Datasets:

totally-not-an-llm
/

PileV2-axolotlformat-smallmix

Dataset card Viewer Files Files and versions Community

Split (1)

train · 23k rows

text stringlengths 0 13M
Calculate the lowest common multiple of 14 and 2. 14 Calculate the smallest common multiple of 8 and 18. 72 What is the smallest common multiple of 24 and 30? 120 What is the common denominator of -61/116 and -11/174? 348 What is the lowest common multiple of 568 and 48? 3408 What is the least common multiple of 242 and 132? 1452 Calculate the smallest common multiple of 16 and 954. 7632 Calculate the common denominator of -1/22 and -79/2. 22 Calculate the least common multiple of 2891 and 3. 8673 What is the smallest common multiple of 11 and 9? 99 What is the lowest common multiple of 390 and 18? 1170 Calculate the lowest common multiple of 44 and 281. 12364 Calculate the common denominator of 15/484 and 41/352. 3872 Find the common denominator of -33/76 and -137/24. 456 What is the common denominator of -3/40 and -1/5956? 59560 Calculate the lowest common multiple of 360 and 760. 6840 What is the common denominator of 95/22 and 13/134? 1474 Calculate the lowest common multiple of 420 and 70. 420 What is the common denominator of 81/10 and 2/5? 10 Calculate the least common multiple of 27 and 22029. 198261 What is the lowest common multiple of 36 and 10988? 98892 Calculate the smallest common multiple of 40 and 45. 360 What is the lowest common multiple of 50 and 10? 50 What is the common denominator of 83/184 and 95/24? 552 Calculate the common denominator of -99/8 and -23/8. 8 Calculate the common denominator of 41/1928 and 63/10. 9640 Calculate the common denominator of -95/482 and -111/10. 2410 Calculate the common denominator of 40/3 and -8/411. 411 What is the lowest common multiple of 108 and 87? 3132 Find the common denominator of 73/118 and -69/14. 826 Calculate the common denominator of 3/464 and -17/580. 2320 What is the common denominator of 97/18 and 97/50? 450 Calculate the least common multiple of 410 and 656. 3280 Calculate the common denominator of -139/84 and -37/42. 84 What is the smallest common multiple of 10724 and 8? 21448 What is the least common multiple of 218 and 9? 1962 Calculate the common denominator of 29/30 and 91/30. 30 What is the smallest common multiple of 274 and 78? 10686 Calculate the common denominator of 107/30 and 81/280. 840 What is the least common multiple of 96 and 28? 672 Calculate the common denominator of 121/36 and -52/63. 252 Find the common denominator of -203/330 and 3/7. 2310 Calculate the common denominator of -87/256 and -149/768. 768 What is the least common multiple of 315 and 35? 315 What is the lowest common multiple of 70 and 35? 70 What is the least common multiple of 129 and 228? 9804 What is the common denominator of -5/832 and -27/208? 832 What is the common denominator of 2/1847 and 29? 1847 Find the common denominator of -57/20 and -97/236. 1180 What is the least common multiple of 354 and 590? 1770 Calculate the common denominator of -107/54 and -1/27. 54 Calculate the common denominator of 37/77 and -99/10. 770 Calculate the lowest common multiple of 639 and 33. 7029 Calculate the common denominator of 25/396 and -19/2. 396 Calculate the smallest common multiple of 150 and 42. 1050 Calculate the smallest common multiple of 10621 and 39. 31863 Calculate the least common multiple of 63 and 402. 8442 What is the least common multiple of 132 and 44? 132 What is the least common multiple of 24 and 70? 840 What is the least common multiple of 760 and 40? 760 Calculate the least common multiple of 14 and 264. 1848 Calculate the common denominator of 89/180 and -14/81. 1620 Calculate the common denominator of -46/93 and -23/209. 19437 What is the common denominator of 19/1496 and -73/1122? 4488 What is the common denominator of 18/425 and 31/425? 425 What is the common denominator of -101/128 and -3/16? 128 What is the common denominator of -2/15 and -53/24? 120 What is the common denominator of -149/30 and 13/1050? 1050 What is the common denominator of -45 and 26/113? 113 What is the common denominator of 59/120 and -71/192? 960 What is the lowest common multiple of 4200 and 8? 4200 Find the common denominator of 35/396 and 41/68. 6732 What is the common denominator of 89/208 and 77/234? 1872 What is the least common multiple of 112 and 26? 1456 Calculate the lowest common multiple of 26 and 9. 234 Find the common denominator of 10/143 and -21/44. 572 Calculate the smallest common multiple of 1824 and 96. 1824 Calculate the common denominator of 58/303 and 57/4. 1212 What is the lowest common multiple of 6948 and 2? 6948 Find the common denominator of -25/36 and -41/576. 576 Calculate the common denominator of -103/222 and 25/124. 13764 Calculate the smallest common multiple of 24 and 462. 1848 Calculate the lowest common multiple of 5820 and 48. 23280 What is the common denominator of 67/4 and -13/992? 992 Calculate the smallest common multiple of 972 and 4860. 4860 What is the common denominator of -35/1514 and -85/16? 12112 Calculate the lowest common multiple of 840 and 720. 5040 What is the common denominator of 5/5106 and 37/6? 5106 What is the common denominator of 91/10 and -71/34? 170 Find the common denominator of 32/61 and -63/16. 976 Find the common denominator of -113/36 and 1/10. 180 Calculate the smallest common multiple of 166 and 20. 1660 What is the smallest common multiple of 30 and 22? 330 Calculate the lowest common multiple of 50 and 1800. 1800 Calculate the common denominator of 3/373 and -44. 373 Find the common denominator of -17/46 and 71/2. 46 Calculate the lowest common multiple of 117 and 18. 234 Calculate the common denominator of 77/72 and -145/1422. 5688 Calculate the least common multiple of 1010 and 1010. 1010 What is the least common multiple of 9 and 72? 72 What is the common denominator of 19/9 and 71/2442? 7326 What is the common denominator of 39/3142 and -77/10? 15710 Calculate the common denominator of 83/147 and 69/35. 735 Calculate the lowest common multiple of 270 and 10. 270 Find the common denominator of 3/10 and 31/725. 1450 What is the smallest common multiple of 18990 and 24? 75960 Find the common denominator of 49/121 and -65/99. 1089 What is the common denominator of 73/196 and -3/98? 196 What is the smallest common multiple of 175 and 1050? 1050 What is the smallest common multiple of 22 and 1384? 15224 Calculate the smallest common multiple of 220 and 1080. 11880 What is the least common multiple of 20 and 300? 300 Calculate the lowest common multiple of 1300 and 11. 14300 What is the common denominator of 30/53 and 67/2? 106 Calculate the common denominator of 17/3 and 97/10. 30 What is the smallest common multiple of 12 and 16? 48 Calculate the common denominator of 137/30 and 77/195. 390 Find the common denominator of 24/629 and -41/7. 4403 What is the smallest common multiple of 168 and 672? 672 What is the lowest common multiple of 100 and 30? 300 Calculate the common denominator of -9/16 and -59/32. 32 Calculate the smallest common multiple of 280 and 440. 3080 Calculate the common denominator of -53/70 and -5/7. 70 What is the least common multiple of 16 and 48? 48 Calculate the common denominator of 2/749 and -47/2889. 20223 Find the common denominator of -25/203 and -111/56. 1624 What is the smallest common multiple of 1127 and 4? 4508 What is the least common multiple of 450 and 55? 4950 Calculate the least common multiple of 328 and 10. 1640 What is the common denominator of -49/27 and 26/1449? 4347 Calculate the lowest common multiple of 156 and 78. 156 What is the smallest common multiple of 198 and 90? 990 Find the common denominator of 19/124 and -65/6. 372 What is the smallest common multiple of 494 and 684? 8892 Calculate the lowest common multiple of 168 and 231. 1848 What is the lowest common multiple of 24 and 6168? 6168 Calculate the smallest common multiple of 20 and 165. 660 What is the common denominator of -89/46 and 67/828? 828 What is the least common multiple of 64 and 256? 256 Calculate the lowest common multiple of 36 and 14124. 42372 Calculate the smallest common multiple of 90 and 72. 360 Find the common denominator of 13/5 and 75/448. 2240 What is the least common multiple of 36 and 60? 180 What is the lowest common multiple of 110 and 806? 44330 Calculate the common denominator of 81/3620 and -5/22. 39820 Calculate the common denominator of -49/66 and -82/33. 66 Find the common denominator of 37/10 and -5/251. 2510 What is the common denominator of 17/10 and 27/3070? 3070 Calculate the lowest common multiple of 80 and 640. 640 Find the common denominator of 93/20918 and -101/2. 20918
What is the nearest to -4/3 in -0.4, 21/46, 5, 1/24? -0.4 Which is the closest to 5/2? (a) 11.84 (b) 1 (c) -5/4 (d) 56 b Which is the closest to -159? (a) -2 (b) -9842 (c) 8 a Which is the nearest to 3/10? (a) 1 (b) -2/3 (c) -39 (d) 36 (e) 73 a What is the nearest to -1 in -4, -2/29, -993, 179? -2/29 Which is the closest to -4.5? (a) 9 (b) -0.1 (c) -2/19 (d) 67 (e) 1 c What is the closest to -0.1 in 15, -5, 190, 0.2, 123, -2/7? -2/7 Which is the nearest to 0.1? (a) 0.6 (b) 28 (c) 0.054 (d) 5 (e) -0.233 c What is the closest to 1/3 in -2/19, 17, 1/6, 0.081, 8? 1/6 Which is the nearest to -66? (a) -16 (b) 1/10 (c) -25044 a Which is the nearest to 8/3? (a) -0.4 (b) 3 (c) 344 (d) -0.5 (e) -0.08 b Which is the nearest to -1/4? (a) -2/15 (b) 5 (c) -8 (d) -2/5 (e) -368 a What is the closest to -3/12610 in -2, -246, 2, -0.1? -0.1 Which is the closest to -1/4? (a) -15 (b) 2846 (c) -0.12 c Which is the nearest to 9? (a) 4 (b) -2 (c) 99 (d) -7/2 a What is the closest to 2 in -6, 1/5, -47, -914, 2/9? 2/9 Which is the nearest to 0.1? (a) -3/14 (b) -5 (c) -514 (d) 4 (e) 0 e What is the closest to -0.645 in -0.3, 20, 1/2, -1, 1.4, 1? -0.3 What is the closest to -5/6 in 1/9, 0.2, 10, -5/8, -0.3, 1/2? -5/8 What is the closest to -2/21 in -1, -36, -5/3, -4/3, 352? -1 What is the closest to 0.06 in 53728, -1/2, -0.1, -1? -0.1 Which is the closest to 9? (a) 0 (b) 154 (c) -1/3 (d) 3 (e) -1 (f) 1/2 d What is the nearest to 3 in -1/4, 4, -10643921? 4 What is the nearest to 40 in 2, 10699, -128? 2 Which is the nearest to -0.3? (a) 26 (b) 43/4 (c) 0.5 (d) -0.2 d What is the nearest to -31 in 222, 3/8, 46, -3? -3 Which is the closest to 631? (a) -32 (b) -0.2 (c) 1/3 (d) 0.46 (e) 2/21 d Which is the nearest to 0.019? (a) 9/4 (b) -2 (c) -3 (d) -11 (e) 0.01 e Which is the closest to -6? (a) 3 (b) -0.1 (c) -0.09 (d) 8 (e) -1.7 e What is the nearest to -1 in -5/2, 0.066954, -2/9? -2/9 Which is the closest to -1? (a) 8/9 (b) 3 (c) -0.7 (d) -0.3 (e) 0.926 c What is the closest to -17 in -0.3, 7, 2/13, -0.12, 4, 2/65? -0.3 Which is the nearest to -1/108? (a) -12 (b) 1/26 (c) 0.1 (d) 195 b Which is the closest to 39/55? (a) -1 (b) -62360 (c) -0.5 c Which is the nearest to -3.14? (a) 2 (b) -3.23 (c) -4 (d) 5 (e) -3 b Which is the closest to 0? (a) 0.1 (b) -2/17 (c) 3/22 (d) 49 (e) -2 a Which is the nearest to 37/583? (a) -11 (b) -0.3 (c) -1/4 (d) -0.2 (e) 0.5 d What is the nearest to 0.2 in 0.7, -6/13, -3, 44395? 0.7 What is the closest to -0.9 in 89, -0.03, 0.2, -27/7? -0.03 What is the closest to 2642 in -2/13, -1, -2/9? -2/13 Which is the closest to -271? (a) 2 (b) 0.5 (c) -21/17 c Which is the nearest to 42.3? (a) 5 (b) 0.5 (c) 0.4 (d) 0 (e) -1.188 a Which is the nearest to 4? (a) -234 (b) -0.4 (c) 3 (d) -18/385 c What is the nearest to 634 in 0.1, 25, 62, -1/2? 62 Which is the closest to -1? (a) 5/2 (b) -0.3 (c) 7.07 (d) -1.4 d Which is the closest to 1? (a) -0.2 (b) -4 (c) -160 (d) 4 (e) -5968 a What is the closest to 0.07 in -4, 120, -5, 376, 0, -2/9? 0 Which is the nearest to 1? (a) 0.5 (b) -3/2 (c) 0 (d) 5.8 (e) -443 a Which is the closest to 478? (a) -2/5 (b) 1795 (c) -2/7 c What is the closest to -116 in 0.05, -56, 0, 1? -56 Which is the nearest to -2/21? (a) -0.12 (b) -1.28 (c) 0.4 (d) 495 a What is the nearest to -1/109 in 1, 3615, 144? 1 Which is the nearest to -67.8? (a) 5/3 (b) -2/7 (c) -2/23 (d) 3 (e) -135 e What is the closest to -24071143 in 5, -2/15, -2, -3? -3 Which is the closest to -33? (a) 0.5 (b) 310 (c) -181 (d) -2 d What is the nearest to -2/297 in 43, 1/3, -9.7? 1/3 What is the nearest to 0 in 3998, 111/4, 2/9, 0.9? 2/9 Which is the nearest to 0.5? (a) -2 (b) 313 (c) 2/4877 (d) -4 c Which is the nearest to -0.9? (a) 2/7 (b) -3644/65 (c) 1 a What is the nearest to 6.1 in 16033, 53, -2/7? -2/7 Which is the nearest to 31? (a) -142 (b) -1/28 (c) 0 (d) -4 c What is the closest to 0.1 in 236, -5, -0.1, 6.092, 3? -0.1 What is the closest to 70 in -3/25, 1/2, 4, -1/16, 3? 4 Which is the nearest to 0? (a) 1 (b) -2 (c) 873 (d) 1/10 (e) 52 (f) 4 d Which is the closest to 0.2? (a) 53 (b) -0.11 (c) -958 (d) 2/5 d Which is the closest to 207.586? (a) -8 (b) 9 (c) 1 (d) -2 b What is the nearest to -3/2 in 0.1, -68, 4/7, -31, -10? 0.1 What is the closest to 2/3 in 5, -1.6, 2/5, 45, -2.62? 2/5 What is the closest to 2/3 in -63103, 5, -2/39, 0.4, -4? 0.4 Which is the nearest to -0.2? (a) -10/11 (b) -325 (c) -3 (d) 9 (e) 0.3 e Which is the nearest to 1/3? (a) -5 (b) -2 (c) -2/101 (d) -18979 (e) 0 e Which is the nearest to 1/5? (a) 28 (b) 4 (c) -0.29 (d) 1.54 (e) -1/8 e Which is the closest to 1928? (a) 0.5 (b) -2 (c) -14/9 (d) -2/3 (e) -4 a Which is the closest to 44.4? (a) -1/10 (b) 4 (c) 10 (d) 0.2 c What is the closest to 1/5 in 0.2, 41, 1/9, 123.2? 0.2 Which is the nearest to 0.1? (a) 0.2 (b) 2/13 (c) 210534 b Which is the nearest to 1? (a) -2/3955 (b) -2 (c) -7 (d) 0.2 d Which is the closest to -81? (a) 16 (b) 2 (c) -3 (d) 2/77 (e) 3 c Which is the closest to -135/8? (a) -4.3 (b) 5 (c) -2/15 (d) 0.3 a Which is the nearest to 8/101? (a) -0.3 (b) 2/3 (c) 105 (d) 17 (e) 0 (f) 5 e Which is the nearest to -114? (a) -36 (b) -2/57 (c) -3/5 (d) -1/6 (e) 0.2 a What is the nearest to -0.042 in 1/5, -5, 2/264309? 2/264309 What is the nearest to 18/1369 in 0.4, 20, -3? 0.4 What is the nearest to -1 in -13, 31, 2/7, 1/2, -2/5, -1/121? -2/5 What is the closest to 17 in 4, -54, -2/7, 22, 2/27? 22 What is the nearest to -4/7 in -4, 6.0728, 2/3? 2/3 Which is the closest to -5871? (a) 0.5 (b) 0 (c) -0.3 (d) 1/54 (e) -2 e Which is the closest to 3? (a) -31431 (b) -3/2 (c) -2 (d) 4 d Which is the closest to 1? (a) -14586 (b) 2 (c) -1/14 b What is the closest to -1/2 in 4/5, 0.4, 47, 1, -3.274, -1/8? -1/8 Which is the closest to -0.02? (a) -0.3 (b) 15 (c) 13 (d) -346 a Which is the nearest to 16? (a) 0.00239 (b) 0.2 (c) -2/23 b Which is the closest to -0.3? (a) -3/163 (b) -571 (c) 5 a What is the nearest to -1/3 in 4/318177, 3/5, 0.2, 2/5, 0? 0 Which is the nearest to -4.3? (a) -9 (b) 8 (c) 0.093 c What is the closest to 0.1 in 3, 11, 3/5, -129, -47? 3/5 Which is the nearest to 0.2? (a) -1224 (b) -1 (c) 103 (d) 3/7 d What is the nearest to 8/7 in 1/3, 0.1, 8/69, 4/109? 1/3 Which is the closest to -22554? (a) 2/3 (b) 2/11 (c) 0.27 b What is the closest to 32 in -0.009673, -2, -2/649? -2/649 What is the nearest to -1 in 0.6, -1/4, -50160? -1/4 Which is the nearest to -1/2? (a) -12/809 (b) -2/3 (c) -14 (d) 1/6 (e) 0.05 b What is the nearest to 0.3 in -3/63742, 2/3, -3/4? -3/63742 What is the nearest to -1/3 in -5, 0.1, 105041, -1? 0.1 Which is the closest to 172? (a) -3/7 (b) -3/157 (c) 0.3 (d) 4 (e) 0.5 d Which is the closest to -0.4? (a) -14 (b) -2 (c) -2/3 (d) -2/11 (e) 426/5 d What is the nearest to -4/9 in 3, -3564, -5, 0.3, -7/4? 0.3 What is the closest to -1/3 in -113, 10, -2/9, 17, 0.057? -2/9 Which is the closest to 0.1? (a) 109/2 (b) 7/4 (c) 9 (d) 0.1 (e) 0.3 d Which is the nearest to 0.04? (a) -0.0707 (b) 0.4 (c) 5 (d) 1/6 (e) -1/2 a What is the closest to 3930 in -1/3, 1, 1/7, -2, -1? 1 What is the closest to 3/2 in 0.5, 77, 9, 2/5, -0.7? 0.5 What is the nearest to -0.17 in 6, 334/15, -2, 2? -2 Which is the nearest to -13? (a) -0.0641 (b) -25 (c) 13 (d) 0.2 b Which is the nearest to 8386? (a) -3 (b) -1 (c) -5 (d) -1/5 d What is the closest to 1 in 0.4, 2/11, 6/161, -8, 6? 0.4 Which is the closest to 1? (a) -1.65 (b) 1132 (c) -3/4 c Which is the closest to -6219? (a) -2 (b) -0.1 (c) -5 (d) -0.26 c Which is the nearest to 2? (a) 732007 (b) -25 (c) -1 (d) -2/7 d What is the closest to -0.1 in 0.1, -2, -0.1, 13, -0.904? -0.1 Which is the closest to 412? (a) 3 (b) -0.9 (c) 100 (d) -3 (e) 4 (f) -2 c Which is the closest to 0.1? (a) -2 (b) 0.047583 (c) -7/3 b Which is the closest to 1/3? (a) -109 (b) -5/4 (c) -0.1 c What is the closest to -1 in 3, -152, -8, -0.45? -0.45 What is the nearest to 0.99 in 1282, -0.5, -8? -0.5 Which is the closest to -2? (a) 0.2 (b) 1/4 (c) 6/49 (d) 1101 c What is the closest to -1317262.1 in -5, 0, 5? -5 What is the closest to -5107 in -0.05, 4, -186? -186 Which is the nearest to 0.1? (a) -4 (b) -2 (c) 1869 (d) -0.5 d What is the closest to -10/21 in 0.8, 0.33, -2, 3? 0.33 Which is the nearest to -0.1? (a) -78 (b) -1885 (c) 10 c
Calculate the remainder when 154 is divided by 139. 15 Calculate the remainder when 3381 is divided by 242. 235 What is the remainder when 44687 is divided by 9? 2 Calculate the remainder when 17801 is divided by 10. 1 Calculate the remainder when 3335 is divided by 787. 187 Calculate the remainder when 131163 is divided by 11921. 32 Calculate the remainder when 78354 is divided by 419. 1 Calculate the remainder when 13066 is divided by 1641. 1579 Calculate the remainder when 8881 is divided by 279. 232 Calculate the remainder when 117906 is divided by 551. 543 What is the remainder when 879606 is divided by 28? 14 Calculate the remainder when 23990 is divided by 3943. 332 Calculate the remainder when 10048 is divided by 910. 38 Calculate the remainder when 3005 is divided by 1479. 47 Calculate the remainder when 435 is divided by 180. 75 What is the remainder when 733 is divided by 163? 81 Calculate the remainder when 5898 is divided by 114. 84 Calculate the remainder when 63836 is divided by 268. 52 What is the remainder when 31198 is divided by 200? 198 What is the remainder when 240194 is divided by 1005? 1004 What is the remainder when 13321 is divided by 1902? 7 What is the remainder when 748607 is divided by 669? 665 What is the remainder when 762124 is divided by 28? 20 What is the remainder when 417117 is divided by 29794? 1 What is the remainder when 7924 is divided by 1970? 44 What is the remainder when 3964 is divided by 1882? 200 Calculate the remainder when 7286 is divided by 909. 14 Calculate the remainder when 16529 is divided by 271. 269 Calculate the remainder when 31994 is divided by 421. 419 What is the remainder when 556297 is divided by 595? 567 Calculate the remainder when 7807 is divided by 37. 0 What is the remainder when 85016 is divided by 230? 146 Calculate the remainder when 1294 is divided by 39. 7 Calculate the remainder when 11900 is divided by 1698. 14 Calculate the remainder when 5825 is divided by 324. 317 Calculate the remainder when 65416 is divided by 146. 8 What is the remainder when 24535 is divided by 269? 56 Calculate the remainder when 4249 is divided by 291. 175 What is the remainder when 8201 is divided by 24? 17 Calculate the remainder when 3457 is divided by 29. 6 What is the remainder when 251 is divided by 251? 0 What is the remainder when 1036 is divided by 888? 148 What is the remainder when 5273 is divided by 865? 83 What is the remainder when 8423 is divided by 355? 258 What is the remainder when 27777 is divided by 22? 13 Calculate the remainder when 7411 is divided by 1079. 937 Calculate the remainder when 4038 is divided by 366. 12 Calculate the remainder when 775095 is divided by 289. 286 Calculate the remainder when 17105 is divided by 17105. 0 Calculate the remainder when 4513 is divided by 110. 3 What is the remainder when 710456 is divided by 236815? 11 Calculate the remainder when 32102 is divided by 1182. 188 What is the remainder when 5133 is divided by 2555? 23 What is the remainder when 3751 is divided by 695? 276 What is the remainder when 13720 is divided by 12? 4 Calculate the remainder when 59654 is divided by 187. 1 Calculate the remainder when 559 is divided by 81. 73 Calculate the remainder when 3108 is divided by 990. 138 Calculate the remainder when 369524 is divided by 203. 64 What is the remainder when 23630 is divided by 1573? 35 Calculate the remainder when 27367 is divided by 130. 67 What is the remainder when 70835 is divided by 167? 27 Calculate the remainder when 46905 is divided by 701. 639 Calculate the remainder when 33356 is divided by 8. 4 Calculate the remainder when 3939 is divided by 1105. 624 Calculate the remainder when 11358 is divided by 160. 158 Calculate the remainder when 4038 is divided by 1333. 39 What is the remainder when 96343 is divided by 5659? 140 Calculate the remainder when 3648 is divided by 1118. 294 Calculate the remainder when 18803 is divided by 144. 83 Calculate the remainder when 29402 is divided by 196. 2 What is the remainder when 1160312 is divided by 21? 20 Calculate the remainder when 30715 is divided by 59. 35 What is the remainder when 1969 is divided by 34? 31 What is the remainder when 5890 is divided by 400? 290 Calculate the remainder when 176835 is divided by 673. 509 Calculate the remainder when 23564 is divided by 3. 2 Calculate the remainder when 3430 is divided by 1692. 46 Calculate the remainder when 860 is divided by 427. 6 Calculate the remainder when 32324 is divided by 16096. 132 Calculate the remainder when 19954 is divided by 259. 11 What is the remainder when 40706 is divided by 79? 21 What is the remainder when 32934 is divided by 30? 24 What is the remainder when 1265 is divided by 160? 145 Calculate the remainder when 6425 is divided by 267. 17 Calculate the remainder when 4739 is divided by 2257. 225 Calculate the remainder when 3141 is divided by 30. 21 What is the remainder when 7983 is divided by 52? 27 Calculate the remainder when 3922 is divided by 992. 946 Calculate the remainder when 54294 is divided by 18096. 6 Calculate the remainder when 7200 is divided by 55. 50 Calculate the remainder when 1324 is divided by 539. 246 What is the remainder when 16967 is divided by 67? 16 Calculate the remainder when 3438 is divided by 64. 46 Calculate the remainder when 4544 is divided by 182. 176 Calculate the remainder when 12310 is divided by 4097. 19 Calculate the remainder when 144201 is divided by 6866. 15 Calculate the remainder when 15927 is divided by 15916. 11 What is the remainder when 537 is divided by 36? 33 Calculate the remainder when 36137 is divided by 38. 37 Calculate the remainder when 1296826 is divided by 376. 2 Calculate the remainder when 5665 is divided by 2652. 361 Calculate the remainder when 1228 is divided by 147. 52 What is the remainder when 2872 is divided by 67? 58 What is the remainder when 185370 is divided by 33? 9 Calculate the remainder when 3859 is divided by 149. 134 What is the remainder when 86495 is divided by 32? 31 What is the remainder when 4243162 is divided by 274? 272 Calculate the remainder when 253640 is divided by 179. 176 What is the remainder when 1136690 is divided by 20? 10 Calculate the remainder when 78068 is divided by 71. 39 Calculate the remainder when 61453 is divided by 60. 13 Calculate the remainder when 3434 is divided by 75. 59 Calculate the remainder when 18024 is divided by 5997. 33 What is the remainder when 155000 is divided by 346? 338 Calculate the remainder when 171250 is divided by 233. 228 What is the remainder when 3709 is divided by 155? 144 Calculate the remainder when 20345 is divided by 20298. 47 What is the remainder when 5522 is divided by 17? 14 What is the remainder when 6977 is divided by 34? 7 Calculate the remainder when 4291 is divided by 4267. 24 What is the remainder when 110959 is divided by 10? 9 What is the remainder when 201213 is divided by 1863? 9 What is the remainder when 164247 is divided by 8? 7 Calculate the remainder when 112789 is divided by 7049. 5 What is the remainder when 7400 is divided by 7105? 295 What is the remainder when 8766 is divided by 612? 198 What is the remainder when 723 is divided by 179? 7 What is the remainder when 799039 is divided by 79? 33 Calculate the remainder when 4464 is divided by 151. 85 Calculate the remainder when 11706239 is divided by 560. 559 Calculate the remainder when 4462 is divided by 265. 222 What is the remainder when 981556 is divided by 53? 49 What is the remainder when 362397 is divided by 453? 450 What is the remainder when 2963 is divided by 57? 56 What is the remainder when 11019 is divided by 5496? 27 Calculate the remainder when 2271 is divided by 794. 683 Calculate the remainder when 44728 is divided by 63. 61 What is the remainder when 37861 is divided by 12562? 175 What is the remainder when 235976 is divided by 76? 72 Calculate the remainder when 225021 is divided by 75006. 3 Calculate the remainder when 6638 is divided by 34. 8 What is the remainder when 169608 is divided by 83? 39 Calculate the remainder when 2514 is divided by 30. 24 Calculate the remainder when 206963 is divided by 6898. 23 What is the remainder when 6092 is divided by 185? 172 Calculate the remainder when 5653 is divided by 564. 13 Calculate the remainder when 85052 is divided by 48. 44 Calculate the remainder when 137277 is divided by 27423. 162 What is the remainder when 364823 is divided by 12? 11 What is the remainder when 15751 is divided by 267? 265 What is the remainder when 142170 is divided by 632? 602
Let q be 6-455/(-40). Let a = q + -27. Factor 3 - a - 222z - 300z*2 + 282z. -3(10z - 1)*2 Let o be 3 - (-403 - -2 - 72/24). Suppose 411g = og + 8. Factor -4/7h + 2/7hg + 0. 2h(h - 2)/7 Let s(z) be the third derivative of z5/60 + 1553z*4/12 + 2411809z*3/6 + 26z2 - z + 1. What is n in s(n) = 0? -1553 Let v(f) be the second derivative of f5/300 - f*4/20 + 3f*3/10 + 139f*2/2 - 32f - 1. Let n(m) be the first derivative of v(m). Factor n(z). (z - 3)*2/5 Suppose 41904/13h*2 - 4038/13h*3 + 152/13h*4 - 120960/13h + 82944/13 - 2/13h5 = 0. Calculate h. 1, 3, 24 Let l be (((-8)/3)/((-2)/9))/(-12 + 18). Factor 3w + 0 + 6/7wl. 3w(2w + 7)/7 Let y(m) be the third derivative of 0m5 + 0m + m*2 + 1/1344m*8 + 0m*4 + 1/240m*6 + 0m*3 + 24 - 1/280m*7. Find r such that y(r) = 0. 0, 1, 2 Factor -5x*2 + 470x + 6493x - 6658580 + 2075x + 935x + 1567x. -5(x - 1154)2 Let f(l) be the first derivative of 1/6l*5 + 1/45l*6 - 8/3l*2 + 1/3l*4 - 2 - 4/9l*3 - l. Let q(s) be the first derivative of f(s). Factor q(n). 2(n - 1)(n + 2)3/3 Let 57/5x*2 + 6x + 0 - 3/5x4 + 24/5x*3 = 0. Calculate x. -1, 0, 10 Let i(a) be the first derivative of 15a*4/8 - 43a*3/2 + 78a*2 - 72a + 4424. Factor i(b). 3(b - 4)2(5b - 3)/2 Factor 5n*4 + 107 - 68n*2 - 3n*4 + 2n*4 + 133 + 26n*3 - 2n*4 - 104n. 2(n - 2)2(n + 2)(n + 15) Let x(j) be the third derivative of j6/480 - 31j*5/240 - 65j*4/96 - 11j*3/8 + 28j*2 - 3j + 3. Factor x(p). (p - 33)(p + 1)2/4 Let p be 90/675 - -15758/15. Factor -18700 + 12288n - 29273 - 83099 + 4n*3 - pn*2. 4(n - 32)*3 Let v = 197512 + -987527/5. What is l in 3/5l*2 + vl + 6 = 0? -10, -1 Let z(o) be the first derivative of -4/3o3 + 70 + 0o + o*4 + 2/3o*2 - 4/15o*5. Factor z(h). -4h(h - 1)3/3 Suppose 0 = -x + 5 - 2. Let d be (-17 - -4)(-536)/19162. Let 10/11q2 - 8/11q*x + 0 - dq + 2/11q4 = 0. Calculate q. 0, 1, 2 Let z(s) be the first derivative of -s6/45 + 4s*5/75 + 8s*4/5 + 64s*3/45 - 256s*2/15 - 10563. Let z(f) = 0. Calculate f. -4, 0, 2, 8 Let n(k) be the second derivative of -2k7/105 - k6/5 + 3k5/5 + 7k*4/3 + 52k*2 - 77k + 2. Let i(v) be the first derivative of n(v). Factor i(y). -4y(y - 2)(y + 1)(y + 7) Suppose 0 - 5/4s4 + 0s - 1/4s3 + 5/4s*2 + 1/4s*5 = 0. What is s? -1, 0, 1, 5 Let d(k) = 9k - 24. Let c be d(3). Suppose 32 = 4b - cn, -3n + 32 = 38b - 34b. Factor -b + 8/3v - 2/9v2. -2(v - 6)2/9 Let g(v) be the third derivative of v8/84 - 23v7/105 + 9v*6/10 + 29v*5/30 - 49v*4/6 - 16v*3 + 7v2 + 54. Determine x so that g(x) = 0. -1, -1/2, 2, 3, 8 Let s(y) = y2 + y + 2. Let v(u) = -4u2 + 91u - 67. Let p(r) = 44s(r) + 4v(r). Determine w so that p(w) = 0. -15, 3/7 Let j(u) be the third derivative of 8u7/525 - 14u*6/25 + 159u*5/25 - 208u*4/15 + 66u*3/5 - 2508u*2. Solve j(h) = 0. 1/2, 9, 11 Let k be (-294)/126(-1)/91. Let r(g) be the second derivative of -1/273g7 + 0g*2 + 2/195g*6 + 1/39g*3 + 0 + 15g - kg4 + 0g*5. Factor r(i). -2i(i - 1)3(i + 1)/13 Let k(h) = -5h5 - 15h*4 - 3h*3 + 15h*2 - 8h. Let p(a) = 6a5 + 17a*4 + 2a*3 - 15a*2 + 10a. Let x(s) = -5k(s) - 4p(s). Factor x(t). t*2(t - 1)(t + 3)(t + 5) Let k(m) = -30m - 418. Let s(b) = 87b + 1254. Let u(q) = -17k(q) - 6s(q). Let y be u(-35). Factor 6/7ry + 8/7 - 24/7r + 10/7r3. 2(r - 1)(r + 2)(5r - 2)/7 Let p(j) be the first derivative of -j6/24 + j5/5 - 183. Find i such that p(i) = 0. 0, 4 Suppose -286 = -5k + 5z - 2z, -4z - 47 = -k. Let h = k - 56. Solve 2o*4 - 22o*2 + 36o + 6o3 - 6o*h - 14 - 2 = 0. -4, 1, 2 Let i(z) = 2z4 - z3 + 14z2. Let c = -396 - -391. Let h(v) = -3v*4 - 15v*2. Let x(p) = ch(p) - 6i(p). Factor x(w). 3w*2(w - 1)(w + 3) Let m = -2513 - -2513. Let r(j) be the first derivative of 0j*2 + mj - 5/2j4 + j5 + 5/6j*6 - 1 + 0j*3. Factor r(q). 5q*3(q - 1)(q + 2) Let w(c) be the third derivative of 0c + 1/120c6 + 74c*2 + 0c*3 + 1/30c*5 + 0 - 1/8c*4. Factor w(p). p(p - 1)(p + 3) Let n(s) = s3 + s2 + 9s + 25. Suppose 4l + 2 = -3a, -2a = l - 72 + 70. Let p be n(l). Solve 98/5o + 2/15op + 686/15 + 14/5o*2 = 0 for o. -7 Suppose 3j = -2y + 14, -j = 2y - 6 - 0. Suppose 15d2 + 9d*2 + 3d*4 - 144 - 19d*3 + 96d - d*3 - jd3 = 0. Calculate d. -2, 2, 6 Let w(f) be the third derivative of -f6/30 - 38f5/15 + 30f*4 + 336f*3 + 6915f*2. Let w(h) = 0. Calculate h. -42, -2, 6 Suppose -298201k + 298326k = 250. Let -18/5 - 116/5l*k + 74/5l - 26/5l4 + 84/5l*3 + 2/5l5 = 0. What is l? 1, 9 Let m(z) = z4 + 32z3 - 37z*2 - 72z + 2. Let r(w) = 3w4 + 95w*3 - 111w*2 - 217w + 7. Let q(u) = 7m(u) - 2r(u). Find s such that q(s) = 0. -35, -1, 0, 2 Let r(h) be the third derivative of -h*7/175 - 17h*6/150 + 4h*5/25 - 699h*2. Let r(d) = 0. What is d? -12, 0, 2/3 Let p(h) = -34h*2 - 382h + 3806. Let n(o) = 12o2 - 6o - 2. Let u(s) = -6n(s) - 2p(s). Factor u(l). -4(l - 190)(l - 10) Let h(z) be the second derivative of 0z3 + 5 - 2/21z*7 - 4z + 0z2 + 0z*6 + 3/5z*5 - 2/3z4. Find p such that h(p) = 0. -2, 0, 1 Let n(m) be the second derivative of m7/105 + m*6/20 - 49m*2/2 + 3m - 1. Let g(y) be the first derivative of n(y). What is c in g(c) = 0? -3, 0 Factor 16/5g + g2 - 1/5g*3 - 16. -(g - 5)(g - 4)(g + 4)/5 Let p(k) be the second derivative of -k7/6300 - 2k*6/675 - 31k*3/6 - 4k + 17. Let f(q) be the second derivative of p(q). Factor f(r). -2r2(r + 8)/15 Let c(b) be the second derivative of b*5/330 + 17b*4/132 + 10b*3/11 + 29b*2/2 + b - 2. Let h(s) be the first derivative of c(s). Factor h(z). 2(z + 2)(z + 15)/11 Let c(l) = -l5 - l4 + l2 + l - 1. Let o(i) = -164i*5 + 1227i*4 - 1182i*3 - 481i*2 + 450i + 155. Let u(j) = 5c(j) + o(j). What is d in u(d) = 0? -5/13, 1, 6 Let l = -93 - -101. Let m(j) be the first derivative of 3/7j*4 + 26/21j*3 - l + 8/7j + 12/7j2 + 2/35j5. Find c such that m(c) = 0. -2, -1 Let q(r) = r2 - 8r + 9. Let u(i) = 3i*2 - 1. Let b be u(2). Let m be q(b). Factor -2v + mv3 - 16v*3 - 24v*3. 2v(v - 1)(v + 1) Let r = 163430 - 163425. Suppose 3m + m = 0. Determine d so that 2/3d*r + 0 + 0d*2 - 4/3d*4 + 0d + md3 = 0. 0, 2 Find w such that 219w*2 - 5w*4 - 74w*2 - 38w*2 - 72w*2 - 10w*3 - 20w = 0. -4, 0, 1 Let j(d) be the first derivative of 121/2d - 108 + 1/6d*3 - 11/2d2. Factor j(z). (z - 11)2/2 Let u = 127 + -103. Determine d, given that 8d3 + 20d*4 - 34d*4 + 2d*5 + 8d*2 + 8d*3 + ud*2 = 0. -1, 0, 4 Let y(n) be the first derivative of -40n*3/3 + 3115n*2/6 + 130n/3 - 1923. Factor y(z). -5(z - 26)(24z + 1)/3 Let t = 0 + 2. Let f(o) = o2 - 895o - 6314. Let n be f(-7). Suppose 0it - 1/4i*4 + 0i*3 + ni + 0 + 1/4i5 = 0. What is i? 0, 1 Let h be ((-2)/6)/(2225/(-5340)). Factor hy*3 + 12/5y*2 - 16/5y + 0. 4y(y - 1)(y + 4)/5 Let r(u) be the third derivative of -11/8u*4 + 1/2u*5 + 0u*3 + 2u*2 + 0 + 32u + 1/40u6. Factor r(f). 3f(f - 1)(f + 11) Suppose -2u = -3o - 14, 186u - 187u + 7 = 5o. Let -14/5f*2 + 6/5f - 2/5f4 + o + 2f*3 = 0. What is f? 0, 1, 3 Suppose 5i = 16w - 86, 18 - 32 = -i - 2w. Find u such that -1/4ui - 11/2u + 23/4 = 0. -23, 1 Let g(w) be the second derivative of -w*7/21 - 2w*6/3 + 18w*5/5 - 19w*4/3 + 13w*3/3 - 2079w. Factor g(x). -2x(x - 1)*3(x + 13) Suppose 4710q - 1611 = 4709q. Let r = -1611 + q. Factor r + 1/4n2 - 5/2n. n(n - 10)/4 Let d = 1539/4450 - 29/89. Let g(b) be the second derivative of 1/75b*6 + 0 + 0b*2 - 1/30b*4 + db*5 - 29b - 1/15b3. Factor g(h). 2h(h - 1)(h + 1)*2/5 Let u = -329/60 + 409/60. Determine q, given that 2/3q*2 - 2q + u = 0. 1, 2 Let b(q) be the third derivative of -3q8/28 + 127q*7/21 - 2683q*6/30 - 138q*5 - 54q4 + q2 - 13q - 95. Solve b(o) = 0. -1/2, -2/9, 0, 18 Let m(y) = -5y - 42. Let z be m(-10). Solve 40t2 - 4t*4 + zt - 13t2 + 6t*3 - 2t*5 - 11t*2 + 0t2 = 0. -2, -1, 0, 2 Let m(s) = -s3 - 55s2 + 162s - 111. Let z(l) = -l*3 - 55l*2 + 160l - 110. Let k(w) = -6m(w) + 5z(w). Factor k(a). (a - 2)(a - 1)(a + 58)
Collect the terms in 6w2 - 104w*3 + 237w*3 - 129w*3. 4w*3 + 6w*2 Collect the terms in -3016p - 69p2 + 67p*2 + 3017p. -2p2 + p Collect the terms in 17i - 17i - 2737i*2. -2737i*2 Collect the terms in -56x + 132908 - 132908. -56x Collect the terms in -1531s*2 + 738s*2 - 746s*2 - 6 + 4 + 2s. -1539s2 + 2s - 2 Collect the terms in -1300u - 3964u + 1174u + 1. -4090u + 1 Collect the terms in 3 - 53 - 1 - 2m2 + 51. -2m*2 Collect the terms in -4195u*3 - 2714u*3 + 883u*3 - 3615u*3. -9641u*3 Collect the terms in 0o - 56o + 82o + 76o. 102o Collect the terms in -19086c - 16487c - 4774c. -40347c Collect the terms in -4j - 40965j*3 + 3j + 40992j3. 27j*3 - j Collect the terms in 16 + 58v - 14v2 + 10 - 58v. -14v2 + 26 Collect the terms in -1038q*3 - 2115q3 + q2 - q*2. -3153q*3 Collect the terms in -22y - 3 - 1 - 28y + 139y. 89y - 4 Collect the terms in 49b*2 + 54b*2 + 57b*2 - 223b*2 + 57b*2. -6b*2 Collect the terms in -7 - 124y + 522y + 16 - 9. 398y Collect the terms in 16896b2 + 1 + 3b + 3b - 6b. 16896b2 + 1 Collect the terms in -5286 + g2 + 20g*3 + 5286. 20g3 + g2 Collect the terms in -913r2 + 216r*2 - 185r*2 - 412r*2. -1294r*2 Collect the terms in 5728y*2 + 4953y*2 - 3134y*2. 7547y*2 Collect the terms in -1173j + 4j2 + 2370j - 1197j - 6j*2. -2j*2 Collect the terms in -57 - 18186l*3 + 57 - 3l*2 + 3l*2 + 18188l*3. 2l*3 Collect the terms in 8k - 19k + 10k*2 + 9k + 11k2. 21k*2 - 2k Collect the terms in -540422d2 + 3d - 3d. -540422d*2 Collect the terms in 964 - o - 964 + o - 2369o*3. -2369o*3 Collect the terms in 335r - 335r + 941r*2. 941r*2 Collect the terms in 1 - 17 + 22 - 24o + 1 - 4. -24o + 3 Collect the terms in -13 + 70v + 2 + 5 + 6 - 73v. -3v Collect the terms in 20474s2 + 20493s*2 - 40968s2. -s2 Collect the terms in -1021t2 - 1023t*2 + 2040t2 + t3 + 29t3. 30t*3 - 4t*2 Collect the terms in 27 - 13 + 2213l - 14. 2213l Collect the terms in -5 + 1 + 7 + 8 - 7 + k. k + 4 Collect the terms in -70766 - 18p - 96p + 70766. -114p Collect the terms in -6837y + 13779y - 6935y. 7y Collect the terms in -86u + 29 - 14u - 29 + 3u. -97u Collect the terms in -8i3 + 9i*2 - 25 + 1 + 24. -8i*3 + 9i*2 Collect the terms in -1064k*2 - 46 + 531k*2 + 46 + 529k*2. -4k*2 Collect the terms in -6g*3 + 2g*3 + 28g*2 + 9g*3 + 8g*3. 13g*3 + 28g*2 Collect the terms in -15z + 14 + 27 - 58 + 16. -15z - 1 Collect the terms in 5230f - 5230f - 94f*3. -94f*3 Collect the terms in -176l - 3272 + 3272. -176l Collect the terms in 2150698s - 4301390s + 2150704s. 12s Collect the terms in 4 + 5 + 17g*2 + 0 - 15 + 3. 17g*2 - 3 Collect the terms in -2g*2 + 2835g + 11g2 - 2835g. 9g2 Collect the terms in -271r*2 - 105r*2 + 126r*2 - 104r*2. -354r*2 Collect the terms in 720h + 26 + 638h + 459h. 1817h + 26 Collect the terms in -5232r*2 - 5936r*3 + 5232r*2. -5936r*3 Collect the terms in 82g + 100g + 91g - 370g + 83g. -14g Collect the terms in -73210 - 5c*2 + 7c*2 + 73210 - 6c*2. -4c*2 Collect the terms in 4767j - 4723j + 7777j + 11048j. 18869j Collect the terms in 1 + 36m + 0 - 41m - 1 + 3m. -2m Collect the terms in 124b3 + 102b*3 + 226b*3 - 390b*3 + 102b*3. 164b*3 Collect the terms in -530j*3 + 184j*3 - 351j*3. -697j*3 Collect the terms in 308k - 308k - 1 + 2740k*2. 2740k*2 - 1 Collect the terms in -470l*2 - 50 + 154 - 104. -470l*2 Collect the terms in 35a*2 + 2455a*3 - 2442a*3 - 35a*2. 13a*3 Collect the terms in 5 - 5 + 175242l. 175242l Collect the terms in -13h*2 + 2 - 13 + 5h*2 + 11. -8h*2 Collect the terms in -4d*2 - 1745d*3 + 4d*2 + 1766d*3. 21d*3 Collect the terms in 2s + 11s - 11s - 945. 2s - 945 Collect the terms in -7331851 + 7331851 - 96n*2. -96n*2 Collect the terms in 105o - 2 - 202o + 113o. 16o - 2 Collect the terms in -66c*3 - 6c2 + c2 + 64c3 + 4c*2 - 170c. -2c3 - c2 - 170c Collect the terms in 101l2 - 340l*2 - 3l*3 + 0l*3 + 154l*2 + 149l*2. -3l*3 + 64l*2 Collect the terms in -33639m*3 - 33632m*3 - 33637m*3 + 134546m*3 - 33635m*3. 3m*3 Collect the terms in 290z*2 + 1078z*2 - 32z*2. 1336z*2 Collect the terms in 201463 - 201463 - 61s*2. -61s*2 Collect the terms in 10q - 5q + 2q*3 - 16 - 5q. 2q3 - 16 Collect the terms in 4s + 41804 - 41804 - 4s - 2s*3. -2s*3 Collect the terms in -1 + 5 - 2348k*2 - 4 - k. -2348k*2 - k Collect the terms in 90l*3 - 421 + 302 - 93l*3. -3l*3 - 119 Collect the terms in 9l - 10 - 7 + 0 + 12. 9l - 5 Collect the terms in 524 - 1582 - 4c + 514 + 524. -4c - 20 Collect the terms in -152j + 64j + 87j + 1506. -j + 1506 Collect the terms in 133969m2 + 85m*3 + 54m*3 - 133969m*2. 139m*3 Collect the terms in 832x*2 - 1725x*2 - 2726x*2. -3619x*2 Collect the terms in 30 - 45 - 51y*2 - 46y*2 + 15. -97y*2 Collect the terms in 0b + 21b + 2b - 21b. 2b Collect the terms in -733r2 + 252r*2 + 231r*2 + 251r2. r2 Collect the terms in 5 - 26719q - 6 + 1 + 26661q. -58q Collect the terms in -48r*3 + 5r*3 + 17r*3 - 28r*3. -54r*3 Collect the terms in -23275p + 69849p - 23280p - 23292p. 2p Collect the terms in 3 + 4462594i3 - 4462595i3 - 3. -i3 Collect the terms in -7923 + 3962 + 162i2 + 3961. 162i2 Collect the terms in 2457119 + 2457126 - g3 - 4914245. -g*3 Collect the terms in -2n - 290 + 600 - 46. -2n + 264 Collect the terms in 33n - 79n + 22 + 45n. -n + 22 Collect the terms in -814i2 + 334i*2 + 291i*2 + 256i*2. 67i*2 Collect the terms in -344r + 113r + r2 + 231r. r*2 Collect the terms in 2u - 2092 + 2147 - u. u + 55 Collect the terms in 546 - 1204 + 658 - 16r2. -16r*2 Collect the terms in -9587o*3 - 9584o*3 + 19147o*3. -24o*3 Collect the terms in -7j - 21j2 - 45j - 42j + 94j. -21j2 Collect the terms in 4 + 9 - 20 - 5r - 1 + 8. -5r Collect the terms in 8s - 59s + 12s + 25s + 23s. 9s Collect the terms in 101p*3 - 24p*3 - 27p*3 - 22p*3 - 1508 - 30p*3. -2p*3 - 1508 Collect the terms in -1183p*2 + 2400p*2 - 1175p*2. 42p*2 Collect the terms in -421u*2 + 421u*2 + 2183u*3 + 4u. 2183u3 + 4u Collect the terms in 4m3 + 30m*3 - 2m - 53m3. -19m*3 - 2m Collect the terms in -2497s3 - 2500s*3 - 2506s*3 - 2501s*3 - 2483s*3 + 12534s*3. 47s*3 Collect the terms in 51 + 34 - 30j*2 - 21j*2. -51j*2 + 85 Collect the terms in 223w - 611w - 51w*3 + 224w + 166w. -51w*3 + 2w Collect the terms in -63j2 + 175j*2 - 14j*2 - 60j*2 - 56j*2. -18j*2 Collect the terms in -7c*2 + 83 + 0c*2 - 36 - 45. -7c*2 + 2 Collect the terms in 24j - 35j3 - 28j*3 - 20j. -63j3 + 4j Collect the terms in -42l2 + 2l + 17l2 + 4l*3 - 17l*2 - 19l*2. 4l*3 - 61l*2 + 2l Collect the terms in -13697k3 + 21 - 20 + 13587k*3. -110k*3 + 1 Collect the terms in 44 - 219a - a*2 + 219a. -a*2 + 44 Collect the terms in 4v*2 - 60v - 34v - 4v2 - v2. -v*2 - 94v Collect the terms in -102p + 218p + 81p + 249p. 446p Collect the terms in 9202q*2 - 5q + 0q + 5q. 9202q2 Collect the terms in 7 + 3 - 9w - 8 - 56w. -65w + 2 Collect the terms in -12q + 2914909 + q - 2914909. -11q Collect the terms in -4r - 20r + 29r + 21r + 18r. 44r Collect the terms in -444a - 311a - 204a. -959a Collect the terms in -444d3 - 437d*3 + 1334d*3 - 443d*3. 10d*3 Collect the terms in -4 + 6492b + 4 + 0. 6492b Collect the terms in 860 - i2 - 1680 - 22i + 22i + 820. -i2 Collect the terms in 3529a + 2a2 - 1767a + 43a3 - 1762a. 43a3 + 2a*2 Collect the terms in 456d*2 + 12 - 30d + 12d - 9 + 18d. 456d2 + 3 Collect the terms in d + 97d*3 - 875d*2 + 875d*2. 97d*3 + d Collect the terms in -2343 + 2343 + 153g*2. 153g*2 Collect the terms in 473g*3 - 108g*3 - 376g*3. -11g*3 Collect the terms in 345s*2 - 36s*2 - 30s*2. 279s*2 Collect the terms in 14x*2 - 10x - 11x2 - x2 - 12x. 2x2 - 22x Collect the terms in 701 + 695 + 698 - 3r2 - 2094. -3r*2 Collect the terms in -18b*2 - 43b*2 + 104b*2 - 12b*2 - 11b*2. 20b*2 Collect the terms in 324p*2 + 1 - 562p*2 - 1 + 269p*2. 31p**2
What is the nearest to -6 in 15, 0.4, -4/3, -12/5, -3? -3 Which is the nearest to -0.2? (a) -35 (b) 3 (c) -4 (d) 6/13 (e) -3 d What is the closest to -12/41 in 0.3, -0.5, -10561? -0.5 Which is the nearest to 29? (a) -5/6 (b) -16/7 (c) 5 (d) 90/17 d What is the closest to -5535 in -30/481, 2, -2, -4? -4 What is the closest to -2/82441 in -23, 0.2, 0.5, -1/3? 0.2 Which is the closest to 7? (a) 0.826 (b) -3/2 (c) -5 (d) 32 a Which is the closest to -18? (a) 0.1 (b) -254 (c) -2.14 (d) 0.5 c What is the nearest to 0 in -84, 4, 1, 0, -1/18, -705? 0 Which is the closest to 1? (a) 24 (b) 5.7 (c) -4 (d) -3 (e) 2/27 e What is the nearest to 2/7 in 13, -2176.2, -1/8? -1/8 Which is the nearest to 3? (a) 0.1 (b) 0.4 (c) 4/5 (d) 175 (e) 5 e What is the nearest to 0.067 in 2/13, 0, -5, -0.7, -0.1425? 0 What is the nearest to -0.04 in 0.3974, 0.2, 3, -100, -3? 0.2 Which is the closest to -306.113? (a) 3/4 (b) 0.3 (c) 1 (d) -5 d Which is the nearest to 0.5? (a) 3 (b) -770/9 (c) -0.048 (d) 0.3 d What is the closest to 0.1 in 5, -189, 16, 57, 1? 1 What is the nearest to -5.1 in -0.25, -677, 0.3? -0.25 What is the nearest to 1/4 in 1/2, -8, 1.1, -0.08, 27/4, 1/248? 1/248 What is the closest to -35/6 in -1/6, 0.06, 1, -1? -1 Which is the nearest to 1? (a) 3 (b) -38/5 (c) -25535 a Which is the nearest to -2/7? (a) 0.55 (b) -1933 (c) 1 (d) -1 (e) -3 (f) 0.11 f Which is the nearest to -222? (a) -1.1 (b) 1/8 (c) -739 a What is the closest to 0 in 8, 0, 10, 3, -1/236? 0 What is the nearest to 5 in 2, 3, 661996, 4, -0.1? 4 What is the nearest to -0.1 in -3, 3, 64482, -14, 2/13? 2/13 Which is the nearest to -6/77? (a) 142 (b) 4 (c) -0.8 c Which is the nearest to -20767? (a) 2/9 (b) 2/3 (c) 3/40 c What is the nearest to 37 in 1/4, 6, -0.1276, -0.02, 5? 6 Which is the closest to 996/5? (a) -0.4 (b) 1 (c) 6 c Which is the nearest to 0.1? (a) 7 (b) 4 (c) 0.9 (d) -1228 c What is the nearest to -1/498 in -2, -0.4, -0.068, 71? -0.068 What is the nearest to 138/103 in 2576, 0.4, -0.5? 0.4 What is the nearest to 69 in -0.6, 0.2, 4, -2739? 4 Which is the closest to -0.02628? (a) -4 (b) 1/30 (c) -12/7 (d) 2/11 b What is the closest to 2 in 0.3, 3, 7016/5, 0.12, -4, 11/3? 3 What is the nearest to 1 in -1/385, 0.4, -3/11, 449? 0.4 What is the nearest to -11 in 0.0885, 11/6, 0.5? 0.0885 Which is the nearest to -36? (a) 1/8 (b) -1 (c) 8 (d) 3 (e) 29 b What is the closest to 35 in -2/5, -4521, -2, 4/3? 4/3 Which is the nearest to 8? (a) 1/3 (b) -37 (c) -5 (d) 2 (e) 1/5 (f) 40 d What is the closest to 0 in -5/3513, -5, 0, -0.05? 0 What is the nearest to -0.13 in 105, -12.18, 0.2? 0.2 Which is the nearest to 1? (a) -0.67 (b) 3/4 (c) 247 (d) -243 b Which is the nearest to 0.1? (a) 4 (b) 4/3 (c) -4/9 (d) 15 (e) -203 c Which is the closest to 2/15? (a) -3 (b) -1/31 (c) 112 (d) 1/3 (e) 27 b What is the closest to 0.7 in 1/2, 2, 2/9, -0.25, 4, 0.1817? 1/2 Which is the closest to 43? (a) 5 (b) 2 (c) -2 (d) 0.2 (e) 128 (f) 12 f Which is the nearest to -1? (a) -0.08 (b) -11/6 (c) 0.31 (d) 82 b What is the nearest to 140 in 3, 0.53, 0.1, -4, 4? 4 What is the nearest to 3/5 in 6, -29, 1, 1564, 3? 1 What is the nearest to 1/4 in -3444, -0.1, 2.3, 5? -0.1 Which is the nearest to -2/3? (a) 8 (b) 6/2377 (c) -0.25 c What is the nearest to -2/7 in 324, -29, -1/13, -1/5? -1/5 What is the nearest to 1/7 in -12, 271, -4, 2/11, -581, -0.3? 2/11 Which is the nearest to -2? (a) 2/3 (b) 0.06 (c) 5 (d) 1/3 (e) -16779 (f) -2/33 f Which is the closest to 1? (a) 3102 (b) 1 (c) -0.5 (d) -2.78 b Which is the nearest to -0.06? (a) 58/9 (b) -3 (c) 1/7 (d) 6 (e) -0.2 e What is the closest to -0.1 in -8, 4/3, -7, -3, -640? 4/3 Which is the closest to 1240? (a) -4 (b) -26 (c) -0.2 (d) -0.4 (e) 4 e What is the nearest to -12 in -79.9, 620, -0.2, -2/3, 1/2? -2/3 Which is the closest to -2/13? (a) 46 (b) -4 (c) 14 (d) 3 (e) -49 d What is the closest to 100 in -0.1, 11, -7/8, 0.5, -1/28? 11 What is the closest to -4 in 7528, 3.23, -2/15? -2/15 Which is the nearest to -5? (a) 3/101 (b) 0 (c) -3 (d) 1/2 (e) 10 (f) 0.02 c Which is the closest to -1? (a) -44383 (b) -2/53 (c) 1 b Which is the nearest to 1/6764? (a) -1/9 (b) -3 (c) 2/7 (d) 1/51 (e) -0.3 d What is the nearest to -20 in 5, -1699, -0.4, -0.1? -0.4 Which is the nearest to -0.3? (a) 0.7 (b) 130/297 (c) 45 b Which is the nearest to 8/247? (a) -0.6 (b) 4/3 (c) -3 (d) 11 (e) -0.1 e Which is the closest to 235? (a) -1 (b) -0.5 (c) 5 (d) 0.1249 c Which is the closest to 1? (a) -23 (b) 0.06 (c) 8.2 (d) -2/13 b Which is the closest to -0.4? (a) 7.7 (b) 17 (c) -4 (d) -17 (e) 2/3 (f) 5 e What is the nearest to -0.16 in -2014.2, 4, 2/5, -5? 2/5 What is the closest to -1/4 in -5, 44, -3, -18/5? -3 What is the nearest to -2/7 in -1/4, 6, 1/2, 1766, 2/19? -1/4 What is the closest to 0 in 4/3, 33.69557, 0? 0 What is the closest to -70 in -6, -24/11, -4, 0.1, 0, 5? -6 Which is the closest to -2/9? (a) -10/273 (b) -1/3 (c) -2.19 b Which is the nearest to 126? (a) -5 (b) -31.967 (c) -4 (d) -0.5 (e) 0.1 e What is the nearest to -60 in 39/3439, 4, -0.3? -0.3 Which is the closest to 1543? (a) -5/6 (b) -19 (c) 0 (d) -4/9 (e) -103 c What is the nearest to 0 in -1/5, 0.5, -32, 51/10, 4, -3.8? -1/5 What is the closest to -1 in -1/3, 3.1, 1/22, 1/4? -1/3 What is the closest to 0.23 in 4, 9/8, -13? 9/8 What is the nearest to 4 in 20, 2/11, -24.5, 3, 4? 4 What is the nearest to 30/13 in 1/3, -0.1, -0.1346, -5? 1/3 What is the closest to -101 in -1160, -0.01, -3? -3 What is the nearest to -1 in -154, 0.09, 0, 3, 24.8? 0 What is the nearest to 2/9 in 3, -1/1690, -319.7? -1/1690 Which is the nearest to 23910? (a) -10/3 (b) -4 (c) 3/8 c What is the nearest to 4 in 5045, 0.2, 0.1, 0? 0.2 Which is the closest to 1337? (a) 0.02 (b) -0.3 (c) -77 a Which is the nearest to 2/5? (a) -33 (b) -3/7 (c) 0 (d) -234 c Which is the closest to -16? (a) -1/6 (b) -0.01 (c) 62 (d) -4/5 d What is the closest to -1 in 0.6, 1, -2/7, 16/11, -10? -2/7 Which is the nearest to 1? (a) 2/3 (b) 3/23 (c) -701/4 a Which is the nearest to 1902? (a) 9 (b) 3/35 (c) 0.053 a What is the nearest to -17 in 1, -1, 4, -186, 0, -2? -2 What is the nearest to 3 in -0.2, 1916, 0.5, -1/3, -56? 0.5 What is the closest to -15 in -3, -2063, 114/7? -3 What is the nearest to 22 in -2/9, 0.785, -1.7? 0.785 What is the nearest to -1/35 in -76, 0.4, -4, -251? 0.4 What is the closest to 8 in 6/11, 82, -225, 1? 1 Which is the nearest to 2/37? (a) -2/7 (b) 5292/29 (c) 1 a What is the nearest to -4/853 in 2, -3/5, 0.138, -0.5? 0.138 Which is the closest to 2? (a) -0.1 (b) -266/25 (c) -456 (d) -1/5 a What is the closest to -4 in 3, -17/101, 2/7, -0.1, -0.5, 0.5? -0.5 What is the nearest to -3 in -37, -1/7, -9.87, 3, -34? -1/7 What is the closest to -10.3 in -0.5, 21.27, 0? -0.5 What is the closest to -98509 in -1, -4, 2, 3? -4 Which is the closest to 0? (a) -0.13 (b) 5 (c) 8067 (d) 3 (e) -0.1 e What is the nearest to -2/5 in 0, 4/7, -0.5, 0.1, -2/47, 6530? -0.5 What is the closest to 3/64 in 0, -0.1, 230/11, -0.5, 0.4? 0 What is the nearest to 7 in -13/10, 5, 1/3, -26, -3/13? 5 Which is the nearest to -22/41? (a) 0.7 (b) 2/3 (c) -0.069 c What is the nearest to 1 in 2, -2/5, 775, -142? 2 What is the nearest to -0.05 in -17.70076, 1/2, 4? 1/2 Which is the closest to -0.4? (a) 0.2 (b) 0 (c) -3 (d) 1262 (e) 2 (f) -0.04 f Which is the nearest to 67? (a) 6 (b) 5 (c) 459.16 (d) 4 a Which is the closest to 2? (a) -2 (b) -53/4 (c) -10 (d) 78 a Which is the nearest to -110/29? (a) -2 (b) 10 (c) -5 (d) 2 c What is the nearest to 2 in 186, 0, 12, 3/11? 3/11 Which is the nearest to -23? (a) -1/8 (b) 0.3 (c) 16 (d) -361 (e) -1/5 e What is the closest to 0 in 6, -2.993, -321/2? -2.993 What is the closest to -52 in 2/7, -1/8, -11, -2, 15, 1/4? -11 What is the closest to -12 in -1, -23646, -2/15? -1 What is the closest to -1/2 in -0.12, 5/3, -98, 4/3, 0.3, -0.061? -0.12 What is the closest to 4/7 in -2/5, 0.0129, 0, -2/3, 7? 0.0129 Which is the nearest to 1/4? (a) 1 (b) 2/3 (c) -0.099799 c Which is the closest to -0.1? (a) 0.1 (b) 3/4 (c) 2 (d) -80 (e) 1/48 e What is the closest to -0.1 in -0.1, 0.1, 5, 35302, -3/7? -0.1 What is the nearest to -4052409 in 0, -2, -5/3, -1? -2 What is the nearest to -2/127 in 14839, -3, -0.5, 3/4? -0.5 Which is the closest to -1? (a) 3 (b) 0.4 (c) 12 (d) 461 (e) -0.4 e
Calculate -1097326464 divided by 182887744. -6 -3976280 divided by 4 -994070 Divide 26431057 by 6. 26431057/6 Calculate 118 divided by -87675. -118/87675 -10311660 divided by -2062332 5 -106892 divided by 4 -26723 Calculate 1226 divided by -184414. -613/92207 Divide 5 by -10672126. -5/10672126 What is -373576 divided by 195? -373576/195 Calculate -230598 divided by 10026. -23 Divide -75654720 by -5. 15130944 What is -724738 divided by -362369? 2 Divide 17082752 by 3. 17082752/3 Divide -79909520 by 2. -39954760 111717288 divided by 6206516 18 Calculate -152803966 divided by 7. -21829138 1217661 divided by 405887 3 Calculate 1680089 divided by 4. 1680089/4 5420046 divided by 6 903341 Divide -41 by -602222. 41/602222 Divide -20667930 by 55410. -373 297905818 divided by -438742 -679 Divide -5692288 by -28. 203296 1178709 divided by -505 -1178709/505 Divide 5716938 by 1. 5716938 Calculate 7905 divided by 2680. 1581/536 What is -12014597 divided by 3? -12014597/3 -60675480 divided by -49410 1228 Calculate -68666085 divided by 738345. -93 5 divided by -28919532 -5/28919532 What is 2145660 divided by -13004? -165 Calculate -169633 divided by 3998. -169633/3998 Calculate -16418204 divided by -418. 39278 1 divided by -250047050 -1/250047050 Calculate 287100 divided by -877. -287100/877 What is 16554720 divided by -24635? -672 Divide 268792286 by -9. -268792286/9 Divide 82581070 by -40205. -2054 Divide 5 by -14125042. -5/14125042 What is 3459299 divided by 189? 3459299/189 24443200 divided by -5 -4888640 What is 10291464 divided by 36? 285874 19 divided by 13752 19/13752 Divide 134 by 29021. 134/29021 Divide -2475996 by -26913. 92 -29610812 divided by -1397 21196 Calculate 38597447 divided by 49. 787703 Divide -1959881 by -25453. 77 -2216772 divided by -6 369462 6 divided by 4208045 6/4208045 Divide -357540 by -16. 89385/4 What is 503 divided by 70571? 503/70571 What is -6 divided by 12149426? -3/6074713 What is -331272956 divided by -23? 14403172 Divide -153242080 by -38310520. 4 What is 84619914 divided by 20162? 4197 Divide -67627752 by 8. -8453469 -113508875 divided by -22701775 5 -6246356 divided by 1561589 -4 -114 divided by 1084153 -114/1084153 What is 193265960 divided by 2? 96632980 10 divided by -384477 -10/384477 Calculate -209640915 divided by 5. -41928183 Calculate 36073740 divided by -3006145. -12 Calculate 23861948 divided by 1748. 13651 1111648 divided by 24 138956/3 Divide 210843 by -3. -70281 What is 1 divided by 304753? 1/304753 Calculate -564488529 divided by -33. 17105713 Calculate 127934610 divided by -10. -12793461 What is -395293076 divided by -2? 197646538 What is -3696844 divided by 33916? -109 Calculate 27977190 divided by 27838. 1005 Divide -310 by 31011. -310/31011 Divide -702641 by 17. -702641/17 Divide -66825073 by -13867. 4819 Calculate -4 divided by -15770637. 4/15770637 Divide 315203878 by -157601939. -2 What is -281768190 divided by -853843? 330 -166717330 divided by 166717330 -1 What is 1107094 divided by -4? -553547/2 -2011370 divided by 2 -1005685 Divide -1824216 by -13. 1824216/13 What is 135656 divided by -486? -67828/243 Calculate 15151136 divided by -135278. -112 6353307 divided by 57237 111 Calculate 665591735 divided by -73. -9117695 Divide -88534474 by 5. -88534474/5 -185127352 divided by -46281838 4 What is -42889564 divided by 2? -21444782 What is -6 divided by 26462909? -6/26462909 Divide -1 by -7458093. 1/7458093 Calculate 1873802574 divided by 6. 312300429 Divide 80410255 by 16082051. 5 -21865088 divided by -448 48806 Divide 147358190 by -827855. -178 Calculate -91253040 divided by -11406630. 8 What is -184637760 divided by 4? -46159440 Divide -733765880 by -1. 733765880 What is 127364 divided by 766? 63682/383 -6991510 divided by 5 -1398302 Divide -309096 by -4. 77274 Calculate -27374144 divided by 602. -45472 408213771 divided by 58316253 7 Divide 5064 by -16248. -211/677 What is -19 divided by -12050300? 19/12050300 Calculate 70301596 divided by -1033847. -68 What is 300945 divided by 11? 300945/11 What is -5 divided by 6251365? -1/1250273 What is -1184235 divided by 30365? -39 -3743947 divided by 1 -3743947 What is -5504188 divided by 2752094? -2 -261894079 divided by -2 261894079/2 Calculate 220991420 divided by 44198284. 5 704338453 divided by 1 704338453 What is -39 divided by 21557? -39/21557 Calculate 632412645 divided by 126482529. 5 Calculate 7023062 divided by 2. 3511531 28203368 divided by 2 14101684 What is -71 divided by -8317? 71/8317 54497 divided by 2396 54497/2396 Divide -759661 by 1. -759661 What is 33153 divided by 2137? 33153/2137 What is 40215421 divided by 18? 40215421/18 -1084932 divided by -130 542466/65 Calculate -52885820 divided by -1. 52885820 Divide 35689290 by -209937. -170 What is -910270 divided by 2? -455135 Calculate 5 divided by 36341. 5/36341 Divide 4 by -475268. -1/118817 Calculate 669659256 divided by 114. 5874204 Calculate 265758270 divided by 132879135. 2 Calculate 17984712 divided by -6. -2997452 Divide 2047780 by 2047780. 1 What is 101823152 divided by -1669232? -61 Divide -570029790 by 5. -114005958 288204 divided by -44 -72051/11 Divide 516295 by 104. 39715/8 Calculate -10455404 divided by -2613851. 4 Calculate -29106 divided by -648. 539/12 Divide 5 by -173028. -5/173028 73526041 divided by 853 86197 Divide -3 by -3140885. 3/3140885 Calculate 1199934840 divided by 6521385. 184 267939333 divided by -65367 -4099 What is 174291 divided by 4? 174291/4 Calculate -4 divided by -10082850. 2/5041425 Divide 3009063 by 6. 1003021/2 1273097574 divided by 1698 749763 Divide -1671154770 by -278525795. 6 Calculate -79251 divided by -50. 79251/50 -153564930 divided by -126495 1214 What is -10681200 divided by -890100? 12 Calculate 112946889 divided by 5. 112946889/5 Calculate 5584986 divided by -6633. -842 Calculate 17359054 divided by -6. -8679527/3 24770 divided by 820 2477/82 -42 divided by -395568 7/65928 -12 divided by -23543 12/23543 Calculate 162 divided by 816807. 54/272269 11186684 divided by -18521 -604 Calculate -19523164 divided by -3. 19523164/3 What is 62764139 divided by 1? 62764139 Calculate -9664240 divided by 16. -604015 -98761 divided by 1098 -98761/1098 What is -1444112 divided by -4198? 344 -74675630 divided by -3 74675630/3 530 divided by -23077 -530/23077 6012803022 divided by 3 2004267674 -2 divided by 4445016 -1/2222508 What is 37634160 divided by 10095? 3728 Divide 17156506 by 6707. 2558 What is 18 divided by 1212462? 1/67359 What is -195581250 divided by 28975? -6750 What is 175706451 divided by -19522939? -9 Divide -35386113 by -35386113. 1 -2628 divided by -1360 657/340 4865929 divided by 157 4865929/157 Calculate 15350062 divided by -403949. -38 What is 23959152 divided by -152? -157626 Calculate 12 divided by -288204. -1/24017 Divide 1710 by 641883. 570/213961 What is 1999916 divided by -31? -1999916/31 What is 29789 divided by 55? 29789/55 Divide -3196 by 6819. -3196/6819 Calculate -622965863 divided by -4. 622965863/4 348 divided by 13903 348/13903 Calculate 118961 divided by 669. 118961/669 Divide -16317373 by 23. -709451 -15076585 divided by -191 78935 Calculate 174239942 divided by 739. 235778 Calculate 12708928 divided by 272. 46724 -5516637 divided by -5 5516637/5 What is -13583310 divided by 377? -36030 What is -298 divided by -902525? 298/902525 Divide 1069 by -17017. -1069/17017 What is -98841652 divided by 518? -190814 -3126640 divided by -5 625328 0 divided by -416906543 0 Calculate 814852 divided by -6. -407426/3 Divide 93 by -976555. -93/976555 What is 16868113 divided by -13? -16868113/13 4922955432 divided by 4 1230738858 Divide 1145894400 by -25984. -44100 Divide -84693996 by 9410444. -9 Calculate -4012764 divided by 402. -9982 1071782412 divided by 3 357260804 4 divided by -184297999 -4/184297999 Divide -3596058 by -184. 1798029/92 Divide -318975 by -23. 318975/23 6867 divided by -888 -2289/296 What is -2 divided by 95848021? -2/95848021 Calculate 51339952 divided by -12834988. -4 What is -194 divided by -1501423? 194/1501423 Divide 7446682 by -6. -3723341/3 73408470 divided by 93395 786 Calculate -31571 divided by 75. -31571/75 What is 9017376 divided by -1392? -6478 Divide -101140 by -1848. 25285/462 -11422675 divided by 6259 -1825 -144484116 divided by 20640588 -7 -92324820 divided by 1519 -60780 Divide 20419909 by -709. -28801 What is 2 divided by 7829025? 2/7829025 570827 divided by -10 -570827/10 What is 63994752 divided by -8? -7999344 -1151 divided by 42314 -1151/42314 Calculate 219556 divided by 59. 219556/59 Divide 3878624 by -7948. -488 What is -23469 divided by 119? -23469/119 What is 145430 divided by 1? 145430 Calculate -65844994 divided by -38. 1732763 What is 7537965 divided by -8? -7537965/8
Simplify (z(z/(z/(z(z*7z)/z)))/z)/(z*(7/2)z)(zz*(-1)z)/zzz(-13) assuming z is positive. z(-17/2) Simplify m*(-12)m*(-16)(m/((mm/(m/(m/m(-2/15)mm))mm)/m)m)(-5/6) assuming m is positive. m(-457/18) Simplify (((c/((ccc*3)/ccc))/c(-1/6))(-2/129))(1/24) assuming c is positive. c(29/9288) Simplify (((kkk(k(k/k1)/k)/kk)/k)/(kk(-1/3)))/(k(-15)/(k/((k(-2/15)/k)/k)k)) assuming k is positive. k*(307/15) Simplify (aa(2/13))(-1/11)/(a*33(aa(-9/4))/aa) assuming a is positive. a(-18221/572) Simplify ((c43/c)46)(-24) assuming c is positive. c(-46368) Simplify ((((t/(t(-2/9)/t))/ttt)/t)*(-6)ttt*(-1/10)t*(-2)ttt)12 assuming t is positive. t(-626/5) Simplify m*(-1/13)/mmm0(m(-1/4))(-47) assuming m is positive. m*(607/52) Simplify (jj*0j)*(-28)j*(-1)j/j*4jj assuming j is positive. j(-58) Simplify (ggg/((g/(gg*21))/g)(g33/g)/g)30 assuming g is positive. g1680 Simplify (z/z(-1/14))*(-4/3)/((zz/(z/(z*(-20)/z)z)z)/z18) assuming z is positive. z(256/7) Simplify ((q(1/4))45/(((qq/q*(-2/5)q)/q)/(qqq(5/3))))17 assuming q is positive. q(12767/60) Simplify (h/h(-3/7))(-3/4)/(h/h(3/8)h/h(-1/4)) assuming h is positive. h(-165/56) Simplify ((i/(ii*2)iii(4/5))(8/5))29 assuming i is positive. i(928/25) Simplify (m*(-3)/m(m/(mmmm6))/mm)/(m*4mm(1/17)/m) assuming m is positive. m(-273/17) Simplify ((ppp(7/5))/pp*(8/9))/((p/(p/(((p/(pp*(-4))p)/ppp)/p))p)/pp)(1/6) assuming p is positive. p(103/45) Simplify (h*(8/3)hh(-13)/h)/((h/h(-10))/(h(-1/4)/h)) assuming h is positive. h(-271/12) Simplify ((y(2/5)/(y(-2/3)/y))(5/2))(-2/77) assuming y is positive. y(-31/231) Simplify (b(4/11)/b)(3/2)(b*0b)(-19/2) assuming b is positive. b(-115/11) Simplify (y/(y*42y)(yy(-18/5))/y)(-15/2) assuming y is positive. y342 Simplify (f(-1/15)ff/(ff/(f/(f(ff(2/3))/ff)f)f))/((ff/(fff11)f)/(ff/(f(1/5)/f))) assuming f is positive. f(166/15) Simplify g(-8)gg1g*12g(-1/14) assuming g is positive. g(83/14) Simplify (m9)(3/14)/(m(-12)/(m(-19)/m)) assuming m is positive. m*(-85/14) Simplify ((mm*3/mmm)/(mmm(m/m(8/3))/m))/(m(-3/5)/m(-3/2)) assuming m is positive. m(113/30) Simplify ((p(-1/4)/p)(3/19)(pp1/p)23)32 assuming p is positive. p(13864/19) Simplify (k/(kk/k1k)k/(k/(k(2/35)/kkk)))/(k/k(3/2)k(3/5)) assuming k is positive. k(-3/70) Simplify ((l*0l)/ll)(-6)/(ll/(l/(lll*(-23)))l(-5)/l) assuming l is positive. l20 Simplify ((c(10/13))11)(1/11) assuming c is positive. c(10/13) Simplify ((k*(-1/5)k/(kk(-3/7))k)(-10/11))(27/4) assuming k is positive. k*(-1161/154) Simplify (ff*(-10)f)(-1/16)/(f2)(-5/2) assuming f is positive. f(11/2) Simplify (r/r*4r)*(-21/5)rr(2/75)(rr(-1/3)r)/r assuming r is positive. r*(757/75) Simplify (mmm/m(-21)m)/mm(-4)m((m(-2/5)/m)/m)/m41 assuming m is positive. m(-112/5) Simplify ((u(-8)/u)/u(2/5))/((uu(3/7))/u)3 assuming u is positive. u*(-374/35) Simplify (vv*(5/8)v)/(v*20/vv)(vv20)38 assuming v is positive. v(6245/8) Simplify ((u(1/18)/(u*7u))/(u(-3))(-13/4))(-25) assuming u is positive. u(15925/36) Simplify ((dddd(-2/9)dd2)/(d(-1/4))(13/5))(-26) assuming d is positive. d(-15041/90) Simplify ((aa(-24)/a)/(a/(a(8/3)a)))(-20) assuming a is positive. a(1280/3) Simplify (i(-2/9)/i)/i(2/25)(i/i(-2))/(i13i) assuming i is positive. i(-2768/225) Simplify (((w7w)/((ww/w6)/w))/((wwwwwww/w1www)/w)(33/4))(2/31) assuming w is positive. w(-106/31) Simplify (d(-3))*30(ddd*11/dd)/(d*(-3)dd) assuming d is positive. d(-76) Simplify (cc*(-2/31)/c)/(c((cc(-5))/c)/c)(c(cc19)/c)28 assuming c is positive. c*(17513/31) Simplify ((bb*(-3/11))/bb(8/3))/(b0)21 assuming b is positive. b(79/33) Simplify ((f/(f(-5)/f))/(f/(f/f(-2/41))))/(((ff/((f/(((f/f(-21))/f)/f))/ff)f)/f)/(fff/f13)) assuming f is positive. f(-982/41) Simplify (u5/u)(-12)u*(-10)u(-6) assuming u is positive. u(-64) Simplify (f(f(-5)f)/f)*(5/6)/(ff*(1/4)/fff/(f/(f/((f(-3/5)/f)/f)))fff) assuming f is positive. f(-671/60) Simplify (c(-2/5)/(c/c*(4/7)))/(cc/(((c/c*(2/5))/c)/c)c/(c*(-16)c)) assuming c is positive. c(-708/35) Simplify i(1/14)i(-14)i*(-3)i(3/11) assuming i is positive. i(-2565/154) Simplify ((l*(-1)l)/(l/(l/(l/(ll/(llll/l*(-8))ll)))))/(lll(-9/2)lllll/l(2/3)) assuming l is positive. l(-65/6) Simplify ((b(b/b7)/bbb(3/11))(3/10))(-1/61) assuming b is positive. b(78/3355) Simplify (k11)(2/23)k19/(k(1/16)k) assuming k is positive. k(6953/368) Simplify (k(-2)/k(-9)kk(2/7)k/k(4/3))(-3/10) assuming k is positive. k(-167/70) Simplify v(-1/14)/v*4(v/v(-1/4))(2/17) assuming v is positive. v(-467/119) Simplify q1qq*(7/6)qq(-1/8)qqq(-1/10)/q assuming q is positive. q(593/120) Simplify ((y(-6)/y)/y)(1/4)/(y*(-10)y)(-3/19) assuming y is positive. y(-65/19) Simplify ((j/j14)/(j/((j/(j/j(-2/29)))/j)))/(j(2/13)/(j/(j/j(-2/23)j))) assuming j is positive. j(-141422/8671) Simplify (o/(oo*(6/19)o)o(oo((o*(-3/23)o)/o)/o)/o)/(((oo/(o(o/(o/(o*(-11/4)o)))/o))/o)/oo)(-47) assuming o is positive. o(225149/1748) Simplify (r/r(2/29)r(8/5)/r)/(r(-29)/(rr(-3/11))) assuming r is positive. r(49857/1595) Simplify ((j(-22))(-33))38 assuming j is positive. j27588 Simplify d/d21(d/(ddd/(dd(3/7)d)))/d(dd*10ddd)(7/2) assuming d is positive. d(199/7) Simplify (z(1/3)/z(-3/2))/(z/(((z/z2)/z)/z))(2/43) assuming z is positive. z(425/258) Simplify u(-4)((uuu/u(-1))/u)/u(((u/((u/u*22)/uuu))/u)/u)/u(-8) assuming u is positive. u25 Simplify n(-2/69)nn(1/22)(nn9)(-1/15) assuming n is positive. n(177/506) Simplify ((n(n/(nn/n(1/31)nnn))/nn)/(nn/(n/n14)))/(n13n/n(1/20)) assuming n is positive. n(-19789/620) Simplify (lll/l(-3/13))/(l7/l)(l/l(1/3))(-2/33) assuming l is positive. l(-3616/1287) Simplify (((q/q1qq)/q*(-7))/(qq/(qq(-5))qq/q(-1)))(-26) assuming q is positive. 1 Simplify l(-12)/(l(-4)/l)(l/((l/(l/(ll(-1/2))))/ll))37 assuming l is positive. l(23/2) Simplify ((w/(www*(-3)w)w(-3/7))(-27))(-31) assuming w is positive. w(3348/7) Simplify (a(2/9))(-31)/(a7/((a/(a(a/a*9)/aa))/a)) assuming a is positive. a(-62/9) Simplify l/l(-18)ll/l*7l/l*12ll(-20) assuming l is positive. l(-16) Simplify (p/((pp(((ppp1/ppp)/p)/p)/ppp)/pp))*(4/3)(p/((pp11p)/pp)p)/((pp(-6))/p) assuming p is positive. p(-31/3) Simplify ((rr*(-6)rr(2/3)r)/(((rr(-1/2)/r)/r)/rr/(((r/r*8)/r)/r)r))(-10/11) assuming r is positive. r(325/33) Simplify (ss5)/(s11/s)(s/s2)12 assuming s is positive. s(-16) Simplify p(4/15)pp*14p(pp(-2/15))(-22/7) assuming p is positive. p*(474/35) Simplify (pp(-3/4)/p)10/(p*(-14)p/(p/(p/(pp(-15))p))) assuming p is positive. p*(-19/2) Simplify qqq/(q/q(-2/23))q/q*(-1/14)(q3/q)(-33/4) assuming q is positive. q(-2176/161) Simplify ((p/p(-1/3))/(p(p(p7/p)/p)/p))(1/10) assuming p is positive. p(-7/15) Simplify (((j/(j(3/2)/j)j)/jj(-2/9))/(((j/(j7j))/j)/jj(2/9)/j))(3/8) assuming j is positive. j(181/48) Simplify (x(-1/10))*(-5/4)x*(-23)xx(9/7)x assuming x is positive. x(-1097/56) Simplify (t/t(-2/7)t(-2/21))/((tt*5/t)/(((t/((tt*3)/t)t)/t)/t)) assuming t is positive. t*(-143/21) Simplify (rr*(2/9)r*(-11))/(r/((r/(rrr(2/57)))/r))30 assuming r is positive. r(-17242/171) Simplify (((h(hh(-4/7))/h)/h)/(h/h(2/3)))/(h(-2/5))12 assuming h is positive. h(409/105) Simplify m(-6)m*(-3/13)(m(-1/3))(-39/4) assuming m is positive. m*(-155/52) Simplify gg*(-20)/gg/(gg(5/2)/g)(g/g*(-1/4)g)(-3) assuming g is positive. g(-113/4) Simplify ((f*0ff)/(f(-6)/f))/(f(5/4))(-15) assuming f is positive. f(111/4) Simplify (z(6/7)(z/z(-4))/z)/(z/z(4/3))(1/4) assuming z is positive. z(415/84)
Suppose -51d5 - 10953d*4 + 199644d*3 - 989664d*2 + 979200d - 178176 = 0. Calculate d. -232, 4/17, 1, 8 Suppose -b*2/6 + 3878b/3 - 38755/6 = 0. Calculate b. 5, 7751 Factor o*4/5 - 39008o*3 + 12680265546o*2/5 - 274802488027704o/5 + 274789807957197/5. (o - 65013)*3(o - 1)/5 Factor l*3 - 30l*2 - 103l + 2232. (l - 31)(l - 8)(l + 9) Let 5y2 - 11070y + 22120 = 0. Calculate y. 2, 2212 Let -k*2/4 + 4103k/4 - 3075 = 0. Calculate k. 3, 4100 Find q such that -9q5 + 952q*4 - 1660q*3 - 416q*2 = 0. -2/9, 0, 2, 104 Determine i so that 16i*2/7 - 1684i/7 + 6480/7 = 0. 4, 405/4 Let 9n3/5 + 1806n*2/5 - 6111n/5 + 1836/5 = 0. Calculate n. -204, 1/3, 3 Determine o, given that 34o3/21 + 17008o*2/21 - 4874o/3 + 5692/7 = 0. -8538/17, 1 Factor 2v3/9 + 56v*2/3 + 274v + 660. 2(v + 3)(v + 15)(v + 66)/9 Factor -2s*2/5 + 294s + 1472/5. -2(s - 736)(s + 1)/5 Solve -3o2/7 - 353106o/7 - 10390320603/7 = 0 for o. -58851 Find b such that 6b2/7 + 125952b/7 - 17994 = 0. -20993, 1 Determine b, given that 2b2/3 + 6663b/2 - 2499 = 0. -4998, 3/4 Factor -740l2/3 - 136895l/3 + 925/3. -5(l + 185)(148l - 1)/3 Suppose -2n*2/3 - 4798n/3 - 62036/3 = 0. Calculate n. -2386, -13 Determine l so that l*3 + 296l*2 + 6321l + 11466 = 0. -273, -21, -2 Factor -3d2 - 4524624d + 4524627. -3(d - 1)(d + 1508209) Suppose -5f5 - 100f*4 + 2275f*3 + 33150f*2 - 247500f + 392040 = 0. Calculate f. -22, 3, 18 Suppose 6h4/5 - 1310h*3 - 21892h*2/5 - 8776h/5 + 3504 = 0. Calculate h. -2, 2/3, 1095 Determine p so that 3p2/2 + 10017p/2 - 35133 = 0. -3346, 7 Suppose -3x2 + 5042166x - 2118619830963 = 0. Calculate x. 840361 Let 18r4 + 18824r*3 - 386144r*2 + 2003680r - 426400 = 0. What is r? -1066, 2/9, 10 Suppose -3w5/2 + 27189w*4/2 + 136059w*3/2 - 353673w*2/2 + 95214w = 0. Calculate w. -7, 0, 1, 9068 Factor j*2/2 - 182j + 32683/2. (j - 203)(j - 161)/2 Factor -p3/3 + 89155p*2/3 - 1987554643p/3 + 5960256987. -(p - 44573)*2(p - 9)/3 Factor 3s2 - 18015s - 90150. 3(s - 6010)(s + 5) Suppose v*5/5 - 53v*4/5 + 48v*3 = 0. What is v? 0, 5, 48 Let -24v*4 + 19068v*3 + 1084389v*2/2 + 535041v/2 + 33291 = 0. What is v? -27, -1/4, 822 Factor 512b3 - 109120b*2 + 13634b - 426. 2(b - 213)(16b - 1)2 Suppose 2f*4/3 - 5620f*3/3 + 16816f*2 - 84044f/3 + 39214/3 = 0. Calculate f. 1, 7, 2801 Factor h*5 + 72h*4 + 1841h*3 + 18898h*2 + 53724h - 74536. (h - 1)(h + 7)(h + 22)*3 Suppose 3p*5 - 22023p*4 + 66042p*3 + 12p*2 - 88056p = 0. What is p? -1, 0, 2, 7338 Factor 8n3 + 1700n*2/3 + 3056n/3 + 460. 4(n + 1)(n + 69)(6n + 5)/3 Determine h, given that 6h4/7 - 24h*3 - 1734h*2/7 + 24h + 1728/7 = 0. -8, -1, 1, 36 What is d in d*5/3 + 206d*4 - 2483d*3/3 + 1036d*2 - 1244d/3 = 0? -622, 0, 1, 2 Factor 2b3/13 + 672b*2/13 + 66138b/13 + 1550468/13. 2(b + 34)(b + 151)2/13 Determine a, given that a4 + 1094a3 + 2177a*2 - 7640a + 4368 = 0. -1092, -4, 1 Let 3o2/4 - 108519o/2 = 0. What is o? 0, 72346 Find p, given that -4p4 + 49692p*3 + 248528p*2 + 397680p + 198848 = 0. -2, -1, 12428 What is q in 27q5/7 + 405q*4 + 23067q*3/7 - 24967q*2/7 + 8534q/7 - 960/7 = 0? -96, -10, 1/3 Determine o so that 146o2 - 708o/5 - 22/5 = 0. -11/365, 1 Factor m*3 + 92m*2 - 187m + 94. (m - 1)*2(m + 94) What is q in -2q4/5 + 30484q*3/5 + 60984q*2/5 - 121936q/5 - 243904/5 = 0? -2, 2, 15244 Suppose y*2 + 92462y - 92463 = 0. What is y? -92463, 1 Factor -s*2/8 - 191s/8 - 1016. -(s + 64)(s + 127)/8 Solve 3u*2 - 9348u + 28017 = 0. 3, 3113 Factor 5n2 + 4815n. 5n(n + 963) Factor -p*3/3 + 190p*2/3 + 9812p/3 + 37752. -(p - 234)(p + 22)2/3 Find d such that 4d*4 + 4140d*3 - 12448d*2 + 8304d = 0. -1038, 0, 1, 2 Factor -7084o2/3 + 4o/3. -4o(1771o - 1)/3 Factor 4b*2 - 636b - 4648. 4(b - 166)(b + 7) Determine x so that -x*4/4 - 5707x*3/4 + 11421x*2/4 + 17127x/4 = 0. -5709, -1, 0, 3 Suppose -c*2 - 6294c - 9903609 = 0. Calculate c. -3147 Suppose -2y2/7 - 294996y - 76144810014 = 0. Calculate y. -516243 Let -f*5/3 - 10f*4 - 299f*3/3 - 378f*2 - 576f - 288 = 0. Calculate f. -12, -3, -2, -1 Determine l, given that -2l4/3 - 82l*3 + 2l*2/3 + 82l = 0. -123, -1, 0, 1 What is h in -5h2 - 4300h + 165945 = 0? -897, 37 Suppose -2y2 - 29402y/3 - 9800/3 = 0. Calculate y. -4900, -1/3 Factor 5r3 - 147965r*2 + 1095051880r - 5471560900. 5(r - 14794)2(r - 5) Let -3r5 + 63r*4 + 1320r*3 + 540r*2 - 11712r + 9792 = 0. Calculate r. -12, -4, 1, 2, 34 Factor -4h2/9 + 6100h - 18296. -4(h - 13722)(h - 3)/9 Factor r*5 + 16088r*4 + 128656r*3 + 257280r2. r2(r + 4)2(r + 16080) Factor -4a3/3 - 1588a*2/3 - 520a + 3168. -4(a - 2)(a + 3)(a + 396)/3 Factor -y2/2 + 45509y/2 - 22754. -(y - 45508)(y - 1)/2 Suppose v4/6 + 419v*3/3 + 37547v*2/2 - 13181740v/3 + 494865800/3 = 0. What is v? -484, 65 Solve 5n3 + 995n*2 - 22005n - 22995 = 0. -219, -1, 21 Let -s*5/8 - 64209s*4/4 - 515301300s*3 + 3092385704s*2 - 513696s - 16492723776 = 0. Calculate s. -64212, -2, 4 What is u in -5u5 - 1695u*4 - 11705u*3 - 28305u*2 - 28250u - 9960 = 0? -332, -3, -2, -1 Find d, given that d*3/4 - 163d*2/2 + 28985d/4 - 96100 = 0. 16, 155 Factor -f*2/3 + 105533f/3. -f(f - 105533)/3 Factor -2v*2/7 + 528v/7 + 702. -2(v - 273)(v + 9)/7 Suppose -3m4/4 + 70275m*3/4 - 102860634m*2 - 308740041m = 0. What is m? -3, 0, 11714 Solve -11h4/4 - 3h*3/4 + 132h*2 + 388h + 96 = 0. -4, -3/11, 8 Solve 3x2/7 + 31446x/7 + 721671/7 = 0. -10459, -23 Factor h*2/2 - 103h/2 - 1230. (h - 123)(h + 20)/2 Let -j5/2 + 39j*4/2 + 62j*3 + 42j*2 = 0. What is j? -2, -1, 0, 42 Determine z, given that -58562z*3 - 117126z*2 - 58566z - 2 = 0. -1, -1/29281 Factor n*2/4 + 581n/2 + 23961/4. (n + 21)(n + 1141)/4 Find z, given that 3z*2 - 1551z + 41076 = 0. 28, 489 Let u*5/6 + 61u*4/2 - 1181u*3/6 - 2989u*2/2 - 7960u/3 - 1386 = 0. What is u? -189, -2, -1, 11 Suppose -4x3/3 + 10576x*2/3 - 2305372x - 32969832 = 0. What is x? -14, 1329 Let -3i2/5 - 639i/5 + 9234 = 0. Calculate i. -270, 57 Factor y*4/4 - 5y*3 + 141y*2/4 - 207y/2 + 108. (y - 8)(y - 6)(y - 3)*2/4 Factor -3n*2/2 + 1667n + 1112. -(n - 1112)(3n + 2)/2 Suppose -9q2/7 + 380q/7 + 1664/7 = 0. What is q? -4, 416/9 Factor -3k3 + 2562k*2. -3k*2(k - 854) What is o in 8o5/5 - 482o*4/5 + 3984o*3/5 - 10918o*2/5 + 10648o/5 - 408 = 0? 1/4, 2, 5, 51 Factor 2i3/5 + 92i*2 + 2970i - 291600. 2(i - 40)(i + 135)2/5 Let n2/4 - 226623n/2 - 453247/4 = 0. What is n? -1, 453247 Find d, given that d4 + 118d*3 - 1043d*2 - 4116d + 37044 = 0. -126, -6, 7 Factor -2l2/13 - 133872l/13 - 267736/13. -2(l + 2)(l + 66934)/13 Factor n*3 + 1293n*2 + 17930n + 30696. (n + 2)(n + 12)(n + 1279) Factor 12v2 - 16v/3 - 176/3. 4(v + 2)(9v - 22)/3 Solve -92n*4/9 - 172n*3 - 5216n*2/9 + 1360n + 16000/9 = 0 for n. -10, -8, -1, 50/23 Solve -2t3/9 - 84224t*2/3 - 28074t + 505340/9 = 0 for t. -126335, -2, 1 Factor -x*2 + 10145x - 20286. -(x - 10143)(x - 2) Suppose 4s*4/9 - 6844s*3/9 - 9140s*2/3 - 34292s/9 - 13720/9 = 0. What is s? -2, -1, 1715 Suppose -50f5 + 56290f*4 - 101208f*3 + 53960f*2 - 8992f = 0. What is f? 0, 2/5, 1, 1124 Factor 33o3 + 51o*2 - 3048o + 4224. 3(o - 8)(o + 11)(11o - 16) Solve -5k3 - 17965k*2 - 16092055k + 80910025 = 0 for k. -1799, 5 Let 7q3/4 + 24q*2 + 47q/4 - 117/2 = 0. Calculate q. -13, -2, 9/7 Factor q*3/9 - 64q*2/9 + 943q/9. q(q - 41)(q - 23)/9 Solve 2g4/3 - 376g*3/3 + 8338g*2 - 229416g + 2204136 = 0 for g. 23, 33, 66 Determine t so that -3t3 + 2346t*2 - 446688t - 4704480 = 0. -10, 396 Factor o*2/7 + 168850o/7 + 72363. (o + 3)(o + 168847)/7 Determine j so that -5j*4 - 190j*3 + 127305j*2 - 380510j + 253400 = 0. -181, 1, 2, 140 Solve 4p2 - 5644p + 28120 = 0 for p. 5, 1406 Solve -785x2 - 10960x + 420 = 0. -14, 6/157 Factor 20l2 - 70368l + 28144. 4(l - 3518)(5l - 2) Solve -b2/4 - 71b/2 + 5220 = 0 for b. -232, 90 What is g in -3g4 + 1497g*3 + 1503g*2 - 1497g - 1500 = 0? -1, 1, 500 Determine t so that t*5/2 - 807t*4 - 31049t*3/2 + 17943t*2 + 32660t = 0. -20, -1, 0, 2, 1633 What is x in 18x2 + 79221x + 13203 = 0? -4401, -1/6
11 - (36/(-14))/(135/(-630)) -1 What is the value of (-58)/8790/(-220)? 3/11 (-1196)/20930 - (-346)/(-70) -5 Calculate (-8)/(-76) - (108/(-285))/4. 1/5 Calculate ((-24)/14)/((-105)/735). 12 Evaluate (-12)/162 - 5280/24948. -2/7 ((-132)/(-110))/(4/(400/(-385)) - -4) 8 ((-270)/(-20) - 13)(3 + -2) 1/2 What is the value of 4/(56/(-130)) + 9? -2/7 (-800)/(-208) + (-8)/(-10)65/(-13) -2/13 What is 8/10(3115/(-125) + 72/(-900))? -20 Calculate 33/(-36)(-11)/121. 1/12 Evaluate (-74)/(-925)-60 + 4. -4/5 Calculate 4/6 - ((-92)/2944)/(3/(-100)). -3/8 Evaluate ((-6)/(-24))/(-1)(-44)/(-165). -1/15 Calculate (2/(8/(1104/(-161))))/(2/14). -12 Evaluate (-1105)/(-55) + ((-1572)/(-132) - 12). 20 What is (25/12 - (-72)/(-108)) + 4/(-3)? 1/12 What is the value of (5(-51)/595)/(150/(-490))? 7/5 What is (-1124)/36 + -2 + (-236)/(-1062)? -33 What is the value of (880/(-64) - -14) + (-3)/12? 0 Calculate 6654/1620 + 124/(-70). 3/7 Calculate (((-135)/30)/3)/((-3)/(-36)). -18 What is the value of (3/1540/24)/(2/(-60))? -10 What is the value of (63/(-49))/(1245/140 - 9)? 12 Evaluate 5 + (-4 - -28)/12 - 12/2. 1 What is 20/(-14) + (-21268)/(-2863)? 6 Calculate 1221/2035((-40)/9 - 0). -8/3 What is 5/2(-24)/60? -1 Calculate 2750/(-825) + 2/6. -3 150/(-10) - (4 - (-2 - -8)) -13 What is 759/(-2645) + -4 + (-94)/(-23)? -1/5 What is the value of (-137)/(-274)(-3 + 1)? -1 Evaluate ((128/36)/(-16))/(4/(-144)) - -7. 15 Calculate 2 - (-70)/(-9) - ((-8)/(-36) - 0). -6 Evaluate (-83)/95616-64(-2 - 0)4. -4/9 Evaluate (-7 - 947/(-135))9. 2/15 Evaluate (-2409)/105 + (-66)/1155. -23 10/(-14)(-32193)/(-6570) -7/2 Evaluate 0 + -3(-24)/(-18) + 2. -2 What is 8/(-20)-14 + -5 - 291/(-15)? 20 Evaluate (((-48)/20)/3)/(-4(-18)/20). -2/9 Calculate 19/693-3 - (-93)/341. 4/21 Evaluate (12 + (-30)/5)(-2)/4. -3 Calculate 30/(-9)(-1)/(20/36). 6 Calculate ((-12)/(-56))/(49/(-686)). -3 Evaluate (-130)/455 - (-6)/316/210. -2/15 Calculate (-43)/(-4) - (24 - 14). 3/4 What is the value of (-18 - -15)(-6)/90-3? -3/5 (348/(-36) + 9)15 -10 What is 2(-45)/55(-76)/(-114)? -12/11 Calculate 595/(-105) + (5 - 2). -8/3 60/630 + 20/(-63) -2/9 0/(3 - 1)(670/(-30) - -22) 0 What is (7 + (-8588)/1235)-51? -3/13 What is the value of 72/120(5/(-180) - (-4)/(-16))? -1/6 What is (-46)/115 - -9 - 11? -12/5 What is the value of (-2)/(-13) + 1700/442 + 14 + 1? 19 Evaluate 3696/(-1008)(0 + (-1 - 5)). 22 3 - ((-432)/40 + 12) 9/5 What is 3/26776/(-1386)12/(-22)? 4 Calculate (33200/3220)/20 + 3/(-7). 2/23 What is ((-70)/(-5) - 11) + (-3)/1? 0 Evaluate ((-15)/20)/((-8)/4486). 7 What is (-25)/(-20) + (-20)/15? -1/12 (19/(-28))/(60/96) - 4/(-14) -4/5 What is (-42)/(-4) - ((-56)/504)/((-6)/(-27))? 11 What is (-3)/36 - 833/84? -10 What is the value of (4/26 - (17 + (-4020)/234))-3? -1 Calculate -1 + ((138/189)/((-22)/33))/(-1). 2/21 Evaluate (-72)/(-180) + (-321)/15 - 6. -27 Calculate 663/(-357) - (3 - 5) - (-83)/(-91). -10/13 Evaluate 21 + (-23 - 3906/(-189)). -1/3 What is the value of 1(-20 + 6) - 7/((-28)/(-8))? -16 What is the value of 3/(-24) + 113/8? 14 Calculate (-990)/(-1232) - (-3)/(-8)(0 - -1). 3/7 What is ((-64)/24)/((-74)/333)? 12 What is 2 - 0 - 7 - (20/(-12) + -4)? 2/3 Evaluate (-1830)/96 + -1 + 162 + -142. -1/16 Calculate (2/(-8))/(112/(-512)). 8/7 Evaluate (-17 - -21) + (-3 - (-5)/(-11)). 6/11 Calculate -4 - 55/(-110)(1 + (4 - 1)). -2 What is -17/28 + (-177)/12 + 1? -14 What is the value of 12/(-16)4/7? -3/7 (-41)/(17425/100)1/(-2)1 2/17 Calculate (196/(-21))/(10/453). -14 (-4)/(-12)444/(-592) -1/4 What is the value of 26/(-13) + (-53 - -9)/11? -6 (198/154 - -14) + -15 2/7 What is (-695)/2224(-2)/(-5)(-2 + 1)? 1/8 What is 352/33 - 10 - 10/6? -1 Calculate (-5)/35(18/(-12) + (-1 - 1)). 1/2 (-715)/(-26)36/(-45) -22 610/36(1 - 4) -5 What is the value of (((-2752)/160)/43)/(1/(2/10))? -2/25 Calculate -8 - 1 - (-438)/48. 1/8 What is (-56)/14 - 5/(-1) - -1? 2 What is the value of 0 + 2 + 36/(-21) + 14040/(-1512)? -9 Calculate (2 - 3/(-2))(-22 - (-2 + -18)). -7 Calculate (-2 - -4) + (-114)/(-22) + 379 + -386. 2/11 What is (122/(-14))/(90/90) + 9? 2/7 -1((-34)/(-136) - 27/156) -1/13 Evaluate (-29 - -30)21/14(-11)/(-9). 11/6 Calculate 96/10(-225)/(-135). 16 Evaluate (-50)/(-5) + 28/(-4) - -4. 7 Calculate 3/16(2163 - 2211). -9 Evaluate (140/(-77))/10 - 122(-1)/550. 1/25 What is the value of (2320/(-232))/(-3 - 7/(-3))? 15 (3 + -1)-2 + -18736/(-1386) 6/7 Evaluate -121 - ((-1500)/1350 - 2020/45). 34 What is (7 + -3)/((-11)/(88/72))? -4/9 What is the value of (-1106)/(-79) - (-3 - 4)? 21 Evaluate ((-756)/(-112))/(42/56). 9 (212/265)/(57/(-15)) -4/19 Calculate 3/(-41) - (-261268)/(-163959). -5/3 Calculate 7 - 136/16 - 35/(-22). 1/11 Evaluate (-657)/(-730)(62/54 - 1). 2/15 What is ((-174)/(-45) - (-30)/225)/(14/49)? 14 Calculate (21/(-8))/((-16)/1728-99). -3/11 Calculate 10/(-25)(-525)/(-15). -14 Calculate (9880/(-1900))/(2/10). -26 451/(-820) + ((-18)/(-8))/(9/3) 1/5 (1/((-102)/9))/(4/8) -3/17 Calculate 16 - 32(-1)/(-6). 15 Calculate 3/(-36) - ((-8899)/660 - -13). 2/5 What is the value of (50 - 90 - -50) + (-10)/(-1)? 20 What is (1/6)/(-3(1 - (-15)/(-20)))? -2/9 Calculate (12/10)/(891/45). 2/33 Evaluate -3033/(-990) + -10 + 0. -9 7 - 1 - (-3 + (-202)/(-22)) -2/11 What is the value of (-810)/216 - ((-4)/10 - 138/30)? 5/4 Evaluate -2 + (15 + -11 - (-8)/(-10)). 6/5 Calculate ((-220)/(-15) - 15)/((0 - -2)/(-12)). 2 Evaluate ((-183)/305)/(2/(-15)-6). -3/4 Evaluate ((-8)/(-20))/((-426)/(-355)). 1/3 What is the value of (-44)/(-77)6615/1008? 15/4 What is the value of (-22)/(-110) + (1032/390 - 3)? -2/13 What is the value of (-56628)/(-1980) - 129? -2/5 Calculate 16 - 21 - (-13 + (-43)/(-1)). -35 Calculate ((8 + (-53)/7)/2)/(18/(-21)). -1/4 What is (33/55)/(11/180) - (-7 - -17)? -2/11 What is the value of (-4750)/(-600) + 2/(-3)6 - 4? -1/12 What is ((-54)/(-2232)31)/((-6)/44)? -11/2 Evaluate (4 + 5/(-2))/((-6)/80-5). 4 Evaluate (-930)/(-372)(-16)/50. -4/5 What is the value of (-2)/13(-481)/(-111)? -2/3 ((0 - 4/20)6)/(192/128) -4/5 Calculate (((-36)/(-4))/(-9))/(((-7)/1)/(-49)). -7 Calculate 42/70 - 128/480 - (-110)/(-6). -18 Evaluate (-12)/12 + (-27)/9. -4 Calculate ((-54)/126)/((-4)/(-1 - -29)). 3 0/(-31) + (1 - -1) 2 Evaluate -1132/(-70) + 549/63 + -9. 8/5 Calculate -4((-11)/(-4) + 1 + 6 + -14). 17 Evaluate (-1 - -2)/(-4 - (-125)/50). -2/3 Calculate (-60)/36(-30)/3 + 10/(-15). 16 What is 328/(-105)5? -4 What is the value of (-2)/(-10)(-35)/42(-1 - -3)? -1/3 What is 2 + 9(-45)/(-324)(0 - 2)? -1/2 What is the value of 60/(-21)14/(-36)? 10/9 Calculate 6 + 16/((-400)/165). -3/5 Evaluate ((-2 - 1) + 6)/(30/(-130)). -13 (-4)/(-26)(90/150)/((-36)/(-195)) 1/2 Calculate (1 - (-12)/(-6))(3 - 6 - -1). 2 Calculate (-3)/(-2)(-1122)/495 + 1 + 2. -2/5 What is -1(-1 - -2) - (-1482)/1326? 2/17 What is (27690/(-71))/78 + (-1)/(-1 + 0)? -4 Calculate (-2)/(214/42). -3 Evaluate (13 - 5278/403)/(3/(-2)). 2/31 Calculate ((-3)/(-4))/(633/16880). 20 8814/3393 - 20/(-290) 8/3 Calculate 0 - ((-20)/(-48))/(54/30). -5/8 What is (1/2(-432)/648)/(2/(-10))? 5/3 Evaluate (7 + 1 - 4)((-325)/(-20))/5. 13 (52/(5200/(-125)))/((3/(-4))/1) 5/3 Evaluate -1 - 221/(-238) - (-24)/728. -1/26 Evaluate (1479/(-319))/17(-3)/(9/2). 2/11 5/(10/(-36))(-35 - (-3195)/90) -9 ((-42)/210)/((-2)/(-75)) -15/2 Evaluate (-2)/((-11)/(99/(-90)))-50. 10 Calculate (-1668)/120932/4. -2/29 What is ((-400)/10400)/(24/(-52)4/12)? 1/4 Evaluate (-13)/((-156)/(-348)) - -22. -7 Calculate (-27)/(2(-3)/(-9)3717/(-236)). 18/7 -17 + ((-118825)/(-5740) - 150/40) -2/41 Calculate (-13 - -16)((-4)/14 - (-249)/63). 11 4((-10)/(-24))/((-235)/94) -2/3 (-32)/4 - ((-13 - -11) + 4) -10 Calculate -28 + 3018/30. -10 Calculate 16/28 + (-12 - 894/(-77)). 2/11 What is the value of (1 - -1 - 1)/((-55)/(-1870))? 34 What is 3 - (((-136)/(-20))/(-17) - (-47)/15)? 4/15 Calculate 33/135-3 - 160/(-120). 3/5 What is the value of ((-1541)/(-201))/(25/15 + -2)? -23 What is the value of (-6)/(-93) + (655/(-117769))/((-1)/(-24))? -2/29 What is (8/(160/(-45)))/(57/19)? -3/4 (240/216)/((-8)/36) -5 What is (-27)/45 - (-464)/40? 11 Evaluate 52 + (20 - 39) - 14. 19 Evaluate 3((-9)/60)/((-195)/(-130)). -3/10 118/1292 - (-6)/(-51) -1/38 What is 6 + -172(-10)/(-280)? -1/7 What is (-1)/(85/1030) - 7/(1547/(-26))? -12 ((-1876)/(-2010))/((-112)/(-408)) 17/5 What is the value of ((-6)/(-4))/(27/36)(-2)/26? -2/13 What is the value of 2/(-27) - 010/(0 + 40)? -2/27 Evaluate (711/(-237))/(9/(-66)). 22 Evaluate 61 + -58 - (-1 + (4 - -2)). -2 Evaluate (12/48 + 35/4)(-9)/(-54). 3/2 What is (-4)/(((-2)/(16/(-24)))/6)? -8 ((-4)/5)/((-6)/20)(-5328)/1184 -12 Evaluate 7/(112/480)(-2)/6. -10
Let s be (130/(-198) + (-32)/(-288))-44. Solve -p + 13p = s for p. 2 Let a be (-4)/(-24) + 178/12. Let y = a + 0. Solve 1 = 4u - y for u. 4 Let z = 269 - 246. Suppose -4 = -4w - 2n, -11w + z = -10w - 5n. Solve -a - 6 = -wa for a. 3 Suppose -3x = 3q - 135, -4x + 833q = 834q - 195. Solve -40 = 30w + x for w. -3 Let o(w) = -5w*3 + 4w*2 + 70w - 15. Let v(c) = -14c3 + 13c*2 + 209c - 46. Let x(s) = 11o(s) - 4v(s). Let k be x(13). Solve 5p + k - 1 = 0 for p. -1 Let k = 2669 + -2640. Solve -6g + k = 5 for g. 4 Let g(q) = q*3 + 5q*2 + 4q + 4. Let j be g(-4). Let v(s) = -7s2 - 2s - 3. Let b be v(-1). Let p = 1 - b. Solve -w = -jw + p for w. 3 Suppose 29z = 6224 - 1853 + 4851. Solve -210 = -12o - z for o. -9 Let d = -10 - -18. Suppose -2s = 2x - 16, 5s - 5x = s - 13. Suppose -184f = 54f. Solve f = -5t - d + s for t. -1 Let v = -15 + -6. Let k = 23 + v. Let a(w) = 2w2 - 15w + 16. Let c be a(7). Solve -ku + 1 = c for u. -4 Let z(x) = 13x*3 - 4x*2 + 2x + 1. Let f be z(1). Suppose 0 = fk - 0k - 24. Suppose b - k = 1. Solve -4q = -bq for q. 0 Suppose -5k + 96 = -2a - 37, -3a = -5k + 132. Solve 12b - k - 21 = 0 for b. 4 Let l(j) = 11j - 84. Let f be l(10). Suppose -fs = -31s. Solve 2q - 2 + 4 = s for q. -1 Let x(t) = -11t - 2. Let l be x(1). Let n = 1376 - 1358. Let m = l + n. Solve -16 = h - mh for h. 4 Suppose -18 + 24 = 3h. Suppose -q - 8 = -a, -a + 2q - 11 = -ha. Solve -af + 5f = 0 for f. 0 Suppose 2h - k - 842 = 0, 40h + 4k + 1263 = 43h. Let m = h - 378. Solve -m = 9d - 7 for d. -4 Let b be (9 - 2)10/2. Let t(v) = 2v3 + v2 - v + 35. Let i be t(0). Let x = i - b. Solve 2k + xk = 0 for k. 0 Let f(j) = j3 - 2j*2 + 12j + 3. Suppose 0g + 8g = -4g. Let l be f(g). Let x(s) = s3 - 4s*2 - 5s. Let n be x(5). Solve la = -na - 6 for a. -2 Suppose 21q + 4q + 225 = 0. Let t(c) be the first derivative of -c*4/2 - 6c*3 + 3c - 1. Let s be t(q). Solve -sn - 7 = -19 for n. 4 Suppose 0 = -3b + 10 + 5. Let k = 9796 - 9796. Let d be 40/(-4) - -12 - (1 - -1). Solve k = -bh - dh for h. 0 Let r = 3670 + -3658. Let m be (0/(-1 - -3))/(-1). Solve -4u + m = r for u. -3 Let z be ((-871)/299 - -3) + (-113)/(-23) + -2. Solve 0 = -zq + 1362 - 1338 for q. 8 Let i be 3260/(-15)(-12)/8. Suppose -i + 854 = 24z. Solve -3 = 5d + z for d. -5 Suppose -m = 2p - 109, -202m = 2p - 206m - 74. Solve pq - 187 = 17 for q. 4 Let j = -27730 - -27835. Solve -jp + 35 = -140p for p. -1 Suppose 3x - 4d = 220, 5x + 0d = 3d + 363. Suppose 4u + 273 = -3q, -x = q - 4u - u. Let w = q - -91. Solve -wf - f = 0 for f. 0 Let d = 508 + -244. Let s be d/77(-7)/(-2). Solve -5m - s = -2 for m. -2 Suppose -5n = j - 41, -6j + 3j - 3n = -39. Solve -jp + 85 = 43 for p. 7 Let h be (-5724)/405 + (-2)/(-15). Suppose 27v - 238 = 10v. Let n = h + v. Solve 5 = 5c - n for c. 1 Let k = 764 + -784. Let z be ((-80)/k)/(3 + -1). Solve zm - 12m - 30 = 0 for m. -3 Let q be 636/(-84) + ((-51)/21 - -3) - -17. Solve 26g + 48 = qg for g. -3 Suppose 2j = -2n + 276, 3j + 634 = 14n - 9n. Solve 18k - n = -41 for k. 5 Let q be (-1)/((-5)/(-15))-1. Suppose -15 = qm, 2a + 2m - 37 = 5m. Let v = 9 + 0. Solve 5h + a = -v for h. -4 Let n(o) = -7o*2 - 43o - 13. Let j be n(-3). Solve -jf = 4f + 228 for f. -4 Suppose -w + 3v = -2w - 9, -9 = 2w + 3v. Solve w = -13s + s + 12 for s. 1 Let p(s) = 12s*2 - 5s + 34. Let r be p(-4). Solve 0 = -55c - 27c + r for c. 3 Let u = -6 + 19. Let q = -8 + u. Suppose 40 = 7j + q. Solve 2 = 3w - jw for w. -1 Let o = 1786 + -1786. Let s(a) = -3a - 40. Let g be s(-16). Solve -c = -oc - gc for c. 0 Suppose -4r = 3q - 585 + 428, 3r - 118 = -2q. Solve 52 = 23b - r for b. 4 Let n = 19714 + -19703. Solve -na + 203 - 181 = 0 for a. 2 Suppose 89 = x + i, -4x + 283 = i - 82. Solve -84w = -xw - 56 for w. -7 Let v = 30 - 67. Let x = 58 + v. Suppose -xd = -18d. Solve d = -j + 5 for j. 5 Let j(c) = -c3 - 12c*2 - 3c - 28. Let p be j(-13). Let y = 185 - p. Solve y = -4q - q for q. -1 Suppose -4k + 5k = 5. Let s(m) = -13 + k - 2m - 8. Let i be s(-8). Solve 4 = -ih - h for h. -4 Let u be (0(-2)/8)/(-3). Suppose -3l - 506 = -6r + 2r, r - 4l - 133 = 0. Let w = -124 + r. Solve -2t + 3 + w = u for t. 2 Suppose -4470 = -383w + 85w. Solve -112 = -r - wr for r. 7 Let k be (-158)/22 - (-2)/11. Let u = -3 - k. Let p(f) = -766f + 9197. Let n be p(12). Solve -um = -n + 17 for m. -3 Let d be (-5 + (-76)/(-20))(-380)/(-6). Let r = d - -81. Solve -rz + 0z + 15 = 0 for z. 3 Let y be 2188/(-64) + 5/(-40). Let i be 20/(-8)(-44)/10 - y. Solve 9 = 8a + i for a. -1 Let m(f) = 41f3 - f2 - 4f + 5. Let v be m(1). Suppose 5a = 4l + 122, -47 = 2l - v. Solve -ab + 20 = -17b for b. 4 Suppose 2h = -v + 126, 14v - 12v - 262 = h. Solve 15w - v = -40 for w. 6 Suppose 7q - 5q + j = 0, 5j = 4q. Solve -558t + 567t - 45 = q for t. 5 Let k = 505 - 300. Suppose -k = -4m - 189. Solve 2u - mu = 0 for u. 0 Let i(u) = u*3 - 6u*2 + 69u - 395. Let s be i(7). Solve 149l - sl = 84 for l. 7 Let y = 90 + -88. Suppose -2i = -5g + 30, 0 = yg + 2i - 3i - 13. Suppose -2m = g, 0 = 2d - m - 60 - 4. Solve 0 = -5l + 11 - d for l. -4 Let f be ((-15)/(-4)2)/(9/30). Suppose -4 = fy - 26y. Solve -28 + 8 = -yr for r. 5 Let m be (8/(-10))/(2/(-20)). Suppose -3142a = -3192a. Solve -4u + m + 0 = a for u. 2 Let n(a) = -a3 + 27a*2 - 2a + 59. Suppose 5m = 2c + 2m - 39, 4c = 4m + 88. Let t be n(c). Solve tj + 10 = -5 for j. -3 Let b(f) = -f*2 - 2f + 115. Let z be b(9). Solve 0 = -3u - z + 25 for u. 3 Suppose 5h - 4x = h - 180, 0 = h + 5x + 69. Let a(o) = 2o2 + 35o - 1. Let l be a(-16). Let u = h - l. Solve u = -2i - 6 - 2 for i. -4 Let i = -735 + 763. Solve ih - 8 = 20 for h. 1 Suppose 1 = 2s - 4u - 1, -4s + 30 = 5u. Suppose -sy - 185 = -5k, k - 6k + 181 = -y. Let x = -2 + 7. Solve -xf - 11 = -k for f. 5 Let t be 7/(-1)-7(-1)/7. Let n(l) = l*2 + 14l + 51. Let b be n(t). Solve bj - j = 0 for j. 0 Let p = -4 - -11. Let q = 264 - 260. Suppose -j + 5 = 4r - 10, -3r - 6 = -5j. Solve jd = p - q for d. 1 Suppose -643 = -9u - 223 + 282. Solve -69k = -uk for k. 0 Let b = 53 + -50. Let p(f) = 2f - 6. Let u be p(b). Let i be ((0/(-2))/5)/(u + 1). Solve z + 5 = -iz for z. -5 Let n be (-12)/18 - (-4)/6. Suppose 4c = s + 4, 4c - 2s + 0s - 8 = n. Suppose 3v - 9 = -3x, 2x - 3x = -1. Solve c = -2t - v + 12 for t. 5 Suppose 3l - 32 = -38. Let n be l + 6 + (-9 + 9)/5. Solve nr = -8 - 4 for r. -3 Let l(y) = y - 7. Let i(a) = 2a*2 - 6a - 11. Let q be i(5). Let p be l(q). Suppose 4g + p = -3u + 10, 0 = -g + 5u + 2. Solve g = -4h - 2 for h. -1 Let s be ((-2)/11)/(177/(-19470)). Solve sy + 329 - 349 = 0 for y. 1 Suppose -6p = -415 - 383. Suppose -7c = -26c + p. Solve 16 - c = 9m for m. 1 Let s be 9 - ((-1)/(-1) - (-10)/(-10)). Suppose -sk + 11 = -8k. Solve -10v = -kv + 3 for v. 3 Let s(c) = -56c - 370. Let o be s(-7). Solve 0 = -op + 9 + 13 for p. 1 Let d(o) = -o3 - 7o*2 - o + 6. Let u be d(-7). Suppose -4i + ui = 63. Solve 3x - 1 + i = 0 for x. -2 Suppose -v = 1 - 3. Let w(u) = u*2 - 13u - 658. Let z be w(33). Solve -8 = -zm - v for m. 3 Let h = 9 + -9. Suppose -11q + 10q = h. Suppose -c + 4 = -qc. Solve 0p - 2p - c = 0 for p. -2 Suppose 8k - 7k = l - 16, -2l + 21 = -k. Let v(f) = -8f - 85. Let g be v(k). Solve -gu + 5 = -1 for u. 2 Suppose i - 1 = 1. Suppose -5a = -6a. Suppose t - 144 + 139 = a. Solve tg = ig for g. 0 Suppose -2x = -6x + 2u + 890, 5x - 1075 = -5u. Suppose xk - 222k = 0. Solve k = 6j - 0j for j. 0 Suppose 16i - 31 = 76 - 43. Solve i = -58t + 57t for t. -4 Let h(k) = -4k*3 + 180k*2 - 172k - 174. Let l be h(44). Solve 1772j - l = 1770j for j. 1 Suppose 0 = 3z - l + 68, 4z - 2l + 73 = z. Let j(w) = 3w + 88. Let p be j(z). Solve 2v - 7v = p for v. -5 Suppose -13h - 69 = -186. Suppose hy - 6y = 3. Solve -y = 4j - 5 for j. 1 Let s = 640 - 588. Let q = -47 + s. Solve 2t - 2t + qt = 0 for t. 0 Let o = -3859 + 3868. Solve -5i = -3i - oi for i. 0 Let s = 9176 - 9131. Solve 0 = 13j + s + 20 for j. -5 Suppose 13c = 130c - 351. Let o(j) = 5j*2 - j - 1. Let v be o(-1). Solve vk - ck + 3k = 0 for k. 0 Let n = -24951 - -24987. Solve -9229z + 9238z - n = 0 for z. 4 Suppose -156p = -165p + 9. Let x = 20 + 6. Solve 5*h + x = p for h. -5
Let f = 0.8 - -0.2. Let g = -20 - -19. Which is the nearest to g? (a) -1/7 (b) 5/4 (c) f a Let w be 19/7 - (2/(-7))/1. Which is the nearest to -7? (a) 3/4 (b) -1 (c) w b Let r = 0.35 + -0.25. Which is the nearest to r? (a) -0.1 (b) 0.1 (c) -5/4 b Let q = -823/11 + 75. Suppose 0 = 3t - 12, 2t + 5 = -4x - 7. Which is the closest to -0.1? (a) x (b) q (c) -4 b Let b = 0 + -0.5. Let m = b + 0.4. Let r be ((-1 - -2) + -3)/13. What is the closest to m in 1, -3/8, r? r Let t = 2.28 - -0.72. Which is the closest to -0.2? (a) 0.4 (b) -0.4 (c) t b Let y = 0.7 - -3.3. Let s(d) = d3 - 9d*2 + 17d + 7. Let r be s(6). Which is the nearest to r? (a) -3/2 (b) y (c) -0.4 c Let g = 10.28 - 10. Let d = -0.02 - g. Let j = 2 - 1.6. Which is the nearest to -1? (a) j (b) d (c) 5 b Suppose 8l - 4l = -16. Which is the nearest to 1/2? (a) l (b) 0 (c) 3/4 c Let k = 2 - 2.4. Let p = -532/1355 + -2/271. What is the nearest to p in 0.5, 1/4, k? k Let h be (1/(-2) - (-5)/(-10))/(-1). What is the closest to h in -2, 5, 20? -2 Let d = 16.6 - 17. Suppose -4q = -9q + 10. Let u = -0.6 + -1.4. What is the nearest to u in q, d, -5? d Let q = -0.54 - -0.24. Which is the nearest to -2/3? (a) -5 (b) q (c) 0.5 b Let t = 2.01 - 0.01. Let h = -0.52 - -0.3. Let w = 0.22 + h. Which is the nearest to t? (a) w (b) -0.3 (c) 0.5 c Let y = 3.85 - 2.8. Let j = y - 0.05. Let h = 0.9 - j. What is the nearest to h in 2, -0.4, 0.3? -0.4 Let o = 336/5 + -67. What is the closest to -2/3 in 1, -2/7, o? -2/7 Suppose -15 = -3d, -n + 2n + 5d = 30. Let q be 2 - ((-3)/21)/1. Let o = -89/35 + q. What is the nearest to -0.1 in 1, o, n? o Let v = 11 + -78/7. What is the nearest to 2 in 4, 3/2, v? 3/2 Let z = -1.8 - -1.7. Let x = z - -4.1. What is the nearest to x in -0.4, 5, 0.4? 5 Let x = -0.96 - -1. Let y = x - 0.64. Let s = y + -0.4. What is the closest to -1/3 in s, -0.4, 4? -0.4 Let r = 0.29 + -0.39. Which is the nearest to -2/5? (a) r (b) -4 (c) 5 a Let q = -1.03 + 0.03. Which is the nearest to q? (a) 4 (b) -0.2 (c) 0.2 b Let b = 6 - 4. Let d = -2.5 + 2.4. What is the closest to d in -2, 0.3, b? 0.3 Let a = -0.04 + 0.04. Let p = 0 + a. What is the nearest to p in 0.5, 0.3, 2/15? 2/15 Let k = 0.17 - -0.83. Let b = 0 + 0. What is the nearest to b in k, 2/3, -3? 2/3 Let q = 41 + -40.9. What is the nearest to q in 5, -1/4, 1/7? 1/7 Let z = -4 - -21/5. What is the closest to -0.1 in -1/7, -0.5, z? -1/7 Let k = 0.09 - 1.09. What is the closest to k in 1/2, -0.3, 2/3? -0.3 Let l = 17 - 16.8. Which is the closest to l? (a) 4 (b) 2/7 (c) -1 b Let r be 36/40 - 1/2. Which is the closest to -2? (a) -1 (b) 0.2 (c) r a Let z = -247 - -1732/7. Let j = 0.02 - -2.98. Which is the closest to j? (a) z (b) -3 (c) 0.2 a Let y = -26 - -27. Which is the closest to 2/5? (a) -1 (b) -1/6 (c) y b Let u = -2 + -1. Let y = 1/15 + 2/45. What is the nearest to 1 in y, u, 1/3? 1/3 Let r(p) = -p + 8. Let y be r(8). What is the nearest to y in -0.5, -2/21, 0.4? -2/21 Let p = -27/25 + 1. Let q = -5.5 + 4.5. Which is the closest to 1? (a) p (b) 5 (c) q a Let r = 0.25 - 0.45. Let w = 3.2 + r. Let l = 0.4 + 0.1. Which is the nearest to -2? (a) 5 (b) w (c) l c Let f = 18.13 + -0.13. Let n = -18.2 + f. Let l(x) = x - 3. Let y be l(0). Which is the nearest to n? (a) 0.2 (b) y (c) 4/5 a Let u(a) be the second derivative of -11a3/2 - a2 + 2a. Let w be u(-2). Let p be 2/5 + w/(-110). What is the nearest to 0.1 in -0.2, p, -5? p Let f = -21 - -21.5. What is the nearest to f in 3, 4, 0? 0 Let g = -21.8 + 23. Let x = -1.6 + g. Which is the nearest to -1? (a) 1/7 (b) -4 (c) x c Let s = -119 - -831/7. Let d be 1/(-2)3/6. What is the nearest to 0 in s, d, -1? d Let f = -303/10 - -131/4. Let r = f + -11/5. What is the nearest to -1/2 in r, 2, -4? r Let q = -7 - -6.9. Which is the closest to -1? (a) 1 (b) 1/4 (c) q c Let m = 1.27 + 0.73. What is the nearest to 20 in 1, m, -2? m Let o = 8 - 5.5. Let h = 2 - o. Suppose -1 = 2f - 3f. What is the nearest to f in -0.3, h, 3? -0.3 Let d = -94 - -95. Let a = -0.24 + -0.06. What is the closest to 1/3 in a, -0.9, d? a Let v = 7 + -7.1. Let x = v + -0.2. Which is the nearest to 1? (a) 4 (b) -0.4 (c) x c Let d(y) = -2y - 19. Let z be d(-9). Let v = -0.3 - -0.8. Which is the nearest to z? (a) 2/17 (b) -2 (c) v b Let n = -0.8 - -0.9. Let i(f) = f3 - 5f*2 + 3f. Let y be i(4). Let u = -14 - -16. Which is the closest to n? (a) 0.5 (b) u (c) y a Let p = 1.3 + -1.1. Let l(t) = -t3 - t2 - t - 4. Let d be l(0). Let k = 13.8 + -14. What is the closest to -2/5 in d, p, k? k Let x = -22.7 - -23. Let o = -0.4 + -0.1. What is the nearest to -1 in x, o, -5? o Let d = -25 - -24. Which is the closest to -1? (a) 0.1 (b) d (c) 2 b Let g = -1.18 - -1.28. What is the nearest to 0.2 in g, 2, 4? g Let a = 0.9 + -0.7. Let p = a - 3. Let r = 3 + p. What is the nearest to 1/4 in 4, r, -5? r Let q = 85.2 + -85. Which is the nearest to -4? (a) q (b) -4 (c) -2 b Suppose 20t - 16t = -16. Which is the closest to -0.1? (a) t (b) -0.5 (c) 0.08 c Let t = -0.06 + -0.2. Let s = 0.16 + t. Which is the nearest to s? (a) 2/3 (b) -3 (c) -2/9 c Let y = 3 - 7. Which is the nearest to 2/5? (a) -2/13 (b) y (c) -3/5 a Let o = -1312471/1547 - -11039/13. Let r = o + -8/17. What is the nearest to 2/5 in 2, -1, r? r Let h be (-2)/((-183)/(-189) - 1). Let g be 0/(-1) + 14/h. Which is the nearest to 2/5? (a) g (b) 0.1 (c) 0.5 c Let i = -0.011 + 26.011. Let l = 27.94 - i. Let s = 0.06 + l. Which is the nearest to 1? (a) 0.2 (b) s (c) 1 c Let o = -692/7 + 99. Which is the closest to 1? (a) -3/7 (b) o (c) -0.5 b Let r = -42.2 + 42. Let x = 118/5 - 23. Which is the nearest to -1/2? (a) r (b) x (c) -4 a Let v = -106 - -106. What is the closest to 0 in v, -8, 0.4? v Suppose -u + 7t - 3t = 12, 5t - 14 = u. Which is the nearest to u? (a) -3 (b) 1/7 (c) 5 a Let t = -27 + 26.6. Which is the nearest to 0? (a) t (b) -3/5 (c) 5 a Let l be -2 + -43/(-4). What is the nearest to l in 1/3, 2/23, -1/4? 1/3 Let w = -13.04 - -0.04. Let m = -12.9 - w. Which is the closest to m? (a) -0.4 (b) -2 (c) 3 a Let o = -11.84 + 9.9. Let z = o + -0.06. Let t = z - 0. Which is the nearest to -2/3? (a) t (b) 2/9 (c) 0.4 b Let l = -0.3 + 0.4. Let v = -2 - -1.6. What is the nearest to l in -0.5, v, 2/3? v Let q be 2/(-3) + (-1)/(-4). Let v = q - 1/12. What is the closest to 0.1 in -5, 2/5, v? 2/5 Let d = -42/85 + 5/17. Let p = -13.92 + 14. Let v = p - -1.92. What is the nearest to d in 4, -2, v? -2 Let x be (-197)/225 - 3 - -3. Let m = -33/25 - x. Let q be (-3)/14 + 2/4. What is the closest to q in 0.3, 0, m? 0.3 Suppose -p - 3o = -1, -2o + 52 = -2p - 2p. Let w be 1/4 - p/4. What is the closest to -1 in 1, w, 3/7? 3/7 Let k be 2 - (0 + 1/(-1)). Suppose 0 = -0f + f + k. Let x be 14/18 - (-3 + 4). What is the closest to -2 in x, 0.2, f? f Let v = -3 + 1. Let g = v + 2. Which is the nearest to 0.1? (a) -2 (b) g (c) 4 b Let r = -1.39 - -1.39. Which is the closest to r? (a) 35 (b) -3/5 (c) -1 b Let h = -0.05 - -0.05. Let c = h - 0.2. Let i = 1 - 0.9. What is the nearest to i in c, 0.2, 2? 0.2 Let m = 250/3 - 26009/312. Let r = m + 2/13. Which is the nearest to -2? (a) 0.1 (b) -5 (c) r a Suppose -198 = h - 198. Let z = 7 + -11. What is the closest to h in 0.5, z, -5? 0.5 Suppose -5n + u + 3 = 0, -2u - 5 - 1 = -n. Let b = 316.2 + -316. What is the closest to 0 in b, -2/3, n? n Let f = 172 + -170. What is the nearest to 2 in -2, f, -3/2? f Suppose 5o + 132 = 7. Let s be 2/(-15)o/(-20). What is the closest to 3 in -1/9, s, 1/8? 1/8 Let l = -18 + 23.5. Let z = l + -6. Which is the closest to 2? (a) z (b) -5 (c) -3 a Let p = 21.6 + -22. Let h be (1/(-5))/1 - -1. Which is the closest to -1/2? (a) -5 (b) p (c) h b Suppose 7j - 3j - 23 = -5w, -5j + 3w + 75 = 0. Let v be ((-2)/j)/(3/4). Let o = v + -5/18. What is the nearest to 0 in 5, -1/3, o? -1/3 Suppose -4y - 15 = 5v, -2y = -4v + 15 - 1. What is the nearest to -2/5 in -5, -4/7, v? -4/7 Let y = -25.2 + 25. Which is the closest to 0.2? (a) 1/7 (b) -0.3 (c) y a Let z = -13 + 12.9. Let y be (2 - -8)*(-2)/15. What is the nearest to z in -1/2, 0.1, y? 0.1 Let r = 0.067 + 0.033. Which is the closest to r? (a) 3/4 (b) 4/3 (c) 0 c Let i = -0.1 - -0.2. What is the nearest to -1 in -0.5, i, -3/5? -3/5 Let f = -379/21 - -55/3. Which is the closest to 1/4? (a) -0.3 (b) f (c) -5 b
Let n(s) = -6 - 36s + 6. Let j be n(-1). Suppose -3b = -36 - j. Is b a multiple of 12? True Let m(f) = 5f - 25. Is m(7) a multiple of 5? True Let h be (-2)/1(-217)/14. Let d = h - 17. Is d a multiple of 5? False Let b(v) = v. Let x(n) = n*2 - 7n + 7. Let y be x(7). Is b(y) a multiple of 7? True Suppose -3c = 2p + 3p - 32, -3c + 12 = 0. Is 6 a factor of (-33)/(-6) + p/8? True Let a(k) = -k*2 + 12k - 9. Let n(y) = y*2 - 11y + 8. Let c(g) = -4a(g) - 5n(g). Let v be c(4). Suppose -2o = -2, 5l - o - v = o. Is l even? True Suppose 2b - 220 = -0y - 2y, -2b = -4y + 464. Is 19 a factor of y? True Suppose 4h + t = 4, h = 3t - t - 8. Let r(s) = -s3 + s2 + s + 46. Is 23 a factor of r(h)? True Let q(u) = u3 - u2. Let s be q(1). Let i(h) = -3h*2 + 11 + 2h - 3h + 1 + h3 + 2h2. Is i(s) a multiple of 12? True Is 10 a factor of 1 + (-10)/(-3 + 2)? False Let h(q) = q3 - 7q2 + 5. Let k be h(7). Let d = -1 + k. Suppose 2y - db = 3y - 48, -3y + 5b + 110 = 0. Does 20 divide y? True Let q(b) = 55b + 1. Let j be 81/99 - 4/(-22). Is q(j) a multiple of 11? False Let o(d) = d + 7. Let v be o(-8). Let a be v/(-3) - 10/(-6). Suppose 0 = l - a - 5. Is l a multiple of 7? True Let q = 35 + -71. Let f be 8/q + 2/9. Let k(n) = -n2 - n + 6. Is 6 a factor of k(f)? True Let z(k) = 2k*2 - 14k + 48. Is z(8) a multiple of 16? True Suppose 3k + 62 = -o, 2k + 0k - 5o = -64. Is 15 a factor of 1840/44 + (-4)/k? False Let z(k) = 2 - 2k + 4k + 3k2 - 2k*2 + k. Is 15 a factor of z(-7)? True Suppose 2j - 116 = t + 71, j + 2t - 86 = 0. Does 10 divide j? False Is 18 a factor of (-7 + 1)/((-12)/72)? True Suppose 2h + 8 = 0, 12 + 20 = 4t - 4h. Suppose -162 = -5j + 7z - 3z, -2j = tz - 48. Is 4 a factor of j? False Let h(u) = -40u - 4. Let b = -17 - -15. Is h(b) a multiple of 27? False Suppose 2o - 566 = -4u, 0 = -u + 7o - 6o + 149. Is 18 a factor of u? True Let h(g) = g*2 + g + 2. Is h(6) a multiple of 11? True Let g = 256 + -100. Does 13 divide g? True Suppose 0d - 2j = -d + 11, 3d = 5j + 28. Let x(f) = 10f*2 + 10 - 9 + 7f*2 + 6f*2. Is 9 a factor of x(d)? False Suppose 2t = 3y - 29, -2y - t = -4t - 21. Does 6 divide y? False Let d be 4/((-1 + -1)/(-2)). Let b be ((-6)/d)/((-3)/28). Suppose -2r + 12 = -b. Is r a multiple of 13? True Let s(a) = -a - 6. Let h be s(-5). Let r(j) = 38j2 - j. Does 11 divide r(h)? False Suppose -3p - 4o = -52, -2o + o = 5. Is 12 a factor of p? True Suppose -5x - 4w - 21 + 54 = 0, -5w + 10 = 0. Suppose 3f + xo = 56, 4f = f + 5o + 76. Is f a multiple of 7? False Let b(a) = -a2 - 3a - 5. Let k be b(-4). Let q be 0 - -2 - (k + -3). Suppose q = 3m + 2. Is 2 a factor of m? True Let j be (156/10)/(2/10). Let s = j + -47. Let f = -19 + s. Does 5 divide f? False Let h = -14 + 20. Let y(z) = z2 - 3z. Let c be y(h). Suppose 0 = 3g - 0g + d - 38, g = -3d + c. Is g a multiple of 6? True Let f(c) = 3c + 27. Let y(g) = -2g - 14. Let l(u) = -4f(u) - 7y(u). Let w be l(7). Is (-2)/w + (-92)/(-8) a multiple of 10? False Let o(j) = 5j - 3. Let n be o(-5). Let q = -59 - -19. Let d = n - q. Is d a multiple of 5? False Let n(w) = w*2 + 18w + 19. Let o be n(-17). Is 6 a factor of ((-16)/(-6))/(o/9)? True Let q be (25/15)/(2/6). Suppose h + 4h = q. Is (-164)/(-12)h3 a multiple of 16? False Suppose -2t + 22 = -0. Is 11 a factor of t? True Let d = 4 - 1. Let t be ((-6)/(-12))/(2/220). Suppose 3n = -k + 8n + 31, -4k - dn = -t. Is 8 a factor of k? True Suppose 4f - 73 = -o + 72, 0 = -5o + 4f + 605. Is o a multiple of 36? False Suppose -2n + 7n = 3t + 270, -3t + 186 = 3n. Suppose -5j + 139 = 3z, 0 = -3z + 2j + 47 + n. Does 19 divide z? True Let o be 80(-1 - (-2 - 0)). Suppose -6m + o = -m. Is m a multiple of 8? True Does 13 divide 4/(3 - 7) + 44? False Let s be (-10 - 4)14/(-4). Let u = -35 + s. Suppose 3q - 2v = 21, 3q - u = 3v + 4. Is q a multiple of 9? True Suppose 0 = -3n - 5p + 105, 4n - n = p + 123. Does 9 divide n? False Suppose 3g - n = -g - 6, -4g = -3n + 10. Let k be 1(198/3)/3. Let j = k + g. Is 7 a factor of j? True Let s(j) = j - 1. Let b = 9 - 3. Let u(w) = -7w + 38. Let n(p) = bs(p) + u(p). Is n(0) a multiple of 16? True Suppose -t = 3h + 388, -4h = -2t + h - 798. Is 15 a factor of t/(-10) - (-4)/(-10)? False Let s(r) = 2r*2 + 4r + 3. Let m be s(-2). Let v = m - -11. Does 9 divide v? False Let r(m) = 2m - 3. Let t = -2 + 5. Let u be r(t). Suppose 40 = uf - 14. Does 7 divide f? False Is 5 a factor of 18/72 - (-163)/4? False Let i = 4 + 1. Suppose 5u = -2n + 4, -3n - iu - 17 = -4n. Is n a multiple of 3? False Suppose 0 = i - 2i - 1. Let d be (2 - 0)(-1)/i. Suppose 0 = 3k + d - 68. Is k a multiple of 11? True Let h be (-5)/(-3) - 2/(-6). Let y(q) = 2 + 4 + q + q*h + 0. Is y(0) a multiple of 6? True Suppose -1 = -3d - 4. Let t be (0 - d - 0)-6. Does 5 divide (-4)/t - (-26)/6? True Is 4 a factor of (-2)/(1 + -5)(23 + 1)? True Let n = -2 + -6. Let l(h) = -3h - 9. Is l(n) a multiple of 7? False Let n be 31(5 - 4) + -2. Suppose 0 = 3w - 70 - n. Does 11 divide w? True Let k(y) be the third derivative of -y5/60 + 7y*4/12 - 3y*2. Does 22 divide k(6)? False Suppose -90 = 5z - 1755. Does 35 divide z? False Let i(o) = 48o - 6. Is i(7) a multiple of 55? True Suppose 2 + 22 = -4c. Let q(b) = b*3 + 7b*2 + 6b + 3. Is 2 a factor of q(c)? False Let j = 101 + 88. Is j a multiple of 21? True Suppose -3 = -2n + 3n. Does 16 divide ((-14)/n)/(5/45)? False Let o(r) = r*2 + 9r + 10. Let c be o(-8). Suppose -2s - 174 = -4s. Suppose -3l + 3n = -s, 0l - cn = l - 26. Does 15 divide l? False Let q(s) be the first derivative of 3s2/2 - 15s - 3. Does 2 divide q(8)? False Suppose -t = -n - 0t - 28, -3n - 69 = 2t. Let x = n + 52. Does 11 divide x? False Let p(l) = l + 2. Let q be p(0). Suppose qo - 7o + 65 = 0. Does 13 divide (-2)/(2/(-1))o? True Suppose 5m = 8m - 216. Is m a multiple of 12? True Let a(z) = -29z + 44. Is a(-5) a multiple of 9? True Let g = 1 + 3. Is 25/g + 10/(-40) even? True Does 57 divide 5100/14 - ((-5)/7 - -1)? False Let l(w) = -3w - 1 + w + 5 - 4w. Is 20 a factor of l(-6)? True Let u(r) = 2r*2 - 2. Let n be (12/(-8))/((-1)/2). Suppose 0 = s + 3v - 8, -2s + 0v + nv = 20. Is 13 a factor of u(s)? False Suppose 3d + 20 = 2d. Let x be (-11)/4 + 5/d. Does 12 divide (-3)/x(39 - 2)? False Let p(m) = 3m2 + 1. Let q be p(1). Let g(c) = c3 - 3c*2 - 6c + 6. Let b be g(q). Is 3 - ((-126)/b)/(-3) a multiple of 13? False Is (-5)/((-15)/6) - -2 a multiple of 2? True Let a(f) = -5f - 2f - 3 + 6f. Is 5 a factor of a(-8)? True Suppose 0 = -2c + 4k - 21 + 257, -362 = -3c - 2k. Is c a multiple of 15? True Suppose -7s + 3s - 5q = -177, 5q = -15. Let g = -95 + s. Let p = -12 - g. Does 13 divide p? False Is 122/6 + (-8)/(-12) a multiple of 7? True Suppose -2f = 3j - 5j - 106, -120 = -2f - 5j. Let w be 700/22 - (-10)/f. Suppose -3b = -w + 5. Does 7 divide b? False Suppose 2r + 8 = -2r. Let h = 3 - r. Suppose 31 = 3d - h. Does 6 divide d? True Let z be (4 - 5)(1 - 9). Is (4 + z)/(4/14) a multiple of 21? True Suppose 0 = 5l - 20 - 0. Let u(p) = p*2 - p + 1. Does 12 divide u(l)? False Suppose -4w = -5j - 2w + 43, 3j - 23 = 4w. Is 6 a factor of ((-48)/j - 2)-3? False Suppose -r + 39 = 5t, -r + 0r + t + 45 = 0. Is 13 a factor of r? False Let x = -202 - -307. Does 13 divide x? False Does 9 divide ((-66)/(-4))/((-21)/(-56))? False Suppose -2l + 42 = -0l. Is 12 a factor of l? False Suppose z - 6m = -3m - 18, 2z = -5m + 19. Does 12 divide ((-17)/3 + -3)z? False Let z(o) = 0o3 - 3o - o*3 - 6o*2 - 4 + 0o. Suppose g + 2g = -18. Is 8 a factor of z(g)? False Suppose 36 = 2h - 2t, -t + 28 - 12 = h. Suppose 0 = -2s + h - 1. Does 4 divide s? True Is 228/14 - (-8)/(-28) a multiple of 4? True Let k(n) = -7n3 - 2n2 + n + 6. Is k(-3) a multiple of 13? False Let a be 3 - (104/2)/4. Let y(s) = s3 + 11s2 + 7s + 6. Does 12 divide y(a)? True Let y(f) = f*3 - 2f + 22. Does 12 divide y(0)? False Suppose 534 = 3g - 114. Does 31 divide g? False Let r = -6 - -11. Suppose -23 - 102 = -rs. Does 25 divide s? True Let t = -7 - -15. Let s = t - 5. Suppose 2l = -sl + 125. Is 13 a factor of l? False Suppose -3 = 2r + 9. Let n(t) = 5t + 8. Let w be n(-6). Let j = r - w. Is 7 a factor of j? False Suppose t + 98 = -t - 3f, -3t - 4*f - 145 = 0. Let m = 131 + t. Is m a multiple of 22? True
