 3/19 in 6.38, -2/7, 9? -2/7 Which is the closest to 326? (a) -19/2 (b) 4 (c) -2/5 b Which is the nearest to 0? (a) -0.1 (b) -11 (c) 1 (d) -1/2 a Which is the nearest to 22? (a) 2/5 (b) 1/2 (c) -3 (d) -2/11 b What is the closest to -0.2 in -3, 1.28, 0, -27, -1/6? -1/6 What is the nearest to -1 in 5, 3, -86, -784? 3 What is the nearest to 0 in 3, 54, -1, -156? -1 What is the nearest to -0.1 in -6, 405, 1/3, 6, -2/3? 1/3 What is the closest to 6 in -168, -5, 2, 0? 2 What is the closest to -0.2 in -1/3, -5/3, -4/9, -2/5, -3/7? -1/3 What is the nearest to -2 in -5, 1/14, 21/25, 4? 1/14 What is the closest to 1/5 in 4, -57, -0.2, -0.1? -0.1 What is the nearest to 91.33 in -0.07, -0.1, 4/7? 4/7 What is the closest to 0.07 in 5, 4, -61.5? 4 Which is the nearest to 43? (a) -2/19 (b) -5 (c) 0.1 (d) 59 d Which is the closest to 0.13? (a) -1/6 (b) 2/19 (c) 3/52 (d) 2/9 b What is the closest to 0 in -1/7, -0.09, 29, -0.07, 1/2? -0.07 Which is the closest to 3/5? (a) -6/467 (b) -0.02 (c) -4 a Which is the nearest to 0.1? (a) 0.02 (b) 63.81 (c) 0.05 c Which is the closest to 0.1? (a) -0.3 (b) -4 (c) 2/13 (d) 0.126 d What is the nearest to -0.2 in -35, -1/6, -0.038, 2/7, 22? -1/6 Which is the nearest to -0.3? (a) 5 (b) 0.42 (c) -1/6 (d) 3/2 c Which is the nearest to -1.3? (a) -16 (b) 1/2 (c) -1 (d) 0.09 c Which is the closest to -2? (a) -5 (b) 11/6 (c) 652 a What is the closest to 98 in -3/2, -0.4, -4, 2/7? 2/7 What is the nearest to 1 in -217, -0.4, 0.4, -0.09? 0.4 Which is the closest to -0.4? (a) -2/7 (b) -11 (c) -84 (d) 5 (e) -0.5 e What is the closest to 0.2 in 0.9, 19, 7, 0.07, 0? 0.07 Which is the nearest to 3? (a) 0 (b) -1/17 (c) 0.09 (d) -1/4 c What is the nearest to -74 in 12, -2, -48? -48 What is the nearest to -5/239 in -3, 0.4, -5? 0.4 Which is the closest to 18429? (a) -0.3 (b) -0.03 (c) 3 (d) 0.5 c What is the nearest to -92 in -2/17, -0.09, 4? -2/17 Which is the nearest to 1/75? (a) 31/3 (b) -1/4 (c) 1 (d) -2 b What is the closest to -4 in -30, 3/2, -4, -0.3? -4 What is the closest to -3/2 in 0.14, 0.2, 7/16, 3/4? 0.14 Which is the closest to -190? (a) 4/7 (b) -1/4 (c) -3 (d) 2/15 c Which is the nearest to -4? (a) 0.1 (b) 1 (c) -1.4 (d) -345 (e) -10 c What is the nearest to -0.01 in -5, 3, 0.4, -2, -7/9? 0.4 Which is the closest to 8/3? (a) 10 (b) 30 (c) 3 c Which is the nearest to -0.8? (a) 4893 (b) 2 (c) -2/7 c What is the nearest to -2/11 in -0.11, 0.3, -260, 3? -0.11 Which is the nearest to -1? (a) -5 (b) -0.09 (c) -4 (d) -10 b Which is the nearest to 1/3? (a) 1/4 (b) 0.8 (c) -19 (d) -0.2 a Which is the closest to -10? (a) 16 (b) -3 (c) 4.7 b What is the closest to -3/8 in 25, 0.3, 2/73, -0.7? -0.7 What is the closest to 65/11 in 3, -11, 66? 3 Which is the closest to 3/10? (a) -3 (b) 502 (c) -1/7 c Which is the nearest to 7? (a) 5 (b) -1 (c) 2 a What is the nearest to -1 in -717, -2, 0.062? -2 What is the nearest to 6 in 3, 1/2, 56, -4, 4? 4 What is the closest to 5/82 in 2/9, 1, 522? 2/9 What is the nearest to -1296 in -3/2, -5, 1, 0.3? -5 What is the closest to 1.37 in -3, -4, -1, 2/33? 2/33 Which is the closest to -33? (a) 9 (b) 2/7 (c) -2/5 (d) 8 c What is the nearest to 16 in -4, -1.77, 4, -5? 4 Which is the closest to -80? (a) 2 (b) -2/17 (c) -0.051 (d) 1/8 (e) 0.5 b Which is the nearest to -806? (a) -0.11 (b) 4 (c) -3/5 (d) 0.4 (e) -0.3 c Which is the closest to 0.1? (a) -7 (b) 5/6 (c) -1/6 (d) 3 c Which is the closest to -16/29? (a) -0.3 (b) 13 (c) 0.7 (d) -1 (e) -1/4 a Which is the nearest to -3? (a) 0.09 (b) -52 (c) 1 (d) -4 d Which is the closest to -7? (a) -15.97 (b) -1 (c) 13 b What is the closest to -1468 in -0.4, 4, -2/27, 1? -0.4 What is the closest to -0.1 in -2, -1/8, -0.005, 1/81, 1? -1/8 What is the nearest to -14066 in -2/9, 2/3, 2/5? -2/9 Which is the closest to -1? (a) 2/9 (b) 1 (c) 1.36 (d) -2/19 d What is the nearest to -8 in 0, -0.4, -1/554? -0.4 What is the nearest to 4 in 33, 2/3, 6, 35, 0? 6 Which is the nearest to 7? (a) 4 (b) -1 (c) -1/4 (d) 1/3 (e) 0.18 a Which is the closest to -801? (a) 0.05 (b) 17 (c) -2/5 c What is the closest to -3 in -63, 1/4, 0? 0 What is the closest to -0.05 in 68, -0.05, 0.03, 4, 0.3? -0.05 Which is the nearest to 0? (a) 4.5 (b) -59 (c) 2 c Which is the closest to -3? (a) -2/7 (b) 2/5 (c) -2/17 (d) 1/4 a What is the closest to 1 in 6, 0.16, -83? 0.16 What is the nearest to 20/53 in -5, 5, -8? 5 What is the closest to -14/17 in 0, -4, -9, -3, -2/11? -2/11 Which is the nearest to 0? (a) 1/3 (b) 15/2 (c) 3 (d) 2/99 d What is the closest to 4 in 15, 1/10, 1, -28.5? 1 What	{ "pile_set_name": "DM Mathematics" }
c) -1 c What is the nearest to 0.1 in -1, 15/16, 0.4? 0.4 Which is the nearest to -2/55? (a) 2 (b) -8 (c) -2 (d) 0.5 d Which is the nearest to -0.1? (a) 78 (b) -1/9 (c) -4/3 (d) -2 b What is the nearest to 0.4 in 4, 10, -3, -0.5? -0.5 What is the closest to 1 in -1/7, -11, -4/3? -1/7 What is the closest to 4/5 in -2, -1/3, 1? 1 Which is the closest to -0.1? (a) -0.3 (b) 3 (c) 7 (d) 0.12 a What is the nearest to -0.1 in -1/52, -4, 2/7? -1/52 Which is the nearest to 1? (a) 3/2 (b) -1/8 (c) 2/9 (d) -0.15 a Which is the nearest to 0.1? (a) 17 (b) -0.5 (c) -3 b What is the closest to -1/2 in -3, -0.36, -6/7? -0.36 Which is the closest to 0.2? (a) -30 (b) -5 (c) 0 c What is the closest to 0 in 0, -1/2, -0.4? 0 What is the closest to -7 in 22/15, 0.1, -1/3, 0.4? -1/3 Which is the nearest to -0.3? (a) 2/7 (b) -1.5 (c) 3/7 (d) 5 a Which is the nearest to 1? (a) 2/51 (b) -2/15 (c) 0.5 c What is the closest to 0.09 in -5, -250, 1? 1 Which is the closest to -2/3? (a) -0.2 (b) 1 (c) -1/86 a What is the nearest to -9 in 122, 0.5, -2? -2 Which is the closest to -0.6? (a) 1/8 (b) -4 (c) 0.3 (d) 1 a Which is the closest to -0.1? (a) -17 (b) -3 (c) -2/19 c What is the closest to 1 in 0, -4, 0.09, -22? 0.09 Which is the nearest to 1/5? (a) -16 (b) -3 (c) -1 (d) 0.2 d What is the closest to -1/2 in -0.2, -0.33, -1? -0.33 Which is the nearest to 0.1? (a) -35 (b) 5 (c) -2 c Which is the closest to 1/2? (a) 1/3 (b) -45 (c) -0.3 (d) -1 a Which is the nearest to 1/2? (a) -1 (b) 0.2 (c) 4 b Which is the closest to -6? (a) -3/4 (b) -0.1 (c) -2/9 (d) 4/3 a What is the nearest to -2/31 in -9, 0.5, -5, -1? 0.5 Which is the nearest to 1? (a) -191 (b) -2/19 (c) -1 b Which is the closest to -1/8? (a) 0 (b) -0.3 (c) 7 (d) 5 a Which is the closest to -0.2? (a) -25 (b) 2/15 (c) 1 b Which is the closest to -8? (a) 1 (b) -14 (c) -5 c Which is the nearest to 1? (a) -5 (b) 6/5 (c) 5 b Which is the closest to 0? (a) -0.3 (b) 1 (c) -4 a Which is the nearest to 4? (a) 0.3 (b) 1 (c) -0.02 b Which is the closest to -2/7? (a) 0.041 (b) 0.4 (c) 0.2 a What is the closest to 1/4 in -0.1, 5, 170, -2? -0.1 What is the nearest to 0 in 0.5, 5, 114, -2/25? -2/25 Which is the nearest to -2? (a) 0.3 (b) 0 (c) -2 (d) -0.1 c Which is the nearest to -0.1? (a) -3/4 (b) 1 (c) 3/4 (d) 23 a Which is the closest to -10? (a) 3 (b) -0.4 (c) -0.5 (d) 1 c What is the nearest to 1/4 in 3, -2/9, 1/15, -177? 1/15 Which is the nearest to -38/15? (a) 2/3 (b) -0.1 (c) 0.5 (d) -3 d Which is the nearest to -220? (a) 0.3 (b) -0.5 (c) 0.1 b Which is the nearest to -1? (a) -73/4 (b) 0.5 (c) 3/4 (d) 0.3 d What is the closest to 0 in -1.6, 0.5, 0.3? 0.3 Which is the nearest to 0? (a) 1/3 (b) 30 (c) 0.1 c What is the nearest to 20 in -0.3, -3, -6, 4/7? 4/7 What is the nearest to 1.2 in -0.06, 0.3, -2/7? 0.3 What is the closest to 0.1 in 4, 0.14, 3, -0.2? 0.14 Which is the closest to 1/3? (a) 3 (b) -0.1 (c) 2 b Which is the nearest to -0.1? (a) -1/7 (b) -4/3 (c) 2 (d) 0.08 a What is the closest to -3/2 in 1/8, -1, 0.1, -3/49? -1 What is the nearest to 0.1 in 110, 1, 4, 0.7? 0.7 What is the closest to -2/3 in -26/5, 1.4, -1/3? -1/3 Which is the nearest to 123? (a) -2/11 (b) -0.4 (c) -1 (d) -2 a Which is the nearest to 0? (a) 0.1 (b) 2/5 (c) -3 (d) 4 a Which is the closest to 3/5? (a) 0.2 (b) -9 (c) 5/6 c What is the closest to 1 in 240/47, 3, 1? 1 Which is the nearest to -0.1? (a) 6 (b) 0 (c) -51 b What is the nearest to -71 in -0.9, 2, 5? -0.9 Which is the nearest to 0? (a) -1/7 (b) -4 (c) 1/186 c Which is the closest to -2/7? (a) -157 (b) -0.2 (c) 0.4 b What is the nearest to 2/5 in -1/2, 2/21, 3/13? 3/13 Which is the closest to 1? (a) 1/4 (b) 4/5 (c) -64 b Which is the nearest to 0.16? (a) -4 (b) 1/9 (c) 9 b Which is the nearest to -0.1? (a) -4 (b) -1 (c) 433 b Which is the closest to -2/7? (a) 25 (b) -0.2 (c) 0 (d) -20 b What is the nearest to 61 in 1, -0.1, 1/13? 1 Which is the nearest to -1? (a) -4 (b) -0.1 (c) 6 b What is the closest to -2/5 in -5, 3, -2/7, 2? -2/7 Which is the nearest to -0.6? (a) -3/2 (b) -5/2 (c) 3 (d) -0.06 d What is the closest to 2 in 0.2, 22, 5/2? 