Datasets:

totally-not-an-llm
/

PileV2-axolotlformat-smallmix

Dataset card Viewer Files Files and versions Community

Split (1)

train · 23k rows

text stringlengths 0 13M
Let u(i) = -10530i - 102. Let v(n) = 31n. What is u(v(z))? -326430z - 102 Let c(v) = -6041v. Let g(i) = 3i2 + 592i. Determine g(c(a)). 109481043a2 - 3576272a Let a(m) = 28m2 - 5. Let g(d) = 182993d. What is a(g(r))? 937620265372r2 - 5 Let p(f) = -2f*2. Let y(l) = -146l + 364l + 37l. Give p(y(c)). -130050c2 Let o(z) = 8z*2. Let x(d) = -8d - 18. Let l(q) = 5q + 8. Let a(i) = 5l(i) + 3x(i). What is o(a(s))? 8s*2 - 224s + 1568 Let r(n) = 384n2 - n + 183. Let l(h) = h2 + 3. What is r(l(i))? 384i*4 + 2303i*2 + 3636 Let v(q) be the third derivative of 0 + 0q - 5/6q3 + 11/24q*4 - 10q*2. Let m(n) = -16n + 7. Let f(z) = -5m(z) - 7v(z). Let j(p) = -5p. Give f(j(d)). -15d Let x(l) = -4l - 2. Let q be x(10). Let i = q + 44. Let r(s) = -4s. Let u(d) = 2d. Let j(f) = ir(f) + 5u(f). Let t(z) = 18z*2. Calculate t(j(h)). 72h*2 Let t(y) = 3y. Let u(h) = 6982h2 - h + 14. Give t(u(z)). 20946z*2 - 3z + 42 Let y(o) = 13o - 4. Let a(j) = 5j*2 + 8j - 10. Let i(l) = -36l2 - 60l + 75. Let v(s) = 15a(s) + 2i(s). Determine y(v(n)). 39n2 - 4 Let k(b) = -30b. Suppose -j + 3z + 8 = 0, 99z - 95z + 6 = -j. Let c(q) be the first derivative of 22 + 0q + 0qj + 1/3q*3. What is c(k(o))? 900o*2 Let l(n) = 7n2. Let m(k) = k2 - 556110k. Give m(l(r)). 49r*4 - 3892770r*2 Let t(r) = -55274r. Let b(z) = -295z2 - 2. Calculate b(t(q)). -901288447420q*2 - 2 Let m(x) = 5x2. Let z(t) be the first derivative of t3 + 117t - 969. Give m(z(l)). 45l*4 + 3510l*2 + 68445 Let p(f) = -35f + 20. Let y(z) = -z + 1. Let c(x) = -5p(x) + 100y(x). Let u(l) = -38l - 182. Let j(g) = 8g + 39. Let h(b) = 14j(b) + 3u(b). Give c(h(w)). -150w Let f(y) = -25y. Let p(m) = 29m - 88m + 33m + 36m - 3. What is p(f(r))? -250r - 3 Let p(s) = -20266s. Let i(b) = -5417b2. Calculate i(p(n)). -2224820165252n*2 Let c(d) = d. Let m(g) = 360g*2 - 495g - 30195. Let h(t) = -t - 61. Let j(l) = 990h(l) - 2m(l). What is c(j(b))? -720b2 Suppose -1613 = -4s - 53. Let h(i) = 17i + 390 - s. Let c(b) = 4b*2. What is h(c(x))? 68x*2 Let i(z) = -16z2. Let x(b) be the third derivative of -b5/8 + 37b3/3 + 47b*2. Let s(l) be the first derivative of x(l). Determine s(i(h)). 240h2 Let k(t) be the third derivative of -t5/60 + 27t2 - 27. Let j(y) = -1123y. Determine k(j(f)). -1261129f2 Let i(y) = 46y*2 + 2y*2 - 3y2 + y2 - 2y2 - 42y*2. Let f(a) = a. Let c(l) = -44l. Let n(t) = 2c(t) + 110f(t). Calculate i(n(w)). 968w2 Let i(l) be the first derivative of -l2/2 - 1312. Let y(a) = -1174a - 4. What is i(y(v))? 1174v + 4 Let l(q) = 2360q. Let c(u) = -2u + 2038. Calculate c(l(h)). -4720h + 2038 Let n(k) = -k*3 + 15k*2 - 4k - 17. Let h be n(14). Let q(a) = a + 123 - h. Let y(r) = r2. What is y(q(b))? b2 Let p(x) = -1878x. Let l(j) = -129484j. What is p(l(i))? 243170952i Let w(i) be the first derivative of -1500i*2 + 3843. Let n(o) = -2o. What is w(n(t))? 6000t Let j(d) be the third derivative of d4/6 + d3 - 13d*2. Let t(n) = -n - 1. Let y(h) = -j(h) - 6t(h). Let c(f) = 0f + 12f - 22f - 13f. What is c(y(m))? -46m Let w(t) = -2t2 + 27. Let u(s) be the second derivative of -s4/24 - 93s2/2 - 4s + 11. Let n(l) be the first derivative of u(l). Determine n(w(r)). 2r2 - 27 Let b(o) = 7o*2. Let a(x) = 53735x. Determine b(a(h)). 20212151575h2 Let x(z) = 13z. Let c be -1038(-3)/(6 + 0). Let v(i) = ci - 262i - 254i. Determine x(v(o)). 39o Let p(a) = 18a + 53. Let r(d) = -20d2 - 3d + 25. What is r(p(x))? -6480x2 - 38214x - 56314 Let d(h) = 1. Let p(q) = q + 9. Let a(c) = -36d(c) + 4p(c). Let f(i) = -1123i2 - 1154i*2 + 2275i*2. Give a(f(g)). -8g*2 Let r(d) be the third derivative of -257d4/6 - d3/6 + d*2 + 2d - 263. Let c(k) = 4k2. Calculate c(r(y)). 4227136y*2 + 8224y + 4 Let l(s) = 12s + 24. Let k(f) = -1185f*2 - 2f - 1. What is l(k(h))? -14220h2 - 24h + 12 Let w(s) = -3s. Let t(q) = -10663240q. Calculate t(w(l)). 31989720l Let z(i) = -10i*2. Let s(y) = 2y*2 + y - 5. Let v be s(-3). Suppose -12f = -vf - 4. Let o(m) = 27 - m - 27 - fm. Calculate o(z(q)). 30q2 Let c(q) = 4q. Let f(z) be the second derivative of 11z6/180 + 15z*4/4 + 98z. Let o(h) be the third derivative of f(h). Determine c(o(l)). 176l Let h(z) = 29z. Let m(l) = 31576l2 - 2l. What is m(h(b))? 26555416b2 - 58b Let i(l) = -39l + 17. Let a(t) = 44t*2 + 5t. Calculate i(a(d)). -1716d2 - 195d + 17 Suppose u = 3p + 6u - 61, 4p + 5u - 73 = 0. Let f(r) = -r + pr - 2r. Let w(d) = 4d2. Determine f(w(i)). 36i*2 Let i(b) = -3b + 30b2 - 58b*2 + 27b*2 + 3b. Let g(s) = 27s - 2. Calculate i(g(y)). -729y*2 + 108y - 4 Let k(t) be the third derivative of t*6/80 + 4t*4/3 - 59t*2. Let p(w) be the second derivative of k(w). Let x(u) = -11u*2. What is p(x(o))? -99o*2 Let u be (3 + (-14)/7)21. Let j(n) = -21 + u - 4n + 2n. Let p(f) = -2f + 42. Calculate j(p(g)). 4g - 84 Let j(g) be the first derivative of 1838g3/3 - 2505. Let p(h) = -2h*2. Determine p(j(f)). -6756488f*4 Let g(a) = -2a. Let j(t) = 43583t - 580. What is j(g(i))? -87166i - 580 Let c(y) = 2y2. Suppose 5g + 19 = 4g - 3o, 0 = -2o + 4. Let w = -18 - g. Let l(m) = -2 - 5 + w + m - 6. Determine c(l(r)). 2r*2 - 24r + 72 Let n(h) be the first derivative of -103h2 - 1. Let q(s) = 6769834 + 3s - 6769834. Calculate q(n(u)). -618u Let p(x) be the third derivative of x5/30 - x2 - 11x. Let q(y) be the third derivative of 13y4/24 + y3/3 - 63y*2. Determine q(p(o)). 26o*2 + 2 Let j(s) = -11s. Suppose -x = 3x - 8. Let w(f) = f2 + 2f*x - 4f*2 + 0f*2. Determine j(w(d)). 11d*2 Let a(u) = 3u. Let s(w) be the first derivative of -w5/12 + w3/2 - 2w2 + 28w - 85. Let q(h) be the second derivative of s(h). Calculate q(a(l)). -45l2 + 3 Let b(u) = 3256184u. Let r(s) = -8s. Give r(b(j)). -26049472j Let i(c) = -7405c. Let t(h) = 33h*2 - 181. What is t(i(n))? 1809522825n*2 - 181 Let c(f) = 28f. Let s(p) = 74690p + 74698p - 149377p. What is c(s(w))? 308w Let a(d) = 12774d2. Let j(v) = -1916v. What is a(j(s))? 46894069344s2 Let w(a) = 2a. Let f(m) = -42m + 2. Let i(j) = -103j + 1. Let l(y) = -2f(y) + 3i(y). Calculate l(w(v)). -450v - 1 Suppose -2l + 121 = -17. Let t(x) = x + lx2 - x - 71x*2. Let n(w) be the first derivative of 19w*3/3 - 14. Determine n(t(z)). 76z4 Let f(v) be the third derivative of v4/24 - v3/3 + v2 - 18. Let p(o) = -7o + 12. Let z(x) = -6f(x) - p(x). Let w(y) = -902y2. Calculate z(w(h)). -902h*2 Let u(n) be the third derivative of 67n*6/240 + 17n*4/24 + 29n2 - 2. Let v(j) be the second derivative of u(j). Let w(f) = f2. What is w(v(y))? 40401y2 Let d(w) = -425 - 418 + 10w*2 - 412 + 1255 + 16w. Let o(t) = -11t. Give d(o(i)). 1210i*2 - 176i Let p(l) = 692l2 + 14. Let v(t) = 1036t*2 + 20. Let u(y) = -20p(y) + 14v(y). Let s(i) = -7i*2. What is s(u(c))? -3086272c*4 Let u(h) = 71h*2 - 2. Let r(x) be the second derivative of 0 + 0x*2 + 1/6x*3 - 99x. Determine r(u(t)). 71t2 - 2 Let g(t) = -2267t*2. Let r(d) = -463d*2. What is r(g(m))? -2379490807m*4 Let r(n) = -2n. Let x(c) = -10582974c. Determine x(r(o)). 21165948o Let d(r) = r. Let g = 162 - 160. Let t(j) be the third derivative of gj3 + 0j*4 - 1/30j*5 + 0j + 0 - j*2. Calculate t(d(x)). -2x*2 + 12 Let y(x) be the second derivative of 30x4 + x3/3 + 4133x. Let f(q) = q. What is f(y(k))? 360k*2 + 2k Let o(b) = 14b2 - 7b*2 - 8b*2. Let h(n) = -10n. Let j(z) = 3z. Let q(w) = 4h(w) + 18j(w). Determine o(q(v)). -196v*2 Let x(o) = -24 - 17o - 24o + 42o. Let p be x(26). Let k(u) = 4up + 2u*2 - 7u*2. Let m(w) = -2w. Give m(k(j)). 2j2 Let a(l) = 7l + 5. Let w(m) = -4m - 3. Let n = 208 + -140. Let c = 73 - n. Let d(y) = cw(y) + 3a(y). Let o(k) = -8k*2. Calculate o(d(j)). -8j*2 Let l(f) = -76f. Let o(d) = -2d2 + 2587d - 3. Determine o(l(k)). -11552k2 - 196612k - 3 Let c be -5 + -3(-6 + 5) + 7. Let b(h) = -h2 + 6. Let z(y) = y2 - 5. Let q(i) = cb(i) + 6z(i). Let u(x) = -3x*2 + 32x. Determine u(q(l)). -3l4 + 32l*2 Let w(t) = -14795t. Let d(v) = 12v2 - v. What is d(w(l))? 2626704300l*2 + 14795l
Let d = 608 + -428. Suppose 0 = -12a + 291 + 249. Calculate the greatest common factor of a and d. 45 Let s be 3/(3/128) + -2. Let f be (-10 + 7)((-42)/45)/((-9)/(-45)). What is the greatest common factor of f and s? 14 Let k be 420520/160 + (-9)/(-12). Calculate the highest common factor of 22 and k. 11 Let i(d) = -9d - 13. Let b be i(15). Let n be b/(-6) - 55/33. Let w be -3 + 1/((-1)/(-49)). Calculate the highest common factor of n and w. 23 Suppose 2840 = -7w - 13w. Let n = -98 - w. Calculate the greatest common factor of 44 and n. 44 Let w(c) = 17c3 + c2 - 6c + 6. Let k be w(1). Let b(u) = 2u - 24. Let t be b(k). What is the greatest common factor of t and 6? 6 Let f = 560 + -556. Suppose 2u + 138 = 4u - 2p, -fp + 228 = 3u. Calculate the highest common factor of u and 36. 36 Let q = -56 + 62. Suppose -3a - q = -15. Suppose -4l - ac + 43 = 0, 3c + 21 = 2l + 4c. Calculate the greatest common factor of 70 and l. 10 Suppose 13j - 3336 = 5j. Let w = -381 + j. Let z(r) = -r2 + 12r - 2. Let u be z(11). Calculate the highest common divisor of w and u. 9 Suppose -i + 157 = -4r, 4i + 47 = -2r - 45. Let x be (225/12)/((-5)/r). Calculate the greatest common factor of 12 and x. 6 Let g = 380 + -375. Suppose -4t = -gl - 254, 4t - l + 3l = 240. Calculate the highest common factor of t and 671. 61 Suppose -4z - 1208 = -1720u + 1715u, -3u + z = -722. What is the greatest common divisor of 17280 and u? 240 Let g(u) = 53 + 6u + 0u - 4u - 2. Let o be g(-15). Calculate the greatest common factor of o and 14. 7 Let p(j) = 103j2 - 6j + 1. Let i be p(1). Suppose -3b + 63t - 62t = -i, 2b + t = 62. What is the highest common factor of b and 8? 8 Suppose -4a = 8, 5g - 266 = -42a + 45a. Calculate the highest common factor of 1222 and g. 26 Let q be (-530351)/(-623) + (-5)/(-7). What is the greatest common factor of 6 and q? 6 Let q be (55/(-5))/((1/3)/(-1)). Suppose 15k - 27 = q. Suppose 2 = s, -s + 10 = v - 0s. Calculate the highest common factor of v and k. 4 Let m be 14/7(880 - -1). Suppose -5678 - m = -15s. What is the greatest common factor of s and 58? 58 Let a = -7405 + 11933. Calculate the greatest common factor of a and 112. 16 Let u = 24 - -155. Suppose -256 = 177r - ur. Calculate the greatest common divisor of 64 and r. 64 Suppose 5l + 11820 = 20l. Let h = l - 482. Calculate the greatest common factor of 36 and h. 18 Let p(q) = q2 - 19q + 89. Let u be p(7). Suppose 4o - 3r + 35 = 164, -ur + 25 = 0. What is the greatest common factor of 4 and o? 4 Let v be 3 - (1-2 - -1). Let k(l) = 2l + 2. Let q be k(v). Let d(t) = t2 - 192t + 2512. Let i be d(14). Calculate the greatest common divisor of i and q. 10 Let h(o) = -11o - 53. Let l be h(-7). Let j be l/(-36) - 1005/(-9). What is the greatest common divisor of j and 74? 37 Let f = -861 + 857. Let o be (45/(-12) + 9 + f)48. Calculate the highest common divisor of o and 288. 12 Suppose -5n + 5x = -700, 3n - 56x + 55x - 428 = 0. Let i(j) = j3 + 8j*2 + 9. Let t be i(-8). What is the greatest common factor of n and t? 9 Suppose -18 = 13y - 10y. Let z(g) = g2 - 4g - 44. Let k be z(y). What is the greatest common factor of 512 and k? 16 Suppose n = 58 - 4. Let i be (14 + -8 - -477) + -6 + 9. Calculate the greatest common divisor of i and n. 54 Let j(s) = -s + 10. Let f be j(10). Suppose f = g + 4g - 20. Suppose -4c + 14 = 2d, 0 = -5d + gc + 8 - 1. What is the highest common factor of 1 and d? 1 Let d = 32535 - 14955. What is the greatest common factor of 15 and d? 15 Let k be 8/((-104)/(-5499)) + 3. Calculate the greatest common divisor of 142 and k. 142 Suppose 3i - 180 = -2y - y, y - 63 = -4i. Suppose 7a - 4d - 104 = 6a, -5d = a - y. Suppose 3k - 420 = a. What is the highest common divisor of 21 and k? 21 Let i be 9 + 4/(-2) + (-43400)/(-70). Calculate the highest common factor of i and 513. 57 Let m(q) = -2q*2 + 80q - 334. Let c be m(35). What is the highest common factor of 14 and c? 2 Let m(x) = x*3 + 10x*2 + 24x + 150. Let w be m(-9). What is the greatest common divisor of 55 and w? 5 Let s(k) = -2k2 - 83k + 3340. Let h be s(-59). What is the greatest common divisor of 1479 and h? 51 Suppose 5z - 5v - 26110 = 0, 46v - 47v + 10456 = 2z. Calculate the highest common divisor of z and 234. 78 Suppose -1 + 29 = t + 4w, -4t - 3w = -73. Let l be (22 - 3) + (11 - t). What is the highest common divisor of 378 and l? 14 Let q be 1 - (2 + 7) - -10. Let w = -14 + 13. Let m be ((-9)/18)/(w/44). What is the greatest common divisor of m and q? 2 Suppose 0 = 2z + 5i - 255, -5z + 3i = 301 - 985. Suppose 9v - z = -6v. Calculate the greatest common divisor of 63 and v. 9 Suppose -5y - 40 = -2r - 4y, 100 = 5r + 5y. Let n be -10((-7)/(-5))/(r/(-150)). Suppose i + 45 = 4i. Calculate the greatest common factor of n and i. 15 Suppose 456 + 120 = -3z. Let b = -176 - z. Let k(m) = 2m - 14. Let u be k(13). Calculate the greatest common factor of u and b. 4 Let j(g) = -21g + 510. Let q be j(24). Let x(m) = 18m2 - m + 1. Let n = 14 - 13. Let r be x(n). Calculate the highest common factor of q and r. 6 Suppose -231 = g - 3p, 3g - 2p - 256 = 4g. Let o = g - -256. What is the greatest common factor of o and 6? 2 Let a be 40/(-2) + (8933 - -148). Calculate the greatest common divisor of 82 and a. 41 Let c = 536 - 526. Let n be 1 + -1 - -3 - -1. Let j = 74 - n. What is the greatest common divisor of c and j? 10 Let d(i) = i3 + 3i*2 - 13i - 1. Let a(u) = -2u - 1. Let v(h) = a(h) + d(h). Let f be v(3). What is the greatest common divisor of 301 and f? 7 Let d = -13564 - -13657. Let y(p) = 0 + 1 - 2p + 7p2 + 1 + p3. Let x be y(-5). What is the highest common divisor of x and d? 31 Let d = -46 + 52. Suppose 0 = 2f - 2t - d, -3t + 7t + 12 = 3f. Let k = 124 - f. Calculate the greatest common factor of 31 and k. 31 Let u = -259 - -418. Let o = -27 + u. What is the highest common factor of o and 176? 44 Let p(y) be the first derivative of -2y3/3 + 19y*2/2 + 14y + 131. Let t be p(10). What is the greatest common factor of t and 92? 4 Let t(d) = 7d2 - 7d + 18. Let h be t(7). What is the highest common factor of 588 and h? 12 Suppose 9998 = 386s - 363s + 1327. Suppose 2p - 16 = 4b - 66, -2b = 2p - 28. Calculate the greatest common factor of s and b. 13 Let x be 6471 + 8 - 9 - 12/4. What is the highest common divisor of 446 and x? 223 Let j be 1715/1530 + (-539)/(-6). What is the greatest common factor of 17910 and j? 90 Suppose 31s - 3320 = -21s - 31s. Let y be 1 + -2 + 320 + 1. What is the highest common factor of s and y? 40 Let q = 1189 - 1760. Let x = -539 - q. What is the highest common factor of 288 and x? 32 Let m(x) = -338x - 967. Let l be m(-24). What is the greatest common factor of l and 5? 5 Let j(b) = 121b - 79. Let q be j(1). Let p = -59 + 80. Calculate the highest common divisor of q and p. 21 Suppose 14o - 5620 + 1633 - 1683 = 0. Calculate the highest common factor of o and 20. 5 Suppose -13f + 5488 = -6f. Suppose 458x - 454x = f. Calculate the highest common divisor of 4 and x. 4 Let s = 18373 + -17205. Calculate the highest common divisor of s and 803. 73 Let v(j) be the second derivative of j4/3 - 7j*3/2 + 3j*2 + 2j - 4. Let y be v(6). What is the highest common divisor of y and 324? 12 Suppose -248 = -5h + 2r, 3h - 7h + r = -196. Suppose -46o + 38 = -44o. Suppose 0 = -oz + 20z - 16. Calculate the highest common factor of h and z. 16 Let m be (12/16)/((-78)/(-3640)). What is the highest common divisor of 1141 and m? 7 Let r = 209 + -168. Suppose 257 = 4i - 5l, 3i - l - r = 138. Calculate the highest common factor of i and 203. 29 Suppose -3b + 92262 = 3x, 0 = 558x - 553x + 3b - 153764. What is the highest common factor of 191 and x? 191 Suppose -620 + 894 = 87k - 944. Calculate the greatest common factor of k and 19250. 14 Suppose -z - 3 = 3p, 22 + 0 = 2z - p. Let i be -282/(-4)27. Calculate the greatest common factor of z and i. 9 Suppose 75t - 29t = 71t - 1300. Calculate the highest common divisor of 6526 and t. 26 Let n = 7969 + -6653. Calculate the highest common factor of 564 and n. 188 Let z(r) = 17r2 + 10r - 29. Let n be z(7). Suppose -6o = -25o + n. What is the greatest common divisor of 414 and o? 46 Let q = 286 - 166. Suppose -q = -r - 2*r. Calculate the greatest common divisor of r and 64. 8
Suppose -7q + 226 = -75. Let w = q + -19. Calculate the remainder when w is divided by (-1 - 36/(-8))/(6/12). 3 Let o be -235/(-2) + (-23 - -23). Suppose 339s - 332s = o. Calculate the remainder when 28 is divided by s. 3 Let u(d) = 1265d + 8868. Calculate the remainder when 583 is divided by u(-7). 11 Suppose 5j - 735 = m, -3j - 174m + 441 = -169m. Calculate the remainder when 2936 is divided by j. 143 Let z be -1 - (-2 + -2438/12). Suppose 4a - z = -2d, -68 = -4a - 9d + 5d. Calculate the remainder when (-14)/(15/(-7) + 2) is divided by a. 18 Let j(w) = -6w*3 - 3w*2 + w - 28. What is the remainder when j(-6) is divided by 193? 189 What is the remainder when 491 is divided by 5 + 56/(-10) + 1480/50? 27 Suppose -b + 368 = 22b. Calculate the remainder when (b/24)/(1 + (-1105)/1107) is divided by 10. 9 Suppose -46976 = -75z + 13549. What is the remainder when z is divided by 19? 9 Let q(j) = -6j + 5. Suppose 86k - 566k + 2418 = -77k. What is the remainder when q(-7) is divided by k? 5 Suppose -8v + 3n + 38 = -7v, -5n - 77 = -2v. Calculate the remainder when 1145 is divided by v. 38 Let t = 16 + -4. What is the remainder when (-18)/120-5 + (-687)/(-12) is divided by t? 10 Suppose -3b = 20 - 86. Let o(p) = -4p2 - 56p + 12365. What is the remainder when b is divided by o(49)? 5 Suppose -28h - 49 + 469 = 0. Calculate the remainder when 179 is divided by ((-276)/h)/((-60)/150). 41 Let j = 61 + -56. Suppose -jz - 123 = -8z. Suppose -3k - q = -136, -z = -2k - q + 49. What is the remainder when k is divided by 8? 6 Let l = -6870 + 6888. Let k = 1 - 1. Suppose k = t + o - 69, 4t - 3o = 6t - 141. Calculate the remainder when t is divided by l. 12 What is the remainder when 5437 is divided by 21 - (-11 + (-408)/(-18))-3? 35 Let r(b) = b*3 + 11b*2 - b - 43. Let w be r(-11). What is the remainder when 499 + 1w/(-4) is divided by 17? 14 Let h(v) = 117v + 3835. What is the remainder when h(-21) is divided by 294? 202 Let y(x) = 2x*2 - 12x + 5. Let l be y(6). Suppose a = r + 34, -la + 0r + 174 = -r. What is the remainder when a is divided by 12? 11 Let b(l) = -156l - 469. Let q be b(-3). Let a = -188 + 134. What is the remainder when 134 is divided by ((q - 5)a/(-12))/(-1)? 26 Let o(v) = 5v2 - 7v - 7. Let u = 212 + -209. Calculate the remainder when 127 is divided by o(u). 8 Suppose -20t = -25t + 185. Suppose 1 + 9 = -5r, 4k - 5r - 94 = 0. Calculate the remainder when t is divided by k. 16 Suppose 4j - 264 = -64. Suppose 5l = -0l + j. Suppose lp = 4p + 1134. Calculate the remainder when p is divided by 48. 45 What is the remainder when 418 is divided by 211 + ((-175)/(-7))/5-1? 6 Let m be (3/6)/((-3)/(-18)). Suppose 4r + i - 159 = 0, -4r - mi + 6i + 163 = 0. Calculate the remainder when 77 is divided by r. 37 Let r = 29011 - 28949. Calculate the remainder when r is divided by 0 + 1 + 1 + 14. 14 Let v = -21870 + 21960. Let c(w) = 8w*2 + 4w + 2. What is the remainder when v is divided by c(-2)? 12 Let z = -797 - -896. Calculate the remainder when z is divided by 53. 46 Let m be (-2)/(-4)0/2. Suppose -2y - 21 = -g - 5, -g + 5y + 16 = m. Suppose 894j = 883j + 682. Calculate the remainder when j is divided by g. 14 Let o(i) = 0i + i*2 + 5i*2 + 1 + 2i + i*3. What is the remainder when 44/(-19 + 8) - (-103)/1 is divided by o(-4)? 24 Let i = -212 - -70. Let v = -69 - i. What is the remainder when v is divided by 7? 3 Suppose -2b + d + 81 = 0, -b - d + 22 + 17 = 0. What is the remainder when ((-48)/26 - (-56)/(-364)) + 58 is divided by b? 16 Suppose 0 = -4k - 25 + 37. Suppose -7s = -ks + 168. Let a = s + 79. Calculate the remainder when a is divided by 13. 11 Let r = -1196 + 1537. Calculate the remainder when r is divided by 43. 40 Let q = 24 - 10. Let u(g) be the first derivative of -5g4/4 + g3/3 + 2g2 + 5g - 20. What is the remainder when u(-2) is divided by q? 13 Let c(u) = -u*3 + 31u*2 - 5u - 1503. What is the remainder when 3246 is divided by c(29)? 16 Calculate the remainder when 16 + 1600 + 1 + (-15)/(-5) is divided by 328. 308 Let h = 19 - 16. Suppose -4i + hc + 11 = -0c, 0 = i + 4c - 17. Suppose 2y - 70 = -iy. What is the remainder when y is divided by 8? 2 Suppose 2i + 5h - 23 = 10h, 4h + 45 = 3i. Let n be ((-3)/3)/((-1)/(-2)). Let u(d) = -6d - 1. What is the remainder when i is divided by u(n)? 8 Let u = -744 + 1185. What is the remainder when u is divided by 26? 25 Let d(m) = 2m2 - 15m - 100. Let z = -775 + 788. What is the remainder when 180 is divided by d(z)? 8 Let o(p) = -p*2 - 17p - 27. Let j be o(-13). Let k = 59 - j. Suppose -l + 1 + 0 = 0, 2g = -4l + k. Calculate the remainder when g is divided by 8. 7 Suppose -24 = -l + d, -2l - d - 2 = -47. Suppose 0 = 3f - 13 - l. Calculate the remainder when (6 - 6)/(4/(-2)) - -22 is divided by f. 10 Let f(r) = 34r2 + 2r + 3. Calculate the remainder when 162/(-108) - (-487)/2 is divided by f(-1). 32 Let b = -44 - -49. Suppose -2h = -3r - 96, 5h + 2r = br + 222. Suppose h + 91 = 7d. What is the remainder when 56 is divided by d? 18 Let a(d) = -d*3 + 17d*2 - 27d + 6. Let h be a(12). Let o = 411 - h. Calculate the remainder when 15 is divided by o. 6 Let z be (-315)/(-36) + 12/(-16). Calculate the remainder when 268 is divided by (-504)/(-15) + z/20. 30 Suppose -2662u = -2f - 2657u + 2726, 4u = -f + 1363. Calculate the remainder when f is divided by 4. 3 Calculate the remainder when 1665 is divided by (1/2)/((-20)/20) - (-3279)/6. 27 What is the remainder when (15/35 - (-2)/(-21))0 + 984 is divided by 32? 24 Let f = -369 - -468. Suppose -10o + f - 9 = 0. Let h = -8 - -47. Calculate the remainder when h is divided by o. 3 Let m be (-3)/(-8) - (-33)/(-88). Suppose -2j = 5c - 17, 0 = 4j - c - 2c - 73. Calculate the remainder when (5 - 1) + 27 + m/4 is divided by j. 15 Suppose -5j = -4p - 173, 222 - 67 = 5j + 5p. Suppose 110 + j = q. Suppose -5i + 3i + 72 = 0. What is the remainder when q is divided by i? 35 Suppose -787 = 2i + 3l - 2867, -4i + 4180 = -4l. Let u = i - 723. Suppose 3m - u + 104 = 0. Calculate the remainder when m is divided by 25. 22 Let o = -6285 - -6488. What is the remainder when o is divided by 83? 37 Let y(u) be the third derivative of 5u*4/24 - 17u*3/2 - 2u*2. Suppose -40d + 28 = -38d. Calculate the remainder when y(21) is divided by d. 12 Let v = 25740 + -25262. Calculate the remainder when v is divided by 435. 43 Let b = 346 - 272. Let p = b - -21. Calculate the remainder when 188 is divided by p. 93 Let l = 28306 + -25225. What is the remainder when l is divided by 97? 74 Let z(p) = -74 - 21p + 18p - 11p - 86p - 13p. What is the remainder when z(-7) is divided by 36? 33 Let w(b) = 58b2. Let d be w(1). Let r = -53 + d. Suppose rv - k = 160, -5v + 128 = -v - 5k. What is the remainder when v is divided by 12? 8 Let t(k) = k*3 + 10k*2 + 22k - 2. Let y be t(-5). Suppose yf - 43 = 113. Calculate the remainder when 66 is divided by f. 6 Let b = 1481 - 1322. What is the remainder when 640 is divided by b? 4 Let j(c) = 2c + 59. Let n = -27 - -46. Suppose 0 = -nr + 8r + 132. Calculate the remainder when j(0) is divided by r. 11 Let w(o) = -o*3 - 19o*2 + 44o + 47. Let d be w(-21). Let m = d - -2. Calculate the remainder when 18 is divided by m. 4 Let p = 6718 - 6648. Calculate the remainder when 134 is divided by p. 64 Let c(n) = 9n2 - 2n - 1. Let s(u) = u - 1. Let b be s(0). Calculate the remainder when c(b) is divided by ((-8)/(-10))/(98/245). 0 Let o(g) = -142g - 2607. What is the remainder when o(-40) is divided by 29? 28 Let j = -9232 - -9281. Calculate the remainder when 4605 is divided by j. 48 Let o = 499 + -465. What is the remainder when o is divided by (2 + (-12)/8)/((-4)/(-104))? 8 Let v(t) = 35t*3 + 18t - 2t - 3 - 34t*3 - 12t*2. Suppose 4p - 18 = -2l, 0 = 5p - 0l - 2l - 36. What is the remainder when v(11) is divided by p? 4 Calculate the remainder when ((-107)/5)/(((-60)/275)/12) is divided by 38. 37 Let a(b) = 3b + 14. Let o be a(0). Let c be o5/((-175)/(-30)). Suppose 6 = -2w, -w = -3z + w + c. Calculate the remainder when z is divided by 1. 0 Let t = -6231 - -6982. Calculate the remainder when t is divided by 36. 31 Suppose 1136 + 1744 = 9y. Calculate the remainder when y is divided by 28. 12 Let h(k) = k2 - 15k + 10. Let p be h(15). Suppose -pa = -102 - 98. Suppose -2r = -0*r - 62. Calculate the remainder when r is divided by a. 11
-1965460 divided by -7 280780 Divide -217 by 15. -217/15 What is -991300 divided by 43100? -23 Calculate 7 divided by 6511. 7/6511 Calculate -9 divided by -1157. 9/1157 Divide 156 by 1661. 156/1661 621 divided by 9 69 13826 divided by 5 13826/5 What is -41719 divided by -13? 41719/13 What is 4 divided by -81321? -4/81321 What is 32 divided by -25839? -32/25839 Calculate 4 divided by 462680. 1/115670 -5099280 divided by -5 1019856 Calculate 150 divided by 2399. 150/2399 What is 245652 divided by 11166? 22 Divide -1 by 188055. -1/188055 Divide 2183 by -67. -2183/67 Divide 27390 by -5478. -5 Calculate -23339 divided by 1. -23339 19573 divided by 5 19573/5 Calculate 25 divided by -3666. -25/3666 Divide 2189 by 11. 199 What is -44 divided by 14448? -11/3612 5 divided by -56412 -5/56412 Divide -530910 by 306. -1735 What is 4 divided by 649? 4/649 What is -17860 divided by 4? -4465 What is 100206 divided by 33402? 3 67862 divided by -1 -67862 -27672 divided by -2306 12 Divide 313260 by 13620. 23 What is -2202780 divided by 440556? -5 What is 15952 divided by -5? -15952/5 What is -19064 divided by 9532? -2 Calculate -4884 divided by 33. -148 -80 divided by -186 40/93 What is -2 divided by 8792? -1/4396 Divide -249564 by -124782. 2 Divide -876885 by 2. -876885/2 What is -3508230 divided by 233882? -15 Divide 45252 by 838. 54 Divide 102043 by 1. 102043 -130140 divided by 65070 -2 What is 5 divided by 185232? 5/185232 Divide 65136 by -5428. -12 What is -166738 divided by 583? -286 What is -826410 divided by 165282? -5 Calculate -111 divided by -455. 111/455 Divide 17 by -91490. -17/91490 377940 divided by -10 -37794 What is 793548 divided by 658? 1206 What is 183429 divided by 267? 687 Calculate -64242 divided by -6. 10707 What is 2 divided by 16691? 2/16691 What is -1944 divided by -15? 648/5 What is 1947 divided by 114? 649/38 Divide 896 by 18. 448/9 What is 74087 divided by -9? -74087/9 Divide -63110 by -3. 63110/3 Divide 244161 by 27129. 9 What is -358736 divided by -4? 89684 What is -365883 divided by -133? 2751 What is -565436 divided by 4? -141359 3184512 divided by -5 -3184512/5 Divide -1953820 by -535. 3652 What is -23 divided by 2495? -23/2495 -332730 divided by -1 332730 What is -42673 divided by 1? -42673 Divide -2854514 by 1. -2854514 What is 2584570 divided by 2318? 1115 What is 202923 divided by 9663? 21 Divide -3690 by 615. -6 Calculate -103 divided by -19572. 103/19572 -411 divided by -2248 411/2248 Divide -3 by 28715. -3/28715 -18 divided by -15840 1/880 -200312 divided by 1372 -146 Divide 1710 by -510. -57/17 -19 divided by -384 19/384 What is -259200 divided by -400? 648 5 divided by 226867 5/226867 Divide -3 by -49338. 1/16446 Calculate -6992 divided by -1. 6992 What is 4 divided by -11216? -1/2804 Calculate -3416 divided by 8. -427 Calculate 2105 divided by 165. 421/33 Divide -1 by 86913. -1/86913 What is 3554443 divided by 1679? 2117 -1427 divided by 139 -1427/139 What is -55315 divided by 115? -481 What is -876096 divided by 4? -219024 What is -11874 divided by -5937? 2 Divide 58655 by -11731. -5 Divide 16682 by 8. 8341/4 Divide 386790 by 77358. 5 Divide -7770550 by 5. -1554110 5 divided by 79926 5/79926 Divide -1054858 by 3. -1054858/3 Divide -1077080 by 107708. -10 What is -429 divided by -22? 39/2 -188210 divided by -638 295 Divide -66 by 973. -66/973 What is -6 divided by -39744? 1/6624 Calculate -411 divided by -263. 411/263 Calculate -3110965 divided by -55. 56563 What is -13321 divided by -5? 13321/5 What is -316 divided by 642? -158/321 Calculate -1741677 divided by -6. 580559/2 Divide -470276 by 1321. -356 Divide -2 by 23234. -1/11617 Calculate 0 divided by 15530. 0 209 divided by -16 -209/16 What is -16 divided by 1632? -1/102 Divide 424944 by 141648. 3 Divide -868252 by -2. 434126 Divide 61 by 116. 61/116 Calculate 824568 divided by -17544. -47 Divide -150790 by 30158. -5 -2301 divided by -59 39 What is 186620 divided by 7? 26660 Calculate 1722010 divided by 1722010. 1 Calculate 1274 divided by -205. -1274/205 What is 4 divided by 48971? 4/48971 Calculate -30861 divided by -14. 30861/14 -706546 divided by -2 353273 Divide 71428 by 5102. 14 -11 divided by -5229 11/5229 -3 divided by 82 -3/82 Divide 18224 by 5. 18224/5 What is 131340 divided by -26268? -5 Divide 31610 by 109. 290 13 divided by 766 13/766 5 divided by -163385 -1/32677 What is -42559 divided by -97? 42559/97 Divide -2791 by -126. 2791/126 Calculate -14196 divided by -338. 42 -25 divided by -4180 5/836 Divide -36 by 341. -36/341 Divide 60312 by -4. -15078 -50 divided by 7814 -25/3907 Divide -1 by 5978. -1/5978 What is -329 divided by -5461? 329/5461 What is -403060 divided by 5? -80612 17045 divided by -14 -2435/2 Divide -5240251 by -41. 127811 Calculate 185 divided by -621. -185/621 What is -49 divided by 54175? -49/54175 Divide -28359 by -198. 3151/22 7552930 divided by 215798 35 -521316 divided by -14481 36 Divide 136768 by -5. -136768/5 What is 3 divided by -164863? -3/164863 What is -2546 divided by -19? 134 What is -12800680 divided by -2? 6400340 Calculate -79 divided by 159. -79/159 Divide -77318 by 134. -577 Calculate 1167 divided by 150. 389/50 8 divided by 41319 8/41319 Divide -363808 by 90952. -4 Divide 12305 by -2461. -5 What is -1141164 divided by 190194? -6 -2 divided by 6265 -2/6265 Calculate -1108196 divided by 2. -554098 Divide -1488 by -12. 124 -1271979 divided by -1789 711 Calculate -211896 divided by -654. 324 Calculate 2972360 divided by 5. 594472 Divide 4623 by -20. -4623/20 Calculate -4 divided by 1616706. -2/808353 Calculate -82819 divided by 11. -7529 Divide 54686 by -1. -54686 What is 631773 divided by 70197? 9 Divide 765055 by 2. 765055/2 11680 divided by 23 11680/23 Divide 1096806 by -21506. -51 Divide -2 by -18101. 2/18101 Divide -1228388 by -19. 64652 Divide 4581 by 24. 1527/8 What is 6554994 divided by 222? 29527 518580 divided by -36 -14405 Divide -1075412 by 4. -268853 What is 82832 divided by -82832? -1 What is 470250 divided by 150? 3135 849028 divided by -5177 -164 -198631 divided by -6 198631/6 Divide 1355237 by -104249. -13 988926 divided by 6 164821 32116 divided by -7 -4588 Calculate 446502 divided by -148834. -3 Calculate 111276 divided by -27819. -4 Calculate -1 divided by 29824. -1/29824 What is 6919860 divided by 5? 1383972 -5412 divided by 2 -2706 -143871 divided by 8463 -17 What is -230 divided by 491? -230/491 56287 divided by 473 119 What is -977920 divided by -8? 122240 Divide 172248 by 24. 7177 Divide -2 by -128719. 2/128719 2647 divided by 5 2647/5 Divide -57336 by 3. -19112 -4980636 divided by -11556 431 Calculate -1 divided by 53306. -1/53306 Calculate -52 divided by -498. 26/249 What is 2 divided by -2526? -1/1263 What is -314119 divided by -24163? 13 What is -270008 divided by -1? 270008 Calculate 1000 divided by 55. 200/11 What is 134154 divided by 174? 771 Calculate 40029 divided by -2. -40029/2 Calculate -2278858 divided by -8317. 274 Calculate 3744616 divided by 1872308. 2 Divide 64154 by 64154. 1 -157872 divided by -528 299 Divide 11048 by 4. 2762 94653 divided by -117 -809 Divide 214 by 36761. 214/36761 What is 433 divided by -2260? -433/2260 Divide -5 by -349750. 1/69950 21385656 divided by -6 -3564276 Divide -1 by 12630. -1/12630 Divide -2457 by 32. -2457/32 117688 divided by 117688 1 Divide 50748 by 3. 16916 -2536882 divided by -42998 59 Calculate -80 divided by -19204. 20/4801 Divide -3256 by -19. 3256/19 Calculate 232 divided by -126. -116/63 What is -5 divided by -8750? 1/1750 Divide 747 by 290. 747/290 760405 divided by -5 -152081 What is -34169 divided by -727? 47 Calculate -3257 divided by 258. -3257/258 Divide -295 by -755. 59/151 -3 divided by -91590 1/30530 What is 0 divided by 28822? 0 938 divided by 6 469/3 Divide 1674930 by -6. -279155 What is 447440 divided by 70? 6392 What is -4352 divided by -236? 1088/59 18430 divided by 11 18430/11 Calculate 0 divided by 980976. 0 What is 464964 divided by -232482? -2 Calculate 151134 divided by -6. -25189 Divide 76 by 541. 76/541 Divide -2318184 by 289773. -8 Calculate 192324 divided by -2. -96162 7290 divided by 729 10 Divide 36419 by 8. 36419/8 240633 divided by -1 -240633 Calculate -3 divided by -10741. 3/10741 -267360 divided by -17824 15 Calculate 242568 divided by -20214. -12 Divide -39 by -9632. 39/9632 1 divided by -274783 -1/274783 Divide -32 by -239. 32/239 120697 divided by -1 -120697 5 divided by 112408 5/112408 -15 divided by 4310 -3/862 Divide -8279 by 114. -8279/114 What is 58794 divided by -9799? -6 Divide 74778 by -3399. -22 What is 116 divided by 3154? 58/1577 Divide 5305 by 5. 1061 Divide -407679 by -407679. 1 Divide -294848 by 544. -542 Divide 1141560 by -142695. -8 Calculate 2945916 divided by -6. -490986 What is -35 divided by -143? 35/143 Calculate -249124 divided by 2042. -122
Solve 2v - 951w + 947w + 18 = 0, 4w - 41 = -6v - 15 for v. 1 Solve -3x - 5n - 16 - 12 = -x - 0n + 25, -30n - 270 = 0 for x. -4 Solve 3i + 5c - 10 = 0, 0 = -2i - 5c - 6056 + 6066 for i. 0 Solve r = -3p + 13, -36294r - 5p = -36299r + 5 for r. 4 Solve -2 = -f + 5k, 3f + 2k - 1975 = -7f - 2007 for f. -3 Solve -3p = -64m - 268, -55m + 51m - 44 = -5p - 8 for m. -4 Solve 281u + 3o - 12 = 278u, 29o - 26o = 5u - 28 for u. 5 Solve 4s + 9 = -3310n + 3315n, -22n - s - 72 = 0 for n. -3 Solve -5u + 39 = -6, -4x - 5 = -4u - 25 + 72 for x. -4 Solve 5t + 6y = 7y - 40 + 69, 5t - 28y - 77 - 60 = 0 for t. 5 Solve 664d = 11m + 665d - 224, -2m + 24 = -4d for m. 20 Solve 8h = -5i - 18, 645i = 643i + 2h - 28 for i. -10 Solve 6w = 4527995k - 4527993k + 18, 5k + 109 = -w for k. -21 Solve 0 = 3m - 0m + d + 15, 9839d + 32 = -5m + 9835d for m. -4 Solve 7i - 10 = -5c, c + 10 = -10c + 8c - i for c. -5 Solve s - 3v + 1 = 0, 5v - 333 + 353 = 0 for s. -13 Solve -3i = 22z + 114, 3i + z - 24 = 8z - 5z - z for i. 6 Solve 7944b - 7941b + 5w = -27, -17w = -5b + 31 for b. -4 Solve -2n + 9y - 44 = 0, -133108n + 20 = -133112n + y for n. -4 Solve -426s = -430s - 2b + 80, -129 = -7s + 2b for s. 19 Solve 398p - 98 = 394p + 2q, 103 = 4p - 3q for p. 22 Solve -3v + 0v - 4i + 2 - 17 = -5i, 0 = 25i - 23i - 18 for v. -2 Solve -2p = -d - 1, 5d + 23394 = -3p + 23389 for p. 0 Solve 5q + 7305a + 35 - 195 - 49 = 7304a, 0 = -6q + 6a + 222 for q. 41 Solve -2m + 4 - 18 = -4i, -198m + 101m - 10 = -5i - 92m for i. 5 Solve 2a + 2a = -5n + 86, 0 = 17n - 14n - 102a + 366 for n. 14 Solve 0 = c + l + 2, 63c + 73c - 131c - l + 22 = 0 for c. -4 Solve 552190t - y = 552189t + 21, -23t = y - 435 for t. 19 Solve 2248w + 3v - 22 = 2246w, 74 = 5w - 2v for w. 14 Solve -s = -h - 87, -24h + 31h + 411 = 10h + 5s for h. -3 Solve -2d - 40 = 8i, 45 - 13 + 0 = -5d - 3i for d. -4 Solve -5h + 83 = 39l, 4h - 12 = -7925l + 7921l for l. 2 Solve 864905g - 864901g - 12 = -3r, 3 = 3r + g for r. 0 Solve -228 = -z + 4g, 5g + 357 - 289 = 12z + 3g for z. -4 Solve 0 = 2q - 5n - 42 + 108 - 38, -n - n = 51q + 196 for q. -4 Solve 20898q - 39 = 3s + 20899q, -s = -5q - 3 for s. -12 Solve -2w = 4o + 18, 270589 = -4w - 5o + 270547 for w. -13 Solve -530y + 540y + 3h = 80, 3y + 5h - 106 = 0 for y. 2 Solve 6j + 2171 = 16r + 2095, 0 = 3r + 4j - 4 for r. 4 Solve -8u + 16 = 2x, 2x - 10u + 10u - 36 = -3u for x. 24 Solve -h = 22p + 193, 286h - 858h + 285h + 8 = -2p - 289h for p. -9 Solve 2q - 2 = 0, -149 = -5c + 453q - 456q - 476 for c. -66 Solve -21c - 6c = 7c + 8c - 39c - 10i + 47, 4c - i = -38 for c. -9 Solve 3i + 38 = 2p, -1506427p = -1506423p + 4i + 24 for p. 4 Solve 0 = a - 4z + z - 1, 277z - 273z = 16a - 18a - 8 for a. -2 Solve 4y = 5h + 60 + 10, -15826y - 252 = 18h - 15823y for h. -14 Solve 0 = -4s - 4a - 20, 47a - 52a - 2 = -7s - 1 for s. -2 Solve -5d - 22o - 7 = 25o + 25o - 76o, -2o = -0o - 6 for d. 1 Solve 20z + 232 - 332 = 5j, -5j - 40 = -5z for z. 4 Solve -2m + 4k - 12 = 0, -33m = -28m + 9k + 11 for m. -4 Solve -f = -4s - 4, 2814s = 2817s + 4f + 41 for s. -3 Solve -2y - 2r = 784 - 1559 + 791, -27 - 14 = 3y + 4r - 9 for y. 0 Solve 506 = 5l - 12g + 25g, 14 = 3l + g - 38 for l. 5 Solve 101 = -5o + 26, -14f + 14f + 5o = -5f - 60 for f. 3 Solve 21t - 27 = -4b + 28t - 22t - 118, 156 = -8b - 4t for b. -19 Solve -2h - 105v - 702 = -288, -v - 7 = -h for h. 3 Solve -25b - 9 = -22b - 5d - 2, 9d = -6b - 33 for b. -4 Solve 0 = 238l - 233l, -13t - 74 = 3l + 4 for t. -6 Solve -4v + 0b - b + 4 = -18, 3v + 6114 - 6108 = 3b for v. 4 Solve -3 = -l - 5, 146 + 72 = w - 0w - 105l for w. 8 Solve -3n - 8n + 3o - 56 = 0, -176837o = 4n - 176841o + 32 for n. -4 Solve -2s - 10 = 0, -523 = 20j - 3s + 382 for j. -46 Solve 721r - 4t + 72 = 721r - 6t, 0 = -25r + t + 86 for r. 2 Solve 2f + 259 - 139 = -n + 147, 0 = -46f - 4n + 298 for f. 5 Solve -l = -4t + 72, 128t + 2l + 240 = 129t + 124 for t. 4 Solve -a = -r - 13, -14r + 24 = -3a - 51r + 33r for a. 4 Solve z = 4k + 32, z + 1720k = 4z + 1725k - 11 for z. 12 Solve 3m = 6q + 30, 18 = 946899m - 946896m - 3q for m. 2 Solve 5w - 13 = -2h - 0h - 3, 15 = -4h + 4h - 3h for w. 4 Solve 13 = 3x - i, 16375x + 4 = 16378x + 8i for x. 4 Solve 3u = -35q - 289, -2q + 3134u = 3135u + 48 for q. -5 Solve -3y - 504 = -6d, -4d - 89347 = -y - 89685 for d. 85 Solve -474d + 478d + v = 30, 3v - 100 = -2d for d. -1 Solve 14a + 2u - 29 = 9a, a + 81u = -4a - 14u + 2540 for a. -5 Solve 0 = -16n + 4w - 92, 2n - 52w + 57w - 137 = 0 for n. 1 Solve -17i + 818 = -3g + 680, -30 = -5i + 3g for i. 9 Solve -1061k = -1060k - 2, -2k - k - 23 - 79 = 2l - 5k for l. -49 Solve -255a + 227a - 8 = 2c - 30a, a - 10 = -c for c. 3 Solve -5q = -10k + 215, 13077q + 13075q - 39230q + 109 = 5k - 13079q for k. 22 Solve 0 = 6x - 5s - 4, -3x + 2441s - 2449s = 19 for x. -1 Solve 0 = -4u + 13u - 8u - 4x + 9, 11x = 39 + 5 for u. 7 Solve 23w = -4c + 22w + 25, 2w - 24 = 4c + 2 for c. 2 Solve l + l + 18q - 14q - 18 = 0, -335 = -67q for l. -1 Solve 4n - 20p + 92 = 0, -31n + 35n + 49 = p + 14 for n. -8 Solve -3b = 29n + 827, 670b - 670b + 5n = -140 for b. -5 Solve y - 3270h + 3265h - 5 = 0, 5h + 5 = 4y for y. 0 Solve -3r - 42 = 2w + 13 - 6, 3w - 4r + 116 = 0 for w. -32 Solve -5b - 821x + 818x = -5, -30 = 5b - 4x for b. -2 Solve i + 3i - 27934j + 2 = -27929j, 0 = -2i - 3j - 12 for i. -3 Solve b + 5h - 2h = 13h - 123, -5h + 185 + 202 = -4b for b. -93 Solve -3m + 2f + 22 = 0, 51f + 49f + 52f - 149f = -2m + 32 for m. 10 Solve -5o = -3u + 62, 5o + 1357u - 1353u = 141 for o. 5 Solve 3s + 23b + 20 = 25b, b = s + 5b - 12 for s. -4 Solve -t = 0, -3t - 1728785 = -5o - 1728800 for o. -3 Solve 66321p = 66320p + 5j + 20, 4j = -20 for p. -5 Solve -22 = -m - 4h, -8193m - 5 = -8195m + 5h for m. 10 Solve 2j = -4o - 2, 79 = -5o - 5j + 54 for o. 4 Solve 0 = 68k - 72k + 5x + 7, -4 = -17k + 16k - x for k. 3 Solve 2v - 9555 = 3c - 9522, -7c + 3v = 82 for c. -13 Solve w + 8 = -7332c + 14671c - 7336c, -4w + 43 = 3c for w. 7 Solve 22650o = 22655o - 5v + 8 - 63, -4v + 9 = -3o + 44 for o. 9 Solve 3q - 7q = -4n + 100, -2q - 5n - 56 - 1 = 0 for q. -26 Solve 0 = 5p + 5o + 510 - 465, 3p + 3o = 4o - 11 for p. -5 Solve 0 = 4p + 99j + 776, -10p + 2j + 4 = -15p - j for p. 4 Solve 30 = -5g - 5d - 0d, -5d - 34 = -38241g + 38244g for g. 2 Solve 0 = 900c - 903c - 2k + 59, c - 29 = 4k for c. 21 Solve -28q = -w + 44q - 73q - 13 - 45, -8w - 3q - 154 = 0 for w. 4 Solve -5v + 4x = 69, 360x + 11 + 3 = -5v + 359x for v. -5 Solve -3d = -5q - 0q + 19, 5d - 9850 = 2q - 9888 for q. -1 Solve 12k - 21k = -4i - 17, -7i + 0i = 5k - 4i - 46 for k. 5 Solve -r + 6 = -104u + 105u, -2u - 30 = -4r for u. -1 Solve 3r + 8 = -r, 3g - 9g + 2r = 3g - 472 for g. 52 Solve 495r - 497r = 5s - 17, 6r - 67 = s for r. 11 Solve j = -5d - 31, -5d + 12 = -19j - 11j - 2d for j. -1 Solve -12x + 22x + 7x + 8s = 5s - 28, -5x - 69s + 1286 = 0 for x. -5 Solve 42 = 2j - 6o - 80, j + 2 = 26j - 2o - 136 for j. 4 Solve -4k - 3b = -25, 0 = k + 3b - 14147 + 14134 for k. 4 Solve 4i + 187p = 225p - 18, 4i = -2p + 18 + 4 for i. 5 Solve 3c - a = 2a + 120, -23704c - 185 = -23713c + 4a for c. 5 Solve m - 3m - 7g = 31, -33381m + 33385m - 2g - 18 = 0 for m. 2 Solve -66636 = -2q - 3t - 66646, -q + 3t = -13 for q. 1 Solve d + 0d = 7v + 173, -5d + 4d + 208v - 212v = 102 for d. -2 Solve -5x + 3b - 147 = 0, 943x - 1874x - 2b + 148 = -936x for x. -30 Solve 0 = 8c - 7u - 51, -18849c + 18845c + u = -33 for c. 9 Solve -5t - 205 = -5c + 10c - 0t, 49 = -31t + 173 for c. -45 Solve -2s + 21w = 118, -10s + 5s - 5w = -21 - 29 for s. 4 Solve -5a = u + 10, 11a + 118u + 8 = 113u for a. -3 Solve -n - 21l = -n + 19 + 23, 8l = 5n + 19 for n. -7 Solve 2l + 3b = 75, -188l + 183l = -4b + 123 for l. -3 Solve -5d = 4g + 33 + 48, -4g = d - 1251 + 1264 for d. -17 Solve -5q = -6j + 31, 4q + 22j + 4 = 21j + 14 for q. 1 Solve w + 16 = -2c, 4w + 25 + 13 = 2c + 11 - 7 for c. -3 Solve -h - 3d + d - 6 = -6d - 8, 6d = -2h - 24 for h. -6 Solve 7b + b = 8w - 5 - 81 + 22, 0 = 2*w - b - 20 for w. 12
Simplify (z/(z*2z))(7/2)/(z5/z*(-3))(z9/(z(-1/7)z))/(z/(z9z)z1) assuming z is positive. z(8/7) Simplify ((s5s)/s)/s*(2/155)s/s*33s/(s/((s/s(-2/15))/s)) assuming s is positive. s(-12499/465) Simplify (((xx(-2/3)/x)/x)(-6/29))(-30)/((x(1/4)xx0x)/(xx/(xxx(-1/3)x)x)(-2/57)) assuming x is positive. x(-250063/19836) Simplify (w3w3)45/(www*(-4/7)w*(-3/16)w)(26/9) assuming w is positive. w(132817/504) Simplify ((m(10/13))(1/2)(mmm18mmm)(-2/71))44 assuming m is positive. m(-10692/923) Simplify x(2/7)/(xx(-7)/x)(xx/(((x(-1/2)/x)/x)/x)x)*(-1/25)x*(-2)(x/x*(5/4))/x(x(2/7))(-1/23) assuming x is positive. x(60589/16100) Simplify (l(3/8)/(l/(l(-6/5)/l)))(-14)(ll*(-1/5)/ll/l*(2/3)l)/(ll0l/(((l/l6)/l)/l)) assuming l is positive. l(1901/60) Simplify (r/r*(1/59)r*16/rr*(-5/12)/(r/(r/((r/(rr/((r/(r/(r*(-9/11)/r)r))/r)))/r))))(-4/7) assuming r is positive. r(-166543/13629) Simplify (((o7/(o/(o(-2/9)o)))(1/4))13)(-32) assuming o is positive. o(-6344/9) Simplify ((x/(x1/x))(-9))(-6)/((x(-2))(2/25))41 assuming x is positive. x(1514/25) Simplify ((z4(z/(zz(-2/11)z))/z(z(-2)zzz)/(z/z(-4/7)))(-11))(3/2) assuming z is positive. z(-186/7) Simplify ((k/(k*6kk))/(k(k*(2/3)k)/k))(-14)/((k3kk(-1/2))/((k/k(-1))/k)(-1)) assuming k is positive. k(701/6) Simplify v6/(v(-1/3)/v)(v1/v)(-17)(vv/v(-3/4)v(-2/3))(-11) assuming v is positive. v*(-187/12) Simplify (((mm*14)/mm/(m(-16)/m))/(m(-10/7)(m/m(-5))/m))6 assuming m is positive. m(1194/7) Simplify (r/(r(rr(2/29))/r)(rrr*(-8)rrrr)/r)(33/2)/((r/r(-7))/(r(-5)/r)r(1/4)/r5) assuming r is positive. r*(-6947/116) Simplify ((xx*(-1/14)/xxx)/((x23/x)/xx))/((x(x(-3/32)/x)/x)/(x(x*(-5/7)x)/x)) assuming x is positive. x(-4187/224) Simplify ((n0/n)/n)42/(n1/n*(-2/15))((n/(n(n(1/6)nn)/nn)n)/(n5n))/(n0)(19/4) assuming n is positive. n*(-923/10) Simplify ((pp*0p)/(((((pp(-2/19))/pp)/p)/p)/ppp))/(pp(2/7))(-2/5)((pp(-1/2))/p)(-1/8)p*4p0 assuming p is positive. p(71097/10640) Simplify ((r*1r/(r/(r/(((r/(r/(r/(r/(r/(r/(rrr*(-8/7)r)))))))/r)/rr))))/(r(-17)r(1/30)))(3/17) assuming r is positive. r(3803/1190) Simplify ((k9kk)/(kk(-2/25))(k0)(-3/32))(-42) assuming k is positive. k(-10584/25) Simplify (g/(g/(g/((g/g*(-6)g)/g))))/(g*(-5)g)(g/g1g)*(3/34)g*(-6)/gg*(2/9)(g0)42 assuming g is positive. g(-2659/306) Simplify (z(-1/5)/zz1)(-47)(zz(-5))/zzz(1/3)/zz*(1/4)zz(-2/3) assuming z is positive. z(319/60) Simplify ((((c/c(2/3))(2/3))0)9)(21/2) assuming c is positive. 1 Simplify (((ww((ww(-8))/w)/w)/((w(-1/16)w)/w))/(www(1/3)w)(-10))(-10) assuming w is positive. w(-6335/24) Simplify (y1y)(3/4)/((yy*(-2/23))/(yy*(-5)))(y(-2/7))(-4/7)/(y*2/(yyy(1/2))) assuming y is positive. y(-3099/1127) Simplify ((f/(ff/((ff(-1/2))/f)))/(f/f(-1/6)))(-2/61)(ff((f/(f/f(2/7)))/f)/f)(-29)(fff3f)/fff(-1) assuming f is positive. f(-4097/1281) Simplify ((s/(s/(s(1/5)/s)))/s0ss*3/ss*6s)/((s0)(1/9))(-1/62) assuming s is positive. s(46/5) Simplify ((a2/a)(-39)/(a(1/5)/((((a/a0)/a)/a)/a)))(-1/16) assuming a is positive. a(103/40) Simplify (k(-1))(3/7)(kkk(-2/9))(-4/31)(kkk*(-1)kk)(-19)k(-1/13)/k(-7) assuming k is positive. k(-1288108/25389) Simplify (s0s(-1/4)s*(-5/2)/sss/(s6/s))/(s(s*1s)/ss/(sss/(s(2/13)/s)))(-5/7) assuming s is positive. s(-2677/364) Simplify (((y(-2/97)y)/y)/(y/(((yy(-3/5))/y)/yyy)y))/((y/(y1/y))/y)(-3/22) assuming y is positive. y(-786/485) Simplify ((d(1/7)/d)/d*(-1/7)d(-2/17)/d0)/(((d/(dd5))/ddd(d*(-3/2)d)/d)/(d*1d(-2/7))) assuming d is positive. d(183/34) Simplify ((((nn(-3))/(n/(n12/n)))(-23))(-31))(-7/10) assuming n is positive. n(-19964/5) Simplify (((f(3/8)f)/(ff(-4)))/((ff(-2/7))/f)(4/9))/(f1/f(-9)(f(f/f*1)/ff)(1/91)) assuming f is positive. f(-36095/6552) Simplify (n(-3)/n(2/15))*(-8)(n*4(n/n*(2/11))/n)/(n/(nn1))40 assuming n is positive. n*(11366/165) Simplify (((yy(y(-2/29)/yy)/yy)/yy15)/(y/((y(-1/11)y)/y))45)(1/23) assuming y is positive. y(-10578/7337) Simplify (((s(1/12)/s)/ss(-42))/((((s/((s27/sss)/ss))/s)/s)/((ss12)/s)))(-5/6) assuming s is positive. s*(175/72) Simplify ((((uu(-10))/u)/u)15(u/u(-5))(10/9))(2/25) assuming u is positive. u(-38/3) Simplify ((f6((f*2f)/f)/ff(2/7)/(f/(f(f(f(f*(3/7)f)/ff)/f)/f)))(7/5))(-26) assuming f is positive. f(-1586/5) Simplify ((yy1)(1/85))*36y*8y*(-3)/y(yy(8/7))/y(5/4) assuming y is positive. y(13661/2380) Simplify (m4/m1)(-4)/(((m1/m)/m)13m/(mm(-1)/m)mm/(m(((mm/m(-4)m)/m)/m)/m)) assuming m is positive. m*2 Simplify (((aa*5)/a)/a(aaa*(2/15)a)/a)*46(a/a2)/(a/a(-5))(a(-1))7 assuming a is positive. a(4022/15) Simplify ((f(-18)/f)/(f/f(-15))f(11/6)/f(-11))(10/13) assuming f is positive. f(-665/39) Simplify ((f(1/2))(-22/9))*(-50)(f/(f/f1))23(fff2)/f2 assuming f is positive. f(775/9) Simplify ((dd(-15))/d)(-46)/(d/(d/((d/(d/d*(-6)))/d))dd(-3/11)) assuming d is positive. d(7659/11) Simplify ((t/t(-3/5))37/(t/((t(t*(-2/17)/t)/tt)/t))(-2/35))17 assuming t is positive. t(35296/35) Simplify ((z(1/4))*13/(((z(zz/((zzz(-4)zz)/z))/z)/z)/z(-7)))/((z(-2/7)/z)(-17/3)z*0zz(-2/3)) assuming z is positive. z(-1123/84) Simplify ((((q/q(-2))(-10/7))39)(-23/3))(-2/31) assuming q is positive. q(-17940/217) Simplify (j4j(4/7))(-1)/(j*6/jjj(-5)((j/(j*0j)jj)/j)(27/4)) assuming j is positive. j(-345/28) Simplify ((y*(6/19)y/(y/((y(y/(y/(y24/y)))/y)/yy))yy)/(y(-23)/((y/y(-26)y)/y)))(5/3) assuming y is positive. y(2385/19) Simplify ((m/((mm*9m)/m)mmmm)/((m/m(-8))/m))(-3/26)((m/(mm(-1/8)))/m(2/23))(21/5) assuming m is positive. m(1527/920) Simplify (u(2/3))(3/10)/(u*(-3)uu(4/7))(u(1/4))(-26/3)u(-4/3)(u*(-2)u)/uu assuming u is positive. u(-201/70) Simplify ((x(-2)/x)/(xx(-4)))(4/33)/(x/x*4((xx/x1x)/xx)/xx*(-1/4)x(-6)) assuming x is positive. x(33/4) Simplify (z(2/13)/z(1/8))/(zz/z(2/7))(14/3)(((z*(-3/5)zz)/z)/(zz(1/4)))/(z0/z)(-49) assuming z is positive. z(-30067/520) Simplify (w2/((w/(w(-11)/w))/w))(4/5)/(((w/(w/w(-1/3)))/(w/w(-3/10)))/(w4/(www*0w))) assuming w is positive. w(-161/30) Simplify (l31l(-2/63)(l/l33)/(l(2/13)l))(-17) assuming l is positive. l(30430/819) Simplify (((qqq/(q/q(-2/13))q)/((q/q*(-6/5))/q)q/(q*(-7)/q)(q2/q)/q)(3/19))(-30/13) assuming q is positive. q(-12456/3211) Simplify (s/(s/s*(-2/13))s/s*5s*(-6)s6)/(s/s(2/13)s/(s/(s/s4)))(7/9) assuming s is positive. s(-290/117) Simplify ((x/(x7/x)x/x10)/(x11xx0))(-43) assuming x is positive. x1118 Simplify ((c(-4/7)cc(2/5))/(c(-6)/c(-1/8)))/((c(-1/4))(-25))(-15/2) assuming c is positive. c*(7501/140) Simplify ((u(u/(uuu1))/u)10)(-25)/(((u(-1)/u)/u)(8/5))(-11) assuming u is positive. u(2236/5) Simplify (x(-2/17)xxxx/x*(-12)xxx*6/(((x(x(xxx/(xx/((x/(x/(((x*5x)/x)/x)))/x))xx)/x)/x)/xx)/x))(2/3) assuming x is positive. x(214/17) Simplify rrr(-2/3)r/r*29r(-45)/(r5r) assuming r is positive. r(-233/3) Simplify m43mm9mmmmmm(-43)mm(19/5)/m assuming m is positive. m(94/5) Simplify (i(-1/4)/i(-6)i*(1/3)/iiii(-1))/(i5i(-2))45 assuming i is positive. i(-1547/12) Simplify (ff/(ff(-3/2)/ff)f/(f/f8))(-1/7)((f(f/(f/(f/(f/(f1ff)))f))/f)3)5 assuming f is positive. f*(57/2) Simplify (((tt(tt*(-1/6)/tt)/t)/(t(2/23)/t))/(t(-2/3)t(1/4)))(-1/61) assuming t is positive. t(-291/5612) Simplify (n(-2/13)/(n(-9/7)n)(nn*(3/8)nnnn)/(nn(-8/5)))(4/13) assuming n is positive. n(22229/11830) Simplify (((p(-2/3)/p)/p)6/(p(1/7)(((((p(-2/65)/p)/pp)/p)/p)/p)/p))(-23) assuming p is positive. p(116288/455)
Collect the terms in -8z3 - 6z*3 - 3z*3. -17z*3 Collect the terms in 11j + 7j - 16j. 2j Collect the terms in 23u + 24u + 17u - 59u. 5u Collect the terms in -1 - h*2 + 5h*2 + 0h*2 + 2. 4h*2 + 1 Collect the terms in 2q*3 - 554997q*2 + 554997q*2. 2q*3 Collect the terms in -199q + 2 - 2 + 204q. 5q Collect the terms in -4j + 6j - 3j. -j Collect the terms in 870d - 428d - 434d. 8d Collect the terms in -140g*2 + 3g*3 + 140g*2. 3g*3 Collect the terms in 24t*2 - 13t2 - t2 - 5t2. 5t*2 Collect the terms in 3q*2 - 2q*2 - 5995q + 5995q. q2 Collect the terms in -m - 3m - 4 + m + 4m. m - 4 Collect the terms in 6s*2 + 814s - 814s. 6s*2 Collect the terms in 6p + 139 - 139. 6p Collect the terms in 20u*2 - 6u + 3u + 3u. 20u2 Collect the terms in -304 - 3c + 304. -3c Collect the terms in 315 - 176 + 23p*3 - 139. 23p*3 Collect the terms in 23a*3 - 26a*3 - 18a*3. -21a3 Collect the terms in 2447186 + f3 - 2447186. f*3 Collect the terms in -13 - 13 + 39 + 2w*2 - 13. 2w*2 Collect the terms in 92 - 22u*3 - 92. -22u*3 Collect the terms in 50q*2 - 38q*2 + 26q*2 + 124q*2. 162q*2 Collect the terms in -17 - 4o + 34 - 17. -4o Collect the terms in -730c*3 + 373c*3 + 358c3. c3 Collect the terms in -21a + 26a + 0 - 7a + 0. -2a Collect the terms in 7996t2 - 7996t*2 - 47t*3. -47t*3 Collect the terms in -2667r*2 - 2670r*2 + 5336r2. -r2 Collect the terms in 480f3 - 241f*3 - 235f*3. 4f*3 Collect the terms in -2m*3 + 0m*3 - 91m2 + m3. -m*3 - 91m*2 Collect the terms in -1244m + 545m - 985m. -1684m Collect the terms in 87x*2 + 0 - 1 + 1. 87x*2 Collect the terms in 0 + 342c*2 + 0 - 350c*2. -8c*2 Collect the terms in -34h + 20h + 19h. 5h Collect the terms in -2s - 2s + s3 + 4s + 0s. s3 Collect the terms in 94 + 90 - 11u*2 - 184. -11u*2 Collect the terms in -82h*3 + 43h*3 + 40h3. h3 Collect the terms in -15u - 9u + 32u. 8u Collect the terms in 76k2 + 65k*2 - 128k*2 + 5. 13k*2 + 5 Collect the terms in 3t*2 + 0t*2 - 2t2. t2 Collect the terms in -876r2 + 397r*2 - 430r*2. -909r*2 Collect the terms in 1 + 183r*2 - 184r2 - 1. -r2 Collect the terms in -8 + 2 + 6 + 10t. 10t Collect the terms in -2 - 244q + 2 + 240q. -4q Collect the terms in -h2 - 175h - 108h + 98h. -h*2 - 185h Collect the terms in -94l + 94l - l*2 - 3l*2. -4l*2 Collect the terms in 36 - 4k - 78 - k + 42. -5k Collect the terms in -a2 - 697a + 697a. -a2 Collect the terms in -2 + 120o + 5 + 2 - 3. 120o + 2 Collect the terms in i3 + 11i*3 + 6i*3 - 3i*3. 15i*3 Collect the terms in 2k - 17299k2 - 5k + 17298k2 + 3k. -k2 Collect the terms in -f3 - 6 + 0f3 + 6. -f3 Collect the terms in 50y*3 - 4y - 24y3 - 24y*3 + 4y. 2y3 Collect the terms in -2 + 2 + 42g - 41g. g Collect the terms in 79r*3 - 8r*3 - 18r3 + r3. 54r3 Collect the terms in g - 1371 + 0g - 3g. -2g - 1371 Collect the terms in -14g + 0g*2 - 16g*2 + 8g + 4g. -16g*2 - 2g Collect the terms in 7h + 4504 - 4504 + 5h. 12h Collect the terms in -2l*3 + 2l*3 - 2l*3. -2l*3 Collect the terms in 126v*3 - 106v*3 - 24v*3. -4v*3 Collect the terms in 146a*3 - 143a*3 - 2a*2 + 2a*2. 3a*3 Collect the terms in 5x - 11x - 12x - 10x. -28x Collect the terms in 0 + 1 - 2 + 6m. 6m - 1 Collect the terms in -2a + 5a + a - 2a. 2a Collect the terms in -58j3 + 14j*3 + 145j*3. 101j*3 Collect the terms in 0v*3 - 2v*3 + 2v*3 + 3v*3. 3v*3 Collect the terms in -432p*2 + 202p*2 + 189p*2. -41p*2 Collect the terms in 4 + 19g*3 - 18g3 - 3 - 1. g3 Collect the terms in 5z3 - 20 - 2z*3 + 9 + 11. 3z*3 Collect the terms in -1146 + 2b - 1147 + 2293. 2b Collect the terms in 202q + 3 - 3 - 198q. 4q Collect the terms in -15i2 - 7i*2 - 10i*2 + 23i*2. -9i*2 Collect the terms in 65 + a + 11a - 65. 12a Collect the terms in -4m*3 - 5085m*2 + 5085m*2. -4m*3 Collect the terms in -2a*2 - 106 + 29 + 22 - 78. -2a*2 - 133 Collect the terms in 14c*3 + 2c - 2c - 16c*3. -2c*3 Collect the terms in -10438 + 3h*2 + 10438. 3h*2 Collect the terms in 46r*3 - 17r*3 - 20r*3 - 11r*3. -2r*3 Collect the terms in 6k - 4k + 213 - 213. 2k Collect the terms in 144g3 + 5 - 5. 144g*3 Collect the terms in 4t*2 + 8t*2 - 13t2. -t2 Collect the terms in -4v - 6v + 5v. -5v Collect the terms in 83 - 172 + 89 - 19l. -19l Collect the terms in 24v - 106 + 106. 24v Collect the terms in 5y - 277 + 277. 5y Collect the terms in -8 + 2s + 33 - 11 - 14. 2s Collect the terms in 346j - 5j*2 - 346j. -5j2 Collect the terms in -20w + 39w - 29w. -10w Collect the terms in 13y - 10y2 - 13y - 13y2. -23y*2 Collect the terms in -8 + 2r*2 + 14 - 4r*2 - 6. -2r*2 Collect the terms in -17s2 + s2 - 7s2. -23s*2 Collect the terms in 122 - 10t - 7t - 122. -17t Collect the terms in 4w2 + 5w*2 - 4w*2 - 6w2. -w2 Collect the terms in -q*2 + 2720 - 2720 + 0q2. -q2 Collect the terms in 8238m2 - 8238m*2 - 2m*3. -2m*3 Collect the terms in 149z*2 - z + 148z*2 - 294z*2. 3z*2 - z Collect the terms in -4924r*2 + 1 + 4927r*2 + 2 - 3. 3r*2 Collect the terms in -30c*2 + 22c*2 + 14c*2. 6c*2 Collect the terms in 2g - g - g - 9g3 + 0g. -9g3 Collect the terms in -q + 2207q*3 + 3111q*3 + q. 5318q*3 Collect the terms in -465c*2 + 231c*2 + 245c*2. 11c*2 Collect the terms in 17q3 - q3 + q - q. 16q3 Collect the terms in 43z*3 - 8z*3 + 41z*3. 76z*3 Collect the terms in 8x*3 + 6x3 - x3 - 2x3. 11x*3 Collect the terms in -k + 103k*3 - 105k*3 + k + 0k. -2k3 Collect the terms in -2j*2 + 79822 - 79822. -2j*2 Collect the terms in 363p + 349p - 194p. 518p Collect the terms in -4 + 5027n*2 + 4 - 5029n*2. -2n*2 Collect the terms in -36y - 16y - 2y. -54y Collect the terms in 6g*2 + 26g - 46g2 - 26g. -40g2 Collect the terms in -319n*2 + 167n*2 + 157n*2. 5n*2 Collect the terms in -140x*3 - 15x + 15x. -140x*3 Collect the terms in 2y*2 - 2y*2 + 27y*2. 27y*2 Collect the terms in -6y*2 + 22 - 11 - 11. -6y*2 Collect the terms in 35s + 3s - 5s*2 - 38s. -5s2 Collect the terms in -1272g*2 + 636g*2 + 638g*2. 2g*2 Collect the terms in 8c*2 + 0c2 + c2 + 3c2. 12c*2 Collect the terms in 4z - 40z - 13z - 1. -49z - 1 Collect the terms in -175f*3 + 42f*3 + 43f*3 + 44f*3 + 47f3. f3 Collect the terms in 6z - 2z - 2z - z. z Collect the terms in -20z*3 + 10z*3 - 15z*3. -25z*3 Collect the terms in -100i - 102i + 198i. -4i Collect the terms in -2 - 128t - 859t + 2. -987t Collect the terms in -457q2 + 228q*2 + 232q*2. 3q*2 Collect the terms in -5s*2 + 0s*2 - 1 + 6s2 - 29. s2 - 30 Collect the terms in 8576 - 8576 - 2m. -2m Collect the terms in -y*2 - 60y*2 - 32y*2 - 37y*2. -130y*2 Collect the terms in 0s*2 + 10s2 - s2 - 3s2. 6s*2 Collect the terms in -21c - 32c + 55c. 2c Collect the terms in 175u + 4u3 - 175u. 4u3 Collect the terms in -38 - 55 + 13 + 2y - 41. 2y - 121 Collect the terms in -10h - 5h + 14h + 3h. 2h Collect the terms in -20 + 20 - 17j. -17j Collect the terms in 3j3 - 34 - 19 - 4j3 - 6. -j3 - 59 Collect the terms in 11q + 8q + 13q - 13q. 19q Collect the terms in 194 - 194 - 14m. -14m Collect the terms in -x3 + 96x*2 - 96x*2 - 27x*3. -28x*3 Collect the terms in -22i + 59i - 22i. 15i Collect the terms in -2d + 2 - 5d + 5d. -2d + 2 Collect the terms in 4m + 15192 - 15192. 4m Collect the terms in -158i + 0i + 9i - 112i. -261i Collect the terms in 232d2 + 225d*2 - 457d*2 - 2d*3. -2d*3 Collect the terms in 19h - 21h + h. -h Collect the terms in -6 - 2f*3 + 6 + 7f*3. 5f*3 Collect the terms in -5430 - 5c + 5430. -5c Collect the terms in -18x*2 + 37x*2 - 22x*2. -3x*2 Collect the terms in -7 - 615z*3 + 7. -615z*3 Collect the terms in -10t*2 + 65t*2 - 11t2 - t2 - 7t2. 36t*2 Collect the terms in 6h*3 + 2h*3 - 4h*2 + 5h*3 + 3h*2. 13h3 - h2 Collect the terms in 0g3 + g3 - 5g*3. -4g*3 Collect the terms in 6v - 13v2 - 6v. -13v2 Collect the terms in 11 + 4 + 10 - 2o*2 - 25. -2o*2 Collect the terms in -299y*2 + 3y*3 + 299y*2. 3y**3
Suppose -o*3/2 - 99013o*2/2 + 396076o - 792168 = 0. Calculate o. -99021, 4 Let -2f2/3 - 25628f/3 + 2270752/3 = 0. Calculate f. -12902, 88 Let -3y3 - 2733y*2 + 46421955y + 86444678925 = 0. What is y? -2595, 4279 Determine i so that -958i4/17 - 646614i*3/17 - 109420494i*2/17 - 104686354i/17 + 4088484/17 = 0. -337, -1, 18/479 Factor -4t2 + 510636t + 12768400. -4(t - 127684)(t + 25) Let -5s5 + 756260s*4 + 22691885s*3 + 62781760s*2 + 40846140s = 0. Calculate s. -27, -2, -1, 0, 151282 Suppose -2d5/15 - 88d*4/15 - 1024d*3/15 - 2252d*2/15 + 342d/5 + 156 = 0. Calculate d. -26, -15, -3, -1, 1 Factor -5v2 + 4649285v - 9298550. -5(v - 929855)(v - 2) Solve -3j3/7 + 1118613j*2 - 39151362j/7 - 46981656/7 = 0. -1, 6, 2610092 Find c such that -53210494276c4/5 - 159632866872c*3/5 - 106425140693c*2/5 - 553623c - 18/5 = 0. -2, -1, -3/230674 What is h in 100h5 + 77820h*4 + 1462096h*3 + 3650544h*2 - 3642176h + 777216 = 0? -759, -16, -4, 2/5 Find h, given that 2h4/5 - 180952h*3/5 + 1809338h*2/5 - 1628388h/5 = 0. 0, 1, 9, 90466 Determine n so that 3n3/2 - 88179n*2/2 + 88173n = 0. 0, 2, 29391 Let -4i2 + 97719032i - 596813075938564 = 0. What is i? 12214879 Suppose -3m5 - 2739m*4 - 34899m*3 + 180831m*2 - 62406m - 275400 = 0. What is m? -900, -17, -1, 2, 3 Let -3k5 + 13713k*4 + 27771k*3 - 1523133k*2 + 1481652k = 0. Calculate k. -12, 0, 1, 9, 4573 Determine m so that -m*2/7 - 4203m/7 - 1800 = 0. -4200, -3 Solve -6s4/7 + 142000s*3/7 + 615466s*2/7 - 473420s/7 = 0 for s. -5, 0, 2/3, 23671 Find z such that 4z4/5 + 3640z*3 - 18684z*2/5 - 2186352z/5 - 8519472/5 = 0. -4551, -6, 13 Let 5x5 + 1412435x*4 - 12712370x*3 - 14124800x*2 = 0. What is x? -282496, -1, 0, 10 Determine q so that 3q*3/4 - 108231q*2/4 + 27966633q - 27939576 = 0. 1, 1064, 35012 Suppose -2d3/7 + 6238d*2/7 + 479408d/7 - 140536 = 0. What is d? -77, 2, 3194 Determine o so that -2o5/3 - 494o*4/3 - 10944o*3 - 846040o*2/3 - 7571200o/3 = 0. -160, -35, -26, 0 Find t such that -t*2 + 30998t + 41483655 = 0. -1285, 32283 Let 2y2 + 416541632y + 21688366398652928 = 0. Calculate y. -104135408 Solve -3f3/4 + 3771f*2/2 - 4272435f/4 + 175151424 = 0 for f. 361, 1792 Let -4a3/7 + 3452396a*2 - 36502018056064a/7 - 109506271669248/7 = 0. Calculate a. -3, 3020848 Solve -3b5/2 + 2316b*4 - 48150b*3 + 267549b*2 - 799809b/2 + 178191 = 0 for b. 1, 6, 13, 1523 Factor -2q2/5 - 511652q - 163617355690. -2(q + 639565)2/5 Factor 3u*3/2 - 100443u*2/2 + 8604816u - 369530046. 3(u - 33309)(u - 86)*2/2 Solve 2c*3/7 - 156546c*2/7 - 782780c/7 = 0. -5, 0, 78278 Solve 3p2 + 9642p - 2005080 = 0. -3410, 196 Factor -3v3 + 4728583v*2 + 3152390v. -v(v - 1576195)(3v + 2) Factor 3h*2 + 181276332h + 2738425711947852. 3(h + 30212722)2 Solve -2i*4/3 - 1762i*3/3 - 20230i*2 + 126674i/3 - 64220/3 = 0 for i. -845, -38, 1 Find x such that -4x4 - 600x*3 + 4372x*2 - 3768x = 0. -157, 0, 1, 6 Determine x, given that 2x5 + 1588x*4 + 105950x*3 - 146694668x*2 - 17285621944x + 3163070055088 = 0. -386, 107, 257 Solve 20y4 + 361015y*3 - 10934355y*2 + 84075525y - 20341125 = 0 for y. -18081, 1/4, 15 Factor -21u2/2 + 100948u - 9614. -(u - 9614)(21u - 2)/2 Factor k*3/4 + 89414379k2/4. k2(k + 89414379)/4 Determine o, given that -o2/9 + 15986o/9 + 18032552/9 = 0. -1058, 17044 Solve 3d5/4 - 546d*4 - 1466751d*3/2 + 303120090d*2 + 924624531675d/4 = 0. -585, 0, 949 Factor -2h4/21 - 3842h*3/7 - 885590h*2/7 - 207912674h/21 - 1816355676/7. -2(h + 79)3(h + 5526)/21 Factor 2h2/9 - 1024h/3 - 460800. 2(h - 2400)(h + 864)/9 What is x in 2x2 + 50162x + 6139668 = 0? -24958, -123 Factor 2j4/5 - 322392j*3/5 + 13004642412j*2/5 - 1012891507992j/5 + 19741827047202/5. 2(j - 80559)2(j - 39)*2/5 Determine v, given that -3v*5/2 + 17181v*4/2 + 1142709v*3 - 3479655v*2 + 6993657v/2 - 2336943/2 = 0. -133, 1, 5857 Factor 4h2/5 + 8272h/5 - 1954176. 4(h - 840)(h + 2908)/5 Suppose 3o5 + 52059o*4 - 104142o*3 - 208254o*2 + 104139o + 156195 = 0. Calculate o. -17355, -1, 1, 3 Solve 2z3/9 - 12783092z*2/9 - 588025406z/9 - 6762304336/9 = 0 for z. -23, 6391592 Let -3k4 - 150k*3 + 663k*2 + 810k = 0. What is k? -54, -1, 0, 5 Find t such that 3t5/5 + 444t*4/5 + 7854t*3/5 - 18876t*2/5 - 26289t/5 = 0. -127, -23, -1, 0, 3 Find w, given that -w*2/4 + 589372w = 0. 0, 2357488 Find m, given that 2m4 - 170838m*3 + 4866659754m*2 - 46302822312770m + 1936146400152636 = 0. 42, 28459 Suppose 264p5/7 + 2181670p*4/7 + 1966564p*3/7 - 247894p*2/7 - 33052p/7 = 0. Calculate p. -8263, -1, -1/12, 0, 2/11 Solve -f*5/2 - 37107f*4 - 593625f*3/2 + 853384f*2 + 1113090f = 0. -74206, -10, -1, 0, 3 Find l such that 3l4/5 + 16653l*3/5 + 11977314l*2/5 - 48109188l/5 + 48175848/5 = 0. -4701, -854, 2 Find f such that 2f3 + 82644f*2 + 16691806f - 103126452 = 0. -41119, -209, 6 Let 3h3/4 + 451077h*2/4 - 5753145h + 5640375 = 0. What is h? -150410, 1, 50 Factor -6n2 - 22965822n - 43952415011307/2. -3(2n + 3827637)*2/2 Factor 4z*3 - 1514912z*2 + 144022382900z - 111134345545000. 4(z - 188975)2(z - 778) Determine d, given that -4d2 - 688241448d - 29604768171571044 = 0. -86030181 Determine n so that 2n2 + 10698n + 1509160 = 0. -5204, -145 Let 5h4 - 30460h*3 - 6403020h*2 - 118902400h - 579232000 = 0. Calculate h. -184, -10, 6296 Factor -2d2/5 + 1586806d/5. -2d(d - 793403)/5 Factor -j*5 + 78j*4 - 215j*3 - 750j2. -j2(j - 75)(j - 5)(j + 2) Factor o3/4 - 1223501o*2/4 + 2446999o/4 - 1223499/4. (o - 1223499)(o - 1)2/4 Determine y, given that y4 + 4y*3 - 326044y*2 + 652064y = 0. -574, 0, 2, 568 Find v, given that 2v5/3 + 584v*4/9 - 8770v*3/3 - 2446880v*2/9 - 621944v - 353056 = 0. -102, -59, -4/3, -1, 66 Factor -2o2/9 + 28078o/9 + 648968/3. -2(o - 14108)(o + 69)/9 Suppose 2u4/11 - 5914u*3/11 + 1124032u*2/11 - 2224424u/11 = 0. What is u? 0, 2, 202, 2753 Determine a so that -a*3/9 + 42436a*2/9 + 254647a/9 + 212210/9 = 0. -5, -1, 42442 Solve -15r3 - 9548694r*2 + 114586488r = 0. -3182958/5, 0, 12 Factor -2p3 + 5790p*2 + 34844p - 92832. -2(p - 2901)(p - 2)(p + 8) Factor 8t*3/9 - 144614t*2/3 - 578488t/3 - 1735496/9. 2(t + 2)2(4t - 216937)/9 Suppose j3/3 - 295908j*2 - j/3 + 295908 = 0. What is j? -1, 1, 887724 Solve 4o*3 + 78044o*2 + 361466796o - 189734093100 = 0. -9993, 475 Factor 74k2 - 9578k/7 + 13124/7. 2(k - 17)(259k - 386)/7 Suppose 4y*3 + 2312y*2 + 228444y - 1454760 = 0. Calculate y. -449, -135, 6 Find b, given that -49b4/8 + 3050117b*3/4 - 189777825577b*2/8 - 651097146984b - 4465649803392 = 0. -96/7, 62261 Factor -a*2/2 + 219771a/2 + 1758296. -(a - 219787)(a + 16)/2 Factor -5p*5 + 216295p*4 - 2338851875p*3 - 7018502415p*2. -5p*2(p - 21631)*2(p + 3) Factor 3d5 - 113814d*4 - 95609160d*3 - 26514275616d*2 - 2445116139648d. 3d(d - 38766)(d + 276)3 Determine u so that u2 + 58357379u - 116714762 = 0. -58357381, 2 Find h such that -5h3 - 51730h*2 - 654645h + 815807435580 = 0. -6891, 3436 Factor 4u4 - 82683512u*3 + 744151392u*2 - 2232453960u + 2232453852. 4(u - 20670869)(u - 3)*3 Let 2d*5/15 + 4874d*4/15 + 2960366d*3/15 - 14618d*2/15 - 8871368d/15 + 5920744/15 = 0. What is d? -1286, -1151, -2, 1 What is y in 5y4 - 6177130y*3 + 30885560y*2 - 43239750y + 18531315 = 0? 1, 3, 1235421 Determine l so that 5l3 - 5598312l*2 + 35829004l - 13435872 = 0. 2/5, 6, 1119656 Let 24b5 - 23378b*4 + 4069756b*3 + 837845272b*2 + 1590061200b - 138325824 = 0. Calculate b. -116, -2, 1/12, 546 Solve -4d3 - 51672d*2 - 168210084d - 8607765712 = 0. -6433, -52 Find w such that w*2/5 + 80195324w + 8039112489331220 = 0. -200488310 Solve -3g3/7 + 6582g*2 + 4078563g/7 - 1807182 = 0. -91, 3, 15446 Solve -2v5/13 + 433106v*4/13 + 15594144v*3/13 + 57179240v*2/13 + 55446784v/13 = 0. -32, -2, 0, 216589 What is f in -2f4/5 + 1334f*3/5 + 30146f*2/5 + 23426f = 0? -17, -5, 0, 689 What is b in 34b3/3 - 90776b*2/9 - 5407112b/9 - 211904/9 = 0? -56, -2/51, 946 Find f such that 28f3 + 87628f*2 - 3859072f - 2233792 = 0. -3173, -4/7, 44
Let s = -0.729 + 4.099. Let b = s - -160.63. Let d = 163.9999883 - b. What is d rounded to 6 dps? -0.000012 Suppose -483t = -484t - 26740 - 69122. What is t rounded to the nearest 10000? -100000 Let u = -1615.07871 - -3.10871. What is u rounded to the nearest 100? -1600 Let t = -8.32 + 6.59. Let v = t + -70.57. Round v to 0 dps. -72 Let s = 1.6018 + 0.1062. Let p = 1.2 - s. What is p rounded to 1 dp? -0.5 Let d = 1034547166 - 1034547204.99999845. Let o = d - -39. What is o rounded to 7 dps? 0.0000016 Let d(i) = -2i3 + 39i*2 + 35i + 157. Let v be d(-8). Round v to the nearest 1000. 3000 Let f = -0.426577 - -0.49011. What is f rounded to two dps? 0.06 Let h = 81814.5066 + 14.4934. Let l = 81814.9987 - h. Let t = l - -14. Round t to 3 dps. -0.001 Let l = -1346.999556 + 1347. Round l to 5 decimal places. 0.00044 Let h(s) = 47s2 + 972s - 2906. Let d be h(3). What is d rounded to the nearest 100? 400 Let k(d) be the third derivative of -117d4/8 - 3d*3 + 10d*2. Let y be k(-6). Suppose r + 6558 = y. What is r rounded to the nearest one thousand? -4000 Let m be (-11102/18)/((-1)/(-3)). Let q = 124 + m. Round q to the nearest 10. -60 Let q = 1.77 - -22.23. Let d = 15.1 - q. Round d to zero dps. -9 Let b = 0.0236608 - 2.4235568. Let r = -14 - -11.6. Let f = r - b. Round f to 5 decimal places. -0.0001 Let r = 18 + -24. Let j be (r - -2)/((-5)/70). Let b = 68 - j. Round b to the nearest 10. 10 Let i be (-3)/(-3) - ((-1 - 1) + 87644). Let p = 87059 - i. What is p rounded to the nearest ten thousand? 170000 Let q = 1279 + -1258.148. Let p = 0.728 + q. What is p rounded to the nearest integer? 22 Let c = -82424330.63999821 - -82424332. Let n = 1.36 - c. Round n to 7 decimal places. -0.0000018 Let j = 258 + -393. Let i be (39510/j)/((-1)/(-600)). What is i rounded to the nearest ten thousand? -180000 Suppose 0 = 3r + 3u + 28689, 3r + u + 21805 + 6876 = 0. Let t = -4869 - r. What is t rounded to the nearest 1000? 5000 Let k(c) = -7c - 6. Let f be k(-2). Let g(u) = -2u + 13. Let m be g(f). Let p be (-1040003 - m)/(10/25). What is p rounded to the nearest one million? -3000000 Suppose -2m + 4w - 3w = -473202, 3m - 709802 = w. Suppose -2t - 1743415 - m = 5q, 0 = -2t - 3q - 1980009. Round t to the nearest one million. -1000000 Let k = 40 - -141. Let i = k + -151.9. What is i rounded to the nearest integer? 29 Suppose 44h - 38h = 134418. Suppose -2x = q + h, 2q = 5x - 1316 + 57310. Round x to the nearest one thousand. -11000 Let r = 0.1639552 - 0.14625. What is r rounded to 3 decimal places? 0.018 Let m = 263 - 248. Let h = m - 19.04. What is h rounded to one dp? -4 Let l be 1 - 1 - (-3 + (-3 - 1985583)). Suppose 8x + l = -654411. What is x rounded to the nearest 1000000? 0 Suppose -4m - 638842 = 23n - 28n, -4n + 3m = -511074. What is n rounded to the nearest ten thousand? 130000 Let j = 0.452 + -0.801. Let d = j + 0.041. Let p = d + 3.688. Round p to one dp. 3.4 Let s = -163.97154408 - 2.02835812. Let a = s - -166. Round a to five decimal places. 0.0001 Let c = -6.46 + 1.66. Let r = 17.6 + -24. Let f = c - r. What is f rounded to 0 decimal places? 2 Let j = 0.003 - 43.003. Let r = j - -43.99. Let u = r - 0.9798. Round u to 3 dps. 0.01 Let c = 101 - 34. Let v = 67.048 - c. Round v to 2 dps. 0.05 Let s = -348 - -604.4. Round s to the nearest one thousand. 0 Let u = 7.99 - 39.5. Round u to 0 dps. -32 Let w = -1.9681497 + 1.95769. Round w to three dps. -0.01 Let n = -2 + 2.29. Let m = n - 0.34. Let t = m + -0.39. What is t rounded to 1 dp? -0.4 Let r = 89 + -88.98501. Round r to two dps. 0.01 Let f = 0.842405 + -819.236405. Let m = 818 + f. Round m to 2 dps. -0.39 Let z = 1281716 + 1094096. Let s = z + -2375773.89773. Let l = s + -38.1. What is l rounded to four dps? 0.0023 Let o = 468952.920085 - 468954. Let k = o + 1.08. Round k to five decimal places. 0.00009 Let r = -6855.0021175 + 6855. What is r rounded to four decimal places? -0.0021 Let d = 83 + -82.729. Let v = 0.189 - 0.783. Let j = d + v. Round j to 2 dps. -0.32 Let j = -11.44045747 + 10.028451. Let w = 1.412 + j. Round w to 6 dps. -0.000006 Let p(y) be the first derivative of 53y4 - y3 + 17y*2/2 + 12y + 70. Let m be p(7). What is m rounded to the nearest ten thousand? 70000 Let o = -257 - -245. Let c be (-122170)/60 - 2/o. What is c rounded to the nearest one hundred? -2000 Let l = 8912854 + -1477874. Suppose -13n = 5u - 8n + l, 0 = -4n + 16. Round u to the nearest 100000. -1500000 Let h = 0.010625 + -0.010819215. Round h to five decimal places. -0.00019 Let p be 2/3 + (-777061)/(-327). What is p rounded to the nearest 1000? 2000 Let j be 2/7 - (-135390)/14. Let o(i) = 321i2 + 39i - 199. Let z be o(11). Let y = z - j. What is y rounded to the nearest 1000? 29000 Let w = 0.36915 + -323.90915. What is w rounded to the nearest 10? -320 Suppose -3q - 1723666 = 2x, -5x - 75470 = 2q + 1073615. What is q rounded to the nearest one thousand? -575000 Let q = -20273017 + 20273943.0517. Let c = q - 926. Round c to 3 dps. 0.052 Let r = -0.08955 - -59.32455. What is r rounded to the nearest ten? 60 Suppose -361t - 55217507 - 23913693 = 0. What is t rounded to the nearest ten thousand? -220000 Let t(s) = -40s + 851. Let x be t(-25). What is x rounded to the nearest 1000? 2000 Suppose -4d - 3o = -42044, 2d + 11118 - 32130 = -4o. Let u = d + 5056. Round u to the nearest one thousand. 16000 Suppose 0 = -7o - 93 + 121. Suppose 5d = -og + 3g - 130996, -g - 52396 = 2d. What is d rounded to the nearest one thousand? -26000 Let v be (1 - 0 - 3) + -4. Let g be 2/(8/v)5996/(-6). Suppose -2i = 6, t + 2i + g = -i. What is t rounded to the nearest 100? -1500 Let m = 57.84293046 - 2599.84149346. Let r = -2542 - m. What is r rounded to 4 decimal places? -0.0014 Let s = -64 - -68. Suppose -sf + 2i = -171038, f - 4f = -4i - 128286. Let q = 76958 - f. Round q to the nearest ten thousand. 30000 Let t = 31226 - 31226.83957. Let f = t - -0.8016. Let r = f + 0.038. Round r to 5 decimal places. 0.00003 Let b(c) be the third derivative of c*5/60 + 5c4/24 - c3/6 + 14c2. Let z be b(-8). Let q = z - 10. Round q to the nearest integer. 13 Let h = 34 + -27. Suppose 8k - 166 = hk. Suppose 0 = g + 806 - k. Round g to the nearest 100. -600 Let w = -0.2203 - -907.2203. Let q = 910.435 - w. What is q rounded to 1 decimal place? 3.4 Let k(y) = 1991y*2 - 210y - 5. Let z be k(3). Round z to the nearest one thousand. 17000 Let y = -27 + 27. Let i(b) = b*3 - 2b*2 - 16290268. Let n be i(y). Let u = -35590268 - n. Round u to the nearest 1000000. -19000000 Let w = 0.079 + -3.779. Let m = -3.70057 - w. Round m to 4 dps. -0.0006 Let s = 78 + -63. Suppose -3a - s = 2a, 4a = -5l + 3. Suppose m - 168003 = -ln, -2n - 4m + 2m + 112006 = 0. Round n to the nearest 10000. 60000 Suppose 0 = -1110m + 1122m + 10632. Suppose -5p - 4j + 48 = 0, -3p + 2j + 26 = 3j. Let t be p/14 + m/7. What is t rounded to the nearest 10? -130 Let j = -518 - -787. Let i = j + -268.999999196. What is i rounded to seven dps? 0.0000008 Let o = -0.495473 - 0.142224. Let w = o + 0.6326. Round w to three dps. -0.005 Let u = -714514394 + 336102153. Let z = u + 378412221.5999913. Let m = z - -19.4. Round m to 6 dps. -0.000009 Suppose 7f + 4 = -59. Let m be 100((-76323)/f + 3)24. What is m rounded to the nearest one million? 20000000 Let r = 597.495 + -599. Let u = r - -1.94. What is u rounded to 1 dp? 0.4 Let b = 1703 - 1709.8. Let q = -29 - -23.5. Let w = q - b. What is w rounded to zero dps? 1 Let i = -1768387 - -1258895. Let v = 509490.560122 + i. Let w = v + 1.44. Round w to five dps. 0.00012 Let m(f) = -470f - 177. Let r be m(-23). Suppose -r = 2k + 1133367. What is k rounded to the nearest one hundred thousand? -600000 Let k = 1572.27563 - 1572.2. Let q = -0.0705 + k. What is q rounded to three dps? 0.005 Let m = -4460 - -3798.8. What is m rounded to the nearest one thousand? -1000 Let d = 1479054.8799891 + -1479055. Let f = 8 + -7.88. Let a = f + d. What is a rounded to 6 dps? -0.000011 Let g = -347 - 165. Let j = g + 511.999998152. What is j rounded to 7 decimal places? -0.0000018 Let k = -1995738.455937 - 1077455.64389. Let w = k - -3073207.2. Let d = w - 13.1. Round d to 5 decimal places. 0.00017 Let j = -8902.78 + 8837. What is j rounded to the nearest 10? -70 Let x = 10888 + -10773.6. What is x rounded to the nearest one hundred? 100 Let s = -65 - -68. Suppose -82336 = -t + 10k - 7k, -sk = 2*t - 164654. Round t to the nearest 1000. 82000
33.849 1656.2 Product of 118.8 and -5. -594 Work out -3497 2. -6994 583 * -4 -2332 Work out 0.11 * 0.08. 0.0088 -86.92 times 1 -86.92 Product of 3 and -27.4. -82.2 What is the product of -0.1 and 0.298? -0.0298 Product of 0.1 and -0.083. -0.0083 -6 * -8 48 -98 times -3 294 What is the product of 0.3 and 183? 54.9 Work out -4.36 * 0.1. -0.436 Multiply -0.3 and -0.052. 0.0156 Multiply 0.4 and 12.1. 4.84 Multiply 10790 and -1. -10790 -1.9 times -4 7.6 Calculate -515-2. 1030 What is 0.16 times 4? 0.64 Multiply -0.054 and 0.12. -0.00648 -1292 -3 3876 What is 1 times 6.56? 6.56 -19 times -1.1 20.9 Product of -8 and -60. 480 What is the product of -0.0173 and 4? -0.0692 Multiply -0.969 and 0.1. -0.0969 Product of 31 and 3.56. 110.36 Multiply 2316 and 0.5. 1158 1.10.03 0.033 Work out -0.1 -0.2559. 0.02559 -12-79 948 -1.587 -130.5 What is -1 times -8348? 8348 -3-1.82 5.46 What is 0.03 times -158.3? -4.749 -7630.5 -381.5 -2.981 times 0.3 -0.8943 What is the product of 23 and -9? -207 What is -0.03 times 1.7? -0.051 -0.149 * 2 -0.298 Multiply -0.54 and 2. -1.08 Multiply 942 and 2. 1884 What is the product of 122 and 4? 488 Calculate -4-0.0471. 0.1884 Product of 10 and 290. 2900 -0.481 -32.4 -100 * 16 -1600 Multiply -0.048 and 1.1. -0.0528 0.0360.1 0.0036 Product of -1092 and 5. -5460 Work out -3.07 0.1. -0.307 What is the product of 7.4 and -0.08? -0.592 -1.84 times 37 -68.08 Multiply -5 and 170. -850 Multiply -20.51 and 0.08. -1.6408 3.7129 477.3 Multiply -0.082 and -0.063. 0.005166 Work out -1.04 -0.3. 0.312 What is the product of 5 and -20? -100 Multiply -98 and 2. -196 Calculate -0.6418. -11.52 Calculate 60.202. 1.212 Product of -295 and 13. -3835 Product of 142 and 12. 1704 0.03 times -5.6 -0.168 Product of 1.7 and 0.074. 0.1258 What is -78 times 1? -78 Product of -3 and 3.8. -11.4 Work out 0.4 * 0.97. 0.388 What is the product of -0.17 and -0.5? 0.085 What is the product of -13.4 and -0.2? 2.68 Product of -60.6 and 3.6. -218.16 What is 12 times 6? 72 What is -449 times 0? 0 Work out 19 * -9.5. -180.5 Multiply -1 and 33.7. -33.7 Multiply 0.4 and 0.59. 0.236 Multiply 3 and 1270. 3810 What is -1603 times -0.9? 1442.7 Calculate 0.090.01. 0.0009 What is the product of -5 and -140? 700 What is -9 times 71? -639 110 times 0.6 66 Work out -107.3 0.05. -5.365 2-110 -220 17 0.1 1.7 What is the product of -30 and -0.08? 2.4 -220 * 0.01 -2.2 0.1792 times -3 -0.5376 -0.912 -10.8 -0.075-2 0.15 Product of 0.03 and 0.12. 0.0036 -0.5 times -30 15 Work out -4 * 0.04. -0.16 Work out 0.12017 * -0.1. -0.012017 Work out 3 * 14. 42 0.079 times -1.3 -0.1027 What is the product of -4 and 1346? -5384 What is the product of -4 and -23? 92 Multiply 0.699 and 3. 2.097 3 times -40.5 -121.5 -12.9 times -3 38.7 4 times 80.5 322 -3 times -93 279 What is -11 times -3.7? 40.7 Product of 1.954 and 3. 5.862 What is 0.147 times 40? 5.88 What is 6 times -63? -378 Multiply -0.004 and -0.08. 0.00032 14116 1624 Calculate -0.30.33. -0.099 12-0.32 -3.84 Calculate -0.143-0.02. 0.00286 -18.0460 0 What is the product of -1401 and 3? -4203 Multiply -0.039 and -21. 0.819 1000.03 3 0.43446 1378.4 Work out 5 -5. -25 What is -1.32 times -0.3? 0.396 Product of -25 and 7. -175 Product of 6 and -646. -3876 What is the product of 0.041 and -5? -0.205 Calculate 0.7420.2. 0.1484 What is -0.0674 times 0.3? -0.02022 Multiply 147 and -23. -3381 -4 -2271 9084 What is the product of 0.088 and -3.1? -0.2728 0.03 times -116 -3.48 What is 0.02 times -0.44? -0.0088 Calculate -58640.5. -2932 Work out 0 1.59. 0 -35 * 34 -1190 -2715 -405 What is the product of 6.7 and 0.68? 4.556 -2 -19 38 Calculate 0.25-4. -1 Calculate -6-0.64. 3.84 Calculate -0.2-0.05. 0.01 5 59.3 296.5 What is the product of -0.4 and -1413? 565.2 -20-34 680 0.045 -4 -0.18 -0.002-65 0.13 -0.921 -18.9 0 times 2039 0 Product of 2 and -0.2427. -0.4854 -4050-0.6 2430 9.532 304 Multiply 106 and 43. 4558 What is the product of 64 and 6? 384 Product of 1 and -19.1. -19.1 Work out 0.4 * 49. 19.6 -0.14 times -50 7 What is the product of -0.3 and -123.5? 37.05 50.133 0.665 Product of 6617 and 5. 33085 What is the product of 0 and 0.29? 0 What is -0.1 times -0.00656? 0.000656 1.1 -0.14 -0.154 What is -8 times 0.014? -0.112 What is -1.1 times 0? 0 -0.4 times 150.4 -60.16 Product of 0.22 and -2. -0.44 Multiply 1 and 0.09. 0.09 What is the product of 1.09 and -14? -15.26 Work out -0.3 * 14.7. -4.41 What is the product of -0.07841 and -0.1? 0.007841 Multiply 58 and -1. -58 What is the product of 7.6 and 0.4? 3.04 What is -0.07 times 2447? -171.29 What is the product of -0.11 and -0.3? 0.033 13 * 34 442 Product of -0.065 and -0.033. 0.002145 Work out -44 * 1. -44 Work out 13 * 5.28. 68.64 Calculate -0.2628. -7.28 Product of 6 and -78. -468 Product of -0.844 and -3. 2.532 130.4 5.2 24 * 0.35 8.4 What is 312 times -0.2? -62.4 Calculate -127-0.11. 13.97 Multiply -5 and -2128. 10640 Product of -0.6 and -839. 503.4 Product of -0.5 and 18.8. -9.4 -0.7 0.0881 -0.06167 Calculate 161063. 48318 2.7 times 0.4 1.08 Product of 27 and -39. -1053 -0.4 -104 41.6 What is -22 times 9? -198 What is 0.178 times -0.12? -0.02136 Multiply -7 and 234. -1638 What is the product of 0 and 30.7? 0 1 times -4.1 -4.1 0 * -0.0262 0 -0.22108 -23.76 455-0.3 -136.5 What is the product of 63 and 30? 1890 0.09-16 -1.44 -1.23 2 -2.46 -0.01243 * 1 -0.01243 Product of 0.05 and -8. -0.4 Calculate -59-0.1. 5.9 What is 431 times -0.21? -90.51 What is -0.3 times 9.57? -2.871 -146 -3 438 22.170 0 Multiply 0.4 and 45.8. 18.32 Calculate -0.0417.88. -0.7152 Calculate -0.03529. -15.87 -2052 3 -6156 -0.3 times 4.9 -1.47 Work out 0.2 * -0.35. -0.07 Product of 0.2 and -89. -17.8 Calculate 0.4-139. -55.6 Multiply -0.04 and -4.29. 0.1716 Calculate -0.30.058. -0.0174 What is the product of -3.5 and -2? 7 0.1 * 397 39.7 What is -9 times -0.1? 0.9 Calculate -0.081.455. -0.1164 Calculate 179-0.1. -17.9 Calculate 230.15. 3.45 Work out 1 -0.2. -0.2 -13395 -6695 -0.2-595 119 Multiply -44 and 0.1. -4.4 Work out -5 * 92.4. -462 Work out -1 * -145.5. 145.5 What is 0.082 times -4? -0.328 0.1002-0.2 -0.02004 -5.1 times 26 -132.6 What is -0.22 times -0.007? 0.00154 What is the product of -80 and -0.5? 40 2 times -133.7 -267.4 -0.41416 -6.624 Product of -0.09 and -412. 37.08 What is the product of 0.05 and 16.6? 0.83 -4-73 292 -2 -2171 4342 Product of 3 and 13.8. 41.4 8.7 times 20.6 179.22 -2412 * 1 -2412 Work out 170 * 21. 3570 Work out -5 * 1955. -9775 Calculate 263.9. 101.4 Product of -32 and 2.1. -67.2 3 -53 -159 What is -6 times 0.4236? -2.5416 Product of 0.32 and 5. 1.6 What is the product of -219 and 81? -17739 What is 738 times 0.5? 369 0.4 * -0.0084 -0.00336 Multiply 0 and 133. 0 -4 times -1349 5396 Product of 43 and 12. 516 Product of 1 and -0.116. -0.116 What is 0.2 times -1697? -339.4 What is the product of -1.7 and -0.553? 0.9401 Work out 7 * -78. -546 -0.123 times -7.2 0.8856 Product of -474 and 0.9. -426.6 Multiply -696 and -0.06. 41.76 What is the product of 3.7 and 0.056? 0.2072 Work out -2 * -684. 1368 -64 * -0.3 19.2 Work out -0.235 * 5. -1.175 What is the product of 25.7 and -3? -77.1 What is -136 times -0.1? 13.6 Work out -0.126 * -6. 0.756 What is 0 times -1269? 0 -1 * -58.4 58.4 Work out -40 * -0.06. 2.4 Product of 90 and -1. -90 5 times 54 270 6141 614 Product of -0.31 and -0.05. 0.0155 What is 151 times -13? -1963 Product of -0.07 and -326. 22.82 -277 -2 554 Product of 0.2 and -12. -2.4 What is 58 times 109? 6322 What is the product of -266 and -6.1? 1622.6 -0.71-8 5.68 Multiply 88 and 0.2. 17.6 -2 times 0.048 -0.096 -0.01 0.0943 -0.000943 What is the product of 4 and 281.5? 1126 -288-0.5 144 What is -0.05 times 0.4? -0.02 -5-0.0876 0.438 What is the product of -147 and -3? 441 What is 1060 times 0.08? 84.8 -0.3 * -1862 558.6 Product of -0.3 and 325. -97.5 Work out 12 * -49. -588 What is the product of -105 and -0.47? 49.35 Work out 0.05 * -3. -0.15 Work out 0.4 * -4. -1.6 0-12.5 0 -46-1.3 59.8 Calculate -349-0.6. 209.4 521 -0.4 -208.4 Multiply 3 and -4. -12 Multiply -0.4 and -546. 218.4 What is the product of -1229.7 and -0.4? 491.88 Multiply 0.4 and -0.1168. -0.04672 0.3 * -26 -7.8 Calculate -3-19. 57 Product of -1 and -237. 237 -10.2 times -91 928.2 0.5 times 5005 2502.5 0.03 times 20 0.6 0.4-6964 -2785.6 -198.4 * -2 396.8 0.01710.1 0.00171 Product of 9.1 and -8. -72.8 What is the product of -0.5 and 40? -20 -5 1409 -7045 What is -3665 times -3? 10995 Calculate 3448. 1344 What is -853 times 0.12? -102.36 What is the product of 0 and 130? 0 Product of 4 and -285. -1140 6710 0 0 Multiply -0.01 and 118. -1.18 Work out 0.123 * 0.3. 0.0369 Multiply 46 and -0.9. -41.4 -14.64 times -0.4 5.856 What is the product of -0.1 and -2.64? 0.264 -0.143*-0.09 0.01287 What is the product of -749 and 0.09? -67.41 What is the product of 0.69 and 17? 11.73
Collect the terms in 69b2 + b - 68b2 - b. b2 Collect the terms in 25 - 29 + 13 + s*3 - 5s*3. -4s*3 + 9 Collect the terms in -7z*2 + 12z2 + z2. 6z2 Collect the terms in 8n + 28n3 + 5n*3 - 8n. 33n3 Collect the terms in 3w*2 - 69w*2 - 41w*2. -107w*2 Collect the terms in 0o + 2o + 3o - 2o. 3o Collect the terms in -859o + 4 - 4. -859o Collect the terms in 46m3 + 38m*3 + 4m*3. 88m*3 Collect the terms in -21v*2 + 23v*2 - 14v*2 - 12v*2. -24v2 Collect the terms in 8 - 8 - y3 - y*3. -2y*3 Collect the terms in 14z + 10z + 10z - 3z. 31z Collect the terms in 897x3 - 2 - 895x*3 - 3 + 5. 2x*3 Collect the terms in -3a + 4a + 0a - 2a. -a Collect the terms in -266j - 60 + 60. -266j Collect the terms in -8d + 0d + 3d*2 + 8d. 3d2 Collect the terms in 16b3 - b2 + b*2. 16b*3 Collect the terms in -2 + 5 - 5 + 2j*3. 2j*3 - 2 Collect the terms in 3 + 0 - 2b - 3. -2b Collect the terms in -45u*2 + 58u*2 - 3u*2. 10u*2 Collect the terms in -327n*2 + 650n*2 - 322n2. n2 Collect the terms in -3o - 3o + 4o. -2o Collect the terms in 0t2 - 983t*3 + 985t*3 + 0t*2. 2t*3 Collect the terms in 222s - 93s - 117s. 12s Collect the terms in -b2 - 12b*2 - 2b*2. -15b*2 Collect the terms in 51a*3 - 25a*3 - 27a3. -a3 Collect the terms in 2 - 2 + 67547l2 - 67543l*2. 4l*2 Collect the terms in -13z + 11z + 10z. 8z Collect the terms in -27h*3 + 4h3 + h3. -22h3 Collect the terms in 33m - 75m + 9m*3 + 42m. 9m3 Collect the terms in 29p*2 + 33p*2 - 1 - 77p*2. -15p*2 - 1 Collect the terms in 2 - 3 - d - 4. -d - 5 Collect the terms in 17i - 17i + 4i*2. 4i*2 Collect the terms in -16j - 3j - 6j*2 + 2j + 2j2 - 5. -4j*2 - 17j - 5 Collect the terms in -4p3 + 52p - 52p + 5p3. p3 Collect the terms in -735y + 474y - 1383y - 186y. -1830y Collect the terms in -25 - 20 - 10 + y. y - 55 Collect the terms in 61p*2 - 316p*2 + 256p2. p2 Collect the terms in k*2 + 29k - 15k - 15k*2 - 14k. -14k2 Collect the terms in 4 - 192q*3 - 4 - 138q*3. -330q*3 Collect the terms in -343f + 683f - 343f. -3f Collect the terms in -16j*3 - 21j + 21j. -16j*3 Collect the terms in -12h - 16h + 51h - 20h. 3h Collect the terms in -15m2 + 9m - 9m. -15m*2 Collect the terms in 10f + f - 16f + 3f. -2f Collect the terms in 236o - 15o3 - 236o. -15o3 Collect the terms in 2f*2 + 0 - 10 + 6 + 4. 2f2 Collect the terms in -j2 + 0 + 10 - 3. -j*2 + 7 Collect the terms in 2h*2 + 150h - 250 - 150h. 2h*2 - 250 Collect the terms in -3n + n + n + 8n - 5n. 2n Collect the terms in -2n*3 - 6n3 - n3. -9n3 Collect the terms in -92 - 85 + 177 + 10w. 10w Collect the terms in 9m*3 + 3 - 2 - 1. 9m*3 Collect the terms in 2p + 12 + 5 - 16 - 1. 2p Collect the terms in 13k*3 + 15k*3 + 5k*3 - 37k*3. -4k*3 Collect the terms in 35g*3 - 78g + 78g. 35g*3 Collect the terms in -2i*2 - 3i*2 + 8i*2 - 8i + 0i2. 3i*2 - 8i Collect the terms in 857f + 857f - 1712f. 2f Collect the terms in 1772d3 + 1771d*3 - 3542d3. d3 Collect the terms in 39n - 39n + 11n2. 11n*2 Collect the terms in 4q - 19 + 5 + 1 + 13. 4q Collect the terms in 24b*2 - 21b + 21b. 24b*2 Collect the terms in -6c*2 + 26c*2 - 5c*2 + 143c*2. 158c*2 Collect the terms in 26 + 38 + 32 - 96 - 2o*2. -2o*2 Collect the terms in -458 + 458 - 32p. -32p Collect the terms in -3n + 0n + 3n + 3n. 3n Collect the terms in -2a + 782 + a - 782. -a Collect the terms in -5b*2 + 5b - 5b - 5 + 5. -5b*2 Collect the terms in 3b - 7b + 8b. 4b Collect the terms in 639 + 2c*2 - 639. 2c*2 Collect the terms in -10c*2 - 3c - 14c + 17c. -10c2 Collect the terms in 1102 + j2 - 2212 + 1110 + j2. 2j*2 Collect the terms in 30 - 72 - 2g + 42. -2g Collect the terms in -15 - 4i*2 + 24 - 9. -4i*2 Collect the terms in -6 + 104z - 106z + 6. -2z Collect the terms in 72395p2 - 36198p*2 + 0p - 36199p2 + 0p. -2p2 Collect the terms in -1405a2 + a3 + 0a3 + 1405a2 + a3. 2a3 Collect the terms in -4q*2 - 2q*2 - 7q*2 + 28q*2. 15q*2 Collect the terms in -5u - 8u + 7u*2 + 23u - 10u. 7u*2 Collect the terms in -145l*3 - 5l*3 - 12l*3. -162l*3 Collect the terms in 4n + 10n2 - 37n*2 - 4n. -27n2 Collect the terms in -2q + 24 - 54 + 30. -2q Collect the terms in d3 + 6d*3 - 11d*3. -4d*3 Collect the terms in -2g - 3g - 9g + 8g. -6g Collect the terms in 4x2 + 817x - 817x. 4x*2 Collect the terms in 0 + 3 + 7i*3 - 3. 7i3 Collect the terms in -h2 - 65 - 30 + 95 - 2h2. -3h*2 Collect the terms in -27351 + 27351 - 3z. -3z Collect the terms in 0o + 11o + o + 2o. 14o Collect the terms in 3 - 20b*3 - 1 + 59b*3. 39b*3 + 2 Collect the terms in 3l*2 + 5l*3 - 3l*2 - 27l*3. -22l*3 Collect the terms in 0i + 18i - 4i - 7i - 6i. i Collect the terms in 0y - y - 44 + 44. -y Collect the terms in 11v + 2v - 10v. 3v Collect the terms in -3k + 10k3 + 21k - 7k - 11k. 10k3 Collect the terms in -26a - 43a + 70a. a Collect the terms in -9h2 + 9h*2 + 5h2 + h2 - 9h2. -3h*2 Collect the terms in -22w*3 - 69w*3 - 14w*3. -105w*3 Collect the terms in 3z + 202 - 101 - 101 - 2z. z Collect the terms in -5020d*3 + 5032d*3 + 4d*2 - 2d*2 - 2d*2. 12d*3 Collect the terms in 32c*2 - 2 - 35c*2 + 2. -3c*2 Collect the terms in -1724k - 1722k + 3435k. -11k Collect the terms in 40a - 34a - 5a. a Collect the terms in -3a2 - 3a*2 - 19a*2 - 2a*2. -27a*2 Collect the terms in -3 - 7867o - 5o2 + 2 + 7867o. -5o2 - 1 Collect the terms in 2i*3 + 641i*2 - 641i*2. 2i*3 Collect the terms in 33d - 7d3 - 61d + 28d. -7d*3 Collect the terms in 40 + 53 - 93 + 0x*2 - 3x*2. -3x*2 Collect the terms in -1 - 1089h + 1089h - 3h*2 + 1. -3h*2 Collect the terms in -33g*3 - 23g*3 - 9g*3. -65g*3 Collect the terms in -112q2 - q3 - 110q2 + 222q2. -q3 Collect the terms in -165i3 - 19i*2 + 36i*2 - 17i*2. -165i*3 Collect the terms in -13239z - 17z2 + 13239z. -17z2 Collect the terms in -2q + 15q2 - 13q*2 + 2q. 2q2 Collect the terms in 2n*2 + 2n + 6n - 8n. 2n2 Collect the terms in 52728j - 52728j - j2. -j2 Collect the terms in -16l*3 - 19l*3 + 0l*3. -35l*3 Collect the terms in h - 2h + 5h - 2h. 2h Collect the terms in i2 - i2 - 19i3 + i2 - 8i3. -27i3 + i2 Collect the terms in -47 + 47 - 257r2 - 252r*2 + 507r*2. -2r*2 Collect the terms in -9a - 56 + 113 - 58. -9a - 1 Collect the terms in -4l*2 - 1 + 9l*2 - 2l*2 + 19l*2. 22l*2 - 1 Collect the terms in 2 - 1 + 1 - 2h. -2h + 2 Collect the terms in -4h + 10h + 10h. 16h Collect the terms in -6q*3 + 404815q*2 - 404815q*2. -6q3 Collect the terms in t3 + 0t3 + 3t*3 - 5t3. -t3 Collect the terms in 18 + 116w3 - 235w*3 - 18 + 118w3. -w3 Collect the terms in 3p + 49 - 32 + p. 4p + 17 Collect the terms in -19k3 + 8k*3 + 7k*3 - 25k*3. -29k*3 Collect the terms in 12l*2 + 23 - 42 + 19. 12l2 Collect the terms in -2007 - v3 + 2007. -v*3 Collect the terms in -4 - 468w*3 + 231w*3 + 4 + 234w*3. -3w*3 Collect the terms in 13u + 3u - 26u + 11u. u Collect the terms in 2r*2 - 6580 + 6580. 2r*2 Collect the terms in 7p*3 - 8p*3 - 16p*3. -17p*3 Collect the terms in 1847a*2 - 3a + a + 2a - 1848a2. -a2 Collect the terms in 18b3 - 6b*3 - 4b*2 + 4b*3. 16b*3 - 4b*2 Collect the terms in 3h*2 + 28739h - 5 - 28739h. 3h*2 - 5 Collect the terms in -1 + 6 + 4 - 2j. -2j + 9 Collect the terms in 6s*2 - 13s + 13s. 6s*2 Collect the terms in -21r*2 + 5r3 - r3 + 0r2. 4r*3 - 21r*2 Collect the terms in -7h + h + 5h + 4h. 3h Collect the terms in -3y - 2y - 8y + y. -12y Collect the terms in 965k*3 + 934 - 934. 965k*3 Collect the terms in -383n - 7n3 - 216n*3 + 383n. -223n3 Collect the terms in -15 + 17m + 4m - 21m - m3. -m3 - 15 Collect the terms in -4t - t - 10t. -15t Collect the terms in 2k*3 + 6k*3 + 0k*3. 8k*3 Collect the terms in -4k*2 + 93k*3 + 4k*2. 93k*3 Collect the terms in 938f - 1885f - f2 + 947f. -f*2 Collect the terms in 9g*2 - 27g*3 - 1 + 1. -27g*3 + 9g*2 Collect the terms in -123j - j*3 - 127j + 250j. -j*3