Let l = -8319 + 16180. Let c = l - 7840.044. Let o = -21 + c. What is o rounded to 2 decimal places? -0.04 Suppose -5n - 17 = 3, 10 = i - 5n. Let v be (48/i)/((-1)/(-20)). Round v to the nearest 10. -100 Let j = -0.013 - 0.023. Let m = 1.944 + -1.71. Let p = m - j. Round p to one decimal place. 0.3 Suppose -5n = 5963035 + 1084625. Let o = n - -856503. Let u = 153029 + o. What is u rounded to the nearest 1000000? 0 Let f = -2 + 2.3. Let m = f + -0.300014. Round m to six decimal places. -0.000014 Suppose -3f = -0f - a - 23, -3f + 3a = -21. Let o be 4/16 + (-21600002)/f. What is o rounded to the nearest 1000000? -3000000 Let t(p) = 16p - 6. Let i(f) = -49f + 18. Let w(n) = 3i(n) + 8t(n). Let q be w(-6). What is q rounded to the nearest ten? 120 Let v = 82383.059 - 82334. Let f = v - 49. Round f to two dps. 0.06 Let y(t) = 829t*2 - 2 - 3 + 2616t*2. Let z be y(-3). Round z to the nearest one thousand. 31000 Let y be (-50)/(3/57-1). Round y to the nearest 100. 1000 Let r = 137 + -137.00000166. What is r rounded to seven decimal places? -0.0000017 Let f = -0.200135 - -0.2. What is f rounded to 5 decimal places? -0.00014 Let n be 75(-1 - (-41197)/(-3)). What is n rounded to the nearest one hundred thousand? -1000000 Let w = 325 - 324.9999839. Round w to 6 dps. 0.000016 Let o = 3633 + -3534.043. Let y = -99 + o. Let w = -0.04299977 - y. What is w rounded to 7 dps? 0.0000002 Suppose -u - 59 = -2u. Round u to the nearest 10. 60 Suppose 4r - 1 + 25 = 0. Let g(x) = -x3 - 7x*2 - 6x - 4. Let t be g(r). Let q be (16/(-6))/t-10350. Round q to the nearest one thousand. -7000 Let q(z) = -201z*3 - 18z*2 - 255z*3 - 4z + 4z2 - 81z*3. Let m be q(12). Round m to the nearest one hundred thousand. -900000 Let p = 0.700006 + -0.7. Round p to 5 dps. 0.00001 Let o = 0.09659351 - -0.08340747. Let j = o - 0.18. What is j rounded to seven dps? 0.000001 Let f = -20 + 21.8. Let g = 1.8001 - f. Round g to three decimal places. 0 Suppose -4h + 0n = 2n - 4, 2n = -2h + 4. Suppose h = 3w + 689448 - 5549448. What is w rounded to the nearest one hundred thousand? 1600000 Let b = -72.979 - -73. What is b rounded to 2 dps? 0.02 Let u = -4152.998 + 4147. Let t = -6 - u. Round t to two dps. 0 Let h = -50344.2017 - -50347. Let x = -2.8 + h. What is x rounded to three decimal places? -0.002 Let n = -131 - -4. Let u = 60 + n. Let h = u + 66.9999917. Round h to 6 dps. -0.000008 Let r = 11 + -3. Let d = 1563771.00007 + -1563763. Let y = r - d. What is y rounded to four dps? -0.0001 Let p = -85.99908 + 86. What is p rounded to 4 dps? 0.0009 Let v(a) = -4a*3 - 2a*2 + 2a + 6. Let i be v(-4). Let n be i(1809120/(-9))/2. Let r = n - -33112480. What is r rounded to the nearest one million? 11000000 Let g be (-15)/(-6)(-18)/(-15). Let b(o) = -5600 - o*2 - o + 3o - go. Let n be b(0). Round n to the nearest one thousand. -6000 Let c(g) = -g2 - g + 50945758. Let m be c(0). Let i = m + -33458345. Let o = -9487413 + i. What is o rounded to the nearest 1000000? 8000000 Let g = -0.599984 + 0.6. What is g rounded to 6 decimal places? 0.000016 Let j = 464.0281 - 464. Round j to 2 decimal places. 0.03 Let m = 246 + -246.0171. What is m rounded to three decimal places? -0.017 Suppose 15k - 10k - 83000 = 0. Round k to the nearest one thousand. 17000 Suppose l + 18 = 3w - 0l, 5 = 4w + 5l. Suppose -q - 4i + 3 = -4, -wq + 2i = 9. Let z(v) = 8099v - 1. Let x be z(q). Round x to the nearest one thousand. -8000 Let x = 1147690.0194 - 1147829. Let d = -139 - x. Round d to 3 decimal places. -0.019 Suppose -3 - 9 = -3x. Let v be (x + 6)/(2/(-4360)). Round v to the nearest 1000. -22000 Let a = 223059.897053 - 223060. Let f = -0.113 + 0.216. Let m = f + a. What is m rounded to 5 dps? 0.00005 Let n = -27 + 27.00508. Round n to 4 decimal places. 0.0051 Let j(m) = m*2 + 6m + 7. Let b be j(-5). Let v be (-11)/(0 + b/(-2)). What is v rounded to zero dps? 11 Let s = -234 + 122. Let f = -112.03936 - s. Let w = -0.04 - f. Round w to 4 dps. -0.0006 Let u = -1489 + 1004. Let x be (u + 1)20/(-8). Round x to the nearest 100. 1200 Let n = -68.8 - -68.9387. Let h = n + -0.15. Round h to 3 dps. -0.011 Let b = 4536954.36711 + -4536868. Let j = 86.33 - b. Let i = j + 0.038. What is i rounded to four dps? 0.0009 Let c = 0.1912 + 85.7258. Let k = -86 + c. What is k rounded to two dps? -0.08 Suppose 0 = -5s - 5281054 + 31054. Round s to the nearest 100000. -1100000 Let y = -2153 - -2142.9936. Let w = 10 + y. Round w to three dps. -0.006 Suppose 0 = -7t + 3t - 123600. What is t rounded to the nearest 1000? -31000 Let f(z) = z*3 - 4z*2 + 2z - 2. Let q be f(4). Suppose 1340008 = -i - i + 4o, -3o + q = 0. What is i rounded to the nearest 100000? -700000 Let q = 2.751503510483 + 1785892.028497369517. Let f = q + -1785873.78. Let r = 21 - f. Round r to 7 dps. -0.0000009 Suppose -r + 2r + 3 = -x, -2r = -2x + 10. Let w = -4 - r. Suppose w = -3b - 4z - 2396, 0 = -5b + 4z - 5411 + 1407. Round b to the nearest one thousand. -1000 Let k = -0.09 + 6.09. Let q = 430874 - 430868.00033. Let a = q - k. What is a rounded to four decimal places? -0.0003 Let i = 2315 - 2203.7. Let s = -105 + i. Let x = 6.246 - s. What is x rounded to two decimal places? -0.05 Let g = -3 + 1. Let m(o) = 15374o*3 - 2o*2 + o + 2. Let y be m(g). What is y rounded to the nearest ten thousand? -120000 Suppose -4v = -3v - 1. Suppose 0u - 4 = -3k + u, 4k + 3u = -12. Let n be k + 2 - v-2298. What is n rounded to the nearest one thousand? 2000 Let g = 2.499988 + -2.5. Round g to six decimal places. -0.000012 Suppose 0 = -3k - 2u - 3u + 523, k = 4u + 180. Let x = 248 - k. What is x rounded to the nearest ten? 70 Let u(w) = 154688w3 + w2 - 4w. Let r be 4/(-10) - 44/(-10). Suppose -s + 0s = r. Let z be u(s). What is z rounded to the nearest 1000000? -10000000 Let h = -21.993 + -0.007. Let i = 22.022 + h. What is i rounded to 2 decimal places? 0.02 Let w = 50.999926 - 51. Round w to 5 decimal places. -0.00007 Suppose 0 = -3x + 4h - 722992, h - 4h - 6 = 0. Round x to the nearest 10000. -240000 Let h = -0.105 + 0.066. Let b = 458 + -463.761. Let w = h + b. What is w rounded to the nearest integer? -6 Let h = -36.0000005 + 36. What is h rounded to 7 decimal places? -0.0000005 Let v be -2 + 101/2. Suppose 32 = vq + q. Suppose -200 = -qo + 3o. What is o rounded to the nearest one hundred? 0 Suppose 6k = k + 20. Suppose -2q + 4200862 - 1180874 = -kr, 0 = 5q - r - 7549997. Round q to the nearest one hundred thousand. 1500000 Let u = 0.145 - 0.0398. Let o = u + -0.11. Round o to 3 decimal places. -0.005 Let y = 204.0113 + -204. Round y to 3 dps. 0.011 Let n = -0.7 - -8.7. Let w = n + -7.65. What is w rounded to 1 dp? 0.4 Let a = 0.032 - 3.632. What is a rounded to the nearest integer? -4 Let z = -15 - -15.135. What is z rounded to two dps? 0.14 Suppose 7 = -5w - c + 16, 2w = -5c + 22. Let t = w + 1. Suppose -tj = -3j + 9400. What is j rounded to the nearest 1000? 9000 Suppose -156 = 4t - 784. Suppose -2g = 1577 - t. What is g rounded to the nearest 100? -700 Let y = -125.569911 + 126.8699. Let k = -5.3 - -4. Let l = k + y. What is l rounded to 5 dps? -0.00001 Let d = -124.247 + 0.247. Let n = d + 83. Let h = -41.00069 - n. Round h to four decimal places. -0.0007 Let g be (-4)/(-10) + 25399992/20. Round g to the nearest 100000. 1300000 Suppose 5651783 = -o + 22851779. Suppose 2w + 12900010 = 5w + 5l, 0 = 4w - 2l - o. What is w rounded to the nearest 1000000? 4000000 Let q = -31.4 + -30.62. Let u = -0.98 + q. Let k = u + 63.129. Round k to 2 dps. 0.13 Let d(z) = -9402z2 - z - 1. Let h(s) = s2 + 1. Let m(p) = -d(p) - 2h(p). Let x be m(1). What is x rounded to the nearest 1000? 9000 Let y = -126 + 124.44. Round y to 1 dp. -1.6 Suppose -3z - 400015 = -2b, 48846 - 448826 = -2b - 4z. What is b rounded to the nearest 100000? 200000 Suppose -782 = -5p - 3k + 1218, 4p + k - 1593 = 0. Let l = p - 987. What is l rounded to the nearest 100? -600 Let w = -3 + 19. Let t = w + -16.0068. Round t to three decimal places. -0.007 Let i(w) = -w - 1. Let p be i(-3). Round p to the nearest ten. 0 Let j(u) be the second derivative of 77u*4/4 - 5u**3/6 + u. Let c be j(-5). Round c to the nearest 1000. 6000 Let h = 1221.5220701 + 0.0009299. Let b = h + -1221. Let v = 0.087 + b. Round v to 1 dp. 0.6 Let c = 558030431 - 884337590. Let u = 326307104.9999979 + c. Let x = u + 54. What is x rounded to six dps? -0.000002
Four letters picked without replacement from kakmxkzxmxmxxaax. Give prob of picking 1 m, 1 k, and 2 x. 27/364 What is prob of picking 2 z and 2 h when four letters picked without replacement from {l: 1, h: 7, d: 1, z: 3}? 7/55 Two letters picked without replacement from jnngdxxg. What is prob of picking 2 n? 1/28 What is prob of picking 3 g and 1 k when four letters picked without replacement from {p: 2, k: 4, g: 7}? 28/143 Two letters picked without replacement from aaaaiidi. What is prob of picking 1 i and 1 a? 3/7 Two letters picked without replacement from yebebjyjiojjyy. Give prob of picking 1 i and 1 y. 4/91 Two letters picked without replacement from ffpqfpu. Give prob of picking 2 p. 1/21 Three letters picked without replacement from {l: 9, v: 4, e: 1, n: 1, g: 3}. Give prob of picking 1 l and 2 g. 9/272 Two letters picked without replacement from rrrssr. Give prob of picking 2 r. 2/5 Calculate prob of picking 2 g when two letters picked without replacement from wgwwwwwwdwuwwg. 1/91 Two letters picked without replacement from {s: 3, b: 4}. Give prob of picking 1 b and 1 s. 4/7 Two letters picked without replacement from mbuflvlfm. What is prob of picking 1 u and 1 m? 1/18 Calculate prob of picking 1 e and 1 q when two letters picked without replacement from {f: 2, q: 1, r: 1, w: 2, e: 2, z: 1}. 1/18 Three letters picked without replacement from lrsrrzxzrdddrrxzdzxz. What is prob of picking 1 l, 1 s, and 1 r? 1/190 What is prob of picking 1 o, 1 c, and 1 n when three letters picked without replacement from {o: 2, c: 1, n: 4}? 8/35 What is prob of picking 1 p and 2 g when three letters picked without replacement from {g: 7, b: 2, o: 1, p: 1, q: 4}? 3/65 Two letters picked without replacement from {c: 1, a: 3, b: 1, v: 2}. Give prob of picking 1 c and 1 v. 2/21 Calculate prob of picking 2 e and 2 t when four letters picked without replacement from eeetteteettttttttet. 231/646 What is prob of picking 1 y and 1 f when two letters picked without replacement from {y: 1, l: 4, f: 6}? 6/55 Two letters picked without replacement from {p: 7, o: 6}. What is prob of picking 2 o? 5/26 What is prob of picking 1 n, 1 z, and 2 q when four letters picked without replacement from {w: 1, q: 3, z: 1, p: 1, h: 2, n: 3}? 3/110 What is prob of picking 2 m when two letters picked without replacement from {m: 6}? 1 Three letters picked without replacement from {v: 2, y: 16}. Give prob of picking 3 y. 35/51 What is prob of picking 4 r when four letters picked without replacement from rkkrrkkrrrkrrrrrrk? 11/68 Calculate prob of picking 1 v, 1 n, and 1 f when three letters picked without replacement from {v: 1, n: 2, f: 1, e: 2, y: 1, c: 2}. 1/42 Two letters picked without replacement from trtrt. Give prob of picking 2 t. 3/10 What is prob of picking 1 b, 2 e, and 1 y when four letters picked without replacement from {y: 1, e: 1, b: 2, g: 1, h: 1, z: 1}? 0 What is prob of picking 1 e and 2 j when three letters picked without replacement from {j: 4, l: 1, e: 3, w: 5}? 9/143 Calculate prob of picking 1 z and 2 c when three letters picked without replacement from mzbcbrbcrrcccr. 5/182 Three letters picked without replacement from {r: 2, p: 3, c: 3, q: 12}. Give prob of picking 2 q and 1 p. 33/190 Four letters picked without replacement from hghhhhhghhh. Give prob of picking 2 g and 2 h. 6/55 Two letters picked without replacement from {b: 3, a: 4, w: 1, c: 2, p: 1, e: 1}. Give prob of picking 1 c and 1 b. 1/11 Two letters picked without replacement from {k: 2, h: 1, b: 1}. What is prob of picking 1 h and 1 b? 1/6 Four letters picked without replacement from {a: 2, b: 6}. What is prob of picking 4 b? 3/14 Calculate prob of picking 2 z when two letters picked without replacement from gkzkzkzkkzggkgk. 2/35 Three letters picked without replacement from boaobaaoofffaboaa. Give prob of picking 1 a and 2 o. 3/34 What is prob of picking 1 i and 1 t when two letters picked without replacement from {i: 7, j: 4, t: 5, h: 3}? 35/171 Two letters picked without replacement from hbkh. Give prob of picking 1 h and 1 b. 1/3 What is prob of picking 1 o, 2 d, and 1 b when four letters picked without replacement from dbbodybdcdbkdyy? 8/273 Three letters picked without replacement from jjeess. What is prob of picking 1 s and 2 e? 1/10 Three letters picked without replacement from {l: 2, z: 1, c: 1, s: 1, d: 5}. Give prob of picking 1 z, 1 s, and 1 c. 1/120 Two letters picked without replacement from bbdfbbdddb. What is prob of picking 2 d? 2/15 Calculate prob of picking 1 o, 1 h, and 1 i when three letters picked without replacement from {o: 1, h: 3, i: 4, l: 1, d: 6, a: 1}. 3/140 Four letters picked without replacement from pkkxxxxxkxwxkp. What is prob of picking 2 p and 2 k? 6/1001 What is prob of picking 3 k and 1 e when four letters picked without replacement from {k: 9, e: 3}? 28/55 Two letters picked without replacement from uuuukuuukuukkuuuuu. Give prob of picking 2 k. 2/51 Four letters picked without replacement from {u: 4}. What is prob of picking 4 u? 1 Four letters picked without replacement from xsxsxsxxxxxssxsssxss. Give prob of picking 1 x and 3 s. 80/323 Two letters picked without replacement from {y: 4, g: 10, p: 5, b: 1}. What is prob of picking 2 y? 3/95 Three letters picked without replacement from {c: 2, l: 3, x: 1, y: 6}. Give prob of picking 2 y and 1 c. 3/22 Four letters picked without replacement from tvvmdvrnttdr. Give prob of picking 1 v, 2 r, and 1 m. 1/165 What is prob of picking 2 j when two letters picked without replacement from djdddjjjjddjdj? 3/13 Two letters picked without replacement from {p: 3, v: 4, l: 1}. Give prob of picking 2 p. 3/28 What is prob of picking 2 m when two letters picked without replacement from oyooooymmomomooo? 1/20 Two letters picked without replacement from {l: 1, j: 1, x: 2, q: 1}. What is prob of picking 1 j and 1 q? 1/10 Calculate prob of picking 1 o and 1 w when two letters picked without replacement from {o: 4, a: 2, w: 1, n: 1}. 1/7 Calculate prob of picking 2 e when two letters picked without replacement from {y: 16, e: 4}. 3/95 Two letters picked without replacement from fmzffmzzzzmzz. Give prob of picking 2 z. 7/26 Three letters picked without replacement from dfdfdff. Give prob of picking 1 f and 2 d. 12/35 What is prob of picking 1 f and 1 n when two letters picked without replacement from {p: 2, n: 5, f: 1, w: 3, x: 3, r: 1}? 1/21 Calculate prob of picking 1 c and 2 j when three letters picked without replacement from cyyjsysjxyyjiys. 3/455 Three letters picked without replacement from {a: 2, i: 2, t: 2, j: 5, m: 9}. Give prob of picking 2 j and 1 a. 1/57 Calculate prob of picking 1 n, 1 x, and 1 y when three letters picked without replacement from gxgynrf. 1/35 What is prob of picking 1 b, 1 a, and 1 c when three letters picked without replacement from bcgffbgaff? 1/60 What is prob of picking 2 r when two letters picked without replacement from rrrrrfrffrrrrrrrfrrr? 12/19 Two letters picked without replacement from pnnddndnndpdn. What is prob of picking 1 d and 1 p? 5/39 Four letters picked without replacement from {z: 2, p: 5, m: 2}. Give prob of picking 1 z, 2 p, and 1 m. 20/63 Calculate prob of picking 2 n and 2 l when four letters picked without replacement from llqoqnoqnq. 1/210 What is prob of picking 1 w, 2 j, and 1 b when four letters picked without replacement from {v: 10, x: 1, b: 2, j: 4, w: 1}? 1/255 What is prob of picking 2 f when two letters picked without replacement from {f: 4, l: 1, m: 3, c: 5}? 1/13 Calculate prob of picking 2 s and 1 h when three letters picked without replacement from {h: 9, s: 2}. 3/55 Four letters picked without replacement from {e: 2, v: 3, h: 1, j: 3, r: 1, m: 7}. What is prob of picking 1 j, 2 m, and 1 r? 9/340 Two letters picked without replacement from {r: 3, t: 1, o: 6, d: 2, z: 2, k: 4}. Give prob of picking 2 z. 1/153 Two letters picked without replacement from xxxxxxqxxxxxxxx. What is prob of picking 2 x? 13/15 Calculate prob of picking 1 r, 1 w, and 1 u when three letters picked without replacement from uuwwuwwuuuurw. 35/286 Calculate prob of picking 2 o and 1 r when three letters picked without replacement from {l: 5, u: 3, r: 2, o: 2}. 1/110 Three letters picked without replacement from biffifrffxirifrifb. What is prob of picking 1 f and 2 r? 7/272 Calculate prob of picking 1 r and 1 q when two letters picked without replacement from qqmqqqqqqrqqmrqqqqmq. 3/19
What is the thousands digit of 359800239? 0 What is the thousands digit of 12539164? 9 What is the units digit of 83627198? 8 What is the hundred millions digit of 322502862? 3 What is the hundreds digit of 181931837? 8 What is the units digit of 539257111? 1 What is the hundred millions digit of 429203648? 4 What is the thousands digit of 72148422? 8 What is the millions digit of 1095282418? 5 What is the hundred millions digit of 1281016245? 2 What is the hundred millions digit of 1851407129? 8 What is the ten thousands digit of 3264339559? 3 What is the ten thousands digit of 168555601? 5 What is the hundreds digit of 1769590269? 2 What is the ten thousands digit of 2523113312? 1 What is the units digit of 29144782? 2 What is the tens digit of 29196650? 5 What is the billions digit of 1014510474? 1 What is the hundred millions digit of 270842692? 2 What is the ten millions digit of 102439286? 0 What is the tens digit of 447723515? 1 What is the thousands digit of 368554099? 4 What is the hundreds digit of 5210535046? 0 What is the hundreds digit of 149145599? 5 What is the thousands digit of 157353027? 3 What is the hundred millions digit of 203545034? 2 What is the ten millions digit of 128550180? 2 What is the hundred thousands digit of 54878963? 8 What is the ten millions digit of 196632177? 9 What is the ten millions digit of 32599535? 3 What is the millions digit of 307314115? 7 What is the thousands digit of 70540105? 0 What is the hundred millions digit of 103395833? 1 What is the billions digit of 2910862566? 2 What is the ten millions digit of 2401736987? 0 What is the ten millions digit of 2172031689? 7 What is the thousands digit of 977549905? 9 What is the tens digit of 130065257? 5 What is the hundreds digit of 76914515? 5 What is the hundreds digit of 422866922? 9 What is the units digit of 1518865330? 0 What is the hundreds digit of 302444? 4 What is the hundred thousands digit of 264714607? 7 What is the hundreds digit of 70608840? 8 What is the units digit of 55034438? 8 What is the thousands digit of 1000441801? 1 What is the hundreds digit of 76391490? 4 What is the hundred thousands digit of 745597661? 5 What is the ten millions digit of 21539526? 2 What is the ten thousands digit of 4104418655? 1 What is the thousands digit of 3106238764? 8 What is the millions digit of 329840994? 9 What is the millions digit of 51740289? 1 What is the millions digit of 5235034162? 5 What is the hundred thousands digit of 11199606? 1 What is the hundred thousands digit of 5845716? 8 What is the ten millions digit of 190916331? 9 What is the hundred thousands digit of 743155151? 1 What is the hundreds digit of 120545480? 4 What is the hundred millions digit of 1762799847? 7 What is the thousands digit of 65955365? 5 What is the tens digit of 753064912? 1 What is the tens digit of 1085158931? 3 What is the hundred millions digit of 246434688? 2 What is the millions digit of 241715620? 1 What is the hundred thousands digit of 246665064? 6 What is the thousands digit of 552166976? 6 What is the thousands digit of 75516384? 6 What is the hundred millions digit of 1469997014? 4 What is the thousands digit of 163695672? 5 What is the billions digit of 1260330459? 1 What is the thousands digit of 2883470167? 0 What is the ten millions digit of 613048673? 1 What is the millions digit of 4656494? 4 What is the ten thousands digit of 2268580185? 8 What is the thousands digit of 342479028? 9 What is the millions digit of 47998379? 7 What is the hundred thousands digit of 2514047716? 0 What is the hundreds digit of 1778933828? 8 What is the hundred millions digit of 514532988? 5 What is the hundreds digit of 93234130? 1 What is the hundred thousands digit of 2184390800? 3 What is the hundreds digit of 1101132312? 3 What is the ten thousands digit of 974153398? 5 What is the units digit of 61809539? 9 What is the tens digit of 2786013982? 8 What is the units digit of 42989997? 7 What is the ten thousands digit of 178715891? 1 What is the ten thousands digit of 2077217089? 1 What is the ten thousands digit of 519485658? 8 What is the tens digit of 1747934286? 8 What is the millions digit of 5063938297? 3 What is the thousands digit of 74876276? 6 What is the ten thousands digit of 4078409? 7 What is the thousands digit of 743534535? 4 What is the tens digit of 1757878762? 6 What is the hundred thousands digit of 15824898? 8 What is the units digit of 1178474295? 5 What is the hundred thousands digit of 728580698? 5 What is the ten millions digit of 230450466? 3 What is the hundred thousands digit of 2653178494? 1 What is the hundred millions digit of 1876970719? 8 What is the ten millions digit of 37195584? 3 What is the hundred thousands digit of 81276203? 2 What is the ten thousands digit of 39047370? 4 What is the millions digit of 47273255? 7 What is the ten thousands digit of 2113499587? 9 What is the units digit of 15703018? 8 What is the units digit of 148606785? 5 What is the tens digit of 69326041? 4 What is the hundred thousands digit of 76461184? 4 What is the hundreds digit of 963040474? 4 What is the millions digit of 137598224? 7 What is the ten millions digit of 22330468? 2 What is the units digit of 126326617? 7 What is the ten millions digit of 2392775656? 9 What is the tens digit of 200010235? 3 What is the hundred thousands digit of 56902673? 9 What is the thousands digit of 56879022? 9 What is the ten thousands digit of 1233439058? 3 What is the hundreds digit of 230983215? 2 What is the hundred thousands digit of 170311517? 3 What is the hundred thousands digit of 124951632? 9 What is the thousands digit of 1450053176? 3 What is the ten thousands digit of 245983245? 8 What is the hundred thousands digit of 2260737155? 7 What is the millions digit of 182146767? 2 What is the hundreds digit of 571344867? 8 What is the hundred millions digit of 8908488291? 9 What is the hundreds digit of 69050451? 4 What is the millions digit of 264249860? 4 What is the ten millions digit of 84809389? 8 What is the ten millions digit of 2098553104? 9 What is the hundred thousands digit of 3918370368? 3 What is the ten millions digit of 25091743? 2 What is the thousands digit of 69520294? 0 What is the hundreds digit of 30788926? 9 What is the tens digit of 2351711810? 1 What is the millions digit of 169618673? 9 What is the hundreds digit of 9001396? 3 What is the billions digit of 1037787136? 1 What is the billions digit of 1079045196? 1 What is the hundreds digit of 145197982? 9 What is the ten thousands digit of 694957041? 5 What is the units digit of 57101347? 7 What is the ten millions digit of 128118524? 2 What is the ten millions digit of 4140739786? 4 What is the hundreds digit of 314273844? 8 What is the ten millions digit of 44640488? 4 What is the billions digit of 3528542584? 3 What is the hundred thousands digit of 180404326? 4 What is the tens digit of 1267451320? 2 What is the millions digit of 605366199? 5 What is the hundreds digit of 4084281238? 2 What is the hundred millions digit of 816575129? 8 What is the units digit of 4852191659? 9 What is the hundred thousands digit of 53076192? 0 What is the ten thousands digit of 97719097? 1 What is the hundreds digit of 236837035? 0 What is the units digit of 80384641? 1 What is the thousands digit of 36381518? 1 What is the units digit of 136139435? 5 What is the thousands digit of 22541406? 1 What is the ten millions digit of 90933396? 9 What is the ten millions digit of 285347951? 8 What is the millions digit of 291865019? 1 What is the units digit of 3375670523? 3 What is the thousands digit of 17374070? 4 What is the ten millions digit of 182379813? 8 What is the ten thousands digit of 161342163? 4 What is the thousands digit of 60098242? 8 What is the thousands digit of 2668213287? 3 What is the hundred thousands digit of 276773499? 7 What is the millions digit of 658593869? 8 What is the ten thousands digit of 1686105144? 0 What is the millions digit of 91958045? 1 What is the thousands digit of 32454926? 4 What is the millions digit of 604172608? 4 What is the millions digit of 20472243? 0 What is the billions digit of 7379145564? 7 What is the ten thousands digit of 704368526? 6 What is the millions digit of 451236552? 1 What is the units digit of 195713622? 2 What is the ten thousands digit of 704781135? 8 What is the units digit of 109655303? 3 What is the hundreds digit of 146932546? 5 What is the tens digit of 53533469? 6 What is the hundred thousands digit of 57623934? 6 What is the ten millions digit of 209954523? 0 What is the ten millions digit of 2792916681? 9
What is the remainder when 345 is divided by 44? 37 What is the remainder when 273 is divided by 109? 55 Calculate the remainder when 83 is divided by 5. 3 Calculate the remainder when 801 is divided by 136. 121 What is the remainder when 197 is divided by 74? 49 Calculate the remainder when 717 is divided by 99. 24 Calculate the remainder when 2078 is divided by 10. 8 What is the remainder when 140 is divided by 47? 46 What is the remainder when 800 is divided by 77? 30 What is the remainder when 812 is divided by 178? 100 What is the remainder when 336 is divided by 83? 4 Calculate the remainder when 161 is divided by 57. 47 What is the remainder when 111 is divided by 19? 16 Calculate the remainder when 73 is divided by 32. 9 Calculate the remainder when 178 is divided by 9. 7 Calculate the remainder when 2996 is divided by 12. 8 Calculate the remainder when 128 is divided by 23. 13 Calculate the remainder when 204 is divided by 55. 39 Calculate the remainder when 99 is divided by 24. 3 Calculate the remainder when 1570 is divided by 1489. 81 Calculate the remainder when 1467 is divided by 32. 27 What is the remainder when 93 is divided by 26? 15 Calculate the remainder when 7 is divided by 4. 3 What is the remainder when 18 is divided by 12? 6 Calculate the remainder when 204 is divided by 71. 62 Calculate the remainder when 327 is divided by 10. 7 What is the remainder when 74 is divided by 70? 4 Calculate the remainder when 467 is divided by 39. 38 Calculate the remainder when 404 is divided by 58. 56 Calculate the remainder when 558 is divided by 43. 42 What is the remainder when 282 is divided by 26? 22 Calculate the remainder when 622 is divided by 30. 22 Calculate the remainder when 110 is divided by 41. 28 Calculate the remainder when 5261 is divided by 7. 4 Calculate the remainder when 199 is divided by 53. 40 Calculate the remainder when 228 is divided by 64. 36 Calculate the remainder when 1500 is divided by 74. 20 What is the remainder when 1694 is divided by 53? 51 Calculate the remainder when 186 is divided by 60. 6 Calculate the remainder when 215 is divided by 10. 5 Calculate the remainder when 384 is divided by 11. 10 What is the remainder when 402 is divided by 132? 6 Calculate the remainder when 399 is divided by 29. 22 What is the remainder when 159 is divided by 23? 21 What is the remainder when 20 is divided by 13? 7 What is the remainder when 363 is divided by 88? 11 Calculate the remainder when 405 is divided by 45. 0 What is the remainder when 699 is divided by 39? 36 What is the remainder when 310 is divided by 43? 9 Calculate the remainder when 48 is divided by 24. 0 Calculate the remainder when 630 is divided by 77. 14 What is the remainder when 539 is divided by 45? 44 What is the remainder when 779 is divided by 197? 188 What is the remainder when 3504 is divided by 135? 129 What is the remainder when 1130 is divided by 14? 10 What is the remainder when 1213 is divided by 81? 79 Calculate the remainder when 300 is divided by 43. 42 Calculate the remainder when 56 is divided by 2. 0 Calculate the remainder when 961 is divided by 26. 25 What is the remainder when 2270 is divided by 33? 26 Calculate the remainder when 127 is divided by 51. 25 What is the remainder when 1176 is divided by 145? 16 What is the remainder when 1472 is divided by 715? 42 Calculate the remainder when 1655 is divided by 27. 8 What is the remainder when 1159 is divided by 37? 12 Calculate the remainder when 107 is divided by 51. 5 Calculate the remainder when 116 is divided by 14. 4 What is the remainder when 148 is divided by 32? 20 Calculate the remainder when 754 is divided by 54. 52 Calculate the remainder when 9809 is divided by 22. 19 Calculate the remainder when 120 is divided by 41. 38 Calculate the remainder when 5567 is divided by 232. 231 Calculate the remainder when 501 is divided by 44. 17 What is the remainder when 361 is divided by 26? 23 What is the remainder when 16477 is divided by 32? 29 What is the remainder when 44988 is divided by 38? 34 Calculate the remainder when 7838 is divided by 196. 194 What is the remainder when 133 is divided by 9? 7 Calculate the remainder when 189 is divided by 25. 14 What is the remainder when 2650 is divided by 2? 0 Calculate the remainder when 643 is divided by 69. 22 What is the remainder when 48 is divided by 11? 4 What is the remainder when 158 is divided by 81? 77 What is the remainder when 6171 is divided by 9? 6 Calculate the remainder when 204 is divided by 122. 82 Calculate the remainder when 997 is divided by 48. 37 Calculate the remainder when 130 is divided by 48. 34 Calculate the remainder when 117 is divided by 17. 15 Calculate the remainder when 340 is divided by 8. 4 What is the remainder when 280 is divided by 57? 52 Calculate the remainder when 5142 is divided by 147. 144 Calculate the remainder when 142 is divided by 36. 34 What is the remainder when 1374 is divided by 37? 5 Calculate the remainder when 179 is divided by 48. 35 Calculate the remainder when 10 is divided by 9. 1 What is the remainder when 85 is divided by 18? 13 Calculate the remainder when 238 is divided by 20. 18 Calculate the remainder when 236 is divided by 80. 76 What is the remainder when 268 is divided by 90? 88 What is the remainder when 170 is divided by 29? 25 What is the remainder when 145 is divided by 21? 19 Calculate the remainder when 580 is divided by 137. 32 Calculate the remainder when 2831 is divided by 118. 117 Calculate the remainder when 695 is divided by 49. 9 Calculate the remainder when 2086 is divided by 1040. 6 What is the remainder when 10100 is divided by 91? 90 Calculate the remainder when 1308 is divided by 21. 6 Calculate the remainder when 99 is divided by 58. 41 Calculate the remainder when 438 is divided by 18. 6 What is the remainder when 500 is divided by 167? 166 Calculate the remainder when 968 is divided by 154. 44 What is the remainder when 470 is divided by 162? 146 What is the remainder when 72 is divided by 12? 0 What is the remainder when 2513 is divided by 168? 161 What is the remainder when 10668 is divided by 110? 108 Calculate the remainder when 83 is divided by 24. 11 What is the remainder when 525 is divided by 51? 15 What is the remainder when 158 is divided by 3? 2 Calculate the remainder when 332 is divided by 56. 52 Calculate the remainder when 42589 is divided by 32. 29 Calculate the remainder when 175 is divided by 93. 82 Calculate the remainder when 98 is divided by 72. 26 What is the remainder when 793 is divided by 207? 172 Calculate the remainder when 45 is divided by 1. 0 What is the remainder when 1603 is divided by 100? 3 What is the remainder when 2128 is divided by 21? 7 Calculate the remainder when 98 is divided by 8. 2 Calculate the remainder when 103 is divided by 26. 25 Calculate the remainder when 4475 is divided by 135. 20 What is the remainder when 345 is divided by 27? 21 What is the remainder when 192 is divided by 43? 20 Calculate the remainder when 1973 is divided by 25. 23 What is the remainder when 411 is divided by 109? 84 Calculate the remainder when 3894 is divided by 1292. 18 Calculate the remainder when 544 is divided by 177. 13 What is the remainder when 31 is divided by 6? 1 What is the remainder when 110 is divided by 14? 12 What is the remainder when 415 is divided by 136? 7 Calculate the remainder when 30 is divided by 2. 0 Calculate the remainder when 188 is divided by 21. 20 Calculate the remainder when 263 is divided by 101. 61 What is the remainder when 437 is divided by 112? 101 Calculate the remainder when 93 is divided by 33. 27 What is the remainder when 13844 is divided by 11? 6 What is the remainder when 2155 is divided by 218? 193 What is the remainder when 401 is divided by 16? 1 Calculate the remainder when 302 is divided by 96. 14 What is the remainder when 477 is divided by 16? 13 Calculate the remainder when 46 is divided by 17. 12 Calculate the remainder when 331 is divided by 30. 1 Calculate the remainder when 959 is divided by 26. 23 Calculate the remainder when 113 is divided by 58. 55 What is the remainder when 46 is divided by 7? 4 What is the remainder when 197 is divided by 67? 63 What is the remainder when 653 is divided by 65? 3 Calculate the remainder when 420 is divided by 120. 60 What is the remainder when 470 is divided by 33? 8 Calculate the remainder when 722 is divided by 121. 117 What is the remainder when 187 is divided by 107? 80 Calculate the remainder when 150 is divided by 65. 20 What is the remainder when 9189 is divided by 317? 313
How many minutes are there between 7:29 PM and 7:31 PM? 2 What is 699 minutes after 12:46 AM? 12:25 PM What is 583 minutes before 2:00 AM? 4:17 PM What is 420 minutes before 5:16 PM? 10:16 AM How many minutes are there between 9:06 PM and 2:10 AM? 304 What is 62 minutes after 11:48 PM? 12:50 AM What is 702 minutes before 7:42 PM? 8:00 AM How many minutes are there between 12:24 AM and 9:14 AM? 530 How many minutes are there between 10:12 AM and 11:56 AM? 104 What is 405 minutes before 4:22 PM? 9:37 AM What is 251 minutes before 9:11 PM? 5:00 PM How many minutes are there between 12:30 AM and 3:05 AM? 155 What is 570 minutes before 10:46 AM? 1:16 AM What is 238 minutes after 4:41 PM? 8:39 PM How many minutes are there between 12:38 AM and 12:20 PM? 702 What is 496 minutes before 10:59 AM? 2:43 AM How many minutes are there between 7:12 AM and 1:12 PM? 360 What is 399 minutes after 7:07 AM? 1:46 PM What is 595 minutes after 8:53 AM? 6:48 PM How many minutes are there between 8:17 PM and 10:08 PM? 111 How many minutes are there between 1:20 AM and 6:45 AM? 325 How many minutes are there between 10:29 AM and 1:30 PM? 181 What is 420 minutes after 2:53 PM? 9:53 PM What is 240 minutes before 2:52 AM? 10:52 PM How many minutes are there between 5:38 AM and 3:37 PM? 599 What is 596 minutes after 10:13 AM? 8:09 PM How many minutes are there between 5:28 PM and 2:12 AM? 524 What is 10 minutes after 6:51 AM? 7:01 AM How many minutes are there between 3:19 PM and 2:23 AM? 664 How many minutes are there between 3:04 AM and 12:46 PM? 582 How many minutes are there between 8:43 PM and 5:06 AM? 503 How many minutes are there between 11:32 PM and 11:34 PM? 2 How many minutes are there between 8:03 PM and 12:14 AM? 251 What is 588 minutes after 7:24 AM? 5:12 PM How many minutes are there between 2:05 PM and 2:40 PM? 35 What is 672 minutes before 12:25 AM? 1:13 PM What is 246 minutes after 10:24 PM? 2:30 AM How many minutes are there between 11:01 PM and 2:15 AM? 194 What is 539 minutes before 6:26 PM? 9:27 AM How many minutes are there between 11:11 AM and 7:05 PM? 474 How many minutes are there between 5:48 AM and 12:36 PM? 408 How many minutes are there between 11:59 PM and 12:18 AM? 19 How many minutes are there between 9:13 PM and 2:57 AM? 344 What is 609 minutes before 11:08 AM? 12:59 AM How many minutes are there between 11:08 PM and 10:11 AM? 663 How many minutes are there between 5:16 PM and 8:31 PM? 195 How many minutes are there between 2:09 AM and 1:06 PM? 657 What is 325 minutes after 4:46 AM? 10:11 AM What is 135 minutes after 2:29 AM? 4:44 AM What is 709 minutes after 5:36 AM? 5:25 PM How many minutes are there between 12:23 PM and 12:25 PM? 2 What is 568 minutes before 2:06 PM? 4:38 AM What is 505 minutes before 8:08 AM? 11:43 PM What is 88 minutes after 10:44 AM? 12:12 PM How many minutes are there between 1:31 AM and 9:36 AM? 485 What is 48 minutes after 1:24 AM? 2:12 AM How many minutes are there between 1:51 AM and 3:07 AM? 76 How many minutes are there between 10:14 AM and 5:08 PM? 414 How many minutes are there between 12:46 AM and 11:41 AM? 655 What is 560 minutes after 8:47 PM? 6:07 AM What is 291 minutes after 5:58 AM? 10:49 AM How many minutes are there between 11:27 AM and 4:06 PM? 279 How many minutes are there between 8:21 PM and 8:08 AM? 707 How many minutes are there between 2:29 PM and 5:15 PM? 166 How many minutes are there between 2:29 AM and 10:42 AM? 493 How many minutes are there between 11:15 PM and 12:08 AM? 53 What is 255 minutes before 12:52 AM? 8:37 PM What is 528 minutes after 4:37 AM? 1:25 PM How many minutes are there between 7:44 AM and 9:26 AM? 102 What is 416 minutes before 5:38 PM? 10:42 AM What is 595 minutes before 12:26 PM? 2:31 AM What is 154 minutes before 10:04 AM? 7:30 AM How many minutes are there between 9:12 AM and 6:48 PM? 576 What is 266 minutes before 4:27 AM? 12:01 AM How many minutes are there between 8:58 AM and 5:32 PM? 514 How many minutes are there between 3:50 AM and 9:56 AM? 366 How many minutes are there between 3:27 PM and 1:36 AM? 609 How many minutes are there between 9:53 AM and 9:40 PM? 707 What is 2 minutes before 9:53 PM? 9:51 PM How many minutes are there between 3:14 AM and 12:55 PM? 581 How many minutes are there between 3:03 PM and 4:44 PM? 101 How many minutes are there between 10:35 PM and 12:05 AM? 90 How many minutes are there between 6:40 AM and 4:25 PM? 585 How many minutes are there between 10:28 PM and 11:09 PM? 41 How many minutes are there between 7:26 AM and 4:03 PM? 517 What is 609 minutes before 11:59 PM? 1:50 PM What is 203 minutes after 4:12 AM? 7:35 AM What is 430 minutes before 6:51 PM? 11:41 AM How many minutes are there between 3:38 PM and 3:15 AM? 697 What is 399 minutes before 12:41 AM? 6:02 PM What is 599 minutes before 3:38 AM? 5:39 PM What is 373 minutes after 5:55 AM? 12:08 PM How many minutes are there between 2:24 PM and 4:49 PM? 145 How many minutes are there between 3:15 PM and 10:01 PM? 406 What is 657 minutes after 3:32 AM? 2:29 PM What is 528 minutes before 12:50 AM? 4:02 PM How many minutes are there between 12:19 AM and 3:20 AM? 181 How many minutes are there between 8:53 AM and 1:55 PM? 302 What is 337 minutes after 5:06 AM? 10:43 AM How many minutes are there between 6:23 PM and 10:57 PM? 274 What is 530 minutes after 6:49 AM? 3:39 PM How many minutes are there between 11:28 AM and 5:54 PM? 386 How many minutes are there between 12:09 AM and 11:57 AM? 708 How many minutes are there between 4:32 PM and 10:03 PM? 331 What is 704 minutes after 3:41 PM? 3:25 AM What is 127 minutes after 11:23 AM? 1:30 PM How many minutes are there between 1:04 AM and 7:15 AM? 371 How many minutes are there between 5:35 AM and 4:02 PM? 627 How many minutes are there between 6:26 PM and 4:35 AM? 609 What is 644 minutes before 5:44 PM? 7:00 AM What is 204 minutes after 1:37 AM? 5:01 AM What is 92 minutes after 5:08 AM? 6:40 AM What is 444 minutes after 9:53 AM? 5:17 PM What is 300 minutes after 1:30 AM? 6:30 AM What is 611 minutes before 9:30 AM? 11:19 PM How many minutes are there between 6:58 AM and 9:33 AM? 155 What is 525 minutes after 10:57 PM? 7:42 AM How many minutes are there between 4:38 AM and 10:02 AM? 324 How many minutes are there between 8:34 AM and 5:24 PM? 530 What is 153 minutes after 5:04 AM? 7:37 AM What is 101 minutes before 8:32 PM? 6:51 PM What is 376 minutes after 10:11 AM? 4:27 PM What is 429 minutes before 1:03 AM? 5:54 PM What is 707 minutes before 11:48 AM? 12:01 AM What is 296 minutes before 2:52 AM? 9:56 PM What is 345 minutes before 4:14 AM? 10:29 PM How many minutes are there between 1:45 AM and 10:54 AM? 549 What is 423 minutes before 7:56 PM? 12:53 PM What is 211 minutes before 5:14 AM? 1:43 AM How many minutes are there between 1:52 PM and 7:34 PM? 342 What is 165 minutes after 11:33 AM? 2:18 PM What is 137 minutes after 7:39 PM? 9:56 PM What is 430 minutes after 9:21 AM? 4:31 PM What is 128 minutes after 12:14 AM? 2:22 AM What is 559 minutes after 2:54 PM? 12:13 AM How many minutes are there between 9:09 PM and 11:12 PM? 123 What is 12 minutes after 7:07 AM? 7:19 AM How many minutes are there between 7:28 PM and 12:52 AM? 324 How many minutes are there between 12:38 PM and 12:48 PM? 10 How many minutes are there between 1:02 AM and 8:30 AM? 448 What is 4 minutes before 2:33 PM? 2:29 PM How many minutes are there between 4:03 PM and 8:42 PM? 279 How many minutes are there between 2:59 AM and 1:11 PM? 612 How many minutes are there between 7:39 PM and 3:25 AM? 466 How many minutes are there between 10:39 PM and 3:42 AM? 303 What is 60 minutes after 3:27 PM? 4:27 PM What is 303 minutes before 10:04 PM? 5:01 PM How many minutes are there between 8:36 AM and 12:13 PM? 217 How many minutes are there between 7:23 AM and 5:57 PM? 634 How many minutes are there between 7:06 AM and 1:22 PM? 376 How many minutes are there between 12:07 AM and 7:16 AM? 429 How many minutes are there between 6:11 AM and 3:43 PM? 572 How many minutes are there between 2:14 AM and 10:35 AM? 501 What is 203 minutes before 7:17 PM? 3:54 PM How many minutes are there between 5:47 PM and 3:36 AM? 589 What is 675 minutes after 12:39 AM? 11:54 AM What is 612 minutes after 12:46 PM? 10:58 PM What is 405 minutes after 5:31 AM? 12:16 PM What is 439 minutes after 12:29 PM? 7:48 PM What is 40 minutes after 6:10 AM? 6:50 AM What is 154 minutes after 11:08 PM? 1:42 AM What is 675 minutes after 1:31 PM? 12:46 AM What is 547 minutes after 3:07 AM? 12:14 PM What is 456 minutes after 8:09 AM? 3:45 PM
What is 75.6403 days in seconds? 6535321.92 Convert 14424.9 centuries to years. 1442490 How many meters are there in 17/4 of a kilometer? 4250 What is eleven halves of a microgram in nanograms? 5500 What is 742.5966 centimeters in millimeters? 7425.966 Convert 25525.84 millilitres to litres. 25.52584 What is five eighths of a millisecond in microseconds? 625 What is 7/2 of a litre in millilitres? 3500 How many minutes are there in 3/16 of a week? 1890 How many seconds are there in 15/4 of a hour? 13500 What is 30.28297 millennia in centuries? 302.8297 What is one fifth of a milligram in micrograms? 200 How many centimeters are there in twenty-one quarters of a meter? 525 Convert 2.064949 hours to nanoseconds. 7433816400000 What is 435456.5 grams in milligrams? 435456500 Convert 460.410237s to weeks. 0.0007612603125 Convert 950466.6l to millilitres. 950466600 What is 21/8 of a meter in millimeters? 2625 How many millimeters are there in 98.91068cm? 989.1068 What is 3/8 of a meter in millimeters? 375 What is 13/8 of a milligram in micrograms? 1625 What is 2/15 of a minute in seconds? 8 How many nanometers are there in three fifths of a micrometer? 600 How many years are there in six fifths of a decade? 12 How many grams are there in seven halves of a kilogram? 3500 How many micrometers are there in 15/4 of a millimeter? 3750 What is 41.87529nm in meters? 0.00000004187529 What is 13/4 of a micrometer in nanometers? 3250 How many kilometers are there in 8049.99nm? 0.00000000804999 How many centimeters are there in 6063.238m? 606323.8 How many hours are there in 3/8 of a day? 9 How many minutes are there in six fifths of a day? 1728 Convert 697.6264 grams to nanograms. 697626400000 What is 43/2 of a gram in milligrams? 21500 How many minutes are there in 4/15 of a hour? 16 What is 0.1655151 litres in millilitres? 165.5151 What is 0.0313612 millennia in months? 376.3344 What is 427.4295 centuries in years? 42742.95 What is 21/4 of a millimeter in micrometers? 5250 How many decades are there in 14258.616 months? 118.8218 Convert 0.8524191 grams to milligrams. 852.4191 What is eight thirds of a century in months? 3200 How many nanometers are there in 0.7732737m? 773273700 What is 1/20 of a litre in millilitres? 50 How many millilitres are there in thirteen quarters of a litre? 3250 What is 22.19036 centuries in decades? 221.9036 What is sixty-nine halves of a millimeter in micrometers? 34500 What is 4915.873 micrometers in kilometers? 0.000004915873 What is twenty-six fifths of a millisecond in microseconds? 5200 What is 59231.86km in micrometers? 59231860000000 What is twenty-five quarters of a litre in millilitres? 6250 How many millilitres are there in one quarter of a litre? 250 What is fourty-five eighths of a microsecond in nanoseconds? 5625 Convert 24173.95 litres to millilitres. 24173950 How many centimeters are there in seven sixteenths of a kilometer? 43750 What is 11/8 of a litre in millilitres? 1375 What is seventy-six fifths of a hour in minutes? 912 How many nanometers are there in 7.704542cm? 77045420 What is 1/20 of a kilometer in millimeters? 50000 What is one quarter of a kilometer in meters? 250 What is 0.973747 days in nanoseconds? 84131740800000 How many milligrams are there in 554.6434ng? 0.0005546434 What is one sixth of a hour in minutes? 10 What is 15/4 of a millennium in months? 45000 How many minutes are there in 4/3 of a week? 13440 Convert 28.50869 millennia to months. 342104.28 What is 656460.6 kilograms in tonnes? 656.4606 How many millilitres are there in 380.0576l? 380057.6 How many micrometers are there in 9375.597cm? 93755970 What is one tenth of a millennium in centuries? 1 Convert 582.1473ug to kilograms. 0.0000005821473 How many nanometers are there in 1/10 of a millimeter? 100000 How many centuries are there in 9853.357 years? 98.53357 How many seconds are there in 18.98867 minutes? 1139.3202 What is 2.9592339 months in decades? 0.0246602825 How many millilitres are there in 3/10 of a litre? 300 Convert 150.8393 micrometers to centimeters. 0.01508393 What is 18/5 of a decade in months? 432 How many months are there in thirteen fifths of a decade? 312 How many minutes are there in twenty ninths of a day? 3200 How many micrograms are there in 6/25 of a milligram? 240 How many millilitres are there in 7/8 of a litre? 875 How many minutes are there in seventeen halves of a hour? 510 How many nanograms are there in 52/5 of a microgram? 10400 How many centuries are there in 0.5098108 years? 0.005098108 Convert 361.5313 millimeters to centimeters. 36.15313 What is 3/50 of a litre in millilitres? 60 How many milliseconds are there in one tenth of a second? 100 What is 0.9295912um in millimeters? 0.0009295912 How many millilitres are there in 21/4 of a litre? 5250 What is 25/8 of a day in hours? 75 How many decades are there in three fifths of a century? 6 Convert 0.5873401g to nanograms. 587340100 How many seconds are there in 307486.6 microseconds? 0.3074866 Convert 1426.077t to nanograms. 1426077000000000000 How many nanograms are there in three fifths of a microgram? 600 What is 1/5 of a millennium in decades? 20 How many seconds are there in 26/5 of a hour? 18720 What is three fifths of a litre in millilitres? 600 What is twenty-nine halves of a milligram in micrograms? 14500 What is 3/10 of a microsecond in nanoseconds? 300 What is eighteen fifths of a meter in millimeters? 3600 How many microseconds are there in 0.6026269 seconds? 602626.9 What is twenty-one fifths of a kilometer in meters? 4200 What is one tenth of a century in decades? 1 What is six fifths of a litre in millilitres? 1200 How many centimeters are there in seventy-four fifths of a meter? 1480 How many kilograms are there in 3/25 of a tonne? 120 Convert 362.1131g to tonnes. 0.0003621131 How many milliseconds are there in thirteen quarters of a second? 3250 What is twenty-seven fifths of a century in months? 6480 What is seven halves of a millisecond in microseconds? 3500 How many grams are there in 8/25 of a kilogram? 320 What is nine tenths of a kilometer in centimeters? 90000 How many micrograms are there in 3/8 of a milligram? 375 What is 34/5 of a meter in centimeters? 680 How many millilitres are there in 99172.93l? 99172930 How many millilitres are there in 237.2064 litres? 237206.4 What is 14.24077 grams in micrograms? 14240770 What is 72.552645 seconds in hours? 0.0201535125 Convert 288460.35 seconds to hours. 80.127875 How many millilitres are there in 3/25 of a litre? 120 What is three eighths of a milligram in micrograms? 375 Convert 15.5780646 hours to weeks. 0.092726575 What is 67280.87 millimeters in centimeters? 6728.087 What is 3.194951l in millilitres? 3194.951 What is three tenths of a millimeter in micrometers? 300 What is 304089.9ml in litres? 304.0899 What is 27/5 of a millisecond in microseconds? 5400 What is 14532.012 months in millennia? 1.211001 What is 7.253598 micrograms in tonnes? 0.000000000007253598 What is 54.80388 litres in millilitres? 54803.88 How many litres are there in 90996.2ml? 90.9962 How many centimeters are there in 8436.309 meters? 843630.9 What is 11/2 of a milligram in micrograms? 5500 Convert 110.4519km to millimeters. 110451900 What is 9.586022 seconds in nanoseconds? 9586022000 How many millilitres are there in 45901.62 litres? 45901620 What is 11/2 of a millennium in months? 66000 How many centimeters are there in 6.420618nm? 0.0000006420618 What is 0.7541179ng in grams? 0.0000000007541179 What is 3227.34m in nanometers? 3227340000000 Convert 16.56034 hours to nanoseconds. 59617224000000 How many millilitres are there in 67/5 of a litre? 13400 Convert 65472.41 nanometers to kilometers. 0.00000006547241 Convert 2.846989 litres to millilitres. 2846.989 How many millilitres are there in fourty-five halves of a litre? 22500 How many months are there in 67/4 of a year? 201 What is 7/8 of a centimeter in micrometers? 8750 What is 65.33747 decades in millennia? 0.6533747 What is 195525.7ms in nanoseconds? 195525700000 How many nanoseconds are there in 2.332707 days? 201545884800000 What is 17/4 of a millimeter in micrometers? 4250 How many meters are there in 357512.6cm? 3575.126 How many nanometers are there in 132047.5m? 132047500000000 How many hours are there in 28379.82 weeks? 4767809.76 How many grams are there in 52/5 of a kilogram? 10400 How many millilitres are there in 7/4 of a litre? 1750 How many millilitres are there in 1/4 of a litre? 250 What is 6850.56 tonnes in nanograms? 6850560000000000000 What is 5.372503 decades in millennia? 0.05372503
Is (-6 + (-6 - -13))((-284572)/(-4))/1 prime? True Let h be (-2)/7 - (-451635)/105. Suppose -d + 4m + 2173 = -0m, m = -2d + h. Is d composite? False Let u = 8741 - -6778. Let t = -6542 + u. Is t prime? False Let l be (2078/1 - -1)(18 + -11). Let w = l - 9395. Suppose -w + 773 = -5g. Is g composite? False Let f be (-672)/10 + 9/45. Let k = f + 71. Suppose 0 = -2g + ki + 4166, 0 = 2g - 5i - 2330 - 1841. Is g prime? False Let a = 43308 - -413177. Is a prime? False Let s be 564/1 + 0/3. Let j be (-5 - -3) + s/3. Is 80/32j/5 composite? True Let g be 4/243 + (-3)/(-2). Suppose 0k - gk - 2j = -14, 2j - 8 = 0. Suppose 1188 = 3n - kv, -4n + 1433 = v - 146. Is n prime? False Suppose 9g - 43g + 120666 = 0. Let v = g + 2210. Is v a prime number? False Suppose -5c + 4o = -o + 42875, c + 8578 = 4o. Let f = -583 - c. Is f a prime number? False Let t = -68 - -27. Let r = 45 + t. Is -1 + -3-86r prime? True Let x(s) = 2 - 1 - 42s + 0. Suppose 37 = -5z + 3p, 5z - 57p + 45 = -52p. Is x(z) a composite number? False Suppose 0 = -149y - 1873258 + 7049369. Is y composite? False Suppose m + 83 = -2s, 0s - 5s - m = 206. Let x(z) = -z*3 - 17z*2 - 22z - 32. Let l be x(-16). Let h = s + l. Is h composite? False Let m(k) = -34k3 + 12k2 - k - 7. Let w be m(6). Let p = -4007 - w. Let t = 4180 - p. Is t composite? True Let w(u) = u2 - 12u - 6. Let b be w(-21). Let c = 1179 - b. Suppose z - 641 = c. Is z prime? False Let a(h) = 636h - 5. Let j(r) = -635r + 4. Let s(n) = -2a(n) - 3j(n). Is s(1) a prime number? True Let f = 13 - 16. Let y be (f + -98 + 0)/1. Let w = -4 - y. Is w composite? False Suppose 40z = 41z - 2l - 11126, 5 = -5l. Suppose -11169 = -c - 5f + f, 0 = -c + 5f + z. Is c prime? True Let f(z) = z3 - 41z*2 - 72z + 59. Let h be f(43). Suppose -3w - w + 4b = 1964, -w = -3b + 493. Let c = h - w. Is c composite? False Suppose 12p = 21p - 36. Suppose -4b = -12, 4z - pb = 3306 - 250. Is z composite? True Is 384161 + 2(-9 - 0) a composite number? False Suppose -14l = -l - 1131. Suppose -lm + 5595 = -84m. Is m a composite number? True Let y = -41 + 48. Suppose -yl + 6 = -6l. Suppose 4i + 5z - 13509 = 0, z + 3396 = i + lz. Is i a prime number? True Suppose 0 = -3k + s + 123531, 82354 = 2k - 49s + 46s. Is k prime? True Let n(v) = -7v*3 - 3v*2 + 29v + 291. Is n(-16) prime? False Let p be 106/((1/19 + 0)-2). Let f = p - -2489. Let i = f + -295. Is i a prime number? True Suppose 0 = 2v + 3z - 28246, -3z - 42339 = -9v + 6v. Suppose 5y = 3t + 3785 - v, 0 = -3t - 2y + 10353. Is t a composite number? False Suppose 8x - 243797 = 4x + 5d, -3x + 182809 = 4d. Is x prime? True Suppose 1 = -0u + u. Suppose 2n + u = -5. Is ((0 - 0) + 138)n/(-9) prime? False Suppose 1654 + 2081 = 15n. Suppose -t - f = -14357, -4t - f = -57185 - n. Is t composite? True Suppose 580l - 599l + 11077 = 0. Is l prime? False Suppose 0 = 50n + n - 2848299. Is n a prime number? True Suppose -6z = -97 + 109. Is z/(-7) - 32775/(-21) prime? False Let z = -87903 + 348224. Is z composite? True Let p = 8878 + -4738. Suppose -p = -3u + o, -3u - 21o = -18o - 4128. Is u a composite number? True Let g(v) = 564v - 1. Suppose -2n - 6n = -48. Suppose 10p - n = 4p. Is g(p) composite? False Suppose -6u - 2293 - 329 = 0. Let p = u - -660. Is p prime? True Let r(x) = -50845x - 831. Is r(-4) prime? True Suppose -31v = -30v + f - 9526, -f - 28582 = -3v. Is v a composite number? True Let j = -16895 + 49668. Is j a prime number? False Let k = 78 + -80. Let n(u) = -286u + 1. Let o be n(k). Suppose 2q + 75 = o. Is q prime? False Let p(i) = -4i + 3. Let w be p(-2). Let a be (w - 11)/(21/(-1)). Is (a + -754)/(-8 + 5 + 1) prime? False Let c(h) = 441h - 9. Let o(n) = -1. Let w(x) = c(x) + 15o(x). Let u be w(-3). Is u/440/(-15) a composite number? True Suppose 7z = 6z - 5, 0 = 2j - z - 32467. Suppose -4m + 5151 = t, -5t + 9439 = 3m - j. Is t a prime number? False Let v(h) = 1614h*2 - 4h - 4. Let t be v(2). Let a = 1777 + t. Is a a composite number? False Suppose 5m - 5d = 300590, -m + 4d + 360714 = 5m. Is m prime? False Let z be 3/6 - 21/42. Suppose 5v - 67363 = -4x, zv = 4x - 3v - 67403. Is x a composite number? True Let j(y) = y3 + 13y*2 + y + 5. Let w be j(-13). Let b = w - -70. Let l = b + 53. Is l a composite number? True Let x = 546 + -601. Is x/(-385) + -2 + (-18828)/(-14) prime? False Let b = 15226 - 9999. Is b composite? False Suppose 2h - 3d = 50, 6d + 50 = 2h + 2d. Let x = h + -22. Suppose -xg + 328 = -281. Is g composite? True Is ((-17447199)/(-462))/(2/4) prime? False Let t(s) = 1 - 20 + 19 + s2. Let f be t(2). Suppose -5r = fq - 659, 2r = -3q + 42 + 223. Is r composite? False Is (6 - 8)((-8938641)/232)/(6/8) prime? False Is (-555596)/(-38) + (-133)/(-2527) prime? True Let s(d) = -d*3 - 20d*2 - 26d + 182. Let l be s(-18). Suppose 3f - 6v + 8v - 22525 = 0, -2v = l. Is f prime? False Let y(c) = 102c - 87. Let k(x) = -51x + 41. Let b(v) = 13k(v) + 6y(v). Suppose -2u = -4i - 16, -12 = 4i - 0i - 3u. Is b(i) a prime number? True Let h be 2 - (-16)/(-2) - 24/(-6). Let s be (-26)/4 + (-1)/(h/1). Is -14/s(-9066)/(-4) composite? False Let p(j) = -4 + 0j*3 + 25j + 21j2 - 2j3 + j3 - 3. Is p(16) prime? False Let i be ((-6)/4)/(135/(-48) - -3). Let o be (i/(-20) - 0) + (-11124)/(-15). Suppose -3s + 11 = -o. Is s a composite number? False Let c(y) = -218 - 2y + y + 239. Let l be c(18). Suppose -1352 = -j - lw, 2j - 3w - 2628 = 103. Is j a prime number? True Let t = 1517112 - 1030953. Is t a composite number? True Let k(r) = -27r3 + r2 - 10r - 61. Let q(m) = m3 + 4m*2 - 22m - 15. Let f be q(-7). Is k(f) prime? True Suppose 936261 = j - v, 5v = 2j - 1204371 - 668163. Suppose 0 = 20p + 306877 - j. Is p prime? True Suppose 74253 = -4h - 11911. Let l = -34987 + h. Is l/(-28) + (8/4)/14 a composite number? True Let k(y) = y + 15. Let n be k(-13). Let v = -89 + 91. Suppose vd - z + 12230 = 7d, nd - z = 4899. Is d prime? True Suppose 9n - 1619387 = 4n + 4m, 2n = m + 647756. Is n composite? False Suppose -5i + 0i - 2c - 38 = 0, -2c + 16 = -4i. Is (-10777)/(-3) + (-4)/i a composite number? False Let k be (-3 - -4185) + 01/6. Suppose -i + k + 2813 = 0. Is i a prime number? False Suppose 0 = 36o + 45880 + 160832. Let q = o + 13459. Is q a composite number? False Suppose -f = 3 - 0, -5l + 2f + 4066 = 0. Suppose 4i - 6 = 2i. Suppose -2w = a - l - 3, -4a - 1239 = -iw. Is w a prime number? True Suppose -17o + 19o = 5n - 1363953, 2n + 5o = 545587. Is n composite? True Suppose -4f = 5s - 19085 + 154576, -s + 1 = 0. Let o = f - -57539. Is o a composite number? True Let l(q) = 2q2 + 10q - 12. Let f be l(-6). Suppose -3k - 7272 = -7k + 4w, -4k - 2w + 7302 = f. Is k prime? True Let f = 384823 + -266380. Is f/12 + 6/8 a composite number? False Suppose -370452 = -2v - 2n, 4v - 2n - 554104 - 186770 = 0. Is v a prime number? True Let x(v) = -105v + 3427. Is x(-92) a composite number? True Let c(j) = 569j - 221. Let n(t) = -2t - 1. Let q(g) = c(g) - 6n(g). Is q(6) prime? True Let k = 347760 + -157373. Is k a prime number? True Let h(z) be the first derivative of z4/2 - 5z*3/3 + 2z*2 - 12z + 46. Is h(5) a composite number? True Let w be (4 + -1)8475/(-3). Is ((-2)/(-3))/((-25435)/w + -3) prime? False Let q(l) = 6l*2 + 10l - 8. Suppose -48 + 13 = -5w. Let s be q(w). Suppose 2y - 338 - s = 0. Is y a prime number? True Let v(b) = 819b - 8. Let o be v(11). Let c be (14/4 + -3)/(1/(-11184)). Let q = o + c. Is q prime? False Let y(d) = d3 - 20d*2 + 56d - 84. Let v be y(17). Is 92570/4 + v/2 prime? True Suppose 4b + j = 13080 - 4138, 0 = -3b + 5j + 6718. Let w = b + -553. Suppose -3v - v = 4, -5v = -2f + w. Is f a composite number? False Let p be (0/1)/(12/6). Let v be (p - 7) + -2 + (-2)/2. Is (-4)/v + 588/5 composite? True Let n = -45512 - -435775. Is n prime? True Let l(a) be the second derivative of a*5/20 + 5a4/12 - a3/2 - 2a2 - 7a. Let c be l(-5). Suppose -22750 = -cz + 14727. Is z a composite number? False Let v(l) = l3 + 16l*2 - 10l + 14. Let j = 44 - 59. Let o = 6 + j. Is v(o) prime? False Suppose -52z - 140z = -77313286 - 87730106. Is z composite? False Let h be 2/(2/(-33)1). Let o(u) = -2u*2 + 55u - 450. Let y be o(17). Is (-29532)/(-44) + y/h + -3 prime? False
Solve -92j + 149 = -127 for j. 3 Solve -20121b + 320 = -20101b for b. 16 Solve 75d + 350d + 1044 + 231 = 0 for d. -3 Solve 10w - 37 = -24 + 67 for w. 8 Solve 378c - 549c + 2830 = 395c for c. 5 Solve -372p = 1304 + 1672 for p. -8 Solve -51c = 64c + 115 for c. -1 Solve 144 = -435s + 423s for s. -12 Solve 0 = 132w - 73 - 851 for w. 7 Solve 111 = 4285s - 4248s for s. 3 Solve 204l + 2992 = 149l - 217l for l. -11 Solve 53 = 10p - 197 for p. 25 Solve 128694g + 714 = 128728g for g. 21 Solve 351 = -31h + 58h for h. 13 Solve -6v - 196 = -5v - 29v for v. 7 Solve -746a = -601 - 145 for a. 1 Solve -54b + 8b = 59b + 840 for b. -8 Solve 149b = 556 - 212 + 401 for b. 5 Solve 0 = -1868d + 1499d + 5535 for d. 15 Solve -18321y + 18308y - 195 = 0 for y. -15 Solve 2502 = 266a - 146a + 158a for a. 9 Solve -83665n + 83672n = -112 for n. -16 Solve 138y + 3141 = -171 for y. -24 Solve 3203 + 2495 = -407a for a. -14 Solve -169f + 179f + 110 = 0 for f. -11 Solve 9437 = 12k + 9641 for k. -17 Solve -55 = 572s - 517s for s. -1 Solve -11d + 91d - 30d = -1350 for d. -27 Solve -o - 24 = -28 - 11 for o. 15 Solve -312o + 632o + 144 = 344o for o. 6 Solve -40a + 158 = -53a - 89 for a. -19 Solve -55g - 2g - 415 - 98 = 0 for g. -9 Solve 81u + 198 = 44u + 15u for u. -9 Solve 11399 = 23w + 11008 for w. 17 Solve 0 = -223s + 754s for s. 0 Solve 0 = 272x - 631x + 2872 for x. 8 Solve -10255q + 10417q - 162 = 0 for q. 1 Solve 4m - 181 = -6m - 111 for m. 7 Solve 6592t = 6605t - 429 for t. 33 Solve 17s = -20s - 26s + 315 for s. 5 Solve -30y - 3010 = -120y - 125y for y. 14 Solve -981z - 1356 = -868z for z. -12 Solve 25u + 137 = -188 for u. -13 Solve 342z + 3941 + 1873 = 0 for z. -17 Solve -1951t = -2049t - 490 for t. -5 Solve -3185 = 89j + 204j - 48j for j. -13 Solve 79418s - 79385s = -99 for s. -3 Solve -157c - 1854 = 2856 for c. -30 Solve -4458y - 75 = -4473y for y. 5 Solve -77878w + 77829w = 196 for w. -4 Solve 321i - 1042 = 3131 for i. 13 Solve -29b + 54b - 24 = 24b for b. 24 Solve 232m + 1172 = 3492 for m. 10 Solve 0 = -810l + 620l - 1900 for l. -10 Solve -20r + 459 = 24r + 7r for r. 9 Solve 595 - 421 = -29i for i. -6 Solve 9 - 38 = -5h + 46 for h. 15 Solve 0 = -65q + 32 - 169 + 787 for q. 10 Solve -279k = -348k + 276 for k. 4 Solve -4y - 148 + 315 - 151 = 0 for y. 4 Solve -83n + 135n + 3404 = -96n for n. -23 Solve -641v = -622v + 19 for v. -1 Solve -32u + 31848 = 31208 for u. 20 Solve 4853 = 280b + 6770 + 6203 for b. -29 Solve -1451b + 455 = -1464b for b. -35 Solve 18o + 442 = -46o + 30o for o. -13 Solve -17y - 257y = 3836 for y. -14 Solve 0 = -24i - 0i + 314 - 122 for i. 8 Solve 289a + 51a - 9330 = 29a for a. 30 Solve 12a = 215a - 203 for a. 1 Solve 4984 - 4984 = -418n for n. 0 Solve 72 = 102c - 77c + 22 for c. 2 Solve 1525c + 38716 + 934 = 0 for c. -26 Solve -197n + 212n - 360 = 0 for n. 24 Solve 28g = -355g - 136g - 6228 for g. -12 Solve -144 - 409 = -145k + 317 for k. 6 Solve 0 = 160u + 83u - 1215 for u. 5 Solve 4571 + 1439 = 1202a for a. 5 Solve 103u + 76 = 122u for u. 4 Solve -109d = -67d - 294 for d. 7 Solve -42 = 134j - 148j for j. 3 Solve 66 - 145 + 44 = -5n for n. 7 Solve 352d - 380d = 644 for d. -23 Solve -27 - 210 = -92o - 3365 for o. -34 Solve -35b - 107 = 21b - 163 for b. 1 Solve 3357l + 12636 = 3708l for l. 36 Solve -1050 = -40g - 10 for g. 26 Solve -22c - 44c - 384 = -18c for c. -8 Solve 0 = 111h - 121h - 20 - 20 for h. -4 Solve 888 = 138y - 768 for y. 12 Solve -277 = -7i - 97 - 61 for i. 17 Solve -115 = -88w + 501 for w. 7 Solve -17r = 52r + 759 for r. -11 Solve 140p = -235 - 207 + 22 for p. -3 Solve 0 = -145j - 591 - 714 for j. -9 Solve 55y - 36y - 28y = -108 for y. 12 Solve 92v - 96v - 1900 = 91v for v. -20 Solve -81w + 15732 - 17109 = 0 for w. -17 Solve 40o - 14o + 318079 = 318677 for o. 23 Solve 332q - 324q = 104 for q. 13 Solve 10n - 3n = n + 78 for n. 13 Solve 425g = 447g + 154 for g. -7 Solve 0 = 85y + 122y + 5175 for y. -25 Solve 71z + 713 + 529 = -67z for z. -9 Solve 0 = 378p - 144p - 2574 for p. 11 Solve 83a - 200 = -721 - 309 for a. -10 Solve 22k - 5k - 33 = 6k for k. 3 Solve 0 = 81n + 335n - 6656 for n. 16 Solve -73a + 5046 = 104a + 267 for a. 27 Solve -84o = 58o - 18o - 1860 for o. 15 Solve 30x + 27x + 132x + 4536 = 0 for x. -24 Solve 98j + 671 + 408 + 195 = 0 for j. -13 Solve -21f - 387 + 96 = 24 for f. -15 Solve -79 + 13 = -23f - 43f for f. 1 Solve -18d - 58 = 5d + 264 for d. -14 Solve -181v = -131v - 1150 for v. 23 Solve -32y = 229 + 99 + 24 for y. -11 Solve 60v + 308 = 1448 for v. 19 Solve 13k + 1518 = 1414 for k. -8 Solve 0 = 16h - 142h - 332 - 2692 for h. -24 Solve -403 = -6f + 17f - 524 for f. 11 Solve -3b - 31b + 164 - 28 = 0 for b. 4 Solve 80x - 1113 = 30x - 463 for x. 13 Solve 101s - 112s - 19 - 58 = 0 for s. -7 Solve -29y + 117 = 1 for y. 4 Solve 462v - 1623 = 4845 for v. 14 Solve -772c - 480 = -740c for c. -15 Solve 192p = 135p - 912 for p. -16 Solve 12t - 12 + 50 = 2 for t. -3 Solve 34 = -42o + 22 - 72 for o. -2 Solve 52q - 166q + 456 = 0 for q. 4 Solve -22f + 8 = 96 for f. -4 Solve 2g - 32065 = -32067 for g. -1 Solve 14m - 180 = 20m + 54m for m. -3 Solve 0 = 22i + 21i + 129 for i. -3 Solve 346 = -30x - 26x + 122 for x. -4 Solve 861 - 1617 = 108s for s. -7 Solve -1429f - 2058f - 58168 = -843f for f. -22 Solve -289 = 4i - 26i - 267 for i. 1 Solve 0 = 70y - 577y + 8112 for y. 16 Solve -6224x = -6263x - 585 for x. -15 Solve -301d + 412d = -1554 for d. -14 Solve 51824y = 51811y - 78 for y. -6 Solve -82z + 1122 + 71 = 127 for z. 13 Solve 0 = 10b + 198 - 114 - 264 for b. 18 Solve -21k = 4k - 1 + 26 for k. -1 Solve 0 = -n - 3591 + 3594 for n. 3 Solve -2514d + 2495d = -171 for d. 9 Solve 123z + 5z + 1572 = -3z for z. -12 Solve 749z - 244z - 8080 = 0 for z. 16 Solve 0 = -8v + 2753 - 2881 for v. -16 Solve -131h - 102 = 291 for h. -3 Solve 130o + 205 + 247 = -718 for o. -9 Solve -120 = 918d - 930d for d. 10 Solve 29p + 7p + 546 = -6p for p. -13 Solve -1432d = -1453d + 21 for d. 1 Solve -2112 = -89118o + 89022o for o. 22 Solve -79d + 235d + 1293 = -735 for d. -13 Solve 20p + 2163 + 2294 = 4237 for p. -11 Solve -5n + 32n + 130 = n for n. -5 Solve -64d = -1003 - 953 + 164 for d. 28 Solve -154n = -162n - 120 for n. -15 Solve 42g + 34g - 854 = 15g for g. 14 Solve 707 - 217 = 70u for u. 7 Solve -104g + 2952 = 59g + g for g. 18 Solve -252d = 12d - 11d - 6831 for d. 27 Solve 56a + 824 + 227 + 685 = 0 for a. -31 Solve -527 = -24t + 38 - 229 for t. 14 Solve -29h - 32445 + 32242 = 0 for h. -7 Solve 77h - 508 = -69h - 1822 for h. -9 Solve -53t + 86 + 73 = 0 for t. 3 Solve 5w + 2093 - 2273 = -4w for w. 20 Solve -323f + 1299 = -3563 - 1598 for f. 20 Solve -130683w - 1102 = -130645w for w. -29 Solve 374q - 116 + 4936 = -108q for q. -10 Solve -4311 = 109x - 1259 for x. -28 Solve -15p - 113p + 150 + 1898 = 0 for p. 16 Solve -24h = 126 - 78 for h. -2 Solve 2683 + 2735 = -46s + 5648 for s. 5 Solve -38o - 15o = -13o - 360 for o. 9 Solve 10y + 37 = 1 - 14 for y. -5 Solve v - 13 = -8v + 23 for v. 4 Solve 10b + 0b + 108 - 178 = 0 for b. 7 Solve -524 = -46w - 1932 + 948 for w. -10 Solve 2609n + 1564 = 2701n for n. 17 Solve 14k - 300 = -26 + 48 for k. 23 Solve 28l + 2604 = -5l + 117l for l. 31 Solve -13d + 11d = 12d - 14 for d. 1 Solve 22r - 55 = 253 for r. 14 Solve 126 - 246 = -15n - 165 for n. -3 Solve 805 - 505 + 804 = 69p for p. 16 Solve 0 = -138u + 11u - 145u + 5168 for u. 19 Solve 20616 = -436o + 598o + 697o for o. 24 Solve 14l - 9281 = -9379 for l. -7 Solve 886b - 851b = -175 for b. -5 Solve -184 - 1434 = 537i + 5900 for i. -14 Solve 0 = 49k - 2031 + 2080 for k. -1 Solve 5129 = -11h + 5030 for h. -9 Solve -1296 = -462g + 516g for g. -24 Solve 233 = c - 232 + 466 for c. -1 Solve 35b + 82 + 93 = 0 for b. -5 Solve -453c = -257c + 2548 for c. -13 Solve 0 = -208l + 13l - 48l + 4131 for l. 17 Solve 2033q - 2120q = 1827 for q. -21 Solve -49k - 483 + 989 = 408 for k. 2 Solve 22n = 70n + 234n - 5076 for n. 18 Solve -49h - 162143 = -161800 for h. -7 Solve 332 = 127l - 44l for l. 4 Solve 0 = 375a + 80a - 108a - 5205 for a. 15 Solve 45w + 74w = 529 - 1957 for w. -12 Solve 21h - 240 = h for h. 12 Solve 77y = 35y + 44y - 6 for y. 3 Solve -336h - 3008 = -524h for h. 16 Solve 24c + 192 + 333 = 129c for c. 5 Solve -172u + 51u + 2178 = 0 for u. 18 Solve 757c + 549c = 10448 for c. 8 Solve 5f + 7f + 70 = -2f for f. -5 Solve 784p = 763p + 63 for p. 3
Suppose -h - 51143 = -5j, 46 - 60 = -2h. Is 93 a factor of j? True Let i(q) = -q*2 - 138q - 1828. Does 2 divide i(-111)? False Suppose -20b + 2621 = 5p - 17b, -b - 3 = 0. Let f = p - 441. Is f a multiple of 6? False Let n = 6 - 8. Let h(u) = -11u*2 - 3u - 4. Let j(c) = c*2 - c - 1. Let g(s) = -h(s) + 2j(s). Does 13 divide g(n)? True Let p be -8 + 3 - 20/(-4). Suppose pl + 7l - 21 = 0. Suppose 5d = -l + 108. Is 16 a factor of d? False Let u(r) = 139 + 96 - r + 2r - 4r + 6r. Is 17 a factor of u(35)? True Let h be (336/63)/((-8)/6 + 2). Suppose hx + 120 = 2264. Is 47 a factor of x? False Let w(m) = 255m*2 + 3m + 1. Suppose 2b - 8 = -2, b = n + 4. Is 12 a factor of w(n)? False Suppose 6342 = 4r + 2x, -4r + 5x = 465 - 6814. Does 6 divide r? False Let m(g) = 8g3 - g2 - g + 2. Let i be m(1). Suppose ib = 2b + 1248. Suppose -107 - b = -5s. Is 17 a factor of s? False Suppose -20380 = -23g + 37028. Does 96 divide g? True Suppose 4f + 28 = -f - 4q, -q + 19 = -2f. Let k = f + 11. Suppose o + 4b - 41 = 0, -17 - 115 = -ko - 3b. Is o a multiple of 5? True Suppose 0 = -o - 3u + 3, 5o = 3u - 8u + 15. Suppose -d = m - 183, -2m = od - 1 - 364. Suppose -5i = -20, 5i + m = 4h - 424. Is h a multiple of 14? False Let n(i) = i2 + 3i - 60. Let u be n(7). Does 15 divide ((-8)/u + (-27)/(-15))108? False Let f(s) = s3 - 13s*2 + 8s - 66. Is f(19) a multiple of 13? False Suppose -113t + 697769 = 35363. Is 121 a factor of t? False Suppose 3r - 5r - 5j = 705, -r - 370 = -j. Suppose 17g + 12535 = -6g. Let c = r - g. Is 9 a factor of c? True Let i(x) = 31x + 63. Let u be i(-1). Let r = -18 + u. Does 2 divide r? True Let f(x) be the second derivative of x5/30 - x4/12 + 125x3/6 + x2/2 + 15x. Let c(h) be the first derivative of f(h). Is 12 a factor of c(0)? False Let j = 26 - 10. Suppose 0k - k - 5 = -m + 2k, 0 = 4k. Let l = j - m. Is l a multiple of 2? False Suppose -4l + 71 = s, -5l - 3s + 50 + 37 = 0. Is 22 a factor of (104/(-10))/((-1)/(495/l))? True Let l = 47 + -40. Let x(u) = -6u + 0u + u2 - lu + 6 + 4u. Is x(12) a multiple of 22? False Suppose 110 = -2y - 2z, -2y - 4z - 102 = -0y. Suppose 513v + 635 = 518v - 5p, p = -v + 139. Let j = v + y. Does 30 divide j? False Let i(v) be the second derivative of v5/20 + v4/6 - v3/3 + 7v*2/2 - 16v. Let g be i(-3). Suppose 0 = gp + 78 - 366. Is p a multiple of 11? False Let u = 6 + -5. Let s(o) = 6o - o*2 + 2 - 3 - 4o + 30o3. Is 12 a factor of s(u)? False Suppose 49144 - 12916 = 4t + 4f, f + 45249 = 5t. Is 127 a factor of t? False Let g(j) = -j*2 - 6j + 210. Suppose -20 = -4w + 4d, 4w - 3d - 12 - 5 = 0. Let h be 0/(2(1 - w)). Does 21 divide g(h)? True Let x = 28087 + -19823. Does 169 divide x? False Suppose 11 = 7h + 18. Is 47 a factor of ((-434)/(-6))/(11/(-99)h)? False Let m be (-6)/4 + 87235/10. Let t = m - 4789. Is 6 a factor of t/133 - (-6)/14? True Let d(n) = -5. Let s(z) = z2 + 3z - 5. Let f(p) = -d(p) + s(p). Suppose b - 2 = -0b, 0 = -2t + b - 12. Is 5 a factor of f(t)? True Let z be 1 - -16424/16. Is 6 a factor of z/(-5 - -2 - -4)? False Suppose -3y - 33 = -3a, 2a - a + 49 = -4y. Let m be 2 + -5 + 188 + -85. Let z = m - y. Does 14 divide z? True Suppose 2z = 15p - 11p - 2086, -z + 3 = 0. Suppose 0 = -14r + 2931 - p. Is r a multiple of 4? True Let d(s) = 4s*3 - 31s*2 + 17s - 115. Does 43 divide d(15)? True Let a be 5 - 0(-2)/4. Suppose -5j + 0j = -4z - 194, -2z + 4j - 100 = 0. Let u = a - z. Is 6 a factor of u? False Let c be ((-6751)/129)/(1/(-9)). Let y = c - 453. Is 3 a factor of y? True Suppose 16y - 1478 = 1322. Suppose 2o - 11h - 180 = -7h, -5h = -2o + y. Is o a multiple of 10? True Does 82 divide (4 - -7)/(-66) + 415996/24? False Let l(j) = 3j3 - 21j*2 + 6j - 18. Is l(11) a multiple of 25? True Let n(h) = -11h2 + 3h - 1. Let w be n(2). Let f = w + 21. Is 23 a factor of 0 + (-426)/f + (-2)/3? True Suppose 5j = -5w + 55455, j + 4w - 11178 = -93. Does 18 divide j? False Let k(a) be the second derivative of -a5/20 + 5a*4/4 - 5a*3/6 + 13a*2 - 76a. Does 38 divide k(14)? True Is 33 a factor of 7/((-14)/(-20))(-6735)/(-30) - 1? True Let k = 12958 - 7438. Is 40 a factor of k? True Is (((-42566560)/120)/86)/(1/3-1) a multiple of 21? False Let c = 4693 + -1218. Is 52 a factor of c? False Is 9 a factor of (2/6)/(78/(-27) - -3) - -13895? False Let n(z) = -z*2 + 15z - 29. Let q be n(13). Is (584/(-3))/(2/q) a multiple of 13? False Let n(t) = 28t2 + 18t + 69. Let v be n(-8). Let a = 2408 - v. Is 72 a factor of a? False Suppose -1222v + 549720 = -1198v. Does 4 divide v? False Suppose 25 = -8s + 3s. Is 15 a factor of (30/4)/(s - (-71)/14)? True Suppose 0 = -21q + 51 + 54. Suppose -4h - 218 = -5p - 8h, -224 = -qp - 2h. Is p even? True Let c(p) = -p*3 - 10p*2 - 32p - 43. Let n be c(-6). Let x be 182/(-9) - (-2)/9. Does 25 divide n/x - (-901)/4? True Let j = 8 - 8. Suppose -2n - 2 = j, -5o = -8o + 3n + 9. Suppose 0 = -4u - 3w + 190, 73 = ou - 4w - 11. Is u a multiple of 8? False Let b(c) = -3c3 + 3 + 4c - 4c3 - 21c*3 - 2c*2 + 5c*2. Is 14 a factor of b(-1)? False Is (8734/18)/(284/7668) a multiple of 51? False Suppose -15 = 3m - 6m. Suppose p = -2x + mx + 497, 0 = -4p + 2x + 1958. Is p a multiple of 4? True Is 14865 - -8(11/(-2))/11 a multiple of 45? False Suppose -3z + 5z = 0. Let b be z((-10)/15)/2. Suppose b = -7s + 5s + 224. Is s a multiple of 14? True Suppose -j + 9q + 3210 = 7q, 2q + 6408 = 2j. Is 39 a factor of j? True Let u = 1888 - 1094. Is u + (9 - (-18)/(-6)) a multiple of 25? True Suppose 0 = -1059h + 1047h + 60. Let v = 66 + -37. Suppose -hq + v = -231. Does 13 divide q? True Let q(w) = 44w + 42. Let k be q(-4). Let i = k + 162. Does 14 divide i? True Suppose 0 = 3v + 15, 2w + 5v - 31 = 136. Let p = w - 42. Is 18 a factor of p? True Let s(t) = -7t - 88. Let x(v) = -20v - 266. Let k(z) = 14s(z) - 5x(z). Is k(-25) a multiple of 16? True Is 6 a factor of ((-442)/(-91) - -14)434(-1 - -2)? True Suppose -153980 = -4m - 6u + 10u, -3m + 115541 = 5u. Does 203 divide m? False Let y = -44 - -46. Suppose -7 = -4q + 5. Suppose -2a - qk = -175, 4k = ya + 2a - 300. Does 10 divide a? True Let a(d) = 5d*2 + 14d - 26. Let b be a(-21). Let i = -967 + b. Is i a multiple of 27? True Let p(c) = -24c + 19. Suppose 26z - 34 = -86. Is p(z) a multiple of 2? False Let z(b) be the third derivative of 5b4/12 + 7b*3/3 - 5b2. Let c(a) = a2 + 24a + 142. Let y be c(-10). Does 34 divide z(y)? True Let p(g) = -g2 - 2g - 1. Let b(a) = 13a2 + 35a + 1. Let q(k) = b(k) + 2p(k). Does 17 divide q(-5)? True Suppose -4r + 1086 = 2z - 3z, 3r - 4z = 821. Let v = 312 - r. Does 3 divide v? False Let s = 75 - 180. Let j be ((-6)/7)/(15/(s/2)). Suppose 5q + jx = 1415, q - x + 0x = 291. Is 22 a factor of q? True Suppose 10s + 2s + 34813 = 211453. Does 10 divide s? True Suppose 0u - 24 = 3u. Let v be (-6338)/u - (-1)/(-4). Suppose -v = -82w + 76w. Is 44 a factor of w? True Let t(o) = 4o + 89. Suppose -60 - 66 = 6y. Let g be t(y). Is 10 a factor of 1/(g/(-500)-5)? True Let r(d) = d*3 + 5d*2 + 3d - 3. Let w be r(-4). Let c be (12w/7)/((-2)/(-189)). Let v = c + -22. Is v a multiple of 28? True Let p = -281 + 169. Is 1/2 + (-8)/(p/4389) a multiple of 56? False Let d(g) = -24g + 411. Is 8 a factor of d(-57)? False Let m = -1 - -15. Suppose -414 = -mx + 5x. Let a = 95 - x. Does 12 divide a? False Let a(w) = 110w2 + 1184w + 26. Is a(-17) a multiple of 15? False Let i = 13204 + -8732. Does 43 divide i? True Let m(b) = 541b - 6. Let x be (-12)/(-27) - ((-5)/9)/1. Is 34 a factor of m(x)? False Let u(m) = 38m + 562. Let v be u(0). Let r = 604 - v. Is 14 a factor of r? True Let w = -146 + 237. Let q = w + 38. Is 3 a factor of q? True Let d(f) be the first derivative of -f*4/4 - 4f3/3 - f2 + f - 19. Let z be d(-4). Suppose -3v = z, 2y - 336 = -y - 2v. Is y a multiple of 19? True Let r(v) = 10v*3 + 18v*2 - 40v - 72. Is r(11) a multiple of 52? True Suppose -12j - 40 = -22j. Let w = -1 - -6. Suppose 2f = -2q + 26, jq - 8 = wf + 8. Is q a multiple of 2? False Let x be (-3)/2 + (-49812)/(-8). Suppose -4o - o = -x. Suppose -285 + o = 5j. Is 24 a factor of j? True Suppose 36 = -0u + 9u. Let t be (-2)/u - 18/(-4). Is 186/t - (-10)/(-4) a multiple of 10? False
-245 times -121470 29760150 Multiply 32925 and 1.5964. 52561.47 What is 108 times -1300649? -140470092 What is the product of 8645 and -0.0652? -563.654 Work out 793062 * 14. 11102868 -0.15 * 166488.57 -24973.2855 What is -10980.8 times -162? 1778889.6 Calculate -1071-21008. 22499568 Multiply 5 and -0.00860718. -0.0430359 23691 times -282 -6680862 -0.082873491 -5 0.414367455 What is the product of -0.676 and -20414? 13799.864 -0.06487 * -0.64935 0.0421233345 Calculate 0.11965391.1. 0.13161929 -8666 times 27.23 -235975.18 What is the product of -1.213 and -20120.1? 24405.6813 Multiply -0.07 and -3982.812. 278.79684 -907.567 -282 255933.894 11.0987-4 -44.3948 -0.0404 times 4.4421 -0.17946084 Product of 8.488342 and 0.4. 3.3953368 5125249 times -0.017 -87129.233 What is 8 times -389792.1? -3118336.8 Calculate -1142602.2. -251372 Product of 11517996.9 and 4. 46071987.6 Product of 3.22 and -29176. -93946.72 -2.381 times -3282 7814.442 118.05 times -18946 -2236575.3 Work out 4787065 * -8. -38296520 Product of -26714 and -166. 4434524 Work out 0.26237307 * 0. 0 Calculate 319623469. 58870407 Multiply -111 and -0.05308. 5.89188 What is -3 times -572472? 1717416 Product of -0.280057036 and -5. 1.40028518 -101459-0.094 9537.146 0.5 * -42355225 -21177612.5 Work out -3.517 * 12.314. -43.308338 Work out 0.19885 * -5. -0.99425 What is the product of -30 and -84394? 2531820 Product of 4 and -56392.1. -225568.4 0.4-0.8580911 -0.34323644 Work out 4 -2642.658. -10570.632 What is the product of -283 and 446390? -126328370 117223.41 17223.41 What is the product of -0.2704 and -1867? 504.8368 32.2 times -0.0545268 -1.75576296 267403 times 76.3 20402848.9 Product of -7323.6 and -0.10102. 739.830072 Product of 15833 and 9.83. 155638.39 Calculate 0.651-63.54. -41.36454 What is the product of -16.601293 and 24? -398.431032 -215 times 455258 -97880470 Multiply 6391.1 and 0.07. 447.377 Multiply -0.2 and -3.7561086. 0.75122172 -10.46 times 0.01567 -0.1639082 -1.37 times 72685 -99578.45 What is 680.1863 times 0.3? 204.05589 138.9213.729 1907.23268 Work out 143.956 -507. -72985.692 -68356.5-1489 101782828.5 Multiply 61.2 and 3.9099. 239.28588 Calculate 0.03140.26889. 0.008443146 Product of -13610 and 0.08382. -1140.7902 What is -1701.9 times 1110? -1889109 What is -0.04123648 times 0.5? -0.02061824 Multiply -29065 and 0.1847. -5368.3055 What is -5 times 447338? -2236690 Multiply -55 and -3681750. 202496250 Multiply 10 and 1045710. 10457100 What is the product of 3619.6 and -34? -123066.4 Calculate -20024160.36. -720869.76 Product of -1119086 and 5. -5595430 0.54734.977 2367.4885 Product of 24153672 and 32. 772917504 What is -2539.06673 times -2? 5078.13346 -3-0.085779639 0.257338917 Work out -0.119104 442. -52.643968 5582.1 times 0.01454 81.163734 What is -0.3 times 9832830? -2949849 Calculate 1421380-762. -1083091560 219.13 -641 -140462.33 Calculate -101640910-1. 101640910 Calculate 6667-4.9. -32668.3 281770.00291 81.99507 What is 0.1 times -2.071672? -0.2071672 0449676.8 0 Product of -0.37010489 and -0.1. 0.037010489 14297782 * 0.5 7148891 -0.1 * -151878096 15187809.6 Product of -1.9 and -8390. 15941 -11348.725 -9894.15 Calculate -0.08425-1.8. 0.15165 Product of -379.225 and -0.27. 102.39075 Product of -121.5 and -96050. 11670075 -4373.8596 -1495.4384 Product of 3 and -103887.17. -311661.51 Work out 4.929 -18330. -90348.57 3.30768773 227432.311 What is the product of -0.171 and 227060? -38827.26 Multiply 8525469.63 and -0.2. -1705093.926 Product of -5 and 3126737. -15633685 Product of 0.1150812 and -0.16. -0.018412992 What is the product of 337.3 and 1783.3? 601507.09 93784.72 times -0.5 -46892.36 -0.08 times -2032901 162632.08 Multiply 0.207076817 and 2. 0.414153634 -0.036 19526582 -702956.952 Multiply 10222439 and 0.04. 408897.56 Multiply -25.8 and -463066. 11947102.8 Multiply 0.095 and -2.24132. -0.2129254 0.0139962-1867 -26.1309054 2906048-8 -23248384 Work out 0.4496 * 3427.2. 1540.86912 What is 1099 times -0.52? -571.48 What is the product of -0.07884 and 1352.6? -106.638984 Calculate -8759899-0.107. 937309.193 2.56 -0.5053 -1.293568 Product of 313 and -0.2000031. -62.6009703 Multiply 50 and -3188296. -159414800 0.197 times -817.9 -161.1263 Multiply 79051.2 and -18.5. -1462447.2 12334.83 times -47 -579737.01 What is the product of -0.24 and 1368795? -328510.8 Calculate -1.59105647. -167978.73 What is -216 times 42.90359? -9267.17544 -213.144 48 -10230.912 45 * -0.24678 -11.1051 What is the product of 0 and -980497.2? 0 What is the product of 1136425.9 and 0.2? 227285.18 Multiply 1233.0123 and 6. 7398.0738 -1437004 times 34 -48858136 What is the product of -0.1442 and -0.7617? 0.10983714 What is the product of 38.45 and 698.9? 26872.705 2339 times 1.111 2598.629 -882523011 -97077530 What is 49840907 times 0.4? 19936362.8 10324 times -0.078 -805.272 Calculate -0.0322535398. -676061.94 What is the product of 10353 and -47.046? -487067.238 Work out -0.00600233 * 0.205. -0.00123047765 2.966 * 332.9 987.3814 Calculate -2008628-43. 86371004 Multiply 1.470883 and 0.322. 0.473624326 What is 1705 times -0.04019? -68.52395 What is -203945 times -47.8? 9748571 What is -3099 times 0.07159? -221.85741 What is the product of 0.6 and -9995992? -5997595.2 -466 times 47870 -22307420 What is -5830 times 5272? -30735760 -269650 times -0.22 59323 Work out 89 -5956295. -530110255 Calculate 11-2499491. -27494401 Product of -26 and 105513. -2743338 What is the product of -0.8161 and -5.7686? 4.70775446 Work out -978 -16108. 15753624 Multiply -252838941 and 0.1. -25283894.1 Product of -575643 and 0.011. -6332.073 Product of 2596 and 12754.2. 33109903.2 89679.4031 times -2 -179358.8062 Product of 3 and 14330460. 42991380 Calculate 0.0330.748987. 0.024716571 337 131010 44150370 35.872 * 32 1147.904 Calculate 34-779.5045. -26503.153 What is -0.2 times -766.65? 153.33 What is the product of 3305682 and -11? -36362502 Multiply -1.797 and -383.41. 688.98777 Work out 10720.4 27.7. 296955.08 Product of 0.003 and -9991316. -29973.948 Work out 2 * 38682736. 77365472 Product of -1.30831 and -11.1. 14.522241 Calculate -2858466.8. -1334114.4 Work out -5.78 1.20488. -6.9642064 Work out 0.4 * 2670610.7. 1068244.28 322176512 209797104 What is the product of -102206 and -981? 100264086 1037 1928 1999336 Calculate -3234.6660.062. -200.549292 -0.4 -105400806 42160322.4 0.11 * -93680.5 -10304.855 Product of 5434.6 and 0.03794. 206.188724 Work out 20626 * -41. -845666 Product of 6.6 and 63850. 421410 165.89 * -314 -52089.46 -17411.68 times -354 6163734.72 340 * -2207.726 -750626.84 0.5 * -14992892 -7496446 296272 * -714 -211538208 Multiply 5577736.75 and -0.1. -557773.675 Work out -0.3 * -1983016. 594904.8 83.33 * -8.4 -699.972 Multiply -746695 and 18.5. -13813857.5 Multiply -18.0770896 and -6. 108.4625376 0.13 times -0.056764781 -0.00737942153 Product of -7442427 and 15. -111636405 What is -128424 times 12? -1541088 -179 * 1.35269 -242.13151 -299218093 times -0.4 119687237.2 -6140 times -0.01972 121.0808 Product of -1287 and -22. 28314 88071 times -0.171 -15060.141 Product of 35 and 0.0422448. 1.478568 -987.366 * 0.4 -394.9464 Multiply -1.94 and -11409. 22133.46 0.257038 * -3.3 -0.8482254 What is 0.4551 times 6331? 2881.2381 Product of -5.9 and 1028115. -6065878.5 -1.2941-59611 77142.5951 Product of 18723644 and -0.1. -1872364.4 336132211 70923852 -149 * 0.427659 -63.721191 What is 410658026 times -3? -1231974078 -1275290.02 -2550.58 Work out -0.052 0.411765. -0.02141178 What is the product of -0.1 and 29.66246? -2.966246 45.2 * 117041 5290253.2 Multiply -343601317 and 4. -1374405268 What is the product of -0.094 and 132869.5? -12489.733 Work out 5521970 * 0. 0 -0.099876-9018 900.681768 Product of -123 and 5.094419. -626.613537 Work out 0.35159 -44.7. -15.716073 Product of -23 and 316514. -7279822 Calculate -934850.23. -21501.55 -2564097-0.02 51281.94 831927 times 0.2 166385.4 Multiply -0.163 and 104449.8. -17025.3174 Calculate -1543270-7. 10802890 What is -4 times 122196806? -488787224 Calculate 8505-1654. -14067270 Calculate 56-12545.6. -702553.6 Calculate -0.687575880.1. -0.068757588 Multiply -74963662 and 0.3. -22489098.6 Work out 164221 * 821. 134825441 Calculate 0.11264765. 29124.15 Calculate -4071438-4. 16285752 What is the product of -396 and 1155.75? -457677 Multiply -313441 and -0.11. 34478.51 Work out 1473.715 * 0.95. 1400.02925 0.1 times -1.2115754 -0.12115754 What is the product of -313 and -17184? 5378592 Work out 370 * 91331. 33792470 80 * 1543978 123518240 Calculate -1401-11333. 15877533 Multiply 55.4898 and 0.16. 8.878368 Calculate 0.2-390615. -78123 126.331279*-4 -505.325116 What is the product of 16462 and 2.114? 34800.668
Simplify (h(-1)/(h(2/3)/hh))(-7/3)(h*(-3)h/((h/(hhhhh*(-6)hh))/hh))(3/5) assuming h is positive. h(94/45) Simplify (i(1/11)/i5)(-14)/((i/i3)/(((i/(ii1i))/i)/i)i(1/9)i5) assuming i is positive. i(6100/99) Simplify ((l/l*(-4/3))/(ll0))/(l2)*(1/4)(ll(-10)l(-1/5))(-47) assuming l is positive. l(12997/30) Simplify ((t(-8)/(t18/t))/(t(5/2))(-13))(-23) assuming t is positive. t(-345/2) Simplify (z(-14)z((z/z*(4/13))/zzz)/zzzz/(z/(zz(-9)))z(1/23)/z)(-1/6) assuming z is positive. z*(960/299) Simplify (((zz*(-3/5)z/z*(1/2))/((z/(zz*(1/3)/zz))/(z(-1/5)/z)))(-18))24 assuming z is positive. z(-72/5) Simplify ((((((l*(2/5)/l)/ll)/ll)/l)(3/5)/(l(-1/5)l*(-4)l))31)(-35) assuming l is positive. l(-12152/5) Simplify ((y2yy)*(-2/109)/((yy/(yy(-2/5)/y)yy)/y)(2/15))/(y(-9)/yy*(-1)yyy(-2/7)/y(-3/8)) assuming y is positive. y(3838189/457800) Simplify ((t/((t/t1)/t)t)31/((t(-3/8)/t)/(tt*(-1))))/((tt/t3)/(t/t(-4))(t/(t/(t/t(-2/7))))/(tt(2/15))) assuming t is positive. t(84187/840) Simplify ((m*1/mm)*(-34)(m/(mmm*(1/4)m))*(2/117))/((mmm(-1/2))(-2/29)/(((mmm(-6)mm)/m)/(m(-4/3)/mm))) assuming m is positive. m(-80531/2262) Simplify (((n/n1)/n)*29/((nn*(-3/5))/(nn(-6))))/(n6(nn(2/3))/n)(10/11) assuming n is positive. n(-6676/165) Simplify ((n(-1/3)n)(-37))(-1/11)/((n((((nn(-2/21))/nn)/n)/n)/nn)/(nn(n(-2/9)/n)/n)(nnn3)/n(-1/2)) assuming n is positive. n(-4691/1386) Simplify (h(-3/5)h(-3/4)(hh0/h)(2/155))/((h(-1)/h)/hh*(-1)/h(h/(h*0/hh))(2/37)) assuming h is positive. h(2661/740) Simplify ((p(-1/3)/p)(-7)/(p/p(1/4))(11/2))/(p*(-13)p/(p/(pp/(p(-3)/p))))5 assuming p is positive. p(965/24) Simplify b(11/8)/(bb*23b)(b(-4/7))(-5/13) assuming b is positive. b(-17039/728) Simplify (u/u(-43)u)/(uu(-41))(((u(u40u)/uu)/u)/u)(-41) assuming u is positive. u(-1555) Simplify ((o(2/5))(3/4))(10/7)/((((o(-5)o)/o)/(oo/(o4o)o))/((o/(o/o(-3)))/(o/((oo/o(-6))/o)))) assuming o is positive. o(45/7) Simplify ((r(-21))(-1/60)/((r/r33)/r20))(8/5) assuming r is positive. r(2094/25) Simplify (vv/((vv*34/v)/v)vv)/(v(-18)v)(v(v*(-42)v)/v)/v(-12/11) assuming v is positive. v(-571/11) Simplify (((uu/(u/u(4/7))uuuu(-2/29)u)(-2))(-1/13))23 assuming u is positive. u(51382/2639) Simplify c/(c/((cc/((c/(c/c(1/3)c))/c))/cc))cccc/(cccc/(cc(-2)))(c(-1/2))25(c3c(-6/5))/(c(-1/2)/c)33 assuming c is positive. c(622/15) Simplify (((q(-2/11))(-42))(-28))(-2/7) assuming q is positive. q(672/11) Simplify ((d3)(-33))(2/7)(d4d(-7))/(d(1/3))(-29) assuming d is positive. d(-454/21) Simplify (ff(-5)f)*(-4/25)f*(1/26)f49/f assuming f is positive. f(31537/650) Simplify (l*(-1/5)(l/(l/l*(1/9)l))/ll4ll(1/3))(2/27) assuming l is positive. l(292/1215) Simplify (a(-12)/(a(-10)aaa))(14/3)/((a(1/4))*(-12)(a/(aa(-4/5)))/aa/(a/a(-5))) assuming a is positive. a(-227/15) Simplify (a/(aa/((a/(a(-1/4)/a))/a)a))(30/11)/(a27aa(3/13)) assuming a is positive. a(-8659/286) Simplify (((p*(1/2)p)/p)*(1/16)/((pp(-1/18))/p0))(-26/9) assuming p is positive. p(3419/1296) Simplify ((h(-1)/(((h26/h)/hh)/h))18)7 assuming h is positive. h(-3150) Simplify x6/x6x(-3)/x(1/5)(x(-2))(16/9)/(xx/x*(1/2)x(-1)/x) assuming x is positive. x(-563/90) Simplify (((g*(-7/6)g)/g)/g(6/13))(-8/3)(g1)(-38)g*(-2/3)/(ggg(-3)/g) assuming g is positive. g(-3782/117) Simplify (n/(nnn(-2/25)/n)n/n*(-6)n(n(-2/7)/nn)/n(2/5))/((((n/n(-4/5))/n)/(nn(6/11)))/(n(-1/9)/n(-5))) assuming n is positive. n(225721/17325) Simplify (zz*9zz(-6/5))26(z(-1))(-48)/(z(1/4))(-22/7) assuming z is positive. z(21251/70) Simplify (((q(-3/2)q(-2/13))/((qq(-5))/q(-5/2)))(1/6))(42/13) assuming q is positive. q(-14/169) Simplify ((z/(z/z10))/z*(-10)z*(2/11)z/(zz(-2/43)z))(15/4) assuming z is positive. z(136425/1892) Simplify qq4q/q*(-3/8)(q1/q)/(q(-2/13)q)q*(-7)qq/((q/(q/(q/q(7/4))q))/qq)q(q/q(-1/5))/qq(-3) assuming q is positive. q(249/520) Simplify (t*(6/5)t*5(tt(-2/9))(-34))/(((((tt*3/tt)/tt)/tt)/t*(-9))/(t/(tt(tttt*(-2/5))/tt)tt(-9))) assuming t is positive. t(-2018/45) Simplify (((p/p*(2/7)pp(-3/8))/(p(2/23)p/(p/p(-2/5))))(1/15))32 assuming p is positive. p(14188/4025) Simplify (((t*(-1/4)tt10)(-20/11))(9/7))31 assuming t is positive. t(-59985/77) Simplify ((n/n(-2))45)(-4/21)/((n2)(14/3))(-7/3) assuming n is positive. n(-248/63) Simplify ((ll/l*(4/3))/ll*(-6/11)/l)/((ll/(l/(ll/(l/(l(-2/7)ll)))))/(lll((l/l*0)/l)/l))((ll(-4)l)(-8/3))(1/90) assuming l is positive. l(-36734/10395) Simplify (t(-14)/tt6t(tt((tt/t*(2/59))/t)/t)/ttt(-3))(-1/47) assuming t is positive. t(533/2773) Simplify ((y(-3/4))36y*(1/9)y(1/2))26 assuming y is positive. y(-6175/9) Simplify (w(-1)w2)/(w(-3/7)w*(1/2))(w(-1/2))(8/3)/((w/(w/w*(-4/5)w))/(w*8w)) assuming w is positive. w(2183/210) Simplify g0g(-5)(g/(((g/(g/g*4))/ggg)/g))/g(-7)(g/g*(2/3)g)*(-46)(gg/(g(-6)g)g)/(g/(g(-5)g)) assuming g is positive. g(-178/3) Simplify b(-20)/b*(-6)(bbbb(-35)bb)(-4/3) assuming b is positive. b26 Simplify ((jjj/((j/j0j)/j))39/(j/(j(2/5)/j)j/(j/j(-7))))/(j/(((j/j(1/11))/j)/j)j/((jj(-2/3))/j)(j(-1))(2/45)) assuming j is positive. j*(7889/99) Simplify (h(hh/(hhh(-3/20)h)h)/h)2/(h(-3/11))(-36) assuming h is positive. h(-1047/110) Simplify ((q1)(-2/59))(-37)(q(-1))(-2/25)/(qq5q/(q*(-6)qq)) assuming q is positive. q(-14257/1475) Simplify ((k(1/8)k)/(kk/k(-5/3))k/(k((k/k(-3))/k)/k)kk/k5kk)/((k(1/8)k1)/(k1/k)(2/63)) assuming k is positive. k(-20/3) Simplify (((tttt/(t6tttt))/t)/(ttt/t(-1))(t/(t*6t)tt)/(t*(2/9)t))/((tt0)/t(3/2)(t(-1/3))(-6/29)) assuming t is positive. t(-8243/522) Simplify (((a8/a)/a)/(a(aa/a*(3/8))/aa)a(-7/4)a/(aa8)a)(-4) assuming a is positive. a(43/2) Simplify (c(2/3))(3/34)(cc/(c/c(-2)))12c7c/((c/c*(-1))/c)(c/((c/c(-1))/c))(-28) assuming c is positive. c(-84/17) Simplify (z0)*(-1/38)/(zz*(-1/3)z*4z)((z(1/2))(3/5))(-6/11) assuming z is positive. z(-962/165) Simplify ((x1x)*31((x(-1)/x)/x)15)/((xx0xx)(-13))(5/9) assuming x is positive. x(116/3) Simplify ((pp*(-1/3)p)*(-2/15)/(pp4)31)(7/2) assuming p is positive. p(-9779/18) Simplify ((n*(-5/2)n*(2/17)n)/((n/(n/(n/n*(-1)))n)/n(-1/4)))/((n6/nn6/n)/(n/n1)34) assuming n is positive. n(-995/68) Simplify q/q(-12)q/(q*(-3/2)q)q/(q(-2/109)/q)q(qqqq*(-28))/qq assuming q is positive. q*(-1631/218) Simplify ((aa(-34))(15/2)a(-2/9)aa(aa7)/a)48 assuming a is positive. a(-34376/3) Simplify (((tt(-1))/t)12t(-2/3)t*(-3)t)/((ttt(t/(ttt/((t/t1)/t)))/tt)(-2/91)/(t(2/7)t)(-28)) assuming t is positive. t(-152/3) Simplify ((x(-1))(-4/37)/(x(x/x*(-1/3))/x((x/(x/(xx(1/5)/xx)))/xx)/x))/(x2xx5x*(-6)xx(1/3)) assuming x is positive. x(-2641/555) Simplify ((t(-6)/(ttt1tt)ttt/t*(-2/7)tttttt/(ttt(2/7))ttt)(-2/29))38 assuming t is positive. t(76/29) Simplify ((g2/(g/(g*20/g)))/((ggg(7/5))/(g/g(1/21))))27 assuming g is positive. g(16587/35) Simplify ((xx(-1))(-23))*7(x/x*(2/15)xx0x)/((x*(-5)xx)/x(-1)) assuming x is positive. x(73/15) Simplify (((j/j(-3/13))/j)(13/4)/(j(-22)/(jj*(1/9)jj)))(-6/13) assuming j is positive. j(-931/78) Simplify (w/(w(w*(1/4)w)/w)w)15/(w/(w/w1))24w*(-2/11)w(www/w(3/8))/www/((w/((ww*(3/7)/w)/ww))/w)w/(w(-2)w)w assuming w is positive. w(-3005/616) Simplify (c(-1/17)/(c(-1/19)/c))/((c(-9)/c)/(c5/c)) assuming c is positive. c(4843/323) Simplify ((v(-2))37/(v(-1)v)34)22 assuming v is positive. v**(-1628)
Let m = 0.122 - -0.878. Let f = 54 + -54.96. Let u = -0.04 + f. What is the nearest to u in -5, m, -1? -1 Let q be 1281/210 + (-22)/4. Which is the nearest to -4? (a) -4 (b) q (c) 3 a Let z = 2.9 - 3. Let k(d) = 2d3 - 2d*2 - 4. Let x be k(2). Let r be ((-4)/(-2) - 0)/(-5). Which is the nearest to 1? (a) z (b) r (c) x a Suppose 5j = -5n + 510, 2j - n = 33 + 171. Let g = -102 + j. Let z = -36 + 682/19. Which is the closest to 0? (a) g (b) z (c) 0.1 a Let f(q) = 5q + 0q*2 - 35q + 23 - 2q2. Let y be f(-16). What is the nearest to y in 0.1, 0.2, -4? -4 Let r(p) = p + 8. Let o = 29 - 41. Let d be r(o). Which is the closest to 1? (a) d (b) -2/7 (c) 0 c Let o = -83.53 - -84. Let v = o - 0.17. Let u = v - 0.4. Which is the nearest to u? (a) -1 (b) 3/8 (c) -0.1 c Let b = 0.65 - -6.35. What is the closest to -2 in b, 1, -0.3? -0.3 Let m = -21.5 - -16.5. What is the nearest to -3 in m, -2, 1/3? -2 Let c be (3/2)/((-3)/108). Let k be c/24 - 3/(-2). What is the nearest to -1 in k, 3, -0.2? k Let d be 2 + (-1 - (-2)/(-3)). Let o(u) = -u3 + 20u*2 - 9u - 11. Let n be o(20). Let k = n + 951/5. What is the closest to 2/3 in k, d, -0.4? d Let u = -75.5 + 75. Let l = -49/17 - -92/85. Let p = -2 - l. Which is the closest to -1? (a) p (b) 0 (c) u c Let g = 1.3 - 0.3. Let p = 32/5 - 101/15. Let k = -15 - -15.1. Which is the closest to k? (a) p (b) g (c) -2 a Let j(g) = g*2 - 23g - 49. Let r be j(25). Let t = 0.7 + -0.69. Let q = t + 0.19. What is the nearest to r in q, -2/15, -0.3? q Let t be 30/(-50) - (1742/30 - -1). Let m = -59 - t. Which is the closest to m? (a) 1 (b) 4 (c) -5 a Let b = -74 - -74.78. Let z = -0.7 + b. Let i = 0.08 - z. What is the nearest to i in -0.3, -0.5, -2/9? -2/9 Let u = -9/35 + 2/35. Let w = 521/8 + -65. Which is the nearest to 1? (a) w (b) u (c) 38 a Let t = 8 + 43. Let v = t - 201/4. Which is the nearest to -2? (a) -0.1 (b) v (c) -5 a Let q = -194.8 - -200.8. Which is the closest to -3/2? (a) q (b) -0.5 (c) 24 b Let m(q) = -q*2 - 6q - 1. Let n be m(-4). Let u(y) = y - 6. Let z be u(n). Let i = 3 - 2.7. What is the closest to z in -0.5, i, -0.3? i Let x = 198 + -223. What is the closest to x in -0.07, 1, 4? -0.07 Let u = -142 - -143. What is the closest to u in 1/7, -5, 11? 1/7 Let h = 410 + -420. Which is the nearest to 0.1? (a) 2/5 (b) h (c) -3/2 (d) 4 a Let r = 92/99 + -10/9. What is the closest to r in -1, -0.3, 1/2? -0.3 Let k = -1717 + 1718. Which is the closest to -0.4? (a) k (b) 6 (c) 4/3 a Suppose 4l - 6l = -14. Suppose -f + 2n = 1 - 8, 4n + l = -5f. Let o be (2 - 10/6)/(-1). Which is the closest to o? (a) -4 (b) 2 (c) f c Let l be (-1)/(-5) + -5 + 308/60. Suppose -2 = r - 5. Which is the nearest to -3? (a) l (b) r (c) 1/4 c Let b = -2/259 - 68/777. Let z = 2 - 2.4. What is the closest to b in -3/4, z, 3/5? z Let s = 28/11 + -162/55. Suppose -1 + 0 = -l. Which is the closest to s? (a) l (b) -3/4 (c) -2/7 c Let s = -370 - -368. Which is the nearest to -1/3? (a) s (b) -11 (c) 1/4 c Let b = 14.3 + -14. Let c be (6 - 8)13/3. What is the closest to -0.2 in c, b, 0.5? b Let v = 14 - 7. Let p = v + 0. Let k = p - -1. Which is the nearest to 0.1? (a) 4 (b) k (c) 3 c Let x = -528 + 526. What is the closest to x in 2/11, 4, -2, 0.3? -2 Let u = -23 - -22.994. Let f = -4.006 - u. Which is the closest to f? (a) -2 (b) 0.2 (c) 1 a Let k = -6 - -8. Let p = -0.3 - -4.3. Let i = 4.4 - p. Which is the closest to 2? (a) k (b) i (c) 1/4 a Let o = 125 + -125. Suppose 2r = 4j + 8, j + j = o. Let v be ((-1)/6)/(2/(-8)). Which is the closest to v? (a) 0.4 (b) -0.1 (c) r a Let o = -0.36 + 0.07. Let p = o + -1.71. Let j = -0.23 - 0.27. Which is the nearest to -0.1? (a) p (b) j (c) 0.2 c Let o = 464.039 + -459. Let y = o - 0.039. What is the closest to -1/2 in 3, 0.5, y? 0.5 Let b = 0.111 - 0.211. Let f = 6 + -5.7. Let h = 20 - 24. What is the nearest to b in h, f, -0.1? -0.1 Let p be (-93)/105 - (-2)/7. Let w = 2.8906 - -0.1094. Which is the nearest to 0.2? (a) p (b) -3 (c) w a Let a be (-24724)/(-3258) - 14/63. Let w = -6/181 + a. Let m = 7 - w. What is the closest to m in 0, 1, -0.5? -0.5 Let x = 1.4 - 1.5. Let j = -389.4 + 389. What is the closest to x in j, -1, -1/6? -1/6 Let z = 2.463 + -2.363. What is the nearest to -2 in -3, -1/6, -4, z? -3 Let v be ((-4)/6)/((-732)/(-9) + -6). What is the closest to 0.1 in v, -6/7, 0.5? v Let g = -0.19 - 0.01. Let q = 0.6 + 0.4. Let n = -4 + q. Which is the nearest to -0.1? (a) -2 (b) g (c) n b Let r = -31.02 + 31.32. Let y = 5/6 + -1/3. Which is the nearest to y? (a) r (b) -3 (c) -6/17 a Let f = 0 - 0.8. Let t = -2.28 - -1.08. Let q = t + f. Which is the closest to 1? (a) -0.3 (b) q (c) 1 c Let n be (3/(-14))/((-2)/(-4)). Let p = -21.5 + 18. Let o = p - -3.5. What is the closest to o in n, 0.2, 0.1? 0.1 Let w = -0.31 - -0.01. Let x(s) = s2 + 10s - 3. Let t be 255/(-25) + (-2)/(-10). Let z be x(t). Which is the closest to -2/5? (a) w (b) -4 (c) z a Let u be 1/(-112)-118 - 2. Let q = u + 4/7. Let f = 3.3 - 3.2. What is the nearest to f in -0.6, -0.2, q? -0.2 Let l = -4 + 1. Let t = 21 + -15. Which is the nearest to 1? (a) 0.1 (b) l (c) t a Let m = 2.86 - 0.56. Let k = m - 2.7. Which is the nearest to -1/2? (a) 0.3 (b) k (c) -3 b Let n = 0.017 - 0.117. Let o = 0.03 - 0.13. Which is the nearest to n? (a) -6 (b) o (c) 0.2 b Let c = 0.13 - -0.11. Let z = -0.24 + c. Let r = 3 - 1. What is the nearest to z in -0.3, 0.2, r? 0.2 Let y = -0.119 - -0.067. Let m = -0.148 + y. Let p = 1 - 5. What is the closest to m in 0.3, p, -2? 0.3 Let u = -973 - -970. What is the nearest to 8 in -5, u, 0.3? 0.3 Let x = -19 - -15. Let k = -1 + 2. Suppose -1 = s - 3n, -2s + 4s = 4n. Which is the closest to s? (a) k (b) x (c) 0.1 a Let z = 5.48 - 3.48. Which is the nearest to -0.2? (a) 4 (b) z (c) 2/13 (d) -5 c Let t be (-3404)/(-69) + (-1)/3. Suppose -4v - 21 = -4i - t, -3i + 4v = 26. Let a = -7 - -8. What is the nearest to i in a, 0.5, -0.4? -0.4 Let o = 933 + -6528/7. Which is the nearest to 0? (a) o (b) -36 (c) -0.5 a Let f be (21/28)/((-492)/32). Which is the nearest to 0.1? (a) 2/3 (b) -0.4 (c) f c Let y be (34/(-12) + 3)/((-10)/(-15)). Let x = 4.8 + -0.8. Let f = 7 - x. What is the closest to -1 in f, y, 5/4? y Let p = -5 + 4. Let j = 0.66 + -0.36. Let w(d) = -d + 2. Let r be w(4). Which is the nearest to -0.1? (a) r (b) p (c) j c Let f = 0.104 - -6.596. Let z = -7 + f. Let x be -6 + 9 - (-6)/(-2). What is the nearest to x in 1/10, z, -2? 1/10 Let w = 1247 - 2491/2. Let q = -29/4 + 311/44. Which is the nearest to q? (a) -0.4 (b) w (c) 1/2 a Let d be (-8)/181/(-2). Let n = 27.2 - 26. Let s = -1.5 + n. What is the closest to -1 in s, 5, d? s Let b = 3.3 - 4.3. Let l = 1 - -1. Let z = -1.4 + -2.6. What is the nearest to 3 in z, l, b? l Suppose -3x + 0z - 5z = 3, 0 = -4x - z - 4. Let d be 2/4 - (-5 - -6). Which is the nearest to -1/4? (a) d (b) x (c) -3 a Let v = 49 - 295/6. Let u = 11.94 - 12. Let s = 0.14 - u. Which is the closest to 1/2? (a) v (b) s (c) 4 b Let r = 8 + -13. Let z = 1.2 - 3.2. Let i = z - -1.7. Which is the closest to 0? (a) r (b) i (c) -1 b Let z = -164.1 + 155. Let n = 9 + z. Let f = 2 - 4. What is the nearest to n in f, -3, 5? f Let n = -1 - 0. Let g(q) = 5q2 + 34q - 8. Let c be g(-7). Let y be c + 6 + (-4 - 3). What is the nearest to -1 in y, n, -5? n Let h = 39 + 18. Let l = 59 - h. Suppose -3q + 2q = 2. Which is the closest to l? (a) 3 (b) q (c) -2/5 a Let b = 1.92 + -2.22. What is the closest to -4/15 in b, 3, 7? b Let k = -0.72 + 1.12. What is the nearest to -1/4 in -8, k, -4? k Let u = 548 - 2193/4. Which is the closest to 3? (a) u (b) -0.5 (c) -2/7 a Let m be 32/(-4)-2. Suppose -2c = 2f - 5f + m, -3 = c. Suppose -52 + 44 = 4s. What is the closest to -2/3 in f, 1/3, s? f Let g = 45 - 44. Let r = 11.88 + -12. Let z = r - -4.12. Which is the nearest to g? (a) 7 (b) 3 (c) z b Suppose 0 = 3m + 5 - 17. Suppose mn = 4n + 5n. Let t = 0.5 - -0.5. What is the closest to t in n, 0.01, 2/5? 2/5 Let h = 4.661 + -0.661. Which is the nearest to h? (a) -4 (b) 3/5 (c) 16/7 c Let n = -82.7 + 15.7. Let v = n + 65. Let i be 1/((-1)/(-2)) + 0. Which is the closest to v? (a) i (b) 4 (c) -5 c Let h = -816 + 820. What is the closest to -26 in -0.3, h, 0? -0.3 Suppose 2n + 7 = w, n - 3n - 2*w = -2. Let f be (9/6)/(18/8). Which is the closest to 0? (a) f (b) n (c) -5 a