5/2 What is the nearest to -2/5 in 6/11, -0.2, 1, -0.15? -0.2 Which is the nearest to -4? (a) 0 (b) -0.5 (c) 0.39 b Which is the nearest to 0? (a) 1/4 (b) 1/3 (c) -5 a Which is the closest to -4? (a) 1/4 (b) 24 (c) -0.2 c Which is the closest to 0.1? (a) 6.7 (b) 0.2 (c) 3 (d) 4 b What is the closest to 1 in -0.2, -3/4, -1/7, 1? 1 What is the closest to -1 in 0.2, -1, 0.1, 0.444? -1 Which is the nearest to -1? (a) -3/2 (b) 0.3 (c) -0.1 (d) -4 a Which is the nearest to 0.1? (a) 0.3 (b) 1/89 (c) -20 b Which is the nearest to -1/6? (a) -0.3 (b) 0.4 (c) 0.2 (d) -0.6 a What is the closest to 9/7 in -1, -3, 2/5, 0.1? 2/5 Which is the nearest to -1? (a) -5 (b) -0.02 (c) 5/6 (d) 1 b What is the nearest to -5/38 in 2, -3, 0.13? 0.13 What is the closest to -1 in 0.1, -7, 0, 4? 0 What is the closest to 4 in -2, -83, 3/7, -1? 3/7 What is the closest to 0 in 0.4, -34, 1, 0? 0 What is the nearest to -1 in -2/19, -1, 1/16? -1 Which is the nearest to 0.1? (a) 10 (b) -0.03 (c) -2/9 (d) 1/2 b Which is the nearest to -0.1? (a) -3 (b) 0 (c) -5 (d) -1/3 b Which is the nearest to 0? (a) 12 (b) -2 (c) -4 (d) 1/3 d What is the nearest to 1/2 in -0.25, 0.1, -31? 0.1 Which is the closest to 0? (a) -2/3 (b) 4 (c) 0.3 (d) 2/1803 d What is the closest to -6 in 1/8, -0.2, 0.06? -0.2 Which is the nearest to -20? (a) 0.1 (b) 4 (c) 2/3 a What is the closest to 2 in 0.2, 1/28, 0.06, -1? 0.2 Which is the closest to -3? (a) -4 (b) -2/3 (c) -1/11 (d) 0.1 a What is the nearest to -1 in 0.02, 2/3, 5, -2? -2 Which is the nearest to -1? (a) 0.2 (b) 5 (c) 0.3 (d) 3 a What is the closest to -3 in 3, -1/2, 5? -1/2 What is the closest to 0 in 0.5, 0, -5? 0 Which is the nearest to -1? (a) 4/3 (b) -58 (c) -4 a Which is the closest to -44? (a) -4 (b) 4 (c) -2 (d) -0.09 a What is the closest to 0.1 in -0.5, 0.2, 0.3, 4? 0.2 What is the nearest to -1/3 in -17, 22, 2? 2 What is the closest to 9 in -4, 2/11, 1/6? 2/11 Which is the closest to -3.5? (a) 0 (b) -17 (c) 0.01 a What is the nearest to -0.2 in -4, 0.1, 0.15? 0.1 What is the nearest to -2 in 8, 0.5, 0.04? 0.04 What is the closest to 2/9 in 0.1, 4, 1? 0.1 Which is the closest to 1? (a) -0.4 (b) 7 (c) -24 a What is the nearest to -3 in -1/3, -7, 5? -1/3 Which is the nearest to -3/8? (a) 0.5 (b) -1 (c) 4/7 (d) -1/5 d Which is the closest to -0.1? (a) -4 (b) 361 (c) 0 c What is the nearest to -2/5 in 3, 10/3, 0.2, -91? 0.2 Which is the nearest to 1? (a) -2 (b) -4 (c) -0.07 (d) 1 d Which is the closest to 2/9? (a) -2 (b) -2/11 (c) -7 b Which is the nearest to 4/11? (a) 5 (b) -2.104 (c) 0 c Which is the nearest to -2? (a) 3 (b) -2/7 (c) 9 (d) 11 b Which is the nearest to 1.4? (a) -4 (b) -0.4 (c) -13 b Which is the closest to 2/5? (a) 1 (b) 12/7 (c) 2 (d) -2 a Which is the nearest to -1/6? (a) 4/3 (b) 4 (c) 2/5 c What is the closest to -30 in 0.2, -3/8, 0, -3? -3 What is the nearest to 0 in -3, 2, -5, 0.4? 0.4 What is the nearest to 2 in -0.35, 1/3, 1/9? 1/3 What is the closest to -1 in -1.2, 44, 3, 2/3? -1.2 What is the nearest to -0.1 in -32, 1/3, 0.04? 0.04 What is the closest to 1 in 0.3, -1/6, 2/17? 0.3 What is the closest to 1 in -1, 0.04, 2, 4? 0.04 What is the nearest to -1/3 in -4, 4, -3/2, -2? -3/2 Which is the nearest to 0? (a) -0.3 (b) 5 (c) -9/5 a What is the closest to 1/4 in -0.2, 2/3, 5? 2/3 What is the closest to -0.2 in -2/3, 3, -2/77, -5? -2/77 Which is the closest to -1? (a) 0.5 (b) 1 (c) -1 (d) 1.489 c Which is the nearest to 1? (a) 0.03 (b) 4 (c) 2/9 c Which is the nearest to 1/4? (a) 0.5 (b) 1/588 (c) 0.1 c What is the nearest to 0.1 in -12, 1/6, -0.2? 1/6 What is the closest to 0.6 in -0.3, -1/2, 12? -0.3 Which is the closest to -1? (a) 15 (b) -0.1 (c) -6/5 (d) 0.3 c Which is the nearest to -2? (a) 0.1 (b) 5 (c) -0.7 (d) -3/7 c What is the nearest to 0.3 in -2, -1/8, -5, -2/7? -1/8 What is the nearest to 1.7 in -2, -5, 27, -0.02? -0.02 Which is the closes	{ "pile_set_name": "DM Mathematics" }
on multiple of o and 7? 56 Let c = 887 + 3961. Calculate the least common multiple of c and 16. 4848 Let x = 2123/40 - 523/8. Calculate the common denominator of x and -71/10. 10 Suppose -5m + 21 + 14 = 0. Let i be m/2 + 18/36. Suppose -in - 2r + 63 + 45 = 0, -n = -3r - 34. What is the least common multiple of n and 6? 84 Let f = 6255 - 450365/72. Let y = -3307/4 + 847. Calculate the common denominator of y and f. 72 Find the common denominator of -87/28 and 3433/(-4560) - -2 - 136/102. 10640 Let w = -76301/15 + 5087. Calculate the common denominator of 101/1554 and w. 7770 Suppose -9b + 5b + 2260 = 2m, 0 = -3b - 15. Suppose -z - 4z = -m. Calculate the lowest common multiple of 33 and z. 2508 What is the common denominator of (-17 - 4347/(-147))/((-60)/(-14)) and ((-1)/(-12))/(1/(-166))? 30 Suppose 112n - 108n + 2h - 1270 = 0, 0 = -4n - 3h + 1265. Calculate the lowest common multiple of n and 200. 1600 Let u = 46 + -65. Let f = -25 - u. Let p(o) = -7o - 38. What is the least common multiple of p(f) and 32? 32 Suppose 0 = -2q + 42q - 9280. What is the lowest common multiple of 8 and q? 232 Let q = 15690/11 + -1422. Suppose 10 = 3m + 2g, -3m + 2 = -2g - 0. Find the common denominator of (-1)/(3/m) + (-75)/10 and q. 66 Suppose -5b = -4o - 96, -6o + 24 = 2b - 10o. Calculate the lowest common multiple of 36 and b. 72 Suppose 21s = 20s - 48. Let g = s - -59. Suppose -35 = -6v - g. Calculate the smallest common multiple of v and 16. 16 Let n = -36952 - -2327938/63. Find the common denominator of -81/8855 and n. 79695 Let k = -23/132 + 1/11. Let w = -296975/12 - -24760. Calculate the common denominator of k and w. 12 Let b(t) = t3 - 16t*2 + 14t - 3. Let r be b(15). What is the common denominator of (-1 - -9)/4 + (-153)/150 and 4/r - (-2706)/108? 150 Suppose 165z = 167z - 3c - 4, -4c + 16 = 0. What is the lowest common multiple of 288 and z? 288 What is the common denominator of 55/6 and (730/230972)/(15)? 4746 Let a = -2129/12 - -176. Find the common denominator of a and (-43)/4 + 7/(-42). 12 Suppose -2y + f - 29 = -6y, -5f = -25. What is the smallest common multiple of 108 and y? 108 Suppose -2y = 3r - 332, 4r + 4y - 76 = 372. What is the least common multiple of r and 900? 2700 Let x be 2/(-20) - 74472/80. Let g = 92171/99 + x. Calculate the common denominator of -43/55 and g. 495 Let p = 3287/747 + -24/83. Find the common denominator of ((-2054)/234)/((-5)/(-45)(-294)/14) and p. 63 Suppose 256 - 216 = 2g. What is the common denominator of 49/11 and (g/(-66))/(((-1518)/9)/23)? 121 Let d be 2/(-1)2 - (32 - 1042). Let m = d - 73437/73. What is the common denominator of m and -12/11? 803 Let f = 426 - 435. Let z(u) = u2 - 3u - 75. Calculate the least common multiple of z(f) and 27. 297 Let u be 36 - (4 + -13 + 7). Suppose 322v - 321v - u = 0. What is the lowest common multiple of 4 and v? 76 Let i be 22 - -1(-20)/5. Let o = 0 + i. Suppose -b = -2m + 22 + o, 88 = 4m - 4b. What is the least common multiple of m and 9? 18 Let a(d) be the second derivative of 6d3 + 15d*2 + 16d. Let l be a(10). Find the common denominator of 55/34 and -1 + 1 + l/84. 238 Let z = 279 - 174. Find the common denominator of (z/(-450))/(2/6) and -109/6. 30 Let d be 5/306 - -2528. Let n = 58142/23 - d. Calculate the common denominator of n and 49/11. 253 Suppose 160o - 229 = 155o + 3c, -4o = -2c - 182. Calculate the lowest common multiple of 284 and o. 3124 Suppose 3c + 4q + 46 = 158, 0 = -5c + 3q + 206. Calculate the lowest common multiple of 96 and c. 480 Let g be (-2)/9 + (-31484)/(-9). Let c = 2311 - g. Let v = c + 2309/2. What is the common denominator of v and 41/22? 22 Suppose -3n = -3k + k + 1507, -4k - 4n = -2984. What is the common denominator of (k/28)/((-5)/(-2)) and 442/260 - (-5 - 1)? 10 Suppose -74x + 34044 = 5036. What is the least common multiple of x and 80? 3920 Suppose -2y + 7n + 236 = 11n, -4n + 566 = 5y. Suppose -2a + 146 = -5g, 2a - g - 28 - y = 0. Calculate the smallest common multiple of 64 and a. 1088 Let u = -642100/3627813 + 380/2553. Calculate the common denominator of -31/1827 and u. 12789 Let d = 79143/21905 + 4/1685. Suppose -48 = 938i - 932i. What is the common denominator of d and ((-154)/5(-70)/(-28))/i? 104 What is the least common multiple of 1358 and ((-1)/6-9)/((-18)/(-8148))? 1358 Calculate the common denominator of (-380)/48 + 3 + (3 - 6) and (-40)/(-48)1(-102)/(-28). 84 Let p be (-3 - 4/(-1))/((-3)/(-12)). Suppose -pd = 2i - 554, 4i = -4d + 204 + 356. Calculate the smallest common multiple of 2 and d. 274 Let h be 330/24(-112)/(-18). Let z = -13239/19 - -269557/342. Let f = z - h. What is the common denominator of 99/8 and f? 24 Let t(l) = l*3 - 20l*2 + 38l + 19. Suppose 33 = -2y + 69. Calculate the lowest common multiple of t(y) and 25. 