Let n(w) = -779w + 7795. Let f be n(10). Solve fa = 4y - 17, 2y - 4a + 49 - 65 = 0 for y. -2 Suppose -2c + 19x = 17x + 2, 4x = 24. Solve -q + 1 = f, -3f = -4 - c for q. -2 Let d = -93 - -189. Suppose 87m = dm. Solve -4 = 4t - 0t, m = 5h + t - 14 for h. 3 Suppose -267b + 271b + 5d - 62 = 0, -2d = 4b - 56. Solve 2y = 4i + 10, -1 = -2y + 5i + b for y. -3 Let y(w) be the first derivative of w*3/3 - 4w*2 + 5w + 19. Let c be y(4). Let g be (-5)/(-3) - 3/(c + 2). Solve -gi + 1 + 5 = n, -4n = -2i + 6 for n. 0 Suppose -14u + 20 = -8. Let g be -2(11 + u)3/(-6). Solve 2n + 3 = -2w + g, 4n + 4 = 4w for n. 2 Let x be 2 + -3 + 7(-1)/(-7). Suppose -2b = -7r + 2r - 40, x = 2r. Solve 5n = -h - 6, 0 = -3n + 4h - 2 - b for n. -2 Let a be (11/(33/4))/(4/30). Let s = -14 + a. Let d(z) = -z*2 - 10z - 1. Let b be d(s). Solve -4f + 4k = -2f + 2, 0 = 3f + 4k + b for f. -5 Suppose -13a - 2a + 165 = 0. Suppose 0 = -az - 9 + 64. Solve 0 = -zm + l + 17, 28 = 2m + 2m + 4l for m. 4 Suppose 0 = -5a - 5, -9a = -x - 8a + 325. Let g = x - 320. Solve -18 = gi + w, 5i + 2w = -0i - 24 for i. -4 Suppose 18r = 14r + 12. Suppose -2x = -5x + 5k, -rx = 3k - 24. Solve 3a + 0a = -3q + 12, -1 = xq - 2a for q. 1 Suppose -j = -30j. Solve -4d - 5u = 0, 2d = -jd - u - 6 for d. -5 Let a = 1478 + -960. Let n = a - 514. Solve -12 = nm - p, 2m - 4p = -3m - 15 for m. -3 Let p(q) = -q*3 - 5q*2 - 11q - 84. Let h be p(-6). Solve -3i + 13 = 27t - 31t, -5i + h = -3t for t. -1 Let m be -156 - 15 - 5/1. Let p = 178 + m. Let x be (-70)/(-3) - 6/(-9). Solve -5g + 5 = 5o, -6o + po + x = -g for g. -4 Let m = -333 + 329. Let n be (-7)/(m/((-16)/(-14))). Solve 0 = -j - k + 2, -nj + 5j = k - 6 for j. -1 Let n = -4 + 40. Let l = -36 + n. Suppose 5q - 5h = 125, 0 = -lh + 4h + 20. Solve -4x = -4w - 16, 3x = -0w - 5w + q for x. 5 Suppose 2a + 38 - 31 = -3g, -4g - 14 = -2a. Solve -6 = -2h - i, 2i - a = 3h + i for h. 1 Let o = 366 + -364. Suppose -c - 5z - 19 = oc, z - 3 = -4c. Solve 0 = cj + 2n - 2, -j + 0j = 2n for j. 2 Suppose 13h = 90 + 378. Let p = -34 + h. Solve 0 = b - 5c + 1, 4b - 18 = -pc - 0c for b. 4 Let u be 12/102 - (-15)/(255/134). Solve -3m + 5m = u, -8o = -3m + 44 for o. -4 Suppose 35 = 5v, 3v = -h + 2v + 131. Solve -5a - r = -3, 0 = a + 5r + 109 - h for a. 0 Let c(q) = q*2 + 7q - 115. Suppose -4n - 3g + 14 = -24, 2n + 3g - 22 = 0. Let f be c(n). Solve -fo + x = -1, 3o - 6x + 5 = -4x for o. 1 Let t = 479 + -457. Suppose 2f = s + 4 + t, -4f = s - 58. Solve 2v + 4q = -0v + 10, 0 = -4v - 5q + f for v. 1 Let s(i) = 270i*2 + 265i. Let d be s(-1). Solve w - 4y = 4, -13y + 18y = -w - d for w. 0 Let g be ((-552)/2)/(45/(-30)). Let k = g + -179. Solve p = 4n - 2n - 10, 3p - 25 = -kn for n. 5 Let j = -4029 + 4043. Solve 0 = -3u + u - b - 8, -2u - j = -2b for u. -5 Suppose 13c - 860 = -7c. Suppose 10y - c + 3 = 0. Suppose 0 = 5p - p. Solve -5w - 2x + 0 = y, -3w - 3x + 3 = p for w. -2 Let z be (1/(-2))/((-1)/12). Suppose 6q = 13q + 3269. Let n = q - -469. Solve 2 = -no - 3k - z, -5o = k + 20 for o. -4 Let r = 234 + -220. Suppose 8m - 5y + r = 11m, -3m + 30 = -3y. Solve 6t - 3t - m = 5s, 4s - 3t = -7 for s. -1 Let q(b) = -74b + 2150. Let r be q(29). Solve -4y - 5 = -5x, -r = -3y - 5x + 1 for y. 0 Let m(f) = f*3 - 3f*2 - 2f - 4. Let r be (-8)/24 - 22/(-3) - 3. Let a be m(r). Solve 0 = 4g + 2z - 20, -g + 4 = -2g + az for g. 4 Let b(x) = -55x - 65x - 96 + 104x. Let a be b(-6). Solve 4w - 3c - 26 = a, -w + 0 = c - 3 for w. 5 Let y be (0/(-5))/(12 + -16). Solve 5t - f = 6 - 29, 3f - 9 = y for t. -4 Let x = -16834 - -16837. Solve -3p + 2p + 16 = xy, -p - 5y = -26 for p. 1 Suppose 0 = -37z + 600 - 415. Solve 3n + zw = 2, -5n - 19 = -w - 13 for n. -1 Suppose -80l + 2f = -81l + 6, 0 = 4l - 4f. Solve -5a = -2u + 21 - 8, -a + u - l = 0 for a. -3 Let b = -53 + 54. Let t be 5b(-2 - -3). Solve tq = -7p + 3p - 6, -4p + 4 = 0 for q. -2 Let j = 0 + 3. Suppose -60 = -0b - jb. Let o(z) = -126z - 10576. Let i be o(-84). Solve 5q = -4m - b, 2q - m + i = -4m for q. -4 Let k(m) = 5m + 9. Let q be k(-7). Let x = 26 + q. Suppose 4s = x, o + 0 - 3 = -4s. Solve -j - 1 = h, j - 3 = 3h - oj for h. -1 Suppose -2y - 3 - 9 = -a, 3y + 5a + 5 = 0. Let s be 273/65 - (3/y)/(-3). Solve -2p + 12 = -4t, -p = -t - s + 2 for p. -2 Let z be 130/(-7) + ((-153)/63 - -3). Let y be 95/15 + -5 + (-66)/z. Let k = -3 - -6. Solve yn + 17 = -2v, n - 5n - 32 = -kv for n. -5 Let b(h) = 3h + 69. Let a be b(-20). Suppose -au + 13u = -5t + 15, u = 5t + 10. Solve 4m + 14 - 4 = 2l, -ul + 3 = m for l. 1 Let d(h) = h3 - 32h*2 - 29h - 130. Let z be d(33). Solve 5q = zs + 23, 0 = 2q + 3s - 3 - 10 for q. 5 Suppose -2935d = -2937d + 14. Solve 0 = -j - 2i + d, -5i - 13 = -3j - 3 for j. 5 Let o be (2 + (45/(-12) - -2))/((-187)/(-1496)). Solve 22 = -t - 5d, -6 = -t + d + o for t. 3 Let z = -7 - -11. Suppose -5a = -12d + 8d - 26, -2d - 12 = -2a. Let o = 10 - 5. Solve 5x + 3s - z = 0, ox - as + 3s = 8 for x. 2 Let x(k) = 3k - 3. Let c be x(-4). Let a = c - -28. Suppose -a = -i - 3y, -5i + 2y + 5 = -9. Solve -i = -4q - 3j, q + 0j = 5j - 22 for q. -2 Let v(u) = -u*2 + 85u - 244. Let d be v(3). Solve 7 = -y - dk - 6, k = 3y + 11 for y. -5 Suppose 29 + 51 + 28 = 27k. Solve 14l - 9l - 8 = -kb, 5b = -4l + 1 for l. 4 Let z = 92 - -11. Let d = z - 98. Suppose -2h - dh = -70. Solve k - 6 = 2i, 2i - 4k = k + h for i. -5 Suppose -18 = -3d + 3n, -3n = 2d - n. Suppose 3c = -3s + 12, -2c + 7 - d = 4s. Solve -25 = -4x + 5j, 3j + c = -5x - 9 for x. 0 Let w(p) = -69p + 2243. Let t be w(32). Solve -tn - 16 = -34n + 5v, -4 = v for n. 4 Suppose -x - 4x = -40. Suppose h = 2, -13b + 6 = -xb - 2h. Solve c = -2m - 3, -m - 3c = -3 + b for m. -2 Let q(i) = 16i*2 - 3i - 4. Let d be q(-1). Let y(l) = -l*2 + 13l + 33. Let g be y(d). Solve -5m - 15 = 4z, -gm - 6 = -4z + 3 for m. -3 Let n = -2 + -9. Let q = -9 - n. Suppose 0 = 2x + 5r + 7, 0r = -qx - r + 5. Solve 5g - 4b = 4, 12 = -2g + xg + b for g. 4 Suppose -14z = -16z + 6. Suppose 0 = -4v - zl + 10 + 15, 0 = 4v + 5l - 15. Suppose v = -x + 28. Solve 2n = 5o - x, -n = -4n + o - 14 for n. -4 Suppose 0 = -22x - 113x + 270. Solve xu + 8v + 14 = 3v, -4u + 4v = 0 for u. -2 Suppose 3f - 3 = 33. Suppose -96h - 406 = -t - 100h, -5t = 3h - 1962. Let v = t + -390. Solve -3j + 4i - f = v, 2i - 4 = -j + 2 for j. 0 Suppose 0 = 5n + n - 11 - 13. Solve 5c + 2h = -h + 37, 0 = -nc + 4h + 4 for c. 5 Let u = -84117 - -84118. Suppose -4r + 5 = -3. Solve -ro - 4f + 5 = f, -o - 2f + u = 0 for o. -5 Let g(c) = -225c + 3. Let j be g(0). Solve 0 = -jh - 3k + 21, -h + k + 4 - 3 = 0 for h. 4 Suppose -1 = -3v + 4q, 7 = -11v + 10v + 5q. Suppose 5x + 18 = 78. Suppose x - v = 3f. Solve -fb - 3 = -2z, -3z + 0b - 2 = 2b for z. 0 Suppose -3r - j = 8 - 28, -4j + 20 = 0. Suppose -u = -3a - 2 - 16, 4a + 5 = -ru. Solve 14 = -5c - p, 2p = 3c + 8 + u for c. -3 Suppose -2f = 3u - 17, 15u - 2f = 13u - 2. Suppose -ua - 11 = -5m, 6m - 3a = 3m + 3. Solve mi - 19 = -3q, 6i - 2i + 1 = q for q. 5 Suppose 4x = -1 + 21. Suppose 3n - 6 = 2a, -35 = -xa + 6n - 11n. Solve 1 + 3 = -4t + 5u, -5t = au + 5 for t. -1 Let i(b) = -b*3 + 3b*2 + 5b - 7. Let j be i(1). Solve 0 = -2h - jh + y - 1, 4y = 4h + 8 for h. 1 Let x(w) = 14w2 + 19w + 9. Let y be x(-1). Solve p + 38 = -5q + 11, 2p + y = 0 for q. -5 Let v(h) = -2h3 + 23h*2 - 11h + 3. Suppose 4w - 2w - 5m - 7 = 0, 3m = 9. Let u be v(w). Solve 2 = 5s + 2i - 33, -4s + ui + 5 = 0 for s. 5 Let c(m) = -2m3 + 1. Let j be c(-2). Suppose 13h - 16 = jh. Let r be h/30-21 + 1/5. Solve 5d + 22 = -2i + ri, 4i + 3d = -27 for i. -3 Let b be 12597/1976 + (-6)/16. Solve -3n - 17 - b = -4y, 0 = -y - n - 3 for y. 2 Suppose 206y + 2555 = 717y. Solve -yf = -15v + 12v - 30, -2v - 5f = -5 for v. -5 Let a(k) = 32k - 2238. Let v be a(70). Solve j = 0, vu + j + 12 = -4j for u. -6 Let j = 34609 - 34606. Solve 26h = 29h - 5d + 19, 2d = jh + 13 for h. -3 Suppose 74o - 846 = 27o. Solve -5p - 8x + 6x - o = 0, 0 = x + 4 for p. -2 Let g be ((-5)/(-10))/(2/8)-7. Let c be 33/9 - -1 - g/(-21). Solve cj - 5q = 20, 0 = -2j - 4q + 3*q + 10 for j. 5
Put -13125, 0.02, 6/73, -4 in descending order. 6/73, 0.02, -4, -13125 Sort 3387, 9, 93 in descending order. 3387, 93, 9 Sort 1154, 93, -1, 3/4, -4, -2. -4, -2, -1, 3/4, 93, 1154 Sort -4, 3, -5, -3, 8978, 11. -5, -4, -3, 3, 11, 8978 Sort 24728, -4, -2, 1/15, -3, -0.4 in increasing order. -4, -3, -2, -0.4, 1/15, 24728 Sort 2/9, -36, -2543. -2543, -36, 2/9 Sort -4, 13819, 65, -1, 4, 0. -4, -1, 0, 4, 65, 13819 Sort -68, 12, -2/15, 58. -68, -2/15, 12, 58 Sort -39, 5, 11, 3, 1, -1527 in decreasing order. 11, 5, 3, 1, -39, -1527 Sort 24, -4, 92, -1319 in descending order. 92, 24, -4, -1319 Put 72, -40, -9, 4, -2206 in ascending order. -2206, -40, -9, 4, 72 Sort 1, -5, -1247321 in increasing order. -1247321, -5, 1 Sort -11076, 3, 36, -3 in descending order. 36, 3, -3, -11076 Sort -11, -3, -15, -4, -1400, 4, -5 in decreasing order. 4, -3, -4, -5, -11, -15, -1400 Put 707, 2/25, -50, 0 in increasing order. -50, 0, 2/25, 707 Put -7, -4, -31, -3, 80, -5 in descending order. 80, -3, -4, -5, -7, -31 Sort 3/5, -89/905, -3, 1/6. -3, -89/905, 1/6, 3/5 Sort -9, -374, 3, 2/5, 1/2, -2/3. -374, -9, -2/3, 2/5, 1/2, 3 Sort 3, 9684, -5, -60. -60, -5, 3, 9684 Sort -5, -93, -96, 2, -11, 3 in descending order. 3, 2, -5, -11, -93, -96 Put 4006, 5, 3305 in decreasing order. 4006, 3305, 5 Sort 445, 1, -23, -6, -1. -23, -6, -1, 1, 445 Sort -2/7, 0, 5561088 in descending order. 5561088, 0, -2/7 Sort -2/813, 38.3, 3.58. -2/813, 3.58, 38.3 Put 316, 14, -534 in decreasing order. 316, 14, -534 Put -7317, 1, 1/7 in ascending order. -7317, 1/7, 1 Sort -6, -124, 1, 11, 3, -1, -3 in ascending order. -124, -6, -3, -1, 1, 3, 11 Put 240, -32, -30, -74 in increasing order. -74, -32, -30, 240 Sort 4, 1562392, -5, -2 in descending order. 1562392, 4, -2, -5 Put -289, -1, 0, -4, 1341 in decreasing order. 1341, 0, -1, -4, -289 Sort -10108, -26, 4, -4 in decreasing order. 4, -4, -26, -10108 Sort -21043, 2/7, -195/4, -0.2 in decreasing order. 2/7, -0.2, -195/4, -21043 Sort 40, -35, 10, 7434, -1. -35, -1, 10, 40, 7434 Put -1185, 5, -115, 0 in increasing order. -1185, -115, 0, 5 Sort 3, 1/77, 292.2, 8/3, -5. -5, 1/77, 8/3, 3, 292.2 Sort 5/2, 1, -3, 0.081, 19, -1 in ascending order. -3, -1, 0.081, 1, 5/2, 19 Put 751858, 4, 17 in increasing order. 4, 17, 751858 Sort 1, -178, -24, 8, 3, -67 in ascending order. -178, -67, -24, 1, 3, 8 Sort 19, 848, -24, 4, -4, 0 in decreasing order. 848, 19, 4, 0, -4, -24 Sort -384/17, -4, -3/2, -2/35, 0.1 in ascending order. -384/17, -4, -3/2, -2/35, 0.1 Put 7, -145, 2487, 1/3 in ascending order. -145, 1/3, 7, 2487 Put 5, -2, -2395, 22, 3, -21 in ascending order. -2395, -21, -2, 3, 5, 22 Sort 0.022, 71, -0.2, 2/11, 3 in descending order. 71, 3, 2/11, 0.022, -0.2 Sort 225, -1, 2, 148, -7 in increasing order. -7, -1, 2, 148, 225 Sort 1, -3, 3127, 5, -5, 59 in ascending order. -5, -3, 1, 5, 59, 3127 Put 3, 0, 4, -772, 9 in decreasing order. 9, 4, 3, 0, -772 Sort 101, -38, 0.11385 in ascending order. -38, 0.11385, 101 Sort -26, -4, -2, 57, 5, 3 in ascending order. -26, -4, -2, 3, 5, 57 Put 3/5, 2/3, 5, -3/23, 21, -0.55 in increasing order. -0.55, -3/23, 3/5, 2/3, 5, 21 Sort -2, -9333, -21481. -21481, -9333, -2 Put 4, 0.3, -24882 in decreasing order. 4, 0.3, -24882 Sort -2, 6, -1.6665 in ascending order. -2, -1.6665, 6 Sort -8, 2, -3, -1, 31, -1980. -1980, -8, -3, -1, 2, 31 Sort -0.1, 0.9, 7, -24023, 1/37 in ascending order. -24023, -0.1, 1/37, 0.9, 7 Sort 433754, 2, 1, 22, 5 in decreasing order. 433754, 22, 5, 2, 1 Put 0.0346, -0.174, -1, 0.05 in ascending order. -1, -0.174, 0.0346, 0.05 Put -21, -2, -1, -197, 5, 17 in descending order. 17, 5, -1, -2, -21, -197 Put 0.09, 0.055, -0.4, 5.9, -4 in descending order. 5.9, 0.09, 0.055, -0.4, -4 Sort 119, -4, -11, -3, 15, 3, -6 in ascending order. -11, -6, -4, -3, 3, 15, 119 Sort 3, 150, -29721 in descending order. 150, 3, -29721 Sort 48, 68, 10, -4, 0. -4, 0, 10, 48, 68 Sort 8, 45, -3, 0, 54 in descending order. 54, 45, 8, 0, -3 Sort -27/5, 0, 39/4, 5, 3, 95 in decreasing order. 95, 39/4, 5, 3, 0, -27/5 Sort 4, -1, -12, 48, 18, -42. -42, -12, -1, 4, 18, 48 Put -1/2, 1.9, 2/9, 2/17, -21145 in increasing order. -21145, -1/2, 2/17, 2/9, 1.9 Put 4, 99, 31, 1/4, -3.4 in decreasing order. 99, 31, 4, 1/4, -3.4 Sort 327, 8, -43, -1. -43, -1, 8, 327 Sort 704, 2, -15562 in decreasing order. 704, 2, -15562 Sort 41487, -0.6, -1265 in decreasing order. 41487, -0.6, -1265 Sort -2, 6, -942, 171, 0. -942, -2, 0, 6, 171 Sort 3, 121, 8, -2/653, -3, -2/11 in decreasing order. 121, 8, 3, -2/653, -2/11, -3 Sort -6, 1, -90/853, 27, 0.2 in ascending order. -6, -90/853, 0.2, 1, 27 Put -3/194, 4, -5, -0.4, -2/7 in decreasing order. 4, -3/194, -2/7, -0.4, -5 Sort -0.01, 1/6, 0.2, 3, -30, 3/10. -30, -0.01, 1/6, 0.2, 3/10, 3 Put -221, 3, -3, 0, 1, -149, 5 in decreasing order. 5, 3, 1, 0, -3, -149, -221 Put 1, -2/1367, -1.41, -12/5 in increasing order. -12/5, -1.41, -2/1367, 1 Sort 3, -3/4, -3, 0.5, -30/7, 7.62 in decreasing order. 7.62, 3, 0.5, -3/4, -3, -30/7 Sort -1/2, 333, 3/11, -0.06 in increasing order. -1/2, -0.06, 3/11, 333 Put 0, 814, -1, 3, -12, 4 in decreasing order. 814, 4, 3, 0, -1, -12 Put -560802, 2/197, -2/9 in descending order. 2/197, -2/9, -560802 Put -392, -13, 360, 21, -2 in descending order. 360, 21, -2, -13, -392 Put -5, -100, -39, -1949 in descending order. -5, -39, -100, -1949 Sort -57343, 0, -42, -3 in descending order. 0, -3, -42, -57343 Put -5, -35, -2, 3, 858 in decreasing order. 858, 3, -2, -5, -35 Put -17, -32, -38, -3, -1, 5, 2 in decreasing order. 5, 2, -1, -3, -17, -32, -38 Put -4, -1, 1, -9, -322438 in ascending order. -322438, -9, -4, -1, 1 Put -6, 0.06, 8560 in decreasing order. 8560, 0.06, -6 Sort -14, -29235, -6, -1, 4, -4, 1 in decreasing order. 4, 1, -1, -4, -6, -14, -29235 Sort 0.71, -30, -36, 5/3 in decreasing order. 5/3, 0.71, -30, -36 Sort -85/16, -6.47, 0.05 in increasing order. -6.47, -85/16, 0.05 Sort -684100, -4, -1 in descending order. -1, -4, -684100 Sort -5763, -2, 1, 4, -230 in ascending order. -5763, -230, -2, 1, 4 Sort -20540, 0.1, -0.0355 in ascending order. -20540, -0.0355, 0.1 Put -6, 1707842, 1 in decreasing order. 1707842, 1, -6 Put 15.1, -2/9, 100707 in ascending order. -2/9, 15.1, 100707 Put -187, -1.9, -1/3, 717 in decreasing order. 717, -1/3, -1.9, -187 Put -98797, -0.3, -11, -4/11, 2 in decreasing order. 2, -0.3, -4/11, -11, -98797 Put 21093, 61, 1, -5, 0 in descending order. 21093, 61, 1, 0, -5 Sort 6/47, -125674, 5 in increasing order. -125674, 6/47, 5 Sort 2/13, -5, 500, -1/9, -2.79 in ascending order. -5, -2.79, -1/9, 2/13, 500 Sort -4, 27, -315, 43, -3, -2, 3 in ascending order. -315, -4, -3, -2, 3, 27, 43 Put -1/6, 40, 11, -4849 in decreasing order. 40, 11, -1/6, -4849 Sort 5, -9.1, -11/4, 52.1 in decreasing order. 52.1, 5, -11/4, -9.1 Sort -5583, 12, 3 in ascending order. -5583, 3, 12 Sort 4, -2227, 123. -2227, 4, 123 Put -1235280/17, -0.4, 2, -1 in decreasing order. 2, -0.4, -1, -1235280/17 Put 2, 2/3, -1/7, 6, 36, -2/161559 in descending order. 36, 6, 2, 2/3, -2/161559, -1/7 Sort -1, 3/19, -95/14, -0.5, -20 in descending order. 3/19, -0.5, -1, -95/14, -20 Put -4712, 4, -3, 477, -8 in increasing order. -4712, -8, -3, 4, 477 Sort 2, -2430, -2792 in decreasing order. 2, -2430, -2792 Sort -27, -3, 0, -86, 2, -1, 46 in decreasing order. 46, 2, 0, -1, -3, -27, -86 Sort -5.0132, -3, 5, -4, 0.4 in decreasing order. 5, 0.4, -3, -4, -5.0132 Put 1, -596446, -0.4, -0.5 in descending order. 1, -0.4, -0.5, -596446 Sort 1719060, -2, -15 in descending order. 1719060, -2, -15 Put -5, 5, -7179333 in ascending order. -7179333, -5, 5 Put -5, -4, 0, -13, 2, -112, -3 in descending order. 2, 0, -3, -4, -5, -13, -112 Put -4321, 7, -5, -535 in descending order. 7, -5, -535, -4321 Sort -5, -27, -1, 839, 1, -10 in descending order. 839, 1, -1, -5, -10, -27 Sort -1, 17, 3626, 2 in descending order. 3626, 17, 2, -1 Sort -105, -0.02, -272 in descending order. -0.02, -105, -272 Sort -2, -135, 2, -5, -18, 4, -59 in ascending order. -135, -59, -18, -5, -2, 2, 4 Sort 12.972, 5, 679. 5, 12.972, 679 Sort -4, 3, -386, -3, 28, 2, 41. -386, -4, -3, 2, 3, 28, 41 Sort -1/20, -584, -4077. -4077, -584, -1/20 Put 1, -0.3, 2, -12, -3, 0.06257 in increasing order. -12, -3, -0.3, 0.06257, 1, 2 Put -1/5, 0.7, 231656 in decreasing order. 231656, 0.7, -1/5 Put -383, -3, -2, 29984 in decreasing order. 29984, -2, -3, -383 Put 8/3, 88, 2, -1/9, 0.5, -4 in increasing order. -4, -1/9, 0.5, 2, 8/3, 88 Sort 0.4, 8, -60, -59 in descending order. 8, 0.4, -59, -60 Put -5, -627, -63636, -4 in decreasing order. -4, -5, -627, -63636
Simplify (((v*(-13)/(vv/v(-14)))/(v11(v/v(4/13)v)/v))(-5/4))(-2/51) assuming v is positive. v(-2645/1326) Simplify (t(-4/13)tt/t*(-3/10)t)/(t*18t/t(-21/4)) assuming t is positive. t(-5527/260) Simplify ((vv1)33v*(-5)vv(-3/2))/(v(-3/8)v*(-2/3)v*4v/(v*3v)) assuming v is positive. v(1453/24) Simplify (o(1/9)/(o/(o/(oo(-12)o))))*29(o/(oo(2/7))o/(o/o*(2/21)o))/(((oo(-3)/o)/o)/(o/(o1/o))) assuming o is positive. o(18713/63) Simplify ((o(-6/7))21/(o(2/75)o/o29))(1/63) assuming o is positive. o*(748/4725) Simplify dd*3dddd/d(-2)(d/d*0d)*46(d(-4)/d(-3))/(dd/(dd0/d))(-1/10) assuming d is positive. d*(506/5) Simplify g/(gg/g*1)gg(-3)g(gg*4/g)/gggg/g*(-2/3)(g(-5)/(g/(g2g)))45 assuming g is positive. g(-388/3) Simplify ((x(xx(-1/4))/x)(-1/47)/((x(-4)x)/x(-4)))/(x(2/11)x/(x/(xx/((xx(-2/3))/xxx))))(-16) assuming x is positive. x(77921/6204) Simplify ((o2oo)(3/13)(o/(o/o(-1)))23)/(((oo1o)/o)*(-48)(oo(1/2))/(o(4/9)/o)) assuming o is positive. o(16817/234) Simplify ((ff*(-11)f)/((ff(20/3)ff)/ff))/(f(-3/11)/f)(-46) assuming f is positive. f(-2548/33) Simplify ((u/((u0/u)/u))/u)/u*(-3/4)(u0)23(uuuu*(1/2)uu)(-41)uuu*(7/2)uu(-6) assuming u is positive. u(-889/4) Simplify ((xx(-40)/x)/x35)/(xxx/(xx3))(14/3) assuming x is positive. x(-211/3) Simplify ((((z/(z/z(-9))z)/zzz)/(zz16z))/(z*(-5/9)z27))(-24) assuming z is positive. z(3704/3) Simplify (((w(-1/3))*30w(-1/19)/w(-4/3))(-11))(-1/41) assuming w is positive. w*(-5467/2337) Simplify (((dd1)(-2/9)/(d(-1/7)/d0))10)(-42) assuming d is positive. d*(380/3) Simplify d/(d/(dd*(1/3)))dd(1/6)/dddd*(4/7)/(ddd/d(-2/3))((d/d0)/(d(-3/10)/d))/(d(-2/7))(-1) assuming d is positive. d(254/105) Simplify (t(-1/8)t(-1/3)(tt(-1)tt)30)/(((t(-1)tt)/t)(-8/9)/(t(-1))(12/5)) assuming t is positive. t(6857/120) Simplify ((((d(-7/3)/d)/d)/((dd/d19)/d))/(d/d(9/4)dd/(d/(d/d(42/5)))))(-5/4) assuming d is positive. d*(-1279/48) Simplify (((zz(-1))(-32)(z(-1))(-45))(-46))30 assuming z is positive. z(-62100) Simplify ((i1)(-18/13))39(((i/i(-2/7))/i)/i)(-29)/(i*(-3)i(i/(i((i/i*(2/5))/i)/i)i)/i) assuming i is positive. i(-1144/35) Simplify ((y/y(21/4))(-48)/(y(12/13)y(-5)y))(1/6) assuming y is positive. y(1346/39) Simplify (q(4/39)/q)(4/39)/(q(-4))46 assuming q is positive. q(279724/1521) Simplify (j22)*(-2/5)/((jj20)/(j(-22)j)) assuming j is positive. j(-254/5) Simplify (((ll*(-2/21))/(ll(2/3)))/(((l(-3)ll)/l)/l*(5/4)))/(((lll2l)/l)/(l/l(1/3)))(-33) assuming l is positive. l*(9449/84) Simplify ((hhh(1/4)/h)(2/7)(h*(-4)h)/h0)/(((h(-2/3)/h)/h)/h*(3/4)hh(-5)hh9) assuming h is positive. h(-439/84) Simplify (((((b/b9b)/b)/(b/(b/(((b/(b(b(1/8)/b)/b))/b)/b))))(3/31))(-2/7))(4/13) assuming b is positive. b(27/403) Simplify ((q/q0q*(-21)q)/((qqq*(-16)qq)/qq)23)(1/41) assuming q is positive. q*(257/41) Simplify ((nn*(-10)/nn*(4/15)n/(n/((n*4n)/n))nnn12nn)7)42 assuming n is positive. n(15092/5) Simplify (vv/(v/(vv(-2/5))v)v(3/7)/v)(2/35)(((v(-3)/v)/v)/v(1/3))/((vv(-1))/v)(1/3) assuming v is positive. v(-6123/1225) Simplify ((p/((p/p(-5/6))/pp))*(4/23)(p/(p(-15)/p))15)(-15) assuming p is positive. p(-87925/23) Simplify ((j/j(-1/11))/((j(3/4)j)/j)(j*8j)/j2)(-41) assuming j is positive. j(-13243/44) Simplify ((x/x6xx)/(xx(3/14)xx)xx(-24)x(x/(x/((x(1/3)/x)/x)x))/x)(-3/14) assuming x is positive. x(1339/196) Simplify ((r*(-14/9)/(r/(r((r/(r(2/13)/r))/r)/r)))/(r(-1/4))(5/6))(-1/84) assuming r is positive. r(1405/78624) Simplify h(5/6)h/(((hh/(h*(-6)/h))/h)/h)(((h*(2/5)/h)/h)/hh)/(hh/(h(-2/7)/h))h7/h(-2/15)h(1/2)h(-7)/h assuming h is positive. h(-1094/105) Simplify (w(-2/15)/((w/(w/w(2/15)ww))/w)(w(2/9))(3/8))/(((ww/(w(-2/9)/w))/w)(-47)/(w(1/5))(-2/131)) assuming w is positive. w*(505829/4716) Simplify (((b/(b(bbbbb*(1/7)bbb)/b))/b)(-24)/(b(-2/3)/b)(-3/2))(-2/7) assuming b is positive. b(-2365/49) Simplify (u(-10)u(1/19)(uu/((u/(u(1/8)/u))/u))/(uu*(-1/9)u))(2/17) assuming u is positive. u(-14653/11628) Simplify (g(-2)/((g(2/31)/g)/gggg))/(g(-1/2)/g)(-5)(g*(-2)g)*(-4/29)((ggg(-2/9))/g)/(g(5/4)g) assuming g is positive. g(-385093/32364) Simplify ((vv/v(-3/20))/v(-1/11))/((vv/(vvv(-25)/v)v)/v42) assuming v is positive. v(3793/220) Simplify ((uu/(u/(uuuu*(1/3)/uu))uu)*22/(u(u/(u/((u/((u/(u/u(-1)))/u))/u)))/u)(-24))/(u/u*(-7)u4)(-2/37) assuming u is positive. u(20866/111) Simplify ((z/z(-1))*(-2/11)/(z/(z/(z/(zz*(2/3)z))))(-1/7))/((z/(z(-1)/z)z)/(z(z/(zz(-2)))/z))11 assuming z is positive. z(-5221/231) Simplify ((r/(rr(-2)))(-3/7)(r/r0)(2/11))/(((r(-1)r)/r)(-29))(-40) assuming r is positive. r(89268/77) Simplify (a(-8))*(1/34)(a*18/a)/(a/(aa/(a/(a*30/aaa)))a) assuming a is positive. a(795/17) Simplify (((a/a(-4/7))14)(-48))(1/5) assuming a is positive. a(-1056/5) Simplify (z/(z/((z/z(-4/15))/z)))1/(z6/z(-2/13)) assuming z is positive. z*(-1148/195) Simplify (((cc/(((c/c*2c)/c)/c))/c)(-2/33)/(c0/c)(2/13))/((c(1/5))(1/26))(-3) assuming c is positive. c(-7/1430) Simplify (h(-11)h2)(-28)/((h(((hh(2/15))/h)/hh)/hh7/hh)/((h/h*(1/4)h)/((hh/h(-2/5)h)/h))) assuming h is positive. h(14653/60) Simplify ((q(-16)q(2/3)q)/(q(-14)/q(-10)))(-1/32) assuming q is positive. q(31/96) Simplify (r*(7/5)(r/(rr/r(5/3)))/r)0/(((r/r(5/3))/r3)/(r(-1/2)r0)) assuming r is positive. r(19/6) Simplify ((uu(-6))(7/12)(u16)(2/133))(3/40) assuming u is positive. u(-4271/21280) Simplify ((t/t(-3/5))31)*(1/7)t*(-3/4)t*(-4)t*(1/3)/tt(3/7) assuming t is positive. t(881/420) Simplify (g/((g/(g/(g(gg*21)/g)g))/g)g/(g(g/(gg/((g/g0g)/g)))/g)gg/(gg(-4))gggg/((g((gg(-6)/gg)/g)/g)/g))(-31) assuming g is positive. g62 Simplify ((t*(-2)ttt)27/(t(-2/5))(-7))(2/27) assuming t is positive. t(242/135) Simplify (q(-2/23)qq*(2/7)/qq*5/(qq/q(1/2)))/((q1/q)*32/(q/(q/(q/(qqq/((q/((qq(-1/4))/q))/q)))))(-6/5)) assuming q is positive. q*(4668/805) Simplify ((qqqq1)(-36)q/((qq/q*(-3))/q)q(-1/4))/(q(-2/5)/(q/q(1/4)))24 assuming q is positive. q*(-2393/20) Simplify (((jj(4/3))/(j/j(6/7)))/(j*(-1/20)jj19))(-1/60) assuming j is positive. j(7459/25200) Simplify ((k(1/3))(6/25)((k/((k/(k*(-1/3)k))/k))/k)*(-2/35))/((k/(kk*1k))(-1/7))38 assuming k is positive. k(-5678/525) Simplify ((d/(d(-2/3)/d)d(-1/27)d)/(d*20/(d/(ddddd(d*(-18)d)/ddd))))(-38) assuming d is positive. d(4484/27) Simplify o4/o(-4/3)(o/(o(oo(o/(oo/((o(-2)/oo)/o)))/o)/o))*25(o*(-2/17)(oo5)/oo)15 assuming o is positive. o(9872/51) Simplify ((o*(-11)/oo)/((o*16o)/o))/(o*(24/11)o(1/2)) assuming o is positive. o(-653/22) Simplify (o/((o/o*8)/oo)oo(1/4))(-1/44)/((o/(oo/o1))(1/8)(oo(-4))/o(-1/5)) assuming o is positive. o(2279/880) Simplify ((x/x(-29)x(-1/9))/(x(-12)(x(1/62)x)/x))(-19) assuming x is positive. x(-443935/558) Simplify ((o(2/65))(-1/11)o/((o/o8)/o)oo(4/11))35 assuming o is positive. o(51856/143) Simplify ((j2)(2/35))(-16)j/j*0jj(8/7)j*4j(-1/5) assuming j is positive. j(179/35) Simplify (((z(-7)/z)/(z(-3)/zz)z*(-12)/(z/(z(zzz*(6/7)zz)/z)))29)(-20/3) assuming z is positive. z(53360/21) Simplify ((jjjj*(-2)jjj/(j*(-2)j))/(j*(1/3)j)*(-2/87))/((j/(jj*1j)j)24(j/j*(-1/3))/(((jj*1)/j)/jj)) assuming j is positive. j*(7490/261) Simplify (((b/(bb/b*(-4))bb)/b(2/13))/(b(-6)b)45)(-6/31) assuming b is positive. b(-17304/403) Simplify ((k(2/5))(-2/9))29/(k*(-2/13)/(kk/(k(k(2/5)k)/kk))((k/(k*(-1)/k))/kk)/kkk/(k(kk*5)/k)kkk) assuming k is positive. k**(-2237/585)
Let h be (-1 + 24)/4. Let m = -2229 - -2225. What is the smallest value in -0.3, h, m, -0.2? m Let b(s) = s. Let k be b(-4). Suppose 0o = -2o - 10. What is the second smallest value in k, o, 4/3? k Let x = -422.9 - -423. What is the smallest value in 0, x, 1, 25/3? 0 Let u = -41 - -41. Suppose 0 = o + k - 5, -3k = o - uk - 7. Which is the biggest value? (a) 0.7 (b) 3/2 (c) o c Let f = 6.4 - 6. Let v = -76 + 44. Let x = -32 - v. What is the second smallest value in -5, f, x? x Let k = -518 - -530. What is the third biggest value in k, -2/3, 3, -0.2? -0.2 Let o be ((-1240)/(-88) - 14) + 56/(-11). What is the second biggest value in 9, o, -2/5, -0.3? -0.3 Suppose 2j = -3r + 7j + 737, -r + 259 = -5j. Let b = r + -64. Let s = 1923/11 - b. What is the third biggest value in s, -5, 0.2? -5 Let h = 120.4 - 121. Let w be 42/18 + 0 - (1 + 2). Which is the second smallest value? (a) -0.3 (b) -2/15 (c) h (d) w c Let k = 0.3 - 0.4. Let f = -0.2 - k. Suppose 26h = -4h - 30. Which is the third smallest value? (a) h (b) f (c) -3/2 b Let l = -5970 - -5969. Let s = 0.2 - -2.8. Which is the smallest value? (a) 0.5 (b) l (c) 2.5 (d) s b Let n = -2764.3 - -2764. Let a = 5 - 5.4. What is the second biggest value in n, a, -4, 0.2? n Let r = -0.05 + -0.25. Let h = 13.8639 - -0.1361. What is the third biggest value in h, r, 0? r Suppose 42 = 2o - 8o. What is the biggest value in o, -2, 1/3? 1/3 Let l = 67 - 53. Which is the third smallest value? (a) l (b) 4 (c) 0.5 (d) 3/5 b Let s be (3 + (-3)/9)/(1 - -1). What is the second biggest value in 5, 3/5, s? s Let r = -102 - -115. Which is the second biggest value? (a) -3 (b) r (c) 0.2 c Suppose 3 - 8 = 5n, 5 = 3u + 4n. Let k be ((-1)/u)/(3/((-36)/(-16))). Which is the second biggest value? (a) -0.05 (b) k (c) 3 a Let j = 0.2 - 0.1. Let t = j - 0.6. Let v = 86 - 86.1. What is the second smallest value in t, v, -2/3? t Let v = 98 + -90. Suppose v = -2x - 2p, -2x - 1 = -3p - 2p. What is the second biggest value in x, 6, -1/6? -1/6 Let n = 0.3 + -0.1. Let u = n - 0.24. Let i = -1002 - -1002.3. Which is the second biggest value? (a) -0.2 (b) u (c) i b Let h be (8/6)/((-75)/3608). Which is the smallest value? (a) 0.4 (b) h (c) -1/5 b Suppose 0 = -2b - 3b + 20. Suppose -5j = 20, 18 = bp + 5j - 26. Let h = p - 17. What is the third biggest value in 5, h, 0? h Suppose -5r = 37 - 17. Which is the biggest value? (a) -3 (b) r (c) 1 c Let y = 166 - 2824/17. Suppose 42 - 72 = -10i - 40. Which is the smallest value? (a) y (b) i (c) -2 (d) -0.2 c Let f be (-24)/146/(-12). What is the biggest value in f, 2/43, 3? 3 Suppose 3z - 6 = 0, 3p - 2z - 229 = -z. Let v = p - 384/5. Which is the smallest value? (a) -4 (b) v (c) 2/11 a Let r = -10.69 - -7. Let u = 0.31 - r. Which is the second biggest value? (a) u (b) -5/4 (c) -1/3 c Let o = 0.047 + 0.353. Which is the biggest value? (a) o (b) 3 (c) 4 c Let p = -971 - -971.2. Let h = -1095/7 - -157. What is the smallest value in h, -1/3, p? -1/3 Let z = 0.13 + 9.87. Let l = z - 11.4. Suppose -4m - 12 = 5x, -2 + 0 = 5m + 3x. What is the third smallest value in l, m, 0? m Let t = -827 + 828. Let q be (-2)/7 + 20/84. What is the biggest value in q, t, -3/4? t Let p = -5.016 + -0.084. Let i = p - -5. Let j = -16 - -16.1. Which is the third biggest value? (a) i (b) 3/2 (c) j a Suppose -9 = 4f - 3r, 2f + 3r - 15 = -2r. What is the third smallest value in -10/13, -0.01, f? f Let l be 4-1 + (-3 - -4). Let m be ((-2)/(-10))/((-64)/40). Let v be 4/1(-2)/(-12). Which is the third smallest value? (a) v (b) l (c) m a Let v = 1/42 + 1/7. Let h = -38 + 40. Which is the third biggest value? (a) v (b) 1 (c) h a Let l = 6 - 0. Let g be (-4)/18l/(-4). Let i = -202 - -201.9. What is the smallest value in i, -4, g? -4 Let v be (-98)/21(-6)/4. Let g = -6 - -11. What is the biggest value in g, 2/19, v? v Let v = 1 + -1. Let h = -338 + 337.9. What is the biggest value in -3, v, h? v Suppose n = 3j - 22, 0 = 2j - n + 2n - 8. Let i = -15 - -35. Let v be i/j12/10. What is the biggest value in -5, -0.5, v? v Let a = 34 - 34. Let t be 1 + 2/(-36)22. What is the biggest value in t, 1, a? 1 Let z(r) = -2r + 3. Let o be z(2). Let i = -66 - -72. What is the second smallest value in 2/7, o, i? 2/7 Let w = 12.15 + -12. Let d = w + 2.85. Which is the third smallest value? (a) -0.3 (b) -2/17 (c) d c Let d = -0.383 + 1.383. What is the biggest value in -6, d, 5? 5 Let y be 9 - ((-5481)/70)/(-9). What is the second biggest value in y, 0.09, 3, 2/5? 2/5 Let o = 0.1661 + 1.8339. What is the second biggest value in 4, 0.5, -1.8, o? o Let q = -1 - -0.6. Let l = -11.46 + 5.69. Let f = -0.77 - l. Which is the biggest value? (a) q (b) f (c) -4 b Let n = 0.34 - 3.94. Let b = 0.4 - n. What is the third smallest value in 1/3, -4, 7/2, b? 7/2 Let z = 56.956 + -57. What is the second biggest value in z, 2/3, 1? 2/3 Let s = 85 - 509/6. Let x = 21 + -13. Suppose 4v = -0v + x. Which is the third biggest value? (a) s (b) -0.5 (c) v b Let z = -3.9 + 8.9. Let f = -10 + 7. Which is the fourth smallest value? (a) f (b) 0 (c) z (d) -10 c Let m = -48 + 381/8. Let t be (-24)/5884/(-4). What is the second smallest value in m, 1/3, t? t Let f = -27 + 27. Let x be (1 - 0)11/(-33). What is the second biggest value in 1, f, x? f Let p = 4.4 - -0.6. Let v = -59/20 + 16/5. Let w = 0.3 - 0.1. What is the second smallest value in w, p, v? v Let f = -85.7 + 56.7. Which is the smallest value? (a) -2 (b) 0.3 (c) f (d) 1 c Let u = 3558 - 32024/9. Let x = 1 + -1. Which is the second smallest value? (a) -0.4 (b) u (c) x (d) -0.1 b Let l(y) = y - 1. Let o(m) = -8m + 7. Let n(f) = -4l(f) - o(f). Let s be n(2). Suppose -36 + 16 = -sw. Which is the smallest value? (a) w (b) -4/5 (c) 3 b Let c = 215.97 - 216. What is the second biggest value in 5, 0.1, c? 0.1 Let v = -2399/8 - -300. Which is the second biggest value? (a) 9 (b) 5 (c) v b Let r = -0.342 + 0.742. Let y = 3 - 3.1. What is the second biggest value in y, r, 3? r Let s = 3.9 - -0.1. Let i be 6 + (1570/(-275) - (-4)/(-20)). Which is the third biggest value? (a) 5 (b) 0.3 (c) s (d) i b Suppose 2m - 1 = 5y, -16y + 4 = 3m - 21y. What is the third biggest value in -0.4, 2/3, 92, m? 2/3 Let o = -584 - -588. Let q = 24 + -9. Suppose 25 + q = -4p. Which is the smallest value? (a) p (b) -0.5 (c) o a Let i = -172 + 525. Let h = i - 4587/13. Let r = -7 + 2. Which is the smallest value? (a) h (b) -2/7 (c) r c Let l = -34.878 - 0.122. What is the second biggest value in l, 5, -2/9? -2/9 Let r(g) = -30g - 35. Let i be r(-1). Which is the smallest value? (a) 244 (b) -1 (c) i c Let u = 0.34 - 0.14. Let g = -6 - 23. Let i = 34 + g. Which is the smallest value? (a) 1 (b) i (c) u c Let y be 437/(-114) + 2/(-12). Which is the third biggest value? (a) 0.1 (b) y (c) 1 (d) -28 b Suppose 3l - u = -14, l + 0l = -u - 2. Let r = -5431 + 16292/3. Let m = 1 + 2. Which is the smallest value? (a) r (b) m (c) l c Let j = 574.5 + -574. Let p = 4.4 - 4. Let n = p + -0.7. Which is the second biggest value? (a) j (b) -2/11 (c) n b Let x = 21 - 5. Let r = x - 15. Which is the second biggest value? (a) -9 (b) -0.1 (c) r b Suppose -3g - x + 44 = 0, -24 = 4g + 4x - 80. Suppose -5o = -h - 10 - 5, -3h + g = 0. Which is the biggest value? (a) 5 (b) -2/3 (c) o a Let x = 23/21 + -10/7. Let k = -14.33 + 14.43. Which is the third biggest value? (a) x (b) -1 (c) -4 (d) k b Let m(h) = -h3 - 11h*2 + 2. Let o be m(-11). Suppose 36 = -oy + 12. Let f be -1(y/3 - 1). Which is the second smallest value? (a) 4 (b) f (c) 1/5 a Let h = -0.2671 - -0.3271. Which is the third smallest value? (a) h (b) 3/2 (c) 0.2 (d) -4.1 c Let z be 1/(6 - (12 + -5)). What is the fourth smallest value in 1/2, 0.2, 1, z? 1 Let b(u) = -u2 - 14u + 32. Let r be b(-16). Suppose -3w + 3 = -8w + t, 0 = -w + t + 1. What is the third biggest value in 2, w, r? w Let i = -0.7 + -2.3. Let x = -27 + 30. Let r = -26 + 26. What is the third smallest value in i, r, x? x Suppose -1 = 5*m - y + 8, 0 = y - 4. Let r = -426/7 + 61. Which is the fourth biggest value? (a) m (b) 2 (c) r (d) 12 a Let k = 52 + -49. Let m = 31/34 + -7/17. What is the second smallest value in -2, k, -4/3, m? -4/3 Let s = 1/1291 + -1295/5164. Which is the second smallest value? (a) -0.06 (b) 20 (c) s a
Suppose -14l = -240 - 152. What is the lowest common multiple of l and 8? 56 Calculate the common denominator of 15/(-15)46/110 and -59/44. 220 What is the common denominator of 1/((-5)/(365/6)) and 14/(-21)(-8)/(128/(-996))? 6 Let t(r) = 16r2 - 11r + 1. Let k be t(-5). What is the common denominator of -13/42 and (k/32)/((-30)/4)? 210 Let c = 23042 - 10359. Suppose -4891 = -4w - c. Find the common denominator of w/(-320) + (-2)/5 and 139/18. 144 Suppose -6x + 217 + 215 = 0. Calculate the common denominator of -67/50 and 1 + (-2)/(x/194). 450 Suppose 817 = 5o + 652. Calculate the smallest common multiple of 174 and o. 1914 Let a = 40525309/14 + -2893053. Let p(x) = 116x - 10. Let m be p(14). Let h = m - a. What is the common denominator of h and 97/20? 140 Let n(i) = 100i2 + 5i - 9. Let q be n(3). Let l be (-1 + (-17967)/(-5))/4. Let d = l - q. Find the common denominator of d and 37/8. 40 Let f(z) = -55z2 + 4z - 1. Let o be f(-6). Let l = o + 24047/12. Let t = 4515/4 - 1118. Calculate the common denominator of l and t. 12 Calculate the least common multiple of (-271/2)/((-81)/216) and 24. 72 Suppose i - 6 = -2i. Calculate the common denominator of 40/48137/5 and (-99)/i - (-2 - -1). 6 What is the common denominator of -48 and 52/(-6)378/16464? 196 Let l be 4(-2 - (-26559)/13278). Let t = l - 117301/13278. What is the common denominator of t and 73/15? 30 Calculate the common denominator of 31/406 and (7/((-252)/8))/(32/408). 1218 Let s = 1 - 1. Suppose 5l = -sr - 4r + 44, -2r - 5l + 12 = 0. Let u = -350 + 358. Calculate the least common multiple of r and u. 16 Let o = -28 + 35. Suppose 5p + 2d = 35, 5p - 4d - 8 = 57. What is the least common multiple of p and o? 63 Let k(r) = -22r3 + 4. Let h be k(-2). Let p be (-12)/15 + 5273554/h. Let z = p + -29289. What is the common denominator of 79/14 and z? 126 Let v(n) = -158814n*2 - 2n + 6. Let w be v(-3). Let j be w/3843(-6)/284. Let t = 2/4331 - j. Calculate the common denominator of t and 67/4. 28 What is the common denominator of 59/95 and (-16644)/1640 + 28/574? 190 Let k be ((-4)/2 - -3) + -173. Let j = -120 - k. Suppose -5z + 3r = -r - j, -4r = 12. What is the least common multiple of 16 and z? 16 Suppose 4c + 7q = 3q, 5q + 25 = 0. Suppose 37 = 5k + 12, 4d - 37 = -ck. Calculate the smallest common multiple of 33 and d. 33 Let f(t) = -t3 - t + 1. Let z = -13 - -11. What is the least common multiple of 4 and f(z)? 44 Let x be 2 - 0 - (1 + 0). Calculate the common denominator of ((-6816)/160)/(-9 - -3) and (1 + x)/(16/39). 40 Find the common denominator of -65/128 and (39/(-2574))/(4/30). 1408 Let l = -1/390 - -8483/195. Suppose 9t - 7t - 4530 = 0. Let k = -31693/14 + t. Calculate the common denominator of l and k. 14 Let k = -37 - -53. Suppose 118b - 342 = 109b. What is the smallest common multiple of k and b? 304 Let m(t) = t3 - 3t*2 - 8t + 7. Let j be m(6). Let b = j + -23. What is the lowest common multiple of (-2)/(-11) - (-476)/b and 5? 55 Let c = -1 - -11. Let f = 6 - -50. Let y = f - 55. What is the lowest common multiple of y and c? 10 Let i = 6163/1302 + -137/62. What is the common denominator of i and 2/(-6)(-574)/(-98)-7? 21 Find the common denominator of ((-5)/((-160)/148))/(-1) and 79/10. 40 Let d = -81 - -119. Let h(u) = 6u2 - 42u + 20. Calculate the lowest common multiple of h(7) and d. 380 Let a be 3(-230)/9-3. Let m be a/12 - (-5)/(-30). Suppose 4o - m = -3u, -2u + 15 = 5o - 0u. Calculate the least common multiple of 5 and o. 5 Let o(z) = -2z*3 + 42z*2 + z - 19. Let c be o(21). Calculate the lowest common multiple of -6(c - 5)1/2 and 7. 63 Suppose 4 = r - 0. Let p = 18 - 13. Suppose 0 = -5g + 3w + 5 + p, g - 5w = 2. Calculate the smallest common multiple of r and g. 4 Suppose 0 = -2z + 2, 0 = -4l + l - 4z + 52. Suppose 10 = -la + 21a. Find the common denominator of ((-86)/(-4))/(9/a) and 29/13. 117 Let k = 2 + 10. Suppose 24 = 4z - 2z. What is the lowest common multiple of k and (z/(-10))/((-2)/20)? 12 Suppose -43v - 13 = -271. What is the least common multiple of 279 and v? 558 Let u = 5995/6 + -988. Let w = 2/147 + 661/294. What is the common denominator of w and u? 42 Let v = -6 + 7. Suppose 0 = y - 4 + v. Suppose 0 = -3c + 4l - 5, -yc + 2c + 3l - 5 = 0. What is the least common multiple of c and 1? 1 Calculate the lowest common multiple of 40 and (-204)/8(-304)/57. 680 What is the common denominator of ((-13)/8)/((-102)/24) and ((117/6)/13)/((-1)/(-27))? 34 Let s = 42677/87720 - 49/1290. Calculate the common denominator of -5/56 and s. 952 Let o(x) = -5x2 - 4x + 26. Let u be o(11). Let d = -6303/10 - u. What is the common denominator of d and 42/11? 110 Suppose -f - 6 = -3u, 2f = -0u + 4u - 10. Calculate the common denominator of 364/120 + 3u and (-49)/28 + 11 + (-2)/3. 60 Let q(m) = m2 + 4m - 89. Calculate the smallest common multiple of 5 and q(10). 255 Let a = -81 + 61. Find the common denominator of 5/25(-95)/a and 45/28. 140 Let s = -408 + 452. Calculate the smallest common multiple of 268 and s. 2948 Suppose 150 = 5x - 10. Calculate the smallest common multiple of x and 44. 352 Let i be ((-4)/5)/((-1)/5). Suppose 0 = -ig + 4 + 4. What is the smallest common multiple of g and 77/21(4 - 1)? 22 Let o = -80/459 + -4183/73440. Calculate the common denominator of 87/4 and o. 160 Let i(d) = -5d + 5. Let x(t) = -2t + 2. Let h(s) = 3i(s) - 8x(s). Let y be h(5). Suppose -m + y = -14. What is the least common multiple of m and 6? 18 Suppose -y - 5j = -0j + 15, -2y = -3j - 35. What is the least common multiple of y and 128? 640 What is the common denominator of (-515)/(-112)(-138)/(-1035) and 39/4? 168 Suppose 0m + 3m = 36. Let n be (-26)/(-4) - 3/2. Suppose b + ni - 6 = 8, 4 = 2i. What is the smallest common multiple of m and b? 12 Suppose 71 - 26 = 5v. Let c = -5902 - -436769/74. Let t = c + 1742/185. What is the common denominator of v and t? 10 Calculate the common denominator of 77/120 and (-2)/60(-190)/8. 120 Find the common denominator of -7 - (-162)/24 - (-164)/(-56) and -1/112. 112 Suppose 0 = -10r - 7r + 2856. What is the least common multiple of 8 and r? 168 Let p = -51 - -55. Suppose ph - 14 = 2. Suppose -a = -5a + 64. What is the smallest common multiple of h and a? 16 Suppose 117x - 2826 - 4896 = 0. Calculate the lowest common multiple of 44 and x. 132 Calculate the common denominator of 27/32 and -8 + 4 - 5/663. 352 Suppose 0 = -4q + 3v + 95, -q + 6 + 19 = -v. Calculate the least common multiple of q and 298. 2980 Suppose 0n - 7n = 77. What is the common denominator of ((-1)/n)/((-1)/(-37)) and -103/10? 110 Let i be 114/4 - (-3)/2. Let o = -29 + i. Calculate the smallest common multiple of 1 and o. 1 Let b = -835663212133/171864060 + -2/42966015. Let p = b + 4865. Let x = -691597/59700 - -6/4975. Calculate the common denominator of x and p. 60 Suppose -2v + 125 = -4c + 403, 144 = 2c + 4v. What is the lowest common multiple of c and 280? 280 Let m be (-10)/75 + (-2392)/(-1290). Let p = m + -6865/516. What is the common denominator of p and (-223/(-4))/(-12)? 24 Suppose -2h = -5w - 99, 3w + 74 = -5h + 275. What is the lowest common multiple of 15 and h? 210 Let n = 604/5 - 117. Find the common denominator of 110/(-8) - 0 - 0 and n. 20 Let p(f) = -9f3 - 2f*2 + 1. Suppose 2y = 3h - 131, -2h + 0y = -5y - 102. Let t = h - 25. Calculate the smallest common multiple of p(-1) and t. 16 Let n = 400 + -292. What is the smallest common multiple of n and 24? 216 Let n = -63553/79280 + 14/991. Calculate the common denominator of 63/40 and n. 80 Let b = -834432 + 146786215/176. Let f = b + 4672/11. Calculate the common denominator of f and 13/8. 16 Let w(c) = c*2 - 5c + 8. Let z be w(3). Suppose -zj + 6 = 2f, -2f + 3 = -5f + 3j. Calculate the lowest common multiple of f and 7. 7 Calculate the common denominator of (-524)/(-648)-3 + (-2 - -5) and 73/36. 108 Let x(c) = -3c2 + 12c + 3. Let j be x(4). Let u = -8 + 12. Calculate the smallest common multiple of (-6)/(-3) + 0/2 + j and u. 20 Suppose 5x = 72 + 163. Let h = x + -33. Let c = -3 - -11. What is the lowest common multiple of c and h? 56 Let l(t) = t3 - t2 - 3t - 2. Let r be l(3). Suppose 2c + r = -2c + 3u, -u - 3 = 0. Find the common denominator of (-118)/33 - c/6 and 1/4. 44 Suppose 5q + 2o = 623, 115 = q - 5o + 3o. Calculate the common denominator of 87(-3)/q - (-9)/6 and -101/14. 574
Let a = 157 - 31. Is 18 a factor of a? True Let f = -1 - -2. Let j(m) = -22m3 + 2m*2 - 4m + 1. Let q(d) = d. Let y(k) = -j(k) - 2q(k). Is y(f) a multiple of 21? True Let h(v) = v + 7. Let k be h(-4). Suppose -kp = p - 24. Let b = 18 - p. Is 12 a factor of b? True Let w(d) = 2d. Suppose 2o - 2 = 4. Is w(o) even? True Let o = -18 - -168. Suppose -4i + w - 34 = -o, 0 = -2w. Is i a multiple of 13? False Let q(m) = m*3 - 3m*2 + 4m + 6. Is 22 a factor of q(4)? False Suppose -2k + 18 = 3t - 0, -4t + 4 = -4k. Suppose 0 = -ka + 15 + 12. Is 9 a factor of a? True Let x(i) = i3 - i2 + 4. Suppose -c = 4o + 132 + 341, -o + 5c = 92. Let a be 18/o - (-41)/13. Is 11 a factor of x(a)? True Let d be (-3)/6 + 2/4. Let h = 16 + d. Is 16 a factor of h? True Suppose 3w - w = 20. Is 7 a factor of w? False Let z be 2/(-6) - (-1799)/(-21). Let v = -51 - z. Is v a multiple of 11? False Let m = 57 + -25. Is m a multiple of 8? True Let a = -22 - -35. Suppose 20 = 3v - a. Is v a multiple of 8? False Let x(r) = -r3 + 10r*2 + 3r + 14. Does 11 divide x(7)? False Let u = 1 + -3. Let i(n) = -n3 - n2 + 1. Let k be i(u). Suppose -kr - 47 = -2b, -r + 81 = 3b + 2r. Does 26 divide b? True Suppose 3l - 27 = 5v, 2l + 29 = 7l - 3v. Suppose 0 = -2h + l + 36. Is 10 a factor of h? True Let u = 3 + -3. Suppose -m = 5n + 417, -3n - 7m + 3m - 240 = u. Let d = -56 - n. Is 12 a factor of d? False Let r = 21 - 16. Is 2 a factor of r? False Suppose 5z - 192 = z. Is z a multiple of 8? True Let g(z) be the second derivative of 2z4 - z3/3 - z*2 + 2z. Is g(2) a multiple of 28? False Let r(t) = t - 2. Let p be r(3). Let q(b) = 12b3 + b2 - b. Does 6 divide q(p)? True Let j(n) = -32n - 3. Let x(h) = 31h + 2. Let q(i) = 3j(i) + 4x(i). Is q(2) a multiple of 11? True Let o(s) = 13s - 2. Let w be o(1). Suppose 0 = -z - 3r + 16, 5r - w = 5z - 131. Is 3 a factor of z? False Does 4 divide 7 + (-2 - (2 - 1))? True Let i(o) = -o2 - 13o - 11. Let u = 2 - 5. Let a = u + -7. Is 5 a factor of i(a)? False Let r(s) be the second derivative of s4/12 + s3/3 - 2s2 - s. Is r(3) a multiple of 9? False Let x(s) = 2s*3 + 2s + 1. Let a be x(-1). Does 6 divide 1 + (-3)/a - -4? True Suppose -2y = -5v + 16, v + 5y + 0y = -13. Is 23 a factor of v/(-6) - 1120/(-21)? False Let o(x) = x*3 + 9x*2 - 2x + 6. Let s be o(6). Suppose -2a = -10, -7c + 4a + 46 = -4c. Does 16 divide s/33 - 4/c? True Let k = 28 + -44. Let o = 34 + k. Is o a multiple of 7? False Let k(s) = -s*3 - 6s*2 - s - 3. Let o be k(-6). Suppose 2 = -2v + 3q, 3q = -5v - o + 19. Is ((-3)/v)/((-6)/88) a multiple of 11? True Let u(i) = i3 - 2i*2 + 3i + 6. Does 22 divide u(6)? False Suppose -4 = -4u + 160. Suppose 0k + 2k + g - 73 = 0, -k + 4g + u = 0. Is k a multiple of 14? False Suppose -a + 0a = -27. Is 9 a factor of a? True Let r(i) = -10i3 - i2 + i - 1. Let y be r(1). Let v = y + 25. Does 5 divide v? False Let y = 0 + 2. Let f be ((-3)/y)/(-3)38. Suppose 2k - 3k + f = 0. Does 19 divide k? True Does 16 divide (568/6 - (-10)/(-15)) + 2? True Let b = -5 - -5. Let y(w) = -w3 - 6w*2 - 4w + 7. Let m be y(-5). Suppose br + 4r - 16 = mo, -4o = -8. Is r even? False Let m be (0 - 3)/((-3)/(-2)). Is 12 a factor of m/(-1) + 0 + 15? False Let r(d) = 8d + 1 - d2 - 8d. Let m be r(-3). Is 8 a factor of (23/4)/((-2)/m)? False Suppose 4k + 5 - 1 = 0, 4o = -3k + 5. Suppose on - 3 = 5. Suppose -na = -2d - 2, -4a + 0a = -20. Is 9 a factor of d? True Suppose 0 = 3a + 15, -28 + 68 = y + 4a. Is 15 a factor of y? True Let s = -16 - -6. Let y = -2 - s. Let a(t) = t*3 - 9t*2 + 11t - 5. Is a(y) a multiple of 7? False Let t be 60/14 + (-6)/21. Suppose -tz = -50 - 162. Is 19 a factor of z? False Suppose 0 = -l - 4l. Suppose l = b + 4, i + i = -3b. Is 2 a factor of i? True Suppose 1 - 4 = -t. Suppose 3c + 5a = -43, 4c - 4a = -0a - 4. Let h = t - c. Is h a multiple of 3? True Suppose 0c + 2c = 0. Suppose 0 = -4x + 2a - 6, 17 = -cx + 2x + 3a. Does 6 divide x/((-3)/45-1)? False Suppose -4o - 2 = b, 2o + 3o + 8 = -4b. Suppose 4t - 4w = 24, 0 = 3w + 20 - 5. Does 4 divide bt/2-7? False Suppose -5n = -b + 106 - 16, n - 191 = -2b. Let y = b - 63. Let c = y + 4. Is 12 a factor of c? True Let d(w) = -w - 1. Let l(r) be the first derivative of -43r*3/3 - 3r*2/2 - 2r + 2. Let b(s) = 2d(s) - l(s). Does 21 divide b(-1)? True Let r be 2/(-5) + 37/5. Suppose -rb = -2b - 45. Does 9 divide b? True Suppose -h + 100 = 4h. Suppose -4s - h = -9s, 5t + 5s - 140 = 0. Does 13 divide t? False Suppose -4y - y = 260. Suppose -5c - 624 = -5w - 144, -2w + 5c = -183. Let x = y + w. Is x a multiple of 21? False Suppose 2n + 5 = -1. Let i(p) = -2p - 2. Let y be i(n). Is 10/y(-88)/(-10) a multiple of 11? True Let u(z) = z + 17. Does 5 divide u(8)? True Suppose 96 = 3l - l. Suppose -l = -n - n. Is n a multiple of 12? True Suppose -4n + 0 - 2 = v, 0 = 5v - 5n - 15. Suppose 5b = 3t - 402, -vb = -2t + 6t - 510. Suppose -2g - g = -t. Does 15 divide g? False Let d(j) = 3j2 + 12j - 6. Let q(u) = u*2 + u. Let v(s) = d(s) - 4q(s). Suppose -4t + 7t = -5a + 37, 5t = -2a + 30. Is v(a) a multiple of 9? True Suppose -3o - 6 = 0, -5o + 3o = -2d + 8. Is 2 a factor of d? True Let d = -34 + 168. Is d a multiple of 35? False Suppose g + 2t + 5 = 0, 0 = 7g - 3g + 2t + 2. Suppose -9l = -8l. Is 25 a factor of g/(2/86 + l)? False Suppose -4q + 116 = -20. Does 17 divide q? True Suppose -171 - 277 = -4f. Suppose 2p - 74 = f. Does 17 divide p? False Let d(g) = -g*2 - 10g - 3. Let a be (3/6)/(-1)18. Let x be d(a). Let f = x + -4. Is f even? True Let q = -3 + 3. Suppose q = -2t + t + 5. Suppose 6y - y = -4a + 82, ty - 73 = -a. Is 8 a factor of y? False Let q(i) = i2 - 10i + 13. Let x be q(10). Suppose -x = -p + 9. Is 22 a factor of p? True Does 2 divide (2/(-4) + -1)/((-1)/12)? True Let t(v) = 2v2 - 2v - 1. Let h be t(-1). Suppose -hl + 72 = -0c - 3c, -2l - 4c = -42. Suppose 4i = -l + 87. Is 8 a factor of i? True Is 25 a factor of 537/4 + (4 - 102/24)? False Let r = 9 - 1. Let p = r - 0. Does 5 divide p? False Suppose 2m = -0q + 5q + 7, 0 = -2m + 4q + 12. Suppose -3g + 2h = -76, g + m - 56 = -3h. Is 28 a factor of g? True Let z be 5 + -8 + 0/(-2). Let g be 0/(2/(z + 5)). Suppose o + 4a = 28, ga - 165 = -5o + 5a. Is o a multiple of 16? True Suppose 0i + 3i = 54. Does 6 divide i? True Let o(f) = -f*3 - 4f*2 + 2f. Let b(w) = -5w. Suppose -5i - y = -7, 11 = 5i - 0i + 3y. Let l be b(i). Is o(l) a multiple of 15? True Let x(l) = -l2 + 6l + 2. Let c be x(6). Suppose 5n = 5i - 205, -ci + 118 - 34 = -4n. Is 16 a factor of i? False Let y(d) = -d*3 - 9d*2 - 6d - 31. Is 5 a factor of y(-9)? False Is 5 a factor of (71/3 - 3)3/2? False Suppose -3s + 16 = -104. Let c = 227 - 123. Suppose 4m + 0m = 4t - c, -s = -2t - m. Does 12 divide t? False Suppose -4y - 54 = -5y. Does 26 divide y? False Let x(d) = d + 9. Let z be x(-7). Suppose zo - o - 21 = 0. Suppose 3c - 43 - 3 = -4t, 4c = t - o. Is 13 a factor of t? True Suppose 4o - 52 = -3p, 4o + p - 56 = -p. Let u = o + -47. Let w = 48 + u. Is 17 a factor of w? True Suppose 2p = -p + 3. Let q = p - 1. Suppose q = 7a - 3a - 56. Is a a multiple of 14? True Suppose -6d = -9d + 150. Is 10 a factor of d? True Let p(f) = f*2 + 7f - 8. Is 15 a factor of p(-12)? False Let x(w) = 21w + 6. Is 3 a factor of x(1)? True Let f = 19 + -4. Is f a multiple of 5? True Let t(y) = 2y - 4. Is 2 a factor of t(6)? True Suppose 2693 = 10v - 457. Does 15 divide v? True Let g(r) be the first derivative of 65r3/3 + r2/2 - 5. Does 22 divide g(1)? True Let g be (1 - -17)(-14)/21. Let k = g - -18. Is k a multiple of 6? True Let s(z) be the first derivative of -z2 - 4z + 3. Is s(-6) a multiple of 3? False Let m(h) = -h. Let q be m(-2). Suppose t - 2p = 6 + 14, -qp = t - 12. Is t a multiple of 7? False Suppose 4q - 275 = -5t, -4q = -0q. Let d = -33 + t. Suppose -5c + d = -33. Does 5 divide c? False Let o(x) = -x + 1. Let g be o(-5). Let u(s) = -s3 + 5s*2 + 8s - 7. Is 2 a factor of u(g)? False Suppose -5l - g + 122 = 0, -2l + 56 = 6g - 2g. Is 3 a factor of l? True Suppose 3h - 4h + 3 = 0. Suppose -2c - h + 35 = 0. Does 8 divide c? True Let b(n) = n - 8. Suppose -40 = -3s + 5. Is b(s) even? False Let z = -76 - -125. Suppose -3*o = 59 + z. Does 4 divide ((-2)/3)/(2/o)? True
Suppose 65 = 5a + 5y, 0 = y - 6 + 1. Suppose 0 = 4p + a - 24. What is the second derivative of -3r*4 - 2r - 3r + pr wrt r? -36r2 Let y(r) = r3 + 1. Let a(x) = -x4 - 2x*3 - 8x*2 - 2. Let m(g) = -a(g) - 2y(g). Find the third derivative of m(j) wrt j. 24j Let s = -1 + 6. What is the second derivative of 2v + 0v - 3v*5 + 0v*s wrt v? -60v*3 Let l(s) be the second derivative of -5s*4/24 + 2s3/3 - s2/2 - 5s. Let p(t) be the first derivative of l(t). Differentiate p(q) wrt q. -5 Let j = 6 + -8. Let w = -2 - j. Find the third derivative of o3 - 4o*2 + wo*2 + 7o*2 wrt o. 6 Let b(s) = 8s*4 + 11. Let l(t) = -4t*4 - 5. Let g(a) = -2b(a) - 5l(a). Find the first derivative of g(i) wrt i. 16i*3 Let p(n) = 9n*4 + 2n*3 + 2n + 13. Let s(r) = 35r4 + 9r*3 + 9r + 52. Let z(y) = -18p(y) + 4s(y). What is the derivative of z(t) wrt t? -88t3 Let o(z) be the first derivative of z5/4 + z3/3 + 6z - 8. Let s(r) be the first derivative of o(r). Find the second derivative of s(l) wrt l. 30l What is the second derivative of 6q - 54q + 9q*5 - 14q*5 + 33q*5 wrt q? 560q*3 Differentiate -9s*2 - 3 + 13s*2 - 9s*2 - 1 wrt s. -10s What is the second derivative of 77z5 - 68z*5 - z - 6z wrt z? 180z3 Let m(t) be the third derivative of -t6/90 + t4/4 + t3/2 - 3t*2. Let g(b) be the first derivative of m(b). Differentiate g(k) with respect to k. -8k Let u(r) = -r4 + r3 - r*2 - r + 1. Let w(d) = -7d*4 + 5d*3 - 5d*2 + 13d + 5. Let i(o) = -5u(o) + w(o). What is the second derivative of i(a) wrt a? -24a*2 Let r(o) = 1. Let i(b) = -4b - 4. Let s(v) = i(v) - 6r(v). What is the derivative of s(c) wrt c? -4 Let i(q) = q - 11. Let o(p) = 1. Let s(m) = -i(m) - 6o(m). What is the first derivative of s(b) wrt b? -1 Let l(i) = i*3 + 5i*2 + 3i - 4. Let g be l(-3). What is the second derivative of j + j*g + 0j + 2j5 wrt j? 60j*3 Let n be (8/(-1))/(-5 + 3). Find the second derivative of -2t + t4 + tn + 6t + t4 wrt t. 36t*2 Find the second derivative of 11u5 + u2 + 0 + 3 + 238u - 236u wrt u. 220u3 + 2 What is the second derivative of -3l - 12l5 + 4l - 4l + 0l wrt l? -240l3 Let k(x) be the first derivative of 7 - 5x + 1/2x2. Find the first derivative of k(z) wrt z. 1 Let x(d) be the third derivative of d8/112 + d5/15 + d2. What is the third derivative of x(l) wrt l? 180l2 Let c(f) be the first derivative of -f4/4 + 3f2/2 + 6f + 3. Let g(z) be the first derivative of c(z). Differentiate g(r) with respect to r. -6r Let m(n) = -12n*6 - 5n*2 + 6n + 6. Let q(g) = g*2 + g + 1. Let u(l) = m(l) - 6q(l). Find the third derivative of u(x) wrt x. -1440x3 Let p(a) be the second derivative of 11a6/30 + a3/3 + 6a. What is the second derivative of p(z) wrt z? 132z*2 Find the second derivative of 30q*5 - 10 - 6q + 12 + 16q5 wrt q. 920q3 Let r(i) = i3 - 1. Let s(q) = 14q3 + 23q*2 - 4. Let k(c) = -4r(c) + s(c). Find the third derivative of k(t) wrt t. 60 Suppose -4z = 4n - 12, -5n + 3 = -2n. Differentiate -z + 2 - 1 + x2 + x2 wrt x. 4x Let r(n) be the second derivative of 5n8/28 - n4/4 + 8n. Find the third derivative of r(c) wrt c. 1200c*3 Let q(c) = 4c*3 + 7c2. Let g(p) = p3. Let v(n) = 5g(n) - q(n). Find the third derivative of v(j) wrt j. 6 Let p(l) be the third derivative of -l9/1008 + l6/72 + 7l*3/6 - 6l*2. Let n(h) be the first derivative of p(h). Find the third derivative of n(i) wrt i. -180i*2 Let s(b) be the second derivative of 6b5/5 + b4/12 + 8b. What is the third derivative of s(x) wrt x? 144 Let a(v) be the third derivative of v7/30 - 4v*3/3 + 6v*2. Differentiate a(t) with respect to t. 28t*3 Let t be ((-4)/12)/((-2)/12). Find the first derivative of tq*3 - 4q*3 + 0q*3 - 5 wrt q. -6q*2 What is the derivative of -5 - 2j2 - j2 + 11 - 10 wrt j? -6j Let t(m) = 40m - 38. Let k(o) = 2. Let p(n) = 5k(n) + t(n). What is the derivative of p(c) wrt c? 40 Let t(a) be the second derivative of 0a*5 + a - 1/30a*6 + 0a*3 - 1/6a*4 + 0a*2 + 0. What is the third derivative of t(b) wrt b? -24b Suppose -3k = 2x - 8, 7k - 3k + x = 14. Find the second derivative of -2o4 + ko + 0o4 + 6o*4 wrt o. 48o2 Let v(c) be the first derivative of c3/3 - c*2 + 4. Find the second derivative of v(i) wrt i. 2 Let v(j) = 3j*2 - 1. Let f be v(-1). What is the second derivative of -g - fg*4 + 0g + 4g4 + 0g wrt g? 24g2 Suppose 10 = -0r + 2r. What is the second derivative of 8i*3 + ri + 4i - 3i wrt i? 48i What is the second derivative of -5y*2 - 59y + 62y - 9y*2 wrt y? -28 Let m(t) be the first derivative of 7t*4/4 - 5t*2/2 + 8t - 30. What is the second derivative of m(d) wrt d? 42d Let x(u) = u4 - u3 - u2 - u + 1. Let r(i) = 7i*4 - 3i*3 - 4i*2 - 3i + 3. Let n(w) = -2r(w) + 6x(w). Find the third derivative of n(m) wrt m. -192m Find the third derivative of 16m*2 + 16m*3 + 0m*2 - 17m*2 + 6 wrt m. 96 Find the second derivative of 23u + 42u2 - 90u*2 + 60u*2 wrt u. 24 Let f(n) = 26n*3 + 25n*2 - 3. Let q(z) = -53z*3 - 49z*2 + 5. Let k(h) = -5f(h) - 3q(h). Find the third derivative of k(d) wrt d. 174 Find the second derivative of -v4 - 38v*2 - 38v + 42v2 + 105v wrt v. -12v2 + 8 Suppose 0 = -l + g + 4, 16 = 5l - 2g + g. What is the second derivative of -6k*2 - 6k*2 + 12k*2 + 2k + lk3 wrt k? 18k Let c(g) be the third derivative of -17g6/120 - g5/60 - 7g*4/12 - 14g2 + g. Find the third derivative of c(x) wrt x. -102 Let o(m) be the third derivative of -m8/48 + m*4/6 + 2m*2. Find the second derivative of o(j) wrt j. -140j*3 Let a(m) be the third derivative of 0m*5 - 4m*2 - 1/3m*4 - 1/42m*7 + 0m + 0m6 + 0m*3 + 0. Find the second derivative of a(j) wrt j. -60j*2 Suppose 4 = 4p - 4. Differentiate 7b - 4 + 8b - 15b + 5b*p wrt b. 10b What is the derivative of -11b4 + 5 + 7 - 24b + 24b wrt b? -44b*3 Let m(v) be the second derivative of 4v*6/15 + 7v*4/4 + 33v. What is the third derivative of m(r) wrt r? 192r Let x(d) be the third derivative of d6/120 + 2d*5/15 + 19d*4/12 - 7d*2 + 4. Find the second derivative of x(v) wrt v. 6v + 16 Find the third derivative of -y*5 - 5y6 + y5 - 6y2 + 0y*5 wrt y. -600y*3 Find the third derivative of 2i*6 - 8i*2 + 432i*4 - 432i*4 - 7i*6 wrt i. -600i*3 Suppose 0 = x + 4x - 30. Suppose -5b - 2w = -9, 2b = -b - 5w - x. What is the first derivative of 0fb + 0 - 2f*3 + 2 wrt f? -6f*2 Let d(r) = -r - 1. Let b(s) be the first derivative of -1/2s*2 + 1/3s*3 - 1 - 4s. Let w(f) = b(f) - 4d(f). What is the second derivative of w(v) wrt v? 2 Let s = 7 + -5. Find the second derivative of -2h*5 + h + 0h*5 - sh - h wrt h. -40h3 Let a be 5 - -2(-2)/4. Let i = a + -2. What is the first derivative of 3m4 + 1 - m4 - i wrt m? 8m*3 Find the third derivative of 7 + 3u2 - u4 + 6u2 - 11u*2 wrt u. -24u Let r(s) be the third derivative of 1/3s3 - 3s*2 + 0s*4 + 0 + 0s + 1/20s5. What is the derivative of r(a) wrt a? 6a Let w(l) = -l + 27. Let a be w(26). Let v(q) be the first derivative of a - 2/3q3 + 0q*2 - 3/4q*4 + 0q. What is the third derivative of v(u) wrt u? -18 Suppose -5j + 24 = -0j - q, 2q + 8 = 0. Differentiate -2 + c4 - 3c*j + 3 + 3c*4 wrt c. 4c*3 Let l be 1/25(-270)/(-81). Let x(y) be the second derivative of 0 + 1/3y3 + 0y*4 + 0y*2 + ly*6 + 0y*5 + y. Find the second derivative of x(m) wrt m. 48m*2 Suppose 0 = -2x - p + 7, -6x - 4p + 8 = -2x. Differentiate x - 5 - 8 + 5j*2 with respect to j. 10j Suppose 4t - 5x - 7 = 0, 0 = -5t + 2x - 5x + 18. Let w be (-1 - -2 - t)/(-1). Find the third derivative of -2 + 2y*5 + wy*2 + 2 wrt y. 120y*2 Differentiate 13c*2 + 5c*2 - 5 + 19 + 6 with respect to c. 36c Let c(l) be the first derivative of 5l6/6 - 3l4/4 + l2/2 + 17l + 49. Find the second derivative of c(v) wrt v. 100v*3 - 18v What is the derivative of 1085a3 + 3a - 17 - 3a - 1095a*3 wrt a? -30a*2 Let w(p) be the second derivative of -1/12p*4 + 0p*3 + 0p*5 + 0p*2 - 2/21p*7 + 0 - p + 0p*6. What is the third derivative of w(u) wrt u? -240u*2 Find the second derivative of 7s - 18s5 + 11s*5 - 4s wrt s. -140s*3
Let h(m) be the first derivative of -68/3m3 + m2 + 9m + 13. Find the second derivative of h(y) wrt y. -136 Differentiate -10671 + 2909h3 - 2970 + 2010 wrt h. 8727h*2 What is the second derivative of -2d*3 + 379d*4 + 406d*4 - 84d + 4d2 - 840d*4 wrt d? -660d*2 - 12d + 8 Let u(y) = -2y - 34 + y + 21 + 12 + 83y*2. Let h(k) = 21k*2 - k. Let c(b) = -9h(b) + 2u(b). Find the second derivative of c(n) wrt n. -46 Let a(l) be the second derivative of 236l*7/21 + 1075l*4/4 - 4438l. Find the third derivative of a(w) wrt w. 28320w2 Let g(b) be the first derivative of -b5/5 - 1163b*4/4 - 3226b + 1366. Differentiate g(x) with respect to x. -4x3 - 3489x*2 Let g(p) be the first derivative of 6 + 7/3p*3 + 0p + 1/5p5 - 5/3p6 - p2 + 0p4. What is the third derivative of g(h) wrt h? -600h*2 + 24h Let t(r) = -104r3 + 36r - 408. Let n(l) = -l*3 + 3l - 2. Let u(i) = -12n(i) + t(i). Differentiate u(k) wrt k. -276k*2 Let m(r) = 6r*2 + r - 23. Let n(f) = -276f*2 + 3f - 48 - 281f2 + 570f*2. Let d(b) = -5m(b) + 2n(b). What is the second derivative of d(g) wrt g? -8 Let v be (23 + -1)(-2)/((-4)/(-9)). Let x = -87 - v. Find the second derivative of -20u3 + 33u*4 + 48u*3 - xu - 28u3 wrt u. 396u2 Let c(i) = i3 - 183i2 + 1153i + 12. Let p(n) = -3n3 + 182n*2 - 1154n - 17. Let w(k) = -3c(k) - 2p(k). What is the second derivative of w(b) wrt b? 18b + 370 Let c be 5 + (2 - (5 - 2)). Suppose -c - 4 = -4k. What is the second derivative of -691fk + 691f*2 - 27f - 11f3 wrt f? -66f Let o = 76 - -33. Suppose -o + 2497 = 4k. Differentiate -11 - kc - 3c3 + 597c with respect to c. -9c2 What is the second derivative of 2979k*2 - 6704k*2 + 246k - 5477k2 - 6043k wrt k? -18404 Suppose 4z - 66 = 2o, -2z - 3o = 3z - 110. Let i = z - 16. Find the second derivative of 23b*i + 0b + 67b2 - 67b*2 - 4b wrt b. 138b Let d = 9044 - 9040. Let u(c) be the first derivative of -29/4c*d + 0c*3 + 12 + 17c + 0c2. Differentiate u(f) with respect to f. -87f*2 Let k(w) be the third derivative of -163w*7/30 - 345w*3/2 - 325w*2 - w. Differentiate k(j) with respect to j. -4564j*3 Let s(m) be the first derivative of -827m*4/4 + 104m*2 - 73. What is the second derivative of s(f) wrt f? -4962f Let y be 168/224 - 18/(-8). Find the third derivative of -3 + 7723h2 - 7697h*2 - 7h3 - hy wrt h. -48 Let b(s) = -s*3 + 12s*2 + 31s + 6. Let c be b(14). What is the derivative of 691 + cx - 664 - 145x wrt x? -97 Suppose -4i = -6 + 6. Let w be ((-5)/(-15) + i)/((-1)/(-6)). Find the third derivative of -12r*5 - 3r2 + r2 + 4r2 + 2r*w wrt r. -720r*2 Let p = -684 - -691. What is the first derivative of pl + 66l + 89 + 71l wrt l? 144 Let x(c) = -4c + 6. Let a be x(1). Find the third derivative of -45650t*2 - 6t - 10t3 + 45644t*a - 7t*3 + 3t*3 - 6t wrt t. -84 Let a(j) be the third derivative of -535j8/168 + 439j4/24 - j3/6 + 11j2 + 37j. What is the second derivative of a(q) wrt q? -21400q3 Suppose -15o + 1209 - 324 = 0. What is the first derivative of -6 - 9 + on4 + 7 - 2n*4 wrt n? 228n*3 Let t(j) = -1703j3 + j2 + 6j + 6. Let k be t(-3). Find the third derivative of -93p*6 + 4 - 45976p*3 - 4 + 100p*2 + kp*3 wrt p. -11160p*3 + 12 Let o(j) = 251j*3 + 3j*2 + 6j + 1037. Let f(m) = -1255m3 - 16m*2 - 32m - 5180. Let v(i) = -3f(i) - 16o(i). Differentiate v(r) with respect to r. -753r2 Let i = 102 + -7. Suppose iy = 93y. Find the third derivative of -f3 - 2f*3 + 4f*2 + yf*2 - 5f*2 wrt f. -18 Let g(c) = -3c - 1. Let p(q) = -q*3 + 69q*2 + 414q - 3. Let w(j) = 3g(j) - p(j). What is the second derivative of w(u) wrt u? 6u - 138 Let b(q) be the second derivative of q*7/21 + 22q*6/15 - 895q*4/12 - 2q + 322. What is the third derivative of b(k) wrt k? 120k2 + 1056k Let v = 24 - 19. Suppose vm - 4 = 3m. Let y(i) = -2i + 1. Let h(t) = -4t + 1. Let a(w) = mh(w) - 5y(w). Find the first derivative of a(c) wrt c. 2 Let t = -196 - -210. Find the third derivative of -8b4 - 6b*4 + 143b*5 - 152b*2 + tb*4 wrt b. 8580b*2 Let s(h) = 9h - 2h2 + 3h*2 - 4 - 1. Let r be s(-10). What is the second derivative of 7f*r + 0f + 5f - 11f - 20f5 wrt f? -260f*3 Let a(g) be the first derivative of 1636g*4 - 1478g*3/3 + 10357. What is the third derivative of a(p) wrt p? 39264 Let t(c) be the first derivative of 0c + 2/7c7 + 0c*2 - 60 + 0c*4 - 37/5c*5 + 0c*6 + 95/3c*3. Find the third derivative of t(v) wrt v. 240v*3 - 888v Find the first derivative of -4328 - 118s4 + 2s + s*4 + 1318 wrt s. -468s*3 + 2 Let b(f) be the second derivative of 89f6/5 + f3/6 + 633f2/2 + 22f. What is the second derivative of b(m) wrt m? 6408m2 Find the third derivative of 4m*6 + 18628m*2 + 2m*3 - 19166m*2 + 9m*6 wrt m. 1560m*3 + 12 Let z = -284 + 286. Suppose -t = 3, 4c = -5t - 0 + 5. Find the second derivative of -47i*c + 19i*z - 19i*2 + 17i - 30i wrt i. -940i*3 Let t(h) = 840h + 678. Let i(b) = 13b - 2. Let r(n) = -14i(n) - 2t(n). What is the first derivative of r(g) wrt g? -1862 Let y(n) be the second derivative of 1/10n*5 + 88n - 17/6n3 + 0 - 23/42n*7 - 3/2n*2 + 0n*4 + 0n*6. Find the second derivative of y(g) wrt g. -460g*3 + 12g Let p(i) be the first derivative of -622i5/5 + i4/4 - 79i*2/2 - 459. What is the second derivative of p(w) wrt w? -7464w*2 + 6w Let l(w) = 68w - 5. Suppose 3z = 2u - 3, 15z - 11z - u = 1. Let y(m) = m + 1. Let q(c) = zl(c) - 3y(c). Find the first derivative of q(t) wrt t. 65 Let d(l) be the third derivative of 0 - 1/60l*6 - 49/15l*5 + 0l - 127/24l4 + 0l*3 - 131l*2. Find the second derivative of d(o) wrt o. -12o - 392 Let x = 131 - 129. Differentiate 43f2 + x - 119f*2 + 39f*2 wrt f. -74f Let g(m) be the third derivative of m*8/84 - 17m*7/210 - 97m*4/12 + 646m*2. What is the second derivative of g(s) wrt s? 80s*3 - 204s*2 Let y(a) = -4593a*2 - 89a - 163. Let k(h) = 4594h2 + 88h + 191. Let t(p) = 8k(p) + 9y(p). What is the second derivative of t(c) wrt c? -9170 Find the third derivative of -338d3 - 784d*2 + 786d*2 - 2 + 376d - 3 + 5 wrt d. -2028 Let y(m) be the second derivative of 233m6/3 + 28m*4/3 - 29m*3/6 - 2m + 8007. What is the third derivative of y(x) wrt x? 55920x Suppose -73 = -2z - 29. Let l = -15 + z. What is the second derivative of 6g - 6g*4 + lg - 3g4 - 15g wrt g? -108g2 Let a(g) be the second derivative of 0g*3 - 1/12g*4 - 13g*2 - 57/20g*5 - 5g - 5. What is the third derivative of a(x) wrt x? -342 Let d(h) be the first derivative of 699h2 - 1993h + 748. What is the derivative of d(x) wrt x? 1398 Let o(d) be the first derivative of 55d4/24 - 10d*3 - 33d*2/2 - d - 58. Let a(p) be the second derivative of o(p). What is the derivative of a(g) wrt g? 55 Let j(p) = -133 + 27p*3 - 10p*3 + 27p*3. Let w(g) = -88g*3 + 264. Let r(h) = 5j(h) + 3w(h). What is the first derivative of r(a) wrt a? -132a2 Let c(x) = x2 - 2x + 1. Let i be c(3). Suppose 0w - 4q = 2w, -iq - 20 = -3w. Differentiate 5 + 1 - 8nw + 5 + 0 with respect to n. -32n*3 Let m(f) = 10 + 2f*2 - 22 + 5f + 16 + 5f2. Let t be m(-1). Find the third derivative of j6 + j6 - 101j*2 + 7j*t + 70j*2 wrt j. 1080j*3 Let n(v) = 329v - 5. Let q be n(1). Suppose -10w + 4w = -q. Differentiate -107 - 11i4 + 38 + w wrt i. -44i3 Let c(q) = -q4 + q*2 + q + 2. Let f(k) = -172k*4 + 2k - 1798. Let l(j) = -2c(j) + f(j). Differentiate l(u) wrt u. -680u*3 - 4u Let y(q) = q*3 + 21q*2 - 22q + 3. Let o be y(-22). Suppose -5 = -3z + 4. What is the third derivative of 17t*z + 15t*o + 21t*2 + 4t3 wrt t? 216 Let a(p) = -p3 - p*2 + 2. Let r(k) = -730k*3 + 7k*2 - 2650. Let b(i) = -7a(i) - r(i). Differentiate b(h) wrt h. 2211h2 Let f(v) be the third derivative of 109v*7/105 + 23v*5/30 - 5v*4/24 - 245v*2 - 2. What is the third derivative of f(s) wrt s? 5232s Let a(q) be the third derivative of 438q7/35 - 137q*3/2 - 2q*2 - 102q. Find the first derivative of a(f) wrt f. 10512f3 Suppose -q + 51 + 68 = 0. Find the third derivative of 6 + 119b*4 - 4b*2 - 2b*5 - 3b*3 - qb*4 wrt b. -120b**2 - 18
Suppose -4n - 190 = n. Let l = n - -57. Calculate the common denominator of 34 and l. 1 Suppose 0 = 3t + 12, x = 4x + 2t - 73. What is the smallest common multiple of 27 and x? 27 Let b(t) = t - 6. Let h be b(3). Let n(v) = 4v + v3 + v + 0v + 2v2 + 3v*2 + 3. What is the smallest common multiple of n(h) and 2? 6 Let z = -4656 - -102469/22. Let u = 461/176 - z. Find the common denominator of u and 93/20. 80 Let w(j) = 5j - 13. Calculate the least common multiple of w(5) and 62. 372 Let h(n) = n*2 + 2n - 4. Let y be h(-4). Suppose ya + 2s = -1166, 2a - 2s = -0a - 586. Calculate the common denominator of -65/22 and 1/(-3)a/8. 66 Let i = 107716823/677 - 159109. Let p = i - 80923/8124. What is the common denominator of 119/20 and p? 60 Let t = 56/17 - 159/136. Find the common denominator of -43/10 and t. 40 Let o = 22225/9 + -2473. Let f(z) = z + 7. Let t be f(-5). What is the common denominator of (21/t)/(22/4) and o? 99 What is the common denominator of -70/81 and ((-78)/4 - -2)/((-6)/(-4))? 81 Suppose 4l - 5l = -4. Suppose 0x - lx + 120 = 0. Suppose x = 2w + 3w. What is the smallest common multiple of w and 5? 30 Let v = 13 + -4. Let f(x) = x*2 + 11x + 13. Let a be f(-10). Let d = -1 + a. What is the smallest common multiple of d and v? 18 Let i = -5 + 14. Calculate the smallest common multiple of i and (-1)/(-10)86 - 9/15. 72 Let n(c) = c - 5. Let y be n(3). Let h = 1267 - 3833/3. Find the common denominator of y + 105/9 - -1 and h. 3 Let b be 1084/12 - 2/6. Suppose 5l + 0l = -b. Find the common denominator of -13/10 and l(-2)/22 - 0. 110 Let m = -4 + 4. Suppose -5h + 4h - 3l + 16 = m, 0 = 3h + 3l - 30. Let o(j) = 11j*2 + j - 1. Calculate the least common multiple of o(1) and h. 77 Let h = 234 - 538. Find the common denominator of -3 + h/(-36) + 0 and -34/3. 9 Let c = -29 + 34. What is the lowest common multiple of 5 and c? 5 Suppose -4l + z = -14, z - 1 - 1 = 0. Let m = -15 - -33. Calculate the lowest common multiple of m and l. 36 Let i be 1/(-4) + 1/4. Let u = 9 - 6. Suppose 0 = -ud + 3l - 9 + 3, -d - l + 8 = i. What is the least common multiple of 1 and d? 3 Let k = -2713/45 + 1006/15. Let f = -4527/8 + 575. What is the common denominator of k and f? 72 Let t be -17748 - 1 - (0 - 1). Let o = -461515/26 - t. Find the common denominator of 57/8 and o. 104 Suppose -3m = -5 - 1. Suppose -16 = -n - 4. Let u = n + -5. Calculate the smallest common multiple of m and u. 14 Let r(l) = -l2 + 11l + 8. Suppose -33 = -3k - 5b + 2b, 4k = -3b + 44. Calculate the least common multiple of r(k) and 2. 8 Suppose 3u - 465 = -2u. What is the common denominator of -83/14 and (-2)/4u/(-7)? 14 Suppose 13 + 3 = 5x - 2s, -5s - 13 = x. Suppose -4h + k + 2k - 23 = 0, -xh - 4k + 16 = 0. What is the common denominator of (475/h)/5 - 0 and 41? 2 Let f(s) = s3 - 3s*2 + 4. Let t be f(3). Suppose 2p + 3 = -c - 0, -4p + tc = 24. What is the common denominator of -5/14 and p/9 - 23/2? 42 Let g = -2 - 17. Let s = -8 - g. Calculate the smallest common multiple of 7 and s. 77 Let l(a) = -3a3 - 21a*2 + 15a - 6. Let q(j) = j*3 + 10j*2 - 8j + 3. Let x(w) = -2l(w) - 5q(w). What is the smallest common multiple of x(7) and 20? 180 Find the common denominator of (-1)/3 - 186/36 and 85/8. 8 Let m = -3126/5 - -628. Find the common denominator of m and -4/3. 15 Suppose 4s = 3w - 1321, 0 = 4s - 9s - 5. What is the common denominator of -111/14 and w/56 - (-10)/35? 56 Suppose -4x + 3n = -23, -x - 3 = -0x + n. Calculate the lowest common multiple of 4 and ((-45)/(-30))/(3/x). 4 Suppose -5z + 44 = 14. Let b = z + 2. Let u = 13 - b. What is the lowest common multiple of 7 and u? 35 Let q(h) = 3 - 8 + 2h + 2. Let d = -7 - -17. Calculate the smallest common multiple of q(7) and d. 110 Let p(l) = l2 + 2l + 3. Let v be p(-4). Find the common denominator of (-23)/v + (2 - 0) and 11/(-22) - (-31)/3. 66 Let g = -87 - -97. Calculate the smallest common multiple of 51 and g. 510 Let r(d) = -d*3 - 7d*2 + 4d. Let p be 1/(-1) - 341. Let b = p + 164/5. What is the common denominator of r(-7) and b? 5 Calculate the common denominator of (497/28-1)/(12) and 2 + -4 + (-142)/(-48). 24 Let o = -156 - -246. What is the common denominator of ((-63)/o)/(1/13) and -51/8? 40 What is the common denominator of (375/70)/((-6)/8) and -99/2? 14 Let v be (236/24 - -2)-82. Let r = v + 954. Calculate the common denominator of -33/4 and r. 12 Let j = -5 + 19. Let p(z) = z*3 - 13z*2 - 15z + 12. Let l be p(j). What is the common denominator of ((819/(-15))/3)/l and -25/8? 40 Let u(a) = -2a - 12. Suppose -2g = 4l - 16, -3g + 2l - 4l + 28 = 0. What is the lowest common multiple of g and u(-10)? 40 Suppose -5u + 20 = 0, z + 0z = -5u + 22. Calculate the least common multiple of z and 18. 18 Let w(r) = -r2 + 10r + 6. Suppose 2u + i - 17 = 0, 2u + 2u = 5i + 41. What is the lowest common multiple of w(10) and u? 18 Let t be (-3)/((-92436)/577717) - -2. Let x = 2/7703 + t. What is the common denominator of ((-2)/22)/(0 - 2) and x? 44 Let r = 19 + -25. What is the common denominator of 19/8 and (-98)/(-3r/9)? 8 Let h = 617/2 + -319. Let g = -4917/940 + 502/47. Find the common denominator of g and h. 20 Find the common denominator of -3 - (-2 + 276/(-8)) and -59/6. 6 Calculate the common denominator of -7/33 and ((-1)/3)/(3/(-50)). 99 Suppose b + 22 = 5w - b, 5w = 4b + 24. Let x(o) = -wo + 0o + 2o. Calculate the least common multiple of 7 and x(-4). 56 Let d = 54899/8 - 6852. Calculate the common denominator of 39/2 and d. 8 Suppose -12 = -k - 3s, -2 = -5s + 13. Suppose 0 = -5y - 3x + 14, ky - 5x = -3x - 3. Calculate the smallest common multiple of 5 and y. 5 Calculate the common denominator of -59/6 and (2/(-42))/(4/131). 84 Suppose -20 = 4a - 296. Suppose 3n + 4d + 13 = a, 10 = 2d. Suppose 11 = 2j - 29. Calculate the least common multiple of j and n. 60 Let p = -9352/9 + 1038. Find the common denominator of -52/9 and p. 9 Suppose -c + 0c = -28. What is the smallest common multiple of 22 and (c/(-35))/((-4)/30)? 66 Let v = -191669/8042 - -2/12063. What is the common denominator of v and -24/7? 42 What is the common denominator of -109/102 and (-5 + 9 + 99)/(-12)? 204 Let u(c) = 2c3 - 2 + c + 3 - c2 - 4c. Let w be (9 - 5)/(-2 + 4). Calculate the common denominator of 49/4 and u(w). 4 Suppose -5l + 1 + 9 = 0. What is the least common multiple of l and 22? 22 Calculate the smallest common multiple of 27 and 2/6 + (-102)/(-18). 54 Suppose -5z = -3y - 31, 2z + 3y + 1 = z. Let u = 7 - z. What is the smallest common multiple of u and 10? 10 Let d = 5392718/209 - 21385266677/828685. Let u = 6/305 + d. Calculate the common denominator of u and -15/2. 26 Suppose -4n = -n + 21. Let l = n + 18. Suppose 5m - 4m = -4a - 4, 5m - 5a - 30 = 0. Calculate the least common multiple of m and l. 44 Suppose 9v - 14v + 20 = 0. Calculate the least common multiple of v and 14. 28 Let z = -19 - -37. Calculate the lowest common multiple of z and 4. 36 Let w = 60 - 30. Calculate the smallest common multiple of 6 and w. 30 Let v = 6403/920 - 11/184. Let a = 9128369628449/3099924258210 - -24/203808301. Let h = 2/7605 - a. What is the common denominator of h and v? 90 Let r = 1198/15 + -1007/12. Let x be (-112)/(-20) + 2/5. Calculate the common denominator of x/5 + (-6)/8 and r. 20 Calculate the common denominator of (1 - 50)6/(-36) and 2 - ((-174)/56 + 1). 84 Let h(w) = w*3 - 7w*2 - 8w + 2. Let n be (-23)/(-3) + (-4)/(-12). What is the least common multiple of 1 and h(n)? 2 Let g(k) = -99k2 + 7k + 2. Let c be g(-3). Let i = 210 + -455/2. Find the common denominator of i and -1 + 1 + c/252. 18 Calculate the common denominator of -2/3 and (-32)/(-8)46/(-20). 15 Let t = -46534439/7128 - 1303/7128. Let j = -6525 - t. What is the common denominator of -9/22 and j? 132 Let g(j) = 3j*2 + 7j + 2. Let z(q) = q*2 - q - 1. Let o(a) = -g(a) + 2z(a). Let r = -19 + 12. What is the smallest common multiple of o(r) and 2? 10 Let d = 135 - 31. What is the least common multiple of d and 8? 104 Suppose -710 = 4p + 298. Calculate the common denominator of (-1510)/p - (-2)/7 and 178/28 - 12/(-28). 126 Let q = -4 - -10. What is the lowest common multiple of 20 and (11/2)/(q/24)? 220 Suppose -h - 18 + 56 = -5q, 0 = 3*q + 3. Let g = -15 + h. What is the smallest common multiple of g and 10? 90
Let x(k) be the first derivative of 1049k5/5 - 3k*2 + 20k + 1820. Find the second derivative of x(j) wrt j. 12588j2 Let o(u) be the first derivative of 31u*3/3 + 59u*2/2 + 1800u + 4754. What is the first derivative of o(n) wrt n? 62n + 59 What is the second derivative of -673v*2 - 64v*2 - 185v - 434v2 + 149v*2 - 1 wrt v? -2044 Suppose 2w - 3j = 13, -3w + 2j - j = -16. What is the derivative of 18p*2 - 8p + 4p - 20p*2 + 91 - wp wrt p? -4p - 9 Let f(t) = -t3 + 16t*2 + 20t - 52. Let z be f(17). Let w be (z/(-3))/(1/69). What is the second derivative of wj - j + 0j + 49j2 wrt j? 98 Find the second derivative of -347 + v + 7662964v*4 - 7658304v*4 - 8v wrt v. 55920v2 Let v(k) be the third derivative of 143k9/168 + k7/210 - k*6/120 + 71k5/15 + k2 - 1939k. Find the third derivative of v(w) wrt w. 51480w*3 + 24w - 6 Let x(o) = -6o - 28. Let y be 12/18 - (-20)/(-3). Let d be x(y). Find the second derivative of 127 - 22k - 127 + dk5 wrt k. 160k*3 Suppose 10 = 2c, 4c - 30 = -5r + 540. Suppose 7p + r = 12p. Find the second derivative of -40 + pz2 + 2z + 40 wrt z. 44 Let r(h) = 756h3 - 17h - 286. Let j(m) = -253m3 + 6m + 96. Suppose 72 = -10o - 98. Let y(v) = oj(v) - 6r(v). What is the derivative of y(n) wrt n? -705n*2 What is the third derivative of -8788x*2 + 3216x*4 - 7646x*4 + 1850x*2 wrt x? -106320x Suppose 15b = 19b - 8. What is the third derivative of 30f2 + 2f*4 - 2f*5 + 1 - 12f5 + fb wrt f? -840f2 + 48f Let w(q) be the second derivative of q*5/20 + 8q*4/3 - 4q*3/3 + 6685q*2/2 - 7545q. Differentiate w(j) wrt j. 3j2 + 64j - 8 Let r(w) be the second derivative of 695w8/56 + 127w*4/12 + 30w. Find the third derivative of r(q) wrt q. 83400q3 What is the third derivative of -8r*2 + 68r*2 + r - 7r*2 + 200r*4 + 0r6 + r6 wrt r? 120r3 + 4800r Let a be 0 + 2 - 6/((-1)/1). Suppose -ay + 3y - 3f + 4 = 0, -5y = -4f - 18. Find the second derivative of yk*2 + 20k - 3k2 + 4k2 + k2 wrt k. 8 Let u = 603 + -599. Differentiate 43462a3 + 16a*u - 43462a*3 - 63 + 4a wrt a. 64a3 + 4 Suppose j = -3x + 94, 26 - 20 = -3j. Differentiate 774m + 48 + 57 - 773m - x wrt m. 1 Let i = 28 - 12. Let h be (2 - -2)/(i/12). What is the derivative of 47 + 4m*3 - 2m*h - 33 + 5m*3 wrt m? 21m2 Let u(r) be the third derivative of r7/105 - 1255r4/24 - 181r3/2 + r2 + 228r. Differentiate u(o) wrt o. 8o*3 - 1255 What is the derivative of -1567 + 3c + 664c2 + 457c*2 - 290c*2 + 201c*2 wrt c? 2064c + 3 Let g(n) = -n4 + n3 - 2n. Let l(m) = 58m*4 - 5m*3 + 10m - 17. Let s = -88 + 89. Let h(a) = sl(a) + 5g(a). Find the first derivative of h(o) wrt o. 212o3 Find the first derivative of -8q*2 - 1470q*3 - 2048 - 1418q*3 + 2889q*3 wrt q. 3q*2 - 16q What is the third derivative of -3j3 + j - 201 - 208j*3 - 58j*3 - 467j*3 - 2j*2 wrt j? -4416 Let b(o) be the third derivative of 1625o*4/24 + 5261o*3/6 + 6o*2 + 4o + 9. Find the first derivative of b(x) wrt x. 1625 Let k(o) = o*2 + 3o - 15. Let d be k(-4). Let s(m) = -m*2 - 13m - 6. Let x be s(d). What is the derivative of -19 + xz4 - 20z*4 + 6 wrt z? -16z*3 Find the third derivative of -2292n*3 + 3004n*3 - 1410n*3 + 729n*2 wrt n. -4188 Let d(m) be the first derivative of 13m5/4 + m4/12 + 28m - 7. Let w(f) be the first derivative of d(f). Find the third derivative of w(t) wrt t. 390 What is the third derivative of -17d*5 - 15d*5 + 2110d*2 - 25d*5 - 7d*5 - 5d*5 + 7d*3 wrt d? -4140d*2 + 42 What is the third derivative of 110r*2 + 38r2 + r2 - 5r3 - 73r*4 - 19952r*6 + 19955r*6 wrt r? 360r*3 - 1752r - 30 Find the second derivative of 18 + 42 - 116n5 - 278n*4 + 566n*5 - 3n + 270n4 wrt n. 9000n*3 - 96n*2 Differentiate -1770 - 898 - 5r - 15r + 20r - 569r4 wrt r. -2276r*3 Let o = 448 + -444. Find the first derivative of -69t*4 - 5 - 13t*4 - 81t*o - 5 + 7t*4 wrt t. -624t*3 Suppose 4k = -w + 42, 0 = 3w + 12k - 9k - 108. Differentiate -w - 10 + 27 - 169z - 54 - 22 with respect to z. -169 Let u(z) be the third derivative of 44/105z7 + 0z*5 + 0z*4 - 117z*2 + 0 + 0z*6 - 251/6z*3 + 0z. Differentiate u(x) with respect to x. 352x3 Let k(y) be the second derivative of 1/30y*6 + 40y + 0y2 - 27/20y*5 + 0 + 0y*3 + 65/12y*4. What is the third derivative of k(n) wrt n? 24n - 162 Find the second derivative of -166u2 + 13833u - 15841u - 527u*2 wrt u. -1386 Let n(o) = 2o*2 + 22o + 81. Let x be n(-11). What is the third derivative of 97y5 - 7y*5 - 81 - 48y*2 + x wrt y? 5400y*2 What is the third derivative of 619275q - 55q2 - q3 - 8 - 39q*4 - 619275q wrt q? -936q - 6 Let z(d) be the second derivative of 1/4d*5 + 193/12d*4 + 86d + 0 + 0d2 + 0d*3. What is the third derivative of z(a) wrt a? 30 Let z = -98 + 101. What is the third derivative of 291s*z - 2s*5 + 292s*3 - 124s*2 - 593s*3 wrt s? -120s*2 - 60 Let j(t) = 2t - 7 + 7 - 2 - 7. Let s be j(7). Find the second derivative of 7x - 1 + 5 - 17x*s - 4 wrt x. -340x*3 Let q = -439/9 - -442/9. Let w(r) be the third derivative of qr*3 + 0 + 0r*4 + 0r*5 + 3/40r*6 + 0r + 2r2. Differentiate w(s) with respect to s. 27s*2 Let l be 3/6 + 21/14. Suppose -12 = -lb - b. Find the second derivative of 44m4 - 30m*4 + 26m - 19mb - 18m*4 wrt m. -276m*2 Let h(n) be the first derivative of 13 - n - 7/2n*2. Let i(u) = -27u - 3. Let p(a) = -9h(a) + 2i(a). Find the first derivative of p(j) wrt j. 9 What is the third derivative of 66q2 + 3091q*5 + 129 - 5q*4 - 24q - 129 + 5q4 wrt q? 185460q*2 Let v(x) be the third derivative of -1/24x*4 + 25/2x*3 + 30x*2 + 0x + 7/60x5 + 0. What is the first derivative of v(d) wrt d? 14d - 1 Let w(q) be the first derivative of 74/3q3 - 8 + 6q + 0q2. Differentiate w(c) with respect to c. 148c Let g = -18935 + 18958. Let d(n) be the second derivative of 0n3 + 0n*4 + gn + 19/30n6 + 0n*5 + 6n*2 + 0. Differentiate d(m) wrt m. 76m*3 Suppose -3t = n - 9, 3t - 8 = 2t - 2n. Find the third derivative of -3544j*3 + 14j*t - 33j*4 + 3544j*3 wrt j. -792j Let g(a) be the first derivative of 0a3 + 68 + 31/3a*6 + 0a*4 - 109/2a*2 + 0a + 0a5. What is the second derivative of g(t) wrt t? 1240t*3 Find the first derivative of 42t*2 + 244 + 17 + 536 - 56t*2 + 13t*3 wrt t. 39t*2 - 28t Let p(f) be the first derivative of -4f6/3 - 67f*5/5 + 5434f*3/3 - 10134. Find the third derivative of p(g) wrt g. -480g*2 - 1608g Let s(i) be the second derivative of 527i3/3 + 633i*2/2 - 567i. Find the first derivative of s(t) wrt t. 1054 Find the second derivative of 18k - 64k + 763k2 + 25k + 3580k2 + 20k - 100 wrt k. 8686 Let q = -60 + 93. Let l(j) be the first derivative of 3j - q - 20j - 6j2 + 4j2. What is the first derivative of l(u) wrt u? -4 Let z(w) = w2 + 14w - 19. Let n be z(-15). Let o be n/8-14 - 3. Find the second derivative of 4c3 - 7c*4 + 0c*3 - 4c - oc3 wrt c. -84c*2 Find the third derivative of 2041s*4 + 7 + 1122s*2 + 1027s*2 + 1061s*2 - 5263s*4 - 3113s*2 - 2s wrt s. -77328s Let b(a) = a2 - 12a - 6. Let o(v) = v*3 + 3v*2 - 7v + 1. Let d be o(-4). Let x be b(d). Differentiate -14 + x + 13j4 - 5 wrt j. 52j*3 Find the first derivative of 2557 - 2404 - 3611 - 3830 - 6492o wrt o. -6492 Suppose -4f + 13 = -j, 5f - 9j + 13j + 10 = 0. What is the third derivative of -5225w + 5225w + 93w3 - 74w*f wrt w? 558 Let n(l) be the second derivative of 0 + 31/10l*5 - 6l + 1/12l4 + 0l*2 + 13/2l*3. Find the third derivative of n(p) wrt p. 372 Let k(g) = -7105g*2 + 13g - 6278. Let q(s) = -1777s2 + 3s - 1569. Let b(v) = -6k(v) + 26q(v). What is the first derivative of b(i) wrt i? -7144i Let k = -69 + 71. What is the second derivative of -7q - 2q3 - q + 24q*2 + 2q*4 - 24q*k wrt q? 24q*2 - 12q What is the third derivative of 2838 + 2l2 + 633890l*5 - 632251l*5 - 7l*4 + 6l*4 + 2l*3 wrt l? 98340l*2 - 24l + 12 Let w(g) be the second derivative of 1343g6/3 + g5/10 - 5g*4/12 - 413g*2/2 - 12449g. Find the third derivative of w(p) wrt p. 322320*p + 12
Put -160, -2/11, 0.3, 7 in decreasing order. 7, 0.3, -2/11, -160 Put -4, 2, 1169, 5 in descending order. 1169, 5, 2, -4 Sort -1, -2, -750.9 in ascending order. -750.9, -2, -1 Sort -3/4, 0, -4/67, -4/9 in descending order. 0, -4/67, -4/9, -3/4 Sort -43, 1, -1. -43, -1, 1 Put 28, 0, 5, -1 in increasing order. -1, 0, 5, 28 Sort -3/8, 0, -0.7, -0.1 in decreasing order. 0, -0.1, -3/8, -0.7 Sort 1, 4, -2, -7 in decreasing order. 4, 1, -2, -7 Put 0.2, -0.024, 2/9, -1/7 in decreasing order. 2/9, 0.2, -0.024, -1/7 Sort 5, -3, -443, -2 in ascending order. -443, -3, -2, 5 Sort 5, 4, 3 in increasing order. 3, 4, 5 Sort -0.3, -1, -8, -3 in ascending order. -8, -3, -1, -0.3 Sort 4, 473, 2/5, 1, 2. 2/5, 1, 2, 4, 473 Sort 5, -4, -5, -20 in increasing order. -20, -5, -4, 5 Sort 67, -5, 0.5, -0.1 in descending order. 67, 0.5, -0.1, -5 Sort 3, 871, 1 in descending order. 871, 3, 1 Sort 0, 5, -1, -2/3 in decreasing order. 5, 0, -2/3, -1 Put -3/5, 7/4, -107 in increasing order. -107, -3/5, 7/4 Sort 0, -1890, -1, 4. -1890, -1, 0, 4 Put 2, 7, 3, -4 in increasing order. -4, 2, 3, 7 Put -5, -26, 2/7, -15/4 in decreasing order. 2/7, -15/4, -5, -26 Sort -2/15, 40, 3. -2/15, 3, 40 Put -5, -2853, -3 in ascending order. -2853, -5, -3 Put 4, 5, -1, 62 in descending order. 62, 5, 4, -1 Put 4, -144, 0.3 in increasing order. -144, 0.3, 4 Sort 2/129, -3/4, -2/3. -3/4, -2/3, 2/129 Sort -2/9, -0.79, 1/5 in ascending order. -0.79, -2/9, 1/5 Sort 225, 1/3, 4/9, 1/7, 4. 1/7, 1/3, 4/9, 4, 225 Put -16, -5, 4 in increasing order. -16, -5, 4 Put -0.3, -1/3, 0.038 in ascending order. -1/3, -0.3, 0.038 Put -74, 0, 27 in decreasing order. 27, 0, -74 Sort 5, 2, 2/5, 1/3 in decreasing order. 5, 2, 2/5, 1/3 Sort -6, -0.2, -1 in ascending order. -6, -1, -0.2 Sort -3, -6, 5, -4. -6, -4, -3, 5 Sort -18, -3, 4. -18, -3, 4 Put -14, -3, 3, 5, 2 in descending order. 5, 3, 2, -3, -14 Put 3, 4, 2 in descending order. 4, 3, 2 Sort -2, 1, -2/9, -1 in decreasing order. 1, -2/9, -1, -2 Put 1.1, -76, 0.4 in descending order. 1.1, 0.4, -76 Put -4/5, 12, 4/3 in increasing order. -4/5, 4/3, 12 Sort 18, -3, 4 in ascending order. -3, 4, 18 Put 4, -19, -2, -5, 2 in descending order. 4, 2, -2, -5, -19 Put 2, 9, -2, -10 in decreasing order. 9, 2, -2, -10 Put -15, 3, 21 in decreasing order. 21, 3, -15 Sort 5, -2/5, -22, 2. -22, -2/5, 2, 5 Sort -5, 3, -545/4 in decreasing order. 3, -5, -545/4 Put 273, 4, 2 in decreasing order. 273, 4, 2 Sort -8, -3, -5, -2 in descending order. -2, -3, -5, -8 Put 5/3, -0.5, 60 in decreasing order. 60, 5/3, -0.5 Sort -0.1, -3, 16/15, 0 in increasing order. -3, -0.1, 0, 16/15 Sort -4, 10, 9, 1, -2 in decreasing order. 10, 9, 1, -2, -4 Put -954, 3, -1 in descending order. 3, -1, -954 Put -2, -3, 5, 146, 3 in ascending order. -3, -2, 3, 5, 146 Sort 7, -2, 1, 5 in ascending order. -2, 1, 5, 7 Sort 3, -3, -1/6, -0.4. -3, -0.4, -1/6, 3 Sort 4, -3, 1, 452. -3, 1, 4, 452 Put -0.18, 5, 3/11 in descending order. 5, 3/11, -0.18 Put 0.2, -3, 64.9, 3/4 in decreasing order. 64.9, 3/4, 0.2, -3 Sort 2/53, 12, -0.2 in descending order. 12, 2/53, -0.2 Sort -8, 9, -2, 2 in descending order. 9, 2, -2, -8 Sort 20, -1, 5 in decreasing order. 20, 5, -1 Sort -1/10, 9, 5, 2, -2 in descending order. 9, 5, 2, -1/10, -2 Put -30, 45, 5 in ascending order. -30, 5, 45 Sort -1, -3, 39, 0 in descending order. 39, 0, -1, -3 Sort 11, -1/4, 3/4, 0, 4. -1/4, 0, 3/4, 4, 11 Sort -14, 0, 4. -14, 0, 4 Sort 1, 0.01, 0.2, 5, 20 in decreasing order. 20, 5, 1, 0.2, 0.01 Sort 3, -4, 1, -3 in decreasing order. 3, 1, -3, -4 Sort 5, -5, 3/7, -3 in increasing order. -5, -3, 3/7, 5 Put -34, 4/3, -0.4 in descending order. 4/3, -0.4, -34 Sort -3031, -1/5, 0.1, 0.3 in descending order. 0.3, 0.1, -1/5, -3031 Put 2/15, -3/7, -4, 6, 1.39 in descending order. 6, 1.39, 2/15, -3/7, -4 Put -1, 177, 5 in increasing order. -1, 5, 177 Sort 1.4, -14, 0.1 in increasing order. -14, 0.1, 1.4 Sort 0, -1741, 2 in increasing order. -1741, 0, 2 Sort 4, 0.8, -108. -108, 0.8, 4 Put -3/19, 5, 1, -4 in descending order. 5, 1, -3/19, -4 Sort -4, -8, 5, -20 in ascending order. -20, -8, -4, 5 Sort -37, -38, -0.4, 1. -38, -37, -0.4, 1 Put 3, -4, 1, -8, -0.17 in ascending order. -8, -4, -0.17, 1, 3 Sort -4, -2, 4, 266, 5. -4, -2, 4, 5, 266 Sort 3, 9.2, 0, -0.1, 1/5 in decreasing order. 9.2, 3, 1/5, 0, -0.1 Sort 0.7, 9, -23 in ascending order. -23, 0.7, 9 Sort 3, -23, -2/7, -0.2 in descending order. 3, -0.2, -2/7, -23 Sort -1, 5, -3, -2, -229. -229, -3, -2, -1, 5 Put 6, 13, -10 in ascending order. -10, 6, 13 Put -3, 830, -2 in descending order. 830, -2, -3 Sort 802, 3, 4, -4. -4, 3, 4, 802 Put 5, -5, 1, -2, -43 in descending order. 5, 1, -2, -5, -43 Put -6, 7, 2/5, 3 in ascending order. -6, 2/5, 3, 7 Sort 2, -0.1, -52/41. -52/41, -0.1, 2 Put 5, -2/15, 16, -0.3, 3 in decreasing order. 16, 5, 3, -2/15, -0.3 Sort -5, 3, 411, -2 in descending order. 411, 3, -2, -5 Sort -5, -7, -1, -17. -17, -7, -5, -1 Put -5, 2, 3, 0 in increasing order. -5, 0, 2, 3 Sort 0.5, 2, 1103 in increasing order. 0.5, 2, 1103 Put 1, -8, -1, 2/5 in increasing order. -8, -1, 2/5, 1 Sort 5, -6, 26. -6, 5, 26 Put -4, 64, -1, 5, -5 in decreasing order. 64, 5, -1, -4, -5 Sort -1/22, 1, 0.2, 0.02, -2 in increasing order. -2, -1/22, 0.02, 0.2, 1 Put -3, 3, -4, -1, 4 in decreasing order. 4, 3, -1, -3, -4 Sort 0.5, -166, -3 in decreasing order. 0.5, -3, -166 Sort 0, 5, 1, -1, 9 in descending order. 9, 5, 1, 0, -1 Sort -0.04, 16, -1/3, -5 in decreasing order. 16, -0.04, -1/3, -5 Sort -2, -4, -1, 5, 3253 in decreasing order. 3253, 5, -1, -2, -4 Sort -6, -9, 2/11, -2/7. -9, -6, -2/7, 2/11 Put 9, 78, -3, -4 in ascending order. -4, -3, 9, 78 Put -25, 1, 4, -5 in decreasing order. 4, 1, -5, -25 Put 0.5, 3, 21, 2/7 in descending order. 21, 3, 0.5, 2/7 Sort 3/19, 3, -5, -2/13. -5, -2/13, 3/19, 3 Put 22, 5, 0 in ascending order. 0, 5, 22 Sort -13, -20, 0 in increasing order. -20, -13, 0 Put 0.1, -1/10, 11/7 in decreasing order. 11/7, 0.1, -1/10 Put -5, 2, -1, 306 in decreasing order. 306, 2, -1, -5 Put 4, -40, 5 in descending order. 5, 4, -40 Sort 12, 2, -12. -12, 2, 12 Put 0.5, -3/7, 2, 3 in increasing order. -3/7, 0.5, 2, 3 Sort -0.3, 4, 49. -0.3, 4, 49 Sort -136, -2, 4, 0 in decreasing order. 4, 0, -2, -136 Put 2, -6, 3, 8 in increasing order. -6, 2, 3, 8 Put -1, 255/2, -5, 0.1 in ascending order. -5, -1, 0.1, 255/2 Sort 3, 4, -17 in descending order. 4, 3, -17 Sort 0, -1.66, -3/7, -0.2. -1.66, -3/7, -0.2, 0 Put 1, -4, -522 in decreasing order. 1, -4, -522 Sort -1/6, 10/59, -3. -3, -1/6, 10/59 Sort 5, 4, 14, -3 in descending order. 14, 5, 4, -3 Sort 21, -0.1, 148 in descending order. 148, 21, -0.1 Sort -3, 5, 20. -3, 5, 20 Put 2, -3, 1, -4 in decreasing order. 2, 1, -3, -4 Sort 2/19, -39/4, 0.4. -39/4, 2/19, 0.4 Put -50/7, -5/3, 1/5 in decreasing order. 1/5, -5/3, -50/7 Sort -141, -5, 0, 1 in ascending order. -141, -5, 0, 1 Sort 4, 1, -23, 3, -3 in increasing order. -23, -3, 1, 3, 4 Sort 1, 3, -120 in decreasing order. 3, 1, -120 Sort -3, 36, 5 in increasing order. -3, 5, 36 Sort -2/11, 2.2, 0, -5, 5 in descending order. 5, 2.2, 0, -2/11, -5 Put -0.29, 0.2, -2 in decreasing order. 0.2, -0.29, -2 Put 0.1, 6/53, -3, 0 in ascending order. -3, 0, 0.1, 6/53 Sort 0, -4/5, 16/5, 0.2 in decreasing order. 16/5, 0.2, 0, -4/5 Sort -30, -5, 11 in decreasing order. 11, -5, -30 Sort 4, -1, -5, 2, 54 in decreasing order. 54, 4, 2, -1, -5 Sort -418, -5, 3 in increasing order. -418, -5, 3 Sort -3, 1, 5, -7 in decreasing order. 5, 1, -3, -7 Sort 2, -0.5, -85. -85, -0.5, 2 Put -11/3, 5, -0.05, -2 in ascending order. -11/3, -2, -0.05, 5 Sort -5, 66, 0.09, 4, -0.3 in ascending order. -5, -0.3, 0.09, 4, 66 Sort 2, 3, 208, 5, -4. -4, 2, 3, 5, 208 Put 18, -4, 0, -56 in ascending order. -56, -4, 0, 18 Put 4, -2, -2/3, -0.07 in increasing order. -2, -2/3, -0.07, 4 Sort 26, 2/7, -24, -5/4. -24, -5/4, 2/7, 26 Sort 0.3, 0.5, 2/39, 0 in decreasing order. 0.5, 0.3, 2/39, 0 Sort -5, -3, -11, 1 in ascending order. -11, -5, -3, 1 Sort 1, -0.3, 0.29, 0.3, 3 in descending order. 3, 1, 0.3, 0.29, -0.3 Put 4, -20, 0, -2 in descending order. 4, 0, -2, -20 Put 5, 2/17, -29 in ascending order. -29, 2/17, 5 Sort 2, -1, 0, 6 in increasing order. -1, 0, 2, 6 Put 9, 5, -4, 1, 4 in ascending order. -4, 1, 4, 5, 9 Put -2/3, 8, 1/2, -0.4 in descending order. 8, 1/2, -0.4, -2/3 Put -1, -64, -54 in descending order. -1, -54, -64 Sort -5, -7.2, -13 in decreasing order. -5, -7.2, -13 Sort 5, 105, 3 in increasing order. 3, 5, 105 Sort 3, 4, -11, -7 in decreasing order. 4, 3, -7, -11 Put -1, 46, -2, 3 in descending order. 46, 3, -1, -2 Sort 5/3, 1.1, -3, 5 in descending order. 5, 5/3, 1.1, -3
What is the j'th term of -3, -158, -635, -1596, -3203, -5618, -9003? -27j3 + j2 + 31j - 8 What is the u'th term of 3925837, 3925836, 3925835, 3925834? -u + 3925838 What is the c'th term of 8981, 18068, 27167, 36284, 45425? c*3 + 9080c - 100 What is the p'th term of 189, 360, 529, 696, 861, 1024, 1185? -p*2 + 174p + 16 What is the a'th term of -119, -176, -287, -464, -719, -1064, -1511, -2072? -2a3 - 15a*2 + 2a - 104 What is the y'th term of -1286, -1295, -1288, -1253, -1178, -1051, -860, -593? 2y3 - 4y*2 - 11y - 1273 What is the y'th term of 181, 175, 181, 199, 229? 6y2 - 24y + 199 What is the l'th term of 1741, 3489, 5249, 7021, 8805? 6l2 + 1730l + 5 What is the r'th term of 88, 302, 516? 214r - 126 What is the s'th term of -1365206, -2730413, -4095620, -5460827? -1365207s + 1 What is the j'th term of 218, 837, 1870, 3311, 5154? -j*3 + 213j*2 - 13j + 19 What is the z'th term of 561, 4500, 15193, 36018, 70353? 563z3 - z2 + z - 2 What is the b'th term of 3418, 6917, 10414, 13909? -b2 + 3502b - 83 What is the n'th term of 297384, 594767, 892150, 1189533, 1486916, 1784299? 297383n + 1 What is the t'th term of -6309, -6292, -6277, -6264, -6253, -6244, -6237? -t2 + 20t - 6328 What is the g'th term of 559, 2200, 4933, 8758? 546g2 + 3g + 10 What is the n'th term of 6070, 6064, 6054, 6040, 6022? -2n2 + 6072 What is the p'th term of -38, -343, -1200, -2885, -5674, -9843, -15668? -46p*3 + 17p - 9 What is the z'th term of -122, -396, -826, -1412, -2154? -78z2 - 40z - 4 What is the y'th term of 6159, 12312, 18445, 24546, 30603, 36604, 42537, 48390? -2y3 + 2y*2 + 6161y - 2 What is the s'th term of 69, 1586, 4115, 7656, 12209? 506s2 - s - 436 What is the j'th term of 69255, 69257, 69263, 69273, 69287, 69305, 69327? 2j*2 - 4j + 69257 What is the x'th term of -349, -381, -443, -547, -705, -929, -1231? -2x3 - 3x*2 - 9x - 335 What is the f'th term of -1821279, -3642557, -5463835, -7285113, -9106391? -1821278f - 1 What is the d'th term of 96, 275, 408, 471, 440, 291? -4d3 + d2 + 204d - 105 What is the n'th term of 1039, 2040, 2883, 3490, 3783, 3684, 3115? -13n3 - n2 + 1095n - 42 What is the u'th term of -134, -718, -1754, -3242, -5182? -226u*2 + 94u - 2 What is the o'th term of -36087, -72180, -108275, -144372, -180471? -o*2 - 36090o + 4 What is the x'th term of -322, -2564, -8656, -20524, -40094, -69292, -110044, -164276? -321x3 + x2 + 2x - 4 What is the l'th term of 1376, 2704, 3992, 5222, 6376? -3l3 - 2l*2 + 1355l + 26 What is the s'th term of -19369, -19375, -19381, -19387? -6s - 19363 What is the o'th term of -2386, -4742, -7062, -9346, -11594, -13806? 18o*2 - 2410o + 6 What is the z'th term of 23337, 46676, 70015, 93354, 116693, 140032? 23339z - 2 What is the x'th term of 629617, 1259240, 1888877, 2518534, 3148217? x3 + x2 + 629613x + 2 What is the z'th term of -145, 397, 1299, 2561, 4183, 6165, 8507? 180z2 + 2z - 327 What is the r'th term of 43, 103, 263, 571, 1075, 1823? 8r3 + 2r*2 - 2r + 35 What is the t'th term of -160125, -320252, -480379, -640506? -160127t + 2 What is the r'th term of -50, 450, 1814, 4474, 8862, 15410? 72r*3 - 4r - 118 What is the c'th term of 591294, 591287, 591278, 591267? -c*2 - 4c + 591299 What is the c'th term of 2237, 4469, 6701, 8933, 11165? 2232c + 5 What is the m'th term of 171, 183, 209, 255, 327, 431, 573? m3 + m2 + 2m + 167 What is the h'th term of -345090, -345084, -345076, -345066, -345054? h*2 + 3h - 345094 What is the d'th term of 2897, 5825, 8763, 11717, 14693, 17697, 20735? d3 - d2 + 2924d - 27 What is the a'th term of 257, 333, 571, 1061, 1893, 3157, 4943? 15a*3 - 9a*2 - 2a + 253 What is the a'th term of 11628, 23252, 34876, 46500, 58124, 69748? 11624a + 4 What is the d'th term of -637, -5141, -17369, -41185, -80453? -644d*3 + 2d*2 - 2d + 7 What is the d'th term of -382, -679, -974, -1267, -1558, -1847? d*2 - 300d - 83 What is the t'th term of -16594, -16620, -16646, -16672? -26t - 16568 What is the g'th term of -613549, -613557, -613579, -613621, -613689? -g3 - g2 + 2g - 613549 What is the y'th term of 975, 7826, 26413, 62604, 122267, 211270, 335481, 500768? 978y3 + 5y - 8 What is the s'th term of -173, -488, -801, -1112, -1421, -1728, -2033? s*2 - 318s + 144 What is the o'th term of -67484, -67482, -67478, -67472, -67464, -67454? o*2 - o - 67484 What is the z'th term of 4879, 4899, 4919, 4939? 20z + 4859 What is the p'th term of 194306, 388613, 582920? 194307p - 1 What is the o'th term of 11227, 22452, 33679, 44908? o2 + 11222o + 4 What is the q'th term of -6956, -6951, -6946, -6941, -6936, -6931? 5q - 6961 What is the r'th term of -79, -44, -5, 38, 85? 2r*2 + 29r - 110 What is the l'th term of 35, -130, -295? -165l + 200 What is the p'th term of 318, 263, 208, 153? -55p + 373 What is the y'th term of 405, 1663, 3753, 6669, 10405? -y*3 + 422y2 - y - 15 What is the g'th term of 2150, 8569, 19260, 34217, 53434? -g3 + 2142g2 + 9 What is the w'th term of 52267, 52266, 52265? -w + 52268 What is the o'th term of -212, -435, -794, -1283, -1896, -2627, -3470, -4419? o3 - 74o*2 - 8o - 131 What is the v'th term of -2348, -4699, -7050, -9401, -11752, -14103? -2351v + 3 What is the h'th term of 70, -61, -278, -581? -43h*2 - 2h + 115 What is the i'th term of -462, -506, -600, -762, -1010, -1362, -1836, -2450? -3i3 - 7i*2 - 2i - 450 What is the g'th term of -3804, -3792, -3772, -3744? 4g2 - 3808 What is the x'th term of 55, 75, 121, 193? 13x*2 - 19x + 61 What is the s'th term of 7309, 6889, 6197, 5239, 4021, 2549, 829? s*3 - 142s*2 - s + 7451 What is the y'th term of -30, -24, -28, -42, -66, -100, -144? -5y*2 + 21y - 46 What is the v'th term of 339, 690, 1039, 1392, 1755? v*3 - 7v*2 + 365v - 20 What is the i'th term of 32911, 32915, 32931, 32965, 33023? i*3 - 3i + 32913 What is the h'th term of 4482, 8976, 13480, 17994, 22518, 27052? 5h2 + 4479h - 2 What is the f'th term of -710, -2811, -6306, -11195, -17478, -25155? -697f2 - 10f - 3 What is the l'th term of 5140, 4952, 4766, 4582, 4400? l*2 - 191l + 5330 What is the b'th term of 391, 628, 1011, 1534, 2191, 2976? -b*3 + 79b*2 + 7b + 306 What is the h'th term of 40655, 40654, 40653, 40652, 40651, 40650? -h + 40656 What is the c'th term of -7686, -30758, -69210, -123042? -7690c2 - 2c + 6 What is the o'th term of -570, -596, -658, -774, -962, -1240? -3o3 - 5o - 562 What is the j'th term of 15073, 30126, 45179, 60232, 75285? 15053j + 20 What is the h'th term of 362, 405, 464, 533, 606, 677? -h3 + 14h*2 + 8h + 341 What is the p'th term of 980, 2499, 4020, 5543, 7068, 8595, 10124? p*2 + 1516p - 537 What is the r'th term of 195, -401, -1007, -1629, -2273, -2945, -3651, -4397? -r3 + r2 - 592r + 787 What is the p'th term of -7, 26, 85, 176, 305? p3 + 7p*2 + 5p - 20 What is the b'th term of 106, 550, 1294, 2338, 3682, 5326? 150b2 - 6b - 38 What is the g'th term of -2564, -5127, -7690, -10253? -2563g - 1 What is the r'th term of 481, 876, 1269, 1660, 2049, 2436, 2821? -r2 + 398r + 84 What is the a'th term of 5022, 19976, 44900, 79794, 124658, 179492, 244296? 4985a2 - a + 38 What is the u'th term of 374889, 749777, 1124665? 374888u + 1 What is the c'th term of 553, 1890, 3227? 1337c - 784 What is the y'th term of 1515, 1497, 1479, 1461, 1443, 1425? -18y + 1533 What is the t'th term of 5055, 20431, 46125, 82137, 128467? 5159t2 - 101t - 3 What is the q'th term of 142, 114, 86? -28q + 170 What is the r'th term of 3318232, 3318231, 3318230, 3318229, 3318228? -r + 3318233 What is the m'th term of 94, 148, 204, 262? m2 + 51m + 42 What is the k'th term of 457, 940, 1445, 1984, 2569? 2k3 - k2 + 472k - 16 What is the p'th term of 2156, 2189, 2222, 2255? 33p + 2123 What is the o'th term of 1212, 1162, 1112, 1062, 1012? -50o + 1262 What is the g'th term of -96, -171, -368, -747, -1368, -2291, -3576? -10g3 - g2 - 2g - 83 What is the r'th term of 271193, 542386, 813579, 1084772? 271193r What is the u'th term of 88273, 176549, 264825, 353101? 88276u - 3 What is the b'th term of 704, 2126, 4492, 7802, 12056, 17254, 23396? 472b2 + 6b + 226 What is the z'th term of 692, 1316, 1942, 2570, 3200, 3832, 4466? z*2 + 621z + 70 What is the m'th term of 157, 230, 461, 940, 1757, 3002? 15m3 - 11m**2 + m + 152