In base 3, what is 2201010 - 2111012211? -2101111201 In base 11, what is 392 + 1a596? 1a978 In base 10, what is 189 + 170834? 171023 In base 7, what is -2 - 24225320? -24225322 In base 10, what is 207 - 534170? -533963 In base 2, what is -1000 + -110001110101111110101000111? -110001110101111110101001111 In base 15, what is 36203e7 + 2? 36203e9 In base 12, what is -3b13815 + 22? -3b137b3 In base 12, what is 4895538 + -4? 4895534 In base 6, what is -25 - 510241250? -510241315 In base 8, what is -5 - -256461204? 256461177 In base 13, what is 50 - -388a30? 388a80 In base 10, what is 7666264 + 8? 7666272 In base 16, what is -6c6db - 96? -6c771 In base 5, what is -3 + 11431300020? 11431300012 In base 16, what is -1 + -871e96c? -871e96d In base 13, what is 450c4 - -261? 45355 In base 13, what is -2bb - 3359? -3647 In base 4, what is -2 + -1022103232233? -1022103232301 In base 8, what is -4673 + -1003? -5676 In base 2, what is 10111 + 10101111001110010010111? 10101111001110010101110 In base 12, what is 60 - -10750b0? 1075150 In base 9, what is -3 + -328723365? -328723368 In base 5, what is -102 + 442220112? 442220010 In base 4, what is -331 + -111301222? -111302213 In base 2, what is -1001001010100001 - -1010? -1001001010010111 In base 4, what is -110303020122 + 10? -110303020112 In base 7, what is -33160650 + 11? -33160636 In base 6, what is 120102 + -2252? 113410 In base 5, what is -12341003 - -103224? -12232224 In base 14, what is 26d - d567? -d2d8 In base 16, what is 0 + dc38f? dc38f In base 9, what is 26 - 22472106? -22472070 In base 15, what is 4 + 45ba87b? 45ba880 In base 15, what is -d79c5 - -234? -d7791 In base 11, what is 6a6 + 336341? 336a37 In base 6, what is -2123001 - 203? -2123204 In base 15, what is -3eb + 2723? 2327 In base 10, what is 5 + -40984115? -40984110 In base 14, what is 3814 + a38? 444c In base 16, what is -fe35 + 14? -fe21 In base 13, what is cb0 + -3380a? -3282a In base 10, what is 2023 + 174? 2197 In base 8, what is -224 - 13207? -13433 In base 12, what is 49 + 624749? 624796 In base 4, what is -1121321 + -132033? -1320020 In base 12, what is -19524318 + 5? -19524313 In base 15, what is -116295ba + 4? -116295b6 In base 4, what is -221313 + 1311113? 1023200 In base 13, what is -8 + -76c3b? -76c46 In base 9, what is 2 + -167747458? -167747456 In base 2, what is -10101010 - -10010111101100011? 10010111010111001 In base 2, what is 1000110 + -100110101110100110001111? -100110101110100101001001 In base 5, what is 4042 - -320421? 330013 In base 16, what is 7a0e8c8 - -1? 7a0e8c9 In base 10, what is -346 - 6307? -6653 In base 16, what is -98ebf + -8? -98ec7 In base 11, what is -6a2a0343 - 5? -6a2a0348 In base 3, what is -102102020121 + -112202? -102102210100 In base 15, what is -2 - -6566dd? 6566db In base 11, what is -168a748 + 272? -168a486 In base 2, what is -1101111000010100000000 - 100? -1101111000010100000100 In base 16, what is 7a + -6a2b? -69b1 In base 8, what is -11130062 + 165? -11127675 In base 2, what is 11011101110000101110111 + -1110? 11011101110000101101001 In base 12, what is -42 + -2406a55? -2406a97 In base 14, what is -879c - 4d45? -d703 In base 15, what is -24 + 74eeb1? 74ee8c In base 4, what is -2100 - -31113211? 31111111 In base 10, what is 5 + -78748759? -78748754 In base 10, what is -5 - -92580178? 92580173 In base 11, what is 1419500 + 3? 1419503 In base 9, what is 14023152 + -3? 14023148 In base 6, what is 15 + 52340342? 52340401 In base 15, what is 13ba - aa? 1310 In base 5, what is -1143224204 + -413? -1143230122 In base 9, what is -3 - 53361324? -53361327 In base 4, what is 2333220122 - -31021? 2333311203 In base 3, what is -112101122011212 + -212? -112101122012201 In base 2, what is -1001010011000001 + -1110010000? -1001100001010001 In base 9, what is -31 - -115622? 115581 In base 11, what is 2a7 + -366497? -3661a0 In base 8, what is 50161 + -7371? 40570 In base 12, what is 2b3258 + -20? 2b3238 In base 2, what is 10000101 - -1001100011100011001? 1001100011110011110 In base 11, what is 25583246 - 2? 25583244 In base 12, what is 1410 - 188? 1244 In base 16, what is 628 + -8ab? -283 In base 7, what is 24523 - 1361? 23132 In base 12, what is -12ab42 + 373? -12a78b In base 6, what is -53510043 - 3? -53510050 In base 2, what is 10001110000111110010 - -10001? 10001110001000000011 In base 12, what is -3 - 272200b? -2722012 In base 11, what is 1 + -361986? -361985 In base 11, what is 3780a + 11a5? 38a04 In base 6, what is 1344040410 - 0? 1344040410 In base 13, what is -459 - 684c? -6ca8 In base 16, what is -7b27 + -e2? -7c09 In base 13, what is 4 - -207a77? 207a7b In base 6, what is -1351 - 1332551? -1334342 In base 14, what is -d0500 - 80a? -d0d0a In base 4, what is 121 + 2210033? 2210220 In base 8, what is -1 - -13133504? 13133503 In base 10, what is -15 - -44473122? 44473107 In base 11, what is 363289 - -181? 36345a In base 15, what is 32219 - -4? 3221d In base 10, what is 62 + -16223418? -16223356 In base 10, what is 1819307878 - -4? 1819307882 In base 11, what is -350 + 8a251? 89a01 In base 5, what is -312 - -12341? 12024 In base 2, what is -101100101 + 110101110? 1001001 In base 7, what is 0 - -1050642311? 1050642311 In base 11, what is -1 + -3677666? -3677667 In base 9, what is 1764 + -25861? -24086 In base 13, what is 37a09010 + -4? 37a09009 In base 2, what is -110011011010 + 11011011010? -11000000000 In base 13, what is 5 + 2080bbc? 2080bc4 In base 8, what is 31317714 + 2? 31317716 In base 16, what is fdff3f + 13? fdff52 In base 15, what is -6ac1 + -4ce? -70a0 In base 10, what is 84190376 + 4? 84190380 In base 13, what is -65685 + -7? -6568c In base 11, what is 27 + 12001a? 120046 In base 7, what is -4115 - -2640? -1145 In base 9, what is -1050632 - -186? -1050435 In base 8, what is -141 + 14471? 14330 In base 2, what is -1001111100001 + -100011010? -1010011111011 In base 10, what is 35920 - -122? 36042 In base 12, what is 5985 - 183ba? -12635 In base 6, what is -52051504 + -105? -52052013 In base 16, what is -2 + 1ab0a4? 1ab0a2 In base 14, what is -22 - -694d7b? 694d59 In base 2, what is -1001000111 + -111011011000? -1000100011111 In base 16, what is a1367 - -3fb? a1762 In base 15, what is -25bc969 - 1? -25bc96a In base 10, what is -2927 + -380606? -383533 In base 2, what is 110111010101010111111 - -101? 110111010101011000100 In base 5, what is 4114111023301 - 4? 4114111023242 In base 4, what is 23113003113 + 33? 23113003212 In base 14, what is -136 - 3449? -3581 In base 16, what is f8e - 200? d8e In base 16, what is -7017 - -25f? -6db8 In base 11, what is 5927249 + -5? 5927244 In base 12, what is 2 - -5554579b? 555457a1 In base 3, what is -10120100 - -1100012100? 1012122000 In base 3, what is 20 + 20021211002121? 20021211002211 In base 7, what is -1 - -2426044502? 2426044501 In base 8, what is -1657011 - -145? -1656644 In base 13, what is 5 + 5b3142? 5b3147 In base 4, what is 212 - 10010101122? -10010100310 In base 15, what is 5d1dbe + -17a? 5d1c44 In base 8, what is 6635534 - 13? 6635521 In base 13, what is -3 + -42683bb? -42683c1 In base 8, what is -2621001 - 2263? -2623264 In base 15, what is 693a + -314? 6626 In base 15, what is 7 - 4ed3e? -4ed37 In base 16, what is 5 + -34c310e? -34c3109 In base 7, what is 534151 + -1341? 532510 In base 6, what is -210 - -245324? 245114 In base 13, what is 13 - -69511? 69524 In base 9, what is 12 - 2548027? -2548015 In base 10, what is -114 - 1601768? -1601882 In base 13, what is -7198 + -5c8? -7793 In base 4, what is -1 - 2212011133113? -2212011133120 In base 10, what is 2 - 801331? -801329 In base 10, what is -12033249 + 1? -12033248 In base 12, what is 140a81 - 313? 14076a In base 2, what is 10011010101101001110010 - -1010? 10011010101101001111100 In base 6, what is 104 - 1224202? -1224054 In base 14, what is 22 + -84d0c? -84cca In base 4, what is -13331223211 - -11? -13331223200 In base 16, what is -a4b2cc + 5? -a4b2c7 In base 2, what is 100010101001110001 - 1001001101? 100010100000100100 In base 6, what is -444404 + 142? -444222 In base 13, what is 0 - 5a611c0? -5a611c0 In base 4, what is -3331230131 - -211? -3331223320 In base 4, what is -10032 - 13032332010? -13033002102 In base 11, what is 3 - -5516aa08? 5516aa10 In base 14, what is -4 - -1646774? 1646770 In base 14, what is -13886b0 - 7? -13886b7 In base 13, what is 5c596 + -238? 5c35b In base 7, what is 0 + -25603155? -25603155 In base 5, what is -1241103 + 214001? -1022102 In base 14, what is 1c5 - -b2c? d13 In base 12, what is 30828383 + -5? 3082837a In base 12, what is 0 - 717b074? -717b074 In base 12, what is -37a7b + 304? -37777 In base 9, what is -75437 - 7243? -83681
Let g = -2.5 - -2.4. Suppose -319 = -5m - 39. Let k be 3/4 - 66/m. Which is the fourth biggest value? (a) -1 (b) k (c) -0.4 (d) g a Let w = 0.3605 - 0.1605. What is the biggest value in 5.3, w, 2? 5.3 Suppose 11741 = 7y + 11300. What is the third smallest value in y, 21, -0.4? y Let v = 1.23803 + 0.06597. Which is the biggest value? (a) -3 (b) v (c) -2/11 b Let c = 134 + -203. Let d = c - -74. What is the third smallest value in -0.2, d, -2/7, 18? d Let k be -24/(-152)6/(-2). Let x = -238 - -148. Let w = x - -85. Which is the biggest value? (a) 1/10 (b) k (c) w a Suppose 35s + 1970 = -19310. What is the smallest value in s, -3, 3/5? s Let s be (1/(-5))/(78/156). What is the second biggest value in -6/11, -0.42, s? -0.42 Suppose j + 10 = -37. Let i = j + 43. Let s be 44/(-12) + (-12)/i. What is the biggest value in -1/6, -4/5, s? -1/6 Let p = -7 - -7.2. Let a = 2.2 - 2.1. Let c = -597/7 + 85. What is the fourth smallest value in p, c, 0.4, a? 0.4 Let m = -13153 + 13149. Which is the smallest value? (a) 103 (b) -3/5 (c) 4 (d) m d Let m = -4554 + 4562. What is the fourth biggest value in 11, -2, m, -0.11? -2 Let a = 8.02 + -8. Let s = a - 0.05. Let d = 9207 - 18415/2. What is the second biggest value in s, -2, d? d Let o = 53.351 + -53. Let z = 0.351 - o. What is the biggest value in 1, z, 4, 7? 7 Let t = -0.34 + 1.54. Let m = -2.8 - t. Let r(p) = -4p*2 - 12p + 2. Let u be r(-3). Which is the fourth smallest value? (a) m (b) u (c) 21 (d) 0.1 c Let n(d) = 2d2 - 26d + 7. Let w be n(13). Suppose 5f = -u - 3 - w, 4f + 2u = -2. Which is the second smallest value? (a) f (b) -4.4 (c) 0.05 a Let u = -53 - -48. Let w = -24.5 + -19.5. Which is the fourth smallest value? (a) u (b) w (c) 0 (d) 2 d Let r = -16314 - -16317. Which is the third smallest value? (a) r (b) 1 (c) 0.03359 a Let z = -31.75 + 22.54. Let x = z - -9.21. Suppose 0 = 4b - 5u + 9, -2b + 0b - 4u + 28 = 0. What is the fourth smallest value in x, b, 1/2, 0.4? b Let w = 0.08422 - 364.98422. Let f = 341 + w. Let i = -24 - f. Which is the third biggest value? (a) 3 (b) 1 (c) i c Let g(c) = 50c2 + 32c - 85. Let a be g(3). What is the third smallest value in 2, -3/5, a? a Let n be 3 - ((-5959)/1912 - -6). Let w = n - -2/239. Which is the biggest value? (a) 3 (b) w (c) -2/9 a Let n be (1 - 3/(-33)-57) + (-2 - -6). Suppose -d = -3 - 5. Let x = 49/6 - d. Which is the smallest value? (a) x (b) n (c) 5 b Let t = -29 - -28.37. Let u = t - -1.58. Let l = -0.05 - u. What is the second smallest value in 2, l, -0.4, 6/7? -0.4 Let w = -478.7 - -1017.1. Let a = w + -538. Let c be (-2)/(-2) + 14/(-18). What is the third smallest value in a, c, -1? a Let v = -7403 - -7388. Which is the third biggest value? (a) v (b) -130 (c) -1/6 (d) 0.1 a Suppose a = 0, -a + 3 = 3m - 6m. Let n be m/((-30)/(-12) + -2). What is the smallest value in n, 6/19, 0.3? n Let s = -392721 - -392764. Let f be 2(-6)/(1 + 2). Let h be ((-6)/4)/((-2)/f). What is the fourth smallest value in s, h, -4, 4? s Let j = -167 + 177. What is the second smallest value in 4, j, 1? 4 Let o = -419.647 - -420. Let b = 7.353 - o. What is the third biggest value in -3, b, -0.1? -3 Let m = -14 - -9. Suppose 0 = -9p + 971 - 962. Which is the fourth biggest value? (a) 2/11 (b) m (c) 4 (d) p b Let h be ((-1)/(-1 - 2570/(-2580)))/2. Which is the second biggest value? (a) 1/6 (b) h (c) -0.4 a Suppose 0 = -5x - 2191 + 2181. Which is the fourth biggest value? (a) -1 (b) -3 (c) 0 (d) x (e) 0.07 d Let o = 6833 - 6831. Which is the smallest value? (a) 0.5 (b) -0.3 (c) 1555 (d) o b Let d = -190 - -187. Let r be 1d(-10)/80-4. Let o = 16.9 - 0.9. What is the biggest value in o, r, -3/5, 5? o Let a = 25.786 - 1.846. Let v = -24 + a. What is the third smallest value in v, -5, 1, -1? v Let q = -7649 - -7654. Which is the second biggest value? (a) 7 (b) q (c) -0.125 b Let o(z) = 13z - 15. Let l be o(1). Let n be 1 - 9 - 15/l. Which is the smallest value? (a) 0.3 (b) -5/3 (c) n b Let o = 2.9157 - -12.0843. Which is the fourth smallest value? (a) -4/17 (b) o (c) 3 (d) 0.13 b Let n = 3299/4 + -1649/2. Which is the second biggest value? (a) -2/3 (b) n (c) 2/17 c Suppose -3j + 7j = 36. Let w = 90651 + -181291/2. Which is the third biggest value? (a) j (b) w (c) 0 c Let z = -121.04 - -21.74. Let o = -99 - z. Which is the second smallest value? (a) 1/6 (b) 0.2 (c) -0.5 (d) o a Let w = 93 + -90. Let o be 6/w - (2 - -4)-3. Suppose 3y - o = 4p, 18 = -p - 0y + 4y. What is the third smallest value in p, -0.37, -2/13? -2/13 Let j = 0.42 + -14.92. Let h = j - -12.5. Which is the smallest value? (a) 0 (b) h (c) 2/5 (d) 1 b Let z be ((-18)/297)/((-5)/70) - (-16)/(-24). Which is the second smallest value? (a) 10 (b) z (c) 2 (d) -4 (e) -0.27 e Let r = 1 - 6. Let u = -1.8 - -2.2. Let l = 1 + -0.9. Which is the third smallest value? (a) u (b) r (c) l a Let y = -2510 - -2514. What is the third smallest value in 10.4, -0.1, y? 10.4 Let o = 5 - 1. Let y = 93 + -97.7. Let i = y - -18.7. Which is the third biggest value? (a) o (b) 4/3 (c) i (d) -2/13 b Let r be 0((-12)/8 - (-1 - 1)). Let t be -3 + 34/12 - r. What is the second biggest value in 4, 2, t? 2 Let k = -4.9 - -33.9. Let z = k + -30.9. Let q = z - -1.4. Which is the smallest value? (a) 8 (b) q (c) 0.5 b Let u(p) = -163p + 1469. Let r be u(9). Which is the fourth smallest value? (a) 3 (b) r (c) -3 (d) -1/7 a Suppose 2g - 5c - 2 + 20 = 0, 5g + 5c - 25 = 0. Let v = g - -1. Let y = 1184 + -1180. What is the smallest value in y, 0.3, v? 0.3 Suppose 316f - 297 - 335 = 0. What is the fourth biggest value in 0.5, f, 1141, 5? 0.5 Let x = 24.966 + 0.154. Let j = x + -25. Let u = j + 2.88. What is the third smallest value in 4, u, 0.07? 4 Let z = 118.21 + -1.21. Let m = 116.6 - z. Which is the second biggest value? (a) m (b) 2/9 (c) -1 (d) -0.3 d Let l = 656/3 - 219. Let x be ((-3)/2)/(-3)2. Let h be x - (-3)/(15/(-8)). What is the third smallest value in l, h, -6? l Let f be (-30)/20(18/24)/((-9)/40). What is the fourth smallest value in -2/3, 3, 54, f? 54 Let g = 0.1591 + -0.5591. Let y be (1/(-2))/(27/(-12)). Which is the third smallest value? (a) y (b) g (c) -1 a Let o = 0 - 0. Let m = 425 + -385. Let h be (-10)/25 + m/(-150). What is the second biggest value in h, -5, o, 6? o Let q = -0.4537 + -52.5463. Which is the second smallest value? (a) 4 (b) q (c) 0.1 (d) -0.5 (e) 0.5 d Let g = 5686 + -5675. Let y = -2.1 - -2. Which is the biggest value? (a) y (b) g (c) -1/6 b Suppose -13w - 4j + 25 = -16w, 12 = -w + 5j. Let f be 3/(-2) - -4w/(-21). Which is the fourth biggest value? (a) -0.029 (b) f (c) -2/3 (d) 5 c Let l = -2350 - -2351. Which is the smallest value? (a) l (b) -11 (c) 2 (d) -18 (e) 4 d Let p = -3468.3 + 3468. What is the second smallest value in -2, p, 8, -3? -2 Let i(p) = -14p*2 - 77p - 7. Let r be i(-5). Suppose -2q = -9q - r. Which is the smallest value? (a) -0.2 (b) -104 (c) q (d) -3 b Let x = 11 - -9. Let v be (x/8 - 1)/(11/(-60)). Which is the third biggest value? (a) 0.1 (b) 4 (c) 1 (d) v a Let m = -7 - -12. Let k be (-6 - 3) + ((-56)/49)/((-4)/14). What is the third smallest value in 0.041, k, m? m Suppose 23v = 24v - 5. Let k = 1562.3 + -1564. Let f = 9 - 13. What is the third smallest value in f, -2/3, k, v? -2/3 Let d = -64/5 + 62/5. Let t = 2245 + -3388. Let x = 1143.1 + t. Which is the smallest value? (a) 5 (b) x (c) d c Suppose 750 = 98u + 64. Which is the second smallest value? (a) -6 (b) 6 (c) u (d) -1 d Let z = -7106 + 7108. Let u = -26 - 68. Which is the second smallest value? (a) 2/13 (b) z (c) u a Let i(f) = -f3 + 29f*2 - 211f + 45. Let z be i(13). Which is the third smallest value? (a) 2/19 (b) 0.5 (c) z (d) 4 d Let v = 573 - 546.9. Let y = -30 + v. Let g = y + 4.2. Which is the fourth smallest value? (a) 3 (b) 2 (c) -1/3 (d) g a Let o = -581 - -581.0938. What is the second biggest value in -1, 5, o? o Let v be (-1 - (-20)/16)/(1/(10/15)). What is the second smallest value in 1.5, v, 2/13, 0.5, 3? v Let p be -34/619210*5. Let q = 3/43 - p. Which is the second smallest value? (a) 0.5 (b) 1 (c) 2/7 (d) q c Let b = 3325 + -3332. What is the fourth biggest value in 3, -2/7, b, -1/10? b Let k = -72.39 - -68.513. Let x = -0.123 + k. Which is the biggest value? (a) 0 (b) x (c) -3 (d) -0.4 a
Let o(h) be the second derivative of -h*7/120 + 2h*4/3 - 23h*3/6 - 20h. Let d(x) be the second derivative of o(x). Differentiate d(c) with respect to c. -21c2 Let v(f) = -241f - 130. Let w(x) = 1203x + 651. Let b(s) = -11v(s) - 2w(s). What is the first derivative of b(h) wrt h? 245 Let f be (2/3)/((-20)/(-150)). Let q(b) = b2 - b + 5. Let n be q(0). What is the second derivative of 4d + 6d - 10d*n - 2d*f + 0d wrt d? -240d3 Let j(f) = f5 + 2f3 - f2 + 2f - 1. Let g(u) = -517u*5 - 2u3 + u2 - 42u + 11. Let p(i) = -g(i) - j(i). Find the second derivative of p(r) wrt r. 10320r*3 What is the first derivative of 5 - 137q + 187q + 4 - 3 wrt q? 50 Let u be 4-2(-13)/52. Suppose 4l + 6 = 7l. Find the first derivative of uk*l - 85 + 9k*2 + 87 wrt k. 22k Let s(f) = -f3 + f2 + 2f - 1. Let n(r) = -80r*3 - 13r*2 + 12r - 6. Let v(q) = -n(q) + 6s(q). Find the third derivative of v(h) wrt h. 444 What is the second derivative of 639t*5 + 7t - 9 - 607361t3 + 607361t*3 wrt t? 12780t*3 Let p be (2/(-1))/(((-8)/(-9))/(-4)). Find the third derivative of 5m + 42m3 - 5m - pm3 + 27m*2 wrt m. 198 Suppose 2i - 2 = 2. Let d(c) = c*3 + 16c*2 + 15c + 3. Let q be d(-15). What is the second derivative of -2t + 5t - 2t - it - 3tq wrt t? -18t Let v(m) = m + 1. Let t(u) be the second derivative of -5u4/3 - u3 - 27u*2/2 - 9u. Let l(p) = t(p) + 6v(p). Differentiate l(g) with respect to g. -40g Let s(u) = 495u2 - 45u - 1220. Let y(b) = 45b2 - 4b - 111. Let c(w) = -4s(w) + 45y(w). What is the derivative of c(x) wrt x? 90x Let o(f) = 48f - 57. Let a(c) = -24c + 29. Suppose 3q - 7 = 4y, 0 = 4y - 3q + 8q + 31. Let v(n) = yo(n) - 9a(n). What is the derivative of v(p) wrt p? 24 Let p be (-13 + 25)(1 + 0). Suppose -2v + p = 2v. What is the third derivative of 3n*v - 8n + 11n - 3n - n*2 wrt n? 18 Let b(a) be the first derivative of 3a*4/4 + 62a - 57. What is the first derivative of b(l) wrt l? 9l2 Let u(t) = t2 + 14t + 19. Let b be u(-13). Find the third derivative of -5x2 + 8x*2 + 0xb + x6 + 4x6 wrt x. 600x*3 Suppose 2z = -2x + 28, -2z - x + 7 = -20. Suppose 4a - 3 = z. What is the third derivative of -4p*2 + 4p2 - p2 + 6pa + 5p*2 wrt p? 144p Let i(z) = -6z2 + 2z - 9. Let h(k) = 25k2 - 9k + 35. Suppose 11j + 140 - 41 = 0. Let s(b) = ji(b) - 2h(b). Find the first derivative of s(c) wrt c. 8c Let s(u) be the second derivative of 0u3 - 3/20u*5 + 0u*2 - 4/3u*4 + 0 - 14u. Find the third derivative of s(b) wrt b. -18 Suppose 6g = g - 3h + 121, -25 = -g - h. Let q = -9 + g. What is the third derivative of -8c5 + 0c*2 - qc2 - c2 + 7c2 wrt c? -480c*2 Let g(s) be the third derivative of -37s*6/24 - 55s*3/6 + 6s*2 + 7. What is the derivative of g(o) wrt o? -555o*2 Let x = -66 + 68. Find the first derivative of -13o*x + 3o2 + o2 - 27 - 6o2 wrt o. -30o Let y(q) be the first derivative of -41q4/2 + 2q*3/3 + 296q + 99. Differentiate y(s) wrt s. -246s2 + 4s Let y(i) = -9i + 341. Let u(c) = -c3 + 13c - 512. Let d(p) = 5u(p) + 8y(p). Differentiate d(s) with respect to s. -15s2 - 7 Let n(q) be the first derivative of -11q*4/12 - 13q*2 - 15q + 12. Let c(z) be the first derivative of n(z). Differentiate c(g) with respect to g. -22g Find the third derivative of 33012u - 33012u - 389u*4 + 7u*2 + 32 wrt u. -9336u Suppose 4a = -a + 35. Let g(f) = -20f*2 - 5. Let z(r) = -10r*2 - 2. Let s(d) = az(d) - 3g(d). Differentiate s(i) with respect to i. -20i Let z(d) be the second derivative of 0d3 - 7/5d*6 + 0d*2 - 19/6d*4 + 0 - 4d + 0d5. Find the third derivative of z(k) wrt k. -1008k Let j be 1/(8/(-10) + 1). What is the third derivative of -5nj + 126 + 3n*2 - 126 - 4n*5 wrt n? -540n*2 Suppose -4s + 18 = u, 0u + 10 = 5s - 5u. Suppose -l = -4l + 21. Find the third derivative of 3p4 - 2p*s - lp2 + p2 wrt p. 24p Let b(a) be the first derivative of a6/24 - 5a*4/6 - 2a*2 + 18. Let x(h) be the second derivative of b(h). Find the second derivative of x(v) wrt v. 30v Let y(o) = 3o + 1. Let s(b) = 9b*2 - 14b - 74. Let z(m) = -s(m) - 4y(m). Find the first derivative of z(k) wrt k. -18k + 2 Let l(r) = -241r2 + 11r - 210. Let x(k) = 2k2 + k - 1. Let m(o) = -2l(o) + 22x(o). Differentiate m(d) with respect to d. 1052d Let n be (4/(-12))/((-40)/(-45) - 1). Let k(i) be the first derivative of 0i2 + 0i*n - 2i + 7/4i4 + 8. Differentiate k(r) wrt r. 21r*2 Let t(j) = 3j - 7. Let l be t(8). Differentiate l - 59b3 + 30b*3 - 46 with respect to b. -87b*2 Suppose -5z - 20 = -55. What is the third derivative of -6g2 + 23g*2 + zg*2 - 10g*4 wrt g? -240g Let g = -44 + 46. What is the third derivative of -5w5 - 6w*g - 45w + 45w wrt w? -300w*2 What is the second derivative of 3x - 62x + 20x3 - x5 - 10x3 + 29x*3 wrt x? -20x*3 + 234x Let q = 36 + -19. What is the second derivative of -10p - 17p + qp + 4p*3 wrt p? 24p Differentiate 724 - 1362 + 774 - 89w2 wrt w. -178w Let i(q) be the third derivative of -79q5/60 - 13q*4/24 + 13q*3/3 + 628q*2. What is the second derivative of i(n) wrt n? -158 Differentiate -221 + 106k*3 + 2k + 170 + 483 wrt k. 318k2 + 2 Let h(l) be the second derivative of -17/30l*6 - 5/4l*4 + 0 + 0l*3 + 0l*2 + 0l*5 + 24l. Find the third derivative of h(m) wrt m. -408m Let k(t) be the second derivative of 2t*6/15 + 7t*5/5 + 15t*4/2 + 36t + 2. What is the third derivative of k(a) wrt a? 96a + 168 What is the third derivative of 0c*2 - 86c*2 + 4c*4 - 115c*2 - 5c*3 + 29c*2 + 5c*4 wrt c? 216c - 30 Find the first derivative of 37 + 123h + 2h*3 - 138 - 112 + 0h*3 wrt h. 6h*2 + 123 Let w(p) be the first derivative of 0p - 6 - 5p3 + 0p*2 + 3/4p*4. What is the third derivative of w(y) wrt y? 18 Let h(n) = n + 1. Let k(c) = -44c + 156. Let w(x) = -8h(x) + k(x). Let v(i) = 18i - 49. Let r(l) = 10v(l) + 3w(l). Differentiate r(m) wrt m. 24 Let v(c) be the third derivative of 0c4 + 0 - 13/120c*6 + 0c + 15c2 + 0c*5 - 7/3c*3. Differentiate v(k) with respect to k. -39k*2 Let z(q) be the third derivative of 7q6/30 - q4/12 - q*3 + 112q*2. What is the second derivative of z(l) wrt l? 168l Suppose -5 = -4t + 3t. Let m = -4 - -6. What is the third derivative of -3bm + 2b*6 + 7b*2 - tb*6 wrt b? -360b*3 What is the derivative of 21w - 24w + 27w - 2w2 - 158 wrt w? -4w + 24 Suppose 2 = -c + 3c. What is the derivative of 10g - c - 3 - 4 wrt g? 10 Let o be (-16)/(-4) - (0 - -1). Find the third derivative of -2z4 + 46z*3 + 2z*2 - 46zo - z4 wrt z. -72z Suppose -8p + 9p = 3. Let y(x) be the first derivative of -5 + 0x - 7/3xp - 2/5x*5 + 0x*4 + 0x*2. What is the third derivative of y(w) wrt w? -48w Let o(m) be the third derivative of 0m5 + 1/120m*6 + 1/8m*4 + 0m*3 - 7m*2 + 0m + 0. What is the second derivative of o(a) wrt a? 6a Find the second derivative of 33h*2 - 49h*4 + 3h + 16h2 + 47h*4 + 20h*2 + 27 wrt h. -24h*2 + 138 Suppose -y - 3f - f = -12, 2y - 5f = -28. Let q = y - -4. What is the derivative of -8a + qa - 2 - 3 wrt a? -8 Let t(w) be the third derivative of 0w5 - 12w*2 + 0w*3 + 5/12w*4 - 2/15w*6 + 0w + 0. What is the second derivative of t(z) wrt z? -96z Suppose -12w = -20w + 128. Differentiate -32l*4 + 37l*4 - 20 + w with respect to l. 20l*3 Let l = -918 - -918. Let z(n) be the third derivative of ln*5 + 0n*6 + 0n*4 + 1/21n7 + n2 + 3/2n3 + 0 + 0n. Differentiate z(y) wrt y. 40y3 Let i(k) = -2k*4 - 13k*3 + 32k*2 - 4k. Let g(f) = f4 - f3 - 2f2 - f. Let h(v) = -4g(v) + i(v). Find the third derivative of h(o) wrt o. -144o - 54 Let d(w) be the third derivative of 31w*4/4 - 205w*3/6 - 58w*2 - 2. What is the derivative of d(h) wrt h? 186 Let c be 48/(-12)(-3)/6. Let p(k) be the second derivative of 5/2kc + 1/2k*3 + 0 + k. What is the first derivative of p(h) wrt h? 3 What is the first derivative of -1953 - 6n + 50n + 1921 wrt n? 44 Differentiate -111 + 262 + 2g + 4 with respect to g. 2 Let c(n) = -38 + 8n + 8n*2 + 8n*2 + 30n*2. Let k(z) = 31z*2 + 5z - 25. Let l(y) = -5c(y) + 8k(y). Find the first derivative of l(a) wrt a. 36*a
Let l = 0.012745 - -386.077255. Let h = l - 386. Which is the nearest to -0.1? (a) 0.1 (b) 1.4 (c) -0.5 (d) h d Let h = -1970 + 1974. Let g = 1.2 + -1. Which is the nearest to 0.4? (a) h (b) 2/7 (c) g b Let g = -79.38 - -76.38. Which is the closest to g? (a) -1/525 (b) 4/9 (c) -1 c Let d = 652 + -424. Let t = 228 - d. Which is the closest to t? (a) 0.1 (b) 1 (c) -3 a Let g(p) = -p*3 - 3p*2 + p - 2. Let s be g(-3). Let f = -212 + 137. Let v = 80 + f. Which is the nearest to -1? (a) s (b) 2 (c) v b Let p = 6 + -2. Suppose 0 = -37n + 34n - 15. Let a be 0/((-35)/n - 4). What is the nearest to a in 8, 3/7, p? 3/7 Let p = -0.58 - -3.58. What is the closest to 130 in 2, 0.4, p, 5? 5 Let v = 239/7 - 34. Let t = -380.92 - -383. Let f = t + -2.18. What is the nearest to f in -4, v, 0.1? 0.1 Suppose 22q - 12q + 0 - 20 = 0. Let n be ((-4)/(-6))/(31/(-3) + 4). Which is the nearest to 0.2? (a) q (b) -3 (c) -3/5 (d) n d Let s = -11.81 - -12.81. What is the closest to 38 in 4, s, -1? 4 Let k = 146 - 247. Let z = -98.52 + 1.52. Let d = k - z. Which is the nearest to -1/3? (a) d (b) 4 (c) 1/6 c Let c = 0.12491 - 0.30291. What is the closest to -35 in 0.4, 1/5, c? c Let j be 1 - -21/(-1). Let o = 4889/15 + -4894/15. Let n = -1 - 4. Which is the closest to j? (a) o (b) n (c) 4 a Suppose 2o - y + 14 = 0, 7 - 11 = -y. Let w = -0.82 + 55.02. Let i = -54 + w. What is the closest to i in o, -2/7, -2? -2/7 Suppose 0 = 2y + 620 - 324. Let o = y - -1333/9. What is the closest to -3/7 in -1/6, o, -2? -1/6 Let o = 4.277 - 99.277. Which is the closest to -1? (a) -3 (b) 4 (c) -2/19 (d) o c Let n = -2086.3 - -2086.5. Suppose -1 = -4o - 9. What is the closest to -2 in -8, n, o? o Let t = 1201 - 1198. Let k be ((-448)/(-10))/(8/(-40)). Let g = 2014/9 + k. What is the nearest to -14 in g, t, 0.5? g Let i = 951 + -963. Let s be ((-61)/i - 5)/(4/(-18)). Suppose 8 = 3u + u. Which is the closest to u? (a) -2 (b) s (c) -2/11 c Suppose -4s - 8 = -o, 140o = 143o + 5s + 27. Let l(n) = -n*3 + 3n*2 - 2n + 1. Let q be l(3). Which is the nearest to 0? (a) o (b) q (c) -1 (d) 0.1 d Let h = -8.365 - -12.365. What is the nearest to -1/3 in 486, h, -1? -1 Let r = -76/29 + 65/58. Which is the nearest to -2? (a) 2 (b) -0.57 (c) r c Let p = 4.23 + -4.03. Let i = 79 - 23. Let r = i + -51. Which is the nearest to p? (a) 4 (b) r (c) -5 a Let x = -9983 - -9985. Let h = -26 + 26.5. What is the closest to x in -0.04, -4, h? h Let s = -0.11917 - 0.48083. What is the nearest to 3 in 0.4, -6, s, 3/5? 3/5 Let i = 1123/2 - 609. Let n = i + 47. Let d = -38.1 + 38. What is the closest to -2/5 in n, d, 0.1? n Let s = -2222 + 2221.5. Which is the closest to 1? (a) s (b) 4/7 (c) -9 (d) -5 b Let t = -131311/30 - -22241/5. Let z = t + -71. Let u be 44/(-3) + (-1848)/(-132). Which is the closest to u? (a) z (b) 2/7 (c) 0.6 a Let o = 5.88841 - -0.11159. Let h be -2((-2)/4)/(-1). What is the closest to -2/9 in o, h, -0.3? -0.3 Let d = -35284.7 - -35282. What is the closest to -2/9 in -5, -3, d, 3? d Let p = -4.328 - -5.328. Which is the closest to p? (a) 2/23 (b) 5 (c) 0.1 c Let p be ((-2)/6)/(92/(-24)). Let y = 196 + -205. Let r be (-7)/y + (-1)/182. What is the closest to 2 in 4, r, p? r Let h = -71/504 + 1/63. Let c be (17 - 1605/90)(-4)/10. What is the closest to 2/5 in h, c, -3? c Let f be 2((-483)/345 - 9/90). Let l = 0.1 + -0.1. Let j = l - -0.2. What is the closest to 1 in j, 0, f? j Let m = 31361/28 - 4479/4. Let k = 1.96 - -0.04. What is the nearest to m in 1/2, 1/12, k, -3/4? 1/12 Let d be (2/((-4)/(-1)))/(14/(-7)). What is the closest to -4 in 0.5, -1, d, 7? -1 Let p = -153 - -204. Let x = 46 - p. Which is the closest to 1/2? (a) x (b) 0.9 (c) 4 b Let r = 6564 - 6610. What is the nearest to r in 0, -0.5, -3? -3 Suppose -3o - 34 = -5m, 11m - 27 = 8m + 4o. Which is the nearest to 0? (a) -1/9 (b) -0.1 (c) -3 (d) m b Let i = -27 - -109/4. Let o(t) = 2t + 7. Let x be o(0). Let w be 77/224/x. Which is the closest to w? (a) -17 (b) -3 (c) i c Let f = -0.35 + 0.3. Let g = -0.0825 - 119.4175. Let q = 120 + g. Which is the closest to -1? (a) f (b) q (c) 4 a Let q = -866.7 + 867. Which is the nearest to 2? (a) 3 (b) 0.035 (c) q a Let d = -3243.2 + 3243. Let j = 1/278 + 2769/3058. Which is the closest to 1? (a) j (b) d (c) 3 a Let g = 13466 + -13457. Let h be 2/(-4) + 0 + 0. Which is the nearest to -2/7? (a) -3 (b) 0.1 (c) h (d) g c Let f = -4809 - -4810. Which is the closest to -2? (a) -0.5 (b) 0.5 (c) f (d) -2/17 a Let j be 335/134 + (0 - (-87)/(-42)). What is the nearest to 0.02 in j, -4, -0.1? -0.1 Let h = -0.1 - -0.1. Let o = -214381.05 - -214381. What is the closest to o in 3/2, 4, h? h Suppose f = -5f - 372. Let l = f - -90. Let w be (-20)/(-7) - (-4)/l. Which is the nearest to -1? (a) 2/25 (b) 1/9 (c) w a Suppose 752j + 1263 + 17240 - 455 = 0. Let x = -4 - -3. Which is the nearest to x? (a) j (b) 3 (c) -3 c Let i = 56 - 150. Let o = i - -93. Which is the closest to o? (a) 0.4 (b) -2 (c) 7 b Let m = -1.06 + -0.69. Let h = m - -5.75. Let a = -7 - -12. What is the closest to -0.1 in -0.2, a, h? -0.2 Let m = 128 + -639/5. Let h = 211 + -210.6. Which is the nearest to -15? (a) 0 (b) m (c) h a Suppose 4 = 2g + 2r, g = -0r - 5r + 6. Let s = -36 + 327. Let f = -290.82 + s. Which is the nearest to g? (a) 1/2 (b) -4 (c) f a Let d be (-30)/24 + 177/118. Let i = 6.7 - -2.3. Which is the closest to 0.1? (a) 0 (b) d (c) i a Let d = 26.2 + -26. Let n = -205.996 - -206. Let k = 0.304 - n. Which is the closest to 0.2? (a) k (b) d (c) 2 b Let u = 0 - -2. Let o(y) = 2y*2 - 22y + 31. Let w be o(2). Which is the closest to u? (a) -0.4 (b) w (c) 2 c Let j = -1.6 + -0.4. Let n = 956541.26 - 956541. What is the nearest to n in j, 3, -2/7? -2/7 Let h = -65976773/136 + 485126. Let k = h - 61067/1224. Let c = k + 47. What is the nearest to 0.1 in -2, c, -2/7? c Let t be ((-10)/105-9)/(5/(15/(-6))). What is the nearest to -6 in -2, 8, t, -4? -4 Let f = -0.598 - 0.169. Let j = f + 0.167. What is the closest to -2 in j, 0.3, 3? j Let l = 60684 + -60761.049. Let f = l + 77. Let v = -0.349 - f. Which is the nearest to -1? (a) 2/3 (b) v (c) 3 b Suppose -169 + 28 = -3g. Suppose 5b - 158 = g. Let w = 39 - b. What is the nearest to -2 in 2, w, -0.3? w Let k = -27.8 - -26. Let y = k + 2.3. Let j = -2/211 - 404/1899. What is the closest to -2 in j, 5, y? j Let c be 14 - 698/56 - 10/8. Let u = -69 + 69. What is the closest to c in -0.04, u, -2/3? u Suppose y - 3v + 1548 = -3y, -4y - 1516 = 5v. Let n = y - -769/2. What is the closest to n in 3, -3, 3/8, 0? 3/8 Let l = -15 - -25. Let i be ((-640)/156)/8 - l/65. Which is the closest to 2? (a) i (b) 4 (c) -9 b Let j = 174.42 + -172. Let t = j + -2.12. Which is the closest to 0? (a) -1/7 (b) 2 (c) t a Let c = -3726.787 - -3729. Let h = 0.213 - c. What is the nearest to h in -3, 0.5, 2? -3 Let p = 0.088 + -0.488. Let o = 0.016 + -0.556. Let g = 0.44 + o. Which is the nearest to g? (a) -8 (b) -3 (c) p c Let l = 493 - 3949/8. Let w be 1 + ((-1)/4)/1. Let b = w + l. What is the closest to -2/5 in b, 0, 4/5? 0 Let g = -4958 - -4960. Which is the nearest to g? (a) -1/6 (b) 0.5 (c) -2 (d) -12 b Let h = 375.339 + -374.839. Suppose 12 = -3g + 3d, 4g - 5d + 2 = -18. What is the closest to g in h, -3/8, 1, -5? -3/8 Let v = 4.6212 + -4.9212. Let d = -36.4 - -40. Let x = d + -4. Which is the nearest to 0.1? (a) x (b) v (c) 3/8 c Suppose -43 + 95 = -26h. Let s = 49/10 - 41/10. Which is the closest to 0.2? (a) s (b) -1.8 (c) h (d) -1 a Let i = -0.06708 + -3.93292. What is the closest to i in -5, -10, -1? -5 Let f = 27 + -27.43. Let s = f - -0.73. Let t = 0.34 + -7.34. What is the nearest to t in 3, s, -2? -2 Let j = 766 + -772. Let p be (-12)/(-30) - j/(-5). Suppose -5w + 0w + 15 = 0. What is the closest to -1 in w, 0.3, p? p Let u = 10.5 - 5.5. Let g = -17 - -17. Which is the nearest to 0? (a) g (b) u (c) -0.3 a Let n(t) = -3t + 17. Let r be n(5). Suppose 0j - 4j = 3q + 19, rq = -2. Which is the nearest to 0? (a) -5 (b) -2/3 (c) -2 (d) j b Let w = -2765 + 2760. What is the closest to 1/2 in 86, -1/8, w? -1/8 Let m = -0.86 - 330.14. Let t = m + 335. What is the nearest to t in 4, -1, -4? 4 Suppose -22 = 5z - q, -5z + 3q + 38 = 64. Let u be (-40)/26 + (-2)/(-1). Which is the nearest to u? (a) z (b) -5 (c) 2/3 c
What is 8/3 of a day in hours? 64 What is 13701.5ng in kilograms? 0.0000000137015 Convert 78488.7 days to seconds. 6781423680 How many nanograms are there in 9.056864 tonnes? 9056864000000000 What is 725176.7 years in centuries? 7251.767 What is 3/8 of a minute in milliseconds? 22500 Convert 13494138.3 milliseconds to days. 0.15618215625 What is 25/2 of a decade in years? 125 Convert 45300.53 nanograms to milligrams. 0.04530053 What is 7/2 of a decade in months? 420 How many millilitres are there in 3204.461 litres? 3204461 Convert 990138.4us to seconds. 0.9901384 How many centimeters are there in 1/4 of a meter? 25 What is three tenths of a tonne in kilograms? 300 What is 6.454398 meters in centimeters? 645.4398 What is 1/24 of a week in minutes? 420 How many years are there in 61.04715 centuries? 6104.715 Convert 997.5037 decades to years. 9975.037 How many millilitres are there in 0.7928452 litres? 792.8452 What is 139.371l in millilitres? 139371 What is twenty-five halves of a microgram in nanograms? 12500 What is five quarters of a kilogram in grams? 1250 How many millilitres are there in 955110.8l? 955110800 What is 1389715.8 months in millennia? 115.80965 How many millilitres are there in twenty-one fifths of a litre? 4200 What is 5/8 of a second in milliseconds? 625 Convert 779664.3 millilitres to litres. 779.6643 How many nanograms are there in seven quarters of a microgram? 1750 What is fifteen quarters of a day in hours? 90 How many years are there in 242.07162 months? 20.172635 How many centuries are there in 38.27828 decades? 3.827828 What is 11.09532 milligrams in nanograms? 11095320 What is fifty-two fifths of a microgram in nanograms? 10400 What is twenty-nine fifths of a millennium in years? 5800 Convert 8.525403ml to litres. 0.008525403 How many hours are there in 5/6 of a week? 140 How many minutes are there in 7/6 of a week? 11760 How many grams are there in 246046.5kg? 246046500 What is 32.49728m in kilometers? 0.03249728 What is fifteen quarters of a millimeter in micrometers? 3750 What is fifty-three sixths of a decade in months? 1060 What is 9178.705 minutes in seconds? 550722.3 What is 11/4 of a century in months? 3300 How many centuries are there in three tenths of a millennium? 3 How many centimeters are there in 1336.672 meters? 133667.2 How many months are there in 0.5927658 years? 7.1131896 How many decades are there in 213.40881 months? 1.77840675 What is 701236.5um in centimeters? 70.12365 How many minutes are there in 7/18 of a week? 3920 What is eleven halves of a microgram in nanograms? 5500 What is 46/5 of a kilogram in grams? 9200 What is 6135.855 milliseconds in seconds? 6.135855 How many months are there in 2/15 of a decade? 16 How many centimeters are there in 705.4358 meters? 70543.58 How many micrometers are there in 25478.76m? 25478760000 How many decades are there in 5649.241 years? 564.9241 How many litres are there in 65601.64ml? 65.60164 What is 1/10 of a day in minutes? 144 How many months are there in two fifteenths of a decade? 16 What is 6485731.56s in weeks? 10.7237625 How many seconds are there in three fifths of a day? 51840 How many micrometers are there in three sixteenths of a centimeter? 1875 What is 37/2 of a milligram in micrograms? 18500 How many meters are there in eleven quarters of a kilometer? 2750 How many centimeters are there in 0.9467091um? 0.00009467091 How many meters are there in 2801.741 centimeters? 28.01741 How many millilitres are there in 11/2 of a litre? 5500 What is 0.2963334kg in nanograms? 296333400000 Convert 3.418403 days to milliseconds. 295350019.2 Convert 0.2841052 kilograms to micrograms. 284105200 What is seventeen halves of a centimeter in micrometers? 85000 What is 430969.1 millennia in years? 430969100 What is 1/60 of a millennium in months? 200 What is 25.3460907 microseconds in weeks? 0.00000000004190821875 How many tonnes are there in 77.67188kg? 0.07767188 Convert 7630.46 centimeters to millimeters. 76304.6 What is twenty-seven halves of a millimeter in micrometers? 13500 What is 21/5 of a litre in millilitres? 4200 What is 3/50 of a millennium in decades? 6 Convert 614258.1 milligrams to nanograms. 614258100000 What is three fifths of a litre in millilitres? 600 What is 0.2061268cm in nanometers? 2061268 How many hours are there in 5/28 of a week? 30 How many kilometers are there in 5.203764 nanometers? 0.000000000005203764 How many micrograms are there in thirteen fifths of a milligram? 2600 How many milliseconds are there in 3.422887 weeks? 2070162057.6 Convert 8773.19 minutes to microseconds. 526391400000 How many kilometers are there in 0.1689909mm? 0.0000001689909 How many centuries are there in 143489.31 months? 119.574425 What is 3/25 of a millennium in years? 120 What is three fifths of a litre in millilitres? 600 Convert 765.631 millilitres to litres. 0.765631 What is one tenth of a tonne in grams? 100000 What is thirty-three tenths of a litre in millilitres? 3300 How many milliseconds are there in 51/5 of a second? 10200 Convert 871.0419 nanograms to kilograms. 0.0000000008710419 What is 15/4 of a tonne in kilograms? 3750 How many years are there in 724967.6 decades? 7249676 How many millilitres are there in 54/5 of a litre? 10800 What is 51983618.4 microseconds in weeks? 0.00008595175 How many millilitres are there in twenty-one halves of a litre? 10500 What is 94529.1 millilitres in litres? 94.5291 What is ninety-five halves of a century in months? 57000 How many nanometers are there in 459.021 millimeters? 459021000 What is 791.7943 years in decades? 79.17943 How many centuries are there in 44/5 of a millennium? 88 How many years are there in 17.921013 months? 1.49341775 How many centuries are there in 53.84144 decades? 5.384144 How many micrograms are there in 3/32 of a gram? 93750 Convert 772.69815 nanoseconds to weeks. 0.000000000001277609375 Convert 80.53677l to millilitres. 80536.77 What is 3/32 of a kilometer in millimeters? 93750 What is 19.15683kg in tonnes? 0.01915683 How many months are there in 17/10 of a decade? 204 How many millilitres are there in five quarters of a litre? 1250 How many microseconds are there in fifty-nine quarters of a millisecond? 14750 Convert 8545.119 litres to millilitres. 8545119 What is 109.985kg in milligrams? 109985000 How many millilitres are there in 5906.334l? 5906334 Convert 0.5817834 years to months. 6.9814008 How many tonnes are there in 0.5043215kg? 0.0005043215 What is 21/5 of a kilogram in grams? 4200 How many milligrams are there in eleven halves of a gram? 5500 How many months are there in 5/24 of a century? 250 How many hours are there in 81853.812s? 22.73717 Convert 916.6606nm to meters. 0.0000009166606 What is 1063430.7 months in centuries? 886.19225 How many millilitres are there in three eighths of a litre? 375 Convert 324.4565 kilometers to millimeters. 324456500 How many nanograms are there in 6.415519 tonnes? 6415519000000000 What is 5415.663 minutes in hours? 90.26105 What is 52.49618 millennia in centuries? 524.9618 What is one fifth of a litre in millilitres? 200 How many millimeters are there in 982210.5 centimeters? 9822105 How many millilitres are there in 3/25 of a litre? 120 How many kilograms are there in sixty-one quarters of a tonne? 15250 How many months are there in thirty-one fifths of a decade? 744 How many millilitres are there in 3/25 of a litre? 120 How many nanometers are there in 6.752115 millimeters? 6752115 How many nanoseconds are there in 49212.85 microseconds? 49212850 What is 1/5 of a milligram in micrograms? 200 Convert 1.435058ml to litres. 0.001435058 How many decades are there in 54/5 of a century? 108 How many nanograms are there in fifty-nine quarters of a microgram? 14750 How many meters are there in 5/8 of a kilometer? 625 Convert 4.457002l to millilitres. 4457.002 How many centimeters are there in 40.5231mm? 4.05231 What is 174155.6 grams in milligrams? 174155600 What is 11/7 of a week in days? 11 What is twenty-one quarters of a litre in millilitres? 5250 What is 51.26838m in nanometers? 51268380000 How many nanograms are there in fifty-five quarters of a microgram? 13750 Convert 5.08061 milligrams to kilograms. 0.00000508061 How many micrometers are there in 5.71588mm? 5715.88 What is 2.612968 minutes in seconds? 156.77808 How many decades are there in 1.2732402 months? 0.010610335 What is 1971.639 milligrams in grams? 1.971639 What is 4224.159 months in millennia? 0.35201325 How many millilitres are there in 0.1855052 litres? 185.5052 How many months are there in 13/5 of a century? 3120
Let q be (-55)/(-65) + 2/13. Let p(z) = 58z - 121z + 62z + 1. Let h(u) = 27u + 2. Let o(t) = qh(t) - 3p(t). Let n(b) = -2b. Give o(n(c)). -60c - 1 Let i(h) = -87h + 50h + 47h. Let y(z) be the first derivative of -z5/60 - 3z*2/2 + 1. Let j(s) be the second derivative of y(s). Give j(i(k)). -100k2 Let k(w) = w2. Suppose -3o = -2h - 237, 8h - 3h = 2o - 169. Let v(f) = -o + 144 - 2f - 82. Calculate k(v(r)). 4r2 + 60r + 225 Let j(v) = 2v2 + 241. Let a(b) be the first derivative of -2b*3/3 - 520. What is a(j(p))? -8p*4 - 1928p*2 - 116162 Let m(x) = 5x + 5 - 2 + 2 + x. Let s(t) = 5t + 4. Let a(g) = -4m(g) + 5s(g). Let u(i) be the second derivative of -7i*3/6 - 4i. Determine u(a(y)). -7y Let y(p) = -2p. Let b = 424 + -421. Let f(z) = 36z - 4061 + 4060 - bz. What is y(f(i))? -66i + 2 Let x(d) = -88d + 7d + 49d. Let w(g) = -27g2. What is w(x(c))? -27648c*2 Let l(p) = -39p*2 - 11. Let k(f) = 7f*2 + 2. Let b(w) = -22k(w) - 4l(w). Let y(g) = -3g*2 + 30g + g*2 - 3 + 3. Determine y(b(a)). -8a*4 + 60a*2 Let l(k) = -10k - 819. Let c(n) = 91. Let f(x) = 18c(x) + 2l(x). Let u(y) = -40y + 3. Give u(f(r)). 800r + 3 Let h(n) = 4n. Let l(w) = 41w - 42w - 71 + 7w + 17. Determine l(h(f)). 24f - 54 Let f(j) = 33 - 16j - 122 + 49 + 41. Let u(i) = 5i - 4i - 3i. Calculate u(f(o)). 32o - 2 Let x(k) = 256120k + 1. Let g(l) = 7265l. What is x(g(t))? 1860711800t + 1 Suppose -z - 4v = v - 14, 14 = -5z - 4v. Let r(i) = -10i - 69. Let l(b) = b + 4. Let y(w) = zl(w) - r(w). Let g(j) = -2j. What is g(y(p))? -8p - 90 Let u(k) = 4k2 - 44k. Let f(o) = 2o2 - 24o. Let h(z) = 11f(z) - 6u(z). Let b(q) be the first derivative of q*2 - 4q - 1. Give b(h(t)). -4t2 - 4 Let b(w) be the second derivative of 0w*3 - 1/12w*4 - 27w + 27/2w2 + 0. Let x(p) = 6p - 11p + 6p. Calculate b(x(h)). -h*2 + 27 Let t(w) = -2328w. Let f(x) = -331x2 - 2x. What is f(t(n))? -1793882304n2 + 4656n Let x be 100/(-250) + 12/5. Let i(y) = 649 + y*x - 649. Let t(n) = -48n*2. Determine t(i(q)). -48q*4 Let r be 48/21 - 4/14. Let w(q) = -3q*2 - 4q + 51. Let m be w(0). Let y(u) = -96u2 + 44u*r + mu*2. Let t(z) = 3z*2. Give y(t(x)). -9x*4 Let w(o) = -6o. Let r(j) be the first derivative of j*2 + 6. Let y(b) = 4r(b) + 2w(b). Let s(c) = 9c*2 - 4c*2 + 6c*2 + 59c - 59c. Determine s(y(p)). 176p*2 Let y(f) = f + 3. Let z be y(2). Let l be 1533/105 - (-1 - (-3)/z). Let c(o) = -lo + 23o - 11o. Let x(g) = 7g. What is x(c(b))? -21b Let l be 10/(-6)(3 - 54/9). Let r(m) = 16m + 8. Let t(u) = 2. Let f(s) = lt(s) - r(s). Let a(b) = -4b. Calculate f(a(v)). 64v + 2 Suppose 301o - 311o = -120. Let b(p) = -3p - op + 10p - 4p. Let h(a) = -12a*2. Calculate h(b(m)). -972m*2 Let r(l) = 2l*2. Suppose 0 = -4i - 2i + 876. Suppose y - 5w = -y + i, -5y - w + 392 = 0. Let u(p) = y - 78 + 7p. Determine r(u(g)). 98g2 Let t(w) = 69w*2 + 61w*2 - 147w*2. Let p(o) = -2o - 11. Determine p(t(x)). 34x2 - 11 Let l(v) = 382446v + 6. Let j(i) = 2i. Calculate l(j(k)). 764892k + 6 Let f(s) = 2s. Let a(i) = 27i - 25. Let o be a(1). Let q(j) be the first derivative of 0j + 3 - 7/2j*o. What is q(f(k))? -14k Let w(s) = -2511717s2. Let q(i) = -250i. What is q(w(p))? 627929250p2 Let y(x) be the third derivative of -x4/24 - 28x*2 - 8. Let f(u) = -2u - 997. Give f(y(h)). 2h - 997 Let u(p) = -2p*2. Let f = 92 - 87. Suppose 0 = t - 4j - 22, 8t - ft + j = 53. Let g(o) = -3o2 - to*2 + 5o*2. What is u(g(x))? -512x*4 Let n = -692 + 710. Let y(g) = 16g - 42 + 30 - ng. Let c(z) = -3z. What is y(c(v))? 6v - 12 Suppose 27m - 30 + 30 = 0. Let c(j) = 0j + mj + 6j - 4j. Let o(q) = 95q. Give o(c(a)). 190a Let k(i) = 2i2 + 1 - 1. Let g(u) be the third derivative of 0u*3 + 17/24u*4 - 159u*2 + 0u + 0. Calculate g(k(d)). 34d2 Let m(l) = -19l. Let k(w) = -w + 168292. Calculate k(m(o)). 19o + 168292 Let j(s) = -1800s*2 - 117s + 2. Let f(l) = -4l. Give j(f(u)). -28800u*2 + 468u + 2 Let l(w) = 645384w + 2. Let h(c) = -2c*2 - 38c. Determine l(h(x)). -1290768x2 - 24524592x + 2 Let l(y) = -26y2. Let m(c) be the third derivative of -37c*4/2 + 8786c*2. Give m(l(o)). 11544o2 Let s(r) be the first derivative of r5/30 - 31r2 - 38. Let z(i) be the second derivative of s(i). Let g(n) = 22n. Give z(g(w)). 968w2 Let i(w) = w2 + 23. Let q(p) = 2p*2 + p - 18. Let o be q(5). Let m(y) = 15y*2 + 17y*2 - oy*2. Give m(i(z)). -5z*4 - 230z*2 - 2645 Let x(m) = m + 1. Let q(k) = -7k - 20. Let l(w) = q(w) + 6x(w). Let b(r) = 6r*2. What is l(b(d))? -6d*2 - 14 Let g(x) = -312x*2 - 15. Let c(m) = -21m*2 - 1. Let b(u) = -15c(u) + g(u). Let p(v) = 705v. Calculate b(p(h)). 1491075h*2 Let q(k) = -14k. Let y(t) = -t*2 + 6t + 5. Let h be y(6). Suppose 3m = 2j + 2310, -hj - 886 = -3m + 1424. Let g(d) = -m + 770 + 2d. Determine q(g(u)). -28u Let x(j) = -3716134j2. Let i(a) = -2a - 68. What is i(x(n))? 7432268n2 - 68 Let b(f) = 302f*2 - 51f. Let h(i) = 101i2 - 18i. Let m(o) = 6b(o) - 17h(o). Let s(v) = 16v + 8v - 24v - 2v*2. Give s(m(y)). -18050y*4 Let b(r) = 2r2. Let q(h) be the first derivative of h3/2 + 59h - 81. Let y(z) be the first derivative of q(z). Calculate b(y(v)). 18v*2 Let r(l) = -313 + 112 + 114 + 3l + 118. Let a(g) = -2. Let w(v) = v - 4. Let t(s) = -4a(s) + 2w(s). What is r(t(b))? 6b + 31 Let l(t) = -292t - 7. Let q = 167 + -160. Let f(z) = 146z + 3. Let m(n) = qf(n) + 3l(n). Let j(s) = -s. Calculate m(j(h)). -146h Let y(f) = -19f. Let z(r) = -588r*2 + 2392r. Calculate z(y(b)). -212268b2 - 45448b Let f(l) = 272177l - 3 + 3 - 21l*2 - 272177l. Let o(j) = 15j2 + 3. Calculate f(o(m)). -4725m*4 - 1890m*2 - 189 Let x(g) be the third derivative of -377g*4/8 - 5g*2 + 967g. Let t(o) = -o*2. Determine x(t(s)). 1131s*2 Let j(b) = 121b*2. Let f(d) = 263869d. Determine j(f(k)). 8424848748481k2 Let o(z) = -50676z*2. Let q(g) = 655g. Determine o(q(k)). -21741270900k2 Let s(t) = 2t*2. Let f be (-89 + -10)/(-11) - -16. Let j(a) be the second derivative of -fa + 0 - 3/2a3 + 0a*2. Give j(s(x)). -18x2 Let x(q) be the third derivative of q4/2 - q*3/6 + 71q*2 + 1. Let m(u) = 0u*2 + 8u*2 + 11 - 2u*2 - 11. Give m(x(n)). 864n*2 - 144n + 6 Let r(l) = 2l2 + 95. Let j(d) = d2 + 47. Let t(z) = -7j(z) + 4r(z). Let h(s) = -5s. What is t(h(m))? 25m2 + 51 Let p(a) = -14a*2. Let d(n) = -6n + 5. Let w(v) be the first derivative of -7v2/2 + 6v + 207. Let q(l) = -6d(l) + 5w(l). What is q(p(f))? -14f2 Let p(w) = 8 + 2 + 21w + 20 + 11 - 5. Let c(f) = 11f + 18. Let q(h) = 7c(h) - 4p(h). Let o(r) = -2r. Give o(q(v)). 14v + 36 Let q(y) be the second derivative of -43y*4/12 + 318y. Let f(v) = -5v2. Determine q(f(k)). -1075k*4 Let o(a) = -13a*2. Let v = -39 + 42. Suppose 5p = x, -3p + 28 = 8x - vx. Let m(u) = 18 - 34 + xu*2 + 16. Give o(m(f)). -325f*4 Let x = -156 + 256. Let s(g) = -x - g + 100. Let o(v) = 4031v + 261. Let r(d) = 31d + 2. Let m(h) = 2o(h) - 261r(h). Give s(m(j)). 29j Let x(c) = 2c2 + c + 1. Let r(i) = 4544i*2 - 2i - 3. Let y(t) = r(t) + 3x(t). Let v(g) = 2g. Determine y(v(w)). 18200w2 + 2w Let s(l) be the first derivative of 3l3 - 1. Let v(q) = -35q + 4. Let f(r) = -78r + 9. Let w(z) = -4f(z) + 9v(z). Determine w(s(k)). -27k2 Let n(h) be the third derivative of -h4/8 + 2h2 + 98h + 2. Let x(s) = 85 - 25s - 85. What is x(n(j))? 75j Let c(z) = -115z - 9. Let m(x) = -27x - 2. Let b(t) = -2c(t) + 9m(t). Let o(p) = -37p2. Determine b(o(s)). 481s*2 Let f = -3 + -37. Let y be (-245)/(-2) - 20/f. Let b(r) = yr - 124r - 3 + 3 + 41r*2. Let a(k) = -k. Give b(a(n)). 41n*2 + n Let j(q) = -5 + 5 + 4q*2. Let d(p) be the second derivative of 3p*4/4 + 89p + 2. Let x(y) = -6d(y) + 13j(y). Let n(m) = 25m. Calculate x(n(v)). -1250v*2 Let v(u) = -7u*2. Let i(t) = -11761013t. Determine i(v(f)). 82327091f2 Let s(x) = -79x + 79x - 236x*2 + 486x*2 - 242x*2. Let w(q) = 9q - 4. Let j(o) = -72o + 33. Let d(t) = -4j(t) - 33w(t). Give s(d(k)). 648k*2 Let w = 10 - -3. Let r(b) = -9b + 21b - wb. Let n(p) = -11p2 + 5p*2 - 3p*2 - 6p*2. What is r(n(u))? 15u**2
Suppose 5g + 123 = 2t, -206t = 5g - 204t + 107. Let s = 26916580/1029 + -26158. Let n = -48367/2058 - s. Which is greater: g or n? g Let s be 2-3 - (-2 - 0). Let b(p) = p*2 - 18p + 7. Let a(l) = l*2 - 7l + 2. Let n(w) = 2a(w) - b(w). Let g be n(s). Is g bigger than -10? True Let j be -2 + 0/(-2) - -6. Let m = 9658 - 9664. Is j greater than or equal to m? True Suppose -765 = -6n - 27. Let c be (-486)/n - -3 - -1. Which is smaller: c or 4? c Let d = -1680.9 - -1598. Let m = 43 + d. Let a = -40 - m. Is a > -1/8? True Let o be 2962/342 + 11/(176/(-144)). Is 1 < o? False Suppose 3g - 21 = -0g. Suppose gf + 0 - 35 = 0. Suppose fo = -x + 1, -3o + 3x = -o - 14. Which is smaller: o or -2/15? -2/15 Let o = -409 + 414. Suppose ox - 12 = -5h + 83, 2h - 4x = 38. Is h > 96/5? False Let j(d) = d*2 - 23d - 55. Let y be j(21). Let l = -97 - y. Which is smaller: 2/67 or l? l Let s = 20.07 - 19.179. Let f = 1 - s. Is 1 >= f? True Let m = -2029 + 4220. Let n be m/(-3066) - (-4)/6. Let a = n + 205/10366. Which is smaller: 1 or a? a Let a be (-16)/(-10)(-45)/(-6). Suppose -4q - a = -32. Suppose qk = -z + 1, 0 = 5k - k + 4z - 4. Which is greater: k or -4/27? k Suppose -5z + 20 = 0, 2u + 2z + z + 2 = 0. Suppose 14 = -5v - 4i, v + i + 7 = -2v. Let o = -5 - v. Which is smaller: o or u? u Suppose 85 = -5w - 5d, -11d = w - 8d + 33. Let t = 10/647 - 27871/3235. Which is smaller: t or w? w Let g(u) = 14u2 - 3. Let n be g(3). Let b(l) = l2 - 64l + 664. Let d be b(10). Which is bigger: n or d? d Let s = 64 + -133. Let w be s/51/(-3). Which is greater: 4 or w? w Let r(k) = -k*2 - 14k - 19. Suppose 15d + 44 = -1. Let y be r(d). Is y at least as big as 77/6? True Let n = -79 + -23. Let b = n - -151. Let p = b - 48.8. Is p greater than or equal to -5? True Suppose 2y = -2x - 220, 2x - y = 2y - 195. Let z be (-2)/(-13) - 1x/(-91). Let r be (z - 0) + (-4 - 34/(-6)). Which is smaller: 0.06 or r? 0.06 Let t = -408 - -627. Let s = t + -232.3. Let j = s - -13.4. Is -1 <= j? True Let y(f) = -6f2 + 3f. Let c be y(4). Suppose -2a = -2q + 150, 3a + 3q + 360 - 87 = 0. Is c >= a? False Let p = 17/148 + 12659/37. Let r = -341 + p. Which is bigger: r or 1? r Let q = 550 - 549.958. Let s = 0.158 + q. Is s > -1? True Let a be ((-9)/2)/((-12)/8). Suppose 9 = av + 39. Let c = v + 10. Which is greater: -4/27 or c? c Let r be -7 + (-36)/12 + (-1 - -1). Let i be r + 8 + (2 + -6)/(-4). Which is greater: -7 or i? i Let b = 17947/128550 + 1/2571. Suppose x - 6x = 0. Is b <= x? False Let k(f) = 61f - 355. Let r be k(6). Is 145/14 > r? False Let h(s) = 2s*3 - 144s*2 + 153s - 239. Let i be h(71). Does i = -5? False Let l be (4 + -5 - 8) + -1 + 11. Is l != -2/1823? True Suppose 3b - 2y + 4 = 6b, 0 = 4b + 3y - 6. Suppose 2l - 4c = -112, b = -5l - 13c + 18c - 295. Are l and -62 equal? True Let z = -11742 + 11747. Is z at most as big as -9.69? False Let a = -15013 + 15014. Which is bigger: a or 0.03561? a Let r = 176455/17772 + -18/1481. Let a = r + -13471/1356. Suppose -3y + 3 = -3, -5o = 4y - 8. Are a and o unequal? True Let s(f) = 30f - 440. Let m be s(20). Is 157 less than m? True Let q(x) = x*3 + 28x*2 - 9x - 243. Let g be q(-28). Suppose -8h + 13h = -905. Let c be h/(-21) - 4/12. Does c = g? False Suppose -114u - 123u - 21917 = -230u. Is -3130 > u? True Let l(m) = 71m*2 + 1152m + 17. Let o be l(-13). Is -2960 bigger than o? False Let l = -249991/27285 - -779/85. Which is smaller: 0 or l? 0 Let q = -133 - -137. Suppose 0 = 3c + 4b + 782, qc + b = 5b - 1024. Is -257 <= c? False Let u be (-2 + (-873)/(-93))(-3)/10. Let b = u + 1/62. Let t be (-4)/24-2 + 8/(-6). Which is smaller: t or b? b Let q = -1659914/213 - -7793. Which is smaller: 0 or q? q Let o = -55 + 37. Let u be ((-429)/(-52))/(o/4). Which is smaller: 3/7 or u? u Let a(d) = -6d + 12. Let n = 37 - 35. Let x be a(n). Let v(l) = -3l + 47. Let g be v(x). Does 47 = g? True Let m(d) = -4d + 17. Let n be (2 - 2)/(-2) + 10. Let k be m(n). Let c be (-30)/105 - (-159)/(-7). Do k and c have the same value? True Let w(l) = -28l - 134 - 136 + 271. Let d be w(2). Which is bigger: -54 or d? -54 Let j(b) = 99b - 1807. Let n be j(34). Is n bigger than 1559? False Let s = 11 + -10.2. Suppose -3432d + 1249d + 12389 = 1153d - 7627. Which is bigger: d or s? d Let x = 592 - 595. Which is greater: x or -8/9? -8/9 Let y = 547 + -1381. Is -833 bigger than y? True Let s = 388 + -430. Let w be (s/(-308))/(3/(-32)). Let o be (3 + -1 + -2)/2. Is w greater than o? False Let p = -527 + 472. Let w = p - -366. Which is smaller: 2/7 or w? 2/7 Let x(z) = -z*2 - 2z + 1 - 2 - 2z + 5z. Let p be x(0). Let k = 163.07 + -163. Which is smaller: p or k? p Suppose -9d - 445 = 203. Suppose 3m - 6 = 6. Let j be ((-2556)/54)/((-3)/((-18)/m)). Which is smaller: j or d? d Let b = -27 + 64. Is b less than 7? False Let b = -8 + 7.97. Let p = 0.21 + b. Let l = 7181 + -7181.1. Is p at least as big as l? True Let n = 2994 + -2992.5. Do n and -56/9 have the same value? False Suppose -824y + 71y + 33664 = 299y. Let m be 8/(-20) - 334/(-10). Which is greater: m or y? m Suppose 4i - 25 = -y + 6y, 4y - i + 20 = 0. Let x be ((-30)/(-24) + (-333)/(-60))y. Is -35 bigger than x? False Suppose 4y - 4g = 6y + 16, y + 16 = -4g. Let o be (-29)/5 + 1/(-5). Let i be -5 - -1 - 23/o. Does y = i? False Suppose 9 = -2u + 5u. Suppose 4 = ua - 11. Suppose -aw - 44 = 16. Are w and -13 equal? False Let k = -1422 + 975. Is -444 at most as big as k? False Suppose 299 = 88s + 9417 + 24498. Which is greater: s or -360? -360 Let s = -1012/2535 + -2/2535. Suppose 0 = 6o - 4o + 12. Let z be 5/o(-6)/(-8). Which is greater: z or s? s Let c(y) = y3 - 24y*2 + 24y + 329. Let q be c(14). Are -3 and q non-equal? True Suppose -7 = -w - 4. Let q be (30/(-150))/((-2)/(-10)). Let c be 6 + q - 1 - w. Which is greater: -0.5 or c? c Let j = 20/947 + 667/13258. Which is greater: j or 2? 2 Let c be (3 - (-50)/(-14))(-49)/14. Suppose 0 = -0h + 5h - 15. Suppose h = -cu + 31. Does u = 14? True Let a = 62/5 + -12. Let b = -75 - -78. Suppose bc - 102 = -15. Is c less than or equal to a? False Suppose c = -2c + 18. Let y be (-8)/(-14)(-2 - (-33)/c). Let k be 4/y - 99/15. Which is smaller: -4 or k? k Suppose -5w - 3 + 13 = 0. Suppose -wl + 2 - 12 = 0. Let c be (80/(-14))/l - 2. Are -2 and c equal? False Let c(i) = 5i - 131. Let o be c(27). Let p be ((-48)/10 + o)/((-8)/(-20)). Let z be 3/(-14)(-132)/(-9). Which is bigger: z or p? p Suppose -9h = 79 + 29. Suppose 0 = f - 46 + 69. Are h and f equal? False Let b be 16/(-12)342/456. Which is smaller: b or -2/9361? b Let s(d) = -850 + 5d*2 + 3d*2 + 844. Let o be s(-2). Suppose 2t - 24 = -o. Is t < -8/21? True Let j = -290089 + 290090. Let p = -13107016/9345 - -9818/7. Which is greater: j or p? j Let f = -115 + 119. Suppose 17x - fx + 416 = 0. Is -31 >= x? True Let m be (-7 + 44752/80)/(16/10). Which is greater: 344 or m? m Suppose 0 = w + 13w - 28. Suppose -wz + 3n = 12, 4z + 2n = 2z + 8. Let o be (3/(-9)z)/(-1). Which is greater: o or 1/89? 1/89 Let d = -2940 + 64683/22. Let b = -11.98 - -12. Let y = -1.02 + b. Which is smaller: d or y? y Let p = -17/7 - -19/7. Let g = -11 + 13. Suppose 3v + gv + 2s = 11, -2s = -4v - 2. Are v and p nonequal? True Let f be 105276/930 - 18/(-10). Which is smaller: 135 or f? f Let q = -573 + 577. Suppose -t = y + 20 + 36, 2t - 206 = qy. Which is greater: y or -54? y Let v(a) = a*2 + 17a + 3. Let z be v(-17). Suppose f = 5w - 4, f + 0f - 4 = -zw. Is 2/475 < w? True Let b = 109 - 157. Let a be 2/5 - b/(-45). Which is smaller: 15 or a? a Let r(m) = 3m - 3. Let a(j) = j - 1. Let g(l) = -17a(l) + 6r(l). Let o be g(3). Suppose -6i = 2i - oi. Which is smaller: i or 1/3? i Let s = 6 - 3. Suppose -5w + m = -21, 642w + 3m - 32 = 638w. Suppose -s + 13 = -wu. Which is bigger: u or -27? u Let v(s) = 549s + 6999. Let d be v(-21). Which is greater: d or -0.1? -0.1 Let s(l) = 88l + 73. Let f be s(-9). Let g = -711 - f. Which is smaller: g or 37? g Let c = -15875 + 25536. Which is bigger: 9662 or c? 9662 Let w be (-93)/(-31)((-20)/3)/(-1). Let m(s) = 22s + 1 - 7 - s*2 - 33. Let y be m(w). Is 16/7 equal to y? False Let z be 534/10 + 4/(-10). Let v = -109397 - -109404. Which is greater: z or v? z Suppose -859 = -7n + 436. Suppose -2i = -7i + 2x + 260, -n = -4i - 3*x. Is 49 at least i? False
What is the value of -27 + 16 + 60 + (6 - 1 - 20)? 34 -16 + (6 - 36) + 18 - -22 - (-75 - 0) 69 Calculate 82 + (7 - 40) + -27. 22 What is -1 + -1 + 32 + (24 + -18 - 16)? 20 What is (-5 - (-12 - (5 - (-5 + -2)))) + 7 + -8? 18 Calculate 7 + -32 + (10 - 2 - -2 - (136 + -121)). -30 (57 - 0) + -12 + -13 + -21 + (70 - 17) 64 What is the value of -71 + -35 + 98 + (-1 - -59 - 1)? 49 What is -39 + -49 + (36 + 83 - -39)? 70 What is 53 - 23 - -4 - 142? -108 Evaluate -116 - (31 - 30 - 10) - -3. -104 Calculate 45 + -12 + -24 - 37. -28 -2 - ((-6 - -8) + 4 + 53) -61 Evaluate (15 - 8) + -51 + 77. 33 11 - ((1 - 8) + (15 - 24 - -23)) 4 Calculate 23 + (-96 - -72) + (-2 - -32). 29 What is 79 + -169 + 82 + -34? -42 Evaluate 4 + (-33 - (-102 - -21)) + 43. 95 Calculate -11 - (5 - (51 - -8)). 43 What is the value of 19 - (-10 - -11 - -6) - -14? 26 What is the value of 14 - ((27 - 5) + -110 + 87 + (0 - 11))? 26 Calculate -7 + (-16 - -2 - (472 - 505)). 12 11 + -1 + (-14 - (4 - 3) - (-234 - -212)) 17 What is the value of (-180 - -155) + (32 - -15)? 22 Calculate (8 - 10) + 18 + (-11 - 7) - 127. -129 What is -7 + -35 + 40 + -40? -42 47 - (56 - 26) - 40 -23 What is the value of -30 + 53 - -8 - -65? 96 Evaluate -1 - 10 - (-204 + 168). 25 What is the value of 5 + -11 + -2 + 5007 + -5004? -5 What is (-1 - 78) + 40 + 7 + (1 - 2)? -33 Calculate -67 - ((320 - 337) + (-8 + 3 - -38)). -83 What is the value of (-51 - ((13 - (-16 + 20)) + -23)) + (1 - 8)? -44 What is the value of 31 + 25 - 50 - -37? 43 13 - (10 + (11 - 34) + 13 + 9) 4 Calculate -2 + 26 + -11 + -9 + -23. -19 Evaluate -56 + 59 - -15 - (-29 + -2). 49 -2 + 4 + 2 + (-29 - (-17 - -4) - -59) 47 What is the value of -27 - ((1 + -32 - 118) + 38)? 84 What is the value of 38 - (-23 + 35 + 6) - -76 - 8? 88 Evaluate 10 + 82 + 52 - 62. 82 Evaluate -8434 + 8431 + 1 + 0 + 1. -1 What is the value of (-15 - -9 - -15) + -7 + 6 + 65? 73 What is the value of 4 + 100 + (-1349 - -1192)? -53 What is the value of (-19 - (1 + (6 - 13))) + -3 + 57? 41 What is the value of (-2 - 34) + (6057 - 6022)? -1 What is -6 + (-3 - (-6 - -6) - 7 - (-20 - -18))? -14 Evaluate -65 + (104 + 50 - 122). -33 What is -10 + 11 + (-40 - -26) - 5? -18 (-5084 - -5135) + -121 + 1 -69 5 + 10 + (110 - 45) 80 What is the value of -10 + (17 - -1 - -4) + (18 - 14)? 16 What is the value of -1 + 42 - 6 - (83 - 82)? 34 Calculate -23 - -2 - ((-51 - 31) + 80). -19 What is the value of 5438 - 5601 - (-103 + 2)? -62 What is the value of -18 + -47 + (-7 - (1 - 23)) - 15? -65 What is the value of (41 - 5) + -12 + -5 + -3 + 14? 30 What is -6 + 10 + -14 + 2 + (-6 - -55) + 1? 42 What is (-4 - 10 - -4) + -16 + 15? -11 What is the value of (4 - 9) + 10 + 1 + 36? 42 Calculate -30 + 115 + 66 - 43. 108 Calculate -5 - 15 - -4 - 12. -28 19 + (-20 - -1) + (-31 - -14) -17 Evaluate (0 - 49) + 148 + -109 + -10. -20 What is (62 - ((-8 - -26) + -5)) + (-7 - (4 + -2))? 40 What is (165 - 85) + -253 + 74? -99 Calculate (-15 - -8) + -14 - -29 - (10 + 1). -3 (-40 - (-52 - -13)) + (40 - -1) 40 18 + -39 + -20 - 13 - -3 -51 Evaluate (-2 - -45) + -309 + 221. -45 Calculate (-42 - (-6 + 4 + -3 + -2)) + -10 + 0. -45 Calculate -6914 + 6911 + (6 - -1). 4 -34 - (-53 - (84 + -161)) -58 What is 11 + (-14 - (16 + -38)) + (-13 - 0)? 6 (-2 - -4) + (9 - 2) + (66 - (66 - -25)) -16 What is 4 - (32 + -26) - (-63 + -20)? 81 What is the value of -43 - (-2 - -5 - (-15 + (7 - -9)))? -45 1074 + -1166 - (-28 + -1) -63 15 + 40 + (-90 - -50) 15 What is 1 - 3 - (-2782 + 2764)? 16 36 + -19 + 8 + (43 - 16) 52 Evaluate 52 - (9 + -16 + 7 - -9 - 1) - -2. 46 Calculate (4 - (-9 + -2) - 3 - (-9 - -21)) + -48. -48 What is the value of 5 + 66 - (-880 + 962)? -11 -478 - -618 - (-6 + 46 - -2) 98 What is -57 - ((556 - 528) + 0 + -6 - 4)? -75 What is 16 + -8 + (-2 + 4 - ((11 - 6) + -9))? 14 What is -14 + (78 - 49 - (-2 + 14)) + 52? 55 Evaluate (-25 - (1 - (11 + (-19 - -9)))) + -6. -31 What is 8 + -3 + (38 + 51 + -124 - (0 + 0))? -30 What is the value of 140 + 23 + -65 + -169? -71 -66 - (275 + -151 - 72) -118 Evaluate -5 + -11 + 0 + (-36 - -37) + -1. -16 (-3 - 79) + -985 + 1039 -28 2 + -12 + (287 - 340) - (-9 + 3) -57 62 + (-4 - -9) + -13 + (7 - (-18 + 0)) 79 -2 + 0 + -16 - (-557 + 519) 20 Evaluate 39 - (0 + -6) - (28 - (-8 - -44)). 53 What is -5 + 37 + -6 + 0 - ((6 - 13) + 8)? 25 What is (42 + 44 - 52) + 8 + 0? 42 Evaluate 1390 + -1374 - (126 - 1). -109 What is the value of 1 + -2 + (-51 - (-77 + -19))? 44 (7 - 14) + 0 + -37 - (47 - 58) -33 What is 30 + (-9 - 4) - 40 - -117? 94 What is (-18 - -43 - 13) + 1 + (7 - 20)? 0 Evaluate 24 + (-41 - -66) - -1. 50 Calculate (12 - 4) + -50 + (20 + -25 - (2 + -14)). -35 Calculate (-26 + 9 - (-23 + 29)) + 86. 63 Evaluate -13 - ((-5 - -3) + 3 + (-30 - -15)) - 14. -13 What is -2 + -29 + (30 + -35 - -22)? -14 Calculate -1003 + 1161 - (8 - -89). 61 What is 140 - 112 - (-7 - (-22 - -2))? 15 Calculate -129 - (-22 + -5 - 2). -100 Calculate 20 + 36 + -51 + (8 - (-4 - -7)). 10 What is -9 + (-5 - 4 - (-4 + 1 - 4))? -11 Calculate 27 + (-57 - -17) + 88 + 3 + 3. 81 What is the value of (5 - (3 + 38 + 4)) + (0 - -11)? -29 What is -90 + 17 + (-74 - -135)? -12 378 - 409 - (6 - 5 - -2 - -2) -36 Evaluate 75 - -1 - (-8 + (-24 - (-49 - -11))). 70 Evaluate (-6 - (9 - -4)) + -46 + 0. -65 What is the value of 52 - (-9 + 42 + -31 + 3 + 7 + -7)? 47 Evaluate 81 + 18 - (-5 - (-16 + -1)). 87 What is the value of 1 - 8 - ((8 + (-24 - -19) - -7) + 53)? -70 What is the value of (-3 - -4) + 16 + -20 - 59? -62 Calculate 24 + -5 + -15 + ((4 - -2) + 8 - -1). 19 -18 + -17 - -45 - -21 31 Calculate -10 - -27 - (54 - 114 - -43). 34 36 + -30 + (17 - 16) 7 Calculate -13 + 71 + -92 - -11. -23 What is the value of 12 - (-25 - (74 + -54))? 57 Evaluate ((-12 - 0) + 161 + -113 - -1) + -3 + 10. 44 What is the value of (0 - 12 - (-3 - -2)) + (47 - (28 - -34))? -26 -69 + (-78 - -69) + -32 -110 Calculate 1277 + -1163 + -3 + -49. 62 27 - (27 + (-13 - 3) - 55) 71 What is -16 + -9 - (-104 - -55)? 24 (23 - -38 - 23 - 2) + -14 22 What is (-12 - 1 - 0) + -1 + 0 + 17 + -14? -11 What is the value of (-27 + -27 - 84) + 54? -84 What is -2 - (1 + (1 - 1)) - ((-28 - -58) + -12)? -21 Calculate 376 + -399 - (9 - (0 + -1 + 1)). -32 What is the value of -129 + (-37 - (-63 + -35 + 27))? -95 What is the value of 48 - (-92 - -85 - 15)? 70 What is (10 - (-92 - -26)) + -20? 56 14 - (107 + -162 + 4) 65 Calculate -10 + 19 - (-14 - (-3 + (17 - 6))). 31 What is -28 + 12 + (-6 + -8 + 17 - 38)? -51 What is 11 + -4 + (61 - (-7 + 1 - 9 - -7))? 76 -4 - -29 - (149 + (-65 - -12) + 38) -109 -47 - (13 + -25 + 34 - 48) -21 What is the value of (1 - (-36 + 34) - 46) + -29? -72 -2 + 1 + -1 + -6 - (-41 + 32 + 6) -5 What is -25 + (30 + (13 - 71) - -55)? 2 What is 5 + -6 + 9 + 8 + -5 - 9? 2 What is -855 + 783 + 60 + 5? -7 What is 28 + (-95 - -85) + -4 + (8 - 3) + 2? 21 Evaluate 10 - (-7 - -14) - -21 - 61. -37 1 - -51 - (11 - ((1 - -2) + 38 + -30)) 52 Evaluate (160 - 175) + 100 + (-7 - -1). 79 (15 - -14) + (-38 - -8) -1 What is 34 + -51 + 16 + (1 - (7 + -1)) + -51? -57 What is -11 + (-9 - -71 - (-18 + 22 + (7 - 2)))? 42 Calculate (26 - 20) + (-13 + -52 - 6). -65 What is 35 + -55 + 0 + 65 - (3 + 0 + -4)? 46 -2 - (8 - 4) - ((-2 - 1) + -97 + 98) -4 Evaluate (-15 - (-80 - -30)) + (10 + 0 - (0 - -2)). 43 30 - 4 - (-4 + 35 - 13) 8 Calculate -1 + -8 + 3 + (-6 + 13 - 20). -19 What is (-10 - 3) + 7 - (-32 - (1 - 7))? 20 What is the value of (-10 - (-35 + 4)) + -19 - 39? -37 What is the value of 6 + (-23 - (-47 + 18)) + (75 - 0) + -3? 84 Calculate -8 + (-32 + 11 - -9 - -27) - -22. 29 What is -3 + 13 - 25 - (-40 + 7 + -4)? 22 Calculate (15 - 91) + (-34 - -31) + 1 + 14. -64 What is -3 + -4 + 1 - (9 - (14 - 18))? -19 -4 - (-42 - (32 + -97)) -27 What is -13 + (47 - (33 + 61))? -60 What is (-27 + 8 - -2) + 9 + -4 + (-7 - 89)? -108 (-63 - -54) + (-2 - -35) 24 Evaluate (13 - -1) + -1792 + 1750. -28 What is 8 + (-41 - ((-9 - -6 - -2) + -2))? -30 What is -98 + 15 - -143 - 218? -158 83 + (-72 - (-16 - 32)) 59 Evaluate (6 + 5 + -53 - (108 - 129)) + 80. 59 What is -16 + (6 + 66 - 9) + -15 - (-5 - -6)? 31 -11 + 24 + -14 + -20 + 42 21 Evaluate 9 + 2 + 18 + -43. -14 Evaluate -78 + 40 + 28 + 52. 42 What is the value of (43 - 26) + (0 - (34 - -13))? -30 What is -11 + (-11 - 60 - (-48 - -35))? -69 Calculate -63 - ((2 - (-34 - -1)) + (-7 - 6)). -85 (-27 - (-4 + 0)) + (36 - 24) + -27 -38 Calculate 1 - 106 - (-1478 + 1458). -85 Calculate (-116 - 13) + -288 + 356. -61 Evaluate 6 - (28 + -109 - -14). 73 Evaluate (6 - -77) + -18 - (-30 - -1). 94 Calculate -55 + -2 + -11 + (14 - (15 - (4 + 6))). -59 Evaluate (100 - 13) + 1 + -12 + 7. 83 What is -6 + 36 + -30 + 1? 1 Calculate -5 + ((-35 - 5) + 0 - (10 - 14)). -41 Evaluate (52 - -1) + (2 - (-3 + -8) - (566 - 546)). 46
What is the value of (-20)/(350/(-1470)3)? 28 Evaluate (352408/(-251720))/(((-3)/20)/((-6)/(-4))). 14 What is (-34)/612024(-270)/(-7794)? -2/433 Evaluate (14/52)/((-15022)/(-25752)). 6/13 What is (30/35)/((12/532)/(96/(864/27)))? 114 Evaluate (((-4)/10)/(139/(-417)))/((-1)/80). -96 3830/(-766)26/2 -65 Calculate ((-95)/1716/(-300)-6)/((-13)/5). 1/39 ((-27)/(-31)17025/(-681))/(-3) 75 Evaluate (2148/(-358))/((-1)/(2/((-70)/(-55)))). 66/7 Calculate (-17)/(-8415)886/(-18)330/4. -44/9 Evaluate 530/(-159)(-5)/(-20)-3. 5/2 What is ((28/(-1078))/((-172)/(-6149)))/((-2)/4)? 13/7 What is (82/((-1681)/(-41)))/((((-80)/(-215))/(-4))/2)? -43 What is the value of 28/(-30)(3/(-35))/((-2538)/(-7050))? 2/9 Calculate (85/34-19/90)/((-4)/(-224)). -14 Calculate 5/25(-35)/(3675/(-140)). 4/15 Calculate ((1170/1755)/((-50)/3))/((-3)/(-6)). -2/25 (-26(-30)/28210)/(9/42) 4/31 ((-8894)/(-48917))/((-1)/2) -4/11 What is the value of 52/(-10)(-26)/(1664/(-40))-4? 13 What is 239/(-52)12208/126(-9)/12? 109 Calculate ((-1140)/(-80))/((-6)/(-96)-12). -19 Evaluate ((32/2715)/16)/(((-725)/375)/(-29)). 2/181 What is the value of (2135/(-50))/((10/(-12))/(11525/5532))? 27/2 (((-2)/2)/(-1))/((-6530)/(-111010)) 17 What is (55(-188)/15510)/(1/60)? -40 18612/(-1512)(392/(-4))/(-2) -42 What is the value of (-77)/(((-1)/(-26))/(1268/32968))? -77 (1/3)/(9/(-81))(1344/(-120))/28 6/5 What is (2574/4004)/((-1)/(2/(-1)3))? 27/7 Calculate 867/(-6)138/(-4692). 17/4 What is (((-26)/(-91)-833)/(-7))/((-12)/4)? -34/3 What is 81/2251012/3132-15? -6/29 What is ((-1)/8)/(55/(-308880)39)? 18 What is the value of ((-15)/(-1920))/(((-738)/820)/(1/(15/18)))? -1/96 Evaluate (-20)/(-15)3/35(-5348)/(-6112). 1/10 ((-662480)/1362816)/(5/112) -98/9 What is the value of (((-143988)/(-845))/(-213))/(174/(-45)-1)? -6/29 Evaluate ((-10)/(-475))/((-7)/((-210)/(-3))). -4/19 Calculate (1960/80)/(1/(-6)-3). 49 What is the value of (-2)/(-786)16/6(-522)/232? -2/131 What is ((-15)/6)/(6/8)9703/(-19406)? 5/3 What is (011/220)/(-58/20)? 0 -1((-3)/(-6))/(36/(-72))2 2 Calculate 123/(-1(-7)/2((-4752)/168)/33). -41 What is (-9)/3(-2)/12(-186)/294519? -3/5 What is the value of (-100)/12(-8166)/(-1361)? -50 What is the value of ((-39)/26)/((1323/198)/(-49))? 11 What is the value of 22/(-3)((-24)/30)/(12/(-45))? -22 What is the value of ((-60)/198)/(79/(19118/(-165)))? 4/9 What is -287(-76)/1596(-36)/(-4)? 123 Evaluate (((84/140)/(-1))/3)/((-3)/105). 7 What is ((-18136)/40806)/((-2)/1085)? 24/5 17/(((-95)/10)/(-19)6/(-3)) -17 Calculate (6/(-8))/(1643/508836). -2/31 Evaluate ((-32)/14)/((-6)/(-105)2285/(-2742)). 48 What is -6((-7)/15)/((-19)/(-266)(-35)/50)? -56 (-6)/16(16820/(-29))/58(-36)/(-27) 5 What is 796/15922(-2)/6-228? 76 Calculate (-2025)/22511/(396/(-136)). 34 What is 166/834624/8656? 83 What is (-9)/8-416(-104)/(-192)? 39 Calculate -1(-6)/(-710)(-516)/(-5676)440/(-12). 2/71 Calculate (15352/(-9595))/(3/(-6)(-2)/2). -16/5 (44/(-3))/((-63)/105(-195)/702) -88 Evaluate 24/(-9)(-4)/1496(-84458)/(-46068). 2/153 What is (86/5160)/((64/(-60))/(-8))? 1/8 What is 1/(33/(-18))1583/(-3166)? 3/11 Calculate ((-5)/(-8))/((-1366170)/17628). -1/124 Calculate (-160)/(-128)(-488)/(-10). 61 Calculate ((-6572)/(-3021))/(-31)3. -4/19 What is (930/25)/(45/75)? 62 Evaluate 8/((-20)/5)(-1)/(506/161). 7/11 Evaluate (62/937)/(12/(-144)). -56 Calculate ((-6)/8718850/(-520))/(((-110)/(-4))/1). 1/11 -28(-70)/2038439/3 5/4 ((-60)/(-51))/(236/2006) 10 Calculate 111/((-56)/((-1792)/(-96))). -37 What is (-1)/((-6)/(-18)-6)-6? -3 Calculate ((-1)/10)/(50/160(-456)/1710). 6/5 Evaluate 323/(3827/162). 51 Calculate (-190)/(-798)119/(-2550). -1/90 Evaluate (-10)/921888/960(-45)/(-20). -57 Evaluate 1162/(-90)(-90)/18. 9 What is the value of (476/(-34))/((-1176)/432)? 36/7 What is the value of -3(788/(-394))/(12/(-94))? -47 Calculate (-154)/776/(-144)-4. -1/3 What is the value of (-222)/(-222)1/5? 1/5 ((-12)/(-3))/((-2)/((8/(-32))/((-3)/372))) -62 (19/(114/(-36)))/(189/1782630/98) -44/5 Calculate ((-12)/11)/(-2)64504/43980. 4/5 What is (((-4)/6)/(3/((-171)/(-38))))/((-29)/(-1131))? -39 Evaluate (596/(-107429))/((128/28)/(-8)). 1/103 What is (-17)/67479/70635? -3/10 (((-756)/8)/(-9))/(5384/17920) 98 What is (-10)/476/(175560/126)? -3/22 What is (32/80-30)/((168/(-45))/(-28))? -90 What is 138474/64998(-2)/(6/(-69))? 49 What is the value of 3444/840(-140)/(-7175)20/(-6)? -4/15 What is the value of (-10)/40(-5112)/1065? 6/5 Evaluate (12064/5824)/(4/(-112)). -58 (96656/27616)/((-126)/(-1)) 1/36 Evaluate ((-4)/(-480))/((-19)/(-152)(-10)/(-10))5. 1/3 What is (2/1)/(-43(-74)/(-15910))? -10 Calculate (72/(-4))/(((-936)/32)/(-39)). -24 (8/(-9))/(((-2295)/1377)/((-6)/(-2))) 8/5 (-8)/36(2/5)/((-2864)/59070) 11/6 What is -267/1340-190? 19 ((-11532)/19220)/(-31/250) 50 What is the value of (-1(-1)/2)/(44/((-1936)/66))? -1/3 ((-75)/(-875))/(((-378)/45)/(-14)) 1/7 -6(-850)/(-1632)(-12)/135 5/18 What is the value of 6(-4)/2(-80)/(-12)89/4450? -8/5 What is ((-7220)/(-11400))/(38/2)? 1/30 Evaluate (-3)/((14734/(-139))/1590). 45 Calculate -2766144/(-18432). 54 What is the value of (116932/211232)/(3/(-168))? -31 261920/13096(-87)/(-60) 29 Evaluate 11/(968/(-480))(-11)/84. 30 Evaluate (1/(-6))/(1/3)(-96192)/(-37575)5. -32/5 Evaluate (-7)/((-28)/40)(-5868)/(-978). 60 What is (321)/((637/1911)/((-3)/3))? -96 Calculate ((3-1)/((-21)/2))/(255/2509710-37). -76 Evaluate (((-40)/30)/(36/54))/((-216)/(-27)). -1/4 Evaluate (40575/(-21640))/(9/312). -65 ((-640)/256)/((-10)/111/(-16)) -44 Calculate (-502)/(-1004)(-8)/(-20). 1/5 Evaluate (266/108/4)/(33188/(-82970)). -133 Evaluate ((-84)/7)/((-726)/(-1089)). -18 What is the value of 12/(-8)16/30(1107890/(-76))/119? 98 What is ((-3)/46)/(29205/(-6490))? 1/69 Calculate -21(-24)/352856/52(-6)/2. -6/13 What is the value of (-34584)/(-243529)52/(-16)? -6/13 Evaluate (4/2)/(-6)4309467/(-23549). 61 ((-28)/((-2408)/(-86)))/(3/(114/(-11))-2) -19/11 What is the value of ((-3)/(-18))/(20328/(-33264))? -3/11 ((-8)/9)/(609/261(-40)/14) 2/15 Calculate 1-503339/(-4770). 35 What is (1/5)/((5124/366)/(1051))? 3/2 15(28/(-18))/(1135/(-693)) 42 ((-126)/(-192))/(15/320) 14 3/11230/(-230) -3/11 What is the value of ((-7)/((-105)/3)(-25)/105)/(3/153)? -17/7 ((-4)/14)/(1056/(-137984)8/(-6)) -28 What is 2/(-259)(-896)/(-128)? -2/37 Calculate 104/(-3432)(-231)/(-336). -1/48 What is the value of ((-10080)/641088)/((-10)/36)? 3/53 What is (-936)/(-22620)261/(-27)? -2/5 What is 11/22-1281/9? -9 What is the value of (25240/(-10096))/(3725/20)? -2/149 Evaluate 5/424(-807)/(-1345)8. 3/53 99/44(-2560)/(-192) 30 What is (2(-2)/40)/((-6053)/42371)? 7/10 Evaluate (20/(-8)(-12)/(-35))/(-1026/204). 2/7 What is (-27)/(7128/3872)(-6)/20? 22/5 Calculate ((-2065)/59)/(3/3). -35 What is 45/(-180)(462/9)/11? -7/6 ((-55769)/(-31868))/(21/(-39)) -13/4 1/(1/(-1))(-61)/38552-79 -1/8 What is (-64/(-72)(-8)/18)/((-83576)/62682)? 1/9 Calculate 27/(-2)2(-50)/30. 45 What is (((-75)/18)/5)/((-898)/(-6735))? -25/4 What is (140/(-90)24)/((-34)/12(-44)/187)? -56 Evaluate 4/2(-25)/300(176/(-99))/8. 1/27 What is the value of 29724/(-34678)((-21)/27)/1? 2/3 Evaluate (-684)/57(-19)/313505. 2/55 Evaluate (-18)/52290/(-916). 9 2/110/(-3)(-243648)/36096 45 Calculate 30/(-18)405/5-913/(-2808). -45/8 Evaluate 4-66(-57)/3420. 22/5 What is the value of -38(-99)/44((-738)/(-861))/(27/28)? 76 What is ((-112)/14)/(1-7(-1)/28)? -32 (((-18)/432)/(11/(-528)4))/((-2)/128) -32 (6(-25)/(-750))/(((-35)/7)/1025) -41 (5/(-5))/((-290)/(-348))1875/(-50) 45 Calculate (3/(-4))/((-405)/(360/8)). 1/12 What is (2652/(-260))/(-51)(-8)/12(-135)/12? 3/2 Evaluate (37/(-333)39(-6)/13)/(1/52). 104 ((-60)/864040)/(20/(-18))(-4)/3 -1/3 Calculate (-195(-65)/7605)/(2(-15)/306). -17 What is the value of (1486/(-2273580))/((-1)/90)? 1/17 What is the value of ((-3)/(-12))/((17673/(-1978))/137)? -23/6 What is the value of ((-9)/26)/(((-14)/(-7))/(-1(-32)/(-12)))? 6/13 What is the value of (82/(909872/(-219)))/((-5)/(-80))? -6/19 Evaluate ((-23)/(1104/(-324)))/((33/(-20))/11). -45 What is (8/20025)/((-4)/88)? -22 Evaluate ((-32)/30-16(-475)/(-304))/(4/(-6)). -40 Calculate -21/(-10)(-16)/160/(-7). 0 What is the value of 45/14(-312)/(-390)? 18/7 What is ((-32)/(-64))/(506/138(-42)/4)? -1/77 6090/(-7830)7/(-98) 1/18 Calculate (((-9)/(-12))/(21/7))/(377/(-1584)). -12/7 Evaluate (33/(2970/(-120)))/((-25168)/(-156)). -1/121 Calculate (-3)/18(-8)/(-14)(-866495)/(-26060)2. -19/3 What is (6(-2)/(-32))/(16/(-512)*72)? -1/6
Suppose -4s + 245 + 427 = 0. Suppose 0 = -2p + s - 96. Solve -5i = -4j + p, j - 4 = -2j - 2i for j. 4 Suppose 0 = -3q + 5b + 648 - 614, 0 = -2q + 5b + 31. Solve -qn = 15, 77n - 10 = -5v + 74n for v. 5 Suppose 0 = -4l + 32, 140m - 137m = l + 7. Solve -b - 3q - 9 = 2q, 5q + m = 0 for b. -4 Let r = 1071 + -1066. Solve -3t + ri + 18 = 27, 5i = -t + 17 for t. 2 Suppose 9t + 5376 = -15t. Let s = t - -229. Solve -b + sb + 5r + 10 = 0, 0 = b - 3r - 6 for b. 0 Let p = -200 - -200. Suppose p = 5c - 0c + 9c. Solve 4n - 8n + 3z = 19, 2n - 5z + 13 = c for n. -4 Let q(a) = a*3 + 4a*2 - 3a + 5. Let r be q(-5). Let v = -40 + r. Let l be (-1)/(0 + 0 + 15/v). Solve -3n + n = 3d - 3, -ld = -5n - 3 for n. 0 Suppose 0 = -10k + 6k - u + 130, -5k - 5u + 170 = 0. Solve 3r + 3 = -5i, 28i = 3r + ki for r. 4 Let o = 4235 - 4234. Solve x - 5 = 3n, -2x + n + 4 = -o for x. 2 Suppose 0r - 4r + 8 = 0. Let c(w) = -4 + 5 - w2 - r - 5w. Let m be c(-2). Solve -2y - 3h - 1 = 2, 0 = 3y + mh + 6 for y. 3 Let g = 2853 + -2830. Solve -5i - g = -4z, i + 2 = -1 for z. 2 Let i(n) = 10n2 - 17n*2 + 10n*2 - 4n - 100 + n*3 - 30n + 3. Let t be i(-3). Solve -tj + 15 = 2d, -j + 3j - 3d = 25 for j. 5 Let k = -904 - -668. Let l = k - -238. Solve -9 = lw - 5w, -q - w = -6 for q. 3 Suppose -834 = -210t + 6. Solve 5n - 70 = 3d - 50, tn + 2d + 6 = 0 for n. 1 Suppose 86b - 239 - 5 = 25b. Solve 6r = 3r - 3s, -2s = -br for r. 0 Suppose 3u - 19 + 7 = 0. Let r be u/(-12) - 19/(-3). Let l be (20/6)/(-4r/(-36)). Solve m - 6m + 6 = -4v, -9 = -2m - lv for m. 2 Suppose -5o = -4g - 960, g = -5o - 66 - 174. Let v = -235 - g. Solve b = v, -q - 1 = 2b - 16 for q. 5 Suppose 20 = -0z + 5z. Suppose 66 = zl + 2. Let s = -15 - -18. Solve -4w + 2f - f = -l, sw = 2f + 7 for w. 5 Suppose 588 = 11j + 368. Solve 0 = -0f + 4f + 2c + 10, c = -5f - j for f. -5 Let d be (21/(-42))/((-3)/30 - 0). Solve -r + da = 28, 2r + 4 = -a + 3 for r. -3 Suppose -2y + 5k = -55, 0 = -y - 4k + 10 - 2. Solve y = -5x - 5p, -5 = -27x + 26x + 2p for x. -1 Suppose 0 = 3b + b. Let u(t) = t3 - 3t*2 - 7t - 15. Let w be u(5). Solve b = o - wg + 2g - 4, 0 = -3o + 3g - 24 for o. -4 Let a(w) = 23w + 658. Let m be a(-28). Solve q = 5t + 19, -4q + 5t + m = -2 for q. -1 Suppose -4s - 19x + 40 = -15x, 0 = -2x + 8. Suppose sc = 2f + 24, c = -0f + 3f + 12. Solve -3a - 5n - 26 = 0, -3 = ca - 2n - 5 for a. -2 Let v be (-4)/8(10 + -20). Let j(r) = -r2 + 2r + 15. Let t be j(v). Solve 0 = 2l - u - tu - 1, -l = -4u - 11 for l. -1 Let p(g) = -2g*2 - g - 211. Let s be p(0). Let i = -208 - s. Solve 4b - 4n + 29 + 7 = 0, -5n + 37 = -ib for b. -4 Let d be (-2 - 129/9)/((-14)/42). Suppose 0 = 36m + d - 157. Solve 3 = r - mx + 17, 0 = r + 3x - 16 for r. 1 Suppose 115 - 19 = -4d. Let o be (-2)/d-3 + (-3)/(-12). Solve 0 = -5t + 2n - 4, ot - 5n - 9 = -3t for t. -2 Suppose -r = -5l + 245, -101 = -17l + 15l + r. Let i = 48 - l. Solve x = 3a + 9, 4x = -4a - ix - 28 for a. -4 Let q(d) be the third derivative of 13d4/24 - 47d*3/6 + 58d*2 - 3. Let x be q(4). Solve xi + 19 = -2l, 15 = -4i + i - 3l for i. -3 Suppose f - 36 = -2s - 16, -5s + 49 = 2f. Solve 0 = -72u + 70u - 10, 5i = -fu - 5 for i. 1 Let n(w) = -w + 14. Let r be n(11). Solve -m = -j + 7 + 2, 0 = rj - m - 17 for j. 4 Suppose 14 + 22 = 9c. Let j be 30 - (-4 - c/(-4)). Suppose 2u - j = -h, u - 2h + 12 = 2u. Solve -2k = -0v + 5v - u, -2v = -4 for k. 4 Suppose 2b + 5k = -19, -245b + 247b - 26 = 4k. Let t = -40 + 58. Solve -q + 4m - 1 = -t, -4q + 3m = -b for q. -3 Let b(p) = -p3 + 16p*2 + 50p + 138. Let w be b(19). Solve -5i - 3t = w, 2i + 3 = 6i + t for i. 2 Let m = -8541 + 8565. Solve -4s + 11 = -2d + 19, -5s - d = m for s. -4 Suppose -759 = -198k + 89k - 144k. Solve -3v - 3f + 23 = f, -kf = 2v - 16 for v. 5 Let f(h) be the third derivative of h*5/60 + 23h*4/24 + 52h3/3 - h2 + 92. Let g be f(-17). Solve -3i - 2i = -5v, 3v + gi - 5 = 0 for v. 1 Suppose -9j = -j + 56. Let g be j + 4(-18)/(-8). Solve 3d + g = -4o - 9, 0 = -2d - o + 1 for d. 3 Suppose 94n - 18 = 183n - 98n. Solve 0 = -2g + 6g - 3d - 7, ng - 4d = 16 for g. -2 Let r = -25083 - -25474. Solve -5 = 3g - s, 4g = -5s - 385 + r for g. -1 Let r = -1777 - -1780. Solve 0 = rm - 5z - 29, -3m + 6z = 10z + 7 for m. 3 Let m(p) = p*3 + 10p*2 + 10p - 16. Let d be m(-5). Suppose d = 17o + 25. Solve -5h + 25 = 0, -5c - oh = -0h for c. -2 Suppose -51d + 81 = -21. Solve -3z + 2l - 3 = 0, -d = -2z + l - 4 for z. -1 Suppose 3j + 9j = 864. Suppose -9u = -18u + j. Solve 0 = -3o + 4g - 5, -2o - g - u = -6g for o. 1 Let m = 33313 + -33300. Solve 0 = -31o + 33o - a + 8, -a = 5o + m for o. -3 Let k(n) = -n*3 + 50n*2 + 52n - 49. Let c be k(51). Solve -2w + 4x = 3w + 19, -14 = 4w - cx for w. -3 Let n be 32/8 - 3/(12/(-28)). Suppose nb - 125 = 106. Solve -4g - i - b = 0, -2i = 2g - 3i + 9 for g. -5 Suppose -58090t = -58045t - 2 + 2. Solve -44s - 5 = -5z - 49s, -5z + 3s - 11 = t for z. -1 Let k = -29944 - -29949. Solve 2s = kh + 20, 2h + 36s - 33s - 11 = 0 for h. -2 Let m be (1/2)/((-13 + 3)/(-300)). Solve -6w + 3w - m = 3r, 0 = -4r + 5w + 16 for r. -1 Suppose 102 = -4d - 3o, -5d - 2o + o = 122. Let p be (27/(-12))/(18/d). Solve 0 = 3l - 5t - 35, 3l + 3t + 0 - p = 0 for l. 5 Suppose 225y - 112y - 452 = 0. Solve -5j + 37 = 4a + 16, -ya - 4j + 20 = 0 for a. 4 Suppose -16y = -2y. Suppose 20 = -5w, t + 16 = -0t - 3w. Let u = 8 + t. Solve 0 = -4p - 0p - ua, y = -a for p. 0 Suppose -233 - 667 = -15s. Suppose -6u = -4a - u + s, 30 = 2a + 4u. Solve 3t + 3v = -a, 2t + 3v = -2t - 17 for t. -2 Suppose -176o + 173o = -k - 57, -2o = -4k - 48. Solve -m - w + 17 = 3w, m - 3w + o = 0 for m. -3 Suppose -3u + 4b + 16 = 0, -5u + 62b + 20 = 57b. Solve u = 4p, -2v + 5p + 46 = 54 for v. -4 Let v(g) = -3g + 54. Let z be v(-50). Suppose 208 - z = u. Solve -3b = 3, 1 = uf + 2b - 3b for f. 0 Let q be 120/4(-6)/(-252)7. Solve 3a + 9p - 5 = 13p, -5a - qp = 15 for a. -1 Let i(r) = 12r*2 + 28r - 78. Let k be i(-4). Solve 2x - 4l = 0, x = l + kl for x. 0 Suppose 0 = -2407m + 2442m. Solve 2o - 9 - 9 = -3x, -3x + 5o - 3 = m for x. 4 Suppose 0 = -10b + 19b. Let o be ((b/(-15))/(21))/1. Solve -4u = 16, -5u + ou = -4z + 32 for z. 3 Let i(f) = -5f + f3 - 15 + 15f*2 - 42f*2 + 24f*2. Let k be i(5). Solve 5l + 0l + k = h, 5h - 24 = -l for h. 5 Let k = 245 - 238. Suppose -22c + k + 37 = 0. Solve -3t - 4b - 23 = 0, -c = -3t - 0b + b for t. -1 Let c(s) = 2s*2 - 4s + 3. Let d be c(2). Suppose 514 = 16h - 302. Let b = -47 + h. Solve bm = -0i - 2i + 12, -4m + di + 32 = 0 for m. 5 Let x = -675 + 679. Solve -xg - 26 = 2w, -w - 4g = -8g - 11 for w. -5 Suppose 4873a - 4896a = -943. Solve 0 = -3s - 4h + 12, 25 - a = -4s - h for s. 4 Let v = -38 - 57. Let d = 100 + v. Solve -l = 4h + 2l - d, -7 = -2h + 3l for h. 2 Suppose -311 + 850 = 77q. Solve 24 = 5z + 3p + q, 0 = -4z - 5p + 11 for z. 4 Suppose -40p - 36 = -52p. Solve pr = 5q + r - 21, 0 = -3q + 5r + 5 for q. 5 Let l be (1 - 10)(-11 + (-224)/(-21)). Solve -3g + 2m = 2, -lg - 2g - 8 = -m for g. -2 Let j be (-60 - -4)/(-8) + 4/(-2). Let w be (j/10 - 0)0. Solve 3l - 10 - 5 = w, 3k = 4l - 29 for k. -3 Suppose 574a + 2073 = 1492 + 9765. Let z = -4 + 7. Solve 0u = -zu - 4p - 32, a = u - 4p for u. -4 Suppose 0 = p - 7 - 0. Suppose -155b + 1166 + 817 = 506b. Solve -x - 20 = -4q, 0 = -5x + bq - pq + 20 for x. 0 Let y be (2 - (2 - -4))/(-2). Let q = -190667 + 190669. Solve -d = 2k + 7, qd = -yd + 3k + 16 for d. 1 Suppose 0 = 23u - 19u - 12. Suppose -i = -3n - 13, un - n = -5i + 31. Solve i = 5a - 0a + p, 5a - 13 = p for a. 2 Let u = -1389 - -2148. Let r = u - 750. Solve 2i + 4 = -5l, -l - 2l - r = -i for i. 3 Suppose 2j + 13 = z, -3j - 10 = 2z - 1. Solve 0 = l + 3q - 4, -20 = -5l + zq - 8q for l. 4 Suppose -4y + 20 = -88. Suppose -1 - y = -14c. Solve -2b - 1 + 0 = 3k, -2k = cb + 4 for k. 3 Suppose -4p + 90 - 10 = 0. Suppose 3b = t + 26, -5b + pt - 21t = -54. Solve -3j = j + 2m - 6, -5j = 5m - b for j. 1 Let f = -133 + 137. Suppose i = -2i + fi. Solve 3a + 12 = i, m + a = -0*a for m. 4
What is 436617 to the power of 1/2, to the nearest integer? 661 What is 706426 to the power of 1/2, to the nearest integer? 840 What is the third root of 279888 to the nearest integer? 65 What is the eighth root of 202394 to the nearest integer? 5 What is the square root of 1884543 to the nearest integer? 1373 What is 516600 to the power of 1/3, to the nearest integer? 80 What is 1082614 to the power of 1/3, to the nearest integer? 103 What is the eighth root of 5401678 to the nearest integer? 7 What is 11060932 to the power of 1/10, to the nearest integer? 5 What is the square root of 25093241 to the nearest integer? 5009 What is the cube root of 1735351 to the nearest integer? 120 What is the cube root of 19420608 to the nearest integer? 269 What is the third root of 6958107 to the nearest integer? 191 What is the cube root of 217289 to the nearest integer? 60 What is 373632 to the power of 1/3, to the nearest integer? 72 What is the sixth root of 250845 to the nearest integer? 8 What is the cube root of 13421823 to the nearest integer? 238 What is the cube root of 9357020 to the nearest integer? 211 What is the seventh root of 14116472 to the nearest integer? 11 What is the square root of 3299234 to the nearest integer? 1816 What is the third root of 1144938 to the nearest integer? 105 What is 289838 to the power of 1/3, to the nearest integer? 66 What is the third root of 1676797 to the nearest integer? 119 What is the third root of 1789573 to the nearest integer? 121 What is 461180 to the power of 1/2, to the nearest integer? 679 What is 10821490 to the power of 1/3, to the nearest integer? 221 What is the fifth root of 319587 to the nearest integer? 13 What is the third root of 2288077 to the nearest integer? 132 What is the fourth root of 469995 to the nearest integer? 26 What is the fourth root of 1301043 to the nearest integer? 34 What is 4381634 to the power of 1/3, to the nearest integer? 164 What is 8090732 to the power of 1/3, to the nearest integer? 201 What is 14011698 to the power of 1/3, to the nearest integer? 241 What is the square root of 51275 to the nearest integer? 226 What is 2138016 to the power of 1/3, to the nearest integer? 129 What is 5896438 to the power of 1/2, to the nearest integer? 2428 What is 191629 to the power of 1/5, to the nearest integer? 11 What is the square root of 140849 to the nearest integer? 375 What is the square root of 347845 to the nearest integer? 590 What is the square root of 2795412 to the nearest integer? 1672 What is 6903711 to the power of 1/3, to the nearest integer? 190 What is 7168260 to the power of 1/2, to the nearest integer? 2677 What is the third root of 24505 to the nearest integer? 29 What is the tenth root of 2434011 to the nearest integer? 4 What is the square root of 12678688 to the nearest integer? 3561 What is the cube root of 19701 to the nearest integer? 27 What is the cube root of 3613763 to the nearest integer? 153 What is the eighth root of 23196 to the nearest integer? 4 What is the sixth root of 50015 to the nearest integer? 6 What is the cube root of 152738 to the nearest integer? 53 What is 20456683 to the power of 1/10, to the nearest integer? 5 What is 322947 to the power of 1/4, to the nearest integer? 24 What is the third root of 188075 to the nearest integer? 57 What is 311961 to the power of 1/2, to the nearest integer? 559 What is 9389658 to the power of 1/4, to the nearest integer? 55 What is the square root of 355180 to the nearest integer? 596 What is the cube root of 355995 to the nearest integer? 71 What is 12340815 to the power of 1/2, to the nearest integer? 3513 What is the eighth root of 3486222 to the nearest integer? 7 What is 319580 to the power of 1/3, to the nearest integer? 68 What is the cube root of 151143 to the nearest integer? 53 What is the cube root of 9635258 to the nearest integer? 213 What is 2519742 to the power of 1/8, to the nearest integer? 6 What is the square root of 3698822 to the nearest integer? 1923 What is the square root of 6169297 to the nearest integer? 2484 What is 1673524 to the power of 1/3, to the nearest integer? 119 What is the eighth root of 123763 to the nearest integer? 4 What is 19918217 to the power of 1/9, to the nearest integer? 6 What is the cube root of 521263 to the nearest integer? 80 What is 283716 to the power of 1/3, to the nearest integer? 66 What is 66018 to the power of 1/2, to the nearest integer? 257 What is the square root of 296329 to the nearest integer? 544 What is the third root of 381679 to the nearest integer? 73 What is 2812636 to the power of 1/8, to the nearest integer? 6 What is 399458 to the power of 1/3, to the nearest integer? 74 What is the fourth root of 3241165 to the nearest integer? 42 What is 181418 to the power of 1/7, to the nearest integer? 6 What is 6219208 to the power of 1/9, to the nearest integer? 6 What is 868849 to the power of 1/4, to the nearest integer? 31 What is the square root of 968560 to the nearest integer? 984 What is 401822 to the power of 1/3, to the nearest integer? 74 What is 2123497 to the power of 1/2, to the nearest integer? 1457 What is 349940 to the power of 1/2, to the nearest integer? 592 What is the cube root of 1733122 to the nearest integer? 120 What is the third root of 2042055 to the nearest integer? 127 What is the cube root of 18497646 to the nearest integer? 264 What is 307393 to the power of 1/3, to the nearest integer? 67 What is the tenth root of 12697624 to the nearest integer? 5 What is the cube root of 2509725 to the nearest integer? 136 What is the third root of 486704 to the nearest integer? 79 What is 3346412 to the power of 1/9, to the nearest integer? 5 What is 127118 to the power of 1/2, to the nearest integer? 357 What is 617070 to the power of 1/8, to the nearest integer? 5 What is 181498 to the power of 1/9, to the nearest integer? 4 What is the third root of 1450098 to the nearest integer? 113 What is 6546755 to the power of 1/8, to the nearest integer? 7 What is the seventh root of 2040486 to the nearest integer? 8 What is 515777 to the power of 1/2, to the nearest integer? 718 What is the third root of 220380 to the nearest integer? 60 What is the cube root of 16302848 to the nearest integer? 254 What is the fourth root of 73141 to the nearest integer? 16 What is the ninth root of 1161493 to the nearest integer? 5 What is the seventh root of 2610669 to the nearest integer? 8 What is 13390332 to the power of 1/3, to the nearest integer? 237 What is 17494627 to the power of 1/2, to the nearest integer? 4183 What is 231109 to the power of 1/10, to the nearest integer? 3 What is the ninth root of 1846340 to the nearest integer? 5 What is the sixth root of 502631 to the nearest integer? 9 What is 4071401 to the power of 1/3, to the nearest integer? 160 What is 897792 to the power of 1/3, to the nearest integer? 96 What is the third root of 595866 to the nearest integer? 84 What is the fifth root of 4661707 to the nearest integer? 22 What is 86252 to the power of 1/2, to the nearest integer? 294 What is the ninth root of 11251116 to the nearest integer? 6 What is the cube root of 11332518 to the nearest integer? 225 What is the fifth root of 7184356 to the nearest integer? 24 What is the third root of 6635867 to the nearest integer? 188 What is 672768 to the power of 1/10, to the nearest integer? 4 What is 2214637 to the power of 1/3, to the nearest integer? 130 What is the fifth root of 9476409 to the nearest integer? 25 What is the tenth root of 484736 to the nearest integer? 4 What is 408097 to the power of 1/2, to the nearest integer? 639 What is 107022 to the power of 1/3, to the nearest integer? 47 What is the tenth root of 2849061 to the nearest integer? 4 What is 953856 to the power of 1/3, to the nearest integer? 98 What is the third root of 1493454 to the nearest integer? 114 What is 490467 to the power of 1/6, to the nearest integer? 9 What is 14304400 to the power of 1/3, to the nearest integer? 243 What is 127394 to the power of 1/7, to the nearest integer? 5 What is the cube root of 21489193 to the nearest integer? 278 What is 1496723 to the power of 1/2, to the nearest integer? 1223 What is 540422 to the power of 1/5, to the nearest integer? 14 What is the third root of 132029 to the nearest integer? 51 What is 111607 to the power of 1/6, to the nearest integer? 7 What is the ninth root of 229769 to the nearest integer? 4 What is 980246 to the power of 1/2, to the nearest integer? 990
Expand (2 + 0 - 1)(-397m3 - m2 - 5m + 415m*3 + 1 + 3m*2). 18m*3 + 2m*2 - 5m + 1 Expand (-7n4 + 4n4 + n4)(-411n - 718n + 1991n). -1724n5 Expand -38l + 9696 - 9696 + (4 + 2 - 4)(-l + 2l + l). -34l Expand (-189c*2 + 2 + 95c*2 + 95c*2 + 3c)(-1 - 4 - 2)(c - 4c + 2c). 7c3 + 21c*2 + 14c Expand -2 + 2 - 2n4 + (2 + 1 - 2)(0n4 - n4 + 2n*4) + 3 - 931n*3 + 27n*4 + 931n*3. 26n*4 + 3 Expand (4 - 4 + 2p)(-14p*3 - 36p + 13p3 + 238p). -2p4 + 404p2 Expand -g4 + 5g4 - 2g*4 + (4g + 3g - g)(-g*3 + 0g3 - g3) + 4g4 - 2g - 3g4 + 0g. -9g4 - 2g Expand (1 - 1 - z)(-1 - 10 + 1 + (-1 + 3 - 1)(-6 + 4 + 0) + 5 - 3 + 0). 10z Expand 5y + 7y - 54y + (-4y - 2y + 4y)(4 - 1 - 2). -44y Expand (0v + 2v - v)(14 - 2v2 - 14) + (2v + 4v2 - 2v)(-7v + 19 - 19). -30v3 Expand (-2 + 5 - 7 + 2j)(-24 + 6j*2 + 24). 12j*3 - 24j*2 Expand (17 + 53 - 5)(0g - 6g + 0g). -390g Expand 2s2 + 2 - 2 + (-3s + 2 - 2)(-2s + 4s - s). -s2 Expand ((-4 - y + 4)(-1 - 1 + 13) - y - 5y + 3y)(y2 - 2y*2 + 2y*2). -14y*3 Expand (10 - 16 + 13)(-2i + i - i) + 2i - 4i + 4i + 4i - 8i + 8i. -8i Expand -3x - 29x*5 - 18x*5 + 59x5 + x3 + (0x - x + 2x)(2x*4 + 2x*4 - 3x*4) + 6x5 - x5 - 4x5. 14x5 + x3 - 3x Expand (7 - 4 + 2)(3i + 19 - 19) + 13i - 5 + 5. 28i Expand (15k - 29 + 29)(2 + 0 + 1)(-2 + 1 + 0)(0 + 6 - 3). -135k Expand (t*2 + 4t2 - t2)(5 - 5 - 1). -4t*2 Expand (5 - 12 + 1)(-y + 0y + 3y) + 5y - 2 + 2 + (0 + 5 - 3)(-4y + 2y + 0y) - 2y - 3y + 3y + 3y + y - 3y - 1 + 1 - 2y. -14y Expand 0z2 - 9z2 - z2 - z*2 - 2 + 2 + (2 - 2z - 2)(-z + 2z - 3z) - z2 + 2z*2 + 3z*2. -3z*2 Expand (4y + 2y4 - 4y)(-3 + 4 + 2)(14y - 10y - 7y). -18y*5 Expand (-m + m + 2m*4)(-3 - 1 + 3)(499 - 1043 + 904). -720m*4 Expand 69 - 5f - 69 + f*2 + (-1 + 4 - 1)(-f*2 + 2f*2 + 0f*2) - 3f*2 + 4f*2 + 12f*2. 16f*2 - 5f Expand (-67i - 136 + 136 + (-i + 3i - 4i)(0 - 3 - 3))(1 - 1 + i). -55i*2 Expand (19g*2 + 276g*2 - 66g*2)(2 - 4 + 3 + 2g). 458g*3 + 229g*2 Expand (0f + 4f - 2f)(39 - 29 - 60). -100f Expand (16m + 14m*2 - 16m)(30m*3 - 8m*3 - 2m*3)(-5 + 5 + 1). 280m5 Expand ((4t*2 - 4t*2 - 2t*2)(-t + t - t) + 2t2 + 3t*3 - 3t*2 + 2t*2)(383 - 383 - 31t). -155t*4 - 31t*3 Expand (-17x + 5x2 + 17x)(-x + 7x - 4x) + 5x*3 - 33x*2 + 33x*2. 15x*3 Expand (b + 0b - 2b)(-b - b + 3b) + (-5b + 0b + b)(-10b + 0b - 4b). 55b*2 Expand (-162k - 3 + 82k + 81k)(k - 3k + 0k). -2k*2 + 6k Expand (-2 + 4 + 0)(3o2 - 75 + 73 + o2). 8o2 - 4 Expand u - 2u + 0u + (2 + 2 + 0)(-3u + 4u - 2u) + u + u - u. -4u Expand (0 + 0 + 1)(11 + 7 - 10)(-3 + 6 - 5)(-16 - 4s + 16). 64s Expand (-3c + 0c + 4c)(0 + 0 + 5) - 117c + 27 + 0 - 22 - 5. -112c Expand ((-2c - c + 4c)(2 + c - 2) + 39c - 39c + 50c2)(c - 1 + 1). 51c3 Expand (34j - 19 + 19)(1 + 4 + 4 - 1 + 3 - 4 + (4 - 2 - 1)(-1 + 5 - 2)). 306j Expand 0w*4 + 2w*4 + 6w*4 + (w - 4 + 4)(-13w3 + 38w*3 + 27w*3). 60w*4 Expand (0 - 1 + 4)(0x3 - 4x*3 + 6x*3) + (-3x*2 - 2x*2 + 4x*2)(-8x + 19x + 0x). -5x*3 Expand 0v*2 + 2v*2 - 4v2 - v2 + v*2 - 3v*2 + 3 - 3 + 2v*2 + (4v - 4v - 2v)(3 - 2v - 3) - 6v2 + 6v*2 + 8v*2. 9v*2 Expand (1 - 3 + 4)(f - f + f)(60 + 182 + 222). 928f Expand (4y - 3y + 0y)((-2y3 - y + y)(2 - 2 - 2y) - 61y*4 - 21y*4 + 11y4 + y4 + y*4 - 3y*4). -68y*5 Expand 38 - 7b*4 - 38 - 2b4 + b4 + 3b4 + (2b*2 + 2b*2 + 0b*2)(-2 + 2 + 2b2). 3b*4 Expand (2v*2 - 11v*2 + 0v*2)(-3v - 4v + 2v) + 8v*3 + 0v*2 + 0v*2 + 0v*3 - 2v3 + v3. 52v3 Expand -5h3 + h3 + 2h3 + h3 - h3 + 2h3 + (-h2 + 0h + 0h)(2h - h + h) + 27 + h3 - 27 + h3 - 3h3 + 4h*3 + 2h*3 - 4h*3 - 2h*3. -3h3 Expand (12079 - 12102 - m2 + 8m2)(-2m - 2 + 2). -14m*3 + 46m Expand (-3 + 3 - 2h)(2 + 2 - 5) - 2h + 1 - 1 + (-4 + 3 + 4)(-h + 6h - 4h) - 21h + 2272 - 2272 - 2h + 0h + 0h. -20h Expand (0 - 2 + 0 + (-2 + 2 - 3)(6 - 4 - 1) - 2 + 0 + 3 + (3 - 1 - 4)(-5 + 4 + 2))(0q - 3q + 2q) - q + 1 - 1. 5q Expand (0q2 + 0q*2 - 2q*3)(578q - 340q - 383q). 290q*4 Expand ((-5 + 3 + 0)(4 - 1 - 1) - 1 - 1 + 3 + 4 - 5 + 0 + 1 + 0 + 0 + 1 - 1 - 1 + 0 - 6 - 2)(h3 + h3 - 6h*3). 48h*3 Expand (4 - 4 - 2)(-3z - 9 + 9) - 18 + z + 18. 7z Expand (-3 - 1 + 25 - 4l)(-2l + l - l). 8l*2 - 42l Expand (-o*2 - 14o + 14o + (o - 2o + 3o)(1 - 1 + o))(-o + 2 - 2) + 3 + 4o*3 - 3 - 2o*3 + 4o*3 + 0o*3. 5o*3 Expand (-6 + 3 + 1)(5y + y - 2y)(-y - 2y*2 + y + 6y*2 + 0y*2 - 4y*2 + (2y - 2y + y2)(-2 - 2 + 5)). -8y3 Expand (c + 2c - 2c)(18c2 - 18c*2 + 23c3 + c3 + 0c3 - 2c*3 + (-3c - 3c + 7c)(-3 + 3 + c2) + 2c*3 + c - c). 25c4 Expand (-t3 + 4t3 - t3)(-321t - 328t + 639t). -20t*4 Expand (2h*2 + 0h + 0h)(4h + 3h - h)(-6 + 2 - 4)(-2 + 1 + 3)(4 - 4 + 2h). -384h4 Expand (-3l + l*2 + 3l)(2l - 33l2 + 6l*2 + 76l*2). 49l*4 + 2l*3 Expand -55i + 93i + 176i + (-2 - 1 + 1)(0i - 3i + 5i). 210i Expand (-7n + 6n + 6n)(3 - 2n - 3) + 1 - 1 + 2n2 - n2 + 7n*2 + 6n*2. 4n*2 Expand (-2 + 2 + 2b)(b4 - 4b4 + b4 + (-4 - 1 + 6)(-2b*4 + 4b4 - b4) + 3b4 - b2 - 3b*2 + 0b*4). 4b*5 - 8b*3 Expand (1 - 2 + 0)(0 + 0 - 7)(7 + 16g*3 + 17g*3 - 34g*3). -7g*3 + 49 Expand (1 + 0 + 1)(-9c3 + 6c*3 + 14c*3)(-11c + 14 - 14). -242c*4 Expand (2 + 6 + 3)((1 - 4 + 1)(3u - u - 3u) + 0 - u + 0 - 6u - 5u + 4u). -66u Expand (-125 - 119 - 222 + 97)(-3j2 + 1 - 1). 1107j*2 Expand (4 - 4 - 2)(-255r5 + 1100r*5 - 511r*5) - 2r*5 + 5r*5 - 4r*5. -669r5 Expand -n + n + n5 - 2n4 + (108n - 195n + 118n)(0n4 - n4 - n*4). -61n*5 - 2n*4 Expand (-k - 2k - 4k)(k*2 + 0k*2 + 0k*2) + 14k - 217 + 0k3 + 2k*3 + 217. -5k*3 + 14k Expand 4v3 + 0v*3 + 15v*3 + (3v + v - 2v)(2v2 + 4v*2 + 0v*2). 31v*3 Expand (31 - 31 + 4q*2)((-4 - 3q + 4)(4q - 2q + 0q) - 3 + q2 + 3). -20q*4 Expand (-149h + 82h - 112h)(-h - 3h + 8h). -716h*2 Expand (6w4 + w4 - 5w4)(-6 - 3 - 1 - 5 + 3 + 1 + (0 - 1 + 0)(0 + 4 - 3) + 1 + 3 - 2). -20w*4 Expand (-2o3 + o3 + 4o3)(0 - 1 - 1) + 12 + 460o2 - 69o2 - 10 + o3. -5o3 + 391o*2 + 2 Expand (10n - 31 + 31)(2n - 14 + 10n - 10n). 20n2 - 140n Expand 8i4 - 282i*2 + 125i*2 + 138i2 + (-i + i2 + i)(2i*2 + 0i2 - i2). 9i4 - 19i*2 Expand (q + 2q - q)(5q*3 + 4q*2 + 8q*3 - 10q*3). 6q*4 + 8q*3 Expand (-15a - 29a + 26a)(5a*2 + 10a - 10a). -90a*3 Expand (17 - 4 + 5 + (1 - 1 - 1)(4 - 4 + 4))(-2j - 3j + 4j)(4j - j - 2j). -14j*2 Expand (0d - 3d + 5d)(2d - 2d - 2d*2) + 4d*3 - 5d*3 - 2d*3 + (-2d + 2d + 2d*2)(4d - 2d - d) + (0d3 - 4d*3 + 3d*3)(7 + 4 + 2). -18d3 Expand 3f*4 - 2f*4 - 5f*4 + (0f3 + f3 - 2f3)(0f - 4f - 4f). 4f*4 Expand (-125o + 1 - 4 + 124o)((-4 + 0 + 3)(-1 + 1 - o) + (-2o + 1 - 1)(3 - 1 + 1)). 5o*2 + 15o Expand (-2p - 3 + 3 + (1 - 2 + 2)(3 - 3 + 2p) - p - 3p + 3p + 3p + 5p - 3p)(16p*2 + 16p*2 - 43p*2). -44p*3 Expand (g - 10 + 8 - 9g)(0 + 1 + 0). -8g - 2 Expand ((3m + 0m - m)(6 - 3 - 5) - 33m - 132 + 132)(-2m*3 + 3 - 3). 74m*4 Expand ((-2 + 2 + t)(2t - 2t + 2t) + 2t*2 - 3t*2 + 0t*2 - 455 - 19t*2 + 455)(t - 2t - 4t)(-1 + 1 + t2). 90t*5 Expand (-4v*2 + 3v + 2v2 - 4v)(-4987v*3 + 10125v*3 - 4775v*3). -726v*5 - 363v4 Expand d3 + d*3 - 3d*3 + (1 - 2 + 3)(0d3 - d3 - d3) - d3 + 8d*3 + 7d3 - d3 + 3 - 3. 8d3 Expand (-2d + 3d + 4d)(-31d + 23d - 14d). -110d2 Expand -5l + l + 2l + l + 2l - 4l + (1 + 1 + 0)(2 - 2 - l) + (-3 - 3 - 1)(1 - 2l - 1 + (4l + 0l - l)(3 + 2 - 1)). -75l Expand (-3b + 4b - 3b)(2 + 0 - 3) + 166b - 544b + 17b. -359b Expand (-v - 31v + 8v + (2v + 4v - 4v)(0 + 2 - 4) + (3 + 1 - 2)(3v - 5v + 0v))(-6 + 0 + 1). 160v Expand (-5 + i*4 + 5 - 2i)(584i + 98 + 77 - 175). 584i5 - 1168i**2