275 Suppose 13t + 47 = 73. What is the common denominator of 103/536 and (213/(-18))/(t - (-6 - -6))? 1608 Let j(p) = -p*3 - 9p*2 + 34p + 336. What is the least common multiple of 36 and j(-10)? 288 Suppose -135009 = -100v + 79v. Calculate the smallest common multiple of 21 and v. 45003 Suppose -3s = 4z + s, 4z = -s + 9. Calculate the common denominator of (-22)/(-143)32/(-3 - -1) and -3 + z/(-24)142. 52 Suppose w - 547 = -4w + h, h = -2. Suppose 44d - 120d = -228. Suppose dq = -5o - 4 + w, o - 5q = -7. Calculate the smallest common multiple of 4 and o. 36 Calculate the common denominator of -6 - ((-13515)/4600 + 2/(-23)) and 71/10. 40 Find the common denominator of 86/375 and (-2(-9)/(-150))/(168/4305). 3000 Let v = 6 - 0. Let l(n) = -n*3 + 7n*2 - 4n - 4. Suppose t = k - 7, -4k - 4t + 118 = 122. What is the smallest common multiple of l(v) and k? 24 Suppose -w + 5k - 28 = -2w, 0 = -w - 4k + 32. What is the lowest common multiple of 72 and w? 144 Let l = 203830/13 - 459433665/29302. What is the common denominator of 115/14 and l? 2254 Suppose -15 = -3z, -4z - 16 - 24 = -4k. Suppose 3r - k = 4r. What is the common denominator of 73/8 and (-3)/(r/(-10)) - (-39)/34? 136 Let i be 3/5(19 + 5 + -4). Let k be 0 + (-2 + 26)/4. Let l = i + k. Calculate the lowest common multiple of 8 and l. 72 Let d = 16491 + -15161. What is the lowest common multiple of d and 224? 21280 Let b = 12957 - 12807. Calculate the least common multiple of 2400 and b. 2400 Suppose -12o - 202 = -2722. What is the lowest common multiple of o and 58? 6090 Find the common denominator of ((-6)/(-231))/(42/1281) and 32/203. 2233 Suppose 3s + 9 = 0, -2t = 3t - 3s - 484. Suppose 25 = 2v + 5b, -5v = -5b + 2b - 109. Calculate the least common multiple of t and v. 380 Calculate the common denominator of -71/300 and ((-215984)/21600 + 10)/(2/344). 2700 Suppose 2045 = 105y + 470. Suppose 0 = -3o + 4s - s - 789, 3s + 807 = -3o. Calculate the lowest common multiple of y and 4/30 - o/30. 45 Calculate the smallest common multiple of (-51 + 58)/((3/(-63))/(-1)) and 252. 1764 Let l = -591 - -621. Let s = 56 - 50. What is the smallest common multiple of s and l? 30 What is the common denominator of (-2)/(-8)41736/5859 + -1 and 83/4774? 14322 Let k(f) = -11f2 + 7f - 8. Let l be k(5). What is the smallest common multiple of ((-45)/2)/(124/l) and 33? 495 Suppose 5o + 25 = 5. Let q = 41299/18 - 2293. What is the common denominator of q and o/(-34) + (-1323)/(-170)? 90 Let n be 9560/15(-3)/(-1). Suppose 0 = 2w - 5h + n, -5h = -4w - 3801 - 3. Let a = 7655/8 + w. Calculate the common denominator of a and -103/12. 24 Suppose 5r + p = 4670, -20p - 925 = -r - 22p. What is the least common multiple of r and 340? 3740 Suppose 3o + 16458 - 48027 = 0. Let l = o + -284197/27. What is the common denominator of 85/63 and l? 189 Suppose -17489 = -339n + 38694 + 49585. Calculate the least common multiple of 312 and n. 312 Suppose 7398 = -9p - 4437. What is the common denominator of p/(-945) + (12/21)/1 and -125/138? 1242 Suppose 3z + 12387 = -0z. Let u = z - -82543/20. Let l = 5923/7 - 850. Find the common denominator of l and u. 140 What is the common denominator of 192/15408*(-9)/6 and -69/4? 428 Let d = -197593805 - -754380719. Let n = 3724904443013/6690 - d. Let u = 24/223 + n. Calculate the common d	{ "pile_set_name": "DM Mathematics" }
. 6 Calculate the remainder when 240245 is divided by 6861. 110 What is the remainder when 70853 is divided by 6349? 1014 Calculate the remainder when 51645762 is divided by 51645760. 2 What is the remainder when 212264848 is divided by 21? 19 Calculate the remainder when 55816872 is divided by 3928. 3920 What is the remainder when 47604 is divided by 47458? 146 Calculate the remainder when 7098475 is divided by 292. 247 Calculate the remainder when 40689 is divided by 7241. 4484 Calculate the remainder when 2149859 is divided by 1082. 1007 What is the remainder when 13960156 is divided by 10608? 28 What is the remainder when 5887575 is divided by 126? 99 Calculate the remainder when 218151 is divided by 96. 39 Calculate the remainder when 753178 is divided by 882. 832 What is the remainder when 2653404 is divided by 663330? 84 What is the remainder when 48948906 is divided by 22? 6 Calculate the remainder when 47555 is divided by 1211. 326 What is the remainder when 681495 is divided by 58? 53 Calculate the remainder when 1112 is divided by 856. 256 What is the remainder when 6055184 is divided by 3034? 2354 Calculate the remainder when 44670959 is divided by 1363. 1360 What is the remainder when 226492 is divided by 14153? 44 Calculate the remainder when 398544 is divided by 5109. 42 Calculate the remainder when 185437 is divided by 724. 93 What is the remainder when 1674988 is divided by 334962? 178 Calculate the remainder when 33118858 is divided by 156221. 6 Calculate the remainder when 429232 is divided by 20277. 3415 What is the remainder when 3926473 is divided by 42220? 13 What is the remainder when 36103596 is divided by 1048? 1044 What is the remainder when 107539 is divided by 107528? 11 What is the remainder when 2568895 is divided by 856046? 757 Calculate the remainder when 27529832 is divided by 497. 8 Calculate the remainder when 574822 is divided by 22072. 950 Calculate the remainder when 78351 is divided by 301. 91 Calculate the remainder when 434660 is divided by 35821. 4808 Calculate the remainder when 9853746 is divided by 22. 12 What is the remainder when 36194900 is divided by 72? 68 Calculate the remainder when 321109 is divided by 480. 469 What is the remainder when 35788 is divided by 1531? 575 Calculate the remainder when 81295371 is divided by 5440. 11 What is the remainder when 49630 is divided by 24806? 18 Calculate the remainder when 14892112 is divided by 9534. 4 What is the remainder when 368853 is divided by 92161? 209 What is the remainder when 30648060 is divided by 128? 124 Calculate the remainder when 8295257 is divided by 5234. 4601 What is the remainder when 349158 is divided by 116385? 3 Calculate the remainder when 1233245 is divided by 346. 101 Calculate the remainder when 1140170750 is divided by 128. 126 What is the remainder when 219649 is divided by 38? 9 What is the remainder when 10267688 is divided by 12? 8 Calculate the remainder when 45924089 is divided by 205. 194 Calculate the remainder when 997239 is divided by 2059. 683 What is the remainder when 585721 is divided by 254? 251 What is the remainder when 205459 is divided by 575? 184 What is the remainder when 1700798 is divided by 1700657? 141 Calculate the remainder when 1000429 is divided by 499240. 1949 Calculate the remainder when 690120 is divided by 10297. 221 What is the remainder when 6658442 is divided by 133? 63 What is the remainder when 149171903 is divided by 46? 21 Calculate the remainder when 15291524 is divided by 53. 17 Calculate the remainder when 1434042 is divided by 1433890. 152 Calculate the remainder when 19016786 is divided by 190. 66 What is the remainder when 90463 is divided by 21? 16 What is the remainder when 1110452 is divided by 787? 782 Calculate the remainder when 538000 is divided by 617. 593 What is the remainder when 45008 is divided by 21840? 1328 What is the remainder when 4790650 is divided by 88? 18 What is the remainder when 223033 is divided by 345? 163 Calculate the remainder when 127772 is divided by 114813. 12959 What is the remainder when 230612 is divided by 23053? 82 Calculate the remainder when 2212642 is divided by 1896. 10 What is the remainder when 3431942 is divided by 1715951? 40 What is the remainder when 52161 is divided by 2869? 519 What is the remainder when 10455 is divided by 2284? 1319 What is the remainder when 7685083 is divided by 3405? 3403 What is the remainder when 2545292 is divided by 48? 44 What is the remainder when 1072683 is divided by 3739? 3329 What is the remainder when 26545 is divided by 5619? 4069 What is the remainder when 6206596 is divided by 172404? 52 What is the remainder when 441830 is divided by 63118? 4 What is the remainder when 1801629 is divided by 649? 5 Calculate the remainder when 21216 is divided by 2918. 790 Calculate the remainder when 140096 is divided by 193. 171 Calculate the remainder when 92805 is divided by 92779. 26 What is the remainder when 117098489 is divided by 1198? 1177 What is the remainder when 3152511 is divided by 7281? 7119 What is the remainder when 1169490 is divided by 2576? 