Rearrange (-19m - 1 + 20m + 3)(-2 + 0 + 0) + (22 - 24 - 46)(-4 + 4 - m) to the form j + xm and give j. -4 Express (0 + 4 - 5)(0u - 2u + 3u) + 3028u - 8379u + 3083u as hu + n and give h. -2269 Rearrange (-6i + i + 3i)(-15 - 5 + 451i - 52i - 154i - 53i) to ji2 + pi + l and give j. -384 Rearrange 1 - 10 - 889y + 1 + 4 + 2 to j + by and give b. -889 Rearrange (-1941c - 508 + 3925c - 1988c)(1 + 0 - 3) to the form ic + h and give h. 1016 Express -65 - j - 73340j*3 + 146698j*3 - 73365j*3 + (3j2 - j2 - j*2)(-3 + 3 + 2j) as wj*3 + pj + qj2 + u and give p. -1 Rearrange 32y*3 + 3y*2 - 62255 + 17y - 62259 + 124512 to the form j + ny + dy*2 + uy*3 and give j. -2 Express 199j - 40j - 50j - 46j - 49j - 5 as a + tj and give t. 14 Express 145d - 680d - 721d as m + xd and give x. -1256 Express a - a + a2 + (-1 + 2 - 3)(303a2 - 368a*2 + 1928a*2) + 0a*2 + 0a2 - a2 as ma + r + za*2 and give z. -3726 Express (1 - 7 + 3)(14t3 - 12t*3 - 18t*3) - 7t*3 + 6 - 4 + 41t*3 in the form st*3 + f + ot + ct2 and give f. 2 Rearrange ((5 - 5 + 2x)(30 + 54 - 6) + 2x - x - 5x)(-28x2 - 21x*2 + 47x*2 + x) to ax*2 + qx + rx3 + y and give a. 152 Express (2667a - 453a + 2282a)(1 - 2 - 1) in the form va + y and give v. -8992 Express -24 + 8k + 15 - 21k + 39 + 150 as vk + t and give t. 180 Rearrange 13 + 9o + 259o + 4 - 38 - 4 to ao + z and give z. -25 Rearrange (7i - 7i*3 - 7i)(2378i - 397i + 2255i - 747i) to the form mi + gi4 + ni*2 + wi*3 + k and give g. -24423 Express (-2 + 1 + 3)(16q + 6q*3 - 16q) + 28q3 - 32q*3 + 4q*2 - 5q2 + q3 + 6 - 4 + q*3 in the form fq*3 + tq*2 + uq + k and give k. 2 Rearrange (4 + 2b - 4)(2b - 1 + 1) - 2b*2 - 1 + 1 + 477 - 1232 + 107b*2 - 106b*2 - 7377 - 1343 to the form f + tb + jb2 and give j. 3 Rearrange (0 - 7 - 5)(-3u - 2u + 4u)(-3 + 1 + 4) + 11 + 21u - u - 23u to the form iu + y and give i. 21 Express (-997 - 454 - 815)(5 - 3 - 4)(-k4 + k4 + 3k*4) + k + 4k*4 - 4k4 + k4 as ok3 + mk*2 + ik*4 + z + nk and give i. 13597 Rearrange (5 - 8 - 6 + i + (3 + 2i - 3)(2 + 1 - 1))(0i + 0i - 2i) + 5i - 5i + 2i2 to oi*2 + u + ri and give o. -8 Express 125070h + 6 - 125068h + 101h2 - 6 as l + sh*2 + rh and give r. 2 Express (-2 - 2s2 + 2)(11076133 + 628s - 11076133) as zs*3 + gs + a + ts2 and give z. -1256 Rearrange 33 - 9k + 30 - 445k3 - 65 + 68k*3 to the form r + ok*2 + jk + dk3 and give d. -377 Express 1059 - 2114 - 18m*4 - 2m*4 + 1058 + 2m*2 + 3m*3 in the form pm*2 + vm + u + am4 + im*3 and give i. 3 Rearrange 577r - 2105r - 1749r - 795r to the form cr + j and give c. -4072 Express (-297p + 171p - 238p)(15 - 3 - 36) in the form u + vp and give v. 8736 Rearrange -n3 - 1491598n + 1491598n - 923n*4 + (-16n*4 - 11n*3 + 32n*4 - 15n*4)(1 + 2 - 5) to tn3 + gn + zn4 + l + in*2 and give g. 0 Rearrange -14 + 118y*2 - 165y*2 - 2y + 15 + y*3 to p + wy*2 + ky*3 + my and give m. -2 Rearrange 86 + 2331w2 + 517w - 520w - 86 to aw + r + qw2 and give a. -3 Express -26 + 14b - 8b - 14b - 26b2 + 26 as qb + v + xb2 and give q. -8 Rearrange 9279k - 19102k - 5415k - 15059k - 2368k to the form ck + h and give h. 0 Rearrange (m2 - 2m + 2m)(6m + 2m - 4m)(-83m - 86m + 58m) to the form cm*2 + w + um*4 + zm*3 + sm and give u. -444 Rearrange (9 - 2 + 0)(-1149f*2 - 547f*2 - 334f*2) to kf + bf2 + j and give b. -14210 Express (-3 + 2 - 1)((3 - 3 - 1)(3 + 0 - 4) - 4 + 0 + 5)(0t + t - 20t)(-3 - 2 + 3)(33t + 13t - 6t) in the form bt + j + dt2 and give d. -6080 Rearrange (14a - 14a - 19a)(-112a*2 + 46a*2 - 41a*2)(-a + a - 2a)(-5 + 6 - 4) to the form pa4 + j + wa*2 + ma*3 + ua and give p. 12198 Express (-56835 - 56849 + 113634 - 19h + (-3 + 0 + 2)(3h - 6h + h))(h + 16 - 16 + (4h + 0h - 3h)(1 - 2 + 3)) in the form v + mh*2 + zh and give m. -51 Express -6576d + 171 - 553 + 189 + 189 + (6d - d - 4d)(2 + 0 - 3) as ad + z and give a. -6577 Express (41k*2 - 1383k*2 - 245k*2)(6k - 3k - k + 9k) as qk*3 + xk + m + wk2 and give m. 0 Express (-6s + 6s + 13s + (2s - 6s + 2s)(3 + 3 + 1))(1 - 2 + 2)(s - 2s + 4s) as w + vs2 + is and give v. -3 Express (-7h - 72h - 15h)(-h - 4 + 4) + 56h - 56h + 32h2 in the form zh*2 + t + uh and give z. 126 Express -u - 68 + 1032317962u2 + 2u*4 - 1032317962u*2 in the form zu*4 + ku*2 + v + bu*3 + pu and give v. -68 Express (-1642y - 3390y + 7803y)(0y + 2y + 0y) - 3y*2 - 2y*2 + 6y*2 as ay*2 + i + ty and give a. 5543 Express (-2s - s + 4s)(3 + 2 - 3)(-107 - 96 + 26)(s + 0s - 5s) as hs + ts2 + a and give t. 1416 Express -2i*3 + 150186i - 75001i + 27 - 75109i + 2i2 as c + wi + bi2 + ri*3 and give b. 2 Express (-90h + 34h - 45h)(8 - 59 + 9) as p + mh and give p. 0 Express (31 - 6j3 - 31)(-2j - 78j - 46j)(-1 + 2 - 4) in the form vj4 + oj*2 + z + fj + yj3 and give v. -2268 Express (-2i - i + 5i)(108 - 48 + 64 + (0 + 3 - 1)(3 - 2 - 3))((0 - i + 0)(1 + 6 - 2) + 6i - 2i - i) in the form ci + l + qi2 and give q. -480 Rearrange 374 - 374 - 1110x + 3244x to the form q + bx and give b. 2134 Express (1 - 5 + 2)(-3w*3 + 218779 - 218781 + 630w*3) as jw + c + zw2 + vw*3 and give v. -1254 Express (-33d + 5d2 + 33d)((0 + 0 + 1)(-2d - 1 + 1) + (-1 - 2 - 5)(-3 + 3 + 11d)) as xd*3 + bd + ud2 + j and give x. -450 Rearrange (2 - 4447k*2 - 84k - 184k + 4444k*2)(16 - 16 - 6k)(-3 + 3 + 2k) to ik*2 + dk*3 + ak + tk4 + n and give t. 36 Express (10715g*2 - 5576g*2 - 14782g*2 - 16179g*2)(-1 + 1 - 3) in the form c + hg + wg*2 and give h. 0 Express (7w*2 - 5w + 5w)(-4434w + 1 + 11645w - 4726w) as yw*3 + a + hw*2 + rw and give a. 0 Express 3 + 218b - 651b - 3 + 332b in the form v + cb and give c. -101 Express (0 - 1 + 3)((22 - 42 + 7)(69q + 35q - 134q) - 3q + 2q - 2q) as f + pq and give p. 774 Express -260w*2 + 518w*2 + 0 - 2w + 158w3 - 260w*2 + 4 as qw*3 + y + nw*2 + ow and give o. -2 Rearrange -878l + 627l + 3113l + 999l + 2217l to q + zl and give z. 6078 Rearrange (3f3 + 0f + 0f)(-7 + 19f + 7 + (27 - 24 - 21)(0f + 0f - 2f)) to the form lf*3 + if*4 + of*2 + xf + c and give i. 165 Rearrange -2755k - 1492k + 1494k - 666k - 2711k to vk + a and give v. -6130 Express 9o - 149 + 308 + 69o4 + o2 - 19o4 + o3 - 156 as ko*3 + ao + xo2 + b + yo*4 and give y. 50 Rearrange m - 2m + 5m - 11445 + 447m + 11445 + (3 - 5 + 1)(2m - m + 0m) to y + xm and give x. 450 Express (-78w - 8w - 16w)(-19w + 32w - 6w) as kw + s + cw2 and give c. -714 Rearrange -8h3 + h3 - 14 + 4h3 + 3h - 80 to the form f + zh2 + qh*3 + dh and give q. -3 Express 7037t2 - 98567 + 98567 as ot*2 + yt + s and give o. 7037 Express v*2 - 9v + 3v - 23 + 0 - 269 + 12 in the form iv*2 + bv + q and give b. -6 Rearrange 5k - 499 + 2k - 6k + 527 - 3k2 - k3 to tk2 + o + rk + qk3 and give o. 28 Express (3s*2 + 2s*2 - 3s*2)(-4 + 1 + 0)(3 + 2 + 0)(1405s + 6948 - 6948) as c + ks*2 + bs + os3 and give o. -42150 Express -14w + 25w - 759w*2 - 1245w*2 - 11w as zw2 + jw + u and give j. 0 Express -804 + 6z2 - 795 + 1516 in the form xz + bz2 + t and give t. -83 Express (2 + 2 - 10u + 13u)(4 + 1 - 1)(-107 - 7u*2 - 113 + 216) as hu*3 + gu + n + qu2 and give q. -112 Express ((-1 + 2 - 3)(-k + 0k + 0k) + 24k - 1062 + 1062 + 2k + k + 10 - 4k)(-2 - 2 + 9) as g + uk and give u. 125 Express (2w - 2 + 2)(-26w + 84 - 9 - 27) as mw + fw*2 + d and give f. -52 Express (-10q*2 + 10q*2 + 3q*3)(-151 - 23 - 30) as rq + pq*3 + h + nq*2 and give p. -612 Rearrange (65q*3 + q - 67q*3 - 8q)(-548q + 849q + 1347q + 83q + 1211q) to the form xq3 + aq*2 + dq + o + tq4 and give a. -20594 Rearrange (-1 - 17 - 1)(4f + 8f + 3f) - 1 - 2f + 1 + (-f - 3f - 4f)(2 + 1 - 5) to gf + n and give n. 0 Rearrange 20 - 4 + 2u2 - 39 + (14 - 5 + 8)(-u2 - u2 + 0u2) to the form fu*2 + v + ru and give f. -32
Let w(r) = 3431r2 + 47r - 47. Let g(t) = 429t2 + 6t - 6. Determine 47g(j) - 6w(j). -423j2 Let j(u) = u3 + 2. Let z(t) = 25. Let r(d) = 4. Let f(p) = -6r(p) + z(p). Give 4f(o) - 2j(o). -2o3 Let v(u) = u3 + u2 + u - 1. Let l(g) be the third derivative of g6/30 - g5/30 + g4/12 - g3/3 + 61g*2 + 1. Determine l(x) - 2v(x). 2x3 - 4x*2 Let s(h) = 4h + 9. Let x(z) = -2z - 4. Calculate -2s(p) - 5x(p). 2p + 2 Let m(f) = -5f2 - f. Suppose 0 = 18u - 12u - 42. Let x(v) = 16v*2 + 4v + 1. Give um(y) + 2x(y). -3y2 + y + 2 Let k be (-5)/(5/(-4)) + 2. Let b(c) = c - 1. Let u(v) = -v3 - 18v*2 + 42v + 45. Let n be u(-20). Let a(z) = -z + 1. Determine kb(o) + na(o). o - 1 Let n(z) = -2 - 162z + 316z - 159z + 1. Let o be 1-1 + -2 - 0. Let c(w) = -4w - 1. What is oc(k) + 2n(k)? 2k + 1 Let t(d) = d*3 + 6d - 6. Suppose -21 + 6 = -5c. Let i(k) = 1 + 55k + 10kc - 21 - 35. Determine 6i(p) - 55t(p). 5p*3 Let q(v) = -v - 12. Let x(a) = a + 11. Suppose 13p - 24 = 54. Give px(w) + 5q(w). w + 6 Let n(h) = -6h3 - 3h*2 - 18h - 12. Let m(o) = 9o3 + 5o*2 + 27o + 19. Calculate 5m(g) + 8n(g). -3g3 + g2 - 9g - 1 Let v(g) = 22g2 + 2g - 5. Let r(x) = 23x2 + x - 6. Determine -3r(t) + 4v(t). 19t*2 + 5t - 2 Let a(d) = 13d - 6 + 8 - 16d. Let m(r) = -6r + 5. Suppose -5n - 5b = -30, -n + 2b + 1 + 2 = 0. Determine na(y) - 2m(y). -3y Suppose -5u = 3x + 2x, -8 = 3x - 5u. Let o(v) = 2v2 + 1. Let p be o(x). Let j(a) = -5a. Let c(r) = 9r. What is pc(q) + 5j(q)? 2q Let b(y) = -75y3 + 38y*2 - 23y + 9. Let t(j) = -26j3 + 13j*2 - 8j + 3. Determine -6b(l) + 17t(l). 8l3 - 7l*2 + 2l - 3 Let q(r) = 4r2 + 46r + 24. Let l be q(-11). Let y(o) = 4o + 2. Let b(g) = -3g - 1. Give ly(d) + 3b(d). -d + 1 Let r(p) = p*3 - 2p - 4. Suppose -7 = -3u - 5m + m, -2u - 4m = 2. Let g(o) = o*3 - 4o - 9. Give ur(l) - 4g(l). 5l3 - 2l Let u(h) be the second derivative of 0 + 0h2 + 22h + 0h3 - 7/12h*4. Let t be -31(-2)/1. Let w(z) = 8z*2. Calculate tu(f) + 5w(f). -2f2 Let q be 0 + 1 + -3 + 3. Let m(f) = -f3 - f*2 + f + 1. Let i(c) = 2c*2 - 3c2 - 70 + 69 + c2 + c*2 + c. Calculate qi(z) + m(z). -z*3 + 2z Let o(m) = -7m2 - 36m + 1. Let y(q) = 7q + 1. Give -2o(w) - 10y(w). 14w*2 + 2w - 12 Let s(l) = l*2 + l + 1. Let u(b) = -3b*3 + 3b*2 - 3b + 1. Determine -3s(n) - u(n). 3n*3 - 6n*2 - 4 Let z(h) = -19h*2 - 9h. Let c(x) = 15x - 11x - 7x + x - 5x*2. Calculate -9c(o) + 2z(o). 7o2 Let v(y) = -y2 - 6y + 6. Let h(i) = i3 - 4i*2 - 8i + 9. Let s be h(5). Let x be v(s). Let o(q) = q + 6. Let k(r) = -r - 5. Determine xk(g) + 5o(g). -g Let g(k) = -224k + 6. Let p(l) = -109l + 3. Determine 3g(m) - 7p(m). 91m - 3 Let d(m) = m2 + m + 1. Let z(n) = 5n*3 - 4n*2 - 2n - 9. Let v(g) = -2g3 + 2g*2 + g + 4. Let t(k) = 9v(k) + 4z(k). Give d(f) - t(f). -2f3 - f2 + 1 Let i(q) = -1. Let v(f) = 72f3 + 2f - 5. Determine -4i(y) + v(y). 72y*3 + 2y - 1 Let a(t) = -546t - 52. Let j(s) = 52s + 5. Give 5a(u) + 52j(u). -26u Let b(q) = -9q*2 - 11q. Let x = 21 + -5. Suppose 0 = 2s + 4g - 18, 0s + 5g + x = s. Let w(j) = 5j2 + 6j. Calculate sw(u) + 6b(u). u*2 Let b(o) be the third derivative of 0 + 0o + 29/60o5 - 1/8o*4 - 17/6o*3 - 5o*2. Let d(x) = 10x*2 - x - 6. What is 6b(n) - 17d(n)? 4n*2 - n Let z be 10/7 - ((-416)/(-56) + -8). Let l(a) = -6a - 2. Let q(m) = 6m + 3. What is zq(n) + 3l(n)? -6n Let b(y) = -105y - 14. Let i(a) = 35a + 5. Give -6b(q) - 17i(q). 35q - 1 Let h(z) = 4z - 1. Let d(n) = n*3 - 9. Let a be d(0). Let f = -3 - a. Let c(g) = -g. Suppose -4o + o + 3 = 0. Determine fc(j) + oh(j). -2j - 1 Let r(s) = 10s*2 + 2s. Let z(x) = x*2 - 1. Give r(f) - z(f). 9f*2 + 2f + 1 Let z(l) = l + 4 - 5l + 11 - 5. Let p(c) = -c + 3. What is -7p(r) + 2z(r)? -r - 1 Let y(a) = -a2 + a + 1. Let i(b) = -5b*2 - 2b - 2. Let u(z) = -3z - 3. Let m(t) = 3i(t) - 6u(t). What is -5m(f) + 60y(f)? 15f*2 Let f(u) = 15 - 5 - 17u*2 + 3. Suppose 5q - 11 = -m, m + 1 = -3q + 6. Let k = m + 10. Let y(l) = -4l*2 + 3. Calculate kf(a) - 26y(a). 2a*2 Let t(u) = -2u2 + u3 - 4u2 + 5u*2 + u. Let n(x) = -4x*2 + 7x + 46x3 + 36x*3 + 51x*3 + 47x*3 - 173x*3. Give -n(q) + 6t(q). -q*3 - 2q*2 - q Let b(q) = -12q*2 + 4q + 4. Let d(f) = -14f2 + 5f + 2. What is -2b(n) + 3d(n)? -18n2 + 7n - 2 Suppose -3v + x - 5x - 38 = 0, -2v - 27 = x. Let p(b) = -13b*3 + 4b + 7. Let h(j) = 4j3 - j - 2. Calculate vh(r) - 4p(r). -4r*3 - 2r Let b(g) = g + 1. Suppose -5 = 86k - 91k. Let o(n) = -8n - 4. Give ko(m) + 4b(m). -4m Let p(g) = -3g2 - g + 1. Let c(u) = 4u*2 - 18u + 6. Give c(f) - 6p(f). 22f*2 - 12f Let l = -101 - -102. Let c(t) = t*3 + 3t*2 + t. Let x be c(-2). Let w(g) = -3g - 2. Let s(y) = y*2 + y + 1. Calculate lw(r) + xs(r). 2r*2 - r Let n(v) = -7v + 306. Let z be n(44). Let i(o) = o. Let f(w) = -w + 1. Calculate zf(t) - i(t). t - 2 Let m(d) = -19d + 8. Let f(h) = 9h - 5. Give 13f(u) + 6m(u). 3u - 17 Let q(t) = -2t - 1. Let h(s) = -6s + 73. Calculate -h(l) + 4q(l). -2l - 77 Let w(t) = t - 1. Let h(s) = s - 3. Let v(y) = y + 2. Let c(d) = 3h(d) + 2v(d). Let o(r) = r*2 + r + 6. Let m be o(0). Give mw(b) - c(b). b - 1 Let d(o) be the first derivative of -7o2/2 + 2o - 20. Let i(g) = g. Let k be (-1)/(-2)(3 + -1). Determine kd(p) + 6i(p). -p + 2 Let w(n) = -3. Let y = 340 + -336. Let v(q) = q2 - 5. Give yv(l) - 7w(l). 4l*2 + 1 Let s(y) = 3y - 5. Suppose 6x = 2x - 52. Let b = 8 + x. Let u(v) = -v + 2. Give bu(d) - 2s(d). -d Let p = 659 + -664. Let k(t) = -3t3 - t2 + 4t. Let c(b) = -2b3 + 3b. What is pc(n) + 4k(n)? -2n3 - 4n*2 + n Let g(v) = -9v + 2. Let j be ((-219)/(-292))/((-21)/12 + 2). Let m(d) = -d + 1. Give jm(p) - g(p). 6p + 1 Let w(v) = 4v3 + 3v*2 + 2v + 62. Let r(z) = 5z3 + 4z*2 + 2z + 62. What is -3r(j) + 4w(j)? j*3 + 2j + 62 Suppose -m = 2q - 13, 4q = 7q - 4m + 8. Let a(g) = -13g + 2. Let n(t) = -t + 1. Give qn(z) - a(z). 9z + 2 Let y(g) = -g + 1. Let n = -20 + -4. Let b = -23 - n. Let j(t) = -4t + 9. What is bj(x) - 6y(x)? 2x + 3 Let q(s) = 4s*3 + 2s*2 - 12s - 4. Let b(v) = -9v3 - 5v*2 + 24v + 9. Calculate 3b(m) + 7q(m). m3 - m2 - 12m - 1 Let r(a) be the second derivative of 5a*3/6 - 3a*2/2 + a - 51. Let u(k) = 3k - 2. Suppose -2s + 7 = -2y - 7s, s + 11 = 2y. Calculate yr(q) - 7u(q). -q + 2 Let n(s) = s*2 + s + 1. Let p(o) be the second derivative of 3o*2 + 1/2o*4 - 24o + 0 + 4/3o3. Give 14n(z) - 2p(z). 2z*2 - 2z + 2 Let q(y) = -y - 3. Suppose -3z + 3 - 4 = 4s, -3z + 4 = -s. Suppose 4v = 3 + 5. Let m(a) = -a - 1. Calculate sq(l) + vm(l). -l + 1 Suppose 3 = -4q + 15. Suppose 2v - 3j - 28 = 0, -qv + 20 + 0 = j. Let b(f) = -5f - 5 + 4 + v. Let m(x) = -4x + 6. Determine -6b(h) + 7m(h). 2h Let t(m) = -3m*2 + 11m - 14. Let i(u) = -u*2. Let y be -63/(-15)10/(-4). Let a(h) = 2h*2 + 4h - 5. Let x(o) = yi(o) - a(o). Give 3t(b) + 8x(b). -b2 + b - 2 Let k(t) = 4t + 1. Let n(a) = -7a - 3. Calculate -5k(f) - 3n(f). f + 4 Let c(z) = 4z*3 + 6z + 5. Suppose -6d + 30d = 144. Let u(b) = b + 1. What is du(n) - c(n)? -4n*3 + 1 Let i(l) = 29l*3 + 4l*2 - 4l - 2. Let d(c) = 57c3 + 9c*2 - 9c - 5. Calculate -4d(z) + 9i(z). 33z3 + 2 Let d(a) = -a + 7. Suppose -3q = -2q - 8. Let m be (39/(-26))/(6/q). Let c = 3 - m. Let l(k) = 1. Give cl(o) - d(o). o - 2 Let i(b) = b - 6. Let d be 0 - (3/3 - 45). Let o be 33/d - 1/(-4). Let h(l) = 0 - 2 - 1 + 2. Calculate oi(j) - 5h(j). j - 1 Let m(n) = -11n + 2. Let p(d) = d3 + 10d*2 + 15d - 5. Let c be p(-8). Let v(t) = -12t + 3. What is cm(f) - 2v(f)? -9f Suppose -124 + 152 = 7b. Let q(g) = -5g - 6. Let s = -15 + 4. Let d(k) = -2k - 2. Give bq(i) + sd(i). 2i - 2 Let p(r) = -2r3 - 5r*2 + 2. Let f(l) = -6l*3 - 14l*2 + 6. Let u be (-12)/(-96) + 126/16. Let b = 0 + -3. Determine bf(g) + up(g). 2g*3 + 2g*2 - 2 Let l(i) be the second derivative of -3i*5/20 + 2i*2 - 28i. Let z(g) = -7g3 + g + 8. Determine 5l(w) - 2z(w). -w3 - 2w + 4 Let p(u) = 27u2 + 4. Let z(i) = -i3 - 27i*2 - 3. Determine -3p(t) - 4z(t). 4t*3 + 27t**2
Let r(t) = -3t + 1. Let v(j) = 8j + 10. Let h(b) = -3r(b) - v(b). Determine h(12). -1 Let r(u) = -u2 + 13u - 12. Let a be r(8). Let i = a - 27. Let b(s) = -17s - 1. Calculate b(i). -18 Let v(d) = 29d3 - d2 + 2d - 1. Let y(q) = q3 - 74q*2 + 76q - 218. Let n be y(73). Calculate v(n). 29 Suppose 2f = -0f - 104. Let t = 47 + f. Let w(j) = 2 - 2 + 2 + j. Give w(t). -3 Let u be -2 - -15 - (-2)/(-2). Suppose -u = -4m - 0m. Let r(n) = n + 0n - 3 + m + 2. Calculate r(5). 7 Let t = 3 - 7. Let j(s) = -4s - 7. Let k(v) = -v - 1. Let d(a) = j(a) - 3k(a). What is d(t)? 0 Let y(g) = g3 + 5g*2 - 4g - 2. Let s = -2477 - -2472. Give y(s). 18 Let y(i) = 1. Let u(h) be the second derivative of h4/12 + h3/6 - 3h2 + 2h. Let b(o) = u(o) + 3y(o). What is b(3)? 9 Let i be 98/(-42)(-3)/21. Let m(w) be the first derivative of 2 + 0w + 0w*2 - iw3. Determine m(3). -9 Let i(p) = p2 + 10p + 20. Let h = -177 + 172. What is i(h)? -5 Let f(z) be the second derivative of -23z - z*3 + 0 + 1/20z*5 - 7/12z*4 - 5z*2. Determine f(8). 6 Let h(q) be the third derivative of 2q*2 - 7/120q*6 - 1/24q*4 + 0q - 1/6q3 + 0 + 0q*5. Let i(l) = 16l + 31. Let u be i(-2). What is h(u)? 7 Let l(y) = -76y - 384. Let h be l(-5). Let m(v) = -8v - 1. What is m(h)? 31 Let b(w) be the second derivative of w*5/20 + 11w*4/12 + 3w*3/2 - 6w*2 + 93w. What is b(-10)? -2 Let u(z) = -1 + 2z - z2 + 3z - z. Let j(y) = -4 - 2y - 1433y*2 + 0 + 1434y2 + 1. Let s be j(4). Give u(s). -6 Let y(d) = d3 - 9d2 - d - 7. Let a be -5 + ((-56)/6)/((-12)/18). What is y(a)? -16 Let z(f) be the second derivative of -f7/2520 + f6/240 - f5/60 - f4/4 + 17f. Let i(g) be the third derivative of z(g). Determine i(4). -6 Suppose 3d = 5p + 2d - 311, -d = 5p - 319. Let j be (-36)/p - (-3)/(-7). Let x(n) = -2n3 + n2. Determine x(j). 3 Suppose -y - 5g = 0, -y + 3g = -3y. Let a(m) = -5 - 124m + 27m + 31m + 33m + 32m. Calculate a(y). -5 Let s(c) be the second derivative of -c5/20 + c4/2 - 2c3/3 + c2 + c. Let o(y) = 7y2 + 4. Let r be o(2). Suppose r = 5w + 7. Give s(w). 7 Let m(r) = r*3 + 15r*2 - r + 9. Let a(v) = -6v + 165. Let l be a(30). Calculate m(l). 24 Let a(m) = -m*2 + 0m*2 + 7 + 3 - 6 + 3m. Let f be -1 + 2 + (2 - 0). What is a(f)? 4 Let j(g) = 2g3 - g2 + 1. Let u = 57 - 47. Let o be (-15)/u(-2)/(-6)2. Give j(o). -2 Let m(s) = -19s - 1. Let r = 51 + 12. Suppose -r + 297 = -6q. Let b be 26/q6/4. What is m(b)? 18 Let u(w) = 4w3 + 12w*2 + 17w + 13. Let f(j) = -5j3 - 11j*2 - 17j - 14. Let g(a) = 5f(a) + 6u(a). Give g(18). -10 Let w(r) = r*3 + 6r*2 + 9r + 7. Suppose -6l - 157 + 133 = 0. Determine w(l). 3 Let b(x) be the third derivative of -x6/120 + x5/10 - x4/6 + 8x*3/3 - 36x2 - 2. What is b(5)? 21 Let t(y) = y3 + 7y2 - 2y*3 + 6y - 7 + 2y3. Let a be (8 - 4)1/2. Suppose 2g = -3o - 25, 0 = 2o - 5o + ag - 5. What is t(o)? 13 Let b(y) = y + 4. Suppose 24f - 25f - 3 = 0. Let q be (-1)/((-28)/(-10) + f). Give b(q). 9 Let k be 92/48 + 31/372. Let t(w) be the first derivative of 1/2w*k - 5/3w*3 - 1/4w*4 - 3w + 3. Determine t(-5). -8 Let q(t) = t2 + t - 13. Let h be q(4). Let v(y) be the second derivative of y5/20 - y4/2 - y3 - 5y2 + 3y. What is v(h)? -3 Let f be (-3 - -8 - 2) + -1. Let b(x) = 14x - 13x - 12 + 11xf + x3 + 8x. Calculate b(-10). -2 Let h(m) be the first derivative of -m*3/3 - 5m*2/2 - 3m - 3. Let g(b) = b*2 + 11b - 18. Let r be g(-12). Calculate h(r). -9 Let w(p) be the first derivative of -p*2 - 3p + 1. Let s be (8/(-6))/(11/(-33)). Suppose h - 2 = -4q, -q = -h + q - s. What is w(h)? 1 Let f(m) = 16m - 13. Let z(p) = -47p + 46. Let r(a) = 7f(a) + 2z(a). Calculate r(-2). -35 Let q(x) = -x3 + 3x*2 + 2x. Let v be -6 + 6 - (-18)/6. What is q(v)? 6 Let i(z) = 11z2 + 17z + 150. Let g(s) = 4s2 + 6s + 53. Let y(q) = 17g(q) - 6i(q). What is y(2)? 9 Let j(a) = 2 + a*3 + 46a*2 - 48a*2 - 4a*2. Give j(5). -23 Let q(p) = 4p*2 + 23p - 65. Let f be q(-8). Let r(d) = -4d + 5. Calculate r(f). -23 Let b(g) = -25g + 324. Let f be b(12). Let x(h) = -4h + 92. Calculate x(f). -4 Let f(t) = t. Suppose 7v - 9 = 4v. Suppose 0 = -4u - z + 5, 4u - 4z = vu - 3. Give f(u). 1 Let d(g) be the first derivative of g5/20 - g4/8 + g3/3 + 9. Let y(j) be the third derivative of d(j). Determine y(2). 9 Suppose -5h = 4h - 45. Suppose j - 6 + 0 = 0. Let o(q) = -1 + 4q*2 + 3q*2 - 7q - jq2. Give o(h). -11 Let v(x) = 18x3 + x2 - 1. Suppose 9 = 29f - 20. Determine v(f). 18 Let x be 4 + (-3)/(-6)4. Let q be 6/4(-4)/x. Let g be 2/(-2) - (q + 2). Let i(o) = -o3 + 2o. Calculate i(g). 4 Let b(l) = -48l + 178l - 43l - 41l - 15 - 45l. What is b(10)? -5 Let t(z) be the second derivative of z4/12 - z3/6 - 9z*2 + z. Suppose -14w - 47 = -47. Determine t(w). -18 Let v(w) = -w*2 - 3w - 6. Suppose -2a + 7 = -3o - 0a, 0 = -o + 3a. Let r be v(o). Let n(t) = -t*2 - 4t + 3. Give n(r). -9 Let f(z) = z3 + z2 - z - 5. Suppose -3q = -79 + 31. Suppose -5t + 4 + q = 0. Suppose tb - b = 0. Calculate f(b). -5 Let w(v) = v3 - 6v*2 - 3v + 12. Suppose -5q - 22 = -2k - 0q, 0 = -k - 4q - 2. Calculate w(k). -6 Suppose -62 = 3o - 4y, 5o + 2y + y + 55 = 0. Let u = o + 11. Let p(b) = -2b - 1. Determine p(u). 5 Let j = -5 + 12. Let g(m) = 7m*3 - 19m*2 - m - 6. Let n(h) = 20h*3 - 55h*2 - 3h - 17. Let z(f) = -17g(f) + 6n(f). Calculate z(j). -7 Let r(i) = 2i2 - 3i*2 + 2i*3 - 8i*3 + 7i*3 + 0i3. Let c(u) = u3 - 12u2 + 10u + 10. Let d be c(11). What is r(d)? -2 Let x(o) be the third derivative of -7/24o4 + 1/12o*5 + 1/120o*6 + 0o - 1/2o3 + 20o*2 + 0. Determine x(-6). 3 Suppose -3w = -18 + 12. Let o(d) = -1 + 4 - w - 3d - 10. Determine o(-6). 9 Suppose -5y - 3g + 8 - 7 = 0, -4y = -2g - 14. Let z(f) = f3 - 4f*2 + f + 1. What is z(y)? -5 Let m = 7 + -3. Suppose -o + 2 = 2w - 2, -2o + mw = 8. Suppose o = -4y - 6 - 2. Let j(x) = x3 + 2x2 - 2. Determine j(y). -2 Let r(g) = g2 - 6g + 5. Suppose s = -2v + 14, 0s - 3v = -4s + 1. Suppose si = 5i - 4. Give r(i). -3 Suppose -2d - 5c + 7 - 17 = 0, 2c + 8 = 0. Let v = -1 - -3. Let x(l) = -3l2 + 0l*2 + vl - 7l + 5 + 4l2. Calculate x(d). 5 Let m(c) be the third derivative of -c6/120 + c5/20 - c4/24 + c*3/6 - 684c*2. Suppose -2l + 1 = -5. What is m(l)? -2 Let o(b) = 0b - 30b2 - b3 - 6 - 6b + 25b*2 + 13b*2. Determine o(7). 1 Suppose -9j = 76 - 112. Let k(y) = -6y + 2 + 3y + 2y. Calculate k(j). -2 Let i(t) = -t + 4t - t2 + 0 - 1. Let a(j) = -3 + j2 - 7 + 6 + 2j. Let r be a(2). What is i(r)? -5 Let o = 1 - 1. Let p be (19/(-133))/((-2)/14). Let z(v) = -4 + v2 + 10 + 3 - p. Calculate z(o). 8 Let t(m) = m - 2m + 3m. Suppose -4n + 2i + 16 = 0, 0n - 2i + 8 = 4n. Let l be 10/(-3(-4)/n + -2). What is t(l)? 10 Let m be 8/(-68) + (-6)/(-51). Let n(p) = -p + 8. Let k(w) = -2w + 16. Let x(s) = -2k(s) + 5n(s). Give x(m). 8 Let o(u) = u*3 + 14u*2 + 15u + 11. Let j be 0 - 0 - (4 + 9 - 0). Give o(j). -15 Let p(m) = 6m + 47. Let u be p(-9). Let b(h) = h3 + 7h2 + h + 4. What is b(u)? -3 Let b(w) = -w3 + w*2 - w + 2. Let r(p) = 5p*3 - 7p*2 + 11p - 16. Let s(i) = -6b(i) - r(i). Give s(2). 6 Suppose 3a = b - 2b - 18, 3b = 3a + 6. Let s(u) = u3 + 7u*2 + 4u + 1. Give s(a). 31 Let k = 87 - 83. Let i(a) be the first derivative of 0a2 - 1/3a*3 + k + 0a. Determine i(-1). -1 Let m(i) = -i*3 + 6i2 - i + 5. Let q be m(6). Let t be -1 + 3 - (0 + q). Let l(j) = -7 + j2 - j*t - 8j*2 - 5j - 2j. Give l(-6). -1 Let n(u) = 1 + 95u - 35u - 31u - 28u + 1. Suppose -1 = -j - 3. Give n(j). 0 Let s(n) be the first derivative of 11n*2/2 + 17n - 192. Calculate s(-2). -5 Let m(j) be the first derivative of -j*2/2 - 8. Let i be m(-2). Let u(v) = 4 - 5 - v + iv. Give u(-6). -7 Let z be -3(-3 + (-1 - -3)). Suppose -2t - 4g + 10 = 0, -5g - z = 5t - 2g. Let x(f) = 3 + 0f + 3f - 2f - 1. What is x(t)? -1 Let g(a) = a - 35652 + 35652 + 7a. Determine g(4). 32 Let i(m) = m + 4. Let g be i(0). Let d = 2 - g. Let j(l) = -l*2 + 5l - 3. Let y(f) = 2f2 - 11f + 7. Let r(p) = 9j(p) + 4y(p). Determine r(d). -5 Let l(b) = b*3 + 4b*2 - 7b - 5. Let t(s) = -2s2 - 13s + 9. Let h be t(-6). Suppose -h = -5i, 3d - 3i = -d + 7. Suppose dj + 25 = -j. What is l(j)? 5
Simplify (w(2/7))(-4/9)(www/w(-2/3))/ww*3w(-5)/((w(-2/3)w)/w)(w/(w*(-1)w))(-45) assuming w is positive. w(-2759/63) Simplify ((m/m(-20))(3/2)/(m*(-19)(m*16mmm)/m))(-1/36) assuming m is positive. m(-65/72) Simplify ((w6/(w/(w6w)))/((ww(w(w*(-2)w)/w)/www)/(ww18)))(-1/36) assuming w is positive. w(-29/36) Simplify (hhh(-1)/hh)*(-3/16)((h((h/(hh(hh*(-1))/hh))/h)/h)/h)*49(h(2/9))(-27)/(hh/(h(-1/3)h))42 assuming h is positive. h(-3347/16) Simplify ((uu(-3/7)/u)/u0)17/((u/(u/u0))(1/9)/(u(1/3)/u)(-14/9)) assuming u is positive. u(-1181/189) Simplify ((c1)(-10/9)(c/(c*4c))/(c/(c/c*(-3/4))))/((cc1)(31/4))(-35) assuming c is positive. c(19373/36) Simplify (((hh/(h/((h(-15)/h)/h))h)/(h/(h(hhh/h(4/5)h)/hh)hhhh))/(((h/(h/(h/h20h)h))/h)/h(-9)))(-44) assuming h is positive. h(1056/5) Simplify (((vv*(9/5)vv)/(v/v(-2/15)))/(v(-10)/(v(-1)v)))34 assuming v is positive. v(1394/3) Simplify (pp/((p13/p)/pp)p(-2/5)((p/(ppp*9p))/ppp)/p(-6/7))(-41) assuming p is positive. p(28044/35) Simplify (h(-7)h/h(-1/2))/(h(-4/3)hh(-2/13))(hhh(-2/3)/h)(-37)hh*(1/7)hh(-2) assuming h is positive. h(-3131/182) Simplify ((b/b(-2)b)*(-3/11)(bb5b)/(bb(-7)))/((b(-5/3)/b)/(b(2/5)bb))(-6/25) assuming b is positive. b(14703/1375) Simplify ((q/q(1/9))/(qqq(-1/2)))49/((q(-1/3))(-42)(q*6q)/qqq(q(1/2)/q)/qqqq) assuming q is positive. q(-481/9) Simplify ((a(-2/3))(-3/8))40(a(-1/11)a*(3/2))/((aa(2/3))/a)20 assuming a is positive. a(-127/66) Simplify ((u1/u)/u)/u*(-7)u*5u/(((uu/(u/(u/(u/(uuu(-4)u)uu))u))/u)/u)(u0)(-36)((uu/(u/u*0u))/u)(-46) assuming u is positive. u63 Simplify (r(-4/7)/r)(4/7)(rr/(r(r(r/r*(6/19))/r)/rr))/(r/(r/r*(-32)r)) assuming r is positive. r(30181/931) Simplify (x(-2/7)/xx4)(-3/10)((xx/((x(x/(x*7/x))/x)/x)xx)/(xx/(x*(-7)x)))(-12/5) assuming x is positive. x(-393/70) Simplify ((v*0vv(-2/13)v)/(v*(1/4)v/(vv/v(-1/5))))/((((v/v(2/19))/v)/v)/vvv0/vv)(-1/22) assuming v is positive. v(149213/54340) Simplify ((o/(o*0/o)o)/o)(18/11)/(o(1/5)/o*(-1/2))(o*1/(oo*2o))(-2/69) assuming o is positive. o(6729/2530) Simplify (((kk/(kk(-8)))/k)/(k(2/13)/k))/(kk(1/3)kk/((k(-5)/k)/k))(k/k*2k)(-6/7)/(k1/(k/(k*(2/3)/k)kk)) assuming k is positive. k(11/13) Simplify ((d(2/3)/d)(2/9))(-18/5)/((d1)(-17)/((dd*3)/(d(d/d*4d)/d))) assuming d is positive. d(349/15) Simplify ((((l(-16)l)/((l(-15)l)/l))(-2/45))(-20))46 assuming l is positive. 1 Simplify ((f(-12)/((f/(ff(-1/8)f))/f))/(f*(-1/3)f6))2 assuming f is positive. f*(-379/12) Simplify (hh*(-1/6)/hh/(h*(-9/7)/hh)(hh/(h(h/(hh*8)h)/h)h)/(h/h(4/7)))(-15/4) assuming h is positive. h(-2455/56) Simplify ((((ooo20)/oo(-4))50)(-48))(-6) assuming o is positive. o244800 Simplify (b(-13)b(7/3)b*0bb(2/9))(1/39) assuming b is positive. b(-85/351) Simplify (k/(k/(kk*(-2/11)))kk10(k(-3/2))(-5/9))43 assuming k is positive. k(35905/66) Simplify ((((d/((d/d*(-1))/dd))7)(-2/85))(2/111))(-13) assuming d is positive. d(-364/9435) Simplify (r(-1/3))(-1/19)/(((r(-3/8)r)/r)/(r4/rr))(r(-9)/rr(-1/7))(-45) assuming r is positive. r(1470941/3192) Simplify (j/(j(-1)/j)j(-1/4)(j/(j*(-2/7)jjj))/(jj(-2/9)))/((j/(((jj*(-2)j)/j)/j))(-2/15))(1/12) assuming j is positive. j*(367/1260) Simplify ((((uuu7u)/u)/(u*(-13)/uu))/(u*(4/13)/uuuu(7/3)))0 assuming u is positive. 1 Simplify (ii(-1)/i)45(i(-2/7))48(i/(ii*(-1/2)i)i)(-49)/((i/i0)/i)(-1/8) assuming i is positive. i(-1165/14) Simplify ((l/l(-4))46/(ll(l/(l/l9))/ll)(-36/11))(-1/11) assuming l is positive. l*(-266/11) Simplify (((m/(mmm((m*(-26)/mm)/m)/mm))/(mm*(-4/3)))/((mm*(-2/7)/mmm)/mmm(-4)))(-23/4) assuming m is positive. m(-3335/21) Simplify (c(2/3)/(c/c(-1/8)))(1/36)/((c(-3/4)/c(-5))/((c(-1/2)c)/((cc(1/3)/c)/c))) assuming c is positive. c(-2675/864) Simplify (((x/(xx*14))/xx/(xx(-22)x))/(x*31x(-2/11)))35 assuming x is positive. x*(-9555/11) Simplify ((jj*(-1/2)/jjj)(-40))20/(j/j7j/(j(jjj(1/5)j)/jj)j/(j/(j/j*(-6)j))jjj(-2/5)) assuming j is positive. j(-6002/5) Simplify (d/(dd/d*0)d(-2)/d)(-49)/(((d/(d/d(4/5)))/(d/(d/d(-7))))/(dd/d1d/d(1/4))) assuming d is positive. d(3799/20) Simplify ((f/(f/(f/f*(3/4))f)f)/f)/f(-8)f*(-5)ff/f(-8)((f/(f/(f(-8/3)/f)))/f(5/8))(-2/111) assuming f is positive. f(4105/333) Simplify ((qq(-34))/q(q*(1/3)/q)/qq)/(q*(1/28)q41) assuming q is positive. q(-6359/84) Simplify ((u/(uuu/(u*17/u)))/(uu/u*(-28))u*(3/4)u*(-4/5)u)22 assuming u is positive. u(-3311/10) Simplify ((b/b(6/7))/b(-1/2))/((bb(-4))/(((bb/((b/b*(-2))/bb))/b)/b))((b/(bbb(-2/11)bb)b)/(bb(-1/3)b))(-7) assuming b is positive. b(11567/462) Simplify (u/(u36/u))(2/147)u/(u/(uuu22/u)u)uu*(1/21)/uu assuming u is positive. u*(3320/147) Simplify jj*(8/5)jjj*38j(j32j)(-15) assuming j is positive. j(-2257/5) Simplify ((((i/(i/(i*(-7/5)i)))/i(-6))(-2/113))(-1))(1/72) assuming i is positive. i(7/5085) Simplify ((m(-11/2)/(m/(mm/m14m)))/(m17/m25))39 assuming m is positive. m(-741/2) Simplify ((u(-3/5)/u(-33))8)(1/16) assuming u is positive. u(81/5) Simplify (p(-2/17)p4(p0)(-2/61))/((pp1)(-2/35)/(p(-2/19)/pp(-1/6))) assuming p is positive. p(184817/67830) Simplify ((kk(-2/11)k3)/((k(-2/9)kk)/(k/(k/(kk(2/11)/kk)))))/(k*(-8/9)k14)(-14) assuming k is positive. k*(1681/9) Simplify (((((kkk/k(-1)kk)/k)(11/5))22)(-15))(1/42) assuming k is positive. k(-605/7) Simplify (((((b/(b(b(bbbb*(1/7))/bb)/bb)b)/b)/b)/b*(-14))/(b/(bbb/(b/b(-1))))(4/11))(-9/8) assuming b is positive. b(-279/28) Simplify (r/(r/(rr/(r/(rrrr/r(-1/53)r)))))/((r*(-36)/r)/r)(r(-15/2))(2/87) assuming r is positive. r(67392/1537) Simplify ((i(-2)/i)20)15/(i*(1/6)(((i*(-4)/iii)/ii)/i)/i(i/((i/(ii/(i*(3/2)/i)))/ii))/i(-2/13)) assuming i is positive. i(-34976/39) Simplify ((c/(c/(c*6c))c)/(c/c0))/(c(-4)c*0)(c(-2/5))(2/49)/(c(2/3))(2/15) assuming c is positive. c*(24023/2205) Simplify t/((tt*(-27)/tt)/t)t(-24)t/t*(-24)tt/t(-28)t assuming t is positive. t60 Simplify (h/h(-14/5)hh/h(-4/19))/(h/h(-40)h12) assuming h is positive. h(-4464/95) Simplify ((xx/(x*(1/2)x))/xx)/x3x4/((x/x(-2/9))/x)((x/x(1/12))/(xxx(-3)xxx))(-13) assuming x is positive. x(553/36) Simplify ((w*31/(((ww/(w/((w*(2/25)w)/w))w)/w)/ww))/((w(-2)/w)/(w(2/5)w)))48 assuming w is positive. w(41184/25) Simplify (a/((a/((a/(aa*(-6/11)aa))/a))/a)a)/(a/(a/a*(-2)))(a/a*8)/aaaaaaa/a4aaa((a/(a1/a)a)(-39/5))(-49) assuming a is positive. a(41962/55) Simplify (b(3/28)/(b/(((b*15b)/b)/b)))/(bb(-2/9))(9/4) assuming b is positive. b(159/14) Simplify (((h(11/4)/h)/(h/(h/h(-25)hh)h))/((h/(h/(h*(-19)h)h))/h(-41)))6 assuming h is positive. h(69/2) Simplify (((n10n)/(nn(2/3)n)nn*(2/7)n12)(-8))(10/13) assuming n is positive. n(-36320/273) Simplify (q0)(-17/3)/(((qqq*(2/5))/q)/(((q/((q/(q/(qq*(-3/5))))/q))/q)/q))(q*(-5)q*(-3/5)q)(22/7) assuming q is positive. q(-569/35) Simplify (vv/v(-11)vv5v)*(-29)(v*6/vv(-5))(6/7) assuming v is positive. v(-580) Simplify x(2/19)/x*(3/5)((x/(x/(x/(xx(-2)))))/x)28(x/((x/(x(-1/3)/x))/x))(-47)xx*4/xx/x9 assuming x is positive. x(11164/285) Simplify ((h/(h/(h/(h/((h*(2/3)/hh)/h)))))/(h/(((h(-2/5)/h)/h)/h)))13h/h(-2/5)hh/h(-2/9)h*5/hh6 assuming h is positive. h(-2156/45) Simplify (a*8a(aa*(-3/5)a)/a(aaa0/a)(1/15))/((a/(aa(-2/17)))(-30))(-35/3) assuming a is positive. a(-8086/255) Simplify (t*(-2)t(-4))/(t(2/7))*49((tt(1/4)/tt)/(t*0t))/((t/(ttt*(-1)))/tt)(-2) assuming t is positive. t(-79/4)
Simplify (w(-3/5)/(w(3/5)/w)w(-9)/w(1/2))/((w(1/5))(-2))(1/22) assuming w is positive. w(-213/22) Simplify ((p(-3)p/(pp(-1)p)p)/((p(-4)p)/p(7/2)))/(p(-2/5)/(pp(-12)))(1/16) assuming p is positive. p(307/80) Simplify ((p(2/7))(-16))(3/14)(p((pp(-2/7)/p)/p)/p)4(p/p3p)/(p/((p/(p/((pp(2/3))/pp)))/p)) assuming p is positive. p(-1096/147) Simplify (t/(t/t(6/5)t)tt/t6)(2/13)(t(t/(t0t)tt)/t)*(-5)/((ttt(1/4)tttt)/t(-2/9)) assuming t is positive. t(-39913/2340) Simplify ((k(1/2))(1/55)/(k1)31)/(((k/(k/((kk*(-2))/k)k)k)/(kk(-3/4)))/((k/((k(4/7)/k)/kk))/(k(-1/12)k))) assuming k is positive. k(-65209/2310) Simplify (((s/s7s)/(s(-2/3)s))/(s1/s)(-2/3))/(s*(3/2)/ss/(ss9))(-20/11) assuming s is positive. s(-686/33) Simplify (aaa27aa23a*8/(a/(aa*(2/27))aa))(-6/7) assuming a is positive. a(-3190/63) Simplify ((c(-10)/(c/(c/((c/(c/c(1/5)))/cc))c))/(c(-18))46)(-4/9) assuming c is positive. c(-16336/45) Simplify ((f/((ff*29)/ff)f(7/4)/f)/(ff*(-1/2)ff(-14)))(-1/19) assuming f is positive. f(63/76) Simplify (l(1/6)ll(3/4))(1/16)((l/l(-4/11))/l)/((l/l(-5/3))/l)l(-5/6)lll(-1) assuming l is positive. l(-2147/2112) Simplify (kk/(kk*(1/3))k*(1/3)k*(-6)/(k/((kk/k*(-2)k)/k)))/((k(-1/3))(1/12))(-21) assuming k is positive. k(-31/12) Simplify ((gg(-12))/g)/ggg19gg(-3)g/(g*14g) assuming g is positive. g*(-9) Simplify (r(r(r/r17)/r)/r)(-2)/(r(16/9)/(r(-1/59)/rr)) assuming r is positive. r(16039/531) Simplify (z(1/3)/z)/((zz(3/5))/z)(z*(-7)z)/(z/z*(-2/3)z)((z/z(2/3))/zz)8/(z7zzzz/(zzzz(2/11)z)z) assuming z is positive. z(-2489/165) Simplify ((c/((c6cc)/c))/c4)(2/161)/((c(-1/4))33)(-1/13) assuming c is positive. c(-6353/8372) Simplify (k(1/4)k)*38(k1)(2/7)(kk/(kk(1/4)))(-2/31)/(k/(k/(k(2/7)/kk)kk))49 assuming k is positive. k(28587/217) Simplify (((((t/t2)/t)/t)/t(-3/20))/(((t*(-3/7)t)/t)/t(-19)))(-2/53) assuming t is positive. t(2999/3710) Simplify ((w(-2))*(-2/39)w12/(w/(w/(w(-12)/ww))))(3/11) assuming w is positive. w(940/143) Simplify (z2z11)(-50)/((z1)(-2/23)/(zz(-7)zz5/z)) assuming z is positive. z(-14971/23) Simplify (ss(1/3))(1/10)/(s/s*(2/9)s*(-1/3)/s)(s*(-4/7)s(2/23))(-40) assuming s is positive. s(145391/7245) Simplify ((i(1/4))(-21/5))(1/36)(ii*1i(4/3))(-11) assuming i is positive. i*(-8807/240) Simplify ((y/((((y/(yy/y(2/9)))/y)/y)/y))/((y(-10)/y)/y)(y/y5yy)/(y/(yy(-5))))(-10/9) assuming y is positive. y(-880/81) Simplify z(2/7)/((zz/((z(-3)/z)/z))/z)z/z*(-6/11)zzz/(z*5z)(z(1/3))17(z*(-6/11)z)/((z*7z)/z) assuming z is positive. z(-169/21) Simplify (o(-6)/(o/(oo(1/4)))(o/(o*(5/8)o))/o(-6))(-1/3) assuming o is positive. o(1/8) Simplify (u/(u3u)u/(u/(uu(-1/8)uuu)))*(-8)((u0)(2/7))(-3/5) assuming u is positive. u(-7) Simplify ((((m(-20)/m)/m)/m9)/(((m*(-1/7)m)/mm)/m(2/19)))(-47) assuming m is positive. m(198481/133) Simplify ((o(2/19)/o)8/((o((oo(-29)o)/o)/ooo)/o(-14)))(31/3) assuming o is positive. o(2852/57) Simplify (d1)*(-18/5)(d/d*5)/dd/d*(-6)((d*6d)/(d/d(-5)))/(d(-2/13)d(-6)) assuming d is positive. d(361/65) Simplify ((d/(d(-1/3)/d))(-38/5))(-3)(((d/(d/d*(-2/7)d))/d)(5/7))(-39) assuming d is positive. d*(28634/245) Simplify ((zzz/z(-3/8)z)/((zz(-9)z)/z))*2(z1)15/(z/z0)(-20) assuming z is positive. z(239/4) Simplify k44kk/k*(2/7)k((kk35)/k)(-35) assuming k is positive. k*(-8248/7) Simplify (mm*(-13)(m*(-13/5)/m)/mm(mm*(-2/15)m)/mmm/(m/(mm/m(2/7))))(-38) assuming m is positive. m(47956/105) Simplify (ss/s*(-3)(s*9s)/s)(-9/7)/((s/(s/s(-6)))/(ss(1/4))(s(-1/4))(2/11)) assuming s is positive. s(-471/44) Simplify (q/(q/q(1/5))qq*6q)/((q*(1/2)/q)/qq)*(2/29)((q(-1/3))(3/32))(-1/12) assuming q is positive. q(458641/55680) Simplify ((q*(-36)q)/q)/((qqq/q*(-25))/q)((qq0)/q)/q12 assuming q is positive. q(-75) Simplify (d6d(dd*0)/d((d*(-1/11)/d)/d)/((dd(2/11))/d))/(d(3/4)/dd6(d(-1/3))11) assuming d is positive. d(349/132) Simplify (j14jj/(j(jj/(j/(j*(-1/3)jj))jjj)/j)jjj(-1/9)j(2/31)/j)36 assuming j is positive. j*(12596/31) Simplify (((vvv3v)/v)3)(6/7)(((v(v2/v)/v)/v)/(v/v(2/9)))/(v/v*7v*9v) assuming v is positive. v*(509/63) Simplify (z/((zz/z(-2/9))/z))(-5/12)(z/z(1/3)z)/(zz(-6/7)) assuming z is positive. z(611/378) Simplify (((pp(-20/3))/(p(-2/93)p))/(((p/p(-14)p)/p)/p(-24)))(-24) assuming p is positive. p(33960/31) Simplify (j/((j(-3/10)j)/j)jj(1/21)(j(-3/2))(1/5))(-2/25) assuming j is positive. j(-86/525) Simplify ((n*(-1/3)n)/n)/((n/(n*5/n))/nn)(nn(-6)/n)/(n(-2/11)n)((n*(-2/7)/nnn)/n)(-2/35)(nn1nnnn)(-2/79) assuming n is positive. n(-2738227/638715) Simplify (((v(-1/4)v)/(v/v*(-8))((vv(-1)vv)/v)(-28))13)(2/9) assuming v is positive. v(-1885/18) Simplify ((h(1/4)h/(hh(-4/5)h))/(h(h(1/4)h)/hhh(-4)))/((((h0h)/h)/h)/(h(-2/23)/h)h*(-3)hh/(h/((h(-3/4)h)/h))) assuming h is positive. h*(2053/460) Simplify (qqq((q*(-3)q)/q)/qq/(q(-2/3)q))*(-3/7)/((((qq/q(3/5))/q)/(q8/q))/(q1/q)(-30)) assuming q is positive. q*(236/35) Simplify (((sss(-9/4)s)/s)(2/15)/(s(-7/4)/s((s/((s/(ss15/s))/s))/s)/s))4 assuming s is positive. s*(-677/15) Simplify ((pp(-4/7))/(p(-1)p))31((pp/(p(2/5)p))(-7))(-12/5) assuming p is positive. p(4089/175) Simplify ((s(-22/5)s)/(s/s25)(s(-17)/s)(-1/5))9 assuming s is positive. s(1089/5) Simplify (r/(r/r*(-2/7))r/(((r*19/r)/r)/r)(r/r*(1/3)r)/(rr(-3/4)))(9/7) assuming r is positive. r(-3495/196) Simplify (((((m(m/m*0)/mm)/m)(2/27))(-1/5))40)(-45) assuming m is positive. m*(80/3) Simplify (aa/(a/(aaa*38aa))aa)/a(2/59)(a/a(-1/6))/a(-8/7) assuming a is positive. a(117149/2478) Simplify ((s(6/11)/ss)(-27)(s(7/4)/s)11)(1/41) assuming s is positive. s(-285/1804) Simplify ((a(4/3))(-27)a/a(1/4)(a/a(-6))/a)(2/41) assuming a is positive. a(-117/82) Simplify (w(1/6)w)28/(w(-38)/(w(-2/75)w)) assuming w is positive. w(1791/25) Simplify (d(2/3)dd)*(28/5)dd/(dd*2d)dd*(2/3)(d/(dddd(-2/9))d/d2)/(d1d)(1/26) assuming d is positive. d(6871/585) Simplify (n(-4))(-5/2)n/(n*(8/13)/n)n/n(-4) assuming n is positive. n(213/13) Simplify ((((d(14/5)/d)/d)/d(13/2))/(d/(dd/d1))(-39))(9/2) assuming d is positive. d(-513/20) Simplify ((j/j(-2/19))(-35)(((j*(-16/3)j)/j)/j)/(j/(j/j*(-7/3)jj)jjjj))(-15) assuming j is positive. j(12735/19) Simplify ((oo*19o)/o*(-19/2)o*(-12)o(-3/11))(-5/7) assuming o is positive. o(-2005/154) Simplify ((k(-5)/(k*(2/13)/k)kk(1/2)kk(2/31))(-36))(-2/35) assuming k is positive. k(-6588/2015) Simplify ((rr*(3/8)r)/r)/r*3(r/((r/(rr(-3))r)/r))/r*(3/2)(((rr(-1)/rr)/r)(2/7))48 assuming r is positive. r(-1055/56) Simplify ((k(-1)k)(2/39)(k/((((k/(k*(-2/19)k))/k)/k)/kk))/(k/k(-3)))/(((((k/k(-1/3)k)/k)/k)/kk)/k(-7))21 assuming k is positive. k(-2947/19) Simplify (((y/(y/y4))/y)/(y(3/5)y))*(-9/4)/((yy/y(-3/2))/y(-2/19)(y/(y(-4)y)y)/yy/(yyyy5y)) assuming y is positive. y(-1047/380) Simplify (((m5m)/mm*(-2/9)m)/((mm(5/2))/(m/(m/(m/m0m)))))/((m0/m)(-13/8)/((m/(m/m(-1/3)))/(m(-5)m))) assuming m is positive. m(455/72) Simplify (x/(xx/x(-1/4)))37/(xx/x(-2/23)(x*2xx)/x)(xx6)/x4x(-3)/(x3x) assuming x is positive. x(-5091/92) Simplify (((((hhh(-2))/h)/h)/h)(6/11)(h/(h/(hhh(-1))))(4/7))19 assuming h is positive. h(-1558/77) Simplify ((rr(1/4))6/((r(2/17)r)/r(-1/7)))(4/19) assuming r is positive. r(2970/2261) Simplify (p5p(-2/5)(p0)3)/(((p*(-5/2)/p)/ppp3)/((pp1)/p)(-5/7)) assuming p is positive. p**(307/70)
Calculate the remainder when 3727 is divided by 178. 167 What is the remainder when 226 is divided by 59? 49 What is the remainder when 294 is divided by 78? 60 Calculate the remainder when 93 is divided by 19. 17 Calculate the remainder when 157 is divided by 85. 72 Calculate the remainder when 123 is divided by 27. 15 What is the remainder when 932 is divided by 52? 48 Calculate the remainder when 251 is divided by 168. 83 What is the remainder when 220 is divided by 6? 4 What is the remainder when 9764 is divided by 279? 278 What is the remainder when 6432 is divided by 65? 62 Calculate the remainder when 1543 is divided by 192. 7 What is the remainder when 351 is divided by 59? 56 Calculate the remainder when 154 is divided by 12. 10 Calculate the remainder when 385 is divided by 72. 25 Calculate the remainder when 304 is divided by 138. 28 Calculate the remainder when 60 is divided by 22. 16 What is the remainder when 1765 is divided by 61? 57 What is the remainder when 5917 is divided by 37? 34 Calculate the remainder when 1916 is divided by 19. 16 What is the remainder when 574 is divided by 48? 46 What is the remainder when 33387 is divided by 21? 18 What is the remainder when 166 is divided by 37? 18 What is the remainder when 635 is divided by 176? 107 Calculate the remainder when 1077 is divided by 12. 9 What is the remainder when 519 is divided by 87? 84 What is the remainder when 182 is divided by 23? 21 What is the remainder when 411 is divided by 79? 16 Calculate the remainder when 112 is divided by 69. 43 Calculate the remainder when 39 is divided by 12. 3 Calculate the remainder when 607 is divided by 237. 133 What is the remainder when 234 is divided by 124? 110 What is the remainder when 63 is divided by 22? 19 Calculate the remainder when 103 is divided by 37. 29 What is the remainder when 9 is divided by 9? 0 Calculate the remainder when 454 is divided by 35. 34 Calculate the remainder when 3824 is divided by 75. 74 Calculate the remainder when 432 is divided by 108. 0 What is the remainder when 24680 is divided by 22? 18 Calculate the remainder when 100 is divided by 65. 35 Calculate the remainder when 333 is divided by 16. 13 What is the remainder when 680 is divided by 49? 43 What is the remainder when 2004 is divided by 41? 36 What is the remainder when 595 is divided by 173? 76 Calculate the remainder when 7001 is divided by 699. 11 Calculate the remainder when 608 is divided by 102. 98 Calculate the remainder when 162 is divided by 5. 2 Calculate the remainder when 645 is divided by 335. 310 What is the remainder when 475 is divided by 159? 157 What is the remainder when 386 is divided by 133? 120 What is the remainder when 141 is divided by 26? 11 Calculate the remainder when 1164 is divided by 18. 12 What is the remainder when 615 is divided by 8? 7 Calculate the remainder when 158 is divided by 41. 35 What is the remainder when 4546 is divided by 1514? 4 What is the remainder when 96 is divided by 26? 18 Calculate the remainder when 2143 is divided by 25. 18 Calculate the remainder when 3717 is divided by 1237. 6 What is the remainder when 1731 is divided by 55? 26 Calculate the remainder when 628 is divided by 18. 16 What is the remainder when 39 is divided by 14? 11 Calculate the remainder when 61 is divided by 23. 15 What is the remainder when 190 is divided by 28? 22 What is the remainder when 274 is divided by 46? 44 What is the remainder when 196 is divided by 32? 4 Calculate the remainder when 2040 is divided by 406. 10 What is the remainder when 287 is divided by 170? 117 What is the remainder when 2769 is divided by 66? 63 Calculate the remainder when 266 is divided by 89. 88 What is the remainder when 51 is divided by 27? 24 Calculate the remainder when 99 is divided by 25. 24 Calculate the remainder when 6301 is divided by 129. 109 What is the remainder when 156 is divided by 16? 12 What is the remainder when 78 is divided by 27? 24 Calculate the remainder when 410 is divided by 107. 89 Calculate the remainder when 290 is divided by 112. 66 What is the remainder when 2899 is divided by 35? 29 Calculate the remainder when 545 is divided by 11. 6 Calculate the remainder when 1442 is divided by 179. 10 Calculate the remainder when 3797 is divided by 47. 37 Calculate the remainder when 926 is divided by 305. 11 Calculate the remainder when 877 is divided by 55. 52 Calculate the remainder when 317 is divided by 29. 27 What is the remainder when 20784 is divided by 126? 120 Calculate the remainder when 145 is divided by 75. 70 What is the remainder when 2063 is divided by 6? 5 What is the remainder when 515 is divided by 274? 241 What is the remainder when 339 is divided by 19? 16 Calculate the remainder when 1677 is divided by 60. 57 Calculate the remainder when 569 is divided by 114. 113 Calculate the remainder when 924 is divided by 240. 204 What is the remainder when 283 is divided by 25? 8 What is the remainder when 7071 is divided by 13? 12 What is the remainder when 214 is divided by 20? 14 Calculate the remainder when 306 is divided by 152. 2 What is the remainder when 832 is divided by 33? 7 What is the remainder when 155 is divided by 39? 38 Calculate the remainder when 1605 is divided by 44. 21 What is the remainder when 1271 is divided by 260? 231 Calculate the remainder when 177 is divided by 30. 27 Calculate the remainder when 39 is divided by 25. 14 Calculate the remainder when 979 is divided by 50. 29 What is the remainder when 10841 is divided by 78? 77 What is the remainder when 509 is divided by 127? 1 What is the remainder when 263 is divided by 44? 43 What is the remainder when 5 is divided by 1? 0 What is the remainder when 460 is divided by 114? 4 Calculate the remainder when 170 is divided by 16. 10 What is the remainder when 137 is divided by 20? 17 Calculate the remainder when 366 is divided by 363. 3 Calculate the remainder when 5504 is divided by 2752. 0 What is the remainder when 138 is divided by 3? 0 Calculate the remainder when 8029 is divided by 110. 109 Calculate the remainder when 948 is divided by 187. 13 What is the remainder when 217 is divided by 108? 1 Calculate the remainder when 94 is divided by 49. 45 Calculate the remainder when 159 is divided by 6. 3 What is the remainder when 1966 is divided by 968? 30 Calculate the remainder when 89 is divided by 42. 5 What is the remainder when 216 is divided by 33? 18 Calculate the remainder when 18 is divided by 4. 2 Calculate the remainder when 2717 is divided by 40. 37 What is the remainder when 55 is divided by 3? 1 What is the remainder when 52 is divided by 8? 4 Calculate the remainder when 4480 is divided by 1100. 80 Calculate the remainder when 1290 is divided by 260. 250 Calculate the remainder when 272 is divided by 69. 65 Calculate the remainder when 361 is divided by 50. 11 Calculate the remainder when 269 is divided by 27. 26 Calculate the remainder when 114 is divided by 53. 8 What is the remainder when 332 is divided by 86? 74 What is the remainder when 104 is divided by 18? 14 What is the remainder when 288 is divided by 34? 16 Calculate the remainder when 443 is divided by 37. 36 What is the remainder when 1185 is divided by 583? 19 What is the remainder when 1226 is divided by 481? 264 What is the remainder when 92 is divided by 48? 44 Calculate the remainder when 383 is divided by 75. 8 What is the remainder when 107 is divided by 11? 8 Calculate the remainder when 63 is divided by 29. 5 Calculate the remainder when 22486 is divided by 65. 61 What is the remainder when 279 is divided by 94? 91 Calculate the remainder when 112 is divided by 30. 22 Calculate the remainder when 362 is divided by 28. 26 What is the remainder when 221 is divided by 65? 26 Calculate the remainder when 187 is divided by 47. 46 What is the remainder when 11317 is divided by 10? 7 What is the remainder when 11812 is divided by 179? 177 What is the remainder when 103 is divided by 21? 19 What is the remainder when 21 is divided by 13? 8 Calculate the remainder when 1179 is divided by 387. 18 Calculate the remainder when 489 is divided by 20. 9 Calculate the remainder when 24 is divided by 14. 10 What is the remainder when 4458 is divided by 10? 8 Calculate the remainder when 15983 is divided by 148. 147 What is the remainder when 639 is divided by 606? 33 What is the remainder when 673 is divided by 16? 1 Calculate the remainder when 127 is divided by 11. 6 What is the remainder when 217 is divided by 125? 92 What is the remainder when 114 is divided by 39? 36
Let u = -5 - -3. Let g = 4 + u. Suppose gc - 75 = -3c. Is c a composite number? True Let c(t) = t*3 + 4t*2 + 3t + 2. Let x be c(-3). Suppose -3 = -5w + x, w + 82 = z. Is z a prime number? True Suppose -5d + 24 = 4. Suppose 0 = -2w - w. Suppose -4p = -da - 616, p + wa = 4a + 169. Is p a composite number? False Let f(l) = 9l - 3. Let t be f(-3). Is (-7056)/t + (-1)/5 a composite number? True Suppose -3w = -5v + 3 - 0, -4v = 5w - 32. Let x be (6/3 - v)/1. Is 5 + 2 + x + 1 composite? False Let l(j) be the first derivative of 5j3/3 + 5j*2/2 - 5j - 6. Is l(-6) composite? True Suppose -24 = -2q + 2r, 3q + 4r = -0q + 50. Suppose -x - 16 = -5x. Suppose -3f - q = -xf. Is f a prime number? False Suppose 373 + 12 = g - 4i, 4i = -g + 393. Is g a composite number? False Is (-1)/2 - (-126)/4 composite? False Let k be -1 + (-18)/(3-1). Suppose 0 = -4p - kh + 57, -41 + 3 = -3p + h. Is p composite? False Is (-1114)/(-6) + (-8)/(-6) a prime number? False Let w(a) = -a*3 + 9a*2 - 7a + 1. Is w(6) composite? False Suppose 0 = -5n + 3l + 2348, 0 = 3n - 0n - 4l - 1411. Is n a composite number? True Let w(z) be the third derivative of -29z6/24 + z5/60 + z*4/24 - 3z*2. Is w(-1) a prime number? False Suppose -5 = -2i + 5. Suppose 0 = 5d - io - 495, 3d = -0o - 3o + 309. Suppose d = 2b - 65. Is b composite? False Let c(b) = -b*2 + 7b - 7. Let z be c(7). Let w(a) = -94 + 102 + 3a2 - 8a + 0a2. Is w(z) a composite number? False Let u = 404 + -105. Suppose -f - 2t - 2t + u = 0, 0 = -5f + t + 1537. Is f a composite number? False Suppose 5j - 2p - 1249 = 0, 2j + p - 511 = -2p. Let z = 436 - j. Is z a prime number? False Suppose -2m - 2m = -2i + 8, -2i = -2m - 10. Let u = 29 + i. Is u a composite number? True Suppose 3b = 5b - 158. Suppose -127 = -4l - 3s, -4l = -4s - 199 + b. Is l a prime number? True Suppose -3b + 9 + 3 = 0. Suppose 3s - 732 + 79 = -bc, -c = 4. Is s composite? False Suppose -139 = 4c + 109. Let r be c/(-10) - 1/5. Suppose -p + rp - 50 = 0. Is p prime? False Let o be ((-5)/3)/(2/3 + -1). Suppose 9 + 1 = -2z. Is (6/z)/((-1)/o) composite? True Suppose -3r - 9r + 1020 = 0. Is r a composite number? True Let t(y) = -13y*2 + 2y - 1. Let k be t(2). Let c = -34 - k. Is c a composite number? True Let k = -6 - -15. Let m(d) = 3d2 + 2d - 10. Is m(k) a prime number? True Suppose -3s = 2d - 171 - 134, 5s = -15. Is d prime? True Let p = -12 - -329. Is p prime? True Let i(h) = 6h + 23. Let j(s) = 4s + 15. Let l be (3/(-3))/((-1)/(-5)). Let p(b) = li(b) + 8j(b). Is p(8) composite? True Suppose 0 = 5o - 2o - 12. Let w = 7 - o. Suppose 0 = 2v + 4l - 126, wv = -l + 3l + 213. Is v composite? True Let x(v) = -16 + v + 0v + 4v2 - 4v. Is x(-7) prime? False Let i(w) = -133w + 22. Is i(-7) prime? True Suppose -10 - 2 = -2f. Let k(g) = g*2 - g + 13. Let b(o) = -1. Let x(d) = fb(d) + k(d). Is x(0) a prime number? True Let m = 7 + -5. Suppose my - 6y = -232. Is y a composite number? True Let p(h) = -h*2 + 5h + 2. Let k(u) = -u*2 + 4u + 1. Let a(g) = -5k(g) + 4p(g). Is a(-4) prime? True Let j(y) = -1598y - 11. Is j(-3) a prime number? True Suppose 2p + 4l - 7 = 23, -5p + 57 = l. Let x = p + -8. Suppose -2j = xj - 175. Is j prime? False Is 21592/24 - (-2)/(-3) composite? True Let x(y) be the first derivative of -3y4/4 + y3/3 + y2 + 2y - 4. Is x(-2) a composite number? True Let j = 2375 + -1314. Is j prime? True Is ((-16)/((-192)/(-90)))/(1/(-2)) a composite number? True Suppose -4 = c - 2d, -3d = c - 6d. Let u be -152/(c/2). Suppose up - 30 = -0p. Is p a prime number? False Let p(q) = -3q2 - 11q - 4. Let r(o) = 3o2 + 11o + 5. Let n(f) = 6p(f) + 7r(f). Is n(-8) composite? True Let l = 5 - 2. Suppose 0 = -lw + 3, w + 273 = 4i - 306. Is i prime? False Let w = 4 + -2. Suppose 0 = 3r - wv - 74, -r + 2v + 18 = -0v. Let k = -14 + r. Is k a composite number? True Let k = 1285 - 879. Let t = k + -147. Is t a prime number? False Let h be -1 - 2/((-6)/423). Let d = h - -135. Suppose 0 = 2g + 3g - d. Is g a composite number? True Let d(t) = -t*3 - 5t*2 + 4. Let x be d(-5). Suppose -22 + 100 = 3c - 3b, 5b = -c - x. Is c prime? False Is (1 + -3)51/6-5 composite? True Let p(k) = -103k + 1. Let t be p(-1). Suppose -t - 7 = -3x. Is x prime? True Let t(f) = -4f3 - 3f*2 - 4f - 3. Suppose -2v = 4q - 16, -3v + 5q + 12 = -1. Let m = 4 - v. Is t(m) composite? True Let h(t) = 32t2 + 4t - 11. Is h(-6) prime? True Suppose 1262 = 6y - 148. Is y a prime number? False Let r be (-36)/(-10) - 4/(-10). Suppose 0 = -2v + rm + 454, -147 = 4v - 2m - 1043. Suppose -4f = 5g - 465, -2f + 12 + v = 5g. Is f a composite number? True Let v(l) = -l2 - 8l - 6. Let o be v(-6). Suppose -ot + 436 = -278. Is t prime? False Suppose -5s = 3b - 31, -5s + 8 = -4b - 9. Suppose so - 355 = 5x, -3o + 3x = -6o + 189. Is o prime? True Suppose 7t - 6t = 2. Let u(a) = 4a - 1. Let m be u(-2). Is t - 1 - (m + 3) a prime number? True Suppose 4j = 357 + 159. Let q = j - 71. Is q composite? True Suppose -5o = -3h - 15, h + 20 = 4o - 3h. Suppose o = -3l + 27. Is l a composite number? True Is (-1934)/(-3)(-45)/(-30) composite? False Let z(j) = -j3 + j2 + j + 106. Suppose -9 = 4d - 0n - 3n, -n = -3d - 3. Is z(d) prime? False Suppose 4y - 2p = 3p - 40, -4y - 16 = p. Let w be 2/(-10) - (-369)/y. Is (w/(-4))/((-2)/(-4)) a composite number? False Suppose 8724 = -w + 5w. Is w composite? True Let p(v) = 7v - 12. Is p(9) a prime number? False Let c(y) = 1. Let u(q) = q*2 - 10q - 6. Let g(j) = -3c(j) - u(j). Is g(8) prime? True Let m(j) = -18j + 1. Let p be m(3). Let b = p - -25. Let g = b - -41. Is g a composite number? False Let y(d) = -12d + 6. Let f be y(6). Suppose 0 = -2z - 5o + 261, 2z - 2o - 3o = 231. Let r = f + z. Is r a composite number? True Let j be (13(-2 + -1))/(-1). Suppose -4z = -149 - j. Is z a composite number? False Let d be -1 + -820 + (-11)/11. Is (-2)/(d/(-826) - 1) composite? True Suppose 5z + 0z - 7 = -k, 0 = -k - 2z + 16. Suppose 0 = -3o + 371 + k. Is o prime? True Suppose 410 = s - 40. Let v = -199 + s. Is v a prime number? True Suppose 0 = -s - 0s + 431. Is s a prime number? True Let s(v) = -3v*3 + 7v*2 + 12v - 23. Is s(-11) composite? True Let y(t) = t*3 - 5t*2 + 5t - 5. Let f(q) = -q + 12. Let l be f(6). Let h be y(l). Suppose h = 4p - 63. Is p a composite number? False Let n be (-12)/(-3)6/8. Suppose nf - 3m - 211 = m, 281 = 4f - 5m. Is f composite? True Suppose -6i = -8i + 5878. Is i composite? False Let u(w) = -w*3 + 12w*2 + 11w + 17. Is u(12) prime? True Suppose z = 2g - 4, -6z + 2g + 2 = -2z. Is 214 - (-1)/z-6 prime? True Suppose 3v + 6 = 3c, 2v - 2 = c - 2c. Let i(t) = 2t*2 - 4t - 4 + 0t + 20t*c - 5t*2. Is i(-3) composite? True Let t(v) = -79v. Suppose -3y = -2 + 5. Is t(y) a prime number? True Let p(f) = 2f3 + f2 + 3f + 4. Let s = -11 + 8. Let q be p(s). Let x = 75 + q. Is x prime? False Let q be (-40)/(-4)2/4. Suppose 0 = -5r + 2n + 6, -qn + 3 + 11 = 2r. Suppose 2c = 6z - z - 315, -rc + 10 = 0. Is z composite? True Suppose -3i + 2s = s - 1072, -1441 = -4i - s. Let u = -216 + i. Suppose 0 = 3a + 5r - u, 4a + 47 = -2r + 233. Is a a composite number? True Let b = 22 + -24. Is 143 - (b + -2) - -2 prime? True Let c = 4 + -7. Let t(p) = 7p2 - p + 1. Is t(c) a composite number? False Let p(l) = 5l + 2. Let z(g) = g*2 + 14g + 5. Let b(v) = -8p(v) + 3z(v). Let n be b(1). Suppose -148 = -ns - 2t, -5t + 3 = -17. Is s a composite number? True Suppose -2o = 2x - 1572, -4o + 0o - 2x + 3146 = 0. Is o prime? True Let f = 106 + 177. Let h = f - 106. Is h prime? False Let k(b) be the second derivative of b*4/3 + 2b*3/3 - 5b*2/2 - b. Is k(5) composite? True Let r be (1 + -169)(-20)/15. Let l = r + -159. Is l a composite number? True Let o(r) = -r*3 - 2r*2 + 5r + 3. Let a be o(-3). Is 16 + 1 + a + 1 a prime number? False Let r = 2 - 1. Is r/(-5) - (-872)/10 composite? True Suppose 4c - 4 = 0, -1 = -3z - 2c + 13. Suppose -3t - 2w = 0, -zt - 4w = -6 + 2. Is t/(-7) - (-645)/21 a prime number? True Suppose 0 = 2a + 5 - 25. Suppose a = 3r - 2. Suppose 3f = -3b + 588, -3f - rb + 173 + 420 = 0. Is f composite? False Suppose -5o + 425 = -5r, 3o + 3r = 7o - 338. Is o a composite number? False
Suppose 25x - 12x = 702. Calculate the remainder when x is divided by (95/20)/(1(-2)/(-8)). 16 Suppose 390 - 218 = 5i - 73. Calculate the remainder when 1193 is divided by i. 17 What is the remainder when (-190)/4(12980/(-100) + 11) is divided by 314? 305 Let k = 0 - -2. Suppose ko = 151 - 17. Let y = -35 + o. Calculate the remainder when y is divided by 12. 8 Let m be (-58)/(-18) + (141/(-27) - -5). Let g = m - 47. Let q = g + 54. Calculate the remainder when 23 is divided by q. 3 Suppose -199t + 6440 = 1465. What is the remainder when 144 is divided by t? 19 Suppose 2p = -12v + 13v + 147, 3p = v + 218. What is the remainder when 303 is divided by p? 19 Suppose -b + 324 = 3z, -279z + 648 = 2b - 281z. What is the remainder when b is divided by 58? 34 Let d be -1((-3)/(-9) + (-152)/6). Suppose d = -5c, -4n + 5c + 97 = -n. Calculate the remainder when 94 is divided by n. 22 Let n = -434 - -438. Suppose 3o = 0, -4o + 48 + 0 = np. Calculate the remainder when 597 is divided by p. 9 Let h(n) = -n*3 + 19n*2 - 123n + 2501. What is the remainder when h(19) is divided by 97? 67 Let v = -822 - -823. Calculate the remainder when 102 is divided by (-9030)/(-126) + v/3. 30 Suppose -3b + 5w + 166 = 43, w + 41 = b. Calculate the remainder when 1265 is divided by b. 35 Suppose 86a - 79a = 315. Let m = -182 - -265. What is the remainder when m is divided by a? 38 Let b(w) = -42w3 - 4w*2 - 2w + 4. Let h(c) = c*2 + 2c - 3. Calculate the remainder when h(10) is divided by b(-1). 29 Let o be (1030/35 - 16/(-28)) + 0. Calculate the remainder when 18 is divided by 27/216 - o/(-16). 0 Suppose s = -4r - 81, 2r = s - 4s - 193. Let k = -33 - s. What is the remainder when 138 is divided by k? 26 Let w be 741/133 + (-6)/(-14). Suppose wi - 15i + 567 = 0. What is the remainder when i is divided by 24? 15 Let k = 13007 - 12328. Calculate the remainder when k is divided by 317. 45 Let i(a) = a2 + 16a + 30. Let o be i(-15). What is the remainder when ((-96)/(-2))/(o/60) is divided by 99? 93 Suppose -2292 = -9a - 249. Calculate the remainder when a is divided by (-12 + 3)(25/(-3) + 2). 56 Let z be ((-8)/(-12) - 0) + 10864/21. Let l = -473 + z. What is the remainder when l is divided by 16? 13 Let q(r) = 3r - 6. Let m be q(7). Suppose 17f - 1880 = 211. What is the remainder when f is divided by 621/m + 3/5? 39 Let k = 485 - 418. Let g be (-4)/(-14) - (-6)/(-21). Suppose 0 = i - g - 10. Calculate the remainder when k is divided by i. 7 Let b = 1886 + -1834. Calculate the remainder when 1141 is divided by b. 49 Let r(z) = 50z - 1903. What is the remainder when 883 is divided by r(39)? 37 Calculate the remainder when 1226 is divided by (10/(-8) + 0)/(-1418/25200). 101 Let o(j) = -316j - 1296. What is the remainder when 574 is divided by o(-5)? 6 Let p(l) = -876l + 5301. What is the remainder when p(5) is divided by 71? 69 Let g = 89 + -64. Suppose 4o = 3o + 3y + 3, y = 0. Suppose -ou + 4u - 7 = 0. Calculate the remainder when g is divided by u. 4 Let s(n) = -n3 + 2n*2 + 8n - 8. Let g be s(2). Calculate the remainder when 31 is divided by (42/24)/(g/32). 3 Let x = -458 - -518. Suppose -p - 2t + 32 = -12, 4t = -p + 36. Suppose 3m + 16 = 3i + p, -16 = -m - 3i. Calculate the remainder when x is divided by m. 8 Let y(t) = t3 + 7t*2 - 9t - 7. Suppose -4b + 1 = 3b - 8b, 10b - 42 = -s. Calculate the remainder when s is divided by y(-8). 0 Let l = 4702 - 4237. Calculate the remainder when l is divided by 1. 0 Let t = -14 + 21. Let y(b) = b*2 + 7b - 287. Let q be y(0). Let c = q + 312. Calculate the remainder when c is divided by t. 4 Suppose d = -4f + 41 - 1, -d + 5f = 32. Calculate the remainder when 14477 is divided by d. 5 Suppose -3y = 2n - 48, -107y + n + 53 = -103y. Let c(i) = 8i - 18 - 4i - 14. Calculate the remainder when 68 is divided by c(y). 20 Suppose -13j + 6552 = -34j. Let u = j + 318. What is the remainder when 21 is divided by u? 3 Let h(i) = 3i2 + 100i - 695. Calculate the remainder when (2/(-3))/((-4)/768) is divided by h(6). 11 Suppose 11o - 260 = -4v + 10o, -3o = 4v - 252. What is the remainder when 79 is divided by (-1 + 3)/(11/v)? 7 Suppose 5j = 287 + 173. Let h be -1 - j2/1. Calculate the remainder when 21 + 12/(-30)h is divided by 39. 37 Suppose 4g + 660 = -4q + 680, -22 = -2q + 2g. Let c = -8 - -14. Suppose 2x - c = y, 2x = 5 + 5. Calculate the remainder when q is divided by y. 0 Suppose 0a - 2u = 3a - 49, 5a = 5u + 65. Suppose -92o + 27 = -8o - 141. What is the remainder when a6 - -2 - o is divided by 31? 28 Suppose 5m = 10 + 10. Suppose -48 = mf + 4f. Let g(n) = 2n2 + 9n + 10. What is the remainder when 51 is divided by g(f)? 23 Let g(x) = 79x + 4221. What is the remainder when 540 is divided by g(-50)? 269 Let f be -2156(-10)/75. Suppose 4c - f = -5g, -4c + 2g + g = -140. What is the remainder when c is divided by 11? 5 Suppose 0 = -15u + 9u - 25u. Suppose ud + 170 = 5d. What is the remainder when 218 is divided by d? 14 Let m = 38 - 12. Suppose t - 2 = -3w, 3t - 2t - 5w = m. Calculate the remainder when 38 is divided by t. 5 Suppose 174 = 3w - 93. Suppose 9g - 130 = 347. Let m = 98 - g. Calculate the remainder when w is divided by m. 44 What is the remainder when 13324 - ((-200)/(-20) + (-88)/8) is divided by 119? 116 What is the remainder when ((-6)/4)/(9/(-402))84/21 is divided by 138? 130 Suppose -16r - 12r - 5254 = -47338. What is the remainder when r is divided by 376? 375 Suppose k - 59 = 5b - 10b, -5k - b = -319. Let m = 1319 - 1297. What is the remainder when k is divided by m? 20 Let l(c) = -6c3 - 3c*2 - 17c + 1. Calculate the remainder when l(-4) is divided by 7. 6 What is the remainder when 573 is divided by (-7 + (-43)/(-5))/(2/10)? 5 Let j(u) = -263u + 8467. Suppose 4 = -2i + 164. Calculate the remainder when j(31) is divided by i. 74 Let w = -413 - -469. Let a = 57 + -37. Calculate the remainder when w is divided by a. 16 Suppose p + p + s = 4061, 5p = s + 10163. Calculate the remainder when p is divided by 37. 34 Suppose -2k + 3054 = v, 7v = 12v + 2k - 15286. Calculate the remainder when v is divided by 68. 66 What is the remainder when (-48108)/(-18) - (-12)/(-18) - 10 is divided by 205? 202 Let t(q) = 4q*2 + 11q + 61. Let a = 405 - 410. What is the remainder when t(a) is divided by 32? 10 Let x = 419 + -286. Suppose 6l = -5k + l + 225, l + 185 = 4k. What is the remainder when x is divided by k? 41 Suppose 2t + 97 = 105, 0 = 4p + 5t - 780. Calculate the remainder when p is divided by 0 + 34 + 0 + 2. 10 Let b(x) = -108x + 879. What is the remainder when 143 is divided by b(7)? 20 Let l be -2 + (-661 - (0 + 0)). Let n = l - -933. What is the remainder when n is divided by (52/(-6))/((-24)/108)? 36 Suppose 0 = 16v - 11v + 5, 0 = -4p - 5v + 167. Let h = 426 - p. Calculate the remainder when h is divided by 16. 15 Let a = 3004 - 2978. What is the remainder when 749 is divided by a? 21 Suppose 5w + 3 = -a - 10, -12 = 4w. Let j = -107534 + 107562. Calculate the remainder when j is divided by a. 0 Let l be (69/15 - 5)/((-1)/5). Let g(r) = -5r + lr - 2r + 9r - 49. What is the remainder when 11 is divided by g(13)? 2 Let h be 32-1(-9)/12. Suppose -4t = -a - 125, 5t + 4a - 177 = -5. Suppose -8n + h = -t. Calculate the remainder when 31 is divided by n. 3 Let s(h) = -78h - 727. What is the remainder when s(-11) is divided by 2 + 51(-2)/(-6)? 17 Let t be (-3116)/(-57)(-6)/(-4). Let b = -37 + t. What is the remainder when b is divided by -8(-2)/((-8)/(-6))? 9 Suppose -4g = -2u - 1218, -5g - 2122 + 350 = 3u. Let w = u - -839. What is the remainder when w is divided by 61? 57 What is the remainder when (21 - 5)/2 + 6467 is divided by 10? 5 Calculate the remainder when (-4)/34 - ((-61542)/306 + 20) is divided by 32. 21 Let z = -1 - -5. Suppose zy = 429 - 149. What is the remainder when y is divided by -74(-5 - ((-5715)/300 + 14))(-12 + 2)? 33 Suppose 3l - 15 = -5x, 3x = -2l - 1 + 10. Suppose -2970 = -88m + 22m. Calculate the remainder when m is divided by x. 0 Suppose -2j + 4a = -26, 10a - 12a + 15 = 3j. Suppose 0 = -2t - 4t + 1086. Calculate the remainder when t is divided by j. 6 Let h = -2680 + 3217. Calculate the remainder when h is divided by 128. 25 Let d(k) = -k3 - 26k*2 + 32k + 137. What is the remainder when 256 is divided by d(-27)? 0
Suppose 3h - 270 = -276. Which is the second smallest value? (a) 2/19 (b) h (c) -0.5 (d) 0.14 c Let p = 20/69 - 22/23. Which is the second smallest value? (a) -2/7 (b) p (c) -7 b Suppose 0 = -4z + 3z. Suppose -6f = -f + 5j - 30, 4j - 12 = -f. Suppose -ft = 16 - z. Which is the biggest value? (a) t (b) 5 (c) 1 b Let l be (-2)/9 - (65/(-9) + -1). Suppose 0 = -5m + 12 + l. What is the third smallest value in -0.1, m, -4, -1/5? -0.1 Suppose -3 = -t - k, -t + 4t - k = 17. Let g = -0.02 + 0.1. What is the third biggest value in 0, g, t? 0 Let i = -8551 - -8548. Let a = -0.29 - -0.3. What is the second biggest value in a, 1, i? a Let w = 26 - 12. Let m = w - 10. Which is the smallest value? (a) m (b) -0.3 (c) 0.7 b Let v = 269/330 + -1/66. Let l = 1.1 + -0.5. Let x = 0.4 - l. What is the smallest value in x, 0, v? x Let n = 2/135 + 223/135. Let u = 0.16 - 28.16. Let v = u + 27.9. Which is the second smallest value? (a) n (b) v (c) -3 b Let y = 2316.11 - 2344. Let o = y + 28. Let z = o - -2.89. Which is the second smallest value? (a) z (b) 0 (c) 5 a Let g be -125/2. Let q = -8.56 - 0.44. Let k = q + 6. Which is the second biggest value? (a) k (b) -1 (c) g a Let n = -7 - -11. Let m = 0 - 59. Let q = m - -64. Which is the second smallest value? (a) q (b) n (c) -5 b Let n be (-24)/(-14)1316/282. What is the biggest value in n, -3, 3, 5? n Let m = -37 + 37.2. Let j = m + -0.1. Let u = -18 - -13. Which is the third smallest value? (a) j (b) 0 (c) u a Suppose 2f = -1 + 9. Suppose 0 = -fr + 8. Suppose r + 4 = 3p. What is the smallest value in 1, p, -2? -2 Let w = -12.4 + 14.26. Let s = w - -0.14. Let y = 4 + s. Which is the smallest value? (a) -3 (b) y (c) -2 a Let k be (-26)/(-10) - (-18)/45. Let i be 3/(-47)2/k. Let z = -88/141 + i. What is the third biggest value in -0.4, -2/9, z? z Let n = 16.2 - 111.2. Let p = n + 92. Which is the biggest value? (a) 4 (b) p (c) -2/7 a Let k = -2556 + 2556. Which is the second biggest value? (a) 1 (b) 2/17 (c) k b Let w = 15 - 5. Let p = 5 - w. Let c = -148 - -152. What is the second biggest value in p, 5, c? c Let h = 85 - 84.9. Which is the fourth biggest value? (a) -1/6 (b) 2/3 (c) 2/9 (d) h a Let v = -2102 - -1280. Let m = v - -3155/4. Let l = 1987/60 + m. Which is the third smallest value? (a) 3/5 (b) l (c) 3 c Let u = 24 - 27. What is the second smallest value in -4/3, -3/11, u? -4/3 Suppose m = 4m - 3, 0 = -4f + 5m - 65. Let z be ((-17)/(-10) + -2)4/f. What is the biggest value in 0, z, -2? z Let k = 21 + -20. Let z = 12 - 17. Let l(i) = i*3 + 2i*2 + i + 1. Let v be l(-2). Which is the smallest value? (a) z (b) v (c) k a Let s = 653.55 - 653. Let k = 2.25 + -2. Let f = s - k. Which is the third biggest value? (a) f (b) -5 (c) 3/7 b Let p = 1 - 0. Let u be 1 + (-2)/(-2)-35. Let t = u + 29. Which is the second biggest value? (a) t (b) p (c) -3 c Let t = 3 + -4. Let y be (-1)/t + (-25)/20. Let v = -402.5 - -403. Which is the third biggest value? (a) 0.3 (b) y (c) v b Suppose 0 = 2q - 4q + 6, 3q = 5n + 34. Suppose -234f + 238f = -2m - 16, -5m + 4f - 26 = 0. Which is the third smallest value? (a) m (b) 3 (c) n b Let d = 0.0505 + 0.0495. Which is the biggest value? (a) 1 (b) d (c) 3 c Let x = 3.89 + -0.29. Let d = x - -0.4. Suppose -t + 0 = -4z - 1, 3z - 4 = -4t. What is the second smallest value in d, -0.3, t? t Let d = 23 + -18. Suppose g - 8 - 1 = -o, 54 = 5o + 2g. Let f be o/(-10)20/8. What is the third biggest value in d, 1/5, f? f Let j = -0.07 + 4.07. Suppose -5o + 210 = -5m, -80 - 2 = 2m - 3o. Let v = 44 + m. Which is the second smallest value? (a) v (b) j (c) -3 a Let f = -73.7 - -66. Let l = f - -2.7. Let x = 4.7 + l. Which is the biggest value? (a) x (b) -0.5 (c) 0.5 c Let y = -13 + 4. Let h be (413/14)/((-18)/4). Let l = 631/99 + h. Which is the biggest value? (a) -2 (b) l (c) y b Let g = 182.6 + -343.6. Which is the third smallest value? (a) -1 (b) 0.3 (c) g (d) 0 d Let f = -2.1 - -2. Let k = -42 + 43.3. Which is the third biggest value? (a) f (b) -3 (c) k b Suppose -4i + 7 = 3. Let g = 0.39 + 57.61. Let r = 57.99 - g. Which is the third smallest value? (a) r (b) -0.3 (c) i c Let u = -112 + 102. Let f = u - -7. Suppose 0z = -z. What is the third biggest value in z, f, -0.5? f Let o = 62 + -62. Let h = -0.4 - -0.3. Let w = 2.1 + h. What is the second biggest value in w, o, 1/2? 1/2 Let r = -48 + 48. Let q = 0 + r. Let k = 1.8 + -2. Which is the second biggest value? (a) k (b) 0.3 (c) q c Let x be 29 + -27 + 16/(-10). Which is the third biggest value? (a) 0 (b) x (c) -6 c Let m = -9 + 9.5. Let f = 0.0072 - -0.1928. Which is the smallest value? (a) -2 (b) -2/3 (c) f (d) m a Let k = -1.6 + 0.2. Let d = k + 1.5. Which is the biggest value? (a) -4/7 (b) d (c) 3 c Let y = 22843/7 - 3251. What is the smallest value in 4, y, -0.2? -0.2 Let z = -0.01 - 4.99. Let u = 0 - -0.1. Let w = -182 + 182.4. What is the second smallest value in u, w, z? u Suppose -7p = -4p - 39. Let n(m) = m - 14. Let l be n(p). Which is the second smallest value? (a) l (b) -0.3 (c) -2/15 (d) 0.09 b Let q = -97 + 99. What is the second smallest value in q, -2, 59? q Let u = -25 + 8. Let a be (-4 + u/(-5))-25. Suppose 4t = t - a. What is the biggest value in -2, t, 1? 1 Let x(d) = -d2 + 5d + 26. Let s be x(-3). What is the third smallest value in 0.1, 3, s? 3 Let z = -4/5 + 1. Let b = 70 - 73.3. Let y = b + 2.8. What is the smallest value in 3, y, z? y Let q = -61 - -65. Which is the second smallest value? (a) 3 (b) -3/2 (c) 26 (d) q a Suppose -18 = 17f + 50. What is the third smallest value in 1/66, -0.2, -0.4, f? -0.2 Let t = 1619/3 + -539. Which is the third smallest value? (a) 0 (b) -45 (c) t (d) -1/2 a Suppose 4y + 2n = n + 67, -4y = -3n - 87. Let j be y/(-117) + (-29)/(-104). Let q = -1.05 + 0.05. What is the smallest value in j, q, -2? -2 Let d = -40 + 43. Let g = -31 - -26. Which is the third biggest value? (a) d (b) 4 (c) g c Let x = -81.4 - -81. Let i = -214 - -194. What is the third smallest value in i, x, -0.3? -0.3 Let z be (1/(-2))/(-9 - (-273)/30). Which is the second smallest value? (a) 4/3 (b) z (c) -0.37 c Let i(j) = -j2 - 4j + 1. Let f be i(-4). Let g be 2f(-15)/(-6). What is the biggest value in 15, 0, g? 15 Let f = 1 - 6. Let v = -8 + f. Let k = -11 - v. Which is the second smallest value? (a) k (b) -2/5 (c) 1/8 c Let b = -3 - 9. Let v = 2.5 + -12.5. Let g = v - b. What is the biggest value in -0.5, g, -5? g Suppose 0 = -5f - 33 + 33. Suppose 0 = 4l - 2l - 4. Let r be f + 7/(161/l). Which is the third biggest value? (a) -0.1 (b) r (c) 5 a Let o = -3.4 - 2.6. Let r = o - -5. Which is the third smallest value? (a) -0.1 (b) 0 (c) r b Let f = -7.9 - -6.9. Let d = -10.3 + 14.6. Let c = -0.3 + d. What is the second smallest value in f, c, -5? f Let t = -0.03154 + -0.46846. Let v = 116/5 - 23. Let p = 4.8 + 1.2. What is the second biggest value in v, t, p? v Let y = 9.8 - 9. Let z = y - 1.3. Let g be 6/8 - (-14)/(-24). What is the third biggest value in g, z, 3/4? z Let p be (2/16)/(42/18 - 2). What is the biggest value in 2/3, p, 1? 1 Let w = -2 + 1.5. Let k = -68.83 + 73.83. Which is the fourth smallest value? (a) k (b) 2/21 (c) 0.11 (d) w a Let o = -178 + 178.4. Which is the biggest value? (a) -0.33 (b) o (c) -2 b Suppose -21t = -14t - 7. Suppose -5j - 6o = -o - 30, 5j - 3o - 14 = 0. Let q be (j/22)/(-6 - -7). Which is the third smallest value? (a) t (b) q (c) 4 c Suppose 0 = i + 9i - 60. Suppose 2g = -4x + 2, 2g + 2x + 14 = ix. What is the third smallest value in 0.09, g, -1? 0.09 Let m(l) = -2l*3 + 3l*2 - 3l + 2. Let x(n) = n*2 - 18n + 33. Let j be x(16). Let d be m(j). What is the biggest value in 2, 1/4, d, -2/3? 2 Suppose 2q + 3q + 35 = 0. Let i be (4/(-3))/(q/3). Let z = -11 - -45/4. Which is the second biggest value? (a) -1/4 (b) z (c) i b Let x = -2/353 - -373/3530. Let u = 1.129 - 2.529. Which is the third smallest value? (a) u (b) -0.1 (c) x c Let o be (-3)/15 - (-20)/50. What is the third smallest value in -5, 6, o, -1/3? o Let t = 792/1955 - 2/391. Which is the third smallest value? (a) -2 (b) t (c) 4 (d) -13 b Suppose -4 = -3y - y. Let f be (3/(-2))/(y/2). Let z = -2163.2 + 2163. What is the biggest value in z, f, -2/3? z Suppose -w = -4w - 2i + 58, -w + 5i + 8 = 0. Let g = 0.04 + -0.44. What is the fourth biggest value in -1/2, w, g, 3? -1/2
Rearrange -u + 0u + u - 16u*2 to the form nu*2 + x + yu and give n. -16 Express -7p + 107p*2 + 1 - 2p*3 - 107p*2 in the form g + ap + xp3 + zp2 and give a. -7 Express -d3 + 2d - 3d*2 + 0 - 3 + 3 as u + sd*3 + qd*2 + bd and give b. 2 Rearrange (2k - k - 2k)(-8 + 32 - 11) to zk + f and give z. -13 Rearrange h*2 - h + 6h*3 + 20h*3 - 2h*2 + 2h to yh + i + dh*3 + lh*2 and give d. 26 Express -2 + 0 + 0 - 3k*2 in the form rk + d + wk2 and give d. -2 Rearrange -8f + f*3 - 3f - 2f3 + f to c + vf + pf3 + kf*2 and give v. -10 Rearrange -7f + 3f + 6f to the form mf + v and give m. 2 Rearrange (-x4 - 2x*4 + 4x*4)(-6 + 1 + 0 + 2 - 2 - 1 + (1 - 2 - 1)(1 - 5 + 3)) to h + vx*2 + wx + ox4 + dx*3 and give o. -4 Rearrange (-9c*3 + 8c*3 + 3c*3)((c - 3c + 3c)(-1 + 3 - 3) - 4c + 3c - c) to the form tc*4 + rc + bc2 + a + lc3 and give t. -6 Rearrange (1 - 1 - a2)(-1 + 3 - 1) + 6a*2 - 7a*2 + 19a*2 + (a - 1 + 1)(1 - 1 - 2a) + 5a*2 - 4a*2 - 2a*2 to o + ra*2 + pa and give r. 14 Express 11k4 - 2 + 2k*3 - 7k*2 - 9k*4 + 8k*2 as jk*4 + h + ck + nk3 + qk*2 and give n. 2 Express -9k3 + k3 - k*3 + (-1 + 0 + 3)(k*3 + 0k*3 - 5k*3) in the form xk + lk2 + r + yk*3 and give y. -17 Rearrange -8 - 19 - 10m2 + 30 - m3 to the form im + q + wm*2 + sm*3 and give w. -10 Express -1 + 10a - 6a2 + 2 + 4a*3 - 7a*2 - 8a in the form ua3 + qa*2 + pa + m and give m. 1 Rearrange w*2 - 2w*3 + w - 2 + 7w - 7w - 5w to the form h + aw2 + uw + pw3 and give u. -4 Express (-8t - 6t + 12t)(-2 + 2 + 2)(1 + t - 1)(2 - 1 - 2) in the form yt + mt2 + l and give l. 0 Express 3t - 4t + 3t + 3t as z + bt and give b. 5 Express -63y4 - y3 + 2y + 46y4 - 4y in the form cy + uy*3 + jy*4 + ty2 + x and give c. -2 Rearrange (0 + m2 + 0)((3m - m - m)(-1 + 4 + 0) - 7m - 1 + 3m + 3m) to the form zm3 + l + um*2 + xm and give z. 2 Express l*2 + 4l*2 + 5l*3 - 6l*2 as ql + bl3 + t + gl*2 and give g. -1 Rearrange -47g*3 + 78g*3 - 42g*3 + 3g*4 - 2g to the form bg + mg*2 + hg*4 + v + ig*3 and give i. -11 Express (-2r*2 - 3 + 3)(1 - 1 + 1) as br + zr*2 + s and give z. -2 Rearrange -2b*3 - 1063b4 + b + b2 + 7 + 1064b4 - 3 to z + db*2 + nb*3 + rb + ub4 and give d. 1 Rearrange 60 + 5f - 60 to the form hf + j and give h. 5 Rearrange -10m*2 + 33m*2 - 77m + 77m to s + cm*2 + am and give c. 23 Express 5c3 + 4 + 4 - 5 + c4 - 2 in the form zc*3 + kc*2 + rc + nc4 + g and give n. 1 Express -4d*3 - 2d*3 + 6d*3 + 4d*4 + 1 + d in the form nd*4 + md + f + rd2 + gd3 and give f. 1 Express -a2 + a2 + a3 - a*2 - 1 in the form xa*3 + ya + v + ta2 and give t. -1 Express 2a*3 - 38a*2 - 9 + 38a*2 + a in the form pa*3 + wa + xa2 + o and give o. -9 Express (-4s + 6s - 3s)(0s - 3s + s - 5)(-2s - 1 + 1) in the form os + fs3 + g + cs*2 and give f. -4 Express (10 - 19 - 16 - 32)(-3j3 + 4j*3 - 2j*3) in the form nj*2 + cj + vj3 + x and give v. 57 Rearrange 2y + 7y2 - 29y*2 - 6y - y*2 + 2 - 2 + (-2y - 5y + 6y)(y - y - 2y) - 2y2 + 2y2 + y2 to ly2 + r + iy and give l. -20 Rearrange -9394b2 - b - b3 + 9394b*2 - 23 to the form c + ab + jb3 + tb*2 and give c. -23 Express (-44s + 30s - 113s)(-3 + 4 + 0) + (3 - 3 - 2)((3 - 5 + 1)(0s + 4s - 2s) - 2s + 0 + 0 + 2s + s - s) as y + qs and give y. 0 Express -3h*4 + 12h*2 + 3h*2 + 2h*3 - 27h*2 + h in the form s + bh*4 + nh + mh2 + th*3 and give m. -12 Express -2h*3 + 1 + 5h*3 - 3h*2 - 4h*3 in the form nh + oh3 + t + kh*2 and give k. -3 Express (-2 - 2 + 3)(7s + 2s + s)(s + 4 - 4) in the form ts + f + as2 and give a. -10 Express (2z + 2z + 5 - 5z)(6 + 0 - 3) in the form k + cz and give k. 15 Express 131j2 - 222 - 223 + 445 in the form x + fj*2 + sj and give f. 131 Express -3382 + d - 52d2 + 3382 in the form xd + kd2 + c and give x. 1 Rearrange 6k + 2k4 + 3k*2 - 4k*2 - 4k to the form rk + u + dk*3 + pk*2 + ak*4 and give a. 2 Rearrange (4 - 4 + t)(-2 + 2 + 2) + (-6 + 5 + 10)(-2t + 1 - 1) to i + xt and give x. -16 Express k3 + 21k + 16k4 - 9k*4 - 5k*4 + 2k*3 in the form rk*4 + pk*2 + wk + zk3 + v and give w. 21 Express -2 + 2 + 3t + 6 + 3 in the form jt + b and give j. 3 Rearrange (15t - 4t - t)(-5t2 + t2 + 3t*2)(-1 + t + 1) to the form ct2 + ut + qt3 + dt4 + v and give d. -10 Express -2 + s2 + 2 in the form k + zs2 + ns and give z. 1 Express 48g4 + 0g3 + g3 - 46g4 - g2 + 0g*3 - 1 as f + lg*4 + pg*2 + ug + cg3 and give c. 1 Rearrange -g + 569 - 48g - 568 to r + pg and give p. -49 Express -2k*3 - 4k - 3k2 + 2k*4 + k + 4k*3 + k as rk*4 + yk*2 + zk + ik3 + c and give y. -3 Rearrange (3b - 2b - 3b)(0 + 4 + 1)(-5 + 1 + 3)(-54b - 2 + 8 + 53b) to the form h + lb*2 + mb and give m. 60 Rearrange q - 3q4 - 2 - 43q*2 + 25q*2 + 17q*2 + 6q*4 to the form bq*4 + pq*3 + r + fq*2 + kq and give b. 3 Rearrange 22g2 + 2g - 2g - 4g*2 to the form ig*2 + ug + c and give i. 18 Rearrange (-4 + 3 - 2)(3c*2 - 3c*2 + 2c*3) to dc*2 + jc*3 + t + wc and give j. -6 Rearrange ((-1 - 4 + 3)(o - 2o - o) - 8o - 5o + 12o)(-2o - o + 5o) to the form y + uo2 + fo and give f. 0 Rearrange -2x2 - 3 + 3 + (0 + 0 - 3x)(-5x + 0x + x) to the form jx*2 + ox + g and give j. 10 Rearrange 3j2 - 7j*3 - 2j2 + j2 + 15j3 to the form v + xj*3 + zj + aj2 and give x. 8 Express (3o3 - o4 + 0o4 + 2o*4)(2 - 3 - 3) + 2o4 - 10 + 10 in the form io*2 + n + po*3 + do*4 + qo and give d. -2 Rearrange -o*4 - 2o*3 + 2o*3 - 8o - o*2 + 7o to the form go + no*3 + d + uo*4 + mo*2 and give n. 0 Express ((5s - s - s)(2 + 3 + 0) + (s - s + s)(-4 + 5 + 1) + 6s - 5 + 5)(2s - 2s + 2s) in the form ls + cs2 + t and give c. 46 Express -m4 - 1 - 8m + 3 - 4m3 + 4m*3 as gm + km4 + dm*3 + s + rm*2 and give k. -1 Rearrange -2h - h + 2h - 8h*3 to the form t + ch*3 + oh + kh2 and give o. -1 Rearrange 21c - 6c - 1 + 1 to the form ic + y and give i. 15 Express -195v + 4v*2 + 195v - 1 - 4 as h + sv + ov*2 and give h. -5 Express -4p + 3p + 9 - 7 - 2p*4 as op*4 + dp + c + bp2 + gp*3 and give c. 2 Rearrange (a - 2a + 3a)(-5a3 - 38a*3 - 23 + 25) to the form w + ta + ja4 + ka*2 + na*3 and give t. 4 Express 4m*2 + 0m + 3m - 3m*2 + 2m in the form j + am2 + vm and give v. 5 Express -3b + 0b - 28b in the form j + hb and give j. 0 Rearrange (x*2 + 0x2 + x2)(-1 - 4 + 2)(0 + 0 - 2) to lx + v + gx2 and give g. 12 Express t2 + 0t2 - 3t*2 + 18t*2 - t + t - 3t + 3t + 2t*2 + (t + 5 - 5)(-2 + t + 2) as at + ft*2 + b and give f. 19 Express (x + 2x - 2x)(3 - 1 + 0) + 2 - 2 - 3x - 5 + 5 + 4x - 2 + 2 - x - 2 + 2 + x + (-2 - 2 + 3)(-3x + x + x) as v + yx and give y. 4 Rearrange 0 - c4 - 8 + 6 + 4c + 0 - 3c3 to the form sc*3 + g + mc*4 + bc + yc2 and give g. -2 Rearrange 2 - 1 - 3m*3 - 2m*3 + 6m*3 to sm*3 + n + wm + qm2 and give n. 1 Express (15k - 18 + 5 - 18k)(k2 + k3 - k*2) as qk + n + mk3 + sk*2 + hk*4 and give m. -13 Express (19w + 8w + 0 + 2)(-w2 + w2 + 3w2) in the form r + dw + tw3 + fw*2 and give r. 0 Rearrange (0 - 3 + 1 + (-3 + 5 + 0)(-1 + 4 - 1) - 1 + 0 - 2)(8 - 2f - 8) to the form i + tf and give t. 2 Express 6c - 12c2 + 3c*2 - 10c + 2c in the form s + uc*2 + yc and give u. -9 Rearrange -5v2 - 3v + 4v2 + 3v*4 + 2v*2 + 2v3 - v4 to r + tv4 + cv*3 + dv*2 + iv and give d. 1 Express 23 + 7v2 - 21 + v2 - 2v*2 in the form wv*2 + m + kv and give m. 2 Express (2h4 - 3h*4 + 2h*4)(-4 + 0 + 1)(-4 + 0 + 0) as s + ih*2 + th*4 + wh + ph3 and give t. 12 Rearrange 4 - 5l + 1 - 1 + 2l2 + l to the form fl*2 + il + x and give i. -4 Rearrange (-4 - 7 - 2)(-2 + 0 + 1)(-1 + 1 - 2h3) to mh*3 + r + wh + ah2 and give m. -26 Rearrange -8w + 2w2 + 11w - 2w4 + w3 + w3 to ow*2 + r + gw*3 + aw + zw*4 and give g. 2
What is the remainder when 57903 is divided by 28934? 35 Calculate the remainder when 15277 is divided by 90. 67 What is the remainder when 3032 is divided by 163? 98 What is the remainder when 22310 is divided by 287? 211 What is the remainder when 1323 is divided by 35? 28 What is the remainder when 24773 is divided by 139? 31 What is the remainder when 10439 is divided by 5219? 1 Calculate the remainder when 613264 is divided by 44. 36 What is the remainder when 31518 is divided by 6286? 88 Calculate the remainder when 62870 is divided by 227. 218 Calculate the remainder when 1960 is divided by 1915. 45 What is the remainder when 14194 is divided by 121? 37 Calculate the remainder when 1029 is divided by 529. 500 What is the remainder when 8251 is divided by 47? 26 Calculate the remainder when 27806 is divided by 13893. 20 What is the remainder when 7438 is divided by 6953? 485 What is the remainder when 519 is divided by 46? 13 What is the remainder when 2478 is divided by 145? 13 What is the remainder when 867 is divided by 780? 87 What is the remainder when 23263 is divided by 23076? 187 What is the remainder when 819 is divided by 392? 35 Calculate the remainder when 4616 is divided by 291. 251 What is the remainder when 8370932 is divided by 1954? 1950 Calculate the remainder when 139955 is divided by 10760. 75 What is the remainder when 2771168 is divided by 59? 56 Calculate the remainder when 148876 is divided by 54. 52 Calculate the remainder when 51582 is divided by 119. 55 Calculate the remainder when 343310 is divided by 933. 899 What is the remainder when 3794 is divided by 725? 169 What is the remainder when 12825 is divided by 5204? 2417 What is the remainder when 77080 is divided by 3351? 7 Calculate the remainder when 482 is divided by 132. 86 Calculate the remainder when 6218 is divided by 1980. 278 Calculate the remainder when 1449735 is divided by 114. 111 Calculate the remainder when 2979 is divided by 142. 139 Calculate the remainder when 13115 is divided by 199. 180 Calculate the remainder when 7927 is divided by 10. 7 What is the remainder when 34329 is divided by 33? 9 What is the remainder when 2759 is divided by 221? 107 What is the remainder when 28290 is divided by 1903? 1648 What is the remainder when 1948 is divided by 7? 2 What is the remainder when 6509 is divided by 17? 15 Calculate the remainder when 26628 is divided by 11. 8 What is the remainder when 8818 is divided by 462? 40 Calculate the remainder when 901 is divided by 71. 49 What is the remainder when 10890 is divided by 1201? 81 What is the remainder when 771 is divided by 386? 385 Calculate the remainder when 29336 is divided by 7327. 28 Calculate the remainder when 17545 is divided by 166. 115 Calculate the remainder when 185956 is divided by 11. 1 Calculate the remainder when 30528 is divided by 97. 70 Calculate the remainder when 5403 is divided by 95. 83 What is the remainder when 35378 is divided by 305? 303 Calculate the remainder when 156884 is divided by 7131. 2 Calculate the remainder when 19958 is divided by 38. 8 Calculate the remainder when 7019 is divided by 39. 38 Calculate the remainder when 3792 is divided by 705. 267 What is the remainder when 55619 is divided by 24? 11 What is the remainder when 4135 is divided by 1360? 55 What is the remainder when 1470 is divided by 12? 6 Calculate the remainder when 75555 is divided by 12590. 15 What is the remainder when 778 is divided by 58? 24 What is the remainder when 439829 is divided by 271? 267 Calculate the remainder when 6584 is divided by 174. 146 What is the remainder when 44537 is divided by 295? 287 Calculate the remainder when 6004303 is divided by 254. 251 Calculate the remainder when 1468447 is divided by 218. 217 What is the remainder when 129320 is divided by 3591? 44 What is the remainder when 3227246 is divided by 311? 310 What is the remainder when 157075 is divided by 279? 277 Calculate the remainder when 2845 is divided by 221. 193 What is the remainder when 1558178 is divided by 845? 843 Calculate the remainder when 4070 is divided by 1595. 880 What is the remainder when 3114 is divided by 573? 249 What is the remainder when 74551 is divided by 228? 223 Calculate the remainder when 91911 is divided by 8. 7 What is the remainder when 3822 is divided by 2542? 1280 Calculate the remainder when 7057 is divided by 2348. 13 What is the remainder when 37642 is divided by 24? 10 What is the remainder when 9769 is divided by 9595? 174 What is the remainder when 49458 is divided by 2248? 2 Calculate the remainder when 1077 is divided by 57. 51 Calculate the remainder when 5747 is divided by 940. 107 Calculate the remainder when 1179 is divided by 139. 67 What is the remainder when 53985 is divided by 3373? 17 Calculate the remainder when 206644 is divided by 185. 184 Calculate the remainder when 970 is divided by 562. 408 Calculate the remainder when 2662 is divided by 1141. 380 Calculate the remainder when 605 is divided by 602. 3 Calculate the remainder when 127319 is divided by 1462. 125 What is the remainder when 2645 is divided by 9? 8 What is the remainder when 3756 is divided by 139? 3 What is the remainder when 362676 is divided by 58? 2 Calculate the remainder when 183180 is divided by 61055. 15 What is the remainder when 1149 is divided by 847? 302 Calculate the remainder when 24382 is divided by 127. 125 What is the remainder when 4177 is divided by 67? 23 What is the remainder when 3028 is divided by 1366? 296 What is the remainder when 17469 is divided by 104? 101 Calculate the remainder when 745 is divided by 184. 9 Calculate the remainder when 12419 is divided by 23. 22 What is the remainder when 257542 is divided by 126? 124 What is the remainder when 172449 is divided by 42? 39 Calculate the remainder when 22449 is divided by 11222. 5 Calculate the remainder when 33138 is divided by 2365. 28 Calculate the remainder when 7234 is divided by 2281. 391 What is the remainder when 1343 is divided by 634? 75 What is the remainder when 14185 is divided by 221? 41 What is the remainder when 51085 is divided by 198? 1 What is the remainder when 271456 is divided by 18? 16 What is the remainder when 24690 is divided by 6162? 42 What is the remainder when 41731 is divided by 188? 183 Calculate the remainder when 7379 is divided by 145. 129 What is the remainder when 10087 is divided by 24? 7 What is the remainder when 1380 is divided by 164? 68 What is the remainder when 292684 is divided by 88? 84 Calculate the remainder when 1222 is divided by 1184. 38 Calculate the remainder when 191 is divided by 172. 19 What is the remainder when 27778 is divided by 11? 3 Calculate the remainder when 12051 is divided by 3740. 831 What is the remainder when 4112 is divided by 454? 26 Calculate the remainder when 47147 is divided by 248. 27 Calculate the remainder when 2577 is divided by 74. 61 What is the remainder when 31606 is divided by 101? 94 Calculate the remainder when 21533 is divided by 186. 143 Calculate the remainder when 12902 is divided by 187. 186 What is the remainder when 9606 is divided by 4794? 18 Calculate the remainder when 8479 is divided by 207. 199 Calculate the remainder when 4504 is divided by 118. 20 What is the remainder when 12260 is divided by 1938? 632 Calculate the remainder when 9971 is divided by 3313. 32 What is the remainder when 412 is divided by 82? 2 Calculate the remainder when 117658 is divided by 12. 10 What is the remainder when 2233419 is divided by 381? 378 Calculate the remainder when 4736 is divided by 105. 11 Calculate the remainder when 1858 is divided by 349. 113 What is the remainder when 20781 is divided by 2331? 2133 Calculate the remainder when 805069 is divided by 1855. 1854 What is the remainder when 90111 is divided by 19? 13 What is the remainder when 123489 is divided by 106? 105 Calculate the remainder when 24844 is divided by 4137. 22 Calculate the remainder when 2535 is divided by 290. 215 What is the remainder when 26034 is divided by 51? 24 Calculate the remainder when 42465 is divided by 312. 33 What is the remainder when 3859 is divided by 550? 9 What is the remainder when 2095536 is divided by 580? 576 Calculate the remainder when 6780729 is divided by 84. 81 Calculate the remainder when 134370 is divided by 14. 12 Calculate the remainder when 201395 is divided by 100691. 13 Calculate the remainder when 1808 is divided by 879. 50 What is the remainder when 23185 is divided by 124? 121 Calculate the remainder when 3128 is divided by 39. 8
