|
--- |
|
license: apache-2.0 |
|
--- |
|
|
|
## ICMA version of galactica-125M for molecule captioning task (Mol2Cap) for paper "Large Language Models are In-Context Molecule Learners" |
|
|
|
#### Notice: The input should contain 2 context examples and the cutoff length should be set to 2048 to ensure best performance. |
|
|
|
A simple inference example: |
|
``` |
|
from transformers import AutoModelForCausalLM |
|
|
|
model = AutoModelForCausalLM.from_pretrained("phenixace/ICMA-Galactica-125M-M2C") |
|
|
|
from transformers import AutoTokenizer |
|
tk = AutoTokenizer.from_pretrained("phenixace/ICMA-Galactica-125M-M2C") |
|
|
|
from transformers import GenerationConfig |
|
text = """Generate a caption for the molecule: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CCC4=O)C |
|
Caption: The molecule is a 3-oxo Delta(4)-steroid that is androst-4-ene carrying three oxo-substituents at positions 3, 11 and 17. It has a role as an androgen, a human urinary metabolite, a marine metabolite and an EC 1.1.1.146 (11beta-hydroxysteroid dehydrogenase) inhibitor. It is a 3-oxo-Delta(4) steroid, a 17-oxo steroid, an androstanoid and an 11-oxo steroid. It derives from a hydride of an androstane. |
|
|
|
Generate a caption for the molecule: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]4([C@H]3CC[C@@H]4C(=O)CO)C |
|
Caption: The molecule is an 11-oxo steroid that is corticosterone in which the hydroxy substituent at the 11beta position has been oxidised to give the corresponding ketone. It has a role as a human metabolite and a mouse metabolite. It is a 21-hydroxy steroid, a 3-oxo-Delta(4) steroid, a 20-oxo steroid, an 11-oxo steroid, a corticosteroid and a primary alpha-hydroxy ketone. It derives from a corticosterone. |
|
|
|
Based on the above examples, analyse the similarities and differences between the examples and finally generate a caption for the molecule: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2C(=O)C[C@]\\4([C@H]3CC/C4=C/C(=O)OC)C.""" |
|
generation_config = GenerationConfig( |
|
do_sample=True, |
|
temperature=0.7, |
|
top_p=0.85, |
|
top_k=40, |
|
num_beams=1, |
|
repetition_penalty=1.0, |
|
pad_token_id=0, |
|
) |
|
inputs = tk(text, return_tensors="pt", return_token_type_ids=False) |
|
outputs = model.generate(**inputs, return_dict_in_generate=True, output_scores=True, num_return_sequences=1, max_new_tokens=256, generation_config=generation_config) |
|
|
|
# decode |
|
decoded = tk.decode(outputs.sequences[0], skip_special_tokens=True) |
|
print(decoded) |
|
``` |
|
|
|
Paper Link: https://arxiv.org/abs/2403.04197 |