2562 What is the remainder when 157830 is divided by 1834? 106 Calculate the remainder when 52864 is divided by 265. 129 Calculate the remainder when 203634 is divided by 6557. 367 Calculate the remainder when 31467949 is divided by 369. 367 What is the remainder when 6239 is divided by 1652? 1283 What is the remainder when 164806 is divided by 455? 96 Calculate the remainder when 34106031 is divided by 108. 63 Calculate the remainder when 1956082 is divided by 2687. 2633 What is the remainder when 237089 is divided by 7407? 65 Calculate the remainder when 6960265 is divided by 3480124. 17 What is the remainder when 698509228 is divided by 23? 10 Calculate the remainder when 256009 is divided by 85329. 22 Calculate the remainder when 2903512 is divided by 362937. 16 What is the remainder when 31195774 is divided by 18? 10 Calculate the remainder when 22731 is divided by 7331. 738 What is the remainder when 503047 is divided by 95? 22 What is the remainder when 76175 is divided by 343? 29 Calculate the remainder when 345660 is divided by 7506. 384 Calculate the remainder when 7079031 is divided by 80. 71 What is the remainder when 562976 is divided by 6621? 191 Calculate the remainder when 24726 is divided by 1999. 738 What is the remainder when 11854559 is divided by 27? 20 What is the remainder when 109607359 is divided by 54803674? 11 Calculate the remainder when 181907 is divided by 172. 103 What is the remainder when 5462475 is divided by 914? 411 Calculate the remainder when 1219472 is divided by 955. 892 What is the remainder when 253751 is divided by 569? 546 Calculate the remainder when 5145647 is divided by 1715204. 35 What is the remainder when 16544725 is divided by 1872? 1861 What is the remainder when 105825687 is divided by 162? 159 What is the remainder when 5490669 is divided by 5490668? 1 Calculate the remainder when 2175980 is divided by 1244. 224 What is the remainder when 780788 is divided by 60058? 34 What is the remainder when 3698326 is divided by 21? 16 Calculate the remainder when 235753 is divided by 186. 91 What is the remainder when 7455522 is divided by 21? 18 What is the remainder when 102696 is divided by 826? 272 What is the remainder when 633579 is divided by 211151? 126 What is the remainder when 78270 is divided by 5869? 1973 What is the remainder when 2758276 is divided by 3315? 196 What is the remainder when 18581466 is divided by 19? 17 What is the remainder when 19148713 is divided by 19148705? 8 Calculate the remainder when 1029026 is divided by 257156. 402 What is the remainder when 77747 is divided by 10303? 5626 What is the remainder when 791942 is divided by 1117? 1106 Calculate the remainder when 187270 is divided by 75. 70 What is the remainder when 358647 is divided by 549? 150 Calculate the remainder when 31421044 is divided by 599. 499 What is the remainder when 4835226 is divided by 581? 144 What is the remainder when 94127935 is divided by 1304? 1303 Calculate the remainder when 11599583 is divided by 2494. 2483 Calculate the remainder when 5126665 is divided by 656. 25 What is the remainder when	{ "pile_set_name": "DM Mathematics" }
d Collect the terms in 339b*3 + 395b*3 + 2870b*3 + 24b*2 - 9b*2 - 12b*2. 3604b*3 + 3b*2 Collect the terms in -157o*3 - 96o*3 + 2o*2 + 494o*3 - 167o*3. 74o*3 + 2o*2 Collect the terms in -484h*3 - 65h + 231h3 + 222h*3. -31h*3 - 65h Collect the terms in 4 - 6 - 12q2 + 202q*2 + 100q*2 + 2. 290q*2 Collect the terms in 2 - 3 - 3 + 182371o - 182356o + 4. 15o Collect the terms in 1161d3 + 1116d*2 - 1140d*2 + 707d*3 - 630d*3. 1238d*3 - 24d*2 Collect the terms in -3t + 1742930t2 + 4 - 4 - 1742220t*2. 710t*2 - 3t Collect the terms in 12456r3 - 4215r*3 - 4125r*3 - 4103r*3. 13r*3 Collect the terms in -10191z - 10560z - 10185z + 14z2 + 30936z. 14z2 Collect the terms in -12408b - 2b2 - 12395b - b*2 - 12250b + 37053b. -3b*2 Collect the terms in -90522 - 90517 + 13t + 181044. 13t + 5 Collect the terms in 66087 - 4454j*2 - 33046 - 33039. -4454j*2 + 2 Collect the terms in 63y*2 - 1 + 138y*3 - 279y*3 + 43y*2 + 129y*3. -12y*3 + 106y*2 - 1 Collect the terms in -2226107h + 4451904h - 2226055h. -258h Collect the terms in 1470l*3 - 4402l*3 + 1464l*3 + 1461l*3. -7l*3 Collect the terms in 607o*3 + 831o*2 - 1832o*3 - 831o*2 + 616o*3 + 623o*3. 14o*3 Collect the terms in 1863676a + 15 - 14 - 1863674a + 71a*2. 71a*2 + 2a + 1 Collect the terms in -1 - 75 + 84 - 1 - 5 - 2 - y. -y Collect the terms in -501z - 45 + 58 - 52 + 477z. -24z - 39 Collect the terms in 5317s*3 + 170 + 17565s*3 + 2s + 3585s3 - 172 - 5794s*3. 20673s*3 + 2s - 2 Collect the terms in -34k + 8k + 18k + 1 - 51k*2 + 6k + 11k. -51k*2 + 9k + 1 Collect the terms in -171g2 - 186g*2 - 102 + 373g*2. 16g*2 - 102 Collect the terms in -46 - 2761g + 2899g + 22815g + 13467g + 48. 36420g + 2 Collect the terms in 87b3 + 1534b*3 - 1761b*3. -140b*3 Collect the terms in -90207x*2 - 90308x*2 + 180517x*2. 2x2 Collect the terms in a3 - 28a - 26a + 4a3 - 7a*2 - 5a*2 + 17a. 5a3 - 12a*2 - 37a Collect the terms in 23k + 354 + 24k - 67 + 19k - 67k. -k + 287 Collect the terms in 1937m - 7372m - 3900m. -9335m Collect the terms in 35685i2 - 20228i*2 - 15462i*2. -5i*2 Collect the terms in -197c + 154c + 450c + 423c - 64c. 766c Collect the terms in 102n - 139n2 + 138n*2 - 102n - 356. -n*2 - 356 Collect the terms in 4 - 52372z + 467z2 + 52372z. 467z2 + 4 Collect the terms in -18h*3 + 93h*2 + 613h*3 + 73h*2 - 166h*2. 595h*3 Collect the terms in -233 - 186 + 244k*2 + 420 - 4k*3. -4k*3 + 244k*2 + 1 Collect the terms in 74c + 80c + 63c + 76c + 81c - 370c. 4c Collect the terms in -2 - 2589h + 4901h - 2475h. -163h - 2 Collect the terms in -20106t2 - 20108t*2 - 20028t*2 - 20101t*2 + 80344t2. t2 Collect the terms in 33x - 39x - 103x + 116x. 7x Collect the terms in 5i*3 + 340i + 2i3 + 231i - 915i + 0i*3 + 344i. 7i3 Collect the terms in -700 - 621 + 1995 - 674 + 5q - 4q. q Collect the terms in -2 - 664u*3 + 326u*3 + 387u*3 + 2. 49u*3 Collect the terms in -139x*3 + 1005x - 309x3 - 504x - 501x. -448x*3 Collect the terms in 33c*2 - 66 - 88c + 62 + 88c - 27c*2. 6c*2 - 4 Collect the terms in -62n*2 - 244n*3 + 5 - 5 - 19n*2 - 14n*2 + 99n*2. -244n*3 + 4n*2 Collect the terms in -13 - 3 + 8 + 5 - 3 + 163r. 163r - 6 Collect the terms in 4383o3 + o2 - 6721o3 + 2264o3 - o2. -74o3 Collect the terms in -34t - 103 + 80 + 14t. -20t - 23 Collect the terms in 558p2 - 5p - 40 + 4p + 4. 558p*2 - p - 36 Collect the terms in -27j*2 + 185j3 - j2 - 181j3. 4j*3 - 28j*2 Collect the terms in 251z - 251z - 1137958z*2. -1137958z*2 Collect the terms in -31013m + 21 + 31094m - 21. 81m Collect the terms in 6292235q3 + 6292224q*3 - 12584518q*3. -59q*3 Collect the terms in -20q*3 + 1811 + 1606 - 5017 + 1600. -20q*3 Collect the terms in -4t - 327 + 16953390375t3 + 29 - 16953390376t3. -t3 - 4t - 298 Collect the terms in 175f + 144f3 - 140f - 143f3 - 33f. f*3 + 2f Collect the terms in 506p3 - 1714p*3 - 1550p*3 - 2p + 3p. -2758p*3 + p Collect the terms in -5674d*3 + 22642d*3 - 5659d*3 - 5652d*3 - 5660d*3. -3d*3 Collect the terms in 15 - 11272i*3 - 50i*2 + 47i*2 - 15. -11272i*3 - 3i*2 Collect the terms in 75y*2 + 11y - 622 + 309 - 14y + 8y + 313. 75y2 + 5y Collect the terms in 25739t - 1176t + 14119t. 38682t Collect the terms in 88725k2 + 2 + 4 - 6. 88725k*2 Collect the terms in 474u + 461u + 401u - 107u + 145u. 1374u Collect the terms in -166k3 + k2 - 12159 + 96k3 + 72k*3. 2k3 + k2 - 12159 Collect the terms in 908664558 + 153u - 908664558. 153u Collect the terms in -2g3 - 23950 + 47683 - 25g*2 - 23945. -2g*3 - 25g*2 - 212 Collect the terms in -457u + 10534u + 252330u. 262407u Collect the terms in -35 + 6 + 10 - 16s*3 + 19 - 242s*2. -16s*3 - 242s*2 Collect the terms in -827 + 6w + 1149 - 834 - 5w - 834 + 1346. w Collect the terms in -436642698846l + 24l2 + 436642698846l. 24l2 Collect the terms in 18204 + 11832z*2 + 0z + 0z - 18204. 11832z*2 Collect the terms in 26f + 35f - 406 - 22f. 39f - 406 Collect the terms in -17 - 19 + 5360r + 36 + 5508r - 10865r. 3r Collect the terms in 7572r*3 - 3815r*3 - 3807r*3. -50r*3 Collect the terms in -7790t - 186t3 - 106t*3 + 60t*3 + 7792t. -232t3 + 2t Collect the terms in -83200s2 - 22865s + 22865s. -83200s*2 Collect the terms in -256y*3 - 70y3 + y3 - 255y3. -580y*3 Collect the terms in -2019p + 25 + 50 + 136p. -1883p + 75 Collect the terms in -97i + 27i - 4 + 26i + 38i + 29i. 23i - 4 Collect the terms in -w - 24659w3 + 24510w*3 + 0w. -149w3 - w Collect the terms in -9d*3 + 17 - 5d*3 + 0 - 376d + 374d + 28d*3 + 38d*3. 