Simplify (w(1/5))1 assuming w is positive. w(1/5) Simplify ((s/s(-2/3))(-3/14))(-2/17) assuming s is positive. s*(5/119) Simplify jj*(-3)j/j*3j((j/j(-6))/j)/jjjjj/((j/(j(-1/4)j))/j) assuming j is positive. j*(27/4) Simplify ((uuuu/u*3uu)/uu/((u/(u*(-7)/u))/uu))(-36) assuming u is positive. u216 Simplify (x/x(-8))/(x/(x/x4))x(-1/2)/(xx*(-4/3)x) assuming x is positive. x*(23/6) Simplify (dd*(-8)(dd(-9)d)/d)/(d2/d(-9)) assuming d is positive. d(-26) Simplify (m(-4)/(mm(-4)))(5/14) assuming m is positive. m(-5/14) Simplify (b/b(-1/2))24 assuming b is positive. b36 Simplify ((ppp(-2/9))/(p3/p))/((p9p)/p(-7)) assuming p is positive. p(-155/9) Simplify ((r/r(-3))(-9))(-42) assuming r is positive. r1512 Simplify a*(4/3)aa(1/12)((a/(a/((aaa*(-3)a)/a)))/a)36 assuming a is positive. a(-835/12) Simplify n/n*(-1)n(-3/4)/n assuming n is positive. n(1/4) Simplify (((ff(-3/4))/f)(-34))(2/49) assuming f is positive. f(51/49) Simplify (c(-3/28)/c)/c(-6) assuming c is positive. c(137/28) Simplify (f8/f5)/((f(-1)/ff)/(f/f(-2/17))) assuming f is positive. f(87/17) Simplify q15/(q/q(-10)q) assuming q is positive. q3 Simplify (qq*(2/75)q)/qqq/((q/q*20)/q)qqq assuming q is positive. q*(1952/75) Simplify i(i/(iii*(6/13)))/ii(((i(1/2)/i)/i)/i)/i assuming i is positive. i(-103/26) Simplify (i31/ii)/(i6/i) assuming i is positive. i26 Simplify (u*(-5/3)u/(uu(-1/13)uu))/((u/(u/(u(uuu/(u*(-2/3)uu))/u)))/u)(-1/18) assuming u is positive. u(-1247/351) Simplify k(-10/3)k(3/5) assuming k is positive. k(-41/15) Simplify (d(d/(d/d(4/7)))/d)/(dddd/(dd(-25))) assuming d is positive. d(-192/7) Simplify (j7j)(-3/14) assuming j is positive. j(-12/7) Simplify (v(-1/6)/(v4/v))(12/13) assuming v is positive. v(-38/13) Simplify (f(13/5)/f)50 assuming f is positive. f80 Simplify h(-1/12)/(h*(-7)/hh) assuming h is positive. h(83/12) Simplify ((x(2/7))(-16))6 assuming x is positive. x(-192/7) Simplify (r(-2/5)r)/r(2/9)(r/(r/r(-3)))/r0 assuming r is positive. r(-118/45) Simplify z/z(-1/6)(z/z16)/z assuming z is positive. z(-89/6) Simplify ((hhh0)/hh5)(1/15) assuming h is positive. h(2/5) Simplify (o(-3)((o/(oo*(-2))oo)/o)/o)/(o(-4/5)/(o/(o/(o/(o/((o(-10)/o)/o)))))) assuming o is positive. o(-61/5) Simplify (((d(-1/2)/d)/d)(-8))(2/19) assuming d is positive. d(40/19) Simplify ((v(2/9)v)(2/15))(-5/2) assuming v is positive. v(-11/27) Simplify (r(2/17)/r(1/4))7 assuming r is positive. r(-63/68) Simplify (a5aaa/a2a)(-44) assuming a is positive. a(-308) Simplify (b/(b/((b/(bb(-1/9)))/b)))/(b/(b/(b/(bbb(-1/2)))))b0/b(2/9) assuming b is positive. b*(-11/18) Simplify (nnn(-4)nn(-4/11))/(n(2/17)n*(-7)nn) assuming n is positive. n(658/187) Simplify ((a(-2/3))(1/16))48 assuming a is positive. a(-2) Simplify w/w(2/7)w(-7) assuming w is positive. w(-44/7) Simplify y/(((yy/(y(-1/3)yy))/y)/y)y20 assuming y is positive. y(68/3) Simplify v*11v(-10) assuming v is positive. v Simplify (b(-11/4))(-49) assuming b is positive. b(539/4) Simplify (g0)(4/29)/(g/(((g/(g*(-2/5)g)g)/g)/g)g)(-1/13) assuming g is positive. g(1/5) Simplify (j(j/((jj(j0/jj)/j)/j))/j)/(j/(j*(-1/11)/jj))((j/((jj(-2))/j))/j)29 assuming j is positive. j(637/11) Simplify (l2l)44/(l(-2/3))(-7) assuming l is positive. l(382/3) Simplify (((a/((a/(a(a*(-2/7)a)/a)aa)/a))/a)/a)*(-3/26)(a1)36 assuming a is positive. a(3300/91) Simplify (d/(d(-9/5)/d)d)(-2/41) assuming d is positive. d(-48/205) Simplify ((o(1/14)/o)/o)8 assuming o is positive. o(-108/7) Simplify dd((dd*(-4/9)/d)/d)/ddd(11/3) assuming d is positive. d(38/9) Simplify (bb*17b)(2/11) assuming b is positive. b(38/11) Simplify (yy(1/6))/y(-2/15) assuming y is positive. y(13/10) Simplify f/f(1/4)ff7/f assuming f is positive. f(31/4) Simplify ((f(ff/(f4/fff))/f)/f(2/3))/(f(-2/13)/ff(-3/2)) assuming f is positive. f(-79/78) Simplify (f/f(-4))(3/10) assuming f is positive. f(3/2) Simplify i(2/7)i(2/27) assuming i is positive. i(68/189) Simplify (t(-3)/(t(1/4)/t))/(t/(tt/(((t*(-3)/t)/t)/t)tt)t1) assuming t is positive. t(23/4) Simplify f*16f/(f*(3/13)f) assuming f is positive. f(205/13) Simplify (s(4/3)ss/(s/s*(-6)))/((ss(-3))/s(3/2)) assuming s is positive. s*(-1/6) Simplify ((yyy11/yy)/y12)(-37) assuming y is positive. y*(-37) Simplify ((ss/((s((ss(2/7))/s)/s)/s))/s)23 assuming s is positive. s(276/7) Simplify k5/kk(-8)(k/k(-1/4))(1/33) assuming k is positive. k(-523/132) Simplify p/(p/p0)pp*(-3/4)(pp9pp)/pp/((p/(ppp2))/p) assuming p is positive. p(65/4) Simplify (w(-1/2))(-17)/(w(-4)/(w0w)) assuming w is positive. w(27/2) Simplify (u(9/7))35 assuming u is positive. u45 Simplify ((o/(o/(o/(o/o(-26)))))/oo)(-1/14) assuming o is positive. o(13/7) Simplify m*(-2/15)/(m(m(12/5)/m)/m) assuming m is positive. m(-23/15) Simplify (dd/(d(3/10)d)dd(d8/d)/d)(-1/53) assuming d is positive. d(-87/530) Simplify (x(-1/18)/x)/(x(3/8)xx) assuming x is positive. x(-247/72) Simplify (i(1/4)/i)(-49)i*(2/9)/(ii/(ii/i(-1))) assuming i is positive. i(1367/36) Simplify f/(f16f)fff(2/9) assuming f is positive. f(-124/9) Simplify rr*(2/9)r*(-4)(r/r*(-1)r)(1/20) assuming r is positive. r(-473/180) Simplify ((aa/(a(-4/5)a))/(a(-2/17)/a))(-50) assuming a is positive. a*(-2480/17) Simplify ((nn(-2/7))(1/24))33 assuming n is positive. n(55/56) Simplify u*(-2/7)u*(4/7)uu(1/6)u/u(5/7) assuming u is positive. u(73/42) Simplify (d(d(-1/4)dd)/d)(18/5)(d(-5)/d)/d5 assuming d is positive. d(-47/10) Simplify (a/a(1/8))(-22/7) assuming a is positive. a(-11/4) Simplify ((ggggg3)/g(1/6))/((g/g(-1))/(g/g7)) assuming g is positive. g(-7/6) Simplify (o/o(3/5))/(o*(-1/4)/o)(o*(-2/11)ooo)/(o/(oo(-3))) assuming o is positive. o(323/220) Simplify (s(-1/3))(-1/59)/(s(-1)s(-2/9)) assuming s is positive. s(652/531) Simplify s(2/17)/((s/s(-5/3))/s) assuming s is positive. s(-79/51) Simplify x(-3/23)xx/x(1/8) assuming x is positive. x(321/184) Simplify (g/(gg(g/(g/g*(-18)))/g)g)3 assuming g is positive. g57 Simplify ((q(1/4))9)(36/7) assuming q is positive. q(81/7) Simplify g(-1)/(g(-4)gg)((ggg(-2/5)gg)/g)/((g/((ggg8)/g)g)/g) assuming g is positive. g(58/5) Simplify t/(t(-8/9)t)ttt(1/16) assuming t is positive. t(425/144) Simplify (t*(-5)/(tt*2t))(-43) assuming t is positive. t387 Simplify (r*(2/25)rr(2/11))/(r(-1/5)r4) assuming r is positive. r(-698/275) Simplify ((y/(yy/(y/(y/(y(-2/5)y))))yy)(3/11))(-15/4) assuming y is positive. y(-18/11) Simplify j6j/j24 assuming j is positive. j(-17) Simplify w(-4/13)/(w(-15)w) assuming w is positive. w*(178/13) Simplify kk*9k/(k(-9)/k) assuming k is positive. k21 Simplify (kk(-3/7))(-4) assuming k is positive. k(-16/7) Simplify t/t(-4)tt(-2/5)(t(2/25)/t)/t(2/3) assuming t is positive. t(301/75) Simplify ((((a/(a/(a(-1)a)))/aa)/a)(-21))4 assuming a is positive. a84 Simplify (j(5/3))(-9) assuming j is positive. j(-15) Simplify (m(mm*3m)/m)/(mm/(mm8)) assuming m is positive. m12 Simplify (s(-2))20/((s/(ss(4/5)s))/(s/(ss8))) assuming s is positive. s(-231/5) Simplify ((kk*(-1/4)k)(-9/8))(-32) assuming k is positive. k*63 Simplify ((r/(rr/(r/(r/(rr(1/6))))))/(rr/(r/r*(-6))r))/(r(-5)/(r(-1/5)r)) assuming r is positive. r(299/30) Simplify ((d(1/2))(8/5))30 assuming d is positive. d24 Simplify xx*(2/3)x19 assuming x is positive. x(62/3) Simplify (u((u2/u)/u)/u)(9/5)/(u(-2/11)/u9) assuming u is positive. u(101/11) Simplify u(-2)/(u/u(-4))(u*(-1/3)u)/(((u(u(-2/13)uu)/u)/u)/u) assuming u is positive. u(-241/39) Simplify (i/((iii9)/i))0 assuming i is positive. 1 Simplify (v(1/4)/(v1v))/(v/v*(-2/7)v)(-15) assuming v is positive. v(911/28)
Let x be (4 + -2)/(2/18). Let m be 461/(-9) - (-4)/x. Let r be 1/(-2 - 105/m). Solve 6 = 3t + 5k, 3k - 1 - r = 3t for t. -3 Suppose 0 = -v + 2v + 4a + 7, 0 = 2v - 4a - 22. Solve -4t - 18 = -0s + s, -vt = 2s + 24 for t. -4 Let l(t) = -t*3 + 9t*2 - 12t + 12. Let w be l(8). Let m be 1/(-5) - 184/w. Suppose m + 17 = u. Solve 0h + 5h + j = -u, -2h + 5j = 5 for h. -5 Suppose 2f + 0h - 2 = -2h, -3f - 4h = 1. Solve -fr = -3r - 2c + 4, r - 3c + 8 = 0 for r. 1 Suppose 3v - 8v = -20. Solve -vg + 9 = -5j - 3, 12 = -3j for g. -2 Let d(w) = -w*2 - 8w - 7. Let f be d(-6). Solve 0 = 2n + n - 12, 0 = 5s - 5n + f for s. 3 Suppose 4a + u - 15 + 0 = 0, 10 = 4a + 2u. Let w = 7 - a. Suppose -4y + 108 = 4v, 0 = -y + v + 40 - 11. Solve -i + y = 4i - ws, s = -4 for i. 4 Let i be (-25)/(-30) - 436/(-24). Solve i = -5y + 2m - 3m, -5y - 3m = 27 for y. -3 Let a(j) be the second derivative of j3/3 - j2 + j. Let t be a(3). Suppose 0 = i - t - 1. Solve -5p + 6 = -2q - 0p, 15 = -iq - 4p for q. -3 Let b(g) = -2g3 - g2 - 4g - 2. Let p be b(-1). Solve -2v + 10 = o + o, 11 = o + pv for o. 2 Suppose -3v = -5q - 22, 3v + 3q - 4q = 14. Solve 0 = -x + 2a, 2a - 6 = -v for x. 2 Suppose y - 5y = -20. Let q(s) = s + 1. Let r be q(1). Solve -3w - 6 = 0, j - yw = -rj + 13 for j. 1 Let x(l) = -l3 + 8l*2 - 6l - 7. Let h = -2 + 9. Let g be x(h). Solve 23 = 3y - 4n, 35 = 5y - gy - 5n for y. 5 Suppose -p - 4p = -10. Suppose -2w - pw = 0. Let m be 1 - (-2 - (-2 - w)). Solve q = -n - m, -2q + 3 = 3n - 5q for n. 0 Let j = -2 - -22. Let h = 23 - j. Solve -2x = -3b - 11, 8 = -hb + x - 2 for b. -3 Let s be 518/63 + (-4)/18. Solve -7 = 2a - c, 3a + sc - 4c - 6 = 0 for a. -2 Suppose -2w = -5m + 31 - 8, -4m + 4 = 2w. Suppose mu + 1 - 7 = 0. Suppose -120 = -up - 3p. Solve -2j - 3i = 7, -3i - p = -5j + 11 for j. 4 Suppose 7 + 13 = 4c. Let m = -1 + c. Let r(h) = -h*3 - 2h*2 + h - 4. Let f be r(-3). Solve -mo + 6 = 2l, fo = -o + l + 2 for o. 1 Let j(t) = -5t + 25. Let v be j(4). Solve 4l = 3o - 15, 2l + o - vo = -20 for l. 0 Let o be (-3)/(-2)10/3. Solve 5r - k + 10 = -15, 35 = -or + 3k for r. -4 Let n(d) = 3d - 6. Let k be n(6). Suppose -5r = -8 - k. Solve rw + 7 + 7 = 2j, -2w = -4j + 22 for j. 5 Let s(v) = v2 - 5v - 7. Let p be s(7). Let h(o) = -o + 15. Let l be h(p). Let j = l - 5. Solve -jd - 2d - 4n = -10, 4n = 3d + 26 for d. -2 Let z be (-6 - (4 + -7)) + 3. Solve -2n + 4o + 18 = z, -o - o + 21 = 5n for n. 5 Suppose -1 = 7p - 15. Solve 15 = -5n, pn - 2 = -x - 6 for x. 2 Suppose 5 = r + n + 1, -n - 12 = -3r. Suppose ri - i = -9. Let x be (-24)/(-9) - (-2)/i. Solve 0 = -3v + t - 13 + x, -5v + 3t = 17 for v. -4 Suppose -5y + 4k + 6 = 0, k + 6 - 1 = 3y. Suppose -4f + 14 = -3f. Let q be 2 + 3 + -7 + f. Solve 3r - 2s = -q, -1 = -yr + r - s for r. -2 Suppose 0 = -v - 3v + 44. Let o = v + -3. Solve -3n = -on - 2z - 17, 3z = -n + 7 for n. -5 Let a = -4 - 0. Let t(p) = -p3 - 3p*2 - p + 1. Let y be t(a). Solve -2o - 5r - y = -0r, -2r - 12 = 2o for o. -3 Suppose q - 19 = -14. Let y(i) = -i*2 - 5i - 4. Let o be y(-3). Solve qn - z = -12, 4 = -2n - 2n - oz for n. -2 Let y(b) be the first derivative of b*2/2 - 2b - 4. Let r = 4 - -4. Let v be y(r). Solve -3a = -q + 5, q = 2a - 2 + v for a. -1 Let u = -32 + 11. Let b = -5 - u. Solve b = 4n + d, 5d - 7 = -5n - 2 for n. 5 Let c be (-12)/16 + 23/4. Solve 2r - r - cf - 22 = 0, 0 = r + f + 8 for r. -3 Suppose -4b + 3k + 23 = 0, 5b - 19 = 3b + 3k. Solve -3u = 2u + c + 23, -bu + 2c = 2 for u. -4 Let j = 0 - -3. Solve 4f = -3b + 31, -4b = -jb - 5f + 15 for b. 5 Let o(l) = 0 + l - l2 + 1 - 6l*3 + 2l3. Let q(v) = v2 + 4v + 3. Let h be q(-2). Let r be o(h). Solve -rp + 2a + 9 = 0, 4a - 12 = -4p + 20 for p. 5 Suppose 5g = 3q + 3, -5g = -0g - q - 1. Let y = -20 + 2. Let w be y/(-6) + 2 + -3. Solve i - 2z - 5 = g, wi - 4z = -z + 8 for i. 1 Let d be (9/(-2))/((-3)/(-4)). Let j = 10 + d. Suppose -2t + 0t + f = 0, 0 = 3t + 2f. Solve 5l - o = -4, -2l + 16 = -tl + jo for l. 0 Suppose -14r - 30 = -17r. Solve 3b = -3n + 3, 0 = -2b - 3n + 7n - r for b. -1 Suppose -f + 5 = 4. Let k = -1 + 6. Solve -4r - 5z = -4 - f, -kr = -5z - 40 for r. 5 Suppose -4x + 3x = -2. Let a(m) = -m2 + 5m - 4. Let w be a(7). Let k = -5 - w. Solve 2d = 3n - 0d - k, 0 = -3n - xd - 7 for n. 1 Let w be 175/55 + 8/(-44). Solve -wc - 12 = -3f, -6 = 5f + 5c + 4 for f. 1 Suppose 3i + 4i = 126. Solve 0 = 2r - 4o + i, o + 12 = -2r + 2o for r. -5 Suppose 35 = 10x - 5. Solve 5t + w = -9 - 6, 16 = 2t - xw for t. -2 Let n = 11 + 10. Suppose -4m = -n - 11. Suppose -5b + 3f + 14 = 2f, -3f - m = 2b. Solve 4c = -3u, -2u - 1 = 3c - b for u. -4 Let y be 0/(5 + -1 + -3). Solve -23 = -5n - g, y = 4g - 3g + 2 for n. 5 Let a(w) = w + 4. Let o = -3 - -2. Let q = 2 - o. Let d be a(q). Solve -4j + 3y - 7 = d, -5j - 18 = -4y for j. -2 Let n be ((-12)/(-5))/((-6)/20). Let d be (-6)/4n/6. Suppose 2z - 2 = d. Solve r + z = 2v - 5, -v - 19 = 4r for v. 1 Let x = 13 - 11. Solve 6 = -5k + m, -2k = xm - 0m + 12 for k. -2 Let p(l) = -l*3 - 5l*2 - 4l + 5. Let s be p(-4). Suppose 4f - 20 = 3f. Suppose 3i = -i + f. Solve 2 = 2r - 5k + 3, 0 = -sk - i for r. -3 Suppose -3w + 9 = -0. Suppose -wn = -5n + 54. Let d be n/12 + 1/(-4). Solve 0 = 2o + 4y - 16, -5y = -do + 4o - 19 for o. 2 Suppose 4u - 2u = -5g + 19, 0 = -2g + 2u + 2. Let a = 9 - 2. Let h = a - 1. Solve -gq = -3c - h, 3c + 0 = q - 6 for c. -2 Suppose 5 = -5i - 5b, b - 5 + 6 = 0. Solve i = 5h - 25, -h = -l - 5 - 1 for l. -1 Let a be 159/9 + (-4)/(-12). Let s = -25 + a. Let h = 24 + s. Solve -4r = 3p - 3r + h, 20 = -2p - 5r for p. -5 Let u(s) = -s + 9. Let b be u(6). Solve 0 = -bq + 4g + 10, 4q + 18 = -4g - 6 for q. -2 Suppose 4q + 5n - 19 = 0, 6q - 11 = 4q - 3n. Solve -l - h = -q, h + h = -l + 4 for l. -2 Suppose -10u + 11u = 3g, 3u = -2g + 33. Solve -u = 3a, 5c + 4a + 32 = -0a for c. -4 Let c be (9/(-18))/(1/(-4)). Solve -14 = -u - cz + 4z, -3u - 5z = 13 for u. 4 Let i(m) = 3m + m + 3 - 2 + 2m2 - m3 - 2m. Suppose 2k + 2k + 4 = 0. Let c be i(k). Solve 0x = -5x + s - c, -x - s + 2 = 0 for x. 0 Let b(m) = m2 - 13m + 14. Let x be b(12). Solve -3g = -j + 17, 2g - xj = -4j + 2 for g. -4 Let g be (16/7)/(6/21). Solve -2k - 2d - 12 = 0, 3d + g = 5k + 17 for k. -4 Let k(a) = 8a*2 - 4a + 2. Let s = 7 + -5. Let c be k(s). Solve j - 19 = -0j - 4g, 5g = j + c for j. -1 Suppose 0 = -a - 2a. Suppose -2g + 7 + 1 = a. Solve r + i - 7 = -0r, 17 = -gr + 5i for r. 2 Suppose 0 = -4s, -2u - 2u + 20 = -2s. Solve 5n + 2q = -3, -3n + 3q - 5 = uq for n. 1 Suppose -151 = -5m - 56. Solve -5p = 2b - 20, -3b + m = -3p + 5p for b. 5 Suppose 22 = 3s - 0s + 2c, -24 = -s - 4c. Suppose sz - 21 = -3w - 2, -z = w - 5. Solve 0 = 5y - 25, -zi + 6 = -y - y for i. 4 Let b be 3 + -9(-2)/3. Solve -3c = -s + 13, -4s = c - s - b for c. -3 Let j = 9 + -6. Let b be 1/j + (-123)/(-9). Solve -5x - 3h = b, -4x + 24 = -8x + 4h for x. -4 Suppose -2j = -0j - 10. Suppose 0s - 40 = -js. Suppose -s = -c - 3. Solve 0 = o - 6o + 5m - c, 0 = -4m for o. -1 Let o(w) = w*2 + 10w + 26. Let x be o(-9). Solve -2p - x = -4f + p, 5p + 5 = 2f for f. 5 Suppose 0 = 3j - 8j + 15. Solve -u - p = -3, 2p - 9 = -3u + jp for u. 3 Let d(t) = -t3 - 5t*2 + 4t - 3. Let g be d(-6). Solve 0 = 3b + 4a - g, 0 = -3b + 4a - 4 - 11 for b. -1 Let o(v) = -v*2 - 14v + 4. Let h be o(-14). Solve -w - hw + 2y = 18, 4y = -5w + 6 for w. -2 Suppose 3i = 4j - 7, j = -j - 4i + 20. Solve -12 = -jn + 2w, -5w = 2n - 10 + 4 for n. 3 Let n = -174 + 177. Solve -x - nf + 11 = 0, -2x - 6 = -f - 0 for x. -1 Suppose -3p + 0p + 2 = q, -5p = 2q - 2. Let a be 15/10 + (-122)/q. Suppose 3b = b - w + 44, 2w + 4 = 0. Solve -3y = 3n - b - 1, 5y = -3n + a for n. 4 Let v = 1 - -5. Let g(l) be the second derivative of l3/3 - 5l*2/2 - 4l. Let w be g(4). Solve -2q - wu + v + 5 = 0, -2q = -5u + 13 for q. 1 Let g = 8 - 4. Suppose gj + l = 15, j - 3j + l + 3 = 0. Let r(x) = 3x - 2. Let t be r(2). Solve jk = 5k - tm + 8, 0 = 2m for k. -4 Let q(k) = k3 + 15k*2 + 11k - 25. Let o be q(-14). Solve -x = -3b - b + o, 4b = -4*x + 12 for x. -1
Let h be 29 + (-1 + 0)1. Suppose -w + 3o = -14, 3o + h = -3w - 2o. Let v be (w - -26) + (-4)/2. Solve x - 5y = -v, -4x - 4y - 1 = -5 for x. -3 Let s(k) = k*3 + 4k2 - k - 4. Let x be s(-4). Let y(c) = c2 - 335c - 9383. Let b be y(-26). Solve 0 = 6i - i - bz + 11, 4i - 2z + 8 = x for i. -1 Let b = -2121 - -1410. Let y = 714 + b. Solve yx + 10 = -h, -5x = -2h + 2 + 33 for x. -5 Let t(o) = -11o3 + 2o*2 + 4o + 2. Let c be (1 + 8)/(11 + -10). Let z = c - 10. Let h be t(z). Solve -j = -2d - 0 + 8, 3d - h = j for j. -2 Let c(j) = 936j + 2812. Let o be c(-3). Solve -4h - 5t - 13 = 23, 5t = oh - 4 for h. -4 Let d be ((-140)/10 - -12)/((-2)/716). Let n = 716 - d. Solve -4u + 2a + 8 = n, 5a - 4 = -2u - 0 for u. 2 Let v = 171626 + -171612. Suppose 56 - 4 = 4i. Suppose 4 = 4f - 3p, -3 = -4p + i. Solve -2d = -4b - v, 0 = d - 0d + fb - 1 for d. 5 Let n be (20/15)/((-4)/(-12)). Let v(q) = -3q*2 - 7 + 2q*2 + q - 7q. Let b be v(-3). Solve -6j + 5 = -j - nf, 0 = bj - 5f - 2 for j. 1 Let d be 8/140 + (-4077)/(-315). Solve 2i + 3y = -d + 9, -y - 8 = 4i for i. -2 Suppose 3v + 11t = 7t + 7, -3v + 4t + 23 = 0. Let g be v + 5/(40/(-16)). Solve -5z - gn = -31, 5z - 42 = -5n - 7 for z. 5 Suppose -59w - 15w + 253 + 43 = 0. Solve -49y = -50y - 4g - 17, 5g + 24 = -wy for y. -1 Let g(f) = 6f*2 - 9f + 3. Let x be ((-12)/8)/(2 - 5/2). Let o be g(x). Suppose -4p = -o - 38. Solve 0 = 3i + 2d + 12, -p = 4i + 3d - 1 for i. -4 Let m = 9571 + -9567. Solve -q + y = -4, -y + m + 10 = 5q for q. 3 Suppose 943s - 941s = -o + 4, 5o + 2 = s. Solve o = -2v + 3x - 16, 31v - 4x + 13 = 30v for v. -5 Suppose 3j + 15 = 3a, -2a - 11j + 10 = -16j. Solve 136f = az + 134f + 1, 4z + f = 7 for z. 1 Suppose -21z + 2454 = -15z. Let j = -391 + z. Solve -b + j = 3v - 1, -v + 21 = 4b for b. 4 Suppose -84 = -15i + 6. Let m be i/155 - -3. Solve g + 26 = 5n, 0n + mn - 24 = -g for g. -1 Let u(t) = 3t3 + 25t*2 + 5t - 24. Let w be u(-8). Solve -2x - x + 15 = w, 14 = c + 2x for c. 4 Let u = -294 - -313. Suppose 3z - 154 = -uz. Solve 3h - 5l = 3 - z, 5l + 14 = -3h for h. -3 Let m be -165 + (36/3)/3. Let f be ((-276)/m)/(87/28 + -3). Solve -2 = -5t + 2k, -2t - 3k = -0t - f for t. 2 Let x = 112 + -108. Suppose 5i = xu + 35, 5i - 15 = 3u + 15. Solve io + 2o + 12 = d, -4o = 8 for d. 2 Let c = -51 + -30. Let m = 93 + c. Suppose 0 = ml - 69 - 15. Solve -4q = -5v - 15, 0 = 2v + q - 0q - l for v. 1 Suppose 102g = 94g - 2080. Let x = g + 269. Solve c = -2y + 4, 8 + x = -4c + 3y for c. -2 Suppose -5 = -4u + 3c, 35 = u + 483c - 477c. Solve r - 2 = 2p - 0, -r + up = 1 for r. 4 Let h = 6579 - 6575. Solve -5j - 3l = 21, -3j + l + h = 11 for j. -3 Suppose 4w = -x + 20 - 0, -2w + 28 = -4x. Let d = -37 + 39. Solve r = -2r + w, -do = r for o. -1 Let h(x) = 2x3 - 12x*2 - 12x - 14. Let s be h(7). Suppose 17c - c = s. Solve -24 = 4p + k, c = 4p - 4k - 2 + 6 for p. -5 Let c be (-140)/40 - (-105)/14. Solve 0 = -3k - 4i - 9, ck + 0k - 4i = -12 for k. -3 Let j = 16 - 26. Let h = -8 - j. Solve -hm = -4b + 24, -2 = -0m + m for b. 5 Let x(n) = -22n + 906. Let p be x(41). Solve -v - 1 = b, 2v + 14 = 2b + p for v. -3 Let o = -203 - -185. Let f be o(-1)/((-45)/(-10)). Solve -f = 4l - 2y, 4l + 5y - 21 = 3l for l. 1 Let y = 20 - 16. Suppose 2b = 11g - 12g + 10, -yg + 26 = b. Suppose 48 = gw - 12. Solve 3x + 3a + w = -2a, 3a - 3 = 0 for x. -5 Suppose -2a + 15 = k, a - 13 - 7 = 2k. Let o be a(-1 + 144/30 - 3). Solve 8 = -3i + 5b, i = -2i + b + o for i. 4 Let h(q) be the second derivative of 3q4/2 + q3/3 + 3q*2/2 - 2q. Suppose 109 = -3t + 106. Let k be h(t). Solve -k = 4i + c, -2 = -i + 2c - 0 for i. -4 Suppose 8w - 5w + u - 25 = 0, -2u - 10 = 0. Solve 2y + 2 = d - w, -y - 4d = -3 for y. -5 Suppose -6s = -7s + 5. Suppose sv + 0m = m + 41, v + 3 = 3m. Suppose -5j + 15 = -2r, 4r + 4j - 31 = v. Solve ri + 3c = 32, 0i + 3c = -i + 16 for i. 4 Suppose -12c - 3u + 5 = -11c, -c + 4u - 9 = 0. Let s be (18/(-66))/(c/11). Solve 5m = 3l - 10, 3m = -3l - s - 3 for l. 0 Let w(p) = -9p*2 - 90p - 2 + 5 - p + 2 + 1. Let l be w(-10). Solve -x - 2x = a + 8, 5x + l = a for x. -3 Let n = 237 - 222. Let h be (n/(-21) - -1) + (-4)/14. Solve f - 5c + 29 = h, -18 = f + f - 2c for f. -4 Let l(i) = 5i + 25. Let t be l(-14). Let p = -48 - t. Let f(x) = x + 7. Let w be f(p). Solve 5m = 5b - 30, -m - m = w for b. 4 Let w(n) = 41n + 213. Let v be w(-5). Solve -2p - 6 = -v, a + 3p = -2 for a. -5 Suppose 1 = 12p - 35. Let w be ((-50)/60)/(p/(-18)). Solve -5m = -2s + 19, 5m = -0m + ws - 10 for m. -5 Let h be 2 - -12 - ((-2 - -7)-1)/1. Solve l + 5f + 17 = 0, -l + 2l - h = 4f for l. 3 Suppose 5594v - 5652v = -464. Solve v = -2s + 5j, 43j - 40j = 5s + 1 for s. 1 Let u = 643 + -639. Suppose j - 20 = -uj - c, -4j - 2c = -10. Solve 4a - jf - 10 = 2a, -4a + 3f + 20 = 0 for a. 5 Let w be (-3)/((-66)/28 - 564/(-658)). Solve 0 = -5b + wx + 5, -b - 21 = -9x + 13x for b. -1 Let f(j) = j3 + 15j*2 - 17j - 9. Let z be f(-16). Suppose -19m + 20m = -2b, 3m = 2b + 8. Solve -v + 4i - z = i, 1 = 3v + mi for v. -1 Suppose 5o + 90 = 4o + 31o. Suppose m = -4v + 5v - 7, -3m - 9 = 0. Solve 3u - vu + 6 = 3l, 2u - o = 3l for l. 1 Suppose 314 - 330 = -5i - 2u, 5 = -2i + 3u. Solve 2d - 24 = 4x, 5x - id + 57 = 29 for x. -4 Suppose 0 = 16j + 59 - 283. Suppose jb - 66 = 4. Solve w + z + 2 = 0, bw - 3z + 10 = -5z for w. -2 Let l be 2 - (0 + 3 - 4). Suppose lf + 5k = -20, 2k - 4k = -f + 8. Solve fs - 4n = -4s - 36, -s = -2n + 13 for s. -5 Let w = -8654 + 8659. Let x(d) = 3d - 1. Let j be x(3). Solve 0s + ws + 23 = -2c, 4s = c - j for c. -4 Let u(k) = -k3 + 3k*2 + 37k - 108. Let z be u(3). Solve zn = m + 9, -6m + 3n = -m - 3 for m. 3 Suppose r - 85 = m, -3r - 271 = 5m + 122. Let k = m + 86. Suppose 0 = 4c - 5c + 3. Solve cv - 5n - 35 = 0, -5v + kn + 16 = -29 for v. 5 Let z(k) = -1 - 5k - 6 + 7. Let l be z(-1). Suppose -4i - 3g + 15 = 0, -11i = -6i - 5g + 25. Solve ld + i - 8 = -s, -5d = -4s - 18 for d. 2 Suppose 4u = 2u + 22. Suppose 0 = 19p - 43 - 90. Suppose -5d + pd = -3d. Solve -2k + dk + 7 = 3a, 5a = -4k + u for a. 3 Let h = -124 + 141. Suppose 3o - 4i = -2, -5o - 19i + hi = -14. Solve -3 = 3p - ow + 7, -3w = 5p + 4 for p. -2 Let x(q) be the first derivative of q*2/2 + 15q - 61. Let g be x(3). Solve 3c - 3v + g = -0c, 2v = 3c + 16 for c. -4 Let n = -18 - -51. Let b = 124 + -121. Let r be b/(22/10 + -2). Solve -5q - 4o - o = -r, 5q - 4o - n = 0 for q. 5 Suppose -2s + 76 = 13s + 4s. Solve -4o - 20 = 4k, 8o = -3k + so - 20 for k. 0 Let f be (-1)/(2(-3)/48). Let q = -3 + 4. Let m = 31248 + -31245. Solve 0 = -4z + fj - mj + q, 5z + j = 23 for z. 4 Let o(f) = f*2 + 6f - 3. Let p be o(-7). Solve 0 = 4s + 5g + 9 - 29, 0 = 4s + g - p for s. 0 Let w be 7/(-2)220/(-154). Suppose 10a - 4n = 7a + 31, 0 = -wa + 4n + 41. Solve -at = -4b - 19, 3b + 14 = -2b + 3t for b. -1 Let x be (-5883)/(-333) - (-39)/9. Solve 5z = -o + x, -3o - 19 = 46z - 48z for z. 5 Let p = -2686 + 2698. Solve 4z + 8 = l, -6z = -10z - p for l. -4 Suppose 0 = -m + 2w, -w = -m - 5w + 30. Let y(z) = 3z - 28. Let h be y(m). Solve -3a - 2k = -0k + 4, 3a = hk - 8 for a. -2 Let v be -233(4 + -1 + -4). Let c = -228 + v. Solve 1 = -s + 5n + 6, -c = -s - 5n for s. 5 Suppose v - 32 = -2k - 0k, 26 = v + 5k. Suppose 39 = 5m - v. Solve -3p - 35 = 4u, 3u - 2p = -2u - m for u. -5 Let w(o) = -11o*2 - 299o - 54. Let z be w(-27). Solve -3x - 6 = z, 3 + 11 = 4r - 3x for r. 2 Let l = 16160 - 16152. Suppose -4 = 3u - 13. Solve -s - 13 = -ur, s = -3s + l for r. 5 Suppose 4x = 3a + 94, 0 = 4x + 2a - 139 + 15. Solve -4m = -4h + x, 4 = m + 2h + 5 for m. -5 Let g be (-84)/(-126) - 13/(-3). Solve -5h - gq + 25 = 0, -6h = -5h - 5q + 25 for h. 0 Let u(g) = -2g + 16. Let z be u(2). Let y(l) = -l2 + 7l + 65. Let h be y(z). Solve -5d = 5k - 15, -k = hd - 1 - 2 for k. 3 Suppose 4q - 42 = -5y + 1, 0 = -5y - 2q + 29. Solve 3x - 7 = -3d - 1, yd + 5x = 0 for d. 5 Let f(k) = -k2 + 68k - 1148. Let t be f(36). Solve 4i + m = i, 0 = -i + tm - 13 for i. -1 Let z(j) = -13j2 - 288j - 36. Let y be z(-22). Let r be (2 + -5)/((-1)/(-25)). Let h be (r/(-6))/(1/2). Solve 5n = 5l - h, yl = 4l + 3*n + 16 for l. 1
Let s be ((-3)/2(6 - (1 - -3)))/(-1). Sort 5, s, 2, -13, 11 in descending order. 11, 5, s, 2, -13 Let c be -7 + (45 - 14) + -10. Put 5, c, 2, 1 in descending order. c, 5, 2, 1 Let a be 6/(-9)3444/(-164). Sort a, 4, -4, 5. -4, 4, 5, a Suppose -11h + 5 = -17. Suppose 5q - 6 - 4 = 5g, -3g - 14 = 5q. Let z be g/(-30)(-1)/((-1)/h). Sort 4, -3, z, -2 in increasing order. -3, -2, z, 4 Let t = 30683128/807477 - 10662781300123/254463456918. Let v = t - -6/8293. Let p = v - -90/19. Sort p, -21, 4, -4 in decreasing order. 4, p, -4, -21 Let r = -125 + 130. Suppose rn = -m + 2 + 24, 3m - 23 = -4n. Let k be ((-6)/4)/(9/(-102)). Sort n, -4, k. -4, n, k Let p = -4988 - -4988. Suppose 4x = 3 + 17. Put -123, p, x in increasing order. -123, p, x Suppose 5w - 355 = -j, 2w = 3j + 187 - 28. Suppose 9b = 3b + w. Suppose -11a + 8a - b = 0. Put -3, a, -5 in increasing order. -5, a, -3 Let q = -12156 - -12151. Sort 0.2, q, 0, 50, -2/3. q, -2/3, 0, 0.2, 50 Let i(q) = 4q*2 - 2q + 1. Let g be i(1). Suppose -2o - 5 + 7 = 0. Let s = 20 + -24. Sort o, s, g in ascending order. s, o, g Suppose 8 = v + 1. Suppose 5r + 5 = -5. Suppose -691 = 134f - 155. Put v, r, f in decreasing order. v, r, f Suppose -2s - 274 = -288, 2s - 10 = -l. Let f = 12 + -14. Put l, f, 4 in ascending order. l, f, 4 Suppose -4z + 40 = -5o - 5, -2z + 27 = -o. Suppose 0 = 12w - 11w + z. Let n be ((-2)/w)/((-12)/(-18)). Sort -6/5, n, -2/13 in descending order. n, -2/13, -6/5 Let x be (4 - (-88)/(-20))-10. Let i be ((-176)/18 + 10)9. Sort x, 0, 5, i in decreasing order. 5, x, i, 0 Let p = 935 + -941.17. Let b = -5.95 - p. Sort b, -3, 1/7. -3, 1/7, b Let o(u) = 6u3 + 8u*2 - 111u - 15. Let r be o(-5). Suppose 5y + 4 = -4f - 0, 0 = y. Let w be 16/6 + 1/3. Put f, -4, w, r in descending order. w, f, -4, r Suppose 0 = 2i - 3i - 2. Suppose -o - g = -119, -4o + 457 = g + 8. Put -4, o, i in increasing order. -4, i, o Let p = -0.1 - -1.2. Let v = p + -1. Let n = -2/115 + -136/115. Sort n, v, -2/7 in descending order. v, -2/7, n Let i be (-14)/4((-7)/35)/((-14)/(-20)). Let w = -4 - -6. Suppose -2u - m = 12, 14 = -4u - 5m - 4. Put i, w, u in ascending order. u, i, w Suppose -4u + 2s = -4, 0 = -u + 5u + 3s + 6. Let b be 1(4 + u) - (1 + 4). Sort -10, -4, -5, b in decreasing order. b, -4, -5, -10 Let a = -14.8 + -1.2. Let w = 30.3086 + -30.7086. Sort a, -1/2, w in descending order. w, -1/2, a Let x = 25 + -24. Suppose -5r = 4a + 36, -8 = 9r - 8r + a. Let b be 1(-4 - r)/(-1) + -3. Sort b, -0.02, x in decreasing order. x, -0.02, b Let f = 4 + -18. Suppose 0b - h = -b - 6, -h = -5b - 18. Let s = -1782 + 1785. Put s, b, 5, f in ascending order. f, b, s, 5 Let k(d) = -d - 6. Let j be k(-7). Let v be -2 + (19/114 - (-14)/(-12)). Sort -7, v, j, 0 in descending order. j, 0, v, -7 Let c = 156.75 + 2.25. Let g = c - 108. Sort 0, g, -3. -3, 0, g Let r(t) = -2t*2 - 27t - 36. Let w be r(-12). Suppose 5x = 2x + 3. Suppose -2c = -2n - 18, -2c - 3c + 24 = -2n. Sort n, w, x, 2. n, w, x, 2 Let p = -11/52 + 6/13. Let b = -9 + 11. Let q = 0.25 + 3.75. Put p, -5, b, q in ascending order. -5, p, b, q Let z(o) = o + 8. Let s be z(-4). Suppose 3p - 6p + sp = 0. Suppose -5d - 1 = -a, 5a = -d + 6d - 15. Sort p, d, -2 in decreasing order. p, d, -2 Suppose -z + 3 + 3 = -s, -2z = -s - 11. Suppose 0 = -3a - 6, -14x - 2a + 0a = -24. Sort -5, x, -4, s. -5, -4, s, x Let y = -50.1 + 50.3. Put 4, y, -1, 131/6 in ascending order. -1, y, 4, 131/6 Let o = 44.1 + -41.97. Let g = -9.13 + o. Sort 3, 0.2, g. g, 0.2, 3 Suppose 10j - 393 = -961 - 402. Suppose -2f + f = -2. Sort f, -5, j in ascending order. j, -5, f Let v be 580/420 - 320/36. Put 0.3, -0.4, v, -0.5, 0.01 in ascending order. -0.5, -0.4, v, 0.01, 0.3 Let c be (-4 + 17/2)/((-2)/(-12)). Suppose -8 = 2y - 4d + 14, 4y = -5d + 21. Put c, -2, y, 4 in decreasing order. c, 4, y, -2 Let c be 1 + 3 - (13 + (-36 - -16)). Put 3, -7, c, -5, -2 in descending order. c, 3, -2, -5, -7 Let r = -294.9 - -299.9. Sort r, -0.3, 22/703 in descending order. r, 22/703, -0.3 Let h = -9.497 - -9.6. Let d = 42.103 - h. Let t = d + -45. Sort t, 5, 3/4, 4 in descending order. 5, 4, 3/4, t Let z(u) = -80u - 3356. Let d be z(-42). Sort d, -68, -2/19. -68, -2/19, d Suppose k = 9k - 0k - 16. Sort 5, k, 3, 1 in ascending order. 1, k, 3, 5 Let s = 17.324 - -3.076. Sort 3, s, -5 in increasing order. -5, 3, s Let p be 13/(-1573)-22(-55)/(-20). Let i = 9 - 5. Sort i, p, 1, 5. p, 1, i, 5 Let b(y) = -y*3 + 28y*2 - 120y + 4. Let w be b(5). Sort -19, w, 2. w, -19, 2 Let b = 0.23666 - -0.06334. Sort 0.01, 5, 6, b, 2/5. 0.01, b, 2/5, 5, 6 Let p be (-2 + 164/81)/(913/8217). Let j be (32/(-16))/(-3). Put p, 4/3, j, -2/3 in descending order. 4/3, p, j, -2/3 Let h = -12 + 12. Suppose -4q + 4 = -5q + 3o, -8 = 5q - 3o. Let a(s) = 5s3 + 5s*2 + 9s + 3. Let k be a(-1). Sort h, k, q, -3. k, -3, q, h Let c be (-29)/(-8) - (-57)/152. Put 0, c, 203, -5 in decreasing order. 203, c, 0, -5 Let r = -1.5 + 2. Let x be (-2)/(-25) - (-22 + (-78302)/(-3525)). Sort r, x, -4/5. -4/5, x, r Let k = -139.5 + 139. Let m = 0.4 + -0.33. Let y = m - -0.03. Put 5, y, k in descending order. 5, y, k Let c = 4943 - 4942.6. Sort -3, -6, c, 1/6, -4. -6, -4, -3, 1/6, c Let v(r) be the second derivative of 10r3/3 - 119r*2/2 + 13r. Let n be v(6). Put n, 5, -11, -5 in descending order. 5, n, -5, -11 Let b(x) = 2x3 + 318x*2 - 325x - 805. Let z be b(-160). Let c = -8.3 - -1.3. Let g = -6 - -3. Sort z, c, g in decreasing order. g, z, c Let l be ((-3276)/(-325))/(-14)(-40)/(-32). Put 44, 5, l, 0.5 in descending order. 44, 5, 0.5, l Suppose 5t - 180 = 5m, -m - 816 + 786 = -4t. Sort 0, m, 2, 4 in ascending order. m, 0, 2, 4 Let f = -1407.8 + 1408. Put -1/4, -5, -0.02, f, -3 in descending order. f, -0.02, -1/4, -3, -5 Let u = -1732 + 1737. Let k = 0.3 - 2.3. Let i = k - -1.8. Sort u, 1, 32, i in ascending order. i, 1, u, 32 Let v = -144/913 + -2/83. Let k = 3013 - 3010. Let n = 0.3 - 0.1. Sort -0.1, n, k, v. v, -0.1, n, k Let f be (-4)/((-1011)/(-981) - 1) - 45/225. Put -2, f, -3 in ascending order. f, -3, -2 Let l be (4/(-9)-102)/(4/6). Suppose 9p - 95 = -l. Sort p, -5, 4. -5, p, 4 Suppose 0 = -5c + 11 + 14. Suppose 0 = -6a + 1501 + 1229. Let i be (a/7)/5 - 10. Sort c, -4, i, -3. -4, -3, i, c Let q be ((-9)/(-6))/((-6)/16). Suppose 5b - 163 = -158. Let k(x) = -x - 7. Let i be k(5). Sort 0, i, b, q in decreasing order. b, 0, q, i Let j be 30/6 - (10 + 4 + -6). Sort -6, j, 2, -12, -5. -12, -6, -5, j, 2 Let m = -4892 - -4897. Put 1, m, 44, -4 in increasing order. -4, 1, m, 44 Let y = -321 + 411. Suppose 0 = 16a + 2a + y. Let b be ((-4)/(-12))/(1/6). Sort a, b, 4, -3 in decreasing order. 4, b, -3, a Suppose 85v = -234 + 64. Sort -5, v, -3, -537 in descending order. v, -3, -5, -537 Let s = -91 + 91. Suppose s = 15j - 7 - 8. Sort -3, -4, j, -5. -5, -4, -3, j Let c = 157.51 - 157.61. Put 4, -296, -4, c in decreasing order. 4, c, -4, -296 Let f be 1 + 3 + (-5)/5 + 2. Suppose -2x + 18 - 2 = 4l, -x + 3l - 17 = 0. Put x, f, 102 in decreasing order. 102, f, x Suppose -321838 = 11v - 321893. Sort v, 50, -4, 0. -4, 0, v, 50 Let k be 1/3 - 14/(-3). Let u = -2754.81 - -2728. Let h = -27 - u. Put k, -0.3, h in decreasing order. k, h, -0.3 Let q = 158 - 789/5. Let y = -0.21 + 0.61. Put y, q, 0.005 in increasing order. 0.005, q, y Let n be (2 - 43)/(1 + (0 - 0)). Let y = 44 + n. Suppose -44 = -yd - 62. Sort 3, 5, d. d, 3, 5 Let b = -10607 + 10615. Sort -3, b, 0, 84. -3, 0, b, 84 Suppose -t = -4o + 13, t - o + 3 = -4. Let u be (-2 - 2/1)(t + 4). Suppose -us + 2 = -z + 2z, 0 = 4z - 2s + 10. Put z, 5, -1 in increasing order. z, -1, 5 Let f be 0 + (6 - 2) + (-33)/(-3). Suppose -3 = -2x + 5x, 4j = 3x + f. Sort -4, j, 2, 4. -4, 2, j, 4 Let l = -0.04 - -1.206. Let x = l + -0.166. Put -9, x, 2 in increasing order. -9, x, 2 Let b(j) = -j*2 - 4j + 72. Let f = -297 - -304. Let l be b(f). Sort 4, l, -11 in increasing order. -11, l, 4 Let s = 0.651 - 3.461. Let y = -2.88 - s. Put 5, y, 1/8 in increasing order. y, 1/8, 5 Let m = -6 - 0. Let a(s) = -5s - 30. Let k be a(m). Suppose 5z = 2w - 13 - 15, k = -4w - 4z. Sort -3, 2, -1, w in decreasing order. w, 2, -1, -3 Suppose -2n - 21 = 4a - 5n, -3n + 24 = -5a. Let c = -1/138 + -271/690. Let y = 24 - 28. Sort c, y, -0.1, a in decreasing order. -0.1, c, a, y Suppose -129*o + 232 - 1522 = 0. Sort 20, o, 2 in decreasing order. 20, 2, o
Let p(h) = -h*2 - 7h - 2. Let r be p(-3). Let o = r + -10. Suppose v - 28 - 39 = o. List the prime factors of v. 67 Suppose 915m + 16948096 = 56623411. List the prime factors of m. 131, 331 Let r(u) = u3 + 7u*2 - 7u - 7. Let m be r(-5). List the prime factors of (6 + m/(-5))/(5/(-50)). 2, 3 Let y be ((-25)/(-10))/((-5)/(-10)). Suppose -531 = -ya - 4t, -2t + 7t - 329 = -3a. Let p = a + -20. What are the prime factors of p? 83 Let l(h) = 10h*2 - 33h + 4333. What are the prime factors of l(71)? 2, 5, 131 Suppose -4f + 318 = g, f - 246 = -2f + 3g. Let u be (-49)/(-1) + 101 + -100. Let m = f - u. List the prime factors of m. 2, 3, 5 Let w = -2274 - -23318. What are the prime factors of w? 2, 5261 Suppose u + 5168 = 2q + 1544, 2q = -2u + 3618. List the prime factors of q. 1811 Suppose 5j = 2d + 20, 3j + 4d + 26 = 6j. Suppose 3k - jk + 35 = s, -5s - 5k = -125. Suppose 0 = -3x + 81 + s. List the prime factors of x. 37 Let l be (-24)/18 - (-3)/9. List the prime factors of (36/48)/l - 2195/(-4). 2, 137 Let l be (6 + 32/(-8))-14036. List the prime factors of l/(-16) + (-9)/(-6). 2, 439 Suppose 3t - 3j - 11 = 1555, 2601 = 5t - 2j. Suppose 0 = -2n - 4, -5z = -n - t - 338. List the prime factors of z. 3, 19 List the prime factors of (16/(-24))/((-15)/((-7814925)/(-10))). 47, 739 Suppose 20b = -13b + 241144 + 47903. List the prime factors of b. 19, 461 Suppose -2 = -b + 1. Suppose 0 = 5m - 20, m = bq - m - 451. What are the prime factors of q? 3, 17 Let l(s) = s2 + 37s + 213. Let m be l(-30). Suppose 3i - 10 = 8i. What are the prime factors of i/(-2 + m/(-174) + 2)? 2, 29 Let m(r) = 11r3 - 3r*2 + 13r - 11. Let k be m(-10). Let v = -17065 - k. List the prime factors of v/(-133) + (-2)/7. 2, 3, 7 Let x be -10(-3)/5 - -2256. Let u = x + -1213. List the prime factors of u. 1049 Suppose 0 = 5d + 5m - 265, 3m = 5d + 46 - 335. Let l = d + -52. Suppose 0 = lq + 26 - 122. What are the prime factors of q? 2, 3 What are the prime factors of (-243222)/(-120) + 21/(-35) - (-15)/(-12)? 3, 5 Let h(t) = 31t3 - 27t*2 + 15t - 22. Let v be h(10). Suppose -29p + 6p + v = 0. List the prime factors of p. 2, 3, 103 Suppose -4v - 4o = -88, -3o = -5v + 2o + 130. Suppose 13x = 9x + v. What are the prime factors of ((-12)/(-9))/(x/297)? 2, 3, 11 Let m = 34621 - 23240. List the prime factors of m. 19, 599 Let z = 31 + -89. Let d(f) = -4f + 16. Let p be d(11). Let g = p - z. What are the prime factors of g? 2, 3, 5 What are the prime factors of (-7 + 177)210/24200/28? 5, 17 Let k(h) = 42h2 + 12h - 197. What are the prime factors of k(34)? 11, 13, 31 Let q be -2 + 4 + (-16)/8. Suppose q = -3t - r + 2482, 2r - 4 = -2. What are the prime factors of t? 827 Let s be -185 - (-5 + 2 + 7). List the prime factors of (-3292)/(-14) - 162/s. 2, 59 Let v(z) = 7z2 - 517z - 161. What are the prime factors of v(82)? 4513 Let g = -5814 - -22428. List the prime factors of g. 2, 3, 13, 71 Let x(j) = 33j + 2. Let t(a) = a + 15. Let b be 2/(24/13 - (-2)/(-1)). Let z be t(b). What are the prime factors of x(z)? 2, 17 Let c be -276894/36-70. List the prime factors of (c/(-24))/(-23) + 2/(-12). 11, 79 Suppose 0a + 0a + 2a = 0. Let v be 14 + -6 + a + -1 + -2. Let r(d) = 12d + 3. List the prime factors of r(v). 3, 7 Let q(x) = -x3 - 5x*2 - 8x. Let h be q(-5). Suppose 3y + h = 8y. Suppose 13g - 220 = yg. What are the prime factors of g? 2, 11 Let n = 13232 + -5737. What are the prime factors of n? 5, 1499 Let k(x) = 391x + 372. What are the prime factors of k(3)? 3, 5, 103 Suppose -x - 9 = -4s + 2x, 0 = 2s + 3x + 9. Suppose 0r - 9r + 2475 = s. What are the prime factors of r? 5, 11 Let u(h) = -2h + 14. Let w be u(8). Let g be 48/(-30)(2/(-4) + w). Suppose -2a + ga = 26. What are the prime factors of a? 13 Let j(k) = 7k*2 - 49k - 12. Let s be j(11). Suppose s = n + 69. What are the prime factors of n? 227 Let w = -125 - -125. Suppose 12d + 2k - 208 = 8d, w = 3d - 2k - 170. Suppose 0 = -2i + i + d. What are the prime factors of i? 2, 3 Suppose h + 5 = 4, -4z + 3h = -891. Let a = z - 55. List the prime factors of a. 167 Let y = 42428 + -22266. List the prime factors of y. 2, 17, 593 What are the prime factors of 3 - ((-14738)/(-6))/((-34)/204)? 14741 Let p(n) = -230n - 624. List the prime factors of p(-34). 2, 7, 257 Suppose -4o - 5b = -2o - 1538, 5o + 2b - 3866 = 0. Let f = o + -1134. What are the prime factors of (f/(-27))/(32/(-18) - -2)? 2, 3, 5 What are the prime factors of 4/78 + (-12591560)/(-2652)? 2, 1187 Let c = 13000 - 7209. List the prime factors of c. 5791 Suppose -5t + 18008 = -2n - 48440, -t + 5n = -13262. What are the prime factors of t? 2, 3323 Let p = 11736 + 5039. What are the prime factors of p? 5, 11, 61 Let h = -34733 - -82028. What are the prime factors of h? 3, 5, 1051 Suppose 1685 = -3t - 2t. Let n = t - -562. Suppose 3d + n = 8d. List the prime factors of d. 3, 5 Suppose 0 = -6t - 5386 + 520. Let r = 1297 + t. What are the prime factors of r? 2, 3 Let v(p) = -107p - 7. Let i(r) = -321r - 17. Let c(t) = 4i(t) - 11v(t). What are the prime factors of c(-4)? 19, 23 Let j(h) = -h*2 - 7h + 32. Let m be j(-10). Suppose n = -3k + mk - 213, -k - 229 = -3n. Let i = -73 - k. What are the prime factors of i? 2, 3 Let o be 13948/16 + 12 - (-2)/8. Suppose -3i = -3h - 700 + 64, 4i = -5h + o. What are the prime factors of i? 2, 3 Let i = 4407 - -7201. Suppose -18r + 2144 + i = 0. List the prime factors of r. 2, 191 Suppose 3346 = 4r - 358. What are the prime factors of r? 2, 463 Let l = 3831 - 1191. What are the prime factors of l? 2, 3, 5, 11 Let x(g) = -g3 - 6g*2 - 5g + 669. Let s be x(0). Suppose 2n + 195 = -2b + s, -4n + 2b + 918 = 0. List the prime factors of n. 2, 29 Let p = -2997 - -10608. List the prime factors of p. 3, 43, 59 List the prime factors of (7 - 4846)/(37/(-22) - 24/(-132)). 2, 1613 Let l(n) = -38n3 + 2n*2 - 1. Let d be l(-1). Suppose 0 = -42f + df + 12. List the prime factors of (f - 3)/((-1)/(-80)). 2, 5 Suppose -3j - 10 + 4 = 0, -3r + 3j = 1551. Let l = -115 - r. List the prime factors of l. 2, 101 Let z be (15 - -699) + (-1 - (1 - 1)). Let f = -493 + z. Let r = f + -127. List the prime factors of r. 3, 31 Let n(z) be the first derivative of -z*3/3 + 13z*2/2 - 16z + 53. Let a = 9 + 0. What are the prime factors of n(a)? 2, 5 Suppose 4p - 12p + 6p = 0. Suppose -65n + 58n + 7343 = p. What are the prime factors of n? 1049 Let c(w) = 3w + 9. Let t be c(-3). Suppose 12x - 19x + 1736 = t. Let u = -103 + x. List the prime factors of u. 5, 29 Let a be (-3)/(-2)(-36)/54 - 215. Let j = a + 845. What are the prime factors of j? 17, 37 What are the prime factors of 9/(-6) + (-3885)/(-2)? 3, 647 Suppose -4g = -4, -6g = 5d - 3g - 293. Suppose 3672 = 64i - di. List the prime factors of i. 2, 3, 17 Let i(v) be the second derivative of 11v*3/2 + 9v*2/2 + 8v - 2. Let g = -4 + 5. What are the prime factors of i(g)? 2, 3, 7 Let f = -43 - -46. Let v(h) = -h*3 - 11h*2 - 8h + 23. Let i be v(-10). Suppose -ft + 187 = -5q, it + 4q = 2q + 194. What are the prime factors of t? 2 Let v be 4/(-6) + (-4675)/(-33). Suppose 3c - 5a - 215 = v, -c + 4a + 121 = 0. Let r = 179 - c. List the prime factors of r. 2, 31 Suppose -2978w + 166958 = -2956w. What are the prime factors of w? 7589 Let c be 45/11 - (-1)/(-11). Suppose 0 = 3h - 0u + u - 2302, 0 = -ch - 5u + 3073. What are the prime factors of h? 13, 59 Suppose -39m + 13m = 30m - 1340808. What are the prime factors of m? 3, 23, 347 Suppose 0 = 4z + i - 75, 0 = 2z + 3z - 3i - 115. Let o = 144 + z. Suppose -7r = -74 - o. List the prime factors of r. 2, 17 Let l be (-34)/(-102) + -1 + 6602/(-6). Let u = -834 - l. What are the prime factors of u? 3, 89 Let b(s) = -12 + 23 - 17 + 6s2 - 3s*2 + 6s - s*3. Let i be b(4). Suppose 204 = ic - 18. List the prime factors of c. 3, 37 Let u(o) = -o*2 - 16o - 5. Let h be u(-11). Let l = h + -131. Let p = 290 + l. List the prime factors of p. 11, 19 Let b = 138 + -354. Let p = 232 + b. List the prime factors of p. 2 Suppose -152940 = 75z - 90z. What are the prime factors of z? 2, 2549 Let b = -164 - -246. Suppose -2h + b + 1210 = 0. Suppose -3j + 410 = 5i - 228, 3j + i - h = 0. List the prime factors of j. 2, 3 Suppose 4y + 4 = -5d, y + 12 = -0d - 4d. Suppose 5b + 3c + 47 = 0, -2b + 2c - y*c = 18. What are the prime factors of (198/45)/((-1)/b)? 2, 11
Suppose 2g3/17 - 8g*2/17 + 8g/17 = 0. Calculate g. 0, 2 Factor -38l4/7 - 164l*3/7 - 48l*2/7. -2l*2(l + 4)(19l + 6)/7 Factor 2k3/3 - 436k*2/3 + 23320k/3 + 48400/3. 2(k - 110)2(k + 2)/3 Find s such that 5s3 - 235s*2 + 1400s = 0. 0, 7, 40 Let -p*3/5 - 307p*2/5 + 1556p/5 - 1248/5 = 0. Calculate p. -312, 1, 4 Find u such that -2u2 - 442u = 0. -221, 0 Factor -165k2 - 485k + 30. -5(k + 3)(33k - 2) Determine q so that q2 - 10q = 0. 0, 10 Factor 32h2 - 44h + 12. 4(h - 1)(8h - 3) Solve 20p*5 - 11160p*4 + 1556805p*3 + 8375p*2 - 1170405p + 389205 = 0 for p. -1, 1/2, 279 Let 2l2/5 - 6252l/5 + 4885938/5 = 0. What is l? 1563 Let -2r4/19 + 18r*3/19 + 1958r*2/19 - 31962r/19 + 29988/19 = 0. What is r? -34, 1, 21 Factor g*2/3 + 554g + 230187. (g + 831)2/3 Solve -o5 + 4o4 + o3 - 4o2 = 0. -1, 0, 1, 4 Find m such that -m2/5 + 18m/5 - 17/5 = 0. 1, 17 Factor 3i*2 - 33i - 36. 3(i - 12)(i + 1) Suppose m*4 - 3m*3 + 2m*2 = 0. What is m? 0, 1, 2 Factor 15x*2 - 10x - 105. 5(x - 3)(3x + 7) Factor -2q*3/17 - 48q*2/17 + 290q/17. -2q(q - 5)(q + 29)/17 Find o, given that o3/2 - o2/4 - 67o/4 + 33/2 = 0. -6, 1, 11/2 Determine z, given that -2z2/13 + 22z/13 + 160/13 = 0. -5, 16 Factor d*3/4 + 15d*2/4 + 14d. d(d + 7)(d + 8)/4 Suppose -2r4 + 152r*3 - 3300r*2 + 15400r - 12250 = 0. What is r? 1, 5, 35 Factor -i*2/5 + i/5. -i(i - 1)/5 Find s such that 2s3/3 + 808s*2 + 326432s + 131878528/3 = 0. -404 Solve q*2 + 144q + 143 = 0. -143, -1 Determine l so that 10l4/17 - 134l*3/17 - 38l*2/17 + 4086l/17 - 1620/17 = 0. -5, 2/5, 9 Factor -3d4/4 + 93d*2/4 + 45d/2. -3d(d - 6)(d + 1)(d + 5)/4 What is u in -4u5 - 272u*4 - 1296u*3 - 2296u*2 - 1772u - 504 = 0? -63, -2, -1 Let -2h5 - 4h*4 + 26h*3 + 76h*2 + 48h = 0. Calculate h. -3, -2, -1, 0, 4 Let -4u4 + 2724u*3 - 8148u*2 + 8140u - 2712 = 0. Calculate u. 1, 678 Suppose -6k4/7 + 212k*3/7 - 400k*2/7 = 0. Calculate k. 0, 2, 100/3 Determine n, given that -1682n*4 + 232n*3 - 8n*2 = 0. 0, 2/29 Find s, given that -2s*5 - 44s*4 - 236s*3 + 128s*2 + 638s - 484 = 0. -11, -2, 1 Factor l*2/3 - 4l/3 - 5/3. (l - 5)(l + 1)/3 Factor 4c*3/5 - 2276c*2/5 + 324896c/5 - 322624/5. 4(c - 284)2(c - 1)/5 Factor m*3/2 + 20m*2 + 200m. m(m + 20)2/2 Determine c so that c5/3 - 4c*4 + 11c*3/3 = 0. 0, 1, 11 Suppose -4r*3 + 200r*2 - 3172r + 16224 = 0. What is r? 13, 24 Let 2b5 - 22b*4 + 46b*3 + 22b*2 - 48b = 0. What is b? -1, 0, 1, 3, 8 Solve -4x2/7 - 4x + 72/7 = 0 for x. -9, 2 Suppose -2v5 + 82v*4 - 230v*3 + 70v*2 + 232v - 152 = 0. Calculate v. -1, 1, 2, 38 Let 4w3/7 - 4400w*2/7 + 1218752w/7 - 4804864/7 = 0. Calculate w. 4, 548 Factor -q*5 + 6q*4 - 9q*3 + 4q2. -q2(q - 4)(q - 1)*2 Solve -4y*2 - 40y + 96 = 0 for y. -12, 2 Factor 2r2/5 - 4r. 2r(r - 10)/5 Find u such that u*3/2 + 137u*2 + 267u/2 - 819 = 0. -273, -3, 2 Find f such that 3f3 + 234f*2 + 6084f + 52728 = 0. -26 Solve -2s3/3 + 14s*2 + 98s/3 - 46 = 0 for s. -3, 1, 23 Factor -2p2/19 - 6000p/19 - 4500000/19. -2(p + 1500)2/19 Factor r3/2 - 2153r*2/2 - 1077r. r(r - 2154)(r + 1)/2 Factor -g*4/5 + 3g*3/5 + 17g*2/5 - 39g/5 + 4. -(g - 5)(g - 1)2(g + 4)/5 Factor 2t5/17 - 44t*4/17 + 156t*3/17 - 224t*2/17 + 146t/17 - 36/17. 2(t - 18)(t - 1)*4/17 Factor -12n*4 + 1023n*3 - 255n*2. -3n*2(n - 85)(4n - 1) Factor -4s2/5 + 432s. -4s(s - 540)/5 Solve 5q2 + 150q - 2795 = 0. -43, 13 Suppose -2h3/11 + 698h*2/11 = 0. What is h? 0, 349 Let 3u*4/8 + 33u*3/8 - 9u*2/2 = 0. Calculate u. -12, 0, 1 Factor 45f*2 + 140f - 160. 5(f + 4)(9f - 8) Let -3o4/4 + o3/2 + o*2/4 = 0. Calculate o. -1/3, 0, 1 Factor 2g*4/7 - 276g*3/7 + 5634g*2/7 + 268272g/7 + 1889568/7. 2(g - 81)2(g + 12)*2/7 Let 2t*2/7 + 8t = 0. What is t? -28, 0 Factor 4q2/7 - 32q/7 + 4. 4(q - 7)(q - 1)/7 Factor 2i3 + 60i*2 - 194i + 132. 2(i - 2)(i - 1)(i + 33) Factor n3 - 571n*2 + 1139n - 569. (n - 569)(n - 1)2 Factor 2h*2/11 + 2h - 204/11. 2(h - 6)(h + 17)/11 Find y such that y*2 + 2930y - 2931 = 0. -2931, 1 Solve -g*3/4 - 9g*2/2 - 17g/4 = 0 for g. -17, -1, 0 Determine l, given that -2l2/15 - 1692l/5 - 1073574/5 = 0. -1269 Solve u*2/6 + 5u/6 + 2/3 = 0 for u. -4, -1 Factor -o*2 - 468o - 467. -(o + 1)(o + 467) Factor g5 + 41g*4 + 186g*3 + 212g*2 - 152g - 288. (g - 1)(g + 2)3(g + 36) Solve 3d2/5 - 156d + 10140 = 0 for d. 130 Factor -q4/4 + q3/4 + 10q2 + 29q + 24. -(q - 8)(q + 2)2(q + 3)/4 Let -3k5 + 132k*4/7 - 141k*3/7 + 30k2/7 = 0. What is k? 0, 2/7, 1, 5 Determine l so that l2/6 - 2/3 = 0. -2, 2 Find v, given that -v*2/7 - 392v - 268912 = 0. -1372 Factor -4r2 - 376r + 1164. -4(r - 3)(r + 97) Factor -3z3 + 213z*2. -3z*2(z - 71) Factor -3z2/2 - 3141z - 3288627/2. -3(z + 1047)2/2 Factor d4/5 - 22d*3/5 - 47d*2/5 - 24d/5. d(d - 24)(d + 1)*2/5 Let 3v*2/7 - 495v/7 - 216 = 0. What is v? -3, 168 Factor -d*2 + 58d + 59. -(d - 59)(d + 1) Factor -2a*2/13 + 184a/13 - 704/13. -2(a - 88)(a - 4)/13 Determine u, given that -6u5/7 + 3u*4/7 + 9u*3/7 - 3u*2/7 - 3u/7 = 0. -1, -1/2, 0, 1 Suppose -2u5/7 - 20u*4/7 - 74u*3/7 - 120u*2/7 - 72u/7 = 0. What is u? -3, -2, 0 Determine z so that -2z2 - 72z - 70 = 0. -35, -1 Factor 3w3/5 - 6w*2 + 81w/5 - 54/5. 3(w - 6)(w - 3)(w - 1)/5 Determine s so that -s5/3 + 113s*4/3 - 440s*3/3 + 436s2/3 = 0. 0, 2, 109 Determine n so that -n3/2 - 4n2 - 6n = 0. -6, -2, 0 Factor 2x4 - 4x*3 - 2x*2 + 4x. 2x(x - 2)(x - 1)(x + 1) Find n, given that -n*3/3 - 187n*2/6 - 137n/3 + 92/3 = 0. -92, -2, 1/2 Factor 20r2/3 + 61r/3 + 1. (r + 3)(20r + 1)/3 Factor -w*3 - 6w*2 - 11w - 6. -(w + 1)(w + 2)(w + 3) Determine a, given that 10a5/17 - 304a*4/17 - 1560a*3/17 - 1748a*2/17 - 82a/17 + 420/17 = 0. -3, -1, 2/5, 35 Factor 2d4/11 + 12d*3/11 + 16d*2/11. 2d*2(d + 2)(d + 4)/11 Determine y so that 7y*3/4 + 607y*2/4 - 1361y/2 + 182 = 0. -91, 2/7, 4 Factor -3c2 + 174c. -3c(c - 58) Suppose -z*2 + 39z + 40 = 0. Calculate z. -1, 40 Determine j so that -5j3 + 445j*2 + 2330j + 1880 = 0. -4, -1, 94 Factor -c*3/5 + 2c*2 + 32c/5 - 384/5. -(c - 8)*2(c + 6)/5 Factor 5l3 + 1435l*2 + 105080l + 302460. 5(l + 3)(l + 142)*2 Factor 9h*5 + 1842h*4 + 126073h*3 + 2913324h*2 + 1900464h + 314432. (h + 68)*3(3h + 1)2 What is y in -2y*3/7 - 7520y*2/7 - 7061274y/7 + 14152644/7 = 0? -1881, 2 Find h such that 4h2 - 2040h = 0. 0, 510 Factor b*2 + 4994b + 6235009. (b + 2497)*2 Factor 25d*4 - 115d*3 - 375d*2 - 305d - 70. 5(d - 7)(d + 1)*2(5d + 2) Determine x, given that -x5/5 - 68x*4/5 - 112x*3 - 350x*2 - 2319x/5 - 1062/5 = 0. -59, -3, -2, -1 Find j, given that j*2 + 13j - 68 = 0. -17, 4 Factor 2f2/15 + 880f/3 + 484000/3. 2(f + 1100)2/15 Factor 2b*5/7 - 32b*4/7 + 12b*3 - 80b*2/7 + 26b/7. 2b(b - 13)(b - 1)3/7 Suppose 7j4/5 + j3 - 72j2/5 + 76j/5 - 16/5 = 0. What is j? -4, 2/7, 1, 2 Factor -2t2/5 - 488t - 148840. -2(t + 610)2/5 Determine a, given that 54a*4 + 720a*3 + 228a*2 - 80a - 26 = 0. -13, -1/3, 1/3 Let -c*2 + 49c/3 - 16/3 = 0. Calculate c. 1/3, 16 Factor -q*3/10 - 8q*2/5 - 77q/10 - 49/5. -(q + 2)(q + 7)2/10 Let z2 + 3z - 28 = 0. Calculate z. -7, 4 Factor 4r4/3 + 4r*3/3 - 40r*2/3 + 32r/3. 4r(r - 2)(r - 1)(r + 4)/3 Factor z*4/5 - 46z*3/5 - 155z*2 - 760z - 1200. (z - 60)(z + 4)(z + 5)2/5 Factor b4 + 32b3 + 334b*2 + 1248b + 1521. (b + 3)*2(b + 13)*2 Find f, given that 2f*4/3 + 16f*3/3 + 26f*2/3 + 4f = 0. -6, -1, 0 What is y in -205y4 + 1307y*3 - 2305y*2 + 681y + 18 = 0? -1/41, 2/5, 3 Solve x*3/5 + 4x*2/5 - 29x/5 + 24/5 = 0 for x. -8, 1, 3 Solve -4s2 - 488s - 3648 = 0. -114, -8 Solve -2h5 + 6h*4 + 82h*3 + 210h*2 + 208h + 72 = 0 for h. -2, -1, 9 Factor -3v5 + 3111v*4. -3v*4(v - 1037) Factor -i*3/2 - 39i*2/2 + 84i + 6664. -(i - 17)(i + 28)2/2 Solve -5c*4 + 15c*3 + 75c*2 + 85c + 30 = 0 for c. -1, 6 Find k, given that 2k3 - 140k*2 + 2584k - 4624 = 0. 2, 34 Suppose 5u3 + 170u*2 = 0. Calculate u. -34, 0 Suppose 2m*5 + 30m*4 + 138m*3 + 202m*2 - 84m - 288 = 0. What is m? -8, -3, -2, 1
Let z be ((1 + 0)-3)/((-2)/(-8)). Let o be 2/z + (-6)/(-36). Which is the nearest to o? (a) -1/2 (b) -2/7 (c) -0.4 b Let r be 8/14 - (-866)/(-168). Let g = r + 19/4. Which is the nearest to -0.1? (a) -1 (b) g (c) 0.2 b Let n = 16 - 15.8. Let g = -269.9 + 270. Which is the nearest to 2? (a) 2 (b) n (c) g a Let s = 863.7 - 864. Which is the closest to 3/4? (a) -0.5 (b) s (c) 1/4 c Let r = -43 + 43.5. Which is the nearest to 1? (a) 1 (b) r (c) 0.07 (d) -7 a Let j = 28 - 28.48. Let y = j - 0.02. What is the nearest to -1 in -0.4, 0.05, y? y Let d = 92.4 + -92.6. Which is the nearest to -2/7? (a) 1 (b) d (c) -5 b Let p be 247/91 - (1 + 2). Suppose 5h - 6 - 3 = 3s, 2h = s + 3. What is the nearest to p in 0.1, s, -0.3? -0.3 Let f = -89 - -89.5. Let b(x) = -x + 3. Let m be b(2). Let p be (1 + m)6/(-30). What is the closest to 0.1 in f, p, 3? f Let n be ((-1772)/(-112) - 16)2/10. What is the closest to n in 0.1, 3, -4, -0.1? -0.1 Let j = -8 - -7.79. Let w = 0.3 + j. Let o = -4.09 + w. What is the closest to 1/2 in 2/5, o, -2/11? 2/5 Let h = 206.2 - 206. Let f = -7 - -6. Which is the closest to 0.2? (a) f (b) 3 (c) h c Suppose -10j + j = -45. Let c = -0.013 + -0.087. What is the closest to -1/4 in j, c, 1/2? c Let w = 2.98 + 0.02. Let h = 0.4 - 0.4. Let t(k) = k3 + 6k*2 - 5k + 16. Let u be t(-7). Which is the nearest to h? (a) w (b) u (c) -8 b Let m = -8 - -8.75. Let w = -3.25 - m. What is the closest to 1 in -2/7, w, 1/4? 1/4 Let w be (26/(-32) + 1)(-42)/63. What is the closest to 1/2 in -0.2, w, -56? w Let t be 1 - (-3 + 7) - 0. Let m = -0.211 + -0.789. Which is the closest to 0.1? (a) m (b) 1/31 (c) t b Let s be (-743)/(1 - (-2736)/(-6)). Let g = -3/91 + s. What is the closest to -2/13 in -1, -0.3, g? -0.3 Let t = 0.12 + -1.12. Let h = -7 - t. Let v = 6.2 + h. Which is the closest to -2? (a) -3 (b) v (c) 3/4 a Suppose -g + 3m = 8, -3g + 9 = m + m. What is the nearest to 2 in -4, g, -3/7? g Let p be 32/(-10) + 21/7. Let w = 0.164 + -12.104. Let n = w - -12. Which is the closest to n? (a) p (b) 3 (c) 0.3 c Let u = 1.26 - -6.64. Let i = -8 + u. Let f = 250.6 - 251. Which is the nearest to i? (a) -4 (b) f (c) 0.4 b Let a = -27 + 43. Let r be ((-30)/a)/(39/2). Let s = 2/13 - r. What is the nearest to -2/5 in 0, s, 5? 0 Let s = 26 + -26.4. Let m = -0.7 - -2.7. What is the closest to 0 in m, 5, s? s Let y(c) = -25c - 275. Let k be y(-11). Let x be ((-9)/(-6))/(23). What is the closest to k in -2/3, 3/8, x? x Let w = 22.1 - 22.4. Which is the nearest to -0.91? (a) -1/10 (b) 2 (c) w c Suppose -4k + 44 + 68 = 0. Let x be ((-100)/k)/(-5) + -1. What is the nearest to 4 in -0.3, 1, x? 1 Let h = 39 - 58. Let l = -20 - h. What is the closest to l in -0.4, -5, 5? -0.4 Let n(t) = t. Let r be n(1). Let h = 1 - 0.9. Let w = 4.2 - 4.4. Which is the closest to h? (a) r (b) w (c) -1 b Let o = 0.99 + 1.01. Which is the nearest to 0? (a) o (b) -1/2 (c) -0.1 c Let j = 436 - 436.1. What is the nearest to 0 in j, -22, 3? j Let z = -31/3 + 121/12. Let n = -1.7 + -1.3. Which is the closest to -3/7? (a) -0.1 (b) n (c) z c Let i = 424.9 - 425. Which is the nearest to i? (a) 0 (b) 2/7 (c) -5 (d) -2 a Let d be (-6)/(-9)(-3)/382. What is the closest to -1 in d, 2/11, -0.3? -0.3 Let t = 4.24 + -4.14. What is the closest to 2/11 in 5, 4, t? t Let b = -35 - -33. Let q = -9.2 + 6.2. What is the closest to q in b, 4, 6? b Let c = 18 - 26. Let a = 1.1 - -7.9. Let m = c + a. What is the nearest to 2 in -2, 0, m? m Let u = 8.2 - 8.7. Which is the nearest to 0? (a) 0 (b) u (c) 14/3 a Let u = 34 - 41.5. Let f = 7 + u. Let i = 2.2 + -2. Which is the nearest to -1? (a) f (b) -4 (c) i a Let h = 5 + -6. Let n = -22 - -20. Let v be 2/(-4)n/(-3). What is the nearest to v in 0, 5, h? 0 Let p(u) = -u2 + 14u - 33. Let y be p(7). Which is the closest to -1? (a) y (b) 0.2 (c) 1/10 c Let x = 1/16 - 39/112. Which is the nearest to -1? (a) x (b) 18 (c) 2 a Let q be (-15)/6(4 + 264/(-65)). What is the nearest to -19 in q, -0.5, 2/11, 3? -0.5 Let r = -309 - -297. What is the nearest to 2/7 in -0.2, -4, r? -0.2 Let k = 2175 - 2177. Let z = 0.5 + -0.9. What is the closest to -2/3 in k, z, -2/3? -2/3 Let f = 3.9 - 3.9. Let q = -848.5 + 848. Let w = 1.8 + -2. What is the closest to f in -3, w, q? w Let u = -357 + 358. What is the closest to -2 in u, -6, -3/8? -3/8 Let w = -0.856 - -0.9. Let l = w - -0.156. Let n = -1 + -9. Which is the closest to l? (a) n (b) 1 (c) -3 b Let z = 0.4011 - 0.0011. What is the nearest to -1 in -7/2, 0.2, -5, z? 0.2 Let k = -34 - -59. Let t = k - 28. Which is the nearest to 1/2? (a) t (b) -0.1 (c) -0.02 c Let l be (-8)/6 + 4/(-6). Let k be (l/(-5))/((-3)/(-15)). Let o = -0.09 + 0.14. Which is the nearest to o? (a) 0.3 (b) k (c) -2/3 a Let d = -1145.6 - -1146. Let f = 4.7 + -0.7. What is the nearest to 1 in -1, d, f? d Let t = -1851/4 - -463. Which is the nearest to 4/3? (a) t (b) -0.4 (c) -1 (d) 2 d Let h = 710/7 - 102. Let s = 0 + -1. What is the nearest to s in -1, h, 1/4? -1 Let l be (4 - 55/10)-2. Suppose -3 = lp - 0. Suppose -5x = -4g, -3g + 4x + 3 = 4. What is the closest to p in g, -0.3, -4/5? -4/5 Let i = -28.98 - -29. Let z = 61 - 547/9. Which is the nearest to i? (a) 5 (b) 3 (c) z c Let j = 91.2 + -90.7. What is the nearest to 0 in j, -7/10, 4, -5/6? j Suppose -18i = -15i - 12. Suppose o = -io. Let c be -1 + (3 - (4 - o)). What is the nearest to 7 in -1, 0, c? 0 Let d = -5 + 8. Let l be (0 + 1)/(200/16 + -6). Which is the closest to -2? (a) d (b) l (c) -2 c Let k = 67/10 + -159/20. Which is the nearest to k? (a) -2/3 (b) -6 (c) -2/17 (d) -0.2 a Suppose 5r + 1 = w, 0 = 3r + 2w + 15 - 4. What is the closest to r in 3, -2/17, 0.5, -0.5? -0.5 Let d = 163 + -155.7. Let g = 16 + -9. Let o = g - d. What is the closest to -2/5 in 0, -1, o? o Let j = -10 - -8. Let z = 19 - 19.1. Let v(t) = 2t*3 + 2t*2 - 2t. Let g be v(-2). Which is the closest to z? (a) j (b) g (c) 2 a Let w = -71/100 + 24/25. Which is the nearest to -1/2? (a) 0.1 (b) -0.027 (c) w b Suppose d = 1, -5p + 2p - 3d + 6 = 0. What is the closest to -2/59 in p, 2, 1/5? 1/5 Let i(h) = -h - 18. Let b be i(-10). Let m be 6/(-4)b/28. What is the closest to -0.1 in -1/21, m, 5? -1/21 Let u = 7 - 5. Let r = -4 + u. Let h = 145.5 - 145. Which is the closest to -1? (a) h (b) 0.2 (c) r c Let d be (-4)/55 + 57/209. What is the closest to -2 in -10, 3, d? d Let l = 16.26 - 20.26. What is the closest to -77 in l, 0.2, -1/10? l Let b = -125 + 123. Let g = 0.14 + 7.86. Let q = g + -9. What is the closest to q in -3, 0.6, b? b Suppose 4r - 2u = -4, -4r + 4u + 25 = -7r. Let v be 4/(-84) - 1/r. Let p = -754.8 - -756. Which is the nearest to 1/2? (a) v (b) -0.4 (c) p a Let l = -0.14 + -0.26. Let f = -273 - -275. Which is the closest to 1/5? (a) 5 (b) l (c) f b Let p(l) = 23l - 116. Let x be p(5). What is the nearest to x in 3, -0.1, -10? -0.1 Let t = -17473 - -17475. Suppose -5w = u + 57, -2w - u = 8 + 13. Let x be ((-2)/(-36))/((-3)/w). Which is the nearest to -1? (a) t (b) x (c) -2 c Let j = 1.6 + -2. Let v = -831.1 + 831. Suppose -r + 1 = -2r. Which is the nearest to -0.1? (a) v (b) r (c) j a Let i = -35 - -34.48. Let w = i + 0.42. What is the closest to w in -3/5, 1/3, 4? 1/3 Let v = 0.3 - 0.3. Let q = 1.22 + 0.08. Let w = -4.3 + q. Which is the closest to 0? (a) 1/2 (b) w (c) v c Let x = -0.163 + -1.837. Let i = -0.12 + 0.32. Which is the closest to 0.3? (a) i (b) x (c) -0.1 a Let d = -2.45 - -2.85. Which is the closest to -0.2? (a) -5 (b) d (c) -1 b Let y be ((-6282)/(-15))/(-5 - (-8 + 1)). Let g = 209 - y. Let q(j) = -j2 - j - 4. Let p be q(0). Which is the closest to g? (a) p (b) 0.4 (c) 0 c Let f = -0.0855 - -3.0855. What is the nearest to 2 in 2, f, 0.1, 99? 2 Let p = -0.5311 - -0.5311. Let h = -6 + 17/3. What is the closest to h in p, -0.03, -3? -0.03 Let t = -164 - -166. Which is the closest to 2/33? (a) 2/9 (b) t (c) 0 c Let k be 17/15 + (-621)/345. Let v = -5 - -4. Which is the nearest to k? (a) -3 (b) 0.5 (c) v c Suppose 4r + 6 = 2r, -3s = -5r - 30. Suppose s = 5l + 20. Let x be ((-4)/(-6)*l)/5. Which is the nearest to x? (a) -1/7 (b) -0.5 (c) -1 b Let g = -2.12 + -2.88. Which is the nearest to 12? (a) 0 (b) g (c) 0.02 c Let r = 4.977 + 0.023. Let w = -54 - -54.1. What is the nearest to 0.1 in w, r, 1/4? w
Suppose 5 = -n + 1, -5n = -3k - 9100. What is k rounded to the nearest 100? -3000 Let g(r) = -4r - 5. Let q(d) = -11d - 14. Let a(z) = -8g(z) + 3q(z). Let n be a(-2). Round n to 7 dps. 0 Let d = -38827.634 - -38925. Let t = -108.8794 + d. Let j = t - -11.5. What is j rounded to three dps? -0.013 Let i = -3323277598 + 3323277460.9999943. Let h = i + 137. What is h rounded to 6 dps? -0.000006 Suppose 0 = -p - 4p + 3b - 81858968, 4p + b + 65487188 = 0. Let l = 1171796 + p. Round l to the nearest one million. -15000000 Let f = 7.14 - 0.14. Let w = f - 6.9976. Round w to three decimal places. 0.002 Let j = -6.331 + 6.3. Round j to 2 dps. -0.03 Let u = -60 + 84. Let r = 119 - u. Let x = -96.43 + r. Round x to 1 decimal place. -1.4 Let v = 8.19 - 8.1297. What is v rounded to 2 dps? 0.06 Let z(r) be the third derivative of -13r6/24 + r5/30 - r*4/24 - 6r*2. Let w be z(1). What is w rounded to the nearest ten? -60 Let o = -6.433 - -6.73. Let q = o - 0.3. Round q to 3 decimal places. -0.003 Let d = 7678 + -13678. Round d to the nearest one thousand. -6000 Let d = 0.02054 + 20.18946. Let w = 20 - d. What is w rounded to 1 dp? -0.2 Let j = -11.94 - -12. Let s = -0.0544 + j. What is s rounded to three dps? 0.006 Let r = 0.12 - 0.06. Let j = -0.01 + r. Let o = j - 0.01. Round o to 2 dps. 0.04 Let u be ((-200012)/12 - -1)516. Round u to the nearest 1000000. -9000000 Let b(a) = 266666a + 4. Let v be b(6). Suppose -3r + v = -r. Round r to the nearest 1000000. 1000000 Let s = -26.01995 + 26.12. Let x = 1.1 + -1. Let u = s - x. Round u to four decimal places. 0.0001 Let k = 88 + -87.33. Round k to one dp. 0.7 Let l(k) = 215k2 - 11k + 14. Let a be l(14). What is a rounded to the nearest ten thousand? 40000 Let r = 0 + 4. Suppose 0 = j - r. Let a(k) = 1300001k - 4. Let o be a(j). Round o to the nearest one million. 5000000 Let u = 92.0000328 + -92. What is u rounded to five dps? 0.00003 Let b = 0.3 + -0.23. What is b rounded to one decimal place? 0.1 Suppose 4v - 5b = -3933, -v + 0b - 2b = 967. Let j = -2327 - v. Round j to the nearest 100. -1400 Let y = -6255032 + 6255324.0173. Let n = 292 - y. What is n rounded to 3 decimal places? -0.017 Let c = -0.3 + 0.3000055. Round c to six dps. 0.000006 Let n be 33883/5 + 10/25. Suppose -2a = -n - 98807. Suppose -2792 = -f - a. What is f rounded to the nearest 10000? -50000 Suppose 160342 = 4q - 135658. Suppose j + q = 2j. Round j to the nearest 10000. 70000 Let m = -8 + 8.05. Let i = 0.038 - m. What is i rounded to two dps? -0.01 Let s(z) = -z - 1. Let h be s(-3). Suppose hl - l + 4 = 0. Let m be l/(-18) + (-6120008)/36. What is m rounded to the nearest one hundred thousand? -200000 Let x = 694.34 + -688. Round x to the nearest integer. 6 Suppose -3d = -188259 - 240741. Round d to the nearest 10000. 140000 Let h = -68 + 67.999835. Round h to 5 dps. -0.00017 Let u = 71 - 51. Let n be (0 - u)/((-10)/1975). Let v = -20050 - n. Round v to the nearest ten thousand. -20000 Suppose 5g = 113928 + 22797. Suppose -g = -q + 72655. What is q rounded to the nearest one hundred thousand? 100000 Let i = 0.023849444 - -85.976146656. Let q = -86 + i. Round q to 6 decimal places. -0.000004 Let g = -0.02756596587 - 138.97243470413. Let x = 139 + g. Round x to 7 decimal places. -0.0000007 Suppose -2s + 2k = -778008, -2k = k + 12. What is s rounded to the nearest one hundred thousand? 400000 Let y = 902 - 905.63. What is y rounded to 1 dp? -3.6 Let f = -387.144 + 381. Let n = f - -6.3. Let y = -0.1491 + n. What is y rounded to 3 dps? 0.007 Let g = 1.4 - 0.9. Let v = -0.49999984 + g. What is v rounded to seven decimal places? 0.0000002 Let i be (32/(-12))/((-2)/195). Suppose s - i = -0s. What is s rounded to the nearest 100? 300 Let u(g) = -78750g. Let i be u(8). What is i rounded to the nearest one hundred thousand? -600000 Suppose 9n + 40960000 = 13n. What is n rounded to the nearest 1000000? 10000000 Let x = 52 + -138. Let v = 86.61 + x. Round v to 1 decimal place. 0.6 Let u = -0.003 - -9.803. Let s = 0.5 - -1.6. Let x = s - u. What is x rounded to the nearest integer? -8 Suppose 7 = 2v - x, 3x + 3 = 3v - 6. Suppose -2h + 955 = -155. Suppose vz + h = -z. What is z rounded to the nearest ten? -110 Suppose -585797 = -y - 105806. Let p = -1 - -4. Suppose -j + y = -pf, -3f + 141291 + 1778718 = 4j. Round j to the nearest one hundred thousand. 500000 Suppose -4c - 4y - 7199988 = -0y, 4c = y - 7200003. What is c rounded to the nearest one million? -2000000 Let c = 304 + -469. Let l = c + 186.2. Let d = l + -19. Round d to the nearest integer. 2 Let x be 1 - 22/(-4). Suppose -m + 2700 = -2q, -5m + 5q = xq - 13507. Suppose 5d = m + 8298. What is d rounded to the nearest 1000? 2000 Let y = -19.0000074 + 19. Round y to 6 dps. -0.000007 Let q = 0.0515 - 0.05. Round q to 3 decimal places. 0.002 Let d = 459.98005 - 460. Let q = 0.02 + d. Round q to 5 decimal places. 0.00005 Let k = -9.3 + -5.8. What is k rounded to the nearest 10? -20 Let m = -779 - -1209. Round m to the nearest 100. 400 Suppose 4 - 3 = x. Let f(s) = -x + 4 - 542s - 259s. Let l be f(3). What is l rounded to the nearest 1000? -2000 Let p = 8.624 - -0.226. Let k = 8 - p. Let b = k + 0.84999906. Round b to 7 dps. -0.0000009 Let q = -16 + 19.6. Round q to 0 dps. 4 Let d = 4.347 + 0.523. Round d to the nearest integer. 5 Let t(p) = -1499p2 + 5p + 4. Let n be t(-4). What is n rounded to the nearest 10000? -20000 Let h = 13 + -11. Let r(q) = -4q - 2. Let g be r(h). What is g rounded to the nearest 100? 0 Let q = 53.9999971 + -54. What is q rounded to 6 dps? -0.000003 Let z = -2192.9 + 2192.100012. Let x = 0.8 + z. What is x rounded to five decimal places? 0.00001 Let a = 26.000172 + -26. Round a to 4 dps. 0.0002 Let p = 0.0427 + -0.049. What is p rounded to three dps? -0.006 Let q = 7.5 + -11.488. Let b = -4 - q. What is b rounded to 2 dps? -0.01 Let x(u) = 1100000u*3 - u + 1. Let s be x(1). What is s rounded to the nearest one million? 1000000 Suppose 0 = 16j - 20j + 480. Round j to the nearest 100. 100 Let f = -0.0156 - 0.012. Round f to 3 dps. -0.028 Let q = 99 + 23. Let l = q + -209. Let o = 87.000082 + l. Round o to five dps. 0.00008 Let n = -355 - -150. Let f = -296 - n. What is f rounded to the nearest 10? -90 Let d = -40 - -39.94. What is d rounded to one decimal place? -0.1 Let f be (3/2)/((-3)/(-2068)). Let p = 2654 - f. Round p to the nearest one hundred. 1600 Let n = 240 + -238.87. Let a = n - 0.03. What is a rounded to the nearest integer? 1 Let s(i) be the first derivative of -4 + 45000i*2 - 3 + 3 + 0. Let y be s(6). Round y to the nearest one hundred thousand. 500000 Let d = 14.6 + 0.4. Let x = d + -15.000003. Round x to five dps. 0 Let g = -417.243 + 372.3. Let w = g + -0.057. Let a = -45.000038 - w. Round a to 5 decimal places. -0.00004 Let m = 11 + -7. Let o = m - 3. Let g = 1.00000002 - o. What is g rounded to 7 decimal places? 0 Let f = -0.04 + -7.96. Let h = f - -8.44. What is h rounded to 1 decimal place? 0.4 Let l = -5 + 7. Suppose -2g = lg. Let v be (g - -8)27375/(-3). What is v rounded to the nearest 10000? -70000 Let s = 19.2762 - 19.3. What is s rounded to three decimal places? -0.024 Let o = -1.4 - 0.6. Let g = 114.8 - 112.801. Let f = g + o. What is f rounded to 3 decimal places? -0.001 Let y(s) = s*2 + 7s + 2. Let n be y(-5). Round n to the nearest 10. -10 Let y(p) = 50043p2 - 23p - 20. Let w be y(-15). What is w rounded to the nearest one million? 11000000 Let o = -84.0000063 + 84. Round o to six decimal places. -0.000006 Let o = -50.8 - -116. Let t = -201.8 - o. Let j = -265.29 - t. What is j rounded to one dp? 1.7 Let q(a) = -122223a2 + 2a + 1. Suppose -4t = -5b - 27, t = 2t - b - 6. Let d be q(t). Round d to the nearest one million. -1000000 Let k = -807442220.4993 - -807478424. Let m = 36202 - k. Let o = m + 1.5. What is o rounded to 3 decimal places? -0.001 Suppose -4i + 82747173 - 30347173 = 0. Round i to the nearest 1000000. 13000000 Let k = -400.86 - -0.86. Let v = k - -399.9999787. Round v to six decimal places. -0.000021 Let b = 17191782.915484 + -17191729. Let w = -128.915597 + b. Let o = w + 75. What is o rounded to 5 decimal places? -0.00011 Let p be 5/(-10)(-2 - 4). Suppose -5d = 5y + 26485, 2y = -0y - pd - 10591. What is y rounded to the nearest 1000? -5000 Suppose s + 0s + 5x = -54800005, -5s - 4x = 274000004. Round s to the nearest one million. -55000000
Work out -42.5 * -19.2. 816 What is the product of 24.3424 and -4? -97.3696 What is the product of 0.27 and -24? -6.48 What is -0.006 times -725? 4.35 What is 303 times -0.159? -48.177 Calculate 62094.33. 186282.9 Multiply 4 and -20553. -82212 4.329120.3 1.298736 Product of 199727 and -0.5. -99863.5 Multiply -21 and -982. 20622 -0.3 times 351200 -105360 765 times 0.71 543.15 What is -1.724839 times 0.3? -0.5174517 Multiply -0.7183 and -4. 2.8732 Multiply -24 and -7341. 176184 What is -587 times -9.5? 5576.5 Multiply -9964 and 0.4. -3985.6 81 times 609 49329 13836.53 10874.89 Work out -3.544 82. -290.608 -0.01582-1.5 0.02373 What is 4923.7 times -1? -4923.7 Work out -2.787 2.04. -5.68548 Calculate 0.005119-3. -0.015357 What is the product of -1433.03 and -0.1? 143.303 Work out 59138 -3. -177414 Calculate -0.046.6489. -0.265956 Calculate -0.0571-3.4. 0.19414 -4282 times 1.46 -6251.72 Calculate -1309560. -785700 Calculate 1.9423-0.049. -0.0951727 What is the product of -0.635 and 0.04? -0.0254 -3 times 1400838 -4202514 -21024 times -24 504576 -344 * 5.616 -1931.904 -0.04 * 1.0052 -0.040208 Multiply 0.3 and 837011. 251103.3 Multiply 4081 and -0.03. -122.43 Work out -0.41 * 0.1802. -0.073882 What is the product of 0.09 and -1.073? -0.09657 Product of -0.54286 and 1. -0.54286 Work out -7 * -533.3. 3733.1 1.835.4 63.72 Work out -0.2407 -6.06. 1.458642 Calculate -2.5-11.01. 27.525 Multiply 858679 and -5. -4293395 Product of -73043 and -0.029. 2118.247 Work out -18529 4. -74116 Product of -33 and -611. 20163 Work out -2410261 * -0.1. 241026.1 0.0397 * -10 -0.397 What is the product of 14.4 and -6912? -99532.8 What is the product of -5882.4 and -0.3? 1764.72 Work out 0.9289 * -1.4. -1.30046 Work out -14 * -831.2. 11636.8 Work out 7923 * 0.11. 871.53 What is 0.086 times 6554? 563.644 Calculate 3504-0.15. -525.6 What is -968 times 1.2? -1161.6 -6510.303 -197.253 Product of -2 and -123197. 246394 Calculate -0.5249432. -124716 -9 times -2053.24 18479.16 -0.2534 105.1 -26.63234 120.606 times -0.02 -2.41212 1573.8 times -5 -7869 Multiply -0.3 and 6182. -1854.6 55 times 12.53 689.15 Multiply -284267 and 0.18. -51168.06 0.18 * -284.5 -51.21 Work out 0.0516 * -8.9. -0.45924 What is the product of -0.14028 and -0.091? 0.01276548 15 times -1.537 -23.055 What is -326 times -8? 2608 What is the product of 47371 and -13.2? -625297.2 Multiply 0.1 and -89644. -8964.4 Multiply 49308 and 0.2. 9861.6 Calculate 0.047-7.5742. -0.3559874 Calculate -0.082-0.3751. 0.0307582 Calculate -23.43-519. 12160.17 Multiply -3.4 and -705. 2397 What is 10706 times -20.3? -217331.8 Multiply -904 and -478. 432112 Multiply 0.02656377 and 0.2. 0.005312754 -0.1 -1.7039 0.17039 Calculate 73.527-0.4. -29.4108 -2.7 times -0.3072 0.82944 Calculate -1.720.1045. -0.17974 What is the product of -92947.1 and -0.3? 27884.13 -89047 * 0 0 What is 15 times -239.65? -3594.75 Product of 138 and 230.76. 31844.88 What is the product of -4.543 and 1243? -5646.949 0.0758 times 56 4.2448 What is the product of 1 and 0.8079? 0.8079 -185.47 * 0.021 -3.89487 0.04913.83 0.188053 What is the product of -1 and -51333? 51333 What is the product of 0.11 and 0.13986? 0.0153846 Work out 0.1 9.364. 0.9364 49528-5 -247640 Work out 2 0.7352. 1.4704 Calculate 332710. 33270 Product of 162 and -182. -29484 -8024 54 -433296 Multiply 19.58 and 1420. 27803.6 Product of -3623 and -0.0376. 136.2248 -30 times 0.09657 -2.8971 127 times 1.36 172.72 -8.07-0.023 0.18561 -7805 times -0.01 78.05 What is -0.41 times 1073? -439.93 What is the product of 5 and 125790? 628950 Calculate -0.332460.06. -0.0199476 What is the product of -0.5 and -0.08361? 0.041805 Work out 497 * 0.05699. 28.32403 Multiply 2660 and -1. -2660 -5 times -14978.9 74894.5 Work out 0.021 * 10.78. 0.22638 Multiply 0.4 and 48.69. 19.476 Work out 0.12 * 20391. 2446.92 0.1 times -526 -52.6 3 times -0.48028 -1.44084 -11.46936 * 0.1 -1.146936 Product of -0.5 and -8515. 4257.5 -4.09 * -4.48 18.3232 What is the product of -1 and 67909? -67909 Product of 0.2 and -539157. -107831.4 Multiply -0.1495 and 1.01. -0.150995 Multiply 0.064 and -625. -40 What is -6.132 times 37? -226.884 Product of -0.18318 and -52. 9.52536 Calculate 56899. 34495 -87392 0.27 -23595.84 -0.06 times 914 -54.84 Work out -10068 * 0.2. -2013.6 121 times 1267 153307 -1.89 times 0.0446 -0.084294 Work out -29.2 * 0.035. -1.022 What is -4.6867 times -7? 32.8069 Calculate -636788. -427644 What is -27 times 43524? -1175148 -0.097 times -76 7.372 Product of 24978 and -5. -124890 0.5 -12328 -6164 What is the product of -0.7 and 161743? -113220.1 -5-6394 31970 Product of -0.21534 and 4. -0.86136 Multiply -51.85 and 5.5. -285.175 -12.264-8 98.112 4 * -3.12435 -12.4974 What is the product of -0.00578 and 0.044? -0.00025432 0.0876 * 0.16 0.014016 Calculate -1-1.4583. 1.4583 Product of 0.1 and -0.08533. -0.008533 What is 0.1519 times -3? -0.4557 Work out -0.5 1162.106. -581.053 Work out -493.91 * 0.5. -246.955 What is the product of 21 and -47609? -999789 -2578 times 4.4 -11343.2 -0.39308 -2792.4 What is -166 times 275? -45650 What is the product of -120516 and 0.27? -32539.32 Product of -0.766 and -18.1. 13.8646 Work out 0.09 -17675. -1590.75 6.118 times 0.5 3.059 27326 14652 Calculate 0.1-11.079. -1.1079 What is 2836 times 298? 845128 Calculate -79.51. -79.5 Work out -0.1 1.4. -0.14 What is the product of -4889 and -69? 337341 Work out -0.172 * 2.3. -0.3956 0 * 11003.5 0 Calculate -6.0355-20. 120.71 What is 6.46 times -12.1? -78.166 2.1523 0.09 0.193707 Work out -245 * -0.0506. 12.397 What is the product of -4 and 146.82? -587.28 Calculate 0.434462. 13784.8 Product of -8590 and -0.1. 859 231 times -1188 -274428 Calculate 14.9-74.8. -1114.52 What is -0.1 times 7324? -732.4 Multiply -2 and -2199.83. 4399.66 What is -0.5 times -9346? 4673 -4 times 330.006 -1320.024 -1269 * -4.73 6002.37 What is the product of 0.2 and 2821.56? 564.312 Work out -678547 * 5. -3392735 -57809 -39045 Multiply 0.5 and 17305. 8652.5 Calculate -37053. -11115 What is the product of -1 and 28239? -28239 Product of 0.1 and -17184. -1718.4 Product of 29.205 and 1. 29.205 0.039 * 1.746 0.068094 Multiply -2559411 and -5. 12797055 02.8985 0 Work out -0.1 -13.6847. 1.36847 Multiply 0.502 and 90.2. 45.2804 Calculate -18430. -5520 What is the product of -10.5 and -29? 304.5 -1.3 times -0.06085 0.079105 -24.99-0.2 4.998 What is the product of -3 and 6819.61? -20458.83 -209.5 times 54 -11313 Calculate -68401.7. -11628 What is -1299.95 times -14? 18199.3 Product of -85 and -15859. 1348015 0.177-845 -149.565 -0.53 times 19661 -10420.33 -4287 times 0.11 -471.57 6486 * -395 -2561970 What is 287 times 101.19? 29041.53 -0.03 * 462.06 -13.8618 Work out 0.4 * 654.8. 261.92 Multiply -83335 and 0.06. -5000.1 -0.03-2730 81.9 -6.1958 times -0.2 1.23916 Work out 11 -291388. -3205268 27.3546 * 5 136.773 Calculate -0.69-22741. 15691.29 Multiply 0.6 and 5303. 3181.8 -1135 times 0.138 -156.63 -452 times 871 -393692 Product of -48.625 and 3. -145.875 Product of -79749 and 2. -159498 200270 0.3 60081 What is -704.9 times -0.6? 422.94 -0.4 times 45746 -18298.4 2024-31 -62744 Work out -0.5 -0.169748. 0.084874 Product of 0.029 and 193. 5.597 Work out -50 * 91.6. -4580 -462 * -2587 1195194 Product of 0.3 and -54.31. -16.293 Work out -0.463258 * 4. -1.853032 -33 times -195 6435 What is 13 times 0.0517? 0.6721 What is the product of 0.3 and -539.48? -161.844 What is -0.12149 times 1.05? -0.1275645 -8.49702-2 16.99404 Calculate -1631613. -505808 Product of 0.0956 and 0.1. 0.00956 What is the product of 3 and -131.4? -394.2 Calculate -124552.2. -24552.2 What is 10.22 times -33? -337.26 -0.3044 times 0.33 -0.100452 Calculate 9.5-144. -1368 Calculate 26-0.10357. -2.69282 -580.87 times -0.005 2.90435 Calculate -556178. -339790 What is the product of 0.038989 and -0.02? -0.00077978 -18254 * 2 -36508 Multiply -0.3 and 2.42484. -0.727452 What is -16.2 times -39.3? 636.66 Calculate -488358-0.2. 97671.6 What is the product of -1 and 0.0452242? -0.0452242 Multiply 0.4 and -130.19. -52.076 Multiply -40 and 2.733. -109.32 167-1689 -282063 Calculate 1349. 637 Calculate -9241.6. -1478.4 What is 14.069 times 0.114? 1.603866 Calculate 3-17165. -51495 30152 15652 Multiply 0.20115 and 0.4. 0.08046 Work out 0.7 * -73.2. -51.24 Calculate -2944.83. -1420.02 0.257231 times -0.3 -0.0771693 Calculate -54504-0.15. 8175.6 Product of 1.4 and -54966. -76952.4 Multiply 26.26 and 36. 945.36 What is the product of 0.4 and -2168? -867.2 Product of 0.06 and 11.893. 0.71358 Calculate -66684.5-0.3. 20005.35 Work out 10 -813. -8130 Calculate -4093191. -1305119 Calculate -4-0.01917. 0.07668 Multiply 2.6 and 22129. 57535.4 Product of -0.3 and 223. -66.9 Calculate 0.30965*0.08. 0.024772
Let k(r) = r + 1. Suppose -4y = -y. Let b be k(y). Let s be b/(1(-1)/(-27)). Calculate the highest common factor of s and 3. 3 Let n = 35 + -89. Let r be 28(-3 + n/(-14)). What is the greatest common factor of r and 3? 3 Suppose 4h = 89 - 9. What is the highest common factor of 30 and h? 10 Let i = -25 - -29. Let k = 65 + -37. What is the greatest common factor of k and i? 4 Suppose -88 - 136 = -7n. Calculate the highest common factor of n and 160. 32 Let u = 3 - -2. Let w = u - 1. Let a = -2 + w. Calculate the highest common divisor of a and 6. 2 Let a(m) be the third derivative of m5/15 - m3/6 + 2m2. Let i be a(2). What is the greatest common divisor of i and 5? 5 Let k be 363/8 - (-57)/(-152). Let q = -35 + 51. Let t = 25 - q. What is the highest common divisor of t and k? 9 Let r be 40 - (3 + (0 - 1)). Let u(h) = h2 + 7h + 17. Let p be u(-13). What is the greatest common factor of r and p? 19 Let n = -22 + 46. What is the greatest common factor of 8 and n? 8 Suppose -a - 3a + 720 = 0. Calculate the greatest common divisor of 20 and a. 20 Let z(s) = 2s3 - s2 - 1. Let r be z(5). Calculate the greatest common factor of 32 and r. 32 Let b be 45/(-2)(-1 + -1). Let u(a) = a*2 - 6. Let w be u(6). What is the greatest common divisor of b and w? 15 Suppose -4r + 36 = 4c, 1 = -r - 3c + 14. Let w(a) = 9a + 1. Let l be w(r). What is the highest common factor of 16 and l? 16 Suppose f + 0f - 110 = 0. Calculate the highest common divisor of f and 44. 22 Let s(c) be the third derivative of c*6/120 + 7c5/60 - c4/8 + c3 + c2. Let o be s(-7). Calculate the highest common divisor of 3 and o. 3 Suppose -6l + 30 = -3l. Calculate the highest common factor of 40 and l. 10 Let s(g) = -g + 5. Let o(w) = -5w + 20. Suppose 4a - 9 - 27 = 0. Let q(m) = as(m) - 2o(m). Let y be q(0). Calculate the highest common divisor of y and 20. 5 Suppose -2a + 3a = -3. Let x = a - -6. Suppose xk - 6 = k. Calculate the highest common factor of k and 21. 3 Suppose -u - 2 + 22 = 0. Suppose -u = 4q + q, 54 = r - 3q. What is the highest common factor of r and 14? 14 Let w = 4 - 5. Let s be w + 5(2 - -1). Calculate the greatest common divisor of 56 and s. 14 Suppose -4 = f, 3o - 3f = -0o + 27. Let b(l) = -5l + 3l2 + 1 + 0 - 3. Let v be b(-3). What is the highest common divisor of v and o? 5 Let f(n) = 9n*2 - 5n - 6. Let p be f(-3). What is the highest common divisor of p and 120? 30 Suppose 18 = 2n + 3g, -n + 10 = 2g + 3. Suppose 0 = 5r - 2r - 45. What is the highest common divisor of n and r? 15 Suppose -2k + 7k = 0. Suppose -y - 3y + 80 = k. Suppose 4x - 145 = -5a, -74 - 31 = -4x + 3a. Calculate the greatest common factor of y and x. 10 Let w = -367 + 642. Let u = w - 158. Suppose 3r = 4r - 13. What is the highest common factor of r and u? 13 Let p be -25 - 1/((-4)/8). Let w = -13 - p. What is the highest common divisor of 5 and w? 5 Let o = -32 - -19. Let c be 31 + (-3 - o). What is the highest common factor of c and 26? 13 Let z(f) be the second derivative of f4/12 - 4f*3/3 - 2f*2 + f. Let j be z(7). Let m be 10/(-15) - j/3. What is the greatest common factor of 24 and m? 3 Let o(w) = -6w - 1. Suppose 1 = -2t - 3. Let q be o(t). What is the highest common factor of q and 22? 11 Let u(y) = 4y*2 + 6y + 4. Let t be u(-3). Calculate the greatest common factor of t and 110. 22 Let k(x) = -x*2 - 16x - 6. Let f be k(-14). What is the greatest common divisor of 154 and f? 22 Let s be (-1)/(3 + (-30)/9). Let z be 195/10(-2)/3. Let n(y) = -y3 - 14y*2 - 16y - 6. Let j be n(z). What is the greatest common divisor of s and j? 3 Suppose 0 = -3y - 5d + 16, 0 = 3y + 4d - 7d. Suppose -4f + 5b = -8f + 71, 43 = yf + 5b. What is the greatest common factor of f and 112? 14 Let r be (0 + 1)30/6. Let f be (-1 + 0)(-1 + -1). Calculate the greatest common divisor of f and r. 1 Let z = 14 - 5. Suppose -3n = 4u + 38 + 8, 2n - 3u = -25. Let d = n + 77. What is the greatest common divisor of z and d? 9 Let o = -24 + 37. Calculate the highest common factor of 26 and o. 13 Suppose 38a = 43a - 85. Calculate the highest common divisor of 34 and a. 17 Let p = -1 + 7. Suppose pw = w + 70. Let f(k) = 3k*2 + k. Let y be f(2). What is the greatest common factor of w and y? 14 Let w(m) = -4m + 2. Let p be w(2). Let z be (-3 - 15/p)0. Suppose l - 5h - 39 = -zl, h = -3. What is the greatest common divisor of 60 and l? 12 Let d(x) = 116x*2 - 3x + 2. Let o be d(1). Calculate the greatest common factor of o and 46. 23 Suppose -4l - 2j + 1090 = 0, 2l - l - 250 = 4j. What is the greatest common factor of 108 and l? 54 Let i(r) = r*2 - r - 1. Let m be i(3). Let o(z) = -z + 44. Let s be o(0). Let c = s + 11. What is the highest common factor of c and m? 5 Suppose 2g - 6 = 2o, -2g - 5o = g + 7. Let x(r) = 7r - 1. Let c be x(g). Let j be 0 + 94/6. Calculate the greatest common divisor of c and j. 6 Suppose 3h - 3v - 9 = h, -3h - 5v + 4 = 0. Suppose -j = -2 - h. What is the greatest common factor of 40 and j? 5 Let u be 12/10(-70)/(-3). Let q be u/7 + (-1 - 0). Suppose 0 = 4f + 2r - 14, qf - 8 - 4 = -3r. Calculate the greatest common divisor of 27 and f. 3 Suppose -d + 17 = 2h + 7, 3d + 4h - 36 = 0. Suppose 3m = 4q + d, -4m + 4q = q - 33. What is the highest common divisor of 132 and m? 12 Let m be (8/(-12))/(4/(-6)). Let o(n) = 4n*2 - 4n + 3. Let t be o(2). Let v = 18 - t. Calculate the highest common divisor of m and v. 1 Suppose -4c + 109 = 2t - 3t, 0 = -4c + 4t + 112. Calculate the greatest common divisor of 18 and c. 9 Suppose -4m + 10 = -2m. Suppose 3z + 0x + 3x = 21, mx = 3z + 19. Calculate the highest common divisor of 1 and z. 1 Let c be (-12)/(-84)338 + 2/(-7). Let n be 3/(((-2)/(-16))/1). What is the highest common factor of c and n? 24 Let o(g) = -g3 - 21g*2 - 3g + 36. Let b be o(-21). Calculate the highest common divisor of b and 9. 9 Let l be (3 + (-48)/9)/(-1)12. What is the highest common factor of l and 28? 28 Suppose 0 = 16a - 6a - 200. Calculate the greatest common divisor of 5 and a. 5 Suppose 5c - 1177 = -282. Suppose -c + 437 = 3v. Suppose -v = -4d + 166. Calculate the greatest common divisor of d and 7. 7 Let x(r) = r*2 + 7r + 42. Let g be x(-10). What is the greatest common factor of g and 48? 24 Let c(u) = -u*2 + 9u + 9. Let g be c(9). Calculate the highest common divisor of g and 27. 9 Let w be (-26)/(-13) - (-1)/(-1) - -6. Calculate the greatest common divisor of w and 14. 7 Suppose -3b + k + 100 = 0, -4k + 3 - 19 = 0. Suppose b = 5w - w. What is the highest common divisor of 32 and w? 8 Let w(v) be the third derivative of v4/12 + v3 - v2. Let l be w(-4). Let g be -12(1 + l) + 2. Calculate the greatest common divisor of g and 35. 7 Suppose -417 - 213 = -3j. What is the highest common divisor of 30 and j? 30 Let a = 197 + -137. What is the greatest common divisor of a and 15? 15 Suppose -35 = -4y - 11. Let v be 0 - 1 - 3/(-3). Suppose v = -4s + 4x - 9x + 17, -3s - x + 10 = 0. What is the greatest common factor of s and y? 3 Suppose -12d + 5d + 21 = 0. Calculate the highest common divisor of d and 6. 3 Let x = 141 + -68. Let n = -38 + x. Suppose 2h + 2h - 50 = -3s, 3s - h - 40 = 0. What is the greatest common divisor of s and n? 7 Suppose -253 = -3j + 62. Let v(k) = 5k*2 - 7k + 3. Let h be v(6). Suppose h = 5z + 36. What is the highest common divisor of z and j? 21 Let r = 3 + -1. Let m(b) = 11b*2 + 2b - 2. Let p be m(r). Let x = p - 33. What is the highest common divisor of 52 and x? 13 Let p(t) = 6t. Let r be p(5). Let f = 116 - 71. What is the highest common factor of r and f? 15 Suppose d - 2g = 3d - 6, -d - 5g = -3. Suppose -48 = -ds - s. What is the greatest common factor of 3 and s? 3 Let s(q) = 2q + 17. Let c be s(-4). What is the greatest common divisor of c and 9? 9 Let g(o) = -2o3 - 2o*2 + 2o + 2. Let d be g(-2). Suppose -s + 2b = -d, -3b - 1 = -10. Calculate the highest common factor of s and 12. 12 Let x be 3/(9/51)1. Let d = 35 + -18. Calculate the greatest common divisor of x and d. 17 Suppose 2j = -5d - 11 - 10, 4d + 26 = 3j. Let n = 4 - j. Suppose 2 = 4s - n. What is the greatest common divisor of s and 11? 1 Let w = -61 - -70. Calculate the highest common factor of 135 and w. 9 Let m = 0 + 4. Suppose -mo - 4f + 127 = -o, -51 = -o + 3f. Let s(w) = 6w - 18. Let c be s(6). Calculate the greatest common divisor of c and o. 9
What is -22.88 rounded to 0 decimal places? -23 Round -0.19304 to 3 decimal places. -0.193 What is 18910 rounded to the nearest 1000? 19000 What is 27.489 rounded to the nearest integer? 27 Round 0.3038 to one decimal place. 0.3 Round -15714000 to the nearest 100000. -15700000 What is -0.000000342 rounded to 7 dps? -0.0000003 Round 407400 to the nearest one hundred thousand. 400000 What is 20108300 rounded to the nearest one million? 20000000 Round -0.0028355 to 3 dps. -0.003 What is -0.412238 rounded to 1 dp? -0.4 What is 101.262 rounded to the nearest 10? 100 What is 98840 rounded to the nearest ten thousand? 100000 What is -0.00044 rounded to 3 decimal places? 0 Round -5342000 to the nearest 100000. -5300000 Round -406.62 to the nearest 10. -410 Round 0.002148 to three dps. 0.002 Round 0.0001233 to 5 dps. 0.00012 Round -2429500 to the nearest one hundred thousand. -2400000 Round -387170 to the nearest 1000. -387000 Round -1.2362 to one dp. -1.2 What is 39010 rounded to the nearest 1000? 39000 What is -44.3 rounded to the nearest ten? -40 What is -0.04319 rounded to two decimal places? -0.04 What is -227000 rounded to the nearest one thousand? -227000 What is 0.00004662 rounded to six decimal places? 0.000047 What is -0.000173 rounded to 5 dps? -0.00017 What is -79299 rounded to the nearest one thousand? -79000 What is 0.000119597 rounded to 5 dps? 0.00012 Round 4906210 to the nearest 100000. 4900000 What is 272.23 rounded to the nearest ten? 270 What is 0.00005284 rounded to six dps? 0.000053 Round 4.97 to zero dps. 5 Round 553000 to the nearest ten thousand. 550000 Round -1.022 to 1 decimal place. -1 What is -0.00000976 rounded to 7 decimal places? -0.0000098 What is 7240 rounded to the nearest 1000? 7000 What is 88700 rounded to the nearest ten thousand? 90000 Round -588.5 to the nearest one hundred. -600 Round -0.000011169 to 7 dps. -0.0000112 What is -572400 rounded to the nearest 100000? -600000 What is 0.000071 rounded to five decimal places? 0.00007 What is 0.0003709 rounded to four dps? 0.0004 Round -0.00000428 to 7 decimal places. -0.0000043 Round -166 to the nearest ten. -170 Round 2470 to the nearest ten thousand. 0 What is -0.0000693 rounded to 5 decimal places? -0.00007 Round 0.0046737 to four dps. 0.0047 Round 0.10386 to 2 dps. 0.1 Round -0.002551 to 3 decimal places. -0.003 Round -66850 to the nearest 10000. -70000 Round 0.0000190208 to 6 decimal places. 0.000019 Round -0.00128571 to 5 dps. -0.00129 Round -43015000 to the nearest 1000000. -43000000 Round 0.04555 to 3 dps. 0.046 Round -333120 to the nearest ten thousand. -330000 Round -0.212086 to 3 dps. -0.212 Round 20131.4 to the nearest 100. 20100 What is -1858000 rounded to the nearest one million? -2000000 Round -0.029004 to 2 decimal places. -0.03 What is 1908 rounded to the nearest 1000? 2000 What is -0.00120267 rounded to 4 dps? -0.0012 Round -0.000532 to five decimal places. -0.00053 Round -1388.56 to the nearest integer. -1389 What is 0.00008054 rounded to 6 decimal places? 0.000081 What is -691000 rounded to the nearest one hundred thousand? -700000 What is 43.9 rounded to zero dps? 44 What is 8.071 rounded to 2 decimal places? 8.07 Round 22.7 to zero dps. 23 Round -13964000 to the nearest one hundred thousand. -14000000 What is -0.014376 rounded to 4 dps? -0.0144 Round 25947000 to the nearest 100000. 25900000 Round 0.000078622 to five dps. 0.00008 Round 1475300 to the nearest 10000. 1480000 Round 102.37 to the nearest integer. 102 Round 0.0000005373 to seven dps. 0.0000005 What is -291630 rounded to the nearest 10000? -290000 What is -2760100 rounded to the nearest ten thousand? -2760000 Round -0.000035462 to six dps. -0.000035 Round -16440 to the nearest 10000. -20000 Round 1900.12 to the nearest 10. 1900 What is 0.000284 rounded to four decimal places? 0.0003 What is 7190 rounded to the nearest 1000? 7000 What is 377680 rounded to the nearest 1000? 378000 What is -0.00002868 rounded to 7 decimal places? -0.0000287 Round -0.008255 to four decimal places. -0.0083 What is -0.585 rounded to 1 decimal place? -0.6 What is -223 rounded to the nearest 10? -220 What is -0.000016392 rounded to six dps? -0.000016 Round -1.75 to one dp. -1.8 Round 6.36 to one decimal place. 6.4 What is 0.0040011 rounded to four decimal places? 0.004 What is 1.214 rounded to one decimal place? 1.2 Round -0.000329 to five dps. -0.00033 Round 0.000152814 to 5 decimal places. 0.00015 Round 119450 to the nearest 100000. 100000 What is -0.1267 rounded to three decimal places? -0.127 What is -0.132974 rounded to 4 decimal places? -0.133 Round 5791 to the nearest 100. 5800 Round -0.00034356 to six decimal places. -0.000344 What is -0.00459 rounded to three dps? -0.005 Round -238.42 to the nearest integer. -238 What is -0.55621 rounded to 1 dp? -0.6 What is -0.00239 rounded to 3 dps? -0.002 Round -1.2247 to 1 dp. -1.2 Round -211.4 to the nearest ten. -210 Round -1.3551 to two dps. -1.36 Round -0.23141 to 2 decimal places. -0.23 Round 0.0008785 to five decimal places. 0.00088 What is -2.195 rounded to 1 decimal place? -2.2 Round -0.00031976 to five dps. -0.00032 What is 34400 rounded to the nearest one thousand? 34000 What is -150920 rounded to the nearest one thousand? -151000 What is -129810000 rounded to the nearest 1000000? -130000000 What is -0.0004351 rounded to four decimal places? -0.0004 Round -1.917 to one decimal place. -1.9 Round 0.0056627 to three decimal places. 0.006 What is 24461.2 rounded to the nearest one hundred? 24500 What is -0.00009602 rounded to four dps? -0.0001 What is -0.0001054 rounded to five dps? -0.00011 What is -243.7 rounded to the nearest one hundred? -200 Round 3112100 to the nearest ten thousand. 3110000 What is -0.104 rounded to 2 decimal places? -0.1 What is 0.000000667172 rounded to 7 decimal places? 0.0000007 What is -57120 rounded to the nearest one thousand? -57000 Round 7067100 to the nearest 1000000. 7000000 What is -0.0000021241 rounded to seven decimal places? -0.0000021 Round 173000 to the nearest 10000. 170000 What is 2650 rounded to the nearest one hundred? 2700 What is -1970000 rounded to the nearest 1000000? -2000000 Round 0.0005463 to five decimal places. 0.00055 What is -5434000 rounded to the nearest 100000? -5400000 Round -5.9224 to one dp. -5.9 Round -0.00000394 to 6 decimal places. -0.000004 What is -194.66 rounded to the nearest 10? -190 Round 0.00000496 to six dps. 0.000005 Round -0.00000208 to 7 dps. -0.0000021 Round 33.7 to the nearest 10. 30 What is 0.0005662 rounded to 3 dps? 0.001 Round 32830000 to the nearest 1000000. 33000000 What is -55992000 rounded to the nearest one million? -56000000 Round -180.67 to zero decimal places. -181 What is -6.894 rounded to the nearest integer? -7 What is -11910 rounded to the nearest 100? -11900 What is 28172000 rounded to the nearest one million? 28000000 Round -0.000655 to three dps. -0.001 What is -26710 rounded to the nearest one hundred thousand? 0 Round -0.01276 to two dps. -0.01 What is -13483.5 rounded to the nearest 100? -13500 Round 899 to the nearest ten. 900 What is -32100000 rounded to the nearest 1000000? -32000000 Round 1.1953 to two dps. 1.2 Round 99236 to the nearest ten thousand. 100000 What is -1750100 rounded to the nearest ten thousand? -1750000 What is 10580 rounded to the nearest 100? 10600 Round -0.00012241 to 6 decimal places. -0.000122 Round 0.05145 to three dps. 0.051 Round 0.007614 to 3 decimal places. 0.008 Round 4230 to the nearest one thousand. 4000 What is -110.31 rounded to the nearest integer? -110 Round 0.010294 to two decimal places. 0.01 What is 0.000037332 rounded to seven decimal places? 0.0000373 What is -0.000017408 rounded to 6 decimal places? -0.000017 What is -0.37795 rounded to two dps? -0.38 Round -12041.5 to the nearest one thousand. -12000 What is -28093 rounded to the nearest ten thousand? -30000 Round -203.39 to zero dps. -203 Round 0.0015255 to 3 decimal places. 0.002 Round 2.197 to one decimal place. 2.2 Round 290.7 to the nearest 10. 290 What is 0.13987 rounded to 2 decimal places? 0.14 What is 0.0156476 rounded to three decimal places? 0.016 What is -6191.93 rounded to the nearest 100? -6200 What is 0.11419 rounded to two dps? 0.11 What is -0.01113 rounded to 3 dps? -0.011 Round -5064.9 to the nearest ten. -5060 Round -0.16215 to two decimal places. -0.16 Round -1.4909 to 2 decimal places. -1.49 What is 0.002179 rounded to four dps? 0.0022 What is 0.0036201 rounded to 5 decimal places? 0.00362 What is 0.000008167 rounded to 6 decimal places? 0.000008 What is 1474.83 rounded to the nearest ten? 1470 What is -298.6 rounded to the nearest 100? -300
Let n(g) = -2g. Let s(k) = 126k*2 - 5k. What is s(n(q))? 504q2 + 10q Let f(b) = -31b - 5. Let l(o) = 32o + 6. Let u(q) = 6f(q) + 5l(q). Let h(y) = -y. What is u(h(w))? 26w Let z(n) be the second derivative of 2n*3/3 + 6n. Let j(r) = -2r2. Give z(j(k)). -8k2 Let o(t) be the third derivative of t4/3 - 3t2. Let n(s) = -s + 6. Let z(a) = -3a + 17. Let y(m) = 17n(m) - 6z(m). What is y(o(f))? 8f Let p = 0 - 0. Suppose 3k + 0 - 6 = p. Let s(v) = 2v2 - vk - 3v*2. Let b(i) = -3i. Calculate b(s(q)). 6q2 Let f(t) = -t. Let d(n) = n2 + 4n. Calculate d(f(h)). h*2 - 4h Let z(i) = 4i2. Let p(k) = -2k*2 - 4k - 4. Let c(h) = h*2 + h + 1. Let a(m) = -20c(m) - 5p(m). What is a(z(u))? -160u*4 Let s(u) = 7u*2. Let f(y) = 3y*2 + 8y. Determine s(f(a)). 63a4 + 336a*3 + 448a2 Let n(z) = -z2. Let p(b) be the third derivative of b4/24 + b3/3 - 2b2. Let d(y) = 2y + 3. Let u(l) = -2d(l) + 3p(l). Calculate u(n(a)). a*2 Let h(l) = -3l. Let p(g) be the first derivative of -4 + 0g - 2/3g*3 + 0g*2. Calculate p(h(t)). -18t*2 Let p(g) = -158g*2 + 1. Let a(k) = -2k*2. Determine a(p(j)). -49928j*4 + 632j2 - 2 Let p(g) be the first derivative of g5/120 + g*3 + 6. Let s(a) be the third derivative of p(a). Let x(z) = 9z*2. Calculate x(s(t)). 9t*2 Let x = 3 - 3. Suppose x = -9f + 4f + 10. Let g(q) = q - 4q + 2q + fq. Let m(l) = -2l. Give m(g(i)). -2i Let w(u) = 7u. Let d(m) = 120m. Calculate d(w(z)). 840z Let h(i) = 2i. Suppose -1 = v - 3. Let d(n) = -vn + n + 0n. Give d(h(p)). -2p Let j(l) = 2l*2 - 4l + 11l - 7l. Let n(w) = -86w2. Calculate n(j(p)). -344p*4 Let k(n) = 2n. Let m(r) = r*2 + 141r + 11. What is m(k(g))? 4g2 + 282g + 11 Let g(y) = -2y - 3. Let t(m) = -26m - 32. Let c(z) = -9z - 11. Let p(u) = 17c(u) - 6t(u). Let n(o) = -5g(o) - 3p(o). Let r(w) = w. Give r(n(i)). i Let l(f) = -8f*2 - 6f + 6. Let w(r) = -7r2 - 5r + 5. Let z(k) = 5l(k) - 6w(k). Let d(v) = -4v + 2v + v. Calculate d(z(y)). -2y2 Suppose -f = 2v + 51 + 101, v + 82 = f. Let k be (-12)/v + (-48)/(-26). Let x(h) = -h*k + 4h*2 - 3h + 3h. Let z(d) = 2d*2. Determine z(x(p)). 18p*4 Let f(o) = 11o. Let a(r) be the second derivative of 0 - 5r - 1/3r*3 + 0r*2. Give a(f(b)). -22b Let x(n) = n*2. Let f(b) = -163b - 1. What is f(x(d))? -163d2 - 1 Let m(y) = 41y. Let j(l) = 5l2. What is j(m(i))? 8405i*2 Let i(s) = -3s - 7s + 7s. Let p(a) = -3a2. Calculate p(i(h)). -27h*2 Let d(a) = -161a - 119. Let b(m) = 4m + 3. Let y(n) = -238b(n) - 6d(n). Let k(f) = f. Calculate y(k(h)). 14h Let z(r) = 2r. Let v be (-2)/(-2) - (0 + -1). Let s(l) = -l - 12. Let b be s(-14). Let m(n) = -n + n - vn*b. Determine z(m(x)). -4x*2 Let v(u) = -349u - 2. Let l(q) = -11q. Determine l(v(f)). 3839f + 22 Let b(i) = -i. Suppose -5c + 5 = -5. Let j(g) = -g3 + 3g*2 - 3g + 2. Let u be j(c). Let o(h) = u + 0 - h. What is b(o(s))? s Let g(u) be the first derivative of u*3/3 + 20. Let k(p) = 16p. Give g(k(h)). 256h2 Let m(b) be the first derivative of -b3 - 8. Let c(y) = -6y. What is c(m(a))? 18a2 Let i(b) = 3b + 4 + 5 - 9. Let n(k) = 2k - 2. Let a(j) = -1. Let v(p) = 2a(p) - n(p). What is v(i(s))? -6s Let u(h) = -34h. Let q(l) = 94l. Give q(u(g)). -3196g Let j(i) = 2i2. Let k(n) be the second derivative of n4/2 - 5n. What is k(j(s))? 24s4 Let r(v) = 19v*2. Let q(k) = -3k*2. Calculate r(q(t)). 171t*4 Let x(v) = -2v*2. Let z(y) = -2y + 71. Give z(x(u)). 4u2 + 71 Let g(p) = 2p*2. Let m(y) be the third derivative of -5y*4/8 + 5y*2. What is g(m(d))? 450d*2 Let c(o) = 2o*2 - 5o - 21. Let j(q) = -2q2. What is c(j(g))? 8g*4 + 10g*2 - 21 Let q(h) be the first derivative of -3h2 + 2. Let w(a) be the first derivative of a2/2 - 2. What is q(w(b))? -6b Suppose y - 4 - 4 = -2q, 5y = -2q + 24. Let u(n) = -2 + q + n2. Let s(j) = -j2. Give s(u(v)). -v*4 Let s(x) = -2x. Let u(j) = -2j2 - 72j. Calculate u(s(h)). -8h2 + 144h Let r(b) = -4b2. Let m(j) = 3j + 3. Let n(o) = -o*2 + o + 1. Let k(u) = -m(u) + 3n(u). Calculate r(k(f)). -36f4 Let c(p) = -2p. Let w(f) = -f*2 - 125. What is c(w(h))? 2h*2 + 250 Let k(v) = -3v2. Let j(y) = -1 + 4 - y2 + 6y2 - 6. Let z(g) = -6g*2 + 4. Let m(q) = -4j(q) - 3z(q). What is k(m(c))? -12c*4 Let k(m) = -3m2. Let n(c) be the first derivative of c2 - 2 - 4c2 + 3c2 + c2. Give k(n(b)). -12b2 Let x(v) = -20v*2 + 12v - 12v + 22v2. Let g(q) be the first derivative of q2 + 1. What is g(x(k))? 4k2 Suppose 4d - 8 = -f - 3f, 4 = 2f + 5d. Let x(t) = 0t + ft - t. Let c(n) = -7n. Give c(x(g)). -7g Let q(t) = -t2 + 1. Let h(r) = 7r*2 - 6. Let f(j) = h(j) + 6q(j). Let g(u) = 5u - 5u + 4u2. What is f(g(k))? 16k*4 Let s(t) = t. Let g(p) = 407p*2 - 37p - 37. Let h(f) = 34f2 - 3f - 3. Let m(r) = 3g(r) - 37h(r). Determine m(s(a)). -37a2 Let r(x) = -3x. Let a(m) = -7 + 5 + 2 - 7m2. What is r(a(i))? 21i*2 Let t(l) = -348l. Let z(w) = 4w. Determine z(t(a)). -1392a Let t(n) = -6n + n2 + 2n + 3n. Let p(x) = -5x*2 + 3x. Let a(o) = p(o) + 3t(o). Let q(k) = -4k. Calculate a(q(b)). -32b2 Let p(f) = 2f. Let w(k) be the third derivative of k4 + k2 + 48k. Give p(w(v)). 48v Let y(a) = -a*2 + 0a*2 + 0a*2. Let w(r) = -13r*2. Determine y(w(k)). -169k*4 Let v(m) = 7m + 13. Let z(y) = -y - 2. Let u(k) = 6v(k) + 39z(k). Let x(d) be the third derivative of d*5/30 - 5d*2. Give u(x(l)). 6l*2 Let z(q) = -3q. Let g(f) = f*2 + 80. Determine g(z(d)). 9d*2 + 80 Let i(u) = -22u. Let k(r) = 28r. Give k(i(j)). -616j Let x(u) = 662 - 2u - 662. Let f(d) = -7d - 16d + 6d. Let l(y) = 9y. Let b(i) = 6f(i) + 11l(i). What is b(x(w))? 6w Let m(h) = 79h. Let g(d) = -1778d. Let a(u) = 5g(u) + 112m(u). Let s(k) = -2k. What is a(s(t))? 84t Let v(s) = -13s2. Let i(x) = -2x - 3x + 3x. Calculate i(v(k)). 26k2 Let a(w) = w. Let b(u) = 0u - 8 - 2u - u. Let c(t) = -t - 3. Let f(s) = 3b(s) - 8c(s). What is f(a(v))? -v Let t(n) = 16n*2. Let b(k) = -5k*2 + 5. Calculate b(t(s)). -1280s*4 + 5 Let f(m) be the first derivative of 2m*3/3 + 9. Let y(r) = -7r*2. Determine f(y(g)). 98g*4 Suppose 4a = 2d - 36, -2d - 2a + 36 = -5a. Let u(i) = -31i2 + di*2 + 14i*2. Let n(g) = 5g*2. Give u(n(s)). 25s*4 Let c(u) be the second derivative of 0u*2 - 1/6u*4 + 6u + 0 + 0u3. Let s(n) = 3n. Calculate s(c(l)). -6l2 Let a(w) be the second derivative of -w4/6 + 5w. Let z(p) = -4p2 - 7. Let d(k) = k2 + 2. Let f(v) = 7d(v) + 2z(v). Give f(a(t)). -4t*4 Let t(l) = -4l + 9. Let s(u) = u - 2. Let z(p) = 9s(p) + 2t(p). Let q(m) = 143 + m - 143. What is z(q(c))? c Let u(s) = -2s. Let w(g) = -71g*2. Give w(u(v)). -284v*2 Let w(b) be the first derivative of 4b*2 + 22. Let q(y) = -6y*2. Determine q(w(k)). -384k*2 Let t(l) = -l + 5. Let s(q) = 29q*2. Give s(t(i)). 29i*2 - 290i + 725 Let b(h) = -26h2. Let w(u) = 18u*2. What is w(b(o))? 12168o*4 Let s(y) = 5y. Let w(j) = -16j. What is w(s(v))? -80v Let c(b) = -b - 19. Let f(y) = -2y + 22. Determine f(c(o)). 2o + 60 Let a(t) = -73t. Let p(w) = -w2. Calculate a(p(l)). 73l2 Let j(h) be the second derivative of -h4 + h. Let a(l) = l. What is j(a(z))? -12z2 Let j(p) = -p. Let z(v) = -21v + 9v + 8v + 3. Let t(y) = -y + 1. Let a(h) = -3t(h) + z(h). Give j(a(b)). b Let z(m) = -1053m. Let y(f) = 3f. What is z(y(h))? -3159h Let g(n) = -n - 1. Let w(s) = 3s2 + 3. Calculate g(w(f)). -3f2 - 4 Let j(t) = -t2. Let u(o) = -198o2. Give j(u(y)). -39204y*4 Let o(u) = 30 - 30 + 2u. Suppose 4h + 5i - 2 - 3 = 0, 3h = 4i - 4. Let y(f) = 0 + 3f + h. Calculate o(y(q)). 6q Let x(c) = c + 3. Let n(b) = -2b - 5. Let i(y) = 3n(y) + 5x(y). Let f(r) be the first derivative of 0r + 1 + 0r2 - 2/3r*3. Give i(f(d)). 2d*2 Let d(r) be the first derivative of 5r*2/2 - 23. Let l(c) = 5c*2. What is l(d(p))? 125p*2 Suppose -11j + 10 = -6j. Let a(d) = -d2 + 2 - 2 - 4d*j. Let q(z) = z. Determine q(a(l)). -5l*2 Let z(k) = 3k. Let r(l) = -2232l2 + 217l + 217. Let i(x) = 31x2 - 3x - 3. Let c(p) = 217i(p) + 3r(p). Determine z(c(d)). 93d2 Let x(g) = 21g*2. Let h(n) = 6n - 5. Let i(u) = -u + 1. Let v(j) = -4h(j) - 20i(j). What is v(x(k))? -84k*2