Let h = 675 - 615.2. Let w = h - 67. Let a = w - -5.2. What is the closest to a in 3/5, 0, 0.1? 0 Let t be (0 + 2/8)-3. Let s = -3977 + 3977. Suppose -4w + w - 3x = 3, 4w - 5x = -40. Which is the closest to s? (a) t (b) -4 (c) w a Let j be 8 + 0 + -12 + (0 - 0). What is the closest to -3/38 in -2, j, 5? -2 Let y be 1196/208 + 3(-35)/60. Let w be 1/(-3) + (-1)/(-1). Which is the closest to w? (a) 1/9 (b) -3/16 (c) -2/15 (d) y a Let c(v) = -v*2 + 5v + 7. Let y be c(6). Let j = -59.41 - -61.41. What is the closest to y in 1, j, 5? 1 Let y be ((-336)/(-308))/(3 + 155/(-55)). Which is the closest to y? (a) 9 (b) 0.04 (c) 1/4 (d) -0.3 a Suppose 0k = -5k + 15. Suppose -r = 27 - 23. Let t be r/2421 + 4. What is the nearest to -1 in t, k, 0.3? 0.3 Let q be (16 - 2185/138)/((-3)/18). Which is the closest to -21? (a) q (b) -2/3 (c) -4 (d) 6 c Suppose 0 = -9h - 0 + 45. Let m be ((-168)/420)/(((-32)/(-10))/(-2)). What is the nearest to m in h, 4, 10? 4 Let u = -2367.9 - -2368. Suppose 0 = -w - 3w + 40. Let k = -13 + w. Which is the nearest to 0? (a) u (b) -0.01 (c) k b Let k be (6/(-26))/(466/(-3029)). What is the nearest to -1/15 in -0.04, k, -1? -0.04 Let w = 2487 - 2482. What is the closest to -2/3 in 4/3, w, -1/10, -4/25? -4/25 Let y be (-1)/(4/20) + (21 - (-780)/(-50)). Let s = -0.3 - -0.8. Let z = -1 + s. Which is the nearest to y? (a) z (b) 0.4 (c) 1 b Let o = -0.35 - -1.85. Let x = o + -1.7. Let t(g) = g - 10. Let k be t(10). Which is the nearest to -4? (a) x (b) 0.5 (c) k a Let f = -286.5 + 283. Let m = f + 4.5. Suppose 0 = -g - 2g + 15. Which is the nearest to m? (a) -1/6 (b) -5 (c) g a Let n = 4355 - 4352. Which is the closest to 2.71? (a) 5 (b) -0.3 (c) 1 (d) n d Let p be (1 - 3)/(6/(-1983)). Let c = -7273/11 + p. What is the nearest to 0.1 in 0.3, c, -5, 0.5? 0.3 Let m = 16976 + -16981. What is the nearest to 94 in 1/3, 0.3, m? 1/3 Let n = 1935 - 1934.7. Let o = 130 + -135. Which is the closest to -0.1? (a) -1 (b) n (c) -3 (d) o b Let w = -2.7 - 1.3. Let i = 5997 + -5990. What is the closest to 1 in i, 2/9, w? 2/9 Let v = -37 + 32. Suppose 5t = -5m + 35, -42t - 3m = -37t - 29. Which is the closest to -0.1? (a) t (b) -0.3 (c) -1 (d) v b Let g = -2/5861 + -5851/29305. Let z = 7 + -11. Which is the nearest to g? (a) 8 (b) -0.5 (c) z b Let v = 7/1542 - 359/3598. What is the closest to -0.2 in v, -5/4, -0.1, -0.5? -0.1 Let p = -1.6822 + 1.7822. Which is the closest to p? (a) 0.1 (b) 0.08 (c) -51 (d) -1 a Suppose -5y - 3i = -905, 4y - 5i = 600 + 161. Let f be (-6)/27 + y/180. What is the closest to 1 in f, -0.7, -2? f Let k = -483/10 - -48. Let m(d) = d2 + 3d + 15. Let t be m(-8). Let o = -274/5 + t. Which is the closest to 0? (a) -4 (b) o (c) k b Let d(v) = -3v2 + 42v + 97. Let l be d(16). What is the closest to l in 0.3, -2/39, 2/3? 2/3 Let n be (-16)/40((-34)/12 + 2). Let q = 629 - 628. Let s = 0.02 - 0.42. What is the closest to q in -7, s, n? n Let m be (5/(2975/14))/(6/(-30)). Let g = 0 - 4. Which is the closest to 2? (a) m (b) g (c) -5 a Let m(q) = q3 - 8q*2 + q + 40. Let g be m(7). What is the closest to 1/4 in -0.4, 1, g, 0.02? 0.02 Let g = -2473 + 2472. What is the nearest to g in 0.2, 8, -0.21? -0.21 Suppose 8m - 1012 - 460 = 0. Let n = m - 168. Which is the closest to 0? (a) 5 (b) n (c) 4 c Suppose -p = 9 + 19. Let r be 2/7 - (-22)/p. Suppose -47j - 1151 = -1339. Which is the nearest to r? (a) j (b) -1 (c) 1 b Let h = 94 + -82. Let j(m) = 18m + 427. Let w be j(-24). Which is the closest to h? (a) 0.1 (b) w (c) 2/21 a Let a = 49/66 - 10/11. Let o = 27365 + -27369. What is the nearest to 0 in -1, o, a, -1/8? -1/8 Let l = -1311 - -1310. Let j = -6.6 - -2.6. What is the closest to j in -5/6, -2, l? -2 Let x be (47 + -1)/((-10)/(-570)-15). Let o = 175 + x. Which is the closest to 3? (a) -3 (b) -5 (c) o c Let x = -13.5 + 17. Let f = -307.4 - -308. Let l = 0.4 - f. Which is the closest to l? (a) -1 (b) x (c) -2 a Let d = 23.1 + -24.1. What is the closest to 8 in d, 3, 1.3, -2/13? 3 Let s = 6524 - 6519. Which is the closest to -0.31? (a) 3 (b) -2 (c) s (d) -4 b Let s = -1600 + 1599. What is the nearest to 1/5 in s, 4, -1/3? -1/3 Let m = -23196 - -162370/7. Which is the nearest to -14? (a) m (b) -28 (c) 3 (d) -0.4 d Let d be 6 + -5 - 3 - 5181/(-1035) - 3. What is the nearest to -0.4 in 1/9, d, 1/5? d Let p = 21 + -13. Let j be -3 - -1p/12. Let t = -1.38 - -0.38. Which is the closest to t? (a) j (b) -1 (c) 0.1 b Let l be (40/150)/(10/(-25)). Which is the nearest to -2/3? (a) 0 (b) -1/178 (c) l c Let k = -9211.5 - -9211. What is the closest to -4 in -1, -69, k? -1 Let m = 137.06 - 124.06. Which is the nearest to 6? (a) -5 (b) 0.1 (c) -0.3 (d) m b Let m = -523 - -140. Let n = m + 385. Which is the nearest to 0.13? (a) n (b) 1/5 (c) -5 b Suppose 3m + 9 = 186. Let d(w) = 6w*3 - 50w*2 - 99w - 9. Let f be d(-2). Let y = m + f. Which is the closest to -0.1? (a) -4 (b) -0.01 (c) y b Let n = -872 + 968.3. Let r = n + -95. Let p = -2.7 - r. What is the closest to 0.1 in p, -3, -5? -3 Let w = 0.25 - 2.45. Let i = 29.7 + -27. Let s = w + i. What is the closest to -2 in 0, -2, s? -2 Let k(x) = -2x2 - 68x + 309. Let f be k(-38). Which is the nearest to -2? (a) f (b) 17/2 (c) 0.058 c Let w = 12646 - 12641. What is the nearest to -0.1 in 0.3, w, -0.9? 0.3 Let o = -138 - -133. Let p = -880 + 883. Which is the closest to o? (a) -5 (b) p (c) -1/6 a Let o be 1156/(-76 + -2) - -9. Which is the closest to -3/10? (a) -3/8 (b) o (c) -0.4 a Let s be (-33)/(297/(-8)) + ((-140)/63)/(-5). Let n = -2.3 + 2. Which is the closest to 0.7? (a) n (b) 4 (c) s (d) -1 c Let a = 0.074 - 0.074. Let y = -19407/14 - -2773/2. What is the nearest to 1/2 in -1, a, y? y Let z(l) = -l3 + 6l*2 - 5l + 31. Suppose 12i = -11 + 83. Let y be z(i). Which is the nearest to y? (a) 1/8 (b) 2/9 (c) -4 (d) -4/7 b Let b be (-22)/187 - 70/(-17). Suppose -d + 2p + 45 = bd, 27 = 3d + 3p. Suppose d = -4x + 5. What is the closest to x in -2/9, 4, 2? -2/9 Let m = 134.8 - 134.6. Which is the nearest to 1? (a) 4 (b) 211 (c) m c Suppose 5p + 15 = 3n + 25, -p - 26 = 5n. Let g be 12(2 + 12/(-9)). Let v = g + -13. What is the closest to p in v, -1/3, -2? -1/3 Let g = -0.75 - -16.15. Let j = -10.4 + g. Which is the nearest to 1? (a) j (b) -0.1 (c) -1/2 b Let s = -56.72 - -55.72. Which is the closest to -0.3? (a) -3 (b) 0.24 (c) s (d) 2/19 d Let f = 3.8534 + 1.1466. Which is the nearest to 3/7? (a) -2 (b) -3/5 (c) -6 (d) f b Let u = -0.5618 + 0.3618. What is the closest to u in -32, -1, 1? -1 Let s = 0.8 - 1.1. Let r be (2 - 2)/((-1)/(-2)1036/(-518)). Which is the nearest to s? (a) -1 (b) r (c) 2/11 b Let m = -674/63 + -21137/315. Let y = 78 + m. Let x(g) = -g2 + 144g - 1. Let q be x(0). Which is the closest to y? (a) -3 (b) q (c) 0.5 c Let c = -7246 - -7243. What is the nearest to 3/5 in c, 2/77, 4/9, 1/2? 1/2 Let r = 0.008 - 0.508. What is the nearest to 1 in -5, 0.0048, -2/7, r? 0.0048 Let y = -8 + 4. Let g = -135.21 + 135.41. Which is the nearest to g? (a) y (b) 0.5 (c) 6 b Let q be -3(20/42)/5. Let l = 3149/6 - 519. Let k = 13/2 - l. Which is the nearest to k? (a) 0.1 (b) q (c) 3/7 c Let i be (-18)/30(14/7 - (-32)/(-6)). Which is the closest to 35? (a) -6 (b) -4/3 (c) -1/2 (d) i d Let m be (-24)/16(-16)/(-6). Let k be 5/(15/m) - -3. Let v = -12859 + 12864. Which is the nearest to 1? (a) 0.5 (b) v (c) k a Let d be 87 + 3 + (-3 - 3). Let u be (-9)/4 + d/(-112). Which is the closest to u? (a) -4/5 (b) 2/19 (c) -0.4 a Let h = -1/34 - -177/238. Let o = h - 3/14. Let s = -8.2849 - -10.2849. Which is the nearest to s? (a) o (b) 3 (c) 3/4 b Let o = 3.2 - -0.8. Let f = 24.5 + -15. Let p = f + -11.5. What is the nearest to p in 0, o, -5? 0 Let v = 1327 + -1326. What is the nearest to 4 in 13, 3/5, v? v Let y = 1.9 - 2. Let v = -49 - -362. Let c = -313.3 + v. What is the nearest to y in 4/5, -28, c? c Let w be 1 + (15 + 0)/3. Let k be w/(-6)(0 - -3). Let u be 2/(-3)16/12. Which is the nearest to -2/7? (a) k (b) -11 (c) u c Let r = 382209 + -7259119/19. Let h = r - 150. Which is the closest to 0.1? (a) -1 (b) -44 (c) h (d) 1/5 c Let h = -3621 - -3620. Which is the closest to -14? (a) 3 (b) -5 (c) h b Let t = 935.5 + -936. Let n = -3.1 - -3. Let f be (-2 - -6)*(-1)/(-10). Which is the closest to -1/2? (a) f (b) t (c) n b
Simplify (i/i(-1/3))(-6) assuming i is positive. i*(-8) Simplify (o/(oo*(5/6)o))(-10) assuming o is positive. o(55/3) Simplify (l*(-2)ll(-6))(2/59) assuming l is positive. l(-14/59) Simplify (iii(-1/2))(10/7) assuming i is positive. i(15/7) Simplify d/(dd*(-2/11))dd(5/3)d assuming d is positive. d(127/33) Simplify (d/d(5/4))/(d15/d) assuming d is positive. d(-57/4) Simplify (a*(2/15)a/((((aa(a*(-2/11)a)/aa)/a)/a)/a))(1/2) assuming a is positive. a(217/330) Simplify h/(h(1/12)/h)h15/h assuming h is positive. h(191/12) Simplify (n(-1/4))(26/9) assuming n is positive. n*(-13/18) Simplify (i(i*9i)/i)/ii/i(-1/7)(i/i(2/9))3 assuming i is positive. i(262/21) Simplify (z8/((z(6/5)/z)/z))/(z(2/3)z)(-18) assuming z is positive. z(194/5) Simplify a(-26)aa(a/(a/a(-1/16)))/a assuming a is positive. a(-401/16) Simplify (gggg(-7/3)g)/g(2/43) assuming g is positive. g(209/129) Simplify d/(dd(5/7)/dd)d/d(5/9) assuming d is positive. d(-17/63) Simplify y(y/(y/y*(-6)))/yy*4/yy/y*(-3/4)y(-10)/y assuming y is positive. y(-49/4) Simplify (((x/(x/(xx(-3/5))))/x)/(x/(x/x(-1/5))))/((x0/x)/x)6 assuming x is positive. x(58/5) Simplify jj/j*11(j/(j*(-2/77)jj))/j assuming j is positive. j(-845/77) Simplify (xx*37x)/(x/(x/x(-25))) assuming x is positive. x64 Simplify (w(-2/3))(-7/10)(w(-4)/ww)/w2 assuming w is positive. w(-83/15) Simplify v*(-2)v*(-2/5)(v(-1))50 assuming v is positive. v*(-262/5) Simplify ((d(d/(dd/(d(-7)d)d))/dd)/d6)/(d(-1/9)/(d(d0d)/d)) assuming d is positive. d(-107/9) Simplify (d(-3)/(d/d*(-3/8)))/(dd*(-1/11)d1) assuming d is positive. d(-553/88) Simplify u*(-6)((uuu(-1))/u)/u assuming u is positive. u(-7) Simplify ((t/((t/(tt(-4/13))t)/t)t)/(t(-5)t))(-32) assuming t is positive. t(-2368/13) Simplify ((r*4r)/rr)/(r(-2/15)r)r(2/5)/rr*(-2/5)r assuming r is positive. r(62/15) Simplify (g(2/15)gg1)/(g(1/8)gg/g(-6)) assuming g is positive. g(-719/120) Simplify ((l/((l/l0)/l))(-25/6))(-11/8) assuming l is positive. l(275/48) Simplify (qq(-1)q)*(-1/3)/((qqq/((qqqq(qq*(-1/4))/qqqq)/q))/(q*4q)) assuming q is positive. q(89/12) Simplify (a(-2/45))(-2/21) assuming a is positive. a(4/945) Simplify (w(-2/17))(1/5) assuming w is positive. w(-2/85) Simplify (x(-3)x)/xx(x/x(4/7))/x assuming x is positive. x(-18/7) Simplify ((mm(-2/9))27)(-50) assuming m is positive. m(-1050) Simplify (p2)(-42)p(-2/9)(ppp(-1/4))/p assuming p is positive. p(-3005/36) Simplify x/(x/(xx(-8)/x))xxx/x9 assuming x is positive. x(-14) Simplify (jj(-2))(-45) assuming j is positive. j45 Simplify (((s(-2)/s)/s)(-24))(-2/17) assuming s is positive. s(-192/17) Simplify ((u(-1))(-2/21))10 assuming u is positive. u(20/21) Simplify (s/(ss12))39 assuming s is positive. s(-468) Simplify b(2/35)b(1/4) assuming b is positive. b(43/140) Simplify (yy*0yy)(-1/28)/(y(3/2)/(y/(y(-2/9)/y))) assuming y is positive. y(155/252) Simplify d(1/6)/d(-8) assuming d is positive. d(49/6) Simplify ((g(1/4)/g)(3/4))(-2/7) assuming g is positive. g(9/56) Simplify (p(2/7)p0)5 assuming p is positive. p(10/7) Simplify l(-15)/l41 assuming l is positive. l(-56) Simplify ((f/f4)/f)(-38) assuming f is positive. f152 Simplify ((z/z(-14/9))/(zz(-5)))(-2/109) assuming z is positive. z(-118/981) Simplify ((hh*1/hh)/hhh(-8))35 assuming h is positive. h*(-210) Simplify ((yy1)/y)(-13)/(y(1/2)/y(-2/9)) assuming y is positive. y(-247/18) Simplify (m(-29))(-4/43) assuming m is positive. m(116/43) Simplify (f*(-2/15)ff(-4)f)/(f/(ff/f0)f/(f/((f/(f*(-2/23)f))/f)f)) assuming f is positive. f(269/345) Simplify (cc(2/11))(4/5) assuming c is positive. c(52/55) Simplify (w/(w/(w/w(-4/3))www))(-2/55) assuming w is positive. w(4/165) Simplify (o/(o(1/4)o))(-5/6) assuming o is positive. o(5/24) Simplify (mmm*(-1)mm/(m/(m/(m0m)mm)m))/(m/m(-1/8)m1) assuming m is positive. m(7/8) Simplify hh(-2/5)hh(-1/12)(h(-1/4))30 assuming h is positive. h*(-359/60) Simplify uu*3u(1/7) assuming u is positive. u(29/7) Simplify (f/f*2)/(ff/(f/f*(-4/5)))f*(1/12)f/(f1/f) assuming f is positive. f(-7/60) Simplify (x(-16)/(x(-19)x))(-48) assuming x is positive. x(-96) Simplify (y/(y/(y/y1))y(-5))(-4) assuming y is positive. y20 Simplify ((x/(x/((x/x5)/x)xx))/x(11/2))(-1) assuming x is positive. x(25/2) Simplify (n(-5))(1/25) assuming n is positive. n(-1/5) Simplify t*(1/3)/((tt(-2/43))/t) assuming t is positive. t(49/129) Simplify ((w1)(1/37))(-8) assuming w is positive. w(-8/37) Simplify (o(-1/4))(-19)/((o/(((oo(1/6)/ooooo)/o)/o))/(o(-8)o)) assuming o is positive. o(-13/12) Simplify ((b/(b/b(-16)))/b(2/19))(-50) assuming b is positive. b(15300/19) Simplify (g/((g(-2/7)/g)/g))*(2/17)(g(-1/3))47 assuming g is positive. g(-5455/357) Simplify (l(-7)l)/ll(-5) assuming l is positive. l(-12) Simplify (i*(1/25)/i)/(i/(ii(-22)/i)) assuming i is positive. i(-599/25) Simplify (o/(o*(-5)o)o)21 assuming o is positive. o126 Simplify (a(-7)a*(2/13)a)(1/3) assuming a is positive. a(-76/39) Simplify ((i/i*(-8))/((ii*(-7)/ii)/ii))17 assuming i is positive. i255 Simplify (g/g(-1))17/(((g(g*5/g)/g)/gg)/(g(g1g)/g)) assuming g is positive. g32 Simplify (t2)(15/11) assuming t is positive. t(30/11) Simplify j/(j/j*14)j(3/5) assuming j is positive. j(73/5) Simplify (aa(-1)/a)(9/2)/(a4a(-3)/a) assuming a is positive. a(-9/2) Simplify ((z/(zz/(zz*1)))/(zz/z(2/7)))/(z6z/z(-1/6)z) assuming z is positive. z*(-373/42) Simplify ((yy*(-2/3)y)(-27))(3/16) assuming y is positive. y(-27/4) Simplify (s(-2/5)/s(-2/29))/(s(-2)/sss)(11/8) assuming s is positive. s(1211/1160) Simplify i/i*(-2/45)(iiii(-1/33))/iiii assuming i is positive. i(2977/495) Simplify (f/((f/f15)/f))(-3/8) assuming f is positive. f(-6) Simplify ((z/z*0)/z)/zz(z/((z(-6)/z)/z))/zz*4z4/z assuming z is positive. z15 Simplify (f22)(9/2) assuming f is positive. f99 Simplify (d(2/5)d)43 assuming d is positive. d(301/5) Simplify ((hh/h*(3/4))/h)/(hh*(2/19))h(-5)/h(-2) assuming h is positive. h*(-293/76) Simplify (jj/(jjj*(-1/30)/j)j)/jj(1/4) assuming j is positive. j(77/60) Simplify ooo4o/(oo(-3/5))(o/o1)(-5) assuming o is positive. o(33/5) Simplify (w/w(-1)w(3/4))/(w/(w(-5)w)ww(-4)) assuming w is positive. w(3/4) Simplify k*(-13)kkk((k/(((k/k(1/12)k)/k)/k))/kk)/kk assuming k is positive. k(-107/12) Simplify o(-1/9)ooo/(oo(o/(o/((oo*26oo)/oo)o))/o)o assuming o is positive. o*(-226/9) Simplify ((h/(((h/(hh(2/3)/h))/h)/h))(3/14))(-30) assuming h is positive. h(-120/7) Simplify (b*2/(bb/(b*(-6)b)))(-2/105) assuming b is positive. b(2/21) Simplify ((a/(a/(aaa*(-7)a)))/aa(a*(-3/4)a)/a)(-8/5) assuming a is positive. a(38/5) Simplify (yyy0)(-1/88)y/(y/(y/(y/(y(-2/13)yy))))y/y(-3/4) assuming y is positive. y(511/143) Simplify s*(-2/17)ss(-19) assuming s is positive. s(-308/17) Simplify (s(1/4)s*(-5/4)/s)/((ss(-2/3))/s2) assuming s is positive. s*(-1/3) Simplify (q/(q(q/(q0/q))/q))31 assuming q is positive. q(-31) Simplify (m/m(2/7))(1/8)/(m(-1/2))49 assuming m is positive. m(1377/56) Simplify (iii*3i/i7)25 assuming i is positive. i(-25) Simplify ((o(-4/5)o)/(o/(oo*6o)))6 assuming o is positive. o(216/5) Simplify ((g/(gg2))25)40 assuming g is positive. g(-2000) Simplify (j(-1)jj)(-3/13)/(((j1/j)/jj)/j)(6/13) assuming j is positive. j(3/13) Simplify (uu(-2/57))(6/11) assuming u is positive. u(10/19) Simplify (((uu/(u*0/u))/u)/uuu)16 assuming u is positive. u48 Simplify f/f(1/5)ff(-1/28) assuming f is positive. f(247/140) Simplify (j(1/30)j(-8))(-39) assuming j is positive. j(3107/10) Simplify (g/g1)/g*4(g*(1/2)g)(-3/8) assuming g is positive. g(-73/16) Simplify (f(-5/2))5 assuming f is positive. f**(-25/2)
Calculate the remainder when (-4)/(-2)(-9288)/(-144) is divided by 33. 30 Let i be ((-9)/(-4))/((-3)/(-8)). Suppose 0 = -x + 4c + 14, -3x + x - 3c = -i. Suppose -10q = -xq - 212. Calculate the remainder when q is divided by 27. 26 Let n(x) = 1316x - 3929. What is the remainder when (2 - -7)/((-2)/(-12)) is divided by n(3)? 16 Suppose 7714 = -54p + 8200. Calculate the remainder when 8151 is divided by p. 6 Let j(o) = 6o2 - 4o - 3. Let b be (1 - 6/4)6/(-1). Suppose -u + 2y + 61 = -47, 334 = bu - y. Calculate the remainder when u is divided by j(-2). 25 Let p = 144 - 147. Calculate the remainder when 220 is divided by (-3)/(-9) - -1(-134)/p. 40 Let y(g) = -g*2 + 26g - 27. Let j be y(10). Suppose -5r = 5x - 161 - 54, 0 = 3x + 4r - j. What is the remainder when 41 is divided by x? 2 Let g be 923 + ((-24)/14 - (-8)/(-28)). Suppose -12x + g = 165. Let v = -2 + 24. What is the remainder when x is divided by v? 19 Suppose 14t = 12t - 8. What is the remainder when 34 is divided by (-134 - -1)t/28? 15 Let k = 5253 + -4806. What is the remainder when k is divided by 19? 10 Suppose 187 = 3z - 5m, 2z - 2m - 114 = -4m. Suppose 2u = 14p - 9p + 62, p = -3u + z. What is the remainder when 56 is divided by u? 14 Let q = 23973 - 23095. What is the remainder when q is divided by 167? 43 Let v(g) be the second derivative of -g5/20 - g4/4 + 3g*2/2 + g. Calculate the remainder when (32/(-64)7)/((14/(-40))/1) is divided by v(-3). 1 Let g = 7994 - 7951. What is the remainder when 287 is divided by g? 29 Let b(f) = -f*3 - 11f*2 - 11f + 3. Let w be b(-10). Suppose 0 = -wq + 8q + 45. Calculate the remainder when 57 is divided by 272/q - (-12)/(-54). 27 What is the remainder when (1425/20)/((-1)/(-4)) is divided by -42((-244)/56 - 14/(-4))? 33 Suppose 9a + 92a - 12672 = -187a. Suppose 4r + 173 = 1401. What is the remainder when r is divided by a? 43 Suppose 110 = -5s + 390. Suppose -256r + 40r + 20952 = 0. What is the remainder when r is divided by s? 41 Suppose 1192g - 6897 - 26479 = 0. Let x = -286 - -507. Calculate the remainder when x is divided by g. 25 Let r be -5 - (-35)/213. Suppose 12t + 25 - 265 = r. Calculate the remainder when 377 is divided by t. 17 Suppose -575w + 572w = -2o - 847, o - 4 = 0. What is the remainder when w is divided by 33? 21 Suppose 72m = 75m - 24, 3a - m - 127 = 0. Suppose -239 = -d + 5. What is the remainder when a is divided by d/10 + 4/(-10)? 21 Let h(x) = 3x*2 - 12x - 33. Let k be h(14). Suppose n = -5w + k, 29 = 3w + 3n - 196. Let g = 70 - 50. What is the remainder when w is divided by g? 18 Let h(d) = -6d - 23 - 7 - 14. Let o be ((-1)/3)/(5/(-720)-6). What is the remainder when 11 is divided by h(o)? 3 Let w = -8197 - -8250. Calculate the remainder when 946 is divided by w. 45 Suppose -17f - 9177 = 6f. Calculate the remainder when (-2)/(-19) + (-14721)/f is divided by 17. 3 Let c = 16552 - 16545. Calculate the remainder when 174 is divided by c. 6 Suppose 32b + 3797 = 14773. Let r = b + -291. Calculate the remainder when r is divided by 20. 12 Suppose -4t - 3388 = -158t. What is the remainder when 224 is divided by t? 4 Let h(t) = 4t - 10. Let z(m) = -8m - 42. Let o be z(-6). Calculate the remainder when 206 is divided by h(o). 10 Suppose -3r = -f - 7r - 50, 2f + 40 = 4r. Let v = 42 + f. Suppose v = -2o + 3o. What is the remainder when 47 is divided by o? 11 Let p be (-6)/(-8)40/1. Let o = p - 31. What is the remainder when 45 is divided by (-7)/((-14)/30) - (0 + o)? 13 Suppose 0 = -27d + 20d + 525. Let j = 60 - d. Calculate the remainder when 8/(-20) - 351/j is divided by 5. 3 Let o(s) = s3 + 5s*2 - 21s - 70. Calculate the remainder when 29 is divided by o(-3). 7 What is the remainder when 23959 - 266/3996/(-4) is divided by 34? 31 Suppose r - 2t = 4r - 38, t = -4r + 49. Let a = 613 + -608. What is the remainder when r is divided by a? 2 Let a(i) = -8i*3 - 22i*2 - 68i - 32. Calculate the remainder when a(-3) is divided by 6. 4 Let a be 20/(0 + 4/34). Calculate the remainder when 3 + 6/(12/a) is divided by (63/56)/((-4)/(-160)). 43 Let o = 3103 + -3094. What is the remainder when 388 is divided by o? 1 Let t = -5858 - -8441. What is the remainder when t is divided by 17? 16 Calculate the remainder when 199 is divided by (909/(-45))/(2/(-10)). 98 Let u = -79 - -80. Let t(o) = 109o2 + 22o - 21. What is the remainder when t(u) is divided by 8? 6 Let s = -8110 - -8250. What is the remainder when 160 is divided by s? 20 Let r(p) = -148p - 5158. Calculate the remainder when r(-46) is divided by 236. 234 Suppose 5z = -2j + 70, 0j + 2j - 3z - 70 = 0. Let x(g) = 0 - 18 - 2 - 23g2 + 29g + g*3. Calculate the remainder when x(22) is divided by j. 29 Let a(d) = -3d*3 + 4d*2 + 31d + 36. What is the remainder when 648 is divided by a(-3)? 48 Suppose 22 - 141 = -7w. Let y = w + -9. Let g(n) = n3 - 8n*2 + 3n - 4. What is the remainder when 98 is divided by g(y)? 18 Suppose -3m = 2j + 97, 0 = 4m - j + 4j + 129. Let s = 98 - m. Suppose -4k - k + s = 3w, 2w - 4 = 0. Calculate the remainder when 49 is divided by k. 24 Let a(b) = b3 - 255b*2 + 12b - 3017. Let o = -87 + 162. Calculate the remainder when o is divided by a(255). 32 Suppose -500m + 24540 = -16960. Calculate the remainder when m is divided by (-5)/(-2)8 - -2. 17 Let o = -2826 - -2849. Let p be (6 - 7)(5 + 0). Let c = 16 + p. What is the remainder when o is divided by c? 1 Suppose -5l + 3v + 265 = 0, 87l - 7v = 83l + 212. Calculate the remainder when l is divided by 26 - (9/(-3) + 1). 25 Let m = 60543 + -60475. Suppose -2o = 3v - o - 7, 0 = -v - o + 1. Suppose -vu + 42 + 0 = 0. What is the remainder when m is divided by u? 12 What is the remainder when 10 + (2 - 0) - (-460 + -4325) is divided by 32? 29 Suppose 0 = 6a - 3a + 2q - 1018, -5a + 5q = -1730. Let j = a + -304. Calculate the remainder when 74 is divided by j. 36 Let g(t) = -3t2 + 4t*2 + 5t*2 + 2t + 0t3 + t3 + 5. Let s(o) = -o2 + 3o + 42. What is the remainder when s(4) is divided by g(-5)? 18 Suppose -24u + 25u = 0. Suppose -i + u = -1. Calculate the remainder when (-105)/(-9)(i + 2) is divided by 20. 15 Let f(c) = -c3 - 32c*2 + 30c + 3. Let z be f(-33). Let h = z - 67. Calculate the remainder when 417 is divided by h. 32 Let p = 141 + -129. Calculate the remainder when (-155)/(-5)10 + -1 is divided by p. 9 Let j(u) = 12u + 92. Let t be j(-8). Calculate the remainder when (30/t)/(-15)346 is divided by 12. 9 Suppose 3r - 259 = -49. Let i(k) = 15k + 129. What is the remainder when r is divided by i(-6)? 31 What is the remainder when (-63)/84(-23424)/18 is divided by 82? 74 Suppose -2016 = 58q - 130q + 51q. What is the remainder when q is divided by 2? 0 Suppose 0 = -5d + 3m + 14094, 2d - 8m + m = 5684. Calculate the remainder when d is divided by 128. 126 Let j = -204 + 206. Suppose 3 = -n - 1. What is the remainder when (-2)/n40/10 is divided by j? 0 Let f be (-4 + 4 + -3)128/6. Let g = f + 81. Suppose -2l + 25 + g = 0. Calculate the remainder when 58 is divided by l. 16 Let m(h) = 5h - 15. Let f(v) = 5v. Let a be f(8). Suppose -4r - 4r + a = 0. Calculate the remainder when 17 is divided by m(r). 7 Suppose -2v + 12 = -4u, 5u + 30 = 5v - v. Suppose vn - 5n = -4w + 157, -2n = -2w - 52. Calculate the remainder when 84 is divided by n. 26 Let p be (-940)/18 - 34/(-153). What is the remainder when (-3)/6p/(4 + -3) is divided by 6/1228/1? 12 Let t be 1/(-2)(9 + -9). Suppose t = 14i + 4i - 306. What is the remainder when 779 is divided by i? 14 Suppose 3y - 970 = -310. Suppose 760 = -5p + y. Calculate the remainder when 71 is divided by (13/39)/((-2)/p). 17 Suppose 5y - 3y = -4o + 146, -2y + 138 = -4o. What is the remainder when 800 is divided by y? 19 Suppose 3b = 2g + 7b - 4, -2g - 2b = -14. Suppose 3f + 6 = 6f. Calculate the remainder when ((-121)/(-22))/(f/16) is divided by g. 8 Let p be 5/(-1)(-4)/10. Suppose -40n + 714 = -23n. What is the remainder when (5/5)/(p/162) is divided by n? 39 Let z(u) = 2u - 9. Let o(m) = -53m + 1275. What is the remainder when o(18) is divided by z(9)? 6 Suppose -5f - 4b + 28 = 0, 6 = f + 2b - b. Suppose 3n = q - 20, fn + 3q + 12 = n. Let t = 0 - n. Calculate the remainder when 21 is divided by t. 3 Suppose 2l + 2l = 4o - 32, -4o + 3l = -29. Let x(v) = 6v + 42. Let i be x(-6). What is the remainder when 17 + (i - 3) + -4 is divided by o? 1
Let y(s) = 25s2 + 37 + 36 - 33. Let a(d) = 2d*2 + 3. Let r(z) = -40a(z) + 3y(z). Let g(h) = 3h*2. Give r(g(w)). -45w*4 Let o(s) = 7690s*2. Let u(m) = -m. Determine u(o(v)). -7690v*2 Let y(j) = -31j*2 + 4. Let v(k) = -31k*2 + 5. Let a(u) = -4v(u) + 5y(u). Let g(c) = 3c. Calculate a(g(i)). -279i2 Let t(s) = s2 + 2. Let c = 8 + -2. Let u(w) = 11 + 5w*2 + 0w*2 + 0w*2 + 0w*2. Let n(f) = cu(f) - 33t(f). Let q(o) = 2o*2. Give n(q(y)). -12y*4 Let f(m) = -2m. Let p(z) be the second derivative of -z4/4 - z. Let d = 4 - 3. Let g(n) = -n2. Let a(q) = dp(q) - 2g(q). Give f(a(y)). 2y2 Let u(b) be the third derivative of b4/12 + 2b2. Let t(f) be the first derivative of -f3/3 + 5. Determine t(u(s)). -4s2 Let a(v) = 3v. Let f = 10 + -11. Let o be (-10 + (-1 - -4))f. Let d(g) = 3 + 4 - o - g2. Determine a(d(y)). -3y2 Let v(y) = y3 - 3y + 1. Let m be v(2). Let u be (m - -1) + -1 + -1. Let f(z) = -uz*2 + 2z*2 + 2z2. Let d(l) = l2. Give f(d(g)). 2g4 Let a(j) = -2j. Let q(v) = v*2 + 259v. Give q(a(o)). 4o2 - 518o Let l(z) = -4z. Let s(o) = -10o. Let b(d) = -12l(d) + 5s(d). Suppose 5i + 5 = -5h, 3i = h - 3h + 1. Let t(v) = i + 5v2 - 3. Determine b(t(f)). -10f*2 Let m(j) = -4j + 6j + 0j. Let p(b) = b*2 - 2b + 2. Let o(k) = -4k2 + 9k - 9. Let g(s) = -2o(s) - 9p(s). Give m(g(y)). -2y2 Let q(h) = h2. Let u(c) = 255c*2. Calculate u(q(p)). 255p*4 Let o = -2 + 4. Let i(w) = -ow + 3w + w. Let h(f) = -2f. Let q(l) = 3h(l) + 2i(l). Let n(j) = -4j. Calculate n(q(d)). 8d Let t(c) = 4107c2. Let m(f) = -4f. Give m(t(q)). -16428q2 Let k(l) = 813l*2. Let q(t) = -5t*2. Determine k(q(c)). 20325c*4 Let r(v) = 10 - 26 - 11v + 16. Let h(i) = -2i2. What is h(r(u))? -242u*2 Let z(f) = 2 + 2f - 2 - f. Let m(d) = 6d - 2. Let v(h) = h + 1. Let l(i) = -m(i) - 2v(i). Determine l(z(r)). -8r Let n(z) = -6z2 - 5. Let s(i) = -i2 - 1. Let f(o) = -n(o) + 5s(o). Let b be (4/6)/((-18)/(-81)). Let v(a) = ba*2 - 9a + 9a. Determine f(v(c)). 9c*4 Let n(b) = -18b. Let y(t) = 12t. Let z(k) = 5n(k) + 8y(k). Let f(u) = 857 - 857 + u. Give f(z(s)). 6s Let k(c) = -30c. Let d(a) = 5a*2 + 0a*2 - 6a*2 + 2a*2. Determine k(d(y)). -30y*2 Let v(a) = 72a*2. Let h(s) = 2s*2. Give h(v(o)). 10368o*4 Let y(r) = -2488r*2. Let n(s) = -2s*2. Calculate n(y(u)). -12380288u*4 Let q(r) = -46r2. Let n(f) = -f2. Calculate q(n(i)). -46i4 Let y(z) be the third derivative of -z4/12 - 20z*2. Let s(f) = 23f*2. Give y(s(k)). -46k*2 Let y(q) = q + 8. Let a(j) = 5j + 44. Let f(z) = -4a(z) + 22y(z). Let v(i) = -2i2 - 7i*2 - 5i*2. What is f(v(o))? -28o*2 Let y(p) = -15p. Let b(t) = 2t + 3. Let m(v) = -3v - 5. Let z(o) = -5b(o) - 3m(o). What is y(z(i))? 15i Let b(z) be the first derivative of -2z2 - 1. Let n(m) be the first derivative of m3/3 + 2. Calculate n(b(f)). 16f2 Let b(k) = 3k*2. Let c(m) = 6m + 3. Let a(t) = -t - 1. Let o(p) = -3a(p) - c(p). Determine b(o(n)). 27n*2 Let c(r) = 4r2. Let n(j) be the third derivative of -j4/24 - 6j2. What is n(c(l))? -4l*2 Let g(p) be the first derivative of 3p*2/2 + p + 4. Let n(v) = v. What is n(g(q))? 3q + 1 Suppose 5 = 5i - 10. Let j(h) = -h2 + 3 - i. Let n(l) = -10l*2 - 7l - 7. Let g(k) = 3k2 + 2k + 2. Let w(t) = 14g(t) + 4n(t). Determine w(j(r)). 2r4 Let j(l) = -l. Let n(k) = 5k - 6. Let w(y) = -9y + 11. Let p be -4 - (-7 + 3 - -6). Let v(t) = pw(t) - 11n(t). Give v(j(x)). x Let n(b) = 376b. Let k(q) = 2q2. What is n(k(z))? 752z2 Let i(r) be the first derivative of -r3/3 + 40. Let d(u) = -36u. Determine i(d(t)). -1296t*2 Let q(n) = -4 - 3 + 6. Let v(k) = 2k + 8. Let c be (8/(-5))/(2/10). Let x(f) = cq(f) - v(f). Let a(h) = h. Determine a(x(g)). -2g Let v(m) = 2m. Let f(j) = -j. Let g(n) = 2f(n) - v(n). Let h(y) be the first derivative of y*2/2 - 2. What is h(g(w))? -4w Let a(n) = -2n. Let t(x) = 1861x. Give t(a(y)). -3722y Let d(c) be the second derivative of 0 + 1/6c*3 + 0c*2 + 4c. Let a(n) = -4n2. Give d(a(p)). -4p*2 Let w(x) = 8x + 7. Let y(c) = -6c - 5. Let q(j) = -5w(j) - 7y(j). Let g(l) = 8l*2 - 13l*2 - 12l*2. Give q(g(a)). -34a*2 Let y(t) = -4t. Let a(f) = 11f. What is a(y(c))? -44c Let u(t) = 18t2. Let a(y) = -12y*2. What is u(a(q))? 2592q*4 Let s(w) = 3w*2 - 2w - 2. Let p(n) = 16n2 - 11n - 11. Let b(o) = 6p(o) - 33s(o). Let z(h) = 7h. Calculate z(b(f)). -21f2 Let d(i) be the third derivative of i4/4 + 2i2. Let q(z) be the first derivative of -z2/2 - 1. What is d(q(p))? -6p Let g(h) = -9h. Let b(i) = -63i*2. Determine b(g(d)). -5103d*2 Let c(i) = -16i. Let m(r) = -26r. Determine c(m(k)). 416k Let z(m) = -3m2. Let p = -6 + 9. Let i be 11/p - 1/(-3). Let o(r) = r + 4r - ir. Calculate o(z(y)). -3y*2 Let x(t) = 14t*2. Let o(m) = -21m + 1. What is o(x(a))? -294a2 + 1 Let d(t) = 6t + 7t - 13t + 6t. Let r(k) = -k. Give r(d(z)). -6z Let q(w) = -6w + 2w - w + 2w. Let o(i) = i + 6i - 4i. Determine o(q(y)). -9y Let v(g) = 7g2. Let i(z) = -3z - 5. Let d(j) = -j - 2. Let n = -32 + 17. Let h(k) = nd(k) + 6i(k). Determine v(h(l)). 63l2 Let t(m) be the second derivative of -m7/2520 + m4/4 - 4m. Let o(f) be the third derivative of t(f). Let s(y) = 4y. What is s(o(w))? -4w*2 Let b(m) = 2m - 7. Let c(t) = t - 4. Let y(v) = -3b(v) + 5c(v). Let z(a) = -4a2 + a - 1. Let n(g) = y(g) + z(g). Let q(d) = -4d*2. Give q(n(o)). -64o*4 Let h(i) = -2i2. Let a(x) be the second derivative of -x4/12 - 7x. What is a(h(f))? -4f*4 Let h(d) = -4d*2. Let o(u) be the second derivative of 1/12u*4 + 0 + 0u*2 - u + 0u*3. What is h(o(k))? -4k*4 Let w(f) = -8f*2. Let u(l) = 4l*2 + 1. Determine w(u(i)). -128i*4 - 64i*2 - 8 Let h(g) be the third derivative of -7g*5/15 + 7g*2. Let p(q) = 2q*2. Give p(h(m)). 1568m*4 Let y = -8 - -13. Let w(f) = 4f + 2f - yf. Let j(h) = -4h. Calculate w(j(p)). -4p Let d(z) = -30z2. Let t(i) be the first derivative of -i2/2 + 13. Give d(t(j)). -30j2 Let u(s) be the first derivative of s2 + 26. Let i(m) = m*2 - 3. Let p(j) = -4j*2 + 8. Let t(d) = 8i(d) + 3p(d). Give t(u(n)). -16n*2 Let f(z) = -101z*2. Let y(c) = c. Calculate f(y(i)). -101i2 Let c(d) = -d. Let i(w) = -w2 - 4012. Determine c(i(o)). o*2 + 4012 Let p be (6/15)/(3/135). Suppose d + 4d + 4f - 3 = 0, 2d - p = 4f. Let k(z) = 3 + z2 - d. Let j(c) = c. Calculate k(j(s)). s2 Let a(s) = -2s. Let o(p) = -5. Let i(t) = -9. Let b(k) = 6i(k) - 11o(k). Let n(j) = j + 5. Let r = -7 - -12. Let l(c) = rb(c) - n(c). Calculate a(l(x)). 2x Let q(i) = -i. Let w(b) = 3b2 + b. Let v(u) = -q(u) - w(u). Let l(r) = -2r. Calculate v(l(j)). -12j2 Let k(d) = 2d*2. Let a(q) = 8850q - 1003. Let v(t) = -53t + 6. Let p(l) = -6a(l) - 1003v(l). What is k(p(x))? 6962x*2 Let k(u) = 6u*2. Let v = -2 + 7. Let g(b) = 0b + 3b - vb. Give g(k(f)). -12f2 Let d(a) = -932a*2. Let b(o) = 5o*2. Calculate d(b(s)). -23300s*4 Let f(d) = -52d. Let t(a) = 2a. Calculate t(f(u)). -104u Let p(y) = -1. Let z(g) be the second derivative of g*4/6 + 4g*2 + 5g. Let h(q) = 8p(q) + z(q). Let r(i) = 4i*2 - 4i2 - i2. Determine h(r(o)). 2o4 Let z(x) = 3x. Let w(m) = 62m. Give z(w(g)). 186g Let b(k) be the third derivative of k4/24 + k2. Let t(q) be the first derivative of -q3/3 + 1. Calculate t(b(v)). -v2 Let y(p) = p*2 - 2p. Let w(j) = -6j. Let u(o) = o2 + 5o. Let d(g) = 3u(g) + 4w(g). Let z(t) = -2d(t) + 9y(t). Let m(n) = -n*2. Calculate m(z(s)). -9s*4 Let c(g) = 7g. Let a(k) be the third derivative of -k*4/24 - 4k*2. Let q(u) = 4a(u) + c(u). Let v(i) = i*2. Determine q(v(y)). 3y*2 Let h(i) = -2i. Let w be 14/(-2)(-24)/(-8). Let l(u) = -9u. Let z(x) = wh(x) + 5l(x). Let o(y) = -3y2. Determine z(o(r)). 9r*2 Let m(v) = 2v. Let k(s) = -4750s. Determine m(k(t)). -9500t Let r(z) = -2z2. Let x(u) be the second derivative of u4/2 - 19u. Determine x(r(j)). 24j4 Let v(y) = 3y*2. Let t(m) = -m - 98. Calculate t(v(g)). -3g*2 - 98 Let x(c) = -8c2. Let d(n) = -n2. Give d(x(q)). -64q4 Let n(s) be the first derivative of 0s + 4 - 1/3s3 + 0s*2. Let c(i) = 11i. Calculate n(c(w)). -121w*2
What is the fifth biggest value in 0.06, -52, -0.5, 0.2, -2/7, 0.5, 0.4? -2/7 What is the second smallest value in 0.446, -5/3, -0.345, -5? -5/3 What is the sixth biggest value in -4, 0.5, -0.2, 3, -899, 1/5? -899 Which is the second biggest value? (a) 4 (b) 1/3 (c) 2/13 (d) -3/14 (e) 2 (f) -6/61 e Which is the sixth smallest value? (a) 3/7 (b) -6/7 (c) 3 (d) -5735 (e) 27 (f) -1/4 (g) -0.1 c Which is the fifth biggest value? (a) 87 (b) 0.01 (c) 6 (d) -3 (e) 2/17 (f) 0.05 b Which is the fourth smallest value? (a) 1/4 (b) -1 (c) 269 (d) 0.4 (e) 460 c Which is the fifth biggest value? (a) 58 (b) -0.5 (c) -299 (d) -3 (e) 26/11 c Which is the fifth smallest value? (a) 0.5 (b) 1/3 (c) -0.3 (d) -1/9 (e) 54 (f) 140 e What is the fifth smallest value in -159/5, 2, 6, 3/8, 4? 6 Which is the third biggest value? (a) 5001 (b) -0.51 (c) -8 (d) -5 d What is the smallest value in 3, -0.4, 2/32989, 0.4, -4, 0.17, 1/2? -4 Which is the fourth biggest value? (a) 35 (b) 10 (c) 2 (d) -15540 d Which is the third smallest value? (a) -152.8 (b) -16 (c) -0.536 (d) -2/5 c Which is the fifth biggest value? (a) 4 (b) -5 (c) -2582 (d) -2/3 (e) 0 c Which is the fifth biggest value? (a) -45/8 (b) -13 (c) -4 (d) 0.26 (e) -12 b What is the biggest value in 37577, -4, -6, 1/67? 37577 Which is the biggest value? (a) 1/2 (b) -1/20 (c) -227 (d) -16 a What is the second biggest value in 5, 2, -0.037, -35/9, 4, 1218? 5 Which is the second smallest value? (a) -2/267 (b) 0.1 (c) 0.03 (d) 3/5 (e) 0.2 (f) -134/7 a Which is the biggest value? (a) -204 (b) -0.3 (c) -5536 (d) -3 b Which is the fourth biggest value? (a) 0.06 (b) -1 (c) 5 (d) -57 (e) -3 (f) 0.387 b What is the fourth biggest value in 2, 72, 1/8, -9.1, 3? 1/8 What is the biggest value in 34, 4, 13, -3/2540? 34 Which is the second smallest value? (a) -7 (b) -12 (c) -902 (d) -0.361 b What is the sixth biggest value in 2, 77, -108.6, 2/9, -2/13, -2/11? -108.6 Which is the sixth biggest value? (a) -80 (b) -15 (c) 0.3 (d) 403/6 (e) -0.5 (f) -3 a Which is the second biggest value? (a) 238 (b) 0.3 (c) -4403 (d) 3 d Which is the third smallest value? (a) 70/9 (b) 0.097 (c) -555/11 a What is the smallest value in 84, -0.2, 69, 5150? -0.2 Which is the third smallest value? (a) -121 (b) -298 (c) 38 (d) 0.1 (e) 0.4 d Which is the biggest value? (a) -0.177618 (b) -20 (c) -4 a Which is the third biggest value? (a) 1 (b) -96026 (c) 2/643 b Which is the fifth smallest value? (a) 0.3 (b) 982.3 (c) 2/11 (d) 0.55 (e) 43 b Which is the smallest value? (a) -40062 (b) -1469 (c) 0 (d) 1 a Which is the third biggest value? (a) -0.16 (b) -1 (c) -1/79 (d) -5 (e) 0.02 (f) 0.2 (g) 25 e What is the second biggest value in 2/5, 8/7, 26/9, -3/4, 5, -3075? 26/9 Which is the fourth smallest value? (a) -11 (b) -1 (c) -5 (d) -1/9 (e) -6 b What is the smallest value in -654, -5, 1/60181? -654 Which is the biggest value? (a) -29 (b) 5278 (c) 27 (d) 1 b Which is the third smallest value? (a) 2/5 (b) -1/7 (c) 6.4 (d) 126273 c What is the third smallest value in 0.5, -4, -0.9, 2/7, 31, -25? -0.9 Which is the second biggest value? (a) -1337 (b) 13/38 (c) 1/2 b What is the sixth biggest value in -4/5, 0.27, -3/5, 138, -386, 0.5? -386 What is the smallest value in 7, -978, -4/67? -978 Which is the third smallest value? (a) 0 (b) -2/21 (c) 34 (d) -2016 a Which is the fourth biggest value? (a) -2478 (b) -0.1 (c) -1/7 (d) 6 (e) 583 c What is the third smallest value in -7799, -219, -69? -69 Which is the fourth smallest value? (a) -5 (b) -4 (c) -2/7 (d) 0.1146 (e) 3 (f) -1.1 c What is the third biggest value in -1/4, 7, -6.19, -0.912? -0.912 Which is the second biggest value? (a) -127 (b) -0.39 (c) -13 (d) 2/5 (e) 2/7 (f) -2 (g) -1/9 e Which is the second smallest value? (a) -5 (b) 1 (c) -4 (d) -2/229 (e) 2/215 (f) 0.5 c What is the fourth smallest value in 2/17, 0.9, 16, 2/41, 4, 11, 3? 3 Which is the fourth smallest value? (a) -0.3 (b) 4 (c) 0.05 (d) 2631/58 d Which is the second biggest value? (a) 1 (b) 384/149 (c) 1/56 a Which is the smallest value? (a) 0.238 (b) -38 (c) 0.4 (d) 9 b What is the third smallest value in 0.7, 420, 2/19, -2637? 0.7 Which is the fifth smallest value? (a) -29 (b) 4 (c) -31 (d) -0.064 (e) 2/13 (f) 5 (g) 1 g Which is the smallest value? (a) 129 (b) 0.1 (c) 2 (d) -0.5 (e) 0.99 (f) -4 f What is the smallest value in -3692, -2/9, -35721? -35721 Which is the second biggest value? (a) 1653 (b) 316 (c) -2 b What is the fourth smallest value in 0.765, -944, -0.1, 0.4, 2? 0.765 Which is the fifth smallest value? (a) 3/8 (b) 0 (c) -3.9 (d) -0.64 (e) 2/5 (f) -1/9 a What is the second smallest value in -13/5, 4, 37, -1/7, 5, -55? -13/5 What is the second smallest value in -4/3, 5, 2/5, -0.14, -32.52? -4/3 Which is the fourth smallest value? (a) -46/3 (b) -1 (c) -0.19 (d) -0.5 (e) 3/5 (f) 5 c Which is the third biggest value? (a) -5 (b) 2 (c) 53 (d) -2 (e) 2/11 (f) 1/8 e Which is the second biggest value? (a) 98853 (b) -5 (c) 82 c What is the third biggest value in 2/1473, -1/5, -2051? -2051 What is the fourth biggest value in -3/8, -4/9, -2, -2/7, -3, -1857, -1/3? -4/9 Which is the fourth biggest value? (a) 7 (b) 22004 (c) 2/2305 (d) -0.2 d Which is the smallest value? (a) -2/852429 (b) -4 (c) -19/6 b Which is the second smallest value? (a) 4 (b) 2/5675 (c) -410 (d) 2/3 b Which is the third smallest value? (a) -3/8 (b) 0.01303 (c) 3 c What is the second biggest value in -0.2, -0.5, 2, 53, 776, -2/13, -1/4? 53 What is the fifth smallest value in 5, -1, -0.5, 7, -4, -14640/11? 5 Which is the biggest value? (a) -6 (b) -3/7 (c) -32 (d) -3/5 (e) -30/11 b What is the sixth biggest value in -1/4, 0.5, -2.1, 890, -0.1, -2264? -2264 What is the third biggest value in -1/3, -6/7, -14593996? -14593996 Which is the third biggest value? (a) -2 (b) -339 (c) -2.1395 (d) 0 c What is the third smallest value in -62/1601, -2/9, -5/2, 0.2, -3? -2/9 What is the third biggest value in -47, 3, -0.2, -80, -5, 67? -0.2 What is the biggest value in 5, 0.5, -4656114? 5 What is the second biggest value in -316006, -0.1, -0.12, 1, 3? 1 Which is the second smallest value? (a) 12 (b) -3 (c) 0.01 (d) -4 (e) 1/155 (f) 1 b Which is the third biggest value? (a) 13 (b) -7 (c) 4 (d) 21.474 (e) 1/3 (f) 2 (g) 0.4 c What is the fourth smallest value in -1/5, 2/15, 6/2485, 2/9, 86? 2/9 Which is the biggest value? (a) -284498 (b) 8 (c) 15.1 c What is the smallest value in 0.4, -5, 0.2, -4, -5028, -2/17? -5028 What is the third biggest value in 1, -2/11, -4/13, -0.1, -1/9, 12.9? -0.1 Which is the third smallest value? (a) 0.2 (b) 2/9 (c) 1.683 (d) -1/4 (e) -3/13 (f) 1/19 f What is the second biggest value in 1516, 0.04, -5, 2/61? 0.04 What is the fourth biggest value in 0.5, -4, -5, 2/7, -11171/98? -5 What is the third biggest value in 3/2, -2.5, -8149, 0, -137? -2.5 What is the sixth smallest value in -5, 0.1, -2/7, -0.21, -1, -2/929, -0.3? -2/929 What is the sixth smallest value in 1, -2/19, 86/9, 5, -5, -6/7, -2? 5 Which is the third biggest value? (a) -2 (b) -680 (c) -1 (d) -0.4 (e) -162 a Which is the smallest value? (a) 3/2 (b) 10/7 (c) 7/5 (d) 4 (e) 0.3 (f) -70/11 f What is the second biggest value in 2/39, -252, -933, 2/3? 2/39 What is the biggest value in -0.1, 21/8, 1/268, -31, -3? 21/8 Which is the second biggest value? (a) 2 (b) -5 (c) 0.2 (d) -452354 c What is the fourth biggest value in -10, -4.7, -0.56, -14, 1/3? -10 What is the third biggest value in -4, 5, 238.5858? -4 Which is the second smallest value? (a) 15/2 (b) 73465 (c) 2/15 a Which is the second smallest value? (a) 3/2 (b) -2/5 (c) 7 (d) -195 (e) -18 e What is the smallest value in 0.2, -3/4, -5, 8/3, -2, -1/2997? -5 What is the seventh biggest value in 11.92, 15, 2/5, -3, -1, -4, -1/3? -4 What is the third smallest value in -8, -1/21, 1, -3/4, -3, 0.26, -4? -3 Which is the sixth biggest value? (a) -13/4 (b) 4 (c) 10 (d) -0.5 (e) -3/8 (f) -1158 f Which is the biggest value? (a) -5 (b) 4 (c) -9.3 (d) 2 (e) 128 e Which is the third smallest value? (a) 369 (b) 320/313 (c) -0.3 a Which is the third smallest value? (a) -8/3 (b) -2/2235 (c) -43 b Which is the fourth biggest value? (a) 111 (b) 1/3 (c) 9 (d) 235/14 (e) -0.3 b What is the seventh biggest value in 2, 4, 1215, 5, -4, -3/7, 3/2? -4
Two letters picked without replacement from pupouuocpuppszu. Give prob of sequence sp. 1/42 What is prob of sequence rg when two letters picked without replacement from grmggrggt? 5/36 Calculate prob of sequence pp when two letters picked without replacement from ofrpfp. 1/15 Two letters picked without replacement from {f: 6, c: 3, a: 1, z: 4}. Give prob of sequence cc. 3/91 What is prob of sequence zhz when three letters picked without replacement from {z: 2, h: 1, o: 3, j: 1}? 1/105 What is prob of sequence ee when two letters picked without replacement from cezezecsmexem? 5/39 Three letters picked without replacement from {y: 7, f: 4}. Give prob of sequence yyf. 28/165 What is prob of sequence qa when two letters picked without replacement from {q: 3, a: 2}? 3/10 Three letters picked without replacement from {p: 2, c: 1, k: 2}. Give prob of sequence pcp. 1/30 Calculate prob of sequence iib when three letters picked without replacement from uiuuibubuaiubu. 3/364 Calculate prob of sequence oobl when four letters picked without replacement from llmocboe. 1/420 Calculate prob of sequence uwi when three letters picked without replacement from wvvtwuvtwuttviy. 1/455 Two letters picked without replacement from wvnwnwvwnwnvwi. Give prob of sequence wi. 3/91 Four letters picked without replacement from {v: 3, e: 3, b: 4, l: 3}. Give prob of sequence bblv. 9/1430 Four letters picked without replacement from vviivviivzi. What is prob of sequence izvi? 5/396 What is prob of sequence hv when two letters picked without replacement from gghgivivvg? 1/30 Calculate prob of sequence ccoo when four letters picked without replacement from ocooooooocoo. 1/66 Calculate prob of sequence rz when two letters picked without replacement from {v: 4, k: 1, z: 1, r: 2}. 1/28 Calculate prob of sequence hqe when three letters picked without replacement from {h: 2, z: 1, q: 1, e: 1}. 1/30 What is prob of sequence sv when two letters picked without replacement from vvgsg? 1/10 What is prob of sequence vvo when three letters picked without replacement from vovzviz? 1/35 Two letters picked without replacement from {o: 4, h: 6}. Give prob of sequence oo. 2/15 What is prob of sequence bmm when three letters picked without replacement from fmmjb? 1/30 Two letters picked without replacement from qqjqhfljqxlqh. What is prob of sequence hh? 1/78 Four letters picked without replacement from eoqyyyqoy. Give prob of sequence yqye. 1/126 What is prob of sequence zs when two letters picked without replacement from zsz? 1/3 Three letters picked without replacement from {s: 8, u: 3, z: 6, f: 1}. Give prob of sequence zfu. 1/272 What is prob of sequence jj when two letters picked without replacement from fnjfyhybjjffjjyhyjfj? 21/190 Calculate prob of sequence euuk when four letters picked without replacement from {k: 2, u: 2, e: 2, c: 2}. 1/210 Two letters picked without replacement from ccttvtsthttvttctt. What is prob of sequence sh? 1/272 Calculate prob of sequence xy when two letters picked without replacement from {x: 4, y: 1, t: 2}. 2/21 Three letters picked without replacement from fhhfnrnfnon. What is prob of sequence orn? 2/495 Two letters picked without replacement from {p: 6, g: 1, y: 4, i: 4, w: 1}. Give prob of sequence pi. 1/10 What is prob of sequence an when two letters picked without replacement from {n: 2, g: 1, x: 1, a: 1}? 1/10 What is prob of sequence jeoi when four letters picked without replacement from {o: 4, j: 3, e: 3, i: 4}? 6/1001 Two letters picked without replacement from oiorraj. Give prob of sequence ao. 1/21 What is prob of sequence ccp when three letters picked without replacement from cpccccpc? 5/28 What is prob of sequence llc when three letters picked without replacement from clcccclccccclc? 11/364 Calculate prob of sequence lkl when three letters picked without replacement from {k: 2, l: 11}. 5/39 What is prob of sequence bb when two letters picked without replacement from {b: 5, q: 14}? 10/171 Three letters picked without replacement from dddyddeedydd. Give prob of sequence ydy. 2/165 Calculate prob of sequence tttt when four letters picked without replacement from ttttttttt. 1 Four letters picked without replacement from {v: 2, z: 2, n: 2, s: 13}. Give prob of sequence snvz. 13/11628 Calculate prob of sequence bvi when three letters picked without replacement from kkmmymmvvyyibiykkby. 4/2907 Calculate prob of sequence wrww when four letters picked without replacement from {f: 12, s: 1, r: 2, w: 4}. 1/1938 Calculate prob of sequence eeee when four letters picked without replacement from {e: 9}. 1 Two letters picked without replacement from ahabu. Give prob of sequence uh. 1/20 Calculate prob of sequence fg when two letters picked without replacement from {g: 8, f: 5}. 10/39 Two letters picked without replacement from {k: 3, c: 5}. What is prob of sequence cc? 5/14 Calculate prob of sequence oo when two letters picked without replacement from zoo. 1/3 Two letters picked without replacement from anannaaenaawaana. What is prob of sequence wn? 1/48 Two letters picked without replacement from znzozonzonofznznnn. What is prob of sequence nf? 7/306 Calculate prob of sequence jdpe when four letters picked without replacement from ppeedppppjheejh. 2/1365 Two letters picked without replacement from nhhhi. Give prob of sequence hn. 3/20 What is prob of sequence icpu when four letters picked without replacement from {h: 1, p: 1, i: 2, c: 1, u: 2}? 1/210 Three letters picked without replacement from xxppxxppxxpp. What is prob of sequence ppp? 1/11 Four letters picked without replacement from vjcghhv. Give prob of sequence vgcv. 1/420 Three letters picked without replacement from rrqorbbbbobob. Give prob of sequence obr. 9/286 Three letters picked without replacement from lllll. Give prob of sequence lll. 1 Four letters picked without replacement from mmibfimircc. What is prob of sequence iibc? 1/660 Three letters picked without replacement from {c: 1, u: 2, o: 1}. Give prob of sequence ouu. 1/12 Four letters picked without replacement from rpdrdgpmdddrpd. Give prob of sequence drrr. 3/2002 Calculate prob of sequence zdm when three letters picked without replacement from zxmdmdmdlddlzmmldmdl. 7/570 What is prob of sequence nnum when four letters picked without replacement from nnsuuumsnu? 1/210 Four letters picked without replacement from {f: 2, k: 5, m: 6}. What is prob of sequence mkfk? 2/143 Three letters picked without replacement from lssxlpplxsumsssslp. What is prob of sequence ssm? 7/816 What is prob of sequence unuu when four letters picked without replacement from unrhurrruqurru? 5/2002 Calculate prob of sequence scqq when four letters picked without replacement from {s: 2, b: 1, j: 1, q: 2, n: 1, c: 2}. 1/378 What is prob of sequence ok when two letters picked without replacement from {r: 2, o: 3, j: 3, u: 1, n: 2, k: 3}? 9/182 Calculate prob of sequence tfft when four letters picked without replacement from {f: 7, t: 2}. 1/36 What is prob of sequence rr when two letters picked without replacement from wfrrr? 3/10 Three letters picked without replacement from bssbsgbbss. What is prob of sequence bss? 1/9 Four letters picked without replacement from ggggqqggggggqgg. Give prob of sequence gqqg. 11/455 What is prob of sequence tbb when three letters picked without replacement from {t: 1, b: 14}? 1/15 Calculate prob of sequence uruu when four letters picked without replacement from rrrrrrruururrrrrrr. 1/816 Four letters picked without replacement from {x: 2, z: 6, k: 8, r: 2}. What is prob of sequence zzrz? 1/306 Calculate prob of sequence he when two letters picked without replacement from hwyhgwwhwmhhhewe. 1/20 Calculate prob of sequence el when two letters picked without replacement from mstmesmmmlmlmtmmmmt. 1/171 Calculate prob of sequence pp when two letters picked without replacement from ppppppppfppf. 15/22 Two letters picked without replacement from qwhkrwrrkkkp. What is prob of sequence wk? 2/33 Calculate prob of sequence hh when two letters picked without replacement from {n: 4, q: 6, h: 10}. 9/38 Calculate prob of sequence kk when two letters picked without replacement from tdddddbdkkzzqd. 1/91 What is prob of sequence yy when two letters picked without replacement from yyyxyyyxyyyyyxyyyx? 91/153 What is prob of sequence ogw when three letters picked without replacement from {o: 2, g: 2, w: 1}? 1/15 What is prob of sequence se when two letters picked without replacement from rressrrrsesrrrsr? 1/24
Let n = 0.01 + 0.29. Let h = -244.302 + 244. Let s = h + n. What is s rounded to two dps? 0 Let q = 0.09 + -0.04. Let x = q + -0.45. Let y = 0.4032 + x. What is y rounded to three dps? 0.003 Let g = 0.0500027 - 0.05. What is g rounded to 6 dps? 0.000003 Let v(j) = -754j + 6. Let u be v(4). Let f = u + 7310. Round f to the nearest one thousand. 4000 Let i = -2.2 - -4. Let h = i + -1.799993. What is h rounded to six decimal places? 0.000007 Let q = -37.00064 - -37. Round q to four dps. -0.0006 Let b = -661.0873 - -0.0873. Let u = 661.0000267 + b. What is u rounded to 6 decimal places? 0.000027 Let l = 175 + -173.67. Round l to 1 dp. 1.3 Suppose -8 = -2j - 2j. Suppose 3 + 9 = -jx. Let g be (-37 - x/(-2))-5. What is g rounded to the nearest 100? 200 Let m = -8.5 + 8. Let b = m - 4.5. Let f = b - -10.8. What is f rounded to the nearest integer? 6 Let u = -1.0011 - -0.5874. Let a = u - -0.42. Round a to 3 dps. 0.006 Let i = -2.4292 - -1470140.4292. Let f = i + -1470138.800007. Let x = f - -0.8. What is x rounded to 6 decimal places? -0.000007 Let f = 8528.1421 - 8582.142037. Let l = 54 + f. What is l rounded to five dps? 0.00006 Let s = 15.70735 - 15.7. What is s rounded to 3 decimal places? 0.007 Suppose q - 3q + 4 = 0. Suppose -qn - 3n = 65. What is n rounded to the nearest ten? -10 Let f = -14.7 + -0.3. Let g = -9 - f. Let n = g + -5.9958. Round n to three dps. 0.004 Let q be (-1684)/(-6) + (-8)/12. What is q rounded to the nearest 100? 300 Suppose 0 = 5a - 5l - 12760, -a - a + 5l = -5110. Round a to the nearest one hundred. 2600 Let l = 75.2 + 3. Let d = 95.04 - 0.04. Let z = l - d. What is z rounded to 0 decimal places? -17 Let g = 1154 + -1150.676. Let m = g + 0.096. Let c = m + -4. Round c to 1 dp. -0.6 Let k = 1.5 + -1.524. What is k rounded to two dps? -0.02 Let w = 135.8 + -150. What is w rounded to zero decimal places? -14 Let i be (-1 + -513)/(6/33). Let f = i - -1457. What is f rounded to the nearest one hundred? -1400 Let k(b) = b - 8. Suppose -3 - 15 = -3f. Let p be k(f). Let x = 0 - p. What is x rounded to the nearest ten? 0 Let a = 0.009 - -4.191. What is a rounded to 0 dps? 4 Let y = -13 + 106. Let t = -32 - y. Let d = t + 124.99929. Round d to 4 dps. -0.0007 Let w = 5423 - 9010. Let t = w - -5127. What is t rounded to the nearest one hundred? 1500 Suppose -3u = -8u. Suppose u = 2c + 3c - 8600000. Round c to the nearest 100000. 1700000 Let z = 98.00000112 - 98. Round z to seven decimal places. 0.0000011 Let n = -332934.0900051 + 332938.49. Let r = -4.4 + n. What is r rounded to 6 decimal places? -0.000005 Suppose -24 + 9 = -2v + 3s, 4v = -2s + 22. Let k = v + -6. What is k rounded to 1 decimal place? 0 Let s = -28 + 15. Let j = 17.2075257 - 4.2075322. Let o = s + j. Round o to six dps. -0.000007 Let t = -23 - -22.99968. Round t to 3 dps. 0 Let x = -0.157 - -0.096. What is x rounded to two dps? -0.06 Let g = 6 + -17. Let f be 30/165 - 97899998/g. Round f to the nearest 1000000. 9000000 Let x = -0.1 + 5.1. Let a = 4.8 - x. Round a to zero dps. 0 Let d be -732/((-24)/9 - -2). Round d to the nearest ten. 220 Let s(i) = 8001i*2 - 8i - 20. Let c be s(10). Round c to the nearest one million. 1000000 Let q = 52.69 + -53. What is q rounded to one decimal place? -0.3 Let x(l) = 2l2 - 4l*2 + 4l - 8 + 5l2 - 2l*2. Let g be x(12). Suppose 5c + 953 = q, -c = 6q - 4q + g. Round c to the nearest one hundred. -200 Let o(s) = 2s + 1 + 2s*2 + 2s*2 - 2s*2 + 3s*2. Let p be o(-2). Round p to the nearest ten. 20 Let i = 1 + -13. Let o = i - -11.77. What is o rounded to 1 dp? -0.2 Suppose 3b - 294 = 246. Suppose 6980 - b = 4t. What is t rounded to the nearest one thousand? 2000 Let t be (-13 - -2) + -5. Let i = 8 + t. Suppose iy = 2l + 129990, 5y + 86307 = -l + 21282. Round l to the nearest 10000. -70000 Let g = 384.000522 + -384. Round g to five dps. 0.00052 Let o = 0.06187662 - -0.23812343. Let m = -0.3 + o. Round m to seven dps. 0.0000001 Let o(x) be the first derivative of 1 - x2 - x - 65/3x*3. Let a be o(-3). What is a rounded to the nearest 100? -600 Let p = 171.2 - 165.216. Let u = p + -6. Let l = u + 0.01599906. What is l rounded to seven dps? -0.0000009 Let y = 894.50007 + -895. Let u = 0.5 - 0. Let i = u + y. Round i to 4 dps. 0.0001 Suppose 0 = 3l - 8l - 290000. What is l rounded to the nearest 10000? -60000 Let s(k) = 186k*2 - 2k + 16. Let w be s(11). Round w to the nearest 1000. 23000 Let r = -2.86 + 2.4. Let s = 937 + -948.86. Let k = s - r. Round k to zero dps. -11 Let c = 39 - 39.85. Round c to one dp. -0.9 Suppose 4o = o - 3, -5o = 2z - 3979995. Round z to the nearest 100000. 2000000 Let w = 0.501 + -0.48. Let r = w + 0.181. Let k = -0.2147 + r. What is k rounded to three decimal places? -0.013 Let m(f) = -76983f*2 - 9f + 17. Let o be m(12). Let j = -18623589 - o. Let i = -5862054 + j. What is i rounded to the nearest 1000000? -13000000 Let o = 0.03 + -0.01. Let y = -16 + 15.987. Let w = y + o. Round w to 2 decimal places. 0.01 Suppose 3608 + 16017 = j. Let b = j + 230375. What is b rounded to the nearest 100000? 300000 Let k = -20 + 21.8. Let g = -27.9 - -19.6. Let x = k + g. Round x to 0 dps. -7 Let f = -127442.88081 + 127442. Let a = 0.88 + f. Round a to four dps. -0.0008 Let k = -5.1 - -1.1. Let c = -4.0000004 - k. Round c to 7 decimal places. -0.0000004 Let m(d) = 964d2 + 9d - 3. Suppose -2y + 0o - 16 = 2o, -3y = -o + 28. Let a be m(y). Round a to the nearest ten thousand. 80000 Let t = -36 - -36.0002. Round t to 3 dps. 0 Let v(j) = -j*3 - 4j*2 - 4j - 2. Let x be v(-2). Let o be (-16)/(22496/11250 + x). Let k be (o/(-3))/(2/(-1720)). Round k to the nearest 1000000. 13000000 Let o = 205.1 - 205.5081. Let k = o - -0.41. Round k to three dps. 0.002 Let d = -155170.670078 - -155171. Let n = 7.5 + -7.17. Let l = d - n. What is l rounded to five dps? -0.00008 Let z = 206381.999997 + -206374. Let y = z - 8. Round y to five dps. 0 Let b = 0.18 + -4.88. What is b rounded to the nearest integer? -5 Let v = 76 - 150. Let f = 73.967 + v. Let n = 0.613 + f. Round n to 1 decimal place. 0.6 Let x = -0.03 + 0.03055. Round x to 4 dps. 0.0006 Suppose -s = -6s + 255. Let u = s + -88. What is u rounded to the nearest 10? -40 Suppose -4p + k + 733 = 0, 0p - 2p + 4k + 370 = 0. Let h = -393 + p. Round h to the nearest one hundred. -200 Let u be 70003 + 9/(-6 - -3). What is u rounded to the nearest ten thousand? 70000 Let l = 1238320780.3600001 - 1238309747.34. Let m = -11033 + l. Let a = m + -0.02. What is a rounded to six dps? 0 Let q = 0.65 + -0.649938. Round q to five decimal places. 0.00006 Let c(d) = 48d - 2. Let m be 0 + (-17 - 1)/3. Let z be c(m). Round z to the nearest 100. -300 Let f = 978 + -978.00000489. What is f rounded to seven dps? -0.0000049 Let y = 1842495495229 - 1842495004537.2400065. Let r = y + -490692. Let a = r + 0.24. Round a to 6 dps. -0.000007 Let s = 0.524 + -0.22368. Let h = 6 - 6.3. Let r = s + h. What is r rounded to 4 decimal places? 0.0003 Let p = 287411072 + -287411090.99999934. Let c = -56 + 37. Let o = c - p. Round o to 7 dps. -0.0000007 Let x(u) = 2u3 - 9u*2 - 6u - 5. Let h be x(7). Round h to the nearest 10. 200 Let a = -814 - 138. Let d be (2 + a)/((-2)/80). Suppose -2g + 3g + d = 0. What is g rounded to the nearest ten thousand? -40000 Let s = -296.2 + 33.2. Let r = 266.38 + s. Let k = -0.12 - r. Round k to 0 dps. -4 Let c = -11 - -6. Let n(g) = -2 - 2000000g + 2. Let a be n(c). What is a rounded to the nearest one million? 10000000 Let o(y) = 30598y + 10. Let d be o(5). What is d rounded to the nearest 10000? 150000 Let l = -18565 + 30825. Round l to the nearest 1000. 12000 Let x = 61.98857706 - 63.341493. Let t = 1.394915 + x. Let l = t + -0.042. Round l to seven dps. -0.0000009 Let z = 106986.831 + -107059. Let y = -68.3 - 3.7. Let c = z - y. What is c rounded to 2 dps? -0.17 Let h = 20.88010336 - 12.880102. Let j = h - 8. Round j to 7 decimal places. 0.0000014 Let u = 5828 - -5672. Round u to the nearest 1000. 12000 Let c be (-18000)/(-14)13/(39/(-8400)). Round c to the nearest one million. -4000000 Suppose -6v = 133480 + 124520. Round v to the nearest ten thousand. -40000 Suppose 5i + 4 = -4g, 2 + 22 = g - 5i. Suppose -gf + 2*f = 9800000. What is f rounded to the nearest one million? -5000000 Let d = 5 + -8. Let h = -3 - d. Let p be -1 + 1 + h + 20. Round p to the nearest one hundred. 0 Let a = -0.52 + -0.08. Let r = -1.1 + a. Round r to 0 dps. -2
Is 2736516687 a multiple of 877? False Is 378723617 a multiple of 58? False Is 69754048 a multiple of 112? True Is 6163570 a multiple of 955? True Is 104 a factor of 1064460488? True Does 13 divide 20463443? True Is 7405508 a multiple of 849? False Does 25 divide 625923875? True Does 17 divide 2945828? True Is 27 a factor of 33530897? False Is 111 a factor of 39642301? False Is 14 a factor of 2915589? False Is 13 a factor of 17033979? False Is 1440429461 a multiple of 86? False Does 6147 divide 536034748? False Is 162296428 a multiple of 49? True Is 168608220 a multiple of 66? True Does 82 divide 15426440? False Is 3 a factor of 5190333? True Is 95 a factor of 233385740? True Is 535 a factor of 376901080? True Is 169 a factor of 389486357? True Is 414531810 a multiple of 3429? True Is 205688350 a multiple of 1106? True Is 1574244789 a multiple of 13? True Is 1093724676 a multiple of 29? True Does 27 divide 711787? False Is 6619910 a multiple of 1147? False Is 8 a factor of 1079433? False Does 17 divide 223309378? False Does 21 divide 210860580? True Is 47943979 a multiple of 1259? True Is 16937097 a multiple of 1693? False Is 4175960 a multiple of 8? True Is 188 a factor of 62892956? True Does 2108 divide 22096056? True Is 15 a factor of 84126232? False Is 1096359435 a multiple of 1405? True Is 1262135616 a multiple of 56? True Is 1671950568 a multiple of 24? True Is 67762540 a multiple of 185? True Is 18 a factor of 10548450? True Is 18880460 a multiple of 10? True Does 8 divide 51985712? True Is 223389362 a multiple of 199? False Is 54 a factor of 19297818? True Is 4031038 a multiple of 12? False Is 586355331 a multiple of 649? False Is 174301158 a multiple of 2060? False Does 46 divide 2102197056? True Is 20 a factor of 98392020? True Is 5 a factor of 646175355? True Is 33216710 a multiple of 2457? False Is 6179105059 a multiple of 23? False Does 2457 divide 196326585? True Is 11 a factor of 60055413? True Is 16338393 a multiple of 7? False Is 79 a factor of 272725459? True Is 5487893 a multiple of 13? False Is 12 a factor of 1935718? False Is 16260584 a multiple of 8? True Is 3356448 a multiple of 96? True Is 52 a factor of 19219925? False Is 45 a factor of 4301356005? True Does 2113 divide 303757664? False Is 67919548 a multiple of 144? False Does 10 divide 178577619? False Is 1889 a factor of 489960122? False Is 43487891 a multiple of 5? False Is 9 a factor of 773646344? False Is 274080919 a multiple of 9? False Is 7540150 a multiple of 19? True Does 805 divide 207447695? True Does 180 divide 276421320? True Is 352 a factor of 45553376? True Does 1236 divide 323779994? False Is 23097598 a multiple of 216? False Is 182 a factor of 425347270? False Is 1089 a factor of 1292470? False Does 2976 divide 791165548? False Is 12 a factor of 33778297? False Does 1525 divide 27706137? False Is 2353001295 a multiple of 149? True Does 56 divide 2913166424? True Is 87305837 a multiple of 160? False Is 26446500 a multiple of 125? True Is 48 a factor of 13324404? False Is 162 a factor of 750376? False Does 4 divide 11780912? True Is 25763358 a multiple of 138? True Is 126556127 a multiple of 266? False Is 469249769 a multiple of 112? False Is 14839705 a multiple of 2046? False Does 45 divide 201170340? True Is 15 a factor of 402068967? False Is 319 a factor of 638250096? True Does 38 divide 213512601? False Is 420540 a multiple of 43? True Does 20 divide 10618983? False Does 1181 divide 42945254? False Is 347 a factor of 954683403? True Does 6 divide 14664708? True Is 994440420 a multiple of 230? True Is 4 a factor of 287496? True Is 538 a factor of 39890010? True Is 2328068349 a multiple of 17? True Is 622 a factor of 43043022? True Is 18 a factor of 4180788734? False Is 600 a factor of 1254739233? False Is 27625815 a multiple of 19? False Does 148 divide 601658406? False Does 47 divide 42070851? False Is 2369225471 a multiple of 244? False Is 17 a factor of 662373177? False Is 8975 a factor of 1227878725? True Is 30 a factor of 6638068? False Does 9 divide 2701780575? False Does 180 divide 217509388? False Is 1885600015 a multiple of 21? False Is 66559278 a multiple of 15? False Does 4 divide 94901845? False Is 146337281 a multiple of 41? False Does 863 divide 4451274? False Is 1330 a factor of 3396473976? False Is 68 a factor of 50131698? False Is 2198522913 a multiple of 630? False Is 100 a factor of 20367800? True Is 291 a factor of 587751033? True Does 261 divide 1259325? True Is 29 a factor of 5802233? True Is 51 a factor of 7325044? False Is 334 a factor of 33806733? False Does 84 divide 360716076? True Does 1278 divide 209304450? True Is 119541792 a multiple of 1973? False Is 2041692030 a multiple of 35? True Does 10 divide 4918760? True Does 65 divide 200483075? True Is 1624 a factor of 1345105608? True Does 8 divide 1791333387? False Is 77 a factor of 3051151411? True Is 5981 a factor of 580156671? False Does 43 divide 1902126070? True Is 29 a factor of 24241131? False Is 18 a factor of 971035866? True Does 17 divide 56788466? True Does 874 divide 3800157? False Is 8 a factor of 1552681962? False Is 10 a factor of 74079840? True Is 248 a factor of 71764504? True Does 616 divide 526029504? True Is 470394365 a multiple of 46? False Is 3811 a factor of 794494414? True Is 13 a factor of 21097857? False Is 55 a factor of 1091110460? True Is 5 a factor of 24197933? False Does 424 divide 245747432? True Is 186 a factor of 22996855? False Is 965961516 a multiple of 2938? True Does 1562 divide 264627792? True Does 18 divide 72771300? True Is 9913266 a multiple of 891? True Is 1184375129 a multiple of 49? True Is 115 a factor of 10987895? False Does 120 divide 795068760? True Is 471 a factor of 223142946? False Does 3606 divide 68135370? True Is 2375222 a multiple of 11? False Is 532 a factor of 68701513? False Does 84 divide 7638513? False Does 19 divide 82938173? True Is 2481356125 a multiple of 5? True Does 15 divide 98590331? False Is 41266983 a multiple of 16? False Is 38 a factor of 147923584? False Does 704 divide 2943963968? True Is 8121942 a multiple of 963? True Is 296879070 a multiple of 141? False Is 10968705 a multiple of 900? False Is 17 a factor of 29242667? False Is 15224814 a multiple of 594? True Is 108 a factor of 89363043? False Does 4151 divide 462122434? False Does 1127 divide 23026864? True Does 10 divide 71441410? True Does 365 divide 7179265? False Is 414 a factor of 79698312? True Does 18 divide 28924434? True Does 292 divide 27126005? False Is 4 a factor of 46280826? False Does 2746 divide 75206051? False Does 86 divide 43801606? True Is 98513048 a multiple of 536? True Does 1295 divide 506819035? False Is 841681764 a multiple of 77? True Is 6096 a factor of 2285372112? True Is 42706210 a multiple of 1136? False Does 1994 divide 63263638? True Does 538 divide 60791006? False Is 1278570786 a multiple of 32? False Is 3193 a factor of 76991143? False Does 188 divide 11176600? True Is 1439 a factor of 61892324? False Is 619 a factor of 96297560? False Is 71103570 a multiple of 3? True Is 368509776 a multiple of 197? True Does 1696 divide 28268928? True Does 24 divide 139399728? True Does 62 divide 30169200? True Is 44 a factor of 2059650985? False Does 46 divide 476789494? True Is 1153 a factor of 1611295593? True Does 81 divide 284224950? True Does 6 divide 209852052? True Does 31 divide 8567930? False Does 3 divide 201342977? False Does 553 divide 4472052430? False Is 14 a factor of 260392426? True Is 53 a factor of 61052627? False Does 332 divide 1362246132? True Is 42854256 a multiple of 6? True Is 365 a factor of 312939777? False Does 27 divide 170614215? True Is 2250 a factor of 965916000? True Does 75 divide 242544299? False Is 2866823743 a multiple of 231? False Is 758 a factor of 47874472? False Is 3567 a factor of 930264425? False Is 41357568 a multiple of 96? True Is 80855942 a multiple of 314? True Does 193 divide 890842645? True Is 32482973 a multiple of 9? False Is 1669 a factor of 29431146? True Does 2618 divide 739180254? False Does 40 divide 11408350? False Is 15612863 a multiple of 861? False Is 14 a factor of 13200150? False Does 81 divide 774372474? True Does 45 divide 8188445? False Does 24 divide 26524896? True Is 31193268 a multiple of 6? True Is 24978138 even? True Is 9 a factor of 8670780? True Is 21 a factor of 5133450? True Is 127389705 a multiple of 445? True Does 8 divide 839107? False Is 22605552 a multiple of 716? True Does 55 divide 27125468? False Is 420 a factor of 10784827? False Is 138 a factor of 618433? False Is 25427196 a multiple of 324? True Does 1063 divide 59367487? True Does 956 divide 56897325? False Is 76 a factor of 25490324? True Is 42 a factor of 870337650? True Does 417 divide 424153545? False
Let x(c) = -10c - 27. Let i(o) = 18o + 50. Let l(j) = -3i(j) - 5x(j). Determine l(-3). -3 Suppose p + 11 = -2p + 5j, -7 = -5p + 2j. Let s be (-14)/p18/(-12). Let m(z) = 0 - 1 + 22z - 23z + s. What is m(7)? -1 Let q be 304/57 - ((-2)/(-6))/1. Suppose -qb - 18 = -28. Let w(h) = 6h2 + 6h + 2. Let k(l) = 17l2 + 17l + 5. Let d(c) = -4k(c) + 11w(c). Give d(b). -10 Let q(z) be the second derivative of z*4/6 - 10z*3/3 + 25z*2/2 + 2754z. Determine q(8). -7 Let a(p) = -p*2 + 4p + 6. Let u(o) = 51o + 17. Let z be u(-16). Let h = 806 + z. Determine a(h). -15 Suppose -2z + 201 - 177 = 0. Let q(s) = s*2 - 14s + 30. What is q(z)? 6 Let a(j) = 3j - 1. Let n = 68 - 55. Suppose 3p + 4 = n. Suppose 3q = 5f + 8 - 10, -f + 10 = -pq. Give a(f). -7 Let l = 767/20712 - -4/863. Let o(t) be the third derivative of lt*4 + 1/60t*5 + 0t + 0 + 14t2 - 1/6t*3 + 1/120t6. Determine o(1). 2 Let z(o) = -o3 - 5o2 + 7o + 6. Let b be -1 + -1 - 70/(-14). Suppose -4 = -by - 22. Determine z(y). 0 Let g(u) = -3u*3 + 3u*2 - 2u + 1. Suppose -4 = -2h, -136 = -11z + 16z + 2h. Let c be (z/(-14))/(2/5) - 3. Calculate g(c). -15 Suppose 8 = 19l - 15l. Let v(b) = 3b - 133b*2 - 124b2 - 1 + b3 + 253bl. Give v(3). -1 Let x(l) = 2 + 51l - 104l + 51l + 8. Let a be (-3)/9 - 5/(-15). Suppose 3d + z - 17 = 0, -3d + 25 = -z - az. Determine x(d). -4 Let w(d) = -d3 + 3d*2 - d + 8. Let u(z) = -4z*3 + 20z*2 - 12z + 46. Let y(i) = u(i) - 6w(i). Give y(-2). 2 Let l(i) = 6i*2 + i + 18. Let d = 27179 - 27184. What is l(d)? 163 Let q(u) = 21u - 73. Let p(b) = -19b + 74. Let h(g) = -7p(g) - 6q(g). Determine h(11). -3 Let d(x) = -x3 + x - 2. Let a(y) = -5y3 - y2 + 5y - 9. Let i be (1 - (7 + -3)) + 7. Let s(w) = id(w) - a(w). Calculate s(2). 11 Let i(b) = b*3 + b + 6. Let w be (-13)/65 + (-36)/(-5). Let c be 12/2 + -8 + 4. Suppose -wj + cj = -0j. Give i(j). 6 Suppose 0 = -34y - y - 47y + 574. Let j(z) be the second derivative of 0z2 + yz + 0z3 + 0 - 3/20z*5 + 1/12z*4. Determine j(1). -2 Let m(t) = -2t*2 + 8t + 7. Let r(p) be the second derivative of p*4/4 - 3p*3/2 - 4p*2 - 6p - 4. Let s(u) = 4m(u) + 3r(u). Calculate s(-5). 4 Let l(z) = -z*3 + 3z*2 - z + 2. Suppose 5h - 20 = 5n - 0h, -h = -3n - 8. Let t be -5 + 8 - (-2 - n). Give l(t). -1 Let m(p) be the third derivative of p6/120 + p5/12 - p4/24 + p3/3 - 39p*2 + 53p. Let w = 4 + -9. Determine m(w). 7 Let w(z) = z*2 + 6z - 2. Let f(q) = -q*3 + 3q*2 + 14q - 12. Let l be f(5). Let b(v) = lv2 - 6v*2 - 8 - 6v - 5. Let d be b(4). Determine w(d). -7 Let f(m) = m*2 - 9m - 3. Let r = 511 + -517. Let y be (3 - 12)6/r. What is f(y)? -3 Let h = -3861 + 3846. Let v(t) = t3 + 16t*2 + 17t - 9. Calculate v(h). -39 Let r(u) = 15u - 6. Suppose -168n + 152n = 32. Calculate r(n). -36 Let r(q) = q3 + 6q*2 - 1. Suppose -6b - 61 + 13 = 0. Let g be (-17 + -3)(-2)/b. What is r(g)? 24 Let s(b) be the third derivative of -b6/120 + 7b5/60 - b4/12 + b*3/2 + 7b*2 - 29b. Determine s(6). 27 Let s = -76 + 85. Let i be -1 - ((-25)/7 + s/(-21)). Let b(d) = -id2 + 1 - 84d + 84d. Give b(-1). -2 Let n(x) = -x3 - x2 + 44x + 5. Suppose 10q + 20b = 21b + 65, 3b + 39 = 4q. What is n(q)? 17 Let m(p) = 8p*2 - 25p + 8. Let x(l) = l*2 - 11l. Let f(h) = m(h) - 2x(h). Calculate f(3). 53 Let k(z) = -z2 - 9z + 12. Let m be k(-10). Let a(l) = -l*2 - 1448 - ml + 1446 + 6l. Let p = 32 + -28. Determine a(p). -2 Let y(b) = -b3 - 12b*2 + 13b - 16. Suppose -5c = 19c + 215 + 97. Calculate y(c). -16 Let n = 336 + -336. Let z(g) = -6g2 + 4g2 - 2 - g3 + n + 2g + 2g*3. Calculate z(2). 2 Let y(m) = 4m - 82. Suppose -23r + 24r - 54 = -3c, 6r - 20 = -2c. Determine y(c). -6 Let p(l) = -l2 - 3 - 3l*3 + 0l*2 + 3l + 4l3 + 0l*3. Let c be (-19)/(209/66-3). Give p(c). 7 Let w(y) = -y*2 - 5. Suppose 0 = 5a, -a + 56 = 2h + 2a. Suppose 2o - 7o - 2q + 26 = 0, 0 = 5o + q - h. Calculate w(o). -41 Let v(y) = -682y + 1377y - 698y. Determine v(6). -18 Let l(z) = 14 - 4z - 13 + 15. Let g(j) be the third derivative of -11j4/24 + 47j*3/6 + 2j*2 + 337. Let u(q) = 3g(q) - 8l(q). Determine u(6). 7 Let o(y) = y3 - 14y*2 + 3y + 10. Let h(s) = -s*2 + 28s - 166. Let m be h(10). Give o(m). 52 Let r(t) = -4t + 3. Let j be (5 - -1)/((-62)/(-31)). Determine r(j). -9 Let x(k) be the second derivative of -k3/6 + 2k*2 + 17857k. Let m be 0/(-2) + 5 + -3. Give x(m). 2 Let l be ((-1610)/15)/(-7) + (-3)/9. Let q be (2/9l)/(16/240). Suppose -8x = 2x - q. Let s(h) = h3 - 6h*2 + 6h + 4. Give s(x). 9 Let s(w) = -w*2 - 11w + 7. Suppose -5u + 2b = -18, 0 = u - 22b + 26b - 8. Suppose 8 = -4o, um + 4o + 58 - 6 = 0. Give s(m). 7 Let g(f) = 5f - 65. Let l(p) = -p2 + 135. Let j be l(11). Calculate g(j). 5 Let v(d) = d2 - 15d - 22. Let z = -2382 - -2397. Determine v(z). -22 Let b(m) = -9m - 2m3 + m3 + 662 + 8m2 - 1222 + 572. Determine b(7). -2 Let v(g) = -g2 - 4g - 7. Let h = 602 + -598. Let u(s) = s. Let j(z) = hu(z) - v(z). Let m(c) = -2c2 - 7c - 4. Let y be m(-4). Calculate j(y). 7 Suppose -3n = 63 - 168. Let b be 1/(-5) - (-357)/n. Let h(p) = -p2 - 2p - 1. Let q(m) = -3m2 + 5m + 4. Let a(i) = -2h(i) + q(i). What is a(b)? -4 Let n = -19 - -16. Let z(b) be the third derivative of 9b*2 + 0 + 1/6b*4 + 0b - 1/3b3. What is z(n)? -14 Let z(y) = y3 - y + 2. Let n(g) = -4g3 - g2 + 7g - 13. Let t(l) = -n(l) - 5z(l). Let b(p) = -p*2 + 6p + 18. Let a be b(8). Determine t(a). -5 Let o(x) = -x*3 - 12x*2 + 2x + 28. Let a = 312 + -305. Let z(v) = -v*2 - 3v + 58. Let y be z(a). Determine o(y). 4 Suppose 90d = 47 - 587. Let m(w) = w3 + 8w*2 + 7w + 32. Calculate m(d). 62 Let f(w) be the first derivative of 9w2/2 + 22w + 4142. Determine f(-5). -23 Suppose 0p = p - s - 8, s - 16 = -5p. Let m = -287 - -294. Let u(f) = 4 + f + 4 - m. Determine u(p). 5 Let b(m) = -2m3 + 25m*2 + 15m - 20. Let x = -4151 - -4164. Calculate b(x). 6 Let b(c) be the second derivative of c*5/20 + 7c*4/12 - 7c*3/3 - 15c*2/2 + 4937c. Give b(-6). 105 Let y(t) = t*2 - 16t + 3. Let j(x) = -3x - 1. Let n(c) = -23c + 195. Let p(g) = -6j(g) + n(g). Let z be p(37). What is y(z)? 3 Let k(m) = 58 - 25m - 21 + m*2 - 3m2 - 11. Let o(s) = -s2 - 13s + 14. Let i(l) = 6k(l) - 11o(l). Suppose -5 = -2g - 19. Give i(g). 2 Suppose 4h - 4k = -88, 3k = -2h + 7k - 46. Let m = h - -26. Let l(u) = mu - 6 - 14u - 7u*2 + 6u*2. Give l(-9). -6 Let i = -68 - -68. Suppose 2j = i, 4w = 4j + 4 + 16. Let h(u) = -3u + 1. Give h(w). -14 Suppose 4k - 2k - 5h = -14, k + h = 7. Suppose -k = 7p + 25. Let g(c) = 0 - c3 - 4 + 0c*3 - 7c + 0c3 - 6c*2. Calculate g(p). -8 Let o(x) = -7x + 2. Suppose -16m + 37 + 11 = 0. Suppose 0 = 2s - mu - 3, 2s - 12 = 7s - u. Calculate o(s). 23 Let p = -23914 - -23912. Let q(u) = 8u*3 + 3u*2 + 5u + 4. Determine q(p). -58 Let t(g) = -g*2 + 7g - 9. Let x = -31 - -35. Suppose -4n = n. Suppose xb - 24 = -n. Determine t(b). -3 Suppose -4c + 12 = 0, 5r - 3c = c + 13. Suppose -rz + 4 = -3z. Let x(l) be the second derivative of -3l3/2 - l2/2 + 3l + 4. Determine x(z). -19 Let r(z) = 11z*3 + 23z*2 - 28z - 22. Let j(s) = 5s3 + 10s*2 - 12s - 11. Let m(t) = 7j(t) - 3r(t). Calculate m(0). -11 Let s(h) = h + 25. Suppose 53i = -i - 1174 - 338. Give s(i). -3 Let s(t) = -t - 4. Let q(h) = 192 - 111 + 8h - 74. Let b(f) = q(f) + 6s(f). Suppose -3r + 2r + 12 = 0. Give b(r). 7 Let c(h) = 381h*3 + 5 + 383h*3 - 1141h*3 - 4 + h + 378h*3 - 4h*2. Give c(-3). -65 Let o(y) = 4y - 55. Let a be 3 + (-26 - -13) - -27. Determine o(a). 13 Let k(c) be the third derivative of -c*6/120 + 7c*5/60 - 7c*4/24 - 439c*2. Let p = 3 - 3. Suppose p = 5t - g - 0g - 35, 1 = -4t - 5g. Give k(t). -6 Let y = 5013 - 5014. Let f(c) = 6c + 1. Suppose 0b + 3 = -v - b, 3v + 13 = -5b. Let d(o) = 1. Let z(r) = vf(r) + yd(r). Give z(2). -14 Let n(r) = 4r - 127. Let k be n(39). Let y(m) = -m*3 + 29m*2 - 2m + 63. Determine y(k). 5 Let h = -12 + 12. Let y(f) = 7f - f2 + 4 + 2f*2 + h. Let t be 36/(-7) + (-95)/(-19) + 102/(-21). What is y(t)? -6 Let z(l) be the third derivative of 0l - 1/6l4 + 2/3l*3 + 0 - 38l*2 - 1/60l*5. Suppose 0 = -v - 5q - 1 - 0, 5v + 4q = -26. Give z(v). -8
Calculate prob of sequence rjrr when four letters picked without replacement from srsrbssjsrjrjsjjr. 5/952 What is prob of sequence uji when three letters picked without replacement from {x: 1, g: 2, u: 5, i: 7, j: 1}? 1/96 Four letters picked without replacement from {g: 2, r: 5, e: 5}. What is prob of sequence rere? 10/297 Four letters picked without replacement from gltttplgsstl. What is prob of sequence tsgg? 2/1485 Four letters picked without replacement from stmttsttu. Give prob of sequence usms. 1/1512 Four letters picked without replacement from {t: 2, v: 3}. What is prob of sequence vvvt? 1/10 Four letters picked without replacement from {g: 8, e: 4, f: 7, n: 1}. What is prob of sequence gefe? 28/4845 What is prob of sequence ccc when three letters picked without replacement from ccc? 1 Four letters picked without replacement from ebeyebeby. Give prob of sequence ybbe. 1/63 Three letters picked without replacement from qiqqiqiiqqqqi. What is prob of sequence qiq? 70/429 Three letters picked without replacement from {b: 5, z: 4, d: 1, v: 3}. Give prob of sequence zzd. 1/143 Calculate prob of sequence lhh when three letters picked without replacement from klkdhlhhkl. 1/40 Two letters picked without replacement from {h: 3, v: 12}. What is prob of sequence vh? 6/35 Two letters picked without replacement from hbaaiihlihllab. What is prob of sequence li? 9/182 Calculate prob of sequence eei when three letters picked without replacement from {i: 7, e: 2, q: 3}. 7/660 Two letters picked without replacement from btntnk. Give prob of sequence tn. 2/15 What is prob of sequence wwc when three letters picked without replacement from {c: 11, w: 3}? 11/364 Calculate prob of sequence tss when three letters picked without replacement from {s: 12, t: 6}. 11/68 What is prob of sequence zpz when three letters picked without replacement from pzzppppzzpppzzpppp? 5/68 Four letters picked without replacement from kxxxnxeseekxekk. What is prob of sequence kkek? 4/1365 What is prob of sequence lcc when three letters picked without replacement from cjcccccclcccccc? 2/35 Calculate prob of sequence nsnn when four letters picked without replacement from {s: 1, d: 11, n: 6}. 1/612 Calculate prob of sequence cv when two letters picked without replacement from {v: 2, c: 7}. 7/36 Calculate prob of sequence uqqu when four letters picked without replacement from qqquuq. 1/15 What is prob of sequence ozz when three letters picked without replacement from {z: 11, o: 9}? 11/76 Calculate prob of sequence rr when two letters picked without replacement from ljljrlorjrjllajlaj. 1/51 Four letters picked without replacement from uulmlewwhwuu. Give prob of sequence mlul. 1/1485 Three letters picked without replacement from {x: 1, w: 2, q: 6, d: 2}. What is prob of sequence dqx? 2/165 Four letters picked without replacement from dddddd. What is prob of sequence dddd? 1 Three letters picked without replacement from ghgrrthtghhtfhhftght. Give prob of sequence gth. 7/342 Three letters picked without replacement from {e: 4, h: 10}. Give prob of sequence hee. 5/91 Calculate prob of sequence yi when two letters picked without replacement from {j: 1, y: 1, i: 3}. 3/20 Calculate prob of sequence tv when two letters picked without replacement from {w: 2, v: 4, f: 3, t: 6, z: 1}. 1/10 Two letters picked without replacement from imiri. Give prob of sequence ir. 3/20 What is prob of sequence jx when two letters picked without replacement from {j: 1, x: 1, g: 11}? 1/156 Two letters picked without replacement from mphmcmrmrcmrmmmwmm. What is prob of sequence cp? 1/153 Calculate prob of sequence vo when two letters picked without replacement from pdopmdvdapmdpadpv. 1/136 Two letters picked without replacement from rld. Give prob of sequence dd. 0 Three letters picked without replacement from fkkkffibjkikikkikfb. What is prob of sequence jbb? 1/2907 Calculate prob of sequence gvvg when four letters picked without replacement from {x: 2, g: 3, w: 4, v: 8}. 1/170 Four letters picked without replacement from {g: 7, c: 5, a: 2}. Give prob of sequence cagc. 5/429 Two letters picked without replacement from aaaaaaaaa. Give prob of sequence aa. 1 Calculate prob of sequence ll when two letters picked without replacement from {o: 1, j: 2, l: 2}. 1/10 Calculate prob of sequence pnpn when four letters picked without replacement from {e: 2, m: 9, p: 3, n: 3, q: 2}. 1/2584 Four letters picked without replacement from {u: 2, c: 1, t: 2, k: 1, q: 2, b: 5}. Give prob of sequence ucuq. 1/4290 Two letters picked without replacement from {m: 4, b: 5, y: 2, p: 7}. What is prob of sequence bp? 35/306 Four letters picked without replacement from {c: 5, q: 14}. What is prob of sequence cqqq? 455/3876 What is prob of sequence pj when two letters picked without replacement from ijpppjiiipejjpi? 2/21 What is prob of sequence jjj when three letters picked without replacement from zjzjzjjzzjjj? 7/44 Calculate prob of sequence dh when two letters picked without replacement from hbbhlbflbbdldb. 2/91 Four letters picked without replacement from weeeeedeedeedddde. What is prob of sequence eddw? 5/952 What is prob of sequence lvd when three letters picked without replacement from evdldl? 1/30 Calculate prob of sequence eza when three letters picked without replacement from {e: 1, z: 1, y: 2, a: 1}. 1/60 Two letters picked without replacement from sbbsqsbbbbbsbbspss. Give prob of sequence ss. 7/51 What is prob of sequence djjj when four letters picked without replacement from qjddjdj? 3/140 Four letters picked without replacement from jwegljgliiig. What is prob of sequence wgil? 1/660 Two letters picked without replacement from {f: 1, y: 7, t: 2, s: 1, v: 3}. What is prob of sequence sv? 3/182 What is prob of sequence gvm when three letters picked without replacement from {p: 3, t: 1, m: 1, v: 6, g: 2}? 1/143 Two letters picked without replacement from xmxm. What is prob of sequence mx? 1/3 Calculate prob of sequence vvv when three letters picked without replacement from vvvppvppvpvvpvvtvv. 55/272 What is prob of sequence nku when three letters picked without replacement from unuuukoo? 1/84 What is prob of sequence xqdy when four letters picked without replacement from {q: 3, x: 3, u: 1, p: 3, y: 7, d: 2}? 7/5168 What is prob of sequence lppl when four letters picked without replacement from {s: 4, l: 2, p: 6}? 1/198 What is prob of sequence cs when two letters picked without replacement from bjsjssjsbbjcbbjs? 1/48 Calculate prob of sequence ahaa when four letters picked without replacement from hahhaaa. 3/35 Calculate prob of sequence vq when two letters picked without replacement from {v: 3, y: 5, q: 2}. 1/15 Calculate prob of sequence hu when two letters picked without replacement from beeebeeehuuhubuebhb. 2/57 What is prob of sequence jj when two letters picked without replacement from {j: 4, h: 16}? 3/95 Calculate prob of sequence cn when two letters picked without replacement from kgcghkcnghgghkg. 1/105 What is prob of sequence yar when three letters picked without replacement from afytfgfrfatt? 1/660 What is prob of sequence fnn when three letters picked without replacement from fbbffnfnbf? 1/72 What is prob of sequence qrq when three letters picked without replacement from {x: 1, r: 1, q: 13}? 2/35 Calculate prob of sequence ec when two letters picked without replacement from cceecceccccccccccccc. 51/380 Two letters picked without replacement from {p: 2, c: 6, u: 4}. What is prob of sequence pc? 1/11 Four letters picked without replacement from gygggygygg. Give prob of sequence gyyy. 1/120 What is prob of sequence qk when two letters picked without replacement from {i: 1, k: 5, q: 4}? 2/9 What is prob of sequence wkm when three letters picked without replacement from kmkkmmkkkbkiww? 1/52 What is prob of sequence ap when two letters picked without replacement from ajpapppaaaapjjpaj? 21/136 Calculate prob of sequence vj when two letters picked without replacement from vvvvccjzv. 5/72 Four letters picked without replacement from jjxjzjggjgxxjxg. Give prob of sequence zgjx. 4/1365 Calculate prob of sequence pxp when three letters picked without replacement from {p: 4, x: 6}. 1/10 Calculate prob of sequence mmvx when four letters picked without replacement from {v: 2, i: 1, x: 6, m: 2, t: 3}. 1/1001 Four letters picked without replacement from {w: 2, i: 2, l: 2}. What is prob of sequence iwwi? 1/90
30334 (base 6) to base 12 23aa Convert -203001 (base 4) to base 9. -3060 Convert 662 (base 13) to base 10. 1094 48058 (base 9) to base 8 76601 What is 30300 (base 5) in base 16? 79e What is -40e (base 15) in base 5? -12124 Convert -1010111100 (base 2) to base 5. -10300 Convert -1de8 (base 15) to base 10. -6518 What is -121322 (base 9) in base 12? -3640b Convert 20a (base 12) to base 2. 100101010 What is 34504 (base 10) in base 11? 23a18 Convert 44000 (base 5) to base 12. 18a0 What is 40b (base 12) in base 8? 1113 Convert 333 (base 4) to base 8. 77 What is -10000110100000 (base 2) in base 12? -4b94 -197d (base 16) to base 7 -25011 Convert -268 (base 15) to base 2. -1000100100 What is 14b (base 15) in base 9? 358 What is -3a3 (base 16) in base 15? -421 What is -10424 (base 5) in base 10? -739 What is 91b4 (base 12) in base 2? 11110111011000 What is -1011001001 (base 2) in base 15? -328 Convert 3a (base 11) to base 8. 53 -da (base 14) to base 6 -520 What is -7ac2 (base 14) in base 10? -21338 What is -122330 (base 5) in base 7? -16514 What is 2ec6 (base 15) in base 2? 10011101100110 Convert 211422 (base 6) to base 16. 4346 Convert 1200221 (base 3) to base 14. 648 What is 211211002 (base 3) in base 2? 100000011111010 What is -14773 (base 8) in base 15? -1e86 What is 48d (base 15) in base 10? 1033 Convert 100000001 (base 2) to base 8. 401 402121 (base 5) to base 14 4934 What is 8254 (base 10) in base 16? 203e Convert 1422 (base 8) to base 7. 2202 -104442 (base 5) to base 12 -2203 Convert 22200022 (base 4) to base 2. 1010100000001010 What is -190 (base 16) in base 4? -12100 1a08a (base 13) to base 5 3110040 Convert -10050 (base 8) to base 15. -135b What is -11011 (base 3) in base 11? -a2 -474 (base 13) to base 2 -1100000011 Convert 1ae (base 16) to base 15. 1da What is 2db (base 16) in base 4? 23123 236 (base 10) to base 12 178 What is 1985 (base 16) in base 14? 2549 -1335 (base 7) to base 11 -42a 8295 (base 13) to base 9 26660 Convert 496 (base 15) to base 4. 100101 What is 8da (base 14) in base 7? 5063 Convert 230313 (base 4) to base 14. 1091 What is 102120102 (base 3) in base 15? 2775 What is -1f3b (base 16) in base 6? -101003 What is -5208 (base 15) in base 6? -212125 Convert 37358 (base 10) to base 8. 110756 What is -12232110 (base 4) in base 16? -6b94 1d5 (base 15) to base 12 2b5 What is 7012 (base 9) in base 6? 35402 What is 12130 (base 6) in base 2? 11011110110 What is -10555 (base 6) in base 10? -1511 What is 71a2 (base 14) in base 5? 1111141 Convert 1112010 (base 5) to base 11. 13826 Convert 410 (base 8) to base 12. 1a0 What is -10000101100 (base 2) in base 16? -42c Convert -57436 (base 9) to base 16. -9579 Convert cce (base 16) to base 10. 3278 Convert -6fa (base 16) to base 11. -1384 What is -5a4 (base 16) in base 10? -1444 -1551 (base 10) to base 16 -60f Convert 1454a (base 11) to base 10. 20624 What is -10212001 (base 3) in base 10? -2809 What is 131 (base 9) in base 16? 6d 1408 (base 14) to base 3 11211222 1041 (base 5) to base 4 2102 What is -22100 (base 3) in base 7? -441 Convert 1876 (base 10) to base 14. 980 -4268 (base 9) to base 7 -12104 What is 3223 (base 6) in base 16? 2df -3cb (base 15) to base 11 -718 What is -4244 (base 8) in base 7? -6310 Convert 1000 (base 2) to base 6. 12 What is 810 (base 9) in base 6? 3013 What is 0 (base 3) in base 14? 0 5c83 (base 14) to base 6 202535 What is -202121102 (base 3) in base 13? -6ab8 What is -3235 (base 14) in base 15? -2881 Convert 331 (base 15) to base 9. 881 Convert -88aa (base 16) to base 11. -24316 What is -2012 (base 3) in base 4? -323 What is b91 (base 15) in base 2? 101000110011 What is -20420 (base 8) in base 13? -3b11 Convert -2646 (base 14) to base 11. -5065 -883 (base 15) to base 8 -3603 -2244 (base 10) to base 15 -9e9 Convert -112222221 (base 3) to base 12. -63b1 -10241 (base 5) to base 9 -853 What is -43152 (base 7) in base 3? -112201000 Convert 61176 (base 10) to base 15. 131d6 179a2 (base 12) to base 13 12788 Convert 6e (base 15) to base 13. 80 What is -1000001011000 (base 2) in base 8? -10130 What is 3450 (base 6) in base 13? 4b3 Convert 4199 (base 15) to base 6. 144113 1532b (base 12) to base 11 20470 -225 (base 11) to base 2 -100001101 What is 122222101 (base 3) in base 2? 11001100110001 -191 (base 10) to base 5 -1231 -1445 (base 8) to base 9 -1084 What is -7dc (base 14) in base 12? -aa6 What is 110010000 (base 2) in base 12? 294 Convert 13474 (base 15) to base 11. 42445 What is -672 (base 8) in base 2? -110111010 1000111202 (base 3) to base 6 232502 -11e (base 16) to base 3 -101121 Convert 10330321 (base 4) to base 15. 6021 3372 (base 9) to base 10 2495 What is -334515 (base 6) in base 5? -1401041 Convert -10876 (base 10) to base 5. -322001 Convert -13d (base 16) to base 14. -189 Convert -178 (base 11) to base 9. -248 6c0b (base 16) to base 12 1400b -13180 (base 9) to base 5 -241101 -432 (base 5) to base 9 -140 What is -135b5 (base 13) in base 5? -2124040 Convert -1624 (base 7) to base 12. -467 What is -553345 (base 6) in base 15? -da15 Convert 15120 (base 10) to base 13. 6b61 -11362 (base 7) to base 3 -11000201 -5597 (base 10) to base 13 -2717 What is 113354 (base 6) in base 14? 3846 What is 4326 (base 12) in base 13? 3483 Convert acb (base 13) to base 12. 10a9 15610 (base 9) to base 13 4b42 10010101001 (base 2) to base 6 5305 -777 (base 12) to base 7 -3130 Convert -2245 (base 11) to base 2. -101110001001 What is -21355 (base 6) in base 11? -2243 -1000000 (base 2) to base 6 -144 What is 5531 (base 8) in base 4? 231121 -c19 (base 13) to base 14 -a66 a38 (base 15) to base 11 1804 What is 67c (base 15) in base 3? 2000100 What is -14242 (base 5) in base 6? -5313 Convert -b6b5 (base 16) to base 4. -23122311 -560 (base 10) to base 11 -46a What is -30013 (base 5) in base 11? -1462 111000110111110 (base 2) to base 13 1033b What is 2d0 (base 15) in base 7? 1611 What is 3220220 (base 4) in base 7? 61256 What is 211010100 (base 3) in base 8? 37400 -1301023 (base 4) to base 10 -7243 Convert 201000112 (base 3) to base 8. 33051 Convert -6a7c (base 16) to base 10. -27260 11000011 (base 2) to base 9 236 What is 3331 (base 5) in base 9? 567 Convert -2614 (base 8) to base 5. -21140 1222000 (base 3) to base 12 9b3 What is 443a (base 12) in base 5? 220114 Convert -111111 (base 3) to base 16. -16c What is -3492 (base 10) in base 8? -6644 254a (base 13) to base 2 1010010110101 What is 1010110010 (base 2) in base 9? 846 Convert -6053 (base 7) to base 15. -94b Convert 3022113 (base 4) to base 8. 31227 Convert -187 (base 14) to base 6. -1243 What is -1200 (base 11) in base 4? -120211 What is 100112 (base 6) in base 10? 7820 What is 5232 (base 6) in base 7? 3263 What is -15a (base 12) in base 14? -114 724 (base 15) to base 7 4456 Convert -4351 (base 7) to base 15. -6da Convert -d8f1 (base 16) to base 6. -1105041 Convert -1100001 (base 2) to base 3. -10121 What is -2541 (base 7) in base 12? -680 Convert -1130000 (base 5) to base 3. -1001021220 101100 (base 2) to base 12 38 221012 (base 3) to base 11 569 What is -18776 (base 9) in base 10? -13029 Convert -31012 (base 4) to base 3. -1011001 1022101 (base 3) to base 9 1271 What is 3041 (base 14) in base 10? 8289 -106b5 (base 12) to base 16 -54e9 -3490 (base 10) to base 6 -24054 What is -10001001010 (base 2) in base 5? -13343 -111101 (base 4) to base 13 -809 What is 210210202 (base 3) in base 10? 15896 What is -1085 (base 14) in base 9? -3828 What is 22457 (base 9) in base 7? 61414 Convert 1233103 (base 4) to base 8. 15723 103 (base 16) to base 3 100121 What is 111001000 (base 2) in base 11? 385 102200 (base 3) to base 13 1b3 Convert -121132 (base 6) to base 5. -320030 Convert -23073 (base 9) to base 4. -3300033 What is -2c8c (base 13) in base 8? -14612 Convert 20d3 (base 14) to base 4. 1120221 1448 (base 16) to base 12 3008 -6003 (base 13) to base 7 -53304 Convert 155673 (base 8) to base 6. 1112231 What is 4784 (base 9) in base 15? 10c4 Convert 1fc (base 16) to base 14. 284 -28a (base 12) to base 3 -112121 Convert 401 (base 6) to base 11. 122 What is -312 (base 8) in base 10? -202 Convert 10421 (base 5) to base 12. 514 Convert a6 (base 11) to base 3. 11022 What is 850c (base 13) in base 7? 104512 Convert -1011111000000 (base 2) to base 14. -2304 664 (base 15) to base 2 10110100100 What is 17672 (base 8) in base 3? 102010211 What is 1140 (base 7) in base 8? 644 Convert -13124 (base 5) to base 6. -4451 -1212 (base 13) to base 10 -2550 Convert 16a (base 13) to base 5. 2012 Convert -40025 (base 6) to base 9. -7118 -2214302 (base 5) to base 6 -455102 What is -29c6 (base 16) in base 3? -112200002 Convert -210 (base 12) to base 16. -12c -c5b (base 14) to base 9 -3303 -22243 (base 5) to base 10 -1573
Find the third derivative of 18v + 11v + 357v3 - 157v3 + v2 - 19v3 wrt v. 1086 Let p(i) = -153i*2 + 28i - 185. Let o(b) = -458b2 + 77b - 555. Let g(n) = -4o(n) + 11p(n). Find the first derivative of g(d) wrt d. 298d Let z(v) be the first derivative of 23v*3/6 - 6v*2 + 13v - 9. Let k(j) be the first derivative of z(j). Differentiate k(o) wrt o. 23 Let z be 8/36 - 260/(-45). Let r be (1 + 3)/(3/z). What is the first derivative of -4 - 1 - r + 5a + 4 wrt a? 5 What is the second derivative of 13z - 5z4 - 13z*3 - 72z - 36z wrt z? -60z*2 - 78z Let h(v) = v*2 + 8v - 7. Let o be -3(1 + 5 + -3). Let g be h(o). Find the second derivative of -gm*4 - 14m + 10m + 8m wrt m. -24m2 Suppose 6 = 2c - 0. Find the third derivative of -10k2 + 2k*c - 4k*3 + 0k*3 + 0k*3 wrt k. -12 Let n(w) be the first derivative of -267w5/5 + w2 + 58w + 124. Find the second derivative of n(v) wrt v. -3204v2 Let x(u) = -u3 - 11u2 - u - 8. Let r be x(-11). Differentiate 1 - 108w*r + 44w*3 + 32w*3 with respect to w. -96w2 Let y be 2/(5/((-5)/(-1))). Let j(u) = -u3 + 5u2 + 7u - 2. Let n be j(6). Find the third derivative of d*n - 2d*4 - 4dy - d2 wrt d. -24d Let y = -7 - -19. Let q = y + -7. Find the second derivative of 26u*3 - 2u - qu5 - 26u*3 wrt u. -100u*3 What is the second derivative of -51j*5 - 3j*2 + 19j + 3j2 + 124j*5 wrt j? 1460j*3 Suppose -q = -1 - 1. What is the third derivative of -7s*q + 7s*4 + 5s*4 + 2s*2 wrt s? 288s Let v(b) = b*2 - 2b - 3. Suppose -6w + 2w + 16 = -o, 0 = -5o. Let f be v(w). Differentiate -k + 0 + f - k - 3k with respect to k. -5 Let s = -15 + 18. Let t be (-2)/(-8) + s/(-12). What is the second derivative of 2u3 + tu*3 - 6u + 2u - 7u wrt u? 12u Let r(l) = 283l*2 + 5l + 273. Let b(p) = -2p2 - p + 2. Let x(o) = -5b(o) - r(o). Find the first derivative of x(i) wrt i. -546i Suppose -7 - 7 = -7o. What is the third derivative of -12i4 - 14i*2 - 21i*2 + 58i*o - 21i*2 wrt i? -288i Let p(i) = 83i4 - 3i*3 + 16i*2 + 3i + 3. Let q(j) = j4 + j3 - j*2 - j - 1. Let s(a) = -p(a) - 3q(a). What is the third derivative of s(c) wrt c? -2064c What is the derivative of 2p*2 + p - 30387 - 2p*2 + 17p*3 + 30987 wrt p? 51p*2 + 1 Let a(u) be the first derivative of -129u*4 + 91u*3/3 - 228. What is the third derivative of a(r) wrt r? -3096 Find the third derivative of -91529c*5 + 91529c*5 + 134c*2 - 12c*6 + 2c*4 wrt c. -1440c*3 + 48c Let x(w) be the first derivative of w3 + w2/2 - 2w + 3. Let b be x(-2). Find the third derivative of -bp5 + p4 - p*4 + 4p*5 - 9p*2 wrt p. -240p*2 Let c(i) be the third derivative of 0 + 0i + 0i3 - 1/3i*4 + 9i*2 - 1/30i*5. Find the second derivative of c(n) wrt n. -4 Suppose 117y + 9 = 118y. What is the first derivative of 31i*4 - 16i*4 + 5 - yi*4 wrt i? 24i*3 Let a(l) be the first derivative of 166l7/7 - l6/6 + l*3 + 11l + 103. What is the third derivative of a(r) wrt r? 19920r3 - 60r*2 Let l(s) be the third derivative of 0s + 2/3s3 + 0s*4 + 0 + 17/60s*5 - 7s*2. Find the first derivative of l(d) wrt d. 34d Find the first derivative of -35 + 7 + 76 + 56g4 + 29g*4 + 21 wrt g. 340g*3 Let f(q) = 0q + q*2 - q - 2q - 3 + 4q. Let u be f(-3). What is the third derivative of -2h*2 + 5h*3 + 7h*2 - 2h*2 - uh*3 wrt h? 12 Find the first derivative of 140 - 104c + 271c - 1 wrt c. 167 Let b(h) = 3h - 17. Let g be b(7). Find the second derivative of -643 + 8o + 643 - go*3 wrt o. -24o Let t(q) = q*3 + 13q*2 - 2q - 17. Suppose -2h + 1 - 27 = 0. Let s be t(h). What is the third derivative of sg2 - g2 - 3g2 + 0g*2 - 6g*3 wrt g? -36 Let i be (-20)/190 + 69/114. Let d(f) be the second derivative of 1/2f*2 - 3f - if3 + 0. Differentiate d(w) wrt w. -3 Let u(f) = -6f*3 - 5f - 8. Let t(l) = -l - 1. Suppose -r = -1 - 13. Let i = r + -9. Let j(o) = it(o) - u(o). What is the first derivative of j(d) wrt d? 18d2 Let b(a) be the third derivative of -a7/720 - a*6/144 - 11a*5/60 - 10a*2. Let c(n) be the third derivative of b(n). Differentiate c(f) wrt f. -7 Let h(p) be the third derivative of -43p*7/35 - 3p4/8 + p3 + 249p2. Find the second derivative of h(w) wrt w. -3096w*2 Let j(f) = -f + 12. Let d be j(8). Differentiate -d - 11 - 9b*4 + 5 - 9b*4 with respect to b. -72b*3 What is the first derivative of 92 + 1173q*4 - 1530q*4 + 67 wrt q? -1428q*3 Let f(t) be the third derivative of 353t*5/60 - 43t*4/4 + 238t*2 - 2. Find the second derivative of f(r) wrt r. 706 Let n(h) be the third derivative of 23h*8/48 + 139h5/30 - h2 + 41. What is the third derivative of n(p) wrt p? 9660p2 Let s(o) be the first derivative of 72o5/5 + o4/4 - 7o2/2 + o - 117. What is the second derivative of s(v) wrt v? 864v*2 + 6v Suppose -3a + 5w + 23 = 0, 5w = -2a + 1 + 6. Suppose -3n + 4 + 9 = -b, -25 = -5n. What is the first derivative of 2z - a - 20z*4 + 14z*4 - bz wrt z? -24z3 Let l(w) be the first derivative of 19w*3 - 189w*2/2 + 2w - 263. What is the second derivative of l(f) wrt f? 114 Let l(p) = 12p2 - 13. Let v(i) = -i2 + 1. Let w = -13 - -13. Suppose -y - 5 + 3 = w. Let h(x) = yl(x) - 22v(x). What is the derivative of h(k) wrt k? -4k Let l(u) = -2u2 + 2. Let a be l(0). Find the third derivative of -7 - 42v*3 - 7v - 5va - 7 + 14 wrt v. -252 Let f(a) be the third derivative of 4a*8/21 + 23a5/60 + a4/12 + 6a2 - 3a. What is the third derivative of f(y) wrt y? 3840y2 Suppose -5i - l + 39 = 0, l - 9 = -i + 2. Find the second derivative of 14u5 + 5u + iu - 20u*5 wrt u. -120u*3 Let j be (-1)/(-2)0 - 0. Let w be (11 - 10) + 8(3 + -2). Differentiate 2 + 2 - w + j + h2 wrt h. 2h Let g = 732 - 728. Let x(l) be the second derivative of 0 + 3l + 0l*3 + 2/3l*g - 3l*2. Find the first derivative of x(i) wrt i. 16i Let v(c) = 13c2 + 3c - 2. Let u be v(1). Find the third derivative of -14 + u - 5g2 + 12g*4 + 2g*4 wrt g. 336g What is the second derivative of -2160f4 + 4311f*4 - 154f - 5f3 - 2155f*4 wrt f? -48f*2 - 30f Let g(c) be the second derivative of 23c + 0c*2 + 0c*3 - 11/30c*6 + 17/12c*4 + 0c*5 + 0. What is the third derivative of g(q) wrt q? -264q Let i = 64 + -47. What is the third derivative of -in2 + 155 + n3 - 155 wrt n? 6 Let z(m) be the second derivative of 10m4/3 - m3/3 - 173m2 - m - 178. Differentiate z(w) with respect to w. 80w - 2 Let n(r) = -r3 - r2. Let z(o) = 5o4 - 2o*2 - 11o - 2. Let t(a) = 2n(a) - z(a). Find the second derivative of t(u) wrt u. -60u*2 - 12u Let z(r) = -2r + 1. Let k be z(-4). Differentiate kp*4 - 55p*2 - 47p*2 + 102p*2 + 11 with respect to p. 36p*3 Let k(q) = 4q - 20. Let v be k(21). What is the third derivative of 34m6 - 10m*6 - 77m*2 + vm*2 wrt m? 2880m*3 What is the third derivative of 6 - 4d*2 - 3d*2 - 32 - 260d*6 + 8d*2 wrt d? -31200d*3 Let t(z) = -2z - 19. Let b(i) = 4. Let s(p) = 1. Let n(g) = -b(g) + 5s(g). Let h(o) = 2n(o) + t(o). Differentiate h(x) wrt x. -2 Let d(m) be the second derivative of 0 + 0m2 + 0m*6 - 1/3m*3 + 0m*5 + 0m*4 - 14m + 1/42m7. Find the second derivative of d(f) wrt f. 20f3 Let s(f) be the third derivative of f6/72 - 7f4/8 + f3 + 12f*2. Let l(b) be the first derivative of s(b). Differentiate l(n) with respect to n. 10n What is the third derivative of -494j2 - 22j*3 + 10j*4 + 10j*3 - 11j*4 + 36j*4 wrt j? 840j - 72 Let t(p) = -p*3 - 8p*2 + 7p + 7. Let u be t(-9). Let z = u - 23. What is the second derivative of -10f2 + 6f*2 - 4f*z + 3f wrt f? -16 Find the second derivative of -38c + 24c + 40c2 - 20c wrt c. 80 What is the second derivative of 3462u4 - 3462u*4 - 365 + 672u*5 - u wrt u? 13440u*3 Let d(f) be the third derivative of -13f*6/4 + 91f*5/10 - 183f*2 - 1. Find the third derivative of d(w) wrt w. -2340 Let v be (-6)/(-2) + 0 - (-8 - -11). What is the third derivative of -2a*4 - 3a*2 - 14a*3 + 14a*3 + va*2 wrt a? -48a Let o(k) = -17k4 + 16. Let h = -66 + 72. Let d(x) = 16x*4 - 15. Let j(g) = hd(g) + 5o(g). What is the derivative of j(w) wrt w? 44w**3
Calculate the highest common factor of 4500 and 140. 20 What is the highest common divisor of 400 and 1376? 16 What is the greatest common divisor of 851968 and 832? 832 What is the highest common divisor of 7 and 552223? 7 Calculate the greatest common factor of 17658 and 13122. 162 Calculate the highest common factor of 376 and 6936. 8 Calculate the greatest common divisor of 101579 and 13587. 647 What is the highest common factor of 25465 and 33? 11 What is the greatest common divisor of 78116 and 1986? 662 Calculate the highest common factor of 11536 and 1260. 28 What is the greatest common factor of 287984 and 3772? 164 What is the highest common factor of 1092 and 32676? 84 Calculate the highest common factor of 9702 and 906. 6 Calculate the greatest common divisor of 3 and 74670. 3 Calculate the greatest common factor of 7006 and 837. 31 What is the highest common factor of 8 and 5068048? 8 What is the highest common divisor of 16 and 2945168? 16 What is the greatest common factor of 39444 and 2774? 38 Calculate the greatest common factor of 1672 and 6536. 152 What is the highest common factor of 198030 and 287? 287 What is the greatest common factor of 18998 and 25842? 118 Calculate the greatest common factor of 7128 and 18792. 648 Calculate the greatest common factor of 572 and 659945. 143 What is the highest common factor of 9 and 1965537? 9 What is the highest common factor of 10728 and 4032? 72 What is the highest common factor of 1280 and 67520? 320 What is the highest common divisor of 349938 and 18? 18 Calculate the greatest common divisor of 136452 and 15936. 996 What is the highest common divisor of 60 and 54195? 15 What is the greatest common factor of 3612 and 262644? 516 What is the highest common divisor of 88 and 199568? 8 Calculate the greatest common factor of 468 and 29718. 234 What is the greatest common factor of 111325 and 150? 25 Calculate the greatest common factor of 2170 and 8432. 62 What is the greatest common factor of 202420 and 696? 116 What is the greatest common divisor of 204267 and 685? 137 What is the greatest common factor of 57366 and 180? 18 What is the highest common factor of 48 and 90808? 8 Calculate the greatest common factor of 29162 and 28. 14 What is the greatest common factor of 227504 and 12744? 472 What is the greatest common divisor of 858 and 1144? 286 Calculate the highest common divisor of 763 and 887151. 109 What is the highest common divisor of 3012529 and 3783? 1261 What is the highest common divisor of 16740 and 162? 54 What is the highest common factor of 93330 and 51? 51 What is the greatest common factor of 124 and 11873? 31 What is the greatest common divisor of 10 and 184660? 10 What is the greatest common factor of 7214 and 18? 2 What is the greatest common divisor of 128 and 144? 16 Calculate the greatest common factor of 3 and 178122. 3 What is the greatest common divisor of 75428 and 10900? 436 What is the greatest common factor of 1441 and 341386? 131 Calculate the highest common divisor of 713 and 23092. 23 What is the greatest common factor of 14875 and 19040? 595 Calculate the highest common divisor of 295 and 245. 5 Calculate the greatest common factor of 276 and 2573148. 276 Calculate the highest common factor of 4316 and 97136. 52 Calculate the greatest common divisor of 32482 and 4360. 218 Calculate the highest common divisor of 60 and 2353220. 20 Calculate the greatest common factor of 207 and 15157. 23 What is the greatest common factor of 6 and 518406? 6 What is the greatest common factor of 3 and 15055? 1 What is the highest common divisor of 334940 and 80? 20 What is the greatest common divisor of 15 and 692574? 3 What is the greatest common divisor of 99311 and 47? 47 Calculate the highest common factor of 112 and 93912. 56 Calculate the highest common divisor of 323 and 8143. 17 What is the highest common divisor of 1205 and 965687? 241 Calculate the greatest common factor of 143 and 82849. 13 Calculate the greatest common divisor of 116 and 11948. 116 What is the highest common divisor of 336 and 53046? 42 What is the highest common factor of 2086 and 240784? 298 Calculate the highest common divisor of 1578 and 557823. 789 What is the greatest common divisor of 6216 and 14616? 168 Calculate the greatest common divisor of 304 and 19248. 16 What is the highest common factor of 51490 and 570? 190 What is the highest common divisor of 46492 and 2124? 236 What is the highest common factor of 26467 and 7847? 133 Calculate the highest common divisor of 82155 and 30. 15 Calculate the highest common divisor of 20 and 208390. 10 What is the greatest common divisor of 35758 and 152? 38 What is the greatest common divisor of 132 and 538648? 44 What is the highest common factor of 707 and 53? 1 Calculate the highest common divisor of 29746 and 2996. 214 What is the greatest common factor of 20450 and 24650? 50 What is the highest common divisor of 1086 and 1698? 6 What is the greatest common divisor of 98 and 45864? 98 Calculate the highest common factor of 840 and 28392. 168 Calculate the greatest common factor of 151905 and 8528. 533 Calculate the highest common factor of 2244 and 462. 66 What is the highest common factor of 3800 and 561640? 760 Calculate the highest common factor of 68976 and 2395. 479 Calculate the highest common divisor of 750 and 4656250. 250 Calculate the greatest common divisor of 4617 and 72. 9 Calculate the highest common factor of 1963 and 376443. 151 Calculate the highest common divisor of 72555 and 345. 15 What is the greatest common factor of 144 and 1488? 48 Calculate the highest common divisor of 8004 and 24244. 116 What is the greatest common divisor of 25122 and 1027? 79 Calculate the highest common divisor of 116 and 26941. 29 Calculate the greatest common divisor of 186 and 124682. 62 What is the highest common divisor of 61032 and 24? 24 Calculate the highest common divisor of 147388 and 12. 4 Calculate the greatest common divisor of 5298535 and 110. 55 Calculate the greatest common divisor of 322320 and 40. 40 What is the greatest common factor of 51 and 73389? 51 What is the highest common factor of 278 and 116899? 139 Calculate the greatest common factor of 109977 and 14. 7 Calculate the greatest common factor of 2528 and 96. 32 What is the highest common factor of 3748 and 8? 4 What is the highest common factor of 24839 and 5894? 421 Calculate the highest common factor of 64268 and 12. 4 What is the highest common factor of 14 and 32459? 7 Calculate the highest common factor of 102 and 5746. 34 What is the greatest common divisor of 30 and 87645? 15 Calculate the highest common divisor of 10 and 32960. 10 What is the greatest common factor of 280 and 31000? 40 What is the greatest common factor of 3808 and 25058? 34 What is the greatest common divisor of 112 and 38768? 16 What is the highest common divisor of 112869 and 18? 9 Calculate the greatest common divisor of 843 and 24. 3 Calculate the highest common divisor of 1636268 and 1016. 508 Calculate the highest common factor of 630 and 938. 14 What is the highest common factor of 82940 and 30? 10 What is the greatest common divisor of 24584 and 9128? 56 What is the highest common divisor of 69589 and 5512? 689 What is the highest common factor of 12 and 3651? 3 Calculate the greatest common factor of 5124 and 672. 84 What is the greatest common divisor of 223743 and 195? 39 Calculate the highest common divisor of 99 and 89199. 99 Calculate the greatest common factor of 524 and 8515. 131 What is the highest common factor of 570 and 5982150? 570 What is the greatest common divisor of 13 and 133900? 13 Calculate the greatest common divisor of 3 and 34620. 3 Calculate the highest common factor of 192554 and 344. 86 Calculate the highest common divisor of 440 and 330920. 40 Calculate the greatest common divisor of 3731283 and 846. 423 What is the highest common factor of 162715 and 21? 7 What is the highest common factor of 1762567 and 31? 31 Calculate the highest common factor of 2080 and 337610. 130 What is the greatest common divisor of 3952831 and 103? 103 What is the highest common divisor of 4671240 and 1340? 1340 What is the greatest common divisor of 141 and 3398523? 141 Calculate the highest common factor of 215140 and 21167. 347 What is the greatest common factor of 344 and 5117? 43 What is the highest common divisor of 23274 and 54? 54 What is the highest common factor of 21573 and 6486? 141 Calculate the highest common divisor of 32899 and 167. 167 What is the highest common factor of 2190 and 1260? 30