52d*3 - 2d + 17 Collect the terms in -5175w - 2w*2 - 1603396 + 1603396 - 10w*3 + 5175w. -10w3 - 2w*2 Collect the terms in -18360141480u*2 + 3 - 3 - 34u + 34u + 18360141481u2. u2 Collect the terms in 62h2 - 29h*2 + 24598 - 3h - 33h2 - 9h*3 - 24598. -9h*3 - 3h Collect the terms in 72r2 - 70 - 54 + 175 - 51 - r2. 71r*2 Collect the terms in -u + 2169 + 15219u*3 - 3u*2 - 2169 - 15232u*3 + u. -13u*3 - 3u*2 Collect the terms in 866 + 1490d*2 - 2d - 1891 + 1022. 1490d2 - 2d - 3 Collect the terms in 15s - 13s + 12s - 54s - 11s + 2s. -49s Collect the terms in 38o + 2278236o2 - 2278267o*2 - 38o. -31o2 Collect the terms in 28 + 93o - 238o + 54o + 50o - 11. -41o + 17 Collect the terms in 273u2 - 4259u*2 + 3237u*2. -749u*2 Collect the terms in 5119l*3 + 5129l*3 - 20493l*3 + 5122l*3 + 5128l*3. 5l*3 Collect the terms in -3182k*3 + 1660k*3 + 4k + 3k + 1601k*3. 79k*3 + 7k Collect the terms in -258058y + 8y*2 - 3y*2 + 30 + 258058y - 4y2. y2 + 30 Collect the terms in -39d + 82529970 - 3d3 + 55d - 16d - 82529970. -3d*3 Collect the terms in 24172d*3 - 4040d*3 - 4030d*3 - 4030d*3 - 4032d*3 - 4038d*3 - 4028d*3. -26d*3 Collect the terms in 77204524j*3 + 77204543j*3 - 154409019j*3. 48j*3 Collect the terms in -1112r + r*2 + 2237r - 1116r + 5r*2 + 3r*2. 9r*2 + 9r Collect the terms in -315h + 542h + 184h - 370h. 41h Collect the terms in 655v + 993v2 - 1 - 659v + 1 - 1023v2. -30v*2 - 4v Collect the terms in 10933j - 32725j + 10894j + 10861j. -37j Collect the terms in 456l - 225l - 824l*2 - 231l - 571l2. -1395l*2 Collect the terms in -11d*3 - 30d*2 + 44d*3 - 2d*3 + 12d*2 - 15d*3 - 12d*3. 4d*3 - 18d*2 Collect the terms in -6208c*3 - 26715c*3 - 288 + 288 + 2342c*3. -30581c*3 Collect the terms in 1 - 1 - 242a + 3 - 293a - 2. -535a + 1 Collect the terms in 158493p + 1 + 2 - 3 - 317016p + 158514p. -9p Collect the terms in 1513d - 1692d + 184d. 5d Collect the terms in -314v - 329v - 762v + 1740v - 329v. 6v Collect the terms in -131556 - 248108 - 102059 + 62h + 102453. 62h - 379270 Collec	{ "pile_set_name": "DM Mathematics" }
3364, 4416? 5468 What is next in 16182, 16178, 16174? 16170 What is next in 2173, 2100, 2025, 1948? 1869 What is next in -126, -306, -516, -756, -1026? -1326 What is the next term in 12014, 24037, 36060, 48083? 60106 What comes next: -716, -687, -674, -683, -720, -791, -902, -1059? -1268 What is the next term in 181, 1028, 2445, 4438, 7013, 10176, 13933? 18290 What is next in 9349, 18710, 28071, 37432, 46793, 56154? 65515 What is next in 51, 66, 69, 60, 39, 6? -39 What is next in -2757, -5481, -8177, -10851, -13509? -16157 What is the next term in -487, -610, -733? -856 What is next in 4433, 4478, 4523, 4568? 4613 What is the next term in 22949, 45896, 68843, 91790? 114737 What comes next: 347, 305, 243, 161, 59, -63? -205 What is the next term in -273, -406, -661, -1032, -1513? -2098 What is next in -926, -3693, -8292, -14711, -22938, -32961, -44768? -58347 What comes next: 1787, 1674, 1561, 1448, 1335? 1222 What is next in 4090, 4105, 4124, 4147? 4174 What is next in 160018, 160020, 160022? 160024 What is the next term in -1497, -2983, -4457, -5913, -7345, -8747, -10113? -11437 What is next in -28, -275, -706, -1321, -2120, -3103, -4270? -5621 What is next in -1478, -2937, -4390, -5831, -7254, -8653, -10022, -11355? -12646 What comes next: -7982, -7115, -5670, -3647, -1046, 2133? 5890 What is the next term in -24712, -24714, -24710, -24694, -24660? -24602 What comes next: -1156, -1162, -1178, -1210, -1264, -1346, -1462, -1618? -1820 What comes next: -645, -1251, -1857, -2463, -3069? -3675 What comes next: 9240, 9280, 9334, 9402, 9484, 9580, 9690? 9814 What is next in 8325, 33271, 74833, 132999, 207757, 299095, 407001, 531463? 672469 What is next in 37, 52, 109, 208? 349 What comes next: 115, 717, 1707, 3073, 4803, 6885? 9307 What is next in 17749, 17746, 17745, 17746, 17749? 17754 What comes next: 100633, 100629, 100623, 100615, 100605? 100593 What comes next: -387, -659, -817, -861, -791? -607 What is next in -1433, -2904, -4373, -5840, -7305, -8768, -10229? -11688 What is the next term in 17, 1, -59, -187, -407, -743, -1219, -1859? -2687 What is the next term in -7294, -14631, -21954, -29257, -36534? -43779 What comes next: -24, -55, -150, -345, -676? -1179 What is next in 262, 260, 254, 244, 230, 212? 190 What is next in -314966, -314957, -314936, -314897, -314834, -314741, -314612, -314441? -314222 What comes next: 276, 221, 174, 141, 128, 141? 186 What is the next term in 96759, 96787, 96813, 96837? 96859 What is next in 81, 576, 1451, 2706, 4341? 6356 What is the next term in 109, 243, 433, 703, 1077, 1579? 2233 What comes next: 481, 1197, 2381, 4033? 6153 What is the next term in -6295, -12734, -19173, -25612? -32051 What is the next term in -637, -1197, -1757? -2317 What is next in 5819, 11562, 17305? 23048 What comes next: -16187, -16194, -16205, -16220, -16239, -16262? -16289 What is next in 1944, 1937, 1946, 1989, 2084, 2249, 2502, 2861? 3344 What is the next term in 239, 977, 2207, 3929, 6143, 8849, 12047? 15737 What is next in 16629, 16652, 16661, 16650, 16613, 16544, 16437, 16286? 16085 What is the next term in 85, 114, 109, 70, -3, -110? -251 What is next in 42527, 42528, 42529? 42530 What is the next term in 1286, 1375, 1464, 1553, 1642? 1731 What is the next term in -466, -1842, -4078, -7126, -10938, -15466? -20662 What is the next term in -2338, -2324, -2308, -2290, -2270? -2248 What is the next term in -25, -148, -443, -994, -1885, -3200? -5023 What comes next: 351, 388, 427, 468, 511, 556? 603 What comes next: -709, -1290, -1569, -1396, -621? 906 What is the next term in -15, -254, -653, -1212, -1931, -2810, -3849? -5048 What is next in -3372, -6875, -10378, -13881, -17384, -20887? -24390 What comes next: 125, 91, 63, 41, 25, 15? 11 What comes next: -386, -269, -154, -41? 70 What is next in 325, 580, 665, 496, -11, -940? -2375 What is next in 715278, 715279, 715280? 715281 What is the next term in -1700, -6793, -15282, -27167? -42448 What comes next: 906, 924, 944, 972, 1014, 1076? 1164 What comes next: 3933161, 3933164, 3933169, 3933176, 3933185? 3933196 What comes next: -10185, -20199, -30213, -40227, -50241, -60255? -70269 What is next in -5401, -6224, -7057, -7906, -8777? -9676 What comes next: -194, -422, -682, -974? -1298 What is the next term in 260569, 260573, 260577, 260581, 260585? 260589 What is next in 25940, 103690, 233272, 414686, 647932? 933010 What comes next: 233, 505, 841, 1259, 1777, 2413, 3185, 4111? 5209 What is the next term in -31848, -63630, -95412, -127194, -158976, -190758? -222540 What is next in 5959, 11852, 17743, 23632, 29519? 35404 What comes next: -94, -135, -202, -295? -414 What is the next term in -2035, -4385, -6735? -9085 What is next in 412913, 825830, 1238747, 1651664, 2064581, 2477498? 2890415 What comes next: 86, 194, 340, 542, 818? 1186 What is the next term in 8670, 34653, 77958, 138585, 216534, 311805? 424398 What is next in 2755, 5485, 8195, 10879, 13531, 16145? 18715 What is next in -3281, -3182, -3017, -2786, -2489, -2126, -1697? -1202 What comes next: 924167, 924164, 924161, 924158, 924155, 924152? 924149 What is the next term in -442286, -884575, -1326864, -1769153, -2211442, -2653731? -3096020 What is next in -141, -198, -255, -312, -369? -426 What comes next: 1137, 1602, 2067, 2532, 2997? 3462 What is the next term in 16513, 66032, 148563, 264106? 412661 What is the next term in -348, -1414, -3182, -5652, -8824, -12698? -17274 What comes next: -71, -244, -515, -884, -1351, -1916, -2579? -3340 What is next in 385389, 385386, 385383, 385380? 385377 What is next in 867, 961, 1131, 1383, 1723? 2157 What is the next term in -3826, -3862, -3922, -4006, -4114, -4246? -4402 What is next in 76, 104, 146, 202, 272, 356? 454 What is next in -229, -262, -313, -388, -493, -634, -817? -1048 What is next in 19077, 19021, 18965, 18909, 18853, 18797? 18741 What is next in -9166, -9172, -9182, -9196, -9214, -9236? -9262 What is next in -131, -533, -1209, -2159, -3383, -4881? -6653 What comes next: 375, 1487, 3341, 5943, 9299, 13415, 18297? 23951 What is the next term in 38771, 77430, 116079, 154712, 193323, 231906, 270455, 308964? 347427 What is the next term in -192, -364, -534, -702, -868, -1032, -1194? -1354 What comes next: -110, -969, -3314, -7889, -15438, -26705, -42434? -63369 What is the next term in -13385, -13399, -13413, -13427, -13441, -13455? -13469 What is next in 5370, 21486, 48344, 85944, 134286, 193370? 263196 What comes next: 29722, 59439, 89156? 118873 What comes next: 1464, 2929, 4396, 5865, 7336, 8809? 10284 What is the next term in 37068, 37124, 37180, 37236? 