How many milligrams are there in 259.389ng? 0.000259389 What is 0.1405947 millilitres in litres? 0.0001405947 How many years are there in 0.3336665 decades? 3.336665 How many milliseconds are there in 1/30 of a minute? 2000 Convert 75038.48l to millilitres. 75038480 What is seventeen ninths of a hour in seconds? 6800 How many microseconds are there in 9/10 of a millisecond? 900 Convert 166424.61 months to centuries. 138.687175 Convert 0.1092104l to millilitres. 109.2104 Convert 3392279.1 days to weeks. 484611.3 Convert 3256.005 millennia to centuries. 32560.05 What is eight thirds of a century in months? 3200 How many kilograms are there in fourty-five eighths of a tonne? 5625 Convert 0.7624121 decades to years. 7.624121 How many years are there in one quarter of a millennium? 250 How many months are there in fifty-five quarters of a decade? 1650 How many millilitres are there in 0.1994102l? 199.4102 How many years are there in 27/5 of a century? 540 Convert 775.0865 millennia to years. 775086.5 How many nanoseconds are there in 1/4 of a microsecond? 250 What is 34/5 of a litre in millilitres? 6800 How many hours are there in seven halves of a week? 588 What is 793.9547 centuries in millennia? 79.39547 What is 961848.9mm in kilometers? 0.9618489 What is 702.7264 milligrams in nanograms? 702726400 Convert 10.55213 litres to millilitres. 10552.13 What is ninety-three quarters of a week in hours? 3906 What is 997720.1kg in micrograms? 997720100000000 What is five eighths of a litre in millilitres? 625 What is 72.84507nm in kilometers? 0.00000000007284507 How many milliseconds are there in 17/4 of a second? 4250 What is 2/15 of a century in months? 160 Convert 222410.25 hours to days. 9267.09375 How many centimeters are there in fourty-two fifths of a meter? 840 How many hours are there in 17/4 of a day? 102 How many milligrams are there in seven quarters of a gram? 1750 What is 7/2 of a century in years? 350 Convert 0.4728206ml to litres. 0.0004728206 How many days are there in 15312620.7ms? 0.17722940625 What is 13/4 of a litre in millilitres? 3250 Convert 3.956434ml to litres. 0.003956434 What is 294.892 millilitres in litres? 0.294892 How many litres are there in 87469.33ml? 87.46933 What is five quarters of a hour in minutes? 75 What is 0.8057748 decades in months? 96.692976 How many months are there in 58.3699 centuries? 70043.88 What is 12/25 of a kilometer in centimeters? 48000 What is 2288.92608 minutes in weeks? 0.227076 What is fifty-nine fifths of a century in years? 1180 How many minutes are there in 33.82293 hours? 2029.3758 How many millilitres are there in five quarters of a litre? 1250 How many minutes are there in 5/4 of a week? 12600 How many millennia are there in 14478.705 months? 1.20655875 How many centuries are there in 77/2 of a millennium? 385 What is 25/8 of a kilogram in grams? 3125 What is 16.0365 centuries in decades? 160.365 What is 48/5 of a milligram in micrograms? 9600 How many nanograms are there in 59.40398ug? 59403.98 How many hours are there in 4.753602 nanoseconds? 0.000000000001320445 What is 1/4 of a minute in milliseconds? 15000 How many centimeters are there in 1/5 of a kilometer? 20000 What is one sixteenth of a gram in micrograms? 62500 Convert 0.108805ml to litres. 0.000108805 What is 27/2 of a tonne in kilograms? 13500 How many millilitres are there in 7/4 of a litre? 1750 How many litres are there in 0.4670583ml? 0.0004670583 Convert 2859887.7 months to millennia. 238.323975 What is 995.8259km in nanometers? 995825900000000 What is three tenths of a decade in years? 3 Convert 7652.695 litres to millilitres. 7652695 How many millilitres are there in sixty-seven quarters of a litre? 16750 How many milligrams are there in 26/5 of a gram? 5200 What is fifty-two fifths of a microsecond in nanoseconds? 10400 Convert 19641.66mg to nanograms. 19641660000 What is 1/20 of a kilometer in meters? 50 What is one sixth of a week in hours? 28 What is seven quarters of a meter in centimeters? 175 How many millilitres are there in 8/25 of a litre? 320 What is 4/15 of a week in minutes? 2688 What is 25/2 of a meter in millimeters? 12500 How many millilitres are there in 86363.19l? 86363190 Convert 81885.45 litres to millilitres. 81885450 Convert 541.3367 minutes to milliseconds. 32480202 How many litres are there in 81905.75ml? 81.90575 Convert 0.32399nm to micrometers. 0.00032399 How many nanometers are there in 29/2 of a micrometer? 14500 Convert 8352.044 millennia to months. 100224528 What is 49.27184 litres in millilitres? 49271.84 Convert 7.513576um to centimeters. 0.0007513576 How many millilitres are there in 61/2 of a litre? 30500 What is 15115.4t in milligrams? 15115400000000 What is 74/3 of a year in months? 296 What is 1/20 of a kilometer in millimeters? 50000 What is 0.3580703 nanograms in grams? 0.0000000003580703 How many millimeters are there in sixty-one quarters of a meter? 15250 How many nanometers are there in thirteen fifths of a micrometer? 2600 What is 4/21 of a week in hours? 32 Convert 73641.23 seconds to microseconds. 73641230000 What is 7/4 of a litre in millilitres? 1750 How many nanometers are there in one tenth of a micrometer? 100 Convert 8.15846ml to litres. 0.00815846 What is 377056.4t in milligrams? 377056400000000 Convert 77.40367 millilitres to litres. 0.07740367 Convert 72.79007 millilitres to litres. 0.07279007 How many seconds are there in 34/5 of a minute? 408 What is one twentieth of a minute in milliseconds? 3000 How many meters are there in twenty-five eighths of a kilometer? 3125 What is 982.032 centuries in millennia? 98.2032 What is 0.0139886 millennia in decades? 1.39886 How many millilitres are there in 1.704688l? 1704.688 What is 1/10 of a day in seconds? 8640 Convert 780518.4 centuries to months. 936622080 What is 3/10 of a millennium in decades? 30 How many months are there in seven quarters of a century? 2100 What is 7/2 of a day in hours? 84 How many centuries are there in fourty-five halves of a millennium? 225 What is 13/4 of a century in months? 3900 What is 1/10 of a gram in micrograms? 100000 What is 9/10 of a kilometer in meters? 900 What is twenty-three sixths of a minute in seconds? 230 Convert 35397.62 minutes to milliseconds. 2123857200 What is 21/4 of a millennium in years? 5250 How many nanograms are there in 3/5 of a microgram? 600 What is 77/3 of a decade in months? 3080 What is 1/5 of a kilometer in meters? 200 What is 2/125 of a meter in micrometers? 16000 What is 8486.115kg in nanograms? 8486115000000000 What is 1/10 of a litre in millilitres? 100 How many micrograms are there in 81864.6kg? 81864600000000 What is 9887.353 days in hours? 237296.472 What is 8/25 of a centimeter in micrometers? 3200 What is 61694.793 microseconds in hours? 0.0000171374425 What is 22/15 of a day in minutes? 2112 How many seconds are there in 529.4842 hours? 1906143.12 What is twenty-seven fifths of a meter in millimeters? 5400 Convert 2.631804 days to milliseconds. 227387865.6 What is 619.9609 micrograms in tonnes? 0.0000000006199609 What is 1/10 of a gram in milligrams? 100 How many minutes are there in twenty-one fifths of a day? 6048 How many millilitres are there in 10.84517 litres? 10845.17 What is 1/5 of a millimeter in micrometers? 200 What is seven thirds of a decade in months? 280 What is 13/8 of a millennium in years? 1625 How many milligrams are there in three tenths of a gram? 300 Convert 320086.4 litres to millilitres. 320086400 What is one fifth of a milligram in micrograms? 200 Convert 930.2378 tonnes to kilograms. 930237.8 Convert 1.214713 years to decades. 0.1214713 How many kilograms are there in fourty-one halves of a tonne? 20500 Convert 404227.5 kilometers to centimeters. 40422750000 How many seconds are there in eight fifteenths of a minute? 32 Convert 14663.358 months to decades. 122.19465 What is 45151.53 centuries in years? 4515153 How many millilitres are there in 48/5 of a litre? 9600 What is 61/2 of a kilometer in meters? 30500 How many milliseconds are there in three eighths of a second? 375 How many milliseconds are there in 538.6903us? 0.5386903 Convert 8.698996 milligrams to tonnes. 0.000000008698996 How many millilitres are there in seventy-one fifths of a litre? 14200 How many micrometers are there in 0.0223866 centimeters? 223.866 How many nanoseconds are there in 7839.693 minutes? 470381580000000 How many meters are there in 4.249296km? 4249.296 What is 5.233404us in minutes? 0.0000000872234 Convert 94862.4ml to litres. 94.8624 How many meters are there in one fifth of a kilometer? 200
Let n(i) = i + 23. Let o be (-652)/28 + 16/7 + -2. Let z be n(o). Differentiate -3d3 + 45 + zd*3 - 5d*3 with respect to d. -24d*2 Find the second derivative of 9817f*3 - 9827f*3 + 2153f + 5f2 - 46f wrt f. -60f + 10 Let x(w) be the third derivative of 0w + 0w3 - 239/24w*4 + 71/60w*5 - 12 + 10w*2. Find the second derivative of x(c) wrt c. 142 Let n(l) = -703l - 670. Let c(b) = 4b + 2. Let z(r) = -4c(r) - n(r). What is the derivative of z(f) wrt f? 687 Let i = -30 + 32. Find the second derivative of -365j - 358j - 80ji + 753j wrt j. -160 Let s(f) = 13f3 + 2f + 6. Let h(x) = 1 + 14x3 - 8x*3 - 7x*3 + x. Let d(t) = -2h(t) + s(t). What is the first derivative of d(u) wrt u? 45u2 Find the third derivative of -5455i*4 - 80i*3 - 636i*2 - 500i*2 - 1819i*2 + 80i*3 wrt i. -130920i Let h = 157 - 155. Let t(k) = 209k2 + 193k - 2. Let r(u) = 417u2 + 384u - 5. Let o(d) = hr(d) - 5t(d). What is the second derivative of o(s) wrt s? -422 Let b(d) be the first derivative of 169/3d3 + 0d*5 - 8d*4 + 1/2d*6 + 0d - 156 + 0d2. Find the third derivative of b(n) wrt n. 180n*2 - 192 Let p(d) = -2d*2 + 4d + 8. Let k be p(3). Find the second derivative of k - h - 7 + 3 - 4 + 31h2 wrt h. 62 Let c(o) = 7793o*2 - 3o + 7147. Let u(l) = -15588l2 + 7l - 14288. Let x(j) = 7c(j) + 3u(j). What is the first derivative of x(w) wrt w? 15574w Let f(c) = -6192c + 6070. Let l(z) = 6200z - 6079. Let w(i) = -6f(i) - 7l(i). What is the derivative of w(r) wrt r? -6248 Find the second derivative of -180 + 89 - 173x - 192x3 - 1167x*3 + 97 wrt x. -8154x What is the second derivative of 1 + 645v - 9v + 3514v2 + 64v + 386v + 316v wrt v? 7028 Find the second derivative of -1635l - 20 + 927l*3 + 10 - 10l*2 + 12 - 980l*3 wrt l. -318l - 20 Let f(m) be the third derivative of 303m6/40 + 863m*5/30 - 1234m*2. Find the third derivative of f(u) wrt u. 5454 Let k(r) = -5r*3 - 398r*2 + 33r + 19. Let h(f) = 5f3 + 397f*2 - 32f - 18. Let w(l) = -4h(l) - 5k(l). What is the second derivative of w(u) wrt u? 30u + 804 Suppose 3v = 4v - 3. Let k = -17 + 20. Differentiate -3 + lv - k - 6 wrt l. 3l*2 What is the second derivative of 2 + 2 - 24y*4 + 36y + 1 - 50y2 + 8 + 18y*2 wrt y? -288y*2 - 64 Let n(f) = -7f*2 + 10000f - 42201. Let w(k) = -k*2 + 1428k - 6029. Let q(z) = -3n(z) + 22w(z). What is the derivative of q(s) wrt s? -2s + 1416 Let v = 108 + -52. What is the second derivative of 48g*3 - 1 + 57g + 3 - vg - 1 wrt g? 288g Differentiate -312 - 277 - 202 + 319l3 + 1616 - 123 wrt l. 957l*2 Let i(h) = -41h*2 + 2h - 564. Let u(d) = -d*3 - 42d*2 + 3d - 553. Let k(s) = 3i(s) - 2u(s). Differentiate k(y) with respect to y. 6y2 - 78y Let h(g) be the third derivative of -89g6/24 + 19g5/60 - g3 + 886g2. Find the third derivative of h(a) wrt a. -2670 Find the second derivative of 4935r + 3555r + 3156r + 2024r3 wrt r. 12144r Let l(t) = -53t2 - 382t - 4132. Let r(k) = -46k2 - 385k - 4131. Let m(n) = -6l(n) + 7r(n). What is the first derivative of m(v) wrt v? -8v - 403 Find the third derivative of 133b*5 + 34b*3 + 23b*3 + 3247b*2 + 2409b*5 - 55b*3 wrt b. 152520b*2 + 12 Let o(h) be the third derivative of -2873h6/30 + h5/60 - h*4/6 + 241h*3/3 - 9117h*2. Find the third derivative of o(l) wrt l. -68952 What is the first derivative of -594t*4 - 2t + 153t4 + 1740 + 154t*4 wrt t? -1148t*3 - 2 Suppose 90 = 5t + 2i, 0 = -t + 5i + 25 + 20. Suppose 2 - t = -6n. Find the second derivative of -nx*2 - 20x + 6x2 + 0x*2 wrt x. 6 Let t(g) be the second derivative of 208g + 0g2 + 0g*3 - 3/10g*6 + 31/12g*4 - 1/10g*5 + 0. What is the third derivative of t(v) wrt v? -216v - 12 Let b(n) be the first derivative of -1367n2/2 - 967n + 299. Differentiate b(u) wrt u. -1367 Let q(j) = 9222j + 24702. Let a(t) = 3690t + 9882. Let m(c) = 12a(c) - 5q(c). What is the first derivative of m(h) wrt h? -1830 Let m(k) = k + 13. Let l be m(-20). Let b = 9 + l. Find the third derivative of -29v2 + 21v*2 - 15v*b - 3v*6 + 18v*6 wrt v. 1800v*3 Find the third derivative of 252 + 7r*3 + 31r*2 - 11r*5 + 173 - 409 wrt r. -660r*2 + 42 Let r = 36 - 36. Suppose i + i = r. Find the second derivative of 2u*3 - 20u + 9u + iu*2 + 0u*2 wrt u. 12u Let r = -15079 + 180971/12. Let s(o) be the second derivative of 0 - 9o2 + ro*4 - 14o + 0o3. Differentiate s(i) with respect to i. 46i Differentiate 8296k4 + 4501 + 995k*3 - 3215 - 994k*3 + 6406 wrt k. 33184k*3 + 3k*2 Let v(f) be the second derivative of 6655f*4/12 + 2887f*3/6 + 5228f. Find the second derivative of v(s) wrt s. 13310 Let d(u) be the first derivative of 448u7 - u6/3 + 7u*3 + 24u - 1451. Find the third derivative of d(z) wrt z. 376320z3 - 120z*2 Suppose -18 = -5f + 12. What is the third derivative of k*2 - 70k*f + 13k*2 - 66k - 15k2 wrt k? -8400k*3 Differentiate -1300a*4 - 2300a*4 + 2403 + 1968 + 1057a*4 wrt a. -10172a*3 Let p(z) = 2z*2 + 8z. Let u be p(-7). What is the second derivative of -31q + 8q - 43q2 - uq wrt q? -86 Let l(d) = d - 9. Let v(b) = 2239b + 991. Let y(w) = 6l(w) + v(w). Differentiate y(o) wrt o. 2245 Let v(j) = 3j - 8. Suppose -q + 68 = 62. Let z be v(q). What is the first derivative of -50o + 50o + z + 10o*4 wrt o? 40o*3 Let i(j) = -428j*2 + 1223j. Let g(a) = -426a2 + 1214a. Let d(h) = 6g(h) - 7i(h). What is the second derivative of d(l) wrt l? 880 Let n(t) be the third derivative of 5t9/252 + 11t*6/24 - 57t*5 + 3t*2 - 454t. Find the third derivative of n(s) wrt s. 1200s3 + 330 Let k(o) = -72o*3 + 5o*2 - 6o + 7. Let h = -163 + 164. Let q(j) = -j3 + j2 - j + 1. Let u(a) = hk(a) - 6q(a). Differentiate u(g) with respect to g. -198g2 - 2g Find the second derivative of -2457a + 504a*5 + 3 + 1132a*5 - 176a*5 - 3 wrt a. 29200a*3 Let b(n) = 1429n*2 + 19n + 20. Let s(m) = -7146m2 - 118m - 101. Let l(h) = 11b(h) + 2s(h). Find the second derivative of l(u) wrt u. 2854 Suppose -125 = -4q - 109. Find the second derivative of 2oq + o4 - 4552o2 + 4562o*2 - 28o wrt o. 36o2 + 20 Let t(k) = k2 + 5k + 2. Let o be t(-5). Suppose 0 = -26g - 62g + 264. What is the derivative of g - 10 - x*2 - ox + 2x wrt x? -2x Suppose 0 = 74c - 103c + 290. Let g(r) be the first derivative of c + 0r - r2 + 28/3r*3. What is the second derivative of g(s) wrt s? 56 Let j be (2/(-6))/((-5)/4245). Suppose -3y - 2169 = -4a, 269 = a - 4y - j. Find the second derivative of -o - ao4 - o + 537o*4 wrt o. -36o*2 Let b(s) be the second derivative of 4549s*8/56 - 179s4/12 - s3/3 - s*2/2 + 6387s. Find the third derivative of b(h) wrt h. 545880h3 Let i = -209 - -212. Find the third derivative of -i - 126u*5 - 621u*2 + 673u*2 + 3 + 0 wrt u. -7560u*2 Let u(g) be the second derivative of 0g*3 - 90 + 32g*2 + 2g - 46/3g4. Differentiate u(y) wrt y. -368y Let o(b) be the second derivative of -b*8/56 + 181b*7/7 + 7b*4/12 + 4b3/3 + b2 - 45b + 29. Find the third derivative of o(h) wrt h. -120h*3 + 65160h*2 Let q be (55 - (2 + -2))1755/325. What is the derivative of 226p2 + 16p - 16p - 462p*2 - q wrt p? -472p Let r(a) be the third derivative of -67a8/336 + 7a*6/120 + 123a*4/4 + 677a*2. What is the second derivative of r(o) wrt o? -1340o*3 + 42o Let m(x) = x*2 - x + 6. Let r(f) = 12f*2 + 1176f + 3896. Let h(l) = 10m(l) - r(l). What is the derivative of h(k) wrt k? -4k - 1186 Let z(x) be the second derivative of 1337x3/6 + 289x*2 + 1793x. What is the derivative of z(h) wrt h? 1337 Let n(a) be the third derivative of 7a6/30 + 9a4/8 - a3/2 + 8a2 + 10a - 2. Find the second derivative of n(g) wrt g. 168g Let x be 1-26 + (-26)/(-26). Let v(n) = 69n*3 - 4n + 60. Let q(w) = -206w3 + 11w - 178. Let b(j) = xv(j) - 4q(j). Differentiate b(p) wrt p. 195p2 Let g = -15023 + 15023. Let u(t) be the third derivative of 0t*6 - 11/6t*3 + 0t*5 + 0t*4 + 0 + 7t*2 + 11/70t*7 + gt. Differentiate u(c) wrt c. 132c3 Let g(f) = 1423f*4 + 4f*3 - 12f*2 + 457. Let i(o) = 1422o*4 + 3o*3 - 9o*2 + 456. Let n(p) = -3g(p) + 4i(p). Differentiate n(u) with respect to u. 5676u**3
What is eleven halves of a litre in millilitres? 5500 What is 21.521142 months in millennia? 0.0017934285 How many nanometers are there in 4147.454cm? 41474540000 What is 3/5 of a meter in centimeters? 60 How many grams are there in 5138.791 micrograms? 0.005138791 How many hours are there in 11/8 of a day? 33 What is thirty-one fifths of a gram in milligrams? 6200 How many seconds are there in 6/5 of a hour? 4320 Convert 138691.1 centimeters to kilometers. 1.386911 What is fifty-five halves of a millimeter in micrometers? 27500 How many centuries are there in six fifths of a millennium? 12 How many milliseconds are there in 865836.5 weeks? 523657915200000 How many grams are there in 27/2 of a kilogram? 13500 How many micrograms are there in 1/64 of a gram? 15625 How many kilograms are there in 719560.6mg? 0.7195606 How many millilitres are there in 3/5 of a litre? 600 Convert 60905.85um to meters. 0.06090585 What is twenty-five quarters of a millimeter in micrometers? 6250 What is 9/25 of a litre in millilitres? 360 Convert 946.3252 nanometers to micrometers. 0.9463252 What is 6.572837 micrograms in milligrams? 0.006572837 What is 339108.5ml in litres? 339.1085 What is 1/4 of a kilogram in grams? 250 How many kilograms are there in 27/4 of a tonne? 6750 How many milliseconds are there in five quarters of a minute? 75000 What is one quarter of a kilogram in grams? 250 What is 38928.8 decades in months? 4671456 How many milligrams are there in thirty-one halves of a gram? 15500 How many micrometers are there in seven halves of a millimeter? 3500 How many minutes are there in twenty-five eighths of a week? 31500 How many months are there in 2215.834 decades? 265900.08 What is 6/5 of a millennium in years? 1200 What is one fifth of a day in seconds? 17280 Convert 464577.8 centuries to millennia. 46457.78 What is 2.520638m in micrometers? 2520638 What is 5/4 of a hour in minutes? 75 How many nanometers are there in 7.268826 meters? 7268826000 What is twenty ninths of a day in minutes? 3200 Convert 79.54861g to tonnes. 0.00007954861 What is 3/8 of a micrometer in nanometers? 375 Convert 600954.4kg to tonnes. 600.9544 What is twenty-seven quarters of a micrometer in nanometers? 6750 How many millilitres are there in 0.267396l? 267.396 What is seven sixths of a century in months? 1400 How many kilograms are there in 30684.5g? 30.6845 What is 43/2 of a litre in millilitres? 21500 What is 41/2 of a litre in millilitres? 20500 What is seven halves of a millennium in decades? 350 What is 8/21 of a week in hours? 64 How many centuries are there in 66486.09 years? 664.8609 What is 0.6095781kg in milligrams? 609578.1 What is twenty-one fifths of a second in milliseconds? 4200 How many seconds are there in 8/3 of a hour? 9600 How many tonnes are there in 763168.4kg? 763.1684 What is 0.1100217 grams in micrograms? 110021.7 What is eighteen fifths of a kilogram in grams? 3600 How many millilitres are there in 26/5 of a litre? 5200 How many litres are there in 584.7419ml? 0.5847419 Convert 8.402838 years to months. 100.834056 How many months are there in 1/16 of a century? 75 What is 1/5 of a kilometer in meters? 200 Convert 619562.5l to millilitres. 619562500 Convert 49.46227 days to milliseconds. 4273540128 What is 1/72 of a hour in seconds? 50 How many months are there in 33/5 of a century? 7920 How many millimeters are there in 3/40 of a kilometer? 75000 How many months are there in twenty-seven halves of a century? 16200 What is three eighths of a litre in millilitres? 375 What is sixty-three eighths of a millennium in months? 94500 What is 2864.312km in nanometers? 2864312000000000 How many months are there in 1/16 of a century? 75 Convert 2414.881 hours to seconds. 8693571.6 What is fifty-five quarters of a litre in millilitres? 13750 What is 9/10 of a gram in milligrams? 900 What is 73792.55 decades in millennia? 737.9255 How many nanometers are there in twenty-one eighths of a micrometer? 2625 What is 0.391402 millennia in decades? 39.1402 How many minutes are there in 7/16 of a week? 4410 Convert 51051.52ng to kilograms. 0.00000005105152 What is 1/16 of a tonne in grams? 62500 What is 17/2 of a kilometer in meters? 8500 How many milligrams are there in 0.9321688kg? 932168.8 How many seconds are there in three fifths of a minute? 36 What is twenty-one eighths of a hour in seconds? 9450 How many minutes are there in 30/7 of a week? 43200 Convert 7.874021ml to litres. 0.007874021 Convert 1.462975 millilitres to litres. 0.001462975 How many milliseconds are there in nineteen quarters of a second? 4750 What is 4/3 of a week in hours? 224 Convert 0.4759131 minutes to milliseconds. 28554.786 What is 6/5 of a tonne in kilograms? 1200 What is 8.354027 millennia in months? 100248.324 Convert 827.5104 micrometers to meters. 0.0008275104 What is 187.1099 millennia in years? 187109.9 What is 8.2215873s in hours? 0.00228377425 What is 21/4 of a year in months? 63 How many meters are there in 821481.1mm? 821.4811 How many litres are there in 449.7202 millilitres? 0.4497202 How many meters are there in 11/4 of a kilometer? 2750 What is 8/3 of a year in months? 32 How many millimeters are there in eighteen fifths of a meter? 3600 How many months are there in seven sixths of a year? 14 How many minutes are there in 6233.931ms? 0.10389885 What is twenty-five halves of a milligram in micrograms? 12500 What is seven quarters of a century in years? 175 How many milligrams are there in 0.8994839kg? 899483.9 What is thirty-one fifths of a tonne in kilograms? 6200 How many grams are there in 3/40 of a tonne? 75000 What is 0.2559584 minutes in milliseconds? 15357.504 How many seconds are there in two fifteenths of a day? 11520 How many weeks are there in 61.3544652 minutes? 0.0060867525 What is 25/2 of a litre in millilitres? 12500 What is 507103.17 hours in weeks? 3018.47125 What is eighteen fifths of a litre in millilitres? 3600 How many seconds are there in seventy-two fifths of a hour? 51840 How many decades are there in 2.4717687 months? 0.0205980725 What is 175189.8 hours in nanoseconds? 630683280000000000 What is 7/8 of a litre in millilitres? 875 What is 17/7 of a week in days? 17 What is 2879804.4 months in years? 239983.7 How many meters are there in 0.833747um? 0.000000833747 What is 8/25 of a tonne in kilograms? 320 How many millimeters are there in 1/5 of a centimeter? 2 How many hours are there in 987.1544 days? 23691.7056 What is 16/15 of a century in months? 1280 What is 17/4 of a decade in months? 510 How many kilometers are there in 21.06047nm? 0.00000000002106047 How many milliseconds are there in 3/50 of a minute? 3600 What is twenty-seven quarters of a litre in millilitres? 6750 How many decades are there in 1/10 of a century? 1 How many millilitres are there in 3/25 of a litre? 120 What is 3977.049 seconds in minutes? 66.28415 What is nine tenths of a milligram in micrograms? 900 How many kilograms are there in 37.2301 nanograms? 0.0000000000372301 What is 4/3 of a minute in seconds? 80 How many tonnes are there in 3642.959kg? 3.642959 Convert 329099.1 litres to millilitres. 329099100 What is 49/4 of a tonne in kilograms? 12250 How many millilitres are there in 3/8 of a litre? 375 How many months are there in 96.91045 years? 1162.9254 How many minutes are there in 3/40 of a week? 756 What is 3/8 of a century in months? 450 How many months are there in five quarters of a year? 15 What is 25/2 of a tonne in kilograms? 12500 What is 3/8 of a millennium in months? 4500 What is 31/5 of a decade in months? 744 Convert 90.99427l to millilitres. 90994.27 What is 5.511518 minutes in microseconds? 330691080 Convert 12.95816g to micrograms. 12958160 What is 11/2 of a hour in minutes? 330 Convert 0.5975793 minutes to milliseconds. 35854.758 What is 168.3642us in nanoseconds? 168364.2 How many millilitres are there in 8/25 of a litre? 320 How many millilitres are there in eleven halves of a litre? 5500 What is twelve sevenths of a week in minutes? 17280 How many months are there in fifteen quarters of a decade? 450 How many millennia are there in 2.94486 decades? 0.0294486 How many minutes are there in one fifth of a day? 288 How many millilitres are there in 5/8 of a litre? 625 How many millilitres are there in 0.7300693 litres? 730.0693 Convert 1701080.892s to weeks. 2.81263375 How many milliseconds are there in 9338.409 minutes? 560304540 What is twenty-nine thirds of a hour in seconds? 34800 How many litres are there in 3.159571ml? 0.003159571 How many nanoseconds are there in five quarters of a microsecond? 1250
Evaluate -1317 - -1381 - (0 - -12). 52 -122 + (-54 - -86) + 135 45 -11 + 0 + (14 - (8 + 5) - -15) + -8 -3 What is the value of 4 + (9 - (-16 - -5)) + -38 + 52? 38 -110 - -122 - (17 + 38) -43 Evaluate 12 + (-22 + 18 + 13 - 7) + -10. 4 Evaluate -3 + 20 + (-75 - -13). -45 26 + (11 - -3) + -60 + 27 7 Calculate -4 - (0 - (49 - 4) - 21). 62 What is 24 - (-15 - -16 - (1 - -20)) - 1? 43 What is 10 + -5 + 36 + -10 - (73 + -62)? 20 What is (1 + 8 + -8 - 50 - 7) + 0 + 9? -47 Evaluate (-24 + (0 + -3 - -4) - -13) + -4 + -2. -16 Evaluate -30 + -1 - (37 + -15 + 1 - 36). -18 Evaluate -22 + 12 - (5 + 13 + 0). -28 Evaluate -81 + (2 - 1) - 0 - (0 + 0 + -6). -74 (-1 - 10 - (100 + -143)) + 12 44 What is 24 + -5 + -17 - (-6 + 6 + -2)? 4 Calculate (-5 + (-4 - -7) - -2) + (359 - 350). 9 What is 6 - (1 + -11 + 18 - (2 + (7 - 7)))? 0 What is the value of -446 - -435 - (0 + 0 - -3)? -14 (-17 - (5 + -14) - 54) + 13 + (-4 - -4) -49 What is the value of 5 + 5 + 3 - (-2934 + 2983)? -36 What is 6 - (54 + 18 - (6 - 1)) - (46 - 43)? -64 What is the value of -459 - -416 - (-5 - (0 - 4))? -42 Evaluate (-1 + -3 + 5 - -8 - (-88 + 93)) + -62. -58 What is the value of (143 - (47 + 348)) + 129? -123 What is the value of -69 + 1 + (-121 - (-108 + -20))? -61 Evaluate 59 + -86 + 30 - (21 - -6). -24 What is the value of -20 + 10 + 22 + 0 + -4 + 1 - 71? -62 Evaluate (11 + -26 - (11 + -30)) + -18. -14 What is -9 + 1 + (-26 - ((-5 - 20) + 10)) + 79? 60 (-19 - -9) + (1 + -8 - (-131 - -57)) 57 What is 30 - (6 + (18 - 4))? 10 Evaluate -80 + (137 - 32) - -87. 112 What is the value of 11 + -14 + (5 - 4) - (14 + -39)? 23 Evaluate -29 + (-3 - 6) + 0 + 5 + -8. -41 What is (0 - (-12 - (24 + -23))) + -67 - (-10 + 0)? -44 Calculate (-14 - 65) + 114 + -5. 30 Evaluate (13 - (12 + -27)) + (-1 - (4 - -4)). 19 What is the value of -21 + 38 + -28 + -35? -46 0 - 116 - ((33 - 48) + -7 + -4 + 14) -104 Evaluate (-97 - (-3 - -17)) + 150. 39 What is the value of 265 + -318 - (61 + 5)? -119 (-1 - (-86 + 57)) + 2 30 Calculate -345 + 329 - (-3 + (20 - -1)). -34 Calculate 170 + -187 - ((-81 - 12) + 7). 69 Evaluate 44 + -30 + (25 - 6). 33 18 + (-200 - -87) + -2 -97 -40 - ((-3 - -21) + 15) -73 Evaluate -105 + (12 + 5 - ((10 - -3 - 9) + 10)). -102 What is the value of (2 - 5) + -4 - 31 - (17 + (-1 - 8))? -46 What is the value of -10 - (16 - ((17 - (22 + -15)) + 26))? 10 What is -10 - -2 - (5 + (12 + -29 - -25))? -21 What is the value of (-4 - -1) + 24 - (-8 - (-8 - 13) - 26)? 34 What is the value of (1 - -14 - 7) + 9 + 30? 47 What is -56 + (184 - 43) + -12? 73 What is the value of (-60 - -33) + (-18 - 0)? -45 Evaluate 55 + (-52 + 27 - 1). 29 -1770 + 1765 - (-19 - (3 + 5 + -3 + -6)) 13 369 + -416 - (-5 + -13) -29 Evaluate 34 + -8 + 34 + -12 + -12. 36 What is the value of 1 - -59 - (-5922 + 5964)? 18 What is the value of (353 - 361) + (0 - 9) + -123? -140 Evaluate -179 + 62 + -16 + 51. -82 What is the value of -54 - -96 - (-10 + 4 + 14)? 34 Evaluate 43 + -63 + (43 - 9). 14 -81 - ((8 + 14 - 18) + -22) - (1 - 14) -50 Evaluate -61 - (12 + -22 - (-3 + -8)). -62 What is -43 + (24 - (36 - 58)) + 99? 102 What is the value of -52 + (82 - 59) - (0 + -11)? -18 (0 + (-4 - (-5 + 13)) - (-4 - 0)) + -45 -53 Evaluate (89 - 49 - -22) + 31. 93 Calculate -18 - (-1 + 0) - ((-189 - -153) + -1 + 29). -9 Evaluate -12 + (-2 - (-15 + -12 + 31)). -18 Evaluate -2 - (16 + -91 + 84 + (0 - 46)). 35 What is the value of -3 + 3 + -13 + (-101 - -103) - (-1 + 35)? -45 -10 + 2 + 12 + (115 - 109) 10 What is the value of 3 + (6 - 14 - -16) - (-22 + -12 + -13)? 58 Evaluate (-11 - 1) + 6344 + -6405. -73 Calculate 18 - (13 - (2 - -47) - -25). 29 Evaluate 3 - 11 - ((26 - 0) + (96 - 109)). -21 Evaluate 91 - 99 - (-3 + 32). -37 What is the value of 81 + -105 + 115 + -22 + 7? 76 Calculate 19 + (-11 + 17 - 24) + -2. -1 What is the value of -15 + -2 + 30 + -582 + 612? 43 Evaluate 55 + (0 - 62) + -44. -51 Evaluate 36 + -29 + (-79 + 7 - 7) - 2. -74 Evaluate -7 + 16 + -3 - (-14 - (-2 + -64)). -46 Evaluate -5 - (-32 - (13 + (2 - 8)) - 5 - -9). 30 What is the value of (3 + -6 - 114) + (-59 - -62) + -13? -127 Evaluate -14 + 31 + 0 + -23. -6 6 + (-11 - -66 - 143) -82 Evaluate -272 + 114 + (-22 - -96). -84 Evaluate (-3 - -12 - -9 - -7) + 19. 44 -4 - (11 + (-7 - (15 + -5 + 1))) 3 Calculate 13 - -191 - 216 - (0 + 3 - -7). -22 What is the value of -9 + 2 + (0 - 2) + (-239 - -48 - -177)? -23 Evaluate -1 - 3 - -1 - (23 - (8 + 16) - 1). -1 What is 192 + -172 + (3 - 27) - (-1 + 70)? -73 What is (-220 - -233) + (1 - 2) + -1 + 0 + -47? -36 What is (-38 - -112) + -91 + 59 + 0? 42 Evaluate (17 - 16 - 3) + -2 + 22 - (51 + -44). 11 -212 + (290 + -7 - 148) -77 -173 + 179 + (-1 - -14) - 34 -15 Calculate 0 + 20 + (695 - 729) + 52. 38 (49 - -14 - 53) + -2 + -8 - 23 -23 Calculate (2 + 21 - 3) + -3 - 21. -4 Calculate (31 - 2) + (104 - 132). 1 (13 - (0 - -3) - 5) + (-74 - -2 - -34) -33 What is the value of 21 - (8 - 14) - 36? -9 What is the value of -2 + (3 + -4 - -7) + 140 + -58 + -80? 6 What is (-30 - 1) + (-354 - -393)? 8 What is the value of (-1 - (32 - 2)) + (-30 - -26) + -9? -44 -179 + 174 + -1 + 41 + (-7 - -4) 32 What is the value of 6 + 1 + (26 - 0 - (368 - 322))? -13 What is -34 + -642 + 622 + (7 - (4 + -2) - -1)? -48 What is the value of 12 - (-8 - ((-24 - 2) + 17)) - 101? -90 Calculate 0 - 0 - -20 - (483 - 249 - 291). 77 (-61 - (43 + 0)) + 37 -67 Evaluate -101 - -26 - -31 - -23. -21 What is the value of 11 - (-11 + -4 - (-12 - 0)) - -61? 75 What is 12 - (-37 - -5 - (36 - 63))? 17 What is the value of -79 + 254 + -116 + -15? 44 (2 - -1 - (33 + 1)) + 130 + -195 + 65 -31 -4 - 25 - (4 + -1 + -21 - -14) -25 What is the value of -18 - (7 - -1 - 12) - 22? -36 4 + -5 + 16 - (7 + (-38 - 11)) 57 Evaluate -6 - (26 - (16 + -11) - 3). -24 Calculate -42 - (-29 + -84 + 93 - (-21 - -1)). -42 Evaluate 10 + -5 + -7 + (6 + 14 - 14) + -16. -12 What is the value of (-16 - (-50 + -5)) + -3 + 30? 66 What is the value of -67 + 1 + (-19 - (-41 - (-10 - 10)))? -64 Calculate ((-17 + 5 - 9) + 5 - -25) + -68. -59 What is the value of -331 + 866 + -404 + -33 + 0? 98 106 + (192 - 193) + (-8 - -2) + 2 101 Calculate (-6 - -3 - (-4 + -9 - 4)) + -81. -67 What is the value of (-1969 - -1915) + 19 + -1 - -127? 91 Evaluate (0 - (-5 + (1 - -1))) + (580 - 617). -34 What is the value of -1 + -5 + 9 + -28 - (-158 + 144)? -11 What is (-52 - -1) + (28 + -81 + 20 + 6 - -32)? -46 What is the value of (37 - -76 - 33) + -1? 79 23 + 1 + (7 - 6) + -10 + -14 + 10 11 Calculate -2 - (-18 - (-3 + 2) - (50 - 99 - -38)). 4 What is the value of -1 + -14 + (-1256 - -1183)? -88 What is 0 - -35 - ((166 - 61) + -2)? -68 What is the value of 7 - (47 - (-13 + -11 + 18))? -46 Calculate -15 + -32 + 46 + 19 - 58. -40 Evaluate (0 - -1) + -36 - (-9795 - -9798). -38 What is the value of 21 - (-3 - (-25 - -2) - 20)? 21 -38 + (120 + -98 - -87) 71 Evaluate -4 + 2 + 7 + (-11 - -12) - (108 - 59). -43 Calculate -5 + 7 + -8 + (-7 - (-13 - -12)) - -23. 11 81 + -91 + (-3 - (6 + -3)) + 68 52 (11 - 5 - (-17 - -8)) + 9 24 20 + (3 + 5 + (11 - 17) - -11) 33 Evaluate -95 - (3 + -14 - 39). -45 What is the value of 4 - (12 + -17 + (39 - 19))? -11 What is -30 + 63 - (4 + 6)? 23 Calculate (-12 - (4 - 2)) + 19 + (-65 - -21). -39 What is the value of -50 + (1 - -15) + 32? -2 Evaluate -511 + 523 - (6 + -11). 17 Evaluate 44 + -5 - (73 + -29) - -37. 32 What is -9194 + 9309 + -2 + -37? 76 Evaluate -37 + -50 + 91 + (-3 - 40). -39 What is 4541 + -4541 + 12 + (-5 + 2 - -2)? 11 -336 + 309 + 72 + -11 34 What is the value of (-43 + 12 - -9) + (0 + 5 - (-4 + 15))? -28 Evaluate 12 + (-13 - -5 - (4 - (66 - 0))) - -9. 75 2778 + -2691 + -90 + 2 -1 Calculate 12 - (1 + (2 - 77) - (8960 + -8954)). 92 What is the value of -1 + 22 + (-62 - (15 + -62))? 6 Evaluate -17 + -45 + 69 - -37. 44 Evaluate (-2 - -11 - (-5 - (-8 + 4))) + -51 - -4. -37 What is the value of 18 - 0 - (2 + 66 + -106)? 56 What is the value of -2 + 1 - (-13 + 8 - -34 - 5)? -25 -91 + (-98 - -170) - (0 + -32) 13 What is the value of -124 - (-18 + -24) - 9? -91 What is the value of (-16 - (3 - -12)) + 15 - (-17 - -11)? -10 Evaluate -13 - (43 + 40 + -37 - 128). 69 Calculate 144 + (-85 - -56) - 42. 73 Calculate -86 - (78 - (-42 + 299)). 93 What is 25 + ((-14 - -13) + -1 + -3 - 0)? 20 Evaluate 4 - (-287 - -303 - (45 - 1)) - (4 - -2). 26 Calculate (3 - -68) + (-207 - -145). 9 Calculate 32 + -121 - (-61 + 4). -32 What is 39 - (5 - (-41 + 21 - -27))? 41 Calculate -68 + 7 + -1 + -5 + (13 - (-16 + 37)). -75 Calculate 35 + -61 + 45 + -114 + -3 + (0 - -3). -95 What is the value of 6 + -8 - (0 + 2 + -3) - (-74 + 62)? 11 5 + (-53 - (-28 + -17)) -3 Calculate (-8 + 66 - 117) + 121. 62 Calculate (-10 - (-11 + 6 - -6)) + 5 - (84 - 84). -6
Suppose -3r = -4s - 72, -2r = 8s - 3s + 67. Let z = s - -22. Solve w = -z + 5 for w. -2 Suppose -30 = -4s + u, -5u + 0 = -2s + 6. Let z = 10 - s. Solve -3g - zg = -20 for g. 4 Let k be 23/5 - 60/100. Solve 5r + 9 = -kr for r. -1 Let d = -49 + 51. Let l be -110(-2)/4. Suppose -12 + d = -lc. Solve -cy + 0y - 8 = 0 for y. -4 Let u(c) = 11c*2 - 19c - 20. Let l(w) = -5w2 + 9w + 10. Let t(k) = 9l(k) + 4u(k). Let n be t(6). Solve -ng + 2 = 18 for g. -4 Let a be (0/(-2))/((-1)/(-4 - -3)). Suppose 4h + 16 + 8 = -5s, -5h + 4 = 2s. Let w be (s/(-10))/((-1)/(-5)). Solve a = -wn + 10 + 2 for n. 3 Suppose 4g = 2g + 44. Let l = g - 20. Suppose 3i - c + 3c - 18 = 0, li = -3c + 17. Solve -3a = -ia + 1 for a. 1 Let s be (-9)/(-12) - (-308)/16. Solve -3g = 7g + s for g. -2 Let y(q) = q*2 + q + 37 - 27 - 3q*2. Let x be y(-2). Solve x = m - 6 + 1 for m. 5 Suppose 0 = -10m + 8 + 12. Let o(n) = n*3 + 3n*2 - 5n - 2. Let y be o(-4). Solve 0 = mx + yx for x. 0 Let u be 3 + -6 + 1 + 6. Let v(z) = -z*3 + 8z*2 - 3z + 8. Let n(p) = -p*2 - p - 1. Let f(s) = -3n(s) - v(s). Let i be f(u). Solve -20 = ig + g for g. -5 Let d(q) = 3q + 5. Let c be d(4). Let v = 31 + -31. Suppose v = -r - 5j + 26, 4 = 4r + 2j - 10. Solve -4h - c = -r for h. -4 Suppose 28a - 250 + 54 = 0. Solve al - 6l + 3 = 0 for l. -3 Let f be 42/2 - (2 - 1). Suppose -f = -5u + 5, -3m - 2u + 16 = 0. Let o(p) = p*2 - 2p + 3. Let h be o(m). Solve -hl - 2l = 0 for l. 0 Let c(k) = -k*3 - 4k*2 + 3k - 8. Let m = 25 + -30. Let p be c(m). Solve pb = 7b - 20 for b. 4 Let x(i) = -3i + 104. Let l be x(0). Let f = -102 + l. Solve 0 = 3w + 8 - f for w. -2 Let u(x) = -x*3 - 6x*2 + 3x - 24. Let p be u(-7). Solve -pi + 9 = 5i for i. 1 Let h be (-2)/(3 + (2 - 3)). Let i(t) be the second derivative of t*3/6 + 3t*2/2 + 9t. Let r be i(h). Solve -r + 0 = -o for o. 2 Let i(t) = t + 14. Let s be i(-11). Suppose l - 5 = -sm - 0l, 5m - 5 = -l. Solve m = -d - 0d for d. 0 Suppose -3n = 4p - 4n + 66, 6 = 3n. Let k be 24/p(-24)/9. Solve -ki + 3i + 3 = 0 for i. 3 Let g(l) = -l3 + 5l*2 + 7l - 3. Let t be g(6). Let m = t - 1. Suppose 0 = -4k - 5x + 3, -5x = 4k - 3x - 6. Solve kq - 3q = m for q. -2 Let x = 87 + -52. Suppose 0 = -3z - 3i - i + 35, 2i = -5z + x. Let d(p) = 2p*3 - 9p*2 - 6p + 12. Let l be d(5). Solve 27 - l = -zk for k. -4 Let b be (-3)/24 - (-6)/48. Solve b = -0o + 6o - 6 for o. 1 Let y = -566 - -582. Solve -y = 5u - 21 for u. 1 Let o(n) = -n*2 + 4n - 2. Let k be 5 + 1(1 - 4). Let y be o(k). Suppose -5m + 39 = 4. Solve l - m = -y for l. 5 Let p(b) = b*2 - 8b + 1. Let h(j) = -j*3 + 6j*2 - 2j - 7. Let z be h(5). Let o be p(z). Solve -o = -q - 0 for q. 1 Suppose -b - b + 8 = 0. Suppose 3k = 3c + 41 - 14, -bk = c - 46. Suppose -j + k = -0z + 3z, -z + 7 = j. Solve -g - z = -0 for g. -2 Suppose 5q - 53 - 267 = 0. Suppose 4m = -q + 72. Solve -mk + k = -1 for k. 1 Let w = -2 - -2. Let b be ((-2)/(-6))/(5/1125). Suppose 100 = 5z + b. Solve w = -zs - 13 - 12 for s. -5 Let q(r) = 2r2 + 30r - 126. Let g be q(4). Solve 34 + g = 15k for k. 4 Let p be (-15)/3 - -4 - -39. Suppose -4k + p = 5s, -s - 3s - 4k = -32. Solve -st = -t + 5 for t. -1 Let v(m) = m*2 + m. Let y be v(1). Let b = y + 0. Suppose -bd + 10 = -d. Solve -9z + 4z + d = 0 for z. 2 Suppose 4q + 3t - 5t - 218 = 0, 4q = t + 217. Let b be (1/(-3))/((-9)/q). Solve ba + 0a = -2 for a. -1 Let f(i) = i*2 + 9i + 16. Let d be f(-8). Suppose dc = 5c + 12. Solve 0t = t - c for t. 4 Let t(h) = -h2 + 8h + 7. Let z be 2/((-4)/(-22)) + -3 + 0. Let b be t(z). Solve 0 = 4x + 5 + b for x. -3 Suppose -5z + 0r = -2r + 24, z + 4r = 4. Let d = 0 - z. Solve -4v + 8 = -d for v. 3 Let m = -332 + 336. Solve m - 14 = 5p for p. -2 Suppose 0 = -4x + 5h + 164, -3x - 4h + 71 = -83. Solve 51i - xi - 10 = 0 for i. 2 Let b be 86/282 + 12/(-84). Let d(a) = 4a - 5. Let g be d(2). Solve -gk = -0k - b for k. 2 Suppose 5t + 2i - 18 = 0, -i + 1 = -t - 1. Let w be (0 - -1)-1 - -6. Suppose n - 2j - 8 = 0, 0n + wj + 19 = 2n. Solve -n = 4o + t for o. -1 Suppose 3a - 39 = -4p - 0a, 2a - 22 = -2p. Solve pm - 3m = 12 for m. 4 Let a = -12 - -2. Suppose 3l - 5l + 24 = 0. Let y = l + a. Solve yx = -x for x. 0 Let b be (-1 - 3) + (-16)/(-1). Suppose 0 = -5w - 7 + b. Solve -2s + w = -3s for s. -1 Let q(w) = w*3 - 8w*2 + w - 6. Let r be q(8). Let b be -8 + 12 - 14/2. Let f be r(b + 7/2). Solve -2s - f - 3 = 0 for s. -2 Let t(n) = 16n - 1106. Let u be t(70). Solve 9m + 32 - u = 0 for m. -2 Suppose 2h = 4j - 66, 2h + 2h + 116 = 4j. Let d be 20/h + 48/10. Solve -d - 4 = -2b for b. 4 Let w(u) = 0u*2 - u + 4 - 3u*3 - 5u - 6u2 + 5u. Let d(g) = g3 + g2 - g. Let c(z) = 2d(z) + w(z). Let s be c(-3). Solve 5y - 14 + s = 0 for y. 2 Let l(j) be the third derivative of -j4/8 + j3/6 - 6j2. Suppose 5p + 15 = -5. Let n be l(p). Solve -n = 4r - 1 for r. -3 Let k(v) = v2 + 14v - 34. Let f be k(-17). Suppose i + 4m = f, 0 = -3m - m + 16. Solve 2u + 5 = -i for u. -3 Let t be ((-20)/(-8))/((-10)/(-24)). Suppose 2p - 27 = -v, -p - 8 = -2p + 5v. Solve -px + 16x = -t for x. -2 Let z be -1 - 3 - (15/(-1) - -7). Solve zt + 4 = -0t for t. -1 Let x = -254 - -254. Solve a + 4 - 8 = x for a. 4 Let i be ((-36)/14)/((-8)/6729). Suppose 6p + 12 = i. Solve -3y = -y - p for y. 1 Let h be (-37)/(-5) - 62/(-20). Solve 11s + 9 = hs for s. -3 Let l = -172 - -173. Solve 0 = -2v + 11 - l for v. 5 Let r be 2/(-9) - 695/(-9). Solve -l - r = -74 for l. -3 Let r = -240 - -311. Solve -64a = -ra + 7 for a. 1 Let b = -935 + 937. Solve -6k = 22 + b for k. -4 Suppose -27 = -14b + 141. Solve b = r + 7 for r. 5 Let b be 15/(-2)104/(-39). Solve -6q + b = -10q for q. -5 Let c(k) = -5k3 - k2 + 1. Let w(y) = 16y*3 + 4y*2 - y - 3. Let b(g) = -7c(g) - 2w(g). Let z be b(1). Solve 0l = zl for l. 0 Let a(j) = -1 + 50j + j*2 - 50j. Let u be a(-3). Suppose 7 - 2 = -5f + 5y, -u = -2y. Solve -f + 1 = n for n. -2 Let c(o) = -3o + 21 + 7o - o. Let z be 224/162/(-4). Let y be c(z). Solve -4x = -yx - 8 for x. 2 Let z = -369 + 377. Solve zq - 10 + 2 = 0 for q. 1 Suppose 6 + 3 = 2z + 3d, 5d + 5 = 0. Solve 4f = z - 14 for f. -2 Let c = 65 + -60. Let v be -9(-2)/(-12)2 + c. Solve 0z + 6 = vz for z. 3 Suppose 10 = 69h - 64h. Solve -h + 2 = -4u for u. 0 Let p(c) = -2c2 + c2 + 21 - 5c + 20c. Let z be p(16). Solve zo + 0o + 20 = 0 for o. -4 Let y(x) = 3x*2 + 11x + 5. Let c(j) = j*2 - j + 1. Let p(u) = 2c(u) - y(u). Let m be p(-12). Solve 0 = -2d + 7 - m for d. -1 Let g(n) = -n3 - 3n*2 + 5n + 8. Let v be g(-4). Solve -18 = -vk - 2 for k. 4 Suppose 0 = 10u - 12u. Suppose i = -6i + 28. Solve -in + 9n = u for n. 0 Suppose -5h + 72 = -0a + a, 0 = 5h - 4a - 87. Let l be ((-26)/39)/((-2)/h). Solve -m - 2 = -l for m. 3 Let a = -653 - -664. Solve -au = -3u - 32 for u. 4 Let j = -2243 + 2253. Solve 0 = -3i + 4 - j for i. -2 Let g be ((-12)/2)/(-164 - -162). Let s = -21 + 43. Suppose 0 = -2r - 2 + s. Solve gj - r = -2j for j. 2 Suppose 9 = -2r + 19. Let x be -6 - (2 + (-3 - -4)). Let w be (-6)/(-9) - 129/x. Solve 0j - rj = -w for j. 3 Let a(l) = l3 + 11l*2 + 24l + 5. Let w be a(-8). Suppose -14 = -5z - 4. Solve -w = -zk + k for k. 5 Suppose 2 = -h + y - 5, 25 = 5y. Let x(f) = -5 - f - 4f - f. Let k be x(h). Solve 0 = kn - 5n + 4 for n. -2 Let t(p) = 14 - 3p3 - 6p*2 + 8p + p*2 + 2p3. Let j be t(-6). Solve 0 = f + j - 1 for f. -1 Let g(t) be the third derivative of -t6/40 - t4/12 - t3/3 - 18t2. Let s be g(-1). Solve si + 2i = -5 for i. -1 Let n(l) = l2 + 13l + 64. Let f be n(-5). Solve 0 = -q - 7q + f for q. 3 Suppose -313 = 2p - 323. Solve -pi - 26 + 6 = 0 for i. -4 Let a(b) = b3 + 5b*2 - 9b - 9. Let d = 10 - 16. Let h be a(d). Let j be h + (3 - 0) + 2. Solve 0 = -4s - j - 2 for s. -4 Let b be 8 + -2 + (-28)/7. Suppose 4r = 6r - b. Solve v + 5 = r for v. -4 Suppose -52p = -355 - 165. Solve 6r - p - 2 = 0 for r. 2 Let k(r) be the second derivative of -r3/6 + 3r*2 - 8r. Let x be k(3). Suppose xi + 3p = 24, -p + 2p = -2i + 21. Solve -4f - 7 = i for f. -5 Suppose -36d - 12d = -1008. Solve 16 - d = -b for b. 5 Let x = 12 - 9. Let f = -33 - -37. Solve -xo - 1 = -fo for o. 1 Suppose -6g - 5g + 330 = 0. Solve g = -b + 7b for b. 5
Let s(j) = j*2 - j. Suppose 3m = 22 + 5. Suppose z + 7 - m = 0. Let d(p) = p3 + p2 - p. Determine zd(t) - 2s(t). 2t3 Let f(g) = -52g*2. Let k(l) = 51l*2. Calculate -2f(u) - 3k(u). -49u*2 Let a(o) = -4o + 5. Let d(c) = -2c + 2. What is 2a(i) - 5d(i)? 2i Let f(s) = -2s - 12. Suppose -4q = -5i - 3q + 4, 0 = 2q - 2. Let g(j) be the third derivative of -j3/6 + 2j*2. Determine if(h) - 12g(h). -2h Let h(t) be the second derivative of -t*4/12 + t. Let r(f) = 0f*3 + 2f*3 - 5f*2 + 2f*2. Calculate 4h(i) - r(i). -2i3 - i2 Let a(y) = -12y - 4. Let b(g) = -11g - 3. Give -4a(w) + 5b(w). -7w + 1 Let c(o) = 1. Let y(n) be the third derivative of -n5/30 - n4/12 + 5n3/6 + n2. Give 6c(t) - y(t). 2t2 + 2t + 1 Let l(y) = 1 + 4y + 3y2 - y2 - 3y2. Let j(z) = z2 - 3z - 8. Let h(f) = f*2 - 3f - 7. Let t(p) = 7h(p) - 6j(p). Give -4l(n) - 6t(n). -2n2 + 2n + 2 Let h be -4 + 1(0 + -2). Let n(s) = -4s - 2. Let c = -29 + 24. Let f(q) be the first derivative of 5q2/2 + 2q - 1. Give cf(t) + hn(t). -t + 2 Let o(i) = 7i3 - 10i*2 - 7. Let n(h) = -6h*3 + 9h*2 + 6. Calculate -5n(s) - 4o(s). 2s*3 - 5s*2 - 2 Suppose 0 = 5w - 3m + 6, -3w + 4m = -3. Let f(g) = -6g*3 + 10g*2 + 6g - 4. Let a(h) = 2h3 - 3h*2 - 2h + 1. What is wf(y) - 10a(y)? -2y3 + 2y + 2 Let x(c) = 9c3 + 17c*2 - 23c - 29. Let o(v) = -3v3 - 6v*2 + 8v + 10. Determine -17o(z) - 6x(z). -3z3 + 2z + 4 Let f(h) = -h*2. Let s(q) = 4q*2 - 3q + 2. Let p(l) = 5f(l) + s(l). Let i(o) = -4o*2 - 10o + 7. What is 4i(y) - 14p(y)? -2y2 + 2y Suppose 0 = 5l - 33 + 13. Suppose -2o = -6o + 24. Let m(d) = 8d + 3 - 6d2 + 5d*3 + od*2 - 14. Let u(b) = -2b*3 - 3b + 4. Give lm(i) + 11u(i). -2i3 - i Let g = -1 - -3. Let c(f) = 2f*3 - 2f*2 - 1. Let q = 0 + -2. Let k be (-3)/q8/(-12). Let m(l) = -l*2 - 1. Calculate gm(n) + kc(n). -2n*3 - 1 Let k(x) = -1. Let m(u) = -6u*2 - u - 1. Let y(i) = -13i*2 - 3i - 1. Let l(a) = 9m(a) - 4y(a). What is -3k(n) + l(n)? -2n*2 + 3n - 2 Let o(k) = k*2 - k. Let t(i) = -3i*2 + 6i + 1. Calculate 6o(l) + t(l). 3l*2 + 1 Let c be (-1 - 114/3)-3. Let r(g) = 12g*2. Let o(k) = 4k*2. What is co(p) - 6r(p)? -4p*2 Let u(g) be the second derivative of 0 + g + 5/6g*3 + 0g*2. Let p(o) = 14o. Calculate 6p(c) - 17u(c). -c Let j(v) = 2v. Let b(o) = -18o. Determine 6b(c) + 52j(c). -4c Let q(c) = -26c*3 + 17c*2 + 8c - 23. Let s(r) = -9r3 + 6r*2 + 3r - 8. What is -6q(v) + 17s(v)? 3v3 + 3v + 2 Let z(n) = 9n2 + 9n - 5. Let c be (19 + -7)1/2. Let b(h) = -8h*2 - 8h + 4. Calculate cz(k) + 7b(k). -2k2 - 2k - 2 Let w(k) = 21k3 - 63k*2 + 63k. Let t(o) = -o*2 + o. Determine -126t(f) + 2w(f). 42f*3 Let f(g) = -17g - 14. Suppose 2q - 12 = 3p, -5p + 4p = 5q + 4. Let y(o) = 6o + 5. Determine pf(u) - 11y(u). 2u + 1 Let m(b) = -3b*3 - 4b*2 - 6b + 6. Let o(x) = 4x3 - 2x + 2x2 + 2x + 7x - 7 + 3x*2. What is 5m(v) + 4o(v)? v3 - 2v + 2 Let d(q) = -q*2. Suppose 0l = -2l + 3c + 17, 3l - 24 = 4c. Suppose 0 = -lr + 12. Let w(x) = 0x*2 - 2x*r + 5x*2 + 0x*3. Give 5d(g) + w(g). -2g3 Let g = -2 + -20. Let l(b) = -b + 1. Let h(d) = -12d + 10. Calculate gl(x) + 2h(x). -2x - 2 Let x(m) = -3m*2 + 3m - 1. Let h(p) = p*2 - p + 1. Suppose 2r - 1 + 3 = 0. What is rx(o) - 2h(o)? o*2 - o - 1 Let l(y) = -5y + 4. Let c(p) = 9p - 7. Suppose 0z + z - 4i + 13 = 0, -z - 2i = -17. Suppose 2t = 3t - z. Let s = 7 - 3. Determine sc(x) + tl(x). x Let d(x) = x - 2. Let i = -16 + 8. Let q(h) = 2h - 6. Give id(o) + 3q(o). -2o - 2 Let f(l) = 31l + 6. Let a(r) = r + 1. What is 5a(g) - f(g)? -26g - 1 Let j(x) = -9x*2 - 4x + 4. Let m(q) = -8q2 - 3q + 3. Calculate 3j(h) - 4m(h). 5h2 Let o = -7 - 0. Let y(c) = 3c - 1. Let f(r) = -16r + 3. Let m(n) = 31n - 6. Let g(h) = -11f(h) - 6m(h). Give oy(t) - 2g(t). -t + 1 Let g(u) = 2u3 + 4u - 1. Let v(x) = x. Let b(p) = -p*3 + 5p*2 - 5p + 10. Let y be b(4). Calculate yv(c) - g(c). -2c*3 + 2c + 1 Let r(x) = -5x2 + x + 5. Let y(k) = -1 + 17k - 16k + 0k*2 + 5 - 4k*2. Determine -3r(s) + 4y(s). -s2 + s + 1 Let c(h) = -2h + 1. Let j(i) = 3 - 6 - 5 + 7. Let w(y) = -y + 7. Let q be w(5). Let n be 5 - 2 - 2/1. Calculate nc(k) + qj(k). -2k - 1 Let w(p) = -p + 8. Let k(m) = 4. Give 5k(x) - 2w(x). 2x + 4 Let i(q) = 4q3 + 3q*2 + 2. Let p(d) = 9 + 3d*3 + 2d*3 + 12d*3 + 13d*2 - d. Determine -9i(w) + 2p(w). -2w3 - w2 - 2w Let q(m) = 12m*3 + 3m*2 + 4m + 4. Let w(k) = 24k3 + 6k*2 + 7k + 7. Determine -7q(v) + 4w(v). 12v3 + 3v*2 Let y(f) = -f + 1. Let r(n) = -6 + 4n - 2 + 4. Determine -2r(w) - 6y(w). -2w + 2 Let q(f) = -30f*2 + 3. Let n(x) = 1. What is -2n(c) + q(c)? -30c2 + 1 Let y(t) = -8t - 11t - 14t + 34t. Let u(d) = -d3 + 5d + 1. Suppose 1 = -2w + 11. Calculate wy(r) - u(r). r*3 - 1 Let v(s) = 12s. Let i(f) = -59f. Give -2i(m) - 11v(m). -14m Let s(v) = -2v2 - 2v. Let g(w) = -w*3 - 8w*2 - 9w + 1. Calculate 2g(y) - 9s(y). -2y3 + 2y*2 + 2 Let r(o) = -13o*2 - o + 1. Let q = 0 - -4. Let d(y) = 49 + qy*2 - 49. Calculate -7d(h) - 2r(h). -2h*2 + 2h - 2 Let f(b) = 9b - 2. Let j(p) = -31p + 7. Let d(x) = 7f(x) + 2j(x). Let q = 4 + 1. Let v = 2 + -1. Let c(w) = -7w - 2. Give qd(o) + vc(o). -2o - 2 Suppose -13 = 2w + 3r, 0r - 4r = -3w + 23. Suppose w = -f - 1. Let q(j) = j3 - j2 + j - 1. Let y(k) = -k2 + k - 1. Determine fq(t) + 2y(t). -2t*3 Suppose -5o + 2 + 38 = 0. Let j(d) = d - 3d - d + o + 0d. Let z(x) = x - 3. Calculate -4j(a) - 11z(a). a + 1 Let n(t) = t. Suppose d + 8 = -3y, -6d + 2d - 5y - 4 = 0. Suppose -do + 15 = -o. Let s be ((-2)/4 + 2)-2. Let w(q) = q. Give on(k) + sw(k). 2k Let j(h) = -h2 + 2h. Suppose -d + 9 = 4b, 30 - 8 = 5d - 3b. Let u(c) = 2c*2 - 5c. What is dj(l) + 2u(l)? -l*2 Let c(z) = -z. Let n = 30 + -30. Let u(d) = nd - 4d + 0d + 3d. Let y = 1 + -6. Give yu(j) + 6c(j). -j Let v(p) = p. Let r = -2 + 0. Suppose -13u + 8 = -9u. Let x(d) = -u - 1 + 5. Determine rv(s) + x(s). -2s + 2 Let z be (-135)/(-117) + (-4)/26. Let v(m) = 4m2 - 1. Let a(u) = -u2 + 1. Determine zv(j) + a(j). 3j*2 Let c(w) = -2w*3 - 7w*2 + w - 5. Let i be c(-4). Let x(q) = 9q - 11. Let r(j) = 4j - 5. Calculate ir(n) - 3x(n). n - 2 Let g(z) = -2z*2 + 5z + 8. Let s(l) = -l. Calculate -g(w) - 6s(w). 2w2 + w - 8 Let y = -21 - -31. Let m = 7 - y. Let g(x) = x3 - x2 + 5. Let w(c) = c3 - c*2 + 6. Suppose 4 = u - 0u. Give mw(f) + ug(f). f3 - f2 + 2 Let g(t) = 3t2 + 13t - 4. Let y(i) = -4i2 + 6i*2 + 9i - 13 + 10. Determine 5g(j) - 7y(j). j*2 + 2j + 1 Let z(q) = 5q2 - 11. Let g(v) = 3v*2 + 2. Let p(y) = -7y*2 - 4. Let b(x) = -9g(x) - 4p(x). What is -11b(w) + 2z(w)? -w2 Let l(y) be the first derivative of y2/2 + y - 3. Let o(x) = -x2 + x. What is l(c) - 2o(c)? 2c2 - c + 1 Let b(a) = -a2 - a - 1. Let r(o) = -7o*2 - 2o + 5. Determine 2b(y) - r(y). 5y*2 - 7 Let n(a) = -3a*3 - 7a*2 + 6a - 4. Let c(j) = 5j3 + 13j*2 - 11j + 7. What is 6c(k) + 11n(k)? -3k3 + k2 - 2 Let h(c) = 7c*2 - 3c - 1. Let b(d) = -d*3 - 5d*2 - 3. Let z be b(-5). Let o(l) = 13l*2 - 5l - 2. What is zo(j) + 5h(j)? -4j2 + 1 Let j(y) = y - 2. Let o(t) = -6t + 14. Let r(f) = -6f + 15. Let c(u) = -5o(u) + 4r(u). What is -3c(q) + 16j(q)? -2q - 2 Let g(o) = 2o2 - o - 3. Let s(y) = -y2. Determine -g(n) - 4s(n). 2n2 + n + 3 Let w(g) = 2g + 7. Let u(b) = -1. Let d(p) = -3u(p) - w(p). Let k(m) = -2m - 5. Suppose -4t + 5o + 5 + 5 = 0, -6 = -2t + 2o. Calculate tk(y) - 6d(y). 2y - 1 Let a(f) = 2f2 - f + 5. Let w(r) be the second derivative of -r4/12 - r*2/2 + 11r. What is a(g) + 4w(g)? -2g*2 - g + 1 Let t(f) be the first derivative of 5f3/3 - f2 + 3f - 20. Let b = 6 - 2. Let w(r) = -11r*2 + 4r - 7. Calculate bw(i) + 9t(i). i*2 - 2i - 1 Let o(y) = 3y - 11. Let h(p) = -p + 4. Calculate 8h(w) + 3o(w). w - 1 Let l(y) = -17y*2 - 2. Let f(m) = 6m*2 + 1. Calculate 8f(q) + 3l(q). -3q*2 + 2 Let a(v) = -9v*2 + 7v - 6. Let d(q) = -q*2 + q - 1. Give a(c) - 6d(c). -3c2 + c Let r(g) be the first derivative of g3/3 - g2/2 + g + 1. Let v = 22 + -19. Let y be 2/(-1)(v + -4). Let l(d) = 2d - 2. Give yr(p) + l(p). 2p*2
Let h(o) = 4o2 - 50o + 6. What is h(13)? 32 Let l(s) = -s*2 + 17s - 67. Give l(8). 5 Let j(o) = 3o2 + 14o - 98. What is j(4)? 6 Let y(g) = 3g3 - 63g*2 + 3g - 53. Determine y(21). 10 Let y(v) = v*2 - 16v + 29. Calculate y(4). -19 Let g(a) = -12a - 10. Calculate g(-1). 2 Let q(l) = -l2 - 13l - 1. Calculate q(-8). 39 Let l(w) = 2w + 49. Determine l(-22). 5 Let m(h) = -4h*3 + 31h*2 + 12h - 23. Give m(8). 9 Let r(p) = -2p2 - 3p - 5. Give r(-4). -25 Let p(m) = -m*3 - 7m*2 + 11m + 36. What is p(-8)? 12 Let a(t) = t*2 + 10t + 13. What is a(-7)? -8 Let k(x) = x + 57. Give k(0). 57 Let u(g) = -g*2 - 4g + 6. Calculate u(-5). 1 Let a(j) = -2j2 + 20j + 15. Give a(11). -7 Let a(y) = -5y2 - 25y + 11. Give a(-5). 11 Let c(s) = s2 - 4. Calculate c(5). 21 Let b(z) = -z - 11. Calculate b(5). -16 Let j(b) = b3 + 6b2 + 3b - 10. Give j(-5). 0 Let u(v) = v*3 + 6v2 + 21. Give u(-6). 21 Let x(s) = -s3 - 80s2 + 164s - 1. What is x(-82)? -1 Let p(y) = 4y - 5. Calculate p(8). 27 Let b(f) = f2 + 9f - 110. Determine b(7). 2 Let w(r) = -r - 13. Give w(12). -25 Let a(z) = z + 9. Determine a(-6). 3 Let o(y) = -y*2 - 4y - 19. Calculate o(-5). -24 Let f(r) = -r*2 + 14r - 15. Calculate f(12). 9 Let y(q) = q + 22. Give y(15). 37 Let b(s) = -s*2 - 17. Calculate b(0). -17 Let f(n) = -5n + 9. Give f(-6). 39 Let y(a) = -a*3 - 4a2 + a + 1. What is y(-4)? -3 Let j(p) = p2 - 5p - 48. Calculate j(10). 2 Let i(o) = 89o - 2. What is i(-1)? -91 Let g(n) = -n*2 + 25n + 60. Determine g(27). 6 Let h(w) = w*2 + 2w - 4. Give h(2). 4 Let d(k) = -k*3 - 3k*2 - 5k - 4. What is d(-4)? 32 Let h(n) = 14n3 + n2 + n. Determine h(-1). -14 Let c(f) = f3 + 9f*2 + 3f + 15. Calculate c(-9). -12 Let l(i) = -i*2 - 50i - 26. What is l(0)? -26 Let s(k) = -3k2 - 84k - 83. Determine s(-27). -2 Let n(p) = -2p - 10. Give n(20). -50 Let v(z) = -2z*2 - 47z + 18. Calculate v(-24). -6 Let o(l) = -2l3 + 4l*2 - 1. Calculate o(3). -19 Let z(g) = -2g*2 + 2g - 3. Give z(2). -7 Let v(r) = r*2 - 6r. Give v(8). 16 Let a(j) = -j*3 - 4j*2 + 16j + 45. What is a(-5)? -10 Let l(o) = -o*2 - 22o + 2. Give l(-16). 98 Let u(h) = 3h3 - h2 + 3h - 2. What is u(1)? 3 Let g(p) = 2p + 12. Give g(3). 18 Let z(d) = -d3 + 20d*2 + 22d - 28. Give z(21). -7 Let u(x) = x + 22. What is u(-24)? -2 Let f(q) = q - 16. Determine f(-11). -27 Let u(i) = i*3 - 23i*2 - 110i + 46. Calculate u(27). -8 Let s(r) = -2r2 + 19r - 1. Give s(11). -34 Let v(y) = 2y - 7. Calculate v(4). 1 Let o(i) = i2 + 3. What is o(4)? 19 Let g(v) = -v2 - 10v - 7. Calculate g(-9). 2 Let y(l) = l*2 + 14l - 49. What is y(3)? 2 Let b(m) = -m*2 - 9m - 11. What is b(-7)? 3 Let s(h) = 5h + 142. Determine s(-28). 2 Let i(b) = b3 + 11b*2 + 9b - 15. Calculate i(-10). -5 Let z(g) = -g + 7. Calculate z(4). 3 Let l(t) = -t*3 + 21t*2 - 4t + 80. What is l(21)? -4 Let v(l) = l - 10. Calculate v(5). -5 Let h(a) = -a*3 + 5a*2 + 5a - 5. Determine h(5). 20 Let k(y) = y - 11. Determine k(13). 2 Let r(a) = a*2 + 14a - 23. Determine r(2). 9 Let r(x) = -16x - 2. Calculate r(1). -18 Let f(s) = -s3 - 10s*2 + 3s - 9. Determine f(-10). -39 Let d(i) = -i*3 - 9i*2 - 9i - 28. Give d(-8). -20 Let f(d) = -d*3 - 3d*2 + 6d + 4. What is f(-4)? -4 Let q(u) = u*3 - 51u*2 - 52u - 4. What is q(52)? -4 Let t(k) = k*2 + 10k + 21. Calculate t(-15). 96 Let b(w) = w*3 + 13w*2 + 11w - 11. Give b(-12). 1 Let h(s) = -s - 44. Calculate h(-17). -27 Let b(z) = z*2 + 9z - 4. Calculate b(-8). -12 Let i(h) = h*3 - 14h*2 - 2h + 20. What is i(14)? -8 Let f(m) = -2m + 67. Calculate f(31). 5 Let q(u) = -u2 + u + 21. Give q(6). -9 Let i(x) = 3x. Give i(-4). -12 Let q(z) = z*2 - 9z - 2. Determine q(8). -10 Let z(t) = -t*2 + 9t + 4. Determine z(9). 4 Let p(z) = z + 3. Calculate p(4). 7 Let j(g) = 39g - 1. What is j(-1)? -40 Let s(n) = n2 + 12n + 37. Determine s(-8). 5 Let w(m) = 6m + 33. Determine w(-7). -9 Let d(r) = -r2 + 5r - 3. Give d(4). 1 Let q(y) = 3y + 23. What is q(-12)? -13 Let c(b) = b2 + 114. Give c(0). 114 Let o(u) = u2 + 10u + 12. Determine o(-6). -12 Let d(u) = -u*3 + 10u*2 - 9u. What is d(6)? 90 Let f(x) = -2x - 2. Determine f(-8). 14 Let v(y) = -y3 - 11y*2 - 16y - 23. Calculate v(-10). 37 Let s(n) = n*3 + 5n*2 + 2n - 27. Determine s(-6). -75 Let x(a) = 42a - 28. What is x(-3)? -154 Let p(o) = -5o + 7. What is p(1)? 2 Let u(r) = -r*2 - 15r - 38. Give u(-11). 6 Let r(d) = -d3 - d2 + 9d + 16. Determine r(-3). 7 Let u(q) = -q3 - 22q*2 - 22q - 17. Calculate u(-21). 4 Let q(b) = b*3 + 15b*2 - 2b - 37. Calculate q(-15). -7 Let j(l) = 2l2 + 9l - 9. Calculate j(-7). 26 Let l(u) = 2u. Determine l(14). 28 Let p(s) = -s3 - 4s2 + 2. Determine p(-3). -7 Let m(d) = -d3 + 16d2 - 29d + 9. Determine m(14). -5 Let u(z) = -5z - 19. What is u(-6)? 11 Let j(v) = 17v + 934. What is j(-55)? -1 Let c(a) = a*3 - 5a*2 - 7a + 4. Calculate c(6). -2 Let r(d) = -d*3 - 4d*2 - 5d - 10. Calculate r(-3). -4 Let s(m) = -m*2 + 19m - 17. Calculate s(19). -17 Let m(l) = 14l - 7. Calculate m(-4). -63 Let u(m) = 3m*2 - 16m. What is u(5)? -5 Let g(f) = 43f - 505. What is g(12)? 11 Let q(x) = x - 104. Determine q(0). -104 Let k(z) = 8z + 6. What is k(5)? 46 Let u(r) = -2r - 11. What is u(3)? -17 Let x(p) = p3 + 8p*2 + 5p - 5. Determine x(-7). 9 Let d(k) = k*2 - 6k. Calculate d(4). -8 Let s(z) = -z*3 + 7z*2 - 2z - 6. Give s(6). 18 Let u(q) = 2q - 1. Determine u(5). 9 Let l(d) = d3 + 15d*2 + 57d + 18. Determine l(-6). 0 Let h(y) = -y*3 - 19y*2 - 18y + 4. Determine h(-18). 4 Let j(m) = -m*2 - 16m. Determine j(-14). 28 Let h(j) = -4j + 73. What is h(21)? -11 Let x(i) = -4i + 1. Determine x(7). -27 Let g(d) = -d. Give g(-1). 1 Let z(t) = t*2 - 22t - 20. Calculate z(23). 3 Let f(j) = 2j2 + 7j. Determine f(-5). 15 Let d(o) = -5o2 - 6o - 7. Give d(5). -162 Let w(z) = -z3 + z2 + 10z + 3. Give w(4). -5 Let z(c) = -c2 - 3c + 2. Determine z(-7). -26 Let j(o) = o*2 - 5o - 11. What is j(5)? -11 Let q(l) = -3l3 + 7l*2 + 8l - 3. What is q(-3)? 117 Let h(j) = -j*3 + 6j*2 - 13j + 12. Calculate h(2). 2 Let y(k) = -k*2 - 17k + 14. What is y(-18)? -4 Let l(a) = -a*3 + 12a*2 - 4a - 59. Calculate l(11). 18 Let a(b) = -6b - 9. What is a(-4)? 15 Let z(a) = 117a*2 - 4a + 2. Calculate z(1). 115 Let w(s) = -s*3 + 6s*2 - 3s + 1. Give w(5). 11 Let m(a) = a*3 + 3a*2 - 4a + 3. Calculate m(-4). 3 Let v(i) = -i*3 + 37i*2 + 2i - 19. Determine v(37). 55 Let y(f) = -f*2 - 64f + 1375. Calculate y(-81). -2 Let u(y) = -y*3 + 14y*2 - 13y - 18. What is u(13)? -18 Let u(m) = m*3 - 4m*2 + 5m - 3. Determine u(3). 3 Let b(i) = -17i + 23. Calculate b(2). -11 Let v(r) = 24r + 95. Give v(-5). -25 Let z(a) = 3a2 - 27a + 60. What is z(5)? 0 Let z(l) = l*3 - 4l*2 - 1. What is z(2)? -9 Let d(n) = 3n*2 + 8n + 7. Determine d(3). 58 Let x(a) = 2a - 8. Give x(0). -8 Let l(w) = 4w - 142. Calculate l(32). -14 Let s(b) = -b*2 + 24b - 29. What is s(12)? 115 Let o(n) = 2n3 + 8n*2 + 15n + 33. What is o(-3)? 6 Let v(d) = 6d - 1. What is v(4)? 23 Let u(t) = t + 26. What is u(-40)? -14 Let i(y) = -y - 14. Calculate i(-7). -7 Let h(f) = -9f - 14. Determine h(-3). 13 Let n(w) = -13w + 45. Calculate n(2). 19 Let l(o) = 6o + 85. Calculate l(-15). -5 Let t(h) = h*3 - 13h*2 + 19h - 10. Calculate t(11). -43 Let k(x) = x*3 - 22x*2 - 51x + 79. Determine k(24). 7 Let h(q) = q*3 + 5q*2 - 2q - 23. Calculate h(-5). -13 Let n(d) = -d*3 - 6d*2 + 8d - 5. What is n(-6)? -53 Let m(h) = h*3 - 9h*2 + 7h + 12. What is m(8)? 4 Let p(a) = -a*3 + 18a*2 - 81a - 8. Determine p(9). -8 Let w(j) = -8j - 290. What is w(-37)? 6 Let j(t) = 2t3 - 4. Give j(-2). -20 Let o(f) = f3 + 6f2 - 6f - 14. What is o(-6)? 22 Let i(y) = y*2 - 16y - 5. Give i(15). -20 Let g(s) = -s*2 - 10s - 19. Determine g(-8). -3 Let g(n) = -10n3 + n. What is g(-1)? 9 Let r(g) = 4g - 32. What is r(15)? 28 Let v(d) = d + 28. Give v(-16). 12 Let b(r) = -3r + 3. Calculate b(4). -9 Let r(z) = -z + 2. Determine r(-2). 4 Let k(l) = -6l - 24. Give k(-4). 0 Let i(f) = f*2 - 13f - 36. What is i(19)? 78 Let j(i) = 3i + 15. What is j(-10)? -15 Let h(g) = -11g - 18. What is h(-2)? 4 Let c(t) = t*2 - 32t + 78. Give c(30). 18 Let u(z) = -z*3 - 20z*2 + 24z + 51. What is u(-21)? -12 Let h(q) = -3q + 166. Calculate h(52). 10 Let k(o) = o2 - 18o + 47. Calculate k(15). 2 Let k(z) = z*3 - 9z*2 + 10z - 11. Give k(8). 5
Solve 4l + 14d - 350 = 0, 723d - 718d = 2l + 125 for l. 0 Solve 5l - 40 = -5k, 4k - 6l + 5051 - 5073 = 0 for k. 7 Solve -b + 7u - 45 = -6b + 10u, 0 = -4u + 8u for b. 9 Solve -5z = -5w + 55, 498w - 4z - 9 = 501w for w. 5 Solve -310v + 307v - 4t = -2, 5v + 55 = 5t for v. -6 Solve -5b + 5v = 60, -2b - 179v - 10 = -174v for b. -10 Solve -4p - 5m + 8 = 0, -3m - 3618 = -5p - 3608 for p. 2 Solve -4t = 4h + 8, 2h + 11 + 17 = 2t + 12 for h. -5 Solve 0 = -4k - 3u - 103 + 77, 3k + 28 = 2u for k. -8 Solve -2x + 4d = 12, 2x + 5d - 496 = -481 for x. 0 Solve 5s = 3j + 50, 4j = 990s - 985s - 55 for j. -5 Solve -251 + 243 = 3f + 4u, 4u = -5f - 24 for f. -8 Solve f = 9p - 33, -5p + 5f = 147 - 192 for p. 3 Solve -2s + 5l + 15 = 0, 0 = -3l + 26 - 35 for s. 0 Solve -139 + 177 = 2f - 5j, 22 = 4f - j for f. 4 Solve -4x + 11 = -w, x = 5w - 89 + 87 for x. 3 Solve g + 41 - 49 = -5p, 5p - 5g + 10 = 0 for p. 1 Solve -7l + k = 56, -268 + 232 = -5l - 2k for l. -4 Solve 5r - 1264g + 1262g = -14, 2r + 16 = 6g for r. -2 Solve 0 = -2o + 25c - 10, -1295o - 3c = -1290o + 25 for o. -5 Solve -8 = -4q - i, -731q + 3i - 3 = -736q for q. 3 Solve -4 = 30o - 35o + 21, -5o = w - 29 for w. 4 Solve 0 = 3n + 165 - 168, 16n + 0n = -5s - 4 for s. -4 Solve -7k + 2w = -8, -9k = 2w + 14 - 38 for k. 2 Solve 5c - 2d = 7, 220c - 3d - 6 = 217c for c. 1 Solve -5b - 5k = 0, -2b - 3 = b + 2k for b. -3 Solve x = 5l - 664 + 690, -2x + 42 = -8l for x. 1 Solve 4y + 3f - 32 = 0, 4f + 4175 = 3y + 4201 for y. 2 Solve -29a = 5c - 16a + 4, -5c + 0a + 44 = -3a for c. 7 Solve 365o = 360o - 3a - 16, 0 = -2o + 4a + 4 for o. -2 Solve 0 = -o + n + 9989 - 9996, -4n + 12 = 0 for o. -4 Solve -2r + 5u + 30 = 0, -42033u + 42037u = 5r - 24 for r. 0 Solve -10j - 242 = -7u, j + 5u + 152 - 105 = 0 for j. -27 Solve n = -5a + 5, -4n - 17 = 3a - 20 for a. 1 Solve -2h + 3u + 62 - 36 = 0, 3u - 2u = -2 for h. 10 Solve -21 = m - 4m + 3z, -7m = -3z - 41 for m. 5 Solve 4i - 16 = 4d, 2032i + 13 = -2d + 2035i for d. 1 Solve -5o + c = -20, 4o - 5c + 11 = 69 for o. 2 Solve -12 = 2i, 4n - i = 14 - 0 for n. 2 Solve 0 = -5v - 5i - 30, -v - 44i = -38i + 21 for v. -3 Solve -930o - 3d - 5 + 2 = -927o, -4o - d + 2 = 0 for o. 1 Solve 4m - 2o + 8 = 0, -198o + 39 = 3m - 195o for m. 3 Solve 86s + 1 = -2n + 91s, -5n + 4s = -23 for n. 7 Solve -21m = 2c - 72 - 4, -2c - 28 = -5m for m. 4 Solve 0j - 2u - 12 = -4j, 0 = -4j - 5u + 12 for j. 3 Solve 0 = -5h + 4k - 44, k = 543 - 537 for h. -4 Solve -5m + r = 20, 1039m - 4r = 1042m + 12 for m. -4 Solve 4v - x = 10, -x + 6 = 24v - 20v for v. 2 Solve 0v = 5v - 15, 36v = -5i + 33v - 1 for i. -2 Solve 0 = -2j + 4y - 90 + 60, 5y = -j + 20 for j. -5 Solve l + 6 = -5n, 4n - 43 = 11l - 95 for l. 4 Solve 0 = 2t + 4s + 40, 2t - 64352s + 64357s + 45 = 0 for t. -10 Solve -665p + 660p - 5h = 60, 5p + 4h = -56 for p. -8 Solve 5o - w = 20, -36o + 2w = -34o - 8 for o. 4 Solve -2p = -2, 20i + 4p - 2 = 202 for i. 10 Solve 1 = -3i - 2u + 7u, 15u - 164 = -134 for i. 3 Solve -6q - 39 = 3a, 3a + 4 = -821q + 822q for a. -3 Solve 2y + 3j + 4 = 0, 0 = -43y + 39y - 3j + 4 for y. 4 Solve 0 = 2o + 5n + 41, 24849o - 63 = 24855o + 3n for o. -8 Solve 2i = -12d + 42, 0 = -4i - 884d + 881d for i. -3 Solve -5b - 13n = -142, 86 - 112 = 2b - 4n for b. 5 Solve -3g - 4a + 29 = 0, 0 = -5g + 516a - 511a - 10 for g. 3 Solve 2w - 732y + 47 = -737y, -5y + 8 = -3w for w. -11 Solve -5g + 2d + 39 = 0, -5g + 2g - 2d = -17 for g. 7 Solve -4j + 2k + 18 + 16 = 0, j - 5k = 31 for j. 6 Solve -9u - 55 = -4p - 4u, -774p = -776p + 4u + 32 for p. 10 Solve -3b - 89 = -29s + 34s, 0 = b + 6 - 3 for s. -16 Solve -2o = 4b - 4, -2o + 653 - 649 = 0 for b. 0 Solve i + 4o - 30 = -20, 3i = 3o for i. 2 Solve -4s = 2b + 8, 2s + 12b + 4 = 16b for s. -2 Solve -3p = 2t + 10, -52172p - t = -52173p - 5 for p. -4 Solve -r + 6r = 5j - 50, -3r = -6j + 45 for j. 5 Solve 53h = -7j + 48h + 33, 2j = -4h + 12 for j. 4 Solve 5u + 3b - 46 = 0, 20758u = 20763u - 2b - 11 for u. 5 Solve 4a + 81f - 145 = 96f, 5a = -3f - 58 for a. -5 Solve -3s - 12 = 0, -5f + 6s - 3s = -62 for f. 10 Solve 2k - 25 = 5n, -341k - 165 = -341k + 55n for k. 5 Solve 3 = d, 8802w - 8801w + 4d - 16 = 0 for w. 4 Solve t - 1 - 9 = -2q, 0 = 2q - 6t - 10 for q. 5 Solve -v + 5x - 19 = 0, -4v - 91x + 88x = 7 for v. -4 Solve -2x - 2 = -3m, 11x - 9x - 22 = -3m for x. 5 Solve 4x + 2g = -12, -4 = -5982g + 5984g for x. -2 Solve -15n - 43 = -4k - 8n, 0 = -3k + 5n + 31 for k. 2 Solve -6m - 8 = -5o, -4m = 8o - 4o + 20 for m. -3 Solve 3l + 3 = 0, -l + 4l = 3p + 12 for p. -5 Solve -15 = w - 4c, -56 + 81 = 7w - 2c for w. 5 Solve 3v + 9f = -33, 19f - 6f - 12f - 11 = -4v for v. 4 Solve 0 = m + 2, 11k - 2m - 94 + 128 = 3m for k. -4 Solve 1257j + 2l = 1256j - 1, -4l - 4 = 0 for j. 1 Solve -r + 3d = -13, 10r - 5d = 13r + 31 for r. -2 Solve 17h = 16h - 4n + 45, 4h = 5n - 72 for h. -3 Solve w - 61 = 239c - 236c, -41 = 3c + 4w for c. -19 Solve -4w - 20 = 7l - 3l, -8w = 5l + 25 for l. -5 Solve -2s - 261 = 4z - 175, 4s + 4z + 156 = 0 for s. -35 Solve 9y - 5y + 10 = -2t, -t - 9 = 3y for y. -4 Solve 178n - 183n = 3u - 6, -u = 4n - 2 for u. 2 Solve 4 = 6y + 2q, -15y + 2 = -16y + q for y. 0 Solve -27y = -5f + 71, -10 = -315f + 320f for y. -3 Solve 4s + 13 = 5d, 114s - 124s + 3d = 23 for s. -2 Solve -3i + d = -78 + 81, -5i + 23 = 3d for i. 1 Solve -5g = 36j - 34j - 33, -4g + 5j = 0 for g. 5 Solve 0 = 29i - 34i - 20, v + 6v - 2i + 13 = 0 for v. -3 Solve h - 2 = q, 4q = 2q - 3h - 4 for q. -2 Solve -5w - 29 = 5n - 74, 2w = -n + 18 for n. 0 Solve -3j + 3l + 8 = 2j, 0 = -52j + 2l - 36 + 236 for j. 4 Solve 57q - 117q + 57q - 15 = 0, i - q = 4 for i. -1 Solve 2q = 2d - 4, -642q + 646q + 2 = d for q. 0 Solve 114h - 119h = -2r - 44, 5h = 5r + 50 for r. -2 Solve 2y = 4z + 16 + 4, -3y = -z for z. -6 Solve -2a + 32 = -0p - 9p, 0 = -5a + 3p + 41 for a. 7 Solve 3a - 9 = -3m, 0 = -16m + 18a - 19a - 12 for m. -1 Solve 2t - 10 - 11 = 5w, -2t - 16w = 42 for t. 3 Solve 3y - 30r = -33r - 3, 0 = 4y + 3r + 8 for y. -5 Solve 7861l + 5m + 85 = 7856l, 0 = -3l + 2m - 46 for l. -16 Solve 811 = -5a + 5z + 866, 0 = 2z + 18 for a. 2 Solve -2f + w - 222 = -208, 0 = -3f + 5w - 56 for f. -2 Solve 3l = j + 2, 4l - 8 + 1 = -3j for j. 1 Solve -3l - 31 = v, 3v + 4l + 1352 = 1274 for v. -22 Solve -2w + 149 - 137 = -3d, 2d = -2w - 18 for d. -6 Solve -4g - 4w = 20, 0 = g - w + 2 + 5 for g. -6 Solve 5y = t + 7, 203t = 198t + 15 for y. 2 Solve -4b + 2q + 22 = 0, -3b - 214q = -217q - 18 for b. 5 Solve v = 4w - 18, 3w + w + 5 = 5w for v. 2 Solve -5z + 3r = -41, -3z + 2r - 23 = 7r for z. 4 Solve -54w + 51w + 2t = 39, -3t = 31w + 332 for w. -11 Solve 25n - 38 = -76i + 73i, -4i = -4n + 24 for n. 2 Solve -4j - 49 = -w, 5w = -5j - 2w - 53 for j. -12 Solve 1075u = 1075u - 2y + 1 + 9, 12 = -u + 3y for u. 3 Solve t - n = -5, -7t - 31n = -26n + 11 for t. -3 Solve -3d + 117 = k + 120, 0 = -4k - 2d + 18 for k. 6 Solve 0 = 3c, -4f + 75c = 79c + 36 for f. -9 Solve f - t = 1, -2f - 11 = 4t - 19 for f. 2 Solve -3k - 3x + 24 = 0, 47x = 51x - 20 for k. 3 Solve 46s + 16 = -2f + 48s, 4f = -2s + 40 for f. 4 Solve 6 = -2h + 2f, 27h = 29h - 4f + 14 for h. 1 Solve -9u + 54 = 4p, p - 2u = 679 - 674 for p. 9 Solve -169z + 167z = b - 35, 4b - 4z = -88 for b. -3 Solve 8g = -3d + 7d + 7g, 0 = 11d + g for d. 0 Solve 9 = -15p + 19p + 2u + 25, 20 = -10u for p. -3 Solve 13 = 3z + 4c, 866z - 2c = 863z - 11 for z. -1 Solve 3y + 5o - 48 = 0, 165 = -5y - o + 223 for y. 11 Solve 0k + 3k = 5d - 39, -2k - 13 = d for k. -8 Solve -14 = r - f, 5r - 2 = 9802f - 9803f for r. -2 Solve 5x - 53l = -57l - 25, 2x + 3l + 17 = 0 for x. -1 Solve 8 = -10s - 4l, 0 = -3s + 5l - 4l + 2 for s. 0 Solve -4t + 9t - 9g + 26 = 0, -5t - 5g = -30 for t. 2 Solve -4c - 5o = 11, -2072o + 2075o = 3 for c. -4 Solve -a + 7 = -156i + 151i, -3a + i - 7 = 0 for a. -3 Solve -3k = 5w + 9, -2k - 153 + 142 = 5w for k. 2 Solve -3y + 4d = -1, -76d + 75d = 11y + 59 for y. -5 Solve -15 = 5l, 5i - 2l - 27 + 14 = -6l for i. 5 Solve -2 = i + 3, -4a + 1 + 12 = 3i for a. 7
Solve 2684b = 55094 + 156942 for b. 79 Solve 0 = 1705b - 1755b + 711b + 79981 for b. -121 Solve -42u = 175u - 29u - 10u + 15664 for u. -88 Solve 170w - 3139 = 97w for w. 43 Solve 0 = 6897m + 1053m - 1077m - 108973 + 19624 for m. 13 Solve 260g - 11160 = 52g - 257g for g. 24 Solve 154t = -182t + 295t + 492 for t. 12 Solve 0 = -923b - 1080b + 264396 for b. 132 Solve 203r - 92r - 403r - 53622 = 370r for r. -81 Solve -262o - 61024 + 52378 = 0 for o. -33 Solve -27v - 7v + 237 - 3144 = 23v for v. -51 Solve 78d + 1029 = -38d + 312 - 907 for d. -14 Solve 3646 = 143b - 358 for b. 28 Solve 54j + 25820 + 3022 = -573j for j. -46 Solve -26602r + 2214693 = -5810r - 571435 for r. 134 Solve 39491 = 2613l - 7543 for l. 18 Solve 31z + 1372 - 599 + 795 = -18z for z. -32 Solve 1245 - 376 = 66u + 216 - 2185 for u. 43 Solve 1492b - 71768 - 2716 - 23988 = 0 for b. 66 Solve -582i + 150i - 1144 = 34729 + 18127 for i. -125 Solve -2942263r + 2942119r - 5904 = 0 for r. -41 Solve 0 = -407n + 453n - 2852 for n. 62 Solve -75637 + 153297 = -8729i + 3396i - 135660 for i. -40 Solve 144272 = 4134q + 462590 for q. -77 Solve 2110q - 2164q + 726 + 300 = 0 for q. 19 Solve 35y - 1292668 = -1292493 for y. 5 Solve 1401k = -1425k + 77458 + 38144 + 42654 for k. 56 Solve 1825r - 3757r = -1858r + 6882 for r. -93 Solve 437j = 1488j - 43091 for j. 41 Solve 1063k - 16450 + 5967 - 39372 = 4358 for k. 51 Solve -1544 = 37x - 118x + 1939 for x. 43 Solve -73f - 420f = 2533f + 344964 for f. -114 Solve -219d - 188d - 9724 = -7d + 348d for d. -13 Solve -32g - 311 - 397 = -4 for g. -22 Solve -920 = -1313343l + 1313320l for l. 40 Solve -1503u - 3128u + 78098 + 3880 = -70845 for u. 33 Solve 0 = 135s + 15s + 66s + 5400 for s. -25 Solve -7995 = -11829j + 98466 for j. 9 Solve 0 = -106f + 43f + 59 - 2264 for f. -35 Solve -933z = 30681 - 30618 + 39462 + 31383 for z. -76 Solve 8209t + 4353 - 14898 = 8098t for t. 95 Solve -14458 = -968s + 222s - 4760 for s. 13 Solve -60960 = -1948r - 452r - 2227r + 26953 for r. 19 Solve 395t + 127t + 6843 + 13515 = 0 for t. -39 Solve -662h + 2894 = 122h + 41310 for h. -49 Solve -524r - 4956 + 25258 = -1427 - 6567 for r. 54 Solve 281v = 19v - 134v + 5868 + 11160 for v. 43 Solve -22428 + 19128 = 27l + 48l for l. -44 Solve 80b = 2765 - 1611 + 2766 for b. 49 Solve 79c - 121c - 337c + 8245 = -9568 for c. 47 Solve -28d + 2558 = -3d + 52d - 984 for d. 46 Solve -171o + 73o = 3685 - 843 for o. -29 Solve -5521w + 16015w + 871002 = 0 for w. -83 Solve 294k + 7k = -60k - 75k - 8284 for k. -19 Solve 1171 - 294 = -86z + 8z - 137 for z. -13 Solve -4497 + 46175 = 5954y for y. 7 Solve -40z - 673 = 565 + 202 for z. -36 Solve 126633s = 125476s - 38181 for s. -33 Solve -183 = 33550t - 34040t + 307 for t. 1 Solve 36w + 102w = -33w + 5301 for w. 31 Solve -10892v + 1504v - 478788 = 0 for v. -51 Solve 10275g + 152465 = -94135 for g. -24 Solve -415j + 171j = -208j + 540 for j. -15 Solve 7702g - 101247 - 457025 = -1021g for g. 64 Solve -1012w - 29669 = 34087 for w. -63 Solve -415 + 695 = -252h - 443 - 285 for h. -4 Solve 393b + 481b + 21684 = -14150 for b. -41 Solve 42m + 9360 - 17631 = -9111 for m. -20 Solve 205280 = -171055t + 173621t for t. 80 Solve 124x + 1538x - 358678 = -283x - 793x for x. 131 Solve 0 = -675r + 23r - 588r - 16120 for r. -13 Solve -1071r = -688r + 1083r - 63038 for r. 43 Solve 18270j - 6112j - 6089j - 6187j = 0 for j. 0 Solve 74031 = 979i + 902i + 2553 for i. 38 Solve 78x - 1187 + 131 - 620 = 820 for x. 32 Solve -1034969p = -1035012p - 2150 for p. -50 Solve 39h = 257 + 1102 + 1092 - 384 for h. 53 Solve 90z - 7698 = 6408 - 2046 for z. 134 Solve -168i + 101135 = 106511 for i. -32 Solve 5p + 6 + 44 = 24p - 21p for p. -25 Solve 0 = 633s + 15705 + 20011 + 21039 - 16876 for s. -63 Solve -3857t = -2098t - 1993t + 23634 for t. 101 Solve -60429 = 6h - 1706h + 4858 + 24813 for h. 53 Solve 83v - 23115 - 12414 - 10137 = -691v for v. 59 Solve 12900 - 64631 = -1390x - 21826 + 49325 for x. 57 Solve -674h + 4712 + 6537 = 1630 - 491 for h. 15 Solve 39k - 44k + 50k + 598 = 58 for k. -12 Solve -1192u - 2200 = 1173u - 2446u + 392 for u. 32 Solve 229l + 1025l = 454l - 1344l + 64320 for l. 30 Solve 73y - 7y + 3388 = -61y - 4867 for y. -65 Solve -19073x = -1250841 - 694605 for x. 102 Solve 364928 - 364616 = -8i for i. -39 Solve 1853p + 99409 - 36630 = -1639p - 66425 for p. -37 Solve -834421 = 8836h + 7492h + 161587 for h. -61 Solve 125s + 73s - 1691s = 702s - 96580 for s. 44 Solve -3331c - 2268c - 71224 - 9766 = 70183 for c. -27 Solve -236m + 40736 = -77m + 47732 for m. -44 Solve -173q + 4860 = 40q + 273q for q. 10 Solve 81a - 1063 = -63a + 95a + 799 for a. 38 Solve -273g + 1417g = 37752 for g. 33 Solve -395h + 116033 = 1299h - 136373 for h. 149 Solve 40b + 8787 - 5097 = -42b for b. -45 Solve 130i = 24i - 65i - 69i for i. 0 Solve -23220 + 24405 = 79r for r. 15 Solve -120548s + 26220 = -120985s for s. -60 Solve -1710c + 270c - 1081c - 224369 = 0 for c. -89 Solve -98694c - 3383 + 2041 = -98814c + 9218 for c. 88 Solve -853 - 862 = 48o + 157 for o. -39 Solve -1970 = 3927278n - 3927475n for n. 10 Solve -197s - 28964 = -20887 for s. -41 Solve 7491 = -241n + 19436 + 16493 for n. 118 Solve 0 = 1446m + 9186m + 414648 for m. -39 Solve -1174l + 1836l = 1537 - 16763 for l. -23 Solve 5297w = 8092w - 374530 for w. 134 Solve -98w + 1100 = -139w + 63w for w. 50 Solve -28699 - 21902 = -739k + 1868 for k. 71 Solve -185y + 728865 - 738115 = 0 for y. -50 Solve -735868g + 10212 = -736090g for g. -46 Solve 7645d = 5902d - 10458 for d. -6 Solve 633w - 426w - 9004 = 3002 for w. 58 Solve 0 = 25s + 61132 - 60907 for s. -9 Solve 3213w = 9420w - 199433 - 566846 + 170407 for w. 96 Solve -10u - 540u = -241u + 34608 for u. -112 Solve 6987z = 7059z + 3816 for z. -53 Solve 342t + 233t = -366t - 91277 for t. -97 Solve 457h - 899h - 572 = -464h for h. 26 Solve 383i + 8254 + 7199 = 50i - 4860 for i. -61 Solve 41v + 3233 = -38v + 18v for v. -53 Solve 1177m - 115383 + 227429 = -1918m - 154124 for m. -86 Solve -1390924 + 538134 = -11874g + 38697g + 2124563 for g. -111 Solve 1525415 - 1526314 = 31t for t. -29 Solve -33a + 3a - 13a = -5370 + 2102 for a. 76 Solve -156t + 1231 - 1387 = 0 for t. -1 Solve -417g = 16514 + 7677 - 2507 for g. -52 Solve -43a = 933a - 105a + 11637 - 31670 for a. 23 Solve 5287 - 5267 = -2v for v. -10 Solve 1650f - 607f + 267447 = -1306f - 2184f for f. -59 Solve 202d - 732 = -254d + 517d for d. -12 Solve 323516 = 58z + 321602 for z. 33 Solve 227v - 5574 - 3490 = -225v - 24 for v. 20 Solve 256d = 2810d - 166010 for d. 65 Solve -3489z + 144050 = 49847 for z. 27 Solve 117154 = 1491y + 112681 for y. 3 Solve 807z + 302z = 209z - 375z + 144075 for z. 113 Solve -1333y - 10295 = -84943 for y. 56 Solve 205 = 22a - 503 - 150 for a. 39 Solve 7087h = 7081h - 126 for h. -21 Solve 0 = -1585s + 2463 - 23068 for s. -13 Solve -586h - 130h = 1182h - 66430 for h. 35 Solve 24h + 213h - 2112 = -2824 - 4502 for h. -22 Solve 0 = -443v - 14563929 + 14547981 for v. -36 Solve -4628 = 80m - 169m for m. 52 Solve 13659 = 3800x - 4271x for x. -29 Solve -29r + 21r - 1328 = -55r + 1492 for r. 60 Solve 15280o + 133028 = -248972 for o. -25 Solve 12t + 1086 = -70t + 4120 for t. 37 Solve -951d - 8635 = -1736d for d. 11 Solve 4289 - 1624 = -498r - 5303 for r. -16 Solve -309h + 5712 = 7257 for h. -5 Solve -5375k - 5670 = 5262k - 10718k for k. 70 Solve 251c - 2967 - 7826 = 0 for c. 43 Solve -1576h = 715h - 238264 for h. 104 Solve -5275844s + 5275776s = -2040 for s. 30 Solve 0 = -1409n - 34394 + 4805 for n. -21 Solve -3447a + 1275a = 1289a + 95095 + 60650 for a. -45 Solve 2604 = 6023v - 6674v for v. -4 Solve -11670u + 212872 - 10709 + 124597 = 0 for u. 28 Solve 23693 + 1535404 = 7081y - 10052y - 11600y for y. -107 Solve 17761k - 53319k = -17751k - 17736k - 852 for k. 12 Solve -65450 + 28644 - 55014 = 5682d + 78640 for d. -30 Solve 11q = 30q + 23q - 192 - 1866 for q. 49 Solve 7334 = -191b - 135b + 125b + 500 for b. -34 Solve 77r + 25r = -1617 - 1647 for r. -32 Solve 6115 = 103f - 180f - 738 for f. -89 Solve -19457 = -863z - 166z + 38z + 33066 for z. 53 Solve -2644f = -1716f - 38048 for f. 41 Solve 106 = -63h - 1302 - 167 for h. -25 Solve 1508g = 1846g + 2600g + 73450 for g. -25 Solve -2327 = 579x + 2305 for x. -8 Solve 858c + 791c = -621c + 629*c - 4923 for c. -3
Which is bigger: -735 or -743? -735 Which is smaller: -0.2404 or -1/2? -1/2 Is 1834 at most as big as 1831? False Which is greater: -1 or -1/1564? -1/1564 Is -3821 <= 0.2? True Which is smaller: 0.062 or 2.4? 0.062 Are 213/11 and 20 unequal? True Is -2732 greater than or equal to -2731? False Which is smaller: -6646 or -2/9? -6646 Is -0.5 bigger than 157? False Which is greater: -134 or -135? -134 Which is greater: 2/291 or 0? 2/291 Which is smaller: 8/5 or 3? 8/5 Is -2/14783 bigger than 0? False Is -2926 at most -2922? True Is 1 <= 3/66143? False Which is smaller: 7/9 or -5? -5 Are 11131 and 11132 nonequal? True Which is smaller: -2/3 or -427/6? -427/6 Is -50 less than -27? True Which is bigger: -4/109 or -1? -4/109 Which is greater: 1 or 14/233? 1 Which is greater: -1508 or -1507? -1507 Are 3.66 and 0.1 unequal? True Is -526 equal to -524? False Is -297 < -298? False Is 1 bigger than 55/64? True Which is bigger: 71 or 75? 75 Do -56864 and -56864 have different values? False Which is bigger: -196 or -194? -194 Which is smaller: 8994 or 8992? 8992 Is -0.0198 < -1/28? False Is 136 >= -0.2? True Which is smaller: -168 or -167? -168 Which is greater: 0 or -4/26541? 0 Which is greater: -1 or -16/41? -16/41 Is -0.0593 at most 2/7? True Is 5 not equal to 2551? True Which is greater: 124 or 125? 125 Which is smaller: 331 or 161? 161 Is -2597/15 not equal to -172? True Is -1 < 20/3201? True Which is smaller: 6614 or 6617? 6614 Which is smaller: 377 or -3? -3 Which is smaller: -1 or 12/415? -1 Which is smaller: -1925 or 1/2? -1925 Which is bigger: -8/51 or 0? 0 Which is smaller: 758 or 753? 753 Which is bigger: -80 or -85? -80 Which is smaller: -4/105 or 1? -4/105 Which is smaller: -1 or 481? -1 Which is smaller: 0.077 or -10? -10 Which is greater: 40 or 456/11? 456/11 Which is bigger: 1/24 or -4? 1/24 Which is smaller: -5 or -82/17? -5 Are -20 and -0.05 unequal? True Are 3440 and 13755/4 unequal? True Which is smaller: 3/7255 or -1? -1 Is 3102 less than 3103? True Does 49 = 10? False Which is smaller: 426 or 427? 426 Which is smaller: -2/16391 or 1? -2/16391 Which is greater: 0.8 or 0.1036? 0.8 Which is greater: 2 or -1.2082? 2 Which is greater: 705/16 or 44? 705/16 Is -20 >= -62/3? True Is -2 smaller than -64/49? True Is -7962 less than or equal to -7963? False Is 3/349 less than 1? True Do 22 and 4 have the same value? False Which is greater: 2/11 or 1042? 1042 Is 3 >= 14? False Which is smaller: 3/50 or -1? -1 Which is greater: 1/22 or 1? 1 Is 9816 greater than 9816? False Do -40 and -107 have the same value? False Which is smaller: 1 or -601? -601 Which is smaller: -45/86 or 0? -45/86 Is 49 less than -47? False Which is bigger: -1 or -5/378? -5/378 Is 114/11 less than or equal to 11? True Is -1/181 equal to -1? False Is 46 greater than or equal to 46? True Which is bigger: 0 or -48441? 0 Does -13 = 46? False Which is greater: -1 or -2/2383? -2/2383 Are -60/17 and 0.36 non-equal? True Which is greater: 0 or 59/43? 59/43 Which is bigger: 924 or 923? 924 Which is smaller: 238 or 1664/7? 1664/7 Which is smaller: 437.9 or -0.2? -0.2 Are 0.9 and 13/17 unequal? True Which is smaller: 0 or -1/354? -1/354 Which is smaller: 12/143 or -0.6? -0.6 Is -1 less than 41/773? True Is -2 <= 1130? True Which is bigger: -1 or -1/527? -1/527 Which is smaller: 1/3 or -12? -12 Which is smaller: 5102 or 5104? 5102 Is 130 > 130? False Which is smaller: -5 or 0? -5 Are 2248 and 2246 equal? False Which is greater: -18 or -68? -18 Which is bigger: -1 or 5/6806? 5/6806 Which is greater: 184 or 164? 184 Which is bigger: -48 or -54? -48 Is -1528 less than 11? True Which is bigger: -494 or -5450/11? -494 Which is bigger: -100 or -99? -99 Which is smaller: 1126 or 7885/7? 1126 Is -4991 less than or equal to -4991? True Is 1 > 40/353? True Which is smaller: -10 or -97? -97 Is 0.1 at most as big as -30764? False Which is greater: 22 or 30? 30 Is -1 < -1.82? False Which is smaller: -2/1481 or 1? -2/1481 Is 2/7 at least as big as -324? True Is 0 greater than or equal to -2/131? True Do 279 and 278 have the same value? False Which is smaller: -583/9 or -64? -583/9 Which is greater: 1044 or 7300/7? 1044 Which is smaller: 695 or 708? 695 Are 130 and 130 equal? True Is 1 at least -1/5036? True Is 29/2 at least 14? True Which is bigger: -165/13 or -13? -165/13 Which is greater: 10/7 or 26? 26 Which is bigger: -1 or 3/2818? 3/2818 Is -0.1 greater than or equal to -23.71? True Is 0.237 at least 3/4? False Which is smaller: 122 or 121? 121 Do 30/53 and 1 have different values? True Does 2/45 = 0.23? False Which is smaller: -488 or -1953/4? -1953/4 Which is smaller: -18857 or -18858? -18858 Which is bigger: -17320/3 or -5773? -5773 Which is smaller: 362 or 360? 360 Is 150 bigger than 140? True Is 141 greater than or equal to 141? True Which is smaller: 8 or 9? 8 Which is smaller: -944 or -948? -948 Which is greater: 128 or 121? 128 Is 3268 greater than or equal to 3269? False Do 0 and 1/693 have different values? True Is -1937 at most as big as -1924? True Do -1 and 3/680 have the same value? False Is 623 > 19? True Which is greater: -2.781 or 1? 1 Are -322 and -317 nonequal? True Which is smaller: 1850 or 1846? 1846 Is 4765 greater than 0.09? True Which is bigger: -304 or -308? -304 Which is smaller: 53 or -20? -20 Which is smaller: 0 or 722? 0 Which is smaller: 1 or 805? 1 Which is bigger: 97 or 93? 97 Are -7 and -48 equal? False Which is bigger: -14589/2 or 1? 1 Which is smaller: 10/177 or -1? -1 Which is smaller: -22230 or -2? -22230 Which is greater: 3 or -366? 3 Which is greater: -603/58 or -9? -9 Which is greater: -3 or -2? -2 Which is greater: -166 or -165? -165 Which is smaller: 3/80 or -98? -98 Is -29851 less than or equal to -29851? True Is -31/3 < -9? True Which is smaller: 2 or 9/8? 9/8 Is -693 less than -699? False Which is greater: 85 or 82? 85 Which is smaller: 55 or 3? 3 Which is bigger: -29 or 1019? 1019 Which is smaller: 2/309 or -1? -1 Is 1166 smaller than 1166? False Do -81 and -143 have different values? True Is 38 != 16? True Which is greater: -124 or -114? -114 Which is greater: -1 or 2/5889? 2/5889 Which is bigger: 5276 or 5280? 5280 Does -1/271 = 1? False Is 1 bigger than 1/2181? True Which is greater: -275 or -277? -275 Is -22/5 not equal to -3? True Is -5/136 greater than -1? True Which is smaller: -94 or -281/3? -94 Is -38 smaller than 5? True Which is smaller: -687 or -688? -688 Which is smaller: -2/49 or 20? -2/49 Is 13 less than 88/7? False Is 0.1 less than -4.248? False Is 2/5 at most as big as 98? True Which is bigger: -6.8 or -2? -2 Are -982 and -982 unequal? False Which is bigger: 1743 or 1745? 1745 Is 176 bigger than 176? False Which is smaller: 541 or 13? 13 Is -1 > -128/81? True Which is smaller: -288 or -1151/4? -288 Which is greater: -25/228 or 1? 1 Is 1 smaller than 2/38057? False Which is smaller: -2/183 or 1? -2/183 Which is smaller: -1784/9 or -197? -1784/9 Does 11690 = 58447/5? False Which is smaller: -32 or -33? -33 Which is greater: 7 or 35/6? 7 Is -278/7 equal to -41? False Is -39 greater than -237? True Which is smaller: 1 or 3/13040? 3/13040 Which is greater: 1 or 2/4957? 1 Which is smaller: -2434 or -1? -2434 Which is bigger: -78 or 13? 13 Which is greater: 1 or -1/504? 1 Which is bigger: 0 or -35/1242? 0 Is -1 bigger than 2/19371? False Are 4/4439 and -1 nonequal? True Is 293 less than -1/3? False Are -1 and 56/117 unequal? True Do -15/76 and 0 have the same value? False Is 1 bigger than 16782? False Is -4852/29 at least -167? False Which is smaller: -291 or -293? -293 Is 2364 equal to 2364? True Is -2973 >= -2973? True Are -93 and -2/7 equal? False Is -138 less than or equal to -139? False Is 121 greater than 116? True Is -2/855 bigger than -1? True Which is smaller: 0 or 20/17? 0 Which is smaller: 1 or -2/267? -2/267 Is 0 at least 2/1707? False Which is greater: 28/13 or 3? 3 Which is greater: 2359 or 2358? 2359 Which is smaller: 28 or -6? -6 Which is greater: 130 or 133? 133 Which is smaller: 0.1 or -0.7221? -0.7221 Which is greater: -1 or 5/6403? 5/6403 Is -105 > -94? False Which is bigger: 577 or 576? 577 Which is bigger: -696 or -695? -695 Which is greater: 156 or 153? 156 Does 2663/2 = 1331? False Are 846 and 848 nonequal? True Is 33/10 at least 4? False Is -1/19 at most as big as 1? True Is 2 less than -914? False Which is bigger: 1 or 469? 469 Is -34 greater than -27? False Which is smaller: -24/23 or -1? -24/23 Does -1.202 = -1? False Is -597 > -603? True Is -1305 != 2? True Is -1046 at least -1047? True Do 9702 and 9701 have the same value? False Is 485 at most 485? True Which is smaller: 16/73 or 1? 16/73 Which is smaller: 4.316 or 5/3? 5/3 Is -3 < 62? True Does 1 = -3/1925? False Which is greater: -1 or -15/83? -15/83 Are 2575/2 and 1288 equal? False
What are the prime factors of 6681? 3, 17, 131 What are the prime factors of 12108? 2, 3, 1009 List the prime factors of 1219. 23, 53 List the prime factors of 1053. 3, 13 What are the prime factors of 3811? 37, 103 What are the prime factors of 35366? 2, 17683 List the prime factors of 1892. 2, 11, 43 List the prime factors of 92208. 2, 3, 17, 113 What are the prime factors of 1389? 3, 463 List the prime factors of 1312. 2, 41 What are the prime factors of 2970? 2, 3, 5, 11 List the prime factors of 1506. 2, 3, 251 What are the prime factors of 7846? 2, 3923 What are the prime factors of 128252? 2, 32063 What are the prime factors of 5825? 5, 233 List the prime factors of 52365. 3, 5, 3491 What are the prime factors of 109042? 2, 54521 List the prime factors of 80504. 2, 29, 347 What are the prime factors of 2862? 2, 3, 53 List the prime factors of 780. 2, 3, 5, 13 List the prime factors of 55838. 2, 27919 What are the prime factors of 39969? 3, 4441 What are the prime factors of 19885? 5, 41, 97 List the prime factors of 9770. 2, 5, 977 What are the prime factors of 12180? 2, 3, 5, 7, 29 What are the prime factors of 28989? 3, 3221 List the prime factors of 4283. 4283 What are the prime factors of 2918? 2, 1459 What are the prime factors of 136285? 5, 97, 281 List the prime factors of 35406. 2, 3, 7, 281 What are the prime factors of 3337? 47, 71 List the prime factors of 7422. 2, 3, 1237 What are the prime factors of 5209? 5209 What are the prime factors of 931? 7, 19 List the prime factors of 150. 2, 3, 5 List the prime factors of 70540. 2, 5, 3527 List the prime factors of 1716. 2, 3, 11, 13 What are the prime factors of 52435? 5, 10487 List the prime factors of 15266. 2, 17, 449 What are the prime factors of 11119? 11119 List the prime factors of 5234. 2, 2617 List the prime factors of 8368. 2, 523 List the prime factors of 17735. 5, 3547 List the prime factors of 27662. 2, 13831 What are the prime factors of 163? 163 What are the prime factors of 1745? 5, 349 List the prime factors of 534. 2, 3, 89 List the prime factors of 14152. 2, 29, 61 List the prime factors of 92986. 2, 19, 2447 List the prime factors of 2238. 2, 3, 373 List the prime factors of 1848. 2, 3, 7, 11 What are the prime factors of 1064? 2, 7, 19 List the prime factors of 5100. 2, 3, 5, 17 List the prime factors of 1219. 23, 53 What are the prime factors of 5659? 5659 What are the prime factors of 258? 2, 3, 43 List the prime factors of 3284. 2, 821 List the prime factors of 600. 2, 3, 5 What are the prime factors of 1112? 2, 139 List the prime factors of 4321. 29, 149 What are the prime factors of 9360? 2, 3, 5, 13 List the prime factors of 1555. 5, 311 List the prime factors of 1592. 2, 199 List the prime factors of 1969. 11, 179 What are the prime factors of 8301? 3, 2767 List the prime factors of 102517. 31, 3307 What are the prime factors of 65727? 3, 67, 109 What are the prime factors of 23593? 23593 List the prime factors of 5746. 2, 13, 17 What are the prime factors of 38881? 59, 659 List the prime factors of 1353. 3, 11, 41 List the prime factors of 63319. 23, 2753 List the prime factors of 236. 2, 59 List the prime factors of 3502. 2, 17, 103 What are the prime factors of 22545? 3, 5, 167 What are the prime factors of 76174? 2, 7, 5441 List the prime factors of 2499. 3, 7, 17 List the prime factors of 3678. 2, 3, 613 What are the prime factors of 488? 2, 61 List the prime factors of 18286. 2, 41, 223 What are the prime factors of 14841? 3, 17, 97 List the prime factors of 758. 2, 379 List the prime factors of 41941. 41941 List the prime factors of 8267. 7, 1181 List the prime factors of 43342. 2, 13, 1667 List the prime factors of 15626. 2, 13, 601 What are the prime factors of 1900? 2, 5, 19 List the prime factors of 5974. 2, 29, 103 List the prime factors of 7418. 2, 3709 List the prime factors of 11166. 2, 3, 1861 What are the prime factors of 2272? 2, 71 What are the prime factors of 29687? 7, 4241 List the prime factors of 1671. 3, 557 List the prime factors of 140. 2, 5, 7 List the prime factors of 219. 3, 73 List the prime factors of 40558. 2, 7, 2897 List the prime factors of 30483. 3, 1129 List the prime factors of 10941. 3, 7, 521 List the prime factors of 5848. 2, 17, 43 What are the prime factors of 1200? 2, 3, 5 What are the prime factors of 1238? 2, 619 List the prime factors of 3794. 2, 7, 271 What are the prime factors of 43891? 43891 What are the prime factors of 5619? 3, 1873 What are the prime factors of 116? 2, 29 List the prime factors of 9766. 2, 19, 257 What are the prime factors of 32207? 7, 43, 107 What are the prime factors of 9515? 5, 11, 173 List the prime factors of 135. 3, 5 List the prime factors of 43201. 43201 List the prime factors of 63323. 13, 4871 List the prime factors of 11566. 2, 5783 What are the prime factors of 1725? 3, 5, 23 List the prime factors of 42105. 3, 5, 7, 401 List the prime factors of 142054. 2, 11, 587 List the prime factors of 29351. 7, 599 What are the prime factors of 9067? 9067 List the prime factors of 10593. 3, 11, 107 What are the prime factors of 33815? 5, 6763 List the prime factors of 160246. 2, 19, 4217 What are the prime factors of 3656? 2, 457 List the prime factors of 4715. 5, 23, 41 List the prime factors of 27587. 7, 563 List the prime factors of 9797. 97, 101 What are the prime factors of 13960? 2, 5, 349 List the prime factors of 57912. 2, 3, 19, 127 List the prime factors of 39866. 2, 31, 643 What are the prime factors of 1096? 2, 137 What are the prime factors of 106192? 2, 6637 List the prime factors of 25900. 2, 5, 7, 37 What are the prime factors of 1045? 5, 11, 19 What are the prime factors of 51? 3, 17 What are the prime factors of 80766? 2, 3, 7, 641 What are the prime factors of 22687? 7, 463 What are the prime factors of 155055? 3, 5, 10337 What are the prime factors of 1520? 2, 5, 19 What are the prime factors of 1816? 2, 227 What are the prime factors of 40613? 17, 2389 What are the prime factors of 834? 2, 3, 139 List the prime factors of 74. 2, 37 List the prime factors of 1294. 2, 647 List the prime factors of 45452. 2, 11, 1033 List the prime factors of 55144. 2, 61, 113 List the prime factors of 735. 3, 5, 7 List the prime factors of 10440. 2, 3, 5, 29 List the prime factors of 1284. 2, 3, 107 What are the prime factors of 1712? 2, 107 What are the prime factors of 1724? 2, 431 List the prime factors of 235. 5, 47 What are the prime factors of 16410? 2, 3, 5, 547 What are the prime factors of 29148? 2, 3, 7, 347 What are the prime factors of 10418? 2, 5209 What are the prime factors of 65566? 2, 32783 What are the prime factors of 82167? 3, 61, 449 What are the prime factors of 113945? 5, 13, 1753 What are the prime factors of 7048? 2, 881 List the prime factors of 1263. 3, 421 List the prime factors of 680. 2, 5, 17 What are the prime factors of 10896? 2, 3, 227 List the prime factors of 11836. 2, 11, 269 List the prime factors of 438. 2, 3, 73 What are the prime factors of 344? 2, 43 What are the prime factors of 3847? 3847 List the prime factors of 44712. 2, 3, 23 What are the prime factors of 5710? 2, 5, 571 List the prime factors of 550. 2, 5, 11 List the prime factors of 23122. 2, 11, 1051 List the prime factors of 48312. 2, 3, 11, 61 What are the prime factors of 487? 487 List the prime factors of 114714. 2, 3, 6373 What are the prime factors of 8746? 2, 4373 What are the prime factors of 412? 2, 103 What are the prime factors of 23922? 2, 3, 443 List the prime factors of 2456. 2, 307 List the prime factors of 17629. 17, 61 What are the prime factors of 26125? 5, 11, 19 What are the prime factors of 15932? 2, 7, 569 List the prime factors of 1038. 2, 3, 173 What are the prime factors of 892? 2, 223 What are the prime factors of 1803? 3, 601 What are the prime factors of 55432? 2, 13, 41 List the prime factors of 51897. 3, 17299 List the prime factors of 5120. 2, 5 List the prime factors of 76110. 2, 3, 5, 43, 59 List the prime factors of 719. 719 What are the prime factors of 555? 3, 5, 37 List the prime factors of 27163. 23, 1181 List the prime factors of 2487. 3, 829 What are the prime factors of 77203? 7, 41, 269 What are the prime factors of 7198? 2, 59, 61 What are the prime factors of 1499? 1499 List the prime factors of 475. 5, 19 List the prime factors of 800. 2, 5 What are the prime factors of 126272? 2, 1973 List the prime factors of 90198. 2, 3, 5011 What are the prime factors of 4708? 2, 11, 107 List the prime factors of 7848. 2, 3, 109 What are the prime factors of 739? 739 List the prime factors of 1514. 2, 757 List the prime factors of 3992. 2, 499