Let b be 10/(-8)(-4 - (-7 - -7)). Solve 3r - 2p = b, -2p = -2r - 3r + 7 for r. 1 Suppose 4x - 16 = -0. Let l be ((-26)/12 + 2)/((-10)/60). Suppose -4d - 4 = -16, -i = -5d - l. Solve -3r + 18 = -xy + 46, -r + 3y = i for r. -4 Let n = -2785 + 2787. Solve i + 2h = 4i - 6, -4i = nh - 22 for i. 4 Suppose 77k - 144 = 83k. Let m be ((-4)/(-16))/((-2)/k). Solve 2h + 10 = -2g, 8 = -mg - 2h - 5 for g. -3 Let u(q) = q + 16. Let h(f) = -2f - 17. Let s(p) = 2h(p) + 3u(p). Let y be s(13). Let x(n) = -n. Let o be x(0). Solve 4k + 4 - y = -c, o = 3c - 15 for k. -2 Let q be ((-2)/(-2) + 0)/((-1)/94). Let g = q - -96. Solve 3f = -gf, 3f + 12 = -3n for n. -4 Let x be 18/5(-5)/(-2). Suppose -6 = -xh + 7h. Solve -ht = t + 8, -3j = 4t + 23 for j. -5 Let b = -797 + 810. Solve 5w + b = 8y - 6y, 4y - 13 = -3w for y. 4 Let q be (-8 + 2 + 6)/2. Solve -3u + qz + 13 = z, 5z = 5u - 15 for u. 4 Suppose -2v = 72 - 74. Solve v = a + 2a - b, -2b = -2a + 6 for a. -1 Suppose 10l - 13l = -3r + 9, -2r - 6 = 2l. Solve -3w + 6 = -3s, 2s - 1 - 3 = r for w. 4 Suppose 0 = -3f - 7 + 16. Let h = 434 - 431. Solve hr - 2r - 5 = fk, -r = 3k + 1 for k. -1 Let k(f) = -f - 4. Let t be k(-14). Let p be 1/(-4) - 13/(-4). Suppose 3l = y - p, 3l - l - 6 = -2y. Solve 2c - 20 = yc - 5r, c - t = -r for c. 5 Suppose -93 = q - 95. Solve 0 = 5p - m - 20, -3 - q = 2p - 3m for p. 5 Let g = 3 - -1. Let b be (4 - (-72)/(-20))-145. Let j = -34 - b. Solve n + 5a = -j, -4 = 4n + n - ga for n. -4 Suppose -3z - 5g = -130 - 87, 0 = -2z + 3g + 170. Suppose 0 = 2q - z + 61. Solve -3j - 3s - 18 = 0, -4j = -s + q + 10 for j. -5 Let s be ((-532)/(-1995))/(2/30). Solve h + p = -3p - 15, 0 = 3h + sp + 21 for h. -3 Suppose 82 + 14 = 6b. Solve 0 = 2r, 4w + r + r - b = 0 for w. 4 Suppose -61s - 4 = -63s. Solve -sv + 10 = -3g, 2g + 2v + 15 = 5v for g. 0 Let d(l) = -l3 - l2 - l - 11. Let z be d(-3). Solve -3a + z = -5h - 14, -h - 18 = -5a for h. -3 Let o be 84/27 - ((-1498)/126 + 12). Solve 0 = -os - 3h + 18, 3s = 5h - 11 - 3 for s. 2 Suppose -3h + h + 8 = 2l, 0 = 2h + l - 4. Let u(i) = i3 - i2 + 10. Let x be u(h). Suppose x = 4g - 2. Solve 0 = m - 1, -3n + m + 8 = -g for n. 4 Let q = 115 - 90. Suppose 0 = -0g + 5g - q. Solve 2j + 7 = z - j, 4j = -3z - g for z. 1 Let x = 37 + -35. Let y be x/6 + 805/69. Solve q + 5b = -3q + y, -8 = -4q - 4b for q. -2 Let j be (-2)/13 - (4752/(-78))/6. Let d = -7 + j. Solve 0 = 3f + o + do + 13, -2f - 11 = 5o for f. -3 Suppose 0w + 5v = -w + 3, 4w - 108 = 4v. Suppose w = 4u - 5. Suppose -4m = 5 - 13. Solve -mt + u = t + 5c, 3t - 14 = 2c for t. 4 Let y(s) = 0 - 2 + 17s2 - s - 16s*2. Let q be y(2). Suppose 7 + 1 = 2g. Solve q = -5z - 4b + 8, gz - 2b = b - 6 for z. 0 Let q be 78 + -2 + 1 + 0. Let p be (220/q)/(4/14). Suppose 3o + p = 4s, 6o - 6 = s + o. Solve 0 = sf + 4t + 24, 8t + 16 = 4t for f. -2 Suppose -r + 20 = 3r. Let g = 12 + -3. Suppose 4n = g - 1. Solve -y - 2y + 13 = na, -28 = -ra - 3y for a. 5 Suppose 100 = 46p - 26p. Solve -4m = pt + 20, 5t - 2t + 5 = -m for t. 0 Suppose 0 = p + 2p + 30. Let g be 72/20 - 4/p. Let w = -2 + g. Solve 0 + 1 = -wj + v, 4v = -4 for j. -1 Let a(z) = -z*2 + 6z + 10. Let p be (-7)/(-35) - 68/(-10). Let y be a(p). Solve -2w - 2w - yc = 9, -c + 4 = -w for w. -3 Let t = 247 - 243. Solve -4b + 16 = n, 6 - 2 = -2n + tb for n. 4 Suppose -143t + 30 = -137t. Solve -4y + 15 = -3y + 4p, 17 = 3y + tp for y. -1 Let s(i) = i3 + 9i*2 - 11i - 4. Let y be s(-10). Let w = 127 + -124. Solve -3p = wa - y, 1 = a + 2p - 4 for a. -1 Let f be (-82)/(-10) - ((-690)/(-75) + -9). Solve i + 0i = -c + f, -2i + 31 = 5c for c. 5 Suppose 3y = 4y - 6. Let u = 21 - y. Solve -4r + f - 10 = -f, 3f - u = 4r for r. 0 Let i be (2/6)/(5/75). Solve ix + 5 = l, -16 = 2l - x + 4x for l. -5 Let n(s) = -s*2 + 8s + 13. Let b(y) = -2y + 3. Let t be b(-3). Let d be n(t). Solve 23 = 3o + 5r, -9 = 3o - dr + r for o. 1 Let p(b) be the first derivative of 2b*3/3 + 3b*2/2 - 4b - 16. Let f be p(-3). Solve -2x - 24 = fd, -6d = -3x - d + 14 for x. -2 Suppose -3a + o = 4o - 27, 0 = 3a + o - 25. Solve -4m - a = -t, -t - 3t = 3m + 6 for m. -2 Let j(o) = -4o3 + 5o*2 + 5o + 1. Let l(d) = 3d3 - 5d*2 - 4d. Let p(z) = 4j(z) + 5l(z). Let m be p(-5). Solve -3k - a = -m + 3, -3a = 15 for k. 2 Let l be -20(-6)/93/8. Suppose -lw = -6w. Solve -5d + 3z + z + 7 = w, z - 1 = 4d for d. -1 Let c(n) = 3n + 3 - 3n + n - 1. Let r be c(2). Suppose 5l - r - 11 = 0. Solve 2w + 17 = 5q, 0 = -3q + 5w - l - 2 for q. 5 Let u be (-10)/424/(-30). Let f be (-12)/(-2)u/4. Suppose fw + 4 + 0 = 2z, -5z + 10 = w. Solve 0j - 5j - x + 24 = w, 0 = -2j + x + 4 for j. 4 Let c(p) = -5p + 33. Let f be c(6). Solve 5 = 5m - 0m + fs, 0 = -3m - 2s + 4 for m. -2 Suppose 44b - 102 = 30. Solve -bm = 3, -3n = -m + 4 - 5 for n. 0 Let j be 8/1290/12. Solve 2w = 2z - 12, -jz + 16 = -4w - 3z for w. -2 Suppose -85 = s - 25. Let g be ((-20)/s)/((-2)/(-36)). Solve -w + 9 = -2d, 2w + 4d + 24 = gw for w. 3 Let m(u) = -2u - 2. Let v be m(-2). Solve -5p - 21 = -5a - 66, vp - a - 14 = 0 for p. 5 Let d = -295 - -298. Solve 4j + 3g = 9, -j - 2j - d = -g for j. 0 Suppose 2h = 4a - 28, -5a - 3h + 1 = -23. Solve -4m - 12 = 3j, -2m + a = -4m for j. 0 Let r(u) = -u3 - u2 - 2u - 3. Let t be r(-2). Let q be 1/((-14)/(-78)) + 32/(-56). Solve -5p = -c - 4c + t, -qp - 23 = c for p. -4 Suppose 0 = w - 5, -2o + 36 + 17 = 3w. Suppose -8k = -20k + 288. Let j = k - o. Solve -2n - jq + 4 = -q, 2n + 3q = 5 for n. 4 Let n(l) be the second derivative of l4/12 + l3/2 + l*2 - 11l. Let x be n(-2). Solve 2y - 3w + 13 = x, 4y + 3w - 18 = y for y. 1 Suppose 2w + 21 = 5r - 0r, -2w - 4r + 24 = 0. Solve wo = 8, k - 16 = -6o + o for k. -4 Let k(h) = 3h + 43. Let b(o) = -o - 22. Let p(d) = -5b(d) - 2k(d). Let c be p(16). Solve 4s + 8 = r - 10, 2s + c = r for r. -2 Suppose 3t + 52 = 7t. Let y = t + -13. Let w = 25 - 15. Solve -4f + 3p - 6 = y, -w = f - 4p - p for f. 0 Suppose -4n + 31 = 5j - 7n, j - 5n = 15. Solve -4v + j = -3t - 4, 2t + 5v = 17 for t. 1 Let r(z) = 0 + z - 2z - 1. Let p be r(-1). Suppose 2c = 8, po + 4o + 5c = 84. Solve -4d - 2 = 3y + 2y, 4d + o = 2y for y. 2 Let f = 44 - 47. Let s be 2/f234/(-12). Solve 3l + 4r = -s, l = -4r - 16 + 1 for l. 1 Suppose -3j + 4z = -44, 0 = -5z + 7 + 13. Suppose 5u = -j + 35. Solve um = 5o + 31, 0m + m + 5o = -23 for m. 2 Suppose -165i + 158i + 14 = 0. Solve 5u - 3b + 4b = -4, -iu + b = -4 for u. 0 Suppose -4x + 0n - 2n = 134, 2x = 2n - 76. Let b be (-171)/(-7) + (-20)/x. Suppose 0y = -5y + b. Solve 3l = 2l + 4f - 11, -f = 2l - y for l. 1 Suppose u = -4t + 9, 2u = 337 - 335. Solve d - t - 1 = -g, -g + 9 = 4d for g. 1 Suppose 1 + 7 = 4f. Suppose c = -2i + 9, -fi + 7 + 22 = 5c. Let q be (11 + -5)(-40)/(-48). Solve -3j = -3g + 6, -2j - cg + 5 = -q for j. 0 Let y be -5 + -14 + (1 - 2). Let z be (-14)/(-5)y/(-2). Suppose 10 = 5x - 3x. Solve 0 = 3w - w - 2t - 16, xw = t + z for w. 5 Suppose -6 = -6w + 6. Suppose 5u + 14 = -2t, 5t - t + wu = 4. Solve 0g + g = -k, 4g + tk = -3 for g. -3 Suppose 44 = m + 2v, -4 + 2 = v. Let n = -23 + m. Solve -n = 2t - 3a, -4a - 5 = 2t - 15 for t. -5 Suppose 111 = 87k - 63. Solve 4w = -2u, 2u = -ku - 3w for u. 0 Let d be 10/(-15) + (-34)/3. Let z = d - -15. Suppose 2s - zs + 4 = 0. Solve h + sx = 15, -3x = -5h - 0x - 17 for h. -1 Let d be (3/(-5))/(340/50 + -7). Solve dg + 4a + 16 = 0, -g - 5a + 0 - 9 = 0 for g. -4 Let y = 7140 - 7137. Let t be (0/(-2))/((-1)/(-1)). Suppose 4n - 4h = 9 + 3, 4h - 4 = t. Solve 5 = nk - 2w + w, 0 = -yk - 2w + 1 for k. 1 Let k = -34 + 41. Let q(s) = s - 4. Let m be q(k). Solve -4w = -0w, mw = i - 1 for i. 1 Let z = 23 - 40. Let o = z + 20. Suppose 0 = -0d - 3d - oi, 4d = 2i. Solve -3a = 3t + 3, -2a - 18 = -da - 2t for a. -5 Let z = -1305 - -1321. Solve 0 = 4l - 11u + 6u + 16, 4l + 2u = -z for l. -4 Suppose 4y - 2a - 8 = 0, 3y + 2a = 8y - 12. Solve 20 = ym, 3m - 25 = o + o for o. -5 Let n = -19 - -63. Suppose 3v = -n + 56. Solve 0 = -4x + vm + 12, 5m + 11 + 4 = 0 for x. 0 Suppose 2t + 39 = -55. Let r = -47 - t. Solve 2m + o = r, -3m + 11 = -o - 3o for m. 1
Four letters picked without replacement from {k: 3, b: 17}. Give prob of sequence kkbk. 1/1140 Calculate prob of sequence ez when two letters picked without replacement from {h: 3, z: 2, e: 3}. 3/28 Three letters picked without replacement from wwwwwdww. Give prob of sequence www. 5/8 What is prob of sequence yf when two letters picked without replacement from ffyyfffyyfjyf? 35/156 Two letters picked without replacement from {t: 4, z: 2, e: 2, s: 4}. Give prob of sequence es. 2/33 Calculate prob of sequence lkt when three letters picked without replacement from tltk. 1/12 Three letters picked without replacement from uuuuuu. What is prob of sequence uuu? 1 Three letters picked without replacement from {q: 1, r: 11}. What is prob of sequence rrr? 3/4 What is prob of sequence msll when four letters picked without replacement from ssslllllssssm? 7/858 What is prob of sequence lig when three letters picked without replacement from liliiiigigllolii? 1/42 Three letters picked without replacement from mtqqtqmttah. Give prob of sequence mqq. 2/165 Three letters picked without replacement from ooossooosoo. Give prob of sequence oss. 8/165 Calculate prob of sequence uzu when three letters picked without replacement from {o: 1, r: 1, u: 3, w: 1, z: 2, b: 5}. 1/143 Three letters picked without replacement from {j: 1, g: 5, x: 4}. Give prob of sequence xjg. 1/36 What is prob of sequence jb when two letters picked without replacement from {y: 2, j: 1, b: 2, l: 1, g: 2, f: 1}? 1/36 What is prob of sequence cn when two letters picked without replacement from nncrcanzzc? 1/10 Two letters picked without replacement from lzzqlmbmlmzbpp. Give prob of sequence pq. 1/91 Two letters picked without replacement from urxixkkxuxxikikrxx. Give prob of sequence ik. 2/51 Calculate prob of sequence oii when three letters picked without replacement from oiiiioioiiooooiooio. 40/323 Calculate prob of sequence rrr when three letters picked without replacement from {a: 4, k: 3, r: 10, x: 3}. 2/19 Two letters picked without replacement from ggqqggg. What is prob of sequence gq? 5/21 Three letters picked without replacement from yyqqqqjqjjyo. What is prob of sequence joj? 1/220 Two letters picked without replacement from {p: 7, z: 3, n: 2, e: 3}. What is prob of sequence ze? 3/70 What is prob of sequence yuyu when four letters picked without replacement from yyyyyyuyyuyuuuyuyy? 11/204 What is prob of sequence zaoz when four letters picked without replacement from aaozaoaoaazaoaao? 3/1456 Two letters picked without replacement from {x: 4, l: 1, y: 1, b: 3, c: 5, p: 4}. Give prob of sequence lp. 2/153 Two letters picked without replacement from {x: 2, r: 1, w: 1, i: 1}. Give prob of sequence ir. 1/20 What is prob of sequence vv when two letters picked without replacement from vvvffvfvffvvv? 14/39 Two letters picked without replacement from yyyyzyz. What is prob of sequence yz? 5/21 What is prob of sequence nnkn when four letters picked without replacement from nnnnnnnnnnnnnnknnnk? 5/57 Calculate prob of sequence qqq when three letters picked without replacement from {q: 9, s: 7}. 3/20 What is prob of sequence gh when two letters picked without replacement from ggggghgghggghgg? 6/35 Two letters picked without replacement from xcdmvaadvaxcacvmcx. Give prob of sequence cd. 4/153 Four letters picked without replacement from {i: 1, g: 3, a: 1, x: 1, h: 5, c: 3}. What is prob of sequence acgh? 15/8008 What is prob of sequence jyjj when four letters picked without replacement from yyjyyjyyjjjyyyjjyyy? 35/1292 Calculate prob of sequence mwwm when four letters picked without replacement from mwwmm. 1/10 What is prob of sequence ab when two letters picked without replacement from bjbrjkakujujjjubbak? 4/171 What is prob of sequence td when two letters picked without replacement from dddrvttrddddd? 4/39 Four letters picked without replacement from {k: 2, m: 3, h: 3, p: 2, a: 6}. What is prob of sequence mhma? 9/3640 Calculate prob of sequence xxl when three letters picked without replacement from xxxlxxxx. 1/8 Three letters picked without replacement from {t: 1, r: 1, a: 5, k: 4, x: 1}. What is prob of sequence ktr? 1/330 What is prob of sequence oaoi when four letters picked without replacement from {a: 3, o: 11, i: 4}? 11/612 Calculate prob of sequence wdqn when four letters picked without replacement from {w: 5, r: 5, d: 5, n: 1, q: 4}. 5/5814 Calculate prob of sequence ihx when three letters picked without replacement from bxbbbihxxxxxbiibi. 1/170 Four letters picked without replacement from {z: 2, w: 2, e: 1, r: 2, c: 3, m: 2}. Give prob of sequence zcwc. 1/495 Three letters picked without replacement from vvvmwwvwvmmw. What is prob of sequence vmm? 1/44 Two letters picked without replacement from {b: 4, e: 1, k: 1, u: 2, y: 3}. What is prob of sequence bk? 2/55 What is prob of sequence bl when two letters picked without replacement from {s: 1, k: 2, r: 9, l: 3, b: 4}? 2/57 Two letters picked without replacement from {m: 1, v: 1, l: 1, n: 1, i: 1}. Give prob of sequence li. 1/20 Calculate prob of sequence oqqq when four letters picked without replacement from {o: 17, q: 3}. 1/1140 What is prob of sequence av when two letters picked without replacement from clddlvllladdddcll? 1/272 Two letters picked without replacement from zfpzppzzppvcy. What is prob of sequence yc? 1/156 Two letters picked without replacement from zzzzzzzzzzzzzzzzza. What is prob of sequence zz? 8/9 What is prob of sequence km when two letters picked without replacement from hhhkmhkhhkmhhhkh? 1/30 Calculate prob of sequence cr when two letters picked without replacement from frhffrfkhvrfrhcf. 1/60 Two letters picked without replacement from nnbnlnppnf. Give prob of sequence nl. 1/18 Four letters picked without replacement from mzuozzzpzuupzm. What is prob of sequence ozmm? 1/2002 What is prob of sequence xp when two letters picked without replacement from xxpbebpxxxbxplxnbp? 14/153 Calculate prob of sequence bab when three letters picked without replacement from {m: 3, a: 3, t: 2, f: 5, b: 2}. 1/455 Calculate prob of sequence ef when two letters picked without replacement from {f: 2, e: 1}. 1/3 What is prob of sequence ku when two letters picked without replacement from kubkkkglgkkskkl? 4/105 Three letters picked without replacement from dyqyqqdqqqddqy. Give prob of sequence yyd. 1/91 Three letters picked without replacement from bbbbbbbbbboobbbboo. What is prob of sequence obo? 7/204 Two letters picked without replacement from {o: 1, y: 1, b: 4, a: 7, w: 5, t: 2}. Give prob of sequence oa. 7/380 Four letters picked without replacement from ccxcpxxcc. What is prob of sequence cpcc? 5/252 Calculate prob of sequence cz when two letters picked without replacement from {i: 2, w: 3, c: 2, m: 2, z: 4, e: 1}. 4/91 What is prob of sequence vct when three letters picked without replacement from nvctnvccccdn? 1/132 Two letters picked without replacement from {v: 3, l: 2}. Give prob of sequence vv. 3/10 Three letters picked without replacement from xdttztxthttzdttgdddh. What is prob of sequence zzg? 1/3420 Calculate prob of sequence vv when two letters picked without replacement from {v: 11, z: 7, r: 1}. 55/171 Two letters picked without replacement from rrrftfftrtfrrfetf. What is prob of sequence rr? 15/136 What is prob of sequence zn when two letters picked without replacement from ggzigzgiggyiiggign? 1/153 Calculate prob of sequence gmef when four letters picked without replacement from {m: 1, e: 1, f: 5, g: 1, s: 3, h: 2}. 1/3432 Four letters picked without replacement from xxexxhxxxxxrxuxxxsx. What is prob of sequence xuhx? 91/46512 Two letters picked without replacement from {h: 3, q: 5, x: 2, t: 2}. What is prob of sequence xx? 1/66 Three letters picked without replacement from {f: 1, s: 1, r: 1, o: 2, w: 2, y: 2}. What is prob of sequence ffs? 0 Three letters picked without replacement from {l: 1, f: 7, v: 11}. What is prob of sequence lvv? 55/2907 Calculate prob of sequence sskk when four letters picked without replacement from kskks. 1/10 Calculate prob of sequence swp when three letters picked without replacement from {w: 1, s: 1, i: 3, p: 2, o: 3}. 1/360 What is prob of sequence tw when two letters picked without replacement from ywywyyytm? 1/36 Calculate prob of sequence bt when two letters picked without replacement from {b: 2, t: 2}. 1/3 What is prob of sequence pj when two letters picked without replacement from zzjjjjjppzjzp? 3/26
Calculate the remainder when 2039214 is divided by 281. 278 Calculate the remainder when 18573 is divided by 9260. 53 What is the remainder when 285922 is divided by 5? 2 Calculate the remainder when 7197 is divided by 2388. 33 Calculate the remainder when 19730 is divided by 19664. 66 What is the remainder when 2502 is divided by 200? 102 Calculate the remainder when 19536 is divided by 332. 280 Calculate the remainder when 10288 is divided by 2515. 228 What is the remainder when 36603 is divided by 152? 123 What is the remainder when 13485 is divided by 13422? 63 What is the remainder when 10597 is divided by 130? 67 What is the remainder when 31359 is divided by 104? 55 Calculate the remainder when 1408467 is divided by 19. 16 What is the remainder when 6718 is divided by 1665? 58 What is the remainder when 7795 is divided by 3895? 5 What is the remainder when 6075 is divided by 39? 30 What is the remainder when 48665 is divided by 117? 110 What is the remainder when 657459 is divided by 32? 19 What is the remainder when 117668 is divided by 82? 80 Calculate the remainder when 4027 is divided by 195. 127 Calculate the remainder when 21171 is divided by 441. 3 What is the remainder when 57596 is divided by 111? 98 What is the remainder when 1261 is divided by 475? 311 Calculate the remainder when 55369 is divided by 918. 289 What is the remainder when 13841 is divided by 9? 8 Calculate the remainder when 1218 is divided by 373. 99 What is the remainder when 41816 is divided by 12? 8 What is the remainder when 23641 is divided by 998? 687 Calculate the remainder when 4642 is divided by 135. 52 What is the remainder when 5746 is divided by 1312? 498 What is the remainder when 13181 is divided by 38? 33 Calculate the remainder when 514799 is divided by 132. 131 What is the remainder when 64138 is divided by 578? 558 What is the remainder when 3859 is divided by 635? 49 Calculate the remainder when 3960 is divided by 110. 0 Calculate the remainder when 38316 is divided by 12. 0 What is the remainder when 345 is divided by 54? 21 Calculate the remainder when 576377 is divided by 140. 137 Calculate the remainder when 148 is divided by 65. 18 What is the remainder when 79657 is divided by 23? 8 What is the remainder when 2216 is divided by 729? 29 Calculate the remainder when 3300438 is divided by 110. 108 What is the remainder when 2876 is divided by 64? 60 What is the remainder when 221607 is divided by 5? 2 What is the remainder when 12004 is divided by 147? 97 Calculate the remainder when 2313 is divided by 317. 94 Calculate the remainder when 4243 is divided by 2106. 31 Calculate the remainder when 4001 is divided by 61. 36 What is the remainder when 20073 is divided by 21? 18 Calculate the remainder when 214910 is divided by 903. 899 What is the remainder when 1051 is divided by 109? 70 Calculate the remainder when 946006 is divided by 22. 6 What is the remainder when 5753 is divided by 405? 83 What is the remainder when 158463 is divided by 343? 340 Calculate the remainder when 12020 is divided by 1497. 44 Calculate the remainder when 486 is divided by 10. 6 Calculate the remainder when 19948 is divided by 2848. 12 Calculate the remainder when 2617 is divided by 685. 562 What is the remainder when 170553 is divided by 77? 75 Calculate the remainder when 12071 is divided by 278. 117 Calculate the remainder when 4523 is divided by 1538. 1447 Calculate the remainder when 32204 is divided by 16095. 14 What is the remainder when 10840 is divided by 3? 1 Calculate the remainder when 209123 is divided by 875. 873 Calculate the remainder when 6077 is divided by 87. 74 What is the remainder when 138268 is divided by 414? 406 What is the remainder when 142151 is divided by 65? 61 Calculate the remainder when 58 is divided by 22. 14 Calculate the remainder when 82993 is divided by 775. 68 What is the remainder when 1250 is divided by 28? 18 Calculate the remainder when 19772 is divided by 9865. 42 Calculate the remainder when 571 is divided by 275. 21 Calculate the remainder when 137499 is divided by 1100. 1099 What is the remainder when 1357 is divided by 51? 31 What is the remainder when 8109 is divided by 1997? 121 What is the remainder when 10679 is divided by 46? 7 What is the remainder when 658019 is divided by 220? 219 Calculate the remainder when 6867 is divided by 215. 202 Calculate the remainder when 5195 is divided by 1058. 963 What is the remainder when 18477 is divided by 165? 162 Calculate the remainder when 6906 is divided by 6859. 47 Calculate the remainder when 36791 is divided by 283. 1 Calculate the remainder when 106172 is divided by 42. 38 Calculate the remainder when 7269 is divided by 357. 129 Calculate the remainder when 86019 is divided by 8601. 9 Calculate the remainder when 2790 is divided by 2772. 18 What is the remainder when 471774 is divided by 113? 112 What is the remainder when 165858 is divided by 29? 7 What is the remainder when 57361 is divided by 28663? 35 Calculate the remainder when 36162 is divided by 29. 28 What is the remainder when 601360 is divided by 705? 700 Calculate the remainder when 956 is divided by 457. 42 Calculate the remainder when 1004 is divided by 428. 148 What is the remainder when 37544 is divided by 36? 32 What is the remainder when 16242 is divided by 34? 24 Calculate the remainder when 92269 is divided by 47. 8 Calculate the remainder when 81712 is divided by 3142. 20 What is the remainder when 3485 is divided by 67? 1 Calculate the remainder when 15379 is divided by 15378. 1 Calculate the remainder when 19440 is divided by 720. 0 Calculate the remainder when 1273452 is divided by 15. 12 What is the remainder when 380758 is divided by 38? 36 Calculate the remainder when 41371 is divided by 13778. 37 Calculate the remainder when 201742 is divided by 9. 7 What is the remainder when 246341 is divided by 41056? 5 Calculate the remainder when 922354 is divided by 7. 6 Calculate the remainder when 16158 is divided by 894. 66 Calculate the remainder when 57469 is divided by 47. 35 What is the remainder when 4769 is divided by 7? 2 What is the remainder when 652794 is divided by 21? 9 What is the remainder when 1356638 is divided by 37? 33 Calculate the remainder when 2813154 is divided by 274. 270 What is the remainder when 17516 is divided by 254? 244 What is the remainder when 19768 is divided by 29? 19 Calculate the remainder when 411 is divided by 135. 6 What is the remainder when 29160 is divided by 30? 0 What is the remainder when 6207 is divided by 484? 399 What is the remainder when 308942 is divided by 49? 46 What is the remainder when 45629 is divided by 117? 116 Calculate the remainder when 375581 is divided by 44. 41 Calculate the remainder when 150677 is divided by 83. 32 What is the remainder when 8043 is divided by 9? 6 Calculate the remainder when 64530 is divided by 34. 32 Calculate the remainder when 4441895 is divided by 684. 683 Calculate the remainder when 287460 is divided by 22. 8 What is the remainder when 1761 is divided by 350? 11 Calculate the remainder when 74138 is divided by 764. 30 What is the remainder when 10811 is divided by 111? 44 Calculate the remainder when 34796 is divided by 34791. 5 Calculate the remainder when 5772 is divided by 105. 102 What is the remainder when 2149701 is divided by 2314? 2309 Calculate the remainder when 401799 is divided by 280. 279 Calculate the remainder when 15029 is divided by 188. 177 Calculate the remainder when 102004 is divided by 12. 4 Calculate the remainder when 383846 is divided by 3427. 22 Calculate the remainder when 3483 is divided by 1718. 47 What is the remainder when 253239 is divided by 1849? 1775 Calculate the remainder when 41805 is divided by 162. 9 What is the remainder when 234592 is divided by 13797? 43 Calculate the remainder when 3375 is divided by 188. 179 Calculate the remainder when 3887 is divided by 1934. 19 What is the remainder when 80354 is divided by 3? 2 What is the remainder when 29320 is divided by 27? 25 Calculate the remainder when 211924 is divided by 39. 37 What is the remainder when 6398 is divided by 461? 405 What is the remainder when 47440 is divided by 18? 10 What is the remainder when 15386 is divided by 1592? 1058 What is the remainder when 362592 is divided by 23? 20 Calculate the remainder when 105916 is divided by 17650. 16 What is the remainder when 188911 is divided by 1389? 7 Calculate the remainder when 1889 is divided by 383. 357 What is the remainder when 335778 is divided by 206? 204
What is the next term in 40214, 40089, 39964, 39839, 39714? 39589 What is the next term in -522, 660, 3544, 8130, 14418, 22408, 32100? 43494 What is next in 5417, 5411, 5397, 5375, 5345, 5307, 5261? 5207 What is the next term in -1921, -3754, -5561, -7342, -9097, -10826? -12529 What comes next: 1508140, 3016290, 4524442, 6032596? 7540752 What comes next: 123, 1609, 3081, 4539? 5983 What comes next: -55309, -55255, -55165, -55039, -54877, -54679, -54445? -54175 What comes next: 4528, 8898, 13022, 16810, 20172, 23018, 25258, 26802? 27560 What is next in 3252986, 3252951, 3252916? 3252881 What comes next: 16179, 32271, 48349, 64407, 80439, 96439, 112401, 128319? 144187 What is the next term in 228, -312, -1568, -3522, -6156, -9452, -13392? -17958 What is the next term in -841, -163, 517, 1199, 1883, 2569? 3257 What is next in 28153, 56172, 84191, 112210? 140229 What is the next term in 42291, 169551, 381779, 678975, 1061139, 1528271, 2080371? 2717439 What comes next: -557723, -1115345, -1672967, -2230589, -2788211? -3345833 What is next in -7314, -14427, -21224, -27549, -33246? -38159 What comes next: 912291, 1824407, 2736523, 3648639? 4560755 What is the next term in -11634510, -11634472, -11634434, -11634396? -11634358 What comes next: -688984, -1377856, -2066728, -2755600, -3444472, -4133344? -4822216 What comes next: -1602, -2954, -4230, -5430, -6554? -7602 What is the next term in -388, -695, -960, -1183, -1364, -1503? -1600 What is the next term in 37393, 74877, 112357, 149833, 187305? 224773 What comes next: -9887542, -19775083, -29662614, -39550129, -49437622? -59325087 What is the next term in 15005941, 30011889, 45017835, 60023779, 75029721? 90035661 What comes next: -3005, -3360, -4235, -5864, -8481, -12320, -17615, -24600? -33509 What is the next term in -115077, -460561, -1036311, -1842279, -2878417, -4144677, -5641011, -7367371? -9323709 What is the next term in 28233, 28321, 28533, 28923, 29545? 30453 What comes next: -1916082, -1916000, -1915918? -1915836 What comes next: 2277506, 2277440, 2277378, 2277320, 2277266? 2277216 What comes next: -56071, -112553, -169451, -226771, -284519, -342701? -401323 What is the next term in 931, 7335, 24661, 58351, 113847, 196591, 312025, 465591? 662731 What comes next: -7060, -3802, -570, 2624, 5768, 8850, 11858? 14780 What is next in 1252, 5674, 16522, 37006, 70336, 119722, 188374? 279502 What is the next term in 19757373, 19757380, 19757387? 19757394 What comes next: -589, -3210, -5857, -8536, -11253, -14014, -16825, -19692? -22621 What is next in 16766504, 16766517, 16766538, 16766567? 16766604 What is next in 399269, 399352, 399435? 399518 What is the next term in -1188, -2733, -4998, -8343, -13128, -19713, -28458, -39723? -53868 What is next in 126, 116, 188, 342, 578? 896 What is the next term in 1989, 7190, 15857, 27990, 43589? 62654 What is the next term in 18593969, 37187950, 55781931, 74375912, 92969893, 111563874? 130157855 What comes next: 86273, 172645, 259017, 345389, 431761, 518133? 604505 What comes next: -785, -1631, -2717, -4049, -5633, -7475, -9581, -11957? -14609 What is next in -9090, -9757, -10414, -11055, -11674, -12265, -12822? -13339 What is the next term in -160545, -160517, -160489, -160461, -160433? -160405 What comes next: 11403469, 11403470, 11403471, 11403472, 11403473? 11403474 What comes next: -4770, -19197, -43250, -76935, -120258, -173225, -235842? -308115 What is the next term in -3988516, -3988514, -3988512, -3988510? -3988508 What is the next term in -28747, -29791, -30835, -31879, -32923? -33967 What is the next term in -27718, -25184, -22648, -20110, -17570, -15028? -12484 What comes next: 154276430, 154276431, 154276432, 154276433, 154276434, 154276435? 154276436 What is the next term in -78137, -156325, -234513? -312701 What comes next: 40674, 81653, 122632, 163611, 204590, 245569? 286548 What is next in 6138, 24587, 55322, 98343, 153650? 221243 What is next in -3653, -3575, -3463, -3311, -3113, -2863, -2555, -2183? -1741 What is next in -7519884, -7519885, -7519886, -7519887, -7519888? -7519889 What comes next: -191280, -191178, -191076, -190974, -190872? -190770 What comes next: -541, 2108, 4757, 7406, 10055? 12704 What is next in 1097, 2352, 3629, 4928, 6249, 7592? 8957 What is next in -309743, -310578, -311413, -312248? -313083 What is the next term in 7426, 31324, 71154, 126916, 198610? 286236 What is the next term in -11007, -11014, -11025, -11046, -11083, -11142, -11229? -11350 What is next in 3008488, 3008494, 3008500, 3008506, 3008512? 3008518 What comes next: -372619, -372615, -372609, -372601, -372591, -372579? -372565 What is next in -1029, -2246, -5595, -12150, -22985, -39174, -61791, -91910? -130605 What is the next term in -15113, -62089, -140383, -249995, -390925, -563173, -766739? -1001623 What is next in 12844, 14132, 17636, 24466, 35732, 52544, 76012, 107246? 147356 What is next in 8556, 12063, 17900, 26061, 36540, 49331? 64428 What is next in -1056265, -2112531, -3168785, -4225021, -5281233, -6337415? -7393561 What comes next: -867957, -867827, -867611, -867309, -866921, -866447? -865887 What is next in -18788, -37637, -56548, -75521? -94556 What comes next: 13441, 53665, 120677, 214471, 335041, 482381, 656485? 857347 What is the next term in 3754705, 3754664, 3754623, 3754582, 3754541, 3754500? 3754459 What is the next term in -87673, -175057, -262441? -349825 What is next in 910, 3483, 9318, 20047, 37302? 62715 What is the next term in 1860098, 1860139, 1860196, 1860275, 1860382, 1860523? 1860704 What comes next: -1954, -5515, -11494, -19891, -30706, -43939? -59590 What comes next: 5146, 10350, 15534, 20692, 25818, 30906, 35950, 40944? 45882 What comes next: 1976672, 1976694, 1976716? 1976738 What is the next term in -1115, -7694, -14273? -20852 What is the next term in 11608, 11394, 11180? 10966 What is the next term in 28790149, 28790154, 28790159, 28790164? 28790169 What comes next: -957, -2056, -3287, -4644, -6121, -7712, -9411? -11212 What is the next term in -170212, -340421, -510630, -680839, -851048? -1021257 What is the next term in 30106, 28963, 27820? 26677 What is next in -1672416, -1672411, -1672402, -1672389, -1672372? -1672351 What is next in 15841987, 15841957, 15841915, 15841867, 15841819, 15841777, 15841747? 15841735 What is the next term in 948, 1886, 2734, 3462, 4040, 4438, 4626, 4574? 4252 What is the next term in -273032402, -546064808, -819097214, -1092129620, -1365162026, -1638194432? -1911226838 What comes next: -330205, -329681, -329157, -328633, -328109? -327585 What is next in 1089317, 4357279, 9803895, 17429171, 27233113, 39215727? 53377019 What is next in 9049, 9621, 10193, 10765, 11337? 11909 What is next in 13264, 12619, 10762, 7087, 988, -8141, -20906? -37913 What is next in -77, -1036, -2883, -5630, -9289, -13872? -19391 What comes next: -299676, -299656, -299636, -299616? -299596 What is next in 16562262, 16562256, 16562250, 16562244? 16562238 What is next in 3722, 3886, 4050? 4214 What is the next term in -3946392, -7892778, -11839164? -15785550 What is the next term in 103674, 103590, 103506? 103422 What is the next term in 2305620, 2305824, 2306028, 2306232, 2306436? 2306640 What is the next term in 16108, 25740, 35372? 45004 What is next in 6457363, 12914726, 19372089, 25829452? 32286815 What is next in -8163, -8128, -8087, -8052, -8035, -8048, -8103? -8212 What comes next: -967, -2052, -3231, -4504? -5871 What is next in 275949, 1104112, 2484381, 4416756, 6901237, 9937824, 13526517? 17667316 What is next in -312045, -624249, -936453? -1248657 What is next in -424849002, -424849000, -424849000, -424849002, -424849006? -424849012 What is the next term in 11147, 10417, 9693, 8981, 8287? 7617 What is the next term in -78884, -157634, -236384? -315134 What is next in 6098437, 12196936, 18295447, 24393976, 30492529, 36591112, 42689731, 48788392? 54887101 What is next in 50982, 49936, 48192, 45750, 42610? 38772 What is next in 1258885, 1258929, 1258975, 1259023? 1259073 What comes next: 36287, 72733, 109183, 145637, 182095, 218557? 255023 What comes next: -258524, -258504, -258486, -258470, -258456, -258444? -258434 What is next in -1298, -6673, -16146, -29729, -47434? -69273 What comes next: 4214696, 4214699, 4214702? 4214705 What is the next term in 248651, 497151, 745501, 993701, 1241751? 1489651 What comes next: 133454189, 133454188, 133454187, 133454186, 133454185, 133454184? 133454183 What is next in 1391, 2682, 4011, 5378, 6783, 8226, 9707? 11226
Solve -8n - 18 = -7n + 4d, 5n - 4d = 30 for n. 2 Solve -2 = 5q - 0d - 2d, -18 = q + 4d for q. -2 Solve 4c + 6 = z - 10, 2c - 2z = -14 for c. -3 Solve 3y - 2g + 6g + 47 = 0, 3g + 9 = 3y for y. -5 Solve -18 = -4j - 2s + 4s, 3j = -5s + 7 for j. 4 Solve -c + 8 = -5m, c + 12 = -2c - 3m for c. -2 Solve -2l + 10z = 11z - 5, -5l + 32 = -4z for l. 4 Solve -2f = -3j + 8, -3j + 4f + 8 = -j for j. 2 Solve -3o = b - 6 - 1, 9 = 3b - 3o for b. 4 Solve -l = -4o + 4, -5o + 2 = 4l - 3 for l. 0 Solve u = -5o + 25 - 1, 2u = 4o - 22 for u. -1 Solve -4f - 3 = 4p + 5, -2p - 3f - 8 = 0 for p. 2 Solve -2k = -3k - 2i + 6, 4k = -5i + 12 for k. -2 Solve 0 = -5h + 2o - 28, -2h = -371o + 373o for h. -4 Solve 2g - 1 + 11 = -3u, -u - 3 = g for u. -4 Solve 4f - 6j = -4j + 8, -4j - 16 = 3f for f. 0 Solve 3z - 14a = -13a - 18, -9 = 3z + 2a for z. -5 Solve -4k - 2i = -4i + 6, -3k + i = 6 for k. -3 Solve -10z = -11z, -3z = k + 4 for k. -4 Solve -5f + 2 = j - 5, -j = -4f + 2 for f. 1 Solve l + 14 = -5r, -24l - 4r - 24 = -20l for l. -4 Solve 3h + 14 = -4f, -2h + 8 = -5h - f for h. -2 Solve -3v + 11 = -5p, 19 = -5v + 2p + 12 for v. -3 Solve -3t = w - 10, 5t - 6w + 8w = 17 for t. 3 Solve 0 = 5x + 5b + 5, -2b = -4x + 113 - 99 for x. 2 Solve 18 = 2i - 4f, -i + f + 1 = -4 for i. 1 Solve -3b + 5p - 25 = 0, 2b - 4p + 20 = -3b for b. 0 Solve 5o = -f + 12, 5o - 10f = -9f + 18 for o. 3 Solve 23 = r - 5o + 42, -3r + 23 = 5o for r. 1 Solve 477 = -a + r + 479, 3a - 5r = 12 for a. -1 Solve -2n = 5j + 24, 5j + 14 = 3n - 0 for n. -2 Solve 3q - 4j + 0 - 10 = 0, 0 = -5q + 5j + 15 for q. 2 Solve 2g - 13 = -s, 3s - 31 = -5g + s for g. 5 Solve h = -5d - 6, 3d = 5h - 2h for h. -1 Solve -4w - 3c = -102 + 101, -5c - 5 = 5w for w. 4 Solve -8 = -4g - 4t, 5g - 2t - 2t + 35 = 0 for g. -3 Solve 0 = -5t + o - 7, -4t - 6 = -5o + 4o for t. -1 Solve -2x + 1 = 3y, y + 4x - 9x = 6 for y. 1 Solve -3d - 40 = 5s, 4s + 45 = -d - 4d for s. -5 Solve 0 = -4o - 0y + 5y + 16, 3o = 4y + 12 for o. 4 Solve -4r - 3 = 1, -2i = r + 11 for i. -5 Solve 2k - 5v - 15 = 0, -3k - 5v - 1920 = -1905 for k. 0 Solve 3k = -7y + 43, k - 6k = 2y - 33 for y. 4 Solve 3i - 41 = 8i + 4g, 5i = -g - 29 for i. -5 Solve -5d = 0, -3c + d + 12 = -6 for c. 6 Solve 5v + 88 = 5b + 108, -4b = 3v + 2 for b. -2 Solve -4k + 3a - 15 = 0, -5k - a = -k - 5 for k. 0 Solve -f - 1 = 3s, 0 = -5f + 3f - 3s + 4 for f. 5 Solve i - 4r + 12 = 0, 2r - 10 = -2 for i. 4 Solve 3u = -0s + 3s - 12, 3u + s = -12 for u. -4 Solve -2d = 8m - 11m - 4, 12 = 2m - 5d for m. -4 Solve -3 = -2r + d + 9, -17 = -5r - 4d for r. 5 Solve n + 4t = 11, 2n = 4t - 17 - 9 for n. -5 Solve 0 = r - 5l + 5, 1 - 2 = r - 3l for r. 5 Solve 0 = -3p + 3j - 6, -5 = -3p - 3j + 19 for p. 3 Solve m + 3c = 8c - 5, 18 = 2m + 4c for m. 5 Solve -3q + 4o = -25, -5q - 3o + 2 = -1 for q. 3 Solve -7a + 2b = -6a - 3, 3b = -5a + 15 for a. 3 Solve 3y = 12, 33s - 31s + 5y = 12 for s. -4 Solve -2h = -2j - 4, -4j + 27 = -0j + 3h for j. 3 Solve 2z + 6 = -5v, -z - z = 2v for v. -2 Solve -5g - 16 = 2q, g + 9q = 7q - 8 for g. -2 Solve -4y = 5g + y + 5, 2g - y = 10 for g. 3 Solve c - 1 = d, -5c + 3d = 12 - 23 for c. 4 Solve -2a = -2k - 8, -k + 0a + 4a = 1 for k. -5 Solve -v + 2t = -0 - 3, 4t = -2v - 26 for v. -5 Solve 19o - 18 = 3r + 22o, 4o = 5r - 15 for r. -1 Solve -4a + 3x + 10 = -0a, 3x = -4a - 26 for a. -2 Solve -20 = 5z + 4j, 5z - 2j = 3z - 8 for z. -4 Solve 0 = -5f - j, -j + 6 - 1 = 0 for f. -1 Solve 16 = -4p - 0p + m, 4m = -3p - 31 for p. -5 Solve -2t = 2o - 988 + 996, -2o - 3 = -3t for t. -1 Solve -3f = f - 4s, 2s - 7 = -5f for f. 1 Solve -4r = 135f - 130f - 28, -3r - 5f = -26 for r. 2 Solve -5b = 2n - 29, 3b - 13 = 9n - 8n for b. 5 Solve 5u - 5l + 25 = 0, -5u + 2l - 10 = -0l for u. 0 Solve 5b - 29 + 20 = -4l, 3b = -l + 11 for b. 5 Solve -l = u + 3u + 15, -3u = -2l + 25 for u. -5 Solve 5a + k = 5k - 19, -3a = -2k + 11 for a. -3 Solve 4m + 0 = 2t - 10, -t = m + 1 for m. -2 Solve 0 = -3d + 4y + 21, 12y + 12 = 8y for d. 3 Solve 0 = -2h - 4n + 20, 3n - 15 = 80h - 79h for h. 0 Solve 5p - 3 = d, -d - 3p - 134 = -131 for d. -3 Solve f - 1 = -o, 3o - 2o - 9f - 41 = 0 for o. 5 Solve 59m - 64m + 13 = -2k, -k = m + 3 for m. 1 Solve 10f - 13f - 9 = 3s, -8 = 3s + 4f for s. -4 Solve 4m - o - 2o + 17 = 0, 14 = -4m + 2o for m. -2 Solve -z - c = -2, -7 = 4c - 3 for z. 3 Solve -4l = -3m - 6l + 8, m = 2l for m. 2 Solve -4v - 15y - 13 = -10y, 2y = -2v - 4 for v. 3 Solve 1 = -2z - 4t - 7, -2z + 5t = 8 for z. -4 Solve 12 - 4 = 4x + 2r, -4x - 4r + 8 = 0 for x. 2 Solve 5v - 4x + 3 = 0, -v = -2x + 9 - 12 for v. -3 Solve 1 = 4y - d, -y = -0y + d + 1 for y. 0 Solve 3h = -m + 13, -3h - 5m = -9 - 8 for h. 4 Solve -3g = 4t + 6, -4t = 3g - 2g + 10 for g. 2 Solve -8v + 3x = -7v - 1, -3v + 10 = -2x for v. 4 Solve 2w - 3b = -2, -3w + 0w - b - 14 = 0 for w. -4 Solve -15 = 5a + 5i, 64a - 61a + 5i = -11 for a. -2 Solve -n + 5g + 18 = 0, 15g = 2n + 14g for n. -2 Solve 4c + m = 7 - 3, -16 = 3c - 4m for c. 0 Solve -3r = -4o - 2, 4o + 5 = -2r + 13 for o. 1 Solve -15 = -3y + b - 2b, 0 = 4b for y. 5 Solve -5m + 10w = 7w + 4, 3m = -2w + 9 for m. 1 Solve -5k - 16 = -l, -9 = -22k + 25k for l. 1 Solve -2 = -3q + 7, 2u = -3q + 13 for u. 2 Solve 0 = -f + 22h - 24h + 2, -5f + 10 = 3h for f. 2 Solve 2y + 0y - 3x = 0, -4y - 5x = -22 for y. 3 Solve r + 30 = 2f + 3f, 0 = r + f for r. -5 Solve 8p - 7p + 4z + 11 = 0, -z - 3 = 0 for p. 1 Solve -3k = 5a - k + 9, 0 = 4a - 2k for a. -1 Solve y - 3i + 6 + 8 = 0, 4y = -i - 17 for y. -5 Solve 139i - 135i = 5j, 5i = -j + 29 for i. 5 Solve 3m + 15 = 2u, -4m + 2u - 27 = -3u for m. -3 Solve 11 = -4f - 5, 4f = 5s - 1 for s. -3 Solve 4v - 4c - 18 = -5c, 0 = -c + 2 for v. 4 Solve s + 4h = 19, -4h + 18 = 46s - 44s for s. -1 Solve -3k + 3n + 27 = 0, 6 = 3k + 4n - 0 for k. 6 Solve 2i = -3s - 2s - 29, -2s + i = 8 for s. -5 Solve 20 = -4v - 2f, -2v - 4f + 8f - 10 = 0 for v. -5 Solve 116w - 112w + 2n = -10, -4w = -4n + 4 for w. -2 Solve -3q - 16t = -27t - 92, -2t = -3q + 29 for q. 5 Solve 2j - 4c = -22, 3j - 13 = 6j - 2c for j. -1 Solve 4z - i = 32, 30 = 4z - 4i - 14 for z. 7 Solve -6c + c = u + 18, 0 = -3c + 3u for c. -3 Solve 0 = -4u - 4s - 24, 0 = 56u - 54u - 2s for u. -3 Solve 2w = -80d + 75d - 16, 5w = 5d - 5 for d. -2 Solve 2k - 4 = 0, -10 = 6l - 2l + k for l. -3 Solve 0 = 11n - 8n + 3k - 15, -10 = -2n + k for n. 5 Solve -4u = -4t - 24, -5t + 9t = 5u - 27 for u. 3 Solve -w - 3d = 0, -w = -4w + 5d for w. 0 Solve -n + 7 = -j, 25n - 27n + 9 = -j for n. 2 Solve 2d + 3q = -2d - 31, 2q = 4d + 6 for d. -4 Solve 0 = 3f + 2z - 5, 5z = 2f + 6 - 3 for f. 1 Solve -5l - 3m = 6, -5l + 4m - 22 = 5 for l. -3 Solve -3r = 2g + 7, -4g - 23 = 2r - 5r for r. 1 Solve 9p - 5p + 4g = 12, -15 = -18p - 5g for p. 0 Solve 0g - 3g = -m + 1, 0 = -3m + 12 for g. 1 Solve 4s - 12 = 0, 6s = -2l + 5s - 7 for l. -5 Solve -5g - 2q + 0 - 12 = 0, -12 = 4g + q for g. -4 Solve -6 = 3d + 6, 4h + 8 = 3d for h. -5 Solve 3m - 4f = -14, 2f - 3f = -5 for m. 2 Solve 0 = 2m + 2, 3i = 2m + 5 for i. 1 Solve -3y = 2i + 7, i - 33 = 3y - 41 for i. -5 Solve j = 4a + 4 - 9, 5a - 25 = 5j for a. 0 Solve -3u + 8 = 4q, -3u = 2u - 3q - 23 for u. 4 Solve k + 18 = 4h, -k + 4k = -5h + 14 for k. -2 Solve 4m = 8u + 12, 16 = -3u + m + 12 for u. -1 Solve g = 5n + 15 - 13, -2g = -4 for n. 0 Solve -5g + 4b = 2 - 0, 4g - 3b + 1 = 0 for g. 2 Solve 3v + 3 = 3i, -v - 15i = -12i - 7 for v. 1 Solve 0z = 4j - 4z + 4, 4j - z = 2 for j. 1 Solve -5 = -o, 4c + 4o - 27 = o for c. 3 Solve 0 = 3w - 12, g - w + 12 = -3g for g. -2 Solve -3y + 1 - 13 = 0, 3 = d - 2y for d. -5 Solve 29 - 4 = 5j - 4f, 0 = j + 3f + 14 for j. 1 Solve -4r + 6r - 10 = 0, -5t + 4r = 0 for t. 4 Solve 2q - 5o = 4 + 5, 0 = 2q + 5o + 21 for q. -3 Solve 4t - 3t + 4n = -21, 2n + 10 = 0 for t. -1 Solve 196q + 2 = y + 197q, 3y - 3q + 24 = 0 for y. -3 Solve 0 = -4o - 20, 64o - 67o - 30 = -5g for g. 3 Solve -b + 13 - 7 = 2f, b = f + 3 for f. 1 Solve f = -5d + 6, -2f = 2d - 46 + 42 for d. 1 Solve 18 = c - 3r + 8, c + 30 = -5r for c. -5 Solve 36 = 3p + 5a + 16, -a + 4 = -3*p for p. 0
Expand (u + u - 7u)(-3u + 4u - 2u + 2u + 2 - 2 + (5 - 3 - 3)(0 - 2u + 0)). -15u2 Expand (-k + k - k)(-k + 4k - 3k*3 - 4k). 3k4 + k2 Expand -14y4 + y2 + 13y4 + 5y*3 - 3y*4 + (0y*2 + 3y*2 - 2y*2)(-2y2 + 2y*2 + 2y*2) + 0y + 0y - y4. -3y*4 + 5y3 + y2 Expand (-2 - 1 + 1)(1 - 2 + 2)(2y - 4y + y). 2y Expand (5 - 4 + 5)(-4 + 4 + 1)(-4 + 4 + 2a)(-3a + 3a - 2a). -24a2 Expand -v + v + 2v + (-2 + 2 + 1)(2v - v + v) + (-1 - 4 + 0)((-2 + 0 + 3)(1 - 3v - 1) + 4v + 0v - 5v). 24v Expand (-5 - 2 + 1)(-7y + y + y). 30y Expand (4 - 4 + 2)(5 + 7n - 5) + 2 - 2 - n. 13n Expand 16q*2 - 30q + 30q + (q + 5q - 5q)(4q + 0q - 5q). 15q*2 Expand (-3w - 4w + 6w)(-2w*3 + 0w*3 + 0 - 2). 2w*4 + 2w Expand 0b2 + 0b*2 - 3b2 - 5 + 5 + b2 + (-7 + 0 + 6)(b - b + 2b*2). -4b*2 Expand (-4v + 0v - 5 + 3v)(v2 - v2 + v2). -v3 - 5v*2 Expand 0k*3 + 0k3 - k4 + (0k3 + 10k*3 - 4k*3)(-k + 1 - 1) + 0 + k*4 + 0 + 2k3 - k4 - 2k3. -7k4 Expand -i5 + 0i + 0i + 0i5 + 0i5 - i5 + 3i5 + 0i*5 - 2i5 + (i4 + 0i4 - 3i*4)(2i - 3i - i) + 0i4 - 2i*5 + 0i4. i5 Expand ((6 - 3 - 4)(3z - 2z + z) + 7 - 7 + z + (0z + 0z - z)(4 - 3 - 3))(-z2 + z2 - 2z*3). -2z4 Expand 2 + 0 - m4 + 3m4 + (-5m + 3m + 4m)(31m*2 - 22m*3 - 31m*2). -42m*4 + 2 Expand (3x*3 - 3x3 + x3)(6 - 2 + 2). 6x*3 Expand (5 + 5c - 5)(c2 + 4c - 2c + 4c*2). 25c*3 + 10c2 Expand 0 + k3 + 0 - 5 + 5 - 11k3 + (-5k*2 + 4k*2 + 2k*2)(2k + 2 - 2). -8k*3 Expand (-8v + 13v - 2v)(3 + 1 - 2 - 2 + 5 - 2 + (4 + 1 - 4)(-4 - 3 + 5) - 2 + 0 + 4 + 4 - 5 - 1). 3v Expand (1253 - 1253 + 28r)(1 - 1 - 1)(-2 + 0 + 0). 56r Expand 2a - 2a + a + (0 - 1 - 1)(3a - 2a - 3a) + 5a + 8a + 6a - 4 + 2a + 4. 26a Expand (-r*2 + 3r*2 - 4r*2)(r*2 - r + r) + 0r*2 - 4r*4 + 0r*2. -6r*4 Expand (-a + 0a + 0a)(0a2 - 3a*2 + 4a*2)(0a - 3a + 4a). -a4 Expand b3 - 2b*2 + 2b2 + (b2 + b*2 + 0b*2)(3b - 6b - b). -7b3 Expand (3 + 2d*2 - 3)(1 - 1 - 1 + (0 + 4 - 2)(-3 - 4 + 2)). -22d*2 Expand -2t*3 + 0t*3 + 0t*3 - 2t*3 - 3t*3 + 3t*3 + (-2t*3 + 5t3 - t3)(0 + 0 - 2) - 2t*2 - 2t*3 + 2t*2 - 8 + 11t3 + 8. t3 Expand (6t - 3t + 0t)(6 + 13 + 17). 108t Expand (-3f + 0f + 0f - f + 2f + f + (-4 + 5 - 3)(3f - 2f + f) + 4f - f - 2f - 4f + 6f - 3f)(0f3 + 2f*3 - 5f*3). 15f4 Expand -w5 + 11w5 + 16w*5 + (-3w2 - w2 + 3w2)(w*3 + 0w*3 - 3w*3) + 3w*5 - 2w*5 + 0w*5. 29w5 Expand m2 + 3m2 - 2m*2 + (2 + 0 - 1)(0m2 + 0m2 - m2) - 2m + 2m + 6m2 - m2 - 6 + 6. 6m2 Expand (-2 + 1 - b2 + 2b2)(-4b + 6b + b). 3b3 - 3b Expand (-d*2 - 2d2 + d2)(2d - 2d - d) + (-d - 3d + d)(4d*2 - 2d*2 - 3d*2). 5d*3 Expand (71 - 71 + i)(-3i + i2 + 6i - 4i). i3 - i2 Expand k4 + 0 + 0 + ((-2 + 5 - 1)(3 - 3 + k*4) - 2k4 + k4 + 3k4)(2 - 2 + 3). 13k4 Expand (2 + 4 - 5 + (-3 + 5 + 0)(-2 + 1 + 3))(2u + 6u - 3u). 25u Expand -a - a4 + a + (-5 - 2a + 5)(5a*3 - 4a*3 + 0a*3) + 2a4 - a4 - 4a4 + (-3a + 3a + 2a*3)(-2a + a + 3a) - 2a + 2a - 2a4. -4a*4 Expand (-1 - 1 + 0)(2g + g + 0g) + (6 - 3 - 1)(g + 6g - 3g). 2g Expand (11y3 - 6y*3 + 3y*3)(-1 + 0 - 1). -16y3 Expand -2l3 - l4 + 2l3 + (2l*2 - 2l2 - l2)(3l - 3l + 3l*2) - 14l*2 + 14l*2 - 4l*4. -8l*4 Expand (-2y + 5y - y)(2y - 3y + 0y) + (1 - 6 - 1)(-3y2 + 4y*2 + 3y*2). -26y*2 Expand 2w*2 + 3w - 3w + 2w + w*2 - 2w + (-4w + 4w - 2w)(-w + w - w) - w*2 + w - w + 7w2 + w2 - w*2. 11w*2 Expand (3 - 1 + 0 + (-3 + 4 - 2)(1 + 1 - 1) + 9 - 17 + 11)(0h + 0h - 2h). -8h Expand (5 - 1 - 2 + (-2 + 6 - 3)(-10 - 20 + 53))(-j - 1 + 1). -25j Expand 4 - 4 - i + (0 + 5 - 4)(2i + 2i - i). 2i Expand (5 + 0 - 3)(7 - 2 - 1)(-p + 4 - 4)(-2p - 2p + 5p). -8p2 Expand (2y2 + y2 - 2y2 + (-2 - 2 + 3)(y*2 + 3y - 3y) + 3y*2 - 4y*2 + 0y*2)(4 + 2y - 4). -2y*3 Expand (3t2 + t2 - 5t2)(13 - 13 - 5t) - 3t3 + t3 + t*3. 4t*3 Expand (0 + 1 - 2)(-t - 14t - 5t) + (-7 + 2 + 4)(-3 + 4 - 2)(-3t - 2t + 6t). 21t Expand (q + 0 + 0)(22q - 17q2 + 9q*2 + 6q*2 + 1). -2q*3 + 22q*2 + q Expand -2u2 + u2 - 5u2 + (-4u + 5u - 2u)(2u - 2u + u + (-2 + 1 + 0)(u + u - 4u)). -9u*2 Expand (18g*2 - 2 - 18g2 + g4)(-1 + 5 - 1). 3g*4 - 6 Expand 2k*4 - 5k*4 - 6k4 + (-k2 + 4k - k - 4k)(4k - k*2 - 4k). -8k4 + k3 Expand (0 - a2 + 2a*2 + 1)(5a + 3a - 5a). 3a*3 + 3a Expand (3 - 3 - l)(24l + 9 - 9). -24l2 Expand (-3 - 2 + 3)(5i2 - 6i*2 - 9 - 4). 2i*2 + 26 Expand (0w + 3 - w - w)(0w4 - w4 - 2w4). 6w*5 - 9w*4 Expand (s - 2s + 2s)(16s4 + 25s*4 - 23s*4). 18s*5 Expand (2j*3 - 4j*2 + 4j*2)(0j2 + 0j*2 - 3j*2). -6j*5 Expand (-5j + 5j - 2j)(2 - 1 - j2 + 0j*2). 2j*3 - 2j Expand (i*4 - 2i*4 + 0i*4)(-5 + 4 - 1 + (2 - 2 + 3)(-5 + 3 + 4)). -4i*4 Expand (-86i + i*3 + 88i - 6i3)(-2i2 + 4i*2 - 3i*2). 5i*5 - 2i*3 Expand (-1 - x + 1)(-3x3 - 2x*3 + 6x*3) + 2x*4 - 41x*3 - 5x*4 + 45x*3. -4x*4 + 4x*3 Expand (2 - 2 - l)(2 + 2 - 3)(2 + 1 - 1)(-5l3 + 9l*3 + 4l*3). -16l*4 Expand (-3 - 5 + 6)(3u - u + u)(0u - 2 + 0u + 4u2). -24u*3 + 12u Expand ((d*2 + 4d*2 - 4d*2)(3d + 3d + 3d) - d3 - 3d*3 + 2d*3)(-4d + d + 8d). 35d4 Expand (-2 + 2o*2 + 2)(0o - 4o + 5o) + 2o*3 - 2 + 2 - 36o*3 + 24o*3 + 3o*2 - 2o*2. -8o3 + o2 Expand (2g3 - 1 + 1)(129g - 53g - 178g - 118g). -440g4 Expand m2 - 2m2 - m2 - 2m2 + m2 + 3m*2 + (-3m*2 - 2m*2 + 4m*2)(-1 + 5 + 0). -4m2 Expand 12q3 - q2 - 3q3 + 3q*2 + (2q - 2 + 2)(2q + 2q2 - 2q). 13q3 + 2q*2 Expand (29 - 85 + 28)(0f3 - f3 + 3f*3)(-2 + 2 - 3f2). 168f*5 Expand (2s + 5 - 5)(-5 + 4 + 3). 4s Expand t*5 + 3t - 2t + t2 + t5 - 7t*5 + 7t*5 + 13t5 + (t2 - 2t2 - t2)(3t - 3t - 2t3) + 2t*5 + 4t*5 - 5t*5. 20t5 + t2 + t Expand (-3 + 4 - 2)(2t + 2 - 2)(-193t*2 + 3t + 240t2 - 5t). -94t3 + 4t*2 Expand 0k*2 + 0k*2 - 2k*5 + (6 - 3 - 1)(-k*5 + 0k*4 + 0k*4) - 2k4 + k5 - 3k5 + k5. -5k*5 - 2k4 Expand (i3 - i + i)(8 - 8 + 3i*2) + 0i + 0i - i5. 2i*5 Expand (-6 + 0 + 5)(-7j - j + 3j). 5j Expand (-2c + 5c - 2c)(c - 3c + c) - 3c - 3c*2 + 3c + 0c2 - 6c*2 + 7c*2. -3c*2 Expand (3n*2 - 12n*2 - 5n*2)(2n3 + 3n*3 + 0n*3). -70n*5 Expand (-2h*2 + 3h*2 + 7h*2)(4h - h - 4h + 4h + 3h - 5h + (-1 + 1 - 1)(0h - h + 3h) - 4h + 0h + 2h - 2h + 2 - 2). -40h3 Expand (-2t + 5t - t)(-3t4 - t4 + 0t*4) - 3t*5 + 3t*5 + 3t*5. -5t*5 Expand (-2u + 2 - 2)(0 - 5 + 2)(-8u - 6 - 6 + 8). -48u*2 - 24u Expand (-4 + 2r3 + 4)(-2 - 4 - 6) - 3r3 - 2r*2 + 2r*2. -27r*3 Expand -3b*4 - 3b*4 - 2b*4 + (2b - 2b - 2b*2)(0b2 + 0b2 - b2). -6b4 Expand (-10 + 10 - 5c*2)(4c - c - 2c)(1 + 2 - 5). 10c*3 Expand (-16 + 5 - 3)(5 - 4 - 2)(2l + 0 + 0). 28l Expand (3 - 3 + 5)(-2 + d*2 + 2)(2d2 - 3d2 - d2 + (-d + 2d + d)(-2d + 3d + 2d)). 20d*4 Expand (2m*3 + 5 - 5)(-2 + 6 - 3). 2m3 Expand (-2w + 0w + 3w)(0w4 + w4 + 0w4) + 4w*5 - 18w*5 - 3w*5. -16w*5 Expand (-2 - 3j*5 + 2)(1 - 3 + 1). 3j5 Expand (-x3 + 0x + 0x)(-2 + 3 + 1) + 5x3 + 0x*3 - 4x*3 + 0x*3 + 2x3 - x3 + (1 - 2x - 1)(0x2 - x2 + 0x*2) - 5x*3 + 8 - 8. -3x*3 Expand (-1 + g + 1)(-5 + 1 + 7)(2 + 0 - 1). 3g Expand 9m - m - m + (3 + m - 3)(-3 + 0 + 6). 10m Expand ((1 - 2i - 1)(2 - 1 + 1) + 0i + i - 2i - i + 6i - 4i + (3 - 1 + 0)(2i + 0i - i))(i + 3i - 3i). -2i*2 Expand 0b*2 - 2b*2 + 3b*2 + (-3b + b + 4b)(0b - b + 2b)(-1 - 3 + 8). 9b*2 Expand 14b*4 + 8b4 - b4 + (0b - 4b + 2b)(-b*3 + 2b3 + b3). 17b4 Expand (-z - 1 + 1)(-3z4 + 2z*4 - 1 + 5z*4). -4z*5 + z Expand (0r - r - r)(-3 - 5 - 1). 18r Expand (-2 + 2 - 2w2)(2 - 3 - 2)(-3 + 2 + 3). 12w*2 Expand 2b*5 - 8b*5 + 4b*5 + (0b + 0b + 2b*5)(-1 + 1 - 1). -4b*5
Let j(c) = -c*3 + 3c*2 + 167c - 346. Give j(2). -8 Let l(g) = 10019g - 10042. Calculate l(1). -23 Let f(a) = 963a - 5838. What is f(6)? -60 Let u(s) = 5365s - 37553. What is u(7)? 2 Let l(r) = 10962r + 98658. Calculate l(-9). 0 Let a(p) = p*3 - 14p*2 + 16p - 59. What is a(13)? -20 Let p(c) = -1659c + 13287. Calculate p(8). 15 Let w(p) = -252p + 51. Determine w(1). -201 Let l(j) = 324j + 1948. Calculate l(-6). 4 Let k(y) = -4y*2 + 40y + 114. Give k(13). -42 Let x(r) = -192r + 387. What is x(3)? -189 Let p(k) = -k3 - 18k*2 - 15k + 34. What is p(-17)? 0 Let a(u) = u*3 - 49u*2 + 259u - 108. What is a(43)? -65 Let u(s) = 5s2 + 119s + 625. What is u(-8)? -7 Let q(y) = -y*3 - 27y*2 - 23y + 669. Give q(-25). -6 Let y(k) = 2k3 - 6k*2 - 9k + 34. Give y(2). 8 Let a(b) = 346b - 14443. Determine a(42). 89 Let n(p) = 234p - 1159. Give n(5). 11 Let k(w) = 11w - 316. Give k(1). -305 Let z(f) = -f2 + 7f + 194. Determine z(19). -34 Let w(r) = -1631r + 68511. Determine w(42). 9 Let x(m) = 345m - 81424. Calculate x(236). -4 Let f(i) = -2i3 - 41i*2 + 29i + 153. What is f(-21)? -15 Let b(c) = -c*3 + 7c*2 - 8c + 32. Determine b(7). -24 Let c(k) = -2k2 + 42k - 80. Give c(19). -4 Let o(f) = f*2 - 72f + 548. Determine o(8). 36 Let c(d) = 479d + 948. What is c(-2)? -10 Let h(f) = f3 + 35f*2 + 31f - 142. Calculate h(-34). -40 Let w(q) = q*3 + 20q*2 + 49q - 6. Determine w(-3). 0 Let k(r) = r*3 + 28r*2 + 33r + 164. Give k(-27). 2 Let i(m) = 889m + 4453. What is i(-5)? 8 Let u(b) = -b3 + 4b*2 + 17b - 59. Determine u(8). -179 Let k(g) = 617g - 5535. What is k(9)? 18 Let u(w) = 2w3 - w2 + w + 4. Give u(-3). -62 Let q(b) = 2b3 + 15b*2 - 2b - 69. Give q(-7). -6 Let w(f) = -2f2 + 1. What is w(-2)? -7 Let t(b) = b3 + 28b*2 + 178b - 47. Calculate t(-18). -11 Let p(g) = g*2 - 306g + 18670. Calculate p(84). 22 Let z(m) = -10m3 - 559m*2 + 52m - 114. Give z(-56). 110 Let o(l) = -l*2 - 90l + 10995. Give o(69). 24 Let d(k) = k*3 - 8k*2 + 282k - 2945. Give d(11). 520 Let q(r) = r*3 + 5r*2 - 47r + 44. Calculate q(-9). 143 Let y(r) = 25r2 - 499r - 20. Give y(20). 0 Let o(s) = 29s - 614. Calculate o(21). -5 Let t(n) = n2 + 229n + 11550. Calculate t(-154). 0 Let o(t) = -t*3 + 36t*2 + 6t - 14. Determine o(36). 202 Let y(r) = 6r3 - 4r*2 - 5r + 10. Give y(2). 32 Let k(r) = 8r2 + 189r - 1373. Give k(7). 342 Let q(y) = -2421y + 33892. Give q(14). -2 Let n(b) = -b3 - 14b*2 - 7b + 95. Give n(5). -415 Let f(x) = -x*2 + 38x + 1126. Determine f(-19). 43 Let w(x) = 66x2 - 39x + 61. Calculate w(2). 247 Let s(o) = -5o2 - 34o + 32. Calculate s(-9). -67 Let n(k) = k*3 + 12k*2 - 236k - 2743. Calculate n(-11). -26 Let h(l) = -215l + 602. Determine h(5). -473 Let s(g) = -95g*2 - 5g + 7. What is s(1)? -93 Let a(i) = -i*2 + 33i - 242. What is a(22)? 0 Let r(q) = -49q2 - 436q + 63. Give r(-9). 18 Let b(v) = v*3 + 8v*2 - 37v - 7. Determine b(-12). -139 Let m(u) = 2u3 - 28u*2 + 18u + 68. Give m(13). -36 Let m(z) = 3z2 + 21z + 63. What is m(-6)? 45 Let q(z) = -z*3 + 3z*2 + 56z + 105. Give q(-8). 361 Let w(x) = -2x2 - 79x - 329. Give w(-35). -14 Let w(l) = 8l3 - 271l*2 - 7l - 912. Determine w(34). 6 Let f(m) = -40m3 + 280m*2 - m + 12. Give f(7). 5 Let a(t) = -82t + 916. Determine a(11). 14 Let s(h) = 2h3 + h2 - 2h + 7. What is s(-3)? -32 Let n(l) = -2l3 + 28l*2 + 1054l + 12. Calculate n(31). 12 Let s(m) = 2m2 - 32m + 189. What is s(5)? 79 Let b(r) = -14r2 - 25r + 39. Determine b(1). 0 Let c(y) = -y*2 - 642y - 3188. What is c(-5)? -3 Let p(h) = -474h + 3778. Give p(8). -14 Let h(w) = -w3 + 41w*2 - 41w + 75. Calculate h(40). 35 Let q(c) = -2c2 - 77c + 239. Calculate q(3). -10 Let c(g) = -g*2 + 8341g + 50079. Give c(-6). -3 Let s(h) = -h*3 - 18h2 - h - 15. Give s(-18). 3 Let z(u) = -u3 + 304u2 - 4059u - 289. Calculate z(290). 1 Let x(f) = -118f + 128. Calculate x(1). 10 Let i(b) = 306b + 7328. Give i(-24). -16 Let s(y) = -y*2 - 273y - 10263. Calculate s(-45). -3 Let p(j) = 183j - 1885. Determine p(13). 494 Let f(m) = m3 - 57m*2 - 382m + 210. Calculate f(63). -42 Let r(l) = 2l3 - l2 - 26l + 65. Calculate r(3). 32 Let q(v) = -2v2 - 37v + 2322. What is q(26)? 8 Let u(s) = -9s - 319. Give u(-33). -22 Let u(t) = -t3 - 16t*2 - 42t - 174. What is u(-14)? 22 Let u(b) = -b*3 + 20b*2 - 69b - 161. What is u(7)? -7 Let l(x) = x*2 - 33x + 157. Give l(31). 95 Let z(m) = m*3 - 56m + 17. Determine z(7). -32 Let l(m) = 2m3 - 3m*2 - 46m + 153. What is l(6)? 201 Let u(q) = 12q2 - 69q - 72. What is u(-1)? 9 Let j(a) = -2a2 + 15a + 166. Calculate j(-4). 74 Let w(s) = -s*3 + 55s*2 - 59s - 2481. Determine w(53). 10 Let z(k) = 3k3 - 37k*2 + 41k - 358. Calculate z(12). -10 Let k(d) = -d*3 + 5d*2 - 7d + 23. Determine k(5). -12 Let t(s) = -5s - 42. Determine t(5). -67 Let h(q) = 9q*2 - 6q + 25. Calculate h(-6). 385 Let h(s) = -346s - 1774. What is h(-5)? -44 Let o(b) = 733b - 21196. Determine o(29). 61 Let u(d) = -d*3 - 16d*2 - 45d - 5. Calculate u(-13). 73 Let w(d) = -89d - 2132. Give w(-24). 4 Let k(s) = -s3 - 186s*2 - 539s + 1840. Calculate k(-183). 10 Let c(w) = 2565w - 10284. What is c(4)? -24 Let m(a) = a2 - 3a - 12. Give m(4). -8 Let c(k) = 4k2 - 2k + 10. Give c(5). 100 Let c(i) = -i*3 - 58i*2 + 36i - 1473. Give c(-59). -116 Let g(r) = -r*2 + 3r + 1. Give g(-6). -53 Let l(c) = -393c + 90381. Calculate l(230). -9 Let l(j) = 4j3 - j2 + 2j + 15. What is l(0)? 15 Let m(x) = -2x*3 + 20x*2 - 45x - 5. Determine m(4). 7 Let f(s) = 2s3 + 37s*2 - 13s + 112. Give f(-19). -2 Let d(p) = 2173p - 10778. Give d(5). 87 Let g(s) = -s3 - 18s2 - s - 12. Give g(-18). 6 Let k(h) = h3 + 6h2 - 23h + 39. Determine k(-8). 95 Let r(p) = 2p3 + 70p*2 + 8p + 295. Determine r(-35). 15 Let r(o) = -o*3 + 124o*2 - 592o - 347. Give r(119). 10 Let g(a) = a*2 - 145a + 4378. Give g(43). -8 Let a(x) = 13x2 - x + 4. Give a(0). 4 Let n(w) = -7w*3 + 172w*2 + 74w + 23. Determine n(25). -2 Let z(m) = -271m - 6499. Give z(-24). 5 Let v(m) = -m3 - 13m*2 - 96m - 880. Calculate v(-11). -66 Let o(i) = 24i - 1365. What is o(56)? -21 Let n(o) = -o3 + 27o*2 + 100o - 312. Give n(30). -12 Let x(o) = o*3 + 13o*2 + 23o + 17. Calculate x(-13). -282 Let u(g) = 96g - 1592. Calculate u(17). 40 Let l(o) = -106o*2 + 350o + 1720. Give l(6). 4 Let b(l) = -2174l - 54347. Calculate b(-25). 3 Let i(h) = -h2 - h + 1. Calculate i(14). -209 Let z(m) = -m2 + 1102m - 7643. Calculate z(7). 22 Let v(i) = 11i + 201. Determine v(-19). -8 Let l(q) = -7q - 90. Give l(-9). -27 Let r(t) = 4t2 - 15t + 3. Calculate r(1). -8 Let v(x) = -3x2 - 24x - 28. What is v(-13)? -223 Let p(x) = -x*3 - 12x*2 - 11x - 102. Calculate p(-13). 210 Let y(u) = 6776u - 20333. What is y(3)? -5 Let c(w) = 5w*2 - 71w + 91. Give c(13). 13 Let n(a) = -3a3 - 22a*2 + 12a - 21. Give n(-8). 11 Let w(g) = -16g2 - 231g + 458. Determine w(2). -68 Let n(l) = -l*3 + 21l*2 - 102l + 51. What is n(14)? -5 Let a(y) = -y*3 - 30y*2 + 65y + 76. What is a(-32)? 44 Let i(a) = -52a - 340. What is i(-6)? -28 Let f(z) = -3946z - 39469. What is f(-10)? -9 Let c(o) = o*3 + 7o*2 - 92o + 67. What is c(-14)? -17 Let o(z) = z*2 - 200z + 4975. Calculate o(170). -125 Let p(r) = -r*3 - 51r*2 + 35r - 744. Calculate p(-52). 140 Let n(c) = -369c - 1134. Give n(-3). -27 Let x(o) = -7o - 25. What is x(1)? -32 Let y(x) = -32x + 336. Determine y(-18). 912 Let m(x) = 21x - 2940. Give m(137). -63 Let d(g) = -28g3 + 31g*2 + 2g - 3. Give d(1). 2 Let u(x) = -205x2 + 14x - 12. What is u(1)? -203 Let w(u) = u*3 + 23u*2 - 26u - 51. Calculate w(-24). -3 Let r(m) = 2m2 - 12m + 48. Calculate r(10). 128 Let n(v) = 8v2 + 4v - 9. Determine n(-2). 15 Let t(v) = -21v2 - 116v - 144. Determine t(-2). 4 Let v(u) = 5u + 105. Calculate v(38). 295 Let k(a) = -a2 + a + 88. Calculate k(10). -2 Let q(d) = -d2 - 59d - 22. Determine q(-48). 506 Let s(r) = -14r2 + 13r. Determine s(-2). -82 Let n(d) = 26d + 821. Give n(-38). -167 Let a(n) = 67n + 5371. Determine a(-81). -56 Let j(s) = -2200s - 24209. Give j(-11). -9 Let v(g) = g2 + 24g + 66. Determine v(-31). 283 Let h(q) = -2q3 - 39q*2 + 133q + 514. Calculate h(-22). 8 Let t(v) = -10v2 - 329v + 23. What is t(-33)? -10 Let w(s) = -12s - 30. What is w(-9)? 78 Let l(n) = -675n - 12776. Give l(-19). 49
Let b = 37 - -346. Suppose -b = -4g - 111. Suppose 47 + 4 = 3s. Calculate the highest common divisor of s and g. 17 Suppose 7j = 3j + 5u, -3j + 35 = 5u. Calculate the highest common divisor of j and 45. 5 Let p(n) = 4n - n - 6 - 5n - 3n. Let a be p(-4). Let l = 307 - 195. Calculate the greatest common divisor of a and l. 14 Let l(d) = 6d - 32. Let b be l(7). What is the highest common divisor of 80 and b? 10 Suppose -3y + 9 = -2y. Let m be 3 + -2 + -1 + 3. What is the greatest common factor of m and y? 3 Suppose 2s - 2 = 3s. Let y = s + 4. Let h be (y-1)/((-6)/9). What is the highest common divisor of h and 21? 3 Let m(o) = 3o2 + 7o. Let i be m(-5). What is the greatest common factor of i and 8? 8 Let r = 26 - 0. What is the greatest common divisor of 39 and r? 13 Let f be -2(2/21 + (-37553)/714). Suppose 3p = 12, 0 = 5v - p - 2p - 93. Calculate the greatest common factor of v and f. 21 Let p = 214 + -24. Let j = -135 + p. What is the greatest common factor of 11 and j? 11 Let i = 3 - 5. Let l(y) = -y*2 - 6y + 4. Let w be l(-8). Let a be i/(-6) - 572/w. What is the highest common factor of a and 6? 6 Let c = 6 - 3. Suppose -cj = -2w + 3w - 23, w = -5j + 39. Let h be 1/(-1 + 10/j). What is the greatest common divisor of h and 8? 4 Let h be 282 + (0 - (-1)/1). Let k = h + -163. What is the greatest common factor of 12 and k? 12 Suppose 15 = 6r - r. Let t = -1 - -113. Suppose 0 = -4p + 2k + t, 3p - 3k = -2k + 83. Calculate the greatest common divisor of r and p. 3 Let c be 18 - -2 - (-1 - -3). Let o be (3/2)/(6/12). Suppose 5v = -5l + 635, -5v = -10v + ol + 627. Calculate the greatest common divisor of c and v. 18 Let y be 6/(4/(-32)-3). Calculate the greatest common divisor of 64 and y. 16 Let r(n) = 18n2 + 4n + 4. Let t be r(-3). Let j(d) = d - 2. Let o be j(5). Suppose -oy + 4y - 14 = 0. Calculate the highest common factor of y and t. 14 Let m be ((-108)/45)/(9/(-60)). Let a(t) = -13t3 + 3t2 - 2. Let u be a(2). Let h = u - -174. What is the greatest common factor of h and m? 16 Let f(i) = -i3 + 5i2 + 7i - 2. Let m be f(6). Let c be (2 - 1)122 - -1. Suppose -c = -mt + 53. What is the highest common factor of t and 11? 11 Suppose 0 = -2r + 5n + 26, -r - 8n - 17 = -3n. Let x(h) = h*3 - 3h*2 + 4h. Let t be x(3). What is the highest common divisor of r and t? 3 Let v = -16 + 9. Let g be (v/3)/((-5)/90). Let m be 56/10(-1 + 6). What is the highest common factor of m and g? 14 Let q be (-28)/(-5) - (-21)/(-35). Suppose 0z = -2z + 24. Suppose c - 4c = 5s - 4, qc = s - z. Calculate the greatest common factor of 3 and s. 1 Let o(c) = c*3 + 4c*2 - 2c + 5. Let t be o(-4). Let g be ((-3)/2)/((-24)/(-32)). Let p be g/(4/(-26)) + 0. What is the greatest common divisor of p and t? 13 Suppose -2v + 22 = -v. Calculate the greatest common divisor of 2 and v. 2 Let w = 412 + -283. Suppose 44 = -5g + w. What is the highest common divisor of g and 136? 17 Let x(t) = t*3 - 9t*2 + 10t - 10. Let y be x(8). Suppose 0 = -2m + 22 + 14. What is the greatest common factor of m and y? 6 Let v be 1/(-3) + 79/3. Let y be 44/(-16)-65. What is the greatest common factor of y and v? 13 Suppose -d = -2h + 56 + 22, 0 = -5h - 3d + 206. What is the greatest common factor of 20 and h? 20 Suppose 0 + 105 = 5s. Suppose 0 = -3y + y. Suppose 0 = -yx + 2x - 378. Calculate the highest common divisor of s and x. 21 Let l be (2/2)/((-2)/(-24)). Suppose -84 = -17p + 18. Calculate the greatest common factor of l and p. 6 Let p be (1/2)/((-5)/(-90)). Suppose 4t + p = 5t. Calculate the greatest common divisor of t and 18. 9 Let r(a) = -a2 + 7a. Let i be r(6). Let p be 26/10 + 6/15. Suppose 7v - pv - 24 = 0. What is the highest common factor of v and i? 6 Suppose 2q - 10 = 3q. Let r = q + 6. Let i be (-278)/r - 3/(-6). Calculate the greatest common divisor of 10 and i. 10 Let l(r) = 2r3 - 6r*2 - r - 5. Let u be l(5). Suppose -3h - 15 = -u. Let q = -9 - -19. What is the greatest common divisor of q and h? 5 Suppose c - 4c - 57 = 0. Suppose -3n + 162 = 4k + 43, -3k + 15 = 0. Let b = c + n. What is the highest common divisor of 14 and b? 14 Let a be (-2 + 1)(-84 - 0). Calculate the highest common factor of a and 12. 12 Suppose 2u - 8 = j + 48, -j = 5u - 126. Let k = -15 + u. Calculate the greatest common divisor of k and 33. 11 Let u = -3 + 5. Let m be u - 1 - 92/(-4). Calculate the greatest common divisor of 8 and m. 8 Suppose 3d - 75 = 3z, 0z + 6 = -2z. What is the highest common divisor of d and 22? 22 Suppose 3v + 3024 = 12v. What is the greatest common divisor of v and 14? 14 Let d(x) = x3 + 11x*2 - 12x + 12. Let r be d(-11). Calculate the greatest common factor of 36 and r. 36 Let x be (160/12)/((-2)/(-6)). Suppose 0 = g + 2a - 16, g + 4g + 2a = 88. Let u = -2 + g. Calculate the highest common divisor of x and u. 8 Let j(n) = n - 2. Let p be j(6). Suppose -ps + 12 = -2s. What is the greatest common factor of s and 3? 3 Let z be (-7 - -10)28/3. What is the greatest common factor of 7 and z? 7 Let x be (-28)/(-3) + 14/21. Calculate the highest common factor of 10 and x. 10 Let p be 3 + 7/14(-1 + 51). What is the highest common factor of p and 14? 14 Suppose -40m + 150 = -34m. Suppose -8z - 8 = -4z. Let l(j) = 19j*2 + j + 1. Let y be l(z). What is the greatest common factor of y and m? 25 Suppose -16 = 4m, 3s - 3m = -m + 17. Suppose -2k + s + 13 = 5n, 0 = 2k + 4n - 18. Calculate the highest common divisor of k and 13. 13 Let j be (1 + -2)/((-2)/10). Let w(x) = 3x - 5. Let h be w(j). Suppose -k = -6k + 350. What is the greatest common factor of h and k? 10 Suppose 0 = -5z, 0o + 3o - 75 = -4z. What is the highest common factor of 125 and o? 25 Let c(l) = l*3 + 7l*2 - 4l - 10. Let h be c(-8). Let j = h - -72. What is the greatest common divisor of 10 and j? 10 Let s be (712)/((-2)/(8/(-4))). What is the greatest common factor of s and 12? 12 Suppose 266 + 339 = 5r. Suppose -8s = -7s - r. Calculate the greatest common factor of 11 and s. 11 Let k = 20 + -20. Suppose x - 4x + 336 = k. Calculate the greatest common divisor of x and 14. 14 Let g(d) be the second derivative of -d5/20 - d4/12 + d3/6 + 85d*2/2 + 3d. Let t be g(0). What is the greatest common divisor of 17 and t? 17 Suppose -2x + 83 = -31. What is the highest common factor of 38 and x? 19 Let y = 7 - 5. Let z(g) = g3 - g2 + 6g - 4. Let a be z(5). Suppose -3b = yb - 2l - 156, -4b = -l - a. Calculate the highest common divisor of b and 16. 16 Let o be (-5)/(15/(-6)) + -69. Let m = 152 + o. Suppose 57 = 3d + 3b - b, 0 = 2d - 2b - 28. What is the highest common factor of d and m? 17 Suppose 0 = -0d - 7d + 392. Suppose -4w + 14 = -2w. What is the highest common factor of w and d? 7 Suppose -3q = -p + 1, -4p + 5q + 4 = -0q. What is the highest common factor of p and 3? 1 Let n = 16 + -27. Let p = n + 28. What is the highest common divisor of 51 and p? 17 Let c = 12 + 0. Calculate the greatest common factor of 12 and c. 12 Let j = -379 + 580. Suppose 0 = z - 4n - 134, -3n = -4z + 290 + 220. Let d = j - z. What is the highest common divisor of 30 and d? 15 Let h(r) = -2r*2 - r. Let g be h(-3). Let j(z) = 5z + 2. Let x be j(-2). Let s = x - g. What is the greatest common divisor of s and 56? 7 Let l be -64(-1 + 2)-1. What is the highest common divisor of 16 and l? 16 Suppose 156 + 9 = 5i. Let n = i + -17. Calculate the greatest common factor of 8 and n. 8 Let r be -44((-36)/8)/9. Calculate the highest common factor of 55 and r. 11 Let m be 62/6 + (-11)/33. Calculate the highest common factor of 2 and m. 2 Let g(n) = -n + 54. Let s be g(18). What is the greatest common divisor of s and 48? 12 Let y(h) = -9h3 + 2h*2 + 2h + 1. Suppose 0 = -0a + 3a. Let w be a - (-2 - -3 - 0). Let t be y(w). Calculate the highest common factor of t and 70. 10 Let q = 34 - 19. What is the highest common factor of 135 and q? 15 Let w = -3 - -6. Suppose -w = -2d - d. Suppose -2y - d = -3. What is the highest common divisor of 11 and y? 1 Let a = -15 - -23. Let m be ((-1)/2)/(-1)74. Let t be m/3 - (-3)/(-9). Calculate the highest common factor of t and a. 4 Suppose -3p + 88 = -2l, 3l + 0*l - 12 = 0. Calculate the highest common factor of 8 and p. 8 Let o = -75 - -86. What is the highest common divisor of 1 and o? 1
Let z be 15 + (-12)/(-4) - 2. Suppose 4t + 5x = t + z, 5x - 10 = 0. Suppose -84 = -3r - 3d, -3d = -tr + 34 + 7. What is the units digit of r? 5 What is the hundreds digit of 2/(4/93)(-950)/(-75)? 5 Let w(f) = f*2 - 5 - 7 + 5. Suppose 3k - 1 + 19 = 0. What is the units digit of w(k)? 9 Suppose 0 = -2s + o + 710 + 373, -5s + o + 2703 = 0. Suppose 0 = -7z + s + 237. What is the units digit of z? 1 Let s be 46/(-1)7/(-14). Let d = s - 24. Let f = 32 - d. What is the units digit of f? 3 Suppose -w + 4w + 349 = -5h, -w - 2h = 117. Let z = w - -203. What is the units digit of z? 0 Let o(h) = h2 + h. Let q be o(2). Let i(u) = u2 - 2u + 2. Let t be i(q). Let g = t + 8. What is the tens digit of g? 3 Suppose -5l = -5d + 35, 5l - 3l + 5d = -21. Let s(u) = -u3 - 7u*2 + 7u - 8. Let m be s(l). Suppose m = -2a + 89 - 9. What is the units digit of a? 0 Suppose -10d + 5f - 800 = -11d, -d = 2f - 800. What is the hundreds digit of d? 8 Suppose 2f = j - 2195, -j - 5f + 2188 = -0j. What is the hundreds digit of j? 1 What is the hundreds digit of (-22 - -27)/(33/32 - 1)? 1 Suppose 4d + d = 5. Let z = 9 - d. What is the units digit of 2/z + (-27)/(-4)? 7 Suppose 771 = 3h + 2q, 0 = -4h - 3q + 607 + 422. What is the tens digit of h? 5 Suppose 4a = 3a - 86. Let p = a + 258. What is the tens digit of p? 7 Let v(t) = 2t*2 - 9t - 9. Let l(u) = -u + 5. Let z be l(9). What is the units digit of v(z)? 9 Let p(o) = 2o + 29. Let k be p(-14). What is the units digit of (k - -13)/((-4)/(-14))? 9 Let x(j) = -12j - 10 + 22j - 11 - 11j. Let q be x(10). What is the tens digit of (0 + 4)/2 - q? 3 Suppose 3v = -5y + 4 + 12, -2y + 5v - 6 = 0. Suppose -8 + y = -t. What is the units digit of t? 6 Suppose 2054 + 106 = 6a. What is the hundreds digit of a? 3 Let x(g) = 2 + 6g - 7g + 0g - 2g3 - 3g*2. What is the units digit of x(-4)? 6 Suppose -i = -3, 0 = -5w - 5i + 2i + 14. What is the tens digit of (-200 - w)/(-3) + -3? 6 Let g be (-92)/(-22) + (-2)/11. What is the units digit of 2/(-4)g - (-6)/1? 4 What is the units digit of -3((-369)/6)/((-2)/(-4))? 9 Let s = 1524 + -148. What is the tens digit of s/13 - 24/(-156)? 0 What is the units digit of (1 + -1 + 195)/(207/138)? 0 Let m = 10 + -8. Suppose -260 = -2l - ml. What is the tens digit of l? 6 What is the thousands digit of (((-1069950)/40)/21)/(5/(-8))? 2 What is the tens digit of 16/(-24)-516 - (-1 - -1)? 4 Let j be 34/6 - 1/(-3). Suppose 0 = -2q + 4r + 370, 3r = jr. What is the hundreds digit of q? 1 Let r(d) = 7d + 1. Let c be r(-9). Let y = 89 + c. What is the tens digit of y? 2 Let l(u) = -u*3 + 3u*2 + 6u - 6. Let g be l(4). Suppose 4t - 143 = c, -t = 3c - gc - 42. What is the units digit of t? 7 Let h(j) = -j3 - 13j*2 - j - 8. Let f be h(-13). Suppose 4w - 150 = -2i, 6i - fw = i + 300. What is the tens digit of i? 6 Let m = -1 - -6. Let k(t) = 16t + 204. Let j be k(-12). Suppose 5y - 35 = -ml, y + 0l + 2l = j. What is the units digit of y? 2 Suppose 0 = -0g - 5g - 4a + 90, -3g - 3a + 51 = 0. Let x be g/6(7 + -4). Let b(f) = -f*2 + 11f + 5. What is the units digit of b(x)? 5 Let f(y) = -8y + 2. Let k be f(-2). Suppose -3i + 3 = -15. Let t = i + k. What is the units digit of t? 4 Let y = 165 - 102. Let l be (-4)/(-14) - (-297)/y. Suppose 29 = 5h - 2v, lv - 22 - 28 = -5h. What is the units digit of h? 7 Let g be (11/(-2))/((-3)/6). Suppose -gs + 1270 = 335. What is the tens digit of s? 8 Let s(j) = -2 - j2 + 4j + 1 + 5 - 2j. What is the units digit of s(2)? 4 Let l(a) = -184a*2 + a + 5. Let z be l(6). Let s be (-4)/18 + z/(-153). Suppose x = -o - x + s, 4o = -x + 151. What is the tens digit of o? 3 Let i = 53 - 24. What is the units digit of i? 9 Suppose -5275 = 7a - 32a. What is the units digit of a? 1 Let k = 1188 - 515. What is the units digit of k? 3 Suppose r = 2d + 435, -5r + 9d + 2215 = 7d. What is the hundreds digit of r? 4 What is the tens digit of ((-5)/(25/16))/(2/(-10))? 1 Suppose h - 60 = -2h. Let a = 10 - -5. Let t = h + a. What is the tens digit of t? 3 Let x = 28 - 8. Let r = -10 + x. Suppose -b + 12 + r = 0. What is the tens digit of b? 2 Suppose 2406 = 4t - 7w + 5w, -5t + w = -3006. What is the hundreds digit of t? 6 What is the thousands digit of 357/(-34)2830/(-15)? 1 Let a(w) be the second derivative of -w5/20 + w4/4 + 2w3/3 + w2 - 6w. Let l be a(4). Suppose 15 = lx - 65. What is the tens digit of x? 4 Suppose -3q = -448 - 1154. What is the hundreds digit of q? 5 Suppose -2s - 3h + 24 = 0, 3 = 3s - 4h + 1. Let k(c) = 2c3 - 5c*2 + 8c + 6. Let b be k(s). What is the tens digit of (3 - 2)/(9/b)? 3 Suppose 28156 = 5k - 57a + 53a, -3a + 5616 = k. What is the hundreds digit of k? 6 Let j be (-2277)/7 - ((-32)/14 - -2). Let i = j + 569. What is the units digit of i? 4 Suppose 12 = -7r + 3r, 3g = 3r + 123. What is the units digit of g? 8 Let b(j) = j - 2. Let w be b(7). Let n = w + 3. Suppose 2m - 28 = -2x - 2x, n = 2x. What is the units digit of m? 6 Let j = -124 - -202. Suppose 20n - j = 18n. What is the tens digit of n? 3 Suppose 4w + 2s - 4968 = 0, 2w - 5s = -4s + 2484. What is the units digit of w? 2 Let w(a) = 2a*3 + 37a*2 + 8a + 134. What is the hundreds digit of w(-18)? 3 Let u(p) = 76p2 - 7p - 22. What is the tens digit of u(5)? 4 Suppose -26r = -25r. Suppose r = -16i + 17i - 67. Suppose 242 = 5q + i. What is the tens digit of q? 3 Let d = 2902 - 1735. What is the tens digit of d? 6 Let k(p) = -p2 + 15p - 40. Let h be k(6). Let u = -2 + 0. What is the units digit of (1/(-1))/(u/h)? 7 Let p(a) = 48a3 + 5a*2 - 15a + 12. What is the thousands digit of p(5)? 6 Suppose -8 = 15t - 11t. Let n(g) = -7g3 + g2 - g + 1. What is the tens digit of n(t)? 6 Let j(c) = -8c*2 - 7c - 4. Let s(h) be the first derivative of 3h3 + 4h*2 + 5h - 2. Let k(i) = -6j(i) - 5s(i). What is the units digit of k(-3)? 0 Let h(d) be the first derivative of d*4/4 - 7d*3/3 - 13d*2/2 + 3d + 11. What is the tens digit of h(9)? 4 Suppose -2n + 542 = -4n. Let b = -111 - n. Suppose -3s + 4k + 104 = -0k, 5s - 4k - b = 0. What is the tens digit of s? 2 Let d(i) = -3i - 2. Let o be d(-2). Suppose 0 = 5p + 10, -or = 3p - 14. Suppose 2b = -5u - 0b + 20, 0 = -5u + 3b - r. What is the units digit of u? 2 Let d = 1 - -1. Suppose 5l - 801 = 4p - 86, dl = 3p + 538. Let s = -106 - p. What is the tens digit of s? 7 Suppose 2d = -o + 1466, d + 108 = o - 1355. What is the tens digit of o? 6 Let y = 23 - 1. Suppose y + 82 = 5k - 3i, 0 = 4k + 2i - 70. What is the tens digit of k? 1 Let m(j) = 8j*3 - 5j*2 + 7j - 13. Let u(x) = 7x3 - 6x*2 + 6x - 14. Let w(y) = 6m(y) - 7u(y). What is the tens digit of w(12)? 2 What is the hundreds digit of 642/(-90)-850? 3 Suppose -4v + 4i - 41 + 121 = 0, 3i = -3v + 78. Let n = 13 - v. Let g(k) = -k*2 - 12k - 9. What is the units digit of g(n)? 1 Suppose 8q - 91q = -75115. What is the tens digit of q? 0 Let a(m) = -16m2 - m + 1. Let w(k) = k2 + k + 1. Let c(b) = -a(b) - 3w(b). Let p = 9 + -11. What is the units digit of c(p)? 2 Let g(u) = 22u2 + 3u + 3. Let c = -27 + 25. What is the tens digit of g(c)? 8 Suppose -2494 - 354 = -4v - 4m, 0 = -v - 3m + 706. What is the tens digit of v? 1 Let n(h) = 5h + 14. Let r be n(-3). Let o(p) = -167p3 + 2p*2 + p. What is the units digit of o(r)? 8 Suppose 112m + 14190 = 127m. What is the hundreds digit of m? 9 Let c be -1(-2)/9 + 560/72. Let u(b) = 4b - 27. What is the units digit of u(c)? 5 Let a be (41/4 - 4)-4. Let n = a + 28. What is the tens digit of ((-35)/(-3))/(1/n)? 3 Suppose 2h = 165 + 157. What is the hundreds digit of h - -9(8/(-6) + 1)? 1 Let k = -24 - -162. Suppose 6z = 3z + k. What is the units digit of z? 6 Let q be (1 - 3)/((-16)/(-184)). Let a = q + 83. What is the tens digit of a? 6 Suppose -2b - 2 = 14. Let w = -3 - b. Suppose -wi - 2 = -7i. What is the units digit of i? 1 Suppose 3q - 4v + 2 = 0, -4q = 3v - v - 12. Suppose 6u = 14 - q. Suppose ub - 75 = 7. What is the tens digit of b? 4 Let i be (-680)/(-2) + -8(-3)/(-6). Suppose 0 = b + b - i. What is the tens digit of b? 6 What is the units digit of (2/(-2))/(6/(-84))? 4 Let a = -15 + 51. Suppose g - a = -2g. Suppose -4p = q - g - 8, -5 = -p + 4q. What is the units digit of p? 5 Let i be 11(2 - 1/1). Suppose -24 - i = -s. Let f = s - 23. What is the tens digit of f? 1
What is the tens digit of (12/18)/(2/84)? 2 Suppose -3q - 4t + 177 = 0, -5t = 5q - 2t - 284. What is the units digit of q? 5 Let w be 6/(-3 + 0)1. What is the tens digit of (-8)/(-10)(-55)/w? 2 Suppose 0 = 9c - 4c + 60. Let z = 17 + c. What is the units digit of z? 5 Let r(y) = -y - 6. Let f(k) = -3k + 8. Let v be f(6). Let x be r(v). Suppose xa - 20 = 4j, -5a = -3j - 10 - 17. What is the units digit of a? 6 Suppose 3c + 203 = 4v, v - 11 - 44 = 5c. What is the units digit of v? 0 Suppose -8l + 2l = -540. What is the tens digit of l? 9 Let t be -1 - 4(1 + 1). Let y = t - -14. What is the units digit of y? 5 Suppose 0h - 4 = -2h. Let z = h - -2. What is the units digit of z? 4 Let o(b) = 4b3 + 7b*2 - b - 8. Let r(p) = -3p*3 - 6p*2 + 2p + 7. Let t(f) = 2o(f) + 3r(f). What is the units digit of t(-5)? 0 Let n = 132 + -75. What is the units digit of n? 7 Suppose 0 - 3 = -s. Suppose -sk = -3b + 15, 0k + 3k = b + 1. What is the units digit of b? 8 Let j(q) = 20q2 - 8q - 15. What is the units digit of j(-3)? 9 Let y = -7 - -12. Suppose v = 4q - 20, 4q = 3q + 4v + y. What is the units digit of q? 5 Let b be (5/2)/(1/2). Suppose -3x + 5 = -2h, -b = -5x + 4h + 4. What is the units digit of x? 1 Let u be -1(0/(-1) + -3). Let v be (-4)/(-10) - 396/(-60). Let k = v - u. What is the units digit of k? 4 Suppose -8y + 4 = -4y. Let p = y - -16. What is the units digit of p? 7 Let l be 7/2 + 1/2. Suppose 0 = -t + lt + 4b - 14, 5b - 10 = -3t. What is the tens digit of t? 1 Let j = -16 + 15. What is the units digit of 120/18 + j/(-3)? 7 Let v(q) = q2 - 3q - 7. Let d be v(5). Suppose 3 = -3f - 6, 0 = db + 5f - 6. What is the units digit of b? 7 Suppose -62 = -b - 4t, 3b + t + 0t = 197. Suppose 0 = -5d + b + 4. What is the units digit of d? 4 Let m be 10/25 - 176/(-10). Let s = m + -10. What is the units digit of s? 8 Let k be (-2)/10 + (-22)/(-10). Let o = k - -11. What is the tens digit of o? 1 Let t = 40 - -83. What is the units digit of t? 3 Let d = 5 - 1. Suppose df + 5g - 36 = 2f, -3f - 3g + 36 = 0. What is the units digit of f? 8 Suppose -4d - 7 = 5j, -2j = 3d - 5d + 10. Let w(y) = -2y. Let h be w(j). Suppose f = -f + h. What is the units digit of f? 3 Let z be (-75)/(-20) - (-1)/4. Suppose 2a + 44 = 2l, 31 = -zl + a + 128. What is the units digit of l? 5 Let w = -6 + 39. What is the units digit of w? 3 Let r = -7 + 11. Suppose 6 = 3z - 5x, -rz = z + 3x - 44. What is the units digit of z? 7 Suppose c + 0c = -j + 25, -4 = 2c. What is the units digit of j? 7 What is the units digit of (9 + -10)1-23? 3 Let w(i) = 2i + 33. What is the units digit of w(-12)? 9 Let o be (-2)/4 + (-3)/(-6). Suppose 3g + 2v - 13 = -o, 1 = -v. Suppose 2b = 7b + 4x + 7, 2b - g = x. What is the units digit of b? 1 Let i(c) = 19c3 - c2 + 1. Suppose -4 = -2f - 2f. What is the units digit of i(f)? 9 Suppose 0 = 4o + 2o - 282. What is the tens digit of o? 4 Let a be ((-4)/10)/(8/40). Let u(c) = -5c*2 - 3c + 6. Let x(t) = 4t2 + 2t - 5. Let v(q) = 3u(q) + 4x(q). What is the units digit of v(a)? 4 Let z be (-2)/((-38)/(-42) + -1). Let j = 10 + z. What is the tens digit of j? 3 Let c = -255 - -370. What is the hundreds digit of c? 1 Let q(k) = 41k + 16. What is the tens digit of q(7)? 0 Let f = 2 - 3. Let o be 2 - (1 - 34)/f. Let b = o - -44. What is the tens digit of b? 1 Suppose 3b - 17 = -y, 5y + 3b + 28 - 149 = 0. What is the units digit of y? 6 Let g be 90/12(-4)/(-6). Suppose 4 + 1 = gu. What is the units digit of u? 1 Let i = 70 + -50. Let f(a) = -a*3 - 4a*2 + 5. Let p be f(-4). Suppose -2x - 2g = -i, -2x - 14 = -x - pg. What is the units digit of x? 6 Let o be 21/6 - (-9)/(-6). Suppose 3x - 2 = 5x. Let u = o + x. What is the units digit of u? 1 Let a(c) = -12c3 + c2 - c - 6. What is the units digit of a(-2)? 6 Suppose -8k + 10 - 10 = 0. Let a(q) = q3 + 0q*3 + 6 + q + 3q*2 - 4q*2. What is the units digit of a(k)? 6 Suppose 5p = 24 + 86. What is the units digit of p? 2 Let x(f) = -f*2 + 8f - 1. What is the tens digit of x(6)? 1 Let c be -2 - (-25 - (-4)/(-1)). Suppose l - c = 25. What is the units digit of l? 2 Suppose q - 27 = -4q + 3y, q - 8 = -2y. Suppose 0 = -h - 2h + q. What is the units digit of h? 2 Suppose 5f - 1989 = 3x, -2x - 913 = 5f - 2887. What is the hundreds digit of f? 3 Let m = -430 + 741. What is the tens digit of m? 1 Let s be (-1)/(1 - 2) + -5. Let l be (6/s)/((-6)/8). Suppose 0 = -4z + 5i - 3 - l, 2z + 3i = 25. What is the units digit of z? 5 Let f = -10 + 31. What is the tens digit of f? 2 Let t(s) = 2s + 14. Let l be t(-7). Suppose -u + 141 = 4h, 4h + 0u + 2u - 142 = l. What is the units digit of h? 5 Let t(y) = 4y - 1. Let i be t(1). Suppose -1 = -4n + i. Suppose -11 = -v + n. What is the units digit of v? 2 Let p = -126 + 210. What is the units digit of p? 4 Suppose -3g - 3h = -201, g + 4h + 13 - 77 = 0. What is the units digit of 1/(-2) - g/(-8)? 8 Let q = 76 + -42. What is the units digit of q? 4 Suppose 5i + 4v = v - 47, 40 = -4i - 3v. Let h(o) = o*2 + 6o + 4. What is the tens digit of h(i)? 1 Let m = -31 - -60. What is the units digit of m? 9 Suppose -2q + 2m + 78 = 0, 142 = 3q - 0m + 2m. What is the units digit of q? 4 Let d = -9 + 83. What is the tens digit of d? 7 Suppose 81 = -87r + 90r. What is the units digit of r? 7 Let p = -65 - -154. What is the units digit of p? 9 Let q = -13 - -85. What is the tens digit of q? 7 Suppose 0 = 5j - 176 - 64. What is the units digit of j? 8 Let h = -22 - -25. Let f(g) = g*2 + 3g - 1. Let p be f(-6). Suppose -1 = 3n + 4d, 2n + 2d = -hn + p. What is the units digit of n? 5 Suppose 5x - 7 = 23. What is the units digit of x? 6 Let w(x) = x*2 - 5x. Let d be w(5). Let b = -1 - -2. Let i = b + d. What is the units digit of i? 1 What is the units digit of (6/(-4))/(16/(-1472))? 8 What is the tens digit of 6/18 + (-116)/(-3)? 3 Let r be (-44)/(-36) - (-2)/(-9). What is the units digit of -1 - r - 15/(-3)? 3 Suppose 0 = 19f - 13f - 456. What is the tens digit of f? 7 Suppose -m - 8m + 720 = 0. What is the tens digit of m? 8 What is the units digit of 3 - (210/(-4) - 16/32)? 6 Let x = 9 - 9. What is the tens digit of 11 + (x - (1 - 2))? 1 Let w(q) = 2 + q - 4 - 2 + 2. What is the units digit of w(7)? 5 Suppose -k = -4k - 21. What is the tens digit of k + 4 - -36 - 1? 3 Let j(h) = 21h - 28. What is the hundreds digit of j(8)? 1 Let m(l) = -25l*3 - l - 1. What is the units digit of m(-1)? 5 Suppose 3x - x - 4b - 306 = 0, -2x + 338 = 4b. What is the hundreds digit of x? 1 Let u = -102 + 170. What is the units digit of u? 8 Let c(j) = 5j*2 + 1. What is the units digit of c(1)? 6 Let c = 7 + -5. Suppose u + c = 15. What is the units digit of u? 3 Suppose g = -21 + 119. What is the units digit of g? 8 What is the units digit of (1/(-1))/(22/(-84))? 1 Let v be -2 + (74 - (4 - 2)). Let h be v/15 - 4/6. What is the units digit of (-48)/h(-1)/3? 4 Let x = 94 + -87. What is the units digit of x? 7 Let g be (3/90)/1. Let m(w) = -10w - w2 + 3w - 5 + g. What is the units digit of m(-6)? 1 Let l be ((-12)/9)/((-2)/6). What is the tens digit of ((-13)/l)/(2/(-8))? 1 Let j be (-26)/(-4) + (-5)/10. Let x = j + -3. What is the units digit of x? 3 Let t = 4 + -1. Suppose 0q = tq - 12. Let i(o) = 3o - 4. What is the units digit of i(q)? 8 Let b(y) = y3 - 4y*2 + 5y - 7. What is the tens digit of b(4)? 1 What is the units digit of 2 + (-4 - -100) + 2? 0 What is the hundreds digit of 4666/14 + (-10)/1053? 3 Suppose -2x - 118 = -3i, -5i + 177 = -x - 29. Suppose i = 5t - 3. Let q = t + -5. What is the units digit of q? 4 Let c = -19 - -27. What is the units digit of c? 8 Let v be 104/(-10) + 4/10. What is the units digit of (-8)/20 - 74/v? 7 Suppose -3x - 4p = -160, -4x - p = -328 + 119. Suppose 5y - x = 33. What is the tens digit of y? 1 Suppose 2c - 8 = -2c. Suppose 4t + ch + 3h - 14 = 0, 0 = -3t + 5h + 28. What is the units digit of t? 6 Suppose 4d - 2 = 3d. Let y = d - -2. Let l = y - 0. What is the units digit of l? 4 Let g(a) = 2a - 1. Let r be g(1). Let x(o) = o. Let i be x(r). Let h(v) = 2v3 + v - 1. What is the units digit of h(i)? 2 Let y(h) = -h3 - 3h2 - 3h + 11. What is the tens digit of y(-5)? 7 Let f(b) = 6 - 2b + 6b*2 + 2b3 + 2 - b3 - 5b. What is the units digit of f(-7)? 8 Suppose 79 + 101 = 5l. What is the units digit of l? 6
What is the millions digit of 11230507? 1 What is the millions digit of 9141542? 9 What is the hundred thousands digit of 2776279? 7 What is the tens digit of 10337421? 2 What is the thousands digit of 728363? 8 What is the millions digit of 1734655? 1 What is the millions digit of 3326251? 3 What is the thousands digit of 68487? 8 What is the ten thousands digit of 8749805? 4 What is the hundreds digit of 2500104? 1 What is the ten thousands digit of 32186606? 8 What is the units digit of 8359878? 8 What is the millions digit of 16499261? 6 What is the ten thousands digit of 5537413? 3 What is the ten thousands digit of 360365? 6 What is the thousands digit of 326623? 6 What is the hundreds digit of 62781? 7 What is the hundred thousands digit of 873118? 8 What is the hundred thousands digit of 190662? 1 What is the units digit of 165131? 1 What is the tens digit of 53028? 2 What is the thousands digit of 221131? 1 What is the millions digit of 1200710? 1 What is the hundred thousands digit of 2574679? 5 What is the units digit of 6708263? 3 What is the ten thousands digit of 166837? 6 What is the tens digit of 126043? 4 What is the units digit of 689736? 6 What is the tens digit of 8569214? 1 What is the millions digit of 1095932? 1 What is the hundred thousands digit of 641063? 6 What is the units digit of 143053? 3 What is the hundreds digit of 332745? 7 What is the ten millions digit of 12288721? 1 What is the units digit of 14807647? 7 What is the ten thousands digit of 49516? 4 What is the thousands digit of 22043? 2 What is the hundred thousands digit of 833536? 8 What is the tens digit of 1522894? 9 What is the units digit of 2211144? 4 What is the ten thousands digit of 43917? 4 What is the tens digit of 14999520? 2 What is the hundred thousands digit of 3580089? 5 What is the ten thousands digit of 7708500? 0 What is the units digit of 262057? 7 What is the thousands digit of 7950491? 0 What is the thousands digit of 442226? 2 What is the tens digit of 116070? 7 What is the tens digit of 908060? 6 What is the millions digit of 26520069? 6 What is the hundreds digit of 7103584? 5 What is the units digit of 2231087? 7 What is the thousands digit of 1214566? 4 What is the hundreds digit of 9399573? 5 What is the hundreds digit of 7633521? 5 What is the thousands digit of 670525? 0 What is the hundred thousands digit of 9292343? 2 What is the thousands digit of 191255? 1 What is the hundred thousands digit of 3020837? 0 What is the tens digit of 130884? 8 What is the tens digit of 19924998? 9 What is the hundreds digit of 645284? 2 What is the tens digit of 512839? 3 What is the units digit of 72088? 8 What is the ten thousands digit of 54652? 5 What is the units digit of 172509? 9 What is the thousands digit of 1469851? 9 What is the ten thousands digit of 126775? 2 What is the thousands digit of 34583752? 3 What is the ten thousands digit of 4843880? 4 What is the tens digit of 187299? 9 What is the thousands digit of 1427331? 7 What is the tens digit of 358401? 0 What is the thousands digit of 365908? 5 What is the ten thousands digit of 22726870? 2 What is the units digit of 90097? 7 What is the ten thousands digit of 377095? 7 What is the ten millions digit of 14646943? 1 What is the hundred thousands digit of 7474084? 4 What is the units digit of 28222187? 7 What is the hundred thousands digit of 127292? 1 What is the hundred thousands digit of 211139? 2 What is the thousands digit of 542687? 2 What is the tens digit of 1207104? 0 What is the hundreds digit of 158765? 7 What is the tens digit of 110347? 4 What is the tens digit of 884131? 3 What is the tens digit of 1664509? 0 What is the hundreds digit of 15994346? 3 What is the hundred thousands digit of 29245634? 2 What is the hundreds digit of 2301091? 0 What is the ten thousands digit of 1632186? 3 What is the thousands digit of 8767? 8 What is the hundred thousands digit of 417817? 4 What is the millions digit of 5976514? 5 What is the thousands digit of 6022710? 2 What is the tens digit of 2919676? 7 What is the ten millions digit of 14040097? 1 What is the hundred thousands digit of 8646134? 6 What is the thousands digit of 6206438? 6 What is the tens digit of 103197? 9 What is the thousands digit of 789838? 9 What is the hundred thousands digit of 390082? 3 What is the ten thousands digit of 10521? 1 What is the thousands digit of 1110485? 0 What is the hundreds digit of 3418754? 7 What is the tens digit of 9666748? 4 What is the units digit of 101848? 8 What is the hundred thousands digit of 373174? 3 What is the tens digit of 7377724? 2 What is the ten thousands digit of 267046? 6 What is the ten thousands digit of 6860565? 6 What is the thousands digit of 167639? 7 What is the hundred thousands digit of 806523? 8 What is the millions digit of 4495646? 4 What is the hundreds digit of 305337? 3 What is the thousands digit of 2259697? 9 What is the units digit of 183540? 0 What is the hundreds digit of 2101173? 1 What is the units digit of 3634858? 8 What is the ten thousands digit of 3690699? 9 What is the ten thousands digit of 457221? 5 What is the ten millions digit of 18256443? 1 What is the units digit of 7530008? 8 What is the hundred thousands digit of 15625598? 6 What is the ten millions digit of 11883962? 1 What is the thousands digit of 7120538? 0 What is the hundred thousands digit of 461731? 4 What is the thousands digit of 8065368? 5 What is the units digit of 1964367? 7 What is the thousands digit of 142855? 2 What is the thousands digit of 1044705? 4 What is the hundred thousands digit of 789010? 7 What is the hundreds digit of 198327? 3 What is the ten thousands digit of 2060665? 6 What is the thousands digit of 60831? 0 What is the tens digit of 7162486? 8 What is the units digit of 1098969? 9 What is the thousands digit of 751172? 1 What is the hundreds digit of 2481637? 6 What is the ten thousands digit of 205025? 0 What is the tens digit of 793207? 0 What is the ten thousands digit of 677585? 7 What is the tens digit of 1033562? 6 What is the tens digit of 1220347? 4 What is the tens digit of 1138595? 9 What is the thousands digit of 1893519? 3 What is the thousands digit of 102861? 2 What is the tens digit of 1806303? 0 What is the units digit of 4439? 9 What is the tens digit of 3457976? 7 What is the hundred thousands digit of 17518220? 5 What is the units digit of 3838852? 2 What is the millions digit of 1663154? 1 What is the units digit of 10598375? 5 What is the ten thousands digit of 242842? 4 What is the tens digit of 516473? 7 What is the units digit of 2226005? 5 What is the units digit of 3012466? 6 What is the units digit of 3661041? 1 What is the units digit of 50102? 2 What is the tens digit of 367857? 5 What is the thousands digit of 19662299? 2 What is the thousands digit of 1003336? 3 What is the hundred thousands digit of 807458? 8 What is the ten thousands digit of 12896356? 9 What is the thousands digit of 402805? 2 What is the tens digit of 116968? 6 What is the ten thousands digit of 722759? 2 What is the thousands digit of 281436? 1 What is the thousands digit of 3945013? 5 What is the hundred thousands digit of 8727420? 7 What is the thousands digit of 174643? 4 What is the ten thousands digit of 769618? 6 What is the tens digit of 1163775? 7 What is the units digit of 497507? 7 What is the hundreds digit of 9108888? 8 What is the ten thousands digit of 11635493? 3 What is the tens digit of 1288593? 9 What is the units digit of 3245946? 6 What is the hundreds digit of 427968? 9 What is the ten thousands digit of 7831100? 3 What is the tens digit of 91873? 7 What is the hundred thousands digit of 768045? 7 What is the units digit of 4255115? 5 What is the thousands digit of 2396562? 6 What is the ten thousands digit of 259687? 5 What is the tens digit of 108385? 8 What is the thousands digit of 517675? 7 What is the ten thousands digit of 2012887? 1 What is the units digit of 14603517? 7 What is the ten thousands digit of 424327? 2 What is the thousands digit of 42722? 2 What is the ten thousands digit of 198991? 9 What is the units digit of 1954381? 1 What is the tens digit of 267632? 3 What is the tens digit of 210992? 9 What is the ten millions digit of 28184052? 2 What is the thousands digit of 151069? 1 What is the hundred thousands digit of 237119? 2 What is the hundreds digit of 15247? 2 What is the millions digit of 4588760? 4 What is the tens digit of 2764026? 2 What is the ten thousands digit of 91518? 9 What is the hundreds digit of 35818? 8 What is the tens digit of 12782011? 1 What is the hundreds digit of 13084064? 0
Suppose 0 = 2k - 2i - 498, -4k - 4i = -282 - 690. Suppose -w - 2g = w - k, -4w + 486 = 2g. Calculate the smallest common multiple of 165 and w. 1320 Let b be 6/(-937)(-5)/(-15). Let x be (-2)/3748(1 + 34659 + 5). Let w = x + b. Find the common denominator of w and 73/22. 22 Suppose 5a - 1147 = -47. Calculate the least common multiple of a and (992/31 - 27)(-84)/(-15). 1540 Suppose 46q = 2810 - 464. Calculate the lowest common multiple of q and 237. 4029 Suppose -2i = -5p + 19953, 7i + 49875 = 2i + 5p. Let b = 149551/15 + i. What is the common denominator of 37/81 and b? 405 Let f = 11327 + -10997. Calculate the lowest common multiple of 1140 and f. 12540 Suppose -5k - 3 + 28 = 0. Let m(d) = 7d - kd*2 - 4d*2 + 3d2 + d3. What is the lowest common multiple of 30 and m(5)? 30 Calculate the smallest common multiple of ((-33 - -34)(-1 + 3))/(4/20) and 995. 1990 Let r = 18 + -10. Calculate the lowest common multiple of r and 16 + (15 - 25) - (-336)/2. 696 Calculate the common denominator of 71/888 and -3 + 3 + ((-40836)/720)/(-41). 4440 Let k(s) = -s3 + 13s*2 - 2s + 36. Suppose 69 = 5c + 2n, 0 = 4c - 5n + 4 - 46. Calculate the least common multiple of 8/(-10)(-210)/12 - 0 and k(c). 70 Let a(i) = i3 - 6i*2 - 20i + 18. Let o be a(8). Find the common denominator of 67/186 and 379/o + 66/(-154). 186 Suppose 20p - 324 = -16p. What is the lowest common multiple of 15118 and p? 136062 Suppose -48786 = a - 3a. Suppose -d - 4d - 3c + a = 0, 0 = 2d - 2c - 9754. Let i = 77993/16 - d. What is the common denominator of i and -59/18? 144 Let j be 3/(6/10)(-2)/(-10). Find the common denominator of (1001/63)/11j and -70/87. 261 Let d = -193033/37 + 5217. Find the common denominator of d and -43/1073. 1073 Suppose -54x + 22040 = 3032. What is the smallest common multiple of x and 352? 352 Suppose 0 = -106r + 838 + 223 - 1. What is the smallest common multiple of r and 784? 3920 Let v = -46 + 25. Let m be ((-3)/2)/(8/(2912/v)). Suppose -28a + ma = -80. What is the lowest common multiple of a and 44? 440 Let j = 3304 + -3267. Let n be -19 + -2 - -2 - -3. Let x = -8 - n. What is the smallest common multiple of x and j? 296 Let s(k) = k + 8. Suppose -6n = -n - 320. Suppose 10 = -o + n. Calculate the smallest common multiple of s(-6) and o. 54 Find the common denominator of 24170/(-14025) - (1 - 8/3) and -95/1496. 7480 Let q = 3/1264 - 48679/6320. Let c = 34 + -22. Suppose 3s - s - c = 0. Calculate the common denominator of s and q. 10 Let z = 8/1249 - 83811/19984. Find the common denominator of z and -7/2804. 11216 Let w = -4/2851 - 39430/344971. Find the common denominator of 1/33 and w. 363 Let h be 53145/54(-9662)/7167. Let j = h + 11941/9. Let w = j + -48575/4778. Calculate the common denominator of -8/3 and w. 6 Let n = 53 + -48. Let y be -4((-4888)/n - (-3)/5). Let m = y - 54763/14. Calculate the common denominator of m and -25/2. 14 Let h be (1 - (-18)/(-12))-24. Let w be (h/1)/((273/56)/13). Suppose p + w = 9p. What is the smallest common multiple of 24 and p? 24 Let v(a) = -6a - 274. Calculate the least common multiple of 209 and v(-52). 418 Let y be -9 - 1/(-1) - 0. What is the least common multiple of 506 and 12/y(5 + 177/(-9))? 506 Let a(w) = 94w*3 - 3w*2 + 3w - 2. Let u be a(2). Let p be 6/(-48) - 250134/(-336). Let c = u - p. Find the common denominator of 85/12 and c. 84 Let d = -2/1253489 - 104038897/432453705. What is the common denominator of d and -49/3450? 3450 Let z(g) = 6g3 - 11g*2 + 11g - 13. What is the least common multiple of 698 and z(8)? 4886 Let u = 15/2147 + -131492/75145. Let f be (55/(-10) - -5)4. Find the common denominator of u and f/18255/(-75). 315 Suppose l = 3l - 4m + 250, -464 = 4l + 4m. Let x = l - -1045/9. What is the common denominator of x and -88/21? 63 Let b = -425 - -628. Let v(n) = n*3 - 21n*2 + 21n - 19. What is the lowest common multiple of v(20) and b? 203 Let r(f) = f*3 - 10f*2 - 4. Let x be r(10). Let m be -1 + 331/215 + x/10. Let k = 461/86 + m. Find the common denominator of k and 13/8. 8 Calculate the smallest common multiple of 410 and (1722/27)/(322/15939). 31570 Let p = 383 - 388. Calculate the smallest common multiple of 1 - 8 - 305/p and 90. 270 Let p(c) = 2c + 19. Let m be p(1). Find the common denominator of 34/(-176) + -21 + m and -35/8. 88 Let n = -26238 - -26263. What is the least common multiple of 25 and n? 25 Suppose 8r + 0r = 184. Let a(g) = g*3 - 22g*2 - 25g + 52. What is the least common multiple of 4 and a(r)? 12 Let j(m) be the third derivative of m6/24 - m5/15 - m4/24 + m3/3 + 126m2. Calculate the smallest common multiple of j(2) and 2. 24 Suppose 0 = -21t + 27t + 126. What is the common denominator of t/(-15)(-17)/(-50) and -95/18? 2250 Let j = 32719/136906380 + -4/21405. Let r be 8/(-12) - (-9)/(3799224/639578). Let v = j + r. Calculate the common denominator of v and 133/6. 66 Let t = 2058 - 297. What is the lowest common multiple of 2 and t? 3522 Let u = 5852/9 + -649. Find the common denominator of u and -79/126. 126 Suppose d - 3g = -8g - 17, -d + 2g = -18. Let f = 865 - 856. Calculate the lowest common multiple of d and -6(f - 1 - 9). 24 Suppose 15 = -3a, 6a = 2d + 9a + 1385. Let p = 725 + d. What is the lowest common multiple of 76 and p? 760 What is the common denominator of (-10)/(-160)(-83)/(-2) and 61/64? 64 Let r = 26 + 19. Let c = 283 + -283. Suppose c = 3n + 5i - r, -2i = -2n - 7i + 25. Calculate the least common multiple of 8 and n. 40 Calculate the common denominator of ((-4)/14)/((24960/(-1068))/(-8)) and 79/840. 10920 Let z(n) = -2n3 + 12n*2 - 7n + 3. Calculate the least common multiple of 48 and z(5). 144 Let x(o) = 1376o - 1349. What is the smallest common multiple of x(1) and 2367? 7101 Let s = -7566604367/5626 - -1344935. What is the common denominator of s and 89/8? 22504 Suppose 0 = 22k - 2956 - 6394. Calculate the lowest common multiple of k and 680. 3400 Let c(t) = 128t2 - 40t - 72. What is the lowest common multiple of c(-2) and 52? 520 Let s be 0/(2/((-2)/(-5))). Suppose -6a - 197 + 245 = s. What is the smallest common multiple of a and 6? 24 Suppose -7u + 2u + 10 = 0. Suppose -6v + 43 = 7. Calculate the lowest common multiple of u and (266/35)/(v/5 - 1). 38 Let m = -123 - -59. Let x = -33 + 103. Let d = x + m. Calculate the least common multiple of 24 and d. 24 Let q(m) = 5m2 - 8m + 45. What is the smallest common multiple of q(-5) and 294? 1470 Let b = 186 - 184. Suppose -4r + 40 = -br. What is the lowest common multiple of 15 and r? 60 Suppose -4o + 9o = -55. Let f = o + -1. What is the common denominator of -19/15 and ((-10)/f)/(1/(-2)3)? 45 Let r = 163 + -160. Find the common denominator of (-158)/32 - r(-1)/3 and -57/2. 16 Let m be 72/(-4)(-1)/3. Calculate the smallest common multiple of (-2)/((-12)/166) + 2/m and 10. 140 Let b = 122/1529 - -59239/464816. What is the common denominator of b and 139/114? 912 Suppose 4 + 2 = 6g. Let o be g/(-3) + 12/36. Calculate the common denominator of o/(-3) + -83(-3)/42 and -33/4. 28 Let n(x) = -x3 - 9x*2 + 2x + 11. Let d(j) = -j*2 + j - 2. Let l(c) = 3d(c) - n(c). Calculate the least common multiple of l(-5) and 141. 141 Suppose -718z = -719z + 3o + 54, -5z - 2o + 66 = 0. Suppose 0 = 3r - 2q - 72, 2r + 2r + 3q = 96. What is the least common multiple of r and z? 72 Let g(k) = k + 8. Let j be g(-7). What is the least common multiple of -4 - (8 + (-190)/20 - 57/6) and (4/6)/(j/90)? 420 Let x = 4068 - 11517. Let f = -25051658/15 + 1677565. Let s = f + x. Find the common denominator of 58/3 and s. 15 Let q(s) = -s*3 + 7s - 1. Let v be q(-3). Suppose vp + 34 = 2m + 3p, 3p + 15 = 0. Suppose ml - 9l = 72. What is the least common multiple of 9 and l? 72 What is the common denominator of 108/(-594) + -2(-1627)/4224 and 47/120? 960 Let b be ((-1)/26)/((-2)/7). Let c be (35/(-42))/(104/(-48)). Let w = b - c. Calculate the common denominator of w and -55/18. 36 Let s = 15 - 9. Suppose sh - 7h + 791 = 0. Find the common denominator of (-4)/(-6) - (h/(-231) + -1) and 59/8. 88 Let o(a) = a2 + a - 4. Let m be o(2). Let v(d) = dm + 11 + 5 + 17d + 22. What is the smallest common multiple of v(-15) and 14? 56 Calculate the common denominator of 65/21 and (6/(108/(-42)) - -3)/(-2). 21 Suppose 1245 = -6q + 1263. Calculate the common denominator of (1 - 3)q/(-63)*-54 and -7/82. 574