37292 What comes next: -173981, -347959, -521935, -695909? -869881 What comes next: -194, -718, -1568, -2738, -4222, -6014, -8108? -10498 What comes next: -5039, -10075, -15123, -20183? -25255 What is the next term in -690, -253, 184, 621, 1058, 1495? 1932 What is the next term in -52027, -104058, -156089? -208120 What comes next: -82737, -82707, -82655, -82569, -82437, -82247, -81987? -81645 What is next in 5016403, 5016402, 5016401, 5016400? 5016399 What is the next term in 259, -1184, -2627, -4070, -5513, -6956? -8399 What comes next: 3424954, 3424952, 3424950, 3424948, 3424946? 3424944 What is the next term in -3335, -6525, -9713, -12899, -16083, -19265? -22445 What is the next term in -1040442, -2080881, -3121320? -4161759 What is the next term in -242, -446, -676, -938, -1238? -1582 What is next in 616, 1283, 1950, 2617? 3284 What is next in -110, -336, -832, -1724, -3138, -5200, -8036, -11772? -16534 What is the next term in -1311, -5308, -11971, -21300, -33295? -47956 What is the next term in 2930, 2850, 2788, 2750, 2742? 2770 What is next in 2908, 5981, 9040, 12079, 15092? 18073 What is next in 1002, 1021, 1040, 1059? 1078 What is the next term in 14, -23, -104, -241, -446, -731? -1108 What comes next: 45, 397, 1357, 3231, 6325, 10945? 17397 What comes next: -492, -409, -262, -45, 248, 623, 1086? 1643 What comes next: 617163, 617162, 617161, 617160, 617159, 617158? 617157 What comes next: -29197, -233489, -787991, -1867807, -3648041, -6303797? -10010179 What is the next term in -58, 44, 190, 392, 662, 1012? 1454 What comes next: 13351, 106757, 360289, 854011, 1667987, 2882281? 4576957 What is next in	{ "pile_set_name": "DM Mathematics" }
ve h(b(u)). -u*4 Let f(x) = -5x*2. Let c(u) be the first derivative of 2u*2 - 74. Give c(f(v)). -20v*2 Let b(i) = -5 - 5 - 312i + 10. Let k(q) = -2q2. Calculate k(b(j)). -194688j*2 Let l(y) be the third derivative of -16y5/15 - y3/3 + 413y2 + 2y. Let x(u) = -7u. What is x(l(q))? 448q*2 + 14 Let a = 8 + -3. Let j = a + -3. Let y(i) = -i + 3i - 2i - 4ij. Let m(z) = -z2. Calculate m(y(o)). -16o4 Let j(z) = -5z. Let i(c) = -8c - 5c - 8c + 8c. What is i(j(m))? 65m Let d(n) = 6n*2. Let c(i) = 5i. Let u(x) = -2x3 - x2 + 2x - 3. Let f be u(-2). Let b(s) = -6s - 6s + s. Let p(w) = fc(w) + 2b(w). Give p(d(o)). 18o2 Let g(x) = 2x*2 - 22x. Let v(z) = 2 - 1249z - 2 + 1250z. Let s(a) = -2g(a) - 44v(a). Let b(w) = 5w. Calculate s(b(d)). -100d*2 Let p(d) = 5d*2. Let n(u) be the second derivative of 34u*3/3 - 2u + 19. Give n(p(q)). 340q2 Let m(z) = -130z*2. Let b(r) = 574r. Determine m(b(t)). -42831880t2 Let r(j) = -j2. Let l(y) = -3y*2 + 15y2 - y2 - 6y2. Calculate r(l(d)). -25d*4 Let d(q) = 5q - 30. Let y(f) = -157f2 - 1. Give y(d(i)). -3925i*2 + 47100i - 141301 Let r(k) = 28k + 4. Let g be 0 - (0 + (-4)/(-1)). Let w(a) = 27a + 3. Let s(u) = gw(u) + 3r(u). Let c(t) = t + 4 - 4. What is c(s(z))? -24z Let i(p) = 4p*2. Let s(j) be the second derivative of 8j3 + j2/2 - 340j. Calculate i(s(f)). 9216f*2 + 384f + 4 Let n(h) = -4h2. Let k(a) = 2a*2 - 5a + 5. Let w be ((-6)/(-9) - 0) + (-51)/9. Let d(g) = g*2 - 2g + 2. Let l(b) = wd(b) + 2k(b). Calculate n(l(v)). -4v4 Let y(v) = 3v*2. Let f(s) be the first derivative of -7s*2/2 + 57. Give y(f(z)). 147z*2 Let s(v) = 22v - 2. Let g(x) = -x. Let j(d) = 36g(d) + 2s(d). Let o(w) = -2w. Calculate j(o(p)). -16p - 4 Let p(w) = -9w2 + 2w. Let m(h) = -49h + 69. Determine m(p(n)). 441n*2 - 98n + 69 Let i(p) be the first derivative of 2p3/3 - 12. Suppose 3z - 3b = 12, -2z + 5 = 5b + 4. Let h(t) = -z - 11t*2 + 3 + 5t*2. Determine i(h(j)). 72j*4 Suppose 10 = 3u + 2u. Let l(w) = 2w + 2w - uw. Let a(z) be the first derivative of -3z2 - 115. Determine a(l(q)). -12q Let x(v) = 14v2. Let s(m) = 5m*2 + 2m + 660. Calculate s(x(r)). 980r4 + 28r*2 + 660 Let f(q) = 947q. Let v(x) = -109x2 + x. Calculate f(v(n)). -103223n*2 + 947n Let l(f) = f*2. Suppose 0g = 2k + g - 5, -k - g = 0. Let z be (-16)/(-7) + (-6)/21. Let w(a) = -a2 + ka*z - 2a*2. Determine l(w(i)). 4i*4 Let c(u) = 12u*2. Let r(z) = -81z. Let x(g) = -7g. Let k(i) = 5r(i) - 54x(i). Determine c(k(a)). 8748a*2 Let p(l) = 33l*2 - 3l. Let m(a) be the third derivative of a5/60 + a2 + 21. Give p(m(v)). 33v4 - 3v*2 Let n(z) be the first derivative of 5z*3/3 + 48. Let a(i) = 10i*2 + 5i*2 - 12i*2. Calculate n(a(d)). 45d*4 Let t(g) = -3g - 8. Let h(z) = 184z2. Give t(h(x)). -552x*2 - 8 Let i(w) be the third derivative of 0 + 0w + 45w2 + 5/24w*4 + 0w*3. Let f(k) = -2k*2. What is i(f(o))? -10o*2 Let n(r) = 7r. Let o(z) be the third derivative of 15z4/8 - 24z*2 + 3. Give o(n(q)). 315q Let b(x) = -2x - 14. Let k(s) = s2 + 3s + 21. Let l(y) = -3b(y) - 2k(y). Let p(t) be the first derivative of -3t3 + 1. Give p(l(f)). -36f*4 Let c(h) = 2h. Let a(g) = g*2 - g + 66. Let t be a(0). Let u(d) = td*2 - 124d*2 + 64d*2. Give c(u(j)). 12j*2 Let a(f) = f. Let m(n) = 77171n*2. Calculate a(m(g)). 77171g*2 Let u(n) = -4n + 2. Let p(x) = 8x + 11. Let l(k) = 3k + 4. Suppose s - 2 = 2. Let z(b) = sp(b) - 11l(b). Determine z(u(d)). 4d - 2 Let d(v) = 41447v*2 + 1. Let r(c) = -2c*2. Calculate d(r(z)). 165788z*4 + 1 Let h(q) = -2q*2. Suppose 11i = 14i. Let m(w) be the second derivative of -13w + 1/3w3 + i + 0w*2. Give h(m(g)). -8g*2 Let l(c) = -3c. Let j(k) = -44427k. What is j(l(h))? 133281h Let k(r) = -430r - 1. Let a(l) = -3l*2 - 5l - 55. Let c(v) = 8v2 + 14v + 154. Let i(w) = -14a(w) - 5c(w). Determine k(i(y)). -860y2 - 1 Let j(h) = -284h. Let w(q) = 271q2. What is w(j(a))? 21857776a*2 Let j(m) = 12m. Let r(y) = -y + 6. Let n be r(2). Suppose -4i - n = -4o, -o + 0o = -4. Let q(g) = 2g + ig - 2g*2 - 5g. Determine j(q(p)). -24p2 Let b(n) = 769n*2. Let l(x) = -80x. Give b(l(h)). 4921600h2 Let f(j) = 146j*2 + 7. Let q(u) = 2u. What is f(q(s))? 584s2 + 7 Let s(w) = 3w*2 - 503w. Let c(l) = -51l2. Determine s(c(z)). 7803z*4 + 25653z*2 Let l(w) = 28w. Let d(k) be the first derivative of 9k2/2 - 176. Determine d(l(x)). 252x Let d(k) be the second derivative of k*3/6 - 8k + 28. Let i(u) = -u*2 + 3u*2 + 3u*2. Determine d(i(v)). 5v*2 Let l(k) = 1995k*2. Let d(h) = -594h*2 + h. Determine d(l(c)). -2364134850c*4 + 1995c*2 Let a(g) = -3g*2. Let n(l) = -2l. Let c be 1/(-1 - 0)0. Suppose c = -0b - b - 4. Let j(s) = -s. Let h(o) = bj(o) + n(o). Determine h(a(q)). -6q*2 Let k(f) = -4f. Let i(u) = -195869u. Give k(i(n)). 783476n Let m(t) = -3t. Let n(b) = -4305b. Determine m(n(a)). 12915a Let v(d) = -d2 + 2d - 2. Let o(l) = l*2 - 5l + 5. Let u(c) = 2o(c) + 5v(c). Let y(f) = -14f. Calculate u(y(z)). -588z*2 Let r(u) = 138u. Let g(s) = 6s2 + 1. Calculate g(r(x)). 114264x*2 + 1 Let t(x) be the third derivative of -11x*5/60 + 267x*2. Let i(r) = 4r*2. What is i(t(n))? 484n*4 Let m(i) be the second derivative of -37i*3/6 + 684i. Let u(y) = 25y. Give u(m(q)). -925q Let n(z) = -25z - 870. Let q(a) = a2. Determine n(q(b)). -25b2 - 870 Let j(y) = -y2. Let m(u) = -480u2. Let z(q) be the first derivative of -32q*3/3 + 4. Let k(n) = 6m(n) - 88z(n). Calculate k(j(x)). -64x*4 Let w(g) = 4. Let k(b) = 3 + 1 + 7b + 1 - 6b. Let s(c) = 4k(c) - 5w(c). Let l(z) = -3z. Give l(s(u)). -12u Let f(c) = 7 + 556c - 7 - 555c. Let k(v) = -88v*2. Calculate f(k(n)). -88n*2 Let y(z) = 10z + 7z - 22z. Let r(x) = -10x + 5. Let s(q) = 9q - 4. Let v(k) = 4r(k) + 5s(k). Determine v(y(t)). -25t Let f(q) = -2q*2. Let c(k) = -31k + 6. Give c(f(b)). 62b2 + 6 Let o(i) = -2293i. Let z(g) = 3g2 + 7g. Determine z(o(c)). 15773547c2 - 16051c Let x(a) = -2a + 9. Let q(s) = -21914s. Calculate q(x(h)). 43828h - 197226 Let g(m) = 6m*2. Let s(w) = 39w + 14. Let b(k) = 26k + 10. Let y(z) = -7b(z) + 5s(z). Calculate y(g(q)). 78q*2 Let t = 50 + -46. Let w(g) = tg*2 - 2g*2 - 3g*2. Let i(b) = -4b*2. Determine w(i(d)). -16d*4 Let o(m) = m. Let j(g) = 169g*2 - 240g*2 - 48g + 51g2. Give j(o(n)). -20n*2 - 48n Let k(c) = -253c. Let u(p) be the second derivative of p3/2 - 4p + 91. Calculate k(u(x)). -759x Let k(a) = a2. Let u(x) be the second derivative of -3x*4/2 - 85x. Determine u(k(r)). -18r4 Let t(h) = -158h*2 - 2h. Let b(v) = -6v2 - 72v + 144. Let n(x) = 2x - 4. Let s(w) = -b(w) - 36n(w). Calculate t(s(k)). -5688k4 - 12k*2 Let t(l) = -294l + 108l + 179l. Let y(g) = 20g - 2. What is t(y(d))? -140d + 14 Let k(p) = -5p - 27. Let f(n) = -144n - 1. What is f(k(u))? 720u + 3887 Let q(v) be the second derivative of -109v*4/12 + 409v. Let a(p) = -p*2. Give q(a(h)). -109h*4 Let o(s) = 7s*2 - 3s + 12. Let u(t) = 7t2 - 4t + 16. Let m(g) = 4o(g) - 3u(g). Let r(i) = 36i - 2. Determine r(m(v)). 252v*2 - 2 Let c(h) = -216h2. Let k(m) be the third derivative of m4/12 - 4m2 + 21. Determine c(k(x)). -864x*2 Suppose 0 = -n - n + 10. Suppose 0 = nt - 11 - 4. Let y(m) = 0m - tm + 4m. Let b(j) = j. Give y(b(p)). p Let k(w) = -1043666w. Let r(n) = 2n. Determine r(k(j)). -2087332j Let f(y) = -53y. Let z(l) = -39392l*2. Determine z(f(x)). -110652128x*2 Let p(m) = 2m*2 + 12m2 - m2. Let f(a) be the third derivative of a*4/24 + 49a*2. Determine p(f(o)). 13o*2 Let n(h) = -2h*2. Suppose -313 = 9y - 1447. Let w(a) = 2a2 + 126a - ya. Calculate w(n(p)). 8p*4 Let a(r) = -23r + 10. Let m(s) = 18s - 8. Let n(q) = 4a(q) + 5m(q). Let h(j) = -10j + 1. Determine n(h(i)). 20i - 2 Let z(y) = -147y - 3. Let c(i) = -i*2 - 9i. Calculate z(c(g)). 147g2 + 1323g - 3 Let r(g) = g. Let k(v) = -5v - 4. Let y(i) = -6i - 4. Let	{ "pile_set_name": "DM Mathematics" }