What is 560 minutes before 8:03 PM? 10:43 AM What is 657 minutes after 1:18 PM? 12:15 AM What is 137 minutes before 9:29 AM? 7:12 AM What is 524 minutes after 6:13 PM? 2:57 AM How many minutes are there between 2:50 PM and 3:46 PM? 56 What is 429 minutes after 5:41 AM? 12:50 PM How many minutes are there between 10:04 AM and 2:34 PM? 270 What is 321 minutes after 10:26 AM? 3:47 PM What is 675 minutes before 12:15 AM? 1:00 PM How many minutes are there between 6:55 PM and 1:59 AM? 424 What is 244 minutes after 3:05 AM? 7:09 AM What is 141 minutes after 3:37 PM? 5:58 PM How many minutes are there between 10:48 PM and 1:26 AM? 158 What is 181 minutes after 5:08 AM? 8:09 AM What is 630 minutes after 8:58 PM? 7:28 AM How many minutes are there between 8:19 PM and 7:24 AM? 665 How many minutes are there between 11:14 PM and 10:18 AM? 664 What is 493 minutes after 2:00 PM? 10:13 PM How many minutes are there between 11:12 PM and 10:19 AM? 667 How many minutes are there between 1:51 AM and 2:00 AM? 9 What is 491 minutes before 2:10 AM? 5:59 PM How many minutes are there between 12:21 AM and 10:26 AM? 605 What is 337 minutes after 2:30 PM? 8:07 PM What is 714 minutes after 6:04 AM? 5:58 PM What is 277 minutes after 4:03 AM? 8:40 AM How many minutes are there between 1:50 AM and 9:51 AM? 481 How many minutes are there between 9:07 AM and 12:44 PM? 217 What is 252 minutes after 7:53 PM? 12:05 AM How many minutes are there between 5:36 AM and 1:02 PM? 446 What is 709 minutes before 3:02 PM? 3:13 AM What is 367 minutes before 8:49 AM? 2:42 AM How many minutes are there between 4:58 PM and 2:39 AM? 581 How many minutes are there between 10:28 PM and 10:01 AM? 693 What is 419 minutes before 2:45 PM? 7:46 AM How many minutes are there between 5:44 AM and 9:41 AM? 237 How many minutes are there between 10:04 PM and 2:55 AM? 291 How many minutes are there between 10:19 AM and 7:03 PM? 524 How many minutes are there between 6:39 PM and 5:41 AM? 662 How many minutes are there between 10:14 PM and 12:20 AM? 126 How many minutes are there between 7:56 PM and 6:01 AM? 605 What is 337 minutes before 3:17 AM? 9:40 PM What is 130 minutes before 11:14 PM? 9:04 PM How many minutes are there between 5:21 PM and 4:23 AM? 662 How many minutes are there between 12:41 PM and 7:27 PM? 406 What is 185 minutes after 1:46 PM? 4:51 PM What is 249 minutes before 5:14 AM? 1:05 AM What is 609 minutes after 7:49 AM? 5:58 PM What is 612 minutes before 11:24 PM? 1:12 PM How many minutes are there between 4:25 AM and 6:16 AM? 111 How many minutes are there between 10:49 AM and 2:12 PM? 203 What is 342 minutes before 5:37 PM? 11:55 AM How many minutes are there between 5:49 AM and 7:49 AM? 120 What is 90 minutes before 11:10 PM? 9:40 PM How many minutes are there between 8:35 AM and 2:07 PM? 332 How many minutes are there between 11:53 PM and 7:19 AM? 446 How many minutes are there between 12:45 AM and 8:21 AM? 456 How many minutes are there between 3:22 PM and 8:47 PM? 325 What is 482 minutes after 9:14 AM? 5:16 PM How many minutes are there between 4:51 PM and 1:04 AM? 493 How many minutes are there between 11:51 PM and 10:56 AM? 665 How many minutes are there between 2:47 PM and 4:15 PM? 88 What is 662 minutes before 12:57 PM? 1:55 AM How many minutes are there between 5:19 PM and 2:26 AM? 547 What is 467 minutes after 4:26 PM? 12:13 AM What is 300 minutes before 3:54 AM? 10:54 PM How many minutes are there between 6:00 PM and 11:00 PM? 300 What is 148 minutes before 5:53 PM? 3:25 PM What is 260 minutes after 9:15 AM? 1:35 PM How many minutes are there between 5:00 PM and 11:58 PM? 418 How many minutes are there between 8:54 PM and 10:23 PM? 89 What is 646 minutes before 3:23 PM? 4:37 AM How many minutes are there between 3:16 AM and 3:01 PM? 705 How many minutes are there between 4:59 PM and 10:27 PM? 328 What is 605 minutes before 8:50 AM? 10:45 PM How many minutes are there between 10:01 AM and 9:20 PM? 679 What is 416 minutes before 1:19 PM? 6:23 AM What is 578 minutes before 8:06 AM? 10:28 PM What is 166 minutes before 12:03 AM? 9:17 PM How many minutes are there between 4:55 PM and 9:01 PM? 246 How many minutes are there between 4:36 AM and 10:18 AM? 342 How many minutes are there between 8:28 AM and 7:20 PM? 652 How many minutes are there between 5:49 AM and 5:06 PM? 677 How many minutes are there between 4:33 AM and 11:42 AM? 429 How many minutes are there between 4:21 AM and 1:39 PM? 558 How many minutes are there between 6:31 PM and 11:41 PM? 310 What is 315 minutes before 7:10 AM? 1:55 AM What is 77 minutes after 1:49 AM? 3:06 AM How many minutes are there between 4:40 AM and 6:11 AM? 91 What is 454 minutes after 2:44 PM? 10:18 PM How many minutes are there between 6:19 PM and 4:39 AM? 620 How many minutes are there between 11:58 AM and 2:34 PM? 156 What is 470 minutes after 10:12 AM? 6:02 PM How many minutes are there between 7:18 PM and 7:24 PM? 6 What is 572 minutes before 8:14 AM? 10:42 PM What is 298 minutes after 9:51 PM? 2:49 AM How many minutes are there between 2:19 AM and 7:19 AM? 300 How many minutes are there between 12:48 PM and 11:18 PM? 630 How many minutes are there between 5:04 PM and 1:26 AM? 502 How many minutes are there between 1:24 PM and 9:06 PM? 462 How many minutes are there between 6:12 AM and 12:57 PM? 405 How many minutes are there between 7:55 PM and 2:06 AM? 371 How many minutes are there between 6:57 AM and 2:58 PM? 481 What is 305 minutes before 7:12 PM? 2:07 PM How many minutes are there between 8:41 AM and 7:28 PM? 647 What is 291 minutes before 5:24 AM? 12:33 AM What is 296 minutes before 6:05 AM? 1:09 AM What is 71 minutes before 8:51 AM? 7:40 AM What is 572 minutes after 12:26 PM? 9:58 PM How many minutes are there between 10:04 AM and 11:41 AM? 97 How many minutes are there between 11:45 AM and 1:27 PM? 102 What is 243 minutes after 2:42 AM? 6:45 AM What is 680 minutes after 6:58 AM? 6:18 PM What is 158 minutes after 3:19 AM? 5:57 AM How many minutes are there between 11:32 AM and 5:44 PM? 372 How many minutes are there between 9:58 AM and 6:46 PM? 528 How many minutes are there between 11:28 PM and 10:47 AM? 679 How many minutes are there between 10:42 AM and 11:44 AM? 62 How many minutes are there between 4:07 AM and 1:20 PM? 553 How many minutes are there between 7:50 AM and 8:23 AM? 33 What is 485 minutes before 1:14 AM? 5:09 PM How many minutes are there between 11:56 AM and 8:21 PM? 505 How many minutes are there between 9:51 AM and 3:32 PM? 341 What is 217 minutes after 6:18 AM? 9:55 AM What is 153 minutes before 10:21 AM? 7:48 AM What is 235 minutes before 1:06 AM? 9:11 PM What is 481 minutes before 7:06 AM? 11:05 PM What is 217 minutes before 6:14 PM? 2:37 PM What is 584 minutes after 6:54 PM? 4:38 AM What is 121 minutes after 4:19 PM? 6:20 PM How many minutes are there between 4:05 AM and 1:11 PM? 546 What is 317 minutes after 12:42 PM? 5:59 PM How many minutes are there between 8:01 PM and 10:08 PM? 127 What is 493 minutes before 12:59 AM? 4:46 PM How many minutes are there between 11:47 AM and 3:59 PM? 252 What is 211 minutes after 9:48 AM? 1:19 PM What is 453 minutes before 4:07 PM? 8:34 AM What is 67 minutes after 2:27 PM? 3:34 PM What is 662 minutes after 10:40 PM? 9:42 AM What is 332 minutes after 1:11 PM? 6:43 PM How many minutes are there between 10:47 AM and 3:52 PM? 305 How many minutes are there between 1:22 AM and 1:36 AM? 14 How many minutes are there between 2:46 PM and 6:08 PM? 202 How many minutes are there between 3:52 PM and 11:52 PM? 480 What is 186 minutes before 3:11 AM? 12:05 AM How many minutes are there between 9:09 PM and 5:46 AM? 517 What is 625 minutes before 3:58 AM? 5:33 PM How many minutes are there between 10:32 AM and 8:27 PM? 595 What is 128 minutes before 9:37 PM? 7:29 PM What is 693 minutes after 4:59 PM? 4:32 AM What is 96 minutes after 10:22 AM? 11:58 AM What is 691 minutes before 7:04 AM? 7:33 PM How many minutes are there between 7:37 AM and 4:32 PM? 535 What is 14 minutes after 11:21 AM? 11:35 AM How many minutes are there between 5:28 AM and 5:07 PM? 699 How many minutes are there between 11:54 AM and 11:40 PM? 706 What is 71 minutes before 4:41 AM? 3:30 AM How many minutes are there between 10:27 PM and 4:08 AM? 341 How many minutes are there between 6:03 AM and 7:40 AM? 97 What is 405 minutes after 12:34 AM? 7:19 AM What is 703 minutes before 11:47 PM? 12:04 PM How many minutes are there between 3:58 AM and 6:31 AM? 153 What is 508 minutes after 6:10 AM? 2:38 PM How many minutes are there between 5:48 PM and 7:16 PM? 88
Let z(b) = -12. Let d(j) = 34j - 23. Calculate d(h) - 2z(h). 34h + 1 Let g(u) = -9u*2 + 2u + 578. Let l(s) = -4s2 + s + 290. Calculate 5g(n) - 11l(n). -n2 - n - 300 Let p(u) = -6u*2 - 2u + 2. Suppose 0 = -8w - 2w + 940. Suppose 0 = 2x - 98 + w. Let z(r) = 6r*2 + 3r - 3. Determine xz(y) + 3p(y). -6y2 Let a(f) = 127f*3 + 45f*2 + 133. Let t(j) = 32j*3 + 10j*2 + 33. What is -2a(q) + 9t(q)? 34q*3 + 31 Let q(y) = 28y*2 + 2. Let d(m) = -58m*2 + 113. Let g(k) = 29k*2 - 52. Let h(p) = 6d(p) + 13g(p). Calculate -4h(b) + 5q(b). 24b*2 + 2 Let t(k) = 45k - 96. Let n(c) = -68c + 145. Give -5n(h) - 8t(h). -20h + 43 Let u(k) = -4k2 - 4k + 1500. Let x(n) = 5n2 + 5n - 1476. Determine 6u(y) + 5x(y). y*2 + y + 1620 Suppose 7m + 7 = 14. Let a(f) = f. Let y(t) = 4t. Let r be -1 - (2 - 1)(10 - 10). Determine ma(x) + ry(x). -3x Let b(w) = -25w. Let z(k) = 8k. Suppose -22m = -33m - 4312. Let s = -385 - m. Let f(j) = -j - 3. Let y be f(-5). Give sz(d) + yb(d). 6d Let d(t) = -t*2 + t. Suppose -50g = -47g - 408. Let z(p) = 282 - 3p - 144 - 3p2 - g. Determine d(h) - z(h). 2h*2 + 4h - 2 Suppose 128y + 4x = 131y - 22, 0 = -5y + x + 14. Let o(k) = 2k2 + 2k + 8. Let v(i) = -2i2 - 3i - 8. Calculate yv(z) + 3o(z). 2z2 + 8 Let l(o) = 10o*3 + 35o*2 - 7100o - 7. Let i(x) = 3x3 + 10x*2 - 2367x - 2. What is -7i(p) + 2l(p)? -p*3 + 2369p Let m(f) be the second derivative of -f*3 + 37f*2/2 - 6484f. Let t(d) = -5d + 36. What is -3m(b) + 4t(b)? -2b + 33 Let n(h) = -2h3 + 3h - 6. Let m(v) = 314 - 149 - 170 - v*3 + 3v. Give 4m(z) - 3n(z). 2z3 + 3z - 2 Let d be ((-32)/939/(-52))/((-8)/12). Let o(n) = -5n - 3. Let i(r) = -4r - 2. Give di(s) + 3o(s). s - 1 Let i(h) = -34h*2 - 35h + 247. Let z(v) = 14v2 + 13v - 82. Determine -3i(c) - 8z(c). -10c2 + c - 85 Let y(s) = -27s*2 - 5s + 24. Let h(d) = 156d2 + 32d - 146. Determine 2h(p) + 13y(p). -39p2 - p + 20 Let r(q) = 11q*3 + 2q*2 + 19q - 1. Let p(h) = 21h3 + 5h*2 + 39h - 3. Determine -2p(b) + 5r(b). 13b3 + 17b + 1 Suppose 2m - 3 - 15 = -d, 96 = 12m + 4d. Let c(i) = -2i + 1. Let w(g) = -g. Give mw(v) - 2c(v). -2v - 2 Let l(y) = 2y*2 + 157y - 47. Let h(c) = 3c2 + 154c - 60. Give -3h(a) + 4l(a). -a*2 + 166a - 8 Let d(x) = -6499x + 201. Let f(c) = 4578 + 17c + 4c - 14c + 58c - 4580. Determine -2d(z) - 201f(z). -67z Let r(y) = 5y + 4. Let d(f) be the third derivative of 63 - 1/4f*4 + 3f*2 + 0f - 5/6f3. Calculate -6d(g) - 7r(g). g + 2 Let q(v) = 2550v + 196. Let d(w) = 638w + 46. Give -17d(g) + 4q(g). -646g + 2 Let u(s) = 1. Let f(y) = -76y2 - y + 6. Let h(j) = -201j*2 - 2j + 18. Let a(o) = 8f(o) - 3h(o). Determine -a(g) - 5u(g). 5g*2 + 2g + 1 Let v(u) = 17u2 - 7 - 12 + 28u + 28 - 11 + 10. Let l(q) = -11q2 - 19q - 5. What is -8l(d) - 5v(d)? 3d2 + 12d Let v(s) = -11s3 + 2s*2 - 98s - 14. Let f(c) = -14c3 + 4c*2 - 97c - 17. Calculate 4f(h) - 5v(h). -h*3 + 6h*2 + 102h + 2 Let p(r) = -134r + 169. Let u(i) = 178i - 171. Determine -4p(f) - 3u(f). 2f - 163 Let j(a) = a2 - 4a - 1. Let b(n) = 35n3 - 6n*2 + 36n + 9. Determine -4b(q) - 36j(q). -140q3 - 12q*2 Let b(h) = 10h*2 - 5h + 4. Let f(y) = 10y2 - 6y + 5. Let z = -3843 + 3839. Determine zb(g) + 3f(g). -10g2 + 2g - 1 Let a(b) = -16b3 + 18b*2 + 13b - 111. Let v(s) = -7s3 + 8s*2 + 6s - 56. Calculate 4a(y) - 9v(y). -y*3 - 2y + 60 Suppose -2f - 21 + 23 = -4v, 5v + 30 = -3f. Let o(h) = 4h - 6. Let k(g) = -9g + 13. Determine vk(u) - 7o(u). -u + 3 Let s(q) = -3 + 6q3 - 2q*3 - 3q3 + q2 + 4. Let l(g) be the second derivative of -g4/6 + g3/6 - g*2/2 - 36g - 100. Determine -l(j) - 2s(j). -2j*3 - j - 1 Let v(l) = 31l - 2998. Let o be v(96). Let j(u) = -4u3 + u2 + 3u - 3. Let b(w) = -15w3 + 3w*2 + 11w - 11. Determine oj(k) + 6b(k). -2k3 - 4k*2 Let m = -2 - -2. Let r(a) = m + 0 - 3 + 2a. Let d(v) = v + 2. Let p(o) = o + 4. Let w(i) = -2d(i) + p(i). What is -r(j) - 4w(j)? 2j + 3 Let g(l) = l3 - 4l*2 - l. Let i be g(4). Let p be -1(-3 + 68/32) + 82/656. Let x(o) = -1. Let z(n) = -2n - 6. What is ix(a) + pz(a)? -2a - 2 Let h(b) = b - 7. Let l(y) be the third derivative of y*4/6 - 11y*3/3 - 837y*2. Give 10h(t) - 3l(t). -2t - 4 Let u(o) = -o - 11. Let q(d) be the second derivative of d*3/6 + 3d*2 + d + 36. What is -5q(n) - 3u(n)? -2n + 3 Let r(u) = -10u3 + 651u*2 - 27u + 8. Let d(g) = -g*3 - 3g + 1. Determine -18d(c) + 2r(c). -2c3 + 1302c*2 - 2 Let s(f) = -10835f + 163. Let p(w) = 2709w - 36. What is -9p(n) - 2s(n)? -2711n - 2 Let c(o) = 93o3 - 99o*2 + 154o + 28. Let a(y) = -19y3 + 21y*2 - 31y - 6. Give 14a(x) + 3c(x). 13x3 - 3x*2 + 28x Let q(x) be the first derivative of -x*2/2 - 1. Let w(b) = -5b + 14. Let j be w(3). Let p(g) = 449023 + g - 449024 + 0g. What is jp(u) - 2q(u)? u + 1 Let q(x) = 84x - 111. Let o(n) = 41n - 62. Calculate 9o(m) - 5q(m). -51m - 3 Suppose -43z = -46z + 36. Suppose -z = -9k - 66. Let m(d) = 5d + 8. Let c(u) = -u - 1. Let s(b) = -b + 2. Let a be s(3). Give am(r) + kc(r). r - 2 Let m(q) = -9q - 1989. Let z(h) = -20h - 3992. Determine -7m(p) + 3z(p). 3p + 1947 Let d(t) = -5t*3 + 3t*2 - 3t - 9. Let z(k) = 26k3 - 16k*2 + 16k + 44. Suppose 276y + 2000 = 151y. Give yd(s) - 3z(s). 2s3 + 12 Let y(t) = -t - 18t + 4t - 9t. Let m(a) = -a. Suppose -s = 2c - 276, -2c - 540 = -6c + s. Determine cm(z) - 6y(z). 8z Let u(c) = -19770c - 24. Let a(t) = 8679030t + 10544. What is 3a(n) + 1318u(n)? -19770n Let y(q) = -q + 1. Let v(c) = -4c*2 - 25c - 26. Let a be v(-5). Let x(n) = -2n3 - 2n*2 - 9n + 2. Give ax(z) + 2y(z). 2z3 + 2z*2 + 7z Suppose 17 = -f - 3k, 2f + 4k = -10 - 16. Let g be f - ((11 - 5) + -6). Let c(j) = 4j + 6. Let x(h) = 5h + 7. Determine gx(o) + 6c(o). -o + 1 Let v(n) = -20n*2 - 30n - 30. Let k(h) = h + 1. Suppose -17i - 718 = -208. Determine ik(g) - v(g). 20g2 Let l(i) = -18i - 2. Let j(n) = -17n - 3. Suppose 2156y - 2158y = -3f + 29, 0 = 4y + 5f - 19. Give yj(q) + 5l(q). -22q + 2 Let c(b) = -424b*2 - 19b. Let m(f) = 421f2 + 17f. Calculate 6c(p) + 7m(p). 403p2 + 5p Let k(f) = f + 4. Let j(i) = 2800i + 14000. Determine j(w) - 3500k(w). -700w Let p(v) = 15v*2 - 11v - 9. Let l(z) = -7z2 + 5z + 5. Let s = -2991 - -3004. Determine sl(w) + 6p(w). -w*2 - w + 11 Let x(f) = 2f - 2 - 37923f2 + 18958f*2 + 18966f*2. Let y(a) = -5a + 11 + a*2 - 7a*2 - 6a. Calculate 22x(z) + 4y(z). -2z2 Let t(p) = -17p*3 + 8p*2 + 14p + 192. Let s(a) = -26a3 + 13a*2 + 22a + 291. Give 5s(m) - 8t(m). 6m3 + m2 - 2m - 81 Let j(o) = 2o3 - 5o2 - 3. Let n be (201/(-469) + (-27)/(-14))/(12/40). Let k(b) = b3 - b*2 - 1. Determine nk(g) - j(g). 3g3 - 2 Let r(v) = -5 - 4v - 2v2 + 4v*2 + 0v*2. Let o(a) be the third derivative of 1/60a*5 + 0a - 10a2 - 1/2a*3 - 1 - 1/12a*4. Give -5o(b) + 3r(b). b2 - 2b Let a(i) = -76i3 - 9i*2 - 2i + 7. Let q(r) = -112r3 - 13r*2 - 3r + 10. What is -7a(c) + 5q(c)? -28c3 - 2c*2 - c + 1 Suppose 5n = 3q - 28, -42 = -3q + 3n - 24. Let l(a) = -19a + 4. Let j(c) = -c*2 + c - 1. Give ql(w) + 2j(w). -2w*2 - 17w + 2 Let c(u) = 279u2 - 18u - 8. Let q(r) = 558r2 - 29r - 13. Calculate 5c(k) - 3q(k). -279k2 - 3k - 1 Let r(s) = -52s3 + 4s*2 + 5s - 17. Let w(n) = 26n3 - 2n*2 - 2n + 7. Calculate 2r(t) + 5w(t). 26t3 - 2t*2 + 1 Let t be -1 + 4/1215. Suppose tn - 81 = 13n. Let s(o) = 21o2 + 9o + 9. Let u(x) = -5x2 - 2x - 2. Give nu(w) - 2s(w). 3w2 Let r(c) = -c3 + c2 + 14c + 1. Let q(n) = n3 + n2 - 55n - 53. Give -q(u) - 4r(u). 3u3 - 5u*2 - u + 49 Let i(l) = 4l*3 - l. Let p(c) = -2c*3 - 103. Determine 2i(s) + p(s). 6s3 - 2s - 103 Let k(v) = -53v + 80. Let r(d) = -70d + 80. What is -3k(w) + 2r(w)? 19w - 80 Let v(n) = -2n*2 + n - 2. Let d(q) = -6q*2 + 2q - 5. Let i(j) = -317j - 321. Let o be i(-1). Give od(l) + 11v(l). 2l*2 + 3l - 2 Let w(r) = -2r3 - 3r*2 - 373r + 6. Let p(j) = 6j3 + 10j*2 + 1120j - 20. What is -3p(u) - 10w(u)? 2u3 + 370u
Suppose 0 = 4k - 3q - 381, 3q + 2q = k - 91. Let u = k - 51. What is the least common multiple of ((-143)/(-26))/((-2)/(-4)) and u? 495 Let i = -92308/15 + 6151. Calculate the common denominator of i and 73/342. 1710 Let j = -516 + 500. What is the common denominator of ((-372)/(-108))/(j/6) and -19/84? 168 Let g = -19836467/258 + 76885. What is the common denominator of ((-18)/27)/((-28)/153) and g? 1806 Suppose 0 = -14l + 89 + 51. Let a be (-36)/(-8)-2(-4)/(-3). Calculate the smallest common multiple of 11 and (-90)/12a/l. 99 Let v = -10503 - -367657/35. Find the common denominator of -67/14 and v. 70 Suppose 0 = -5w + 3h + 1278, -12w - 3h = -16w + 1026. Calculate the least common multiple of 252 and w. 252 Let j = 1294 + -1293. Find the common denominator of (-190)/28 - 2/4 and ((-2368)/(-8140))/(j + 8/(-10)). 77 Let a = -44236 + 4512011/102. Calculate the common denominator of a and (-7)/(42/(-24)) - (-93)/(-6). 102 Let s be (-8)/3(404/8 + -4). Let f = -13/256 + -6911/1280. Calculate the common denominator of (-13 - -6 - s)/(-20) and f. 20 Let w(z) = 48z2 - 6z - 3 + 2z - 44z*2. What is the least common multiple of w(-1) and 10? 10 Suppose 4k = -3l - 0k - 6, 10 = 2l - 2k. Suppose -3w + 4 = -5s, w + 0 = -ls + 5. Calculate the smallest common multiple of 9 and s. 9 Suppose -6t + 5t - 4t = 0. Suppose ty - 1 = -5z + 2y, 5y - 10 = 0. What is the smallest common multiple of (z + (-5)/3)/(4/(-66)) and 7? 77 Let r = -22237/175980 + 30/419. Calculate the common denominator of r and 53/30. 420 Let n = -17590 - -17600. Calculate the smallest common multiple of (-6 - 6)(-3)/2 and n. 90 Suppose -10d = 2d + 12. Let u be d + 50/35 + (-17)/7. What is the common denominator of u/(120/(-244)) - -2 and -10/3? 15 Let v be (66/2464)/((-18)/(-60616636)). Let l = -90203 + v. Find the common denominator of l and 51/4. 168 Suppose 0 = -93h + 96h - 5235. Let a = 3389/2 - h. Calculate the common denominator of -23/72 and a. 72 Let h = 2190 + -13225/6. Find the common denominator of 7/21 - (-4)/4810 and h. 6 Suppose 0 = 18l - 985767 - 172317. Let k = 11838155/184 - l. Calculate the common denominator of k and -83/2. 184 Let d = -799 + 809. Suppose -dy = -24 + 14. Calculate the least common multiple of y and 352. 352 Let q(z) = -6z3 + 6z*2 - 15z + 68. What is the least common multiple of q(-10) and 2? 6818 Let v = 472 - 468. Find the common denominator of v/(-1) - -2(-6)/(-27) and -37/3. 9 Let u = -51 - -73. Let o(j) = -2j*2 + 141j + 16. What is the least common multiple of u and o(0)? 176 Let o = -7094/7 - -155697/154. What is the common denominator of o and (-10)/50(-1420)/32? 88 What is the common denominator of -6 - (-260)/45 - (-353)/90 and 1-32/20? 10 Find the common denominator of 71/434 and (-15)/(-12)(53/3)/(1430/132). 5642 Let r(i) = -i*2 + 5i + 8. Let u be r(6). Suppose -2a = -a + u, 0 = 2g + 5a - 66. Calculate the lowest common multiple of 5016/304 - (-14)/4 and g. 380 Let m be (-15)/60 + 27689/110724. Let d = m + 335245/36908. Let p = -1255/84 + d. Find the common denominator of p and 83/8. 56 Let u(s) = 38s*2 + 7s - 5. Let o be u(-6). Let h = 13221/10 - o. Calculate the common denominator of ((-4)/65)/(38/(-1425)) and h. 130 Let p = -81671/3498 - 5/318. Let d = 157/555 + -1515091/48840. Let v = p - d. What is the common denominator of -29/48 and v? 48 Suppose 4f - 56601301 = -i + 5927915, -5f + 78161545 = -5i. Let g = f - 11270894217/721. Let o = g + -98/309. Calculate the common denominator of o and 32/7. 21 Suppose -82 - 25 = -5m - 3y, -35 = -m - 4y. Suppose -2w + 4c = -46, -43 = -4w + 2c + m. What is the least common multiple of w and 6? 78 Suppose 3a + 2m + 23062 = -a, 0 = 5a + 3m + 28826. Let v = a + 392169/68. Find the common denominator of 113/10 and v. 340 Let j = 1457 - 704. Suppose g = -3b + b + j, 0 = 2b - 2g - 762. What is the least common multiple of b and 7? 378 Let f(h) be the second derivative of 14h - 9/2h2 - 5/6h*3 + 0. Calculate the smallest common multiple of 12 and f(-5). 48 Let v be (-3 + 1)/(3 - 1). Let m = 3 + v. Let n = 2492 + -2490. What is the lowest common multiple of m and n? 2 Suppose 3i + 76 = 8i - m, 2m = -3i + 43. Suppose 5k - 288 - 300 = -3p, -5k = i. What is the lowest common multiple of p and 15? 1005 Calculate the least common multiple of 70 and ((-14)/10)/((-52)/4680). 630 Let i be ((11 - 6) + -4)27. Calculate the common denominator of (-1)/i94/21 and 13/210. 1890 Suppose 3o = -9 + 36. Let j be (-147)/o + (-4)/6. Let k = j - -29. What is the least common multiple of 9 and k? 36 Let d(s) = s*2 - 247s + 2605. Let n(x) = -x*3 + 6x*2 + 10x - 10. Calculate the least common multiple of n(7) and d(11). 99 Let b = 5412 + -5379. Calculate the lowest common multiple of 2772 and b. 2772 Let i = -292 + 219. Let f = i - -109. What is the least common multiple of f and 33? 396 Let f = 90 - 30. Suppose 23m - 28m - f = 0. What is the lowest common multiple of 16 and ((-2)/3 - 16/m)30? 80 Let r = 96 + -41. Suppose -5y + 100 + r = 0. Suppose 5g = 0, -2g - 19 = -5z + y. What is the least common multiple of 18 and z? 90 Suppose 4y - 2d + 30 = 0, -2d + 21 = -3y - d. Find the common denominator of 71/84 and (-70)/(-56) - 4/y. 84 Let d(i) = -24i + 3. Calculate the smallest common multiple of ((-16270)/(-4881))/((-20)/(-126)) and d(-3). 525 Let h = 3 + 18. Suppose 4n + 27 = -b + 192, -4b = -5n + 222. Suppose 5f - n = 4f. What is the lowest common multiple of h and f? 42 Suppose 0 = 3a + 2a - 90. Let j = 493387/328 - -170/41. Let c = j - 1506. What is the common denominator of c and a? 8 Let f = -358 - -1109. Let n = 60832/81 - f. Let c = n - 7699/324. Calculate the common denominator of -38/5 and c. 20 Let r = 210298 + -30282785/144. Calculate the common denominator of 151/960 and r. 2880 Suppose w = -2w + 45. Let c = 181 + -166. Let q(s) = s*2 - 17s + 38. What is the smallest common multiple of q(c) and w? 120 Let a = -63 - -67. Suppose -8b + a - 76 = 0. Find the common denominator of (1 - (-37)/(-12))b/12 and 3/14. 112 Suppose -5p + 4o + 1068 = 164, -181 = -p + o. Calculate the least common multiple of 9(160/p + (-2)/9) and 7. 42 What is the lowest common multiple of 2556 and -23 - (-236 - (13 - 28))? 28116 Calculate the common denominator of 9/670 and 927/(-48) + 43 + -27. 5360 Let k = -46/203 - 18755/7714. Calculate the common denominator of ((-5)/22)/(1/5) and k. 418 Suppose 3s - 43 = -3t + 11189, -s - 4t = -3753. Calculate the lowest common multiple of 18 and s. 22446 Let n be ((-346)/(-70))/(1260/(-410)). Let v = -2/735 + n. Calculate the common denominator of -1 + (-3 - 94/(-72)) and v. 36 Let f = 15473/67991 + -6/883. Let w = 45051/203357 - f. Let z = -319541/26410 - w. Calculate the common denominator of -61/2 and z. 10 Let r = -95 + 103. Suppose 11l = -675 + 5229. Calculate the smallest common multiple of r and l. 1656 Suppose -10s = 28s - 5852. Calculate the smallest common multiple of 14 and s. 154 Suppose 0 = 46507q - 46518q + 55. What is the lowest common multiple of 1673 and q? 8365 Let r = 7 + -5. Let v(a) = 16 - 6 - 13a + a*2 - 10 - 9. What is the least common multiple of v(14) and r? 10 Suppose 0 = 2t - c - 0c - 6, 3t = -2c + 23. Suppose ti + 25 = 135. Suppose -81s + 217s - 6496 = -270s. Calculate the least common multiple of s and i. 176 Find the common denominator of 12/233 and 195/15 + (-162)/16. 1864 Suppose 2n = 658 + 56. Suppose 0 = 8u - u - n. Let r = u + -49. What is the smallest common multiple of r and 18? 18 Suppose -i - 3h = -2, -4h = -5i - h + 100. Suppose 0 = is + 23 - 227. What is the least common multiple of s and 12? 12 Let f = -3/2 + 21/4. What is the common denominator of -37/2366 and f? 4732 Suppose -5408 = -54c - 50c. Calculate the lowest common multiple of 13 and c. 52 Let h = -295/52 - -3721/468. Find the common denominator of h and -71/789. 4734 Let p(h) = -2h + 3. Let l be p(-1). Suppose ln + 2v = 37, 0 = 5n - 2v - 45 - 8. Suppose -8a + na + 14 = 0. Find the common denominator of a and -2/41. 41 Let m(f) = f*3 - 15f*2 - 12f. Let w be m(17). Let r = w + -4511/12. Let d = 4/1031 + 87323/80418. Find the common denominator of d and r. 156 Let i = -2/3918523 + 56538917/446711622. Find the common denominator of 167/3990 and i. 3990 Find the common denominator of 3/128 - -2512/(-84) and 37/84. 84
Two letters picked without replacement from yqsqsysgsyyyqsgyy. What is prob of picking 2 y? 21/136 Two letters picked without replacement from {z: 1, k: 1, w: 1, x: 3, a: 1}. What is prob of picking 1 w and 1 a? 1/21 Three letters picked without replacement from {g: 2, b: 7, m: 3, d: 8}. What is prob of picking 1 b and 2 m? 7/380 What is prob of picking 1 p and 1 n when two letters picked without replacement from ffpfenpffpffffp? 4/105 What is prob of picking 2 b when two letters picked without replacement from bcccbcbccccccc? 3/91 What is prob of picking 3 n when three letters picked without replacement from {n: 3, p: 1}? 1/4 Four letters picked without replacement from mmmmnmmmnnn. What is prob of picking 4 m? 7/66 What is prob of picking 1 r, 1 v, and 1 y when three letters picked without replacement from {y: 1, v: 2, r: 3, n: 4, s: 1}? 2/55 Calculate prob of picking 2 v and 2 e when four letters picked without replacement from ehvhhveehevewvevvh. 5/68 What is prob of picking 2 c and 1 f when three letters picked without replacement from {i: 1, c: 9, f: 10}? 6/19 Two letters picked without replacement from {m: 4, s: 1, p: 6}. What is prob of picking 1 m and 1 s? 4/55 Three letters picked without replacement from oobppbopwbbopbboob. What is prob of picking 3 p? 1/204 Two letters picked without replacement from jij. What is prob of picking 2 j? 1/3 Three letters picked without replacement from yyhjhyyyyjyyhyhh. Give prob of picking 2 y and 1 h. 9/28 Calculate prob of picking 1 l, 1 s, and 2 h when four letters picked without replacement from hlyydslldylddhyhyld. 5/1292 Four letters picked without replacement from appapaapvaataalvvlav. What is prob of picking 2 v and 2 a? 72/1615 Two letters picked without replacement from {z: 5, u: 7}. What is prob of picking 1 z and 1 u? 35/66 What is prob of picking 3 t when three letters picked without replacement from otooootltto? 4/165 Three letters picked without replacement from {m: 10, c: 5, v: 1, p: 1, y: 3}. What is prob of picking 1 p, 1 m, and 1 y? 1/38 Calculate prob of picking 2 o and 1 b when three letters picked without replacement from {h: 2, o: 5, b: 13}. 13/114 Calculate prob of picking 1 w, 2 p, and 1 l when four letters picked without replacement from {d: 2, p: 2, x: 1, w: 1, s: 2, l: 1}. 1/126 Four letters picked without replacement from rkreakkararakaaz. Give prob of picking 2 r, 1 e, and 1 z. 3/910 Calculate prob of picking 4 z when four letters picked without replacement from zztzzztzzzztzzz. 33/91 Two letters picked without replacement from kowkwqoz. What is prob of picking 1 z and 1 w? 1/14 Calculate prob of picking 1 b and 2 z when three letters picked without replacement from rnnzznbwrryy. 1/220 Calculate prob of picking 1 l, 1 y, and 2 b when four letters picked without replacement from {c: 1, k: 4, y: 3, w: 3, b: 6, l: 2}. 15/646 Three letters picked without replacement from soysosqqfosqssqssqq. What is prob of picking 1 y and 2 o? 1/323 What is prob of picking 3 y when three letters picked without replacement from {m: 1, x: 1, y: 1}? 0 Calculate prob of picking 2 q when two letters picked without replacement from {t: 3, q: 5}. 5/14 Two letters picked without replacement from rrrearrerrraeaeeear. Give prob of picking 2 a. 2/57 Calculate prob of picking 3 v when three letters picked without replacement from {o: 8, u: 1, v: 7, f: 2}. 35/816 Two letters picked without replacement from ogxic. What is prob of picking 1 g and 1 c? 1/10 Calculate prob of picking 1 m and 1 r when two letters picked without replacement from {p: 1, m: 1, r: 1}. 1/3 Four letters picked without replacement from {h: 5, s: 1, a: 8, k: 5, u: 1}. Give prob of picking 1 h, 1 s, and 2 k. 10/969 Two letters picked without replacement from {w: 2, x: 1, n: 2}. Give prob of picking 1 x and 1 n. 1/5 Two letters picked without replacement from nnnnnnnmnmnnnmnn. What is prob of picking 2 n? 13/20 What is prob of picking 1 o, 1 x, and 1 l when three letters picked without replacement from {m: 2, o: 1, v: 2, h: 1, x: 5, l: 4}? 4/91 Calculate prob of picking 4 z when four letters picked without replacement from zzzzzgzzzzzzzzz. 11/15 What is prob of picking 2 s when two letters picked without replacement from {m: 7, c: 1, s: 4, n: 2, h: 6}? 3/95 Three letters picked without replacement from vvvphphvht. What is prob of picking 1 t, 1 h, and 1 p? 1/20 Two letters picked without replacement from aqyaafqoqaao. What is prob of picking 1 y and 1 a? 5/66 Four letters picked without replacement from egysusd. What is prob of picking 1 d, 1 y, 1 u, and 1 e? 1/35 Four letters picked without replacement from jhhjkjjwjhjhhhhjjk. Give prob of picking 3 j and 1 w. 14/765 Two letters picked without replacement from {n: 1, q: 8, d: 2, f: 1, z: 1, x: 2}. Give prob of picking 1 z and 1 d. 2/105 Three letters picked without replacement from vssvvmsvvjmr. Give prob of picking 1 s, 1 v, and 1 m. 3/22 Two letters picked without replacement from ppepee. Give prob of picking 2 e. 1/5 Two letters picked without replacement from {r: 3, e: 1, j: 3, q: 8, b: 4}. What is prob of picking 2 j? 1/57 Calculate prob of picking 1 m and 1 o when two letters picked without replacement from immmommmmmmiimm. 11/105 Two letters picked without replacement from kkeeecekkeekekeekkk. Give prob of picking 1 k and 1 c. 1/19 Three letters picked without replacement from {r: 8, i: 2, d: 1, m: 5}. What is prob of picking 1 m, 1 i, and 1 r? 1/7 Four letters picked without replacement from {w: 2, f: 2, k: 1, o: 1}. What is prob of picking 4 w? 0 Calculate prob of picking 1 m and 1 x when two letters picked without replacement from {x: 4, m: 1, l: 1, n: 2}. 1/7 Four letters picked without replacement from {u: 2, y: 1, t: 3, g: 4, f: 1}. What is prob of picking 1 u, 2 t, and 1 g? 4/55 Four letters picked without replacement from cpcccccpcccpcccccc. What is prob of picking 2 c and 2 p? 7/68 Two letters picked without replacement from fzeezf. Give prob of picking 2 e. 1/15 Two letters picked without replacement from {n: 4, w: 3, c: 1, z: 2, o: 1, k: 1}. Give prob of picking 1 w and 1 c. 1/22 Calculate prob of picking 1 x and 3 m when four letters picked without replacement from mmxmxm. 8/15 Two letters picked without replacement from nreellednn. Give prob of picking 1 l and 1 r. 2/45 Three letters picked without replacement from lffkozzlfoollllz. What is prob of picking 1 l, 1 f, and 1 o? 27/280 Three letters picked without replacement from {w: 7, f: 3}. Give prob of picking 3 w. 7/24 Three letters picked without replacement from ppppppbpppbbbb. What is prob of picking 2 p and 1 b? 45/91 Two letters picked without replacement from {m: 4, s: 5, d: 8}. Give prob of picking 1 d and 1 s. 5/17 Four letters picked without replacement from zczzzcczzzzzzzzzzz. Give prob of picking 1 z and 3 c. 1/204 Four letters picked without replacement from wwcwwwcwww. Give prob of picking 2 c and 2 w. 2/15 Calculate prob of picking 1 x and 2 i when three letters picked without replacement from iipiiipiiiiixxooioio. 11/95 Four letters picked without replacement from mmffmmmmjmmmjjmmmmmm. What is prob of picking 2 j, 1 m, and 1 f? 6/323 Two letters picked without replacement from axguagaaiiagxib. What is prob of picking 2 i? 1/35 Three letters picked without replacement from {d: 3, n: 4, b: 8, p: 2}. Give prob of picking 2 b and 1 p. 7/85 Three letters picked without replacement from {w: 6, v: 2, s: 3, q: 2}. What is prob of picking 3 w? 10/143 Calculate prob of picking 2 i and 1 n when three letters picked without replacement from {i: 8, n: 3}. 28/55 Four letters picked without replacement from {z: 2, f: 10}. Give prob of picking 3 f and 1 z. 16/33 Calculate prob of picking 2 t, 1 l, and 1 o when four letters picked without replacement from ttbnnbbnononbnblon. 1/1020 What is prob of picking 2 l and 2 u when four letters picked without replacement from lulllluullll? 12/55 Calculate prob of picking 1 h, 1 l, and 1 f when three letters picked without replacement from {f: 3, b: 8, l: 2, h: 2, x: 5}. 1/95 Three letters picked without replacement from {w: 1, a: 12, u: 7}. What is prob of picking 2 u and 1 a? 21/95 Two letters picked without replacement from {l: 3, f: 4, v: 4}. Give prob of picking 1 v and 1 f. 16/55 Calculate prob of picking 2 f and 1 k when three letters picked without replacement from fffcdfffddfkfdcfsf. 15/272 What is prob of picking 2 r and 2 n when four letters picked without replacement from nrrrnnrrlrrrrrl? 9/91
What is the tenth root of 17336 to the nearest integer? 3 What is 13 to the power of 1/5, to the nearest integer? 2 What is 7156 to the power of 1/6, to the nearest integer? 4 What is 112 to the power of 1/4, to the nearest integer? 3 What is 162814 to the power of 1/5, to the nearest integer? 11 What is 150626 to the power of 1/2, to the nearest integer? 388 What is 618 to the power of 1/7, to the nearest integer? 3 What is 111511 to the power of 1/3, to the nearest integer? 48 What is the fourth root of 5898 to the nearest integer? 9 What is the fourth root of 113 to the nearest integer? 3 What is the cube root of 63372 to the nearest integer? 40 What is the cube root of 1352 to the nearest integer? 11 What is the fourth root of 1613 to the nearest integer? 6 What is the sixth root of 39063 to the nearest integer? 6 What is 47486 to the power of 1/2, to the nearest integer? 218 What is 23403 to the power of 1/2, to the nearest integer? 153 What is the square root of 141 to the nearest integer? 12 What is 21943 to the power of 1/7, to the nearest integer? 4 What is 5828 to the power of 1/2, to the nearest integer? 76 What is the third root of 39647 to the nearest integer? 34 What is 103234 to the power of 1/2, to the nearest integer? 321 What is 7553 to the power of 1/4, to the nearest integer? 9 What is the square root of 127129 to the nearest integer? 357 What is the cube root of 3280 to the nearest integer? 15 What is 21699 to the power of 1/6, to the nearest integer? 5 What is the cube root of 2406 to the nearest integer? 13 What is the third root of 17071 to the nearest integer? 26 What is the sixth root of 1052 to the nearest integer? 3 What is 1270 to the power of 1/6, to the nearest integer? 3 What is 5164 to the power of 1/9, to the nearest integer? 3 What is 60729 to the power of 1/10, to the nearest integer? 3 What is the fifth root of 4008 to the nearest integer? 5 What is 3051 to the power of 1/8, to the nearest integer? 3 What is the square root of 3381 to the nearest integer? 58 What is 65136 to the power of 1/8, to the nearest integer? 4 What is 22315 to the power of 1/3, to the nearest integer? 28 What is the cube root of 22325 to the nearest integer? 28 What is 17059 to the power of 1/10, to the nearest integer? 3 What is the seventh root of 1798 to the nearest integer? 3 What is the fifth root of 1847 to the nearest integer? 5 What is the square root of 5465 to the nearest integer? 74 What is the square root of 1209 to the nearest integer? 35 What is the third root of 5770 to the nearest integer? 18 What is the third root of 51600 to the nearest integer? 37 What is 1244 to the power of 1/10, to the nearest integer? 2 What is the square root of 10043 to the nearest integer? 100 What is 9447 to the power of 1/7, to the nearest integer? 4 What is 1944 to the power of 1/9, to the nearest integer? 2 What is 12228 to the power of 1/10, to the nearest integer? 3 What is the square root of 5917 to the nearest integer? 77 What is 1240 to the power of 1/6, to the nearest integer? 3 What is 371 to the power of 1/2, to the nearest integer? 19 What is the third root of 1573 to the nearest integer? 12 What is the square root of 3248 to the nearest integer? 57 What is the square root of 4343 to the nearest integer? 66 What is the third root of 136 to the nearest integer? 5 What is 877 to the power of 1/3, to the nearest integer? 10 What is the third root of 81396 to the nearest integer? 43 What is the square root of 18333 to the nearest integer? 135 What is the ninth root of 6155 to the nearest integer? 3 What is the fourth root of 67329 to the nearest integer? 16 What is 510 to the power of 1/3, to the nearest integer? 8 What is 688 to the power of 1/9, to the nearest integer? 2 What is 133773 to the power of 1/3, to the nearest integer? 51 What is the sixth root of 26888 to the nearest integer? 5 What is 11242 to the power of 1/2, to the nearest integer? 106 What is 1064 to the power of 1/10, to the nearest integer? 2 What is the square root of 1737 to the nearest integer? 42 What is 145 to the power of 1/2, to the nearest integer? 12 What is 108 to the power of 1/6, to the nearest integer? 2 What is the fourth root of 975 to the nearest integer? 6 What is the square root of 9160 to the nearest integer? 96 What is the sixth root of 1657 to the nearest integer? 3 What is the square root of 15275 to the nearest integer? 124 What is the third root of 10149 to the nearest integer? 22 What is the fourth root of 58377 to the nearest integer? 16 What is the seventh root of 7364 to the nearest integer? 4 What is the cube root of 930 to the nearest integer? 10 What is 798 to the power of 1/8, to the nearest integer? 2 What is 8738 to the power of 1/3, to the nearest integer? 21 What is the cube root of 1580 to the nearest integer? 12 What is the tenth root of 395 to the nearest integer? 2 What is the fifth root of 362 to the nearest integer? 3 What is the tenth root of 98152 to the nearest integer? 3 What is the square root of 2386 to the nearest integer? 49 What is the square root of 7515 to the nearest integer? 87 What is the third root of 1550 to the nearest integer? 12 What is the square root of 2079 to the nearest integer? 46 What is 470 to the power of 1/2, to the nearest integer? 22 What is the cube root of 9252 to the nearest integer? 21 What is 11470 to the power of 1/5, to the nearest integer? 6 What is the cube root of 877 to the nearest integer? 10 What is 22247 to the power of 1/2, to the nearest integer? 149 What is 37830 to the power of 1/7, to the nearest integer? 5 What is 991 to the power of 1/2, to the nearest integer? 31 What is the cube root of 1833 to the nearest integer? 12 What is 13621 to the power of 1/2, to the nearest integer? 117 What is 672 to the power of 1/9, to the nearest integer? 2 What is 8225 to the power of 1/5, to the nearest integer? 6 What is the square root of 238 to the nearest integer? 15 What is the square root of 337 to the nearest integer? 18 What is 390 to the power of 1/2, to the nearest integer? 20 What is the seventh root of 2208 to the nearest integer? 3 What is the third root of 2344 to the nearest integer? 13 What is 55 to the power of 1/3, to the nearest integer? 4 What is 130170 to the power of 1/2, to the nearest integer? 361 What is the square root of 56273 to the nearest integer? 237 What is the cube root of 65593 to the nearest integer? 40 What is the sixth root of 857 to the nearest integer? 3 What is 528 to the power of 1/8, to the nearest integer? 2 What is 247 to the power of 1/2, to the nearest integer? 16 What is the square root of 54790 to the nearest integer? 234 What is the third root of 9721 to the nearest integer? 21 What is the square root of 12013 to the nearest integer? 110 What is 1210 to the power of 1/2, to the nearest integer? 35 What is 81263 to the power of 1/10, to the nearest integer? 3 What is the cube root of 72958 to the nearest integer? 42 What is 880 to the power of 1/2, to the nearest integer? 30 What is 4206 to the power of 1/3, to the nearest integer? 16 What is 64221 to the power of 1/6, to the nearest integer? 6 What is 1271 to the power of 1/9, to the nearest integer? 2 What is the cube root of 5022 to the nearest integer? 17 What is 1264 to the power of 1/3, to the nearest integer? 11 What is the square root of 489 to the nearest integer? 22 What is 5900 to the power of 1/3, to the nearest integer? 18 What is the sixth root of 3754 to the nearest integer? 4 What is 4986 to the power of 1/5, to the nearest integer? 5 What is the sixth root of 25041 to the nearest integer? 5 What is 514 to the power of 1/2, to the nearest integer? 23 What is the cube root of 7420 to the nearest integer? 20 What is 33133 to the power of 1/4, to the nearest integer? 13 What is 76338 to the power of 1/3, to the nearest integer? 42 What is the third root of 270 to the nearest integer? 6 What is 96752 to the power of 1/10, to the nearest integer? 3 What is the ninth root of 44335 to the nearest integer? 3 What is 52478 to the power of 1/2, to the nearest integer? 229 What is 104624 to the power of 1/8, to the nearest integer? 4 What is 3579 to the power of 1/3, to the nearest integer? 15 What is 1265 to the power of 1/8, to the nearest integer? 2 What is 1915 to the power of 1/2, to the nearest integer? 44 What is the seventh root of 1103 to the nearest integer? 3 What is 32109 to the power of 1/6, to the nearest integer? 6 What is 764 to the power of 1/3, to the nearest integer? 9
Let v be 0 + -1 + (-16)/(-1). Let u be (-100)/v(1 + -4). Suppose 7 + u = 3s. Is s prime? False Suppose 2x - x = 3, l = -2x - 82. Let s be -33 - (-1 + -2 + 3). Let o = s - l. Is o a prime number? False Suppose 4b - 3q = 5, -b - 5q + 27 + 3 = 0. Suppose f - i = -4f - 5, -5i + 25 = -bf. Suppose 5r - 85 - 30 = f. Is r prime? True Let q be ((-40)/50)/(4/(-10)). Suppose t - 250 = -qw, -3w - 3t + 230 + 139 = 0. Is w a composite number? False Let b be (0 - 1 - -2) + -3. Is b/(-4) + (-97)/(-2) a composite number? True Let a = 6 + -3. Suppose -aj + 154 = -j. Is j a composite number? True Suppose 5d = -v - 138 + 1397, -3739 = -3v + 4d. Is v a composite number? False Suppose -7y = -2y + 5. Is y/2 - 525/(-6) prime? False Let z(w) = w*2 - 6w - 10. Let h be z(7). Let q = 3 + h. Suppose -4v + 5o = -220, qv - 5o + 220 = 4v. Is v a prime number? False Suppose -4z + 471 = -533. Is z a composite number? False Suppose 0 = -2w + 136 + 90. Is w composite? False Let j be 110/6(1 + 2). Let b be 3/6 + (-11)/(-2). Suppose -o = -bo + j. Is o prime? True Let i be 1/((-1 - -3)/(-2)). Let l(z) = -34z + 1. Is l(i) a prime number? False Suppose -224 = -n + 51. Let f be n(-3)/((-15)/(-2)). Is (3/(-6))/(1/f) a composite number? True Let o be (60/18)/((-2)/(-3)). Suppose -oc + 16 = -2u, -2c + c - 4 = -4u. Suppose uj - 158 = -0j. Is j prime? True Let p be (-21 + 6/3)7. Let y = -80 - p. Is y a composite number? False Let t be (2 - -8) + 18/6. Suppose -w - 2 = 4g - 3g, -4w = -4g + 8. Let r = w + t. Is r a composite number? False Let w(p) = 2 - 1 + 2p2 + 2p - p*2 - 5p + 16p3. Is w(2) prime? True Suppose -2i - 5y - 129 = -471, 2y + 180 = i. Let x = 303 - i. Is x composite? False Let n = -354 + 1271. Suppose 3z - o + 0o = n, -o = -5z + 1525. Suppose 3v + 5g - 284 = 0, -2g + g + z = 3v. Is v prime? True Suppose 5g + y - 1020 = 0, -2g + 2y + 2y = -430. Suppose -55 - g = -4o. Suppose 5 = 2v - o. Is v a prime number? False Suppose -4k - 5 - 3 = 0. Let v be (-2)/(-1)(k - -4). Suppose 66 = vr - 5o, -5o + 18 - 98 = -5r. Is r a prime number? False Let h(c) = 180c*2 - 9c - 14. Let k(n) = -36n2 + 2n + 3. Let m(l) = -2h(l) - 11k(l). Is m(-6) a composite number? True Let w(j) = 3j2 - 27j + 13. Is w(11) a prime number? True Suppose -2g = -84 - 64. Suppose -4m + 726 = g. Is m composite? False Suppose -2528 = -r - 5n, r + 4n = 2r - 2501. Is r prime? False Suppose -2g - 482 = 3h, 0 = -3g - 1 - 2. Let f = 303 + h. Is f a composite number? True Let b(h) be the third derivative of h7/1260 + h6/240 - h5/20 - h4/24 + 2h2. Let o(u) be the second derivative of b(u). Is o(7) a composite number? False Let y(u) = -2u*2 + 5u + 2. Let t be y(-4). Let g be 5-3 + 1 + 1. Let n = g - t. Is n a composite number? False Let k(r) = 9r*2 - 8 + 3r*3 - 2r*3 - 3 - 12r. Let z = 5 + -13. Is k(z) composite? False Suppose -3a + 3x + 9 = 0, -a - 6x = -3x + 13. Let t = a + 4. Suppose -3w - tg = -81, 0 = 5w - 0w + g - 119. Is w composite? False Suppose -3l = -4z - 151, l + 2z - 54 + 7 = 0. Is l prime? False Let u(r) = -94r - 1. Let j be u(-5). Suppose j = 5y + 94. Let x = y + -22. Is x prime? True Let q(h) = -48h - 21. Let n be 18/2(-1)/1. Is q(n) a prime number? False Let h(z) = z3 + 7z*2 - 8z - 9. Let c be h(-8). Let i = -15 - c. Is 5 + 2(-3)/i prime? False Is 146(-3)/(-9) + (-1)/(-3) a prime number? False Suppose -12m = -35048 + 2276. Is m a prime number? True Let t(r) = -4r - 18. Is t(-10) composite? True Let n be 0/(1 - 0/(-2)). Suppose 11 = 5m + 4v, 4v + 4 = -0v. Suppose 0 = 3s - 5b - 38, n = b - 4b - m. Is s a composite number? False Let h(i) = i + 1. Let n be h(4). Suppose -nu = -396 - 329. Is u a prime number? False Let q = -4 + 6. Let f be q/3 - (-1295)/(-21). Let b = -39 - f. Is b composite? True Let f be 100/(14/6). Let h = f - 95. Is h a composite number? True Let b = 164 - -143. Is b a prime number? True Suppose 4k + 3o - 2 - 13 = 0, k + 15 = 3o. Is 37 - 2 - k - 0 prime? False Let u(m) = m*2 + 5m - 10. Let f(s) = 3s2 + 19s - 41. Let h(c) = -2f(c) + 9u(c). Is h(-6) a prime number? False Let h = 125 - 74. Is h a composite number? True Is 4/(-2) + -2 + 135 prime? True Suppose -4d + 3l + 15 = -14, -2d + l = -13. Suppose o - 2o = 4m - 156, 4o = dm - 174. Is m a composite number? True Suppose 0 = 3q - 8q - 3h - 36, h = 3. Is (22/(-3))/(2/q) a composite number? True Let k(u) = 149u3 - 4u*2 + 2u + 1. Is k(2) a composite number? False Suppose -3u = 77 - 32. Let v be ((-12)/u)/(1/70). Suppose q = -v + 219. Is q a prime number? True Suppose 5 = 2h - h. Suppose 4y + 58 = hx, 0y + 9 = 3y. Is x a prime number? False Let i(f) = -f*3 + 6f*2 - 3f + 4. Let g be -1(-1 + -4 + 0). Is i(g) prime? False Let q = 5 + -9. Let v be (q1)/(4/8). Is ((-58)/v)/((-7)/(-84)) prime? False Let c be (2 + (-1 - -2))/1. Suppose s = -1, 3x - cs - 17 = -2. Suppose xy - 131 = 3y. Is y prime? True Suppose -5b = -402 - 458. Suppose a = 2i - a - b, 0 = -2i + 4a + 178. Is i a prime number? True Let z(n) = 0 + 4 - 4n - 5 + 77n. Suppose -4 + 0 = -2g. Is z(g) composite? True Suppose 2q = -4 + 8. Suppose -m = -qm - 16. Let f = m - -59. Is f prime? True Let t be 1/(-2) + 3969/14. Let c = t - 92. Is c a composite number? False Let j(f) be the third derivative of 5/6f*3 + 1/60f*5 - 1/3f*4 + 0f + 0 + f*2. Is j(-6) prime? True Let g(o) = -2o + 1. Let a be g(-1). Is (-1)/(2a/(-402)) a prime number? True Let l be (1/(-3))/((-3)/9). Let u be l + -1(-2 + 1). Suppose 0 = -4a - uz + z + 127, 4z = 3a - 119. Is a prime? False Let y(r) = -r*2 - 6r + 5. Let m be y(-6). Suppose -m + 2 = -o. Suppose 0 = -c + 2, oc = -x - 0x + 43. Is x a prime number? True Suppose -u - u = -12. Let p be (-2)/u - (-10)/3. Suppose -pr - 2r + 345 = 0. Is r prime? False Let b = 3109 + -1356. Is b prime? True Let b(p) = 3p3 + 3p + 1. Is b(4) prime? False Suppose 4y - 16 + 0 = 0. Let k(v) = 2v - 5. Let g be k(y). Is g/((-6)/4)-23 a prime number? False Let l(j) = -j3 + 2j*2 + 4j - 1. Let b be l(3). Suppose a - b = -1. Is 0 + 48/2 + a composite? True Let s be (-6)/(-21) + 19/7. Suppose -11 = -sn - 2. Is (3 + -2)/(n/159) a prime number? True Let p(g) = -3g*2 + 2g + 1. Let j be p(-1). Is 6552/15 + j/(-20) composite? True Let i = -2575 + 5738. Is i composite? False Suppose 2l = -g - 0g - 63, 4g = -20. Let f = 18 - l. Is f prime? True Let x be (-15)/20 - 5/4. Is -1 + (x - -3) + 65 a prime number? False Let n = 7 - 1. Suppose 2l = nl - 16. Let h(y) = -y2 + 8y - 2. Is h(l) a composite number? True Let j(m) = -m*2 - 9m + 7. Let b be (-2)/(-1) + (-1 - 10). Is j(b) a prime number? True Suppose -o + 0v - 4v + 2 = 0, -5o - 5v = -40. Suppose -5k + 3y = -0y - 165, 0 = 2y - o. Let w = 89 - k. Is w composite? False Suppose x - 4p = -9p + 694, -2093 = -3x - 4p. Is x a composite number? True Let w(k) = -5k + 2. Let v be w(2). Let y(r) = 58r + 5. Let j(f) = 19f + 2. Let p(u) = vj(u) + 3y(u). Is p(1) a prime number? False Suppose -7a + 3a = 260. Suppose -2j - 204 + 6 = 0. Let t = a - j. Is t composite? True Let b(j) = j*3 + 9j*2 - 11j. Is b(-10) prime? False Suppose 3s - 3 = -z + 8s, -59 = 2z + 3s. Let u = -171 - z. Is 6/(-21) + u/(-7) a composite number? True Let r = 4 + -6. Is r/((-2)/(-57))-1 prime? False Let u(w) = -w2 + 4w - 1. Let a be u(2). Let g be (516/(-18))/((-2)/a). Suppose g = 4f - 9. Is f composite? False Suppose -4p = 2 + 26. Let g be (-7)/(-4)(15 + -3). Let q = p + g. Is q a composite number? True Suppose -23 = -5t - n, 0n + 4n - 17 = -5t. Let x(q) = 6q*3 - 7q*2 - 2q + 12. Is x(t) prime? True Let g(m) = 97m + 8. Let t be g(6). Suppose 3b - t = -2b. Is (b/4)/(2/4) a prime number? True Let m be 1/4 + (-7)/(-4). Let n be -1(0 + -2)/(-2). Is (-33 + m + 0)/n a prime number? True Let r(g) = 7g2 + 6g - 7. Let o be 2/(3/3) + 1. Is r(o) prime? False Suppose -2 = -3x + 2x. Suppose -j = 4p + j + 462, -5p - 577 = xj. Let u = p + 168. Is u composite? False Let o(k) = k3 + 8k*2 + 6k - 7. Let l be o(-7). Suppose lc = -c. Suppose -2j = -m + 33, c = -m - 6j + 2j + 9. Is m prime? False Let a = -95 - -237. Is a a composite number? True Suppose -k + 580 + 1179 = 0. Is k prime? True Let c(b) be the second derivative of -b5/20 - b4/3 + b3 - b2/2 - 3b. Is c(-6) a prime number? False Let d(k) = -27k + 2 - 2 + 2. Suppose y + 3v = -3y - 6, y - 1 = -2*v. Is d(y) a prime number? True
Suppose 6g - 1599990 = -5r + g, -g = -4r + 1280002. What is r rounded to the nearest 100000? 300000 Let t = -1.88 + 2.99. Let j = 0.01 - t. Round j to 1 dp. -1.1 Suppose 4o - r = -2r + 14, 3o - 4 = -4r. Suppose oj + 0j = -324000. Round j to the nearest 10000. -80000 Let m = -39.0989 - -39.31. Let d = -1.0781 + m. Let r = 0.91 + d. What is r rounded to two dps? 0.04 Let o = -0.053105 - -0.053. What is o rounded to five decimal places? -0.00011 Let f(a) = -a3 - 15a*2 + 5a - 9. Let w be f(-19). Round w to the nearest 100. 1300 Let j = 107 - -65. Let a = j + -189.1. What is a rounded to the nearest integer? -17 Let z(s) = 24872s2 - 3s + 1. Let w be z(3). Suppose 32320 = -2x - 2v, 4x + 42758 = v - 21882. Let m = w - x. Round m to the nearest one hundred thousand. 200000 Let k = -1 + 0.9. Let i = 36.6977 + -36.5977035. Let w = i + k. Round w to six dps. -0.000004 Suppose -3o - 11278 + 62803 = 0. Suppose 0b + 15 = 3b, -o = d + 5b. What is d rounded to the nearest one thousand? -17000 Let s(v) = 3v*2 + 7v + 4. Let n be s(-5). Let b = n - 19. What is b rounded to the nearest 10? 30 Let j = 2.3 - -0.7. Let a = 5.59 - 2.6. Let y = a - j. Round y to one dp. 0 Let h = 9.5 + -1.5. Let w = h + -2. Let l = w + -6.000012. Round l to five dps. -0.00001 Let h be 8/(-44) + 57/11. Suppose 2m - hj - 105593 = 0, -m - 18365 = j - 71151. Suppose -1397211 = 5n + m. What is n rounded to the nearest 100000? -300000 Let q = -205336 - -605336. Round q to the nearest one million. 0 Let i = 0.2527 - -0.0543. What is i rounded to 2 dps? 0.31 Let n = -10.0000052 - -10. Round n to six decimal places. -0.000005 Suppose -3y + 5h = -127, 0 = -0h - 2h - 4. What is y rounded to the nearest ten? 40 Let y = 1242 + 978. What is y rounded to the nearest 1000? 2000 Let g(u) = 100u. Let j be g(6). Suppose j = -3c + 5c. Round c to the nearest one thousand. 0 Suppose 0 = -5d + 75829 - 27789. Suppose 2s = 2j - d, 2j - 1098 = -4s + 8486. Round j to the nearest 1000. 5000 Suppose 4r = -r. Suppose 3v - 3k - 6 = 0, rk - 15 = -5k. Suppose -1400004 = -vq - w, 0q - 4w - 279984 = -q. Round q to the nearest 100000. 300000 Suppose -5u = -5j - 19999975, 4u + 3048992 = j + 19048987. What is u rounded to the nearest one million? 4000000 Let n = -1 - -4. Suppose 349791 = ng + 2209791. What is g rounded to the nearest 100000? -600000 Let u = 96.193 - 0.193. Let m = 164 - u. Let a = m + -68.0027. What is a rounded to three dps? -0.003 Let d = 492729 + -340029. What is d rounded to the nearest ten thousand? 150000 Let r = 9077.019042 - 9077. Let f = -43 + 42.981. Let p = r + f. What is p rounded to 5 decimal places? 0.00004 Let j = 7 + -6.9999989. Round j to six decimal places. 0.000001 Let c = -113071 + 194035. Let f = 80958.9933 - c. Let z = 5 + f. What is z rounded to three decimal places? -0.007 Let q = 17923.11195043 + -17933.21195. Let p = -10.1 - q. Round p to seven decimal places. -0.0000004 Let k(h) = 259h - 28. Let o be k(-4). Round o to the nearest one hundred. -1100 Let r = -116 + 110.9. Round r to the nearest integer. -5 Suppose 4q = k - 53, -5q - 5k - 1 = -6q. Round q to the nearest ten. -10 Let d = -4 - -1. Let z be (-5700047)/d + (-8)/12. Suppose -o + 6q - z = 3q, 3o + 3q + 5699985 = 0. Round o to the nearest one million. -2000000 Let r = -32.99 - 1.21. Let g = -34.500025 - r. Let o = 0.3 + g. Round o to five decimal places. -0.00003 Let s = 0.08 + 0.72. What is s rounded to the nearest integer? 1 Let x = 564.2305 - 583.24. Let m = -19 - x. What is m rounded to 3 dps? 0.01 Let d = 49 + -82. Let u = 3.9496609 + -36.9496666. Let a = d - u. What is a rounded to 6 decimal places? 0.000006 Let z = -32.9999976 + 33. What is z rounded to 6 decimal places? 0.000002 Let z(d) be the third derivative of d5/60 - d3/3 - d*2. Let m be z(0). Let n be 1160/2m/(-4). Round n to the nearest 100. 300 Let i = 2.08 - 0.7. Let g = -0.16 + -0.01. Let f = g + i. Round f to one decimal place. 1.2 Let v = -7.1 - -7.099721. Round v to four decimal places. -0.0003 Let b be -391004 + (0 - 2)-2. What is b rounded to the nearest 10000? -390000 Let i = 4.0000147 + -4. Round i to six dps. 0.000015 Let x be ((-24)/(-9))/(3/(-54)). Round x to the nearest 10. -50 Suppose -3t - 36 = 3t. Let d(r) = -566668r - 8. Let h be d(t). Round h to the nearest one million. 3000000 Let a = -12.40000158 - -12.4. What is a rounded to 7 decimal places? -0.0000016 Let q be 147/9 - 2/6. Suppose -q = -3y - y. Suppose 1196 = -2b + 2v, 2b - yv - 119 = -1311. Round b to the nearest 100. -600 Let v = -3.943 - 0.177. What is v rounded to zero decimal places? -4 Let q = 16 - 14.8. Let c = 4.36 - 0.26. Let p = c + q. Round p to the nearest integer. 5 Let r = -30.3 + 29. Let q = -0.8 - r. Round q to one dp. 0.5 Suppose r + 10 = 2q - 1, -3r - 30 = -5q. Let c = -479820 + 743120. Suppose qa = c + 186700. Round a to the nearest one hundred thousand. 200000 Let o = -15.9 + 15. Let i = o - 0.1. Let l = 0.975 + i. What is l rounded to two dps? -0.03 Let r be (-4)/(-6)35. Let g(o) = o2 - ro + 2o2 + 1 + 13o. Let i be g(4). What is i rounded to the nearest ten? 60 Let u = -467840 - -7567840. Round u to the nearest one million. 7000000 Let f = -5950 - -5949.880016. Let u = 0.12 + f. Round u to five dps. 0.00002 Let i = -4.4 + 4.399755. What is i rounded to 5 decimal places? -0.00025 Let i = -1941.1473 + -34242935.8527. Let a = -34244904.9999896 - i. Let h = 28 + a. What is h rounded to six dps? 0.00001 Let m = -18 + 18.0024. Round m to 3 dps. 0.002 Let v = 133348.404 + -133685. Let r = 336 + v. Let x = 0.5 + r. What is x rounded to two dps? -0.1 Let x(d) = d + 1. Let m be x(1). Let b be (8 - 8)/(4/m). What is b rounded to the nearest 1000? 0 Let p = -14 - -14.0068. Round p to 3 decimal places. 0.007 Let k be (12/9)/(32/72). Suppose -ko = 2l - 7l - 94800015, 4o - 126400009 = 3l. What is o rounded to the nearest one million? 32000000 Suppose 3i - 3v - 11565 = 0, -2i - 3v + 6v = -7707. Suppose -u + 73858 = i. Round u to the nearest 10000. 70000 Let t = 4.057 - 0.067. Let z = t - -0.01. Let q = z + -3.35. Round q to 1 dp. 0.7 Let s = 2760706 + -2760702.9999972. Let y = 0.4 - 3.4. Let u = y + s. Round u to six decimal places. 0.000003 Let n = 0.17 + 0.34. Let l = -0.25 - n. Let c = -0.14 + l. Round c to zero dps. -1 Let z be 2903 + (-6 + 3)/1. What is z rounded to the nearest one thousand? 3000 Let z = -5.1 + -39.9. Let w = -110.3 - -64.91. Let f = w - z. Round f to one dp. -0.4 Let d = 821.8 - 737. What is d rounded to the nearest 10? 80 Let f = 4.95 - 4.9717. Round f to 3 dps. -0.022 Let i be ((-3)/(-1))/((-12)/32). Let q(u) be the second derivative of -u*3/6 - 11u*2/2 - u. Let j be q(i). What is j rounded to 0 decimal places? -3 Let h = -8 + 75. Let q = -66.999911 + h. What is q rounded to five decimal places? 0.00009 Let n = -15436372 - -15436375.9999948. Let j = 4.06 - 0.06. Let p = n - j. What is p rounded to six dps? -0.000005 Let c = 6 - 6.045. Let l = 4667191 - 4667191.04500098. Let s = c - l. Round s to seven dps. 0.000001 Let r = -0.37 + -0.08. Round r to 1 decimal place. -0.5 Let k = -333.853 - -334. Round k to 2 dps. 0.15 Let m = -14421 - 4479. What is m rounded to the nearest 1000? -19000 Let v = 5.04 - 5. Let b = v + -0.74. What is b rounded to 1 decimal place? -0.7 Let a = -78.134 - -78. Let q = a - -0.12. What is q rounded to two decimal places? -0.01 Let l = -114 - -114.0005. Round l to 4 dps. 0.0005 Let r = -0.02 - 0.98. Let j = -0.9999877 - r. Round j to six decimal places. 0.000012 Let t = -834.35 - -814. Let c = 0.35 + t. Let u = c + 20.0045. Round u to 3 dps. 0.005 Let n = 1 + -0.2. Let g = -0.800015 + n. What is g rounded to six decimal places? -0.000015 Let i = 2.0000053 - 2. Round i to 6 decimal places. 0.000005 Suppose -4l + 65581 = 21981. Round l to the nearest one thousand. 11000 Let u = 337.000000606 - 337. Round u to 7 dps. 0.0000006 Let w = -0.0000034 + 0. Round w to five dps. 0 Let l(m) = -m + 4. Let n be l(4). Suppose -2g - 4u + 4600000 = n, 5u + 0u - 9200000 = -4*g. Round g to the nearest one million. 2000000 Let d = -6056.8 - -6068.79835. Let v = -12 + d. Round v to 4 decimal places. -0.0017 Let r = -0.04 - -0.54. Let g = -0.49999943 + r. What is g rounded to seven dps? 0.0000006 Let g = 19.8 + -33.5. Let o = -0.3 + 13.3. Let x = o + g. Round x to the nearest integer. -1 Let f = -12 + -9. Let l = f + 21.0098. What is l rounded to 3 decimal places? 0.01
Suppose 5f - 8 = -4w, -3w - 3f = 2 - 11. Let b be ((-26)/(-4))/(w/14). Let c(m) = -bm + 13m - 8m. Let h(d) = -2d*2. Give h(c(g)). -128g*2 Let w(t) be the third derivative of -3t*4/8 + 2t*3/3 + 116t*2. Let a(b) = 3b. What is w(a(q))? -27q + 4 Let d(g) = -22g*2 - 3g. Let j(q) = 30q + 26q - 89q + 30q. Determine d(j(i)). -198i2 + 9i Let m(z) = -602z - 516. Let l(b) = -b - 1. Let o(j) = -516l(j) + m(j). Let s(f) = f. Determine s(o(v)). -86v Let g(c) = -21c + 10c2 - 6c*2 + 62c + 25c - 3c2. Let u(o) = -o. What is g(u(v))? v2 - 66v Let z(x) = -4x*2. Let l be ((-5352)/(-60))/(1/10). Let b(g) = 3g*2 - lg + 892g. Give z(b(v)). -36v*4 Let n(d) = -27d. Let b(o) = 37o. Give n(b(a)). -999a Let v(i) = 2i2 + 104i + 94i - 198i. Let o(s) be the third derivative of -s4/24 + s2. Determine v(o(u)). 2u2 Let m(l) = 3l*2 + 10l + 5. Let g be m(-3). Let a(j) = -gj - 8j + 4j + 3j. Let s(o) = 2o2. What is a(s(w))? -6w*2 Let d(h) = -8h*2 - 2h - 2. Let t(q) = q*2 - q - 1. Let n(z) = d(z) - 2t(z). Let x(k) = 11k2. Determine x(n(g)). 1100g*4 Let k(f) = 10f. Let r(p) = -1916p. Determine r(k(a)). -19160a Let n(c) = -3c + 1. Let s(a) = -2a*2 - 2a + 2. Let q(p) = -p + 1. Let z(l) = -2q(l) + s(l). Calculate z(n(o)). -18o*2 + 12o - 2 Let r(w) be the second derivative of -37w3/6 + w2/2 + w + 18. Let g(h) = -h. Give g(r(q)). 37q - 1 Let c(v) be the second derivative of v*3/6 + v. Let o(u) = 17u - 22u + 28u + 17u. Determine o(c(k)). 40k Let a(c) be the first derivative of c*3 - 1. Let h(q) be the third derivative of -61q*2 + 0q*3 + 1/8q*4 + 0 + 0q. What is a(h(g))? 27g2 Let b(t) = -2t. Let q(o) be the third derivative of 0 - 9o2 + 1/30o*5 + 0o*4 + 0o + 0o3. Determine b(q(v)). -4v*2 Let j(n) be the second derivative of -7n*3/6 + 29n. Let o(i) = -i + 6i - i. Give j(o(h)). -28h Let p(b) = -24b - 3. Let a(k) = -49k - 7. Let j(t) = 3a(t) - 7p(t). Let y(u) be the first derivative of 2u3/3 - 867. Determine y(j(z)). 882z2 Let p(a) = -a2 + 17802. Let w(t) = -t2. Calculate w(p(r)). -r4 + 35604r2 - 316911204 Let p(i) = -57i*2 - 12. Let x(s) = 23s*2 + 5. Let k(y) = 5p(y) + 12x(y). Let v(o) be the first derivative of 2o*2 - 249. Give k(v(r)). -144r2 Let x(j) = j2 - 36. Let b(v) = -2v - 2. Let q(n) = -10n*2 + 2n + 2. Let i(c) = -b(c) - q(c). What is i(x(y))? 10y4 - 720y2 + 12960 Let a(h) be the second derivative of -h4/6 - h. Let c(v) = v + 13. Let w be c(-11). Let k(x) = -x*2 + 0x*2 + 2x*w. Calculate k(a(u)). 4u4 Let j(a) = a2. Let q(p) = -5p + 54. Let o be q(12). Let i(r) = -8r + 1. Let z(b) = -4b. Let d(t) = oi(t) + 13z(t). What is d(j(w))? -4w*2 - 6 Let h(d) = -17d2. Let z(a) be the second derivative of -a6/720 + 7a4/12 + 27a. Let q(w) be the third derivative of z(w). Give h(q(o)). -17o2 Let c(h) = -2h - 6. Let q(j) = 3j - 948. Calculate c(q(b)). -6b + 1890 Let m(w) = 5w. Suppose 2n - 240 = 1416. Let g(x) = 828 + 0x + 2x - n. Give m(g(b)). 10b Let k(i) be the second derivative of -2i*4 - 174i. Let a(b) be the second derivative of b*4/12 + 2b. Determine k(a(h)). -24h4 Let l(b) = 3b*2. Let j(c) = -4c*2. Let z(x) = 2j(x) + 3l(x). Let f = 36 + -23. Let h(s) = -fs + 30 - 30. Calculate z(h(m)). 169m2 Let t(z) = -195836z. Let o(m) = -2m2. Give o(t(q)). -76703477792q*2 Let i(p) be the first derivative of 0p + 4 + 0p2 - 2/3p3. Let s(k) = k2. Calculate s(i(d)). 4d4 Let g(u) be the second derivative of u3/2 - u. Let h(q) be the second derivative of 0 - 1/6q*3 + 0q*2 + q. Calculate h(g(v)). -3v Let t(x) be the third derivative of -x4/3 - x2. Let i(s) be the third derivative of -s*4/12 - 163s*2. Calculate i(t(y)). 16y Let b(t) = 0t - 13t*2 + 0t - 22t2 + 34t*2. Let i(w) = -149w*2. Calculate b(i(r)). -22201r*4 Let i(c) = 16c - 5. Let w(q) = 19q - 6. Let m(l) = -6i(l) + 5w(l). Let r(j) = 28j. Give r(m(u)). -28u Let w(v) = -4v*2. Let y(d) = 152d*2 + 2d - 31. Determine y(w(z)). 2432z4 - 8z*2 - 31 Suppose -10 = 20n - 25n. Let o(g) = -24 + 12 - 10g*n + 12. Let w(z) be the first derivative of -2z*3/3 - 1. Give w(o(k)). -200k*4 Let o(n) = 487n. Let c(s) = -47s2. Determine c(o(a)). -11146943a*2 Let j(k) = -35k. Let s(v) = -1. Let w(o) = 3o - 9. Let x(z) = -9s(z) + w(z). Determine j(x(c)). -105c Let g(m) = -29m. Let w = 0 + 7. Let q(s) = -5s - s + ws. Calculate g(q(z)). -29z Let d(h) = -4860h*2 - 3. Let a(z) = 6z*2. What is d(a(m))? -174960m4 - 3 Let y(a) be the second derivative of a4/4 - 166a. Let k(o) = 21o*2. Determine y(k(q)). 1323q4 Let f(a) be the first derivative of a2/2 + 2a + 81. Let n(g) = 6g*2. Determine n(f(s)). 6s*2 + 24s + 24 Let w(t) be the second derivative of 7t4/6 + 54t. Let l(s) = -9s2. Calculate l(w(r)). -1764r*4 Let b(o) = 3o. Let h(j) = 9j. Let r(p) = 6p. Let u(s) = 3h(s) - 4r(s). What is u(b(v))? 9v Let f(p) = -p2 - 209p. Let y(s) = 3s2 - 2s2 + s2 - 8s2 + 2s*2. Calculate f(y(u)). -16u*4 + 836u*2 Let t(v) = -23v. Let k(h) = -86195h. Give k(t(r)). 1982485r Let u(t) = t*2. Suppose -3p = -2p. Suppose g = -pg + 5. Let s(m) = gm + 4m*2 + 2m - 7m. Determine u(s(k)). 16k*4 Let c(z) be the third derivative of 13z*5/60 + 143z2. Let p(a) = a2 + 19. What is p(c(w))? 169w4 + 19 Let o = -6 + 8. Let l(b) = ob + 3 - 3. Let n(w) be the second derivative of 11w4/12 - 4w + 4. Determine l(n(g)). 22g2 Let v(o) = -12o*2. Let n(k) = -287 - 281 - 284 + 852 + 43k. Calculate v(n(t)). -22188t2 Let m(x) = -x2. Let u(b) = b2. Let n(r) = -5m(r) - u(r). Let z = 37 + -5. Let d(c) = -c + 32 - z. What is d(n(i))? -4i2 Let j(h) = 503h*2 + 505h*2 - 1004h*2. Let o(b) be the first derivative of -6b*2 - 1. Let q(u) = u. Let d(s) = 2o(s) + 27q(s). Calculate j(d(p)). 36p*2 Let a(h) = -38h. Let j(d) = 806d. What is j(a(c))? -30628c Suppose -4c + 179 = 131. Let p(t) = 41t - ct - 13t - 15t. Let w(i) = 62i. What is p(w(o))? 62o Let i(d) = -18d*2. Let o(n) = 31929n. What is o(i(c))? -574722c2 Let a(z) be the first derivative of -1 + 0z*2 + 1/2z*3 - 6z. Let x(g) be the first derivative of a(g). Let w(t) = 3t2. Determine w(x(p)). 27p*2 Let w(b) = -9b*2. Let p(q) = -20q + 6. Let c(l) = -44l + 13. Let t(g) = -6c(g) + 13p(g). Give w(t(r)). -144r*2 Let b(d) = -3d - 2d + d. Suppose -f - n - 3n - 9 = 0, 0 = 2f - 4n - 30. Let p(w) = -fw + 0w + 5w. What is p(b(u))? 8u Let h(i) = 17i2 + 10. Let j(u) = -24u*2 - 14. Let p(l) = 7h(l) + 5j(l). Let k(g) = 62g*2 - 3g. Determine p(k(o)). -3844o4 + 372o*3 - 9o*2 Let j(w) = 37w*2. Let y(i) = 894i. Calculate y(j(o)). 33078o2 Let u(a) = 402a. Let k(d) = 137d. What is k(u(m))? 55074m Let y(u) = 21u - 190. Let t(v) = -2v*2. Give y(t(f)). -42f*2 - 190 Let b(g) = -g. Let k(f) = 13624f - 6. Give k(b(o)). -13624o - 6 Let y(o) = -1261o*2 + 182o - 91. Let q(b) = -28b2 + 4b - 2. Let u(k) = -91q(k) + 2y(k). Let a(z) = -4z. What is u(a(j))? 416j2 Let c(h) = -h2. Let q(k) = 4k + 3. Let a(x) = -5x - 2. Let v(y) = 3a(y) + 4q(y). Let m(n) = 3. Let j(d) = -6m(d) + 3v(d). What is j(c(t))? -3t2 Let s(b) be the second derivative of -b3/6 - 113b. Let m(t) be the first derivative of 11t3 - 5. What is s(m(o))? -33o*2 Let a(w) = 2w. Let s(v) = -449v2 - 51 + 51 + 9v - 5v - 2v. Give a(s(r)). -898r2 + 4r Let i(d) = 4d2. Let g(b) = 1719b*2. What is g(i(c))? 27504c*4 Let f(g) = 11g + 9g + 5g - 26g. Let a(n) = -463n. Give a(f(h)). 463h Let d(z) = z. Let q(o) = 872301o + 6. What is d(q(s))? 872301s + 6 Let j(h) = 7h. Let d(v) = 48v. Let q(p) = -4d(p) + 27j(p). Let u(l) = -3l. Let r(o) = 3o. Let c = 3 + 0. Let b(i) = cr(i) + 4u(i). Calculate b(q(a)). 9a Let l(n) = 15n2 + 2n - 2. Let s(f) = 143f2 + 19f - 19. Let z(x) = -57l(x) + 6s(x). Let m(i) = -133i2. What is z(m(p))? 53067p*4 Let s(l) = -154l - l*2 + 154l. Let c(j) be the first derivative of 6j2 + 2. Determine c(s(v)). -12v2 Let v(w) = -w + 112922. Let s(u) = -u2. Calculate v(s(n)). n2 + 112922 Let o(s) be the first derivative of s3/3 + 196. Let u(x) be the first derivative of -7x2/2 - 2. Determine o(u(m)). 49m*2 Let o(x) = -10 + 8 + x - 4x. Let h(q) = q + 1. Let i(t) = -6h(t) - 3o(t). Let a(w) = -w. What is i(a(d))? -3*d
What is the second derivative of 368q2 - 28q? 736 Find the second derivative of 10686j4 + 355j wrt j. 128232j2 Find the third derivative of 4fkl*3p + 64fklp - fkp - f + 9kl*3p + kl2 + 2l*3p + 2p wrt l. 24fkp + 54kp + 12p What is the derivative of 2pt4 + 1206p + 215t4 wrt t? 8pt3 + 860t*3 What is the second derivative of -2h*3s2 + h3 - 70h2s*2 - 5hs2 - 166hs - 11h wrt s? -4h3 - 140h*2 - 10h What is the second derivative of 1914h2ju3 - 3h*2ju - 4hju*3 - 104hju*2 + hu*2 + 2ju2 - 2ju wrt h? 3828ju3 - 6ju Find the third derivative of -5a*2sv3z*2 + 2a*2sv2z2 + a2v - 46asv*3 + asv2 - 41sv2z - 2svz2 wrt v. -30a*2sz2 - 276as Find the first derivative of -87u*3y + 2u2y - 27y - 14 wrt u. -261u*2y + 4uy Find the first derivative of -2p3q + 1370p3 + 416q wrt q. -2p3 + 416 What is the second derivative of 2h*2s*3 - 2h*2 + 3s*3 + 10s*2 + 43s + 2 wrt s? 12h2s + 18s + 20 What is the second derivative of -715m*5 + 2m*4s - m*2s - 8575ms wrt m? -14300m3 + 24m*2s - 2s What is the third derivative of 3y*4 - 3y*3 + 2y*2 - 21? 72y - 18 Find the third derivative of 661c3r*2 - 2c*2r2 + c2 - 255cr*2 wrt c. 3966r*2 What is the second derivative of 11m3 - m2 + 21m + 6? 66m - 2 What is the second derivative of -4k2w*2 - 36k*2w + 105kw*2 - 1 wrt k? -8w*2 - 72w Find the second derivative of 3319r2 + 6r + 64 wrt r. 6638 What is the first derivative of -2q2w + q*2 - 16qw2 - 2qw + 9341w*2 wrt q? -4qw + 2q - 16w2 - 2w Find the second derivative of 653h5 + 1804h wrt h. 13060h3 What is the derivative of 519i + 21 wrt i? 519 Find the second derivative of -f*4v*2 - 66f*2v*2 + 40fv + 2v*2 wrt f. -12f*2v*2 - 132v*2 Find the second derivative of -2f*3z*2 + 182f*3z + 89f2z*2 + 2f*2z wrt z. -4f3 + 178f*2 What is the third derivative of -5h*4x - 6h3x*2 - 3h*3 + 21h*2x - 7x2 wrt h? -120hx - 36x*2 - 18 What is the first derivative of 32i*3 - 10i*2 + i - 11954 wrt i? 96i*2 - 20i + 1 Find the first derivative of -357l2m + l + 682m + 2 wrt l. -714lm + 1 What is the third derivative of 6604d*3 + 6150d*2 wrt d? 39624 Find the second derivative of -22854i*4r*3 - 2ir2 - 6r*3 + 693r - 2 wrt i. -274248i2r*3 Find the third derivative of 2v*5 - 3v*4 + 35v*3 - 13v*2 + 147v - 2 wrt v. 120v2 - 72v + 210 Find the third derivative of -63q5 - 2q*4z - 2q4 + 123q*2z - 3q2 wrt q. -3780q*2 - 48qz - 48q What is the second derivative of -5k4n + k*3n - 4k3 - 2k - 73n wrt k? -60k*2n + 6kn - 24k Differentiate -bc*2g*3 - bc*2 + 276bcg*3 - 49c*2g*3 + 64c*2g2 with respect to b. -c2g3 - c2 + 276cg3 Find the third derivative of -2gq5 - 104gq2 + 3g + 435q6 + 3q wrt q. -120gq*2 + 52200q*3 What is the first derivative of -114n - 5? -114 Differentiate -20ad*2 + a - 2d - 200 with respect to d. -40ad - 2 Differentiate oy3 + 7oy + 7895o + 994y3 with respect to y. 3oy2 + 7o + 2982y2 What is the third derivative of 1265k*2t*3 - 2k*2t - 3798kt2 - t4 wrt t? 7590k2 - 24t What is the second derivative of -1109z5 + 13z + 28? -22180z3 Differentiate 95l*2 + 295 wrt l. 190l Differentiate -6349q - 2971 wrt q. -6349 Find the third derivative of -79a6 - a4 + 2a2 - 123. -9480a*3 - 24a Find the third derivative of -jp3s*2 - 3jp2 - jps - js*5 - 30p*3s*5 + 21ps2 wrt s. -60js2 - 1800p*3s*2 What is the third derivative of 419b*2c + 8b2l*3 + 2bcl*3 + 2bcl - bl2 wrt l? 48b*2 + 12bc What is the third derivative of 30cw3 + cw*2 + 10w*2 - 8 wrt w? 180c Find the first derivative of -37i4 + 2i*2 + 88 wrt i. -148i*3 + 4i Find the second derivative of 6b2x*5 - 4b*2x - 5b - 13x*5 wrt x. 120b*2x*3 - 260x*3 Find the third derivative of 82k*2u*3z*3 - 2k*2uz3 - k2z*2 - 2u*3z*3 + 2u*2z*3 + 38z*3 wrt u. 492k*2z*3 - 12z*3 Find the first derivative of -402i*4 + i + 450 wrt i. -1608i*3 + 1 What is the derivative of -116hv3 + 46hv + 21154v*3 wrt h? -116v*3 + 46v Differentiate -21f2l*3 + 2f + 216l3 wrt f. -42fl3 + 2 What is the second derivative of -24n*4 - 4n*2 - 48n wrt n? -288n2 - 8 Differentiate -122i*4r*3 + 4i*4r - 2800r3 with respect to i. -488i*3r*3 + 16i*3r What is the second derivative of 489s5 + 4s*2 + 8908s? 9780s3 + 8 What is the first derivative of -c3 - 5c*2l*2 + 10cl - 5c - 513l2 - 2l - 1 wrt c? -3c2 - 10cl2 + 10l - 5 What is the second derivative of -4364q3 + 9q - 25 wrt q? -26184q What is the first derivative of -13f*2kr - 10f*2k - fkr*2 - 4fk + kr*2 + 2k wrt r? -13f2k - 2fkr + 2kr What is the second derivative of 3636n*4 - 2677n wrt n? 43632n2 Differentiate -3327o - 7835 wrt o. -3327 What is the second derivative of 5467t2 - 15t - 18 wrt t? 10934 What is the second derivative of -663q5 - 653q? -13260q3 What is the derivative of -220s4 + s2 + 594? -880s3 + 2s Differentiate 3hn*3t - 21hn*2 - 4h - 11n3 - 4863nt - 1 with respect to t. 3hn3 - 4863n Find the second derivative of 49r5 + 46r + 2. 980r3 Find the second derivative of -3k*4n*2 - 3k*3n - kn2 - 51n*2 wrt k. -36k*2n*2 - 18kn What is the second derivative of 37u*3x*3 + 2u*2x*3 + 3u*2x - ux3 - 4ux2 - 29x*2 wrt u? 222ux3 + 4x*3 + 6x What is the second derivative of -3l3m*2 - 4l*3m + 5l2m + 3lm*2 + 2lm - 2m*2 wrt l? -18lm2 - 24lm + 10m What is the second derivative of -1321f3u + f*3 + 2f*2h*3 + 992fh2u + 6h3u wrt f? -7926fu + 6f + 4h*3 Differentiate -549q + 1169. -549 Find the first derivative of -6937k + 3739 wrt k. -6937 Differentiate -c2g*3 + 3c*2 - 1117c - 857g3 + g with respect to g. -3c*2g*2 - 2571g*2 + 1 What is the first derivative of rv*3 + 26rv + 3v*3 + 14v wrt r? v*3 + 26v Find the second derivative of -5pr*2w + 5pr - p + 2r2w*3 - 16r*2w + rw3 - 6w*3 wrt r. -10pw + 4w*3 - 32w Differentiate -367i2k*2 + 2i*2k + 1147i2 with respect to k. -734i*2k + 2i2 Find the second derivative of -1475u*4 - 6u - 137. -17700u2 What is the derivative of 450j - 1394 wrt j? 450 What is the third derivative of 6167m3 + 883m*2 - m - 2 wrt m? 37002 What is the derivative of -65g*4 + 284 wrt g? -260g*3 Find the second derivative of -375m*3w*2 - 9m*3 + mw + 578w2 wrt m. -2250mw2 - 54m Find the second derivative of -135g5 + 2g*4 - 185g + 6. -2700g3 + 24g*2 What is the second derivative of 268n*4 - n - 14? 3216n*2 What is the second derivative of 15j*2m + 62j2 - 26j + 46m wrt j? 30m + 124 Find the third derivative of -4895p6 - p2 + 35p - 174. -587400p3 What is the first derivative of -3h*2 + 175h - 671? -6h + 175 Find the third derivative of -1288k*3r*3 - 213k*3r2 + k3 wrt r. -7728k3 Find the third derivative of -3b*5 + 10b*3 + 3b*2 - 284b wrt b. -180b2 + 60 Differentiate -81i*3t - 2i3 + 257t wrt i. -243i2t - 6i2 What is the third derivative of -24c*5 - 3c*4 - 29c*3 - 48c*2 + 34? -1440c*2 - 72c - 174 Find the third derivative of -7368pu*4 - 7562pu + u4 - 3u*2 wrt u. -176832pu + 24u What is the first derivative of 2d2i*3 + 25di3 - 2di2 - 43i*3 wrt d? 4di3 + 25i*3 - 2i*2 Find the third derivative of -7260o*4 - 3o*2 - o + 189. -174240o Find the third derivative of 97l3p3 - l3pq + lp2q + 19lq*2 - 3p*3q*2 wrt p. 582l*3 - 18q*2 Find the first derivative of 8g*3mv2x + g*3v*2x - g*3vx2 - g2vx2 - mv*2 + 2mx2 + 14v*2x*2 wrt m. 8g*3v*2x - v*2 + 2x*2 Find the second derivative of -2j4 - j3 + 579j2 - 408j - 6 wrt j. -24j2 - 6j + 1158 Find the second derivative of -42t4 - 13t*3 + 3t*2 + 1487t - 1. -504t2 - 78t + 6 What is the third derivative of 142t3 + 29t*2? 852 Differentiate 626ivz*3 - 2iv - 46i + 2vz*3 wrt z. 1878ivz*2 + 6vz*2
What is 260 minutes before 1:05 AM? 8:45 PM What is 414 minutes before 9:03 AM? 2:09 AM What is 91 minutes before 1:45 PM? 12:14 PM How many minutes are there between 8:28 AM and 2:35 PM? 367 What is 710 minutes after 12:15 PM? 12:05 AM How many minutes are there between 10:42 AM and 11:31 AM? 49 How many minutes are there between 7:25 PM and 9:41 PM? 136 How many minutes are there between 11:22 PM and 3:28 AM? 246 What is 669 minutes before 4:59 AM? 5:50 PM How many minutes are there between 4:48 AM and 11:15 AM? 387 How many minutes are there between 10:15 AM and 8:12 PM? 597 How many minutes are there between 10:28 AM and 8:39 PM? 611 How many minutes are there between 12:01 AM and 3:44 AM? 223 What is 547 minutes after 11:37 AM? 8:44 PM What is 246 minutes after 4:30 AM? 8:36 AM How many minutes are there between 5:37 PM and 6:02 PM? 25 What is 493 minutes before 11:37 AM? 3:24 AM How many minutes are there between 8:57 AM and 11:33 AM? 156 What is 98 minutes before 11:59 PM? 10:21 PM How many minutes are there between 1:45 AM and 8:35 AM? 410 What is 667 minutes before 1:43 PM? 2:36 AM What is 56 minutes before 8:58 AM? 8:02 AM What is 620 minutes before 1:53 AM? 3:33 PM What is 414 minutes before 6:03 PM? 11:09 AM What is 636 minutes before 3:39 AM? 5:03 PM What is 667 minutes before 3:50 PM? 4:43 AM What is 253 minutes before 9:32 AM? 5:19 AM What is 152 minutes after 7:41 AM? 10:13 AM What is 631 minutes after 1:36 AM? 12:07 PM How many minutes are there between 1:15 PM and 5:21 PM? 246 How many minutes are there between 3:52 AM and 12:59 PM? 547 How many minutes are there between 12:18 PM and 11:23 PM? 665 What is 401 minutes before 7:54 PM? 1:13 PM What is 547 minutes after 9:34 AM? 6:41 PM How many minutes are there between 8:17 PM and 7:32 AM? 675 How many minutes are there between 7:36 AM and 9:58 AM? 142 What is 203 minutes before 9:13 AM? 5:50 AM How many minutes are there between 5:48 PM and 6:32 PM? 44 How many minutes are there between 7:50 PM and 5:37 AM? 587 How many minutes are there between 3:15 AM and 9:46 AM? 391 What is 490 minutes before 3:22 AM? 7:12 PM How many minutes are there between 5:17 PM and 3:06 AM? 589 How many minutes are there between 4:59 PM and 6:08 PM? 69 What is 203 minutes before 6:28 PM? 3:05 PM How many minutes are there between 6:08 PM and 1:11 AM? 423 What is 318 minutes after 11:30 AM? 4:48 PM What is 709 minutes after 5:23 PM? 5:12 AM What is 39 minutes after 11:12 PM? 11:51 PM What is 557 minutes after 12:46 PM? 10:03 PM What is 446 minutes before 2:07 PM? 6:41 AM How many minutes are there between 10:36 AM and 5:26 PM? 410 How many minutes are there between 3:00 PM and 12:47 AM? 587 What is 144 minutes before 6:46 PM? 4:22 PM How many minutes are there between 7:06 PM and 11:57 PM? 291 How many minutes are there between 11:39 AM and 12:12 PM? 33 What is 277 minutes before 7:50 PM? 3:13 PM What is 249 minutes before 9:17 AM? 5:08 AM How many minutes are there between 9:20 AM and 10:08 AM? 48 How many minutes are there between 10:10 PM and 3:30 AM? 320 What is 12 minutes after 5:43 PM? 5:55 PM How many minutes are there between 4:21 PM and 10:46 PM? 385 How many minutes are there between 2:55 PM and 6:18 PM? 203 What is 254 minutes before 10:15 AM? 6:01 AM What is 54 minutes before 11:22 AM? 10:28 AM How many minutes are there between 5:37 AM and 8:23 AM? 166 What is 120 minutes before 4:01 AM? 2:01 AM What is 144 minutes after 9:50 PM? 12:14 AM How many minutes are there between 8:32 PM and 11:18 PM? 166 What is 42 minutes after 3:22 PM? 4:04 PM What is 568 minutes before 7:39 AM? 10:11 PM What is 238 minutes before 11:24 AM? 7:26 AM How many minutes are there between 5:04 PM and 3:35 AM? 631 How many minutes are there between 1:24 PM and 6:56 PM? 332 What is 249 minutes before 12:24 PM? 8:15 AM What is 121 minutes before 9:49 AM? 7:48 AM What is 710 minutes before 11:50 PM? 12:00 PM What is 371 minutes after 4:54 AM? 11:05 AM How many minutes are there between 4:35 PM and 6:42 PM? 127 What is 538 minutes after 7:18 PM? 4:16 AM What is 605 minutes before 1:53 PM? 3:48 AM How many minutes are there between 2:34 AM and 3:36 AM? 62 What is 302 minutes before 9:26 AM? 4:24 AM How many minutes are there between 11:43 PM and 9:38 AM? 595 How many minutes are there between 5:24 AM and 12:22 PM? 418 What is 139 minutes after 4:39 AM? 6:58 AM How many minutes are there between 11:40 AM and 10:35 PM? 655 What is 625 minutes after 10:56 PM? 9:21 AM What is 353 minutes before 4:31 AM? 10:38 PM How many minutes are there between 6:10 PM and 12:17 AM? 367 How many minutes are there between 9:44 PM and 11:14 PM? 90 How many minutes are there between 11:54 PM and 8:31 AM? 517 How many minutes are there between 10:15 PM and 8:25 AM? 610 What is 443 minutes before 4:50 PM? 9:27 AM How many minutes are there between 5:58 PM and 6:48 PM? 50 How many minutes are there between 1:25 AM and 11:30 AM? 605 How many minutes are there between 7:16 PM and 10:06 PM? 170 What is 324 minutes after 10:10 AM? 3:34 PM How many minutes are there between 1:26 AM and 7:25 AM? 359 How many minutes are there between 3:01 PM and 5:37 PM? 156 How many minutes are there between 7:31 AM and 7:56 AM? 25 How many minutes are there between 5:04 AM and 1:26 PM? 502 What is 354 minutes after 7:56 AM? 1:50 PM What is 82 minutes before 12:36 PM? 11:14 AM What is 657 minutes after 2:11 PM? 1:08 AM How many minutes are there between 10:51 PM and 7:57 AM? 546 How many minutes are there between 2:49 PM and 5:55 PM? 186 What is 145 minutes after 5:02 PM? 7:27 PM How many minutes are there between 6:06 PM and 7:00 PM? 54 What is 253 minutes after 6:07 PM? 10:20 PM How many minutes are there between 12:30 PM and 8:40 PM? 490 How many minutes are there between 12:51 PM and 5:34 PM? 283 How many minutes are there between 5:18 AM and 10:04 AM? 286 How many minutes are there between 4:58 PM and 8:12 PM? 194 How many minutes are there between 6:20 AM and 3:39 PM? 559 How many minutes are there between 8:40 PM and 3:52 AM? 432 What is 160 minutes before 10:22 AM? 7:42 AM What is 165 minutes after 1:29 PM? 4:14 PM What is 20 minutes before 4:42 AM? 4:22 AM How many minutes are there between 12:38 PM and 8:11 PM? 453 How many minutes are there between 8:42 PM and 4:01 AM? 439 How many minutes are there between 4:46 AM and 3:13 PM? 627 What is 410 minutes after 6:24 PM? 1:14 AM How many minutes are there between 1:19 AM and 3:38 AM? 139 How many minutes are there between 9:22 PM and 8:54 AM? 692 How many minutes are there between 9:32 AM and 5:53 PM? 501 How many minutes are there between 12:09 AM and 4:55 AM? 286 What is 142 minutes after 6:52 PM? 9:14 PM How many minutes are there between 6:04 AM and 8:49 AM? 165 How many minutes are there between 3:32 PM and 2:59 AM? 687 How many minutes are there between 9:45 AM and 6:06 PM? 501 What is 404 minutes before 6:05 PM? 11:21 AM How many minutes are there between 5:30 AM and 4:13 PM? 643 How many minutes are there between 10:14 PM and 11:14 PM? 60 How many minutes are there between 4:25 AM and 10:19 AM? 354 What is 244 minutes before 10:20 PM? 6:16 PM What is 662 minutes before 9:51 AM? 10:49 PM How many minutes are there between 8:11 AM and 4:03 PM? 472 How many minutes are there between 8:49 AM and 5:39 PM? 530 What is 488 minutes after 12:19 PM? 8:27 PM What is 557 minutes before 1:05 PM? 3:48 AM How many minutes are there between 6:27 PM and 12:09 AM? 342 What is 175 minutes after 3:41 AM? 6:36 AM What is 286 minutes after 7:00 AM? 11:46 AM How many minutes are there between 5:52 AM and 4:12 PM? 620 How many minutes are there between 2:11 PM and 9:49 PM? 458 How many minutes are there between 8:02 AM and 11:59 AM? 237 What is 391 minutes after 7:11 PM? 1:42 AM What is 38 minutes after 9:43 PM? 10:21 PM How many minutes are there between 9:44 AM and 2:35 PM? 291 How many minutes are there between 10:09 AM and 8:26 PM? 617 What is 418 minutes before 3:31 PM? 8:33 AM How many minutes are there between 8:34 AM and 6:52 PM? 618 How many minutes are there between 11:14 PM and 2:28 AM? 194 What is 420 minutes after 2:36 AM? 9:36 AM How many minutes are there between 3:02 PM and 10:50 PM? 468 What is 453 minutes after 4:38 PM? 12:11 AM How many minutes are there between 10:10 AM and 3:19 PM? 309 How many minutes are there between 7:51 PM and 3:01 AM? 430 What is 88 minutes after 3:35 PM? 5:03 PM How many minutes are there between 12:22 PM and 9:29 PM? 547 What is 503 minutes before 6:29 PM? 10:06 AM What is 504 minutes before 11:30 PM? 3:06 PM
Find the second derivative of 460172897b2 - 17b - 213815 wrt b. 920345794 What is the third derivative of 29g2t*3 + 7g*2t2 - g2t - 897g*2 - 2056gt3 + 5t3 + t2 wrt t? 174g2 - 12336g + 30 What is the second derivative of -112389d4 - 7d3 + d2 + 2d + 3056428? -1348668d*2 - 42d + 2 What is the derivative of 3o3 - 11o*2 + 41406o - 19173323? 9o2 - 22o + 41406 Find the third derivative of -2890d5 + 6891d*4 + 111887625d*2 wrt d. -173400d*2 + 165384d Find the third derivative of -9935613pu*4 + pu*3 + 1122951pu2 + 4u*2 wrt u. -238454712pu + 6p What is the second derivative of -414107w3 + w2 - 2247467w wrt w? -2484642w + 2 Find the third derivative of 501494544h*6 + 179184347h*2 wrt h. 60179345280h*3 Find the second derivative of 5862360r*3 - 22553700r + 1. 35174160r Find the third derivative of -19h*5 - 9h*4 + 14454h*3 - 2h*2 + 839h + 997 wrt h. -1140h2 - 216h + 86724 Find the third derivative of -36d4 - 8774d3 + d2 - 19d - 19061. -864d - 52644 Differentiate -127d3 - 28d*2 - 566d - 37048520 wrt d. -381d2 - 56d - 566 Differentiate 2223j4v*3 - 447j*4 - 892v*3 - 2078 wrt j. 8892j*3v*3 - 1788j*3 What is the third derivative of -13gn5 + gn*2 - 8gn - 254263n*5 - 21042n*2 - 13n wrt n? -780gn*2 - 15255780n*2 What is the second derivative of -50285721b*2 + 70459055b? -100571442 What is the derivative of -15745665a - 17845589? -15745665 Find the third derivative of -9l*5 - 36501390l*3 - 274l*2 - 39773 wrt l. -540l*2 - 219008340 What is the first derivative of -8590529hj3 + 35084525j*3 wrt h? -8590529j*3 What is the second derivative of 11i*3 - 17953602i*2 - 56536645i - 1? 66i - 35907204 Find the third derivative of -6211q*3r - 645q3 - 781q*2r + 35048r wrt q. -37266r - 3870 What is the second derivative of 207215796n2 - 31218326n - 3 wrt n? 414431592 What is the third derivative of -642117609i3x*2 + 2i*2x*2 - 2i*2x + i*2 + ix - 32404x2 + 134x wrt i? -3852705654x2 Find the second derivative of a3 - 135731670a*2 + 142950642a wrt a. 6a - 271463340 Differentiate 1645411u*3 + 2u*2 - 5169646 with respect to u. 4936233u*2 + 4u Find the third derivative of -1368t4 - 241t*3 + 2t*2 + 13t + 2222 wrt t. -32832t - 1446 Find the third derivative of 1946238b*4 + 88b*3 - 52490b*2 + 5902. 46709712b + 528 Find the third derivative of -4839907iw*3 - 16493iw2 + 2w*3 + 134w*2 wrt w. -29039442i + 12 Find the third derivative of 267227519f5 - 121f*2 + 582f - 379 wrt f. 16033651140f2 Find the third derivative of -19596969d*3 - 3592623d*2 + 2d wrt d. -117581814 What is the third derivative of 398p5 - 3795p4 - p3 + 5p2 + 31p - 100421 wrt p? 23880p2 - 91080p - 6 Find the second derivative of 138366v2 - 165233v - 135. 276732 Find the second derivative of -6713mx*2 - 22m - 444x2 - 577x - 16 wrt x. -13426m - 888 Find the third derivative of -2700n*4 - 1840n*3 + 10298574n*2 wrt n. -64800n - 11040 What is the third derivative of -204s4 + 8544s*3 + 45719482s*2 wrt s? -4896s + 51264 Find the second derivative of 452039162y3 + 562y - 243412 wrt y. 2712234972y Find the third derivative of 17531034u*3 - 3640u*2 - u + 256 wrt u. 105186204 Find the first derivative of 105868492x + 11123583. 105868492 What is the second derivative of 39027364m2 + 101878618m? 78054728 Find the third derivative of 98488359o3 + 602356o*2 - 20o + 1 wrt o. 590930154 What is the derivative of 626278711a3 + 596510658? 1878836133a*2 Find the first derivative of 11ow2 - 2155ow - 1440o + 54338w2 + 3w - 191 wrt o. 11w2 - 2155w - 1440 What is the derivative of 69692476u4 - 108946969? 278769904u*3 What is the third derivative of -17660051o*3 + 3o*2 + 9o - 55160 wrt o? -105960306 What is the derivative of -133834s2t*2 - 504s*2t - 2s + 9224028t*2 - 35t wrt s? -267668st*2 - 1008st - 2 Find the first derivative of 9t*3y*2 - 675956t*3y - 1760t3 - 103t - 3 wrt y. 18t3y - 675956t3 What is the third derivative of 17f*4k - 180f4 + 331f*3k - 2172171f2k - f - 16k wrt f? 408fk - 4320f + 1986k Differentiate 6a*2w*3 + 87aw3 - 2757aw - 609152w*3 + 2w*2 - 2w + 1 with respect to a. 12aw*3 + 87w*3 - 2757w What is the third derivative of 1221362652f4 - 709105171f*2 + 2? 29312703648f Find the second derivative of 84793b2c - 85b2 + 10bc + 55768b + 2c + 1 wrt b. 169586c - 170 What is the second derivative of -27219442ju*3 + 4ju - 1613441j wrt u? -163316652ju What is the second derivative of -91501b3 + 18b*2 - 610b - 9361? -549006b + 36 Find the second derivative of 607695t*4 - 1517383t - 2. 7292340t2 Find the first derivative of -25718831m*2 + 2954943. -51437662m Differentiate 1835lm*3 + 6lm2s + m*3 + 1846165ms with respect to l. 1835m*3 + 6m*2s Find the third derivative of 95761cf*3t - cf2t - cf2 - 2584cft*2 + 11f*3t*3 - 2f*3t*2 + 3f*2t2 + t3 - 2t2 wrt f. 574566ct + 66t*3 - 12t*2 What is the second derivative of 15287262u*3 - 357225333u wrt u? 91723572u What is the first derivative of 74361450y*4 - 26164688 wrt y? 297445800y*3 Find the second derivative of 3w*5 + 270072w*3 + 2w*2 - 95338806w. 60w3 + 1620432w + 4 Find the third derivative of -22s3v*3 + 18326s*3v - 80290s2v*4 + 2v*2 - 9v wrt v. -132s3 - 1926960s*2v What is the second derivative of 116834r4 + 10r*3 + 2r*2 - 2r + 749699? 1402008r2 + 60r + 4 Find the first derivative of -585i3z + 3650iz*2 - 709z*2 - 3449z + 1 wrt i. -1755i2z + 3650z2 Find the first derivative of 29600843o + 3647358 wrt o. 29600843 Find the third derivative of 4743645t3 + 1146609t*2 wrt t. 28461870 What is the first derivative of -310z*2 - 10549z - 31127530? -620z - 10549 What is the third derivative of -120096o*5 - 2o*4 - 5o*3 - 213o*2 + 47o - 96 wrt o? -7205760o2 - 48o - 30 What is the second derivative of -27674973f4 + 2f*3 - 20969558f? -332099676f2 + 12f Find the third derivative of -228371774r3 + 8r*2 + 34172r - 7. -1370230644 What is the third derivative of 650891n5 - n4 + 2n*3 - 17612058n*2? 39053460n*2 - 24n + 12 Find the third derivative of -12339535k3 - 19944k*2 - 41k. -74037210 What is the second derivative of 8178935r4 - r + 7670977? 98147220r*2 Find the second derivative of 2035010r*2 - 43033r + 31 wrt r. 4070020 What is the first derivative of 87a3c*2 + 3a*3 + 28ac2 + 24885a - 22075c + 526 wrt c? 174a*3c + 56ac - 22075 Find the second derivative of -o*3 - 192326o*2 + 2506o - 481 wrt o. -6o - 384652 What is the third derivative of 4d*3n*2o*2 + 2711d*3n*2 - 450d*2n*2o2 + d2no - 2d2o*2 + 6d*2 + 48n*2o*2 wrt d? 24n*2o*2 + 16266n*2 What is the first derivative of 29040134v*3 - 17145710 wrt v? 87120402v*2 What is the second derivative of -8925024t*5 - 88t - 14244 wrt t? -178500480t3 What is the third derivative of 2do3 - 2do + 9d + 8030205o3 + 326o*2 + 49o - 7 wrt o? 12d + 48181230 Find the second derivative of 1105ku5 + 17267ku2 + 1102ku - 17183u wrt u. 22100ku*3 + 34534k What is the derivative of -125sv*3 + 337234sv2 - 11468v*3 - 2974 wrt s? -125v*3 + 337234v*2 What is the second derivative of 1608707f*2 + 29140654f wrt f? 3217414 Find the second derivative of -4m3p*2x - 419024m3px2 + 67409713m*2p*2x - 214mp*2x*2 wrt x. -838048m*3p - 428mp*2 What is the third derivative of -9a*3u3 - a3u2 - 2a*3u + 3a2u*2 + 7au3 + 102123a - 7179u3 - 4 wrt u? -54a*3 + 42a - 43074 What is the first derivative of 242890281cd*3 + 151d*3 - 1552d*2 + 4d + 6 wrt c? 242890281d3 Find the second derivative of -21346475a*4 - 62566216a + 2 wrt a. -256157700a2 What is the derivative of l2y + 34l2z + l*2 + 4lyz - 18ly + 11l - 53576yz - 49y + z - 33 wrt z? 34l2 + 4ly - 53576y + 1 Differentiate 21l2r - 18l2z + 2lr*2 + 24159r*2z + 69324z wrt r. 21l*2 + 4lr + 48318rz Differentiate 4c*4 + 40c*3 + 3c*2 - 601c - 31574182 wrt c. 16c3 + 120c*2 + 6c - 601