Let i(m) = m*2 - 47m - 26. Let o(t) = -t*2 + 70t + 26. Let f(r) = -3i(r) - 2o(r). Calculate f(-7). -30 Suppose 0 = 3w + 5o + 1, 3w - w + 7 = 3o. Suppose -120y = -122y + 4. Let k(n) = 6n2 + y - 4n*2 - 7n*2 + 3n*2 + 2n. Give k(w). -10 Let z = -3 + 9. Suppose zq - 41 = 13. Let n(u) = -4 + 7u - 15u + qu - 3. What is n(5)? -2 Let v = -59 + -293. Let z = -349 - v. Let w(h) = h - 7. What is w(z)? -4 Let c(n) = 2n2 - 2n - 23. Let a(k) = 2k2 - 4k - 20. Let p(y) = -2a(y) + 3c(y). Calculate p(-4). -5 Let d(g) be the first derivative of 10g3/3 + 3g*2/2 - 13g + 10319. What is d(3)? 86 Let u(x) = -x - 14. Suppose -5w - 19w = -6w + 198. Calculate u(w). -3 Let p(d) be the second derivative of d5/20 + 5d*4/4 + 17d*3/6 + 7d*2/2 - 5656d. Calculate p(-14). -35 Let t(z) = -3z + 4. Suppose 41 = 2f + 5j, -4j + 94 = 4f + f. Let g(c) = -14 + 11c + c - 3 + 0. Let n(b) = ft(b) + 4g(b). Calculate n(-3). 22 Let q(i) = -2i3 - 3i*2 + i + 6. Suppose 438 = -245f + 26f. Determine q(f). 8 Suppose -52m + 74m + 59m - 324 = 0. Let p(j) = -2j2 + 17j - 8. Determine p(m). 28 Let z(l) = -80l3 - 28l*2 - 30l - 57. Let r(v) = 37v3 + 14v*2 + 14v + 28. Let t(g) = -13r(g) - 6z(g). Calculate t(-14). 6 Let k(j) = 4j2 + 0j + 2j + 2j*3 + 2 - 2j3 + j3. Let y be 6 + -4 + 6 + 19. Let f = y + -29. What is k(f)? 6 Let h(i) = -i*3 - 11 + 163i*2 - i - 348i*2 + 164i*2. Calculate h(-21). 10 Let w be -3(16/6 + -2). Let c(v) be the third derivative of -19v4/24 - v3/3 + 4807v*2 + 4v. Determine c(w). 36 Let y(v) = 18v + 23 - 16v*2 - 570v*3 - 553v*3 + 1122v3. What is y(-17)? 6 Let i(x) = -x2 - 8x - 6. Suppose 5v = 3v - 14. Let n be i(v). Let j(z) = -8606 - 8606 + 17211 + 9z. Calculate j(n). 8 Let g(m) = -m*2 + 3m - 4. Let t(u) = u*2 - 17u - 57. Let c be (-308)/(-44) - (-26)/2. Let b be t(c). What is g(b)? -4 Let w(d) = 28d2 + 2d - 1. Let k(m) = m - 22. Let p be k(0). Let a(u) = 3u + 9683 - u - 9638. Let x be a(p). What is w(x)? 29 Let y be 2564/284 - 152/5396. Let c(z) = -z2 - 22z + 271. Determine c(y). -8 Suppose 2r = -2r + 40. Let d(l) = -3 - l*2 + 0l + 3l - 7 + rl. Give d(12). 2 Let k(f) = -2f3 + 52f2 + f - 26. Let x(o) = -o3 + 95o2 + 1285o - 81. Let s be x(107). Give k(s). 0 Let w be 37592/9144 - -11/(-9). Let l(x) be the third derivative of -x4/24 - 2x*2. Give l(w). -4 Let t(f) = -3f*2 - 20f - 28. Let d(o) = o*2 + 10o + 14. Let l(m) = -5d(m) - 2t(m). Suppose 4q + 16g = 140, -40 = 4q - 4g - 60. Give l(q). -3 Let h(o) = -7o + 24. Let m be 495/(-165) + (-9 - 1). Give h(m). 115 Let d(p) = 18p + 19. Let x(q) = -33q - 39. Let z(o) = -5d(o) - 3x(o). Determine z(2). 40 Let l(p) = 170p - 25. Let o(z) = 14z - 2. Let h(c) = 6l(c) - 75o(c). Let t(d) = d2 + 41d + 39. Let n be t(-40). What is h(n)? 30 Let l(o) = -o - 1. Let n = 39 - 15. Suppose -2y = -0c + 2c, -y = -c + 6. Suppose x = -cx - n. Give l(x). 5 Let g(l) = -6l + 0l + 9l - 6l - 29 + 2l. What is g(-23)? -6 Suppose 0 = -1822r + 1839r. Let w(s) = s2 + 2s + 8. What is w(r)? 8 Let s = 322 - 303. Let b(j) = -2j2 + 40j - 43. Let m(o) = -o*2 + 20o - 23. Let t(k) = -4b(k) + 7m(k). Determine t(s). -8 Let k(r) = 4r. Let n(f) = 3f - 7. Let g(p) = p - 4. Let q(j) = -5g(j) + 3n(j). Let c(l) = -2k(l) + 3q(l). Let u be -3 + -2 - (-8 + 1). Calculate c(u). 5 Let v(b) = -2b + 10. Let n(f) = -f + 9. Let p be ((-3)/2)/((-15)/24 - -1). Let c(w) = pv(w) + 5n(w). Let h be 2/7 + (-228)/(-84) + 1. Calculate c(h). 17 Suppose -21s + 7s = -70. Suppose -k + 13 = -2t, -st + 6t + 19 = -2k. Let l(y) be the third derivative of y4/12 + 11y3/6 + y2. What is l(t)? -7 Let w(c) = 2c2 - 5c + 4. Let r(m) = m*2 + 3m - 11. Let f be r(5). Suppose 0 = -x + 32 - f. Determine w(x). 7 Suppose -3m - 8 = -4n, 20 = -4m + 2n + n. Let g(d) = -5d2 + 10d + 15. Let k(x) = -2x2 + 3x + 5. Let v(a) = mk(a) + 3g(a). Determine v(-5). 0 Let w be -20 - (11 - (-238)/204(-6 - 0)). Let o(b) = -b3 - 24b2 + b + 18. What is o(w)? -6 Let h(c) = -c3 - c*2 - 1. Let n = 220 - 211. Suppose -4u + n = 3z - 3, -20 = -2u - 5z. Calculate h(u). -1 Let m(s) = 0 + 3 - 9s + 3s2 - 2s*2 + 0s*2. Suppose -5k = -10 - 5. Suppose kh + 15 = 0, -h + 6h + 46 = 3y. Calculate m(y). -11 Let t(m) = 20 + 64m + 0m2 - 89m - 7m2 - 62. Let h(c) = 3c*2 + 12c + 20. Let i(x) = 9h(x) + 4t(x). Give i(9). 3 Let q be 76/6 - (-2)/(-3). Let l(g) = 0g3 + g + 4g*3 - 12g*2 - 49108 - 49103 + 98210 - 3g*3. Give l(q). 11 Let y(m) = -3m*2 - 18m + 20. Let f(r) be the first derivative of -8r3/3 - 26r*2 + 59r - 41. Let j(c) = -4f(c) + 11y(c). Give j(8). 0 Let w(u) = -5u2 + 6u + 2. Let a(d) = -5d2 - 30d + 32. Let z be a(-7). Let i(l) = -4l2 + 7l + 1. Let h(k) = zw(k) + 4i(k). What is h(9)? 7 Let l(a) = a - 4. Let t(p) be the second derivative of p*4/6 - 7p*3/6 - 5p*2 + 15p. Let b be t(6). Suppose -bq + 10 = -15q. Give l(q). -2 Let t(a) be the third derivative of -a*4/6 - 49a*3/6 - 6a*2 - 168a. Give t(-26). 55 Let d(w) = 10w3 - w. Let z(t) = -9 - t3 - 93t*2 + 194t*2 - 95t*2 + 17t. Let m be z(8). Give d(m). -9 Let w(z) = -3z - 21. Let c be (-990)/165(0 - -1). What is w(c)? -3 Suppose 2a - 21 - 12 = -3y, 4y - 20 = 0. Let o(b) be the first derivative of 9 + b2 - 33 - 4 - 13b. Determine o(a). 5 Suppose -2g + 4 = 3l, 8 = -4g + 5l - 7l. Let d be -3 - (-2)/(g - -2). Let a(i) = -4i + 8 - 17 + 2i + 3. Determine a(d). 2 Let q(t) be the first derivative of 2t*2 + 21t + 1084. Determine q(-4). 5 Let t(d) = -d*2 - 5d - 10. Let m = 3721 + -3725. Calculate t(m). -6 Let d(p) = -2p - 4. Let c be d(-8). Let k(w) = 6w - 7. Let g be k(1). Let m(x) = -10x + 2. Let q(r) = -r. Let z(h) = cq(h) + gm(h). Determine z(-2). 2 Let v = 27 + -22. Suppose 4t - vq - 60 = 3t, -4t = -3q - 274. Let l(w) = -38 + t + 5w - 34 - 4w. Calculate l(-3). -5 Let v(s) = -2s3 + 9s*2 + 16s + 35. Let w(r) = 5r3 - 19r*2 - 36r - 77. Let u(m) = 7v(m) + 3w(m). Calculate u(-6). -10 Let b(o) = o*2 - 16o + 50. Let x be b(12). Let g(k) be the second derivative of -5k + 0k*3 + 0k*2 - 1/6k4 + 0. Calculate g(x). -8 Let f = -139 + 36. Let l be (-4)/42 - f/(-21). Let c(x) = -x2 - 2x + 1. Give c(l). -14 Let w(j) = -5j - 11 - 3j + 18 - 2j2 + j2. Suppose 15 = -3n - 2x, 5n - 8x + 5x + 44 = 0. What is w(n)? 14 Let s(m) = m2 + 10m. Let i(a) = -12a2 + 15a. Let y be i(4). Suppose -4b - 11 = c, 0b + b - c + 9 = 0. Let r be b/(-14) - y/(-21). Give s(r). -24 Suppose 3x - 19 = 2s, -1658x + 3 = s - 1657x. Let p(k) = 7k3 - 2k*2 + 2k + 3. Calculate p(s). -65 Suppose -362j = -373j + 11. Let o(l) = -l - 2. Let k(d) = 2. Let h(f) = jo(f) + 3k(f). What is h(5)? -1 Suppose 1762t - 1757t - w = -19, -3t = -3w + 21. Let b(f) = -2f2 + 8f + 27. Give b(t). -15 Suppose -48v - 3v = 3806 + 376. Let y(a) = 6a + 496. What is y(v)? 4 Let n(h) = 5h*3 + 2h*2 - 1. Suppose 3z - 83 = b + 28, 2b - z = -202. Let r = -85 - b. Suppose -3k - r = -5c, 6k = 2c + 3k - 11. Calculate n(c). 6 Let n(r) = -11r. Let j = -434 - -442. Suppose jc - 15c = -7. Determine n(c). -11 Let j(p) = p3 - 3p*2 + 2p + 2. Suppose 0 = -u - 7u + 336. Let f = 45 - u. Let d(i) = -i3 + 3i*2 - i - 1. Let t(s) = fd(s) + 2j(s). What is t(2)? 7 Let r(h) be the second derivative of 7h*3/6 + 5h*2/2 + 368h - 2. What is r(3)? 26 Let y(o) = -o*2 - 4o - 11. Let k be 32/(-3) + 504/189. Determine y(k). -43 Suppose 4a + 32 = -2q + 22, -4q - 20 = -2a. Let t(f) = f - 16f3 + 17f*3 + af*2 + 3f + 6 - 6f2 - 9f. Give t(7). 20 Suppose -5b - 13i = -11i - 61, -2b + 5i = -36. Let l(z) = -3z - 2. Give l(b). -41 Suppose 0 = -2z + 4h - 2, -4z - 4h + 16 + 4 = 0. Let s(g) = 88g - 263. Give s(z). 1 Let i(h) be the first derivative of h6/40 - h5/15 + h4/12 + h3/6 - h2/2 + 3h + 89. Let v(b) be the second derivative of i(b). Determine v(2). 13 Let q(b) be the third derivative of -b*5/60 - 5b*4/8 - 29b*3/3 - 69b*2 + 11b. What is q(-5)? -8 Let f(g) = 63g2 - 11g - 2. Let p(b) = 27b2 - 5b - 1. Let t(y) = -2f(y) + 5p(y). What is t(3)? 71 Suppose 92 = 57q - 136. Let f(k) be the third derivative of k5/60 - k4/12 - k3/6 - 5k*2. Give f(q). 7 Let z(t) = t - 3. Suppose -3d - 23 = -5h, -2h = 5*d + 27 + 1. Let q be -1 - 7/((-7)/d). Determine z(q). -10
Let m(k) = -9k3 + 4k*2. Let z(c) = 3c3 - c2. Give 4m(w) + 11z(w). -3w3 + 5w2 Let u(d) = d2 - d + 1. Let k(h) = -3h3 + 2h*2 - 2h + 2. Give k(j) - 2u(j). -3j3 Let t(x) = -1. Let j(k) = -k2 - 3k + 1. Let l be j(1). Let z(r) = -2r*2 + 3. Determine lt(g) - z(g). 2g2 Let s(q) be the second derivative of -2q*3/3 + 2q. Let k(r) = r. Let d(n) = n*2 + 3n - 5. Let c be d(-4). Determine cs(g) - 5k(g). -g Let w(a) = 9a2 - 4a - 7. Let d(x) = 3x2 + 63 - x - 31 - 34. Determine -7d(r) + 2w(r). -3r*2 - r Let o = 16 - 15. Let i(f) = -10 + 14 - 5. Let v(w) = 2w + 6. What is ov(j) + 4i(j)? 2j + 2 Let g be 68/18-6. Let q(z) = -11 + 10z*2 - 6 + 1. Let b(k) = 2k*2 - 3. Calculate gb(m) + 3q(m). -2m*2 Let w(h) = -7h + 2. Let s(a) = -4 + 5 + 10. Let x(c) = -c + 43. Let u(j) = 9s(j) - 2x(j). Let m be u(-9). Let n(o) = 6o - 2. What is mn(p) - 4w(p)? -2p + 2 Let k be 2/((-1)/3 + 1). Let d(i) = -i + 1. Let l(h) = 5h - 7. Let y(g) = g - 1. Suppose -3a - 5 + 2 = 0. Let w(p) = al(p) + 4y(p). Give kd(c) - w(c). -2c Let v(l) = -14l - 1. Let d(c) = 3c. What is -11d(g) - 2v(g)? -5g + 2 Let t(j) = -j + 2. Let x(v) = -1. Suppose 0 = 2z - 4z + 2. What is zt(d) + 4x(d)? -d - 2 Suppose 0 = l - 3 - 3. Let y(x) = 13x*3 + 11 - lx*3 + 0x + 0x. Let q(k) = 4k*3 + 6. Calculate 11q(f) - 6y(f). 2f*3 Let y(o) = 3o - 5. Let q(h) = -h + 2. Let g(a) = -2a - 4. Let d be 2 + -1 + -15. Let p be g(d). Determine py(c) + 10q(c). 2c Let r(s) = -12s - 2 + 7s3 - 4s*3 + 12s + 2s2. Let w(i) = -16i*3 - 11i*2 - i + 11. What is 11r(c) + 2w(c)? c3 - 2c Let w(r) be the third derivative of -r5/60 + r4/12 - r3/2 - r2 + 52. Let z(g) = -1 + 1 - 1. Determine -w(l) + 2z(l). l2 - 2l + 1 Suppose 3a + 15 = 3d, d + 17 - 2 = -3a. Let o(k) = -3k*2 - 8k. Let q(r) = -4r2 - 12r. Calculate aq(s) + 7o(s). -s*2 + 4s Let p(b) = -b*2 - 3b. Let d(o) = -o. Suppose 5u + 36 = -3l, 3l + 2l - 2u + 29 = 0. Let r(t) = t2 + 7t + 2. Let i be r(l). Calculate id(j) - p(j). j2 + j Let s(x) = -x2 - 2x - 3. Let c(g) = g*2 + 3g + 4. Let k(r) = -5c(r) - 6s(r). Let m(j) = -5j2 + 16j + 11. Give 11k(q) + 2m(q). q2 - q Let n(u) = u3 + 13u. Let a(y) = 2y*3 + 25y. What is 6a(m) - 11n(m)? m*3 + 7m Let o(v) = v*3 - 4v*2 + 4. Let t(n) = -3n*2 + 3. Calculate 2o(i) - 3t(i). 2i3 + i2 - 1 Let b(d) = -6d2 + 8d - 2. Let p(c) = 5c2 - 7c + 2. Determine -3b(a) - 4p(a). -2a2 + 4a - 2 Let z(i) = -3i2 + 5i - 5. Let d(y) = -4y2 + 4y - 4. Give -5d(a) + 4z(a). 8a2 Let h(d) = d + 1. Let j(t) = t - 1. Calculate -4h(b) + j(b). -3b - 5 Let x(k) = -5k*3 + 4k*2 + 5k. Let o(m) = -4m3 + 3m*2 + 4m. Let l = -22 - -27. Give lx(h) - 6o(h). -h*3 + 2h2 + h Let g(m) = -m2 - 2m. Let r(a) = a2 - 19a + 24. Let j be r(18). Let o be ((-30)/(-25))/(2/5). Let t(f) = f. What is jt(d) + og(d)? -3d2 Let l(t) = -3t*2 - 4t - 2. Let r(k) = -k*2 - k - 1. Suppose 6b + 3 = -3. What is bl(f) + 2r(f)? f*2 + 2f Let k(m) = -2m - 1. Let y be k(-1). Let x(f) be the first derivative of -2f*2 - 4f + f*2 - y + 2f. Let z(p) = -p - 1. Determine -6x(b) + 13z(b). -b - 1 Let p(f) = -4f2. Suppose 2d - 6 = 5b - 36, b - d - 9 = 0. Suppose 1 = m - 4s, 0 = -2s - b + 2. Let v(h) = -h2. Calculate mp(l) + 10v(l). 2l*2 Let c(p) = 4p*3 - 5p*2 - 3p. Let q(h) = 2h3 - 3h*2 - 2h. Let l = -4 + 4. Let n(f) = f3 - f2 + f + 5. Let d be n(l). Determine dq(t) - 3c(t). -2t3 - t Let p(i) = -i2 + 2i + 4. Let w(a) = 4a2 - a. Let g be w(1). Suppose -gc = -4c + 8. Let s(n) = -3n*2 + 5n + 11. Calculate cp(r) - 3s(r). r2 + r - 1 Let k(j) = -j2 + 5j. Let u(l) be the third derivative of -l5/20 + l4/2 + 8l*2. Give 12k(r) - 5u(r). 3r*2 Let d(t) = 3t*2. Let q(f) = 2f*2. Suppose 13 = 4i + 33. What is id(w) + 9q(w)? 3w2 Let l(t) = -t. Suppose 2v - 3n - 4 = 0, 5n = -v - 5 - 6. Let i(b) = -3b2 + b. Calculate vi(m) - 3l(m). 3m*2 + 2m Let b = 0 - 4. Let q(m) = 5 + 2m - m - m2 + m + m. Let x(y) = -2y*2 + 4y + 6. Determine bq(l) + 3x(l). -2l2 - 2 Let u = 20 - -11. Let d = 17 - u. Let y(i) = 0 - i + 2 - 3. Let o(t) = -6t - 8. What is dy(s) + 2o(s)? 2s - 2 Let n = 63 + -68. Let s(c) = -2c - 1. Let w(f) = 3f + 2. Calculate ns(k) - 3w(k). k - 1 Let o(w) be the first derivative of 3w*4/4 + 5w*3/3 - 5w - 1. Let g(m) = -4m3 - 7m*2 + 7. Calculate -5g(s) - 7o(s). -s3 Let k(v) = 41v*2 + 9v - 2. Let u(l) = 20l2 + 4l - 1. Determine 6k(z) - 13u(z). -14z2 + 2z + 1 Let f(m) = -5m2 - 18m + 3. Let x(c) = 6c2 + 18c - 4. What is -4f(v) - 3x(v)? 2v2 + 18v Let u(m) = -7m2 - 7m - 4. Let z be (-9)/(-18) + 1/2. Let i = -4 - z. Let b(v) = -4v2 - 4v - 2. Give ib(q) + 3u(q). -q*2 - q - 2 Suppose 5l - 11 = c, -15 = -5c + 3l - 4. Let u be ((-2)/(-5))/(14/35). Let x(a) = a - u - c - 3a. Let q(n) = 1. Determine 3q(f) + x(f). -2f - 2 Suppose -3k + 5n + 1 = -17, -5 = -2k + n. Let v(s) = -2s2 + 5s + 3. Let l(b) be the first derivative of b3/3 - b2/2 - b - 3. What is kv(a) + 3l(a)? a*2 + 2a Suppose -5g = -g - 12. Let v(k) = -k - 3 + gk - k. Let y(x) = 2 - 3 + 4 - 2. Determine 2v(f) + 6y(f). 2f Suppose 46 = -2u + 12. Suppose -4 = -z + 2. Let a(v) = -6v. Let j(r) = -2r. Give uj(h) + za(h). -2h Let y = 22 + -20. Let v(n) = 79n - 77n - 2 - 3ny - n2. Let t(q) = 9q2 - 5q + 5. Give 2t(u) + 5v(u). -2u2 Let g(x) = x2 - 1. Let t(b) = 5b*2 - b - 6. Determine 6g(n) - t(n). n*2 + n Let t(c) = -5c2 + 6. Let r = 11 + -29. Let g = 16 + r. Let s(v) = -v2 + 1. Give gt(u) + 11s(u). -u*2 - 1 Suppose 2a = -2 - 0. Let g(c) = -2c3 - c2 - 2c. Let j = 9 - 6. Let f(s) = -s. Calculate ag(z) + jf(z). 2z3 + z2 - z Let z(t) = 4t*2 + 3t + 6. Let h(q) = 3q2 + 2q + 7. Give -3h(d) + 2z(d). -d*2 - 9 Let v(u) = 4u*3 - 3u*2 + 5u - 5. Let z(r) = r3 - r2 + r - 1. Give v(w) - 3z(w). w3 + 2w - 2 Let b(m) = -5m2 + 2m + 4. Let w(o) = -o3 - o2 + o + 1. Give b(r) - 2w(r). 2r*3 - 3r*2 + 2 Suppose -3l + 2l = 5. Let h = l + 6. Let y(p) = -4p. Let v(q) = q. What is hy(d) + 2v(d)? -2d Let i(o) = 8o*2 - 6o + 6. Let n(b) = 2b2 - 2b - 3. Let g(h) = h*2 - h - 1. Let w(a) = -5g(a) + 2n(a). Calculate -i(s) - 6w(s). -2s2 Let m(s) = 0 - 2s + 0s - 6. Let b(n) = 1. Suppose -8 = a - 2p, 0 = -0a - a + 3p - 8. Determine ab(z) - m(z). 2z - 2 Let p(b) = -6b3 + 2b*2 - 5. Let h(m) = -3m3 + m2 - 3. What is 5h(x) - 3p(x)? 3x3 - x2 Suppose -d + 5d + 8 = 0, 5g - 2d - 9 = 0. Let w(q) = -3q2 - q - 4. Let t(u) = -u2 - 1. Determine gw(v) - 4t(v). v2 - v Let z(s) be the first derivative of 4s*3/3 + 5s2/2 - 1. Let c(j) = j2 + j. Let f(q) = 2q3 - 3q*2 + q - 1. Let h be f(2). Determine hc(w) - z(w). w*2 Suppose 0 = -2g + 2 - 0. Let k be (6/8)/(g/8). Let q(i) = -i3 - 3. Let w(v) = -10 - v3 - 1 - 3v3. Give kw(f) - 22q(f). -2f*3 Let u(t) = -9t*3 - 7t*2 + 7t + 7. Let s(l) = -4l3 - 3l*2 + 3l + 3. Suppose 5 = -3x + p, 0p - 4p - 13 = -x. Give xu(c) + 7s(c). -c3 Let a(m) = 2m*3 + 2m*2 - 2m - 2. Let c be 111/15 - 2/5. Let i = c - 12. Let r(y) = -4y3 - 5y*2 + 5y + 4. What is ia(w) - 2r(w)? -2w3 + 2 Let g(o) = -o2 + 1. Let a(u) = 19u*2 + 2u - 5. Let v(t) = 10t2 + t - 2. Let r(z) = 3a(z) - 5v(z). Give 6g(y) + r(y). y*2 + y + 1 Let l(g) = -280g*2 + 16. Let n(s) = 56s*2 - 3. What is 3l(x) + 16n(x)? 56x*2 Let r(u) = 11u*2 + 17. Suppose 0m = -m + 4. Suppose -mf + 26 = 94. Let p(g) = 4g*2 + 6. Calculate fp(i) + 6r(i). -2i*2 Let i(o) = 3o + 2o - 1 + 9o*2 - 9o. Let c = -6 - -1. Let u(x) = -22x2 + 10x + 2. What is cu(k) - 12i(k)? 2k2 - 2k + 2 Let n(i) be the third derivative of 2i5/15 - i4/6 - 7i*3/6 + 2i*2 + 48i. Let u(f) = 3f2 - f - 2. Calculate -2n(r) + 7u(r). 5r*2 + r Let s(j) = j + 1. Let w(a) = 4a + 6. Let u(k) = k*3 + 7k*2 - 6k + 6. Let v be u(-8). Calculate vs(r) + 2w(r). -2r + 2 Let f(m) = m2 + m. Let d(o) = -2o*3 - 22o*2 - 22o. What is 2d(c) + 44f(c)? -4c3 Let w(l) = 5l*3. Suppose -3k - 5 = 1, 2u - 10 = -2k. Let b(f) = -9f3. Give uw(y) + 4b(y). -y3 Suppose -22 = -5t + 33. Let b(g) = 2g2 - 3g. Let a(k) = 4k2 - 6k. Let j(v) = -6a(v) + 11b(v). Let i(u) = -10u2 + 16u. Give tj(y) - 2i(y). -2y*2 + y
Calculate the highest common divisor of 2575 and 3087837. 103 Calculate the greatest common factor of 152 and 90656543. 19 What is the greatest common factor of 4401185 and 54085? 145 Calculate the highest common factor of 282 and 67335168. 6 What is the highest common divisor of 1445640 and 15358? 14 Calculate the greatest common divisor of 317334099 and 1687. 241 What is the highest common factor of 294169990 and 35? 5 Calculate the greatest common divisor of 60704 and 2433851. 1897 Calculate the highest common divisor of 36679176 and 36. 36 Calculate the highest common divisor of 736025040 and 15. 15 Calculate the greatest common divisor of 11118 and 1645636329. 5559 Calculate the greatest common factor of 596919 and 7995. 123 What is the highest common divisor of 1079405532 and 60? 12 What is the highest common divisor of 234684 and 2591541? 1431 Calculate the highest common divisor of 2299531122 and 2898. 2898 Calculate the highest common divisor of 654 and 937752. 6 Calculate the highest common divisor of 2718170 and 6202. 14 What is the greatest common divisor of 151469853 and 2367? 789 Calculate the highest common factor of 34736 and 74826688. 2672 Calculate the highest common divisor of 22873158 and 1512. 378 Calculate the greatest common divisor of 149761101 and 189. 21 What is the highest common factor of 1848 and 87877713? 231 Calculate the greatest common factor of 23373595 and 70. 35 Calculate the highest common factor of 297 and 7316661. 33 What is the highest common divisor of 23751 and 10579374? 3393 Calculate the highest common factor of 23911704 and 14464. 904 What is the highest common divisor of 40767 and 47625? 381 What is the highest common factor of 13959 and 163053? 297 What is the greatest common factor of 493 and 33796408? 17 Calculate the greatest common factor of 3464695 and 25285. 65 Calculate the greatest common factor of 4777 and 5493244. 17 What is the greatest common divisor of 3926 and 66488773? 1963 Calculate the highest common divisor of 760435053 and 651. 651 What is the highest common divisor of 957 and 106073781? 33 What is the highest common factor of 8589 and 3275612697? 8589 What is the highest common divisor of 37167 and 3342171? 2859 What is the highest common divisor of 379651 and 1387483? 857 What is the greatest common factor of 96726 and 471? 3 What is the greatest common divisor of 14 and 268154187? 7 What is the highest common divisor of 80 and 11947160? 40 What is the greatest common divisor of 57468142 and 82? 82 What is the greatest common factor of 575 and 10368675? 25 Calculate the highest common factor of 84529905 and 1845. 615 What is the greatest common divisor of 2265 and 36843? 3 What is the highest common divisor of 2192 and 122256334? 274 Calculate the greatest common divisor of 8372 and 11571392. 644 Calculate the highest common factor of 102080 and 10580. 20 Calculate the highest common factor of 2080 and 1868620. 260 What is the highest common divisor of 73343 and 50617? 1033 What is the highest common factor of 25090 and 5496530? 130 What is the greatest common factor of 6 and 178871442? 6 Calculate the greatest common divisor of 2 and 803989. 1 Calculate the highest common divisor of 49705296 and 48. 48 Calculate the highest common divisor of 3842410 and 2190. 10 What is the highest common divisor of 300024 and 5618968? 3704 Calculate the highest common factor of 307722877 and 24535. 4907 Calculate the highest common factor of 1074 and 63967440. 1074 Calculate the highest common factor of 21814536 and 11016. 408 Calculate the greatest common factor of 185 and 106870. 5 Calculate the greatest common factor of 4828078 and 21728. 194 What is the highest common divisor of 7181936 and 28? 4 What is the greatest common factor of 3510 and 58669299? 351 What is the highest common factor of 13 and 127658037? 13 What is the highest common divisor of 9 and 16913277? 9 Calculate the greatest common factor of 9336 and 8772168. 24 What is the highest common divisor of 10832 and 13651028? 2708 Calculate the highest common factor of 2109333 and 2090943. 1839 What is the greatest common divisor of 90 and 21880370? 10 What is the greatest common divisor of 4399672 and 1788? 596 Calculate the greatest common factor of 565 and 5975101. 113 What is the highest common factor of 6 and 5013144? 6 What is the highest common factor of 91959703 and 11? 11 Calculate the highest common divisor of 11 and 160637081. 11 Calculate the highest common divisor of 18619 and 8342. 43 Calculate the greatest common divisor of 160892344 and 2512. 1256 Calculate the highest common factor of 882807 and 9. 3 Calculate the highest common factor of 3255 and 3168324. 93 What is the greatest common factor of 4602 and 6036290? 1534 Calculate the highest common divisor of 1176 and 529272. 24 What is the highest common divisor of 1088 and 1951105504? 544 What is the highest common divisor of 61076377 and 2? 1 What is the highest common factor of 3308022 and 102342? 222 Calculate the greatest common factor of 7164 and 1109268. 36 What is the greatest common factor of 20 and 18794255? 5 What is the highest common divisor of 28984120 and 50? 10 Calculate the highest common divisor of 1714 and 33063917. 857 Calculate the greatest common factor of 54908254 and 3246. 1082 What is the greatest common divisor of 155818 and 46982? 338 Calculate the highest common divisor of 70 and 2366035. 35 What is the greatest common divisor of 4156 and 11520432? 4156 What is the greatest common factor of 10986 and 223019462? 3662 What is the highest common factor of 30582392 and 984? 328 What is the greatest common divisor of 5761481 and 55? 11 Calculate the highest common factor of 2482713 and 6114978. 7983 Calculate the greatest common factor of 130451179 and 7473. 2491 Calculate the greatest common factor of 1095572463 and 1338. 669 What is the highest common factor of 1820 and 960540? 140 What is the greatest common divisor of 2329 and 826969675? 2329 What is the highest common divisor of 14011786 and 3370? 674 Calculate the greatest common divisor of 3171860 and 931. 19 What is the highest common divisor of 2755570 and 4750? 190 What is the greatest common factor of 48903535 and 33664? 263 What is the greatest common divisor of 505950 and 108? 6 What is the highest common factor of 4041439 and 248? 31 What is the highest common factor of 16776230 and 11723? 617 What is the highest common divisor of 399 and 34160994? 21 Calculate the highest common divisor of 768 and 28861696. 256 Calculate the greatest common divisor of 86837107 and 1015. 203 Calculate the highest common factor of 152 and 9026767. 19 Calculate the highest common factor of 75820 and 201241444. 15164 What is the highest common factor of 3663894 and 2195? 439 Calculate the greatest common divisor of 7047 and 17806. 29 What is the greatest common divisor of 5225 and 159089755? 1045 What is the highest common factor of 44848282 and 106? 106 Calculate the greatest common divisor of 31768 and 13112. 88 Calculate the highest common factor of 1674405 and 100323. 1413 Calculate the highest common divisor of 7537431 and 96063. 2343 What is the greatest common divisor of 62230989 and 123? 123 Calculate the greatest common divisor of 105 and 162385. 5 What is the highest common divisor of 28 and 103942664? 28 What is the greatest common factor of 70 and 131488570? 10 What is the highest common divisor of 309315 and 416670? 255 Calculate the highest common factor of 6298343 and 704306. 5773 Calculate the greatest common factor of 32 and 406446. 2 Calculate the greatest common divisor of 9239975 and 338225. 2075 What is the greatest common factor of 155524 and 2301228? 2636 What is the highest common divisor of 94033558 and 2444? 94 What is the highest common factor of 6046 and 52366? 2 What is the greatest common divisor of 3224 and 59176? 104 Calculate the greatest common factor of 5170 and 20205394. 1034 Calculate the greatest common divisor of 379643 and 11. 11 Calculate the greatest common divisor of 705980 and 9130. 110 What is the greatest common factor of 212 and 4236714? 106 Calculate the highest common divisor of 2016 and 338808. 24 What is the greatest common factor of 2360 and 2577360? 40 Calculate the greatest common divisor of 384614 and 166. 2 What is the greatest common factor of 7052 and 15382175? 1763 What is the highest common divisor of 402619605 and 30? 15 Calculate the greatest common divisor of 260736 and 1542009. 2037 What is the greatest common divisor of 1818227 and 183? 61
What is the closest to 11 in 5, -2, -0.2, -3/2? 5 Which is the nearest to -37? (a) 2 (b) 0.6 (c) 2/3 b What is the nearest to 4 in -5, -2/19, -38, 2? 2 Which is the nearest to -2/7? (a) 1/3 (b) -2 (c) 0.1 c Which is the closest to -1? (a) -16 (b) 1/8 (c) -0.4 (d) 0.02 c What is the nearest to -4/5 in 1/5, 0.5, -175, 1? 1/5 Which is the nearest to -0.2? (a) -25 (b) 0.2 (c) -1 b Which is the nearest to -2/7? (a) -2/11 (b) -5 (c) -1/9 (d) -1/6 a Which is the nearest to -0.2? (a) -2/17 (b) 235 (c) 4 a What is the nearest to -7 in 5, -3/4, -0.2? -3/4 Which is the nearest to -1/3? (a) -4 (b) 3/4 (c) -2/21 (d) -10 c What is the closest to 1/2 in 1/3, 5, -2/15? 1/3 What is the closest to -3/11 in 0.4, -1, 1/12? 1/12 Which is the closest to 28? (a) 0.2 (b) -5 (c) 3/2 (d) -2 c Which is the nearest to -12/5? (a) 2 (b) 2/11 (c) 0 c Which is the nearest to 2? (a) 4 (b) 1/3 (c) -0.4 b Which is the closest to 0? (a) 3/8 (b) -1 (c) -2/7 c Which is the nearest to 1? (a) -0.4 (b) -0.2 (c) -263 b Which is the nearest to 0.01? (a) -4/3 (b) 0.4 (c) -1 b What is the closest to 4/13 in 0.01, -2, -4? 0.01 Which is the nearest to 2/17? (a) -7 (b) -0.9 (c) 4 (d) 4/3 b What is the nearest to -165 in -2, -0.1, 0.1? -2 What is the closest to 3/8 in -0.4, 0.5, 2/51? 0.5 Which is the nearest to -1? (a) 0.5 (b) 5 (c) -0.3 (d) 1/5 c What is the closest to 1/4 in 3, -1/2, 1/2, -16? 1/2 Which is the closest to 4? (a) 3 (b) 4 (c) 2 (d) 1 b What is the nearest to 0.07 in -17, 0.2, -5, 2/7? 0.2 Which is the closest to -0.2? (a) -78 (b) -3/10 (c) 4 b Which is the nearest to -1/4? (a) 3 (b) -2/3 (c) 0 (d) 2/23 c Which is the closest to -0.1? (a) 0 (b) 13 (c) 0.3 (d) 0.5 a Which is the nearest to -0.3? (a) 3/2 (b) -5 (c) 1/6 (d) 5 c What is the closest to 1 in 3/4, -1, -2/11? 3/4 Which is the nearest to -0.5? (a) 0 (b) -0.4 (c) 1/2 (d) -4/3 b What is the closest to -0.1 in 0, -2/5, -2/3, -26? 0 Which is the nearest to 1/6? (a) -0.4 (b) 7 (c) -0.2 c Which is the closest to 0? (a) 4.3 (b) -6 (c) 1/5 c Which is the nearest to -3? (a) -1 (b) -2/9 (c) 5 a Which is the nearest to 10/9? (a) -3 (b) 1/2 (c) 2/7 (d) 0 b Which is the nearest to -2/3? (a) -69 (b) 3 (c) -0.16 (d) 3/7 c What is the nearest to -2.4 in -3, 2/11, -0.3, 3? -3 What is the closest to 0.01 in 4, 0.09, 1/4, 0.5? 0.09 What is the nearest to -0.2 in -1/3, 0.4, 6? -1/3 What is the nearest to 2 in -9, 3/5, -2.1, 1? 1 What is the closest to 2 in 5, -8, -5? 5 What is the nearest to 0 in 0.3, 10, -0.8, -1/3? 0.3 What is the nearest to -1 in -11/5, -5, 2? -11/5 Which is the nearest to 1/4? (a) -0.02 (b) 0.1 (c) 3/2 (d) 4 b Which is the closest to -3? (a) 3 (b) 5 (c) -2/23 (d) 1/3 c Which is the closest to 2? (a) -4/3 (b) 3 (c) -0.5 (d) -3/32 b Which is the closest to 10/3? (a) -10 (b) 4 (c) 0 (d) -5 b What is the nearest to 2/21 in 0.4, -2/5, 0.2? 0.2 Which is the nearest to 20? (a) 4 (b) -5 (c) -2/13 a Which is the closest to 1/3? (a) -0.1 (b) -0.4 (c) -4 (d) -1/4 a Which is the closest to -3.1? (a) -2 (b) 5 (c) -1 (d) -0.3 a Which is the closest to 3? (a) -1 (b) 2 (c) 5 (d) -3 b Which is the nearest to -1? (a) 7 (b) -1 (c) -2 b Which is the nearest to 3? (a) -3/4 (b) 8 (c) 1 c Which is the nearest to -2? (a) 3/10 (b) -2.3 (c) -1 b Which is the nearest to -0.09? (a) 5 (b) 2/9 (c) 3 (d) 3/5 b What is the closest to -2 in -1/2, 0.3, -5, -1/7? -1/2 Which is the nearest to 5/7? (a) -5 (b) 2/5 (c) 0.06 b Which is the closest to -164? (a) -1/2 (b) 0.5 (c) -0.26 a What is the closest to -1/3 in 3, 2/5, 1, -21? 2/5 What is the closest to 2 in 2/7, -6/7, 21? 2/7 Which is the nearest to 2/7? (a) 3/7 (b) 4/5 (c) -4 (d) -5 a Which is the closest to 0.3? (a) 1/6 (b) 5 (c) 1/9 (d) -0.33 a Which is the nearest to -3/7? (a) 0.2 (b) 1 (c) -0.1 c Which is the nearest to 1/3? (a) -50/3 (b) 0.2 (c) 6 b What is the closest to 2 in 7, 2, 9? 2 What is the nearest to 1 in 0.5, 2/7, -5, -3/7? 0.5 Which is the closest to -0.1? (a) -4 (b) 2/7 (c) -5 (d) 7 b What is the nearest to 1 in 2, -0.4, -9? 2 Which is the nearest to -59? (a) 4/67 (b) 2 (c) 4 a Which is the nearest to 1? (a) -180 (b) -5 (c) 4 c Which is the nearest to 1? (a) 0.2 (b) 1.26 (c) -3 b What is the closest to -2/7 in -2, -5, 3, 4? -2 Which is the nearest to -0.1? (a) 1/3 (b) 0.1 (c) -0.5 (d) 12/13 b Which is the nearest to 2/5? (a) -10 (b) -3 (c) 4 b Which is the nearest to -1/5? (a) 2 (b) 1 (c) 16.5 (d) -4 b What is the closest to -10 in 0.5, -7/4, -0.2? -7/4 Which is the nearest to 0? (a) 1/4 (b) -5 (c) 334 a Which is the closest to 3? (a) 4 (b) -2/3 (c) 21 a Which is the closest to -2? (a) -2 (b) 214 (c) 3/8 a What is the closest to 0.3 in 4/3, -1, 0, -0.3? 0 Which is the nearest to -36? (a) -0.2 (b) -2/11 (c) 1/4 a What is the closest to 0 in -0.4, 0.07, 2, -21/5? 0.07 What is the nearest to -1 in -8, -4, -2, 5? -2 Which is the nearest to 0.2? (a) -2 (b) -42 (c) 0.2 c What is the nearest to 0.2 in -644, -1/10, -5? -1/10 What is the nearest to 1 in -0.4, -3, 127, 1/2? 1/2 What is the nearest to 2 in 0.2, 12929, 4? 0.2 Which is the nearest to 1? (a) 5 (b) -2/9 (c) 6 b What is the closest to -1 in -30, 4, -0.4? -0.4 Which is the closest to 2? (a) -0.7 (b) 3/5 (c) 3 c Which is the nearest to 1? (a) 0 (b) 2/9 (c) 109 b What is the closest to -4/5 in 4, -0.2, -5/2? -0.2 Which is the nearest to 605/3? (a) -2/13 (b) -2/9 (c) 2 c Which is the nearest to -1? (a) 1 (b) 9 (c) -1 c Which is the nearest to -2/5? (a) 15/4 (b) -4 (c) -5 (d) -3 d Which is the nearest to 0? (a) -41/4 (b) 10 (c) 5 (d) 0 d Which is the closest to -2/3? (a) -0.4 (b) 1/4 (c) 2/7 (d) 0.01 a What is the closest to 0.2 in 0.1, 2/27, 0? 0.1 Which is the nearest to -1/2? (a) 2 (b) 4 (c) -14 (d) -2.7 d Which is the closest to 0.1? (a) 2/85 (b) -1 (c) 2 a What is the closest to 1 in 3/5, 4, -310? 3/5 What is the nearest to -0.7 in 1/3, 5/3, 4? 1/3 Which is the closest to -2? (a) 0.3 (b) 6/31 (c) 0.5 (d) 0.08 d What is the closest to 15 in 1, 1.3, -8/5? 1.3 Which is the closest to 0? (a) -6 (b) 5 (c) 4 c Which is the closest to 0? (a) 0.59 (b) 1/8 (c) 0 c Which is the nearest to 0? (a) -1 (b) -1/3 (c) 1/9 (d) -7 c Which is the nearest to -2/9? (a) -0.03 (b) -2/5 (c) -1 (d) -3 b What is the nearest to 8.1 in 22, 1/4, -0.1? 1/4 What is the closest to 1 in 11/5, -132, 5, 1/4? 1/4 What is the nearest to 5/44 in 2/23, 13, 0? 2/23 Which is the nearest to 2/3? (a) -7 (b) 2/5 (c) -0.1 b What is the closest to -9 in -3, -2, 0.2, -1/23? -3 What is the closest to 16 in 2/7, -0.5, 0.1, -3? 2/7 Which is the closest to 1? (a) 0.3 (b) -9 (c) -0.01 (d) -3 a What is the closest to -1 in -1/6, -0.16, 0.5, 1? -1/6 Which is the closest to -5? (a) 0.2 (b) -0.8 (c) 2/7 b What is the nearest to 7/5 in 2, -4, -0.5? 2 What is the nearest to 1 in 3/5, 1, 4/3, -2/7? 1 What is the closest to 0.0594 in 0.1, 4, -2? 0.1 Which is the closest to -1/35? (a) -1/4 (b) -0.2 (c) 0.4 b What is the nearest to -1/4 in 1, -4, -0.08? -0.08 What is the closest to 2/5 in -2, -4, -13, -1.3? -1.3 What is the nearest to -0.2 in 0.1, -2, -4? 0.1 What is the closest to 0.1 in 1/25, 5/2, 2/3? 1/25 What is the closest to -4.5 in 2/9, -4, 0.5? -4 What is the nearest to 0.1 in 0.5, 0.9, 5? 0.5 What is the closest to -3.8 in -1, -5, 12? -5 Which is the nearest to -8/9? (a) -20 (b) 3 (c) 2/9 c What is the nearest to -0.1 in -23, 0, 2? 0 Which is the nearest to -2/7? (a) 0.7 (b) -1/3 (c) 0.19 (d) -3 b What is the nearest to 1 in 2/5, -4, 39? 2/5 What is the closest to 1 in -18, -4, -0.4, 4? -0.4 What is the closest to -1 in -2/3, -6, -2, -5? -2/3 What is the closest to -1 in 1, -5, 0, 0.06? 0 What is the closest to -248 in -0.3, 0.1, 5, 4? -0.3 Which is the nearest to -1? (a) -1 (b) -2/5 (c) 1 (d) 150 a What is the nearest to 1 in -0.1, 2/101, 9? 2/101 What is the closest to 0.2 in 0, -2/37, -2? 0 Which is the closest to 222? (a) -1/4 (b) 0.12 (c) 0.5 c What is the nearest to -0.02 in 1/9, 1/14, -2/7? 1/14 What is the closest to 28 in -1/2, 2/7, -0.07? 2/7 What is the closest to -2 in -3/5, 0.5, -16? -3/5 What is the closest to 0.82 in 2/3, 0.3, -3, -4? 2/3 What is the closest to 0 in 0.3, 5, 1? 0.3 What is the nearest to -2/11 in 2, 2/19, -3? 2/19 What is the nearest to 4 in 0.1, 0.3, 1/2, 0? 1/2 Which is the nearest to 2/875? (a) -3/8 (b) 0.2 (c) -0.1 c Which is the nearest to -1? (a) -0.8 (b) 1 (c) 2 (d) -6 a
Let u(o) = -o*2 + 6o - 1. Let a(x) = x. Let h(s) = -6a(s) + u(s). Let c be h(3). What is the remainder when 28 is divided by (-148)/c + (-2)/(-10)? 13 Let q(v) = 3v - 4v + 0 + 8. Calculate the remainder when 57 is divided by q(-7). 12 Suppose 4n - 80 = -0n - 2m, -46 = -2n + 2m. Calculate the remainder when 62 is divided by n. 20 Suppose 9 = -y + 3i, 3y - 4i + 22 = 5. Let l = y + 6. Calculate the remainder when 8 is divided by l. 2 What is the remainder when (-1240)/10(2/(-4) - 0) is divided by 17? 11 Suppose -2f + 34 = 5i + 2f, -f + 46 = 5i. Suppose 3q + 2y - 44 = 0, 2q - 16 = -3y - y. Calculate the remainder when q is divided by i. 8 Let r(m) = -5m. Suppose 0 = -3q - 6. Let w = 2 + 4. Calculate the remainder when r(q) is divided by w. 4 What is the remainder when -436/(-32) - (-2)/4 is divided by 4? 1 Suppose -2k + 1 = -4s - 1, -5s = -5k + 15. Suppose 2p = -2p - 12. What is the remainder when k is divided by (0/1)/p + 3? 2 What is the remainder when (-8)/(-1) - (-8)/(40/(-15)) is divided by 3? 2 Let k be -1 - (-1 - 1 - -1). Suppose -w + 17 = -2m, k = -2w + 2m + m + 29. What is the remainder when 12 is divided by w? 5 Let y(w) = -w*3 + 7w*2 + 11w - 8. Suppose 25 = -4x + 5u, 0x - 4u = -4x - 20. What is the remainder when 2/(-4)(x + -94) is divided by y(8)? 15 Let x(r) = -r*2 + 4r + 4. Let c be x(4). Suppose 25 = -9t + ct. What is the remainder when 14 is divided by (t/(-2))/((-2)/(-4))? 4 Suppose 13k - 15k - 4m = -42, -3k + 2m + 39 = 0. Suppose 99 = c + c - 5w, 4c - 180 = 4w. What is the remainder when c is divided by k? 12 Suppose -43 = -4k + 2w + 347, -k + 90 = -3w. What is the remainder when k is divided by 17? 14 Suppose -16 - 164 = -5q. What is the remainder when q is divided by 13? 10 Let q be (-4)/6 - 6/(-9). Suppose -a + 10 = a + 3o, q = -4a + 4o + 20. What is the remainder when 18 is divided by a? 3 Let r = 93 + -46. Let o(k) = -k3 - 4k*2 - 3k + 4. Calculate the remainder when r is divided by o(-4). 15 Suppose -26 = -3o - 2u, 5o - 60 = -4u + 9u. What is the remainder when 57 is divided by o? 7 Let r(z) = z3 - 6z*2 + 2z + 3. Let l = 20 - 6. Suppose 2 = -2x + l. Calculate the remainder when r(x) is divided by 8. 7 Let c = -52 - -86. What is the remainder when 99 is divided by c? 31 Let i = -52 + 57. Calculate the remainder when 18 is divided by i. 3 Let b(n) = n3 - 9n*2 - 11n + 10. Let m be b(10). Suppose x - 2x + 5 = m. Calculate the remainder when 14 is divided by x. 4 Let b = -34 - -48. Let n be -1 + -1 + 4 + -4. Calculate the remainder when (39 + 1)/(n + 3) is divided by b. 12 Suppose -2u - 8 = s + 6, -2s + u - 18 = 0. Let y be s/(-15) + 386/6. Let f = y + -39. What is the remainder when f is divided by 9? 8 Let g(c) = c2 + 9c + 3. Let o be (1 - 10)/(3 + -2). What is the remainder when 11 is divided by g(o)? 2 Suppose -h - 8 = -4i, 2i + 3 = 9. Let l = -1 + h. Suppose 0 = -4k + a + 30, 4a + 1 = -lk + 14. Calculate the remainder when 20 is divided by k. 6 Suppose 5x - 5p = 30, 0 = -0x - 4x - p - 1. What is the remainder when 19/2 + 1/(-2) is divided by x - -1(-1 + 5)? 4 Let z = -38 - -41. Suppose 3q + 4k = -4, 4q - 5q - 3k - 8 = 0. Suppose -26 = -zy + q. Calculate the remainder when 38 is divided by y. 8 Let m(o) = -2o + 2. Suppose -6y - 36 = -168. Calculate the remainder when y is divided by m(-3). 6 Let y = -26 + 43. Suppose -15 - 12 = -3d. Calculate the remainder when y is divided by d. 8 Suppose -2m = -5p - 0m + 127, 96 = 4p + 4m. Let i = 35 - p. Calculate the remainder when 29 is divided by i. 9 Let z = -4 - -44. Let s(w) = -w*2 + w + 68. Let k be s(0). What is the remainder when z is divided by 4/10 + k/5? 12 Suppose 0 = b - 6 - 0. Suppose 4v - b = 10. Suppose 2a - 50 = l + l, -5l + 55 = va. Calculate the remainder when 39 is divided by a. 19 Suppose 4m = -5t + 102 + 11, -3m - 3t + 84 = 0. Calculate the remainder when m is divided by 5. 2 Let k(s) = -s + 28. What is the remainder when 38 is divided by k(14)? 10 Suppose 0 = 2v - 2 - 2. Suppose i + 3d = 15, 5d + 19 - 51 = -vi. What is the remainder when i is divided by 0 - (3/(-1) + -8)? 10 Let b(a) = a3 - a2 - 3a - 4. Let d be b(-4). Let q = 123 + d. Calculate the remainder when q is divided by 13. 12 Let p = 1 + 19. Let z(q) = q*2 - 5q + 6. Let x be z(5). Suppose -x - 5 = -f. What is the remainder when p is divided by f? 9 Let v(d) = -d*2 - 9d - 3. Let o = -7 + 21. What is the remainder when o is divided by v(-8)? 4 Suppose i - 2h = 1, 5i - 2h = -0h + 45. Suppose 2j + 2j + 24 = 4t, -j = -2t + i. What is the remainder when ((-42)/8)/(6/(-16)) is divided by t? 4 Suppose 4a = 3o + o + 76, 5a - 71 = -3o. Calculate the remainder when a is divided by 5. 1 Suppose -2s - 2s = -164. Suppose 2g = -8, -3o - 4 = -g + 34. Let f = o + 28. Calculate the remainder when s is divided by f. 13 Suppose u - 4q = -0u - 6, 0 = 2u + 4q. Suppose 0 = 3k - 6 - 3. Calculate the remainder when 4 is divided by u3/(-9)k. 0 Let b(n) = 7n*3 - 2n - 1. Let r be b(-1). Let z(d) = -d*3 - 5d2 + 7. What is the remainder when z(r) is divided by 23? 20 Let u(z) = z3 - 4z2 + 8z - 2. Calculate the remainder when 36 is divided by u(3). 10 Suppose -2p - 57 = -5p. Calculate the remainder when 129 is divided by p. 15 Suppose -5k = -4z + 1, 15 = 3k + 2k. Suppose -2w + 9 = -4h - 17, -4h + 18 = 2w. What is the remainder when w is divided by z? 3 Suppose -2z + 104 = 2z. Calculate the remainder when 75 is divided by z. 23 Suppose 0 = 2l + 2, 4j - 145 + 34 = 3l. Let u = 22 - 8. Calculate the remainder when j is divided by u. 13 Let m(c) = -c + 3. Let r be m(1). Suppose -3d - rk = d - 84, -10 = 5k. What is the remainder when 64 is divided by d? 20 Suppose 0 = 4a - a - 9. Suppose -ay + 8 + 0 = -4s, 3s = 12. Calculate the remainder when 13 is divided by y. 5 Let w(q) = -q*2 + 9q + 4. Let m be w(5). Suppose 24 = 4b - u, u - m = -4b - u. What is the remainder when b is divided by 3? 0 Let a(d) = -3d + 8. Calculate the remainder when 25 is divided by a(-2). 11 Let d(z) = 2z*2 - 2z - 4. Calculate the remainder when 78 is divided by d(4). 18 Suppose 32 = 3j + z, -j - 2z - 56 = -5j. What is the remainder when 47 is divided by j? 11 Let w be 1/26 + 1. Calculate the remainder when (-475)/(-15) + w/(-6) is divided by 16. 15 Suppose 2r + r = 4f - 8, 4r = -3f + 6. Let v(n) = -n - 3. Let o be v(-5). Let a = o - -2. Calculate the remainder when a is divided by f. 0 Let y(b) = b*2 + 8b + 9. Let o be y(-7). Suppose -3x + 70 = ox. What is the remainder when 20/(-1(-2)/4) is divided by x? 12 Calculate the remainder when 4/16 + 750/8 is divided by 24. 22 Suppose 2q + 14 = 2p, -4q - 46 = -0q + 5p. Suppose 0 = 4g - g, -2l + 2g = -12. What is the remainder when 6/(-27) - 101/q is divided by l? 5 Let b = 56 + -40. What is the remainder when 44 is divided by b? 12 Calculate the remainder when 15 is divided by 5 + -2 + 4 + 2. 6 Suppose 5v - i = -5i - 39, 2i = 3v + 19. Let h = 11 + v. What is the remainder when 14 is divided by h? 2 Let z = -27 - -43. Suppose 19 = 4b - 4y - 97, b + 3y - 33 = 0. Calculate the remainder when b is divided by z. 14 Suppose -o = 5q + 14, 4o - 2o - 14 = 4q. Suppose -2i + 3l + 21 = 0, -i - 2i + l + 14 = 0. Let p = i - o. What is the remainder when 4 is divided by p? 0 Suppose 4f = 5u - 68, 5f = -2u - 3 + 50. Let h = -42 - -105. Calculate the remainder when h is divided by u. 15 Let s = -5 - -9. What is the remainder when s/(-18) - 470/(-9) is divided by 18? 16 Let s(b) = -5b + 29. Let d(m) = 2m - 10. Let r(p) = 8d(p) + 3s(p). Let v be r(-6). Suppose v + 14 = 5u. Calculate the remainder when 7 is divided by u. 1 Suppose -2c = -1 - 1. Let y be 33/9 - c/(-3). Suppose -q + 6 + y = 0. What is the remainder when q is divided by 6? 4 Let i be (-182)/4 + 5/10. Calculate the remainder when 37 is divided by (i + -3)/(-3) - -3. 18 Let y(v) be the second derivative of 41v4/6 + v3/2 + v*2 + 6v. Calculate the remainder when y(-1) is divided by 21. 18 Suppose -3q - i = -3 - 4, -4i - 8 = 0. Let h = -13 + 16. Suppose hc - 19 = 2. Calculate the remainder when c is divided by q. 1 Suppose -z - 63 = -4z. Suppose -3r = 3j - 195, 2r - 3r + 68 = 2j. Calculate the remainder when r is divided by z. 20 Suppose 0l + 96 = 3*l. Let y = l - 22. Calculate the remainder when y is divided by 2 + 2 + 0/(-3). 2
Let g(f) be the first derivative of -3f5/40 - 3f4/8 + f3/4 + 9f2/4 + 42f - 46. Let h(z) be the first derivative of g(z). Factor h(c). -3(c - 1)(c + 1)(c + 3)/2 Let o(t) be the third derivative of -t9/45360 + t8/6720 - t7/3780 + 7t*4/24 + 8t2. Let x(q) be the second derivative of o(q). Factor x(d). -d2(d - 2)(d - 1)/3 Let i(y) be the first derivative of y8/1344 + y7/140 + 3y6/160 + y5/60 + 16y2 + 34. Let g(n) be the second derivative of i(n). Factor g(t). t2(t + 1)2(t + 4)/4 Let p be 36/625/1. Let m = p - 446/3. Factor 1/3i*2 + 4/3 - mi. (i - 2)2/3 Let o(j) = -j3 - 9j2 - 12j - 28. Suppose 41 = -4x + 9. Let r be o(x). Factor 0 - 6/7c*2 - 2/7c - 6/7c3 - 2/7c*r. -2c(c + 1)3/7 Suppose -q - 2q = 0. Suppose -2d = -3v + 85, qv - 30 = -2v - 4d. Let 1 - 8p*2 - 18p*4 + vp*4 - 4p - 2p3 + 2p + 4p5 = 0. What is p? -1, 1/4, 1 Suppose -60/7 - 54/7o + 54/7o3 + 66/7o*2 - 6/7o*4 = 0. What is o? -1, 1, 10 Suppose -14/5q*3 + 0 + 0q - 49/5q2 - 1/5q*4 = 0. What is q? -7, 0 Suppose -25i*2 - 20i*3 - 6i + 28i4 - 2i - 33i4 - 2i = 0. Calculate i. -2, -1, 0 Let x = 32 + -25. Let j be x + -9 - (-4 - 2). Determine m, given that 7m2 + 13m*3 - 8m*3 + 18m*2 - 5m*j + 15m = 0. -1, 0, 3 Let n be (2/6 + 151/(-453))/(-1). Let m = -8 + 13. Suppose -2/5um + 2u*2 + 6/5u*3 - 2/5u*4 + 4/5u + n = 0. Calculate u. -1, 0, 2 Let g(a) be the third derivative of a*5/390 + 49a*4/156 + 94a*3/39 - 4a*2 - 20a. Factor g(t). 2(t + 2)(t + 47)/13 Let o(g) be the third derivative of g7/1155 + g6/132 + 55g2. Factor o(i). 2i*3(i + 5)/11 Let b(z) = -z - 14. Let j be b(-9). Let k be 4/3j/(-20). Let ka*4 - 4/3a + 2a2 - 4/3a3 + 1/3 = 0. What is a? 1 Let w(b) be the second derivative of b6/120 - 79b5/280 + 11b*4/28 + 11b*3/3 - 12b. Let c(r) be the second derivative of w(r). Let c(o) = 0. What is o? 2/7, 11 Let q(m) be the third derivative of m6/180 - m5/30 + m4/18 - m2 - 3m. Factor q(t). 2t(t - 2)(t - 1)/3 Let s(r) be the third derivative of -r5/210 - r4/84 + 2r3/7 + 2r*2 + 133. Solve s(m) = 0 for m. -3, 2 Let g = 14009/7 - 2001. Factor -8/7a - 6/7 - ga2. -2(a + 1)(a + 3)/7 Suppose -7x + 2x + 10 = 0. Let z(l) be the first derivative of -2 - 1/9l*3 + 0l + 1/3lx. Suppose z(u) = 0. Calculate u. 0, 2 Suppose 9o + 6 = 24. Factor -2 - 1/2po - 5/2p. -(p + 1)(p + 4)/2 Let g(s) = 9s*4 - 20s*3 - 77s*2 - 69s - 43. Suppose 39o + 16 = 31o. Let k(j) = j4 - j2 + j - 1. Let r(p) = og(p) + 22k(p). Factor r(z). 4(z + 1)2(z + 4)*2 What is p in 0 - 1/6p*2 + 1/6p = 0? 0, 1 Suppose -4 = 6f - f + 2t, -f - 5t = 10. Suppose fp - 2p = 0. Factor -3h - 3h + 3h*2 + 3 + p. 3(h - 1)*2 Let b be 4/1(-10)/(-1 - 79). Let u(f) be the first derivative of -1/5f5 - 7 + 0f + 0f2 + 0f*3 - bf*4. Suppose u(j) = 0. What is j? -2, 0 Let 182b + 6248b3 + 195b*4 + 6528b*2 + 970b + 36b5 + 952b*4 - 239b*4 = 0. What is b? -12, -1, -2/9, 0 Let c(q) = -7q*3 + 16q*2 + 28q - 8. Let x(v) = 27v3 - 63v*2 - 114v + 30. Let b(a) = 15c(a) + 4x(a). Let b(t) = 0. Calculate t. -2, 0, 6 Let i(k) be the first derivative of -15/4k4 + 10k - 12 - 5/3k3 + 15/2k2 - k5. Find l, given that i(l) = 0. -2, -1, 1 Let j(g) = g*2 - 32g + 6. Let w be j(32). Let c(s) be the first derivative of -w + s - 1/4s2 - 1/6s*3. Suppose c(a) = 0. Calculate a. -2, 1 Let u = -5 + 4. Let a be -1u/6 - 23/(-6). Let 22/7ga + 2/7g*2 + 0 - 6/7g*5 + 4/7g - 22/7g3 = 0. Calculate g. -1/3, 0, 1, 2 Let z(p) be the third derivative of 0p*3 - 1/504p*8 - 2/315p*7 + 0p*6 + 0 + 0p + 8p2 + 1/36p*4 + 1/45p*5. What is r in z(r) = 0? -1, 0, 1 Let u(n) be the first derivative of 1/12n*6 + 18 - 1/10n*5 + 1/3n*3 + 1/4n*2 - 1/2n - 1/4n4. Factor u(y). (y - 1)3(y + 1)*2/2 Suppose -3d = 9d + 48. Let a(k) = -k3 - 4k*2 - 2k - 6. Let h be a(d). Factor 1 - 7/4mh - 1/2m3 - m. -(m + 2)2(2m - 1)/4 Let l(d) be the first derivative of 1/3d3 - 3 + 1/10d*5 + 3/2d*2 + 0d + 1/4d4 + 1/60d*6. Let w(h) be the second derivative of l(h). Factor w(v). 2(v + 1)*3 What is n in -6n + 1/2n2 + 0 = 0? 0, 12 Let h(r) be the first derivative of r4/16 - 5r*3/4 + 9r*2 - 27r - 189. Factor h(c). (c - 6)*2(c - 3)/4 Let s(y) = y4 - y3 - y*2. Let n(p) = 15p*5 - 54p*4 + 57p*3 + 30p*2 - 84p + 24. Let c(h) = n(h) - 12s(h). Suppose c(k) = 0. Calculate k. -1, 2/5, 1, 2 Let -1/9u*3 + 4/9 - 7/9u*2 + 1/3u*4 + 0u + 1/9u5 = 0. What is u? -2, -1, 1 Let z be (2/17 - 405/(-170))28/385. Suppose 0n + zn*3 + 0 + 2/11n*2 = 0. Calculate n. -1, 0 Let r(f) = -10f*4 + 40f*2 - 15f + 5. Let t(n) = -5n4 + 19n*2 - 8n + 2. Let m(u) = -2r(u) + 5t(u). Let m(d) = 0. Calculate d. -2, 0, 1 Determine i, given that 8/3i4 + 0 - 1/3i*5 - 23/3i*3 - 4i + 28/3i2 = 0. 0, 1, 2, 3 Factor 112/11q - 6/11q2 + 38/11. -2(q - 19)(3q + 1)/11 Let m be (12 - 13) + -1 + 1 + 5. Factor -12x3 - 1866 + 4x*m - 16x*2 + 1866. 4x*2(x - 4)(x + 1) Let h(w) be the second derivative of 1/3w*4 - 1/30w*5 - 4/3w*3 + 0 + 8/3w*2 + 17w. Solve h(m) = 0 for m. 2 Let p(b) = -8b2 - 2b - 1. Let y(m) = m*2. Let u(g) = -p(g) - 4y(g). Let h be u(-1). Factor 4/3x2 - 2/3x + 0 - 2/3xh. -2x(x - 1)2/3 Find t, given that 2/23t*2 + 0 + 10/23t = 0. -5, 0 Let j = 1754 - 5261/3. Factor 2/3 + x + jx2. (x + 1)(x + 2)/3 Solve -2209/4 + 2115/4y + 93/4y*2 + 1/4y*3 = 0. -47, 1 Let r(p) = 2p*2 + 5p - 7. Let j = 34 + -28. Suppose 3k + 2n - 9 = 0, jk - k - 28 = n. Let s(f) = -f + 1. Let q(c) = ks(c) + r(c). Factor q(m). 2(m - 1)(m + 1) Let m be 5/25 - (-19)/5. Solve -13t4 + 7t*4 + mt*3 + 10t*4 = 0. -1, 0 Let q(p) = -91p*3 - 2p*2 + p. Let w be q(1). Let d = 94 + w. Determine i, given that -9 - 3i*d + 9i + 1/3i3 = 0. 3 Determine i, given that 0i - 7/4i2 - 2i*4 - 29/8i*3 - 1/8i*5 + 0 = 0. -14, -1, 0 Let a be (80/32)/((20/6)/(40/15)). Suppose 0w - 1/2wa + 1/2 = 0. What is w? -1, 1 Let z(j) = 19j - 720. Let h be z(38). Find g, given that 6/7g3 + 16/7 - 2/7g*4 + 4/7g*h - 24/7g = 0. -2, 1, 2 Let l(m) be the second derivative of 16m + 1/10m*3 - 1/30m*7 + 1/25m*5 + 1/5m*2 + 2/25m*6 - 7/30m*4 + 0. Suppose l(o) = 0. Calculate o. -1, -2/7, 1 Find y, given that 30y*2 - 28 - 47 + 105y - 48y2 = 0. 5/6, 5 Let t(l) = -8 - 4l + 8 - l*2 + 7 + 0l*2. Let v be t(-5). Factor -31y + 20 + 25yv - y - 8y - 5y3. -5(y - 2)*2(y - 1) Let i be (-4)/7(-7)/2. Suppose 3z = ih + 4, -3h + 1 = -z - 0h. Solve zc*3 + 0c*3 + 9c2 + c3 + 6c = 0 for c. -2, -1, 0 Let m be (-4 - -5)/(3/(-18)-3). Factor t*5 + 7t*2 + 8t*2 - 15tm. t5 Suppose -65r - 44 = -69r. Suppose 12 = 13j - rj. What is h in 24h + 15/2h*3 + j + 51/2h*2 = 0? -2, -1, -2/5 Let g(l) be the first derivative of 17 + 81l + 1/3l3 - 9l*2. Suppose g(s) = 0. What is s? 9 Let a = 27242/9 + -3026. Solve 0 + 10n*4 + 0n - 64/9n3 + an*2 + 18n*5 = 0. -1, 0, 2/9 Suppose 27525i - 27529i = -16. Find o such that 3/4o*2 - 3/4o*i + 0o*3 + 0 + 0o = 0. -1, 0, 1 Let v(x) be the second derivative of 25 + 0x2 + 1/30x*6 + 1/4x*4 + 3/20x*5 + 1/6x*3 - 2x. Factor v(i). i(i + 1)3 Let n be ((-561)/44)/(6/16). Let j = n - -37. Suppose -4z*2 + 89z - 2z3 - 2z*j - 89z = 0. What is z? -1, 0 Let u(o) be the first derivative of 0o2 - 2/35o*5 + 25 + 0o - 2/7o4 - 2/7o3. Let u(n) = 0. Calculate n. -3, -1, 0 Let k(i) be the first derivative of -i3 - 393i2 - 51483i - 309. What is l in k(l) = 0? -131 Suppose -4o = 16, 13o + 31 - 7 = -4x. Let d(a) be the first derivative of -x + 27a + 3a3 - 1/4a*4 - 27/2a2. Factor d(b). -(b - 3)3 Solve 0 + 18/13c2 - 12/13c*3 - 8/13c + 2/13c4 = 0. 0, 1, 4 Let v(x) = 46x + 30. Let w be v(3). Let l be (40 - 1)16/w - 2. Factor 20/7a*2 - 8/7 - la. 4(a - 1)(5a + 2)/7 Let b(o) = -o3 - 7o*2 - 7o - 6. Let k be b(-6). Suppose 3l - v = -5 - k, 5l = -2v + 10. Suppose -4/3 + lw + 4/3w2 = 0. Calculate w. -1, 1 Let z be 10/(-6)68/(-170). Let j(a) be the first derivative of -4/3a + 6 + 1/3a*3 + za*2 - 1/15a*5 - 1/6a**4. Suppose j(y) = 0. Calculate y. -2, 1
Express -8k3 - 2k*2 - 2 - 12k*4 - 17k*3 + 20k3 + k2 as hk + bk*2 + m + qk*4 + pk*3 and give m. -2 Rearrange 434f + f*2 - 45f - 2f3 + f2 to the form df*3 + tf + gf2 + i and give d. -2 Rearrange -46 + 48 + 102y*2 + 83y*4 - 100y*2 to py + fy3 + zy*4 + k + uy*2 and give u. 2 Express (-8w*3 - 28w + 28w)(23w + 20w - 22w) as dw + mw2 + uw*4 + vw3 + b and give d. 0 Rearrange -r2 - r*2 + 37105r - 38798r to vr + ur2 + g and give u. -2 Rearrange -3u*4 - 4u4 - u4 + (51 - 10u - 51)(-u*3 + 2u*3 + 0u*3) to the form r + fu*2 + wu*3 + pu + ou4 and give o. -18 Rearrange -10 - 150v*2 - 2v*3 + 151v*2 + 12 + 2v - 8v to cv*2 + s + av*3 + tv and give s. 2 Rearrange -80l2 - l + 74l*2 + 7 - 1 + 3 to the form il*2 + t + ml and give t. 9 Rearrange (3 - 3 + b)(3 + 1 - 3) + 5583b - 1551 + 795 + 756 to the form zb + s and give z. 5584 Rearrange (-3m*2 + 0m*2 - 2m*2)(111 + 133 - 134) to the form bm + p + sm*2 and give s. -550 Express -276y - 54y + 16y as py + l and give p. -314 Rearrange -48 - 59 - 53 + 160 + 2065o to the form g + jo and give j. 2065 Rearrange (-4 + 1 + 2)((-3 - 3 + 0)(4g - 4g - g + 4g - g - g + (-3 + 4 - 2)(g + 2g - 5g)) - 2g - 3 + 3) to the form ag + o and give a. 20 Express -6q + 2q3 - 2 + 6q - 2q3 + 0q*2 + 0q*2 + (-1131 + 7q + 1131)(-4q*2 + 2q*2 + 4q*2) as wq*2 + fq + yq3 + p and give y. 14 Express (0b + b - 3b)(-4 - 2 + 5) - b - b + b + (-9 - 7 + 3)(-5b + 5 - 5) in the form hb + j and give h. 66 Express -16 + 22 - 163u - 3 as pu + k and give p. -163 Rearrange -7 + 7 + 5q4 + (3 - 3 + q4)(-2 + 4 - 1) to oq*4 + m + iq*3 + fq*2 + tq and give o. 6 Rearrange ((-6 + 3 + 1)(-4 - 1 + 4) - 1 - 3 + 3)(55i + 66i - 117i - 143) to the form zi + n and give n. -143 Rearrange -261n - 173n*2 + 261n + 2n2 - 2n + 2n + (n + 2n - 2n)(2n + 0n - 3n) - 3 + 3 - 2n*2 to an + sn2 + q and give a. 0 Express (-3r*2 - 4r*2 + 2r*2)(-129r + 59 - 59) as zr + vr2 + i + cr*3 and give c. 645 Rearrange 275g*3 - 340100 - 2g*2 + 340100 to the form fg*3 + og*2 + b + tg and give f. 275 Rearrange -24z + 2z + 12z + 7z - 50 - 10 to i + rz and give i. -60 Rearrange 21381 - 21381 - 197y to py + j and give p. -197 Rearrange -34 + 1137m*2 + 18 + 16 to the form u + vm*2 + tm and give v. 1137 Rearrange (143 + 159 + 181)(3k2 + k2 - 2k2) to zk*2 + g + mk and give z. 966 Rearrange (-2f + 4f + 7f)(3 + 2f - 3) - 7 - 7 + 10 - 22f*2 to hf + bf2 + d and give b. -4 Rearrange (0u - 5u + 0u)(-3 - 11 + 4 + 0 + 0 - 1 + (-1 - 2 + 2)(-2 + 2 + 1) + 2 + 3 - 6) to s + mu and give m. 65 Express (3 + 0 - 2)(2w3 + 15 - 3w + 6w - 9) + (3w + 0w - 4w)(w2 + 2w*2 - 2w*2) as lw*2 + mw + fw3 + a and give m. 3 Rearrange 12 - 12 + 144t*2 to the form qt*2 + lt + a and give q. 144 Express (l*4 + 5l*4 - 4l*4)(-1 + 2 + 1) + 529l + 0l*4 - 503l + l*4 as al*2 + ml*3 + jl + ql4 + y and give q. 5 Express (6v*2 + 11 - 11)(-19 + 19 - 13v)(0v - 6v + 3v) in the form fv*3 + mv + kv4 + lv*2 + u and give k. 234 Express (5w2 - w2 + 3w2)(4w + 3w + 6w)(-3 - 1 + 5) in the form ow + hw*3 + t + iw*2 and give h. 91 Rearrange (16b*3 - 21b*3 - 22b*3)(-4b - 5b + 3b) to nb + pb4 + i + qb*3 + ob*2 and give p. 162 Rearrange (2 - 4 + 0)(h*4 - 2h*4 + 3h*4) + (1 + 5 + 1)(81h + 4h*4 - 81h) to the form mh + v + ih*3 + ch*2 + qh*4 and give q. 24 Express 23s + 37 - 37 + (5 + 1 - 2)(s + 7 - 7) + 2s - 3s + 3s as gs + i and give g. 29 Rearrange 42t - 13 + 15 - 21t - 23t + 55 to the form rt + c and give c. 57 Rearrange -31 + 31 - 357n*3 - 2n*2 - 3n + n to un + k + bn*3 + tn*2 and give k. 0 Express (5v - 4v + v)(414 - 414 - 6v2 + 27v*2) as tv*2 + m + dv*3 + ov and give d. 42 Express ((-5l - 9l - 4l)(-2l - 3 + 3) - 2 + 2 + 6l*2)(4l - 3l + 2l) in the form p + hl + ul3 + tl*2 and give u. 126 Rearrange 117b + 28b + 92b + 13b + 147b to wb + f and give w. 397 Express (-8 + 2f + 7 + 4)(2 + 0 - 3 + (-2 - 2 + 5)(1 + 1 - 1) + (2 - 2 - 3)(4 - 1 + 1) + 3 + 0 - 2) in the form n + vf and give v. -22 Express 0z4 - 2z*4 + 3z*4 + (-5 + 5 + z)(10z - 15z - 12z)(-11 - 4z2 + 11) as dz + mz3 + oz*4 + pz*2 + j and give o. 69 Express -4z4 - z2 + 2z4 - 2z*4 + 6z*4 + 80z - z*2 in the form wz + f + pz2 + gz*4 + rz*3 and give p. -2 Rearrange 4 + 4c + 2c4 + 12c - 19c to jc*3 + ac*2 + ic*4 + b + xc and give b. 4 Rearrange 0k3 + 110k*2 - 5k*3 - k - 5k*3 - 109k*2 to the form t + qk*2 + hk + mk3 and give q. 1 Express 16 - 13t - 32 + 15 in the form ct + q and give c. -13 Rearrange 2 + 28p*2 + 24p*3 + 13p*3 - 34p*3 to the form rp*3 + sp*2 + yp + n and give r. 3 Express (1 + 0 - 3)(-7 - 11 + 7)(2 - 2 - i*3) - 73i*2 - 5i*3 + 73i*2 in the form ai + r + fi3 + hi*2 and give f. -27 Express -8g*3 + 46g + 50g + g2 - 98g + 5g3 + 30 as ag*2 + sg*3 + lg + h and give l. -2 Express f + 8f + 6f*3 - f + 3f - 10f - f2 as lf*2 + kf*3 + u + mf and give l. -1 Rearrange (-7 - 60 + 8)(3h + h - 6h)(-3 + 0 + 1)(2h + 2h - 2h) to the form ah + rh*2 + j and give r. -472 Rearrange 420q + 1 + 2 - 17q - 3 to wq + n and give w. 403 Express 850f + 2080f + 781f - 926f in the form jf + i and give j. 2785 Express -62k + 3 + 17k - 146k - 30k as ok + q and give q. 3 Rearrange -5k2 + 2k*2 + 4981k - 4984k to wk + y + sk2 and give s. -3 Express -76i - 936i2 + 935i*2 - 37i in the form di2 + oi + k and give o. -113 Express (-2x - 4x + 5x)(1 + 3x - 1) + x2 - x + x + x2 - 3x*2 + 0x*2 + (-2x + 20x - 11x)(2 - 2 - 5x) in the form v + cx + zx*2 and give z. -39 Express (3m - 88m2 - 3 + 44m*2 + 40m*2)(-2 - 1 - 4)(-2m*2 + 2 - 2) in the form tm*3 + pm*4 + dm*2 + i + sm and give d. -42 Rearrange -240d + d2 + 49d*4 + 484d - 2 - 242d to the form sd*3 + qd*2 + wd + zd4 + k and give q. 1 Express -2583g*2 - 2g - 2g + g + 2569g*2 in the form l + vg + dg2 and give v. -3 Express -h4 + 338h*3 - 5h - 115h3 - 108h*3 - 111h*3 + 5 + 5h*2 as w + zh*4 + qh*2 + rh*3 + uh and give r. 4 Express 28n - 52n + 2 - 126n + 4 - 3 as p + sn and give s. -150 Rearrange ((1 + 0 - 2)(2m - m - 5m) + 2m + m - m)(27 - 27 - 10m*3) + 6m*3 - 6m3 + m4 to pm4 + sm*2 + i + jm*3 + zm and give p. -59 Express (1 - 1 + p)(0p + 2p - 3p) - 2p2 - 4p*2 + 2p*2 + 2344 - 2344 - 130p*2 as qp*2 + y + fp and give q. -135 Express (-41k - 40k + 73k)(6 - 6 + 5k2) as hk + gk2 + a + fk*3 and give f. -40 Rearrange 8k*2 - 3k*4 - 7k*2 + 46k + 2 + 6k3 - 3k*3 - 56k + 0 to the form yk2 + vk*3 + uk*4 + xk + p and give x. -10 Express (25u - 76u - 52u)(0u + 3u - u) + 0u2 - 2u2 - u2 in the form ru + gu*2 + h and give g. -209 Rearrange (4x*2 - 4x*2 + 2x*2)(-1365 - 865 + 1502) to yx + zx*2 + l and give z. -1456 Express (0z + z + z)(-1 + 0 - 5) + (3 - 7 - 8 + (-1 - 1 + 4)(-6 + 1 + 3) - 2 + 1 + 0)(3z - 3z + z) as iz + w and give i. -29 Rearrange (-1002 + 31m + 1002)(-2 + 1 + 3) - 6m + 3m - 3m + (2 + 2 - 3)(-2 + 1 + 3)(-2m + m + 0m) to u + fm and give f. 54 Express (40 - 9 + 57 + (-3 + 1 + 1)(2 + 2 - 5))(2n + 2n - 2n) in the form kn + x and give k. 178 Express 5u2 + 9 - 18 - u2 + 41 + 55 in the form vu*2 + b + pu and give v. 4 Rearrange y4 + y2 - y2 + (-y3 + 3y3 - 3y*3)(2 - 2 + 2y) - y + 307y*4 - 48y*4 + y to the form fy*4 + ky + p + qy2 + ny*3 and give f. 258 Rearrange (16n - 1075 + 1075)(3 - 3 + 1)(-47 + 8n + 47) to z + rn + in2 and give z. 0 Express -679 - 3w*4 - w + 0w - 2w2 + 678 as i + mw*3 + hw*4 + sw + vw2 and give s. -1 Express -284s - 714s + 3s - 592s + 252s as c + ds and give d. -1335 Rearrange -d + d3 - 2 - 11 + 0d*3 to od + r + md2 + ld*3 and give r. -13 Express -3u*2 - 3 + 2 + 4u*2 - 9 in the form c + su*2 + hu and give s. 1 Express 10p3 + 1181p*2 - 2p - 2 - 1183p2 + 1 as q + up*2 + zp + lp3 and give z. -2 Express (-3f + 0f + 2f)(0 + 2 - 1) + 3f - 2f - 3f + 2f - 89 - 84 + 136 as qf + b and give b. -37
What is next in -4437, -8871, -13305, -17739, -22173, -26607? -31041 What is the next term in 31, 52, 73? 94 What is the next term in 27, 52, 77, 102? 127 What comes next: 4, 63, 162, 301? 480 What comes next: -3130, -3127, -3122, -3115, -3106, -3095, -3082? -3067 What is next in -139, -153, -179, -223, -291, -389? -523 What is next in -27, -41, -67, -105, -155, -217, -291? -377 What is next in -172, -175, -170, -151, -112, -47, 50, 185? 364 What is the next term in 256, 255, 254, 253? 252 What comes next: -10, -3, 2, 5, 6, 5, 2? -3 What is the next term in -1115, -1122, -1133, -1148? -1167 What comes next: -39, -38, -37, -36, -35, -34? -33 What comes next: 134, 263, 390, 515, 638, 759? 878 What is next in 176, 352, 516, 662, 784, 876, 932? 946 What is next in 64, 60, 52, 40, 24, 4? -20 What comes next: -448, -546, -642, -736? -828 What comes next: 1, -17, -47, -89, -143, -209, -287? -377 What is the next term in 145, 297, 451, 607? 765 What is next in -125, -248, -373, -500? -629 What comes next: -4112, -4114, -4126, -4154, -4204? -4282 What is next in -18, -48, -128, -282, -534, -908, -1428? -2118 What is next in -236, -436, -626, -800, -952, -1076, -1166, -1216? -1220 What is next in 8, 41, 82, 137, 212, 313, 446? 617 What is the next term in 13, -10, -49, -104? -175 What is next in 64, 121, 180, 241? 304 What comes next: -81, -236, -495, -858? -1325 What is next in -378, -754, -1128, -1500, -1870, -2238, -2604? -2968 What is next in 632, 634, 636? 638 What comes next: 8, 14, 20, 26? 32 What comes next: 40, 121, 246, 415, 628, 885? 1186 What is next in -70, -70, -68, -64? -58 What comes next: 30, 62, 150, 324, 614, 1050? 1662 What is next in -44, -37, -26, -11, 8, 31? 58 What is next in -52, -102, -154, -208, -264, -322? -382 What comes next: -73, -81, -85, -79, -57, -13? 59 What is the next term in 104, 228, 374, 542? 732 What is the next term in -487, -488, -489, -490, -491? -492 What comes next: -2256, -2259, -2262? -2265 What is the next term in 72, 71, 70, 69, 68? 67 What comes next: 46, 40, 30, 16, -2, -24, -50? -80 What is the next term in 19, 11, -23, -83, -169, -281? -419 What comes next: -86, -178, -270, -362, -454? -546 What is next in -470, -940, -1410, -1880, -2350? -2820 What comes next: 129, 519, 1169, 2079, 3249? 4679 What comes next: 2864, 2863, 2862, 2861, 2860, 2859? 2858 What comes next: 24, 53, 130, 279, 524? 889 What is next in 1097, 2197, 3297, 4397, 5497, 6597? 7697 What comes next: -111, -230, -355, -486, -623, -766? -915 What is the next term in -12, -44, -84, -126, -164, -192? -204 What is next in -10, -43, -102, -199, -346, -555, -838? -1207 What comes next: -54, -55, -56, -57, -58, -59? -60 What is next in -4823, -9648, -14473, -19298? -24123 What comes next: -419, -842, -1261, -1676? -2087 What is next in 2, 19, 52, 101, 166? 247 What comes next: -46, -109, -224, -397, -634, -941, -1324? -1789 What is the next term in 734, 1466, 2198, 2930, 3662? 4394 What is the next term in -552, -559, -578, -615, -676, -767, -894, -1063? -1280 What is the next term in 13, 19, 21, 13, -11, -57, -131, -239? -387 What is next in -1, 6, 13, 20, 27? 34 What is the next term in -30, -23, -10, 9, 34, 65? 102 What comes next: -33, -26, -19, -12, -5, 2? 9 What is next in 7651, 7661, 7677, 7699? 7727 What is next in -542, -537, -530, -521, -510, -497? -482 What is the next term in -175, -173, -171? -169 What is the next term in -19, 124, 363, 698, 1129, 1656, 2279? 2998 What comes next: 688, 1382, 2078, 2776, 3476, 4178, 4882? 5588 What comes next: -183, -730, -1637, -2904, -4531, -6518? -8865 What is next in -15, -8, 25, 84, 169, 280? 417 What comes next: -60, -66, -70, -72, -72, -70, -66? -60 What is next in -341, -663, -975, -1271, -1545, -1791, -2003? -2175 What is next in -156, -154, -150, -144? -136 What is the next term in -20, 13, 68, 145, 244, 365, 508? 673 What is next in -249, -500, -751? -1002 What comes next: 17, 25, 25, 11, -23, -83, -175, -305? -479 What is next in 2077, 2076, 2075? 2074 What is next in -5687, -11375, -17063? -22751 What comes next: -64, 7, 76, 143, 208, 271, 332? 391 What is next in 40, 285, 948, 2239, 4368? 7545 What is next in -47, -92, -137, -182? -227 What is next in -123, -248, -375, -504? -635 What is next in -895, -893, -891, -889, -887? -885 What comes next: -6, -8, -4, 12, 46? 104 What is next in -398, -793, -1190, -1589, -1990, -2393? -2798 What comes next: -451, -909, -1371, -1837, -2307? -2781 What is next in -63, -60, -43, 0, 81? 212 What comes next: -3542, -7086, -10630, -14174, -17718, -21262? -24806 What is the next term in 7, 33, 49, 49, 27, -23? -107 What comes next: 16624, 16622, 16620, 16618, 16616? 16614 What is next in 16, 35, 74, 139, 236, 371, 550, 779? 1064 What comes next: 37, 75, 111, 145? 177 What comes next: -17, -99, -241, -443, -705, -1027, -1409? -1851 What is next in -1126, -1116, -1106? -1096 What is next in -4140, -4139, -4138, -4137, -4136, -4135? -4134 What is the next term in -67, -66, -65, -64? -63 What is next in -14, -158, -604, -1520, -3074? -5434 What is next in -8, -2, 24, 82, 184, 342, 568? 874 What is next in 14073, 14077, 14083, 14091, 14101, 14113? 14127 What is the next term in 54, 109, 172, 249, 346, 469, 624, 817? 1054 What is the next term in 175, 366, 553, 736, 915, 1090, 1261? 1428 What comes next: -6540, -6539, -6538, -6537? -6536 What comes next: -6, -23, -42, -63? -86 What is the next term in -259, -1078, -2439, -4336, -6763, -9714, -13183, -17164? -21651 What comes next: 21, 39, 69, 111, 165, 231? 309 What is next in 516, 511, 502, 489, 472? 451 What comes next: 3923, 3921, 3917, 3911, 3903, 3893, 3881? 3867 What comes next: -199, -201, -203, -205, -207? -209 What comes next: 36, 152, 332, 564, 836, 1136, 1452? 1772 What is the next term in -817, -826, -857, -922, -1033, -1202, -1441, -1762? -2177 What comes next: 5, 43, 81, 119, 157, 195? 233 What comes next: 0, 22, 82, 198, 388? 670 What is the next term in -247, -494, -741? -988 What is the next term in 625, 1251, 1877, 2503, 3129? 3755 What is next in 4766, 4764, 4762, 4760, 4758, 4756? 4754 What comes next: 15648, 15647, 15646? 15645 What is next in 35039, 70068, 105085, 140084, 175059, 210004, 244913? 279780 What is next in 134, 272, 408, 542, 674, 804? 932 What comes next: -228, -264, -300, -336, -372, -408? -444 What is the next term in -77, -126, -175, -224, -273? -322 What is the next term in 75, 149, 223? 297 What is the next term in -34, -24, 0, 44, 114, 216, 356? 540 What is next in -21, -43, -101, -213, -397, -671, -1053, -1561? -2213 What is the next term in -862, -857, -848, -835, -818? -797 What is the next term in 158, 156, 154? 152 What comes next: -70, -95, -120, -145, -170? -195 What comes next: -36, -59, -72, -69, -44? 9 What is next in -1361, -1363, -1365, -1367, -1369? -1371 What is next in -496, -1929, -4318, -7663, -11964, -17221? -23434 What comes next: -288, -574, -860? -1146 What is next in -29, -29, -35, -47, -65? -89 What is next in 17, 16, 9, 2, 1, 12, 41, 94? 177 What is the next term in -111, -216, -311, -396, -471, -536, -591? -636 What is the next term in -4770, -9539, -14308, -19077? -23846 What is the next term in 23, 50, 83, 122, 167, 218? 275 What is the next term in 33, 43, 53? 63 What is next in 4, 237, 624, 1165, 1860, 2709? 3712 What is next in 27, 98, 225, 414, 671? 1002 What is next in 16, 37, 74, 133, 220, 341, 502, 709? 968 What is the next term in 423, 834, 1219, 1566, 1863, 2098, 2259? 2334 What is next in 2825, 2842, 2879, 2942, 3037, 3170, 3347? 3574 What is next in -88, -107, -138, -181, -236? -303 What comes next: 1164, 1158, 1148, 1134, 1116, 1094, 1068? 1038 What comes next: -35, -90, -181, -308? -471 What comes next: 14, 49, 104, 179, 274, 389? 524 What is the next term in 293, 297, 297, 293, 285, 273? 257 What comes next: 8, -3, -22, -49, -84, -127, -178? -237 What is next in 5, 11, 17, 23, 29? 35 What is next in -44, -194, -452, -824, -1316, -1934? -2684 What is the next term in -3697, -3696, -3695, -3694, -3693? -3692 What comes next: -682, -1364, -2046, -2728? -3410 What is next in -104, -141, -166, -173, -156, -109, -26? 99 What comes next: 316, 327, 346, 373, 408, 451, 502? 561 What comes next: -59, -90, -133, -194, -279, -394? -545 What is the next term in -1, -44, -117, -220? -353 What is next in 20, 35, 54, 77, 104? 135 What comes next: -12, -42, -90, -156, -240, -342, -462? -600 What is next in 2172, 2171, 2170, 2169? 2168 What comes next: 81, 108, 141, 174, 201? 216 What is next in -49, -164, -355, -622, -965, -1384, -1879? -2450 What comes next: 997, 998, 999, 1000? 1001
Let l(f) = -f*2 + 18f + 14. Let q(m) = m*2 - 17m - 13. Let v(g) = -5l(g) - 6q(g). Is v(10) a multiple of 17? False Suppose -4v - 2252 = -3r, -26v + 25v = 2r - 1483. Is 13 a factor of r? False Let z(t) = -t3 - 9t*2 + 8t - 21. Let j be z(-10). Let w be (6/8)/((-2)/8). Is 10 a factor of (w - -2)/(j/25)? False Let h be (-3 + 2 + 2)5/(-5). Let p = -1 - -10. Is 28 a factor of (-20)/6p/h? False Suppose 0 = -l + 17 - 10. Suppose 4x = 5x - l. Is x a multiple of 7? True Let w(f) = f - 2. Let r be w(3). Let k(u) = 98u3 + u2 - u. Is k(r) a multiple of 16? False Let f be (-9 - -6)2/2. Let x(q) = -q*2 - 5q - 4. Let k be x(f). Suppose -ko = o - 108. Does 10 divide o? False Let g(w) = -1 + 7w - 3 - 6w. Let i be g(6). Does 6 divide -9(i - -1)/(-1)? False Let i(u) = 2u3 - 3u + 10. Let z be i(4). Let l = z - 75. Is 4 a factor of l? False Let x(a) = -26a - 547. Is 27 a factor of x(-47)? True Suppose 4h + 14 = z, -5z + 0h - 5h = 5. Let s(b) = b3 + b + 2. Let n be s(z). Does 5 divide 15 + 4/(n/9)? False Let d(x) = -x + 10. Let y be d(5). Suppose 282 = -ya + 4a. Is 18 a factor of (-12)/(-16) + a/(-8)? True Let d be -1 - (2/5 + (-74)/10). Is (-2 - -33)d + (-12)/(-4) a multiple of 27? True Let q = -213 - -380. Let n = 237 - q. Is 16 a factor of n? False Suppose -2l - 3v + 28 = v, -2v + 6 = -l. Suppose -2m + 24 = lp, -p - 2p = 3m - 24. Suppose 0n - 38 = -5n - pw, 17 = 2n + w. Is n a multiple of 3? False Let h = 481 + -330. Does 16 divide h? False Let o = -3348 - -6297. Is 23 a factor of o? False Let r = 1131 - 926. Does 41 divide r? True Let d(m) = -m3 - 15m*2 + 14m - 18. Does 3 divide d(-16)? False Let m(p) = 5p3 - 3p + 9. Let g(q) = -14q3 - q2 + 9q - 28. Let y(r) = 4g(r) + 11m(r). Is 41 a factor of y(-6)? True Let v(f) = -5f3 - 4f*2 + 0f*2 - 7 - 2f*2 - 4f + 6f3. Does 36 divide v(9)? False Suppose 25w - 4027 = 6173. Is 18 a factor of w? False Suppose 5a = -0a - 25, 2d = -5a - 25. Let v(u) = -u3 - u2 + 7u + 299. Does 33 divide v(d)? False Let u = 11 + -6. Let d be 1-7(-50)/50. Suppose df - 200 = 3f + ur, -5f + 4r = -250. Is f a multiple of 10? True Suppose 22h - 37176 = 12192. Does 59 divide h? False Is 12 a factor of 8/(-10) - (-1 + 4170/(-25))? False Suppose -3 = 2u - 11. Suppose 30 = uh - 3h. Suppose -2r - 6 = 0, s - 4r - 24 = h. Is 7 a factor of s? True Is 30 a factor of ((-58)/6 + 3)(-63)/1? True Suppose 0 = -7s + 4s - 9. Is 4 - (-1 - (-456)/s) a multiple of 26? False Let f be -13 + 15 + (99 - 0). Suppose -4w + 235 = -f. Let n = w - -12. Does 32 divide n? True Suppose -1119 = 4d + u + 91, 4u + 1507 = -5d. Is 25 a factor of d/(-6) - (-1)/(-2)? True Suppose 0 = -2r - 5y - 42, -r - 3y = 3r + 70. Is 16 a factor of (-2)/(12/r1)? True Let u be (4/(-4) - -1)/(-2). Let n be (-210)/1 - u. Is 16 a factor of (128/n)/((-1)/5)? True Suppose -3k + 3 = 2g - 4, -5g + k + 43 = 0. Let h(o) = o2 - 8o. Let j be h(g). Suppose -l = -jl - 49. Is l a multiple of 7? True Let u = -29 - -14. Is u/(-90) - (-2698)/12 a multiple of 25? True Let m = -35 - -41. Does 30 divide m - 4/(12/9) - -146? False Let g be (15/(-6))/((-7)/1666). Let o = -407 + g. Is 18 a factor of o? False Let o be 1/3 - 20/(-12). Suppose -og = -4g + 52. Suppose g + 10 = 3h. Is 4 a factor of h? True Let u be ((-4)/8)/(1/(-4)). Suppose s = -us + 18. Suppose m - 5i = 32, m - s - 42 = -3i. Is 14 a factor of m? True Suppose -d - q + 675 = -396, -3d - 4q = -3209. Is d a multiple of 5? True Let f(s) = -s3 - 12s*2 + 7s - 35. Does 8 divide f(-13)? False Is 243 + (-12 - (-30)/5) a multiple of 15? False Let y(v) = 4v + 23. Let o(w) = w + 8. Let u(p) = 7o(p) - 2y(p). Let n be u(5). Suppose -5a - nf = -3f - 90, -36 = -2a - 5f. Is 9 a factor of a? True Suppose -3i - 3005 = -5z + 38, 3z = -4i + 1849. Does 34 divide z? False Let o = 23 - 23. Suppose 3m - m - 64 = o. Does 13 divide m? False Let s be ((-247)/26)/((-2)/4). Suppose 0 = 5y + 4u - s, 2y - 3u + 9 = 4y. Suppose -v = -yh - 26, 5h = -v + 11 - 1. Is v a multiple of 5? True Let y = 1071 - 201. Is 79 a factor of y? False Suppose 6o = -3o + 27. Suppose -ov = 45 - 387. Does 35 divide v? False Suppose -7q + 1656 = 5q. Does 6 divide q? True Let l(n) = 24n*2 + 3n + 2. Let b = -17 - -16. Does 6 divide l(b)? False Suppose 5g - 1053 = -3t, 11t = 2g + 10t - 419. Does 11 divide g? False Let r(k) = -53k - 71. Is 25 a factor of r(-7)? True Suppose 0 = -4q + 2q + 30. Is (-13717)/(-165) - 2/q a multiple of 21? False Let g be (-39)/15 + (-4)/10. Let o be ((-156)/16)/(g/36). Suppose 5r - o - 153 = 0. Is 31 a factor of r? False Let n = 1083 - 1046. Does 20 divide n? False Let s(d) = 0 + 1 - 2d - 4 + 0. Let k be s(-4). Suppose -3l + 99 = 2x, -kx - 62 = -l - 12. Is l a multiple of 16? False Let u = -12 - -11. Let z be (15/(-10) - u)12. Is (-244)/6z/4 a multiple of 14? False Let z(k) = k + 6. Let x be z(6). Let g = 17 - x. Suppose 0 = 5v - 5h - 155, 3h = -gv - 2h + 175. Is v a multiple of 10? False Suppose -m + 2v = -474, -4v + 3v + 3 = 0. Does 24 divide m? True Suppose 3h = -11 - 10. Let l be -2(1 + h + -1). Let k = 50 - l. Is k a multiple of 8? False Let x be (8 + -7)/(-1 - 0). Let y be (-4 + 6)51 - x. Suppose 2j + 49 = i, 5i + 3j - y = 181. Is 11 a factor of i? True Let m = -25 - -395. Is m a multiple of 74? True Suppose -4w = -0w - 8. Is w + (-1)/((-3)/204) a multiple of 14? True Suppose 476 = 5z + w, -z + w + 67 = -33. Suppose 96 = 6c - 4c + 5h, 0 = 2c - h - z. Is c a multiple of 15? False Suppose 5g + 58 = 3. Let n(b) = -b3 - 12b*2 - 7b + 12. Let s be n(g). Let q = -17 - s. Is q a multiple of 3? True Let n(d) = -d*3 - 4d*2 + 4d - 3. Let t be n(-5). Suppose to = -b - 0b + 12, 5o - 45 = -5b. Does 4 divide b? False Suppose -3x - 3s - 2s + 203 = 0, 0 = -s - 2. Is x(-1 - -2) - -4 a multiple of 26? False Does 42 divide 28224/216(-18)/(-8)? True Suppose -3g + 6g = -15. Let c(y) = -24y + 3. Let a be c(g). Let n = a - 49. Does 11 divide n? False Let n(k) = k. Let f(i) = 13i + 6. Let s(h) = -f(h) + 2n(h). Does 4 divide s(-2)? True Let z = 1071 + -696. Is 5 a factor of z? True Let z(o) = o*3 - 9o*2 + 8o + 11. Let v be z(8). Let q be (-2)/v + 145/11. Suppose 2a - 11 = q. Is 4 a factor of a? True Let b(q) = 23 - 5q*2 + 6q*2 + 6q + 9. Is b(-8) a multiple of 3? True Suppose 0 = -3f - 3c, 6 - 1 = 3f + 2c. Suppose 2k - 4 = fy - 18, -4k = -3y. Suppose 4q - 5 = ku + 21, -5u = -10. Is 5 a factor of q? False Let v(m) = m + 1. Suppose 15 = 4t - 1. Let a(n) = -14n - 2. Let g(o) = tv(o) + a(o). Is 34 a factor of g(-10)? True Suppose -7u + 2037 = -3u + 5c, 1521 = 3u - 3c. Is u a multiple of 5? False Let v(d) be the second derivative of -8d*3 + 3d*2 + 6d. Is 17 a factor of v(-3)? False Suppose -4x = -5w + 283, 0x - 301 = -5w - 2x. Suppose -z = 4r + w, 4r + 44 + 20 = 4z. Does 9 divide ((-54)/30)/(1/r)? True Let v = 22 - 19. Suppose 230 = vb - 8b. Let h = b + 90. Is 18 a factor of h? False Let j(h) = 8h + 0 - 6 + 1. Let w be (-4)/14(3 - 17). Is 7 a factor of j(w)? False Let o be (-15 + 12)(-12)/4. Let k be (3/2)/(1/(-2)). Is 3 a factor of -62/k + o? False Let y be 5/20 + 30/8. Suppose 2u + 0u = y. Suppose 4d - 2l = ul + 124, d - 3l = 41. Is 13 a factor of d? True Let n(m) = 198m3 - m + 2 + 3m - 199m3 + 2m*2 + 3m. Let y = 1 - 4. Is n(y) a multiple of 10? False Suppose 4t = -4a - 144, -a + 4t - 3t - 38 = 0. Let u = a + 82. Does 5 divide u? True Let i(t) = 0t2 + t2 - 15t + 5t2 - 10 - t2. Let j be i(8). Suppose j = -u + 6u. Does 19 divide u? True Suppose 2j + j = -6. Let m be 370/15 + j/3. Let t = 59 - m. Is 16 a factor of t? False Is 45 a factor of (-30)/(-1)(-45)/(-2)? True Let g(r) = 24r - 16. Let b(t) = -168t + 111. Let h(i) = 2b(i) + 15g(i). Is h(3) a multiple of 12? False Let d(m) = 169m + 3. Let f = 25 + -23. Let z be d(f). Suppose 0 = 3n - 2l - 215, 47 - z = -4n - l. Is 16 a factor of n? False Let k be -2 + (-45)/(25/(-5)). Suppose -309 - 895 = -km. Does 43 divide m? True Let f(j) = 5j*2 + 6j + 1. Is f(11) a multiple of 32? True Let g(r) = 102r + 4. Let j be g(-1). Let x = 346 + j. Is 31 a factor of x? True Suppose 0 = 23a + 24160 - 99600. Is 80 a factor of a? True Suppose -5c = 5h - 690, 5c + 148 = 6c - h. Does 3 divide c? False Suppose -30g + 24g = -1002. Is 7 a factor of g? False
Solve 8z = 10z - 2d + 24, 5z = -2d - 10405 + 10401 for z. -4 Solve -76d + 74d + 89 = -3h, 81 = -2h + 3d + 5 + 10 for h. -27 Solve -26 = 2c + 4b, -1610c - 5b = -1599c + 58 for c. -3 Solve -5t - 1445275 = k - 1445358, -6k = 4t - 82 for k. 3 Solve 3c - 127s + 41s - 1471 = 0, -3c + 7s = -38 - 90 for c. 3 Solve 0 = 5n - 30, -7c + 0c - 66n + 26 = -0c - 64n for c. 2 Solve -88 = -5d + 31i, 0 = -5d - 1198i + 1188i - 35 for d. -1 Solve -l + 25 = 2t, 65224t - 37 = -5l + 65222t for l. 3 Solve -46l - 26r = -45l - 110, r = -3l + 99 for l. 32 Solve -3o - 31 = 24s - 28s - 97, 4s + 39 = 4o - 29 for s. -15 Solve -3c + 80 = -5o, -6c + 183o - 178o + 155 = 0 for c. 25 Solve 4g + 249 = -35d + 2g, -661g - 18 = 4d - 666g for d. -7 Solve -41c + 26c - 13 = -17c - 3u, 14 = 2u + 4 for c. -1 Solve -5f - 90 = 3r, 0 = -2759457f + 2759453f - r - 65 for f. -15 Solve 2j - 10 = 0, -5p - 5 - 36 - 13 = 2j - 2 + 23 for p. -17 Solve 4x + 13843d = 13848d - 37, -6d + 54 = 0 for x. 2 Solve -4m + 248 = -64f - 144, 0 = 4f + 8 + 13 - 1 for m. 18 Solve -27n - 26n = -b - 2n - 768, -n + 12 = b for b. -3 Solve -27 = -r + 3u, -221 = -9r + 29650u - 29645u for r. 24 Solve 7n = 4f - 113, -4f - 7645n = -7642n - 163 for f. 37 Solve -899g - z = -896g - 33, -58g + 260 = -62g + 5z for g. -5 Solve 168 = -7g + 5f, -3f + 8052 = -120g - 238g - 540 for g. -24 Solve -3u = 3c - 15, 59c - 2u - 5 = 66c for c. -3 Solve 0 = 2l - j + 2, -23l + 16l + 13j + 61 = -10l for l. -3 Solve 5w - 28 + 71 = 3g, -19g = -4w - 22g - 29 for w. -8 Solve h - 2t - t + 67 = 0, -3h - 27708t + 63 = -27705t for h. -1 Solve 2m - 306n = -929n + 312n + 307n - 54, -n - 24 = -3m for m. 3 Solve 3k - 2k = 4u + 17k - 336, 4u + 9k - 4k = 116 for u. 4 Solve 9t - 19w + 20 = -20w - 0, 5 = -4w - 3 for t. -2 Solve 3o - 2d - 54 = 0, -284 = -3783997o + 3783999o + 12d for o. 2 Solve -21p = o - 52, -4o = -1157p + 1153p + 144 for p. 4 Solve -5a = -5r + 20, 31a + 3353 - 3309 = -9r for r. 2 Solve 2719y - 2724y + 38 = -j, -y = -2j - 31 for y. 5 Solve -10t = b - 59, 0 = 1124798t - 1124793t - 2b + 18 for t. 4 Solve -3g + 1194 = -108i, -83i - 4g = -48i - 40i + g - 65 for i. -11 Solve -195q - 3q + 4f = 60, 1265q - 1262q - 45 = -3f for q. 0 Solve 4k + 9q - 4q = -16, -4k + 4q = 8 - 28 for k. 1 Solve 256j - 261j + 171 = 7s, -3j = 5s - 125 for s. 28 Solve 5n - 5c = -6c - 2, -11n - 3c + 8 = -7c for n. 0 Solve 0 = 3c + 3a + 72, -a = -5c - 4a + 50 - 168 for c. -23 Solve -31 = 3d - 9d + 5n + 73, -4d + 32 = -n for d. 4 Solve 6t + 23 = -3n + 185, -68297n + 2t = -68300n + 174 for n. 60 Solve 4s + 128 - 64 = -4i, -i - 170s - 26 = 4i - 168s for i. 2 Solve -3y - 3w = -57, 138w = 279w - 140w - 18 for y. 1 Solve -63 = k - 24q, 94k - 37 = 97k + 4q for k. -15 Solve -3c + 110 = -4j, -3c - 323991j = -323989j + 46 for c. 2 Solve 1254z - 15 = 1248z - 3y, -2z = 2y for z. 5 Solve 4359m = a + 4360m + 6, 5a - m - 18 = 0 for a. 2 Solve -14b + 13b = 8r - 3b + 482, -r - 64 = -b for r. -59 Solve -2a + x + 28 = 0, -248a + 244a + 110 = -5x for a. 5 Solve 80 = -5b + 5g, 66 = -58b + 55b - 6g for b. -18 Solve 104 - 34 = -8k + 7j, -4k + 89j = 84j + 50 for k. 0 Solve -1 = 3i - 5y + 3, -1393y + 1400y + 82 = 48i for i. 2 Solve -4s + 59 = 3l, -5l - 4122 = -5s - 4022 for l. -3 Solve -3d - 2m + 339 + 379 = 752, -3m = -3d - 9 for d. -8 Solve -2t - 4m = -108, 6t - 8t + 172 = 33m - 30m + 66 for t. 50 Solve -2o = -2z - 38, -3778o + 4z = -1890o - 1883o - 81 for o. 5 Solve -192m + 5c = -189m - 105, m = 2c + 36 for m. 30 Solve 0 = -6t + 5z + 60, 0 = -5169t + 5191t - 2z - 122 for t. 5 Solve -2j + 5 = -9j + 3j + 6j - 83, j = -3l + 32 for l. -4 Solve -v = -4v - 2s - 32, -430459v + 3s = -430457v - 61 for v. 2 Solve -2k + 2f = 72, -k = 22f + 18f - 55f + 16f + 32 for k. -34 Solve -3 = 3n + 5m - 42, -110m + 7993 - 15381 = -5n - 8033 for n. 3 Solve p - 13 = -4c, -5p - 166c - 171c = -333c - 1 for p. -3 Solve 2i = 6, -4n + 19n - 3n - 27i = 10n - 145 for n. -32 Solve 85 = -7q - 5w, -2q + 6q - 14w + 26w = 11w - 30 for q. -5 Solve -i + a = 0, 2i - 10a - 9a + 5a + a = 21a + 64 for i. -2 Solve -7h - 3j + 54 = h - 3h, 4j = -557h + 5025 for h. 9 Solve 19h + 46 = 3f - 110, -4h = 2f + 46 for f. -5 Solve 72t + 5p - 1537 = 0, -3t - 115p + 43 = -119p for t. 21 Solve -2w + 3t = t + 40, 56w = -10t + 9t + 305 for w. 5 Solve -126 = 2u + 4g, 16u = 111393g - 111373g - 904 for u. -59 Solve 56l + 53 = -3v + 380, 0 = -2v + 2l + 100 for v. 53 Solve 4c - 4450 = -3p - 4425, 4p - 3c + 4c = 16 for p. 3 Solve -27m - 5u = -19m - 124, -m + u - 69 = -6m for m. 13 Solve 1090075d + 6f = 1090071d + 112, 4f - 44 = 5d for d. 4 Solve 11n - 88 = -3m - 94, 0 = m + 13 for n. 3 Solve 166 + 11 = s - 5v, -195s - 37 = -196s + v for s. 2 Solve -32h + 351 - 1029 = -3c + 347 + 514, -4c - 4h - 188 = 0 for c. 1 Solve 993f - 992f = 2r - 6, -4r + 5 - 1 = -f for r. -1 Solve -3k + 4522 = 36j + 4666, 2j = 5k - 8 for j. -4 Solve -i - 546 = 58n - 585, 8n - 3i = 65 for n. 1 Solve 19045n - 9525n - 48 = 9519n + 17m, 0 = n - m for n. -3 Solve 93975j = 93979j + 8, 0 = 3f + 4j + 2 for f. 2 Solve 14 - 23 = 5k + 16, 4y + 2k - 22 = 0 for y. 8 Solve -a - 13w + 77 = -3a - a, a = 69w - 14w - 279 for a. -4 Solve -31x = f + 1874 - 296, -11f + 111 = -8f - 2x for f. 3 Solve -7l + 23 = d - 17 - 42, -80d - l = -83d + 4 for d. 5 Solve z + 156 = s + 192, 2z = -3s - 133 for s. -41 Solve 2o - 53 = -5z - 7, 44o - 115 = -10z + 39o for z. 0 Solve -5m = 0, -2d - 3m - 30509 = -30341 for d. -84 Solve 5j + 18 = -9v, -4v + 4j - 3j + 63 = -4j + 6 for v. 3 Solve 13t + 18y - 19y + 59 = 12t, -3y = t + 63 for t. -60 Solve 3v - 7f = -2f - 7, 11v = 7v - 22f + 134 for v. 6 Solve -1441h + 1436h = -3v + 2v + 4, -5h + 326 = -31v for v. -11 Solve 0 = 3p + 2s + 5550 - 5461, -5s = 15p + 425 for p. -27 Solve 1169 = 2y + d + 5d + 1559, -2d + 4d + 130 = 2y for y. 0 Solve z = -0z - 3z + 76, -32m + 236 = 5z - z - 0z for m. 5 Solve 4d = 4l - 180, -60d + 2l + 288 = -55d + 387 for d. -3 Solve -9 = 48t - 46t - 3s, -t + 5s = 4t + 10 for t. 3 Solve -6u - 192 = 3v, -6v = u + 540 - 497 for u. -31 Solve -p - 2p + 7p + m + 2 = 0, 0 = 1215p - 1218p - 3m - 15 for p. 1 Solve -o - 31 = 7p, -1276p + 1279p = -4o - 99 for p. -1 Solve -8d + 7u = -5d + d - 61, 2d = 78u + 552 for d. 3 Solve 12k - 2f = -10k + 23k - 9, -4k + 8f - 43 = -k for k. -1 Solve 3c = 2p + 21, -5c = -3p - 17c + 123 - 72 for p. -3 Solve 0 = p + 6m - 38, 3p = 680m - 678m - 6 for p. 2 Solve -75f - 4h - 2h = -33f - 38f - 50, 4f + 27 = 5h for f. 2 Solve 0 = t - h - 63, -2h + 1675 - 1533 = 2t for t. 67 Solve -3b + 9q + 33 = 25q - 10q, 0 = -27b + q - 33 for b. -1 Solve -33 = 811o - 812o - 2k, 26o - k - 752 = 0 for o. 29 Solve 951h - 19 = -4v - 952h + 1908h, -5v - 3h - 4 = 0 for v. 1 Solve 6c + 144 = 0, 76576c - 76579c - 70 = -2i for i. -1 Solve 5n + 33 = 5x - 12, 5n - 4n + 21x - 123 = -0n for n. -3 Solve -828u + 8 = 2a - 823u, 12 = 3a + 3u for a. 4 Solve 13t + 56 = 4u + 9, 8t - 6t - 2t - 5u = -75 for t. 1 Solve 134 = 4d - 16121f + 16119f, d = -11f + 45 for d. 34 Solve -5d + 2d + 15 = 3q, 0 = -d + 39111829q - 39111824q - 31 for d. -1 Solve 2h - 7u + 69 + 254 = 0, 0u - 91 + 169 = 3h + 2u for h. -4 Solve 112m - 2p = 904, -98p + 94p = 2m for m. 8 Solve -4h - 98 = 8j - 186, -2j - 14 = -8h for j. 9 Solve -15u - 3l = -18u + 15, -27u - 26u + 19 = -62u + l - 16 for u. -5 Solve -11t - 8724 = -3y - 8636, -5y + 2t + 16 = 0 for y. 0 Solve -3s + 5n - 48 = -5n + 14n, -20 = 31s - 2n + 86 for s. -4 Solve -2f + 8c - 9 = -f + 7, -784f + 5c - 10 = -774f for f. 0 Solve -5p + 110 = 5j + 13p, 4j - 25p - 30 - 19 = 3j - 170 for j. 4 Solve -143g = 5u - 140g + 20, 0 = -3u - 4g - 45 for u. 5 Solve -13 = -4d + 13 - 6, 2019d = 5j + 2030d + 50 for j. -21 Solve -z - 3l + 20 = 0, 2l - 1887861 = 4z - 1887997 for z. 32 Solve 5065z - 5060z + 11t = 3t + 33, 0 = z + t - 3 for z. -3 Solve -72 = -5c - 3n, -28 = -c + 6638n - 6641n + 32 for c. 3 Solve 10q - 45 + 59 - 59 = -l + 28, -5q + 71 = 2l for l. 23 Solve -q = -5m + 35, -9757q + 29m = -19512q + 9756q + 203 for q. 0
What is the closest to -0.3 in 3, 10, -188, -4/11, 0.4? -4/11 Which is the nearest to -1? (a) 0.1 (b) -1/6 (c) 374104 (d) 0.05 b What is the nearest to 2 in 0, -2, 1786, -2/11, -3/4? 0 Which is the closest to -7/2? (a) 0 (b) -567 (c) -4 (d) 1/7 c Which is the closest to 1? (a) 5 (b) 3.7919 (c) 0.443 (d) 4/3 d What is the closest to 1/89 in -8/31, -0.3, -9, -0.11, -4? -0.11 Which is the nearest to 6/55? (a) 2/3 (b) 40 (c) -0.5 (d) 2/9 (e) -7 d Which is the nearest to -1? (a) -2/833 (b) 1/10 (c) -2.57 a What is the closest to -9.2 in -0.1, 0.4, 1, 81? -0.1 Which is the nearest to -0.01? (a) -3180 (b) -1 (c) 5 b Which is the nearest to 274? (a) 5 (b) -2/15 (c) 7/16 (d) 0.3 a What is the nearest to 12 in 0, -1, 1638? 0 Which is the nearest to 14? (a) -2 (b) 4 (c) -157767 b Which is the nearest to -0.1? (a) -4 (b) 0.4 (c) 96/391 (d) 10 (e) 5 (f) 3 c What is the nearest to 9 in 54758, -2/337, -0.2? -2/337 What is the closest to 0.1 in -959629, 3, -4? 3 What is the closest to 1 in 5, 1.1, -2, -7, -26/19? 1.1 What is the closest to 0 in -2, -0.4, 9.8, -961? -0.4 Which is the closest to -0.1? (a) -198 (b) 0 (c) -0.4 (d) -408/25 b What is the nearest to -2/13 in -2, -5/6, 668, -0.1, -1/5? -1/5 What is the nearest to -1/3 in -1.7, 6/5, -0.3, -5, 26/57? -0.3 What is the closest to 1 in -0.2, 1/2, -559, -28/17? 1/2 Which is the closest to 74? (a) 0 (b) -2/13 (c) 6 (d) 0.4 (e) -6 c What is the closest to -3 in 14, 21, 3.2, 0.4, -0.8? -0.8 Which is the nearest to 1? (a) 2 (b) 2/9 (c) -3 (d) -469 (e) -1 (f) -24 b What is the nearest to 3/3326 in -1/7, 0.03, 0.04, 12? 0.03 What is the closest to -0.1 in -2.489413, 0.09, 4? 0.09 Which is the nearest to 0? (a) 1 (b) -0.2 (c) 213084 b What is the closest to -4 in 1/20, 0.4, -0.0009, -0.2, 0? -0.2 Which is the nearest to -96? (a) -3700 (b) 2/3 (c) -3 c What is the closest to -5 in -1/3, -63, 2, -5, 30? -5 Which is the closest to -550? (a) 0.4 (b) -2/7 (c) 2.33 b What is the nearest to -7 in 0.4, 15757, -3? -3 What is the nearest to 0.016 in 2/3, 0.14002, 2, 0.11, 1/7? 0.11 What is the closest to 2/237 in -8, -1869, -1, -3? -1 Which is the closest to 2/15? (a) 5 (b) -3/7 (c) -0.7 (d) 3 (e) -383 (f) -460 b Which is the closest to 2/7? (a) 0.4 (b) -1 (c) 0 (d) 7/90 (e) -3/16 a What is the closest to -2/5 in 2/5, -3, 260/7, -0.009? -0.009 What is the nearest to -20 in 6, -1, 18, -7/2? -7/2 Which is the closest to 470/27? (a) 3 (b) 44/43 (c) -4 (d) 0.5 a Which is the closest to 0.09? (a) -0.3 (b) -1999 (c) -170 a What is the closest to 207357/5 in -0.5, 82, 5, 0.4? 82 What is the nearest to 0 in 5, -0.093, 11, 14871? -0.093 What is the closest to 0.2 in -3.7764, 0.03, 0.2? 0.2 What is the closest to 2 in -2, 56, -24, 3/7, -6? 3/7 Which is the nearest to 0? (a) 0 (b) 5/1278 (c) -4 (d) 2.7 (e) 2/11 (f) -2/5 a What is the closest to 25 in -1, -0.03, -3, 2/341? 2/341 What is the nearest to -2 in 1.5, 4, -4493, -3, 0.5, 1/5? -3 Which is the nearest to -0.7? (a) 24 (b) 10/13 (c) -17 b What is the closest to -34 in -1/7, 2, -1/4, -10/21, 1/3? -10/21 Which is the closest to 1609? (a) -0.017 (b) -8 (c) 8 c What is the nearest to -2/3 in -3, -5, 0.3, 2/7313187, -1? -1 What is the nearest to 1/5 in -3, 176991, -2, 0.06, 0.3? 0.3 Which is the closest to 10? (a) -1 (b) 0 (c) 2/3 (d) 2965.2 (e) 0.4 c What is the closest to -1/4 in -0.054, -12, -0.3, -12.46? -0.3 What is the nearest to -0.1 in -0.748, -20, 4, 5, -0.08? -0.08 Which is the nearest to -1/3? (a) -3114 (b) 6 (c) 5/7 c Which is the closest to 4? (a) 4 (b) -2 (c) 1/8 (d) 225706 a Which is the closest to 1? (a) 0.2 (b) 0.5 (c) -226800 (d) -6/11 (e) 0.1 b What is the closest to -4/7 in -1915.5, 0.8, -11? 0.8 What is the nearest to 3/4 in 22, -217.8, -5? -5 Which is the nearest to -24? (a) -639 (b) -431 (c) 1/3 (d) -0.5 d What is the nearest to 0.43 in -0.42, 5, -5/619, 2/13? 2/13 Which is the closest to 1/12? (a) 42/13 (b) -40 (c) -2/5 (d) -16 c What is the closest to 1.4 in 3, 189, -2/11, 0.06, 0? 0.06 What is the nearest to 0.3 in 2/25, 0.4, 0.89, -28/3, -1/5? 0.4 Which is the closest to 0? (a) -13 (b) -3/50 (c) -2.87 (d) 1/2 (e) -2/23 b What is the nearest to 1/2 in -3, -1, -36.3, -9/10? -9/10 Which is the closest to -4? (a) -2/3 (b) 2/21 (c) -274 (d) -7 d What is the closest to -6 in 0.7, -0.4092, -0.2, 2/3, -3? -3 What is the nearest to -10 in -5, 4, -2, -16, -144? -5 What is the nearest to -72.107 in 4.3, -2/5, 1/2, 0.3, -2/9, 2? -2/5 What is the closest to 52/27 in -10, 2, -442? 2 What is the closest to -18 in 0.4, 3/26, 8/17, -9? -9 Which is the nearest to -17? (a) 129 (b) -5 (c) 96 (d) 0.5 (e) 9 b Which is the nearest to 2/3? (a) -41 (b) 2 (c) -1/58 (d) 0.06 d What is the closest to 9/4 in 2199, -1, -0.3? -0.3 Which is the nearest to 1/4? (a) -3/5 (b) 18 (c) -1 (d) -19 a Which is the nearest to -1? (a) -4 (b) -1/40 (c) -2 (d) -17.05 b Which is the nearest to -0.27? (a) -1/6 (b) 1 (c) -14452/25 a Which is the closest to 1? (a) -14 (b) 2 (c) -2/21 (d) -292 b What is the nearest to 0.1 in 3.43, 6/35, -3, -0.2, 0.04? 0.04 What is the nearest to 1/11 in 0.4, 5, 3/13, -2, -4? 3/13 Which is the nearest to 0.934? (a) 0.1 (b) 0.05 (c) -120 a Which is the nearest to 20/3? (a) -4 (b) 1/5 (c) -3/7 (d) -0.9 (e) 1.2 (f) -125 e Which is the nearest to -1? (a) 36.4 (b) 25 (c) -2 (d) 0.05 (e) 2/53 c What is the nearest to 0.1 in -113, -1/59, 2/3, -2, 42? -1/59 Which is the nearest to 2? (a) -2 (b) -129 (c) 29 (d) 7.7 (e) -0.3 e What is the nearest to 0.25 in -67, 1, 0.1, 0.2, -0.4, -100? 0.2 What is the nearest to -1 in -7, 5/2, 0.6, 16.8? 0.6 Which is the closest to 2/13? (a) -6/7 (b) 4 (c) 140 (d) -252 a Which is the nearest to 119/2? (a) -5 (b) 1 (c) -943.7 (d) 5 d Which is the nearest to -0.1? (a) 178 (b) -3565 (c) -9 c What is the closest to 13 in -11, 18/11, -0.27, -4? 18/11 What is the closest to -6 in -0.2, -0.4, 2/7, -0.3, -2/26813, 2/9? -0.4 What is the closest to 0 in -273, -0.0644, -2/3, -2/15? -0.0644 Which is the closest to 0.038? (a) 1 (b) 334 (c) -4 (d) 10 a What is the closest to 1/4 in 5/4, 3, 4, -72, -0.1? -0.1 What is the closest to -0.08 in -2, 13, 8, 1110, -5? -2 What is the closest to 0 in 392, -2, -2/71, 1? -2/71 What is the nearest to 2/5 in -85, 354, -1/330, 5, 2/3, 4? 2/3 What is the nearest to 2/3 in 2/11, 3, 166, 1/13, -10? 2/11 Which is the nearest to 30? (a) 2/41 (b) -335/22 (c) -0.3 a Which is the nearest to -58510? (a) 2 (b) -11 (c) 3 b What is the closest to -126 in -5, 0.622, 39, -1, -0.3, 2? -5 What is the closest to -34 in -86419, 3/8, -4? -4 Which is the nearest to 2/5? (a) 5 (b) 37797 (c) -32 a Which is the closest to 11? (a) -812 (b) 0 (c) 0.5 (d) -2 (e) -1.18 c What is the closest to -1 in 0.02, 1396.9661, 0, -2/3? -2/3 What is the nearest to 0.031 in 3/11, -2/19, 4, 0.02, -3/5? 0.02 Which is the closest to -3/2? (a) 0 (b) 0.6 (c) -7 (d) -1/7 (e) -107 d What is the nearest to 118 in 12, 8.1, 55? 55 What is the closest to 1 in 0.5, -0.03, 1/7, 383604? 0.5 Which is the closest to -0.1? (a) -5 (b) -742.3 (c) 6 (d) 7/5 d Which is the nearest to 16? (a) 17/29 (b) 1/5 (c) -2 a What is the closest to 0 in 1, -0.4451, 8, -0.2? -0.2 What is the nearest to -0.2 in -0.2, -0.04475, 2, -0.1? -0.2 What is the nearest to 0 in -3, -0.2, 54/17, 166, 0.05? 0.05 Which is the nearest to -1? (a) -2873 (b) -3/490 (c) 1 b Which is the nearest to 12/35? (a) 47.9 (b) -0.04 (c) -6 b What is the nearest to 9 in 562, 2/3, -6, -0.92, 0.1? 2/3 Which is the closest to -1/3? (a) 1 (b) 5 (c) 96191 (d) -1 (e) -2 d What is the nearest to -620 in 1/3, 12, -143? -143 Which is the closest to -8? (a) -5 (b) 3 (c) -1.41 (d) 15 (e) 1 (f) -1 a What is the closest to -53 in -2, -0.06, 0.3, 3, 3/77? -2 What is the nearest to 3 in -9.25, -0.4, 8, -0.2? -0.2 Which is the closest to 0.1? (a) -0.31 (b) -806/45 (c) -9 (d) 2 a Which is the nearest to 38? (a) -77 (b) 4 (c) 0.2 (d) -3 (e) -1 (f) 51 f Which is the closest to -2? (a) 0.2 (b) -2 (c) -1939 (d) 0.3 b Which is the closest to 1? (a) -4 (b) 0.1 (c) 3.624 b Which is the nearest to -3/7? (a) 1/6 (b) -123/254 (c) 0 (d) -12 b What is the nearest to 17.14 in 306/5, 5, 17? 17 What is the nearest to 0.1 in -3/2, 1078, 0.22, 14/5? 0.22 What is the closest to 0.1 in -0.4, 13, -1/3, -1/7, -1544? -1/7 Which is the nearest to 2/77? (a) 58 (b) -0.11 (c) 0.1 c Which is the nearest to -1/20? (a) 350 (b) -2 (c) -13/8 (d) 3/4 d
What is the d'th term of 2084, 4282, 6588, 9002, 11524, 14154, 16892? 54d2 + 2036d - 6 What is the x'th term of 696300, 1392601, 2088902, 2785203? 696301x - 1 What is the o'th term of -334, -1375, -3118, -5569, -8734? -o3 - 345o*2 + o + 11 What is the u'th term of 121437, 121439, 121441? 2u + 121435 What is the m'th term of 8356, 8304, 8252? -52m + 8408 What is the c'th term of 8268, 33124, 74564, 132588, 207196, 298388, 406164? 8292c*2 - 20c - 4 What is the k'th term of 21, -31, -111, -213, -331, -459, -591? k*3 - 20k*2 + k + 39 What is the y'th term of -54, -312, -570? -258y + 204 What is the c'th term of -254, -168, 36, 418, 1038, 1956, 3232? 10c3 - c2 + 19c - 282 What is the b'th term of -1035555, -1035550, -1035531, -1035492, -1035427, -1035330, -1035195, -1035016? b3 + b2 - 5b - 1035552 What is the w'th term of -158, -374, -752, -1370, -2306? -13w*3 - 3w*2 - 116w - 26 What is the r'th term of 329932, 659860, 989788, 1319716, 1649644? 329928r + 4 What is the n'th term of 92799, 185706, 278613, 371520, 464427, 557334? 92907n - 108 What is the w'th term of -9568, -76067, -256564, -608059, -1187552, -2052043, -3258532, -4864019? -9500w3 + w2 - 2w - 67 What is the s'th term of -2598, -10372, -23328, -41466, -64786? -2591s2 - s - 6 What is the o'th term of -247, -244, -261, -298, -355? -10o*2 + 33o - 270 What is the d'th term of -22440, -22405, -22370, -22335? 35d - 22475 What is the w'th term of -873, -842, -751, -570, -269, 182, 813? 5w*3 - 4w - 874 What is the j'th term of 13380, 13384, 13390, 13398, 13408, 13420? j2 + j + 13378 What is the w'th term of 27458, 27522, 27584, 27644? -w2 + 67w + 27392 What is the i'th term of 541666, 541669, 541672, 541675? 3i + 541663 What is the b'th term of 6404, 12799, 19184, 25559, 31924? -5b2 + 6410b - 1 What is the c'th term of 30751, 30748, 30745, 30742, 30739, 30736? -3c + 30754 What is the z'th term of -19, -181, -619, -1471, -2875, -4969, -7891, -11779? -23z3 - z + 5 What is the l'th term of 1467, 1622, 1873, 2214, 2639, 3142, 3717, 4358? -l3 + 54l2 + 1414 What is the d'th term of -21, -278, -535, -792, -1049? -257d + 236 What is the v'th term of 7672, 7690, 7708, 7726, 7744, 7762? 18v + 7654 What is the v'th term of 261719, 261754, 261789, 261824, 261859? 35v + 261684 What is the d'th term of 2200, 4177, 6140, 8083, 10000? -d3 - d2 + 1987d + 215 What is the h'th term of -93243, -93237, -93229, -93219? h2 + 3h - 93247 What is the i'th term of -342, -240, -138, -36, 66, 168? 102i - 444 What is the j'th term of -301, -1468, -3495, -6382, -10129? -430j*2 + 123j + 6 What is the y'th term of 949, 1605, 2263, 2923, 3585, 4249, 4915? y*2 + 653y + 295 What is the k'th term of -470, -255, -40, 175, 390, 605? 215k - 685 What is the r'th term of 53, 8, -51, -124, -211, -312, -427? -7r*2 - 24r + 84 What is the r'th term of 6466, 12920, 19374, 25828, 32282? 6454r + 12 What is the p'th term of -23779, -47558, -71337, -95116? -23779p What is the g'th term of 2735, 5438, 8141? 2703g + 32 What is the i'th term of -54443, -108887, -163331, -217775? -54444i + 1 What is the h'th term of -21, -659, -2377, -5715, -11213, -19411? -90h3 - 8h + 77 What is the o'th term of 319, 646, 971, 1294? -o*2 + 330o - 10 What is the w'th term of -735, -866, -997, -1128, -1259? -131w - 604 What is the w'th term of 9427, 9440, 9453, 9466, 9479? 13w + 9414 What is the u'th term of 19184, 19209, 19250, 19307, 19380, 19469? 8u2 + u + 19175 What is the s'th term of -1083, -1856, -3145, -4950, -7271, -10108? -258s*2 + s - 826 What is the g'th term of -130, -575, -1338, -2419, -3818, -5535, -7570? -159g*2 + 32g - 3 What is the d'th term of -464541, -464560, -464593, -464640, -464701? -7d2 + 2d - 464536 What is the q'th term of 841, 849, 867, 889, 909? -q*3 + 11q*2 - 18q + 849 What is the o'th term of -816, -1640, -2468, -3306, -4160? -o*3 + 4o*2 - 829o + 10 What is the f'th term of 1270, 2631, 4056, 5551, 7122? f*3 + 26f*2 + 1276f - 33 What is the r'th term of -131742, -263486, -395230? -131744r + 2 What is the l'th term of 85653, 171298, 256943, 342588, 428233, 513878? 85645l + 8 What is the j'th term of -20238, -20166, -20094, -20022, -19950, -19878? 72j - 20310 What is the n'th term of -47, -210, -465, -806, -1227, -1722? n3 - 52n*2 - 14n + 18 What is the n'th term of 640, 1268, 1884, 2482, 3056? -n*3 + 635n + 6 What is the c'th term of 3, 490, 1815, 4398, 8659, 15018, 23895, 35710? 70c3 - c2 - 66 What is the g'th term of 5387, 10756, 16125, 21494, 26863, 32232? 5369g + 18 What is the c'th term of 11011, 21857, 32707, 43567, 54443, 65341, 76267? c*3 - 4c*2 + 10851c + 163 What is the u'th term of -514, -547, -592, -655, -742, -859, -1012, -1207? -u*3 - 26u - 487 What is the v'th term of 431, 585, 753, 941, 1155, 1401, 1685, 2013? v3 + v2 + 144v + 285 What is the x'th term of 1447, 3443, 5439? 1996x - 549 What is the h'th term of 4148724, 4148724, 4148726, 4148730, 4148736? h*2 - 3h + 4148726 What is the s'th term of -3361, -13477, -30335, -53935, -84277? -3371s2 - 3s + 13 What is the w'th term of -27, -86, -151, -222, -299, -382? -3w2 - 50w + 26 What is the s'th term of -4248, -8491, -12734, -16977? -4243s - 5 What is the i'th term of 347, 411, 525, 713, 999? 4i3 + i2 + 33i + 309 What is the p'th term of 274, 558, 852, 1156, 1470, 1794, 2128? 5p*2 + 269p What is the y'th term of -66, -201, -566, -1275, -2442, -4181, -6606? -19y3 - y2 + y - 47 What is the u'th term of 661989, 662000, 662025, 662070, 662141, 662244? u3 + u2 + u + 661986 What is the r'th term of -9, 217, 581, 1077, 1699, 2441, 3297? -r3 + 75r*2 + 8r - 91 What is the p'th term of 32696, 130816, 294358, 523328, 817732, 1177576, 1602866, 2093608? p*3 + 32705p*2 - 2p - 8 What is the y'th term of -636, -672, -782, -1008, -1392? -7y3 + 5y*2 - 2y - 632 What is the d'th term of -126, -495, -1110, -1971? -123d2 - 3 What is the z'th term of 691, 2248, 4663, 7930, 12043, 16996? -z3 + 435z*2 + 259z - 2 What is the o'th term of -1408, -1074, -740, -406, -72, 262? 334o - 1742 What is the q'th term of 5172, 5054, 4858, 4584? -39q2 - q + 5212 What is the m'th term of 27933, 27917, 27903, 27891, 27881? m2 - 19m + 27951 What is the w'th term of -16791, -16599, -16073, -15045, -13347, -10811, -7269, -2553? 28w3 - w2 - w - 16817 What is the p'th term of -18905, -37815, -56737, -75677, -94641, -113635, -132665? -p*3 - 18903p - 1 What is the m'th term of -44830, -44823, -44816? 7m - 44837 What is the z'th term of 802, 1611, 2422, 3235, 4050? z2 + 806z - 5 What is the p'th term of -361, -3029, -10279, -24403, -47693, -82441, -130939, -195479? -382p3 + p2 + 3p + 17 What is the l'th term of -200, -1372, -3326, -6062, -9580, -13880? -391l2 + l + 190 What is the l'th term of 74645, 74636, 74627, 74618, 74609? -9l + 74654 What is the c'th term of -539, -1135, -1849, -2741, -3871, -5299? -10c3 + c2 - 529c - 1 What is the r'th term of -1095, -1154, -1219, -1290? -3r2 - 50r - 1042 What is the j'th term of 35, -162, -359, -556, -753? -197j + 232 What is the p'th term of 6707, 13439, 20173, 26909, 33647, 40387, 47129? p2 + 6729p - 23 What is the v'th term of 31467, 31462, 31455, 31446, 31435, 31422? -v*2 - 2v + 31470 What is the u'th term of 36178, 36176, 36172, 36166? -u*2 + u + 36178 What is the w'th term of -783, -725, -577, -297, 157? 7w*3 + 3w2 - 793 What is the g'th term of -207895, -207886, -207867, -207832, -207775, -207690, -207571, -207412? g3 - g*2 + 5g - 207900 What is the s'th term of 587, 607, 629, 653, 679, 707, 737? s*2 + 17s + 569 What is the v'th term of 69195, 69188, 69179, 69168, 69155? -v*2 - 4v + 69200 What is the g'th term of -1672423, -3344845, -5017267? -1672422g - 1 What is the k'th term of 287, 2602, 6453, 11834, 18739, 27162? -k3 + 774k2 - 486 What is the y'th term of -1573, -1516, -1417, -1270, -1069, -808, -481, -82? y3 + 15y2 + 5y - 1594 What is the g'th term of -248, -251, -256, -263, -272, -283, -296? -g2 - 247 What is the q'th term of -3564, -14282, -32150, -57174, -89360, -128714, -175242, -228950? -q3 - 3569q2 - 4q + 10 What is the m'th term of 1378, 10987, 37082, 87907, 171706, 296723? 1374m3 - m2 - 6m + 11 What is the o'th term of -17, -231, -809, -1931, -3777? -30o3 - 2o*2 + 2o + 13
Simplify (y/y*(3/4)y(1/7))/(y(-2/7))(-25) assuming y is positive. y(-27/4) Simplify (p/p(-28))(5/2) assuming p is positive. p(145/2) Simplify o(-2/23)(oo/(oo(-1/11))o)/o assuming o is positive. o(254/253) Simplify (l(5/2)/(l/(l(-6/11)/l)))(-19) assuming l is positive. l*(19/22) Simplify ((iii/i7ii)/i)(1/17) assuming i is positive. i(-3/17) Simplify (u(-2/11)/uu(-2))(2/89) assuming u is positive. u*(-70/979) Simplify (b/(bb18))(-1/8) assuming b is positive. b*(9/4) Simplify d/(dd(dd/(d*(-6)d))/dddd)d(d(ddd/(d/(dd3)d)d)/dd)/dd assuming d is positive. d(-2) Simplify rr/((r/r*(-4/7))/r)r(-11) assuming r is positive. r(-67/7) Simplify (x(-6)/x(-6/5))(-22) assuming x is positive. x(528/5) Simplify (qq0/qq)/q*(-8)(q(-1/2))(-3/46) assuming q is positive. q*(831/92) Simplify ((p(p/(p*(1/4)p))/p)/(p/(pp(-3/7))))(-2/57) assuming p is positive. p(1/42) Simplify (x7)(-8/15) assuming x is positive. x(-56/15) Simplify ((zz3)/(z/(z6z)))(-2/29) assuming z is positive. z(-20/29) Simplify k(-1/5)k*4/kk/k*(-1/6)kk(-11)kk assuming k is positive. k(-121/30) Simplify s/(s/s(-1/4)ss)s*(-12)s assuming s is positive. s(-53/4) Simplify (f(3/17))(6/19) assuming f is positive. f(18/323) Simplify j/j*(-4)j*(-2/7)j*(-3)/jj*(-1/4)j assuming j is positive. j(41/28) Simplify (i(3/2)/i)/(i*(2/13)/i)(ii/i(2/5))(-25) assuming i is positive. i(-1005/26) Simplify ((vvvv*2/v)/vv/(vv(-4/7)))/(v(-2/17)v(-2/7)) assuming v is positive. v(473/119) Simplify (aaa/a*(-2/17)a2)(-6/17) assuming a is positive. a(-522/289) Simplify (((x/(x/(x(-2)/xx)))/x)(-2/105))(-6/17) assuming x is positive. x(-12/595) Simplify (g2)(-4/19)g(-2)/g(-1) assuming g is positive. g(-27/19) Simplify m(-7)mm(-6) assuming m is positive. m(-12) Simplify (u*(3/4)/(uu/(uu6)uu))/(u(1/3))(-39) assuming u is positive. u(67/4) Simplify (((l/l(-2/7))/ll)(-26/5))11 assuming l is positive. l*(-2574/35) Simplify (r/((r/(r(r/(r/(r/(r*(-2/3)r))))/r)r)/r))29/(r(-1/4))8 assuming r is positive. r(64/3) Simplify (b(-22)/b)/b12 assuming b is positive. b(-35) Simplify (k(-25)/k)25 assuming k is positive. k(-650) Simplify (r/r5r*0r)/((rr(2/9)/r)/r(r/(rr/(rr/(r*(-2/5)r)rr)))/r) assuming r is positive. r(-163/45) Simplify c11c/(c(2/51)/cccc) assuming c is positive. c(508/51) Simplify (k(1/2)k22/k)9 assuming k is positive. k(387/2) Simplify ((aa*27a)/a)/aa(1/16) assuming a is positive. a(433/16) Simplify (k0kk)(-7)/((kk/(((kk(-2/11))/k)/k))/(k/(k/((kkk(-2/5)kkk)/k))k)) assuming k is positive. k(-692/55) Simplify (g(12/11)/(((gg5)/g)/g))(-5/6) assuming g is positive. g(80/33) Simplify (r/(r(3/7)r)r)/(r/(rr25)r) assuming r is positive. r(172/7) Simplify (r(8/3)/(rr/((r/(rr(-2/21)))/r)))/(r11(r(2/33)r)/r) assuming r is positive. r(-870/77) Simplify (k1)(-22/3) assuming k is positive. k(-22/3) Simplify (x(-2)/x)/(x/(x/x(1/4))) assuming x is positive. x*(-13/4) Simplify (pp0)24(p/((p0pp)/p))/(pp(1/3)) assuming p is positive. p(68/3) Simplify (yy(-11/5))/(yy/(yy/(y/y(-9)y))y) assuming y is positive. y(-66/5) Simplify m3mmm/(m*(2/19)mm)m assuming m is positive. m(93/19) Simplify ((v/((v(-5/6)v)/v))/v)/(v/(v/(v20/vv))v) assuming v is positive. v(-121/6) Simplify (p(-2)/p)(-46) assuming p is positive. p138 Simplify (tt*5/tt*(-8/3))/(t((ttt*(-7/5)t)/tt)/tt(6/5)) assuming t is positive. t(-7/15) Simplify ((p/p*(-3))/pp*(-6))/(p/(ppp/p(-1))p)(3/5) assuming p is positive. p(-9/5) Simplify (((m(m/m(-8))/m)/m)/m(-3/4))/(m/m(-2/7)m)34 assuming m is positive. m(-1931/28) Simplify (z/(z*(1/11)z))(16/3) assuming z is positive. z(-16/33) Simplify (aaa(7/5))/(a/((a/a(-20)a)/aa)) assuming a is positive. a(122/5) Simplify (((w/w(1/4))/w)36)(-5/12) assuming w is positive. w(15/4) Simplify z19zz16 assuming z is positive. z36 Simplify c*(-1/12)c(-1/12) assuming c is positive. c(-1/6) Simplify (s(-2/3))(-6)(s(1/2))(9/8) assuming s is positive. s(73/16) Simplify ((b(-14/3)b)/bb)(-38) assuming b is positive. b(418/3) Simplify (m/((m/m(1/15))/m))19 assuming m is positive. m(304/15) Simplify (t(-17))(11/3) assuming t is positive. t(-187/3) Simplify n/(n(4/9)nn)n(15/8)/n assuming n is positive. n(-41/72) Simplify z*(-14)(((z/(z(-12)/z))/z)/z)/z assuming z is positive. z(-3) Simplify t*(-4)t/(t*0t)ttt/((t7/t)/t)t/(t*(-1/13)tt) assuming t is positive. t(-90/13) Simplify ((i/i(-12)i)/((i*(-1/21)i)/i))(-2/53) assuming i is positive. i(-590/1113) Simplify ((b*(-1)bb)/(b/(bbb(-6)b)))(5/8) assuming b is positive. b(-15/8) Simplify ((jjj/(j/j*12))/(jj(-5)))21 assuming j is positive. j*378 Simplify (ii*(-1)i)(-16)/((i(-5)/i)/i(-3/8)) assuming i is positive. i(-83/8) Simplify (hh0h)*(28/9)h(-2/9)/h(1/3) assuming h is positive. h(17/3) Simplify (u/u(2/3))/(u*(-8)/u)((u/(u/(u*(-7)/u))u)/u)/u10 assuming u is positive. u(-26/3) Simplify o*(2/41)/(o(o*(-22)/o)/oo) assuming o is positive. o(904/41) Simplify (r/r(-7)(rr(4/11))/r)(-3) assuming r is positive. r(-276/11) Simplify ((q/q7)(-14/5))(3/4) assuming q is positive. q*(63/5) Simplify (rr*24r)/r6 assuming r is positive. r20 Simplify (t/(tt/t(-1/4)))(-46)/(t(-1/5)t(-6)) assuming t is positive. t(637/10) Simplify (v(-3)/v)/v0 assuming v is positive. v(-4) Simplify (u(-1/3)u(u/((u/u(-4/7))/u))/u)49 assuming u is positive. u*(14/3) Simplify (ww/(ww(2/9)www)w(-1/6))/((w(-3/5)w)/(ww5)) assuming w is positive. w(289/90) Simplify ((d/d1d)/(d*(-2/17)/d))/((ddd(-6/7)/d)/d4) assuming d is positive. d(711/119) Simplify ((yyy(-3))(-33))0 assuming y is positive. 1 Simplify (jj*(2/37)(j*(2/17)/jj)/j)(-16) assuming j is positive. j(-1728/629) Simplify t*(-25/4)tt(4/7) assuming t is positive. t(-131/28) Simplify ((uu1)/u)(-48)/(u(-1/5)/u(2/7)) assuming u is positive. u(-1663/35) Simplify c7c1 assuming c is positive. c8 Simplify ((z/(zz(-1/14)/z))/(z(-1/16)/z))(3/35) assuming z is positive. z(717/3920) Simplify (g(-2/5))(9/2)(gg/(g*2g))(-21/4) assuming g is positive. g(69/20) Simplify j*(-10/9)j20 assuming j is positive. j(170/9) Simplify (k*(-13)k)/k(32/7) assuming k is positive. k(-116/7) Simplify g*18g/g9 assuming g is positive. g10 Simplify gg(-13)/gg/(g/g(1/9)) assuming g is positive. g(-116/9) Simplify g*(-21)g(g/(g/(g/g12)))/g assuming g is positive. g(-32) Simplify ((ss*(-2/3)s)(5/4))(9/7) assuming s is positive. s*(15/7) Simplify pp*8(pp/(pp(1/4)))/p assuming p is positive. p(35/4) Simplify (((p/(p/p*(-24)))/p)/p)/(pp*17p) assuming p is positive. p(-45) Simplify x(-23)x(-2/3) assuming x is positive. x(-71/3) Simplify d/(d0/d)d*2((d*(-2)d)/dd)(-7) assuming d is positive. d11 Simplify ((ccc(2/11)/c)/c(-1))/((c/c(-7/4))/(c((cc(1/4)/ccc)/c)/cc)) assuming c is positive. c(37/22) Simplify (d(-3/4)/d)/d*(1/9)((d/((dd6)/d))/d)/d(-3) assuming d is positive. d(-175/36) Simplify (f1/f)(-38)/(f(-2))(-25) assuming f is positive. f(-50) Simplify tt*(2/9)t*(1/6)t*(4/5)tt(-2/5) assuming t is positive. t(251/90) Simplify ((ss(2/65)/s)/s)(-2/19) assuming s is positive. s(126/1235) Simplify z(-48)zzz/(z/(z(zz/z(-3/11)z)/z)) assuming z is positive. z(-470/11) Simplify ((i(-3)i)/(i/(i(-3)i)))/(i/i0)(1/43) assuming i is positive. i(-216/43) Simplify (k(1/3))*22(k(-1/4))(10/7) assuming k is positive. k(293/42) Simplify (f/((f/(f/(f0f)))/f)f)*(1/6)/((f/((ff*(-3/5)f)/f))/(f(f/((f(-3/5)/f)/f))/ff)) assuming f is positive. f*(13/3) Simplify (mm*(-4)((m/m*(-1/13))/m)/mm)/((m/(mm/m(-6)mm))/m(-6)) assuming m is positive. m(1/13) Simplify ((qq/(q/(q/(q*(-1/9)/qq))q))/(((q/(q/(q(-1/3)qq)))/qq)/q))/(q(-1))(-37) assuming q is positive. q(-329/9) Simplify (q7)25 assuming q is positive. q175