mmon multiple of 695 and 155. 21545 Calculate the common denominator of -107/276 and -55/56. 3864 Calculate the common denominator of -121/18 and 37/423. 846 Calculate the smallest common multiple of 21 and 2826. 19782 Calculate the smallest common multiple of 46 and 667. 1334 What is the smallest common multiple of 255 and 30? 510 What is the common denominator of 53/2 and 43/11? 22 Calculate the lowest common multiple of 108 and 54. 108 Calculate the common denominator of -1/149 and -7/4. 596 Calculate the common denominator of -37/7367 and -8/973. 51569 What is the lowest common multiple of 100 and 16? 400 Find the common denominator of -11/100 and -109/20. 100 What is the smallest common multiple of 540 and 60? 540 What is the common denominator of -1 and 113/98? 98 Calculate the common denominator of -75/248 and -133/186. 744 What is the lowest common multiple of 1071 and 630? 10710 Calculate the common denominator of 65/242 and -3/14. 1694 What is the least common multiple of 7700 and 4900? 53900 What is the least common multiple of 64 and 224? 448 What is the common denominator of -21/110 and -27/20? 220 What is the lowest common multiple of 5054 and 42? 15162 Find the common denominator of -41/12 and -4/105. 420 Find the common denominator of -67/78 and 85/624. 624 Find the common denominator of 7/4 and -71/256. 256 Calculate the lowest common multiple of 330 and 66. 330 Calculate the common denominator of -119/10 and -91/248. 1240 Calculate the common denominator of -57/7 and 27/13. 91 Find the common denominator of -67/266 and -30/19. 266 Find the common denominator of -91/90 and -85/696. 10440 Calculate the common denominator of -59/1464 and -131/5856. 5856 What is the smallest common multiple of 4 and 356? 356 Calculate the least common multiple of 4050 and 24. 16200 Calculate the common denominator of -59/532 and 23/1520. 10640 Calculate the smallest common multiple of 24 and 288. 288 Calculate the least common multiple of 600 and 24. 600 Calculate the lowest common multiple of 1011 and 9. 3033 Calculate the smallest common multiple of 126 and 28. 252 What is the common denominator of -59/27 and -86/255? 2295 What is the common denominator of 71/370 and -1/76? 14060 Calculate the lowest common multiple of 1114 and 18. 10026 What is the common denominator of 9/352 and -5/616? 2464 Calculate the least common multiple of 888 and 120. 4440 What is the least common multiple of 816 and 12? 816 Calculate the common denominator of -1/40 and -13/671. 26840 Calculate the least common multiple of 16 and 48. 48 Calculate the smallest common multiple of 50 and 1065. 10650 Find the common denominator of 97/900 and -57/100. 900 Find the common denominator of -1/24 and 91/1128. 1128 Find the common denominator of 91/1488 and -63/16. 1488 What is the least common multiple of 30 and 570? 570 Calculate the common denominator of 41/414 and -97/230. 2070 What is the least common multiple of 23902 and 20? 239020 What is the smallest common multiple of 5768 and 12? 17304 What is the common denominator of 67/120 and 65/4104? 20520 Calculate the lowest common multiple of 100 and 36. 900 What is the common denominator of 17/22 and -79/4250? 46750 Calculate the least common multiple of 1057 and 91. 13741 What is the common denominator of -1/45 and -47/20? 180 Calculate the lowest common multiple of 42 and 147. 294 What is the least common multiple of 96 and 291? 9312 What is the common denominator of -45/7 and 73/8? 56 Calculate the common denominator of 62/567 and -32/489. 92421 Calculate the least common multiple of 322 and 414. 2898 Calculate the least common multiple of 1978 and 344. 7912 Calculate the smallest common multiple of 24 and 248. 744 Find the common denominator of -101/288 and 63/128. 1152 What is the least common multiple of 3900 and 1000? 39000 What is the smallest common multiple of 742 and 21? 2226 What is the lowest common multiple of 11 and 6? 66 What is the lowest common multiple of 42 and 324? 2268 Calculate the common denominator of -127/18 and -103/78. 234 Calculate the smallest common multiple of 215 and 1. 215 What is the lowest common multiple of 2020 and 5? 2020 Calculate the common denominator of 8/9 and -115/72. 72 Calculate the smallest common multiple of 60 and 1000. 3000 Calculate the common denominator of 1/1224 and 29/234. 15912 Find the common denominator of -46/195 and 73/35. 1365 Calculate the least common multiple of 1745 and 35. 12215 What is the common denominator of 97/900 and 3/400? 3600 What is the common denominator of -169/90 and 41/135? 270 What is the lowest common multiple of 8 and 16? 16 Calculate the least common multiple of 36 and 48. 144 What is the common denominator of 79/520 and -11/468? 4680 Calculate the lowest common multiple of 486 and 126. 3402 Calculate the common denominator of 117/250 and 36/25. 250 Calculate the common denominator of 17/48 and -37/342. 2736 What is the smallest common multiple of 416 and 4? 416 What is the common denominator of 19/508 and 47/16? 2032 Find the common denominator of -1/14 and -59/13260. 92820 What is the least common multiple of 75 and 12? 300 Calculate the smallest common multiple of 90 and 530. 4770 Calculate the least common multiple of 1360 and 70. 9520 Calculate the lowest common multiple of 132 and 5808. 5808 Find the common denominator of 52/21 and -59/54. 378 Find the common denominator of 133/18 and -37/618. 1854 What is the common denominator of -87/8 and 27/272? 272 What is the lowest common multiple of 240 and 1656? 16560 Calculate the lowest common multiple of 45 and 75. 225 What is the least common multiple of 76 and 1838? 69844 Find the common denominator of 77/7380 and -15/14. 51660 What is the common denominator of 93/92 and -49/8? 184 Find the common denominator of 91/2 and 56/1067. 2134 What is the common denominator of -8/19 and 24/475? 475 What is the least common multiple of 114 and 11? 1254 Calculate the least common multiple of 237 and 12. 948 Calculate the common denominator of 109/730 and -71/2. 730 Calculate the lowest common multiple of 1554 and 12. 3108 Calculate the least common multiple of 22 and 38. 418 Calculate the common denominator of 139/36 and -83/1890. 3780 What is the smallest common multiple of 3 and 11? 33 What is the smallest common multiple of 152 and 209? 1672 Calculate the smallest common multiple of 160 and 25. 800 Find the common denominator of -33/280 and -77/920. 6440 Calculate the lowest common multiple of 10 and 92. 460 Calculate the lowest common multiple of 32 and 16. 32 What is the common denominator of -53/64 and -93/64? 64 Calculate the common denominator of 19/24 and 88/21. 168 Calculate the smallest common multiple of 424 and 10. 2120 What is the smallest common multiple of 1 and 230? 230 Calculate the smallest common multiple of 27 and 234. 702 Calculate the lowest common multiple of 11 and 920. 10120 What is the common denominator of -3/25 and -117/980? 4900 What is the smallest common multiple of 7936 and 448? 55552 What is the lowest common multiple of 64 and 1964? 31424 What is the smallest common multiple of 30 and 30? 30 Calculate the common denominator of -10/279 and 8/341. 3069 What is the least common multiple of 400 and 40? 400 Calculate the lowest common multiple of 60 and 18. 180 Find the common denominator of -47/9 and -23/14031. 14031 What is the common denominator of -73/10168 and 103/10168? 10168 Calculate the common denominator of 103/5620 and -83/45. 50580 Calculate the least common multiple of 14 and 112. 112 What is the common denominator of -139/66 and -133/6? 66 Find the common denominator of 71/1516 and -19/2653. 10612 What is the least common multiple of 160 and 112? 1120 Find the common denominator of 59/596 and -59/596. 596 Calculate the common denominator of 111/1496 and 127/72. 13464 What is the smallest common multiple of 96 and 168? 672 Find the common denominator of -79/210 and -77/291. 20370 Calculate the least common multiple of 216 and 360. 1080 Calculate the common denominator of -115/238 and 71/2. 238 Calculate the common denominator of 19/1940 and -149/12. 5820 Calculate the lowest common multiple of 400 and 450. 3600 Calculate the least common multiple of 3 a	{ "pile_set_name": "DM Mathematics" }