Let d(g) be the first derivative of 0g2 + 0g - 2 + 1/3g3. Let s(x) = 6x. What is s(d(i))? 6i2 Let z(l) = l2 - 2l - 2. Let p(t) = -2t2 + 5t + 5. Let k(q) = 2p(q) + 5z(q). Let m(f) = 4f2. Give m(k(u)). 4u4 Let w(v) = v2. Let x(m) = -21628m2. Give x(w(l)). -21628l*4 Let i(d) = -10d*2. Let k(m) = -820m*2. Give k(i(w)). -82000w*4 Let f(d) = -11d + 16d2 - 14d*2 - 29d. Let h(c) = -c*2. What is h(f(x))? -4x*4 + 160x*3 - 1600x*2 Let m(b) = 3b. Let c(o) = 1082o2. What is c(m(k))? 9738k*2 Let m(q) = 4q. Let l(c) = 1. Let u(t) = t + 5. Let j(g) = 5l(g) - u(g). Determine m(j(p)). -4p Suppose x + 2i + 10 = 0, -5x - 4i = 16 + 4. Let d(b) = 6b - 5b - 2b + xb. Let o(c) be the third derivative of c5/20 + c2. Give d(o(a)). -3a*2 Let z(j) = -j. Suppose -5n - 5s - 5 = 0, -n + s + 6 - 1 = 0. Let v = 0 + n. Let x(r) = 2 - 2 + vr. Determine x(z(q)). -2q Let m = 6 + -4. Let k(t) = 3t + 2. Let q(s) = -39s - 27. Let l(f) = mq(f) + 27k(f). Let w(g) = -g2. Determine l(w(j)). -3j*2 Let n(g) = g. Let k(a) = -17a*2 + 4 - 58a + 19a2 - 4. What is n(k(j))? 2j*2 - 58j Let w(k) = -202k2 + 100k*2 + 86k2. Let h(a) = a2. Calculate w(h(z)). -16z4 Let j(t) = -3t. Let s(f) = -3f. Let x = -3 + 5. Let g(z) = xj(z) - 3s(z). Let u(v) = 5v. Let b(q) = -4q. Let d(i) = -6b(i) - 5u(i). What is g(d(p))? -3p Let z(n) = 2n2. Let g be 8/6(-6)/(-4). Suppose 13 = k - 5d, -4k + 4 = 3d + d. Let p(h) = 3h - gh - kh. Calculate z(p(i)). 8i2 Let g(w) = -2w. Let s(d) = d + 6. Let n be s(-6). Let q(c) = -2c + nc - 2c2 + 2c. Determine q(g(j)). -8j2 Let p(y) = y. Let d(n) = 4n. Let r be 33/(-9) + 2/3. Let s(k) = -k. Let c(a) = 2a - 4. Let t be c(-5). Let v(j) = rd(j) + ts(j). Calculate p(v(o)). 2o Let h(x) = -187x. Let g(v) = v2. Determine h(g(c)). -187c*2 Suppose -4m + 5w + 39 = 0, 4m - 3w - 30 = -w. Let i(s) = -m + 6 + 3s2. Let y(l) = -l2. Determine y(i(n)). -9n4 Let j(b) = -6b. Let q(r) = 11r2. Determine j(q(k)). -66k*2 Let v(p) = 6p*2. Let q(a) = 42a*2. What is v(q(o))? 10584o*4 Suppose 0j = -2y + 4j + 44, 46 = 3y - j. Let n(q) = -14q + yq - q2. Let w(i) = -8i*2. Give w(n(r)). -8r4 Let u(g) be the second derivative of g4/6 - 6g. Let b(z) = -4z - 3z + 3z. Calculate b(u(d)). -8d2 Let v(r) = 2r. Let n(q) = 2q + 2909. What is n(v(z))? 4z + 2909 Let p(d) be the first derivative of -d*2/2 - 1. Let y(a) = 2a - 117 + 117 - 4a. Determine p(y(o)). 2o Let r(q) = 10q2. Let n(f) be the first derivative of -f2 - 3 + 2f - 3 - 2f. Give r(n(g)). 40g*2 Let r(o) = 2o. Let x(h) be the second derivative of -h*4/6 + 2h. Calculate r(x(u)). -4u2 Let f(a) = -4a. Let d(x) = 466x. Give d(f(g)). -1864g Let h(u) = 1121u - 418. Let c(v) = 32v - 12. Let n(f) = 209c(f) - 6h(f). Let i(s) = 3s. Give n(i(q)). -114q Let o(l) = 3l. Let i(h) = -44h. Calculate o(i(a)). -132a Let j(q) = 34497q. Let o(k) = k*2. Calculate j(o(h)). 34497h*2 Let r(s) = -4s*2. Let y(h) = 5h*2. Let j(x) = 3r(x) + 2y(x). Let c(p) = -2p - 10. Determine c(j(u)). 4u2 - 10 Let x(w) = -4w*2. Let r(s) = 1171s - 1. Determine x(r(z)). -5484964z2 + 9368z - 4 Let c(t) = -2t. Let v(j) be the second derivative of -8j*3/3 - 13j. Calculate v(c(q)). 32q Let l(t) be the first derivative of -2t + 1/2t3 + 0t*2 + 1. Let m(n) be the first derivative of l(n). Let k(b) = 2b*2. Calculate m(k(r)). 6r*2 Let w(s) = 3s*2. Let z = 14 - 12. Let h(m) = -5m*z + m - m + 4m*2. Calculate w(h(c)). 3c*4 Let f(k) = 6k. Let t(x) = -433x. What is t(f(h))? -2598h Let b(w) = 2w2. Let a(v) = 4v. Calculate b(a(p)). 32p2 Let s(o) = -87o - 3. Let q(g) = -g. Determine s(q(z)). 87z - 3 Let h(t) = t. Let b be 2/3 - 4/(-3). Let x(j) = -bj - j - 8j. What is x(h(v))? -11v Suppose -2n = 4r - 10, 3r - 3n + 1 - 4 = 0. Suppose 5x = 5a, 2a + ra - 14 = -3x. Let w(l) = 0l - 3l + xl. Let u(j) = 3j2. Give w(u(q)). -3q2 Let d(h) be the first derivative of h2 - 1. Let i(t) = t*2 + 2. Let c(m) = 8m*2 + 18. Let p(n) = 4c(n) - 36i(n). What is p(d(w))? -16w*2 Let x(r) = 10r. Let l(j) = -3j2. Give x(l(w)). -30w*2 Let q(m) = m. Let o(n) = 2n. Let d = -1 + -3. Let z(w) = do(w) + 6q(w). Let p(f) = 3f2. Determine z(p(g)). -6g2 Let l(t) = t2. Suppose 0 = 2s - 3 + 1. Let x be ((-1)/(-3))/s3. Let z(i) = 1 + i2 - x. What is l(z(q))? q4 Let r = 1 - 1. Let q(x) = -2x2 + 0x + rx. Let s(g) = -126g + 64g + 65g. Give s(q(c)). -6c2 Let g(w) = 4w*2 - 5. Let c(q) = -5q*2 + 6. Let a(r) = -5c(r) - 6g(r). Let i(o) = 12o. Calculate a(i(y)). 144y2 Let d(g) = -g2. Let i(v) = 21v*2 + 5v - 5v + 11v*2. Determine d(i(f)). -1024f4 Let u(v) be the second derivative of -v6/180 - v*3/2 - 2v. Let j(z) be the second derivative of u(z). Let m(o) = -3o2. Calculate j(m(h)). -18h*4 Let f(l) = -2l*2. Let m(r) = 9r*2 - 4r - 2. Calculate m(f(u)). 36u4 + 8u*2 - 2 Let k(h) = h + 2h + h - 8h. Let f(i) = -9i. Calculate k(f(v)). 36v Let j(v) be the third derivative of -v4/24 + 4v*2. Let m(g) = 2g. Give m(j(k)). -2k Let n(i) = i. Let d(f) = f2 + 20f - 44. Determine d(n(p)). p*2 + 20p - 44 Let s(m) = -4m2. Let r(z) be the second derivative of z3/6 + 4z. What is s(r(j))? -4j2 Let g(r) = 3r + 3. Let k be ((-12)/(-8))/((-1)/2). Let u(a) = -6a - 5. Let z(l) = ku(l) - 5g(l). Let t(x) = -2x*2. Calculate z(t(w)). -6w*2 Let k(d) = 3d2 + d2 - 2d2. Let m(j) be the third derivative of 0j3 + j2 + 0j + 0 + 1/24j*4. What is m(k(w))? 2w*2 Let x(q) = 27q + 1. Let d(s) = s. What is x(d(z))? 27z + 1 Let i(f) = -4f. Let s(n) = 2n2 - 8n - 8. Let a(q) = q*2 - 5q - 5. Let p(m) = -8a(m) + 5s(m). Give p(i(l)). 32l2 Let q(z) = 4z - 496 + 496. Let f(x) = 2x. Give q(f(i)). 8i Let x(a) = -4a2 + 8a2 - a2. Let m(w) be the third derivative of -w5/30 + w2. Give m(x(q)). -18q4 Suppose -o = 2o - 33. Let h = o + -9. Let v(y) = -2yh + 18 - 18. Let m(x) = 4x*2. Calculate m(v(r)). 16r*4 Let m(l) = -4l2 - l2 - 2l2 + 5l*2. Let h(x) = -3x + 3x - 6x*2. Let w(c) = 4h(c) - 11m(c). Let p(r) = -2r*2. Give w(p(v)). -8v4 Let j(k) = k2. Let l(s) = -s + 5. Let c(b) = 2. Let d(n) = 5c(n) - 2l(n). What is d(j(i))? 2i2 Let v(c) = 3c. Suppose 0n - 12 = -4n. Let x(r) = -n + 3 - r. Calculate v(x(l)). -3l Let h(c) = 160c*2 - 68c - 68. Let f(b) = 7b2 - 3b - 3. Let p(i) = -136f(i) + 6h(i). Let j(z) = z*2. What is p(j(w))? 8w4 Let w(d) = d2. Suppose 5y - 119 = -4u, -2y - 77 = -2u - y. Let a(b) = -38b2 - 2 + 2 + ub*2. Calculate a(w(r)). -2r*4 Suppose 11 = 2n - 37. Let d(g) = -n - 2g + 24. Let k(a) = -8a*2. Determine k(d(w)). -32w*2 Let s(g) = 3g2. Let x(f) = f2 + 208. Calculate s(x(u)). 3u4 + 1248u*2 + 129792 Let j(d) be the first derivative of -4d*3/3 - 3d2/2 - 3. Let k(n) = n2 - n. Let v(g) = j(g) - 3k(g). Let p(z) = -2z*2. Determine v(p(h)). -28h*4 Let f(n) = 2n. Let s(c) = -2c2 + 357c. Calculate s(f(m)). -8m2 + 714m Let l(m) = 15m. Let s(z) = 19z*2 - 10z*2 - 10z*2. Give l(s(p)). -15p*2 Let k(v) = -9v + 13. Let f(g) = -2g + 3. Let w(y) = -26f(y) + 6k(y). Let p(c) = 4c. Give p(w(r)). -8r Suppose -11 = -5t + 4. Let f(i) = 2i - i - ti. Let v(l) = -9l2. What is f(v(b))? 18b*2 Let f(d) = -5d. Let r(v) = -262v2 - 2v. Determine f(r(a)). 1310a2 + 10a Let w(q) = q. Let a(n) = -9n + 3n - 10n. Give w(a(j)). -16j Let x(t) = -4t - 35 + 70 - 35. Let v(a) = -4a. Determine x(v(u)). 16u Let o(r) = r2. Let a(i) = -2i*2. Let j(k) = 2k*2 + 1. Let l(v) = -5a(v) - 6j(v). Let b(x) be the first derivative of l(x). What is b(o(f))? -4f2 Let j(b) = -b2. Let l(f) = -f*2 + 439f. Give j(l(q)). -q*4 + 878q*3 - 192721q2 Let p(n) be the third derivative of n8/20160 - n*5/60 - 3n2. Let f(r) be the third derivative of p(r). Let w(q) = -q. What is w(f(k))? -k2 Let s(b) = -18b2. Let l(m) = 3m*2. Calculate s(l(t)). -162t*4 Let k(d) = 12d*2. Let x(r) = 4r*2 - 1. Determine k(x(b)). 192b*4 - 96b*2 + 12 Let a(m) = -5m2. Let h(d) be the third derivative of d7/2520 - 5d4/24 + 5d*2. Let u(z) be the second derivative of h(z). Give u(a(t)). 25t*4 Let d(t) = 4t*2. Let i(a) = 4a2 + 3. Let n = -58 + 55. Let l(c) = -1 - 1 + 3 + c2. Let y(b) = nl(b) + i(b). Determine y(d(h)). 16h**4
Simplify (62sqrt(152))/(-5sqrt(24)/sqrt(3)) - ((sqrt(76) - (sqrt(76) - (1sqrt(76) + sqrt(76)))-6) + sqrt(76))/(sqrt(700)/sqrt(7)). -8sqrt(19)/5 Simplify 5((sqrt(252)/(sqrt(7) - sqrt(700)2)-1)/((sqrt(240)/sqrt(16))/(sqrt(315)/sqrt(7))))2. 540/361 Simplify -1((-1 + sqrt(1584))5-1 + 0 + sqrt(1584)-2-4 + sqrt(1584) + 5)5. -240sqrt(11) - 50 Simplify 5(sqrt(176)/(1sqrt(176)))/((sqrt(72) - (sqrt(72)-1 + sqrt(72))) + (sqrt(288) - (-1sqrt(288) + sqrt(288)))). 5sqrt(2)/36 Simplify -5(4 + -2 + sqrt(272) + 4 + ((sqrt(272)2 + -2)2 - (sqrt(272) - (0 + 2sqrt(272)))*2)). -4130 + 140sqrt(17) Simplify ((-4sqrt(1210) + sqrt(1210) - sqrt(10) - sqrt(810)4)/((sqrt(288) + (sqrt(288) - 1sqrt(288))-1 + sqrt(288))4))2. 6125/2304 Simplify (1-6(sqrt(224) + sqrt(224)-1))/((sqrt(84)/(sqrt(3)-2))/((sqrt(4) - 1sqrt(144)) + sqrt(4))). 0 Simplify (5-4(-3 + (sqrt(245) - (0 + -2sqrt(245))) + -1 + -5) + -5)2. -147000sqrt(5) + 912625 Simplify -33((3(sqrt(99) + -5))2-2 + -3)6. -29160sqrt(11) + 120690 Simplify 3(3sqrt(5) + -5)3 - (sqrt(5) + sqrt(10)/(sqrt(6)/sqrt(3)) + (sqrt(5) - (sqrt(500) + 4)2)). 104sqrt(5) + 471 Simplify (1((3sqrt(360))/sqrt(12) + sqrt(30))-5)/((sqrt(160) - -3sqrt(160)2)5). -sqrt(3)/7 Simplify (sqrt(12)/(-2sqrt(2))-2 + (-4sqrt(96) - (2sqrt(54))/sqrt(9)))/(((-2sqrt(96))/sqrt(12))/sqrt(4) + sqrt(2)1-4 + sqrt(22)/sqrt(44)). 34sqrt(3)/11 Simplify -5 + (4 + 4sqrt(17)-5 + -2 - (sqrt(153))*2-5-45). -15303 - 20sqrt(17) Simplify 2 + ((22sqrt(78) - (sqrt(78) - sqrt(78)-14))/(sqrt(96)4 - sqrt(1200)/sqrt(8)))*2. 255/121 Simplify -2(2((-5(0 + sqrt(117)) - sqrt(117) - ((-1sqrt(117) - sqrt(117)) + -4)) + 3 + 3 + (sqrt(117) - (0 + sqrt(117)))))2. -15776 + 1920sqrt(13) Simplify (-311sqrt(1323) - (-5 + -3(sqrt(108) - 3sqrt(108)-1)))*2. 90sqrt(3) + 268 Simplify (sqrt(2299) + (sqrt(2299)3 + sqrt(2299) - sqrt(2299))-1 - (0 + sqrt(2299))1) + 4(3 + (sqrt(2299) - (-4-1sqrt(2299) + sqrt(2299))*2)). -229888 + 11sqrt(19) Simplify (-2(sqrt(1862)-2 + sqrt(38) - (sqrt(1862)-1 + sqrt(38)))/((sqrt(32) + sqrt(96)/sqrt(3))-2 + sqrt(32)))*2. 931/36 Simplify 1(sqrt(2178) - (sqrt(2178) - (sqrt(2178) - sqrt(2178)2))-4)/((sqrt(90)2)/sqrt(10)-1) + 1. -99sqrt(2)/2 + 1 Simplify (-4 + (sqrt(931) + (sqrt(931) - 2sqrt(931)))*2 + 1 + sqrt(1539) + sqrt(19) - (((sqrt(171) + sqrt(19))3)*2 - sqrt(475)4)) + -5. -2744 + 30sqrt(19) Simplify (-6((sqrt(48)/sqrt(4))/sqrt(4) + sqrt(9)/sqrt(3)6) + -4)2 - (-6(-1sqrt(3) - sqrt(3)) + (sqrt(243)-2 + sqrt(243) - sqrt(243)) + 2)*2. 360sqrt(3) + 5196 Simplify -2 + ((3 + 0 + sqrt(5))*2 - (-4sqrt(20) - sqrt(5) - sqrt(5))*2) + (-54(sqrt(500) + 0 + sqrt(500)))2. 6sqrt(5) + 799512 Simplify (2 + (sqrt(180) - sqrt(180)2 - sqrt(180))2)3 + -5 + (sqrt(1800)3 + sqrt(50))/(((sqrt(50) - sqrt(1800)) + sqrt(50))/sqrt(5)). -19sqrt(5)/4 + 2161 Simplify 3 + (4 + -5(sqrt(88)/(sqrt(512) - sqrt(8)) - (-5 + sqrt(891))))2. -1860sqrt(11) + 1078856/49 Simplify (-4 + 2sqrt(98) + 5 + -1 - (-3(sqrt(98) + 1) + sqrt(98) + (sqrt(98) - (0 + sqrt(98)) - sqrt(98)) + 1))*21. 140sqrt(2) + 2454 Simplify -5(0 + sqrt(153) + 1 + -2 - ((-1 + sqrt(153))4 - (sqrt(153) + (sqrt(153) - (0 + sqrt(153))) + -2)))2 + 2. -3063 + 60sqrt(17) Simplify 0 + -3 + (5sqrt(240)/(sqrt(8)-3))/(3-1(3sqrt(6) + sqrt(6) + sqrt(6))). -3 + sqrt(5)/9 Simplify (sqrt(10) + (-1sqrt(10)6 - sqrt(10)))/((sqrt(10)3)/sqrt(5)) + (sqrt(360)/(sqrt(225) - sqrt(9)))/(sqrt(24)/sqrt(48)). -sqrt(5) Simplify ((sqrt(960)/sqrt(3) - (-1sqrt(500)-4 - sqrt(500))) + -1 + (3sqrt(720)1 - (sqrt(720) + -1 + -3)))*2. 12sqrt(5) + 29 Simplify ((-6sqrt(140)2)/sqrt(4))/((-5sqrt(175) - sqrt(7))3) + 0 + 3. 2sqrt(5)/13 + 3 Simplify (((-1sqrt(120))/sqrt(3))/(sqrt(28)/(sqrt(14)/sqrt(2))))/((sqrt(150)/sqrt(40))/(1sqrt(48))). -8sqrt(2) Simplify (-3 + ((2(sqrt(132)2 + sqrt(132)) + sqrt(132) - sqrt(132) - sqrt(132) - sqrt(132)) + sqrt(132)-14)/((sqrt(308)2-1)/sqrt(7)))*2. 9 Simplify (-4(sqrt(12)/sqrt(3)-4 - sqrt(4)))/(sqrt(242) + 2sqrt(242) - sqrt(24)/sqrt(108)) + 3. 30sqrt(2)/49 + 3 Simplify ((1sqrt(343)5)2 + (sqrt(343) + 1)-4 - (-4 + (-1sqrt(343))2 + -3)) + -2. -28sqrt(7) + 8233 Simplify (-2 + -3(-4(-1 + sqrt(425))-3 + 2)2 + 3)-4. -14400sqrt(17) + 735596 Simplify (((sqrt(2) - sqrt(6)/sqrt(12)) + sqrt(98)4 + sqrt(2))*2 + (sqrt(200) + -2 + -2sqrt(200))*2-4)-3. -5547/2 + 480sqrt(2) Simplify -2 + sqrt(162) + -5 + 5 + 5(sqrt(2) - ((1 + sqrt(2) - sqrt(2)) + 1)). -12 + 14sqrt(2) Simplify (-3sqrt(20)/sqrt(2) + sqrt(10) - 1sqrt(160))/(2sqrt(800)/sqrt(4)). -3sqrt(5)/10 Simplify -5((sqrt(320) - -4(0 + sqrt(320))) + (sqrt(320) + 2)2 + 3 - (1 + (-5 + 1 + sqrt(320) - sqrt(320)) + 0)2). -1590 - 360sqrt(5) Simplify ((-1sqrt(392) + sqrt(392) - sqrt(392))55)/((sqrt(700)2)/(sqrt(7) - -6sqrt(28)/sqrt(4))). -245sqrt(2)/2 Simplify (-4sqrt(1452)-3)2 + -3 + sqrt(192) + 3 + 0. 8sqrt(3) + 209088 Simplify (((sqrt(180) + (sqrt(180) - sqrt(180)-1-3))/(-5sqrt(12)2))/((sqrt(5)2 + sqrt(5))1 + sqrt(5) + sqrt(20)/(sqrt(12)/sqrt(3))))*2. 3/2500 Simplify (sqrt(95) - ((sqrt(95) + -1sqrt(95))1 + sqrt(95)) - sqrt(95)-24)/(53(sqrt(125)-2 + sqrt(125))) + 0. -8sqrt(19)/75 Simplify ((sqrt(180) + sqrt(180)1 + sqrt(180))2)/(2sqrt(400)) + (-4(sqrt(180)-1 + 5))*2. -9591sqrt(5)/10 + 3280 Simplify (sqrt(1815) - (5((sqrt(1815)-4 + sqrt(1815) - sqrt(1815)) + sqrt(1815)) - sqrt(1815) - sqrt(1815)))/(sqrt(432)-2)-3. 99sqrt(5)/4 Simplify ((sqrt(25) + 4sqrt(25))4 + sqrt(25) - (sqrt(300)-1 - sqrt(300) - sqrt(300))/sqrt(12))/(sqrt(405)-26-4). sqrt(5)/18 Simplify (sqrt(330)/(sqrt(11)2) - 41sqrt(30))/(2sqrt(250) + -5sqrt(20)/sqrt(2)). -7sqrt(3)/10 Simplify -5(((1(sqrt(336)-3 - sqrt(336)))/sqrt(12))/(sqrt(256) + (sqrt(256) - (-3(3sqrt(256) - sqrt(256) - sqrt(256) - sqrt(256)) - sqrt(256)))))*2. -35/36 Simplify ((-3(-1 + sqrt(19))*2 + -1 - (sqrt(475)2 + -4))6 + 2)4-1. 96sqrt(19) + 1360 Simplify -6(((sqrt(112)-1)/sqrt(2) - (sqrt(56) - (sqrt(56)1 + sqrt(56))-4))/(-4sqrt(392)1))*2. -75/14 Simplify ((sqrt(120)/sqrt(2))/sqrt(6))/(41sqrt(5)) - (sqrt(8)/(sqrt(8)/sqrt(2)) - (sqrt(2) + 4 + 2)). sqrt(2)/4 + 6 Simplify (((-3 + sqrt(2736) + -2 + sqrt(2736))-35)2 - ((0 + (sqrt(2736) + -1)2 - sqrt(2736)) + sqrt(2736) + (sqrt(2736) - (sqrt(2736) + -1))-2)1)-5. -12326450 + 269880sqrt(19) Simplify (((sqrt(5500) + sqrt(5500)-1 - (sqrt(220)2)/sqrt(4))4)/(4sqrt(1100)-1 + sqrt(1100) + -2sqrt(1100)6))*2 + 1. 1141/1125 Simplify (2sqrt(448))*2-2 + 3 - -3((2sqrt(448))*2 - sqrt(448))2. -48sqrt(7) + 7171 Simplify (-4 + (2(1sqrt(13)-5)2 - (sqrt(13) + -1)262))1. 24sqrt(13) + 478 Simplify ((sqrt(360)/(sqrt(6)-4) - sqrt(60)) + sqrt(60) + (-5sqrt(4860) - sqrt(4860)))/(-1sqrt(1728)-11). -217sqrt(5)/48 Simplify (5((42sqrt(2057) + (sqrt(2057) + 0)-4 + sqrt(2057))-3 + 3 + 2sqrt(2057)1 + 4))2. -50050sqrt(17) + 8692050 Simplify (sqrt(10)4)/sqrt(2) + (sqrt(1800)/sqrt(10))2 - ((sqrt(2420)1 + sqrt(2420))/((sqrt(56)/sqrt(2) + sqrt(28) - sqrt(28))/sqrt(7)))*2. -2240 + 4sqrt(5) Simplify -3(4((-4 + sqrt(200) + -1 - sqrt(200))5 + -4))2. -40368 Simplify sqrt(36)/sqrt(12)1 + -2 + sqrt(432) + ((sqrt(270)/sqrt(9))/sqrt(10) - 1sqrt(48)). -2 + 10sqrt(3) Simplify (sqrt(3087)5 - sqrt(315)/(sqrt(10)/sqrt(2)))/((sqrt(9) + sqrt(144) + -1sqrt(36))6). 17sqrt(7)/9 Simplify (2 + 4(sqrt(1088) + sqrt(1088)14 + sqrt(1088)) + 3 + (-1(-2 + sqrt(1088)) - sqrt(1088)) + sqrt(1088) + -4)*2. 1104sqrt(17) + 575561 Simplify ((sqrt(99) + (sqrt(99) - (sqrt(99) + sqrt(99)6)))6 + (-4(sqrt(99) + -5sqrt(99)) - sqrt(99)))/(6((sqrt(324)-45 - sqrt(324)) + sqrt(324))). sqrt(11)/48 Simplify (sqrt(153)/sqrt(36) + sqrt(612) + 4 + sqrt(612))2 + ((sqrt(187) - -6(sqrt(187) + sqrt(187)-4))/sqrt(11)-5)*2. 100sqrt(17) + 501989/4 Simplify (((2sqrt(130))/sqrt(10) + sqrt(13))6 + 0 - (1 + sqrt(468) + sqrt(468)-1 + sqrt(468) + sqrt(13) + -1sqrt(208)))*2. -30sqrt(13) + 2926 Simplify -2 + 5 + -5(sqrt(98) - sqrt(2))2 + (6sqrt(128)/sqrt(4) + 2)*2. 96sqrt(2) + 799 Simplify -4(-6-2sqrt(5) - sqrt(35)/((sqrt(28) - sqrt(7)) + sqrt(7) - sqrt(7))) - ((sqrt(80)4)*2 + (sqrt(110)/sqrt(2))/sqrt(11) + sqrt(5)). -1280 - 46sqrt(5) Simplify 6(-3 + ((sqrt(720) - (sqrt(720) - -1sqrt(720))-2) + -2 + 3(-1 + sqrt(720) + -2))*2) + 3. -12672sqrt(5) + 277191
What is the next term in -27617, -27640, -27679, -27740, -27829, -27952, -28115? -28324 What is next in -5138, -10297, -15466, -20651, -25858, -31093, -36362? -41671 What is next in -3324, -3317, -3310, -3303, -3296, -3289? -3282 What comes next: 465, 259, 53, -153, -359, -565? -771 What is next in 534302, 1068604, 1602906? 2137208 What is the next term in 564, 1000, 1418, 1824, 2224, 2624, 3030? 3448 What is next in -2268, -9061, -20384, -36237, -56620, -81533? -110976 What comes next: 88777, 88778, 88779, 88780, 88781? 88782 What comes next: -132, -223, -290, -321, -304? -227 What comes next: -23791, -23792, -23793? -23794 What comes next: -3426, -3257, -3090, -2925, -2762, -2601? -2442 What comes next: -5109, -10212, -15315, -20418? -25521 What is next in 6312, 12613, 18914, 25215? 31516 What is the next term in -304, -917, -1838, -3061, -4580, -6389, -8482? -10853 What is the next term in 2472, 4966, 7460, 9954, 12448, 14942? 17436 What comes next: -386, -865, -1658, -2759, -4162, -5861, -7850? -10123 What is the next term in 1099, 4115, 9045, 15889? 24647 What comes next: -981, -998, -1027, -1074, -1145, -1246, -1383? -1562 What comes next: -73615, -147217, -220817, -294415, -368011? -441605 What is the next term in -9455, -18918, -28381, -37844? -47307 What comes next: 59, 214, 383, 494, 475, 254, -241, -1082? -2341 What comes next: -1983, -7081, -15579, -27477, -42775, -61473? -83571 What is the next term in -2016, -1145, -274, 597? 1468 What comes next: 1356, 1188, 1020, 852, 684, 516? 348 What comes next: 99, 61, -63, -321, -761, -1431, -2379, -3653? -5301 What is next in 575, 1169, 1777, 2399, 3035, 3685, 4349? 5027 What is next in 782, 6210, 20926, 49568, 96774? 167182 What comes next: 706, 713, 720, 727, 734? 741 What is the next term in -41771, -167077, -375915, -668279, -1044163, -1503561, -2046467? -2672875 What is next in 506, 515, 546, 611, 722, 891? 1130 What is the next term in -23458, -46923, -70398, -93889, -117402, -140943, -164518? -188133 What is the next term in 3385, 3409, 3433, 3457, 3481, 3505? 3529 What is the next term in -587, -1216, -1865, -2540, -3247, -3992, -4781, -5620? -6515 What is the next term in -7356, -14725, -22098, -29475, -36856, -44241? -51630 What is the next term in 29, 54, 31, -64, -255, -566, -1021, -1644? -2459 What is the next term in 2151, 2148, 2157, 2184, 2235? 2316 What comes next: -1372, -2580, -3788, -4996, -6204, -7412? -8620 What is the next term in 22484, 22522, 22620, 22808, 23116, 23574, 24212? 25060 What is the next term in -203, -428, -655, -884, -1115, -1348, -1583? -1820 What is the next term in 1891, 3745, 5563, 7345? 9091 What is the next term in -88403, -88400, -88397, -88394, -88391? -88388 What is the next term in 2628, 5185, 7742, 10299? 12856 What is next in 57807, 57837, 57895, 57987, 58119, 58297? 58527 What is next in 51, 74, 101, 126, 143? 146 What is next in 5836864, 5836865, 5836866? 5836867 What is next in -1730, -1737, -1744, -1751? -1758 What is the next term in 1675, 3232, 4789? 6346 What is the next term in -352, -337, -278, -151, 68, 403, 878, 1517? 2344 What is next in 721350, 721347, 721342, 721335, 721326? 721315 What is next in 883, 1145, 1407, 1669, 1931, 2193? 2455 What is next in 5231, 10464, 15701, 20942? 26187 What comes next: 1113, 1379, 1659, 1953, 2261, 2583? 2919 What is the next term in -2263, -4502, -6741, -8980, -11219, -13458? -15697 What is the next term in -1581, -6292, -14133, -25104, -39205, -56436? -76797 What is the next term in 1945, 1998, 2049, 2098, 2145? 2190 What comes next: -336375, -336377, -336379, -336381, -336383, -336385? -336387 What is the next term in -239, -1217, -2937, -5399, -8603, -12549? -17237 What comes next: 2094, 2112, 2134, 2160, 2190, 2224, 2262? 2304 What is next in -98, -908, -3100, -7364, -14390, -24868? -39488 What is next in -199, -329, -389, -373, -275? -89 What is the next term in 141, 180, 243, 330, 441, 576? 735 What is next in -79086, -316354, -711800, -1265424, -1977226, -2847206? -3875364 What comes next: 1359, 5354, 11979, 21210, 33023, 47394, 64299, 83714? 105615 What is the next term in 311909, 311869, 311827, 311783, 311737, 311689, 311639? 311587 What is the next term in 18631, 37342, 56053, 74764? 93475 What is next in -284360, -284358, -284356, -284354, -284352? -284350 What is the next term in -8035, -8034, -8033, -8032? -8031 What comes next: -46, -26, 0, 32, 70, 114, 164? 220 What is next in -79008, -79006, -79002, -78996, -78988, -78978? -78966 What is next in 151, 171, 235, 349, 519, 751? 1051 What is the next term in 46, 225, 406, 589? 774 What is next in -865, -744, -621, -496, -369, -240? -109 What comes next: -50693, -50678, -50653, -50618, -50573? -50518 What comes next: 28, 29, 28, 31, 44? 73 What comes next: 26544, 53032, 79474, 105876, 132244, 158584, 184902, 211204? 237496 What is the next term in -540842, -1081683, -1622524, -2163365, -2704206, -3245047? -3785888 What is next in -3903, -15594, -35083, -62370, -97455? -140338 What comes next: 27, 157, 519, 1233, 2419? 4197 What comes next: 22879, 45758, 68637? 91516 What is the next term in -7325, -7328, -7331, -7334, -7337? -7340 What is next in -10371, -20711, -31021, -41301, -51551, -61771? -71961 What is next in 84335, 84339, 84345, 84353, 84363, 84375, 84389? 84405 What comes next: -1395, -1389, -1397, -1425, -1479, -1565? -1689 What is next in 366, 1112, 2244, 3768, 5690? 8016 What is the next term in -39246, -78493, -117740, -156987? -196234 What is the next term in -927, -883, -839, -795? -751 What is next in 697, 1415, 2133, 2851, 3569? 4287 What comes next: -1327, -1343, -1381, -1453, -1571? -1747 What comes next: -18819, -37706, -56595, -75486, -94379, -113274, -132171? -151070 What comes next: 82465, 82463, 82461, 82459, 82457, 82455? 82453 What comes next: 313, 0, -313, -626? -939 What is next in -3305131, -6610263, -9915395? -13220527 What is the next term in -1951, -3843, -5735, -7627? -9519 What is the next term in -12563, -50254, -113071, -201014, -314083? -452278 What is the next term in -705, -694, -683, -672, -661? -650 What is the next term in 1351, 1269, 1057, 649, -21, -1019, -2411? -4263 What comes next: -270, -399, -386, -231, 66, 505? 1086 What is the next term in 119, 307, 665, 1277, 2227, 3599, 5477? 7945 What is next in 895, 1512, 2129, 2746? 3363 What comes next: -544, -1111, -1678? -2245 What is the next term in 167707, 167701, 167695, 167689? 167683 What is the next term in 22798, 22806, 22828, 22870, 22938, 23038? 23176 What is the next term in 2223, 4444, 6669, 8904, 11155, 13428, 15729, 18064? 20439 What is next in 268, 433, 610, 805, 1024, 1273, 1558? 1885 What is next in 1010, 1107, 1268, 1493? 1782 What is next in 2671, 5489, 8307, 11125, 13943, 16761? 19579 What comes next: 65068, 65064, 65060? 65056 What comes next: 114, 928, 3144, 7464, 14590? 25224 What is next in -64248, -64246, -64242, -64236, -64228? -64218 What comes next: -73983, -147965, -221947? -295929 What is the next term in -31666, -126539, -284662, -506035? -790658 What is the next term in -234, -474, -716, -960, -1206? -1454 What comes next: 687, 2215, 4587, 7803? 11863 What comes next: 146, 890, 2824, 6542, 12638, 21706, 34340, 51134? 72682 What is next in 4192, 4274, 4356, 4438? 4520 What is the next term in -52154, -52149, -52142, -52133, -52122? -52109 What is the next term in 426294, 852584, 1278874, 1705164, 2131454, 2557744? 2984034 What is the next term in -81196, -81200, -81206, -81214? -81224 What comes next: 9, 28, 85, 198, 385, 664, 1053, 1570? 2233 What is the next term in 79656, 318633, 716928, 1274541, 1991472, 2867721, 3903288? 5098173 What comes next: 524, 690, 856? 1022 What is next in 21998, 21999, 22000, 22001, 22002? 22003 What is the next term in -80186, -80145, -80104, -80063, -80022, -79981? -79940 What is the next term in -335, -2602, -8683, -20462, -39823, -68650, -108827? -162238 What is the next term in 19739, 39473, 59207, 78941, 98675? 118409 What is next in -18358, -18356, -18354, -18352, -18350? -18348 What is the next term in 318531, 318525, 318507, 318471, 318411, 318321? 318195 What is next in -1255, -2301, -3325, -4315, -5259, -6145? -6961 What is next in -426, -893, -1362, -1833, -2306, -2781? -3258 What comes next: -32461, -129818, -292073, -519220, -811253, -1168166, -1589953? -2076608 What is the next term in 3246, 3244, 3240, 3234, 3226, 3216, 3204? 3190 What is the next term in 6749, 13507, 20279, 27071, 33889? 40739 What is next in 360, 499, 732, 1059, 1480? 1995
Rearrange -3j2 + 6j - 2j4 - 6j + 26 - 30 to gj + i + rj*4 + nj*2 + xj*3 and give i. -4 Express -2 + 4 + 2h + 0h + (-2 - 1 + 2)(-21h - 19h + 5h) as u + yh and give u. 2 Rearrange (5d - 3d + 0d)((5 - 1 - 2)(-3 + 5 - 1) + (3 - 3 - 2)(-1 - 1 + 3) + (-4 + 1 + 1)(-2 + 2 + 1)) to the form xd + w and give x. -4 Rearrange u2 - u2 - u*3 + (0u*2 + 0u2 - u2)(179 - 179 + 17u) to the form mu + q + pu*2 + lu*3 and give l. -18 Rearrange -26f*2 - 56f*2 + 18f*2 to jf*2 + bf + a and give j. -64 Express (-76 + 76 - 4q)(-2 - 2 + 6)(0q*2 + 0q*2 + 2q*2) + 4q3 + q3 - 3q3 in the form xq + uq2 + lq*3 + d and give l. -14 Rearrange (1 + 3 - 6)(2z + 1 + 0 - 5z) to wz + y and give y. -2 Rearrange 2d + d - d + (1 - 1 + 2)(4 - 4 + 13d) - d - 2 + 2 to f + bd and give b. 27 Rearrange 1 - 1 + 2 + 0p*2 + 3p*2 to op*2 + a + mp and give a. 2 Express ((-7 + 2 + 3)(0 + 1 - 3) - 4 + 0 + 6 + 1 - 2 - 1)(2 - i - 2)(-23 + 24i + 23) in the form li + q + oi*2 and give o. -96 Express -4y*2 + 0y*2 + 8y*2 + (-5y + 3y + 4y)(0y - y + 5y) in the form vy + oy2 + s and give o. 12 Rearrange -15a - 23a2 + 6a*2 + 32a - 18a to m + ya + va2 and give v. -17 Express (5u - 3u - u)((-2 + 2 - 1)(0 - 4 + 2) - 5 - 1 + 7) in the form v + su and give s. 3 Express -1 + 1 - 49o2 + 30o*2 in the form ao*2 + so + v and give a. -19 Rearrange -101i - 1 - 1 + 74i to the form z + ui and give z. -2 Express 35f + 180 - 4f - 178 in the form a + cf and give c. 31 Rearrange (2 - 1 - 2 + (-3 + 2 + 2)(-4 - 1 - 2))(t + 2t - 2t)(2 - 5 + 0) to the form k + lt and give k. 0 Rearrange -89o4 + 178o*4 - 3o*2 + 10o - 91o4 - 2 to the form bo*2 + qo + ko3 + uo*4 + g and give u. -2 Rearrange (-2 - 2 + 1)(d + 4d + 20d) to wd + a and give w. -75 Express -10b*2 + 42b*2 - 19b*2 + 37b*2 as gb*2 + u + mb and give g. 50 Express 3j3 + 2j*3 + 0j*3 - 4j*3 + 2j*3 + 4j3 + (-9 + j2 + 9)(2 - 2 + j) as xj + k + mj2 + dj*3 and give d. 8 Express (-10o - 4o + 3o)(4 - 3 + 7) as k + mo and give m. -88 Express 2g3 + 11g - 17g + 3 + 2g*2 - 1 in the form kg + wg2 + d + pg*3 and give k. -6 Express (-1 + 4 - 2)(-2g + 16 - 16) + (2g + 0g + 0g)(-3 - 2 + 2) in the form r + og and give o. -8 Express -1 + 1 - t*2 in the form m + dt + ht2 and give h. -1 Express -18n + 18n + 5n*2 + (-2 + 2 - 1)(3n2 - 6n*2 + 2n*2) + 6 - 2n*2 + 4n*2 - 1 in the form in*2 + p + rn and give p. 5 Express -u*2 + 4u*2 + 2u*3 + 323u - 341u in the form gu + tu2 + zu*3 + i and give g. -18 Rearrange -2 + 3c + c*4 + 74c*2 - 2c*3 - 74c*2 to the form ic*4 + ac + fc2 + wc*3 + x and give i. 1 Rearrange 0z*3 - 2z*3 + 0 - 6 + (-4z2 + z2 - z*2)(-z + z - 2z) + z3 - z3 - z3 to fz*3 + d + nz + kz2 and give d. -6 Rearrange (7 - 8 - 5)(-20d3 - d3 + 3 - 5 + (0d*2 + 3d*2 - 5d*2)(2 - 2 - d)) to od2 + cd*3 + l + xd and give c. 114 Express ((-l + l + 3l)(1 - 3 + 0) + 0l + l + l + (1 - 1 + 1)(0l + 2l - l) - 3l + 6l - l)(0 + 1 + 3) as u + il and give i. -4 Express 8i3 - 2i*4 - 2i + 0i2 - 9i3 - i2 in the form zi3 + ti*2 + hi + a + oi4 and give o. -2 Express -20o - 50o + 19o as h + ao and give a. -51 Express 6 - 12p + 3p - p2 - p2 + 7p in the form mp2 + z + gp and give m. -2 Rearrange (0g3 + 0g*3 - 2g*3)((3g - 6g + 2g)(5 - 1 + 1) - 1 + 1 - 2g) to z + cg*2 + fg*3 + dg + sg4 and give z. 0 Rearrange 4 + 3 - 3 - 5 - 12a to va + y and give v. -12 Rearrange -18q - 23q + 21q to the form lq + n and give l. -20 Express -88 + j + 88 as o + kj and give k. 1 Express (2 - y - 2)(-6 + 3 + 1) + 1 - 2y - 1 - 2y + 2y + 3y + (-3 + 5 - 1)(-y + 4y - y) in the form wy + l and give l. 0 Rearrange (-3y + 5y + y)(-y - 2 + 2) - 13y2 + y2 + 4y2 to n + iy*2 + uy and give n. 0 Express -c - 2 - 14c + 15c + 46c2 as xc*2 + pc + s and give x. 46 Rearrange (3 - 3 - 1)(-1 + 2 + 2)(-3m + 5m - 3m) to km + n and give k. 3 Rearrange a - 5a3 + a3 + 0a3 - a3 to the form pa2 + ha*3 + g + la and give l. 1 Rearrange (9 - 8 + 27)(1 - 1 - 2q) to pq + u and give p. -56 Rearrange (-x + x + x2)((4 + 3 - 5)(1 + 0 - 2) + 3 + 0 - 4 + 2 - 5 + 0) to the form s + jx*2 + gx and give j. -6 Rearrange 253m3 + m4 - 255m3 - m - 3 + m2 + 2 to the form l + fm3 + om + um4 + km*2 and give k. 1 Rearrange -3 + 3 + i - 2i*2 + 0 to mi*2 + f + ri and give m. -2 Rearrange 3r3 - 2r3 + r2 - 2r3 - 28 to mr*3 + z + qr + pr2 and give m. -1 Express -2b - b - 5b2 + 2b*3 + 6b*2 - 3b*2 as hb + x + mb2 + qb*3 and give h. -3 Express 2t*3 + 2t + 0t + t2 + 2t*4 - 8t*4 in the form ut*2 + lt*3 + ct*4 + wt + b and give w. 2 Rearrange -2w3 + 1 + 3w*2 - 2w*2 - 16w*4 - 6w*3 - 2w + 9w3 to h + zw*2 + dw + mw3 + aw*4 and give a. -16 Rearrange -51j + 39j2 + 51j + (-1 + 3 - 3)(-2j*2 + 0j*2 + 4j*2) to the form cj + kj2 + d and give k. 37 Rearrange -67s + 11s - 2 + 28s to the form bs + j and give j. -2 Rearrange -2 - 18j*2 + 3j*3 + 2j2 + j + j2 + 1 to the form aj3 + lj*2 + g + xj and give x. 1 Rearrange -7p4 + 13p*4 + 4p*4 + (-4p + 2p + 4p)(-1 - 3 + 5)(2p3 - p2 + p2) to the form lp + cp2 + jp*3 + y + dp*4 and give d. 14 Rearrange -4a - 1992 + 1992 to the form ta + q and give q. 0 Express -5z + 16 - 2z - 22 + 7 in the form mz + k and give m. -7 Rearrange (0r + 2r + 0r)(18r2 - 17r*2 + 4 - 2r*3 - 6) to the form lr*4 + h + mr*2 + yr + br3 and give l. -4 Express 4m + 9m - 2m*4 + 2 - 11m + 2m3 in the form qm + zm3 + bm*4 + gm*2 + p and give q. 2 Rearrange -128r + 128r - 2 - 9r*2 to or + n + br2 and give n. -2 Rearrange (2303 - 2303 - 28i)(3 - 2 - 2) to o + vi and give v. 28 Express 39q - 10q + 8q as lq + g and give g. 0 Express 26y + 10y - 15y in the form h + iy and give i. 21 Rearrange 2y - 7y*2 - 2y2 + y2 + 0y2 + 2 to the form j + ky*2 + cy and give c. 2 Express -2 - x*3 + 4 + x + 0x + 0x3 as sx + ux3 + tx*2 + i and give t. 0 Rearrange 65 - 137 + 74 + 15l - 2l3 to jl*2 + al + d + pl3 and give p. -2 Rearrange 3f*2 - 3f*2 - 2f*2 + (-2f + 2f - 2f)(0f + 2f - f) + (0f - f + 0f)(-2f + 3f + f) to the form uf2 + k + hf and give h. 0 Express (21 - 13 + 29)(-4z + z + 2z + (5z - z - z)(-2 + 2 + 2)) in the form p + lz and give l. 185 Express -10h - 81 + 9h - 130 as b + dh and give d. -1 Express 51 - 25 + 24f - 23 as rf + w and give r. 24 Rearrange (2 - 5 + 4)(5a - 90a - 16a) to the form da + l and give d. -101 Express (4u - 2 + 2)((-2 + 2 - 1)(5 - u - 5) + 0u + 0u + 2u) in the form tu2 + s + du and give t. 12 Express (-3q + 2q - 2q)(47 + 12q2 - 10q*2 - 2q + 3q) as wq*3 + a + lq + vq2 and give v. -3 Express 5y*2 - 3y*2 - 4y2 + y - y - y2 + (-7 + 7 - 1)(-2 + 2 + 2y*2) as w + vy + oy2 and give o. -5 Rearrange -3u + u + 2u4 + 10u*2 + 2u*4 - 9u*2 + 1 to h + ru*4 + du*3 + pu + qu2 and give h. 1 Express 3 + 9b - 9b - 5b*3 - 2 in the form r + vb + ob3 + ib*2 and give o. -5 Rearrange (19r + 336 - 336)(-3 - 2 + 1) to the form w + nr and give n. -76 Rearrange a3 - a4 - 2 + 2 - a + 3a - 2 to the form da*3 + ja + ra2 + w + sa*4 and give w. -2 Express 4x*2 - 15x*2 - 12x*2 + 5x*2 in the form px*2 + r + dx and give p. -18 Express -r*3 - 8r*2 - 3r + 2r2 + r + r4 in the form v + br*4 + fr*3 + jr*2 + cr and give c. -2 Rearrange -2 - 4d - 7d*2 + 3d + d*2 + 4d*2 to the form fd + a + rd2 and give r. -2 Rearrange 5f - f*2 - 3f - 4f - 7f to the form pf2 + t + af and give a. -9 Express (5 + 0 - 4)(4b*3 - 5b*3 + 2b*3)(-5 - 4 + 7 - 2b) in the form xb*3 + r + lb*4 + nb + ob2 and give x. -2 Express (-p4 - 2p*4 - p + 5p*4)(39 - 19 - 18) as i + qp4 + kp + op3 + hp*2 and give o. 0 Express 3g + 3g4 + g - 2 + g as bg + ug3 + qg*2 + hg*4 + l and give h. 3 Express -2h + 0h2 - 4h*3 + 54 + 0h*2 - 55 in the form dh + g + ah2 + oh*3 and give o. -4 Rearrange (-1 + 1 - 3c)(2c*2 + 3c - 3c) - 4c3 + c3 + 0c3 - 2c + 2c + 3c*3 to kc*2 + fc*3 + w + pc and give f. -6
What is (3/9-1)/((2/12)/1)? -2 Calculate (9140/25592)/((-3)/(-7)). 5/6 What is the value of ((-342)/5814)/((-3)/17)? 1/3 Calculate 336/(-126)(-3)/4(-12)/(-2). 12 What is the value of (-2)/216/(-72)? 2/9 Evaluate (1/3)/(16(-46)/35328). -16 Calculate ((-1)/2)/(-1618/9216). 16 (6/5)/((-336)/5880) -21 Calculate 2/2(-51)/(-153)750/(-10). -25 What is the value of (-7)/(-3)(-24)/(10584/315)? -5/3 ((3/(-15))/(171/95))/((-26)/(-429)) -11/6 What is ((-80)/640)/(5/(-60))(-1)/(-21)? 1/14 What is ((-55)/(-30))/(5/208/(-6))? -11/2 Calculate 1(1/(-7))/(3/63). -3 What is the value of (-3)/13(-7)/(-21)-2? 2/13 What is the value of (-22)/(-154)(-12)/2? -6/7 What is (108/(-64))/(10/12)? -3/2 What is the value of (35/(-14)2)/(-35)? 1/7 What is ((-12)/(-6)1)/(-3)27/2? -9 Evaluate (-6)/16174(-6)/18. 17/2 What is (-17)/((-442)/143)-1(-4)/(-2)? -11 Calculate (10/432/(-100))/(164/(-410)). 2 Evaluate ((-658)/1128)/((-7)/(-9)). -3/4 Calculate 1/3(70/10)/(-21)3. -1/3 (-1250)/200(-84)/(-245) -15/7 (3540/4425)/(32/10) 1/4 What is the value of ((1/4)/((-10)/8))/((-572)/(-715))? -1/4 (14/(-6))/((-217)/(-1488)) -16 Evaluate (3/(-54))/(71/(-284)). 2/9 Calculate 481/((-962)/(-26))(-2)/(-26). 1 Calculate -1518/(-540)-110-3. 15 Calculate 21-3556/13720. -2/7 ((-9)/(-3))/(-9)14/((-1428)/(-34)) -1/9 (-1)/(-4)-83/(-10) 3/5 What is the value of 48/166/(-171)? -2/19 Calculate ((-58)/(-3306))/(((-10)/12)/(-5)). 2/19 Calculate ((6768/(-32))/47)/((15/4)/(-5)). 6 Calculate (-120)/155/(70/7). -4 Calculate ((570/72)/19)/((-390)/(-117)). 1/8 Evaluate -1((3/(-5))/(10/25))/(-6). -1/4 Evaluate ((-21)/(-4))/(((-135)/162)/((-90)/(-27))). -21 Calculate 140((-816)/34)/(-120). 28 What is the value of (1212/3232)/((-2)/32)? -6 162/(-108)6/12-24 18 What is the value of ((15/(-6))/(-5))/((-43)/(-86))-1? -1 ((-7400)/(-148))/(13/(13/(-2))) -25 What is -54247/380? -13 36/(-3906)-31651/(-6) -31 Evaluate (-4)/(9/((-252)/(-8))). -14 What is ((-1075)/645)/((-5)/(-45))? -15 What is 12/55/26(-221)/(-323)? 6/19 What is the value of 10/201/1(-184)/2990? -2/65 What is 182/328/(-12)? -3/4 Evaluate ((-25)/((-4550)/84))/((-72)/(-117)). 3/4 What is the value of -18223/(-3220)(-20)/(-2)? 13 Calculate ((-20)/5740)/((-1)/14). 2/41 Evaluate (18/10)/(3/(-6)). -18/5 Evaluate (2/(-3))/((-196)/37737/6). 11 Evaluate 47/(-4653)(-7)/(35/(-30)). -2/33 (-30)/2((-3)/2)/((-783)/(-116)) 10/3 Calculate (6/(-4))/(10/15). -9/4 What is (22/22)/(19/126)? 14 (-110)/99(-336)/320 7/6 Calculate ((-8)/(64/(-12)))/((-57)/(-190)). 5 Evaluate ((-18)/(-24)2/(-3))/(495/110). -1/9 Calculate (2751/(-655))/((-1)/((-10)/3)). -14 What is the value of (11/((-3861)/18))/(13/(39/(-2)))? 1/13 Calculate ((-4)/(28-1))/((-5)/(35/(-7))). 1/7 Evaluate 22/(-99)92. -4 What is (-90)/27(-45)/(-40)(-8)/6? 5 Evaluate (4/(-6)(-9)/(-12))/(11565/4626). -1/5 What is (-18)/(-15)(-275)/108/(-44)? 6 What is (-6)/5215/903? -2/7 ((-31)/(1519/49))/((-10)/(-4)) -2/5 What is (-452)/(-113)-103/(-6)? 20 Evaluate ((-12800)/(-1200))/((-12)/(-3)). 8/3 What is -3(-6)/42/(-1)? -9 What is the value of ((238/136)/((6/(-8))/3))/(-2)? 7/2 Evaluate (-10)/8(-72)/1208. 6 What is (1/(-6))/(((-50)/(-400))/(2/(-20)))? 2/15 (-2850)/1906/9 -10 What is the value of (-4)/((23/(-69))/(1/12))? 1 510/(-525)-9(-6)/9 -4/7 Calculate -13(-72)/(-312)16/4. -12 What is ((-9)/30-4)/(((-6)/(-3))/(-10))? -6 Evaluate -2-415/(-120)22. -4 What is the value of 56/35(5/(-3))/(40/60)? -4 What is the value of 54/(-1)-1((-3285)/(-90))/(-73)? -27 Calculate ((-2)/3)/(130/(-455))3-1. -7 Calculate 1/((16/(-12)(-18)/(-8))/1). -1/3 Calculate 164/2465/20. 1/6 Calculate 206/(-48)(-38)/10-2. -19 Evaluate (-1890)/420(-7)/(-84). -3/8 What is (105/42)/((5/(-40))/(18/(-12)))? 30 What is the value of -33/(-18)1296/(-1404)? -6/13 Calculate (-41)/(1230/225)(-2)/3. 5 Evaluate 59/(-354)24/(-92). 1/23 What is (-4)/1((-70)/14)/((-20)/(-24))? 24 Calculate ((-16)/40)/(322/(-115)(-2)/(-16)). 8/7 Evaluate ((-345)/(-10925))/(4/(40/3)). 2/19 (7/42)/(20/(-144)) -6/5 (2/(-5))/((-200)/(-125)2) -1/8 What is the value of ((-13)/91)/(26/(-2730))? 15 4(-21)/(-24)(-12)/(-7) 6 What is the value of -22/61188/(-44)? 18 Evaluate (4/(256/(-36)))/(177/(-236)). 3/4 What is (3(-5)/15)/((-185)/2775)? 15 ((-4)/(-10))/(((-972)/(-3915))/(-18)) -29 ((-12)/(-32))/((-1755)/(-1248))70/12 14/9 (44/8)/(-1(-3)/6) 11 Calculate (((-21)/(-56))/(-3))/((-31)/155). 5/8 Evaluate (-2094)/(-12215)30/2. 18/7 Evaluate (-624)/(-39)(-15)/(-400). 3/5 Evaluate (8(-27)/(-36))/((54/4)/(-3)). -4/3 What is (-6)/2(-2)/12-42? -4 Evaluate (-2)/(-5(-8)/(-140)). 7 Evaluate (3/(-2))/(6/(-48))3/(-6). -6 Evaluate (640/(-12))/1036/24. -8 What is (-534)/89(-1)/39? 2/13 What is ((-48)/(-3780))/((-33)/(2310/28))? -2/63 Calculate (28/3094)/(12/156). 2/17 Evaluate (((-6)/(-27)-3)/(-1))/((-8)/(-156)). 13 What is the value of (-40)/4-52/(-25)2? -8 What is (0(32/(-10))/(-16))/10? 0 What is 1/716170/(-210)? -11 What is (-392)/(-245)(-45)/12? -6 What is (35/35)/(43/252)? 9 What is the value of (-1)/(611/(-132))? 2 Calculate (4/10)/((200/(-625))/((-1)/20)). 1/16 What is (-9945)/1175/85? -5 What is the value of (12/2)/((-2100)/150)? -3/7 Evaluate (3245/(-2596))/((-10)/(-264)). -33 (-5(-24)/120)/((-29)/2) -2/29 Calculate 1040/(-5720)10(-11)/56. 5/14 (((-18)/5)/(-3))/(109/(98100/135)) 8 What is 83(-10)/(130/(-13))? 24 What is ((-12)/(-14)1)/((-216)/378)? -3/2 What is the value of (((-72)/8)/207)/((-2)/(-2))? -1/23 Calculate 98/(-7)(-5)/(-10). -7 Evaluate ((-6)/(-8))/((152/(-32))/(-19)). 3 What is the value of (216/(-126))/((-204)/(-42))? -6/17 Evaluate 88/2(204/32)/(-5). -22 (-4)/((-1)/(-2)1) -8 What is (28/6-1)/(6/(-216)12)? 14 What is (-144)/(-24)(-3)/62/18? -1/3 Calculate (-2800)/(-1750)(-10)/(-24). 2/3 What is the value of (6/2(-140)/16)/(180/(-240))? 35 What is (-1547)/4424/(-2)? 7 ((2/(-6))/(20/12))/((-417)/(-695)) -1/3 Evaluate (4/(-6))/(141/1692). -8 What is (-30)/1080-301(-4)/5? -2/3 (-12)/(-16)-2(-39)/(-117) -1/2 Calculate (-8)/10(16/(-36))/((-6)/135). -8 (-14)/357-289(-6)/(-2) 34 Calculate 1/((((-464)/(-32))/(-29))/(6/4)). -3 Evaluate (45/420-16)/(3/(-14)). 8 What is the value of ((-2)/(-76))/((-1)/(720/70))? -1/19 (1/(12/(-4)))/(19/57) -1 What is (4/(-18))/(514/(-43947))? 19 What is 5/(-11/5)58196/(-72745)? 20 What is ((-1)/12)/((-36)/(-72))36/(-6)? 1 What is (-2)/436/42(-77)/88? 3/8 Calculate ((-36)/8)/(54/108). -9 Calculate 6(-4)/(-16)((-25520)/(-120))/(-11). -29 What is the value of (-1100)/804/5? -11 What is ((-4)/(-21))/((-59)/177)-7? 4 6(248/(-32))/31-1 3/2 (2/286)/(2970/21780) 2/39 (2/(-2))/(-1)(-212)/1908 -1/9 Calculate (4/(-10))/(20/300-1). 6 7/143/42-4 -1/7 What is ((-280)/(-5355))/((-4)/(-36))? 8/17 What is the value of ((208/24)/(-13))/((32/3)/4)? -1/4 What is 135/189/(-27)-2? 5 Evaluate (2/31)/(13800/18600). 2/23 What is the value of (14/(-42))/((-17)/357)? 7 What is (-1)/(3/((-357)/(-17)))-3? 21 Evaluate 153/(-102)2/(-12). 1/4 (30/(-15))/(-8)2 1/2 What is the value of (1220/2928)/((-2)/6-5)? 1/4 Evaluate 17(-440)/1215552/(-2). 16 Calculate (245/(-210))/((-4)/(-6)). -7/4 What is the value of (-10)/(-12)3402/810? 7/2 What is the value of (-360)/(-468)(-13)/(-1)? 10 Calculate (126/1827)/((-20)/(-290)). 1 What is the value of (-114)/(-1((-408)/(-36))/17)? 21 Evaluate ((-9)/10)/(1017/678). -3/5 (64/400)/((-2)/(-275)) 22 Calculate (-1(-50)/(-40))/(-10). 1/8 (3/54)/((-7)/(-210)) 5/3 What is the value of (((-15)/2)/(-3))/((1080/20)/108)? 5 Calculate (-3)/12-8(-9)/(-99). 2/11 Evaluate 3/(37/(962/(-2730))). -1/35 Evaluate 24/88(-44)/(-8)816/72. 17 What is the value of (-9)/(-56)60/45? 3/14 Calculate (-7160)/(-136935)(-9)/(-4). 2/17 Calculate ((-5)/(-5)(-8)/(-16))/((-21)/(-12)). 2/7 Evaluate ((-42)/56)/(481/148). -3/13 What is (-5)/(-10)(-102)/170(-30)/(-1)? -9 ((-21)/(-56)-11)/(77/(-616)) 33 Calculate (-804)/(-1742)(-78)/9. -4 Calculate 20/9099/(-12)6. -9 What is the value of 390/650275/5? 33 What is (4/8)/((-47)/940)? -10 ((-7)/((-875)/6))/(((-434)/35)/31) -3/25 ((-12)/4)/142/362 -7 Calculate 234/13((-13)/26)/((-8)/16). 18 Calculate ((404/(-1515))/(4/10))/(1/8). -16/3 Evaluate ((-5)/2)/(-18(-75)/3240). -6 Calculate (392/35)/(-1(-34)/(-85)). -28 Evaluate ((-16)/24)/(((-4)/(-4))/(-2)). 4/3 What is (1/(-2))/((-18)/(-48))(-12)/4? 4 Calculate ((57/171)/(4/(-6)))/(-1). 1/2 Calculate (((-110)/(-33))/(-10))/(2/(-84)). 14 Evaluate 0/(8/63). 0 Calculate ((-3)/(-27))/(2/78)51/(-17). -13 Calculate (35/1302)/((-335)/(-804)). 2/31 Evaluate 2/((-1)/(26/65-40)). 32 Evaluate 629/((-3132)/(-120))(-1)/4. -5/3 Calculate 201/60-36/15. -2/5
Let y(x) = -2x3 - 6x*2 - 3x + 1. Let a be y(-6). What is the greatest common factor of 94 and a? 47 Let r be 70/6 + 2/(-3). What is the highest common divisor of 1 and r? 1 Let s(b) = 17b2 - 2. Let p be s(2). Let d = 7 - 11. Let g = 10 + d. Calculate the greatest common factor of p and g. 6 Let q(p) = -p3 + 9p*2 + 9p + 10. Let x be q(10). Suppose x = 2n - 1 - 3. Calculate the highest common divisor of 16 and n. 2 Let z = 42 + -23. Let i = 21 - z. Suppose -20 - 36 = -4d. What is the greatest common divisor of i and d? 2 Let h(j) = j*3 - 3j2 + j + 4. Let q be h(3). What is the greatest common factor of 7 and q? 7 Let l(s) = -s2 - 13s - 3. Let d be l(-13). Let p be (9/6)/(d/(-10)). What is the highest common factor of 2 and p? 1 Let j = 2 - 3. Let d be 2 + -19(j + -1). Calculate the highest common divisor of d and 16. 8 Suppose m - 4m = -75. What is the greatest common divisor of m and 5? 5 Suppose 446 = 5y - 3j - 1134, 658 = 2y + 4j. What is the greatest common divisor of y and 29? 29 Let v = -55 + 113. Calculate the greatest common divisor of v and 406. 58 Let p = 9 - -5. Let k(t) = -9 - t + 7t - t. Let j be k(6). Calculate the greatest common factor of p and j. 7 Suppose 6t - 4t = 56. Suppose y - 5y = -t. Let s be (-139)/(-4) + (-2)/(-8). Calculate the highest common factor of y and s. 7 Suppose -5p = 4f - 155, -3p - f - 4f + 106 = 0. Calculate the greatest common factor of p and 3. 3 Suppose 6 = -3c - 3. Let i be (-19)/(-2) - c/(-6). Calculate the greatest common divisor of i and 3. 3 Suppose p + r + 7 = 26, 0 = -p + r + 17. Calculate the highest common divisor of 18 and p. 18 Let g be 0/(2/(6/3)). Suppose g = -3q - 7 + 19. What is the greatest common divisor of 36 and q? 4 Suppose g + 100 = 3o, 3o + 64 = 5o + 2g. Suppose -9 = 3a - o. Calculate the greatest common factor of 72 and a. 8 Suppose 5d + 34 = 139. Suppose 6z - 3z - 5w = d, z - 4w = 0. What is the highest common divisor of z and 108? 12 Let r be 4/((18/(-4))/(-9)). What is the greatest common factor of 24 and r? 8 Suppose 7 = -3h + 4h. Suppose 4j - 5j + 35 = 0. Calculate the greatest common factor of j and h. 7 Let c be (-237)/(-21) + 4/(-14). Suppose -c = -g + 3. Suppose -w + 33 = -93. What is the highest common factor of w and g? 14 Let x = -202 - -338. Calculate the greatest common divisor of 17 and x. 17 Let k be 570/4 - 1/(-2). Suppose -4f + 2i + 49 = 7i, -5f + 71 = 3i. Suppose f = 6s - 62. Calculate the highest common divisor of s and k. 13 Suppose 0m - 411 = -3m + 3f, 5f = -2m + 239. What is the greatest common factor of m and 33? 33 Let u = 14 - 2. Suppose -6 - 4 = 5w. Let q be (-1)/w80/5. What is the greatest common factor of q and u? 4 Suppose 1572 = 19t - 898. Calculate the greatest common factor of t and 52. 26 Let d = 64 - 44. Suppose 2f + 2l + 2l - 60 = 0, -l + 99 = 4f. Suppose -2o + 5u + 18 = -o, f = 2o - 4u. Calculate the highest common divisor of d and o. 4 Suppose 65 = -3q + 8q. Let i = 39 - -52. What is the highest common divisor of q and i? 13 Suppose 31 = 3g + 4. Suppose -218 - 97 = -5t. What is the highest common divisor of t and g? 9 Suppose 36 = 4o - 5b + b, o - 3b = 3. What is the greatest common factor of 132 and o? 12 Suppose 4y + 24 = 2t, 2t - 4t = y - 29. Suppose t = 5g - 6. Suppose gb + 4 = 2v + 2v, v + 2b - 10 = 0. What is the highest common divisor of v and 12? 4 Suppose 5l + 3l = 40. Calculate the highest common divisor of l and 1. 1 Let f = 0 + 104. Calculate the greatest common factor of f and 8. 8 Suppose 4 = l - 0l. Suppose ly = y + 135. Let x be (-4)/681/(-6). Calculate the greatest common divisor of x and y. 9 Let w = 16 - 15. Let c = -9 + 20. What is the highest common divisor of w and c? 1 Let l be 2416/183. Suppose 0 = -u - u + l. What is the highest common divisor of 16 and u? 16 Let f(d) = d*3 - 9d*2 - 3d + 1. Let m be f(9). Let q be m/(-3) - (-4)/(-6). Calculate the highest common divisor of q and 64. 8 Let i be 3/(24/(-52))-14. Let q = i + -42. Calculate the highest common factor of 7 and q. 7 Let k(h) = -4h3 - h2. Let s be k(-2). Let w = s - 16. Let b be 2/(-5) + 1448/20. What is the highest common factor of b and w? 12 Let q be -2(-2)/24 - (-475)/30. Let j = 2 + 0. Suppose -js = -y + 8, -10 - 6 = -2y - s. What is the greatest common divisor of y and q? 8 Let z(w) = 4w*2 - 13w - 10. Let k be z(10). Let x = k + -152. What is the highest common factor of 12 and x? 12 Suppose -3b = -x - 25, -8x + 30 = b - 4x. What is the greatest common divisor of b and 10? 10 Let k(b) = 2b + 6. Let d be k(0). Calculate the highest common factor of d and 42. 6 Suppose 1 - 5 = -2f. Suppose -40 = -s - fk + 4k, -118 = -3s + 5k. Calculate the highest common divisor of s and 4. 4 Let k = -10 + 14. Suppose 2 = km - 42. Suppose 0 = -3z + 5u - 2, 3z - 5 = -2u - 0u. What is the highest common divisor of z and m? 1 Let b(i) = -i3 + i2 - i + 9. Let a be b(0). Let k = -103 + 202. Calculate the greatest common divisor of a and k. 9 Let v be 2(-5)/(-20)2. Calculate the highest common factor of 9 and v. 1 Suppose -146 = -4u - 34. What is the highest common divisor of 70 and u? 14 Suppose 4c = 5c - 112. Calculate the highest common factor of c and 16. 16 Suppose 3q = -12, -2r - 4q = 4 + 8. What is the greatest common divisor of r and 6? 2 Let x be 81/(-2) + (-4)/(-8). Let r = 2 - x. Let z be 2 + r + (-4)/2. What is the highest common factor of z and 14? 14 Let v(x) = x3 - 19x*2 + 18x + 13. Let n be v(18). Calculate the highest common divisor of n and 13. 13 Suppose 11n = 10n + 195. What is the highest common factor of n and 78? 39 Let d be (32/(-6))/(10/(-15) - 0). What is the greatest common factor of 56 and d? 8 Let t(r) be the third derivative of r6/120 + r5/10 + r4/6 - r3/3 + r*2. Let s be t(-5). What is the highest common factor of s and 15? 3 Suppose -1800 = 12y - 22y. Calculate the greatest common divisor of 40 and y. 20 Let q be (-4)/(-1) + -1 + 0. Calculate the greatest common divisor of q and 30. 3 Suppose -3l - 12 = 3, 5y + 3l = 0. Suppose 0 = yd - 8d + 315. Calculate the highest common factor of 21 and d. 21 Let w(i) = i*2 - 5i + 4. Let f be w(4). Let h be f/2 + 12 + 0. What is the highest common factor of h and 4? 4 Let g = -14 - -10. Let n be g/18 + 58/18. Let h = 11 - n. What is the greatest common factor of 4 and h? 4 Let b(n) = n*2 + 2n + 2. Let h be b(-2). Let q be (-128)/(-12) + h/6. Calculate the greatest common factor of 11 and q. 11 Let z be (-10)/3 - 5/(-15). Let x = 5 + z. What is the greatest common divisor of x and 2? 2 Let g be 1 - (-4 - 1) - 0. Suppose 2p + 138 = 3m, -m + gm = 4p + 228. What is the highest common divisor of 12 and m? 12 Let q(v) = v*3 + 2v*2 + 2v + 2. Let l be q(-2). Let k be ((-1309)/14)/(l/4). What is the highest common factor of k and 17? 17 Suppose -5a = -2a - 12, -5b = -2a + 478. Let q = b - -199. What is the highest common divisor of q and 21? 21 Suppose d + 6 = 12. Calculate the greatest common factor of d and 9. 3 Suppose -5y + 23 = -7. Suppose yv - v = 0. Suppose 3d - 3 = -vm + 4m, 3m - d - 4 = 0. What is the greatest common divisor of m and 21? 3 Let v = -56 + 104. What is the highest common factor of v and 12? 12 Let o = 67 + -57. Calculate the greatest common factor of 2 and o. 2 Suppose 0 = -3a + 6, -3l - 5a + 235 = 33. Calculate the greatest common divisor of l and 4. 4 Suppose 6c - 8c + 8 = 0. Let o be (2/c)/(3/6). Calculate the greatest common factor of 11 and o. 1 Let a(t) = t2 + 15t + 5. Let c be a(-15). Calculate the greatest common divisor of c and 55. 5 Let p(a) = -245a + 3. Let o be p(2). Let w = -344 - o. Calculate the highest common divisor of 13 and w. 13 Let n(z) = -z2 + 37z + 38. Let r be n(23). What is the highest common divisor of r and 40? 40 Suppose 4i - o + 6o = -128, 2i - 2o + 46 = 0. Let r = i - -54. What is the highest common factor of r and 9? 9 Let t be (-1)/3 + (-100)/15. Let w be (t - -9)2/4. What is the greatest common factor of 4 and w? 1 Suppose z = 5z - 320. What is the highest common divisor of z and 16? 16 Suppose -101 + 345 = 4n. Let k = n - 30. Let y be -1 + k(2 + -1). Calculate the highest common factor of y and 10. 10 Let l(p) = -2p2 + 11p - 2. Let x be l(5). Calculate the greatest common divisor of x and 27. 3 Suppose -5i = 3r - 100, -3i + 0i + 126 = 4r. Let m(a) = 4a - 8 - 8a2 - 7a - 4 - a**3. Let f be m(-8). What is the highest common factor of f and r? 6
Calculate 304466814982875 - -1. 304466814982876 What is the difference between -1.6293 and -0.9016208? 0.7276792 Subtract 41297375430 from -50. -41297375480 What is 0.1359 take away 0.0235112139? 0.1123887861 Subtract 0.3 from 32372482347626. 32372482347625.7 Add -33623363550 and 12. -33623363538 Subtract -1.734804 from -0.034596. 1.700208 Subtract 200 from -4.49141474. -204.49141474 Work out 207618 - -10.436. 207628.436 Add 4 and -97483250732766. -97483250732762 Put together -0.12 and 5195209572.7. 5195209572.58 What is 126088819 less than -4140? -126092959 Sum 176 and 142147386718. 142147386894 -1480086859428 - -1 -1480086859427 Calculate 75493732113 + -0.8. 75493732112.2 Calculate 0.1753026 - 62164. -62163.8246974 Put together -1 and 135930233.66. 135930232.66 Calculate 4822052.8537 + -24.24. 4822028.6137 What is -6670.108 - -856300? 849629.892 What is -63892884.52 less than 47? 63892931.52 0.175 - -1112516702 1112516702.175 Work out -323.276063 - -6628. 6304.723937 Subtract -18224381661470 from 0.2. 18224381661470.2 Put together -2.3 and 12119824479. 12119824476.7 Calculate -89729541681 - -0.89. -89729541680.11 What is -1.04 - 1942593098203? -1942593098204.04 What is 768934741273 minus -16? 768934741289 What is the difference between 0.1864 and -56096667? 56096667.1864 Put together 0.57 and -2528575289.861. -2528575289.291 What is -28653552845 less than 3.3? 28653552848.3 Sum -132561207434 and -11. -132561207445 What is 0 minus 5956621640887? -5956621640887 What is the distance between -2223673735 and 4.9? 2223673739.9 Work out -91408190 + 851. -91407339 -145 - -20731602405 20731602260 Total of 52.45 and 0.450927056. 52.900927056 Total of -2677 and -2313134360. -2313137037 What is 71147 - 17164.841? 53982.159 Subtract 701.3498381 from 1067. 365.6501619 Calculate -0.23599 + 0.8097973. 0.5738073 Add 2.78800781821 and -114. -111.21199218179 -76832 - -39811.87 -37020.13 Work out -1858877 - 20.706. -1858897.706 What is -14403983351 - -13? -14403983338 Total of -9.45331357 and 3392. 3382.54668643 What is 36173 minus -95.3144? 36268.3144 Work out -3442213987 - 174.292. -3442214161.292 What is 164831 take away -3482927? 3647758 What is -2184620 minus -2012.64? -2182607.36 Add together -7.83886 and 18978453. 18978445.16114 What is 0.0943 take away 19261443326? -19261443325.9057 Subtract 3146919.876 from -90. -3147009.876 Add -4 and 371838490776. 371838490772 Add together 193437094 and -378.73. 193436715.27 What is 32654814170.58 less than -0.108? -32654814170.688 Work out -21379.5223422 + -1. -21380.5223422 Add -934878158486 and -1.3. -934878158487.3 Add -0.1104753048 and 10.2. 10.0895246952 0.3 - 1340178294628 -1340178294627.7 What is -4137920 - -36132? -4101788 Calculate -2311 - -1786910734. 1786908423 0.3309+-14368.7189 -14368.388 -0.21 - 0.53697528205557 -0.74697528205557 Put together 501.9456 and -2500.6089. -1998.6633 Add together 1371500104 and -0.045. 1371500103.955 What is -23 minus 3981.14296749? -4004.14296749 10149388708200 + -0.7 10149388708199.3 Sum 0.2 and 84876694775964. 84876694775964.2 What is 120737737156 less than -7? -120737737163 Sum 2.0299 and -415985040.4. -415985038.3701 What is 24129 - 21.6696608? 24107.3303392 What is 0.07 plus 160074.48368? 160074.55368 Work out -0.15 - 60542106448363. -60542106448363.15 Put together -25.4 and -4.70910241. -30.10910241 Calculate -3580.498 + -37408. -40988.498 Add 29888647 and 54630. 29943277 Work out -132278631150 + 983. -132278630167 What is 0.00173 less than 19999935? 19999934.99827 Add 23.585156234 and 0.0716. 23.656756234 What is -74314858 + 80272? -74234586 Total of 202.01686532 and -1.44. 200.57686532 Calculate 9.54 - 42630800913. -42630800903.46 Add together 195777873698 and -0.4. 195777873697.6 Calculate -7.725 - 842863390.15. -842863397.875 What is -1.118945310101 take away -0.5? -0.618945310101 What is the distance between 715 and 605101098.1? 605100383.1 What is the distance between -74360619.5 and -35.7? 74360583.8 Sum 280877074 and -51.2. 280877022.8 Calculate 11746603 + 130229.225. 11876832.225 Put together 2099 and 185701809. 185703908 16190.677 + -2936 13254.677 Add 84335593734719 and 0.4. 84335593734719.4 What is 3 - -14603438161559? 14603438161562 What is 0.548775 plus 22957? 22957.548775 Work out -18364391.3276 + 16. -18364375.3276 What is 2 take away 298.180201574801? -296.180201574801 -60945641939 + 0.091 -60945641938.909 Calculate -20205698234 + 3.5. -20205698230.5 Calculate -0.07156501952 + -70.3. -70.37156501952 Sum -59621519 and -97957. -59719476 What is 0 less than 5549274522295? 5549274522295 109436748117+-808 109436747309 What is 13935.7 less than -1260385? -1274320.7 Calculate 0.12599 - -123.27753. 123.40352 What is the difference between -1268 and -5901046559? 5901045291 Total of -19567 and -145483193. -145502760 3512297.22 - -0.97 3512298.19 Add together -157719860311 and 0.03. -157719860310.97 5+-27998.582651 -27993.582651 What is the difference between 752773242885 and 0.5? 752773242884.5 Add together -669665471 and -3892.8. -669669363.8 -0.1 + 1164.386302535 1164.286302535 What is -1.6 + -0.00770621771451? -1.60770621771451 What is -35812156361550 less than -8? 35812156361542 What is 3037125 take away 1056977? 1980148 143302333 - 38.06 143302294.94 Calculate 35.9 + -3985.985156. -3950.085156 Calculate 482870 - 4368934. -3886064 Total of -73461391956.6 and 0.08. -73461391956.52 Total of 763745076708 and 0.048. 763745076708.048 What is 248 plus -30.4714025? 217.5285975 Calculate 226 - 22583430.193. -22583204.193 Work out -354031973539 + -5. -354031973544 Calculate -12114 + -0.076814677. -12114.076814677 What is -1 minus 506.910153588? -507.910153588 -107869881 + 78291 -107791590 Total of 21.504 and -0.15037113. 21.35362887 Add together 0 and 47794809318. 47794809318 Total of -697.733 and 1610.0311. 912.2981 Calculate 4 - 21747.792179281. -21743.792179281 Work out 9998 + -25619632112. -25619622114 What is -77.03 - -8731185? 8731107.97 Calculate 3267320 + 121038638. 124305958 Work out -0.1 - -709479291.55. 709479291.45 -0.00057 + 3767138 3767137.99943 Add together 6215 and -0.14637292. 6214.85362708 Total of 94995654.33 and -69928. 94925726.33 Put together -2835 and -246159267499. -246159270334 0.08 - 266648624699 -266648624698.92 -0.02405 - -14016.9134 14016.88935 Subtract 3 from 55005183264749. 55005183264746 What is 14041 + 53722195? 53736236 Work out 384965.53404 + 21. 384986.53404 5358187479145 - -5 5358187479150 What is the distance between -358290702728183 and 0.1? 358290702728183.1 Add 2 and 29456587.57813. 29456589.57813 516438.94 + -2169 514269.94 Put together 97109.7961904 and -1.18. 97108.6161904 What is -2091512 plus -28210880? -30302392 Work out -936.1 + 6936424.812. 6935488.712 What is 0.73 less than 28032489560? 28032489559.27 Calculate 1202142 + 1247644.3. 2449786.3 What is -0.3 plus 13334138091178? 13334138091177.7 Work out 273617744 - -217. 273617961 Calculate -0.8411502015 + 64. 63.1588497985 Work out -2038357469 + 178. -2038357291 Calculate 172681366.2394 - -0.3. 172681366.5394 What is 4250506 less than -0.299411? -4250506.299411 What is -18.64 - -1359095.9774? 1359077.3374 Work out -16.4992643 - -2182. 2165.5007357 What is 9.29523 take away 394140596? -394140586.70477 What is the difference between 3311276.963933 and -2? 3311278.963933 Add -112 and 369009943695. 369009943583 What is -195273 take away -6233537? 6038264 What is the distance between 26409 and 1072465? 1046056 Work out -2859.6 + -1536855.7. -1539715.3 What is -462.448 less than -418679? -418216.552 What is 25016029759 + -0.09159? 25016029758.90841 Calculate 30.8111 + -586642. -586611.1889 Calculate 1.128257 - -764.9. 766.028257 What is -41387.4456 take away -3155? -38232.4456 Total of 0.062 and 3016.7506282. 3016.8126282 Total of -617 and -29.9806694. -646.9806694 What is -2068.952 - 28226? -30294.952 Calculate 41917 + -0.057517866. 41916.942482134 What is 49425263 - 14.6701? 49425248.3299 What is the distance between 0.339 and 2644875119.11? 2644875118.771 Put together 1269949505340 and -160. 1269949505180 What is the distance between -17637252753 and -0.01? 17637252752.99 What is 2535276867182 plus 5? 2535276867187 Work out -203894435941 - -2. -203894435939 What is 2.6 less than -43.04856901468? -45.64856901468 14.6158968+91 105.6158968 What is the distance between 8121504835 and 8803? 8121496032 Subtract 2274540 from 38405.5. -2236134.5 What is 1652382943 minus 37.1? 1652382905.9 What is 6312 plus 75998893? 76005205 What is -51.6093235 minus -10.38? -41.2293235 Put together 8 and 322853122. 322853130 What is the distance between 7.34773 and 83904? 83896.65227
Let u(g) = 6g3 - 3g*2 - 4g. Let k(n) = 6n3 - 2n*2 - 3n. Suppose -8 = 5f - 2m - 2, 2m + 4 = 0. Determine fu(j) + 3k(j). 6j*3 - j Let l(s) = 43s - 5. Let b be l(2). Let v(w) = -95w3 + bw*3 - 5w - 3w. Let f(d) = -d3 - d. Determine 8f(g) - v(g). 6g3 Let l(o) = 6o*3 + 8o*2 + 4. Let f be ((-115)/46)/(12/4). Let z(h) = h3 + h2 + 1. Determine fz(u) + l(u). u3 + 3u2 - 1 Let h(z) = -z2 + 1. Let k(l) be the third derivative of 11l5/30 - 11l*3/6 + 103l*2 - 3l. Calculate 22h(m) + 2k(m). 22m2 Let x(j) = -2j3 + j2 - 1. Let l(m) = -m*3 + 3m*2 + 5. Determine l(a) - 3x(a). 5a3 + 8 Let g(r) = r + 1. Let t(z) be the third derivative of z4/8 + 5z*3/6 + 24z*2. Let q = 27 - 28. Give qt(l) + 4g(l). l - 1 Let q(z) = 4z*2 + 3z + 1. Let l(n) = -2 + 3 - 5n2 - 2n - 2n - 2. Let i be (-11)/(-4) + (-3)/(-12). Suppose 0h + i = -h. Calculate hq(w) - 2l(w). -2w2 - w - 1 Let q(k) = -50k*2 - 6k - 10. Let o(n) = 17n2 + 2n + 3. What is 10o(a) + 3q(a)? 20a2 + 2a Let h(b) = 15b2 - 7b - 11. Let o(m) = -7m2 + 4m + 6. Give -4h(d) - 7o(d). -11d2 + 2 Let s(h) = 3h*2 - 6. Let c(o) be the first derivative of -3o*3 + 17o + 127. Determine -6c(r) - 17s(r). 3r2 Let p(g) = 11g*2. Let u be 16/9 - (-6)/27. Let f(c) = -5c + 2c + 3c + 4cu. Determine -17f(l) + 6p(l). -2l*2 Let i(x) = 4x + 76. Let y(z) = 6z + 114. Determine 8i(o) - 5y(o). 2o + 38 Let q(x) = -11x + 1. Let o be ((-10)/(-4))/(7/(-14)). Let c(t) = -12t + 2. Let j(d) = oq(d) + 4c(d). Let f(w) = 76w + 32. What is -3f(p) + 32j(p)? -4p Let c(h) = 91h3 + 5h*2 + 18. Let a(j) = -136j*3 - 7j*2 - 26. Calculate -5a(t) - 7c(t). 43t*3 + 4 Let r be 24/(-1) + 2/1. Let s(j) = -9 - 4j + 1 - 8 + 15j3 - 11j*2 - 6 + 18. Let i(u) = 4u*3 - 3u*2 - u - 1. What is ri(w) + 6s(w)? 2w*3 - 2w - 2 Let a(z) = -z2 + 2. Let j(l) = -l3 + 25l2 - 15l - 10. Give -5a(w) - j(w). w3 - 20w*2 + 15w Let z(h) = h*2 + 2. Let t(s) = -6s*2 + 38s + 5. Let y(v) = -v*2 + 7v + 1. Let f(o) = 2t(o) - 11y(o). Give 2f(u) + z(u). -u2 - 2u Let w(v) = -v. Let p(n) = -3n. Let k(c) = -5p(c) + 18w(c). Let z(x) = -2x. Let o = -8 - -16. Let s = o - 4. Determine sz(y) - 3k(y). y Let z(c) = c*2 - c - 1. Let n(d) = d - 7. Let j be n(7). Let v = j - 1. Let k(x) = -31x*3 + 2 - 3 + 29x*3. Determine vz(w) + k(w). -2w3 - w2 + w Suppose 0 = 4r + 25 - 9. Let s be 3/r - 14/(-8). Let a(c) = s + 3c + 2 - 7 + 2. Let x(h) = -2h + 1. Determine 3a(y) + 4x(y). y - 2 Let k(r) = 8r + 71. Let s(d) = 7d + 74. Calculate -6k(n) + 5s(n). -13n - 56 Let d(f) = -6 + 0 + 0f*2 - f + 8f*2 + 6 - 2. Let z(i) be the first derivative of 1 + 1/3i*3 + 0i*2 + 0i. Determine -d(p) + 6z(p). -2p2 + p + 2 Let j(k) = k2 + 4k. Let z(a) = -a. Let t(o) = 10 + 7o - 3 + 0o + 7o2 + o3. Let u be t(-6). Let n = -1697 - -1702. Give nz(x) + uj(x). x*2 - x Let k(q) = 2q - 188. Let c(b) = 3b - 282. What is 5c(n) - 8k(n)? -n + 94 Let m(q) = -4q - 3. Let w(t) = -10t - 6. Give 13m(i) - 6w(i). 8i - 3 Let w(b) = -2b + 5b - 10b2 + 3b - 2. Let v(h) = 19h2 - 11h + 4. What is -6v(c) - 11w(c)? -4c2 - 2 Let t(v) = -4v - 9. Suppose 5d + 5f = 22 - 7, -2d + 9 = f. Let l(b) = b2 - 4b - 7. Let n be l(d). Let o(x) = -4x - 4 + 0 + 2x. Give no(k) - 2t(k). -2k - 2 Let g(z) = 11z - 6. Let u(m) = -5m + 3. Suppose 0 = -4l + 153 - 5. Let c = l - 31. Give cg(o) + 13u(o). o + 3 Suppose -5d - 4t + 22 + 4 = 0, d - 5t = -18. Let l(v) = -2v*2 - 4v + 2. Let n(f) be the first derivative of -f*2/2 + 1. Determine dn(g) - l(g). 2g2 + 2g - 2 Let z(c) = c*2 - c. Let i(g) = -36g*2 - 5g. Calculate -i(d) + 5z(d). 41d*2 Let p(v) = -7v*2 + 2v - 15. Let s(q) = -3q2 + q - 7. Determine -4p(n) + 9s(n). n2 + n - 3 Let u(c) = -c3 - 2c + 11. Let f(r) = -4r3 + r2 - 7r + 34. Give 2f(s) - 7u(s). -s*3 + 2s*2 - 9 Let d(s) = -s. Let z = -321 - -320. Let f(c) = -21c + 3. Give zf(g) + 18d(g). 3g - 3 Let o(j) be the second derivative of 3j5/20 - j4/4 - 3j2/2 + 642j. Let w(x) = -18x3 + 17x*2 + 17. Determine 34o(c) + 6w(c). -6c*3 Let m(s) = 4s - 5. Let f = 1580 + -1586. Let g(h) = 4h - 6. Determine fm(i) + 5g(i). -4i Let u(c) = 30c3 - 14. Let o(q) = -6q*3 + 3. Let h be 4 - (2/(-11) - (-6400)/352). Determine ho(j) - 3u(j). -6j*3 Let j(g) = -137g*3 + 6g*2 + 5g. Let n(q) = 135q3 - 5q*2 - 4q. Determine -5j(v) - 6n(v). -125v3 - v Let v(w) = w3 + 2w. Let r(o) = 4o3 + 7o. Suppose 3k + 65 = -u, 7k - 6k - 5u + 11 = 0. Give kv(b) + 6r(b). 3b3 Let w be 9/15 + (-88)/5. Let m(i) = 6 - 525i + 260i + 259i. Let o(z) = -2z + 2. What is wo(h) + 6m(h)? -2h + 2 Let u(b) = b*2 - b - 1. Let t(z) = 6z*2 - 97z - 3. Give -t(r) + 4u(r). -2r*2 + 93r - 1 Let f(d) = 8d + 2. Let q(l) = -1. Give 2f(s) + 4q(s). 16s Let f(m) = m - 1. Let n = -995 + 994. Let x(r) = r + 7. Calculate nx(q) + 2f(q). q - 9 Let r(g) = 4g2 + 6g. Let f = -1417 + 1411. Let x(j) = -j*2. Calculate fx(c) - r(c). 2c2 - 6c Let m = 17682 + -17687. Let p(b) be the third derivative of -b6/120 - b4/24 + b3/6 - b2. Let c(x) = -4x3 - 8x + 5. Determine mp(z) + c(z). z3 - 3z Let l(z) = 2z - 4. Let d(q) = q - 1. Suppose 0 = -0a + 6a - 4a. Suppose a = -4t + 4u, -3u - 6 = -0t - t. Determine td(m) + l(m). -m - 1 Let h(a) = -40a*3 - 6a*2 - 7a + 7. Let d(f) = -20f3 - 3f*2 - 4f + 4. Give 7d(r) - 4h(r). 20r3 + 3r*2 Let q(g) = -11g*3 - 2g*2 - 3g. Let f be 18/(-8) + ((-21)/(-4) - 5). Let t(o) = -12o3 - 3o*2 - 4o - 1. Determine ft(s) + 3q(s). -9s3 - s + 2 Let s(j) = -4j3 - j2 - 3j - 1. Let k(i) = -4i3 - i2 - 2i. Suppose 4z = 3p + 6, -2z - 4 = -4p - 2. Calculate zk(o) - 2s(o). -4o3 - o2 + 2 Let m(t) = -5t. Let a = 11 - 13. Let q(l) be the second derivative of l3/6 + 35l. Give am(r) - 6q(r). 4r Let c(w) = -w3 + 4w*2 + 25w. Let o(u) = -5u2 - 25u. Determine -3c(z) - 2o(z). 3z3 - 2z*2 - 25z Let c(l) = 27l + 13. Let b(o) = -9o - 5. What is -17b(v) - 6c(v)? -9v + 7 Suppose 7z + 22 = 71. Let j(r) = 7r + 4. Let g(f) = 3f + 2. What is zg(u) - 4j(u)? -7u - 2 Let m(p) = 2178p + 36. Let x(g) = -622g - 10. Calculate 5m(h) + 18x(h). -306h Let z(v) = 54v2 - 30v + 15. Let u(f) = -f*2 - 2f + 1. Calculate -15u(b) + z(b). 69b*2 Suppose b = -2b + 24. Suppose 2c - 5v = -1, 3c + 3v - 1 = b. Let l(g) = -57gc - 10g + 58g2 + 3g. Let h(d) = -d. What is 4h(a) - l(a)? -a2 + 3a Let a(y) = -4y2 - 5y. Let r = 1011 - 1007. Let s(v) = -4v2 - 4v. What is ra(t) - 5s(t)? 4t2 Let g(c) = -c + 1. Let q(h) = 345 - 85 - 88 - 85 + 6h - 93. Determine -10g(a) - 2q(a). -2a + 2 Let k(s) = 291s - 8. Let b(w) = 145w - 3. Determine 5b(a) - 2k(a). 143a + 1 Let w(z) = -2z + z2 + z + z + 1. Let l(u) = u3 + 5u2 + 5. Let j(p) = p3 - 5p2 - 3p + 1. Let t be j(5). Let h = t + 19. Determine hw(q) - l(q). -q3 Let d(m) = -2m + 5 + 3 - 9. Let f(l) = 10l + 6. Determine -16d(u) - 3f(u). 2u - 2 Let n(m) = -m*3 + m + 1. Suppose -11 = -4o + 9, 0 = -z - 2o + 8. Let g(i) = 2i + 2. Calculate zn(f) + g(f). 2f*3 Let y(l) = -14l*2 + 14l - 12. Let f(i) = -7i2 + 6i - 5. Determine 14f(x) - 6y(x). -14x2 + 2 Suppose r = 5 - 1. Suppose 5v = 2q - 6q + 12, 12 = rq - 4v. Suppose -q = 2s - 1. Let k(w) = -w2. Let u(i) = i2 + i - 2. Calculate sk(a) + u(a). 2a2 + a - 2 Let a(w) = -19w - 2. Let o(m) = 19m + 2. Calculate -4a(c) - 5o(c). -19c - 2 Let q(x) = 4x2 - x - 43. Let d(t) = 2t*2 - t - 21. Determine -7d(m) + 4q(m). 2m*2 + 3m - 25 Let s(l) = 3l2 - 23. Let p(v) = -v2 + 2v. Calculate 2p(d) + s(d). d2 + 4d - 23 Let p(h) = -h + 2. Let v(k) = 5k + 97. What is 6p(b) + v(b)? -b + 109 Let l(a) = 11a2 - 16a + 2. Let i(q) = -13q2 + 16q - 3. Give -2i(z) - 3l(z). -7z2 + 16z Let r(p) = 3p + 30. Let k(y) = -3y - 26. Determine -3k(h) - 2r(h). 3h + 18 Let h(d) be the first derivative of 2d*2 + 3. Suppose -18v = -9v - 27. Let n(t) = -5t - 1. Calculate vh(b) + 2n(b). 2b - 2 Suppose -10h + 4h = 66. Suppose -n + 2v = 2, 5n - 4n - 4v = -4. Let w = n - h. Let k(b) = -14b - 5. Let p(j) = -5j - 2. Give wp(t) - 4*k(t). t - 2
What is the closest to 2/7 in 5, 0, 1/4, -5? 1/4 Which is the closest to -0.1? (a) 0.3 (b) 4 (c) 3/44 c What is the closest to 11 in 2/7, -4, -2? 2/7 What is the nearest to -1/3 in 1, 0.5, 6, 0.3? 0.3 Which is the closest to -1? (a) 3/5 (b) -1/6 (c) 2/7 (d) -3 b What is the nearest to 18 in 0, 5, 2/3? 5 What is the nearest to -13 in 4, -2/9, -0.081? -2/9 Which is the closest to 10? (a) -2/11 (b) -2 (c) 1 (d) -32 c Which is the nearest to -0.1? (a) -13/5 (b) 3/4 (c) 4 (d) -2/9 d What is the nearest to 0.5 in 8, 5, -2, 2/5? 2/5 Which is the nearest to -1.5? (a) 7 (b) -0.1 (c) 26 b What is the closest to -2/5 in 6, 4, 3, -2/15? -2/15 What is the closest to 0 in 3.7, 1, -5, 2? 1 Which is the nearest to -3/4? (a) 5 (b) 35 (c) 0.01 c Which is the nearest to 0? (a) -25 (b) -1/5 (c) 4/3 (d) 0.3 b Which is the nearest to -1/28? (a) -1 (b) 0.3 (c) 3 (d) 0.4 b Which is the closest to 2/13? (a) -456 (b) -2 (c) -0.5 (d) 0.3 d What is the closest to 1 in -9, 3, 14, -3? 3 What is the closest to -0.11 in -3, 0.8, 3, 5? 0.8 What is the nearest to -0.1 in 1/37, 0.3, 0, -0.1? -0.1 What is the closest to -7 in -4, -8.4, 0.2? -8.4 What is the nearest to -1 in 0.1, 44, -1, -4? -1 What is the closest to 0.02 in -5, 26, 1/7, -4? 1/7 Which is the closest to 30? (a) -2/5 (b) 0.4 (c) 2 c What is the closest to -1/13 in -2/5, 2/13, -3/4? 2/13 Which is the closest to 1? (a) 0.5 (b) 2/7 (c) 2 a Which is the nearest to -2/15? (a) 0.3 (b) -1 (c) 0.09 (d) -8 c What is the nearest to 1 in 1, 0, 1100, 4? 1 Which is the closest to -7? (a) 2 (b) -0.1 (c) -35 b Which is the closest to 42? (a) -2/13 (b) 8 (c) 0.5 (d) 3/4 b Which is the closest to -2/5? (a) -3 (b) 0.2 (c) -0.2 (d) -0.03 c Which is the closest to 0? (a) -0.2 (b) 5 (c) 2/19 (d) 2 c Which is the closest to 16? (a) 3 (b) 0.2 (c) -2/3 a Which is the closest to 2/11? (a) 1/3 (b) 3 (c) 24/7 a Which is the nearest to -1/4? (a) 4 (b) 2/7 (c) -1/7 (d) 2/11 c What is the nearest to 1/4 in -5/7, 1/4, -0.5, 0.5? 1/4 What is the closest to 5/2 in -3.5, -3/5, -2/7? -2/7 What is the nearest to 35 in 4, 1/4, -0.02? 4 What is the closest to 2 in -23, 3, 2? 2 What is the nearest to 1/4 in 1/7, 3, 1? 1/7 Which is the nearest to -35? (a) -2/7 (b) -0.1 (c) -6 c Which is the nearest to -2014? (a) -2 (b) 2/17 (c) -1/4 (d) 1 a Which is the closest to 1321? (a) 2 (b) 1 (c) 0.2 a Which is the nearest to -0.03? (a) 1 (b) 13 (c) 4/9 (d) 2 c What is the closest to 75 in 5, 1/7, 0.2, 2? 5 Which is the nearest to 0.02? (a) -0.4 (b) -0.3 (c) 5/4 b What is the closest to -0.29 in -1/4, 2/15, -0.2, 0? -1/4 What is the closest to 0.1 in -1/12, 6, -3? -1/12 What is the nearest to -7 in -5, 0.7, 0? -5 What is the closest to 1 in -0.3, 1184, -0.2, -5/4? -0.2 What is the nearest to -0.22 in 0.3, 3, -27/4? 0.3 What is the nearest to 0 in 0, -4, -2, 3.3? 0 What is the closest to 2 in -5, 0.3, 115, 5? 0.3 What is the closest to -1 in -5, 2, 0.1, -178? 0.1 Which is the nearest to 2? (a) -12 (b) 2 (c) 0.03 (d) 1/2 b What is the closest to 0 in 0.4, 1436, -1? 0.4 Which is the closest to -1? (a) 5 (b) -0.14 (c) -0.2 (d) 2 c Which is the nearest to 2? (a) -1 (b) -3/4 (c) -20 (d) 27 b Which is the nearest to -0.1? (a) -5 (b) 0.3 (c) 6.8 b Which is the closest to 1? (a) -3 (b) -0.114 (c) 1 c What is the closest to 0.131 in -2, 2/13, 14? 2/13 What is the nearest to -1/3 in 0.5, 2/5, -1/20? -1/20 Which is the closest to 0.7? (a) -2/3 (b) -5/2 (c) -1/4 (d) -3 c Which is the closest to -1? (a) 36 (b) 3 (c) 6 b Which is the nearest to 1/29? (a) -3 (b) 2 (c) 4 b Which is the nearest to -11? (a) -3 (b) 3 (c) 0.13 a What is the nearest to 0 in 0, 1/12, -2, 18? 0 Which is the nearest to -3? (a) 2 (b) 0.05 (c) -2/5 c Which is the nearest to 0.1? (a) -7 (b) -3 (c) 3/4 c What is the closest to -1 in -4, -78, -2/7, -2/15? -2/7 What is the nearest to 1/4 in -5, 2/5, 0.2, 17? 0.2 Which is the nearest to -3/4? (a) 0.006 (b) -2 (c) -0.3 c Which is the closest to 0.1? (a) -8.7 (b) 2 (c) 3/2 (d) -2 c What is the nearest to -0.2 in -1, 0.1, -0.4, 1? -0.4 What is the nearest to -5 in 5, -4.4, 2/15? -4.4 Which is the closest to -19? (a) -2/21 (b) 1/2 (c) -0.1 (d) 0.1 c Which is the closest to 0? (a) -4.1 (b) 5 (c) -0.036 c What is the closest to 0 in 2/3, -2/5, 2/573? 2/573 Which is the closest to -1? (a) -1/6 (b) 15 (c) 4 a Which is the closest to -0.4? (a) 1/6 (b) 6 (c) 4 a Which is the nearest to -2/5? (a) 0.3 (b) 42/11 (c) -0.3 (d) 2/5 c Which is the closest to 1? (a) 4 (b) -5/4 (c) -53 (d) -2/5 d What is the nearest to 3 in -0.7, 2/17, 1/5, 0? 1/5 Which is the nearest to -1? (a) 2/7 (b) 139 (c) 3 a What is the nearest to 0 in 0.2, -6/19, 0.4, 1/3? 0.2 What is the nearest to -1/2 in 176/3, -0.1, -4? -0.1 What is the nearest to 12 in 12, 0.1, -5, -2/3? 12 Which is the closest to -110? (a) -1 (b) 2/9 (c) -4 (d) -0.3 c Which is the closest to -0.3? (a) -0.3 (b) 1.3 (c) 4 (d) 3/5 a What is the nearest to 1 in 3/7, -0.4, -5, 9? 3/7 Which is the nearest to 0.1? (a) 5/4 (b) -1.3 (c) 2 (d) -1/3 d Which is the nearest to 0.1? (a) -3 (b) 0.2 (c) -7 (d) 2/23 d What is the nearest to -0.1 in -17, 1, 0, -3? 0 What is the closest to -0.1 in 2, -7, 1.3, -0.06? -0.06 Which is the nearest to 1/3? (a) -1/4 (b) -16 (c) -2 a What is the nearest to -0.8 in 1, 2/69, 2/9? 2/69 Which is the nearest to 0? (a) 1/8 (b) 65 (c) -0.5 (d) 5 a What is the closest to 2 in -2/3, 2, 0.5? 2 What is the nearest to -45 in -3, 0.3, -0.05? -3 What is the nearest to -1/2 in 2/5, -3, 0.3, -5/2? 0.3 What is the closest to 9 in 4/5, -4, 0? 4/5 Which is the closest to 2/3? (a) -0.2 (b) 2 (c) 0.2 (d) -33 c Which is the closest to -3? (a) -3/7 (b) -3/11 (c) -0.4 (d) 6 a Which is the nearest to -0.1? (a) 0 (b) 7 (c) 0.4 (d) 3 a What is the nearest to 2/9 in -0.1, 2, -2.1? -0.1 What is the nearest to -4/7 in -0.4, -1, -2, 0? -0.4 Which is the closest to -10/9? (a) 4/9 (b) -2/9 (c) -0.1 b What is the closest to -17 in -1/3, -4, 10? -4 Which is the nearest to 6? (a) -4 (b) 3 (c) -2/7 (d) 14 b What is the nearest to 0 in -1/2, 2, 2.5? -1/2 What is the closest to -0.2 in -3/2, 0.1, -2/5? -2/5 Which is the nearest to -1? (a) 0.61 (b) -4 (c) 1 (d) 5 a What is the nearest to 0 in 5, -41/2, 0.2, -4? 0.2 What is the closest to -1 in -0.21, -1, -5? -1 Which is the nearest to 0.1? (a) -2 (b) 0.4 (c) -0.106 c Which is the nearest to 0.05? (a) 1/3 (b) -5 (c) -88 (d) 1/2 a What is the closest to 0 in -0.2, 2/5, 3? -0.2 Which is the closest to -5/7? (a) 6 (b) 1 (c) -0.1 (d) 3 c What is the nearest to 0.2 in 1/8, -12, -4? 1/8 What is the nearest to 1 in -5/4, -3, 0.3? 0.3 Which is the nearest to 0.2? (a) 0.001 (b) 0 (c) -14 a Which is the nearest to -1/3? (a) -1 (b) 28 (c) -2/5 (d) -2 c Which is the closest to -2/7? (a) 0 (b) -2/11 (c) -3 b Which is the nearest to -2/71? (a) -5 (b) 3/7 (c) 2 (d) 3 b Which is the nearest to -15? (a) -8 (b) -2/3 (c) 1/7 a Which is the nearest to 0.1? (a) -4/7 (b) -7/6 (c) 0.5 (d) -4 c Which is the nearest to -1? (a) 3 (b) 5 (c) 0 (d) 3/19 c Which is the nearest to 14? (a) 2 (b) 22 (c) -1/4 b What is the nearest to -0.02 in -0.3, -1, -2.4, -2? -0.3 What is the nearest to 2 in -4, -2/9, 3, 0.5? 3 Which is the closest to 184? (a) 0.2 (b) 3 (c) 1 (d) -0.1 b Which is the nearest to -1? (a) 0.02 (b) -1/4 (c) -0.5 (d) -1/7 c What is the closest to 0.1 in -2/3, 11, 0.3, -0.2? 0.3 Which is the nearest to 2? (a) 4 (b) 0.7 (c) 3 c Which is the closest to 0.02? (a) 0.1 (b) -1/10 (c) 0.01 (d) 0 c What is the closest to 2 in -3, 0.07, -0.2, -0.4? 0.07 Which is the nearest to 1? (a) -4/3 (b) 10 (c) 0.3 c Which is the closest to 1? (a) 5/8 (b) -1/3 (c) -5 (d) 4/7 a What is the closest to -0.2 in -2/3, 1/6, 3, 12? 1/6 Which is the nearest to -0.01? (a) 2 (b) 2/3 (c) 5 b What is the nearest to 0 in -5/2, 0, -3? 0 What is the nearest to -1 in 2.3, 0.026, 0.2? 0.026 Which is the nearest to 2/7? (a) -10 (b) -3/2 (c) -2 (d) -0.5 d Which is the closest to 0? (a) 3/7 (b) 0.5 (c) -1650 (d) 3 a Which is the nearest to -2/5? (a) -3 (b) -3/44 (c) 4 (d) 3/5 b What is the closest to 0 in -1, 1/2, 0.7, -3/8? -3/8 What is the closest to -0.1 in -2/215, 0.2, 0? -2/215 Which is the nearest to -0.1? (a) -65 (b) 0.5 (c) -3 b What is the nearest to 0 in -2/13, -5/6, 1/13, -2? 1/13 What is the closest to 2 in 3/7, 6, -20? 3/7 Which is the nearest to 2? (a) 4 (b) -5 (c) 2/3 (d) 5 c
Let s = 333 - 565. Let u = s - -232.000111. What is u rounded to five decimal places? 0.00011 Let z = 13 + -9. Suppose 2v + 13859357 = -4g - 19340637, -5g - 41499988 = zv. What is g rounded to the nearest one million? -8000000 Let j = -2.7 - -3.07. Let t = 0.448981 + -0.079271. Let g = j - t. Round g to 4 dps. 0.0003 Let s = 56 + -31. Let o = s - 25.0000051. What is o rounded to six dps? -0.000005 Let a = -23 - -23.0000065. Round a to six dps. 0.000007 Suppose -6 = 3u, 2b - 4u - 39508 = -3b. What is b rounded to the nearest 1000? 8000 Let v = 8 + -2. Suppose -vc = -5c - 5100000. What is c rounded to the nearest one million? 5000000 Let z be 2 + 13/1 - 0. Let v be (-288)/(-10)218750/z. What is v rounded to the nearest one hundred thousand? 400000 Let k = 3.872338 - 129.906188. Let p = -0.17615 + k. Let d = -127 - p. What is d rounded to one decimal place? -0.8 Suppose 5v = 3h - 19, -h + 5 = -0h - v. Suppose -hd = -5a + 3285, -a - 3d = -0a - 675. Round a to the nearest 100. 700 Suppose -10 = -5p + 5k, 0 = 3k + 2k + 15. Let n be p/4 - 60/16. Let z be 5(-75)/3n. What is z rounded to the nearest 1000? 1000 Let u be (-31139994)/18 + (-2)/6. Round u to the nearest one hundred thousand. -1700000 Let a(u) = 78603u - 7. Let i(l) = 52402l - 5. Let d(q) = 5a(q) - 8i(q). Let h be d(5). What is h rounded to the nearest ten thousand? -130000 Let i = 997 - 949.9. Let d = i - 43. Let z = -4.1000023 + d. Round z to 6 dps. -0.000002 Let i = 0.1 + -0.1. Let q = 3.0005 + -3. Let g = i + q. Round g to four dps. 0.0005 Let o = 1.5 + -1.499976. What is o rounded to five decimal places? 0.00002 Let p = 5.5 - 5.4999977. Round p to 6 dps. 0.000002 Suppose 3j = 6, 7j = -2r + 3j + 106468. Let n = r - -156770. What is n rounded to the nearest 100000? 200000 Let n = 0.033 + -0.0368. Round n to 3 dps. -0.004 Suppose 3f + 4b + 1289984 = 0, -f + 5b - b = 430016. What is f rounded to the nearest one million? 0 Suppose -5a + 7000008 = -0x + 2x, 0 = a + 2x - 1400008. Round a to the nearest 100000. 1400000 Suppose y + 87546 - 593562 = -4f, 1518012 = 3y + 3f. Round y to the nearest 10000. 510000 Suppose -3t = -3 - 3, 2t + 510440 = -3l. Let b = -252148 - l. What is b rounded to the nearest ten thousand? -80000 Let n = -383 - -383.0289. What is n rounded to three dps? 0.029 Let k = -4.07 - 4.08. Let m = k - -2.5. Let n = -6 - m. What is n rounded to 1 dp? -0.4 Let z = -380886.34 - -396603.3355. Let n = z + -15732. Let q = n - -15. Round q to three dps. -0.005 Let v be 34050/(-6)-3. What is v rounded to the nearest one thousand? 9000 Let n = 127.4968 + -90.25686. Let t = n + 0.75386. Let j = -38 + t. What is j rounded to 3 decimal places? -0.006 Let b = 0.34 - -0.06. Let p = b - 1.7. Let m = p - -1.30054. Round m to 4 decimal places. 0.0005 Let j = 13 - 10. Suppose -jy - 560 = -7y. Round y to the nearest one hundred. 100 Let y = 623039 - 623040.043882. Let i = -0.043866 - y. Let s = i - 1. What is s rounded to 5 dps? 0.00002 Suppose -69000 = -4y + y. Round y to the nearest 10000. 20000 Let o = -452.99999789 - -453. What is o rounded to 7 decimal places? 0.0000021 Suppose 963 + 2237 = 5g. Round g to the nearest one hundred. 600 Let d = 660 + -659.8205. Let o = 0.0261 + d. Let j = o - 0.21. What is j rounded to 3 decimal places? -0.004 Let g be 27 + (0/2)/(-2). What is g rounded to the nearest 10? 30 Suppose -t + 2 = -5. Suppose -2 - t = -z - 3r, z = r - 7. Let q = 13 + z. Round q to the nearest one hundred. 0 Let j be 63972/(-81) + (-4)/18. What is j rounded to the nearest 100? -800 Let v = -21 - -20.9939. Round v to 3 decimal places. -0.006 Suppose 4c = -240 + 760. Round c to the nearest one hundred. 100 Let u = 1.045 - -0.03. Let k = -0.145 + u. What is k rounded to one decimal place? 0.9 Let w = 194770116.00000097 + -194770111. Let r = w + -5. Round r to seven dps. 0.000001 Suppose 768200000 = -0v - 23v. Round v to the nearest 1000000. -33000000 Let v = 231 - 228.34. Round v to one dp. 2.7 Suppose -3161 = -h - 3x, 2x = 3h + 4x - 9504. What is h rounded to the nearest 100? 3200 Let n be 1 + (-1 - -1) + 20. Let x be 18/n(-1 - -8). What is x rounded to 0 decimal places? 6 Suppose -3f + 5m = -4f - 28980, f = -3m - 28988. What is f rounded to the nearest ten thousand? -30000 Suppose 3h - 3k + 104139 = 0, -2h + 2974 = 2k + 72392. Let u = h + -31289. What is u rounded to the nearest 10000? -70000 Let l be (-15)/(-7) - 1/7. Suppose n - 2h - 533 - 877 = 0, -2790 = -ln - 2h. Round n to the nearest one thousand. 1000 Let d = 0.19 - 0.189994. Round d to 5 dps. 0.00001 Let o = 0.008 + -30.008. Let f = -31.3 - o. What is f rounded to 1 dp? -1.3 Let p = 6468 + -6413.43. Let u = p + -55. What is u rounded to one dp? -0.4 Let i be (46 + 0)(-136)/16. Round i to the nearest 10. -390 Let i = -12 + 8. Let x = -106116980 - -106116984.00000008. Let p = i + x. What is p rounded to seven dps? 0.0000001 Let t(y) = y - 9. Let n be t(9). Round n to 4 dps. 0 Let p = -3.96 + 4. Let r = -0.048 - p. Let k = r - -0.0917. Round k to three dps. 0.004 Let s = -2575281 - 1324719. Round s to the nearest 1000000. -4000000 Let h = 119.6163726 + -110.41639. Let f = 9.2 - h. What is f rounded to six dps? 0.000017 Let n(k) = k3 + k2 + 2. Let u be n(0). Let r(s) = 10s3 - 6s - 4. Let g be r(6). Suppose 2x = -ux + g. What is x rounded to the nearest one hundred? 500 Let c = -5 + 5. Let s = c - -0.1. Let r = s + -0.09976. What is r rounded to 4 dps? 0.0002 Suppose -369 = -5w - 3a, -2w - a + 147 = -0w. Round w to the nearest ten. 70 Let g(i) = i3 - i2 - i + 1. Let z(v) = -3v3 + 5v*2 + 5v + 3. Let p(m) = -2g(m) - z(m). Let f be p(7). Round f to the nearest one hundred. 200 Suppose 2h - 4507 = -1751. Suppose 5b = 1022 + h. What is b rounded to the nearest one hundred? 500 Let d = -9 - -31. Suppose -103 + d = -v. What is v rounded to the nearest 10? 80 Let d = 36.00000502 - 36. What is d rounded to seven dps? 0.000005 Let u = 0.13 + -1.3. Let c = u + -0.91. Let b = -3 - c. What is b rounded to 1 decimal place? -0.9 Let f = 4 + -10. Let u = -9 - f. Let o = -3 - u. Round o to the nearest 100000. 0 Let w = -3.4 - -3.4000002. Round w to 7 decimal places. 0.0000002 Let z = -0.26 - -0.122. What is z rounded to one dp? -0.1 Let g = -81.53 - -82. Let x = 0.4700058 - g. What is x rounded to 6 dps? 0.000006 Let s = -1.2 + 0.2. Let r = 0.99 + s. Let f = r - -0.17. Round f to 1 decimal place. 0.2 Let k = 0.99 - -50.01. Let l = k + -49.83. What is l rounded to one dp? 1.2 Suppose 0 = -2j - 3j + 10. Suppose 3 = jz - 7. Suppose zh - 110005 = 2c, -2h = 2c - 0h + 109998. What is c rounded to the nearest ten thousand? -60000 Let q = -16.6 - -17.29. Round q to 1 decimal place. 0.7 Let j = -119.0000176 - -119. What is j rounded to six decimal places? -0.000018 Let o = 435.999999537 + -436. Round o to 7 dps. -0.0000005 Let j = 8 - 8.04. Let i = j + 0.03999994. What is i rounded to 7 dps? -0.0000001 Let c = 88 + -87.9999939. What is c rounded to 6 dps? 0.000006 Let b = -2.989 + 3. Round b to 2 dps. 0.01 Suppose 0h + 4h = 28. Suppose 346 - h = 3l. Suppose 2n - 9 = l. What is n rounded to the nearest ten? 60 Let l(u) = -2u - 131600u2 + 2029176u*2 - 169837u*2 + 1322262u*2. Let w be l(2). Round w to the nearest 1000000. 12000000 Let q(f) = -108998f + 20. Let w be q(-10). Round w to the nearest one hundred thousand. 1100000 Let z = 30566769 + -30566672.000094. Let x = z + -97. Round x to five decimal places. -0.00009 Let g(c) = -c + 9. Let h be g(9). Suppose 0i - 2i = h. Suppose i = 4r - 565 - 395. Round r to the nearest 100. 200 Let x = -36 + 35.999999888. What is x rounded to 7 dps? -0.0000001 Let o = 22 + -19. Suppose -4y - 4 = 0, -17202 = 4m + oy + 186801. Round m to the nearest ten thousand. -50000 Let l = -0.02 - 0.58. Let a = 1.1 + l. Let h = -0.24 + a. What is h rounded to one decimal place? 0.3 Let u = 3 - -1. Suppose 0 = uv + 3n - 29600, -15883 = -3v - 4n + 6317. What is v rounded to the nearest one thousand? 7000 Let x = 12.7 + -15. Let m = 34540.3033 - 34538. Let d = m + x. What is d rounded to three dps? 0.003 Let h = 284.338 + -284.485861. Let a = 0.148 + h. Round a to 5 decimal places. 0.00014 Let p be (33200/2)/(3/(-150)). Round p to the nearest 1000000. -1000000 Let j(i) = 6i*2 + i - 1. Let h be j(1). Let o be h/(132/(-69) - -2). What is o rounded to the nearest ten? 70 Let l = 5.36 + -5.3. Round l to 2 decimal places. 0.06
Let q(w) = 116w2 - 1. Let u = -3 - -14. Let f(s) = 2s - 21. Let d be f(u). Is q(d) composite? True Suppose 105 + 23752 = c. Is c a composite number? False Let i be (-1 - 1) + (-1122)/(-11). Let q = 253 - i. Suppose k = -2k + q. Is k composite? True Let l = 3017 + 15346. Is l prime? False Let j = -1 + -3. Is 6/15 + j/((-100)/40915) composite? False Is (-56698)/(-10) - (-7)/(245/(-28)) prime? True Let x = 4 - 4. Suppose 4g - 3d - 47 = x, 3g - 45 = -3d + 6. Is 2584/g + 3/7 composite? True Let c(h) = 3h*2 + 123h - 63h - 56h + 19. Is c(-8) a composite number? False Is 80686(4 - 56/16) prime? True Let h = -4000 + 11411. Is h a composite number? False Suppose -2u - 1 = -u. Is -2 + u + 1 + 1903 prime? True Suppose -d + 14 = 11. Suppose -4c + h + 2539 = 0, dh + 0h - 3 = 0. Is c composite? True Let o = -368 - -855. Is o a composite number? False Let f(c) = 15c*2 + 13c - 21. Let u(h) = 7h2 + 6h - 10. Let g(v) = -3f(v) + 7u(v). Is g(-6) composite? True Let r be (-19)/(-7) - 4/(-14). Is 1 + 182 + 1 + r a composite number? True Let w = 148796 + -37783. Is w prime? False Suppose l - 8 = -9. Is l + 0 + (111 - 13) a composite number? False Let i(n) = 2n2 + n + 985. Is i(0) a composite number? True Suppose 17 = 3b - 3x + x, -2b + 7 = 3x. Suppose -c + 5c - 729 = -s, 0 = -4s - bc + 2927. Is s a prime number? True Suppose -3x + 610 = -x - a, -3x + 3a + 909 = 0. Suppose x = -2h + 3n + 5483, 2h = -5n + 5192. Is h a composite number? False Suppose 4z - 3j - 17 = 5z, 11 = -3z - j. Let q(i) = 311i*2 + 4i + 7. Is q(z) composite? True Let n = -84 + 73. Let l(g) = -g*3 - 5g*2 - 23g. Is l(n) a composite number? True Let c(j) = 3j2 - 12j - 31. Let l be c(-10). Let x = l + 488. Is x a prime number? True Let v = 40731 - 27890. Is v a prime number? True Let c(w) = -140w - 85. Let y(b) = -141b - 87. Let r(a) = -7c(a) + 6y(a). Is r(14) a composite number? False Let s(n) = -3407n - 11. Is s(-2) composite? False Suppose r = 5 + 1. Let p be -163 + (-2)/(-4)r. Is p/(-3) + 1/(-3) composite? False Let x be 1/(4/(40/2)). Suppose -1157 = -xc + 1488. Is 4(3 + c/4) prime? True Let v = -12 - 113. Suppose 3a + 90 = 378. Let i = a - v. Is i composite? True Let n(t) = 13t*2 - 47t + 177. Is n(-41) prime? True Suppose -6q + 7253 = -2q + 3m, -q - 5m + 1792 = 0. Is q a prime number? False Let q be -102((-201)/(-2))/(-3). Suppose -c = 2c - q. Is c prime? False Let w(r) = 15r + 2. Let p = -5 - -8. Let o(u) = -u + 1. Let x(f) = po(f) + w(f). Is x(12) composite? False Is (1/1)/(10 + 92574/(-9258)) prime? True Let l(t) = 29t3 - 7t*2 + t + 31. Let r be l(5). Suppose -5d = -4a - 8703, -2d + 0a + 4a = -r. Is d a prime number? False Suppose 6u = -10108 + 80842. Is u a composite number? False Let n(v) = 49v*2 + 6v - 38. Is n(5) a prime number? True Is (5 - 8 - -18332)1 a prime number? True Is (-20746)/(-50) - 6/(-75) a prime number? False Let c(t) = 3t + 37. Let x(n) = 1. Let h(l) = c(l) - 2x(l). Is h(16) a prime number? True Let x(y) = -4y*2 + 6y - 18. Let u be x(8). Let h = u + 395. Is h composite? True Let k(j) = 37j3 - j2 - 2j - 1. Suppose -3n - 16 = -7n. Suppose 5m - 3r = -nr + 13, -8 = 2m - 4r. Is k(m) a composite number? True Let m(p) = -6p3 + p2 + 2p + 2. Let r be m(3). Let d = 239 + r. Is d prime? False Suppose -8031 = -3k + 585. Suppose -8g = -0g - k. Is g composite? False Let i(q) = q - 1. Let j be i(3). Suppose -jr - 3r = 0. Suppose a - 37 = -ra. Is a a prime number? True Let m(g) = 12g + 18. Let w(r) = 6r + 9. Let t(o) = 2m(o) - 5w(o). Let x be t(-14). Let q = x + 28. Is q prime? True Let r = 14844 + 2939. Is r prime? True Suppose 5r - 10r + 4k + 13413 = 0, -2r = -3k - 5368. Is r composite? True Let g = 1782 + -409. Suppose 4v - g = -3d + 8d, 3v + 5d = 986. Is v a prime number? True Suppose 5 = -2u - 5o, u + 4o = -0o + 2. Is (4 - (-156)/(-8))u prime? False Let r = 1186 + 13665. Is r composite? False Suppose -3l - 2c + 22701 = 2c, -12 = 4c. Is l composite? True Let w be (-5)/28/10. Let b be 0/w(-3)/(-6). Suppose b = -4h + 6 - 26, 5h + 141 = 2l. Is l composite? True Suppose g - 6g + 60 = l, -4g = 5l - 342. Let y be (50/(-3))/(2/9). Let w = l - y. Is w prime? False Suppose 4s + 3p = 2056, 16s + 2p = 21s - 2570. Is s composite? True Let q = 92 + -87. Suppose -3x = 2g + 10 - 1146, -qx - 2865 = -5g. Is g a prime number? True Let a be (-569)/((4/(-20))/(2/(-5))). Let y = 2523 + a. Is y a prime number? False Let v = 46648 + -22451. Is v a composite number? False Let m(g) = g - 2. Let r be m(6). Is (-23 + 2 + 1)(-127)/r composite? True Suppose 2q = -3 + 7. Suppose 2c = q + 8. Suppose -902 - 143 = -cw. Is w a prime number? False Suppose -4d + 1449 = -359. Let a = 1 - -3. Suppose ag + 0g = d. Is g composite? False Let b = -226 + 107. Let i be (20/2)/((-2)/b). Suppose 0 = -o - 4o + i. Is o prime? False Suppose 324 = -0i - i. Let x = 61 + i. Let n = -40 - x. Is n a composite number? False Suppose 20 = -5m - 0m, -3m = -5a + 19697. Is a prime? False Let w = 7146 - -5327. Is w prime? True Let l be (403 - -5) + (-4)/2. Suppose -5i = w - 159, 5w - l - 333 = 3i. Is w a composite number? False Let c(t) = t2 + 2t - 5. Let h be c(-4). Let j = 16 - 12. Suppose 810 = 5d - r, -hr = -jd + r + 664. Is d prime? False Suppose -795163 = -12l + 383321. Is l a composite number? False Let o(n) = 1229n2 + 10n - 23. Is o(8) a composite number? False Suppose -3o + 60761 = -2s, -4o + 81010 = -5s - 0s. Is o composite? True Let t be 216 + 0(-3)/(-9). Let a = t - -1740. Is (a - -4)/2 - 3 composite? False Suppose 20 = 5x, -2y + 2x + 2 = 12. Is (-14)/(-10)(-3505)/y a composite number? True Suppose -4l + 21 = 5z - 67, 3z + 56 = 4l. Suppose -43 = -5v + l. Is 3/v + 4215/20 prime? True Let f(b) = 2b*2 + 13b + 2. Let q = 1 + -10. Is f(q) a prime number? True Suppose -1 = -2m + 3. Suppose -5v + f + 1316 = 0, -mv - 4f - 94 = -616. Is v composite? False Let r = 24 + -19. Suppose 0 = t + 4a - 149, -777 = -rt - 0a - 4a. Is t composite? False Let d = -17 - -21. Suppose -2r - 88456 = -dy, 5y = -3r + 18333 + 92215. Is (y/16)/((-4)/(-2)) a prime number? True Suppose 5z = -l - 11, -6l + l - 2z = -37. Let i = l - -508. Is i a composite number? True Let z = 542 - 63. Is z a composite number? False Let o(g) = 81g - 12. Suppose 6j - 4 - 26 = 0. Is o(j) a composite number? True Let w = -1591 + 2598. Is w a composite number? True Let d(i) = -i2 + 12i + 12. Let f(y) = 4y + 3. Let h(v) = -4v - 3. Let w(m) = -6f(m) - 5h(m). Let g be w(-3). Is d(g) composite? True Suppose 0 = 7k - 8k. Suppose k = -4v + 6v - 1438. Is v a composite number? False Suppose 5k - 155 = -5p, 2p = -4k + 3p + 104. Suppose 5 + k = 4i. Suppose -ir = -13r + 795. Is r composite? True Let f(w) = -w*2 - 7w - 4. Let m be f(-6). Suppose 0 = -l - ml + 9. Is (-65)/(-3) + 1/l a composite number? True Let r(v) = 51v*3 + 2v*2 - 4v + 5. Let u(w) = 50w3 + w2 - 3w + 4. Let f(a) = -3r(a) + 4u(a). Let y be f(-1). Let p = 46 - y. Is p a prime number? False Suppose 4f - f = 8391. Suppose 0 = -2z - 2s + s + f, 3s = z - 1388. Is z composite? True Let g be 12(-3)/2. Let w(v) = -2v3 + 3v*2 - 5v - 2. Is w(g) a prime number? False Let c = 25042 + -16895. Is c a prime number? True Suppose 5c - 16541 = -2s, -2050 = -c + s + 1254. Is c a composite number? False Let k(c) = 387c2 + 29c + 13. Is k(-6) prime? False Let f(k) = -k*2 - 5k + 11. Let t be f(-6). Suppose 3j = -tj + 1304. Is j a prime number? True Let g(z) = 2z2 - 5z + 1. Is g(-10) a composite number? False Suppose -u - 5u + 990 = 0. Suppose -55 = q - 5b + 28, -3q + 2b = 236. Let v = u + q. Is v a composite number? True Suppose 3k - 735 = 453. Suppose p + 0r = 2r + 394, r + k = p. Is p a composite number? True Let g be ((-3)/(-9))/(1/24). Suppose -5l - 2q = -0l - 14, -4q + g = 0. Suppose 2d + ld = 1468. Is d a prime number? True Suppose 0 = -2k + k - 203. Let v = 196 - 276. Let i = v - k. Is i a composite number? True Let r(b) = -b*3 + 3b*2 - 4b + 3. Suppose 7 = 2i + 1. Let w be r(i). Is (1869/w)/(2/(-6)) a prime number? False Is ((-1)/4)/(62/(-129208)) composite? False Let g(s) = -s2 + 11s + 14. Let i be g(12). Suppose 3p + 12 = 0, 5n = 3n + p - i. Let x(d) = -147d + 2. Is x(n) composite? False Let g = -1466 + 6505. Is g a prime number? True