Convert 0 (base 10) to base 16. 0 What is -4 (base 13) in base 9? -4 -1 (base 14) to base 6 -1 What is -7 (base 9) in base 13? -7 What is 3003 (base 4) in base 8? 303 What is -110111 (base 2) in base 16? -37 Convert 18 (base 12) to base 4. 110 Convert 1024 (base 5) to base 11. 117 Convert 2 (base 13) to base 11. 2 Convert 1 (base 11) to base 12. 1 8b (base 12) to base 4 1223 What is 5 (base 15) in base 6? 5 -1 (base 14) to base 11 -1 What is -313 (base 9) in base 7? -513 What is 15 (base 9) in base 5? 24 1 (base 14) to base 5 1 What is -5 (base 11) in base 6? -5 What is 6 (base 8) in base 12? 6 What is -4 (base 15) in base 5? -4 What is 25 (base 14) in base 5? 113 54 (base 12) to base 5 224 4 (base 5) to base 11 4 20 (base 6) to base 14 c Convert 3 (base 12) to base 9. 3 Convert 7c (base 14) to base 7. 215 Convert 4 (base 9) to base 13. 4 What is 16 (base 16) in base 4? 112 Convert 22 (base 4) to base 12. a What is -1 (base 11) in base 13? -1 Convert 1 (base 12) to base 16. 1 What is -11 (base 16) in base 6? -25 Convert 10010010 (base 2) to base 8. 222 0 (base 7) to base 8 0 -11 (base 3) to base 16 -4 -7 (base 12) to base 16 -7 What is -1010 (base 2) in base 7? -13 -115 (base 8) to base 14 -57 -4 (base 10) to base 14 -4 Convert -7 (base 13) to base 12. -7 Convert -1 (base 8) to base 6. -1 -10000 (base 2) to base 8 -20 Convert 2 (base 4) to base 6. 2 110 (base 9) to base 8 132 20 (base 10) to base 4 110 61 (base 9) to base 2 110111 -15 (base 7) to base 13 -c What is -1111 (base 3) in base 2? -101000 What is 1 (base 14) in base 11? 1 What is -6 (base 12) in base 9? -6 -72 (base 12) to base 5 -321 What is -11 (base 16) in base 12? -15 What is 56 (base 14) in base 13? 5b Convert 5 (base 8) to base 13. 5 Convert 2110 (base 3) to base 6. 150 What is -5 (base 7) in base 10? -5 30 (base 6) to base 14 14 What is 4 (base 7) in base 12? 4 Convert 1 (base 3) to base 9. 1 11110010 (base 2) to base 13 158 Convert 10010 (base 3) to base 13. 66 What is 11 (base 12) in base 13? 10 -245 (base 10) to base 11 -203 Convert 45 (base 12) to base 11. 49 Convert 10 (base 3) to base 16. 3 Convert 3 (base 8) to base 12. 3 -1 (base 14) to base 8 -1 What is 54 (base 15) in base 16? 4f Convert -1e (base 16) to base 13. -24 Convert 100 (base 2) to base 12. 4 What is -210 (base 5) in base 4? -313 Convert 0 (base 13) to base 3. 0 12 (base 8) to base 11 a What is -4 (base 6) in base 5? -4 What is 12111 (base 3) in base 11? 125 13 (base 13) to base 4 100 -1 (base 6) to base 10 -1 What is 1 (base 11) in base 13? 1 34 (base 5) to base 9 21 0 (base 3) to base 9 0 7 (base 8) to base 10 7 612 (base 7) to base 6 1223 Convert -112 (base 5) to base 3. -1012 -6 (base 7) to base 10 -6 -13 (base 9) to base 3 -110 What is -2 (base 15) in base 12? -2 What is 110122 (base 3) in base 6? 1325 What is -20 (base 13) in base 12? -22 What is -64 (base 7) in base 6? -114 Convert -21 (base 6) to base 7. -16 Convert -2 (base 14) to base 4. -2 What is 8 (base 15) in base 10? 8 -110010 (base 2) to base 11 -46 Convert -6 (base 16) to base 11. -6 What is 34 (base 8) in base 5? 103 Convert 21 (base 10) to base 9. 23 What is -13 (base 8) in base 12? -b 1 (base 16) to base 10 1 -ee (base 16) to base 6 -1034 What is 4 (base 13) in base 16? 4 -32 (base 4) to base 2 -1110 4 (base 14) to base 10 4 What is -111111 (base 2) in base 10? -63 Convert -6 (base 9) to base 5. -11 What is 68 (base 13) in base 15? 5b What is 75 (base 15) in base 5? 420 What is 2013 (base 5) in base 12? 196 Convert 9 (base 10) to base 14. 9 Convert 0 (base 9) to base 2. 0 Convert -100 (base 2) to base 10. -4 -1 (base 8) to base 9 -1 What is -5 (base 12) in base 15? -5 5 (base 9) to base 14 5 What is -63 (base 9) in base 7? -111 What is a (base 11) in base 12? a Convert -43 (base 11) to base 13. -38 What is -30 (base 6) in base 9? -20 -2 (base 3) to base 2 -10 Convert -78 (base 9) to base 14. -51 -85 (base 15) to base 13 -98 What is 12 (base 6) in base 5? 13 -5 (base 10) to base 3 -12 3 (base 6) to base 14 3 -100011 (base 2) to base 5 -120 What is 8 (base 10) in base 6? 12 What is 2 (base 13) in base 2? 10 -10 (base 3) to base 6 -3 Convert -32 (base 7) to base 3. -212 -111100 (base 2) to base 16 -3c 7d (base 16) to base 3 11122 136 (base 14) to base 15 114 What is -3 (base 16) in base 4? -3 10 (base 5) to base 13 5 Convert -3 (base 7) to base 5. -3 What is 3 (base 8) in base 11? 3 What is 43 (base 5) in base 10? 23 -1 (base 8) to base 9 -1 Convert -43 (base 15) to base 4. -333 -10 (base 6) to base 15 -6 What is -8 (base 11) in base 8? -10 What is 4 (base 8) in base 14? 4 11 (base 10) to base 8 13 -1122 (base 3) to base 15 -2e What is -2 (base 4) in base 11? -2 Convert 33 (base 11) to base 3. 1100 -33 (base 8) to base 16 -1b What is 1 (base 10) in base 14? 1 -36 (base 7) to base 5 -102 Convert 110 (base 3) to base 7. 15 17 (base 12) to base 3 201 What is -1 (base 8) in base 13? -1 18 (base 16) to base 6 40 Convert -75 (base 13) to base 11. -88 1010101 (base 2) to base 5 320 Convert 4 (base 7) to base 4. 10 Convert -10 (base 8) to base 7. -11 What is 310 (base 4) in base 16? 34 What is 1111010 (base 2) in base 7? 233 30 (base 6) to base 11 17 3 (base 9) to base 4 3 What is -b (base 14) in base 7? -14 What is 2100 (base 3) in base 7? 120 Convert 2 (base 7) to base 6. 2 -18 (base 16) to base 14 -1a What is 1 (base 3) in base 6? 1 What is 453 (base 8) in base 11? 252 What is -2 (base 14) in base 6? -2 What is -4 (base 14) in base 8? -4 What is -32 (base 4) in base 16? -e Convert 422 (base 6) to base 2. 10011110 Convert 3 (base 9) to base 7. 3 Convert 86 (base 11) to base 14. 6a -1 (base 2) to base 7 -1 a (base 14) to base 12 a What is -184 (base 14) in base 9? -376 -13 (base 16) to base 6 -31 Convert -3 (base 7) to base 12. -3 -111 (base 2) to base 15 -7 What is 76 (base 13) in base 2? 1100001 What is -353 (base 7) in base 10? -185 Convert a4 (base 13) to base 7. 251 What is -322 (base 7) in base 6? -431 6 (base 14) to base 16 6 Convert -1001 (base 2) to base 10. -9 What is 20 (base 3) in base 14? 6 What is 0 (base 8) in base 16? 0 What is 5 (base 7) in base 8? 5 -110 (base 2) to base 15 -6 What is -243 (base 5) in base 15? -4d What is 3 (base 12) in base 16? 3 300 (base 4) to base 2 110000 Convert 9 (base 15) to base 7. 12 -10001 (base 2) to base 16 -11 What is -35 (base 6) in base 10? -23 What is 2 (base 10) in base 12? 2 What is -1 (base 8) in base 5? -1 What is 2 (base 12) in base 6? 2 Convert 5 (base 14) to base 3. 12 122 (base 3) to base 15 12 What is -54 (base 15) in base 14? -59 3212 (base 4) to base 16 e6 Convert -12 (base 14) to base 9. -17 -11 (base 6) to base 3 -21 Convert -10 (base 3) to base 11. -3 What is 26 (base 14) in base 15? 24 19 (base 14) to base 11 21 Convert 11 (base 5) to base 13. 6 What is -10010111 (base 2) in base 12? -107 -1110 (base 2) to base 16 -e 7 (base 14) to base 5 12 What is -106 (base 8) in base 10? -70 Convert 22 (base 11) to base 12. 20 What is -6 (base 8) in base 4? -12 -20 (base 3) to base 6 -10 Convert 104 (base 7) to base 14. 3b What is -25 (base 12) in base 11? -27 -11 (base 9) to base 16 -a -3 (base 16) to base 7 -3 85 (base 13) to base 2 1101101 99 (base 15) to base 12 100 -7 (base 16) to base 9 -7 2 (base 9) to base 4 2 What is 10100 (base 2) in base 6? 32 Convert -61 (base 13) to base 11. -72 6 (base 9) to base 10 6 Convert 13c (base 14) to base 2. 11111010 13 (base 6) to base 9 10 What is 15 (base 7) in base 6? 20 What is -1 (base 13) in base 3? -1 -28 (base 10) to base 11 -26 What is -1 (base 4) in base 2? -1 What is -9 (base 15) in base 8? -11 What is -22 (base 4) in base 3? -101 What is -414 (base 6) in base 13? -bb Convert 3 (base 8) to base 7. 3 What is 35 (base 8) in base 5? 104 Convert 3 (base 16) to base 3. 10 Convert -5 (base 11) to base 9. -5 What is -122 (base 4) in base 10? -26 -d (base 16) to base 14 -d Convert 415 (base 9) to base 11. 288 What is -44 (base 7) in base 6? -52 Convert 5 (base 14) to base 11. 5 What is 1b (base 12) in base 3? 212 What is 12010 (base 3) in base 6? 350 -3 (base 4) to base 9 -3 What is 19 (base 16) in base 9? 27 What is -1b (base 14) in base 15? -1a What is -12111 (base 3) in base 13? -b5 Convert 34 (base 10) to base 2. 100010 Convert -a (base 14) to base 9. -11 Convert -1 (base 15) to base 12. -1 What is -164 (base 8) in base 16? -74 Convert 11 (base 2) to base 14. 3 Convert -111000 (base 2) to base 13. -44 What is 21 (base 6) in base 16? d What is -1 (base 12) in base 7? -1 3 (base 7) to base 2 11 -18 (base 9) to base 5 -32 Convert 2 (base 13) to base 4. 2 What is 102 (base 11) in base 14? 8b Convert 330 (base 6) to base 2. 1111110 -19 (base 11) to base 7 -26 -3c (base 15) to base 7 -111 Convert 0 (base 16) to base 5. 0 What is d (base 15) in base 3? 111 Convert 15 (base 8) to base 16. d
Suppose -4h = -3h - 11. Let d = -10 + h. Which is the nearest to -0.2? (a) 5 (b) d (c) -5 b Let p = 4 + -3. Let u = 7.04 + -7. Let z = u - -0.46. What is the nearest to -1 in p, 2/11, z? 2/11 Suppose -2y = -2t, -4t + 2y - 2 = -y. Let w be t2/(-8)-2. Which is the closest to -0.1? (a) w (b) 1 (c) 0 c Let u = -0.5 - -0.1. Suppose -2x = 4d + 22, 2d + 2x + 13 - 1 = 0. Which is the closest to u? (a) -0.5 (b) d (c) -3 a Let t = -0.08 - -0.28. Let u = -5 - -4. Which is the nearest to 2/5? (a) u (b) -5 (c) t c Let w = -14 - -14.2. Let y = w + 4.8. Which is the closest to 0.1? (a) -3 (b) -4 (c) y a Let s be (1 + (-8)/6)/(5/30). Which is the closest to s? (a) 2 (b) -1/2 (c) 0.4 b Let q = 0.3 - -0.7. Suppose -4o + 5o = 3l - 15, -5l = -o - 25. Suppose -5s = -f, 0s + 5s - 2f = l. Which is the closest to s? (a) 2 (b) q (c) 1/7 c Let f = -2 + -1. Let z be (-2)/7 + f/14. Which is the nearest to -0.1? (a) 0.5 (b) 1/4 (c) z b Let h = -0.511 - -0.011. What is the closest to -0.1 in h, -11, 1? h Let m = -54 + 380/7. Let d = 38/33 + -158/99. Which is the closest to m? (a) -5 (b) d (c) 1/7 c Let r = -3.9 - -4. Let o = 2 - 0. Let v be o/6 + (-2)/(-3). Which is the nearest to 1/2? (a) 1/8 (b) r (c) v a Let h = -23 + 20. Suppose 3q + 0q = 6. Let x = 2 - 7. Which is the closest to -3? (a) q (b) h (c) x b Let x = -50.5 - -50. What is the nearest to 1/5 in x, 0.09, 4? 0.09 Let r = 61 - 60.7. Let s(h) = h + 1. Let g be s(-2). What is the closest to g in r, -2, 2/17? -2 Let y(p) = -2p - 8. Let o be y(-6). Let i be (-1)/2o/(-10). What is the nearest to -1 in 1/3, 1, i? i Let m = 0.042 - -0.058. Which is the nearest to m? (a) 0 (b) 4/3 (c) -4/7 a Let p be 4/6(-3)/(-5). Let r = 57 + -57.2. What is the closest to p in r, 0, -1/4? 0 Let o be 51/(-126) - 2/21. What is the closest to o in -12, -3/4, 1? -3/4 Let n be (-28)/24(-12)/21. What is the closest to 1 in 0, n, 3/5? n Let x(l) = -4l2 + l + 1. Let k be x(-1). Let t = 8 - 8.1. Which is the closest to 0? (a) k (b) 0.5 (c) t c Let n = 16 - 15.91. Let h = n - -0.91. What is the closest to -2/7 in h, 0.4, -3? 0.4 Let c = 14 + -16. Let k = 0.05 - 2.05. Let s = k + -1. What is the nearest to 2 in 4, s, c? 4 Let d(l) = -l3 + 6l*2 + 6l + 8. Let q be d(7). Let z = -55 + 50. Let k = 0.3 + -0.2. Which is the closest to k? (a) -4/3 (b) q (c) z b Let m = 1284/7 - 184. Which is the nearest to -0.1? (a) 0 (b) 0.2 (c) m a Let o be (-5)/3 - ((-949)/78 - -12). Let u = 1 - 1.5. What is the nearest to 0.2 in -3, u, o? u Let r = 0.153 + -0.153. Let s = 0.1 + -0.5. Which is the closest to r? (a) -0.5 (b) s (c) 5 b Let g = -1.73 - 1.27. Let d = -2 - -5. Let t = d - -2. Which is the nearest to g? (a) t (b) 2/17 (c) 1 b Let j = -5 + 5.2. Let w = j + 0. Which is the nearest to -0.1? (a) -2/7 (b) -5 (c) w a Let h = -0.3 + 0.16. Let b = h + -0.06. Let d = -2 + 1.7. What is the closest to -1 in 2/13, d, b? d Let u be -62/(-16) + -1. Let r = -81 + 84. What is the nearest to u in -0.1, 0, r? -0.1 Let i = -6.14 + 0.14. Let y = -6 - i. What is the nearest to y in 1/2, -0.4, 0.2? 0.2 Let s = 0.2 - 0.2. Let j = -22.7 + 17. Let h = j + 6. Which is the nearest to -0.2? (a) s (b) -0.5 (c) h a Let h = -2 + 4. Let v = -1 - -0.9. Let r = 171 - 167. What is the nearest to v in r, -2/3, h? -2/3 Let u = -28 + 28.4. Which is the closest to 0.1? (a) -1 (b) -3 (c) u c Let x = 0.06 + -0.26. What is the nearest to 1 in 1, 0, x? 1 Let i = 17 - 49/3. What is the closest to i in 0.7, -0.1, 4? 0.7 Let i = 2.3 - 1.54. Let n = i - -0.24. Let s = 4 - 8. Which is the nearest to 0.1? (a) n (b) s (c) -1/9 c Let t = 3.9 - 0.9. Let p be (-1)/2(-2)/8. Which is the closest to 2/11? (a) -4 (b) t (c) p c Let l = -7.3 + 7. Let p = l - -0.2. Let y = 0 + p. Which is the closest to 0? (a) -2 (b) y (c) 0.5 b Let v be (-7)/(-30) - 20/50. Which is the closest to v? (a) 2/11 (b) 0 (c) 2/13 b Let m(h) = -7h2 + 3h + 6. Let p be m(-3). Let y be (p/15)/2 + 2. Let s = 0.1 + 0.1. Which is the nearest to -0.1? (a) -3/2 (b) s (c) y c Let u = 0.15 + -0.05. Let h = -0.17 + 0.17. What is the nearest to u in 3/4, h, -2? h Let p = -65 + 64. Let j = 1/27 - 61/189. Let b be -2(-2)/122. What is the nearest to b in p, j, -4/3? j Let g = 147 + -147. Let k = -0.9 + 1. Which is the nearest to k? (a) 5 (b) g (c) -0.2 b Let x = -5.12 + 0.12. Let u = x + 5.1. What is the closest to -4 in 3, -1/2, u? -1/2 Let s = 97 - 97. Let t = 10 + -48/5. Which is the closest to t? (a) -4/9 (b) s (c) -3 b Let x be (0 - (-1)/4-2)-8. What is the closest to -0.2 in -1/2, 3, x? -1/2 Let l be ((-3)/1 + 0)1. Which is the closest to 1? (a) 4 (b) l (c) 0.2 c Let j = 10 + -1. Let z = j - 6. What is the closest to 1 in z, 0.4, -4/5? 0.4 Let v = -6 - -6. Let f = -0.36 + v. Let n = f + 0.06. What is the closest to 0.2 in 2, n, -3? n Let r = -7.2 + -1. Let m = 4 + r. Let y = m + 4. What is the nearest to y in 2, 4, -2? -2 Let g = 0.08 - 0.38. Which is the nearest to 2/5? (a) -0.05 (b) g (c) 1/4 c Let p = 0 - 1. Let i = -0.7 - p. What is the closest to 2 in i, -4, -0.5? i Let v = 0 - -1.5. Let q = -1.9 - -3.9. Let u = v - q. Which is the nearest to -1? (a) u (b) 0 (c) 0.4 a Let g = -0.1 + 0.1. Let l = -2.1 - -1.97. Let d = l + -0.37. What is the nearest to -0.2 in d, g, -5? g Let o = 0.01 + 0.09. Suppose 2 - 6 = q. What is the closest to 1 in 1, o, q? 1 Let x be 8/912/16. Which is the nearest to x? (a) -2 (b) -0.2 (c) 3 b Let s = 0.01 + 0.01. Which is the nearest to 1? (a) 0.5 (b) s (c) -0.2 a Let g(w) = -w*2 - 6w - 6. Let o be g(-4). Let a be (o - 3)(2 - -1). What is the nearest to -5 in -1/3, a, 0.3? a Let k be 3/1575/20. Let u = -0.1 - 0.3. Which is the nearest to -1? (a) u (b) k (c) -1 c Let m = -199/95 - -11/5. Which is the nearest to 0.1? (a) -1 (b) -2.2 (c) m c Let z = 0.4 + -0.7. Let o = -5 + 5.4. Let w = o + z. What is the nearest to 1 in w, -4, -1? w Let s be ((-2)/4 + -1)-6. Let d be (12/s - 2)3. What is the closest to d in -2, 2/11, -1/3? -2 Suppose -8 = 4d - b, 20 = 2d - 6d + 4b. Let v = 1.1 - -3.9. What is the nearest to d in v, 0.2, -5/4? -5/4 Let t = -29 - -25.95. Let q = -3 - t. Let s = -3.05 + q. Which is the nearest to -1? (a) 4/5 (b) s (c) -4 a Let z = 0.5 - 1. Let s = -3.964 - 0.036. Which is the closest to 0.1? (a) -0.1 (b) z (c) s a Let c = -5.01 - -0.01. Let r = -5.03 - c. Let z = r + -0.27. What is the closest to 0.2 in 3, z, 4/5? z Let q = -3.16 + 1.16. Which is the nearest to q? (a) 3/5 (b) 1 (c) 0.1 c Let g = -6/13 - -5/39. Suppose 3f - m = -1, 0m + 4m + 30 = -5f. Which is the nearest to 1? (a) -1/7 (b) g (c) f a Let r = 73/4 - 18. Let m be (-55)/(-15) + (-2)/(-6). Let s be m(42/44 - 1). What is the closest to s in r, -2/13, 2/3? -2/13 Let r = 22 - 15. Suppose -r = 5j + 3. Which is the closest to 1/2? (a) -1 (b) j (c) -0.1 c Let y be (-133)/539 - (-6)/14. What is the nearest to -1 in y, -3/8, 2/7? -3/8 Suppose -3a = 5q - 5, 2a + 14 = -0q + q. Suppose o - 7 = r, o + 24 = -qr + 3o. What is the nearest to -2 in 2/9, r, 0? 0 Let r = -1.4 - -1.7. Let f be 2/((-6)/(-2) + -12). Let y be ((2/2)/(-1))/(-1). What is the nearest to -2/3 in r, y, f? f Let r = 0.4 + -0.8. Let m = -0.1 + r. What is the closest to -1 in m, 2, 0? m Let z = -82.98 - -82. Let n = z + -0.02. Which is the closest to 1? (a) 5 (b) n (c) -4 b Let b be -3(-2)/6(-2)/1. What is the closest to 1 in b, 2, -9? 2 Let r = -7 + 14. What is the closest to 0 in 1, r, 0? 0 Let j = 1.1 - 3.1. Let t be -3 - (-21)/27 - -2. What is the nearest to -3 in 2, j, t? j Let w = -0.9 + -0.1. Let z = w - -0.6. Which is the nearest to 2/3? (a) 1/2 (b) 0 (c) z a Let l = -1 - 0. Let b = -0.13 + 0.03. What is the closest to l in -2/7, -4, b? -2/7 Let d = 1.1 - 0.1. What is the nearest to -7 in d, 4/5, -1/3? -1/3 Let j be (0 + 3/78)/1. Let p = -55/78 + j. Which is the closest to -2/7? (a) 3/2 (b) p (c) 4 b Suppose -5j + 2g + 19 = 3g, 4g - 28 = -4j. Which is the nearest to -2/7? (a) -2/3 (b) -5 (c) j a Suppose 3v = 3 + 3. Suppose 0f + 2f = 5c + 18, vf = 8. What is the closest to -0.1 in -5, c, -1/2? -1/2 Let n = 6/119 + -40/119. Let w = 0.9 - -0.3. Let i = -1.6 + w. What is the closest to -2/5 in n, 5, i? i Let v = 0.1 + 0.4. What is the closest to -0.2 in v, 2/9, -2/7? -2/7 Let m = -0.1 - -3.1. Let p = -3.2 + m. What is the nearest to -0.1 in -5, 2, p? p
Let q = 7 - 9. Let i be (-7)/(-4) + q/4. Find o such that 0 + 9/4o2 + io*4 - 1/2o - 3o3 = 0. 0, 2/5, 1 Let f be (9/12)/((-1)/128). Let r be ((-10)/(-6))/((-56)/f). Factor rc*2 + 2/7 - 10/7c + 10/7c4 - 2/7c*5 - 20/7c*3. -2(c - 1)5/7 Let f(n) = -n2 - n + 1. Let m(s) = 6s2 + 58s - 154. Let y(u) = -10f(u) - m(u). Factor y(t). 4(t - 6)*2 Factor -2 - 8l*3 - 6 + 8 + 4l*2. -4l*2(2l - 1) Suppose 8 = -17w + 21w. Let s(j) be the first derivative of -3/10j*w - 2/5j - 1/15j3 - 1. Factor s(z). -(z + 1)(z + 2)/5 Let p(s) be the third derivative of s8/112 + s7/70 - 8s2. Factor p(y). 3y*4(y + 1) Let i(v) be the first derivative of -v5/330 + v4/66 - v3/33 - v2 + 3. Let g(u) be the second derivative of i(u). Solve g(r) = 0. 1 Let v be (10/18)/((-35)/(-42)). Determine r so that r - v - 1/3r2 = 0. 1, 2 Let l(m) be the first derivative of -m3 + 3m*2 + 24m + 34. Factor l(b). -3(b - 4)(b + 2) Let 14/15m + 6/5m*3 + 2/15 + 2m*2 = 0. What is m? -1, -1/3 Suppose -4r - 29 = -5f, -9 = 5r - 3f + 11. Let x = r - -4/3. Factor 1/3z - xz4 + 2/3z*2 + 1/3z*5 - 2/3z3 - 1/3. (z - 1)3(z + 1)2/3 Let o(c) = 13c*3 - 11c*2 + 24. Let l be 7/(-32/(-6)). Let d(t) = -9t3 + 7t*2 - 16. Let v(p) = ld(p) + 5o(p). Factor v(m). 2(m - 2)*2(m + 1) Let r = 167/10 + -33/2. Let z(i) be the first derivative of 0i - ri*2 + 1/10i*4 - 2/15i*3 - 1 + 2/25i*5. Find l such that z(l) = 0. -1, 0, 1 Let v be -1 - (2 - (2 + 0)). Let o be (v/5)/(6/(-10)). Factor -ou*2 - 1/3 + 2/3u. -(u - 1)*2/3 Let u(g) be the second derivative of 0g*3 - g + 1/6g*4 + 1/5g*6 + 1/21g*7 + 0 + 3/10g*5 + 0g*2. Factor u(n). 2n*2(n + 1)*3 Let m = 9 - 5. Factor 2d*4 - 4d*4 + md + 4 + 6d3 - 2d*2 - 10d. -2(d - 2)(d - 1)*2(d + 1) Let p = 343/795 - 5/159. Factor -2/5g5 - 4/5g*3 + 6/5g*4 + 6/5g - 4/5g2 - p. -2(g - 1)*4(g + 1)/5 Let g = 2494/5 + -497. Factor 3q2 + gq*4 - 3/5q - 21/5q3 + 0. 3q(q - 1)2(3q - 1)/5 Suppose -3z = -b - 14 + 4, -z = 3b - 10. Factor -2/9k*b - 2/9k + 2/9k3 + 0 + 2/9k*4. 2k(k - 1)(k + 1)*2/9 Factor -12 - 16t + 2t2 + 3t*2 + 11t*2 - 20t*2. -4(t + 1)(t + 3) Let j = -17 + 20. Let d(i) be the third derivative of 2/3i*3 + 0 + 1/60i*5 - 1/6i*4 + ji*2 + 0i. Find p such that d(p) = 0. 2 Factor -1/4z + 1/4z*3 - 1/4z*4 + 0 + 1/4z*2. -z(z - 1)*2(z + 1)/4 Let k = 24 - 23. Suppose 6l2 + k - 3 + 3 - 10l - 5 = 0. Calculate l. -1/3, 2 Let v(w) be the third derivative of -w6/60 - w5/15 + 61w2. Factor v(j). -2j*2(j + 2) Let o be (5 - 1)/(21). Suppose -4 = -3i + o. Factor 18r2 + 22r - 1 + i + 3. 2(r + 1)(9r + 2) Suppose 5u - 1 = 14. Let t(v) be the second derivative of 1/3vu + v2 - 1/10v*5 - 1/6v*4 - 2v + 0. Factor t(x). -2(x - 1)(x + 1)2 Let j(t) be the first derivative of -t5/70 + t4/14 - t3/7 + t*2/7 - 2t - 3. Let r(w) be the first derivative of j(w). Factor r(x). -2(x - 1)3/7 Factor 12 - 10t*2 - 10t + 3t3 - 6t*2 + 3t*3. 2(t - 3)(t + 1)(3t - 2) Factor -54 - 36r*2 - 2/3r*4 - 72r - 8r3. -2(r + 3)*4/3 Factor -5/4m*3 - 5/2 - 25/4m - 5m2. -5(m + 1)*2(m + 2)/4 Let y(m) = m*2 + 26m + 120. Let r be y(-6). Factor -1/3c + 1/3c*2 + r. c(c - 1)/3 Let h be (18/15)/(176/(-60)). Let q = h + 21/11. Factor 7/2r3 - 3/2r - 1 + 3/2r4 + qr2. (r + 1)3(3r - 2)/2 Let k(g) be the third derivative of 1/48g4 - 1/840g*7 - 1/48g*5 + 1/120g*6 - 6g*2 + 0 + 0g + 0g3. Determine u so that k(u) = 0. 0, 1, 2 Let b be ((-2)/3)/(8/(-36)). Let -1 + 4 - 3 + w - wb = 0. Calculate w. -1, 0, 1 Let b(d) = 5d*2 + 105d + 690. Let l(s) = -s - 2. Let f(n) = -b(n) + 15l(n). Suppose f(a) = 0. What is a? -12 Factor -55i*2 - 80i*3 + 5i*4 - 6i - 40i4 - 4i. -5i(i + 1)*2(7i + 2) Let t be (3 - 0)/((-19)/((-418)/33)). Solve -1/4 + 1/4m*t - 1/4m*3 + 1/4m = 0 for m. -1, 1 Let k be (5 - 5) + 1 + 0. Suppose t - 5u - 5 = -0u, u = -2t - k. Factor -1/3s*3 + t - 1/3s*2 + 0s. -s*2(s + 1)/3 Let t(n) be the third derivative of -n7/70 + n6/5 - 3n5/4 - n4 + 8n*3 - 4n*2. Factor t(s). -3(s - 4)*2(s - 1)(s + 1) Suppose 3y*4 + 1 + 7y*3 - 13y*3 - 4 + 6y = 0. What is y? -1, 1 Let l(v) be the first derivative of v*6/9 + 2v5/15 - v4/6 - 2v3/9 + 2. Let l(z) = 0. What is z? -1, 0, 1 Let a = 44 + -42. Factor -2/3 + 4/3c - 2/3ca. -2(c - 1)*2/3 Suppose c + 9 = 2x, 0 = -0x + 3x + 5c + 6. Find a such that 8a*3 + 7a*x - 18a*3 - 3a2 - a4 - a = 0. -1, 0 Suppose 0 = 6r + 95 + 1. Let j(o) = -o3 - 16o*2 - o - 12. Let u be j(r). What is p in -1/5p*u - 3/5p*3 - 2/5p*2 + 0p + 0 = 0? -2, -1, 0 Let o(q) = -q*2 + q + 1. Suppose -h + 1 = 3. Let s be (h - -11)(-8)/6. Let g(r) = 10r2 - 14r - 12. Let j(i) = so(i) - g(i). What is y in j(y) = 0? -1, 0 Let g = 567/5 - 113. Determine z, given that 0z - 6/5z3 + gz*2 + 0 = 0. 0, 1/3 Let t(q) be the first derivative of -2q*3/21 + 3. Factor t(f). -2f*2/7 Suppose 6m - 5d = 2m + 19, -2d = -5m + 28. Suppose l - m = -l. Factor 3f3 - 4fl + f3 - 2f2 - 2f*3. -2f*2(f + 1) Let i(h) be the second derivative of h*6/30 - 3h5/20 + h4/4 - h*3/6 - 8h. Factor i(q). q(q - 1)3 Let s(d) = -15d*2 + 40d - 35. Let p(l) = 22l2 - 60l + 53. Let c(u) = -5p(u) - 7s(u). Factor c(h). -5(h - 2)2 Let q be -3 + (-2505)/(-27) + 0. Let w = 90 - q. Find a, given that 2/9a*2 + 0 - 2/9a*3 - 2/9a*4 + wa = 0. -1, 0, 1 Suppose 8z - 6z + 3z2 - 8z = 0. What is z? 0, 2 Suppose 4r - 4 = 4. Suppose 4m = 2f + 42, -2m + 20 - r = 2f. Suppose -4l + 3l2 + l2 + ml2 = 0. What is l? 0, 2/7 Let d(q) be the second derivative of -q6/80 + q*5/40 + 5q4/96 - q3/24 + 14q + 4. Factor d(c). -c(c - 2)(c + 1)(3c - 1)/8 Let d(q) = -q3 - 6q*2 + 15q - 6. Let t be d(-8). Let -1/2n + 5/4n*4 - 7/4n*5 + 0 + 9/4n*3 - 5/4n*t = 0. Calculate n. -1, -2/7, 0, 1 Let s(l) = -2l*2 - 2l - 13. Let o(d) = d - 6 - 2d - 4d*2 + 3d*2. Let x(v) = -13o(v) + 6s(v). Find q such that x(q) = 0. -1, 0 Suppose -3b = 2b + 15. Let m be 1 + (b + 2)/(-1). Solve 4v*2 - 4vm - v4 + v2 = 0. -1, 0, 1 Let i(q) be the first derivative of q6/2 + 21q5/5 + 57q*4/4 + 25q*3 + 24q*2 + 12q + 8. Factor i(v). 3(v + 1)3(v + 2)*2 Let p = -2 + 14. Find a, given that 10a*3 - 8a*2 + 21a*2 - 9a*2 + 2a*5 - 4a*4 + pa*4 = 0. -2, -1, 0 Factor 28/5b - 2/5b2 - 98/5. -2(b - 7)2/5 Let i(w) = w2 + 2w + 3. Let l be i(-2). Suppose 4t + 4 + 18 = 3k, 14 = -k - 4t. Determine s so that 0s + 2/5s*k + 0 + 0s*l - 2/5s*4 = 0. -1, 0, 1 Let j = -16 - -19. Let p(x) be the first derivative of -4/3x - j - 8/9x3 + 5/3x*2 + 1/6x*4. Factor p(c). 2(c - 2)(c - 1)2/3 Let x(j) be the second derivative of 2j*6/75 - 7j5/25 + j4 - 6j3/5 - 25j. Factor x(l). 4l(l - 3)*2(l - 1)/5 Let d(k) = -10k2 + 20k - 10. Let h(n) = 2n2 - 4n + 2. Let y = 2 + -5. Let m(q) = yd(q) - 14h(q). Factor m(o). 2(o - 1)2 Let y = 203 + -2231/11. Let -yo*2 + 0 - 4/11o = 0. What is o? -2, 0 Let l(u) be the second derivative of u*7/42 + 11u6/180 + u5/40 - u4/24 - u3/36 - 7u. Determine w so that l(w) = 0. -1, -1/3, 0, 1/2 Suppose 0i + 3i - q = -1, q = -4i + 1. Let r be (-1)/(-3)(2 + 0). Factor -rz*4 + 1/3z*5 + iz*3 - 1/3z + 0 + 2/3z2. z(z - 1)*3(z + 1)/3 Let j(a) be the third derivative of -a*6/30 - 2a5/45 + a4/18 - 6a2. Factor j(w). -4w(w + 1)(3w - 1)/3 Let u(w) be the first derivative of w4/16 + 7w3/12 + w2 - 4w + 31. Let u(q) = 0. Calculate q. -4, 1 Let b(j) be the third derivative of 10j*7/21 - 19j*6/6 + 38j*5/5 - 26j*4/3 + 16j*3/3 + 5j*2. Determine h so that b(h) = 0. 2/5, 1, 2 Let x be (2 - -1)20/(-6). Let l be x/(-2 + (2 - 1)). What is q in -lq2 + q + 0q - 5q + 14q*3 = 0? -2/7, 0, 1 Suppose 0 = -10w + 5w + 10. Let v(f) be the first derivative of 0f + 0f3 + 1/10f*2 + w - 1/20f*4. Factor v(c). -c(c - 1)(c + 1)/5 Let j(z) be the third derivative of -z5/120 + z4/48 + z3/2 - 25z*2. Let j(q) = 0. Calculate q. -2, 3 Determine p so that 1/3p*3 + 1/3 - 1/3p*2 - 1/3p = 0. -1, 1 Let y(t) = t*2 + 3t - 1. Let m be y(-4). Let a be 2/(-9) - (-58)/18. Find q, given that qa - q3 - q + q**m = 0. -1, 0, 1
Simplify (f(f/f1)/ff)(-2/81)/(f(-2/5)f/f(-3/4)f) assuming f is positive. f(-3847/1620) Simplify h6hh*(-3/5)(hh(3/4))/h0 assuming h is positive. h(163/20) Simplify (i(-7/6))(-21) assuming i is positive. i(49/2) Simplify (i5)26 assuming i is positive. i130 Simplify (oo/o(2/5))/o(-2/17) assuming o is positive. o(146/85) Simplify (u14)32 assuming u is positive. u448 Simplify ((p/((p/(p/p*(1/56))p)/p))/pp)/p33 assuming p is positive. p(-1793/56) Simplify ooo/(o(-24)/o)oo(-2/79)o assuming o is positive. o(2368/79) Simplify (v(7/6)/v)/v(-14/9) assuming v is positive. v(31/18) Simplify (ii(8/19)i)/(i/(i/i(1/4))) assuming i is positive. i(165/76) Simplify ((w(-1/3)/w)25)(-15) assuming w is positive. w500 Simplify ((a/(a*(-3/4)a))/(a*(-4/9)aaa))/(a/a*0a)7 assuming a is positive. a(-569/36) Simplify (r/(rr/(r/(rr/(rr(-1/3)))rr)r))*(9/7)r*(-2)/rr/(rrr(1/7)) assuming r is positive. r(-32/7) Simplify (zzz*(-10))/zz*(2/3)((zzz(z2/z)/z)/zz)(19/2) assuming z is positive. z(121/6) Simplify (j0)(3/49)/(j/(jjj(-1)))(-37) assuming j is positive. 1 Simplify (x(-2/3)/x(-1))/((xx(-2)x)/x)(-9/10) assuming x is positive. x(-17/30) Simplify b*(-6)(bb(-5))/bbb((b/(b/(b/((bb/(b1b))/b)b))b)/b)(-5/6) assuming b is positive. b(-23/2) Simplify ((q5)(-1/2))3 assuming q is positive. q(-15/2) Simplify (x(x/x(2/5))/x)(4/13)/(x0/(xx*4x)) assuming x is positive. x(402/65) Simplify ((i(-1)/i)(1/5))(1/42) assuming i is positive. i(-1/105) Simplify (j(-2))(-1/6) assuming j is positive. j(1/3) Simplify aa(-7/6)aa19a assuming a is positive. a(125/6) Simplify (j(3/7)/(jj6))(1/30) assuming j is positive. j(-23/105) Simplify (c(-2)c(cc(3/7))/c)(-42) assuming c is positive. c*24 Simplify (yy*6yyy*(-2/19)/y)/(y(y/((y(-1)/y)/y))/y)(-49) assuming y is positive. y(3874/19) Simplify (x(-1))(-2/27)/(x(1/4))(2/57) assuming x is positive. x(67/1026) Simplify (f*1ff5)/(f3f/f(-6/5)) assuming f is positive. f(9/5) Simplify (((g/g6)/g)/g(1/3))24 assuming g is positive. g(-152) Simplify (z13)23 assuming z is positive. z299 Simplify ((g(-10)/g)/(g/g(-6)))(-1/12) assuming g is positive. g(3/2) Simplify (r/(r/r1)r/(rr(r/(((rrr5r)/r)/r)rr)/r))/(r*(-3)r/(r*9r)) assuming r is positive. r16 Simplify (y/(y/y(-1/2)))*30/(y/((yy/y*(1/3))/y)yyy)(16/9) assuming y is positive. y(-565/27) Simplify (yy50)/y(-5/8) assuming y is positive. y(413/8) Simplify (((bb/(bb(-2/3)/b)bb)/b)/b)/(bbb1b)(bb/b0)(-44) assuming b is positive. b*(-268/3) Simplify l/(((ll*7)/l)/ll)(ll8)/l assuming l is positive. l2 Simplify y*(-3/4)y*(-2/13)y/(y/(yyy/(y/(y/y*4))yy))yyy*0y assuming y is positive. y*(161/52) Simplify f/(ff*18ff)f(-15) assuming f is positive. f(-35) Simplify ((b/b*(-2)b)/b)/((bb9b)/bb)(b/(bb(-2)))/((b/(b1/b))/b) assuming b is positive. b(-6) Simplify (f1)(2/67)f*(2/7)f(1/2) assuming f is positive. f(765/938) Simplify m*5mm15 assuming m is positive. m21 Simplify ((y0/y)/y)(16/9)/((yy((yy*(-4))/y)/yy)/(y(y4yy)/y)) assuming y is positive. y(40/9) Simplify ((m(-9)/m)/m)/(m(m((m/(m5/m))/m)/m)/m) assuming m is positive. m(-7) Simplify (dd(1/2))(-2)/(d(2/3))(-27) assuming d is positive. d*15 Simplify (g(g/(g/((g/g*3)/g)))/gg(-1/5)/g)/(g(-2/5)/g)(-6) assuming g is positive. g(-63/5) Simplify (mm(-20))/((m/m(-4/15))/m) assuming m is positive. m(-289/15) Simplify ((ww*(-2/13)w)/(w/((w/(w/w*5))/w)w))(-43) assuming w is positive. w(-2150/13) Simplify (r0)(-6)/(r/r*(2/5)r/(r/(rr(-1))r)) assuming r is positive. r*(2/5) Simplify kk*(-33)kk(-35) assuming k is positive. k(-66) Simplify p(-7/4)p12 assuming p is positive. p(41/4) Simplify ((z/(z1/z))(-5/7))(-6/7) assuming z is positive. z(30/49) Simplify (r/((rr(-2/21))/r)r)/(rrrr((r(rr/((rr(-10/7)r)/r))/r)/r)/r) assuming r is positive. r(-7/3) Simplify k0/(kkkk/(kk/(k/k*(-32))k)kk) assuming k is positive. k(-36) Simplify (h(-2/7)/(h(((hh*(1/9))/h)/hh)/h))/(h0)(-8/5) assuming h is positive. h*(-25/63) Simplify ((zz*(5/4)zz)/zz/(z/(z/z*(2/23))))/((zz*(1/4))/zzz(-1)z) assuming z is positive. z(67/23) Simplify r32/(r(-8/5)/r) assuming r is positive. r(173/5) Simplify (n/(n(n/((n/((nn*(-7)n)/nn))/n))/n))/(n(1/3)n) assuming n is positive. n*(11/3) Simplify (ww*(-1/10))/(ww*(-7/4)w) assuming w is positive. w*(13/20) Simplify (mm*(-2)m)(-17/3)/((m/m(-1))/m)(-8/7) assuming m is positive. m(8/7) Simplify (((l/(l/l(-2)))/l)(6/7))(17/3) assuming l is positive. l(-102/7) Simplify ((s/s(-2/11))(1/52))(2/21) assuming s is positive. s(1/462) Simplify (k(10/7))(1/68) assuming k is positive. k*(5/238) Simplify ((vv/v*(-1/6))/(v/(vv*(-6))))/(v/(v((vv(5/3)/vv)/v)/v)v/(v1/v)) assuming v is positive. v(-25/6) Simplify hhh/h2hhh*(1/4)(h/h(3/5))(-6) assuming h is positive. h*(17/20) Simplify (ss*1s)*(4/31)s*(-3)ss0 assuming s is positive. s(-50/31) Simplify ((b/b2bb)/b)(5/19) assuming b is positive. 1 Simplify ((b/(bb*40bbb))/b)/b(-44) assuming b is positive. 1 Simplify h(4/7)h/(h/h(1/8)) assuming h is positive. h(39/56) Simplify s(-15)s/((s/(ss14))/ss)s assuming s is positive. s Simplify (r(-5)/((r/(r(-6)/r)r)/r))(16/7) assuming r is positive. r(-208/7) Simplify (p/(p/(p/((p(-1/2)/p)/p))))/p(3/5)p(-2/21)pp(-8/3) assuming p is positive. p(239/210) Simplify ((p42/p)/p)/((p(-5/4)/pp)/p) assuming p is positive. p*(169/4) Simplify ((tt(-2/9))/t6)(-1/16) assuming t is positive. t(47/144) Simplify (l*18ll)/(l(-4/11)/l) assuming l is positive. l(235/11) Simplify ((a(-3)/a)/(a/(aa*(1/14)a)))(1/14) assuming a is positive. a(-41/196) Simplify i9/i(4/11)(i(-1/2))(-31) assuming i is positive. i(531/22) Simplify ((((bb/(b*(1/2)/b))/bb)/b)/b)*(-16/11)(bb6)/((b/(b/(b/(b/((b/(b/b(2/5)))/b))b)))/b) assuming b is positive. b*(378/55) Simplify ((k(k/(k/k*(-1/3)))/kk)/k)/(k/(kk(-6))k)kk/k*(2/7)k/(kk(3/5)) assuming k is positive. k(-653/105) Simplify ((f(f/f*(-4/3)ffff)/f)(2/81))50 assuming f is positive. f(1900/243) Simplify (p(-8)/ppp9)9 assuming p is positive. p9 Simplify d/(((dd/(dd(-11/5)d)d)/d)/d)d(d(1/46)/d)/d assuming d is positive. d(-271/230) Simplify ((q/(qq(-1/6)))/q(2/19))/(q(-2/5))(-10/11) assuming q is positive. q(-379/1254) Simplify ((k(-2)/k)/k)/kk(k(kk(kk/(kkkk(3/2)kk)k)/kk)/k)/k assuming k is positive. k(-13/2) Simplify (f4/(ff(f/(f/f1f))/f))(-2/67) assuming f is positive. f(-6/67) Simplify ((y2/y)/y)(-4) assuming y is positive. 1 Simplify (x/x(-1))(-1/74)/(x/x*(-5)x*(3/2)x) assuming x is positive. x(-631/74) Simplify ((o0)(-13))29 assuming o is positive. 1 Simplify l*(-10/3)/(ll/((ll7ll)/l)l) assuming l is positive. l(8/3) Simplify (y/y(3/7))(-22) assuming y is positive. y(-88/7) Simplify ((j/j(8/3))/j)(2/3) assuming j is positive. j(-16/9) Simplify (x(-2)/x)/(xxx/x*(1/4)xx)(xx(1/2))/xx1 assuming x is positive. x(-25/4) Simplify (y/(yy/(yy*(-15/4))))/(y(yy(y*(-42)/yy)/y)/yy) assuming y is positive. y(145/4) Simplify (r3)38/(r(-2/5)/r(2/9)) assuming r is positive. r(5158/45) Simplify (m/(m/(m/((m/(m/(m/((m/(m/(mm(2/7))))/m))))/m))))(-23)mmm/m(2/7)mmm(-7) assuming m is positive. m(-223/7) Simplify ((p/p*(1/4)p)/(p/((p/p(1/2))/p)))/(p(-3)/(ppppp/p(1/3))) assuming p is positive. p(95/12) Simplify (mm/(mm(-14)))(-35) assuming m is positive. m(-525) Simplify (d/d(1/18))/dd/((d/(d/(dd(5/3))))/d) assuming d is positive. d(-13/18) Simplify (l/l(-4))/(l(2/13)l) assuming l is positive. l(50/13) Simplify (oo*(-1)o)*(-2/27)/((ooo(-7)/o)/(o/o8)) assuming o is positive. o(-29/27) Simplify a/a17(a(-8)/a)/a assuming a is positive. a(-26) Simplify (f/((f/f(-1/9))/f))(2/19) assuming f is positive. f(16/171) Simplify f4f(1/4)f*(-1)f(-4/9) assuming f is positive. f(101/36)
What is the r'th term of 2111608, 2111615, 2111622, 2111629, 2111636, 2111643? 7r + 2111601 What is the i'th term of -921453, -920525, -919597? 928i - 922381 What is the g'th term of -263520, -526915, -790290, -1053645, -1316980, -1580295? 10g2 - 263425g - 105 What is the s'th term of 347512, 695024, 1042536? 347512s What is the u'th term of 352662947, 705325899, 1057988863, 1410651845, 1763314851, 2115977887, 2468640959? u3 + 352662945u + 1 What is the m'th term of 1972362, 1972394, 1972440, 1972500, 1972574? 7m2 + 11m + 1972344 What is the c'th term of -602206, -2408643, -5419374, -9634399? -602147c2 + 4c - 63 What is the c'th term of 1846, 14816, 50042, 118648, 231758, 400496? 1854c3 + 4c*2 - 20c + 8 What is the m'th term of 788454, 788449, 788444, 788439, 788434? -5m + 788459 What is the a'th term of 21433, 42922, 64449, 86014? 19a*2 + 21432a - 18 What is the u'th term of 4263, 9085, 13897, 18699, 23491, 28273, 33045? -5u2 + 4837u - 569 What is the o'th term of -1381661326, -2763322653, -4144983980? -1381661327o + 1 What is the v'th term of 1302649, 1302636, 1302623, 1302610, 1302597? -13v + 1302662 What is the h'th term of 29743, 35066, 40389? 5323h + 24420 What is the p'th term of 222074, 222015, 221944, 221861, 221766? -6p*2 - 41p + 222121 What is the y'th term of 11463, 11394, 11271, 11094? -27y2 + 12y + 11478 What is the v'th term of 999321, 1998643, 2997963, 3997281, 4996597, 5995911? -v*2 + 999325v - 3 What is the l'th term of -243, -370, -439, -450, -403, -298, -135? 29l2 - 214l - 58 What is the s'th term of 40354, 80292, 120230, 160168, 200106, 240044? 39938s + 416 What is the x'th term of 15651, 30436, 43469, 53874, 60775, 63296? -146x*3 + 15807x - 10 What is the z'th term of 7056541, 28226085, 63508659, 112904263? 7056515z2 - z + 27 What is the p'th term of 4009, 7942, 14493, 23656, 35425, 49794, 66757? -p3 + 1315p*2 - 5p + 2700 What is the k'th term of -86140, -86161, -86196, -86245? -7k2 - 86133 What is the v'th term of -10246, -20753, -31532, -42583, -53906, -65501, -77368? -136v*2 - 10099v - 11 What is the h'th term of -25009, -24378, -23381, -22018, -20289, -18194, -15733? 183h2 + 82h - 25274 What is the z'th term of 610203, 610207, 610211, 610215, 610219, 610223? 4z + 610199 What is the u'th term of 27932823, 27932844, 27932865, 27932886, 27932907? 21u + 27932802 What is the i'th term of 540919, 540917, 540915? -2i + 540921 What is the z'th term of -23314, -31022, -43866, -61846, -84962? -2568z*2 - 4z - 20742 What is the y'th term of -13292, -12840, -12388, -11936, -11484, -11032? 452y - 13744 What is the j'th term of -3195, -2564, -1933, -1302, -671, -40? 631j - 3826 What is the x'th term of 26586, 53464, 80342, 107220, 134098, 160976? 26878x - 292 What is the b'th term of 18568, 38117, 57666? 19549b - 981 What is the n'th term of -2648493953, -2648493952, -2648493951, -2648493950, -2648493949, -2648493948? n - 2648493954 What is the z'th term of 1089, -19761, -76359, -186579, -368295, -639381, -1017711, -1521159? -2979z3 + 3z + 4065 What is the j'th term of -798336, -798375, -798414, -798453? -39j - 798297 What is the y'th term of -7295, -29223, -65773, -116939, -182715, -263095, -358073, -467643? y3 - 7317y*2 + 16y + 5 What is the v'th term of 4559, 4457, 4279, 3995, 3575, 2989? -5v3 - 8v*2 - 43v + 4615 What is the l'th term of 1785, 6069, 13211, 23217, 36093, 51845, 70479, 92001? l*3 + 1423l*2 + 8l + 353 What is the r'th term of 2670, 5679, 8750, 11883, 15078, 18335, 21654? 31r2 + 2916r - 277 What is the q'th term of -65707, -131484, -197261, -263038? -65777q + 70 What is the h'th term of 28791013, 28791015, 28791017, 28791019, 28791021? 2h + 28791011 What is the m'th term of 2048, 4099, 6178, 8285, 10420, 12583, 14774? 14m2 + 2009m + 25 What is the u'th term of 3756, 3682, 3566, 3408, 3208, 2966? -21u2 - 11u + 3788 What is the x'th term of 6114, 23854, 53226, 94230, 146866? 5816x2 + 292x + 6 What is the o'th term of 58262, 57568, 56876, 56186, 55498, 54812, 54128? o*2 - 697o + 58958 What is the x'th term of 3554039, 3553988, 3553937? -51x + 3554090 What is the o'th term of 5209, 5637, 6345, 7327, 8577, 10089, 11857? -o3 + 146o*2 - 3o + 5067 What is the d'th term of -12375, -12245, -11743, -10683, -8879, -6145, -2295? 31d3 - 87d - 12319 What is the o'th term of -133213, -131445, -129677, -127909, -126141? 1768o - 134981 What is the k'th term of -2984, -1787, -590? 1197k - 4181 What is the i'th term of 1660, 3167, 4630, 6049? -22i2 + 1573i + 109 What is the d'th term of 3194, 6213, 9232? 3019d + 175 What is the v'th term of 77680, 75367, 73050, 70729? -2v*2 - 2307v + 79989 What is the t'th term of -837, -3391, -9351, -20421, -38305, -64707, -101331, -149881? -284t3 + t2 - 569t + 15 What is the v'th term of 6860, 13252, 19172, 24620, 29596, 34100, 38132? -236v2 + 7100v - 4 What is the x'th term of -4232, -28374, -92342, -216050, -419412? -3319x3 + x2 - 912x - 2 What is the z'th term of 291826, 583682, 875572, 1167514, 1459526, 1751626, 2043832? 3z3 - z2 + 291838z - 14 What is the c'th term of -11439362, -22878730, -34318098, -45757466? -11439368c + 6 What is the b'th term of -40678, -162930, -366682, -651934, -1018686? -40750b*2 - 2b + 74 What is the l'th term of 74413, 147660, 220907, 294154, 367401, 440648? 73247l + 1166 What is the x'th term of -7074, -13878, -20728, -27618, -34542? x3 - 29x*2 - 6724x - 322 What is the z'th term of 1554, 3499, 5838, 8571, 11698, 15219? 197z2 + 1354z + 3 What is the r'th term of 67680156, 67680154, 67680152, 67680150, 67680148, 67680146? -2r + 67680158 What is the g'th term of 17484, 16996, 16508, 16020, 15532, 15044? -488g + 17972 What is the b'th term of 17231, 68818, 154813, 275228, 430075? 2b3 + 17192b*2 - 3b + 40 What is the x'th term of 704, 708, 700, 668, 600, 484, 308? -2x3 + 6x*2 + 700 What is the b'th term of 20546, 20356, 20042, 19604? -62b*2 - 4b + 20612 What is the b'th term of -14254, -28486, -42678, -56812, -70870, -84834? 3b3 + 2b*2 - 14259b What is the r'th term of -1420, -2222, -3084, -4012, -5012? -r*3 - 24r*2 - 723r - 672 What is the f'th term of -40013, -39544, -39071, -38594, -38113, -37628, -37139? 2f2 + 463f - 40478 What is the j'th term of -58590, -117173, -175734, -234267, -292766, -351225, -409638? j*3 + 5j*2 - 58605j + 9 What is the v'th term of -64392, -128940, -193486, -258030, -322572, -387112? v*2 - 64551v + 158 What is the i'th term of 2993, 6093, 9199, 12311, 15429, 18553? 3i2 + 3091i - 101 What is the v'th term of 225733, 225747, 225771, 225805, 225849, 225903? 5v2 - v + 225729 What is the x'th term of 1040, 1208, 1388, 1574, 1760, 1940, 2108? -x3 + 12x*2 + 139x + 890 What is the q'th term of 3168, 23062, 77048, 182172, 355480? 2841q3 + 7q + 320 What is the y'th term of 68279, 136469, 204663, 272861? 2y2 + 68184y + 93 What is the r'th term of -14482, -28448, -42386, -56296? 14r2 - 14008r - 488 What is the y'th term of -320, -279, -330, -479, -732, -1095? -y*3 - 40y*2 + 168y - 447 What is the t'th term of -265183, -530271, -795353, -1060429, -1325499, -1590563? 3t2 - 265097t - 89 What is the d'th term of 235010, 234755, 234500, 234245? -255d + 235265 What is the z'th term of -163375, -163279, -163183, -163087? 96z - 163471 What is the q'th term of 19652, 78737, 177256, 315209? 19717q2 - 66q + 1 What is the l'th term of -2092, -17425, -59040, -140077, -273676, -472977, -751120, -1121245? -2190l3 - l2 + 99 What is the c'th term of -35887046, -35887042, -35887026, -35886992, -35886934, -35886846, -35886722, -35886556? c3 - 3c - 35887044 What is the x'th term of 17146, 18129, 19112, 20095, 21078, 22061? 983x + 16163 What is the n'th term of 119780, 239546, 359322, 479108? 5n*2 + 119751n + 24 What is the v'th term of 5033, 20024, 44987, 79922, 124829? 4986v2 + 33v + 14 What is the j'th term of 704, 1968, 2992, 3656, 3840, 3424, 2288? -20j3 + 1404j - 680 What is the t'th term of -6117, -12597, -19093, -25605, -32133, -38677? -8t2 - 6456t + 347 What is the f'th term of 492, 799, 1252, 1857, 2620? f*3 + 67f*2 + 99f + 325 What is the w'th term of 11860, 47274, 106012, 187840, 292524? -39w3 + 11896w*2 - w + 4 What is the i'th term of -95788, -382820, -861206, -1530946, -2392040? -95677i**2 - i - 110
Suppose -4 = -3i + i. What is the remainder when i is divided by 2? 0 Let r be ((-12)/(-10) + 0)25. Let t = -19 + r. Calculate the remainder when t is divided by ((-4)/(-12))/((-2)/(-36)). 5 Suppose -m = 4m + 30. Let x(w) = -w + 1. What is the remainder when 19 is divided by x(m)? 5 Suppose 0 = -6s + 2s + 2m + 8, -5m = -4s + 8. Suppose sr + 0r - 33 = -3u, 4r + 2u - 70 = 0. Calculate the remainder when 34 is divided by r. 16 Suppose 3v = -2r + 8 + 15, -5r + 4v + 23 = 0. Let a(c) = -11c*3 + 2c*2 + 2c + 1. Calculate the remainder when a(-1) is divided by r. 5 Let j = 12 + 0. Let c(x) = -12x - 2. What is the remainder when c(-3) is divided by j? 10 Suppose -4w + 22 = -0l + l, 4w + 2 = 3l. What is the remainder when 40 is divided by l? 4 Suppose 4z = 1 - 9. Suppose -4u + 0u + 128 = 0. Calculate the remainder when u is divided by (z/6)/(8/(-408)). 15 What is the remainder when (-8)/(-48) - (-814)/12 is divided by 19? 11 Let c = 93 - -3. What is the remainder when c is divided by 14? 12 Suppose -3a + 10 = 91. Let u = a + 39. What is the remainder when 45 is divided by u? 9 Suppose -3n - 4y = -53, 3n - 2n - 31 = 2y. Calculate the remainder when 44 is divided by (n/(-4))/((-3)/12). 21 Calculate the remainder when -15 - -104 - (-2 - -2) is divided by 15. 14 Let h = 68 - 47. What is the remainder when 62 is divided by h? 20 Let l(j) = -j*2 + 12j + 9. Calculate the remainder when 162 is divided by l(8). 39 Let z(h) = h*2 + 4h + 10. Let b be z(-7). Suppose 5j = b + 34. Let m = 0 + j. What is the remainder when 24 is divided by m? 11 Let c(n) = 2n + 7. Let s be c(-5). Let a = s + 15. What is the remainder when 34 is divided by a? 10 Let l be (1 - 37) + (-2)/(-1). Let i be l/(-5) + 2/10. Suppose -if = 4a - 2f - 68, 76 = 5a + 4f. What is the remainder when a is divided by 7? 5 Let z(b) = -b - 6. Let n(u) = 4u + 19. Let p(l) = -3n(l) - 8z(l). What is the remainder when p(-7) is divided by 11? 8 Suppose 0 = -4x - 2p + 150, 0 = x - 4x - 4p + 125. Calculate the remainder when x is divided by ((-38)/3)/((-24)/2527). 16 Suppose -3u - 3i + 106 = i, u + 5i - 28 = 0. Calculate the remainder when u is divided by 13. 12 Suppose -1 = 3n + 5u - 23, 5u + 2 = 3n. What is the remainder when n is divided by 4? 0 Let g be -1(-2 - (8 - -1)). Suppose -2k + 5f = 21, 2k = 5k + 4f - 3. Let p = k + g. What is the remainder when 14 is divided by p? 6 Let y = 45 - 26. Let u = 0 + y. Calculate the remainder when 55 is divided by u. 17 Let o = 112 + -109. Let i = -2 + 12. What is the remainder when i is divided by o? 1 Let f = 9 - 7. Suppose -9 + 1 = -4y, fy = -4j + 64. Let h = j - 2. Calculate the remainder when 24 is divided by h. 11 Let s = 0 + 3. Suppose u - 3g + 4g = s, -5u = -2g - 8. Calculate the remainder when 3 is divided by u. 1 Let u be 0/(-4 - -2 - -1). Let s = u + 2. Calculate the remainder when s is divided by 1. 0 Let r(s) = s2 + 0s*3 - 6s*3 - 1 + 3s*3. Let d be r(-1). Calculate the remainder when -2 - (5 - d - 47) is divided by 11. 10 Suppose 5z - 2z = 6. Suppose t - 2 = -x, -5t = -4x - 0x - 10. What is the remainder when z is divided by t? 0 Calculate the remainder when 129 is divided by -263/(-18)3. 12 Suppose 0 = 5k - 0k - 4z, -z - 7 = -3k. Suppose -k = c - 36. Calculate the remainder when 63 is divided by c. 31 Let b = -11 + -3. What is the remainder when 10 is divided by (-2)/(b/6 - -2)? 4 Suppose -66 - 14 = -10b. Let g(k) = -k3 - 2k*2 - 5k - 2. Let t be (6/4)/((-1)/2). Calculate the remainder when g(t) is divided by b. 6 Let x = -10 - -33. Suppose 4l = -0z - 2z + 10, 4l - 4z - 28 = 0. Suppose -x - 33 = -ly. What is the remainder when 27 is divided by y? 13 Let h(j) = -j*2 - 2j. Let s be h(2). Calculate the remainder when 29 is divided by ((-10)/s)/(1/8). 9 Let w be ((-2)/(-4))/(1/4). Let d(q) = -q*2 - 2q + 6. Let l be d(-3). Suppose 7 = lr - w. Calculate the remainder when 4 is divided by r. 1 Suppose -4u + 0u = -316. What is the remainder when u is divided by 16? 15 Let g(u) = 19u + 2. Let y(v) = v*2 + 8v - 8. Let p(d) = -1. Let a(n) = 4p(n) - y(n). Calculate the remainder when g(3) is divided by a(-4). 19 What is the remainder when ((-62)/5)/(11/(-55)) is divided by 16? 14 Let u = 9 - 4. Suppose g - u = -1. Let x(c) = -c3 - 3c*2 - 2c + 2. What is the remainder when g is divided by x(-2)? 0 Let c(x) = x*3 + 5x*2 - 6x + 4. Let j be c(-6). Let z be j/(-18) + 276/27. Suppose -p + 23 + z = 0. Calculate the remainder when p is divided by 9. 6 Let z = -90 - -110. Calculate the remainder when 97 is divided by z. 17 Let d = 8 - 3. Suppose 0 = -5g + d, 0g = -4o + g + 315. Calculate the remainder when o is divided by 20. 19 Let z(n) = -4n - 6. Let w(c) = c*2 + 5c. Let p be w(-4). What is the remainder when 19 is divided by z(p)? 9 Let q(a) = 2a - 1. Suppose -w = -6 + 2. Suppose wf + 8 = -2x, 0 = x + x + 2f. Calculate the remainder when 13 is divided by q(x). 6 Calculate the remainder when 17 is divided by (-4)/(-6)216/16. 8 Let o(k) = -k2 + 16k - 10. Let w = 6 - -2. What is the remainder when o(4) is divided by w? 6 Suppose 3g - 28 = 2g. Let r(h) = -h*3 - 7h*2 - 7h + 4. What is the remainder when g is divided by r(-6)? 8 Let w = 4 - 0. Calculate the remainder when 38 is divided by -39(1 - w/3). 12 Let d be ((-4)/(-3))/(4/42). Suppose 0 = -3l + 25 + d. What is the remainder when l is divided by 7? 6 Let f(l) = -3l + 1. Let x be f(-4). Let o = x + -6. Calculate the remainder when o is divided by 3. 1 Suppose q + g - 15 = 0, 0q - q - 2g + 20 = 0. Let k(h) = -3 + qh2 - 3 + h3 - 2 - h. Calculate the remainder when k(-10) is divided by 1. 0 Suppose -5h + 2h = -9. Let x = 0 + 10. Suppose 4n - 30 = x. Calculate the remainder when n is divided by h. 1 Suppose 0 = -4f - 2s + 254, -f - 3s - 5 = -71. Calculate the remainder when f is divided by 33. 30 Let j(v) = 2v - 4. Let d be j(7). What is the remainder when 3/15 + 88/d is divided by 5? 4 Let d be ((-4)/4 - 239) + -2. Suppose 2z + 0c - 2c - 40 = 0, -4c = 2z - 70. Calculate the remainder when d/(-5) + 6/(-15) is divided by z. 23 Calculate the remainder when -2 + (2 - 0 - -52) is divided by 18. 16 Suppose -3d + 165 = d - 5j, 2d + 4j - 102 = 0. Let y = d + -27. Calculate the remainder when y is divided by 2/(-4)(-1 + -19). 8 Let c(y) = -2y - 12. Let t be c(-6). Suppose t = 12i - 11i - 11. What is the remainder when 18 is divided by i? 7 Suppose 61 = -3m + 4m. Let y = m + -28. Calculate the remainder when y is divided by 18. 15 Suppose -6s + 20 = 3b - 5s, 5b = -5s + 30. Calculate the remainder when (-2)/3(-9)/(-6) + 21 is divided by b. 6 Suppose 4s - 12 = u, -3u + s + 20 - 1 = 0. Let r = u + -4. Suppose -rg = -g - 30. What is the remainder when g is divided by 6? 4 Let b = -1 - -15. Let h be 32/b - (-2)/(-7). Suppose -74 = -ha - 4m, 3a + m - 106 = -0m. What is the remainder when a is divided by 12? 11 Let k(u) = 2u*2 - 10u - 13. What is the remainder when k(8) is divided by 18? 17 Suppose 14p - 466 = 122. What is the remainder when p is divided by 86/8 + 1/4? 9 Let v = -41 + 46. Calculate the remainder when 12 is divided by v. 2 Suppose 2d - 2h = 110, -3d - 5h + 70 = -63. What is the remainder when d is divided by 13? 12 Let b = -47 + 110. Calculate the remainder when 67/(b/6) is divided by 2. 0 Let y = -42 + 69. Calculate the remainder when y is divided by 8. 3 Suppose 0j + 2 = v + j, -32 = -4v + 4j. Calculate the remainder when (-20)/v10/(-4) is divided by (-2 - -3)/((-1)/(-4)). 2 Suppose -3p - 2l = 8, l - 11 - 3 = 3p. Let j(d) = d3 + 5d*2 + 2d - 5. What is the remainder when ((-4)/2)/((-3)/6) is divided by j(p)? 1 Let m(a) = 5a2 - 23a + 16. What is the remainder when m(9) is divided by 36? 34 Let c be 1 + -2(-86)/4. Suppose 0 = 5k - 2w - 168, k + 4 - c = 2w. What is the remainder when k is divided by 11? 10 Let x = 7 + -5. Suppose -3 - x = -t. Calculate the remainder when t is divided by 3. 2 Let s(y) = y*2 - 2y + 6. Calculate the remainder when s(-3) is divided by 13. 8 Let m = 15 - 1. Let x = 41 + -26. Let i = x - 10. What is the remainder when m is divided by i? 4 Suppose 11y - 8y = 42. Calculate the remainder when 54 is divided by y. 12 Let t be (-20)/(-6)(-3)/(-2). Suppose -b - 5a = -19 + 2, -ta - 11 = -3b. Calculate the remainder when 25 is divided by b. 4
Calculate the lowest common multiple of 16512 and 20352. 875136 Find the common denominator of -103/1721250 and -173/45900. 3442500 What is the lowest common multiple of 3944 and 171190? 19858040 What is the least common multiple of 2540990 and 14? 17786930 Calculate the lowest common multiple of 11752614 and 4. 23505228 Calculate the common denominator of -14/2104047 and -95/208. 437641776 Find the common denominator of 43/11025 and -41/73710. 2579850 Calculate the common denominator of -89/28554 and 83/2293838. 6881514 Calculate the common denominator of 67/57514248 and 109/396. 57514248 What is the smallest common multiple of 5 and 1772537? 8862685 Find the common denominator of -86/6100575 and 59/61005750. 61005750 Calculate the smallest common multiple of 863356 and 332060. 4316780 What is the common denominator of 161/1287690 and 149/12104286? 60521430 What is the common denominator of -3/220048 and -45/41148976? 41148976 Calculate the common denominator of -4/7865 and 69/1850836. 1119755780 Calculate the common denominator of -41/229268 and -109/2522. 22238996 Calculate the smallest common multiple of 960 and 11552. 346560 What is the lowest common multiple of 99042592 and 47690? 495212960 Calculate the common denominator of -107/18160 and -81/14003176. 140031760 What is the smallest common multiple of 1633476 and 3996? 14701284 What is the least common multiple of 1502082 and 500694? 1502082 What is the common denominator of -37/17643875 and -47/7824675? 899837625 Calculate the common denominator of 11/576 and 74/692211. 132904512 Find the common denominator of -86/2367495 and 89/31122. 33144930 Find the common denominator of 27/4933040 and -87/4. 4933040 Calculate the least common multiple of 569907 and 35587526. 320287734 Find the common denominator of 127/2104884 and 53/35676. 2104884 What is the smallest common multiple of 47016 and 396? 517176 Calculate the common denominator of -58/9 and 71/6370068. 19110204 Find the common denominator of 133/9455070 and -91/799020. 56730420 Find the common denominator of -11/414233 and -44/6817. 7041961 Calculate the common denominator of 61/14381475 and 79/113800. 115051800 Find the common denominator of -167/83580 and 137/10451480. 219481080 What is the smallest common multiple of 1471720 and 880? 32377840 Find the common denominator of -73/3457650 and 109/3108. 6915300 What is the common denominator of 43/13266 and 77/54? 39798 Find the common denominator of -59/2012916 and 107/7968. 16103328 What is the lowest common multiple of 119 and 12994562? 12994562 Calculate the least common multiple of 41978934 and 65730. 1469262690 Calculate the least common multiple of 2703083 and 69. 186512727 Calculate the least common multiple of 105520 and 949680. 949680 Calculate the smallest common multiple of 20688 and 129072. 55630032 What is the common denominator of -125/36 and -3/66399872? 597598848 What is the common denominator of 47/37492576 and 57/4802768? 1162269856 What is the least common multiple of 2307520 and 4153536? 20767680 What is the smallest common multiple of 59351838 and 96? 949629408 Find the common denominator of 137/507280158 and -1/7623. 507280158 Calculate the least common multiple of 5481 and 78561. 235683 Calculate the common denominator of -79/110 and 47/12363879. 123638790 What is the common denominator of 49/74429 and -101/106974? 28134162 Calculate the common denominator of -115/2374962 and 71/2166. 45124278 Calculate the smallest common multiple of 686374 and 2243915. 58341790 What is the common denominator of 8/1163277 and -41/45? 5816385 What is the common denominator of -61/91 and 15/2012972? 14090804 Calculate the common denominator of 65/4 and -5/840883537. 3363534148 What is the common denominator of -83/1563582 and 119/72? 18762984 What is the lowest common multiple of 63731446 and 6745? 6054487370 Calculate the smallest common multiple of 753024 and 148. 753024 Calculate the smallest common multiple of 25490970 and 6. 25490970 What is the common denominator of 32/63 and -71/354090? 7435890 Calculate the common denominator of 83/2372925 and 17/569502. 14237550 Calculate the common denominator of 17/10181424 and 151/5553504. 61088544 Calculate the common denominator of -65/174 and 149/9438. 273702 Find the common denominator of 87/19402570 and -71/10583220. 116415420 What is the smallest common multiple of 18055 and 1474? 26613070 What is the lowest common multiple of 28 and 93814784? 93814784 Calculate the common denominator of 57/7856362 and 17/23972. 204265412 What is the common denominator of -3/140835085 and -95/4? 563340340 Calculate the common denominator of 20/453 and -32/107727. 16266777 What is the least common multiple of 78 and 54814852? 2137779228 Calculate the smallest common multiple of 245 and 2354285. 115359965 What is the common denominator of -169/285978 and 53/3102? 13440966 What is the common denominator of -97/10 and 52/520373? 5203730 What is the common denominator of -83/10 and -127/155521752? 777608760 Calculate the smallest common multiple of 4344470 and 5213364. 26066820 What is the smallest common multiple of 115440 and 576732? 426781680 What is the common denominator of 13/10222 and 173/12290610? 233521590 Calculate the least common multiple of 3328686 and 24282. 236336706 What is the lowest common multiple of 14653038 and 34190422? 102571266 Calculate the smallest common multiple of 2466 and 52362. 7173594 What is the common denominator of -20/4824503 and 20/4824503? 4824503 Calculate the smallest common multiple of 12490 and 2802756. 14013780 Calculate the common denominator of -31/20 and -81/39857384. 199286920 Calculate the common denominator of 13/95 and -51/8257970. 8257970 What is the lowest common multiple of 1593342 and 3468? 54173628 Calculate the common denominator of 103/6 and -17/969834. 969834 What is the smallest common multiple of 171255 and 925? 31682175 Find the common denominator of 113/3558 and -23/444063. 526658718 Calculate the smallest common multiple of 1190255 and 45543. 167825955 What is the smallest common multiple of 1258624 and 32? 1258624 Calculate the least common multiple of 1015842 and 294. 49776258 Calculate the common denominator of 71/185688 and -89/7148988. 14297976 Calculate the common denominator of 121/23226 and 17/588. 46452 What is the lowest common multiple of 160427 and 1176? 188662152 What is the lowest common multiple of 26255 and 10629145? 945993905 Calculate the smallest common multiple of 1139250 and 1106700. 38734500 Calculate the lowest common multiple of 4653162 and 171891. 330374502 Find the common denominator of 151/22836 and 79/16877880. 185656680 Find the common denominator of 13/283700996 and -143/18. 2553308964 Calculate the smallest common multiple of 35 and 756255. 5293785 What is the common denominator of 35/1322 and 55/6772? 4476292 What is the common denominator of 28/2547207 and -61/117351? 43302519 What is the least common multiple of 6200 and 613800? 613800 What is the common denominator of -121/10651488 and 37/2995731? 95863392 What is the smallest common multiple of 1222657 and 276828? 14671884 Calculate the lowest common multiple of 137718 and 4590600. 13771800 What is the lowest common multiple of 3027370 and 679? 21191590 Calculate the common denominator of -27/366988 and 41/4904. 449927288 Calculate the common denominator of -37/1703 and 22/5293317. 68813121 What is the smallest common multiple of 414 and 1318746? 90993474 What is the common denominator of -117/1280 and 57/2402720? 19221760 Calculate the common denominator of -65/112 and 67/51051630. 408413040 Calculate the common denominator of 33/1300 and 69/619840. 3099200 Calculate the least common multiple of 42023280 and 92451216. 462256080 Find the common denominator of -93/390908 and 83/3151544. 507398584 What is the lowest common multiple of 59772174 and 51590? 298860870 Calculate the common denominator of -41/283024 and -45/868. 8773744 Calculate the smallest common multiple of 19716240 and 1344. 552054720 Calculate the lowest common multiple of 8683 and 24795. 11331315 Calculate the smallest common multiple of 7722 and 197604. 7706556 What is the smallest common multiple of 24 and 138884? 833304 What is the common denominator of -61/24961210 and -47/37720? 99844840 What is the least common multiple of 137575 and 9865? 271435475 Calculate the common denominator of 43/1917 and 33/81655. 156532635 Find the common denominator of -85/101376414 and 99/720076. 1419269796
Expand (-6m + 4m + 3m)(-23 + 11m + 4 - 10m). m*2 - 19m Expand (0v - 4v + 2v)(-2 - 4 + 4)(7 + 1 + 6). 56v Expand (-3z2 + 14z - 12z + 0z*2)(-3z - 3z + 4z). 6z*3 - 4z*2 Expand 3w*4 - 21w*5 - 3w*4 + (-3w*4 + 3w4 + w4)(-1 + w + 1) + (w2 - 1 + 1)(-3w3 + 7w*3 + 0w*3). -16w5 Expand (s2 - 5s2 + 3s*2)(-12s3 - 33s*3 + 84s*3). -39s*5 Expand (85 + 66 - 102)(2d - 6d + 3d). -49d Expand (0 - 2n + 0)(-3n + 2n + 4n). -6n*2 Expand (-3h - h + 0h - h - h + h + 2h + 0 + 0 + 0 + h + 0 + (-3h + h + 3h)(3 + 3 - 5) + h + 2h - h)(-1 + 2 - 5). -4h Expand (0m3 - 3m*3 + 2m*3 + (0m*2 - 6m*2 + 4m*2)(3m - m + 0m) + 0 + 0 - 2m3)(2m2 - 3m*2 + 0m*2). 7m*5 Expand -2u*3 - 2 + 2 + 0u*2 - 2u*3 + 0u*2 + (5u*3 - 3u*3 - 3u*3)(5 + 1 - 5) + 0 + 0 + u*3 - 4u*3 + 0u*3 - 6u*3. -14u*3 Expand (1 + 4 - 3)(-9 + 9 + 4t2)(-2t2 - 2t*2 + 3t*2). -8t*4 Expand (-12 + 2 + 5)(2w - w + w). -10w Expand (-4x2 + 3x*2 - 2x*2 + (0 - 2x + 0)(-2x + 5x - x))(-3 + 4 - 2). 7x2 Expand 2b - 2b4 - 2b + 2b4 + 0b*4 + 3b4 + (b2 + 3 - 3)(-2b*2 + 2b*2 + 2b*2). 5b*4 Expand (7c - c3 - c3 - 3c)(-2c2 + 4c2 + c2). -6c5 + 12c*3 Expand (0x + x + 3x)(4x - 4x + 4x). 16x2 Expand (b3 + 2b3 - 2b*3)(2 + b - 2) + 0 - 2b4 + 0. -b4 Expand (-1 + 3y*4 + 0y*4 - 4y*4)(6 + 5y - y - 2y). -2y5 - 6y*4 - 2y - 6 Expand (-3q - 7q*3 + q + 3q*3)(q - q + 2q). -8q*4 - 4q*2 Expand (2 + 4 - 1)(-3w - 3w + 5w)(2w2 - w + w). -10w*3 Expand (0 - 2 - 1)(-3p + 3p - p) - 75 + 75 - 19p. -16p Expand (13r2 - 39r + 39r)(r*2 - 2r2 - r2) - r*4 + 1 + 3r - 3r. -27r*4 + 1 Expand (2w*3 + 16w*2 - 16w*2)(2w + 4w - 4w) + 0w*4 + 0w*4 + 2w*4. 6w4 Expand (w2 - 5w2 - w2)(-2w + 0w*2 + 2w*2 + 3w - 2). -10w4 - 5w*3 + 10w*2 Expand (-5 - 2 + 4)(-3f + f + 0f)(-f3 + 3f3 - f3)(-4 + 0 + 3). -6f4 Expand -2 + 2 + o4 + (5o2 + 0o*2 - 2o*2)(-6o2 + o2 + o2). -11o*4 Expand 0 - 2v + 0 + (5 + 12 + 2)(-2v + 2 - 2). -40v Expand (r2 - 4r3 - r2)(2 - 1 - 6)(4 - 3 - 2). -20r3 Expand -11j*3 + 898j*2 - 898j*2 + 3j - 3j - j3 + (2j - 2j - j)(-j*2 + 6j*2 - 4j*2). -13j*3 Expand (4 + 2 - 4)(0p + 0p - p) + 2p - p + p - p - 2 + 2 + (0 - p + 0)(-3 + 2 + 2) + 1 - p - 1 - 3p + 3p + 2p. -p Expand (5 - 5 - 2)(3f2 - 3f2 + f2) + (4f - 4f + 3f)(3f - 2f - 2f). -5f*2 Expand (-76 + 76 - 6k*5)(2 - 2 - 1). 6k5 Expand (26 - 7 + 11 + 71)(-2x + 3x - 3x). -202x Expand (7b3 + 8b - 8b)(1 + 0 + 0)(-3 + 5 + 0)(0 + 0 + 2). 28b3 Expand (-4u*3 + 3u*3 + 2u*3)(-2u + 2u - 2u - u - 5 + 5 + 5u - 3u - u + (0 + 0 + 1)(-2u + 0u + 0u)). -4u*4 Expand (1 - 1 + 2j*2)(3 - 1 - 4)(1 - 4 - 1)(-1 + 1 - j). -16j3 Expand (-3 + 13 - 1)(-t - t + 0t)(-4 + 6 + 0). -36t Expand (-3l + 3l - 6l)(-2l - 2l + 3l) - 2 + 2 - 2l2 + (-4l*2 - 2l*2 + 4l*2)(0 + 0 + 1) + 4 - l2 - 4. l2 Expand (-4w + 2w - 6w)(0w + w + 0w) + 0w2 - 2w*2 + 3w*2. -7w*2 Expand ((0 + 1 + 1)(-2k - 5 + 5) + 21 - 39 - 25k + 16)(0k2 - k2 + 3k2) - k3 + 5k*3 - 2k*3. -56k*3 - 4k*2 Expand (-2a - 2a2 - 1 + 2a)(12 - a - 12). 2a3 + a Expand (w2 - w + w)(-2w - 1 - 3w + 3w). -2w3 - w2 Expand (-88z + 4z3 + z2 + 88z + 2)(-10 - 2 + 0). -48z*3 - 12z*2 - 24 Expand -12612a*2 + 12612a*2 - 215a4 + (a2 + a*2 + 0a*2)(-1 + a2 + 1) - a4 + 0a3 + 0a3 - a4 + 3a4 + 0a*4. -212a*4 Expand p - 1 + 1 + (0 - p + 0)(-1 + 0 - 1) + (7 + 3 - 6)(5p - 4p + p)(1 - 3 + 4). 19p Expand (-5 - j + 5)(-1 + 1 + j) - 5j2 - 4j*2 + 5j*2 + (3j + j - 5j)(-3j + j + 3j). -6j2 Expand (-n - 3n + 2n)(3 - 6 + 1)(-3 - 6 + 1)(2 - 2 + 3). -96n Expand 2t3 + t3 - 4t3 + (-4 - 2t + 4)(-5t2 + t2 + t*2) + 5t3 + t3 - 4t3 + 3t*3 + 0t*3 - 2t3 + (-2 + 2 - t2)(-2t + 0 + 0). 10t3 Expand 17n*2 - 21n*3 - 17n*2 + (-4n + 0n + 2n)(0n2 - n2 + 2n2). -23n*3 Expand (-4 - 3v + 2v - v)(10v + 6v - 7v). -18v*2 - 36v Expand (-94 + 195j + 94)(0j + j2 + 0j). 195j3 Expand (8q - 2q - q)(q*2 + 5q - 5q). 5q*3 Expand 3g*2 - 2g*2 + 0g*2 + (1 - g - 1)(-2g + 2 - 2) + (-11 - 2 - 13)(-g*2 + g - g). 29g*2 Expand (-11 - 6 - 3)(b - b + b*2). -20b*2 Expand (4j - 4j + j2)(j2 + j2 - 3j2) + 2j*4 - 14j*4 + 0j*4 + (-5 + 3 + 0)(-2j4 + 0 + 0). -9j*4 Expand (-w - w + 0w)(3w*4 + 3w*4 - 5w4) + w5 - 2w5 + 2w5 - w5 + 6w5 - 3w*5 - 7w*5 + 4w5 + w5. -w*5 Expand (2u4 - u4 - 2u4)(-1 + 1 + 2u) + 5u*2 - 2u*5 + 3u*5 - 4u2. -u5 + u*2 Expand (3n + 2n + 0n)(-1 + 1 - n2 + (1 - 1 + n)(4n - 5n + 3n)). 5n*3 Expand (5b - 5b - b)(1 + 2 - 5) - b + 0b - 3b. -2b Expand -3h5 + h5 + 3h5 + (h2 + 0h2 + h2)(2h*3 - 6h*3 + 0h*3). -7h*5 Expand ((4 + 7 - 16)(-y - 3y + 3y) + 2y - y - 3y)(0y - 3y + 4y). 3y2 Expand ((4 + 2 - 4)(0 + 2 - 3) - 4 + 1 + 1 + 0 + 1 + 0)(-3k*3 - 9k*3 - 14k*3). 78k*3 Expand (71m*3 + 76m*3 - 148m*3 + 21)(m*2 - 2m2 - m2). 2m5 - 42m*2 Expand -8w*3 + 0w*3 + 2w*3 + (0 + 1 - 2)(w*3 - 1 + 1) + (-w - 1 + 1)(w*2 + 3w*2 - 3w*2). -8w*3 Expand (3x*3 + 2 - 2)(-2 + 3 + 1) + 4x3 + 0x3 - x3 - 4 + 4 - 2x3. 7x*3 Expand (2 + 0 - 4)(3 + 4 - 4)(12 - 8 - p - 6). 6p + 12 Expand (-5 + 6u2 - 3u*2 + 3)(-3 + 2 - 2). -9u2 + 6 Expand (-6 + 0 + 4)(0u - u + 0u)(u - u + 3u*2). 6u3 Expand (l3 - 3l + 3l)(2l - 2 + 2) - l*4 + 0l*4 + 0l*4 - 4l*4 + 2l*4 + 3l*4 + 4 - 4 + 2l*4 + (-2l + 0l + 0l)(0l + 3l3 + 0l). -2l4 Expand (12p*4 + 4p*3 - 4p3 + (p3 - p + p)(0 - 2p + 0))(-1 + 0 + 0). -10p*4 Expand (-4f + f + 5f + (-7 + 7 - 7)(0 - f + 0))(3 - 2f - 3). -18f2 Expand (-2 + 2 - 2c*3)(-5 + 6 + 4) - 2c3 + 4c*3 - 3c*3. -11c*3 Expand (2f - 2f - 2f)(f + 23 - 23) - 2f*2 + 3f*2 + 0f*2 + 7f*2 - 3f*2 + 3f*2. 6f*2 Expand (1 + 0 + 1)(-5o3 - 2 + 2) - o + o - o3. -11o*3 Expand ((1 - 1 - 2a)(6 + 0 - 5) - 15 + 24 - 8 - 50a)(a4 + 0a*4 - 4a*4). 156a*5 - 3a*4 Expand (3056 - 3056 - 103o*3)(1 - 1 + 1). -103o3 Expand (-1 + 2r + 1)(-1 + 0 - 3) - r + 2r + 0r - 2r + r - r + (-5 + 3 + 1)(r - 4r + 5r). -11r Expand (-2 + 1 + h - 3h)(-1 + 1 - 2h)(3 + 5 - 2). 24h2 + 12h Expand (-32h2 - 2 + 32h*2 - 23h*4 - 2h)(h + 0h + 0h) - 2h*5 - 2h*5 + 2h*5. -25h*5 - 2h*2 - 2h Expand ((0i2 + 2i*2 + 0i*2)(2 - 1 + 1) + 4i2 + 5i*2 - 2i*2 + 0i + i*2 + 0i + 2i2 - 2i + 2i)(4 + 3 - 5). 28i2 Expand (-2t - 2t + 3t)(6 + 3 - 7). -2t Expand ((1 - 2 + 0)(1 - 1 - 2v) - v + 3 - 3 - 4v + 8 - 8)(2v - 2v + v). -3v2 Expand (0 + 0 - 2f)(-4f + 3f + 2f) - 3f2 - 3f*2 - 15f*2 + 1. -23f*2 + 1 Expand (h - h + h)(-h*2 - 2h2 + h2) - 2h3 - 4h*3 + 5h3 - h3 + 5h3 - h3 + (0 + 1 - 4)(-2h3 - 3 + 3). 6h*3 Expand 2c*4 + 5c4 + c4 + (2c2 - c2 + 0c*2)(c*2 + 2c - 2c) - 3c*4 - 3c*4 + 4c*4. 7c*4 Expand (0a + 0a + 2a)(-a + 0a + 3a) + 23 + 3a*2 - 23. 7a*2 Expand 4p2 - p2 - p*2 + (3p + p - 2p)(2p + p + 0p) + (1 - 3p + 5 - 7)(0p - p + 4p). -p*2 - 3p Expand (-4 + 4c - 2c + 3)(-2 + 2 + 11c). 22c2 - 11c Expand (4q - 5q + 3q)(-4q2 + 2q2 + q2)(0 + 4 - 3). -2q*3 Expand ((-2 + 2 + 2y)(0y + 0y + 2y) - 2y2 + 5y*2 - 2y*2)(2y3 + 5y*3 - 18y*3). -55y*5 Expand (-3 - 2g + 3)(3 + 4 - 4)(11 - 10g3 - 11) - g4 + 0g*4 + 2g*4. 61g*4 Expand (-6k + 15k + 65k)(-k + k - k). -74k*2 Expand (-237p*2 + 1 + 0 + 208p*2 - 2p)(-5p + 4p + 3p) + 2p2 - 2p*2 - 2p*3. -60p*3 - 4p*2 + 2p Expand -2b + 2b - 2b4 + (2b*3 - 3b*2 - 2b*2 + 0b*3)(-b - 2b - 2b). -12b4 + 25b*3 Expand -2o4 - o3 + o*3 + (0o*2 - 4o*2 + 3o*2)(-2o2 - o + o) + 0o*3 + 0o3 - o4 + 0o4 + 5o*4 + 4o*4. 8o*4 Expand (5 - 4 + 3 - 2r)(2r + 5r - 6r). -2r2 + 4r Expand -6 + 4r2 + 6 + (-2 - 1 + 2)(3r2 - 2r*2 + 0r*2). 3r*2 Expand (4 - 4 + s)(2 - 1 + 1)(2 + 9 - 6). 10s
What is 0.03967 minus 25735521320? -25735521319.96033 What is -108740074982 take away -133? -108740074849 Add 443514 and 6932754. 7376268 What is -2165.7811042746 plus -0.5? -2166.2811042746 What is the distance between -1958212275 and 36? 1958212311 What is the difference between -1201071147077 and 130? 1201071147207 -38.696271 + 0.2373 -38.458971 14725568.27409+78 14725646.27409 Work out -2553018368 + -7656. -2553026024 What is -1.16500244741 minus 1.14? -2.30500244741 -10999742879803 + -5 -10999742879808 What is -118081584549024 minus -0.3? -118081584549023.7 Calculate -35 - -188.462551461. 153.462551461 -40.7130591+53247 53206.2869409 Work out 40734.4 + -4909899.1. -4869164.7 -60516637.5268+5 -60516632.5268 What is -993.30818776 take away -7? -986.30818776 Subtract -39.002 from 4985.955. 5024.957 Add together -0.20221 and 48062593. 48062592.79779 What is 5735.9909217 less than -35? -5770.9909217 Subtract 45041607247 from -0.125. -45041607247.125 What is 11.18 - -639081465? 639081476.18 420462412828832+-0.3 420462412828831.7 Sum -111279 and 400522.31. 289243.31 What is -19116.53767403 take away 0.9? -19117.43767403 What is -1429801546353 plus 0.14? -1429801546352.86 What is 0.016 + 863410512? 863410512.016 Calculate 1336 - -59.53442988. 1395.53442988 Work out 2241445290664 - 2. 2241445290662 2 - -1166511812779 1166511812781 Add -0.713 and -254222314. -254222314.713 Work out -2.3 - 3461007753458. -3461007753460.3 What is 6 less than -16457312890424? -16457312890430 Add -0.02 and 54058870114. 54058870113.98 What is 14673.6036114 plus -222? 14451.6036114 What is the difference between -101.716249543838 and 0.1? 101.816249543838 Add -11582313606157 and -14.3. -11582313606171.3 Calculate 27299 - 2.23274655. 27296.76725345 What is the difference between -0.5 and 699152.74811? 699153.24811 -0.7605+-21837846 -21837846.7605 1.925020304 - -154 155.925020304 Add together -1265560821479 and 3. -1265560821476 Put together -227409.26 and 1604549. 1377139.74 Add 5 and -4475704989766. -4475704989761 Calculate 4.6925 - -969.11982. 973.81232 Work out -20 - -432482463233. 432482463213 What is 2 - -36723570017? 36723570019 -1299.40712601+-5 -1304.40712601 Total of 0.010248 and 0.02106032. 0.03130832 What is 2.9 minus -3474935.24402? 3474938.14402 Add -8363997.3258 and -0.1. -8363997.4258 8768.0414 - -45106.2 53874.2414 What is 0.1 less than 9758830183861? 9758830183860.9 Calculate -23259.0973 - 192. -23451.0973 What is -15 + -14739.71959826? -14754.71959826 Total of -27930644130.1 and 0.8. -27930644129.3 What is -483961 less than -431207? 52754 What is the distance between -67313249 and 0.357? 67313249.357 Work out -35608415865 - 28. -35608415893 Calculate -4 + -21896.622923087. -21900.622923087 What is 30978 plus 1418008? 1448986 What is 13 - -3611758840? 3611758853 Put together 3683366960 and -2559. 3683364401 Add together -0.059 and -895674877. -895674877.059 Work out 17.531 - -57835373. 57835390.531 What is 0.1742 minus -26621275? 26621275.1742 Work out -41.27964 - -1.16979. -40.10985 Work out 70895931 + 1519. 70897450 -38673 + -38.835709 -38711.835709 -53.4624+0.0779089 -53.3844911 Add -0.2 and -64882615. -64882615.2 What is the difference between -6730.527655 and -32? 6698.527655 What is 15994843202811 - 0? 15994843202811 Total of 9054.917141466 and -0.4. 9054.517141466 Subtract 15253712.492 from -22. -15253734.492 What is 21698564821 minus 177? 21698564644 Work out 119406187 + -0.23634. 119406186.76366 Sum -16540747 and -12000.027. -16552747.027 275205658 + -5.387 275205652.613 -7 + 277207047486 277207047479 Sum 1599160 and -179804471. -178205311 What is 73 minus 40486665068? -40486664995 Subtract 0.46311 from 85846829. 85846828.53689 Sum -29 and 148721541761.1. 148721541732.1 What is -538 - 34.05072153? -572.05072153 Sum 5 and 234071533803. 234071533808 What is the distance between -0.05 and -70567800.58? 70567800.53 What is 1 take away 18228.96558438? -18227.96558438 1640.5508 + -24839.44 -23198.8892 What is the difference between -27.850024 and -11.135? 16.715024 707328086936 - 0.4 707328086935.6 What is 3.619 - 99110.649893? -99107.030893 Work out 38283811.314034 - 0.1. 38283811.214034 What is 213587681 less than -67909? -213655590 0.6301 + -1132.7206 -1132.0905 What is the distance between 52 and -15385647262? 15385647314 Put together 0 and 268920754917.1. 268920754917.1 Subtract -147.292248085 from -0.01. 147.282248085 -0.2185 - 4194.8477 -4195.0662 Calculate 0.0564 + 6577.1131. 6577.1695 353960.9197 - 25440 328520.9197 What is -0.4808 take away -9.2754025? 8.7946025 What is 107 less than -2422.047440483? -2529.047440483 Subtract -4 from 104772645498. 104772645502 Work out -1.3 + -2672610453835. -2672610453836.3 Calculate -4 + -172569478159. -172569478163 10.928765236 + -2 8.928765236 What is 694379140 take away -0.0525402? 694379140.0525402 What is the difference between 1724679 and 291.13816? 1724387.86184 What is -1.902 take away 0.3482708? -2.2502708 Add -18913468 and 50.659. -18913417.341 -0.68303 - -0.0193206 -0.6637094 Subtract -133.5 from 3493147.49483. 3493280.99483 What is -6464751154 take away 76535? -6464827689 What is -13649722.7257195 less than 5? 13649727.7257195 What is -9146525.11312 + -3? -9146528.11312 Calculate 17675403685930 + 4. 17675403685934 What is -1975.26 minus 474684.42? -476659.68 Add 263 and -118272186359. -118272186096 Total of -4440 and -143322110. -143326550 Calculate 5 - -29334218828. 29334218833 Add together 0.0091 and 2253907294. 2253907294.0091 Sum 31454.5921 and 5.6027. 31460.1948 Calculate -5 - 1289727402.95. -1289727407.95 What is -15727.2595172 + -0.6? -15727.8595172 Work out -0.503 + 16611.424705. 16610.921705 What is -2 minus 294912419057.11? -294912419059.11 Work out 26930996675 + 0. 26930996675 Add together 887523144 and -16.3. 887523127.7 What is -0.59749909877 take away -3? 2.40250090123 -0.3 - 3474740175 -3474740175.3 Add together 0.2 and -14718369166305. -14718369166304.8 Add together -25976469345350 and 3. -25976469345347 What is 13.3928 + -84681.66? -84668.2672 What is the difference between 0.386 and -47196.426? 47196.812 What is -756 less than -6662252.785? -6661496.785 Calculate -3274.76397 - 46306. -49580.76397 Add together 45925.36319 and -6.8. 45918.56319 Work out 5 - 0.24677013086627. 4.75322986913373 What is 121075627524 less than 0.4? -121075627523.6 What is the difference between 11806 and -4670639368? 4670651174 What is 28154450311935 less than 0.2? -28154450311934.8 Calculate -9009 - 3454802794. -3454811803 95663954 + 305.5 95664259.5 Work out -4486.75229 + -0.83. -4487.58229 -0.047545735345174 + 0.1 0.052454264654826 Work out 20.5 + 372702.751. 372723.251 Total of 438413.9736 and 34. 438447.9736 -0.1 + 110987319607 110987319606.9 Subtract 2288799714635 from 10. -2288799714625 What is -1821.824381582 - 38? -1859.824381582 Work out 733596.55 + 59257. 792853.55 2 - 19721895607728 -19721895607726 Calculate 19748361096075 + 0.3. 19748361096075.3 What is 4266018643 - -23.9? 4266018666.9 Put together -31 and -74194895.5. -74194926.5 What is the difference between 13 and -30105.0116323? 30118.0116323 Sum -16.9301146 and 761. 744.0698854 What is 22838370 less than -467.5? -22838837.5 -21286200115 - 16 -21286200131 Work out 6 + -902901055177. -902901055171 -99819585.4252 + 4 -99819581.4252 What is 6380.40306 less than 0.1187869? -6380.2842731 Total of -118867359205 and -1.6. -118867359206.6 What is 14.6216189 + 166.62? 181.2416189 Put together 32444822 and 42431894. 74876716 -20110730 + 1890865 -18219865 Total of 648840081039 and -5. 648840081034 Total of -3699919815344 and 5. -3699919815339 Total of 566646 and 54218570. 54785216 Calculate 93 - 0.304691472958. 92.695308527042 What is the difference between -0.617 and 478.52140651? 479.13840651 Add -71824640301 and 3. -71824640298 What is 1951521904705 - -0.07? 1951521904705.07 Total of -0.9405 and 98918397. 98918396.0595 Put together -84.7 and -375.054726. -459.754726 Total of -170328.83 and -1277660. -1447988.83 Calculate -9 - -347908697051. 347908697042 Sum 1730.3 and -8863057. -8861326.7 Calculate 2543 + 39676796.11. 39679339.11 Add together -13689118918470 and -6. -13689118918476 Calculate 58.33 + -84291116. -84291057.67 0.0334891419 + -677.84 -677.8065108581 What is -0.032 - 7324154638? -7324154638.032 Work out 0.3 + 4426948183914. 4426948183914.3 Calculate -141205790 + 1662. -141204128 Add together 868316995350 and 4. 868316995354 Work out 2073.118335863 - -2. 2075.118335863 Sum 0.2375614 and 723478. 723478.2375614 Add together 0.083018422 and -536. -535.916981578 Work out -4.0907 - 4681.5231. -4685.6138 Work out 0.5476 - 0.3827352225. 0.1648647775
Suppose -12 = -5s + 28. Suppose -32 = -4f - s. What are the prime factors of f/(-9) + (-141)/(-9)? 3, 5 Let m = 58 - -15. List the prime factors of m. 73 Let y(m) = -m*2 + 13m - 14. Suppose 0 = -2t + 6 + 16. List the prime factors of y(t). 2 Let g(c) = -c3 + 89. Let u be 0/(3 + 3 + -8). Let m be g(u). Suppose 0 = 5o + 2i - m, i - 4i = 9. List the prime factors of o. 19 Let p be -3 + (1 - 1 - 30). Let r = -3 - p. What are the prime factors of r? 2, 3, 5 Let y(t) = 2t + 2 + 0t2 + t2 - 3. Let d be y(3). Let w = 21 - d. What are the prime factors of w? 7 Let n = -18 + 7. Let y = 15 + n. What are the prime factors of y? 2 Let l be 51/2(-10)/15. Let v be ((-33)/6)/((-1)/(-2)). Let k = v - l. List the prime factors of k. 2, 3 Suppose -2a + 6 = -0a. What are the prime factors of a? 3 Let z = -2 - -6. Let f = 3 - z. List the prime factors of f - (-4)/(4/5). 2 Suppose 4c - 12 - 40 = 0. Suppose -4w + 0 = -p - c, 2w - 45 = -5p. List the prime factors of p. 7 Suppose 2a = 3 + 3. Let g(h) = -h3 - h2 - h + 3. Let z be g(-3). Suppose z = aw + w. List the prime factors of w. 2, 3 Let f(x) = x3 + 9x*2 + 8x - 1. Let r = 2 - 10. Let j be f(r). Let v = 1 - j. What are the prime factors of v? 2 Let o = 62 - 26. List the prime factors of o. 2, 3 Suppose -a + 5p = -6 - 8, -5a - 10 = -5p. Let y = a + 10. List the prime factors of y. 2 Let h = -69 - -118. What are the prime factors of h? 7 Let y = 219 - 113. What are the prime factors of y? 2, 53 Let w(x) = -23x + 2. What are the prime factors of w(-1)? 5 Suppose -g + 45 = 4g. Let p = g - 13. Let f(m) = -m2 - 7m + 3. List the prime factors of f(p). 3, 5 Let u(k) = 2k2 + 4k + 3. What are the prime factors of u(-2)? 3 What are the prime factors of 3/(-5) + (-3572)/(-20)? 2, 89 Let x(j) = j*3 - 7j*2 + 3j - 13. Let i(t) = -t*3 + 7t*2 - 4t + 12. Let g(l) = -6i(l) - 5x(l). What are the prime factors of g(6)? 11 Let q(i) = i*3 + 7i*2 - 2i - 6. Let v be q(-7). Let x = -9 - v. Let z = -9 - x. List the prime factors of z. 2 Let a(s) = s. Let f be a(7). Let g = f + 5. What are the prime factors of g? 2, 3 Let l = 68 - 61. What are the prime factors of l? 7 Let r = 17 + -1. Suppose -2t = 8 - 26. Let w = r - t. What are the prime factors of w? 7 Let o be (1 + 1)/(6/9). Suppose -4x - 2y = -74, 0y = 3x + oy - 51. List the prime factors of x. 2, 5 Suppose 13z = 12z - 34. Let v = -9 - z. List the prime factors of v. 5 Let m(p) = 4p2 + 9p - 2. Let q be m(6). Suppose -6z + 11z - 406 = -4h, -2h + z + q = 0. List the prime factors of ((-2)/(-3))/(6/h). 11 Let s(m) = m3 - m2 + m - 1. Suppose 0 = -5r + u + 8, -3u + 2u - 4 = -r. Let b be s(r). Let n = b - -9. What are the prime factors of n? 3 Suppose -4u + 6 = q, 0u = u + 2. Suppose -3h + 7 = -q. What are the prime factors of h? 7 Suppose -b + 3x = -18, -2b + 6b - 132 = -3x. What are the prime factors of b? 2, 3, 5 Let p(d) be the third derivative of -d*4/8 - 7d3/6 - d2. Let m be p(-5). Suppose -o + 4s + m = o, 3s - 12 = 0. What are the prime factors of o? 2, 3 Let a(o) be the third derivative of -o6/120 + o5/15 + o*4/6 - 2o*3/3 - 2o*2. Let w be a(4). Let t = w - 8. What are the prime factors of t? 2 Suppose -92 = 2v - 6v. List the prime factors of v. 23 Let l = 49 - 10. What are the prime factors of l? 3, 13 Suppose -l = -0 + 4. Let x be 20/(-6)(l + 1). Let t = x - 6. What are the prime factors of t? 2 Suppose -5n - 5b = -1370, 3b - 1413 = -5n - 41. What are the prime factors of n? 5, 11 Let g(l) = l*3 + 15l*2 + 11l + 9. What are the prime factors of g(-14)? 3, 17 Let p be (-56)/(-7)1/2. Let g = p + 34. List the prime factors of g. 2, 19 Suppose 16 = 4u - 28. List the prime factors of u. 11 Suppose 3y + 4 = 4a - 26, 4a - 4y = 32. Let h = a - -11. What are the prime factors of h? 17 Suppose -166 = -4s + 5w, -w - 3w - 8 = 0. Suppose -4 = -h + 4o, 13 = -2h - o + s. List the prime factors of h. 2, 3 Suppose d + 32 = -3m + 3d, 0 = -5m - d - 49. Let q = 25 + m. List the prime factors of q. 3, 5 Let p = 2 - -27. What are the prime factors of p? 29 Let s = -3 + 5. Suppose 7j = sj + 20. What are the prime factors of j? 2 Let g(n) = -11n3 - 4n*2 - 4n - 2. What are the prime factors of g(-2)? 2, 3, 13 Let q be (-2)/(-3) - 40/(-3). Let t(r) = -r*2 - 10r + 4. Let l be t(-10). Suppose 2z - lz + 8 = f, f - q = -4z. What are the prime factors of f? 2 Let w = -7 - -6. Let y(n) = 19n*2 + 1. What are the prime factors of y(w)? 2, 5 Let c be 39/12 - (-1)/(-4). Suppose z + 2u = 15, 5z = cu + 2u. Suppose -v - 20 = -zv. What are the prime factors of v? 5 Let b be 125 + -6 + 1 + 3. Suppose -a + 14 = h - 27, -3a + b = 5h. List the prime factors of a. 41 Let k(b) = b + 1. Let v be k(2). Suppose d + 2d = vg, 4d - 27 = -5g. What are the prime factors of d? 3 Let l(d) = -6d + 5. Let u(q) = -q + 3. Let x be u(8). List the prime factors of l(x). 5, 7 Suppose -3w - 8a = -4a - 205, 4w - 280 = -4a. List the prime factors of w. 3, 5 Let p = -49 - -192. List the prime factors of p. 11, 13 Let d(k) be the second derivative of k4/4 + k3/2 - k*2/2 + k. What are the prime factors of d(-3)? 17 Suppose 3 = -0u + 3u. What are the prime factors of 4/u + 17 + 3? 2, 3 Suppose 0 = -h - 2z + 5, 2h = 3z + 10. Suppose 2k + 3b = 2b + 12, -3k - hb = -4. List the prime factors of k. 2 Suppose -5 = -5d - 2v, -4d + 5v + 1 = -3d. Let t(w) = -d + w*2 - 7 + 5w - w. List the prime factors of t(-6). 2 Suppose w - 4w = -12. Let o = w - -1. Suppose 6 = -4n + on. What are the prime factors of n? 2, 3 Let h(r) = 18r - 3. Suppose -2w = -5w, 4 = 2p - 3w. List the prime factors of h(p). 3, 11 Let d = -19 - -33. What are the prime factors of d? 2, 7 Let r = -21 + 45. Let g = r + -12. List the prime factors of g. 2, 3 Let w = -22 - -31. List the prime factors of w. 3 Let q = 6 - 20. Let k = -2 - q. List the prime factors of k. 2, 3 Let l = 2 + -1. Let z = l - -1. List the prime factors of z. 2 Let n(g) = 4g2 + 4g + 2. What are the prime factors of n(-2)? 2, 5 Let k(l) = 3l - 1. Suppose 5n = -5i - 0i - 15, i - 27 = 5n. Let o = 5 - i. List the prime factors of k(o). 2 Let p = 147 + -97. What are the prime factors of p? 2, 5 Suppose 3k = -0 + 63. List the prime factors of k. 3, 7 Let b(w) = -95w + 1. What are the prime factors of b(-3)? 2, 11, 13 What are the prime factors of (-5 - 125)/(-5) + 3? 29 Let f(h) = -h2 + 4 - h2 + 2h*3 - 3h3 - h2. Let q be f(-3). Let d = 13 - q. What are the prime factors of d? 3 Let i = 54 + -35. Let n = i + -10. Let w = -4 + n. What are the prime factors of w? 5 What are the prime factors of (-500)/(-6) + -2 - (-10)/15? 2, 41 Suppose -2x + z + 59 = 0, -5x - 4z = -0x - 141. Suppose 38 = 3a + 2t, -5t + 4 = x. List the prime factors of a. 2 Let a = 9 - 5. Suppose 4z - 4y - a = 0, -2z - 2 = 4y - 10. List the prime factors of z. 2 Let r(u) = -u + 8. Let k be r(-8). Suppose -4i - 8t - 3 = -3t, 0 = i - 4t - 15. Suppose 26 = io - k. List the prime factors of o. 2, 7 Let m = 249 - 90. List the prime factors of m. 3, 53 List the prime factors of 235/(-5)(-19)/2. 7, 19 Let p be (16/40)/(1/10). Let f = p + -1. What are the prime factors of f? 3 Let q be (-3)/12 - (-42)/8. Let p = q - 2. Suppose a = pd + 2, -18 = -4a + a - 3d. What are the prime factors of a? 5 Suppose -185 = -4j + 3j. What are the prime factors of j? 5, 37 Let o(u) = -45u*2 + u. Let r be o(1). Let n be (12/(-8))/(3/r). Suppose -n = -w - w. List the prime factors of w. 11 What are the prime factors of 2 + -1 + -3 + 58? 2, 7 Let y be 1(18 - 0/(-1)). Let i = y - 8. What are the prime factors of i? 2, 5 Suppose 2p - 455 = 5s - 174, 4s = 3p - 425. What are the prime factors of p? 11, 13 Suppose 5g = 4c + 29, 0 = 3c + 4g - 22 + 5. Let h be (c/1)/(-1) + 6. Suppose 4x + h = 51. What are the prime factors of x? 11 Suppose -5t = 3q - 39, 2q + 2t = -3t + 21. Let x = q + -9. What are the prime factors of x? 3 Let l = 15 - 0. List the prime factors of l. 3, 5 Suppose -19 = 4x - 7. Let n(p) = 7p - 9. Let f(l) = -4l + 5. Let a(s) = -5f(s) - 3n(s). What are the prime factors of a(x)? 5 Suppose 36 = 5q - q. Suppose f = 4f - q. Suppose -2z + fz - 2 = 0. List the prime factors of z. 2 Let y(a) = -a3 - 6a**2 - a - 4. Let h be y(-4). Let i be (-78)/3 - (1 + -4). Let k = i - h. What are the prime factors of k? 3
Let g(z) = 30z2 + 14z - 6. Let m(w) = -10w2 - 5w + 2. What is -6g(a) - 17m(a)? -10a2 + a + 2 Let t(b) = -b. Let l(v) = -2v*3 + 2v*2 - 5v - 2. Let a(u) = -u - 1. Let s(m) = -2a(m) + l(m). Determine -s(h) + 4t(h). 2h3 - 2h2 - h Let z(q) = -q2 - 2q + 7. Let o(s) = -s2 - s + 7. Give -4o(a) + 3z(a). a2 - 2a - 7 Let q(w) = -14w2 + w + 2. Let x(g) = g2 - 1. Let t(h) = q(h) + 2x(h). Let v be t(1). Let r(d) = -13d + 9. Let z(m) = -7m + 5. Determine vz(n) + 6r(n). -n - 1 Let b(d) = 35d2 + 28d - 28. Let q(t) = -t + 1. Calculate -b(o) - 28q(o). -35o*2 Suppose 2h - 8 = -2k, 2h - 3k = 2k + 1. Let c(v) = -5 + 2 - 1 + h. Let n(l) = -l*2 + 4. What is -4c(o) - n(o)? o*2 Let v = 127 + -126. Let m(q) = 0q*2 - 2 + 3q - q*2 + 3q*2. Let i(h) = h. Give vm(b) - 4i(b). 2b2 - b - 2 Let i(t) = t3 - 3t - 3. Let k = -69 - -73. Let y(f) = 5f*3 + 2 - f + 3f - 3f3 - 3f*3. Calculate ki(d) + 6y(d). -2d*3 Let b(l) = -5l*3 + 2l - 2. Suppose -2v = -7v + 20. Let t(u) be the third derivative of -3u6/40 + u4/8 - 2u3/3 - u2. What is vt(o) - 7b(o)? -o*3 - 2o - 2 Let k(x) = 2x - 14. Let h(i) = 4i - 28. Give -2h(a) + 5k(a). 2a - 14 Let h(d) = -d2 + 5d - 5. Let z(u) = -u + 1. Give 2h(b) + 10z(b). -2b2 Let q(x) = -x2 - 2x - 2. Let u(z) = z. Give -q(i) - 4u(i). i2 - 2i + 2 Let w(n) = n. Let u(p) = p + 1. Let s(b) be the second derivative of -b*3/6 - 3b. Let f(g) = -3s(g) + u(g). What is f(h) - 2w(h)? 2h + 1 Let f(u) = -7u + 3. Let o(y) = 36y - 16. Determine 11f(i) + 2o(i). -5i + 1 Let a(l) = -7l + 7. Let p(q) = -3q + 3. Let j(f) = 4a(f) - 9p(f). Let m = -29 - -30. Let i(o) = 9o - 1 - o - 4. Calculate mi(y) + 6j(y). 2y + 1 Let g(m) = m*2 - 11m + 4. Let a(w) = w*2 - 11w + 3. Give 4a(q) - 3g(q). q*2 - 11q Let c = 58 - 59. Let g(q) = -q + 1. Let u(n) = -7n + 8. Give cu(j) + 6g(j). j - 2 Let q = 36 + -39. Let u(t) = 2t*3 - 4t2 - 4. Let s(n) = -n3 + 3n2 + 3. Give qu(c) - 4s(c). -2c*3 Let t(h) = -2h*2 + 6h + 2. Let a be 1(3 + -1 - 1). Let b(n) = -2 + n + 0n + a + 2. Determine -4b(w) + t(w). -2w*2 + 2w - 2 Let a(k) = -k - 1. Let f(m) = 31m + 4. Calculate 6a(u) + 2f(u). 56u + 2 Let z(o) be the third derivative of o7/1008 + o6/360 + o*5/60 + 3o*2. Let t(i) be the third derivative of z(i). Let l(u) = -u - 1. What is 3l(n) + t(n)? 2n - 1 Let b(k) = -113k*3 - 11k*2. Let q(h) = 28h*3 + 3h*2. Calculate 6b(n) + 22q(n). -62n*3 Let n(p) = 2p*3 - 6p*2 + 5p - 1. Let z(w) = 2w3 - 5w*2 + 4w - 1. Give -4n(l) + 5z(l). 2l3 - l2 - 1 Let q(i) = -7i*2. Let c(w) = 42w*2. Suppose 175 = 7g - 2g. What is gq(y) + 6c(y)? 7y*2 Let y(r) = 5 - 2r - 2r - 8 + 0r. Let q(n) = 2n + 1. Calculate 5q(u) + 2y(u). 2u - 1 Suppose -l + 4l = 15. Let q(u) = 3 + 3u - 3. Let i(y) = -31 - 28 + 59 + 2y. Calculate li(a) - 3q(a). a Suppose 2h = -7 - 1. Let x(d) = 2d2 - 4d - 8. Let k(l) = l*2 - 1. Let v(m) = 4k(m) - x(m). Let c(y) = y*2 + 2y + 2. Determine hv(z) + 7c(z). -z*2 - 2z - 2 Let d(w) = 2w. Let v(b) be the first derivative of b + 4 + 1/2b*2. Calculate -d(h) + v(h). -h + 1 Let j(g) = 1 + 1 + g - 4. Let x(d) = -2d + 3. Let a(t) = t*2 + 5t - 27. Let q be a(-8). Let u = 1 - 3. Give qj(h) + ux(h). h Let y(i) = -4i2 + 6i + 4. Let m(s) = s*2 - s - 1. Calculate 10m(q) + 2y(q). 2q*2 + 2q - 2 Let r(n) = 3n2 + 3n - 10. Let h(c) = -4c2 - 4c + 11. Determine 5h(q) + 6r(q). -2q2 - 2q - 5 Let t(i) = 3i2 - 8i - 14. Let n(g) = 3g - 3g*2 + 2g + 46 + g*2 - 37. Give 8n(z) + 5t(z). -z2 + 2 Let v(r) = -6 - 2r + r - 1. Let p(w) = w + 6. What is -6p(z) - 5v(z)? -z - 1 Let z(q) be the third derivative of -7q6/30 + 4q*5/15 + 8q*3/3 + 16q*2. Let c(y) = 9y*3 - 5y*2 - 5. Determine 16c(s) + 5z(s). 4s3 Let x(l) = l2 + 0l2 + 2l - 3l. Let b(j) = -7j*2 + 4j + 1. Calculate -b(h) - 6x(h). h2 + 2h - 1 Let q(p) be the second derivative of -5p4/12 - p3/2 + 3p*2/2 - 2p. Let o be 42/(-10) + 2/10. Let w(r) = -6r2 - 4r + 4. Determine oq(l) + 3w(l). 2l2 Let p(r) = r3 + 9r*2 - r - 7. Let j be p(-9). Let q(l) = l + 6. Let i(m) = -m - 1. Let o(d) = -5i(d) - q(d). Let a(v) = 21v - 6. What is ja(f) - 11o(f)? -2f - 1 Let x be -3 - 1/((-2)/(-4)). Let w(u) = -6 - 3u - u + 0u + 2. Let y(r) = -6r - 6. What is xy(h) + 8w(h)? -2h - 2 Let n(p) = -p*2 - p. Let b(m) = -2m*3 + 6m*2 + 6m. Calculate b(j) + 6n(j). -2j*3 Let n(l) = -l + 1. Let t(m) = -8m - 17. What is 6n(h) - t(h)? 2h + 23 Let f(s) = -4s2 - 4. Suppose 29p = 25p - 12. Let u(i) = -5i*2 - 5. Determine pu(k) + 4f(k). -k2 - 1 Let c(o) = 2o*2 + 1. Let s(p) = -3 + 7 + 3 + p + 6p*2 - 4. Determine -7c(b) + 2s(b). -2b*2 + 2b - 1 Let g(d) = -d*3 + 2d2 + d + 1. Let f(o) = -o3 + o*2 + o. Let i(s) = -2f(s) + g(s). Let t(c) = -3c3 + 4c - 4. Give -4i(j) - t(j). -j3 Let j(c) = -2c*2 - c + 5. Let o(r) = -1. What is j(u) + 5o(u)? -2u2 - u Let x(j) = -5j*2 + 4j - 3. Let y(i) = -5i2 + 3i - 2. Calculate -3x(o) + 4y(o). -5o2 + 1 Let q(h) = -4h*2 + 12h + 7. Let g(o) = -o*2 + 3o + 2. What is 9g(n) - 2q(n)? -n*2 + 3n + 4 Let s(n) = 6n3 - 9n*2 - 15n + 9. Let o(d) = 3d3 - 4d*2 - 7d + 4. What is -9o(b) + 4s(b)? -3b3 + 3b Let r(v) = -v - 1. Let q(s) = s*3 - 4s*2 - s + 1. Let i be q(4). Let t(y) = -1. Determine it(g) + 3r(g). -3g Let x(o) be the second derivative of o3/2 - o2 + 2o. Let t(s) = 12s - 9. What is 2t(j) - 9x(j)? -3j Let u(t) = 13t*2 + 13t + 7. Let l(c) = -11c2 - 4c + 5. Let s(p) = 5p2 + 2p - 2. Let v(q) = -6l(q) - 14s(q). What is -2u(z) - 7v(z)? 2z2 + 2z Let u(x) = -1 - 4x2 + 1. Let l be u(1). Let v(r) = 2r + 3. Let f(b) = 2b + 2. Let j(o) = o2 + 4o. Let s be j(-5). Calculate lv(z) + sf(z). 2z - 2 Let f(x) = -3x*2 + 17x + 3. Let a(u) = u*2 - 6u - 1. Give 11a(t) + 4f(t). -t*2 + 2t + 1 Let l(r) = -14r - 8. Let b(n) = -13n - 7. Let s(f) = -3b(f) + 2l(f). Let c(v) = 5v + 2. Determine -7c(q) + 3s(q). -2q + 1 Let i(u) = -3u. Let m(d) be the first derivative of 15d*2/2 - 18d + 4. Let w(a) = -a + 1. Let y(p) = m(p) + 18w(p). Determine 3i(c) - 2y(c). -3c Let n(t) = -3t + t - 2t + 4 + 3t. Let c(o) = o - 7. Calculate -4c(p) - 7n(p). 3p Let m(b) = 4b2 - b + 15. Let n(g) = -6g*2 + 2g - 22. What is -7m(v) - 5n(v)? 2v2 - 3v + 5 Let o(v) = v*2 - 13v - 51. Let q be o(16). Let p(w) = 2w3 + 2w*2 + 2w - 2. Let b(y) = -2y3 - 3y*2 - y + 3. What is qp(u) - 2b(u)? -2u*3 - 4u Let g(q) = 8q2 - 7q + 15. Let i(h) = -4h2 + 3h - 7. Give -6g(u) - 13i(u). 4u2 + 3u + 1 Let j(w) = -w*2 - 3 + 2w + 2 + 4. Suppose 0 = -3n + 2v + 2, -n - v = -4. Let a(z) = 10 - 4zn + 8z + z - 2z. Give 4a(h) - 14j(h). -2h*2 - 2 Let o(r) = -23r*2 - 7r - 13. Let i(a) = -12a2 - 4a - 7. Calculate 11i(y) - 6o(y). 6y2 - 2y + 1 Let j(x) be the third derivative of -x6/120 - x5/60 + x*3/6 - 18x*2. Let z(b) = -2b3 - b2 + 3b + 3. Give 3j(n) - z(n). -n*3 - 2n*2 - 3n Let y(f) = -f*3 - 2f - 6. Suppose -3v - 3q + 2 = -2q, -3v - 2q + 7 = 0. Let s(p) = 1. Determine vy(d) - 5s(d). d3 + 2d + 1 Let j be 1-5(-9 - -8). Let h(i) = 3i3 + 7i*2 - 9i - 4 - 1 - 2i3. Let v(g) = g3 + 4g*2 - 5g - 3. Calculate jv(r) - 3h(r). 2r3 - r2 + 2r Let u(t) = 3t + 6. Let w = 2 + 4. Let l(n) = -n - 1. Determine wl(f) + u(f). -3f Suppose -4a + 33 = 9. Let v(y) = 8y2 - 2y - 1. Let m(l) = -40l2 + 10l + 5. Let h(o) = 2m(o) + 11v(o). Let s(i) = i*2. Give as(t) - h(t). -2t2 + 2t + 1 Let v(c) = 6c3 - 5c*2 + 7c + 4. Let a = -2 + 1. Let q be 5/2(-1 + a). Let p(b) = -7b*3 + 6b*2 - 8b - 5. Determine qp(n) - 6v(n). -n*3 - 2n + 1 Suppose -3l = 7 - 1. Let o(x) = 3x - 1. Let s = -9 + 11. Let m(w) = 5w - s - 6w + 2. Calculate lm(a) - o(a). -a + 1 Let q(u) = 6u + 3. Let c be (126/45)/(4/10). Let i(s) = 13s + 7. Determine cq(k) - 3i(k). 3k Let u(x) = 3x2 - 3x. Let z(r) = 6r2 - 11r. Let b(t) = 13t2 - 21t. Let s(y) = 3b(y) - 5z(y). Calculate 3s(n) - 8u(n). 3n2 Let t(c) = c3 + c2 + c + 1. Let o(l) = -6l. Let d be o(1). Let b(x) = 7x3 + 6x*2 + 7x + 6. Let j be ((-2)/(-10))/(1/5). Determine dt(z) + jb(z). z**3 + z
Find the common denominator of 19/3482730 and -8/50445. 3904140330 Calculate the least common multiple of 2050699 and 14896. 623412496 What is the common denominator of -37/21 and 79/14448? 14448 What is the common denominator of 97/16 and -53/21887446? 175099568 Calculate the least common multiple of 1170 and 60015. 4681170 Find the common denominator of 49/110 and -46/8357. 919270 What is the least common multiple of 83014004 and 14604? 249042012 Calculate the lowest common multiple of 638274 and 126252. 11488932 Calculate the smallest common multiple of 17575 and 675583. 16889575 What is the smallest common multiple of 16667797 and 9? 150010173 Find the common denominator of -14/1757289 and 17/183. 107194629 Calculate the smallest common multiple of 3276 and 944853. 11338236 Calculate the least common multiple of 261 and 9474876. 274771404 What is the smallest common multiple of 958315 and 1490? 285577870 Calculate the least common multiple of 19139246 and 848538. 172253214 Calculate the smallest common multiple of 3813490 and 8. 15253960 Find the common denominator of -109/10230 and -79/22902. 3549810 Find the common denominator of -61/45 and 16/557055. 557055 Calculate the common denominator of 109/286 and -21/64322362. 707545982 What is the least common multiple of 24800 and 119800? 14855200 Calculate the common denominator of -52/5985 and -127/138480. 55253520 Find the common denominator of 133/451344 and 81/62792. 3542599056 What is the least common multiple of 312 and 730824? 9500712 Find the common denominator of -37/164635796 and -49/1038. 493907388 What is the least common multiple of 7444650 and 912570? 141448350 What is the lowest common multiple of 200 and 25186080? 125930400 What is the common denominator of -55/36350949 and -1/16332? 145403796 Find the common denominator of -83/47050 and -81/274400. 258210400 Calculate the least common multiple of 4544850 and 1478. 4544850 What is the least common multiple of 11770590 and 18525? 1118206050 Calculate the common denominator of -125/24 and 5/25309599. 202476792 What is the common denominator of 11/944926 and 49/404188? 69924524 Calculate the common denominator of -103/10555080 and -109/20. 10555080 Find the common denominator of 109/78 and -37/104536640. 313609920 Calculate the common denominator of 73/155256 and 61/276. 3570888 What is the least common multiple of 408 and 1424936? 72671736 What is the common denominator of 13/40257 and -71/758160? 376805520 What is the least common multiple of 916335 and 4785305? 43067745 What is the least common multiple of 41834 and 2834? 4559906 Calculate the least common multiple of 20 and 11068032. 55340160 Calculate the common denominator of 17/15 and 83/178079565. 178079565 What is the lowest common multiple of 104864 and 4142? 217173344 What is the smallest common multiple of 40 and 10981560? 10981560 Calculate the common denominator of -109/260814 and 93/3042830. 9128490 Find the common denominator of 33/25067390 and -33/20053912. 100269560 Find the common denominator of -51/1280 and 55/2330664. 372906240 Calculate the smallest common multiple of 728 and 24616. 2240056 Calculate the least common multiple of 1038168 and 320. 41526720 Calculate the lowest common multiple of 27163100 and 24940. 787729900 What is the common denominator of 79/81666 and 25/301554? 1368150498 Calculate the common denominator of -127/7040 and 99/2247200. 98876800 Calculate the lowest common multiple of 16821441 and 7866. 33642882 Calculate the lowest common multiple of 187545 and 12717. 795003255 What is the smallest common multiple of 14936 and 921444? 3440671896 Find the common denominator of 67/31724085 and 15/36197. 222068595 Calculate the common denominator of 69/912905 and 1/3651620. 3651620 Calculate the lowest common multiple of 576252 and 1088476. 9796284 Calculate the common denominator of 97/5923206 and 91/40146174. 361315566 What is the smallest common multiple of 65612 and 4051541? 16206164 Calculate the common denominator of -59/9 and -27/212533364. 1912800276 Calculate the lowest common multiple of 478 and 526. 125714 Find the common denominator of 113/463530 and 99/56. 12978840 Calculate the common denominator of 83/192 and -86/107385. 6872640 Find the common denominator of 71/12 and 59/99375822. 198751644 Find the common denominator of -13/145659 and -151/420. 20392260 Calculate the least common multiple of 3454140 and 13202. 991338180 Calculate the lowest common multiple of 11 and 191903. 2110933 Calculate the common denominator of 33/692 and 81/298796. 51691708 Find the common denominator of 71/171801 and 26/279. 5325831 Calculate the least common multiple of 3511342 and 3006. 31602078 Find the common denominator of -67/23777636 and 71/10. 118888180 What is the common denominator of 64/9 and 5/418288851? 418288851 Find the common denominator of -111/115730 and -51/740. 8564020 Find the common denominator of 65/4 and -101/725437270. 1450874540 Calculate the lowest common multiple of 104521 and 36830. 30311090 What is the common denominator of -3/11976116 and 71/12? 35928348 Calculate the least common multiple of 157780 and 599564. 2997820 What is the common denominator of -37/570 and -19/3125? 356250 What is the least common multiple of 327 and 2585807? 7757421 Calculate the lowest common multiple of 3993 and 133881. 16199601 What is the least common multiple of 5111410 and 430? 5111410 Calculate the common denominator of -121/191464 and -37/1144. 2106104 What is the lowest common multiple of 13561068 and 1072? 54244272 Calculate the lowest common multiple of 1595070 and 638028. 3190140 What is the least common multiple of 30648828 and 38040? 306488280 Calculate the common denominator of 89/14156 and 91/6101236. 6101236 What is the least common multiple of 394443 and 45248247? 316737729 What is the least common multiple of 296 and 248442531? 1987540248 Find the common denominator of 97/281295 and -41/370125. 7032375 What is the least common multiple of 41111840 and 880968? 123335520 What is the least common multiple of 54232 and 12039504? 12039504 Calculate the common denominator of 121/312 and 71/1050540. 27314040 Find the common denominator of -77/23454 and 113/390900. 1172700 Find the common denominator of -155/627984 and 151/163404. 32027184 Calculate the smallest common multiple of 7414 and 233878. 2572658 What is the least common multiple of 6302272 and 808? 636529472 What is the least common multiple of 487392 and 8352? 42403104 Find the common denominator of 151/1483416 and 169/360. 7417080 Calculate the least common multiple of 98073260 and 343256410. 686512820 Calculate the least common multiple of 19098668 and 36. 171888012 Calculate the lowest common multiple of 569995 and 7370625. 213748125 What is the smallest common multiple of 2904 and 1866? 903144 Calculate the common denominator of 33/4040000 and 89/4848. 12120000 What is the common denominator of 107/1152 and -137/5094432? 20377728 Calculate the common denominator of -113/2992 and 2/1393. 4167856 Calculate the least common multiple of 26505 and 27528. 7845480 What is the least common multiple of 71544 and 48576? 13164096 What is the common denominator of -5/9546 and -143/3000774? 129033282 Calculate the common denominator of 139/20856828 and 43/4. 20856828 Calculate the common denominator of 43/16750 and -101/1364250. 91404750 What is the least common multiple of 320 and 6357120? 6357120 Calculate the smallest common multiple of 355050 and 21618600. 194567400 What is the common denominator of -46/7 and -19/3029612? 21207284 Calculate the common denominator of -62/9813 and -137/270. 883170 Find the common denominator of 121/24 and 77/86867184. 86867184 What is the lowest common multiple of 2375846 and 21382614? 21382614 Calculate the common denominator of -17/385 and 104/97253145. 680772015 Calculate the smallest common multiple of 73425 and 72270. 32160150 What is the least common multiple of 4293561 and 37512? 103045464 Calculate the least common multiple of 7160722 and 4163. 164696606 What is the common denominator of 23/382512 and -11/624? 382512 Calculate the smallest common multiple of 104084530 and 83267624. 416338120 What is the common denominator of -97/31029096 and 157/78? 403378248 What is the lowest common multiple of 13947476 and 17434345? 69737380 Find the common denominator of 131/2328 and -71/2845398. 11381592 Calculate the smallest common multiple of 321180 and 123365238. 1233652380 Find the common denominator of -109/300 and -31/6465. 129300
Solve -325 = -12y - 13y for y. 13 Solve 599p - 52p + 105 = -3177 for p. -6 Solve 4g - g = -16g - 285 for g. -15 Solve -69u = -8u + 116u - 12u for u. 0 Solve -5s + 450 = 500 for s. -10 Solve 1 - 119 = 13x - 14 for x. -8 Solve 125c = -1503 + 628 for c. -7 Solve 125f + 94f = 275f + 1792 for f. -32 Solve -273f + 251f + 22 = 0 for f. 1 Solve 18d - 8d = -16d - 390 for d. -15 Solve 148b + 324 = 28 for b. -2 Solve 8751 = 846n - 2835 + 2280 for n. 11 Solve 4z + 21z = -z + 3z for z. 0 Solve 23l + 45 = -21l - l for l. -1 Solve -174 = -78n - 252 for n. -1 Solve -31v - 961 = 143v + 605 for v. -9 Solve 0 = -62y + 28y + 35y + 14 for y. -14 Solve 17010 = -3425a + 3911a for a. 35 Solve -12j - 798 = -834 for j. 3 Solve 0 = 16g - 1069 + 1181 for g. -7 Solve 249v + 7v - 6400 = 0 for v. 25 Solve 1135 = 85u - 140 for u. 15 Solve 424 = 86s - 33s for s. 8 Solve -2r = -2954 + 2918 for r. 18 Solve 511l = 462l - 637 for l. -13 Solve 108v - 1027 + 1436 = -3155 for v. -33 Solve m + 29 = 18 for m. -11 Solve -14d + 231 - 38 = -3 for d. 14 Solve 282p - 1027 + 4975 = 0 for p. -14 Solve -o + 6o + 319 = 319 for o. 0 Solve 32206 = -20w + 31866 for w. -17 Solve -5l - 78 = 10l + 117 for l. -13 Solve -48q = 30q - 18q + 480 for q. -8 Solve -75 - 153 = 20l + 18l for l. -6 Solve -3926 = -6667z + 6818z for z. -26 Solve 60i = -150i - 2940 for i. -14 Solve 4452 = 446n - 1702 - 1428 for n. 17 Solve -144z + 1703 = -13z for z. 13 Solve -91r + 1152 = -102r + 83r for r. 16 Solve 45p + 1277 = 352p - 565 for p. 6 Solve 66c + 2564 - 2432 = 0 for c. -2 Solve 447c = 457c + 160 for c. -16 Solve 58h - 1696 = -362 for h. 23 Solve 377 + 151 = -t + 133t for t. 4 Solve -48o + 187 = -1253 for o. 30 Solve -5x + 24x - 256 = 51x for x. -8 Solve -2608v - 2856 = -2200v for v. -7 Solve -375650 = -28l - 374978 for l. 24 Solve 0 = -3491l + 3475l + 22 - 102 for l. -5 Solve -64 = -60k + 26k + 32k for k. 32 Solve 61l + 286 - 1140 = 0 for l. 14 Solve -16004 = -702n - 1262 for n. 21 Solve 216 = -21732q + 21714q for q. -12 Solve 0 = -19p - 45p + 128 for p. 2 Solve 979 = -21z + 769 for z. -10 Solve 31g - 368 = 4 for g. 12 Solve -31l = 40924 - 41668 for l. 24 Solve 746h = 479h - 7106 + 2300 for h. -18 Solve -291t - 1051 = -9781 for t. 30 Solve 44m - 7072 = -219m + 535m for m. -26 Solve 74b + 297b + 67b = 438 for b. 1 Solve -19h - 6201 = -6182 for h. -1 Solve 23f + 131066 = 131388 for f. 14 Solve -756q + 364q = 450q - 21892 for q. 26 Solve 259y - 5511 = 92y for y. 33 Solve -154h + 100h = 324 for h. -6 Solve -2f + f = -3f + 28 for f. 14 Solve -3p - 212 + 5 = -72p for p. 3 Solve 0 = 161m - 853 + 48 for m. 5 Solve -1135 - 5112 = -315z + 3833 for z. 32 Solve 372 = -521v + 369v - 1756 for v. -14 Solve 89v - 28v = 671 for v. 11 Solve 55t = 18 + 762 + 485 for t. 23 Solve -708 = -49h + 76 for h. 16 Solve 41a + 4a - 72a + 135 = 0 for a. 5 Solve 0 = -59c - 8c + 16c - 459 for c. -9 Solve -720 = -924u + 464u + 500u for u. -18 Solve 50b = 9b + 1022 - 366 for b. 16 Solve -1155i + 5903 = 15766 + 23632 for i. -29 Solve 238f - 22f - 3888 = 0 for f. 18 Solve -5935b = -5797b - 3450 for b. 25 Solve 30 = -30l + 120 for l. 3 Solve -68h + 1065 = 145h for h. 5 Solve 0 = 18u - 39u - 4 - 80 for u. -4 Solve -656 = 698o + 4240 + 2084 for o. -10 Solve 0 = -55i - 335i - 6240 for i. -16 Solve -104l + 1860 = 83l - 32l for l. 12 Solve -39p - 451 = -568 for p. 3 Solve -389 = -116r + 573 + 82 for r. 9 Solve -110k - 988 - 527 = 685 for k. -20 Solve -340a - 78 + 6198 = 0 for a. 18 Solve 9w + 14w + 140 - 2 = 0 for w. -6 Solve 44n = -247 + 263 - 192 for n. -4 Solve 2037g = 2028g - 117 for g. -13 Solve -4l = -7l + 17l - 14 for l. 1 Solve 311w - 290 = -1845 for w. -5 Solve 6732 = -127g + 6986 for g. 2 Solve 2304u - 2348u + 1408 = 0 for u. 32 Solve -216k + 407 = -427k + 248k for k. 11 Solve -489n + 516n = 53 + 55 for n. 4 Solve 48l + 22l = -350 for l. -5 Solve 0 = 88b - 0b + 2b - 450 for b. 5 Solve -38w - 40w - 277 = -1525 for w. 16 Solve 46n = -821n - 34136 + 8993 for n. -29 Solve -9f + 153 = 189 for f. -4 Solve -590 = 100w + 110 for w. -7 Solve -45674s + 160 = -45682s for s. -20 Solve -142g + 33 = -131g for g. 3 Solve 11r + 83r + 7393 - 5231 = 0 for r. -23 Solve 175n - 416n = 1205 for n. -5 Solve -13n - 270 = 194 - 399 for n. -5 Solve -140p = -86p + 174p + 456 for p. -2 Solve -936l + 2161 + 8100 = -605l for l. 31 Solve -957 = -30g - 57g for g. 11 Solve 1776o - 1826o = 300 for o. -6 Solve -543 = 80y + 410 - 73 for y. -11 Solve -264c + 3934 = 17c for c. 14 Solve 8 = 108j - 492j - 4216 for j. -11 Solve 28s + 154 = -32s + 67s for s. 22 Solve 0l - 107 = -4l - 63 for l. 11 Solve 15h = h + 500 - 290 for h. 15 Solve 39p - 4718 = -86p + 799p for p. -7 Solve 489b + 192b + 15544 - 2605 = 0 for b. -19 Solve 9g - 37g + 14g + 126 = 0 for g. 9 Solve -42b + 1178 = 52b - 420 for b. 17 Solve -646h + 717 = 496 - 5593 for h. 9 Solve -575 = 30m - 49 - 106 for m. -14 Solve 19p + 11p - 31p + 5 = 0 for p. 5 Solve -4884 = -84v - 5472 for v. -7 Solve 83k + 5899 = -264k for k. -17 Solve 452 = 117v - 102 - 616 for v. 10 Solve 25n = -39 + 414 for n. 15 Solve 15x - 21x = 56x + 1302 for x. -21 Solve 2711r = 2816r - 210 for r. 2 Solve 0 = 446m - 465m + 171 for m. 9 Solve -36z + 565 = -124z - 579 for z. -13 Solve 140z + 111 = 100z - 129 for z. -6 Solve 2449 + 692 = -560x - 779 for x. -7 Solve 43033 = -95w + 45028 for w. 21 Solve 27n - 1245 = -56n for n. 15 Solve -124i = 35i - 62i + 3977 for i. -41 Solve 294 - 303 = b for b. -9 Solve 1122 + 153 = 97y - 471 for y. 18 Solve -34c + 20361 = -651c for c. -33 Solve 157k - 292k - 945 = 0 for k. -7 Solve 102f - 232f + 10564 = 426f for f. 19 Solve -101r - 595 + 898 = 0 for r. 3 Solve 66v - 203 + 379 = -946 for v. -17 Solve -269 + 91 = -15g - 103 for g. 5 Solve 317q - 587 = 364 for q. 3 Solve 2856 = -21753z + 21585z for z. -17 Solve 209a = 28975 - 31065 for a. -10 Solve -5f = -53229 + 53259 for f. -6 Solve 547 = 78t + 313 for t. 3 Solve 125b = 117b - 96 for b. -12 Solve 36h + 91h + 399 + 617 = 0 for h. -8 Solve -68n - 243 - 29 = 0 for n. -4 Solve 5 = 51b - 462 - 94 for b. 11 Solve 71 = -130r + 201 for r. 1 Solve -213v - 51 = -216v for v. 17 Solve 0 = 26m - 361813 + 362255 for m. -17 Solve 0 = 99a - 88a - 132 for a. 12 Solve 111h - 439 + 571 = -645 for h. -7 Solve -116a + 208a - 107a + 165 = 0 for a. 11 Solve 425a - 158a - 5340 = 0 for a. 20 Solve -6915 = -503w + 2460 - 824 for w. 17 Solve 32d + 167 = -185 for d. -11 Solve -50w + 87734 - 86334 = 0 for w. 28 Solve -466u + 480u + 4 = -10 for u. -1 Solve -24m + 255 = -m - 8m for m. 17 Solve 24 + 66 = 15u for u. 6 Solve 3295 = -293j - 238j + 20818 for j. 33 Solve -899 = -422x + 218x + 733 for x. 8 Solve -52z - 7032 + 7968 = 0 for z. 18 Solve 2571a - 2590a - 190 = 0 for a. -10 Solve -14074 - 4178 = -368m - 139m for m. 36 Solve -64u + 288 = 1440 for u. -18 Solve 65 = 20q - 70 - 5 for q. 7 Solve 49s = 31s + 4s - 126 for s. -9 Solve -26761 - 11928 + 10472 = -973x for x. 29 Solve 0 = -49x - 52x + 104x - 33 for x. 11 Solve 28k + 240 - 59 = -43 for k. -8 Solve -385 = 575u - 540u for u. -11 Solve 35g + 1037 = 862 for g. -5 Solve -588c + 832 = -524c for c. 13 Solve -4x + 32x + 8 = -132 for x. -5 Solve 0 = -23d + 72 - 86 + 37 for d. 1 Solve -24u + 550 = 6u + 20u for u. 11 Solve 12w + 7w - 4w = 225 for w. 15 Solve -14u + 132 = 2u - 49u for u. -4 Solve -2432w + 4976 = -285w + 341w for w. 2 Solve -758 = -63i - 254 for i. 8 Solve 80p = 765 - 125 for p. 8 Solve -3708n = -3702n for n. 0 Solve -117z + 94z = 23 for z. -1 Solve -30u + 10 - 30 + 440 = 0 for u. 14 Solve -117 = 52n - 26 + 221 for n. -6 Solve -210 - 28 = 73w + 54 for w. -4 Solve -16z = -8z + 13z - 105 for z. 5 Solve 35k - 326 = -1026 for k. -20 Solve 172h + 49 = -10 - 113 for h. -1 Solve 2o - 7o = o - 72 for o. 12 Solve -12u - 7u - 43332 + 43674 = 0 for u. 18 Solve 25a = -500 + 400 for a. -4 Solve -332 = -14x - 500 for x. -12 Solve 24d - 400 = -424 for d. -1 Solve 47q - 77 + 229 = -177 for q. -7 Solve -30i + 1989 = -2114 + 3353 for i. 25 Solve 330817 = 36o + 330529 for o. 8 Solve 51d + 979 = -38d for d. -11 Solve -38o = 73o - 111 for o. 1 Solve -115l + 265 = 274 + 796 for l. -7 Solve -178a - 662 = 2364 for a. -17 Solve 245t + 8 + 13 = 266t for t. 1 Solve 15923s - 15944s + 441 = 0 for s. 21 Solve -298x - 230x + 7509 + 5163 = 0 for x. 24 Solve -1838o = -1822o + 176 for o. -11 Solve -1421 + 1361 = 6y for y. -10 Solve -1660 = 47c - 1472 for c. -4