+ 20) - -14 -1 (-88 - -16) + 90 + -49 -31 Calculate 0 + -67 + -158 + 315 + -148. -58 What is 18 + -4 - (-62 + 37 + -11)? 50 What is the value of 77 - (92 + -181 + 217)? -51 10 + (-4 - (-44 - -13)) + 5 - 11 31 Calculate (-3 - (-48 + 70 + -37 + 1 + -3)) + -115. -101 Evaluate -3 + 1 + (9 - 5) - (235 - 161). -72 What is the value of 101 + -99 + -1 + 11 + -2 + -19 - -26? 17 What is (4 - (-1 + -2)) + (33 - 8) - (0 - -5)? 27 What is 7 - (21 - 10) - (-11 + 17 + -93 + -2)? 85 1 - (-2 + -57) - (61 - (20 - -27)) 46 Calculate -89 + 223 + -108 + 2 + 82. 110 42 - (32 + 53) - -38 -5 17 + 11 + 1 + (7 - 39) -3 What is (-7 + 4 + 25 - 164) + (-19 - -24)? -137 What is 81 - (-20 - (-58 - 5 - -31))? 69 What is the value of 8 - ((-6 - (-61 + -1)) + (-2 - 6) + 1)? -41 49 + -7 + (-3 - -28) + -12 55 284 + -289 + (1 + -3 - 7) - -118 104 218 - (65 - -31) - 97 25 What is -53 + (7 - (-2 + 21 + -18)) - (-1 - -7)? -53 What is 76 + (-15 - (-19 - (-11 + -4))) + -3? 62 (42 + -3 - 5) + (-151 - -150) - (-6 + 1) 38 Calculate -5 + -2 - (44 - 47) - ((1 - 3) + 40). -42 Evaluate -54 + 52 + 50 + -23. 25 Evaluate -66 + -1 + (25 - (-12 + 52) - 4). -86 What is the value of (9 - 74) + (-4 - -31) + 0? -38 Evaluate -25 + 0 + -6 - (-334 - -208). 95 Evaluate -4 - (124 - 120 - -50). -58 -101 + 161 + -67 + -86 -93 Evaluate 2007 + -2002 - (-5 - -1). 9 What is -1 + (-1 + 3 + -18 + 29 - 20) - -98? 90 Evaluate 86 - -3 - (-84 - (43 - 117)). 99 What is the value of (46 - 12) + -36 - 45? -47 Evaluate 27 - (-32 + -3 + 47) - 52. -37 Evaluate (29 - (-15 + 25)) + -14 - (116 - 4). -107 What is (0 - -1 - (-22 - -55)) + -8? -40 Calculate 3 - (2 + 24) - (-15 - -9 - 7). -10 Evaluate (3 - 7 - -6) + (-20 - 0) - (-7 - -13). -24 What is 5 + 48 + (-17 - -29) + -14? 51 What is (-71 - -14) + 14 + -4 - -18? -29 Evaluate -136 + (3 + -2 - -2) + -85 + -57 + 149. -126 Calculate 28 + (71 - 71) + 49. 77 Evaluate 1 + -15 - (225 + -213). -26 Evaluate 0 + 9 + 1 - (-4944 - -4952). 2 Evaluate 8 + 1 + -5 + -5 + -102 + 95 - 7. -15 -9 + 52 + -47 + 0 + -22 -26 Calculate (-26 + 49 + 6 + -1 - -6) + 8. 42 What is the value of 28 + 6 + (-6 - -98 - 0)? 126 What is (14 - (121 + -35)) + 61 - (-1 + (11 - -1))? -22 (13 - -3) + (-95 - -73) - ((81 - -3) + -3) -87 Calculate (99 - -69 - 83) + -15. 70 What is the value of -164 - -157 - 137 - -27? -117 (-53 - 2) + 901 + -812 34 Calculate 24 - (10 - (-17 + 18 + 4)). 19 Evaluate (-1 - -66) + (27 - 0) + 375 + -411. 56 30 - (10 + (-10 + 29 + -8 + -18 - -8)) 19 What is the value of -895 + 876 - (-46 + -1)? 28 102 + -71 + -122 + 73 -18 What is the value of -58 - ((1 - -23) + 56 + (26 - 94))? -70 What is the value of (44 - 58 - (1 - -36)) + 31? -20 What is (537 - 192) + -413 - (-2 + 2 + (-9 - 1))? -58 Calculate -43 + 0 + (3753 - 3643). 67 Evaluate (16 - -52) + (-17 - (-4 - 23)). 78 What is 2 + (-15 - (46 + -8 + (10 - 11)))? -50 Evaluate 163 - (-123 - (-125 - 115)). 46 Calculate (-6 - -10 - -43) + (15 - (30 + -4)). 36 (18 - -2 - (-126 + 142)) + -86 + -3 -85 Calculate 207 + (-125 - (33 - 58)). 107 What is the value of (-84 + -127 - -68) + 37 + -18 + -1? -125 Calculate 53 - (148 + -40) - (-1 - 1). -53 What is 0 - -5 - (-365 - -361 - (62 + 0 + -2))? 69 What is -2 + (-8 + 9 - 4) + (4 - 3) + 18? 14 What is the value of (454 - 457) + -1 + 4 + -7 + 10? 3 What is the value of 1 + 24 + -7 - (22 - -36)? -40 Evaluate 14 - 17 - (16 + -31 - -43 - (-3 + 1)). -33 Evaluate 18 - (-35 - -48) - -20. 25 Calculate 30 + (-3 + 29 - 48). 8 -25 + (-11 - 6 - -2 - -30) - 27 -37 Calculate -1 - ((-862 - -858) + (-1 - -13) + (2 - 3)). -8 38 - -1 - (-50 + 136 + -67) - 32 -12 What is the value of -40 - (30 - (98 + -41))? -13 What is the value of (6 - -28) + -48 - (42 + -11)? -45 (112 - 0) + -2 + (-6 - (23 + -40)) 121 What is -33 + 77 + -50 + 4? -2 -22 - (-19 - (33 - (-23 - -14))) 39 Evaluate (1 - -17) + (16 + -47 - (82 - 122)). 27 Evaluate -48 - 4 - (-30 + -1). -21 What is the value of 95 + -50 + -98 + -4 + 12? -45 What is (-87 - (-42 + 18)) + 17? -46 (0 + 1 + -4 - (-24 + 101 + -44)) + 2 -34 What is (2 - 69) + 152 + -134? -49 What is (32 - (8 + -12)) + -9 + 44 + -52? 19 Evaluate 6355 - 6326 - (8 + -2 + -1). 24 What is the value of -2 + (-1 - -53 - (0 + -1)) + -715 + 720? 56 (18736 - 18910) + 52 + 0 -122 What is (16 - 9 - (126 + -5 + 5 + -15)) + -2? -106 Calculate -48 + 90 + -83 + 101. 60 -13 + (-58 - (-64 + -15)) 8 What is (-24 + 24 - 108) + 47? -61 Calculate 52 + -30 + -82 - 1. -61 Evaluate (-25 - (3 - 10)) + 21 + (0 - 63). -60 Evaluate (-8 - 22) + 8 - (-59 - -61). -24 Calculate 69 + -2 + (-73 - (-110 + 65)). 39 Calculate (10 + -138 - (25 + -37 + 39)) + (0 - -9). -146 What is 1 + 11 + 9 + (-23 + 14 - 4)? 8 -15 - (-7 - 8) - (-184 - -109) 75 (12 - 2) + (3 - 29) + 71 + (0 - -7) 62 6 + -11 + (58 + -54 - (3 + 6)) -10 Calculate (-10 - 3 - 0) + (-22 - 8) + 35. -8 Calculate 38 - (86 + -26 + -34). 12 Calculate -28 + 30 + 7 + -11 + (-8 - -1). -9 Calculate (-8 - (-41 - -30)) + (-2 - (1 - (-2 - 64))). -66 What is the value of (2 - -1) + -9 + (-162 - -171) - 8? -5 What is the value of -54 - (75 + (48 - 220))? 43 What is the value of (-1 - 1) + 36 + 12 + 11 + 2 + -16? 43 What is 170 - 256 - (-5 + (-11 - -8))? -78 127 - (-65 - (-94 + 15)) 113 (99 - (32 + -25)) + -63 29 What is the value of 132 + -160 - 11 - (23 + -2 + -2)? -58 Calculate (9 - 33 - -30) + 6 + -5 + -33. -26 What is 5 + ((76 - -4) + -13 - 11) + 13 + -2? 72 What is -2 + (2 - 17) + (-3 + -41 - -37)? -24 7 + 27 + -3 + (1 - -25) + -72 -15 What is -2 + (-24 - (-44 - (-50 + 28))) + -9 + -1? -14 What is the value of 1 - 28 - (-22 - (-29 + 22 + -4))? -16 What is the value of 57 - 0 - ((0 - ((-22 - -46) + -16)) + -6)? 71 12 + -44 + (48 - -19) 35 0 + 43 + -33391 + 33479 131 Evaluate 17 - (-14 - -41) - 18 - 8. -36 Calculate 1 + 14 - -3 - (1073 - 1068). 13 Evaluate (-35 - (-20 + -12) - (3 + -1 + -59)) + 3. 57 Evaluate -35 + 20 + (7 - -2) - (-42 + 19). 17 Calculate (8 - (-14 + 6 - -13)) + 37 + 15. 55 What is 49 - (935 + -937 - (-21 - 1))? 29 What is (1 - (-2 + 1)) + 104 - (-62 - -91 - 15)? 92 What is the value of -32 - (5 + 0 + 1 - ((0 - -20) + -9))? -27 Calculate -59 - (8 - (-3 - (3 + (-16 - (-15 + 8))))). -64 What is the value of -410 + 393 + (1 + 0 - 4)? -20 Evaluate 4 + 39 - (18 + -12 + 2 + -2 + -10). 47 What is the value of (6 - (3 + -7)) + (-18 - -22) + -15 + -87? -88 Evaluate -40 + (-93 - -42) + 26. -65 What is 14 - 7 - 10 - 13 - 26? -42 What is 55 + (17 - 140) + 83? 15 Evaluate (12 - -10) + (-178 - -174). 18 What is the value of 1 - 14 - (-56 - -105 - 64)? 2 (-18 - (13 + -3 + -34)) + 41 + -5 + 4 46 What is 36 + (32 - (-33 + 69)) - -1? 33 What is the value of -18 - (-5 + (5 - -4) + -16)? -6 Evaluate 70 - (89 - (24 - -71)). 76 Calculate (-37 - -38) + (0 - (-7 - (6 - (64 - 7)))). -43 What is the value of 26 + -1 + -12 - (5 - (4 + -83))? -71 Evaluate -6 + 2 + -5 - ((34 - 21) + -43). 21 Evaluate 127 - 80 - (-21 - 19). 87 What is (33 - (162 - 99)) + (-1 - (-11 + -1))? -19 Calculate -12 + 0 - (92 - (-115 + 217)). -2 Calculate -116 + 23 + 29 + 74. 10 Calculate (11 - 2) + -29 + (-58 - -63). -15 Evaluate -3 + 1 + 23 - (-27 + 38 + -94). 104 Evaluate (-9 - -33 - (-33 + -8)) + -10. 55 Calculate (-65 - -33 - 13) + 49. 4 Calculate 1 + -20 + (25 - -12) - (23 - 14). 9 What is -115 + 21 + 212 - 96? 22 -39 + (-18 - (-11 + -21)) + -7 -32 -4 + (-2 - -2) - (5 - 46 - (82 - 116)) 3 Calculate -38 + -53 + 103 + 56. 68 Evaluate (41 - -90 - 128) + (-1 - 1) + -11 + -85. -95 Evaluate -39 - (62 - 13) - -26. -62 13 + (-24 - 0) + 22 + 29 40 What is 21 - 1 - (37 - (59 + -41))? 1 What is 1436 + -1384 + (-7 - -4 - (2 - -5))? 42 What is the value of 24 - 24 - (-2 + -3 + (-11 - -11)) - -21? 26 Evaluate 36 + (42 - (2 + -19 + 26)). 69 -2 + (33 - (-9 - -19)) + 26 47 What is 14 - (-2 - -5) - (110 + -117 + (-3 - -8))? 13 What is the value of 1 - ((-12 - -5) + (4 - 2)) - 85? -79 What is -11 + 11 + (-1 + -2 - (-4 + 4))? -3 What is -14 + -22 + (-6 - -34) + -10 + 65? 47 What is the value of 17 + (1 - 23 - (-294 - -293))? -4 Evaluate 13 + (-52 + -36 - -152). 77 What is the value of 1442 + -1443 - (29 - (1 + 1))? -28 What is 6 + (-73 - -53) + 37? 23 Calculate 0 - 10 - (55 + -88 + 46). -23 2 - -27 - (1 + -2) - (-58 - (-474 + 405)) 19 What is (-73 - -50 - (7 + -1)) + 11? -18 3 + -4 - 3 - 67 - (16 + -25 + 13) -75 What is the value of -36 -	{ "pile_set_name": "DM Mathematics" }