List the prime factors of 291118916. 2, 11, 6616339 List the prime factors of 76340049. 3, 25446683 What are the prime factors of 48905799? 3, 16301933 What are the prime factors of 93300174? 2, 3, 11, 41, 1277 List the prime factors of 3933308991. 3, 1311102997 What are the prime factors of 2073738571? 463, 4478917 What are the prime factors of 59657261? 59657261 What are the prime factors of 419909919? 3, 11, 13, 23, 42557 List the prime factors of 19014631. 19014631 List the prime factors of 2212539737. 2212539737 What are the prime factors of 163930446? 2, 3, 29, 104681 List the prime factors of 75860883. 3, 7, 1204141 What are the prime factors of 122628? 2, 3, 11, 929 What are the prime factors of 1369989487? 1369989487 What are the prime factors of 81593445? 3, 5, 5439563 List the prime factors of 568816960. 2, 5, 1777553 What are the prime factors of 127477127? 29, 83, 211, 251 List the prime factors of 1146906618. 2, 3, 11, 13, 233, 5737 List the prime factors of 3709366992. 2, 3, 379, 67967 List the prime factors of 2898453995. 5, 383, 1513553 List the prime factors of 79790470. 2, 5, 229, 34843 List the prime factors of 175310739. 3, 19, 1025209 List the prime factors of 958852762. 2, 7, 5231, 13093 List the prime factors of 235289248. 2, 17, 617, 701 What are the prime factors of 123678209? 123678209 List the prime factors of 771469808. 2, 5749, 8387 List the prime factors of 623486240. 2, 5, 13, 43, 6971 List the prime factors of 618798851. 11, 47, 421, 2843 List the prime factors of 28082052. 2, 3, 167, 173 List the prime factors of 378361738. 2, 189180869 What are the prime factors of 143836813? 17, 757, 11177 What are the prime factors of 6739837? 13, 17, 30497 List the prime factors of 56538824. 2, 1297, 5449 What are the prime factors of 98030471? 7, 11, 367, 3469 What are the prime factors of 6959925? 3, 5, 7, 491 List the prime factors of 342818360. 2, 5, 43, 199313 What are the prime factors of 304154656? 2, 13, 731141 What are the prime factors of 1664405201? 151, 2437, 4523 What are the prime factors of 33343673? 11, 59, 83, 619 List the prime factors of 62160424. 2, 7770053 What are the prime factors of 74212537? 7, 19, 29, 71, 271 List the prime factors of 30890591. 127, 243233 What are the prime factors of 349986613? 53, 1129, 5849 What are the prime factors of 166175740? 2, 5, 73, 113819 What are the prime factors of 53778596? 2, 3253, 4133 What are the prime factors of 235214510? 2, 5, 23521451 List the prime factors of 699713191. 79, 2659, 3331 What are the prime factors of 519204507? 3, 19, 23, 67, 257 What are the prime factors of 97868774? 2, 37, 43, 30757 List the prime factors of 1363407870. 2, 3, 5, 11, 4131539 What are the prime factors of 297728089? 17, 1030201 What are the prime factors of 165289429? 101, 1636529 What are the prime factors of 24275705? 5, 97, 50053 What are the prime factors of 1057053674? 2, 14251, 37087 List the prime factors of 818018969. 818018969 What are the prime factors of 681512059? 719, 947861 List the prime factors of 455112095. 5, 41, 2220059 List the prime factors of 643076861. 7, 3079, 29837 What are the prime factors of 142159050? 2, 3, 5, 11, 3191 List the prime factors of 596297079. 3, 7, 181, 17431 List the prime factors of 117121107. 3, 39040369 What are the prime factors of 71998417? 17, 4235201 What are the prime factors of 111225297? 3, 19, 1951321 What are the prime factors of 73363902? 2, 3, 19, 157, 4099 List the prime factors of 4473152645. 5, 13, 68817733 List the prime factors of 47708879. 103, 479, 967 What are the prime factors of 3341871607? 3341871607 What are the prime factors of 2219488474? 2, 7, 158534891 List the prime factors of 30066337. 7, 197, 21803 List the prime factors of 2483182471. 7, 11, 71, 454213 What are the prime factors of 157486924? 2, 7, 89, 63197 What are the prime factors of 3577665725? 5, 17, 8418037 List the prime factors of 92309756. 2, 7, 11, 107, 2801 What are the prime factors of 185794166? 2, 61, 337, 4519 What are the prime factors of 266773315? 5, 167, 319489 List the prime factors of 219928831. 219928831 What are the prime factors of 79553112? 2, 3, 3314713 What are the prime factors of 247256124? 2, 3, 31, 664667 List the prime factors of 327224638. 2, 13, 131, 191, 503 List the prime factors of 342459126. 2, 3, 19025507 What are the prime factors of 100272725? 5, 7, 79, 7253 What are the prime factors of 494405930? 2, 5, 23, 2149591 What are the prime factors of 18436744? 2, 2304593 List the prime factors of 864402546. 2, 3, 7, 53, 577, 673 List the prime factors of 567949635. 3, 5, 11, 59, 19447 What are the prime factors of 11669061? 3, 449, 8663 What are the prime factors of 940115752? 2, 191, 615259 What are the prime factors of 1557879256? 2, 194734907 List the prime factors of 17521130. 2, 5, 11, 47, 3389 List the prime factors of 4269301465. 5, 11, 13, 491, 12161 What are the prime factors of 3135793871? 7, 17, 31, 89, 9551 What are the prime factors of 3325456794? 2, 3, 11, 23, 199153 List the prime factors of 2089873218. 2, 3, 263, 1324381 What are the prime factors of 940844312? 2, 593, 198323 What are the prime factors of 505656387? 3, 56184043 What are the prime factors of 2432229859? 2432229859 List the prime factors of 5203698623. 17, 306099919 List the prime factors of 11853459. 3, 61, 2399 List the prime factors of 72999039. 3, 37, 657649 What are the prime factors of 502959514? 2, 251479757 What are the prime factors of 745851405? 3, 5, 13, 3824879 List the prime factors of 2714039825. 5, 7, 59, 83, 3167 List the prime factors of 1173296603. 37, 31710719 What are the prime factors of 902181867? 3, 67, 293, 15319 List the prime factors of 1034678470. 2, 5, 7, 43, 139, 2473 What are the prime factors of 402435500? 2, 5, 41, 67, 293 What are the prime factors of 872028614? 2, 59, 337, 21929 List the prime factors of 2544248950. 2, 5, 251, 202729 List the prime factors of 6799263303. 3, 7, 323774443 List the prime factors of 100738549. 17, 5925797 What are the prime factors of 2824180184? 2, 7, 769, 65581 List the prime factors of 123036194. 2, 6827, 9011 What are the prime factors of 584384038? 2, 7, 31, 233, 5779 What are the prime factors of 592943714? 2, 11, 17, 1585411 List the prime factors of 320143668. 2, 3, 13, 739, 2777 What are the prime factors of 706091798? 2, 17783, 19853 What are the prime factors of 41929989? 3, 23, 607681 List the prime factors of 1779604643. 33827, 52609 List the prime factors of 25577143. 25577143 What are the prime factors of 5982305362? 2, 11, 71, 3829901 What are the prime factors of 184795216? 2, 19, 31, 19609 What are the prime factors of 67374015? 3, 5, 23, 401, 487 What are the prime factors of 1325879658? 2, 3, 24553327 What are the prime factors of 17736348? 2, 3, 7, 19, 11113 List the prime factors of 62124292. 2, 101, 367, 419 List the prime factors of 56945621. 71, 73, 10987 What are the prime factors of 101496424? 2, 23, 67, 8233 List the prime factors of 12036407. 12036407 What are the prime factors of 165526908? 2, 3, 13793909 List the prime factors of 148570118. 2, 74285059 List the prime factors of 2672952649. 29, 31, 2973251 What are the prime factors of 308400464? 2, 47, 67, 6121 What are the prime factors of 699795496? 2, 87474437 What are the prime factors of 107417826? 2, 3, 359, 1847 List the prime factors of 57891408. 2, 3, 1206071 List the prime factors of 1047993182. 2, 523996591 List the prime factors of 37278258. 2, 3, 6213043 List the prime factors of 36922011. 3, 7, 17, 103423 What are the prime factors of 21342935? 5, 47, 90821 What are the prime factors of 37231384? 2, 4653923 What are the prime factors of 447549906? 2, 3, 74591651 What are the prime factors of 515865690? 2, 3, 5, 41, 139801 List the prime factors of 406343297. 406343297 What are the prime factors of 3823413371? 1231, 3105941 List the prime factors of 371878922. 2, 185939461 List the prime factors of 218886672. 2, 3, 37, 3331 What are the prime factors of 84073629? 3, 151, 185593 List the prime factors of 46863500. 2, 5, 19, 4933 List the prime factors of 1764756952. 2, 7, 29, 67, 331 List the prime factors of 2206508649. 3, 735502883 What are the prime factors of 37321733? 79, 229, 2063 What are the prime factors of 64905516? 2, 3, 13, 46229 What are the prime factors of 2476698026? 2, 11, 5953, 18911 What are the prime factors of 40232428? 2, 23, 61, 67, 107 List the prime factors of 391490536. 2, 48936317 List the prime factors of 335157416. 2, 11, 19, 18223 List the prime factors of 34650940. 2, 5, 29, 59743
Let m be 5 + (-66)/(-1 - 0). Suppose 0 = 5d - x + 6x - 305, -m = -d + 4x. What is the units digit of d? 3 Suppose -121 = 4l - 1345. What is the tens digit of l? 0 Let j be 13/(-9) + (-14)/(-6). Suppose -2h + 317 = i, 0i + jh = i - 325. What is the units digit of i? 1 Let m be 10/(-2)(-4)/10. Let b(p) = -5p - 9 - p*3 + 10p2 + 8 - pm. What is the tens digit of b(8)? 2 Suppose 1 = 3j + 3r + 76, -3j = -2r + 50. Let y be 377/3 - j/60. Let k = y + -82. What is the units digit of k? 4 Let p = 79 - 59. Let w(n) = -n*2 + 22n - 30. What is the units digit of w(p)? 0 Let r = 10 + -14. Let f be 15/4 + r/(-16). Suppose -v - f + 38 = 0. What is the tens digit of v? 3 Suppose -7u = 2u - 486. Let r = u + -32. What is the units digit of r? 2 Suppose -3r - f = 31 + 3, -4r + f - 43 = 0. Let g = -9 - r. Suppose gx + 3x - 85 = 0. What is the units digit of x? 7 Suppose -13 = -2v - 7. Suppose -288 = vj - 6j. What is the tens digit of j? 9 Let y be (-8)/6(-48)/32. Suppose 5o + 4w = 164, 0o - o + 44 = -yw. What is the tens digit of o? 3 Let i = -22 - -23. Suppose 4z + i = -15. Let h = z - -13. What is the units digit of h? 9 Let u = -5 - -10. Suppose 2v = 3h - 172, -2h + h = uv - 29. What is the units digit of (-12)/(-9)h/3? 4 Suppose 4c - 482 = 714. What is the units digit of c? 9 Let z = -133 - -109. Suppose 6r - r - 275 = -5o, -2r = o - 52. Let x = o + z. What is the tens digit of x? 3 Let j = 72 + -64. Suppose -3h + j - 2 = 0, 3o - 3h = 237. What is the tens digit of o? 8 Let a be 1912/(-60) + (-6)/45. Let t = 23 + a. Let c = 34 + t. What is the units digit of c? 5 Let a = 2 - 11. Let v(z) = 75z*3 - 76z*3 + 4z - 2z2 - 6z*2 - 11. What is the units digit of v(a)? 4 Let g(y) = 3y*3 - 2y*2 + 5y + 16. Let t be g(-3). What is the tens digit of t/(5/(-2) - -2)? 9 Let p(c) = -5c3 - 120c*2 - 2c - 29. What is the units digit of p(-25)? 6 Suppose 16g - 2g + 9492 = 0. What is the tens digit of (-3)/4 - (g/8 + 4)? 8 Suppose 3a - 2871 = -5k, 5a = 6a + 3. What is the hundreds digit of k? 5 Let a = 627 - -90. What is the units digit of a? 7 What is the units digit of 398 + 1 + -2 + -1? 6 Let g be 2 + (21 - (-12)/(-4)). Suppose 2m = 50 + g. What is the units digit of m? 5 Let w(g) = 46g*2 + 25g - 28. What is the tens digit of w(-6)? 7 Let o(a) = 14a2 + 28a - 353. What is the hundreds digit of o(12)? 9 Let v(d) = d*3 - 14d*2 + d - 10. Let c be v(14). Suppose -a + 160 = 2a + 4n, cn - 4 = 0. What is the units digit of a? 2 Let k(n) = 8n + 16. Let l(u) = 17u + 32. Suppose 4m + d - 23 = 6d, 3m + 4d + 6 = 0. Let o(h) = ml(h) - 5k(h). What is the tens digit of o(-10)? 4 Suppose 707 - 291 = t. What is the units digit of t? 6 Suppose 4f + 4g = -g + 1243, 3f = -3g + 936. Suppose 355 = 7j - f. What is the tens digit of j? 9 Suppose 4d + 0d - c - 9392 = 0, -2d + 3c + 4706 = 0. What is the hundreds digit of d? 3 Let d = -8346 - -12460. What is the units digit of d? 4 Let c(x) be the first derivative of -x4/4 + 4x*3/3 + 9x*2/2 - 3x + 6. Let m be c(6). Let r = 29 + m. What is the units digit of r? 8 Suppose 0u + 5u + 395 = 0. Let f = u + 170. What is the tens digit of f? 9 Let l(d) = -d*2 - 48d - 5. What is the units digit of l(-27)? 2 Let j = 2831 - 1543. What is the thousands digit of j? 1 Let b(c) = 32c2 - 3c + 7. What is the hundreds digit of b(4)? 5 Let b(i) = 14i2 + 7i - 8. What is the tens digit of b(7)? 2 Let n = -7 + 9. Let j(u) = 2 + 1 - 4u + 6u - u*3 + 2un. What is the units digit of j(-3)? 2 Let l(w) = w3 + 5w2 + 8w + 7. Let m be l(-6). Let q(g) = 17g - 81. Let s be q(12). Let p = m + s. What is the units digit of p? 6 Let l be (-3)/6 - ((-1540)/8 - -3). Let t = l + -46. What is the units digit of t? 3 Let v be (-3)/(-1) - 980/(-4). Suppose -50 = 2z - v. What is the tens digit of z? 9 Let y = 1531 + -1406. What is the units digit of y? 5 Suppose 17g + 26368 = 33g. What is the tens digit of g? 4 Let m(p) = 49p + 1115. What is the hundreds digit of m(50)? 5 Suppose 3h - 5j = -20, h - j = -1 - 3. Let t be 1 + -3 + (2 - h). Suppose 5k - 2r + t = 35, r = -k. What is the units digit of k? 5 Suppose -40n + 48n - 2280 = 0. What is the tens digit of n? 8 Let b = -6 - -2. Let t be -7 + 28/b + 4. What is the units digit of (-94)/(-10) + (-6)/t? 0 Let t(u) be the third derivative of u6/120 - u5/30 - u4/12 - u3/6 - 5u*2. Let w be t(3). Suppose wj = -2j + 8. What is the units digit of j? 2 Suppose -49 - 28 = -11y. Suppose 0 = 5b + ym - 6m - 1230, b + 4m - 227 = 0. What is the hundreds digit of b? 2 Suppose 2h = 5j - 1806, -h + 4h + 718 = 2j. What is the units digit of j? 2 Let d be (4/5)/((-10)/(-125)). Suppose b - 13 = -2a, 5b - 6b + 5a = 15. Suppose 0 = -5u - 0h - h + d, -u = -bh - 2. What is the units digit of u? 2 Let a(v) = 23 - 88 + 35 - 5v. What is the units digit of a(-12)? 0 Let s = 709 - 213. Suppose -a = 7a - s. What is the tens digit of a? 6 Let j = 5348 + -3813. What is the tens digit of j? 3 Let j = 2090 + -1395. What is the units digit of j? 5 Suppose -z + 3i - 5i + 314 = 0, -4z - 5i + 1241 = 0. What is the units digit of z? 4 What is the units digit of (5485/(-4))/(430/(-688))? 4 Suppose -10o + 1237 + 343 = 0. What is the tens digit of o? 5 Let s(z) = z*3 + 7z*2 - 2z + 7. Let y be s(-8). Let l = 14 + y. Let t = l - -32. What is the units digit of t? 5 Suppose 5m - 208 - 802 = 0. Let c = m - 15. What is the units digit of c? 7 Let l(y) be the third derivative of 2y5/15 - y4/12 - y*3/6 - 3y*2. What is the tens digit of l(-2)? 3 Suppose 0 = 2s + 120 + 150. Let p = -26 - s. Suppose 5z - p = 96. What is the tens digit of z? 4 Let n(d) = 2d*2 - 2d - 3. Let i be n(6). Suppose -7t + 4t + 111 = 0. Let r = i - t. What is the tens digit of r? 2 Let j be (-2)/6 + (-30)/(-9). Suppose -940 = -5y + 8f - jf, -2f - 2 = 0. What is the tens digit of y? 8 Suppose 0 = -m, 10m - 7m = -5s + 5520. What is the thousands digit of s? 1 Let b(h) = -h3 + 8h*2 - 7h. Let u be b(6). Let d = -24 + u. What is the units digit of d? 6 Suppose 0 = -2p - 2u, -3p + 2 = -5u - 22. Let t be (3 - p)(-2)/(-4). Suppose 3w + 1 - 5 = -m, t = -m - 5w + 6. What is the units digit of m? 1 Suppose -5f - 5k + 7 = -8, 3k = 2f + 14. What is the tens digit of (390/20)/(34/(-40) - f)? 3 Suppose 2l = -2p + 866, 3l = -3p + 6p + 1281. What is the units digit of l? 0 Let x(r) = -r*3 + 2r*2 + 3. Let q(b) = -6b*3 + 11b*2 + b + 16. Let n(z) = 6q(z) - 33x(z). What is the units digit of n(-3)? 0 Let n(l) be the third derivative of l5/60 + l4/12 + 2l*3 + 35l*2. What is the units digit of n(8)? 2 Let d = 4 - 1. Suppose -5p + 38 = -3h, 2h - 4p + p + 24 = 0. What is the units digit of h/((6/(-17))/d)? 1 Suppose 4j + 12 = -5u, -5u - 4j - 8 = -u. Let q be ((-1)/(-3))/(u/204). Let y = 37 + q. What is the units digit of y? 0 Let w = 1208 + 3142. What is the hundreds digit of w? 3 Let p(h) = 2h*3 - 10h*2 + 7h + 13. Let t be p(7). Let d = t + -120. What is the tens digit of d? 3 Let n(j) = 0 + 6j + 1 - 2. Suppose 0 = 5s - 5 - 20. What is the units digit of n(s)? 9 Suppose 5l - 5f + 2f = 42, -5l - f + 26 = 0. Suppose 1575 = 3v + lv. What is the units digit of v? 5 Let o = 1469 + -1008. Suppose 2v + 128 - o = -5i, 0 = -3i + 9. What is the hundreds digit of v? 1 What is the tens digit of (-8)/(-4)-2 - (-18809)/7? 8 Suppose -11 + 3 = -2j. Suppose 126 = -3r - jw, 3r - 3w + 168 = -r. Let m = r - -74. What is the tens digit of m? 3 Let p be 42/(2/(-2 + -6)). Let c be (2/(-2) - p) + -2. Suppose -7x = -2x - c. What is the tens digit of x? 3 Let s(x) = 2x + 1. Let t be s(-2). What is the hundreds digit of (-51)/(-34)(-2 - 562/t)? 2 Let h = 5 - 8. Let g = -42 - -46. What is the tens digit of 2 + h + g + 18? 2 Let m(c) = -252c - 6. What is the units digit of m(-2)? 8 What is the tens digit of (-230 - -3)/((-3)/6)? 5 Let z = 20 - 20. Let s be (0/(-2))/(-2 - z). Suppose -x - h + 35 = -0x, s = 4x + 5h - 135. What is the tens digit of x? 4 Let k(j) be the second derivative of j4/12 + j3 - 25j*2/2 + 15j. What is the units digit of k(-13)? 6 Let d be -5 + (-162)/(-30) - 86/(-10). Suppose dg + g = 1230. What is the units digit of g? 3 Suppose 0 = -8q + 5q + 6, 4q - 8 = d. Let x(a) = 14 - a*2 - a + 2a*2 + 14. What is the units digit of x(d)? 8 Let z(y) = -29y - 67. Let m be 318/(-39) - 6/(-39). What is the tens digit of z(m)? 6
Evaluate (-36 - -37) + (-6 - 4). -9 What is (1 - 15) + (2 - (-8)/1)? -4 422/(-1055) + ((-4)/(-6))/((-45)/(-12)) -2/9 What is the value of 24/28 + 1560/(-2310)? 2/11 Calculate (2/(-10))/((-2)/(-22) - (-1064)/(-1540)). 1/3 What is the value of (-60)/(-16)512/(-384)? -5 Calculate (-42)/(-4)-14(-34)/833. 6 What is the value of (((-9984)/260)/32)/(6/(-20))? 4 Calculate (-180)/(-45) - 203/56. 3/8 Evaluate -1 + (6/(-20))/(6 + 1287/(-208)). 3/5 Evaluate -49(-35 - (-10458)/294). -28 Calculate 18 - 8/((-1)/6(-74 - -80)). 26 What is the value of 1/(-1)-2 + 64/(-16)? -2 ((-20460)/(-90))/31-61/(-4) 11 What is the value of 10/(-6)(-104)/(-26)6/5? -8 Evaluate (3720/(-80) + 46)((-9)/8 + 1). 1/16 What is (-108)/(-351) + 45/(-104)? -1/8 (-9 - 128/(-12))/(343/147) 5/7 What is ((9880/45)/52)/(2/9)? 19 What is the value of (9/2 - 0) + 131639/(-4862)? 2/17 Calculate (-330)/(-7920)(-32)/(-30). 2/45 Calculate (-13)/(208/24)93/9. -9/2 What is -2 + (18 - (19 - 11) - 2)? 6 What is the value of 28/(-21) - 90/(-81)? -2/9 Calculate (1 - 5/2) + (6/6)/4. -5/4 (50/96 + (-3)/9)/(324/48) 1/36 4/(-6) + (204/9010 - 1) 21 22/(-5) + 12/(-15)(-12 - -7) -2/5 What is the value of (-61)/(-33) + (-6)/3610? 2/11 Calculate (147 - 143)30/8. 15 ((-1045)/(-570))/(22/4) 1/3 What is the value of 150/5(-1 + 3/(-24)-12)? 15 What is the value of (2(-6)/(-39))/2? 2/13 What is the value of (-5)/(-10 - (1240/(-12))/10)? -15 Evaluate (-204)/(-27) - (-2506)/(-1611). 6 Calculate (-2478)/3540 + (18/48)/(1/(-4)). -11/5 0 + 0/(-2) + -4 + 1000/220 6/11 Evaluate ((-1)/3)/(190/45 - (-48)/108). -1/14 What is 4 - (-8 - (3 - 9) - -9)? -3 What is the value of 3228/(-4035)2/28? -2/35 Calculate (-14 - (-12 + 16))(16/5 + -3). -18/5 9680/(-10164) + (-5)/7 -5/3 344/(-1204) - (0 + (-144)/(-35)) -22/5 (2/(-6))/(36/72) -2/3 What is the value of -2 - (-22)/12 - (-20)/(-720)-222? 6 -7813/392/(-4) 13 Calculate -16((-30)/20 - 54/(-24)). -12 Evaluate 114/(-4)(-5)/95133/21. 19/2 6/(-8) - (-54)/(-480)28/(-3) 3/10 What is 66/(-176)1(-8)/6-6? -3 ((-2)/(-5) - (-8352)/(-480)) + -9 -26 What is ((-8)/(-36) + (-10)/18)/((-1)/1)? 1/3 What is the value of 232/(-174)8/24? -4/9 (170/153)/(2/94) 5/4 Evaluate (40/70)/(8 + 167/(-21)). 12 Calculate 2/(-3)(150/210 + (-95)/(-14)). -5 What is ((-162)/(-192))/((-17)/102) - -5? -1/16 Evaluate (1650 - 1681) + (70 - -1). 40 What is the value of (39/(-156))/((-4)/80)? 5 What is 1 - (-21 - 1113/(-49))? -5/7 Evaluate (0 - 171/18 - -5)(-104)/(-39). -12 Evaluate -15 + 136/17 + -1. -8 What is the value of 8631/8222/14? 3/2 What is the value of 8/36 - (-158)/18? 9 Evaluate (-2121/2205)/(27/(-15)). 1/9 What is ((-1311)/396 - (-1)/4) + 2 + 1? -2/33 Evaluate (-1142/3465)/(-1 - 3/(-6)). 4/15 Calculate (-1166)/(-242) + -7 + (-553)/(-77) - -17. 22 What is the value of -2 - 4 - (-231)/35? 3/5 Calculate (-373)/25 - ((-16)/350)/(912/(-1596)). -15 4/250 - (-16270)/(-1250) -13 Calculate 15/(-12)2093/2990. -7/8 (((-456)/16)/19)/(6(-1)/100) 25 15/22 - (3 + (-40)/16) 2/11 (((-8)/24)/(-1))/(41/1107) 9 Calculate -11 + (-19 - (-48 + 22)). -4 What is the value of 5/(-6) - (-752)/(-1128)? -3/2 (-640)/2080 + (-34)/(-195) -2/15 What is the value of (-1764)/(-49) + -40 + 0 + 2 + 20? 18 What is the value of 5/(2090/196) + 14 + (-1876)/133? 4/11 ((-7)/2 + 120/30)/((-8)/(-64)) 4 Evaluate (-1356)/(-3729)6/(-16). -3/22 Calculate 705/235 + 86/(-28). -1/14 ((-1098)/108)/(-61)102 17 Calculate (-4 + 3)/2 + 10/100. -2/5 What is the value of 04/12 - 69/(-207)? 1/3 What is ((-2520)/4410)/(2/(-11) - (-480)/3003)? 26 Calculate 7/((-2)/2 + 351/234). 14 What is (70/60)/(119/(-340))? -10/3 What is (2700/(-15))/10 + 30? 12 What is the value of 1984/(-124) - (-11 - -8)? -13 What is the value of (1/12 - 424/(-96))(-1 - -3)? 9 Calculate 6312/2160 - 3/4. -2/5 Evaluate (-120)/75 + 891/585. -1/13 (-2)/(-4(-7 + 6 - (-21)/14)) 1 (-34)/(-63) - 36/84 - (-96)/(-135) -3/5 What is the value of 12(-10)/420 - -41(-1)/(-21)? 5/3 Evaluate (420/(-400) + (-2)/(-8))20. -16 Calculate (-4 + 155/30)/(364/208). 2/3 What is -160/24 + 0? -5/2 (-1 + 6/4)/((-28)/504) -9 Calculate ((-376)/(-91) - (-156)/(-546)) + -4. -2/13 (13 - 52)/3 + 19 6 ((-31 - -1)/(-6))/(5840/(-3504)) -1/5 What is (-54)/3 - (-8)/((-104)/(-143))? -7 What is 4872/(-216) + 7/126-8? -23 ((-6160)/(-264))/(21/18) 20 Calculate (333/1480)/((-6)/48). -9/5 -21 + 30 - (39 + -22) -8 What is the value of (34 + 5040/(-175))/(-21/5)? -13 What is (14/35)/(((-34)/4)/((-55)/(-22)))? -2/17 What is the value of (31 - 33)/((-12)/3)4/(-47)? -2/47 What is the value of (2/16 + (-141)/360)/(770/(-105))? 2/55 (-3)/(-3) + 1 - (-6 + (-592)/(-72)) -2/9 Calculate 64/352 + 1764/99. 18 Calculate 2 + 1 - (440/(-15))/(-11). 1/3 6-1 + (2/(-35))/(170/(-15300)) -6/7 (719/719)/(1 + (-10)/8) -4 What is (-108)/(-8) - 14 - 0? -1/2 What is (-3)/63 + 100(-130)/2184? -6 What is the value of (641 + -613)(-1)/2? -14 14/(-4 + (7 - 5))4 -28 What is the value of ((-3)/(-42))/(200/(-140))? -1/20 What is ((-135)/200)/9250/(-450)? 1/24 What is the value of (-10)/(-35) - ((-115)/(-7))/5? -3 What is 10/(-644) + ((-4275)/(-126) - 34)? -2/23 Calculate 1185/240 - (17 + -12). -1/16 What is (-629)/(-21) + 20/(340 - -80)? 30 What is 1386/90 - 11 - (-5 - -8)? 7/5 (3 + 552/(-180))(-40)/(-24) -1/9 What is (-2310)/77 - (3 + -23)? -10 Calculate 6 - (-140)/60 - (8 - -1). -2/3 (19/(-57))/(7/(-168)) 8 Calculate (-8)/12((32 - 26) + -3). -2 Calculate 126/132(-64)/224. -3/11 What is the value of 12/22 + (6900/176 - 35/(-28))? 41 What is the value of (30/34 - 1) + ((-1064)/(-476))/19? 0 Evaluate ((-7)/28 + 2/40)/(14/(-1330)). 19 Calculate ((-1708)/305)/(48/30). -7/2 What is the value of 208/26-3 + 7? -17 Calculate ((-72)/54)/(110/453). -2/11 What is the value of -68/72 - -3(-340)/90? -12 Calculate (-7 - 16)/(38/38). -23 What is the value of 63/(-30)(-18 - -15)8/42? 6/5 What is the value of ((-68)/(-408))/(21/9)? 1/14 Calculate 13 + (-17 - (0 - 4)). 0 Calculate ((5/(-20))/((-1)/2))/((-4)/40). -5 What is the value of (((-50)/(-12))/((-50)/(-15)))/((-6)/(-72))? 15 Evaluate 15 + -29 + 16 + 13. 15 ((-3)/4)/((-21)/(-12) - 2) 3 Calculate (-2 - (2 - 4) - 0/22)/(-3). 0 -277/(-945)5 1 What is the value of 24/(-9) + (-17 - (-118)/6)? 0 Evaluate ((-145)/1160)/((-10)/(-8)). -1/10 What is 1309/154 - (2/4 + 0)? 8 Calculate 3(88/18 - 4)(-736)/(-256). 23/3 Evaluate (-7)/301 - (-4950)/27950. 2/13 Evaluate 6/11((-85)/(-102) - (-6)/(-12)). 2/11 Calculate (-146)/42 - ((-8 - 1668/(-84)) + -11). -13/3 What is the value of (-1 + -23 + 2)/(100/(-60))? 3 Calculate (-10)/((-120)/28) - 10/(-15). 3 Calculate -2 + 28/18 + (-561)/(-5049). -1/3 What is the value of (-16)/(-14)(-91)/(-52)? 2 -4 + (-1 - (13 - 8)) -10 What is (-3830)/(-1000) - (-2 + 6) - (-9)/36? 2/25 2/(-13)(-114478)/1036 17 What is ((20 - 21)/((-1)/(-5)))/(145/(-232))? 8 What is (-464)/48(-2)/1300/200? 29 51/(-6)6526/390 -17 Evaluate ((-2)/(12/(-27)))/(-3)(-231)/231. 3/2 Calculate 1197/(-570)4/(-21). 2/5 What is the value of 4953/508 + 1/4? 10 Calculate (-506)/460 - 1/(-10). -1 Calculate 8/(-6)(-1863)/(-828). -3 What is the value of (-456)/399(-2 - 5)? 8 What is the value of ((-8)/(240/135))/((-18)/108)? 27 Calculate 212/(-530) - -624/520. 1/13 (6 + 1160/(-190))/((-120)/456) 2/5 Evaluate ((-12)/5)/(2 - 504/270). -18 What is (-3)/(((-981)/(-108) - 9)-2)? 18 Evaluate (13 - 2123/165)/(-3). -2/45 Calculate (-2)/(-8)(-1 + -1)1173/2346. -1/4 Calculate ((-90)/(-675) + (-41)/(-30))(-10)/3. -5 Evaluate (-56)/644 + 186/23 - 47/6. 1/6 Calculate 2/(-4) - ((-363)/66 - -14). -9 Calculate (2 + (-12)/5)/(18653/(-805) - -23). 7/3 (2/(-5) + 516/215)/(2/(-8)) -8 Calculate (15/(-372))/((-145)/232). 2/31 What is the value of -3(-8)/(-120)-55? 11 Calculate (-3674)/(-4676) - ((-5)/7 + 2 + -1). 1/2 (0 + -50)(-932)/(-2330) -20 Calculate (140/15 - 7)642/17227. 2/23 What is the value of (-70)/(-18) + 781/1278(-4)/(-22)? 4 What is the value of (-5 - 19 - -25)(-12)/34? -6/17 Calculate (161 + -1)3/21 + (-2)/(-14). 23 Evaluate -3 - 504/22 - 53/3498060. -26 Evaluate -8 + (15 - (-5 - 4505/(-374))). -1/22 What is the value of 6705/(-298)(-24)/(-20)? -27 What is the value of 4/(-6)(21 + -10)/55? -2/15 What is (-3)/(-105)13 - (-1508)/(-1885)? -3/7 What is (-94)/8 + (-31)/(1364/(-33))? -11 What is the value of (-351)/13 - (-15 + -1)? -11 What is the value of 2068/1540 + (-1)/5? 8/7 20/(-8) + (8 - 8 - 0) - -2 -1/2 Calculate (10/8 + (-2)/(-8))(-326116)/12873. -38 Calculate (-25)/(-15) - ((-182)/(-30) + 8 - 7). -27/5 What is (144/15)/(234/(-390))? -16 (20/((-280)/266) - -20)/(2/14) 7 (-24)/4(385/84)/(-11) 5/2 Evaluate (-273)/(-1001) - -5(-328)/44. -37 7-1 + (-12909)/(-1655) 4/5
What is the u'th term of 1704, 2206, 3002, 4098, 5500? u*3 + 141u*2 + 72u + 1490 What is the d'th term of -8211, -7814, -7413, -7008? 2d2 + 391d - 8604 What is the n'th term of 1555378, 1555401, 1555426, 1555447, 1555458? -n*3 + 7n*2 + 9n + 1555363 What is the s'th term of -17698, -35289, -52792, -70207? 44s2 - 17723s - 19 What is the o'th term of -11147, -15529, -19911? -4382o - 6765 What is the p'th term of -4351, -8529, -12715, -16915, -21135, -25381? -p3 + 2p*2 - 4177p - 175 What is the g'th term of 36293, 72656, 109091, 145598? 36g2 + 36255g + 2 What is the y'th term of 30799, 30771, 30735, 30691, 30639? -4y2 - 16y + 30819 What is the g'th term of 474704, 949405, 1424116, 1898843, 2373592? g3 - g2 + 474697g + 7 What is the h'th term of -9100807, -9100776, -9100725, -9100654, -9100563, -9100452? 10h2 + h - 9100818 What is the i'th term of 66957, 110910, 154861, 198810, 242757? -i2 + 43956i + 23002 What is the a'th term of 376, 1485, 3316, 5857, 9096, 13021, 17620, 22881? -2a*3 + 373a*2 + 4a + 1 What is the j'th term of 3679, 3335, 3555, 4621, 6815, 10419, 15715, 22985? 47j3 - 673j + 4305 What is the y'th term of 7599410, 7599384, 7599358, 7599332, 7599306? -26y + 7599436 What is the m'th term of 475778, 951559, 1427340, 1903121? 475781m - 3 What is the x'th term of -286, 72, 1832, 5696, 12366, 22544? 117x3 - x2 - 458x + 56 What is the r'th term of -850, -1022, -1208, -1414, -1646? -r3 - r2 - 162r - 686 What is the z'th term of 5071516, 10142880, 15214242, 20285602, 25356960, 30428316, 35499670? -z2 + 5071367z + 150 What is the i'th term of 11972, 20726, 29480, 38234, 46988, 55742? 8754i + 3218 What is the c'th term of 804901, 804891, 804875, 804853? -3c2 - c + 804905 What is the r'th term of -88786807, -177573613, -266360421, -355147231? -r2 - 88786803r - 3 What is the x'th term of 44828, 82040, 119252, 156464, 193676? 37212x + 7616 What is the z'th term of -132601, -530703, -1194201, -2123095? -132698z2 - 8z + 105 What is the m'th term of -1409641, -1409646, -1409651? -5m - 1409636 What is the s'th term of -133845, -133850, -133845, -133824, -133781, -133710, -133605? s3 - s2 - 9s - 133836 What is the l'th term of 3232, 6398, 9426, 12244, 14780, 16962? -12l3 + 3l*2 + 3241l What is the s'th term of -825024, -825361, -825916, -826683, -827656? s*3 - 115s*2 + s - 824911 What is the n'th term of -618154, -618163, -618172? -9n - 618145 What is the b'th term of -7155968, -14311949, -21467930, -28623911, -35779892, -42935873? -7155981b + 13 What is the b'th term of -19498, -39051, -58648, -78283, -97950, -117643? b3 - 28b*2 - 19476b + 5 What is the b'th term of 262917, 262757, 262597, 262437? -160b + 263077 What is the r'th term of 22221, 41480, 60737, 79992, 99245, 118496, 137745? -r2 + 19262r + 2960 What is the m'th term of 22463671, 44927347, 67391021, 89854693, 112318363, 134782031, 157245697? -m*2 + 22463679m - 7 What is the d'th term of 5130, 5354, 5728, 6252? 75d2 - d + 5056 What is the s'th term of -1871330, -3742670, -5614024, -7485398, -9356798, -11228230, -13099700, -14971214? -s3 - s2 - 1871330s + 2 What is the n'th term of -605261, -1210519, -1815777, -2421035, -3026293? -605258n - 3 What is the a'th term of 321233, 1284914, 2891055, 5139662, 8030741, 11564298, 15740339, 20558870? a3 + 321224a*2 + 2a + 6 What is the l'th term of 1978979, 3957909, 5936843, 7915781, 9894723? 2l2 + 1978924l + 53 What is the i'th term of -466817, -932266, -1397715, -1863164? -465449i - 1368 What is the c'th term of 394, 1882, 4484, 8200, 13030? 557c*2 - 183c + 20 What is the j'th term of 1342957, 2685895, 4028819, 5371723, 6714601, 8057447, 9400255? -j3 - j2 + 1342948j + 11 What is the a'th term of 75126, 72556, 68272, 62274, 54562, 45136? -857a2 + a + 75982 What is the p'th term of 8535, 14037, 23215, 36075, 52623, 72865, 96807? p3 + 1832p2 - p + 6703 What is the m'th term of -3168, -3055, -2850, -2511, -1996? 7m*3 + 4m*2 + 52m - 3231 What is the g'th term of 4325, 3957, 3577, 3191, 2805, 2425? g*3 - 12g*2 - 339g + 4675 What is the b'th term of 55541, 222373, 500491, 889895, 1390585? 55643b2 - 97b - 5 What is the t'th term of 4607, 14323, 30503, 53153, 82279, 117887, 159983, 208573? t*3 + 3226t*2 + 31t + 1349 What is the d'th term of -308583, -617052, -925521? -308469d - 114 What is the u'th term of -473280, -946539, -1419784, -1893021, -2366256? -u3 + 13u*2 - 473291u - 1 What is the x'th term of -19405, -27369, -35333? -7964x - 11441 What is the n'th term of -104742, -208438, -312136, -415836, -519538, -623242? -n2 - 103693n - 1048 What is the y'th term of -6643230, -13286447, -19929658, -26572863, -33216062? 3y2 - 6643226y - 7 What is the x'th term of 100144, 99387, 98630, 97873? -757x + 100901 What is the i'th term of -104617, -209082, -313549, -418018, -522489, -626962, -731437? -i2 - 104462i - 154 What is the m'th term of 5621618, 5621715, 5621812? 97m + 5621521 What is the z'th term of -268625, -268559, -268449, -268289, -268073, -267795, -267449? z3 + 16z*2 + 11z - 268653 What is the c'th term of -1536, -1406, -818, 456, 2644, 5974, 10674? 38c3 + c2 - 139c - 1436 What is the v'th term of -905180, -905190, -905200, -905210, -905220? -10v - 905170 What is the g'th term of 8607, 68761, 232005, 549879, 1073923? 8590g*3 + 5g*2 + 9g + 3 What is the l'th term of 3032837, 3032811, 3032775, 3032729, 3032673? -5l2 - 11l + 3032853 What is the y'th term of -1311, -4823, -10653, -18783, -29195, -41871? 3y3 - 1177y*2 - 2y - 135 What is the y'th term of -3598, -3228, -2200, -178, 3174, 8192, 15212? 56y3 - 7y*2 - y - 3646 What is the w'th term of -577561, -1155132, -1732703? -577571w + 10 What is the x'th term of 125000, 124999, 124998, 124997? -x + 125001 What is the f'th term of 5666, 4888, 3598, 1802, -494, -3284, -6562? f*3 - 262f2 + f + 5926 What is the r'th term of -207373, -414269, -621163, -828055? r2 - 206899r - 475 What is the c'th term of -3977476, -7954947, -11932418, -15909889, -19887360? -3977471c - 5 What is the k'th term of -2285, -8313, -14341, -20369, -26397? -6028k + 3743 What is the u'th term of 704371, 704368, 704365, 704362, 704359? -3u + 704374 What is the f'th term of 109197, 218464, 327815, 437292, 546937, 656792, 766899? 7f3 + 109218f - 28 What is the f'th term of 3878, 8530, 13182? 4652f - 774 What is the k'th term of -242356648, -484713296, -727069944, -969426592, -1211783240, -1454139888? -242356648k What is the q'th term of -94, -420, -980, -1768, -2778, -4004, -5440? q*3 - 123q*2 + 36q - 8 What is the m'th term of 168, 636, 1394, 2448, 3804, 5468, 7446, 9744? m*3 + 139m*2 + 44m - 16 What is the n'th term of -352163, -352143, -352123, -352103, -352083, -352063? 20n - 352183 What is the z'th term of 759007, 1518041, 2277075, 3036109? 759034z - 27 What is the x'th term of -433819, -1735286, -3904399, -6941158, -10845563, -15617614? -433823x2 + 2x + 2 What is the s'th term of 10963, 43097, 96617, 171523, 267815? 10693s2 + 55s + 215 What is the w'th term of 67371086, 134742169, 202113252, 269484335, 336855418, 404226501? 67371083w + 3 What is the g'th term of 223, 1423, 4435, 10081, 19183, 32563, 51043, 75445? 137g*3 + 84g*2 - 11g + 13 What is the k'th term of 19271, 9583, -105, -9793, -19481, -29169? -9688k + 28959 What is the c'th term of 535626, 1071244, 1606858, 2142468? -2c*2 + 535624c + 4 What is the h'th term of -1708, -5108, -11894, -23758, -42392, -69488? -282h3 - h2 - 1423h - 2 What is the j'th term of -170610, -169819, -169028, -168237, -167446? 791j - 171401 What is the p'th term of -8658796, -17317597, -25976398, -34635199, -43294000? -8658801p + 5 What is the b'th term of -363089527, -726179054, -1089268581, -1452358108? -363089527b What is the a'th term of -15893, -30274, -43159, -54548, -64441, -72838? 748a*2 - 16625a - 16 What is the a'th term of 3691, 15008, 33871, 60280, 94235, 135736, 184783? 3773a2 - 2a - 80 What is the f'th term of 854580, 1709166, 2563752, 3418338? 854586f - 6 What is the r'th term of -494, -3142, -5790? -2648r + 2154 What is the c'th term of -64823, -129759, -194699, -259643, -324591? -2c2 - 64930c + 109 What is the a'th term of -16065, -16082, -16111, -16152, -16205? -6a2 + a - 16060 What is the g'th term of 40453, 40110, 39767, 39424, 39081? -343g + 40796
Solve -4l + 18 = 3i, 1375i - 8 = 1374i - 2l for i. 2 Solve -2d - 8 + 9 = s, -2d + 2 = 2s for s. 1 Solve 0 = 3b - z - 18, 4b + 231z = 233z + 26 for b. 5 Solve 4d = -12773p + 12771p - 14, -4d = 3p + 19 for d. -1 Solve 54p = -2h + 10, -2p - 167h = -170h + 15 for p. 0 Solve -5l + 3x = 2129 - 2157, -l - 22 = 4x for l. 2 Solve -3u - 5c = 102 - 82, -4c - 24 = 4u for u. -5 Solve 5s + 3x - 18 = 0, 94s + 4x - 2 = 91s for s. 6 Solve h - 9 = -2u, 4u + 20h - 11 = 11h for u. 5 Solve -6931a + 6927a - 4q = 28, 3a + q + 17 = 0 for a. -5 Solve 4s - 30 = 48u - 51u, -2u + 5s + 20 = 0 for u. 10 Solve -90 + 51 = r + 4l, r + 2l + 29 = 0 for r. -19 Solve 0 = -2w - 2o + 6, 5w - 5o + 773 = 798 for w. 4 Solve -21 = 1876u - 1881u + p, 2p + 22 = 5u for u. 4 Solve 82d + 3i = 84d - 14, -5d = 5i + 65 for d. -5 Solve -k - 20 = -5l, 1865l - 1861l + 2k - 16 = 0 for l. 4 Solve r = -11t - 1270 + 1489, 3t = -r + 59 for r. -1 Solve -13 = 3k - 329d + 325d, -2k - 14 = -4d for k. 1 Solve 5s - 16o = -14o + 15, 5s + 219 = 88o - 196 for s. 5 Solve 400f - 401f = g - 12, 0 = 3f - 3g - 24 for f. 10 Solve -2910 + 2916 = 5l - j, j - 12 = -4l for l. 2 Solve 4k + 5q + 222 - 179 = 0, 64 = 3k - 5q for k. 3 Solve -3y - 15k - 20k = -31k - 2 + 8, -3k = 4k for y. -2 Solve -22g - 23 = -c - 19g, -2c + 2g = -18 for c. 2 Solve 2o - 4t = -78, -4o + 49 + 4 = 3t for o. -1 Solve -2y - 96s = -100s - 2, s = -4y + 40 for y. 9 Solve 30 = -5m + 3l, 763m - 6 = 760m - 3l for m. -3 Solve -u = -5o - 8, 2u - 9o + 17252 - 17266 = 0 for u. -2 Solve 5s - 30 = 144f - 149f, 22 = 4f + 5s for f. 8 Solve 0 = 8g + 8m + 8, 0 = 226m - 227m - 2 for g. 1 Solve i + 5h - 56 = 0, -4i + 52 = -7i + 5h for i. 1 Solve 47 = -2w + f + 65, -2f = 20 for w. 4 Solve -6i - 139 = -3x - 178, 4i - 8 = 0 for x. -9 Solve 703 - 723 = 4x, -3i + 22 = -2x for i. 4 Solve -6s - 64 = -12s - m, -3s = 5m - 50 for s. 10 Solve -3s - 8 = z, -382s + 378s = 8 for z. -2 Solve 2r + 75 = -5m, -357m = -5r - 356m + 15 for r. 0 Solve -83 = 7x - 4f, -3x + 155 = 3f + 200 for x. -13 Solve -34240t + 34241t - 4f = 14, 0 = -t + 2f + 12 for t. 10 Solve -5997o - 16 = 4s - 5996o, 0 = -3s - 4o + 1 for s. -5 Solve -67v - 20 = 5b - 76v, -7v = 5b - 0b + 20 for b. -4 Solve -5m - 70 = -5h, -775h + 777h - 46 = 4m for h. 5 Solve 643 - 671 = -5k + 4u, -10 = -4k - 3u for k. 4 Solve -463v + 29 = -468v - t, -5t = -3v - 23 for v. -6 Solve 0 = 3359w - 3356w + 27, 4g + 4w = -20 for g. 4 Solve -5m - 3u - 7 = 0, -3m - 27 = 53u - 55u for m. -5 Solve -14 = 4y - 2n, -18n = -3y - 16n - 14 for y. 0 Solve 3k - 34 = -5h, 44 = 7h - 231k + 234k for h. 5 Solve -3h + 1 = -5c, 0 = -83h + 87h - 4c - 4 for h. 2 Solve -322g - 3j - 5 = -317g, -4g + 2j = 4 for g. -1 Solve i + 3843 - 3813 = -5s, 2s + 10 = 0 for i. -5 Solve -4p + 6 = -3n + 1, -p + 3n = -8 for p. -1 Solve 0 = i - 4, -8o = -8o + o - 2i + 3 for o. 5 Solve -5s + 2f - 1 = 0, -5f + 8 = 12s + 30 for s. -1 Solve 2t - 2 = -5f, -1186t - 4 = -f - 1190t for f. 0 Solve 5a - 98 = -3g - 102, 5g = 2a - 17 for g. -3 Solve 2c = -13q + 14q - 9, -18 = 6c for q. 3 Solve -2q - 2n + 8 = 0, -12n + 11n = 5q - 20 for q. 4 Solve 2u - 19 = 3a, -9u + 6a + 8 = 8a for u. 2 Solve -y + 941 - 881 = -5j, 4j = 3y - 59 for j. -11 Solve 11g - 28 = -2p + 7g, 4p - 4g = -52 for p. -4 Solve -b = 5i + 23, -4466i - 18 = -4463i + 2b for i. -4 Solve -3n + c - 1 = 0, -3n - c = 12 - 13 for n. 0 Solve -3o - 10 = -5v - 8o, -8 = -v + 2o for v. 4 Solve 5m + 6z - 45 = -37, -3z = 4m - 10 for m. 4 Solve y - 7 = 5b, 26b - 21b - 3 = -4y for b. -1 Solve 0 = 2b + 326s - 323s - 25, 5b + 2s - 24 = 0 for b. 2 Solve 31 = -5r + 2o, -r - 244 = 3o - 248 for r. -5 Solve 352k - 5 = -x + 354k, -69 = 19x + 3k for x. -3 Solve -3q - 5w = 1347 - 1376, -w - 11 = -5q for q. 3 Solve h - 2864f + 2862f - 6 = 0, 3h = -2f - 22 for h. -4 Solve 4x = 5z - 6, -2z + 78x - 8 = 79x for z. -2 Solve 5y + 31 = 2d, 6y - 128 = 4y - 7d for y. 1 Solve -2i = -62 + 60, -5 = -3j - 5i for j. 0 Solve -3c - 4 = -c - a, 0 = 2c + 1424a - 1421a + 28 for c. -5 Solve -12d = i - 89, -5d - 35i + 34i + 40 = 0 for d. 7 Solve 8 = 152y - 150y - 4s - 0, -3s - 33 = 3y for y. -6 Solve 0 = -4u - 2x - 24, -78u - 4x - 24 = -73u for u. -8 Solve -5i - 10 = w, 5w = 2i + 31 + 27 for i. -4 Solve d - 2x = -8x - 46, 3d + 33 = -3x for d. -4 Solve 0 = -8n + 2k - 22, k - 3 = n - 1 for n. -3 Solve -9j - 1 = 5r, 5j + 3r + 12 = 11 for j. 1 Solve -3w + 357 = 7s + 323, -2w = 3s - 16 for w. 2 Solve -7 = -4q + 3g, -64q - 42 + 292 = -2g for q. 4 Solve -2p - 14z - 5 = -15z, 20 = -5p + 4z for p. 0 Solve -5d + 4m - 24 = 26, 0 = 2m - 10 for d. -6 Solve 0 = -75y + 73y - 4x - 10, -4y + 2x + 30 = 0 for y. 5 Solve 349u + 5a = 351u + 37, -u + a - 11 = 0 for u. -6 Solve -2w = 3s + 5, -4s + 7w - 117 = -91 for s. -3 Solve 3h = 255n - 251n + 26, -4n + 62 = 41h for h. 2 Solve 3p = -3l - 184 + 241, -5p + 4l - 76 = 0 for p. 0 Solve -3 = 3o + 5109c - 5112c, -4c = -3o - 5 for o. 1 Solve 2v + 393s = 396s + 36, 5s = -2v - 44 for v. 3 Solve -4q = 4, 281 - 289 = 3v + 5q for v. -1 Solve -7f - 39 = -5b, 0 = -2f - 2b + 90 - 84 for f. -2 Solve -w = -r - 5, -2r + 0w + 0w - 19 = w for r. -8 Solve 0 = 2u - 5k + 15, 60 = -3u + 84k - 89k for u. -15 Solve -26q + 33q - 21 = -5x, -q + 5x = -3 for q. 3 Solve 14l - 2v - 14 = 11l, -5l - 4v - 6 = 0 for l. 2 Solve 5u - 34 = -4, -6y + 10y + 2 = -3u for y. -5 Solve 2g + 3u = 8, 5g = -1009u + 1010u + 20 for g. 4 Solve 4d - 3u = 50, 0 = 41558u - 41556u - 4 for d. 14 Solve -3m - h - 6 = 8, 3m + 29 = -4h for m. -3 Solve 39a - 35a = -5m + 33, 0 = 14a + 5m - 53 for a. 2 Solve 2h = -5a - 6, -43 = -h + 5a - 46 for h. -3 Solve -2l + 2 = 0, -584n + 587n = -2l + 8 for n. 2 Solve -3w - 58 = -4h, 5w - 10h + 275 = 125 for w. 2 Solve 195 = 25j - 5x, -163j + 2x - 26 = -166j for j. 8 Solve 0 = 35s - 39s + n + 14, 2n = 6s - 20 for s. 4 Solve 2c + 4 = -y + 13, 4 = -4y for c. 5 Solve 2p = -l - 14, 345p - 344p = -5l + 11 for l. 4 Solve -k + 485 - 483 = 5x, 4k + 3x + 9 = 0 for k. -3 Solve 0 = 6h - 4j - 46, 3h - 19 = 19j - 18j for h. 5 Solve 41o + 4 = 40o + 4m, 0 = -3o - m + 53 for o. 16 Solve 7 = w + 2y, -2w + y - 3 = 3 for w. -1 Solve -6 = u - b, 94u - 99u - 4b - 21 = 0 for u. -5 Solve 5a - 5i - 20 = 0, 2 - 35 = 3a + 2i for a. -5 Solve 2i + 12 = -3m, -22m + 5i = 18 + 70 for m. -4 Solve v - 13 = -o, 11339o - 20 = v + 11337o for v. 2 Solve -5 = -5p, -96i + 93i + 5p = -27 + 5 for i. 9 Solve -2a + 86 = 55n - 18, -19 = -2n + 5a for n. 2 Solve -49 = 4q + 15w, -11q - 5w = -10q + 16 for q. -1 Solve 0 = -2u - 4c + 12, -5u = -40c + 12c - 30 for u. 6 Solve 4243h - 4242h - 3m = 15, -2m - 62 = -18h for h. 3 Solve 0 = -4o - 4k + 4, -50 = -4o + 2k - 28 for o. 4 Solve -2a - 2q - 22 = 0, 0 = -6a - 2q - 2323 + 2277 for a. -6 Solve 0 = j + 67p - 69p - 13, 4j = 4p + 36 for j. 5 Solve w + 5y - 36 = 0, -76 = 1446w - 1443w - 8y for w. -4 Solve 3m - 12 = -4h, 4m = 7h + m + 8 + 4 for h. 0 Solve 0 = -y - 3a + 10, -5y = -7y - 2a - 0a for y. -5 Solve 2s + 1357m - 1361m - 34 = 0, 3 = -2m - 3 for s. 11 Solve 3f + 34v = 29v - 17, 2v = -2 for f. -4 Solve 4o - 556 = -h - 567, 0 = 2o - 3h - 5 for o. -2 Solve 0 = o + 5w + 28, 1583o - 1581o + 4w = -26 for o. -3 Solve -7677i = -7679i - 2r - 4, -i = -4r - 13 for i. 1 Solve 2f = -3i - 8, -2i = -4f - 104 + 88 for f. -4 Solve -r - 9 = -2x, 46x + 7 = -3r + 48x for r. 1 Solve 24z - 21z = 2f + 3, 0 = -2z + f for z. -3 Solve 223z - 4t = 220z + 31, -t = 3z - 26 for z. 9 Solve -7v - 269s - 47 = -264s, 0 = -2v - 2s - 14 for v. -6 Solve -59680v = -59677v + 2r - 5, 2r - 4 = -4v for v. -1 Solve -2609b + 10 = -2610b - 5n, 6b - 4n = 8 for b. 0 Solve 2253r - 102 = 2256r - 5z, -20 = -4r - 2z for r. -4 Solve -o + 2s = -4, -14 = -2o + 15s - 17s for o. 6 Solve 0 = -4f + 32, -2o - 5f + 2f + 20 = 0 for o. -2 Solve 5h + 8m = 5m + 54, 32 = 3h + 2m for h. 12 Solve 0 = j + 5y - 18, 0 = 23j - 24j + 3y - 14 for j. -2 Solve 4f = -2c + 26, 0 = -4c + f + 1262 - 1255 for c. 3 Solve -10 = 4c + l, -273 = -3c - l - 280 for c. -3 Solve 0 = -2u + 8, -q + 442 = 3u + 426 for q. 4 Solve 3m + 4z = 11, 38385z - 29 = -5m + 38389z for m. 5
Suppose 3w + 10 - 29 = 4x, -x + 5w - 9 = 0. Let f = 6 + x. Suppose -m + fg + 5 = -0g, 1 = -g. Solve 0 = -2r + r - m for r. -3 Let m(t) = t*2 + 9t + 3. Let o be m(-9). Let g be ((-8)/o)/(10/(-105)). Suppose -4d = -5b + 35, 3b - 2b = 5d + g. Solve -4w = -1 - b for w. 1 Suppose 2d = -3d - 20. Let v = d + 7. Solve 0 = -vq - 4 - 2 for q. -2 Let t(a) = a3 - 17a*2 - 19a + 54. Let k be t(18). Solve -k + 33 = -y for y. 3 Suppose 114 = 15w - 9w. Solve -4t - w = -7 for t. -3 Let k = 3 - -17. Let r(m) = -m3 + 3m*2 - 2m + 2. Let p be r(2). Let s be ((-2)/4)/(2/(-12)). Solve -pi = si - k for i. 4 Let d be (3 + -1 + 23)/(-1). Let x = 51 + d. Suppose -u - 4o = -x, -3u + 3 = -2o - o. Solve -2s + u = -4 for s. 5 Let d be (-10)/(-2) + (-1)/(14/(-1134)). Solve j + d - 85 = 0 for j. -1 Let d = -67 + 112. Let g = d - 45. Solve g = -f - 3 + 2 for f. -1 Let l be (-1)/31 + 21/9. Solve 10g - l = 12g for g. -1 Let w be 6 + -1 + 1/1. Suppose 0 = -3q + w, 0q + 12 = 5j + q. Suppose -12p + 6p + 30 = 0. Solve pl - 3 = j for l. 1 Let b be (-1 - -2)/((-2)/(-8)). Let l be ((-14)/(-14))/(32/6 + -5). Let d = 26 + -18. Solve lo = b + d for o. 4 Let s(q) be the second derivative of -q5/20 + q4/6 + 2q3/3 - 5q. Let p be s(3). Solve 2y = -py + 20 for y. 4 Suppose 55 = 4j - 3a, 4a = 5j + a - 65. Let x = 24 - j. Suppose 11m = xm. Solve m = -0i + i + 4 for i. -4 Suppose 3i - 5t - 295 = 25, -2i = 4t - 250. Let g = i - 111. Solve -gf - 2 = -5f for f. 2 Suppose 0 = a + a - 22. Suppose -2v = -35 + a. Solve -5u + 3 + v = 0 for u. 3 Let l(a) be the second derivative of a5/40 - a4/8 - a3/3 - 5a. Let r(d) be the second derivative of l(d). Let u be r(4). Solve -j = 2j - u for j. 3 Let r be 6/((-15)/50 - 0). Let b be 16/r(-15)/6. Let s(d) = -d - 7. Let g be s(-7). Solve gl + 10 = -bl for l. -5 Suppose -14 = -3r - 4r. Suppose -q + rq = 3q. Solve -y = -4 - q for y. 4 Let d be 0/(-1)(-8 + 200/24). Solve d = 2s - 12 + 8 for s. 2 Let v(p) = p*3 + 10p*2 - 24p + 2. Let o be v(-12). Solve 35 - 25 = -od for d. -5 Suppose 0 = n + 3, 0j + 4n = 5j - 32. Let x = 2 + j. Let z be 3/x81. Solve 0 = -zr - 0r for r. 0 Let r = -8 + 14. Let k(a) be the first derivative of -a*4/4 + 7a3/3 - a2 + 5a + 262. Let d be k(r). Solve d = -5f + 9 for f. -4 Let q(s) = 2s3 - 8s*2 + 15s + 3. Let x be q(3). Solve -14p + x = -8p for p. 5 Suppose -7x - 5 = 2. Let w be 2x/6 + (-12)/(-9). Let d = 8 - 6. Solve -w = -dc - 5 for c. -2 Let q(m) = -3m*3 + 3m*2 + m - 1. Let y be q(-1). Suppose -4 = -5g - 3z + yz, -5g - 4z = 16. Solve v = -g + 1 for v. 1 Let x = -169 + 175. Solve -u = -xu + 2u for u. 0 Suppose -147x + 144x = -30. Suppose 39 = xa + 9. Solve m = -a - 1 for m. -4 Let u(z) = 3z*2 - 10z + 10. Let j be u(4). Let t = j + -12. Solve -tg = -2g + 16 for g. -4 Let b(x) = 2x - 9. Let w be b(7). Let p be 0 + 7 + (1 - w). Solve 0i - pi = 0 for i. 0 Let f = 7 + -3. Let i(u) = u3 - 6u*2 + 6u - 2. Let a be 1/((-3 + -1)/(-20)). Let o be i(a). Solve -w = ow + f for w. -1 Let m(z) = -13z + 6z2 - 4z*2 + 4z - 17 - z*2. Let v be m(11). Solve -3y = -vy - 8 for y. -4 Suppose 5r = 5p - 205, -5p + 4r - 8r = -178. Let s(y) = 10y. Let c be s(-3). Let k = p + c. Solve k = -5t - 7 for t. -3 Let w(q) = -5q + 2. Let b be w(-2). Suppose 0 = z - 5z + b. Let d be (2/z)/(10/150). Solve -5v - d = -0v for v. -2 Suppose 0m - 5m = 4y - 15, 2y + m = 9. Let n be (1/5)/(1/y). Solve -x = n - 0 for x. -1 Let s(m) be the first derivative of -m*3/3 + 9m*2/2 + 10m + 11. Let d be s(10). Solve 4o = -do for o. 0 Let k(d) = -2d - 3. Let x be k(-3). Let n be (-61)/x - -4. Let q = 26 - 25. Solve q = nl - 1 for l. 1 Let y(k) = -3k - 7. Let h be y(-8). Suppose -j = 5g - 10, h = 3j + 3g - 1. Solve 2x = x - j for x. -5 Let l be 4/(-12) - (-22)/(-6). Let s = l + 6. Solve -sj - 3 = 7 for j. -5 Let j(g) = -3g + 9 + 8 + 0g + 2. Let z be j(6). Solve z + 9 = 5h for h. 2 Let c be 0/(-43/(-6)) + 1. Let w be c((9 - 1) + 3)1. Solve 0 = 2m + 1 - w for m. 5 Let h(p) = -p + 27. Let a be h(-7). Suppose -17 = v + 4b, -5b - 3 - a = -4v. Solve -3 = vq + 6 for q. -3 Suppose -24p - 3 = -25p. Solve 2o = 1 - p for o. -1 Let o be (321/27)/(14/12). Solve -10 = 12n + o for n. -1 Let r = 576 - 570. Solve -10c - r + 46 = 0 for c. 4 Let u(m) be the first derivative of -m*2/2 + 1. Let a be u(-2). Let f be (4 + -4)/(-21). Solve 0w - w - a = f for w. -2 Let l be (0 + 5)264/55. Solve 4w + l = -2w for w. -4 Let i be (32/(-3))/((-54)/108). Solve 2a = -ia for a. 0 Let d be (3 - -9) + 1 - 4. Let c(r) = r2 + 5r - 32. Let i be c(-9). Solve -p = -ip + d for p. 3 Suppose 3c - 5s = -12, -2c + 5s - 8 = s. Let l be ((-6)/c)/((-11)/(-22)). Solve -lf = -0 + 6 for f. -2 Let p = -794 - -794. Suppose -3t = 2o - 21, -5o + 0t + 30 = 3t. Solve n + o = -pn for n. -3 Let s be (120/(-270))/(2(-1)/9). Let w = 9 - 0. Suppose -a = -0a - w. Solve -a = -z - sz for z. 3 Suppose 5n - 15 = 0, v + 3v + 2n - 90 = 0. Solve vb = 22b for b. 0 Let n be ((-8)/16)/((-1)/(-20)). Let d be (8/n)/((-22)/55). Solve g + 3 = dg for g. 3 Let a(d) be the first derivative of d3/3 + 11d*2/2 + 7d + 11. Let i be a(-11). Suppose -72 = -ib + 3b. Solve 5x - 3 + b = 0 for x. -3 Suppose 33n - 45n + 828 = 0. Solve -j + n = 73 for j. -4 Let r be -5 - (-2 - 19) - (2 + -2). Suppose 8 = -15k + 19k - 2n, k - 4n - r = 0. Solve -4z + kz = 12 for z. -3 Suppose k + 2k = 5p - 26, 4k - 8 = -4p. Let d be (-10)/p + 26/4. Solve -i = -d + 1 for i. 3 Suppose -5f + 1 = 2q, -4q + f - 4f = -9. Suppose qw + 6 = 0, -4i - 2w = -0i - 12. Solve -iv - 15 = -v for v. -5 Let a be 50/25 - (-1 - -3). Suppose a = -5p + p + 20. Solve 1 = pv - 4v for v. 1 Let w be -5(-1 + (-6)/(-10)). Suppose w = 4g - 3g. Suppose -4 = -x - g. Solve 0t = -xt for t. 0 Suppose o = -5d + 21, 0d + 5d = -4o + 9. Solve 0 = 7n - d + 40 for n. -5 Let c(g) = -20g + 143. Let z be c(7). Solve 6 = -zr + 9 for r. 1 Let w(c) = 2c*2 + 1. Let n be w(1). Let y be 1 + -8 + ((-32)/48)/(2/(-33)). Solve n = yo - 13 for o. 4 Suppose 5z = 5q + 572 - 487, -z + 3q + 13 = 0. Solve -zu - 12 = -13u for u. -2 Let c be 7/3 - 2/6. Let o(z) = 6z*2 - 4z*3 + c + 5z - 2z3 + 3z*3 + 4z*3. Let t be o(-5). Solve 2b = -tb for b. 0 Let u be ((-3)/(-2))/(21/(-28)) - -4. Solve -34v + 32v = u for v. -1 Suppose -49 + 1 = -8d. Let u(z) = -2z2 + 15z - 8. Let v be u(d). Solve 7t = vt - 9 for t. 3 Let c = 71 - 47. Suppose 7f = 11f - c. Solve fj = 3j for j. 0 Let q = 1 + -3. Let l be (-1 - q) + 10-1. Let m(a) = a3 + 9a*2 - 2a - 9. Let g be m(l). Solve -s + g = 2s for s. 3 Suppose 195 = -5z + 5f - 190, z = -3f - 57. Let r be 27/8 + 27/z. Solve rv = v + 6 for v. 3 Suppose -3n + 18 = -3y, -5y = 3n - 0n - 18. Let j(c) = -c*2 - 5c - 4. Let b be j(-4). Solve b = -ni + i - 25 for i. -5 Let h(f) = 51f*2 - 3f + 1. Let w be h(1). Let v = w + -41. Solve 0n = -4n + v for n. 2 Suppose -q + 60 = 19q. Solve qn + 7 = -2 for n. -3 Let p be ((-393)/6 - 2)(-112)/(-70). Let a = p - -114. Solve d + a = -d for d. -3 Suppose 8v + 46 = s, -2v + 32 = 2s - 6v. Solve 11f = sf - 15 for f. -3 Suppose 3g + x - 38 = 0, -5g - 5x + 39 = -11. Let a be -4 + -1 + -1 - 1. Let f = a + g. Solve 1 + f = -2w for w. -4 Let a = 18 + -14. Solve -i = i - a for i. 2 Suppose -17 = -2h - 5z, h - z = z - 5. Let f be (-3)/(h - (-20)/(-18)). Solve 4i + f = 7 for i. -5 Let n(u) = -42u - 2. Let c be n(1). Let z = -39 - c. Solve zk + 5 = -0k for k. -1 Suppose -700m + 694m = -18. Solve 2 = -2a + ma for a. 2 Suppose -3x + 3 + 12 = 0. Let h be (-4)/6(-4)/((-32)/(-84)). Let r(c) = c2 - 11c + 20. Let t be r(9). Solve -hs + ts = x for s. -1 Suppose 3x + 3f - 120 = 0, 0x - x = -f - 44. Suppose -x = v - 8v. Solve 19 = -5y - v for y. -5 Let a(h) = -h3 - 10h*2 - 11h - 14. Let p = 210 - 219. Let y be a(p). Let t be ((-4)/2 + 1)0. Solve tj = -4j + y for j. 1 Suppose -4k - 2i + 10 = -14, k - 6 = -5i. Let d = k + -4. Suppose 5o = 15, 27 = -f + df + 5o. Solve -2r - f = -2 for r. -5 Let h(x) = 2x3 - 10x*2 + 3x - 1. Let u be h(5). Solve 0 = uz - 11z for z. 0 Let b be ((-4)/6)/((-1)/3). Let t = 49 + -44. Solve 1 = bf - t for f. 3 Suppose -5 = -a, 2a = -3h + 15 + 52. Let o = -18 + h. Suppose -2s = 3z + o, 4z + 5s + 8 = 2z. Solve z = t - 1 for t. 2
Simplify (1(-4(1 + (sqrt(112) - (sqrt(112) + 5 + sqrt(112) + 1) - (-4 + (sqrt(112) - (sqrt(112) - sqrt(112)-4))))) + 0))2. -384sqrt(7) + 16144 Simplify ((sqrt(459) - (2sqrt(459) + sqrt(459))) + (sqrt(7344) + (sqrt(7344) - sqrt(7344)2) - sqrt(7344)))/(-3sqrt(243)6) + 2. sqrt(17)/9 + 2 Simplify (6(sqrt(234)/(sqrt(9)1) + (-1sqrt(3146) - sqrt(3146) - sqrt(3146)) + sqrt(26)))/((sqrt(96) + (sqrt(96) - sqrt(96)-2-5))/sqrt(3)). 93sqrt(13)/16 Simplify (sqrt(400)-2-23)/((sqrt(35)-1-4)/(sqrt(112)2)). 96sqrt(5) Simplify sqrt(9)/(2sqrt(18)/sqrt(6)) + -4 + -5((sqrt(75) + 1 + sqrt(75) + sqrt(75))2 + sqrt(3) + sqrt(6)/(sqrt(8)/sqrt(4))). -3384 - 319sqrt(3)/2 Simplify (-1(sqrt(153)-2-1 + sqrt(153) - (sqrt(153) + -3(1sqrt(153) - sqrt(153)))))/(sqrt(900) + sqrt(900)-2 + sqrt(900) - (sqrt(225)1 + sqrt(225))). sqrt(17)/5 Simplify ((sqrt(66) - (sqrt(66) - -6(sqrt(66) + sqrt(66)2)) - 6(sqrt(66) - sqrt(66)-3))/(-3-6sqrt(600)1))*2. 539/900 Simplify ((2 + 0 + sqrt(108) + sqrt(108))-5)*2 - (-3 + (2sqrt(15)/sqrt(5)-5)2). 1200sqrt(3) + 10603 Simplify (3(-1 + sqrt(2880) + -2 + sqrt(2880)-1 + 1 - (0 + sqrt(2880))-12))*2. -1728sqrt(5) + 103716 Simplify -2 + ((sqrt(117)2 + 3 - ((sqrt(117) - (0 + sqrt(117) + 0)) + sqrt(117) - sqrt(117)) - 1(sqrt(117) + (sqrt(117) + 1)4)) + 2 + -1)2. 1051 Simplify (2 + ((((-1sqrt(136) + sqrt(136) - sqrt(136))/sqrt(8) + 2 - (-1sqrt(272) + 1)) + 1)5)*2)-5. -19635 - 1500sqrt(17) Simplify (-1sqrt(98)/sqrt(7)4)/(sqrt(24)/(sqrt(12) - -2sqrt(12)) + (6(sqrt(32) + sqrt(2)) - sqrt(2))) + 5. -3sqrt(7)/22 + 5 Simplify -5(sqrt(3) + -3) + sqrt(75)-6 - ((sqrt(3) - (sqrt(3) + sqrt(3) + -1)) + 4 + (sqrt(48) + sqrt(48) + 2 - sqrt(3)))*2. -119sqrt(3) - 142 Simplify -1(sqrt(567) + (-1(2 + sqrt(567)))2 - (sqrt(567) + 2 + 0)2 - (0 + (2 + sqrt(567) + 1sqrt(567) - sqrt(567)))). 2 Simplify (((-1sqrt(24))/sqrt(12) + (sqrt(6)/sqrt(3) - sqrt(2))*2-4)-6 + (-5(4 + -5sqrt(2) - sqrt(2)))2 + 5)-5. -11025 + 5970sqrt(2) Simplify (5 + -2 + sqrt(1100) + 0 + sqrt(1100) - (5 + 2 + sqrt(704) + -1))2 + 3. -72sqrt(11) + 1596 Simplify (3(-2 + (5(sqrt(2400) - -1sqrt(2400)))/((sqrt(8) - 5-2sqrt(8))3) + -2))*2. -2400sqrt(3)/11 + 47424/121 Simplify (-5(sqrt(72)/sqrt(3) + sqrt(24)) + 1sqrt(24)3)/(-2-1sqrt(8)-1-1). -7sqrt(3)/2 Simplify sqrt(171)2 + sqrt(19) + -1sqrt(19)-5 + (2sqrt(304))*2 + -5 + ((-2(0 + sqrt(2736)))*2 + 0)-2. -20677 + 12sqrt(19) Simplify (-4(sqrt(250) + sqrt(10)) - sqrt(40)/sqrt(196))/((sqrt(350)-1)/(-2sqrt(112) + sqrt(7))). -169sqrt(5)/5 Simplify (-4 + (2sqrt(1088)-1 - sqrt(1088) - 3sqrt(1088)1) + 1 + 5)25. -960sqrt(17) + 195860 Simplify ((sqrt(720)15 + sqrt(720))1)/((sqrt(250) + -1sqrt(250) + sqrt(250) + sqrt(10))-26). -sqrt(2)/2 Simplify ((2 + sqrt(567))4 - -2sqrt(567)1)*2 + 2 + (((-1 + sqrt(567))-6 - sqrt(567))*2 - sqrt(567)) + 4. 99sqrt(7) + 48301 Simplify (-6(sqrt(16) + -2sqrt(576) + sqrt(576) + sqrt(16)))/((sqrt(48)/sqrt(3)5)/sqrt(2)). 24sqrt(2)/5 Simplify -1(5((2 + sqrt(612))-3 + -5-2sqrt(612))1 + -4)*2. -750856 + 14280sqrt(17) Simplify ((sqrt(119) + -3sqrt(119) + sqrt(119) - sqrt(119))-4 + -4-3sqrt(119))/(-6sqrt(252)3). -5sqrt(17)/27 Simplify (0 + (sqrt(36)/(sqrt(6) + sqrt(486)-2))/(1sqrt(5000))5)*2. 3/28900 Simplify ((1 + ((sqrt(18) - (sqrt(108)/(sqrt(6) + sqrt(12)/sqrt(2)) + sqrt(18))) + 2sqrt(648))/((6(-2sqrt(90) + sqrt(90)) + sqrt(90))/sqrt(10)))2)2. -92sqrt(2)/5 + 1158/25 Simplify 1((2sqrt(175) + sqrt(175))*2 + sqrt(175) + -3) + (0 + sqrt(49)/(2sqrt(567) - sqrt(567)))*2. 5sqrt(7) + 127339/81 Simplify ((sqrt(136) + (sqrt(136) - sqrt(136)1) - ((-2sqrt(136))/sqrt(4) + sqrt(34)))1)/(-3(sqrt(200)/sqrt(4) + -4(sqrt(6)/sqrt(3) + sqrt(2) + sqrt(2)))). sqrt(17)/7 Simplify 1(0 + sqrt(2299))*2-1 + (sqrt(1216)-1 - (-1 + sqrt(19) + 5))2. -744 + 72sqrt(19) Simplify ((-2sqrt(198) - sqrt(198))-6 + 2sqrt(198)2)/(((1sqrt(198))/sqrt(9))/(-1sqrt(704))). -528sqrt(11) Simplify ((sqrt(63) - sqrt(7623)-2 - (3sqrt(9072) + sqrt(9072) - sqrt(63)))/(-43sqrt(900)6))*2. 7/900 Simplify sqrt(468) - (1-1sqrt(468) + sqrt(468)) - ((sqrt(468) + -1)2 + 3 - sqrt(468)) - (sqrt(39)/sqrt(3) + 0 + 3 + sqrt(637) + sqrt(637)). -475 + 9sqrt(13) Simplify -2 + (sqrt(66)24 - 1sqrt(66)-1)/((sqrt(384) + 1(sqrt(384) + sqrt(384)2))5). -2 + 9sqrt(11)/160 Simplify 4 + 1-3(sqrt(468) + -1)*2 + 4 + (((sqrt(13) + -1)3)*2 - sqrt(13) - (sqrt(117)4)/sqrt(9)). -1273 + 13sqrt(13) Simplify 3 + ((-2 + sqrt(162) + 0 + 0)-1 + 0)*2 + 4. -36sqrt(2) + 173 Simplify -3 + 634sqrt(272)3-5-2. -3 + 8640sqrt(17) Simplify ((-3 + ((sqrt(1008) - ((sqrt(1008) - (1 + sqrt(1008))1) + sqrt(1008))) + sqrt(1008) - sqrt(1008))4-1)-2 + 5 + 1)2. 400 Simplify sqrt(200) + (sqrt(200) - (-2 + sqrt(200)))1 + sqrt(200) + ((sqrt(200)-2 - sqrt(200)) + 3)2 + 1(3 + sqrt(200)) + -3sqrt(200) + -3. -180sqrt(2) + 1811 Simplify (2((5(sqrt(75)-2 + sqrt(75) - sqrt(75)) - 6(sqrt(75)-1 + sqrt(75))) + -5)-6)*2. 72000sqrt(3) + 1083600 Simplify (-1-5(-4 + -1 + sqrt(7) - (sqrt(84)/(sqrt(24)/sqrt(2)) + sqrt(7)))-2 + -3)-4. -188 - 40sqrt(7) Simplify 52(4(sqrt(612)-2)2 + (sqrt(1377) - (-1 + sqrt(1377))4)*2)4. -8640sqrt(17) + 888040 Simplify (1(5 + 3sqrt(396)-2 + 4 + 5) + 3)*2. -1224sqrt(11) + 14545 Simplify (-6(sqrt(128) - (sqrt(128) - -1sqrt(128)))-4)/(sqrt(576)-2 + sqrt(4) - (sqrt(36) - (sqrt(36) - sqrt(144)/sqrt(4)))). 48sqrt(2)/13 Simplify (sqrt(200) + (sqrt(200) - -1sqrt(200)) + sqrt(486)/sqrt(3) - (-1sqrt(256))/((sqrt(96)/sqrt(4))/sqrt(3)))2. 3698 Simplify (16-6(sqrt(9) + (sqrt(144) - (sqrt(144) - (sqrt(144) + sqrt(144)3))) + sqrt(144))/(sqrt(108)2)-2)2. 47628 Simplify -1sqrt(425)6-2 - 2(3 + (sqrt(119)-3)/sqrt(7)). -6 + 66sqrt(17) Simplify (sqrt(140)/(sqrt(10) - sqrt(90)))/((sqrt(7) - (sqrt(252) - 3sqrt(252))) + sqrt(7) + sqrt(7)) + ((sqrt(198)-3)/(-1-3sqrt(11)))2. -sqrt(2)/30 + 18 Simplify (1(((2sqrt(76) - sqrt(76)) + sqrt(76) + sqrt(76) - sqrt(76))-1 - (sqrt(76)2 + sqrt(76))2))/(1sqrt(64)1 - sqrt(64)2-3). -2sqrt(19)/7 Simplify ((-1sqrt(280))/sqrt(8) - ((sqrt(1260)-1 - sqrt(35)) + sqrt(35)))/((sqrt(50) + sqrt(5000) + sqrt(50))/sqrt(10) + sqrt(5) + 4sqrt(45)). sqrt(7)/5 Simplify ((-2-1sqrt(1701) - sqrt(1701))-1)/((sqrt(14) - sqrt(140)/(sqrt(10)-2))/(sqrt(6)/sqrt(3)-1))-6. -36sqrt(3) Simplify (-4(sqrt(187) + 3sqrt(187) - sqrt(187)) - sqrt(187) - -5((-2sqrt(187) - sqrt(187)) + sqrt(187)))/(2(sqrt(99)6 + sqrt(22)/sqrt(2)-3)). -23sqrt(17)/30 Simplify 6((2 + sqrt(112) + 1 - ((sqrt(112)1 - sqrt(112)) + 5)) + -4 + (6(-1 + sqrt(112)-2 - sqrt(112)) + 1)2). 4344sqrt(7) + 217842 Simplify -3((4(sqrt(432) + 0) + sqrt(432))-6-1 - (((sqrt(432) + sqrt(432) + 0)-4 + sqrt(432))-1 + 3)*2). 432sqrt(3) + 63531 Simplify (-1sqrt(550) + sqrt(176)/(sqrt(8)2))/(-51sqrt(1331)6). 3sqrt(2)/220 Simplify -3 + 4 + sqrt(720) + (sqrt(720) - (sqrt(720) + (3 + sqrt(720)3)2)) + -1 + 3(-3sqrt(720) + -3). -6498 - 312sqrt(5) Simplify ((1(sqrt(114) + (sqrt(114) - (sqrt(114)1 - sqrt(114)))-1))/((sqrt(6) - sqrt(216)2) + sqrt(864)-2) + -5)-4. 20 Simplify -2 + (4(-1(sqrt(245) + -1) - sqrt(245) - 2sqrt(245)1)4-23)2. -516096sqrt(5) + 36135934 Simplify (-51(3 + -3 + sqrt(891)2 + -3 + 4 + 1))2. 1800sqrt(11) + 89200 Simplify (sqrt(208)/(sqrt(32)/sqrt(4)))/(sqrt(2) - sqrt(18)/sqrt(144)) - (1sqrt(13) + 1 - (-1 + sqrt(832)))2. -641 + 88sqrt(13)/3 Simplify ((sqrt(936) + sqrt(936)-2)/(sqrt(2) + (2sqrt(12))/sqrt(6)))2 - (-3 + (0 + sqrt(13) + 0)2 + 3(sqrt(13) + 2 + sqrt(13))2). -126 - 24sqrt(13) Simplify (sqrt(1900)-1 + 5 - (sqrt(1900) - ((2sqrt(1900) - sqrt(1900))*2 + 5))) + -1 + (4sqrt(1900))*2 + -2. -20sqrt(19) + 32307 Simplify (-3 + (-4 + (-5 + (-1 + sqrt(396))-5 - (1sqrt(396) + -5 + 3)))3)2. 1944sqrt(11) + 128385 Simplify (2(sqrt(5616) - sqrt(5616)1 - sqrt(5616))1)/(sqrt(3) + sqrt(21)/(sqrt(7)-2) - (sqrt(3) + -3sqrt(9)/sqrt(3))) + -4. -48sqrt(13)/5 - 4 Simplify (1(sqrt(152)-3 - sqrt(152)) - sqrt(152))/(sqrt(800)-3) + ((sqrt(76)2)/sqrt(2))/(sqrt(2) + sqrt(4)/sqrt(50)). 11sqrt(19)/6 Simplify (5(-4sqrt(110) + sqrt(110))41)/(((sqrt(1440)3-4 + sqrt(1440) - sqrt(1440)) + sqrt(1440))5). sqrt(11)/11 Simplify (sqrt(19) + -1 + -5 - (sqrt(152)/sqrt(8)1)2 - (sqrt(133)/sqrt(7) + -4 + sqrt(684)2)*2) + 2. -3250 + 105sqrt(19)
Let x = -90 - -288. What is the greatest common factor of x and 22? 22 Let d = 233 + -158. What is the greatest common factor of d and 60? 15 Suppose 0 = -0g - 2g + j + 33, 9 = g + j. Suppose -387 = -8d + 397. What is the highest common divisor of d and g? 14 Let l(d) = d2 + 6d - 1. Let z be l(4). What is the greatest common divisor of 91 and z? 13 Let h be (1 + -4)(2 + -4). Suppose 2c - hc = -44. Calculate the greatest common divisor of c and 88. 11 Suppose -3f + 66 = -4t - 8f, 3t + f + 55 = 0. Let l = -8 - t. What is the greatest common factor of l and 44? 11 Let b(z) = -z3 - 19z*2 + 18z + 15. Let j be b(-20). Calculate the highest common divisor of 5 and j. 5 Suppose -5z + 3p = -535, 2z + 3p = 4z - 205. Calculate the highest common divisor of z and 10. 10 Suppose 0 = -4g + 5b + 218, b + 4b = -4g + 198. What is the greatest common factor of 26 and g? 26 Let q = 11 + 0. Let r = q - 5. What is the greatest common divisor of 6 and r? 6 Let i be (-2 - -13)/(-1 + 2). Suppose -98 = -2z - 32. Calculate the greatest common factor of z and i. 11 Let v(r) = r*3 - 9r*2 + 5r - 24. Let c be v(9). What is the highest common divisor of 105 and c? 21 Let a be 0 + 2 + 1 + 5. Suppose -3p + 7 = -a. Suppose c - 38 = -2c + pg, 4c - 3g - 36 = 0. What is the highest common factor of c and 6? 6 Let j be ((-30)/25)/(6/(-20)). Suppose jo = 4h + 1280 - 396, -218 = -o + 2h. Calculate the greatest common divisor of 28 and o. 28 Let h be (-51)/(-1 - (-4)/(-8)). What is the highest common factor of h and 17? 17 Let g = -6 + 11. Suppose -3y = gu - y + 10, y + 5 = -u. Suppose x - 9 = -ux. What is the highest common divisor of 36 and x? 9 Let t = -5 - -10. Calculate the highest common factor of t and 5. 5 Let q be 26((-10)/(-4) - 1). Let g(p) = -7p + 5. Let t be g(-3). What is the highest common factor of t and q? 13 Let p(l) = -l + 6. Let w(t) = -3t + 11. Let j(g) = -10p(g) + 4w(g). Let h be j(-14). Calculate the greatest common divisor of 36 and h. 12 Let h be (-58)/(-3) - 40/30. What is the highest common factor of 45 and h? 9 Let c(m) = -m + 12. Let t be c(-8). Calculate the highest common factor of 180 and t. 20 Let f(k) = 2k2 + 31. Let x be f(-12). Calculate the highest common factor of 29 and x. 29 Let v = 3 + -1. Suppose g = -g + v. Calculate the greatest common divisor of 5 and g. 1 Let n = -25 - -43. Calculate the greatest common divisor of 90 and n. 18 Let k be 616/(-35)(-5 - 0). Suppose -2c = 2c - k. Let f = c - 6. Calculate the greatest common factor of 128 and f. 16 Let z(p) = 60p + 4. Let c be 2/6 + (-8)/(-3). Let h be z(c). Let a be h/10 + (-6)/15. What is the greatest common divisor of a and 6? 6 Suppose 2u = -2r - 2u + 6, 4r - 5u - 77 = 0. What is the greatest common divisor of r and 91? 13 Let h = -35 - -53. Let t(w) = 36w2. Let c be t(2). What is the highest common factor of h and c? 18 Suppose -3c = -h - 241, 3c - 5h - 235 = -h. What is the greatest common divisor of c and 27? 27 Let u be -2 + 0 + (0 - -1). Let d be u/((1 + 2)/(-3)). Let i be 51/(d + 3/6). What is the greatest common factor of i and 51? 17 Let t be (196/(-35))/(2/(-5)). Calculate the highest common factor of t and 70. 14 Let g be (7/2 - 3)2. Let z(m) = 93m + 1. Let l be z(g). Suppose -50 = -2x - 5u + 2u, 0 = -4x - 3u + l. What is the highest common factor of x and 44? 22 Suppose 0 = -4z - 2z + 120. Calculate the greatest common divisor of 180 and z. 20 Suppose -4i - i + 15 = 0. Suppose ib - 2b = -9. Let p = b + 25. Calculate the highest common factor of p and 2. 2 Suppose 3c + 10 - 1 = 0. Let a be 275/5 - 1c. Suppose l = 2w - 0l - a, w + 5l = 40. What is the highest common factor of 12 and w? 6 Suppose 0f - 3f + 30 = 0. Let d(w) = -w2 + 16w - 10. Let z be d(f). What is the greatest common divisor of z and 20? 10 Let q = -3 + 7. Suppose qm = 9 + 3. Calculate the greatest common divisor of m and 21. 3 Let r be (-1)/2 - 2/(-4). Let q = r + 5. Suppose -34 = -2n + 6. What is the greatest common factor of q and n? 5 Let v(d) = -d - 1. Let x be v(-6). What is the greatest common divisor of 45 and x? 5 Suppose -2l = -3l + 2y + 7, 4y + 8 = 0. Suppose ls - 8s + 5 = 0. Let j be 0/(-2) - (0 + -5). What is the greatest common factor of j and s? 1 Suppose -3s + t + t + 225 = 0, -5s = t - 388. Let x = -10 + 17. Calculate the greatest common factor of s and x. 7 Let n = 21 - 13. Calculate the greatest common divisor of n and 12. 4 Let d = -16 + 11. Let n(k) = -51k + 9. Let l be n(d). Calculate the highest common factor of 24 and l. 24 Let d(z) = -z2 - 7z. Let s be d(-4). Suppose l - s = -3l. Suppose -b = -5o + 3 - 1, -5o - 4 = -lb. Calculate the greatest common factor of b and 24. 3 Suppose 0 = -2c + 258 - 62. Suppose 2j = 98 + c. What is the highest common factor of 14 and j? 14 Let j(v) = -v*2 - 11. Let n be j(0). Let s = 3 + n. Let x(u) = -4u - 8. Let h be x(s). What is the highest common factor of h and 36? 12 Suppose -5 + 39 = d. Suppose -4v - w - 4 = -6v, -5w = v - 24. Suppose 0x + 2x = 2u - d, vx = -4u + 92. What is the greatest common factor of 30 and u? 10 Suppose 5v = 4c - 25, -13 = 3c + 4v + 7. Suppose 6a - 2a - 32 = c. What is the greatest common factor of 56 and a? 8 Let h = 27 + -8. What is the highest common divisor of h and 57? 19 Let m(u) be the second derivative of -7u3/3 + u2/2 - u. Let d = 4 + -5. Let g be m(d). Calculate the greatest common divisor of g and 5. 5 Let b be 3 - (16/(-72) + (-331)/9). Let v = 7 + -11. Let x be (3 - 1)/((-1)/v). What is the greatest common factor of b and x? 8 Let g(a) = -34a. Let l be g(-1). Calculate the greatest common divisor of 34 and l. 34 Let w = -138 - -139. Suppose c + 24 = -7. Let o be 1/4 - c/4. Calculate the highest common divisor of w and o. 1 Suppose 109 = 5q - 31. Calculate the highest common factor of 7 and q. 7 Suppose 4b = b + 9. Suppose -90 = -2y - by. What is the highest common divisor of 126 and y? 18 Suppose 0 = 2m - 0m - 10. Let l(g) = 7g3 - g + 1. Let r be l(2). Calculate the greatest common factor of m and r. 5 Suppose 4j = 4v + 204, -3v = -5 - 10. Let i = -20 + j. Suppose 4f + 6 = 22. Calculate the greatest common divisor of f and i. 4 Let d = 4 - -11. Calculate the highest common factor of 45 and d. 15 Suppose -3q + 6q + 33 = 4u, 17 = u + q. Calculate the highest common divisor of 24 and u. 12 Let p(u) = u*3 - 3u*2 + u - 1. Let o be p(3). Let j be -4((-26)/(-4) - 3). Let v = -9 - j. Calculate the greatest common divisor of o and v. 1 Let y(l) = 17l - 1. Let p be y(2). Calculate the highest common divisor of 165 and p. 33 Let u(j) = -20j*3 + 2j*2 - j - 2. Let y be u(-1). Suppose 0 = -2h + 5t + 7, -2h - 5t = -16 - y. What is the highest common factor of h and 99? 11 Let m = 16 - 1. Let h be (4/(-8))/((-3)/180). Calculate the highest common divisor of m and h. 15 Let v(b) = b2 - 2b*2 - 2b - 3b - 2b + 3. Let u = 10 + -16. Let h be v(u). What is the highest common factor of 99 and h? 9 Let o be 3/(5 + -2)0. Let w(c) = -c2 + 48. Let b be w(o). Let r = 16 - 10. Calculate the greatest common factor of b and r. 6 Let t(m) = -5m + 7m2 - 3m*3 - 2 + 2m*3 + 14m. Let u be t(8). What is the greatest common divisor of u and 24? 6 Let w = 32 - 14. Calculate the greatest common divisor of w and 9. 9 Let s be (-2)/(-6) + 85/15. Suppose 0 = 3n - 3 - s. Suppose -m - nm = -b + 10, 0 = -2b + m + 6. Calculate the highest common divisor of 10 and b. 2 Let s(x) = -x2 - 2x + 5. Let o be s(-5). Let r(k) = k*2 + 6k. Let u be r(o). Let a = u - 16. Calculate the greatest common factor of 3 and a. 3 Let f(y) = -y*3 - 5y*2 - y - 2. Let z be f(-5). Calculate the greatest common divisor of z and 6. 3 Suppose -30 = 3r - 0r. Let o = 12 + r. Calculate the highest common divisor of 16 and o. 2 Suppose s = -0s - 2j + 10, -3s - 5j + 25 = 0. Suppose -3v = -2v + x - 12, s = 3v - 2x - 26. Calculate the highest common factor of v and 2. 2 Let t = -1 + 2. Let p = 2 - t. Let n be 7p(-5 - -11). What is the highest common divisor of n and 6? 6 Let i(k) = 5k. Let x be i(3). Calculate the greatest common factor of x and 135. 15 Let g(l) = 4l - 3. Let i be g(4). Calculate the greatest common factor of i and 26. 13 Let i = 5 + -6. Let z be (-43 + 3)/(0 + i). What is the highest common factor of z and 5? 5 Suppose 0 = -2k + b + 42, -4b = -3k + 13 + 45. Suppose 83 + k = 5r. Suppose 0l - l = -7. Calculate the greatest common divisor of l and r. 7
Let v(b) be the third derivative of 1/6b4 + 0 + 0b + 1/60b5 + 2/3b*3 + 5b*2. Let g be v(-5). What is the highest common divisor of 9 and g? 9 Let w = 54487 - 28953. What is the greatest common factor of w and 68? 34 Let a be (25480/50)/(6/15). Suppose 28c - 1162 - a = 0. What is the highest common divisor of c and 116? 29 Let v(i) = -4i2 + 108i - 93. Let q be v(25). Calculate the highest common factor of 6313 and q. 107 Let v = -4 + 7. Suppose 91s + 11s + 11s + 4984 = 21934. Calculate the highest common factor of s and v. 3 Let h = -75 + 120. Let r be 2/(-9) + 5950/h. Let n = r + -34. Calculate the highest common factor of 14 and n. 14 Let m(h) = -h3 - 6h*2 + 7h + 3. Let s be m(-7). Suppose 0 = -4t + 20, -2t - s = -k - 6. What is the greatest common divisor of 49 and k? 7 Let q be (-195)/124-1-2. Let l = q + 184. Suppose d + l = 10d. Calculate the greatest common factor of 42 and d. 6 Let m(c) = c*3 - 13c*2 + 16c + 58. Let t be m(11). Let a be 1/((-7299)/(-912) + t). What is the highest common divisor of 57 and a? 19 Let l = -3256 + 27527. What is the greatest common divisor of 13 and l? 13 Let t = 100 - 86. Let p be t/6 + 26/(-78). Suppose pf = 5c - 55, -3c - 3 = -5f - 17. What is the greatest common divisor of 13 and c? 13 Suppose 6 = -3d - 3v - 18, 3d + 4v + 28 = 0. Let o be -6(d - (-8)/30-5). Calculate the greatest common divisor of o and 560. 16 Let u be 20 + 0 - (-3 - (182/(-52))/((-70)/20)). Let m be (-64)/(-6)(-3)/(-2). Calculate the highest common divisor of m and u. 8 Let n = 1249 + -1084. Calculate the highest common divisor of n and 195. 15 Let s be (15/(-9))/(2/(-6)). Let r be -11s/2-6. Calculate the greatest common factor of r and 33. 33 Let l be 551 + 9 + -9. Calculate the greatest common factor of 459 and l. 51 Suppose s + 4s = 55. Let q(n) = 66n + 70n - n2 + 20 - 148n. Let h be q(-7). What is the highest common divisor of h and s? 11 Let o = -12935 + 12987. What is the greatest common divisor of o and 169? 13 Let b = -68 + 108. Suppose -6130 = -39y + 1670. Calculate the highest common factor of b and y. 40 Suppose -26q + 21q = -v + 4240, 5v = -q + 21252. Calculate the greatest common divisor of 625 and v. 125 Let j(y) = 68y2 + 2y + 2. Let g be j(-1). Suppose -o = -4d - g, -3 - 1 = -d. Suppose -f - 84 = -4f. What is the highest common factor of o and f? 28 Suppose 53r + 1135 - 30499 - 78385 = 0. Calculate the greatest common divisor of 152 and r. 19 Suppose 0 = -1145k + 1146k - 264. Calculate the highest common divisor of 408 and k. 24 Suppose -5n + 29 + 31 = 0. Suppose -5g - 653 = 92. Let u = g + 185. Calculate the greatest common divisor of n and u. 12 Suppose 458 - 4989 = -44s + 309. What is the highest common divisor of s and 1210? 110 Let i = 1791 + -1008. Calculate the highest common divisor of i and 3045. 87 Let b = -117 + 171. Suppose -4c - 665 = -229. Let x = 190 + c. What is the highest common divisor of x and b? 27 Suppose -16329 = -45z + 10671. What is the highest common factor of z and 224? 8 Suppose 26f - 75 = f. Let m(x) = 4x*2 + 2x - 3. Let k = -6 + 3. Let p be m(k). Calculate the highest common divisor of p and f. 3 Let i = 3025 + -2677. Calculate the highest common divisor of 1992 and i. 12 Suppose -22f - 110529 = 9f - 551907. Calculate the greatest common factor of 126 and f. 126 Let c(k) be the first derivative of 2k3/3 + 35k*2 + 68k - 67. Let j be c(-35). Calculate the highest common factor of 12 and j. 4 Suppose 5 - 11 = 2q, 0 = -4a + 5q - 1473. Let p = 251 + a. Let l = 131 + p. What is the highest common divisor of 90 and l? 10 Suppose -1146s = -1141s - 5550. Calculate the greatest common divisor of s and 30. 30 Let j = 3064 - 3060. Calculate the greatest common factor of 47 and j. 1 Suppose 1003 = p - 392. Calculate the greatest common factor of 285 and p. 15 Suppose -3t + 15 = -0. Suppose ts = 29 + 11. Let x(k) = 32k + 320. Let o be x(-9). What is the greatest common divisor of o and s? 8 Let a = 302 + -227. What is the highest common divisor of 2130 and a? 15 Let l = 1765 + -1471. What is the highest common factor of l and 2499? 147 Let q(s) = -2s3 - 66. Let y be q(0). Let b be (44/y)/(1/(-54)). Calculate the highest common divisor of b and 1152. 36 Let k be (-6 - (-25 + 6))(7 - 0). Suppose -202 = -3c + 5z, -3c - z + 99 = -k. What is the greatest common divisor of 8 and c? 8 Let j = 7166 - 6261. What is the highest common divisor of j and 1629? 181 Let a(p) = -28p + 11. Let q be a(0). Let z be (3 - 2)-4 + 125. What is the greatest common factor of z and q? 11 Let n be 0/(1(-12 - -10)). Suppose 2z - 11 = 3. Suppose n = 2g + z - 55. Calculate the highest common divisor of 24 and g. 24 Let s(t) = 2t2 - 260t - 4580. Let m be s(-17). What is the greatest common divisor of 323 and m? 19 Let q(d) = -d*3 + 16d*2 - 87d + 890. Let f be q(14). Let z(i) = -23i + 2. Let s be z(-2). Calculate the highest common factor of s and f. 16 Let a be (-36 - 48)/((-6)/9) + (5 - 0). What is the highest common factor of 27379 and a? 131 Suppose 1264 = 17k + 159. Calculate the highest common factor of k and 481. 13 Suppose -4v = 0, 2v + 3v + 80 = 4z. Let q = 78 + -363. Let y = q - -290. What is the greatest common divisor of z and y? 5 Suppose 3x + c = 27304, 0 = -2x - c + 14866 + 3338. Suppose 13w = x + 2860. What is the highest common divisor of 40 and w? 40 Suppose 29i - 25i = -5j + 23, -i = 3j - 18. Calculate the highest common divisor of 47 and j. 1 Let k = 20462 + -19879. What is the highest common divisor of 2597 and k? 53 Let x(i) = 6i*2 - 54i - 107. Let l be x(-2). Suppose -4d + d - 4m + 3225 = 0, -5m = 0. What is the highest common factor of d and l? 25 Suppose -3180 = -23x + 3x. Suppose 6j - x = 2j - 3w, -35 = -j + 4w. Calculate the highest common divisor of j and 143. 13 Suppose 130 = 4j + 138, -38 = -2s + 3j. Calculate the highest common factor of 144 and s. 16 Suppose 5a - 17y = -14y - 1406, 3y - 286 = a. Let g = a + 282. What is the highest common factor of g and 27? 1 Let x = 33596 + -33528. What is the highest common factor of 68 and x? 68 Let z(y) be the first derivative of 17y2/2 - 232y + 142. Let i be z(16). What is the greatest common divisor of i and 25? 5 Suppose 17g + 22 = 56. Let i = 932 + -914. Calculate the greatest common factor of i and g. 2 Let v = 756 + -416. What is the highest common factor of v and 20? 20 Suppose -3t - 551 = -4k, -6t = -2k - 11t + 243. Suppose -64 = -kw + 133w. What is the greatest common divisor of 208 and w? 16 Suppose 4 = -4c - 0c, 4c - 348 = -4h. Calculate the highest common divisor of h and 1628. 44 Let u(o) = -32o - 2364. Let x be u(-74). Calculate the greatest common factor of x and 3778. 2 Let q = 60 - 18. Suppose 11t = -84 + 216. What is the greatest common divisor of q and t? 6 Let p(t) be the second derivative of -t*3/2 - 3t*2/2 + 9t. Let i be p(-3). What is the highest common divisor of i and 6? 6 Suppose 0 - 8 = -2f. Let m = 96 + -15. Suppose m = fp - 47. Calculate the greatest common divisor of 288 and p. 32 Let r be 6/(-4)(-2)/(-3). Let p be r/2 - (-452)/8. Suppose -5x = -5j - 715, -5j = -346x + 345x + 155. Calculate the highest common factor of p and x. 28 Suppose 77l + 9179 = 33126. Calculate the greatest common divisor of 3 and l. 1 Let n = -392 + 400. Suppose -nf + 168 = -f. What is the highest common divisor of 126 and f? 6 Let r be (0 - 1)(-263 - 8). Let s(x) = 56x - 9. Let z be s(4). What is the highest common factor of r and z? 43 Let g be (-3 - 1)115/(-20). Let u be (4 - 1 - 2)115. What is the highest common factor of u and g? 23 Suppose 0 = -0k - 4k + 2w + 2690, 3w + 15 = 0. Calculate the highest common factor of k and 10. 10 Suppose v = -0j + 3j - 1790, 2j + 3v - 1197 = 0. Let i = j + -465. What is the highest common divisor of 616 and i? 44 Let p = 8480 + -7899. Calculate the highest common divisor of p and 1411. 83 Let w = 128 + -350. Let c = -178 - w. Calculate the highest common divisor of 24 and c. 4 Let n = 389 - 384. Suppose -4x + ny - 1 = -32, x + y - 10 = 0. Suppose -192 = -2d + b - 4b, 2d - 4b = 206. What is the highest common divisor of x and d? 9 Let q = -10441 - -10525. What is the highest common divisor of 2919 and q? 21 Let p be (-1005)/(-12) - 2/(-8). Suppose 54o - 1038 - 474 = 0. Calculate the highest common factor of o and p. 28
Suppose 44t = 5m + 48t - 679, -4m + 552 = t. Find the third derivative of -25 + 23 + mp3 - 20p*2 + 6 wrt p. 834 Let x(h) be the third derivative of 191h6/24 - h5/30 - 407h4/12 + h2 - 337h. Find the second derivative of x(i) wrt i. 5730i - 4 Suppose 22q = 8q + 294. Find the third derivative of 2918f*5 - 28f*2 - qf*2 - 2871f*5 - 19f*2 wrt f. 2820f*2 Suppose -y = -18 + 12. Suppose 338 = -4l + yl. What is the second derivative of -79k*3 - 76k*3 + k + lk*3 wrt k? 84k Let m(c) = -c*3 - 47c*2 + 18c + 848. Let z be m(-47). Let p(y) be the first derivative of 20/3y3 + 0y*z + 5y + 1. Differentiate p(n) wrt n. 40n Let n(c) be the first derivative of -663c*3 - 3c*2/2 + 394c - 1590. What is the second derivative of n(l) wrt l? -3978 Suppose -8s + 34 = -7s. Suppose s = 4l + 10. Find the second derivative of 3j + lj - 6j*2 - 5j*2 wrt j. -22 Let t be (-2 + 4)3/(-2). Let h be t - (-2 - -2 - 26)2. What is the first derivative of -18p*3 + hp*2 - 49p*2 + 14 wrt p? -54p*2 Let i(x) = -13x + 13. Let z be i(0). Find the first derivative of 29j - 49j*4 + 23 - 29j + z wrt j. -196j3 Let z(p) = -p3 + p2 - 2p - 1. Let q(l) = -1643l3 + 9l*2 - 18l + 1812. Let j(t) = -2q(t) + 18z(t). Differentiate j(n) wrt n. 9804n2 Let o(z) be the first derivative of 11z*2 + 7/6z*3 + 18 + 14z. Let c(x) be the first derivative of o(x). Differentiate c(m) wrt m. 7 Let p(w) be the second derivative of -6437w4/12 - 4127w*2/2 - 5268w. What is the first derivative of p(z) wrt z? -12874z Let t(l) be the third derivative of -l6/120 - 583l*5/30 + 6l*3 - 2919l*2. Differentiate t(h) wrt h. -3h*2 - 2332h Let f(o) be the second derivative of 0o5 - 2 - 4/3o*3 - 2/3o*4 + 0o*2 - 13o - 58/15o6. Find the third derivative of f(g) wrt g. -2784g Let f(j) = -3j3 - 2088j*2 - 2668j - 7. Let l(v) = -2v3 - 1387v*2 - 1779v - 5. Let h(i) = -5f(i) + 7l(i). Find the second derivative of h(m) wrt m. 6m + 1462 What is the second derivative of 698071m*5 + m - 698006m*5 - 155 + 2m*3 - 3m wrt m? 1300m3 + 12m Let q be 7 + -21/46. Differentiate -15d2 - 6d*2 + 21d*2 - qd*2 - 78 - 19d*2 with respect to d. -46d Let i(w) be the third derivative of 0w + 0w*5 - 47/3w*3 + 0 - 43/40w*6 + 140w*2 + 0w*4. What is the derivative of i(y) wrt y? -387y*2 What is the third derivative of 1211w*3 + 2149w*2 + 28w + 316w2 - 28w wrt w? 7266 Suppose -12 = -3i + y, -i + 1 = 3y - 13. What is the third derivative of -254q3 - q5 - qi + 0q*2 - 3 + 10q*2 + 252q*3 wrt q? -120q*2 - 12 Let h(l) be the second derivative of -232l*5/5 + 351l*2/2 - 32l. Find the first derivative of h(y) wrt y. -2784y2 Let k(r) be the second derivative of 0r*3 + 0r*4 + 0r*5 + 87/2r*2 - 194r + 0 - 161/30r6. Find the first derivative of k(p) wrt p. -644p*3 Let m(i) be the third derivative of -61/60i*6 + 0i*4 - 28i + 3i2 + 0 + 0i*3 - 73/30i*5. Find the third derivative of m(u) wrt u. -732 Let k be -12 + 22 + -2 + 0 + -1. Find the third derivative of kf*2 + 291 + 17f*3 - 284 + 12f*3 + 17f*3 wrt f. 276 Let j(y) be the first derivative of 2182y*3/3 - 3336y*2 + 6114. Find the second derivative of j(v) wrt v. 4364 Let g(h) = 28h*3 - 91h*2 - 3417h - 7. Let f(q) = 23q3 - 46q*2 - 1709q - 4. Let w(v) = -11f(v) + 6g(v). Find the second derivative of w(u) wrt u. -510u - 80 What is the second derivative of 1002i*4 + 560i*4 + 0i + 315 + 4i - 2i*2 - 5i + 3i wrt i? 18744i*2 - 4 Let w(s) = -27s*3 - 10s*2 + 1616s + 10. Let h(d) = 14d3 + 5d*2 - 809d - 6. Let t(r) = -5h(r) - 3w(r). What is the second derivative of t(c) wrt c? 66c + 10 Let j(k) = -k - 6. Let d be j(-10). Suppose 36c - 5l - 7 = 40c, 0 = 5c + 3l - 1. What is the first derivative of 12 - 508g2 - d + 492g*c wrt g? -32g Let u(w) = -w + 19. Let b be u(24). Let g(a) = a*2 + 9a + 21. Let k be g(b). What is the first derivative of 2m + k - 32m + 11 wrt m? -30 Let r(o) = -o*3 - 4o*2 - o + 10. Let x be r(-3). Let y(m) = 6m - 4. Let d be y(1). Find the third derivative of 14ux + 8u*2 + 5u*d + 6u*4 wrt u. 480u Let h(u) = -22u2 + 2u. Let z(b) = 4214b2 + 22b + 5178. Let r(o) = 22h(o) - 2z(o). Find the first derivative of r(k) wrt k. -17824k Let t(d) = -d3 + 6d*2 - 10d + 18. Let r be t(4). Differentiate -l*3 + 144 + rl*3 - 47l + 44l with respect to l. 27l*2 - 3 Let y(d) = -5d*4 + 4d*3 + 160d*2 - 365. Let j(o) = -12o*4 + 9o*3 + 316o*2 - 730. Let u(f) = 4j(f) - 9y(f). What is the derivative of u(w) wrt w? -12w*3 - 352w Let f(m) = m*2 - 5m + 7. Let z be f(4). What is the derivative of -k + k - 17kz - 4k*3 + 197 - 8k*3 wrt k? -87k*2 Find the second derivative of -5535l*4 + 15708l*4 + 2l*2 - 2l*2 - 67129l + 66277l wrt l. 122076l*2 Find the second derivative of 12609u + 5004u4 + 2u*2 - 2u*5 - 3207u - 2391u wrt u. -40u*3 + 60048u*2 + 4 Let v(w) be the third derivative of 0w*5 + 193w*2 + 37/30w*6 + 35/6w*4 + 0 + 0w*3 + 0w. What is the second derivative of v(k) wrt k? 888k Let f(b) = -2032b*2 + 126b - 416. Let x(z) = 4063z2 - 273z + 833. Let h(l) = 13f(l) + 6x(l). What is the derivative of h(i) wrt i? -4076i Differentiate -77p - 40p3 + 39p*3 + 382p + 1712p - 2696 wrt p. -3p*2 + 2017 What is the third derivative of 39u - 243u5 + 2 + 4u*3 - 39u + 318u5 - 367u*2 wrt u? 4500u*2 + 24 Find the second derivative of -16d + 4d3 + 4076 - 10d*4 + 5d - 4083 wrt d. -120d2 + 24d Differentiate 56s + 459s*2 - 227s*2 + 286 - 233s*2 wrt s. -2s + 56 Let m = 413 - 318. What is the third derivative of m + 23c2 - 189c*2 + 13c3 + 93 - 188 wrt c? 78 Let q(m) = -m3 - 8m2 - 10m - 20. Let t be q(-6). Let g = 50 + t. Find the second derivative of -13w + 4w - gw + 3w + 13w3 wrt w. 78w What is the derivative of 2435 - 659 + 2940 - f + 19f + f2 - 299 wrt f? 2f + 18 Find the second derivative of 137 + 4328p2 - 4328p*2 + 227p*3 - 7p - 3304p3 wrt p. -18462p Let u be 36 + (2 - 2)(-1)/2. Let o = 41 - u. Find the first derivative of 14 + 25f*4 - 5f*2 + of*2 - 36 wrt f. 100f*3 Let j = 39701/10 - 3970. Let f(h) be the third derivative of -2/3h*3 - jh*6 + 6h*2 + 0h*5 + 0 + 0h*4 + 0h. Differentiate f(s) with respect to s. -36s2 Let o(h) be the second derivative of -449h*4/6 + 683h*3/6 - 847h. What is the second derivative of o(m) wrt m? -1796 Let j = -88 + 91. Let t(m) = -153m2 - 8m - 26. Let d(z) = -152z2 - 10z - 27. Let n(l) = jd(l) - 4t(l). What is the second derivative of n(x) wrt x? 312 Let q(s) = 5s - 3 - 6s + 4. Let g be q(-3). Differentiate 30 - 4j3 + 4j*3 - 185j*g + 211j*4 wrt j. 104j*3 What is the first derivative of -4477c*3 - 2477 - 8913c*3 + 4380c*3 wrt c? -27030c*2 What is the second derivative of -1397d + 357d - 466d - 116d2 + 1055d*2 + 268d*2 wrt d? 2414 Suppose 0 = 2m - 4, -11d - 5m + 35 = -6d. What is the second derivative of 4k + 2kd - 27 - 3k*5 + 34 wrt k? -20k*3 Suppose 4j = o - 38, o - 11 = -7j + 2j. Suppose -3i = 2u - 135, i - o - 27 = 2u. Find the first derivative of i - f2 + 4f*2 + 2f*2 - 30 wrt f. 10f Let c(w) = 10255w + 6371. Let s(f) = -41050f - 25485. Let y(k) = 25c(k) + 6s(k). What is the derivative of y(x) wrt x? 10075 Suppose 0 = 11b - 76 + 10. What is the third derivative of -7u + 78ub - 3414u*3 + 3414u*3 + 4u*2 wrt u? 9360u*3 Let p(l) be the second derivative of -203l*6/15 + 475l*3/6 - l + 232. What is the second derivative of p(m) wrt m? -4872m*2 Let v be (-8)/28 + 22476/21. Let x = -117 + v. Find the third derivative of -14c*2 - 953c + xc + 13c*6 wrt c. 1560c*3 Find the first derivative of -128g*3 - 688 - 1217g*3 + 6g*3 - 451 wrt g. -4017g*2 Let w = -895 + 897. Let i(a) = -a + 7. Let f be i(-6). What is the first derivative of f + 9 + w + 37t - 2 wrt t? 37 Suppose 9w - 672 = 183. Find the third derivative of 195t3 + t2 + 198t3 - 389t*3 - 5t4 + w - t4 wrt t. -144t + 24 What is the third derivative of -12q*6 + 29q*6 - 6q + 6q + q3 - 16q*6 - 504q*4 + 5q*2 + 78 wrt q? 120q*3 - 12096q + 6 Let a be 82(-5)/(-4). Find the first derivative of 15 + 63v3 - 28 + a wrt v. 189v**2
Is 10349005 a multiple of 208? False Is 495 a factor of 91329011? False Is 14348060 a multiple of 40? False Is 39 a factor of 1114445751? False Is 1107240326 a multiple of 8? False Does 962 divide 6280898? True Does 191 divide 9899022? False Is 3348211020 a multiple of 15? True Does 344 divide 475354558? False Is 1772 a factor of 241266228? False Is 21 a factor of 1526422152? False Does 17 divide 193504642? True Does 11 divide 1082898579? False Does 54 divide 64308168? True Is 7 a factor of 1380260? True Is 195243978 a multiple of 3642? True Is 64 a factor of 90740992? True Does 1902 divide 814404622? False Is 1830054174 a multiple of 78? True Does 10 divide 13652772? False Is 475359280 a multiple of 983? False Is 4 a factor of 69398452? True Is 371821298 a multiple of 25? False Does 7376 divide 536095056? True Is 193549664 a multiple of 1351? True Is 3512 a factor of 343666589? False Does 344 divide 301904492? False Does 176 divide 41126799? False Is 38334912 a multiple of 3? True Does 148 divide 204230941? False Does 20 divide 1001612060? True Is 4073478 even? True Is 66321590 a multiple of 190? True Is 139 a factor of 874284702? True Does 29 divide 600283905? True Is 21 a factor of 837918750? False Does 127 divide 7380203? False Is 18906433 a multiple of 14? False Does 33 divide 161424879? True Is 57146715 a multiple of 2235? True Does 722 divide 638788778? True Is 19 a factor of 98228946? False Is 119 a factor of 198878825? False Is 933148224 a multiple of 51? True Does 29 divide 1055036936? True Is 727328118 a multiple of 1154? True Does 275 divide 177268333? False Is 14038272 a multiple of 18? True Does 32 divide 33744384? True Is 31527930 a multiple of 870? True Is 1058 a factor of 736097189? False Is 275057126 a multiple of 263? False Is 67798318 a multiple of 33? False Is 22461216 a multiple of 272? True Does 20 divide 37262020? True Does 1032 divide 7593993460? False Is 42 a factor of 2230326? True Does 19 divide 58740393? False Is 48 a factor of 1979701? False Does 6 divide 198648449? False Is 1428035 a multiple of 5? True Does 54 divide 1458334? False Does 28 divide 1211800072? True Is 3583609848 a multiple of 234? True Is 2291145 a multiple of 379? False Is 332 a factor of 32726568? True Is 429261300 a multiple of 234? True Is 283338653 a multiple of 952? False Is 30562074 a multiple of 666? True Is 1300993972 a multiple of 449? False Is 78689160 a multiple of 110? True Is 3558538715 a multiple of 46? False Is 146488368 a multiple of 3891? True Is 2581269 a multiple of 306? False Is 83 a factor of 44587849? True Does 7856 divide 611809568? True Is 368 a factor of 87692192? True Is 11407909 a multiple of 693? False Does 64 divide 2368200512? True Does 25 divide 1858464814? False Is 17 a factor of 7092793823? False Does 28 divide 73315588? False Does 996 divide 7379673? False Is 96249342 a multiple of 23? True Is 73 a factor of 11754752? True Is 3 a factor of 1256081? False Is 28 a factor of 618830380? True Does 125 divide 807256522? False Does 239 divide 1547345093? False Is 1055344 a multiple of 284? True Is 53499438 a multiple of 229? True Does 38 divide 115268473? False Does 490 divide 1152198250? True Is 1359 a factor of 44850558? False Is 11 a factor of 18577669? True Is 149248856 a multiple of 194? True Is 441 a factor of 75703179? False Does 4066 divide 24557286? False Is 528 a factor of 54277576? False Is 7 a factor of 127028762? True Does 22 divide 1627561100? True Is 90 a factor of 3280379? False Is 1160 a factor of 63151524? False Is 42553142 a multiple of 94? True Is 32419365 a multiple of 33? True Does 6 divide 4911553? False Is 416 a factor of 73706873? False Is 2951246 a multiple of 563? True Does 107 divide 64661022? False Is 267164625 a multiple of 4875? True Is 42454925 a multiple of 1475? True Is 37736680 a multiple of 20? True Does 127 divide 791370147? True Is 10 a factor of 13714097? False Is 45786330 a multiple of 365? True Is 7149471 a multiple of 1732? False Is 15407472 a multiple of 16? True Does 2 divide 77027? False Is 397206950 a multiple of 4822? False Does 1639 divide 1112802719? False Does 1459 divide 102305080? True Does 19 divide 74570231? True Is 45169135 a multiple of 8? False Is 235649637 a multiple of 146? False Is 219652848 a multiple of 2800? False Is 489821098 a multiple of 4501? False Is 338 a factor of 141665264? True Is 123 a factor of 17078427? True Is 1868 a factor of 2021177? False Is 371 a factor of 93182957? True Is 38125229 a multiple of 19? True Is 6 a factor of 1419198702? True Is 144040923 a multiple of 5? False Does 1154 divide 68590664? False Is 364977235 a multiple of 763? True Does 33 divide 1810182? True Is 52918212 a multiple of 102? True Is 3530 a factor of 3892808718? False Does 3552 divide 1573195008? True Does 43 divide 65628682? False Does 389 divide 1233837818? False Is 269481051 a multiple of 1467? False Is 12515545 a multiple of 35? True Is 23963518 a multiple of 53? False Is 969 a factor of 31861689? True Does 7 divide 519633380? True Does 11309 divide 2254200352? True Is 49 a factor of 1135024682? False Does 1524 divide 15366647? False Is 20 a factor of 3575403151? False Is 65 a factor of 9770967? False Does 273 divide 20887503? True Is 21129755 a multiple of 260? False Is 1378192953 a multiple of 10? False Is 16 a factor of 14015844? False Is 753202552 a multiple of 29? False Is 674 a factor of 136685178? True Is 35 a factor of 3769691463? False Is 3217164258 a multiple of 11? True Is 137 a factor of 10147864? True Is 181 a factor of 189935444? False Is 1048 a factor of 134804240? True Does 92 divide 53306054? False Is 112854808 a multiple of 429? False Is 21 a factor of 600996963? True Does 43 divide 404499753? True Is 614 a factor of 66404714? True Does 14 divide 60164867? False Is 2950 a factor of 931677850? True Does 6 divide 1570778904? True Is 3407 a factor of 136073342? False Is 126 a factor of 77501655? False Is 701 a factor of 130593297? False Is 411 a factor of 50219174? False Is 1516990899 a multiple of 29? True Does 156 divide 1347907? False Is 324946875 a multiple of 1507? True Is 5325005 a multiple of 2? False Is 27 a factor of 6866663? False Is 169947052 a multiple of 14? False Is 38 a factor of 18524072? False Is 43746728 a multiple of 12? False Is 355 a factor of 102649519? False Is 12 a factor of 29029008? True Is 29 a factor of 3604874? True Is 25515308 a multiple of 191? True Does 32 divide 868148? False Is 165 a factor of 17751525? True Is 2703 a factor of 80454795? True Is 3271222400 a multiple of 10? True Does 23 divide 7043064? False Is 161 a factor of 42268457? True Does 13 divide 9675237? True Is 2815 a factor of 1133296480? True Does 1167 divide 858922503? True Is 146288064 a multiple of 3016? True Is 61219106 a multiple of 108? False Does 6 divide 2282945? False Is 516276318 a multiple of 745? False Is 2422 a factor of 102634672? True Is 59 a factor of 103366502? False Does 6303 divide 3483156964? False Does 3422 divide 181389470? False Is 21360372 a multiple of 86? False Is 20502117 a multiple of 4? False Does 976 divide 88909439? False Is 10856943 even? False Is 44 a factor of 21620764? True Does 4 divide 1008486320? True Does 27 divide 230726906? False Is 1431 a factor of 181002331? False Does 4137 divide 580967199? False Is 47 a factor of 53032979? False Does 6 divide 103705569? False Does 1304 divide 1882074673? False Does 41 divide 2440336604? False Is 222438587 a multiple of 7? True Is 93 a factor of 18187359? True Does 18 divide 87889200? False Does 2206 divide 731092629? False Does 2630 divide 16713650? True Is 89996264 a multiple of 8? True Is 884261952 a multiple of 36? True Does 2 divide 59579113? False Is 2327 a factor of 630351722? True Is 578 a factor of 7031666? False Is 233307107 a multiple of 47? True Is 5 a factor of 141862732? False Does 318 divide 33306366? True Is 3700 a factor of 180393500? True Is 41877488 a multiple of 66? False Does 21 divide 7321544? False Is 369 a factor of 641498013? True Does 8846 divide 433164495? False Does 15 divide 9301905? True Is 1076 a factor of 5984712? True Is 109108077 a multiple of 183? True Does 9 divide 513910419? False Does 6 divide 229148915? False Is 923484764 a multiple of 11? False Does 11577 divide 2219207352? False Is 35 a factor of 533141362? False Is 73911793 a multiple of 31? False Is 1722 a factor of 35109799? False Is 145584162 a multiple of 11? False Is 2416 a factor of 61214192? True Does 15 divide 19171297? False Does 669 divide 7924974? True Is 2424 a factor of 202367640? True Is 271580481 a multiple of 1803? True Is 11080942 a multiple of 100? False Is 131618747 a multiple of 181? False Is 77 a factor of 86728096? False Is 1950429 a multiple of 19? False
Calculate the remainder when 15659109 is divided by 65. 24 Calculate the remainder when 628899 is divided by 20. 19 Calculate the remainder when 33460128 is divided by 22. 20 Calculate the remainder when 264174 is divided by 4063. 79 What is the remainder when 740850 is divided by 24695? 0 Calculate the remainder when 362556 is divided by 120852. 0 What is the remainder when 1083147 is divided by 19? 14 Calculate the remainder when 217599 is divided by 1078. 921 Calculate the remainder when 863627 is divided by 13707. 86 What is the remainder when 114479 is divided by 36177? 5948 Calculate the remainder when 30749 is divided by 3073. 19 What is the remainder when 9967433 is divided by 31443? 2 Calculate the remainder when 159973 is divided by 53308. 49 What is the remainder when 162088 is divided by 452? 272 What is the remainder when 134587563 is divided by 49? 47 Calculate the remainder when 47979 is divided by 1687. 743 What is the remainder when 42774926 is divided by 5980? 5966 What is the remainder when 13489025 is divided by 769? 765 What is the remainder when 2589033 is divided by 25381? 171 What is the remainder when 137514 is divided by 5499? 39 What is the remainder when 133485 is divided by 44108? 1161 Calculate the remainder when 74630 is divided by 1659. 1634 Calculate the remainder when 1995018 is divided by 249376. 10 Calculate the remainder when 68083 is divided by 511. 120 Calculate the remainder when 11091485 is divided by 1232383. 38 Calculate the remainder when 288439 is divided by 1885. 34 What is the remainder when 3105755 is divided by 3235? 155 Calculate the remainder when 10748447 is divided by 224. 31 What is the remainder when 101942 is divided by 6140? 3702 What is the remainder when 13685301 is divided by 6842649? 3 Calculate the remainder when 2625395 is divided by 1131. 344 Calculate the remainder when 7666318 is divided by 921. 835 Calculate the remainder when 9933 is divided by 236. 21 What is the remainder when 183459 is divided by 30516? 363 What is the remainder when 53477 is divided by 1467? 665 Calculate the remainder when 145983 is divided by 177. 135 What is the remainder when 12635720 is divided by 529? 26 What is the remainder when 28101882 is divided by 96570? 12 Calculate the remainder when 14677955 is divided by 828. 827 Calculate the remainder when 9098979 is divided by 22. 21 Calculate the remainder when 4309785 is divided by 1077443. 13 What is the remainder when 167139 is divided by 2258? 47 What is the remainder when 5962665 is divided by 1005? 0 Calculate the remainder when 236109 is divided by 1357. 1348 What is the remainder when 22275628 is divided by 241? 239 What is the remainder when 3741383 is divided by 970? 93 What is the remainder when 224275 is divided by 387? 202 Calculate the remainder when 181796 is divided by 4214. 594 What is the remainder when 797940 is divided by 20416? 1716 What is the remainder when 274325 is divided by 1614? 1559 What is the remainder when 11576747 is divided by 826908? 35 Calculate the remainder when 31817 is divided by 9964. 1925 Calculate the remainder when 64601961 is divided by 14. 11 What is the remainder when 1356972 is divided by 6? 0 Calculate the remainder when 82616249 is divided by 93. 71 What is the remainder when 88244 is divided by 8513? 3114 Calculate the remainder when 11119114 is divided by 11119113. 1 Calculate the remainder when 1135211 is divided by 39145. 6 Calculate the remainder when 3628298 is divided by 2427. 2360 What is the remainder when 1836306 is divided by 337? 330 What is the remainder when 49409 is divided by 48076? 1333 Calculate the remainder when 2593621 is divided by 79. 51 Calculate the remainder when 4316704 is divided by 300. 4 What is the remainder when 55158137 is divided by 54? 53 What is the remainder when 1027429 is divided by 165? 139 Calculate the remainder when 326473 is divided by 1631. 273 What is the remainder when 1416809 is divided by 472179? 272 Calculate the remainder when 119250 is divided by 770. 670 Calculate the remainder when 43626500 is divided by 579. 8 What is the remainder when 1957378 is divided by 398? 14 What is the remainder when 36305 is divided by 802? 215 Calculate the remainder when 576101 is divided by 3892. 85 What is the remainder when 296544 is divided by 296151? 393 Calculate the remainder when 2090156 is divided by 60. 56 What is the remainder when 10231269 is divided by 170? 159 Calculate the remainder when 88417 is divided by 88266. 151 What is the remainder when 244204 is divided by 2160? 124 What is the remainder when 2256334 is divided by 20? 14 What is the remainder when 3790342 is divided by 2952? 2926 What is the remainder when 27379111 is divided by 1153? 1126 What is the remainder when 16228301 is divided by 46? 7 Calculate the remainder when 413960 is divided by 10501. 4421 Calculate the remainder when 399162789 is divided by 193. 189 What is the remainder when 3709578 is divided by 14? 12 What is the remainder when 276766 is divided by 3412? 394 Calculate the remainder when 15252168 is divided by 15252143. 25 What is the remainder when 559663746 is divided by 284? 282 Calculate the remainder when 48020423 is divided by 31. 28 What is the remainder when 1370003 is divided by 228332? 11 What is the remainder when 8066823 is divided by 240? 183 Calculate the remainder when 1581196 is divided by 1984. 1932 What is the remainder when 6767770 is divided by 132? 130 What is the remainder when 1242568 is divided by 5061? 2623 What is the remainder when 209920554 is divided by 1858? 1856 Calculate the remainder when 25576781 is divided by 86117. 32 What is the remainder when 5003262 is divided by 73? 61 Calculate the remainder when 17265 is divided by 3118. 1675 What is the remainder when 30442137 is divided by 16? 9 Calculate the remainder when 10453999 is divided by 7548. 19 Calculate the remainder when 108656403 is divided by 692079. 0 What is the remainder when 17537935 is divided by 69? 67 Calculate the remainder when 125181 is divided by 298. 21 What is the remainder when 6058536 is divided by 14? 8 Calculate the remainder when 27371129 is divided by 5885. 5879 Calculate the remainder when 404883 is divided by 1131. 1116 What is the remainder when 769266 is divided by 275? 91 Calculate the remainder when 24757 is divided by 3540. 3517 Calculate the remainder when 71688 is divided by 35824. 40 What is the remainder when 7841 is divided by 3594? 653 Calculate the remainder when 44230363 is divided by 15. 13 Calculate the remainder when 122586 is divided by 8153. 291 What is the remainder when 160454 is divided by 1821? 206 What is the remainder when 1074275 is divided by 26201? 34 Calculate the remainder when 385903057 is divided by 340. 337 Calculate the remainder when 2021798 is divided by 732. 14 Calculate the remainder when 214550218 is divided by 1067. 1059 What is the remainder when 396561 is divided by 88? 33 What is the remainder when 1117798 is divided by 38? 28 What is the remainder when 1168964605 is divided by 14? 11 What is the remainder when 789820 is divided by 4467? 3628 Calculate the remainder when 30400 is divided by 95. 0 Calculate the remainder when 246300558 is divided by 115. 113 Calculate the remainder when 180744 is divided by 171. 168 What is the remainder when 5662458 is divided by 5083? 5079 What is the remainder when 11520124 is divided by 5760046? 32 What is the remainder when 13607797 is divided by 25? 22 Calculate the remainder when 60686701 is divided by 5302. 9 What is the remainder when 20870588 is divided by 152? 76 Calculate the remainder when 142233792 is divided by 974204. 8 Calculate the remainder when 53534 is divided by 1447. 1442 Calculate the remainder when 296699 is divided by 148270. 159 What is the remainder when 16119610 is divided by 1249? 16 Calculate the remainder when 3511040 is divided by 1217. 1212 Calculate the remainder when 1449731 is divided by 17. 5 What is the remainder when 2259990 is divided by 1031? 38 Calculate the remainder when 9718013 is divided by 2588. 73 Calculate the remainder when 75886 is divided by 62. 60 Calculate the remainder when 22760253 is divided by 2820. 33 Calculate the remainder when 428973 is divided by 453. 435 Calculate the remainder when 292508 is divided by 2537. 753 Calculate the remainder when 3488183 is divided by 218010. 23 Calculate the remainder when 1165511 is divided by 2871. 2756 Calculate the remainder when 193696 is divided by 389. 363 Calculate the remainder when 726958 is divided by 156. 154