Let f(x) = 4x2 - 5x + 2x2 - 4x*2. Let h(l) = -3l*2 + 6l. Give 6f(y) + 5h(y). -3y2 Let f(b) = -2b + 5. Let x(c) = 2c - 4. Let d be (-38)/14 - 18/63. Give dx(l) - 2f(l). -2l + 2 Let c(s) = -7s3 - 3s*2 - 5s + 6. Let u(i) = -6i3 - 2i*2 - 4i + 5. Let l be 3(-3 - (-52)/12). What is lc(r) - 5u(r)? 2r*3 - 2r*2 - 1 Let x(w) = -9w*3 + 5w*2 + 5w. Let s(y) = 10y3 - 6y*2 - 6y. What is -5s(z) - 6x(z)? 4z3 Let r(l) = 2l*3 + 3l*2 + 7l + 5. Suppose 5i = -11 + 1. Let z be (-80)/12 + i/6. Let f(j) = -3j*3 - 4j*2 - 10j - 7. Determine zr(h) - 5f(h). h3 - h2 + h Let o(v) = 7v3 - 6v*2 + 6v + 7. Let b(k) = -11 + 15k3 + k2 - 4k*2 - 10k*2 + 26 + 13k. Determine 6b(c) - 13o(c). -c*3 - 1 Let g(j) = -12j + 4. Let h(d) = 3d - 1. Determine 2g(p) + 9h(p). 3p - 1 Let v(j) be the third derivative of -j5/10 - j4/6 - 2j2. Let b(y) = 3y*2 + 2y. What is -5b(f) - 2v(f)? -3f2 - 2f Let z(f) = 2f3 - 3f + 4. Suppose 4w = -c - 11, -3w - 2w - 5 = 0. Let k(t) = -5t*3 + 7t - 9. Determine cz(i) - 3k(i). i*3 - 1 Let l(b) = 11b - 2. Let h(u) = -44u + 9. Calculate -6h(j) - 26l(j). -22j - 2 Let q(d) = 6d3 - 2d*2 + 4d - 4. Suppose -3c = 4j - 8, 5c - 17 - 2 = -j. Let l(y) = 5y*3 - 2y*2 + 3y - 3. Calculate cl(o) - 3q(o). 2o3 - 2o*2 Let d(a) = 3a*2 - 2a. Suppose 4n - 7 = -3n. Let c(r) = r2 + r - 2. Let x(w) = -w2 - 2w + 3. Let m(f) = -3c(f) - 2x(f). Determine nm(o) + d(o). 2o2 - o Suppose 7j = 5j - 4k + 26, -5j + 5k = 10. Let c(p) = 6p3 - 9p*2 + 4p. Let o(g) = 5g3 - 8g*2 + 3g. Determine jc(y) - 4o(y). -2y3 + 5y*2 Suppose 8 + 0 = 4k. Let h(c) = kc + c - c + 5. Let i(d) = 1 + d - 5 - 2d. Give -2h(a) - 3i(a). -a + 2 Let p(k) = k*3 - 6k + 3k2 + 0k*3 + 6k3. Let g(o) = o3 + o*2 - o. Determine 5g(d) - p(d). -2d3 + 2d*2 + d Let u = -32 - -49. Let f(l) be the third derivative of 0 + 1/15l*5 + 1/4l4 + l2 + 0l - l3. Let a(r) = -11r*2 - 17r + 17. What is uf(q) + 6a(q)? 2q2 Let j(n) = 5n*2 + 20n. Let s(t) = 2t2 + 7t. Calculate -3j(u) + 8s(u). u*2 - 4u Let x(j) be the second derivative of -j*3/3 + 5j*2/2 + j. Let d(g) = -3g + 9. What is -6d(s) + 10x(s)? -2s - 4 Let j(d) be the third derivative of d6/40 + d5/12 + 7d*3/3 + 25d*2. Let f(u) = 2u*3 + 3u*2 + 9. Calculate 8f(z) - 5j(z). z3 - z2 + 2 Let v(l) = l3 + l2. Let k(g) = -7g*3 - 6g*2 + 2g - 1. Give -k(f) - 6v(f). f3 - 2f + 1 Let b(n) be the second derivative of -3n3/2 + 3n*2/2 - n + 5. Let a(k) = 26k - 8. Give 3a(j) + 8b(j). 6j Let c(q) = 4q. Let x(v) = -v - 8 + 8. Let j(f) be the third derivative of -f4/24 + f3/3 - 3f2. Let l be j(3). Give lc(p) - 3x(p). -p Let l(t) = t - 7. Let v be l(4). Let d(w) = w + 5. Let f(c) be the first derivative of c2/2 + 6c - 1. Calculate vf(s) + 4d(s). s + 2 Let z(t) = -t + 1. Let d(g) = -4g + 4. Let a(w) = -5w + 5. Let r(i) = 6a(i) - 7d(i). What is r(m) - 4z(m)? 2m - 2 Let w(y) = 7y + 7. Let b(t) = -4t - 4. Suppose r + n - 1 = -4, 6 = -2r + 3n. Determine rw(j) - 5b(j). -j - 1 Let s = 7 - 4. Let w(l) = -sl - l + 3l. Let m(d) = 7d + 2. Let h = 0 + -1. What is hm(j) - 6w(j)? -j - 2 Let n(r) = 5r + 35. Let i(j) = j + 7. What is 11i(d) - 2n(d)? d + 7 Let f(w) = -2w - 2. Let j(i) = -6i - 5. Let k be (18/(-27))/(3/18). What is kj(x) + 11f(x)? 2x - 2 Let v(x) = 4x*2 - 2x - 3. Let m(q) = 5q2 - 3q - 7. Let c(b) = -1. Let p(g) = -3c(g) + m(g). Let k be (-8)/36 - (-50)/(-18). Give kv(a) + 2p(a). -2a*2 + 1 Let w(l) = 6 + 3l + 3 - 6. Let o(x) = 16x + 16. Calculate -2o(t) + 11w(t). t + 1 Let d(v) = 2v + 5. Let y be (-2)/39/(-3). Suppose 3a = -y - 7. Let q(i) = -i - 2. Give ad(j) - 8q(j). 2j + 1 Let x = 35 - 36. Let v(y) = -8y*2 + 7y + 2. Let p(j) = -j*2 + j. Calculate xv(u) + 6p(u). 2u*2 - u - 2 Let c(k) = 4k*3 - 3k*2 - 5k + 3. Let p(b) = 3b3 - 2b*2 - 4b + 2. Give -2c(l) + 3p(l). l*3 - 2l Let q(n) = 2n2 - 3n - 11. Let w(s) = -s*2 + 2s + 10. Calculate -2q(o) - 3w(o). -o*2 - 8 Let k(c) be the second derivative of 7c5/20 - c4/2 + c*3 + 4c*2 + 14c. Let h(d) = -5d - 2d + 2d - 7 + 5d*2 - 6d*3. What is 6h(l) + 5k(l)? -l3 - 2 Let t(z) = z + 1. Let r(b) = 6b + 3. Give -5r(q) + 15t(q). -15q Let c(x) = 5x*2 - 17x - 9. Let o(b) = b*2 - 6. Let w(i) = -2i*2 + i + 11. Let a(y) = -7o(y) - 4w(y). What is 9a(j) - 2c(j)? -j2 - 2j Let j(t) = -37t3 - 2t*2. Let k(a) = 6142a*3 + 333a*2. Determine 333j(y) + 2k(y). -37y*3 Let c(d) = 14d - 6. Suppose -3p + k + 1 = 0, -2p = 4k + 5 - 29. Let n(z) = 0z - 2z - 2z - z + p. What is 3c(l) + 8n(l)? 2l - 2 Let x(m) = 5m*2 - 16m*2 - 5m*3 + 4m*3 - 2m + 9m2. Let p(i) = 4i*3 + 11i*2 + 11i. Give 2p(d) + 11x(d). -3d3 Let b(w) = 3w*3 + 2w*2 - 3w - 3. Let d(i) be the third derivative of 13i6/120 + 3i*5/20 - 13i*4/24 - 13i*3/6 - 2i*2. Give -9b(k) + 2d(k). -k3 + k + 1 Let w(g) = -g - 1. Suppose -3d - 3s = 12, 2d + 19 = 6d - 3s. Let h be 8/6 + (-3)/9. Let c(v) = -v - 3v + 3v - h. What is dc(b) - 2w(b)? b + 1 Suppose 2g + 4 = n, -6n + n + 20 = g. Let l(i) = i - ni + 2i. Let a(z) = -z - 1. Let b be (-5 - -3)(-6)/(-4). Determine bl(x) + a(x). 2x - 1 Let p = 8 + 4. Suppose -4y + 0 = -p. Suppose w + y = 4. Let m(f) = f - 1. Let l(t) = -7t + 8. Determine wl(i) + 6m(i). -i + 2 Let f(c) = -3c*2 - c + 4. Let q(r) = -16r*2 - 6r + 21. Calculate 11f(z) - 2q(z). -z*2 + z + 2 Let u(f) be the second derivative of 5f*3/6 - 5f*2/2 - 3f - 17. Let z(a) = -1. Calculate -u(s) + 4z(s). -5s + 1 Let m(z) = 4. Let v(o) = 1 + 19o2 + o - 6 - 18o*2 + 0. Give 3m(x) + 2v(x). 2x*2 + 2x + 2 Let r = 2 + -2. Let j(t) = 1 + 0t - t + rt. Let m(l) = -4l + 5. Let a be (1 - (-15)/(-5)) + (0 - 7). Determine aj(y) + 2m(y). y + 1 Let c(n) = -28n*2 - 6n + 6. Let l(o) = -o*2 + o - 1. Give c(t) + 6l(t). -34t2 Let j = 32 + -29. Let u(n) = -17n - 8. Let t(g) = -g + 2. Let z(w) = -3. Let l(h) = 6t(h) + 5z(h). What is ju(s) - 8l(s)? -3s Let m(i) = -4i*3 + 3i*2 + 8i - 3. Let n(c) = 9c3 - 7c*2 - 17c + 7. Give -14m(o) - 6n(o). 2o3 - 10o Let k(y) be the first derivative of -y - 11. Suppose -50 = 2x + 3x. Let a(q) be the first derivative of -2q3/3 - 10q - 1. Calculate xk(p) + a(p). -2p*2 Let y(v) = -16v*3 + 3v*2 + 3v + 3. Let n(b) = -304b3 + 56b*2 + 56b + 56. What is 3n(r) - 56y(r)? -16r3 Let n(a) be the third derivative of -a4/24 - 5a*3/6 + 2a*2. Let c(u) = 1. Calculate -3c(v) - n(v). v + 2 Let j(h) = -2h. Suppose -2s + 160 = 2s. Let a be 1/(-4) + 50/s. Let m(t) be the third derivative of t3/6 - t2. Give aj(b) - m(b). -2b - 1 Let z(d) = 54d*3 - 4d*2 - 4d - 4. Let k(o) = -594o3 + 45o*2 + 45o + 45. Determine -4k(j) - 45z(j). -54j3 Let r(z) = 6z + 92. Let d(s) = 2s + 31. What is -17d(n) + 6r(n)? 2n + 25 Let x(c) = 59c + 8. Let s(i) = i + 1. What is 6s(k) - x(k)? -53k - 2 Let v(y) be the second derivative of 4y3/3 + y2 + 3y. Let t(q) = -23q - 6. Let z = 4 - -2. Determine zt(l) + 17v(l). -2l - 2 Let b(n) = -36n + 2. Let a(g) = -g + 1. Give 4a(j) - b(j). 32j + 2 Let u(k) = -2k2 + k + 1. Let y(h) = 5h*2 - 2h - 4. Calculate -11u(o) - 4y(o). 2o2 - 3o + 5 Let j(w) = -8w3 - 7w*2 - 5w - 2. Let m(f) = -f*2 - f - 1. Calculate j(g) - 5m(g). -8g3 - 2g*2 + 3 Let p(q) = q. Let a be 2/8 + (-5)/4. Let y(n) = -5n - 11n + 2n. Calculate ay(i) - 12p(i). 2i Let q(i) = -114i. Let n(x) = 228x. Calculate -4n(g) - 7q(g). -114g Let a(m) be the first derivative of 2m3 + 10m*2 + 26m + 19. Let x(s) = -s*2 - 4s - 5. Determine -3a(o) - 16x(o). -2o2 + 4o + 2 Let q(d) be the second derivative of 3d4/4 + d3/6 - 5d*2/2 + 35d. Let u(v) = 5v2 - 3. Give 3q(k) - 5u(k). 2k*2 + 3k Let p = 67 - 61. Let h(m) = m + 7. Let o(y) = y + 8. Determine po(r) - 7h(r). -r - 1 Let b(s) = -5s2 + 6s. Suppose 2 = 5u - 4t, 3u - 2 = t + 2. Let r(q) = 10q2 + qu - 10q - 3q. Determine 13b(y) + 6r(y). y2 Let m(j) = j3 + j*2 - j. Let f(v) = 4v*2 - 4v. What is -2f(r) + 8m(r)? 8r3 Let p be (1 + -3)/2-3. Let w(u) = -u2 - u3 + 6up - 1 - 3u*2 - u. Let z(b) = 4b*3 - 3b*2 - b - 1. Determine -3w(d) + 4z(d). d*3 - d - 1
List the prime factors of 1092. 2, 3, 7, 13 List the prime factors of 8376. 2, 3, 349 What are the prime factors of 815? 5, 163 What are the prime factors of 1769? 29, 61 List the prime factors of 82780. 2, 5, 4139 What are the prime factors of 3016? 2, 13, 29 List the prime factors of 473. 11, 43 List the prime factors of 30634. 2, 17, 53 List the prime factors of 1179. 3, 131 What are the prime factors of 1466? 2, 733 What are the prime factors of 39631? 39631 What are the prime factors of 14388? 2, 3, 11, 109 What are the prime factors of 10140? 2, 3, 5, 13 What are the prime factors of 1098? 2, 3, 61 List the prime factors of 5288. 2, 661 List the prime factors of 968. 2, 11 List the prime factors of 875. 5, 7 What are the prime factors of 90428? 2, 13, 37, 47 List the prime factors of 99565. 5, 19913 List the prime factors of 8089. 8089 List the prime factors of 105635. 5, 37, 571 What are the prime factors of 1085? 5, 7, 31 What are the prime factors of 19576? 2, 2447 List the prime factors of 8083. 59, 137 What are the prime factors of 800? 2, 5 List the prime factors of 26885. 5, 19, 283 List the prime factors of 28133. 7, 4019 What are the prime factors of 1035? 3, 5, 23 What are the prime factors of 11359? 37, 307 What are the prime factors of 639? 3, 71 List the prime factors of 517. 11, 47 List the prime factors of 5863. 11, 13, 41 What are the prime factors of 2415? 3, 5, 7, 23 List the prime factors of 8853. 3, 13, 227 List the prime factors of 12001. 11, 1091 List the prime factors of 24645. 3, 5, 31, 53 What are the prime factors of 11715? 3, 5, 11, 71 What are the prime factors of 58597? 7, 11, 761 List the prime factors of 30300. 2, 3, 5, 101 What are the prime factors of 6211? 6211 List the prime factors of 6561. 3 List the prime factors of 2249. 13, 173 List the prime factors of 3529. 3529 List the prime factors of 90851. 47, 1933 What are the prime factors of 2147? 19, 113 What are the prime factors of 72904? 2, 13, 701 What are the prime factors of 73? 73 What are the prime factors of 25669? 7, 19, 193 What are the prime factors of 12526? 2, 6263 What are the prime factors of 54099? 3, 6011 List the prime factors of 295. 5, 59 What are the prime factors of 290? 2, 5, 29 What are the prime factors of 8231? 8231 List the prime factors of 3591. 3, 7, 19 List the prime factors of 57546. 2, 3, 23, 139 What are the prime factors of 1245? 3, 5, 83 List the prime factors of 1796. 2, 449 What are the prime factors of 3625? 5, 29 List the prime factors of 1034. 2, 11, 47 What are the prime factors of 19229? 7, 41, 67 What are the prime factors of 694? 2, 347 What are the prime factors of 19572? 2, 3, 7, 233 What are the prime factors of 52292? 2, 17, 769 What are the prime factors of 20281? 17, 1193 What are the prime factors of 7059? 3, 13, 181 What are the prime factors of 436? 2, 109 What are the prime factors of 477? 3, 53 What are the prime factors of 3296? 2, 103 What are the prime factors of 523? 523 List the prime factors of 2631. 3, 877 List the prime factors of 7839. 3, 13, 67 List the prime factors of 604. 2, 151 What are the prime factors of 1115? 5, 223 What are the prime factors of 24644? 2, 61, 101 List the prime factors of 24624. 2, 3, 19 What are the prime factors of 559? 13, 43 List the prime factors of 98366. 2, 137, 359 What are the prime factors of 7433? 7433 List the prime factors of 9868. 2, 2467 List the prime factors of 500. 2, 5 What are the prime factors of 9074? 2, 13, 349 List the prime factors of 106830. 2, 3, 5, 1187 What are the prime factors of 497? 7, 71 List the prime factors of 10468. 2, 2617 List the prime factors of 4201. 4201 What are the prime factors of 57151? 67, 853 List the prime factors of 1323. 3, 7 What are the prime factors of 7314? 2, 3, 23, 53 What are the prime factors of 50935? 5, 61, 167 List the prime factors of 1651. 13, 127 List the prime factors of 16571. 73, 227 List the prime factors of 5943. 3, 7, 283 List the prime factors of 8808. 2, 3, 367 What are the prime factors of 489? 3, 163 What are the prime factors of 1013? 1013 What are the prime factors of 45423? 3, 7, 103 List the prime factors of 6787. 11, 617 List the prime factors of 10029. 3, 3343 List the prime factors of 23275. 5, 7, 19 List the prime factors of 989. 23, 43 List the prime factors of 66706. 2, 33353 List the prime factors of 8514. 2, 3, 11, 43 List the prime factors of 32. 2 What are the prime factors of 922? 2, 461 List the prime factors of 25407. 3, 941 What are the prime factors of 36482? 2, 17, 29, 37 What are the prime factors of 1243? 11, 113 What are the prime factors of 33243? 3, 7, 1583 List the prime factors of 30214. 2, 15107 What are the prime factors of 11566? 2, 5783 List the prime factors of 7025. 5, 281 What are the prime factors of 23825? 5, 953 What are the prime factors of 6213? 3, 19, 109 What are the prime factors of 954? 2, 3, 53 List the prime factors of 55859. 83, 673 What are the prime factors of 13208? 2, 13, 127 What are the prime factors of 1142? 2, 571 What are the prime factors of 1384? 2, 173 List the prime factors of 835. 5, 167 What are the prime factors of 6812? 2, 13, 131 What are the prime factors of 621? 3, 23 What are the prime factors of 27675? 3, 5, 41 List the prime factors of 61445. 5, 12289 What are the prime factors of 10366? 2, 71, 73 What are the prime factors of 1245? 3, 5, 83 List the prime factors of 3512. 2, 439 List the prime factors of 2025. 3, 5 List the prime factors of 2511. 3, 31 List the prime factors of 11651. 61, 191 What are the prime factors of 1565? 5, 313 List the prime factors of 1357. 23, 59 List the prime factors of 1163. 1163 What are the prime factors of 502? 2, 251 List the prime factors of 59969. 7, 13, 659 What are the prime factors of 936? 2, 3, 13 What are the prime factors of 16758? 2, 3, 7, 19 What are the prime factors of 71170? 2, 5, 11, 647 What are the prime factors of 13671? 3, 7, 31 What are the prime factors of 614? 2, 307 List the prime factors of 160. 2, 5 What are the prime factors of 3526? 2, 41, 43 List the prime factors of 1486. 2, 743 What are the prime factors of 1084? 2, 271 What are the prime factors of 1035? 3, 5, 23 What are the prime factors of 15470? 2, 5, 7, 13, 17 List the prime factors of 430. 2, 5, 43 List the prime factors of 21343. 7, 3049 What are the prime factors of 23475? 3, 5, 313 List the prime factors of 796. 2, 199 What are the prime factors of 303? 3, 101 List the prime factors of 3214. 2, 1607 List the prime factors of 9427. 11, 857 List the prime factors of 19393. 11, 41, 43 What are the prime factors of 5769? 3, 641 What are the prime factors of 7619? 19, 401 List the prime factors of 1708. 2, 7, 61 List the prime factors of 5327. 7, 761 List the prime factors of 700. 2, 5, 7 What are the prime factors of 1192? 2, 149 List the prime factors of 7365. 3, 5, 491 List the prime factors of 4709. 17, 277 What are the prime factors of 39131? 109, 359 List the prime factors of 37695. 3, 5, 7, 359 What are the prime factors of 10579? 71, 149 List the prime factors of 375. 3, 5 What are the prime factors of 16933? 7, 41, 59 What are the prime factors of 1884? 2, 3, 157 List the prime factors of 3739. 3739 What are the prime factors of 23731? 19, 1249 List the prime factors of 5939. 5939 What are the prime factors of 8425? 5, 337 List the prime factors of 679. 7, 97 List the prime factors of 4707. 3, 523 List the prime factors of 25561. 25561 What are the prime factors of 59504? 2, 3719 What are the prime factors of 3483? 3, 43 What are the prime factors of 120378? 2, 3, 20063 What are the prime factors of 49231? 7, 13, 541 What are the prime factors of 5917? 61, 97 List the prime factors of 3801. 3, 7, 181 List the prime factors of 456. 2, 3, 19 List the prime factors of 1474. 2, 11, 67 What are the prime factors of 27557? 17, 1621 List the prime factors of 995. 5, 199 What are the prime factors of 52906? 2, 7, 3779 What are the prime factors of 1739? 37, 47 What are the prime factors of 55298? 2, 43, 643 What are the prime factors of 56511? 3, 7, 13, 23 List the prime factors of 8831. 8831 What are the prime factors of 2713? 2713 What are the prime factors of 764? 2, 191 List the prime factors of 5210. 2, 5, 521 What are the prime factors of 52900? 2, 5, 23 List the prime factors of 83147. 17, 67, 73 What are the prime factors of 2096? 2, 131 What are the prime factors of 4506? 2, 3, 751 What are the prime factors of 2119? 13, 163 List the prime factors of 56555. 5, 11311 List the prime factors of 4485. 3, 5, 13, 23 List the prime factors of 3765. 3, 5, 251 What are the prime factors of 123007? 123007
Suppose 4p + 4 = 44. What are the prime factors of 62/p - 3/15? 2, 3 Suppose -5s - 5p + 165 = 0, 4s - 152 = 3p - 48. What are the prime factors of s? 29 Let r be (2 - -47) + -2 - -1. Suppose 2g = -2g + r. Let d = g + -8. What are the prime factors of d? 2 Let f(y) = 2y*3 + 2y*2 + 5y + 3. List the prime factors of f(5). 2, 41 Let w = 2 + -3. Let b = w - -3. What are the prime factors of 45/6 - 1/b? 7 Let q be 1/2 - 20/(-8). Suppose -3c + 229 = 5x, -qx + 6c = c - 117. List the prime factors of x. 2, 11 Let i = 12 - 18. Let a be (-2 + 4)i/(-4). Suppose 0q + y + 39 = 4q, aq - 34 = -4y. What are the prime factors of q? 2, 5 Suppose 2m - 4b = -62, b = m - 4b + 31. Let r = 50 + m. Suppose -u + r = -3. List the prime factors of u. 2, 11 Let u(s) = 6 - s*3 - 2s*2 - 1 - 4s + 11s. Let t be u(-4). List the prime factors of -3 + t/(-1 + 2). 2, 3 Let n = 15 - 0. List the prime factors of n. 3, 5 List the prime factors of -514/105 - 1558/(-6). 7, 37 Let o(g) = 26g - 29. What are the prime factors of o(15)? 19 Let u(s) = -3s*2 + 14s - 1. Let x be u(6). List the prime factors of x/(-1) + 3 - -1. 29 List the prime factors of ((-492)/(-3))/((-6)/(-12)) + 1. 7, 47 Suppose 175 + 549 = 4a. What are the prime factors of a? 181 Let l(q) = 26q*2 + 4q - 1. List the prime factors of l(-2). 5, 19 Let h(c) = c*2 + 2c + 6. List the prime factors of h(-5). 3, 7 Let c(w) = w*2 + 7w + 12. What are the prime factors of c(-10)? 2, 3, 7 Let f(t) = 2t + 2. Let b be (1 + -23)/(-3 + 1). Let j = b - 6. List the prime factors of f(j). 2, 3 Let m = -6 - -8. Suppose 4r = -5f + 30, -mr - 3f = -4r + 4. Suppose 0 = -rd + 65 + 35. List the prime factors of d. 2, 5 Let w be 49/2 + 1/(-2). Let g be 2/3w/1. Let h = g + -11. List the prime factors of h. 5 Let c be -1(0 + -2) - -10. Suppose -m - h - c = -3, -h = 5. Let x(j) = -3j - 4. List the prime factors of x(m). 2 Let w(h) be the first derivative of h3/3 + h2/2 - 6h - 1. List the prime factors of w(-5). 2, 7 Let u(a) = -a3 + 6a*2 - 2a - 3. List the prime factors of u(5). 2, 3 Let v = -292 - -559. List the prime factors of v. 3, 89 What are the prime factors of 2 - (1 + -25 + 2)? 2, 3 Let g(k) = -k*2 + 14k - 19. Let s be g(12). Suppose n = -2p + 5n + 12, 0 = -p + 5n + 15. Let q = p + s. What are the prime factors of q? 5 Suppose -7f + 5q = -2f - 335, 0 = -f - 2q + 58. List the prime factors of f. 2 Let i = 202 - 108. Let g = i - 59. What are the prime factors of g? 5, 7 Let l(d) = 2d*2 + 11d + 9. List the prime factors of l(-7). 2, 3, 5 Suppose 4z - c - 1124 = 0, -z - 3c = -70 - 211. List the prime factors of z. 281 Let o(y) = 2y2 - 14y - 3. Let x be o(10). Let j = x + -23. What are the prime factors of j? 2, 17 Let f = -34 - -52. What are the prime factors of (-3)/(-1 - f/(-21))? 3, 7 Suppose -5a + 55 = -4g, -2a - 4g + 44 = 2a. Suppose 9 = 4p - a. Let j(t) = 2t - 3. List the prime factors of j(p). 7 Suppose -13k + 6k = -1050. What are the prime factors of k? 2, 3, 5 Suppose 8 = s - 2s. Let h(j) = -j - 8. Let z be h(s). What are the prime factors of 0 + (-16)/(-2) - z? 2 Suppose -z = 2h, 5z - 4 = -5h + 6. List the prime factors of -10((-9)/(-6) + h). 5 Let u(b) = 4b2 - 6b*2 - 3b + 6 - b*3 - 3b*2 + 7b. List the prime factors of u(-6). 2, 3 Suppose -3i - 4n + 16 = 0, -2i + 18 = 3i - 2n. What are the prime factors of i? 2 Suppose -5s = 3v - 1346, -4v = -5s - 2v + 1336. List the prime factors of s. 2, 67 Suppose -7 = -h - 4. What are the prime factors of h? 3 Let v = 25 - -7. List the prime factors of v. 2 Let u(z) = 5 + 3z + 10z + 2z2 - 4z - 3z2. Let b be u(9). Suppose 2 = -bv + 47. List the prime factors of v. 3 What are the prime factors of (5 + -1)/(0 - (-3)/42)? 2, 7 Let i = 35 - -71. List the prime factors of i. 2, 53 Let k = 55 - 6. What are the prime factors of k? 7 Let n(v) = v*3 + 9v*2 - 11v - 6. Let x be n(-10). Suppose 92 = -0s + 3s + 4c, -160 = -xs + 4c. What are the prime factors of s? 2, 3 Let i = -125 + 128. List the prime factors of i. 3 Suppose -165 = -5n + 4x, 5n = -x + 167 - 2. What are the prime factors of n? 3, 11 Let l(q) = -q*3 + q - 16. Let f be l(0). Let o = -2 - f. List the prime factors of o. 2, 7 Suppose 13k - 3708 = 4k. What are the prime factors of k? 2, 103 Suppose 4k - 2h - 2 = -0k, 17 = -k + 4h. Let b(i) = 5i - 2 + k - 3i. What are the prime factors of b(1)? 3 Let m = 82 + -41. What are the prime factors of m? 41 Let g = 0 - 0. Suppose 5b - 16 - 54 = g. What are the prime factors of b? 2, 7 List the prime factors of 2 - 21/(-3) - 2. 7 Let r = -5 - -4. Let o be r/1 + 1 + 4. Let w(a) = a*2 - 3a - 1. What are the prime factors of w(o)? 3 Suppose s = 3s + 44. Let k = 82 + s. Suppose 4h + 2w = -2w + k, -3w = h - 5. What are the prime factors of h? 2, 5 Let k(u) = -u2 + 2u + 1. Let y be k(2). Suppose -j + y = -4. List the prime factors of j. 5 Suppose -f + 3f + 12 = 0. Let w(c) = 2 - 5 + 0c2 + c2 - 2c2 - 7c. What are the prime factors of w(f)? 3 Let m(r) = -r*2 - 12r - 7. What are the prime factors of m(-6)? 29 Let i be (-1 - -1) + 3 + -9. Let t(h) = h*3 - 8h*2 + 9h - 4. Let o be t(7). What are the prime factors of o/3i/(-4)? 5 Let g(s) = 171s*2 + 5s - 5. List the prime factors of g(1). 3, 19 Suppose -28 = -2n + 84. Suppose 3j - 19 = n. Suppose -3h - x + 38 = 0, -4x + 9x = j. List the prime factors of h. 11 Let q = 105 + -41. List the prime factors of q. 2 Let h be 2/(-4) + (-1)/(-2). Let x be (-3)/62h. Suppose 2z + x = 6. What are the prime factors of z? 3 Let s(a) = -3a3 - 4a*2 - 2a + 1. What are the prime factors of s(-3)? 2, 13 Suppose -395 = 4y - 1699. What are the prime factors of y? 2, 163 Let z = 210 + -73. List the prime factors of z. 137 Let b = 124 + 5. What are the prime factors of b? 3, 43 Suppose 215 - 15 = 5z. List the prime factors of z. 2, 5 Let s(i) = -i*3 - 6i*2 - 7i + 2. What are the prime factors of s(-5)? 2, 3 Suppose 5s + 5p + 18 - 3 = 0, -5p = s - 13. Let h = s + 4. What are the prime factors of (-63)/(-12)(-8)/h? 2, 7 Let q(y) = -6y - 7. What are the prime factors of q(-2)? 5 Let c(p) = 4p*2. Let b be c(-1). Let g be (-5 + b)/((-1)/3). Suppose -gd + 8 = 2i, 0 = -0d + 5d + 5i - 15. What are the prime factors of d? 2 Let l(d) = -d + d - 4d + 14 + 3d. Let f be l(10). Suppose -s - 6 = -fs. What are the prime factors of s? 2 Let b(x) = 4x*2 - 5x - 1. List the prime factors of b(-3). 2, 5 Suppose -5o + 94 + 66 = 0. Suppose -o - 58 = -2l. Suppose -2y - 3y = -l. List the prime factors of y. 3 Suppose 3g + g + 5d - 337 = 0, -4g + 3d + 361 = 0. What are the prime factors of g? 2, 11 Suppose 2n - s - 95 = -3n, 2s = 5n - 95. What are the prime factors of n? 19 Let f(w) = 3 + 5w - 2 - 4w. Let n be f(1). Suppose -3r + 0t + 4t + 14 = 0, 2t - 14 = -nr. List the prime factors of r. 2, 3 Let k = -25 - -55. What are the prime factors of k? 2, 3, 5 Let y = 24 + -39. List the prime factors of y((-6)/3)/1. 2, 3, 5 Let q = -10 - -9. Let d = q + 1. Suppose d = -5a + 5 + 10. What are the prime factors of a? 3 Let g(p) = -p3 + 6p*2 + 6p - 2. Let w be g(6). Let t = w + -20. What are the prime factors of t? 2, 7 Let j(y) be the second derivative of y*6/360 + 3y5/40 + y4/4 + y*3/3 - y. Let n(t) be the second derivative of j(t). List the prime factors of n(-9). 2, 3 Let a be (-2)/7 + (-237)/(-21). Suppose -a + 86 = 5b. What are the prime factors of b? 3, 5 Let d be (-216)/(-21) + (-4)/14. Suppose 3p - 2 = 13. Suppose pc - 30 = d. What are the prime factors of c? 2 Let u = 30 + -19. Suppose 3g = -5b + 2, 3b - g + u = 1. List the prime factors of (b/(-4))/((-1)/(-8)). 2 Suppose -35 = 5z - 5d, -3d + 25 = -5z - 0d. Let r(a) = -16a - 3. List the prime factors of r(z). 29 Let r(j) be the first derivative of -j3/3 + 16j + 3. List the prime factors of r(0). 2 Let s be 303/12 + (-2)/8. Let q = 37 - s. List the prime factors of q. 2, 3 Let y(l) = l + 14. List the prime factors of y(12). 2, 13 Suppose 5c - 15 = -3i + 181, 3i - 3c = 204. What are the prime factors of i? 67 Let v(b) = 2 + b*2 - 3b*2 + 3b*2 + 2 + 9b. Let i be v(-6). Let h = -1 - i. List the prime factors of h. 13 Let y(o) = o + 13. Let x be y(-7). Let j = 5 + x. What are the prime factors of j? 11 Let w(s) = s*3 - 9s*2 - 12s + 25. Let i be w(10). Let t be (-2)/7 - (-16)/7. Suppose -3g + tg = -if + 13, 5g = -f + 13. What are the prime factors of g? 2
What is the third derivative of 194b3k*3 - 24b*3k*2 wrt k? 1164b*3 What is the first derivative of -9822n*3 + 7995? -29466n*2 Find the second derivative of 7189k*5z - 5361kz wrt k. 143780k3z Find the second derivative of -7w4 - 11w*3 - 6w*2 - 2w - 3951. -84w2 - 66w - 12 What is the second derivative of 35f2n*3s - f*2n*3 + 6f*2n*2 - fn*3s - 12fn*3 - 6n3 - n2 wrt f? 70n3s - 2n3 + 12n*2 What is the second derivative of 9hn2 - 2hnt*2 - hnt - 2hn + 13n*2t*3 - 6n*2t - 4t3 + 3t*2 wrt t? -4hn + 78n*2t - 24t + 6 What is the first derivative of 23m*4 + 74m*3 + 2872 wrt m? 92m*3 + 222m*2 What is the second derivative of -175m*2x*2 + 7m*2 - 263mx - 16x*2 wrt x? -350m*2 - 32 What is the second derivative of -3347j*4y*2 - 3j*3y*3 + 23jy3 + jy + 4j + 2y*2 wrt j? -40164j*2y*2 - 18jy3 What is the second derivative of -745o*2y2 - o2y + o2 + 5oy - 4y*2 + 27 wrt o? -1490y*2 - 2y + 2 What is the second derivative of -244q4 - 2q*3 + 89q? -2928q2 - 12q What is the third derivative of -139k4 - k3t*2 + 2k*2t*2 + 5kt2 wrt k? -3336k - 6t2 What is the second derivative of -3w*2x*3 + 31w*2x + 9w2 + 110wx3 - 3wx wrt w? -6x*3 + 62x + 18 Find the third derivative of 15q5 - 5q*4 + 163q*2 - 2. 900q*2 - 120q Find the second derivative of 9816o5 - 721o - 1. 196320o3 Find the third derivative of -5w*6 + 17w*3 - 885w*2 wrt w. -600w*3 + 102 Differentiate 3v*2 + 9v - 121 with respect to v. 6v + 9 What is the third derivative of -gsw3 - 13gsw*2 + 8gsw - 3gs - 2gw*4 + 54sw4 - s - 2w*2 wrt w? -6gs - 48gw + 1296sw Find the second derivative of 5186w*2 - 5517w. 10372 What is the second derivative of -7c5 - 57c*4 - 371c wrt c? -140c3 - 684c2 What is the second derivative of w5 - 137w2 + 41w + 1? 20w3 - 274 What is the second derivative of -d3j - 6d2j - 148d2 - 2dj + 46j - 2 wrt d? -6dj - 12j - 296 What is the third derivative of 11cg3t*2 + 4cg3 - 2cg2t*2 - 2cgt*2 - 2cgt - 203 wrt g? 66ct*2 + 24c What is the second derivative of 27h4 - 8h*3 - 1402h - 2? 324h2 - 48h Find the third derivative of -176a5 - 372a*2. -10560a*2 What is the third derivative of -2781a*4 + 61a*2 - 21 wrt a? -66744a What is the second derivative of 14f3n4 - f3 + 10f2n + 20fn*4 + 32 wrt n? 168f*3n*2 + 240fn2 What is the second derivative of 213c*2dx2 - 80c*2dx + 3c*2x*2 + 11cd + 2x wrt x? 426c2d + 6c2 Differentiate -2i*3r - 766i2r*2 + 1716r*2 with respect to i. -6i*2r - 1532ir*2 What is the derivative of -644m*4 + 5m*2 + 8493 wrt m? -2576m*3 + 10m What is the first derivative of 7357v2 - 7714 wrt v? 14714v What is the derivative of 3mo - 1724m + 255o*3 wrt o? 3m + 765o2 What is the third derivative of -60w*4 + 6w3 - w2 - 107w + 15? -1440w + 36 What is the derivative of 695p + 1252 wrt p? 695 Find the second derivative of -27gz2 + gz + 3710g + 23z3 + z2 - 2z wrt z. -54g + 138z + 2 What is the second derivative of -1594u3 + u2 + 5u + 620? -9564u + 2 Find the third derivative of 299d3 - 4726d*2. 1794 Find the first derivative of -2d*3 - 74d*2 - 420 wrt d. -6d*2 - 148d What is the second derivative of 218v3 + 4v - 54 wrt v? 1308v What is the derivative of -5901c*4 - 27354 wrt c? -23604c3 What is the second derivative of z4 + 259z3 - 452z wrt z? 12z2 + 1554z Find the third derivative of 5p4 + 228p*3 + 294p*2 + 7p wrt p. 120p + 1368 Find the third derivative of 15432b*6o + b*2o - b*2 + 7o - 17 wrt b. 1851840b3o Differentiate -866f - 228 wrt f. -866 Differentiate -386w - 338 with respect to w. -386 What is the second derivative of -57d2n - 16d2 + d + 7325n wrt d? -114n - 32 Find the first derivative of b3g*2 - 6b*3v - 264b2g*2 + 78bg2v + 3g2 wrt v. -6b*3 + 78bg2 Find the third derivative of -4bk3 - 1795b - 51k3 - k2 wrt k. -24b - 306 What is the third derivative of -1168s5 - 1688s*2? -70080s*2 Differentiate 2296d + 12094 wrt d. 2296 What is the second derivative of -941u5 + 6u + 32? -18820u3 What is the third derivative of 542o5 + o4 - o*3 - 17868o*2? 32520o*2 + 24o - 6 Find the third derivative of 5a2m*3 - 147a*2m*2 - 3m*3 wrt m. 30a*2 - 18 What is the first derivative of 79h*3p - 6402h3 - 19h*2py + h2y + 2hp*2y wrt p? 79h3 - 19h*2y + 4hpy What is the second derivative of -c3h*3m - c*3hm2 + c2m + 11ch*3m*2 + 2ch3m + 3h3m wrt m? -2c3h + 22ch*3 Differentiate -89dp4 - d - p4 + 6374 with respect to p. -356dp3 - 4p*3 What is the derivative of -2ajm + 5aj + 3am + 5jm + 19 wrt a? -2jm + 5j + 3m Find the first derivative of 44dhi - 51di + d - 2hi + 1 wrt h. 44di - 2i What is the derivative of -16909ov*2 + 17v*2 + 453v wrt o? -16909v2 What is the first derivative of -495n*4 - 55 wrt n? -1980n*3 Find the third derivative of -3j*6w + 775j3w + j*3 + 86j*2 - 2j - w wrt j. -360j3w + 4650w + 6 What is the second derivative of -16w*4 - 3w*3 + 19w*2 + 1332w + 5 wrt w? -192w2 - 18w + 38 Find the third derivative of 2q6 + 4q*4 + 11q*3z*3 - 38q*2z*3 - 11qz3 wrt q. 240q*3 + 96q + 66z3 What is the derivative of -54cqsw2 - 4cqs - 3csw3 + 2cw3 - qw*3 + 334s wrt q? -54csw2 - 4cs - w3 Differentiate 2108g - 5969 with respect to g. 2108 What is the derivative of 207j + 189 wrt j? 207 What is the third derivative of 3l*6 - 2530l*3 - 3861l*2 wrt l? 360l*3 - 15180 What is the first derivative of 2j*2 - 67j + 141 wrt j? 4j - 67 What is the derivative of 4j*3 - 1451j*2 - j + 12328? 12j*2 - 2902j - 1 Differentiate 4819p + 8943. 4819 What is the first derivative of -1895b*3 - 1598 wrt b? -5685b*2 What is the second derivative of 3462t*5y3 + t2y3 - 11ty3 - 1082y*2 wrt t? 69240t*3y*3 + 2y*3 What is the third derivative of -2c*2g*2h*4 + 14c*2g*2h - 2c2h*4 + 3c*2h*2 wrt h? -48c*2g*2h - 48c2h Find the second derivative of 6i3u + 2i3 - 128i*2 + 58iu - i wrt i. 36iu + 12i - 256 What is the derivative of -2o4 + 2301o*3 + 4927 wrt o? -8o*3 + 6903o*2 What is the derivative of -3t*3v - 6426t3 - 61t*2v + 4v2 + 2v wrt v? -3t3 - 61t*2 + 8v + 2 What is the third derivative of -322a3n*3 + 184a*3n*2 - an*2 wrt n? -1932a*3 What is the first derivative of 500j*4y2 - j3y + y2 - 170y - 6 wrt j? 2000j3y*2 - 3j*2y What is the second derivative of 261g3u*2y - 2g3u + 2g2u - 6g2y + 2gu*2y - g wrt u? 522g3y + 4gy What is the derivative of 26h3w - 132h3 + 4h*2w wrt w? 26h3 + 4h*2 Find the third derivative of 3x*6 + 141x*4 + 6x*3 + 3589x*2. 360x*3 + 3384x + 36 What is the third derivative of 2654r3 - 1741r2? 15924 What is the third derivative of p3z - 295p*3 - 1163p*2z + z wrt p? 6z - 1770 What is the first derivative of -3964x - 397? -3964 Find the second derivative of 32g2x*3 + 832g*2x + g*2 + 21gx4 + gx - x*3 wrt x. 192g*2x + 252gx*2 - 6x What is the derivative of -2o3p3 - o3s + 102o*3 + 76o*2p*3s + 2os wrt s? -o*3 + 76o*2p*3 + 2o What is the third derivative of q*3t*3z*2 + 7q*3t*3z - 158q3z3 - q2t3z3 - q2t3 - 2q*2t*2z*2 wrt z? -948q*3 - 6q*2t*3 What is the third derivative of 5n*4x*2 - 2n*4x + 4n3 - 2n*2x - 8n2 - 128nx2 wrt n? 120nx2 - 48nx + 24 What is the second derivative of -252d*5 - 3d*2 - 2d - 62 wrt d? -5040d3 - 6 What is the first derivative of 2g*2r*2 - 38g*2 - gr*2 - 7r - 2 wrt r? 4g2r - 2gr - 7 Differentiate -a*2ko - 3a*2k - a*2op - akop + 45kop - 4k wrt p. -a*2o - ako + 45ko Find the first derivative of 26q2w*3 - 6qw3 + 2qw2 - 617w*3 wrt q. 52qw3 - 6w*3 + 2w*2 Find the third derivative of 668d*5n + 3d4n - 4807d2n + dn wrt d. 40080d*2n + 72dn What is the second derivative of -2z5 + 874z*4 - 2z + 664? -40z3 + 10488z**2
What is the q'th term of 198, 1457, 2716, 3975, 5234? 1259q - 1061 What is the a'th term of 19920, 159497, 538364, 1276167, 2492552? 19941a3 - a2 - 7a - 13 What is the d'th term of 41898, 84176, 126456, 168738? d2 + 42275d - 378 What is the r'th term of 19071, 32229, 45387, 58545, 71703, 84861? 13158r + 5913 What is the l'th term of 1848, 7911, 18018, 32169? 2022l*2 - 3l - 171 What is the v'th term of 42139, 337287, 1138505, 2698861, 5271423, 9109259, 14465437, 21593025? 42178v3 - 33v2 + v - 7 What is the s'th term of 3426, 6852, 12560, 20544, 30798, 43316, 58092? -s3 + 1147s2 - 8s + 2288 What is the t'th term of 336433, 672023, 1007613, 1343203? 335590t + 843 What is the y'th term of 5434356, 10868851, 16303348, 21737847, 27172348, 32606851, 38041356? y2 + 5434492y - 137 What is the q'th term of -2131, -2445, -2967, -3697, -4635? -104q2 - 2q - 2025 What is the b'th term of -54671, -109300, -163889, -218438? 20b2 - 54689b - 2 What is the f'th term of -23144755, -46289462, -69434169, -92578876, -115723583? -23144707f - 48 What is the m'th term of -49390968, -98781952, -148172936, -197563920, -246954904? -49390984m + 16 What is the a'th term of 32549, 32532, 32493, 32420, 32301, 32124, 31877? -2a3 + a2 - 6a + 32556 What is the r'th term of 2586, 2641, 2754, 2937, 3202, 3561? 2r3 + 17r*2 - 10r + 2577 What is the a'th term of -13989, -14068, -14177, -14316? -15a2 - 34a - 13940 What is the l'th term of -1471, -2988, -4509, -6034, -7563, -9096, -10633? -2l2 - 1511l + 42 What is the d'th term of 14965, 14248, 13533, 12820, 12109, 11400, 10693? d*2 - 720d + 15684 What is the y'th term of 184452, 735085, 1652808, 2937627, 4589548? y*3 + 183539y*2 + 9y + 903 What is the g'th term of 2589, 4364, 5595, 6288, 6449, 6084, 5199, 3800? g*3 - 278g*2 + 2602g + 264 What is the s'th term of -29664, -119071, -268050, -476595, -744700, -1072359, -1459566, -1906315? s*3 - 29792s*2 - 38s + 165 What is the q'th term of -9322, -8418, -7514, -6610? 904q - 10226 What is the l'th term of -2574458, -5148912, -7723366, -10297820, -12872274? -2574454l - 4 What is the v'th term of 10038995, 10038996, 10038997, 10038998, 10038999, 10039000? v + 10038994 What is the b'th term of -10385, -41477, -93299, -165857, -259157, -373205, -508007? -b*3 - 10359b*2 - 8b - 17 What is the s'th term of -437276, -437293, -437318, -437351, -437392? -4s2 - 5s - 437267 What is the q'th term of -5870, -23487, -52852, -93965, -146826, -211435, -287792? -5874q2 + 5q - 1 What is the v'th term of -24471, -51212, -77951, -104688? v*2 - 26744v + 2272 What is the k'th term of 58301, 100682, 143063, 185444, 227825? 42381k + 15920 What is the l'th term of 2077, 17045, 57689, 136855, 267389? 2141l*3 - 8l*2 + 5l - 61 What is the q'th term of 2516971, 2517060, 2517149? 89q + 2516882 What is the o'th term of 143801602, 287603210, 431404818, 575206426? 143801608o - 6 What is the t'th term of 8264, 8051, 7684, 7163, 6488? -77t2 + 18t + 8323 What is the c'th term of -40301, -161297, -362983, -645359? -40345c2 + 39c + 5 What is the i'th term of -137877, -275793, -413729, -551691, -689685, -827717, -965793? -i*3 - 4i*2 - 137897i + 25 What is the k'th term of -90707, -90590, -90473, -90356? 117k - 90824 What is the f'th term of -1300, -2832, -4624, -6682, -9012? -f3 - 124f*2 - 1153f - 22 What is the v'th term of 733766, 1467437, 2201130, 2934857, 3668630, 4402461, 5136362, 5870345? 2v3 - v2 + 733660v + 105 What is the h'th term of 6842, 6814, 6770, 6710, 6634, 6542? -8h2 - 4h + 6854 What is the a'th term of 445, 838, 1867, 3832, 7033, 11770, 18343? 50a3 + 18a*2 - 11a + 388 What is the b'th term of -135293, -135281, -135267, -135251, -135233? b*2 + 9b - 135303 What is the f'th term of -589984, -2359997, -5310020, -9440053, -14750096, -21240149? -590005f2 + 2f + 19 What is the i'th term of 57414800, 57414798, 57414796? -2i + 57414802 What is the l'th term of 2308700, 4617394, 6926088, 9234782, 11543476? 2308694l + 6 What is the c'th term of 32096447, 64192892, 96289337, 128385782, 160482227, 192578672? 32096445c + 2 What is the x'th term of -20794, -21209, -22342, -24553, -28202, -33649, -41254, -51377? -60x3 + x2 + 2x - 20737 What is the m'th term of 46951, 91315, 135679? 44364m + 2587 What is the z'th term of -3366770, -6733546, -10100320, -13467092? z*2 - 3366779z + 8 What is the d'th term of 266, 1495, 4594, 10457, 19978, 34051, 53570? 149d3 + 41d*2 + 63d + 13 What is the v'th term of 1861, 7469, 16799, 29839, 46577, 67001? -2v3 + 1873v*2 + 3v - 13 What is the n'th term of -3308, -13017, -29220, -51935, -81180, -116973, -159332, -208275? -3n3 - 3229n*2 - n - 75 What is the p'th term of -843, -777, -655, -477, -243, 47? 28p*2 - 18p - 853 What is the c'th term of -22143, -15515, -8887? 6628c - 28771 What is the a'th term of -5171359, -5171361, -5171363, -5171365? -2a - 5171357 What is the u'th term of 27962, 111612, 251030, 446216, 697170? 27884u2 - 2u + 80 What is the y'th term of -292, -75, 360, 1007, 1860, 2913, 4160? -y*3 + 115y*2 - 121y - 285 What is the n'th term of 69204, 69197, 69182, 69159, 69128? -4n2 + 5n + 69203 What is the d'th term of -599, -1614, -5185, -12590, -25107, -44014? -213d3 + 476d - 862 What is the t'th term of 105956, 109134, 112312, 115490, 118668, 121846? 3178t + 102778 What is the o'th term of -8775420, -17550830, -26326240, -35101650, -43877060, -52652470? -8775410o - 10 What is the w'th term of -44633, -92923, -141209, -189491, -237769, -286043, -334313? 2w2 - 48296w + 3661 What is the a'th term of 26702, 38620, 50538, 62456? 11918a + 14784 What is the x'th term of 274650, 549279, 823888, 1098477, 1373046, 1647595, 1922124? -10x*2 + 274659x + 1 What is the l'th term of 42556994, 42556977, 42556960, 42556943, 42556926, 42556909? -17l + 42557011 What is the o'th term of -77331, -77320, -77297, -77256, -77191, -77096? o3 + 4o - 77336 What is the l'th term of -62297, -124339, -186381, -248423, -310465? -62042l - 255 What is the y'th term of 16103793, 16103795, 16103797, 16103799, 16103801, 16103803? 2y + 16103791 What is the v'th term of -25306, -25604, -26100, -26794, -27686, -28776, -30064? -99v2 - v - 25206 What is the b'th term of -1222, -1434, -1816, -2374, -3114, -4042? -b3 - 79b*2 + 32b - 1174 What is the b'th term of 169354, 677284, 1523818, 2708962, 4232722, 6095104, 8296114? b*3 + 169296b*2 + 35b + 22 What is the s'th term of 22325, 22510, 22695, 22880? 185s + 22140 What is the g'th term of -1411369253, -1411369257, -1411369271, -1411369301, -1411369353, -1411369433, -1411369547, -1411369701? -g3 + g2 - 1411369253 What is the m'th term of 1376, 3906, 6436? 2530m - 1154 What is the s'th term of 45974, 92039, 138108, 184181, 230258? 2s2 + 46059s - 87 What is the u'th term of -913178, -1826411, -2739644, -3652877, -4566110? -913233u + 55 What is the r'th term of 4324, 2149, -42, -2255, -4496, -6771? -r3 - 2r*2 - 2162r + 6489 What is the q'th term of 792664, 792676, 792690, 792706, 792724, 792744? q*2 + 9q + 792654 What is the v'th term of 47378, 95408, 143438, 191468? 48030v - 652 What is the d'th term of 3317, 15541, 36667, 66695, 105625? 4451d*2 - 1129d - 5 What is the l'th term of 21500, 13873, 6246, -1381, -9008? -7627l + 29127 What is the v'th term of -258, -2665, -9154, -21765, -42538, -73513, -116730, -174229? -340v3 - v2 - 24v + 107 What is the z'th term of 27, 1633, 3239, 4845, 6451? 1606z - 1579 What is the d'th term of 3600, 28784, 97104, 230118, 449384, 776460, 1232904? 3593d3 + 10d*2 + 3d - 6 What is the t'th term of 57271935, 57271934, 57271933, 57271932, 57271931, 57271930? -t + 57271936 What is the h'th term of -106800, -106769, -106738, -106707, -106676? 31h - 106831 What is the o'th term of -5670407, -11340812, -17011217, -22681622? -5670405o - 2 What is the n'th term of -428646, -857327, -1286040, -1714779, -2143538, -2572311, -3001092? n*3 - 22n*2 - 428622n - 3 What is the f'th term of 4676, 11354, 18032, 24710, 31388, 38066? 6678f - 2002 What is the n'th term of 1292, 2304, 2998, 3374, 3432, 3172? -159n*2 + 1489n - 38 What is the k'th term of 156382476, 312764957, 469147440, 625529925? k*2 + 156382478k - 3 What is the q'th term of 2497287, 9989208, 22475767, 39956970, 62432823? q*3 + 2497313q*2 - 25q - 2
Let a(c) = -13c3 + 4c*2 + 3c + 5. Let g be a(-6). Suppose 2l - 692 = -2b, 5l + 1221 = -b + g. What is the units digit of l? 3 Let g be (7/7)/(4/3728). Let a = g - 608. What is the tens digit of a? 2 What is the tens digit of ((-32288433)/(-2094))/(-1 + (-3)/(-2))? 3 Let r be 46/(-207) + 19112/(-18). Let s = -684 - r. What is the units digit of s? 8 Let h(p) = 464p*3 + p - 1. Let a be h(1). Suppose -a = 7r + r. What is the units digit of (-1)/(-1) + -5 - r? 4 What is the hundreds digit of ((2 + 4702)/(-2))/(-4 + (-689)/(-182))? 9 Let m(x) = 72x2 + 542x - 23. What is the hundreds digit of m(-12)? 8 Let d(q) = -2q - 4. Let w be d(-2). Let r = -6 - -6. What is the units digit of 3 - -102 - (r + w/(-2))? 5 What is the thousands digit of (-142219)/(-44) - 2/8? 3 Let w(l) = -l - 14. Suppose 1 + 10 = -g. Let h be w(g). What is the tens digit of (-25)/((h - -5)/(-4))? 5 Suppose 3h + 5 = -5i - 5, 6 = -3i + 2h. What is the units digit of (-48 - -101)/(i/(-12))? 8 Let d(x) = -x2 - 10x - 31. Let u be d(-6). What is the tens digit of u/(28/(-740))(-6)/(-15)? 7 Let k = 60905 - 34396. What is the tens digit of k? 0 What is the hundreds digit of (-42808)/(-10) - (-4)/20? 2 Let p(o) = -o + 6. Let k be p(11). Let t be 240/(25/k) - 4. Let w = t - -118. What is the units digit of w? 6 Let s be (7122/(-12))/(-1)-2. Let v = -269 - s. Suppose v = 6a - 60. What is the tens digit of a? 6 What is the tens digit of 16/4842 - -1706? 2 Let g be (-99)/(-5) - (-4)/20. Suppose -gm - 2 = -21m. Suppose -a + 3w + 82 = 0, mw = -a - 3a + 398. What is the tens digit of a? 9 Suppose -2g = 29 - 35. Let c(k) = 176k + 56. What is the tens digit of c(g)? 8 Let p(v) = 689v*2 + 80v + 364. What is the ten thousands digit of p(-5)? 1 What is the units digit of -5 + (62968 - (3 + 2)) + -6 + 7? 9 Suppose 5p - 1 - 2 = -g, -6 = 3p. Suppose 0 = x + 4k - 14, 0 = -2x - k + g - 6. Suppose -4i + 5i = -3a + 58, -i + 37 = xa. What is the units digit of a? 1 What is the units digit of (2049830/110 - (54/66 + -1)) + -1? 4 Suppose 0 = -30z + 47z + 25364. What is the tens digit of (z/(-6))/(44/66)? 7 Suppose -5w + 3698 + 11007 = 0. What is the hundreds digit of w? 9 Let p be 148/28 + -5 - 8914/(-14). Suppose -3k - 620 = p. Let z = -242 - k. What is the units digit of z? 7 Suppose -3d - 3q = -0q - 24, 8 = 2q. Suppose 3f + 3w - 852 = 0, 0 = 5f + 3w - dw - 1390. What is the units digit of f? 9 Let n be -11(-3 + -20) + -1. Suppose 8a - n = 4a. What is the tens digit of 4644/a + 2/7? 7 What is the thousands digit of ((-6384)/(-36))/(3/(-5 + 68))? 3 Let k(h) = -25h3 + 4h*2 + 43h + 222. What is the units digit of k(-7)? 2 Let d(w) = -9w - 29. Let b be d(-8). Let q = 122 - b. What is the tens digit of q? 7 Suppose -3t + 5t + 24 = 0. Let l(d) = 12d - 99. Let g(w) = -4w + 33. Let h(o) = -11g(o) - 4l(o). What is the tens digit of h(t)? 8 Suppose 5k + r + 2r - 105 = 0, -2k + 41 = r. Let v be ((-306)/(-8))/(k/240). Suppose 0 = -0h - 5h + v. What is the hundreds digit of h? 1 What is the hundreds digit of 2(1 + (-16722)/(-4)) + (-28 - -20)? 3 Suppose 9j + 15 = 5j + 5x, 0 = 3j - 4x + 12. What is the tens digit of (-1 + j)/(1(-4)/2584)? 4 Let g = 383 - 645. Let u = g + 1554. What is the hundreds digit of u? 2 Let b = 56 - 54. Suppose 14 = 5r + 3u - 4u, 16 = -br - 5u. What is the hundreds digit of (-53)/r(-2 - 4)? 1 Let o(w) = 18760w - 770. Let g(j) = 73j - 3. Let c(b) = -1540g(b) + 6o(b). Let m be (10/(-8) - -1) + 25/20. What is the tens digit of c(m)? 4 Let o(y) = -10 + 7y - 7y2 + 13y3 + y2 + 4y - 14y*3. Suppose 0 = -a - 4l + 3, -4a - 4l - 24 = 0. What is the tens digit of o(a)? 3 Suppose -234 + 248 = 7l. Suppose -833 = -lj + 3f - 124, 3j - 1059 = 3f. What is the tens digit of j? 5 Suppose -43w = -57w. Suppose w = -3n - 3f + 1137, 4n + 1113 = 7n - 3f. What is the tens digit of n? 7 Suppose 0 = 2x - 4c + 8, 33c = -x + 30c + 6. What is the hundreds digit of 4 + 384 - (3 + x)? 3 Let v = 404 + -408. What is the tens digit of ((-920)/24)/(3/(18v))? 2 Suppose -2k = -4 - 4. Suppose -3 - k = h. What is the tens digit of (1 - -85) + h/(35/(-15))? 8 Let g(a) = -a*3 + 13a*2 - 11a - 9. Let s be g(12). Suppose 1 = -q + sp, 0p - 4p = -5q + 6. What is the hundreds digit of (28/112)/(q/2056)? 2 Suppose -35q - 32q + 201875 = -221967. What is the thousands digit of q? 6 Let m be -108(-5 + 255/(-6)). Suppose 12o + m = 18o. What is the tens digit of o? 5 Suppose 22129 - 73661 = -7i + 39384. What is the ten thousands digit of i? 1 Let k = 1571 - -1617. What is the hundreds digit of k? 1 Let w(f) = 26f2 + 25f - 329. What is the units digit of w(18)? 5 Let r(p) = -54p + 159. Suppose 0 = 3z - 5z + 4f - 32, 0 = -f. What is the units digit of r(z)? 3 Suppose 2l = 6o - 9o + 13, 2o - 16 = -5l. Suppose -od + b + 35 + 893 = 0, 3b = -5d + 1542. What is the tens digit of d? 0 Let g = -966 - -664. Let f = g - -549. Let s = f - 64. What is the units digit of s? 3 Let o = -92 - -152. Let p(m) = -m*2 + 42m - 314. Let q be p(32). Suppose qd - o = d. What is the units digit of d? 2 Suppose 179f - 139567 = 1141178. What is the tens digit of f? 5 Suppose 2n - 802 = -2m, 21n - 25n = -4m + 1564. What is the tens digit of m? 9 Let a(y) = -46y + 32. Let t be a(-3). Let z = 636 - t. What is the units digit of z? 6 Let o(n) = -n*2 - 8n + 35. Let s be o(3). Suppose -sz = 2v - 484, 1826 = 5z + 4v + 618. What is the tens digit of z? 4 Let m(s) = 2s2 + 7s - 18. Suppose 0 = 2i - 12 + 18, -b - 2i - 15 = 0. What is the tens digit of m(b)? 8 Let s be (-1421)/(-28) + 21/8. Let r = 57 - s. Suppose rt = q + 2t - 56, 2t + 244 = 5q. What is the tens digit of q? 4 Suppose 110h = 117h - 115752. What is the units digit of h? 6 Suppose -5q + 13f = 12f - 26297, 2f = -4. Suppose 7r + 849 = q. What is the tens digit of r? 3 Suppose -5z - s = -3s - 20, -2z - s + 8 = 0. Suppose -2h - zr + 434 = 0, 3h = -4r + 80 + 573. What is the tens digit of h? 1 Let m(s) = s3 + 4s*2 + 2s - 2. Let g be m(-2). Suppose 2j = -d + 632, 0 = -d + gj + 56 + 584. What is the tens digit of d? 3 Let s(w) = -w*3 - 2w*2 - 41w + 225. What is the hundreds digit of s(-21)? 4 Let r be 0 + (-12)/(-3)1. Suppose rn - 6n = 5c + 16, 5n + 5 = 5c. Let y = n + 17. What is the units digit of y? 4 Suppose c + 1 = n, 3c = -2n - c + 20. Let q be -4(-5)/n + -30. What is the tens digit of (-2005)/q - (-2)/(-10)? 8 Suppose -5n + 165178 = u, 2n - 34u = -39u + 66085. What is the hundreds digit of n? 0 Let t(g) be the third derivative of g6/120 - g5/60 - 7g*4/24 + 13g3/3 - g2. Let b be (-2 + 7 - -5)/2. What is the tens digit of t(b)? 9 Let y(n) be the first derivative of 2n5/5 - n4/4 + n3/6 + n2/2 - 19n - 30. Let i(u) be the first derivative of y(u). What is the tens digit of i(3)? 9 Let b(x) = 43x2 + 2x - 66. What is the thousands digit of b(7)? 2 Let s = 2 + 43. Suppose -14g = g + s. What is the units digit of ((-8100)/8)/(-5) - g/2? 4 Let g(c) = -268c - 98. What is the tens digit of g(-19)? 9 Let h(m) = -m*3 - 17m*2 + 18m + 2. Let r be h(-18). Let t be 4/224/r. Suppose -t = -4o + 480. What is the units digit of o? 6 Suppose -y - 5 = 0, p + 16y = 11y - 35. What is the hundreds digit of (-19654)/(-12) + (p - (-366)/36)? 6 Let t = 2849 + -2874. Suppose -4o + 192 = 5b + 6, 0 = -5o - 3b + 226. Let u = t + o. What is the tens digit of u? 1 Suppose 108w + 250 = 103w. What is the hundreds digit of 0 + 376 - 3/((-30)/w)? 3 Let o(p) = -2p3 + p2 + 54p - 7. Let t be o(-7). Let u = 587 - t. What is the units digit of u? 7 Let f be (-5)/15 - (-3686)/6. Suppose 0 = -12n + 4298 - f. What is the hundreds digit of n? 3 Let u(z) = z3 + 10z*2 + 8z + 21. Let y = -312 + 304. What is the tens digit of u(y)? 8 Suppose 0 = 2o - 3a - 21, -28o + 5a - 22 = -31o. Suppose 0 = 3y - o, 6x = 8x + 2y - 222. What is the units digit of x? 8 Suppose 0 = -9v + 10v - 4. Suppose -m - vb = -11, -29 + 8 = -5m - 3b. Suppose -j = -2x + 82, mx - 82 = -j + 31. What is the units digit of x? 9 Let k(v) = v - 9. Let s be k(11). Suppose -i - 449 = -m, -4i = -sm - i + 896. What is the tens digit of m? 5 Let g = -138 + 43. Let m be g((-36)/20)/3. Let i = m + -50. What is the units digit of i? 7 Suppose -1 = -3l + 2l, 4z - 3l = -19. Let c(k) = -11k*3 + 7k*2 - 6k + 2. What is the hundreds digit of c(z)? 8
What is twenty-three sixths of a year in months? 46 How many centuries are there in 2.433058 millennia? 24.33058 What is 3/50 of a century in years? 6 How many litres are there in 3353.819 millilitres? 3.353819 How many decades are there in 1591.645 millennia? 159164.5 What is sixty-four fifths of a litre in millilitres? 12800 Convert 404.2151 days to seconds. 34924184.64 How many meters are there in 837.2614um? 0.0008372614 What is 3/8 of a microgram in nanograms? 375 How many litres are there in 0.3351097ml? 0.0003351097 Convert 675174.3 years to months. 8102091.6 How many millilitres are there in 88638.99l? 88638990 What is 34.47918 months in years? 2.873265 How many grams are there in 3214.143mg? 3.214143 Convert 9.605127 micrograms to nanograms. 9605.127 How many months are there in 41.83028 decades? 5019.6336 What is 2/125 of a kilogram in grams? 16 Convert 749256.7 centuries to decades. 7492567 What is thirteen quarters of a year in months? 39 How many years are there in 1/5 of a century? 20 How many nanograms are there in 3.75183 tonnes? 3751830000000000 What is one fifth of a minute in seconds? 12 How many meters are there in 3/10 of a kilometer? 300 What is 21/5 of a litre in millilitres? 4200 Convert 70262.21mg to grams. 70.26221 What is fifty-four fifths of a century in decades? 108 What is 776.2323l in millilitres? 776232.3 What is 85/4 of a century in years? 2125 How many micrometers are there in 3/5 of a centimeter? 6000 What is seven eighths of a meter in millimeters? 875 What is 5728.266 decades in centuries? 572.8266 How many millilitres are there in 506.7859 litres? 506785.9 What is 138245.1 weeks in minutes? 1393510608 Convert 394692.9 meters to centimeters. 39469290 How many milliseconds are there in 191.1905 nanoseconds? 0.0001911905 How many days are there in 29.301075s? 0.0003391328125 What is 0.0710278 kilometers in millimeters? 71027.8 How many millimeters are there in 457.0387nm? 0.0004570387 What is 589.6898nm in kilometers? 0.0000000005896898 How many weeks are there in 126856.422 milliseconds? 0.000209749375 What is 17/2 of a litre in millilitres? 8500 How many decades are there in 55.45329 years? 5.545329 How many grams are there in 37660.34ug? 0.03766034 How many decades are there in 752.0296 millennia? 75202.96 How many tonnes are there in 90217.18ug? 0.00000009021718 Convert 0.9541001ml to litres. 0.0009541001 How many years are there in 285104.16 months? 23758.68 What is 3/25 of a litre in millilitres? 120 What is 5/4 of a minute in seconds? 75 How many milligrams are there in 3/25 of a gram? 120 What is 451966.1 years in months? 5423593.2 What is 130.3224 litres in millilitres? 130322.4 What is 1/54 of a week in seconds? 11200 What is 2/27 of a week in seconds? 44800 How many litres are there in 97671.5ml? 97.6715 How many millilitres are there in 5.14926 litres? 5149.26 What is 2.791205 milligrams in grams? 0.002791205 What is 4.605809km in micrometers? 4605809000 How many decades are there in 1392.034 centuries? 13920.34 Convert 2.054195 millennia to years. 2054.195 How many centimeters are there in 1/4 of a meter? 25 What is 0.9543885 litres in millilitres? 954.3885 Convert 1933.842 months to decades. 16.11535 How many millilitres are there in 20090.48 litres? 20090480 How many weeks are there in 382.350024 milliseconds? 0.0000006321925 How many minutes are there in 128467.38ms? 2.141123 Convert 24.23171 litres to millilitres. 24231.71 What is 5/4 of a millennium in months? 15000 How many years are there in 11/8 of a millennium? 1375 What is fourty-three thirds of a decade in months? 1720 Convert 240.1442ml to litres. 0.2401442 What is 77.60299 centuries in decades? 776.0299 What is 0.6584272 millilitres in litres? 0.0006584272 How many meters are there in nine tenths of a kilometer? 900 What is 27/4 of a litre in millilitres? 6750 What is 91.38792 millimeters in kilometers? 0.00009138792 How many hours are there in 43.621092 milliseconds? 0.00001211697 How many years are there in 32/5 of a century? 640 What is 23/6 of a century in months? 4600 Convert 881152.38us to hours. 0.00024476455 How many minutes are there in 7194.01 weeks? 72515620.8 What is 90.08794 decades in months? 10810.5528 What is 222.2537cm in millimeters? 2222.537 How many centuries are there in 2.4948324 months? 0.002079027 Convert 68949.9 millilitres to litres. 68.9499 What is one twentieth of a gram in micrograms? 50000 What is 320.7386 centimeters in millimeters? 3207.386 Convert 0.8225552 meters to nanometers. 822555200 Convert 640.6181 tonnes to milligrams. 640618100000 How many decades are there in one quarter of a millennium? 25 How many years are there in 6/5 of a decade? 12 How many nanometers are there in 3/40 of a micrometer? 75 What is 76.13269 centuries in millennia? 7.613269 Convert 98.40073s to nanoseconds. 98400730000 What is eleven quarters of a tonne in kilograms? 2750 Convert 4.429782l to millilitres. 4429.782 What is 1/5 of a decade in months? 24 How many millimeters are there in 13/4 of a meter? 3250 What is eleven halves of a gram in milligrams? 5500 How many decades are there in 0.0576629 years? 0.00576629 What is 67.72016ml in litres? 0.06772016 How many minutes are there in seventeen sixths of a hour? 170 What is 3/5 of a decade in years? 6 How many decades are there in 817660.9 millennia? 81766090 What is twenty-one fifths of a litre in millilitres? 4200 Convert 0.1132661 weeks to days. 0.7928627 How many millimeters are there in 3/40 of a kilometer? 75000 How many millilitres are there in 6/5 of a litre? 1200 How many nanometers are there in 8759.594 meters? 8759594000000 What is 2/125 of a gram in milligrams? 16 How many nanometers are there in seventy-five halves of a micrometer? 37500 Convert 8450.187l to millilitres. 8450187 How many milliseconds are there in 5132.521 seconds? 5132521 Convert 993682.5 centuries to millennia. 99368.25 Convert 772.6684ng to kilograms. 0.0000000007726684 What is 3/10 of a milligram in micrograms? 300 How many millilitres are there in one fifth of a litre? 200 How many kilometers are there in 64.50529 millimeters? 0.00006450529 How many milliseconds are there in 1/4 of a second? 250 What is one quarter of a meter in millimeters? 250 What is fourty-nine quarters of a hour in seconds? 44100 What is 72/5 of a milligram in micrograms? 14400 Convert 577.292ml to litres. 0.577292 What is 51/5 of a centimeter in millimeters? 102 What is 0.2897775 years in decades? 0.02897775 Convert 1.920189mg to tonnes. 0.000000001920189 How many micrometers are there in 3/10 of a centimeter? 3000 What is thirty-two fifths of a gram in milligrams? 6400 How many millilitres are there in fifty-three quarters of a litre? 13250 What is 42/5 of a gram in milligrams? 8400 What is 74.31731 decades in years? 743.1731 Convert 8.296555 days to minutes. 11947.0392 What is eleven halves of a millisecond in microseconds? 5500 How many minutes are there in twenty-one halves of a hour? 630 How many millilitres are there in 85771.9l? 85771900 How many nanograms are there in 99506.28kg? 99506280000000000 What is fifty-nine fifths of a kilogram in grams? 11800 What is 32/5 of a hour in minutes? 384 What is 62/9 of a week in minutes? 69440 How many decades are there in 5.44897 centuries? 54.4897 How many grams are there in 9/25 of a kilogram? 360 What is 2/15 of a day in seconds? 11520 What is 5.438534 days in hours? 130.524816 How many years are there in 29.990757 months? 2.49922975 How many hours are there in 5/6 of a week? 140 What is 457374.2 litres in millilitres? 457374200 What is 8/15 of a century in months? 640 How many months are there in nine tenths of a decade? 108 How many months are there in five quarters of a millennium? 15000 What is 750244.2 litres in millilitres? 750244200 What is 629.2712 weeks in hours? 105717.5616 How many milliseconds are there in 1226.495 minutes? 73589700 How many millimeters are there in 29/5 of a centimeter? 58 What is 11/2 of a millennium in centuries? 55 Convert 2.92078 years to decades. 0.292078 How many millilitres are there in nine tenths of a litre? 900 Convert 98.93517mm to meters. 0.09893517 How many millilitres are there in 6674.301 litres? 6674301 What is one ninth of a week in seconds? 67200 How many millilitres are there in 3/5 of a litre? 600 How many millilitres are there in 6/5 of a litre? 1200 What is 27/4 of a meter in centimeters? 675 What is 3/8 of a micrometer in nanometers? 375 How many milligrams are there in 11/8 of a gram? 1375 What is 99963.17um in millimeters? 99.96317
Let i = -27 + 3. Suppose 5v = 3v + 26. Calculate the remainder when (i/10)/(2/(-95)) is divided by v. 10 Let z = 130 - -571. Let x = z - 692. Calculate the remainder when 94 is divided by x. 4 Suppose -4a = 5d - 10, 0d - 5a = -4d + 8. What is the remainder when 61 is divided by 330/10 - (2 - -3) - d? 9 Suppose -310y = -348y + 298984. What is the remainder when y is divided by 21? 14 Suppose 2i + 460 = 2b, -23i = -4b - 22i + 917. Calculate the remainder when 1080 is divided by b. 164 Suppose 66r - 920 = -128. What is the remainder when 148 is divided by r? 4 Suppose -2t = 33d - 34d - 1933, -4832 = -5t + 2d. Calculate the remainder when 978 is divided by t. 12 Let t(a) = 2a3 - 31a - 21a2 + 237 - 476 + 243. Calculate the remainder when 254 is divided by t(12). 62 Suppose 0 = -w + 35 + 91. Suppose -w = -7r + r. Calculate the remainder when 17/17(-156)/(-4) is divided by r. 18 Suppose 0j - 14232 - 5088 = -84j. Calculate the remainder when 904 is divided by j. 214 Let m(i) = -2i*3 - 10i*2 + 32i + 195. Calculate the remainder when 125 is divided by m(-5). 20 Suppose -5h = -4n + 1341, 4n - 2h - 1337 = -h. Let k = -147 + n. What is the remainder when k is divided by 7? 5 Suppose 5v - 8136 = -4q + 572, -3q + 6504 = -3v. What is the remainder when q is divided by 542? 4 Let l(z) = 2z - 7. Let q be l(5). Suppose 18 = -qc + 6, 2c = -y + 76. Let a = 1582 + -1553. What is the remainder when y is divided by a? 26 Let h(n) be the first derivative of -23n*2/2 - 29n - 44. Calculate the remainder when h(-6) is divided by 22. 21 Let k = -14383 - -14521. What is the remainder when 12142 is divided by k? 136 Suppose -15 = -4p - 3a, -3p - a = -1 - 9. Suppose 3w - p = -4v + 2v, w = 4v - 27. Suppose -v = 2o - 32. What is the remainder when 50 is divided by o? 11 Suppose -u = -5a + 44, 145u - 141u = 4a - 48. What is the remainder when 125 is divided by a? 5 Let c(r) = r*3 + 6r*2 - 7r - 12. Let d be c(-6). Let p = 53 + -18. What is the remainder when p is divided by d((-144)/(-27) - 5)? 5 Let o = -29 - -33. Suppose -m - f = f - 112, of = -5m + 536. Calculate the remainder when m is divided by 36. 32 Let d(l) = 52l + 312. Calculate the remainder when 179 is divided by d(-5). 23 Let y = -50 - -92. Let l = -32 + 38. Suppose -2b = -28 + l. What is the remainder when y is divided by b? 9 Let t = 10652 - 10496. What is the remainder when 1709 is divided by t? 149 Let x(t) = 78t + 1. Suppose 3p - 30 = -12p. What is the remainder when x(p) is divided by 32? 29 Suppose h = -94f + 91f + 16, -5f + 3h = -8. Let b(m) = 2m3 - 5m*2 + 6m - 4 + 0m + 0. Calculate the remainder when b(f) is divided by 18. 14 Suppose -7g = -4g - 2x - 10, -5x - 20 = -5g. Suppose 682 = gs + 4f - 500, f = 4. What is the remainder when s is divided by 73? 72 Let j(q) = -3q - 3. Let m be j(3). Let w(t) = -3t - 4. Calculate the remainder when 3/(54/2842) - 5/(-45) is divided by w(m). 30 Suppose -3y + 27 = 2n - 46, -5y = 3n - 120. Suppose -4i - y = z + 48, -3i = -z + 43. Calculate the remainder when 26 is divided by (-136)/i - (-6)/4. 6 Suppose 43a - 4060 = 38a. Suppose 20 = 16w - a. Let v(u) = u2 - 7u + 6. Calculate the remainder when w is divided by v(8). 10 Suppose 2x - 24 = -4r, -5 - 15 = -x - 4r. Let k(l) = l3 - 4l*2 + 4l + 3. Calculate the remainder when 66 is divided by k(x). 9 Suppose 0 = -183n - 50n - 753 + 4947. Calculate the remainder when 249 is divided by n. 15 Suppose 0 = -t - 2 + 11. Let z = -806839 + 807449. What is the remainder when z is divided by t? 7 Suppose 1156 = 58x + 60x - 3210. Calculate the remainder when 2643 is divided by x. 16 Let y = 68 + -78. Calculate the remainder when 100 is divided by (-4)/y + ((-1981)/(-35) - 13). 12 Suppose -13c + 25985 - 4836 = -17474. Calculate the remainder when c is divided by 48. 43 Suppose -7 = -12c + 65. Let m(p) be the first derivative of -p*3/3 - 2p*2 + 15p + 9. What is the remainder when c is divided by m(-6)? 0 Let c = -22881 + 23163. What is the remainder when 1315 is divided by c? 187 Suppose -120u - 10581 + 32501 = 40u. Calculate the remainder when 216 is divided by u. 79 Let a = -19 + 14. Let s(m) = -m*3 - 4m*2 + 6m - 7. Let t be s(a). Calculate the remainder when 72 is divided by 6/8 - (339/t - -4). 22 Suppose -20f + 19f + 2r + 244 = 0, r = -5f + 1165. Calculate the remainder when f is divided by 78. 0 Suppose m + 2m - 5z + 8 = 0, 0 = -5m - 2z - 34. Let b be -3 + (1 + m)(-14)/10. Suppose 0j - bj = -392. What is the remainder when j is divided by 34? 30 Suppose 34h - 488 = 2096. What is the remainder when 448 is divided by h? 68 Let h = 1285 + -45. Calculate the remainder when h is divided by 17. 16 Suppose -2666h - 220 = -q - 2669h, -4h + 1034 = 5q. Suppose -2i + 4 = -0i. Suppose 104 = 2t + i. Calculate the remainder when q is divided by t. 49 Let h be (-1)/(-2 + 3/2). Suppose 9i + hz = 7i + 28, 2i = -z + 23. Let s = -15 - -20. What is the remainder when i is divided by s? 4 Let o = -6426 + 6447. What is the remainder when 108 is divided by o? 3 Let v(w) = w2 - 15w - 20. Let r(x) = 2x2 - 23x - 30. Let z(y) = 5r(y) - 8v(y). Calculate the remainder when 97 is divided by z(-3). 6 Let w be 220/1212/10. Suppose -3k + w = o, k - 6k + 30 = 5o. Calculate the remainder when 278 is divided by k. 6 Let j(k) = -2k2 + 172k*3 - 91k*3 - 3k - 3 - 101k3. What is the remainder when j(-2) is divided by 32? 27 Let y = -3 + -2. What is the remainder when (-7 + 5 - -2) + -2 + 21 is divided by (-35)/146/y? 1 Let o = -16361 + 16368. What is the remainder when 671 is divided by o? 6 Calculate the remainder when 544 is divided by (-2 + 16/5)/((-2)/(-5)). 1 Let k(a) = a*2 - 5a - 556. What is the remainder when k(-27) is divided by 10? 8 Let r(m) = -m*3 + 5m*2 - m - 1. Let j = -58 + 38. Let q = -19 - j. Calculate the remainder when r(2) is divided by q. 0 Let y(g) = -15g + 182. What is the remainder when 205 is divided by y(7)? 51 Suppose 2o - 287 = -5j - o, -o + 59 = j. What is the remainder when j is divided by (-3198)/(-91) + 2 - 1/7? 18 Let h(t) = -2t - 31. Let l = -43 + 25. Let o be h(l). Suppose -43 = -ow + 7. Calculate the remainder when 55 is divided by w. 5 Suppose 261 = 11n - 432. Let m = n + -52. Calculate the remainder when 29 is divided by m. 7 Let i(j) = -276j + 636. Calculate the remainder when 4953 is divided by i(2). 81 Calculate the remainder when 4 + (-20 - 928)/(-2) is divided by 261. 217 Suppose -2w = -4q + 874, 1094 = 6q - q - w. Let j(r) = 150r + 310. Calculate the remainder when q is divided by j(-2). 9 Suppose -4g - 4k = 32, -5g = -3k - k + 40. Let o be (1 - 0) + 90 - (-16 - -18). Let w = o - g. Calculate the remainder when w is divided by 7. 6 Let n(m) = -9m3 - 2m*2 - 21m - 25. What is the remainder when 889 is divided by n(-2)? 79 Let z be (-14 + 0)/((-6)/1149). Suppose -zy = -2690y + 36. Calculate the remainder when -122/5-5 is divided by y. 2 Suppose 52f - 11f = 11486 - 4024. Calculate the remainder when 2546 is divided by f. 180 Let u(f) = f*2 - 36f + 233. Let s be u(28). Suppose -2r + 5g = -13, -5g = sr - 10r + 4. What is the remainder when 15 is divided by r? 6 Let q = -33 - -78. Let l = 20 + -20. Suppose l = 2p - 4p + 264. What is the remainder when p is divided by q? 42 Let o(t) = -7t + 5. Let w be o(0). Suppose -74 = wh - 249. Calculate the remainder when 67 is divided by h. 32 Let c = 30 + -26. Suppose -277 = -3y - 5r, 7y - 313 = 4y + cr. What is the remainder when y is divided by 385/5 - 4? 31 Let n = -2 - -3. Suppose -5f - 186p + 183p + 489 = 0, -2p - 263 = -3f. What is the remainder when f is divided by 2 + 13 - n/(-1)? 13 Let h be 205/(-10)-1. Suppose -hj = -352 + 42. What is the remainder when j is divided by 8? 7 Let r(y) = -y2 - 11y + 3. Let h be r(-12). Let k(b) = b*3 + 8b*2 - 20b - 39. Calculate the remainder when k(h) is divided by 9. 6 Calculate the remainder when -8 + ((-192)/(-15))/(52/20150) is divided by 127. 126 Suppose -18d + 42d - 72 = 0. Let h(b) = -5b + 54. What is the remainder when h(8) is divided by d? 2 Let n = 7101 - 5350. Calculate the remainder when n is divided by 6. 5 Suppose 42x - 5885 = -2063. What is the remainder when 438 is divided by x? 74 Let s be -16*5/(10/18). Let n = -77 - -85. What is the remainder when -1 - s/(4 - 1) is divided by n? 7
What is 1/5 of a kilometer in centimeters? 20000 Convert 189.935mg to grams. 0.189935 What is 32/5 of a litre in millilitres? 6400 What is 3/25 of a micrometer in nanometers? 120 How many centimeters are there in 9/10 of a meter? 90 How many decades are there in 1/4 of a millennium? 25 What is three tenths of a millimeter in micrometers? 300 How many months are there in three sixteenths of a millennium? 2250 What is 21/2 of a century in years? 1050 How many micrograms are there in one tenth of a gram? 100000 How many centimeters are there in thirteen fifths of a meter? 260 What is 0.6179685 months in years? 0.051497375 How many grams are there in 5/4 of a kilogram? 1250 Convert 516.8321us to seconds. 0.0005168321 What is twenty-five quarters of a millennium in years? 6250 Convert 32201.03m to nanometers. 32201030000000 How many seconds are there in seven sixths of a hour? 4200 How many weeks are there in 795535.02 hours? 4735.3275 How many days are there in 5.1086979 minutes? 0.003547706875 What is 51/4 of a decade in months? 1530 What is 0.2651237 days in hours? 6.3629688 Convert 1.860864l to millilitres. 1860.864 What is 3.251459 litres in millilitres? 3251.459 How many months are there in 463.1436 centuries? 555772.32 What is 1/4 of a tonne in kilograms? 250 How many milliseconds are there in 45/2 of a second? 22500 What is 5/8 of a centimeter in micrometers? 6250 How many months are there in 8/3 of a millennium? 32000 Convert 1.016532 nanograms to tonnes. 0.000000000000001016532 Convert 0.2226694 years to centuries. 0.002226694 How many millilitres are there in seven halves of a litre? 3500 What is 1/6 of a century in months? 200 What is 3792.864km in nanometers? 3792864000000000 What is seven sixths of a week in hours? 196 What is 22312.338 months in centuries? 18.593615 How many millilitres are there in 1936.188l? 1936188 What is 7/8 of a litre in millilitres? 875 How many meters are there in fourty-two fifths of a kilometer? 8400 What is 7/4 of a year in months? 21 What is one twentieth of a microgram in nanograms? 50 Convert 2178.054 nanometers to centimeters. 0.0002178054 How many nanoseconds are there in 69171.68 minutes? 4150300800000000 What is 570194.9g in micrograms? 570194900000 Convert 0.7823419 years to months. 9.3881028 What is 3/10 of a kilometer in meters? 300 Convert 3.735596 centimeters to micrometers. 37355.96 What is seven quarters of a microgram in nanograms? 1750 What is 1/16 of a centimeter in micrometers? 625 Convert 524182.7 nanometers to micrometers. 524.1827 What is five sixths of a hour in minutes? 50 What is 1/16 of a minute in milliseconds? 3750 How many weeks are there in 153854.0703 nanoseconds? 0.00000000025438834375 How many nanograms are there in one tenth of a microgram? 100 How many millilitres are there in 11/2 of a litre? 5500 How many millimeters are there in 8029.112 nanometers? 0.008029112 What is 3/8 of a day in seconds? 32400 What is 72705.99ng in kilograms? 0.00000007270599 What is 2/125 of a kilogram in grams? 16 Convert 41547.7 millilitres to litres. 41.5477 What is 5/8 of a day in minutes? 900 How many months are there in 25/4 of a millennium? 75000 How many millimeters are there in 3158.454 meters? 3158454 What is 11/4 of a microsecond in nanoseconds? 2750 How many millilitres are there in 3/8 of a litre? 375 How many nanoseconds are there in 7121.135 days? 615266064000000000 What is thirty-two fifths of a hour in minutes? 384 Convert 27042.75 decades to centuries. 2704.275 What is five quarters of a litre in millilitres? 1250 What is 29/5 of a litre in millilitres? 5800 How many months are there in fifty-seven fifths of a decade? 1368 What is fifteen quarters of a kilogram in grams? 3750 How many months are there in 1/20 of a millennium? 600 Convert 0.7308007 centuries to millennia. 0.07308007 What is 78.74213um in nanometers? 78742.13 What is 3/5 of a litre in millilitres? 600 How many kilograms are there in 0.3393968 tonnes? 339.3968 How many decades are there in one tenth of a millennium? 10 Convert 7.754608l to millilitres. 7754.608 How many millilitres are there in 43/2 of a litre? 21500 What is 71651.38 kilograms in nanograms? 71651380000000000 How many micrograms are there in 6.654287ng? 0.006654287 How many litres are there in 116248.1 millilitres? 116.2481 What is 1/10 of a century in years? 10 Convert 5.3454 months to years. 0.44545 Convert 86224.31 millennia to months. 1034691720 How many micrograms are there in one fifth of a milligram? 200 How many decades are there in 74457.7 centuries? 744577 What is 1089.612ns in minutes? 0.0000000181602 What is seven thirds of a hour in minutes? 140 What is 19/4 of a millennium in months? 57000 How many decades are there in 17.66621 millennia? 1766.621 Convert 6153.49 kilometers to millimeters. 6153490000 What is 18/5 of a litre in millilitres? 3600 How many nanoseconds are there in 0.8729373s? 872937300 How many nanograms are there in 0.1610538kg? 161053800000 Convert 148.218525 seconds to days. 0.0017154921875 How many years are there in 1/5 of a decade? 2 Convert 4.023046 millilitres to litres. 0.004023046 How many millilitres are there in fifteen quarters of a litre? 3750 How many nanometers are there in 426.431cm? 4264310000 What is 39.67131ml in litres? 0.03967131 What is 8.958s in nanoseconds? 8958000000 How many hours are there in 0.8635771 weeks? 145.0809528 What is 8064.752ms in nanoseconds? 8064752000 How many millilitres are there in twenty-seven quarters of a litre? 6750 How many minutes are there in eight thirds of a hour? 160 What is 5/4 of a millennium in months? 15000 What is 3/25 of a second in milliseconds? 120 How many nanograms are there in 69.27589ug? 69275.89 How many days are there in 90799.02 minutes? 63.054875 What is one quarter of a second in milliseconds? 250 What is 0.2863788 centimeters in millimeters? 2.863788 How many millilitres are there in 3/50 of a litre? 60 How many millilitres are there in fourty-four fifths of a litre? 8800 What is 5/8 of a meter in millimeters? 625 Convert 29004.83nm to millimeters. 0.02900483 How many millimeters are there in 37/2 of a meter? 18500 How many millilitres are there in 3/8 of a litre? 375 What is twenty-nine halves of a microgram in nanograms? 14500 How many millimeters are there in 524.2161nm? 0.0005242161 How many millilitres are there in one quarter of a litre? 250 What is twenty-one fifths of a litre in millilitres? 4200 Convert 0.9567159g to kilograms. 0.0009567159 How many decades are there in twenty-seven halves of a century? 135 How many nanograms are there in fourty-five quarters of a microgram? 11250 How many days are there in 2358.0234s? 0.0272919375 What is 5173.434 months in decades? 43.11195 What is three tenths of a meter in centimeters? 30 What is 3/40 of a tonne in grams? 75000 What is 52639.1ug in grams? 0.0526391 How many meters are there in three tenths of a kilometer? 300 How many nanometers are there in 55.93375 micrometers? 55933.75 How many millilitres are there in eleven eighths of a litre? 1375 What is 3/32 of a milligram in nanograms? 93750 What is twenty-five halves of a year in months? 150 What is 13/4 of a millimeter in micrometers? 3250 How many nanograms are there in 51/5 of a microgram? 10200 Convert 276.7428 meters to millimeters. 276742.8 How many grams are there in twenty-six fifths of a kilogram? 5200 What is 51/7 of a week in minutes? 73440 Convert 7403.44 weeks to days. 51824.08 How many millimeters are there in 0.6091687um? 0.0006091687 How many minutes are there in 3/7 of a week? 4320 How many millimeters are there in fourty-nine fifths of a centimeter? 98 How many kilograms are there in 29/5 of a tonne? 5800 What is 3/32 of a gram in micrograms? 93750 How many millilitres are there in 0.302137l? 302.137 How many centimeters are there in fifteen quarters of a meter? 375 How many meters are there in three fifths of a kilometer? 600 Convert 20456830.8ns to weeks. 0.000000033824125 Convert 4.604075 micrometers to nanometers. 4604.075 What is 1/28 of a week in minutes? 360 How many months are there in 69/2 of a century? 41400 How many decades are there in five quarters of a millennium? 125 What is one quarter of a centimeter in micrometers? 2500 Convert 47.2197 micrometers to meters. 0.0000472197 What is fourty-four fifths of a millennium in years? 8800 What is 5/8 of a litre in millilitres? 625 Convert 315.6923 millimeters to centimeters. 31.56923 What is 0.8157821 millennia in decades? 81.57821 How many years are there in sixty-seven quarters of a millennium? 16750
Let w = 339 + -559. Let b be ((-5)/w)/(4/32). Let k be 2/(-9)9/15. What is the second smallest value in b, -2/5, 3, k? k Let c be (-16 - 492/(-30))20. What is the third smallest value in 26, -5, 1, c? c Let p = 1.928154 - -0.071846. Let v = -394/119 - -24/7. What is the third smallest value in -0.3, p, v? p Let u be 65/((-8190)/(-108)) + 80/(-126). What is the second biggest value in u, -8, -0.4, 11? u Let m = -1.8627 - -4.8627. What is the fourth biggest value in m, -7/3, 36, 3/7? -7/3 Let u = -2.3 + 0.3. Let q be (-50)/(-95)(-3591)/(-756). What is the fourth biggest value in q, -0.1, 1/9, u? u Let x = -1279/3783 - -6/1261. What is the fourth biggest value in -1, -0.1, 1, x? -1 Let y = 160 + -1117/7. Suppose -6n = -4n + 2, -2l + 2n - 202 = 0. Let z = l - -127. Which is the second biggest value? (a) y (b) z (c) 1 c Let c = -0.41523 - -0.01523. What is the third smallest value in 1, 5/3, c, 2/9, 0? 2/9 Let n = -173113 - -173112.8. Let h be (-84)/(-99) + (-4)/6. What is the second smallest value in n, 3/5, h, -3.8? n Let b = 67 + -73. Let h be (4/10)/(8(-7)/(-105)). What is the smallest value in h, b, 0.039? b Let m = 36.54 - 38.39. What is the second smallest value in -4, 2, m? m Let q(y) = -2y - 11 + 5 - 1. Let a be q(-6). Let m be ((-30)/a + 4)/8. What is the third biggest value in 0.2, -2/7, m? -2/7 Let p = 1053.7 - 1053.8. Which is the second biggest value? (a) -0.5 (b) p (c) 0.4 (d) 0.5 (e) -1/3 c Let f = -4.8 - -4.84. Let l = 532 + -528. What is the second smallest value in 3, l, f, -0.1? f Let f be 1 + (-14)/(-10) - 2. Let p be 296/49 + -1 + -1 - (45 - 41). What is the fourth smallest value in -1/3, 2/13, p, f? f Let z(b) = -39b + 126. Let i be z(4). Let g = i + 28. What is the third smallest value in -1/4, 2, 2/21, g? 2/21 Let j = -8.75 - -13.75. What is the fourth biggest value in 2, 68, -0.5, j? -0.5 Let h = -19392 - -19393. Suppose 10 = -2z + 2. Which is the second smallest value? (a) h (b) z (c) 0.2 (d) -14 b Let o(j) = -j3 + 19j*2 + 92j + 20. Let q be o(23). Let t be q/50 + (-8)/(-30). Which is the fourth biggest value? (a) 0.4 (b) -0.5 (c) 4/3 (d) t b Let q be 52/36 + (-1)/(-2). Let d = -629/342 + q. Let z be (-245)/1403/(-7). What is the third smallest value in z, -2/5, d? z Let n be (-2 + 15/18)((-96)/294)/(-4). What is the fourth smallest value in n, -8, -2/11, 0.2, 4? 0.2 Let f = -8479 + 33863/4. Which is the third biggest value? (a) f (b) -1/2 (c) -0.03 a Let j = -9.1 + 8.6. Let r = 49.3 + -49. What is the fourth biggest value in j, 0, -5, r? -5 Let y = -2.502 - -2.802. What is the second smallest value in -1, -2, y, 0.21? -1 Let g = 10 - 6. Suppose -f = 1, -5d = 3f - gf - 31. Let i = -2092 - -2095. Which is the biggest value? (a) i (b) 0.5 (c) d c Let z = -9513.6 - -9514. What is the third smallest value in 2/13, 8/11, z, 0.01? z Let z = 38794 + -43391. Which is the smallest value? (a) z (b) -1 (c) 0 (d) -0.3 a Let q be 20 + -18 - (12 - 10). What is the fifth smallest value in -3/8, 3, q, 2050, 0.4? 2050 Let s = 14226.3555 - 14230. Let g = s - 0.0555. What is the biggest value in 3, g, -1/4? 3 Let m(z) = -z - 14. Let t be m(-10). Let f be (-459)/t(-8)/(-12). Let l = -74 + f. Which is the third smallest value? (a) 1 (b) 1/3 (c) l c Let q = -547/7 - -6003/77. What is the fourth smallest value in q, -3/8, 0.07, -0.5? 0.07 Suppose 0 = 29t - 42t - 13. Let u = 9.1 + 2.8. Let v = u - 12. Which is the third smallest value? (a) 0.1 (b) -2 (c) v (d) t c Let k = 22 + -10. Suppose 32w - 17 = 175. Let l be w + 1(-102)/18. What is the smallest value in k, l, -1/3? -1/3 Let t = -7.71605 + 7.51605. Let u be (6/4)/(1/(-4)). Which is the biggest value? (a) 1/2 (b) u (c) t a Let o = 15.7 - 21.6. Let p = -5.6 - o. Let w be (-1)/4 - 1/4. Which is the second biggest value? (a) 0.1 (b) 7 (c) p (d) w c Let m = 1259 + -1262. What is the fourth biggest value in m, -0.2, 48/11, -4? -4 Let a = -11/653 - 3177/5224. What is the fourth biggest value in -0.2, 0.5, a, 32? a Let m = 3917/4 - 980. What is the fourth smallest value in 0, 1/5, -5, m, -12? 0 Let l be (-216)/(-270)10/(-36)(-123)/(-164). Let m = 0.1 - -0.9. Let g = 0.1 - 0.2. Which is the biggest value? (a) m (b) l (c) g a Let l = 3.81 - -0.19. Let z be (-74 - 1)(4 - (-80)/(-24)). Let v = z + 448/9. Which is the third biggest value? (a) l (b) 2 (c) v c Let l = 4 - 9. Let g = 1 + l. Let v = -477/1924 + -1/481. Which is the second biggest value? (a) -1/3 (b) g (c) v a Let o = -7.6657 - -3.6657. What is the third biggest value in 1/10, -12, o, 2/7? o Suppose 0 = -p - 3k + 13, -k - 1 = 3p - 0k. Suppose 0 = 52r - 58r - 54. Which is the fourth smallest value? (a) r (b) p (c) -5 (d) -0.4 d Let t = 3800 - 15201/4. What is the smallest value in t, -0.5, 0.4, 1/3, 0.11? -0.5 Let v = -1929/3388 - 1/484. Let p = -46 - -277/6. Let y = p + 4/3. Which is the third smallest value? (a) y (b) 0 (c) v a Let z be -312/(-30) - 2. Let n = -60352.1 + 60352. Which is the third biggest value? (a) -3 (b) z (c) 2 (d) n d Let z be (-19 - -14) + 13 + -11. What is the third smallest value in 158, -0.3, z? 158 Let j = 128 + -129.03. Let v = j + 1.53. Let w = 6 + -6. What is the biggest value in 4, v, -6, w? 4 Let k = -175 + 277. Let x = -104 + k. Let q be (x/6)/(70/42). What is the smallest value in q, 1/2, 0.33? q Suppose 55w + 17741 + 7315 = w. What is the second biggest value in 0, -4/7, w, 0.1? 0 Suppose 0 = 4w + o - 1, 11w - 21 = 7w - 5o. What is the third smallest value in 2/15, -28/9, w, -3? w Let s be (-34)/(-105)(-36)/(-6). Let h = 2/635 + 9511/4445. Let w = s - h. What is the second smallest value in -0.09, -0.3, w? w Let u = 10229 - 10443. What is the smallest value in -0.1, 0.1, 5, 1/4, u? u Let n = 1809 - 1810.2354. Which is the second biggest value? (a) n (b) 0.1 (c) 3 b Let n = 15 + -14.6. Let x = 144 - 148. Which is the fourth biggest value? (a) n (b) -20 (c) 0.3 (d) x b Let b = -4083 + 4079. What is the third biggest value in b, 9, 0.1, 0.16? 0.1 Let h = -1.3359 - -0.3359. Which is the second smallest value? (a) -0.1 (b) -2 (c) h c Let z = -1819 - -1541. What is the second smallest value in 4, -0.3, -5, z? -5 Let v = 1.7 + 3.3. Let d = 12284.75 - 12285. Which is the second smallest value? (a) -1/2 (b) d (c) v b Let n = 1.8 + -9. Let u = -7 - n. Let s = -0.419 + 0.719. Which is the second biggest value? (a) u (b) -8 (c) s a Let z = -180 + 185. Let g = 19.3 + -29. Let j = 9.3 + g. What is the second smallest value in j, z, 0.1? 0.1 Let z = 4133 - 4138. Let k be (-6)/(-2) + (-91)/14. Which is the second smallest value? (a) 5/2 (b) k (c) z b Let g = -0.043 + -0.257. Let w = 0.614 + 3.386. Let n = 4 + -7/2. Which is the third smallest value? (a) n (b) 1/4 (c) g (d) w a Let b = -18738 - -18690.292. Let x = b + 0.208. Let g = x - -47. What is the smallest value in g, -4, 1, -5/3? -4 Let y = -0.028 + -7.772. Let r = y + 12. Let o = r + -6.2. What is the smallest value in -0.2, o, 1? o Suppose 5d = -4 - 11. Let c(b) = b*3 - 2b*2 - 2b + 1. Let f(j) = -j - 4. Let h be f(-4). Let t be c(h). What is the third smallest value in -2/7, d, t? t Let x(r) = r*2 + 28r + 22. Let t be x(-9). Let y = -149 - t. Which is the fourth biggest value? (a) -10 (b) -4 (c) 0.5 (d) y a Let o = -171 + 176. Let s(t) = -5t + 27. Let q be s(o). Which is the fourth biggest value? (a) q (b) 0.2 (c) -5 (d) 6 c Suppose -9h = -4j - 4h - 9, 4j - 2h - 6 = 0. Let k = 0.42152 - 1.92152. Which is the second biggest value? (a) -0.01 (b) k (c) j a Let n(t) = -t*2 - 36t - 239. Let k be n(-27). Which is the fifth biggest value? (a) -0.0379 (b) -0.4 (c) -0.3 (d) 2 (e) k b Let y = -5/1167 + -1067/23340. Which is the smallest value? (a) -4 (b) y (c) 2 (d) 2/53 a Let v = 3.25 + -98.55. Let j = v + 5.3. Let w = j - -90.1. Which is the fourth biggest value? (a) -1/3 (b) 3/5 (c) -0.5 (d) w c Let u = 0.136 + -0.056. Let f = 0.219 - u. Let n = 0.049 - f. What is the third biggest value in -5, -1, n? -5 Let w = -14.64 - 0.36. Let p = -153.95 + 154.25. What is the second smallest value in -1/3, p, w? -1/3 Let h = 5.592 - -1.008. Which is the smallest value? (a) 2/3 (b) h (c) -0.14 (d) -4 d Let n = 5997 - 5995. Which is the second smallest value? (a) n (b) -3 (c) -521 b Let x = -2.0295 - -0.0295. Suppose -4j = -4s + 84, 0 = -4j - 0j - 4. Suppose -4d - d + s = -2f, -5d + 3f + 20 = 0. What is the biggest value in 2, d, x? d
Which is greater: -14/6467 or -2/45? -14/6467 Is 0.2 != -253/25? True Is 400 greater than or equal to 313? True Which is greater: 2 or -1153? 2 Which is greater: -1703 or -1699? -1699 Is -343521 less than -343521? False Is -37/23627 < -1? False Is -942 smaller than -833? True Is -3433.3 greater than or equal to -9? False Do -1 and 130/11923 have the same value? False Is -32850 at most as big as -32850? True Is 8489 > 8441? True Is 3811/7 not equal to 1? True Which is smaller: -3/1124455 or 0? -3/1124455 Which is greater: -39210 or -39231? -39210 Which is greater: -1629/124 or -1? -1 Which is greater: -494 or -498? -494 Is -0.015 at least -490.1? True Which is bigger: 5/991842 or -0.1? 5/991842 Is 3563 <= 25? False Which is greater: -9 or -2650/319? -2650/319 Is -13/1562 smaller than 1? True Does 161282 = -0.1? False Is -19694 at most as big as -19697? False Which is smaller: -10/22419 or 0? -10/22419 Are -2/15 and 0.0899 nonequal? True Is 2211 at least 79583/36? True Are 54616 and 54557 equal? False Is 0 greater than 1366/5917? False Is -1 less than -23/185686? True Which is bigger: 20430 or -70? 20430 Which is smaller: 0 or -258/235? -258/235 Is 44038 > 308269/7? False Does -103994 = -103950? False Is 155134/29 >= 5349? True Which is bigger: 226001 or 226000? 226001 Which is greater: -2 or 370? 370 Is 353 != 58? True Is -95202 at most as big as 5? True Is -5.776 > 7? False Which is greater: -153698/3 or 1? 1 Which is bigger: -23 or -1575/31? -23 Which is bigger: 133/1370 or -1? 133/1370 Which is smaller: 1 or 5/321113? 5/321113 Which is greater: -3445.9 or -2/9? -2/9 Is 0.0506 greater than 141? False Which is smaller: 0.407 or -0.203? -0.203 Which is smaller: -4.6757 or 30? -4.6757 Are 331817 and 331821 equal? False Which is greater: 120/7 or -398? 120/7 Which is smaller: 13 or -245546? -245546 Are -199562 and -1396932/7 equal? False Is -3202 less than -3302? False Which is greater: 0 or 49.9144? 49.9144 Is 2583 greater than or equal to -3/22? True Is 0 less than or equal to 2/12349989? True Are 1/226043 and 1 non-equal? True Which is smaller: 14.1164 or 2/7? 2/7 Which is bigger: 3 or 2913/754? 2913/754 Is 1 less than 1/639106? False Which is greater: -29533 or -29534? -29533 Which is greater: 9057 or 72? 9057 Do -11 and -452/43 have the same value? False Is 7366870 >= -0.1? True Are 505 and 5558/11 equal? False Is -12946 at least as big as -38834/3? False Which is bigger: 556475 or 556474? 556475 Are -1 and 2/262663 non-equal? True Which is smaller: 1 or 754/2517? 754/2517 Is 1345/6 less than -188? False Are -2 and -7425.74 equal? False Is 331079 greater than 331079? False Do -5678 and -39754/7 have different values? True Which is smaller: -2066 or -3/5? -2066 Is 18 less than -414.93? False Which is bigger: -20082 or 10? 10 Which is smaller: -5/7 or 4424? -5/7 Is -97/1585 less than 0? True Is -4026783 less than -4026783? False Do 1/3 and -6/22049 have different values? True Does 273936 = 273935? False Which is smaller: -6997/36 or -195? -195 Which is bigger: 445 or -182? 445 Which is smaller: -849 or -933? -933 Which is bigger: -8/11941 or 0? 0 Which is bigger: 87.29 or -2/99? 87.29 Which is smaller: 813703 or 813707? 813703 Is -149780 equal to -149779? False Are -168 and -7.09 non-equal? True Is 1 bigger than -2/708515? True Is 2033026 greater than or equal to 2033025? True Are -14/675 and 0.0001 equal? False Is 87434 equal to 87430? False Are 2/19 and 2469.9 equal? False Which is bigger: -15 or -2/9? -2/9 Is 362 at least 455? False Which is greater: 21835/4 or -2? 21835/4 Is -5/10652 not equal to 0? True Which is greater: -63702.3 or -1? -1 Which is smaller: 1/32 or 49/40? 1/32 Which is bigger: -1404594/7 or -200657? -1404594/7 Which is smaller: -2890307 or -2890306? -2890307 Is 24 < 118/5? False Are -4046 and 25 unequal? True Which is bigger: -1475 or -11799/8? -11799/8 Do 18067 and 18066 have the same value? False Is 78225 bigger than 78226? False Do 200947 and -0.4 have different values? True Is 182 smaller than -944? False Is 143248 at least -0.07? True Which is smaller: 7025375 or 7025374? 7025374 Which is smaller: 34492 or 34493? 34492 Which is greater: -42452/7 or -6065? -42452/7 Which is smaller: 22.09 or -0.186? -0.186 Are -260881 and -260881 nonequal? False Is -1457086 <= -1457085? True Is 71294 less than 71294? False Are -41766 and -41765 nonequal? True Is 0.0047 not equal to 292? True Which is smaller: 4041/32 or 126? 126 Is -174617 > -174625? True Is -133711 < -1/5? True Are 6068 and 6122 nonequal? True Are 0 and -16/17791 equal? False Is -4 at least as big as -119281? True Which is bigger: -1/820484 or 0? 0 Is -7355/664 less than or equal to -12? False Which is smaller: -11430/499 or -24? -24 Which is smaller: 13163 or 13141? 13141 Which is smaller: 15/250966 or -1? -1 Is -17014 at most as big as 0? True Is -1 at least as big as 16480/11? False Which is smaller: -1 or -1138? -1138 Is 21237 < 169905/8? True Is 139406 at least 139408? False Which is greater: 437/27 or 16? 437/27 Is -6844 at least -6845? True Which is greater: 2278 or 2011? 2278 Which is smaller: 710052/13 or 54620? 710052/13 Which is bigger: -95578 or -95586? -95578 Which is bigger: 0 or -1/5869952? 0 Which is greater: -319082 or -319084? -319082 Is 8320 < 8319? False Which is greater: 28385 or -0.1? 28385 Is -1 less than 0.0352299? True Is 1 greater than -1/1096848? True Which is smaller: -2820 or -11281/4? -11281/4 Which is bigger: 1/8 or -27817? 1/8 Which is smaller: 2190 or -4? -4 Which is smaller: 856 or 59036/69? 59036/69 Is -183334 bigger than -183333? False Is -1997977 at least as big as -1997977? True Which is greater: -1/214057 or 0? 0 Is 10074 at least 10069? True Is -72445 > 0? False Which is smaller: 158 or 362? 158 Which is smaller: 7094 or -0.4? -0.4 Which is bigger: 40284 or 40286? 40286 Is -10/134839 smaller than 1? True Is 122727 at most 122727? True Is 549740 at most 549741? True Which is smaller: -2645 or 9? -2645 Is 62734 at most as big as 62767? True Is -1140 less than -71? True Is 1068 greater than or equal to -1673? True Is -2 equal to -2340/731? False Which is smaller: 10043/643 or 17? 10043/643 Which is greater: -1 or 2/78447? 2/78447 Do -4/7901 and 3 have the same value? False Is 734 greater than 837? False Is -0.0403 greater than or equal to 11.4? False Is -141/1426 equal to -1? False Is -111 >= 154? False Is -89/45 greater than 2/5? False Is -2799 <= -2111? True Is 273012 equal to 273012? True Is 50750 > 2/11? True Which is greater: -73156 or -73159? -73156 Are -2926 and 32 nonequal? True Is -652986 at least as big as -652986? True Which is bigger: -216069 or -216076? -216069 Do -92/59 and -16 have the same value? False Which is smaller: -6 or 39338? -6 Does -84 = 583? False Which is greater: -1 or 2776.93? 2776.93 Which is greater: 1098644 or 1098643? 1098644 Is -109682 at most -16? True Which is bigger: 28694 or 28709? 28709 Is 0 bigger than -2/37987? True Which is smaller: -24577/3 or -8193? -8193 Which is greater: 15/71 or -557? 15/71 Is -0.1 greater than 43164? False Is 1931 != -46/7? True Are -1/2 and 4558 non-equal? True Is 7145297/5 < 1429059? False Do -1361851 and -1 have different values? True Is -3958 != -4229? True Is -943 bigger than -81? False Does 114 = 4863/43? False Which is smaller: 708282 or 708278? 708278 Are 231872 and 231874 equal? False Which is smaller: -9/20288 or 0? -9/20288 Is -0.61 greater than 5684? False Which is smaller: 1/21 or 270.52? 1/21 Which is smaller: -51417/14 or -3674? -3674 Which is greater: -17 or -6385/381? -6385/381 Is 89123/4 > 22282? False Which is greater: 179988 or 179986? 179988 Which is smaller: -0.089 or 207? -0.089 Is 108567 not equal to 108567? False Which is smaller: 2520/17 or 148? 148 Which is greater: 21526/3 or 7175? 21526/3 Which is smaller: 30 or 3153/103? 30 Which is smaller: -39 or -79? -79 Which is smaller: -1362 or -25887/19? -25887/19 Is -52/1733 greater than or equal to 1? False Is -7125 smaller than -7122? True Which is bigger: 9 or 5.556? 9 Are -8957 and -89577/10 unequal? True Is 95335 smaller than 95325? False Which is greater: 229 or -160? 229 Which is smaller: 3339 or -92? -92 Which is greater: 5129 or 5133? 5133 Is 158377/34 != 4658? True Is 2022/19 smaller than 42? False Is -81440 smaller than -81439? True Which is greater: 62860 or 16? 62860 Which is smaller: 56/139109 or 1? 56/139109 Is -11754 at most as big as -11754? True Is 21793/9 equal to 2422? False Which is bigger: 0 or -51/9734? 0 Which is greater: -1 or 1/318302? 1/318302 Is 1070/153 not equal to 0? True Which is greater: 0 or 1/5300? 1/5300 Which is bigger: -39341 or -39346? -39341 Is 31240 smaller than 31239? False Which is greater: 0 or -2/98555? 0 Which is smaller: -167797 or -167796? -167797
Let f(w) = -9w4 + 12w*3 + 9w*2 + 2. Suppose 0 = x + x - 10. Let c(p) = 18p*4 - 24p*3 - 17p*2 + p - 5. Let v(l) = xf(l) + 2c(l). Factor v(q). -q(q - 2)(3q + 1)2 Let k(v) = v2 + 17v - 8. Let u(s) = -16s + 8. Let y(z) = 4k(z) + 5u(z). Factor y(p). 4(p - 2)(p - 1) Let z = 29/100 + -1/25. Factor 1/4r - 1/4r*2 - 1/4r*3 + z. -(r - 1)(r + 1)*2/4 Let a(q) be the third derivative of 4q7/315 - q6/20 + q5/15 - q4/36 - 2q2. Factor a(r). 2r(r - 1)2(4r - 1)/3 Let k(c) be the first derivative of -4c*3/3 - 4c*2 - 10. Suppose k(a) = 0. Calculate a. -2, 0 Let -1/4l*2 + 3/4l + 0 = 0. Calculate l. 0, 3 Let h be 1((-22)/(-2))/(-1). Let l = -8 - h. Factor w3 - 4w*3 + 6w*l + 0w - w*2 - 2w. w(w - 1)(3w + 2) Factor 1/6o + 0 - 1/6o4 - 1/6o*3 + 1/6o*2. -o(o - 1)(o + 1)2/6 Let q = 131/2 + -913/14. Factor qj*2 + 0 + 2/7j. 2j(j + 1)/7 Let a be 85/68 + (-1)/1. Let j(i) be the first derivative of i*3 + ai*4 + 0i + 1 - 3/5i5 - 1/2i*2. Solve j(h) = 0 for h. -1, 0, 1/3, 1 Let f = 3/122 - -467/854. Find j such that 0j - 6/7j3 + 24/7j*4 - fj*2 + 0 - 2j*5 = 0. -2/7, 0, 1 Factor 12/5d*4 + 0 + 0d + 0d2 - 4/5d*5 - 8/5d*3. -4d*3(d - 2)(d - 1)/5 Suppose 4i = 3o + 18, 2o + 7 = -i - 3o. Factor -1/3w*i + 0 + 1/3w*2 + 0w. -w*2(w - 1)/3 What is w in -4w4 + w5 + 2w*4 + 60w*3 - 59w*3 = 0? 0, 1 Let y be (-9)/141329870/(-4095). Let w = y + 2/1833. Factor -27/7f2 - 12/7 - wf. -3(3f + 2)*2/7 Let l(r) be the first derivative of 2/3r*3 - 2r - r*2 + 1 + 1/2r*4. Factor l(z). 2(z - 1)(z + 1)2 Let n be 0((-3)/4)/((-27)/(-18)). Factor 35/6c4 - 2/3c*2 + nc - 2/3c3 + 0. c2(5c - 2)(7c + 2)/6 Let x = -4 - -7. What is u in 0u*2 - u + 3 + 7u + xu2 = 0? -1 Solve -2f*5 - 4f*2 - 4f*2 + 2f*5 - 12f*3 + 4f*5 = 0. -1, 0, 2 Let u be 9/(-4)(-2)/3. Factor -3 + 0s2 - 9/2s + us3. 3(s - 2)(s + 1)2/2 Let q(s) be the third derivative of s7/630 - s6/240 + s4/144 - 12s2. Suppose q(f) = 0. Calculate f. -1/2, 0, 1 Let f(u) be the second derivative of -u4/96 - u*3/12 - 3u*2/16 + 14u. Factor f(a). -(a + 1)(a + 3)/8 Let m = -664999/280 - -2375. Let w(f) be the third derivative of 0 - mf*7 + 0f - 1/96f6 + 0f*3 + 0f*4 + 1/120f*5 + 4f2. Factor w(z). -z2(z + 2)(3z - 1)/4 Let w be (-40)/(-60) + (-26)/42 + 0. Let z(r) be the second derivative of -wr*3 + 0 + 0r*2 + 1/42r4 - r. Determine b, given that z(b) = 0. 0, 1 Let z(y) be the third derivative of -y7/1050 + y*5/300 - 7y*2. Let z(w) = 0. Calculate w. -1, 0, 1 Suppose 3n + 4c + 2 = 0, n = -4n + 3c + 16. Let d = n + 0. Factor 2/3r*3 - 4r*d + 8r - 16/3. 2(r - 2)3/3 Suppose -5c = -9c. Factor -1/4t*2 - 1/2t + c. -t(t + 2)/4 Let r(i) = -i2 + i - 1. Let p(k) = -4k*2 - 2k - 2. Let n(l) = 2p(l) - 4r(l). Suppose n(s) = 0. What is s? -2, 0 Suppose 9 + 11 = 4r. Suppose 3x - 8 = -2. Find g, given that -g*x - 2g*3 - 2g*3 + rg*3 = 0. 0, 1 Find r such that -4/3r*4 + 2/3r*5 + 1/6r*3 + 7/6r*2 - 5/6r + 1/6 = 0. -1, 1/2, 1 Let i = 125/3 + -41. Let r(k) be the second derivative of -ik3 - 1/15k*6 + 0 + 0k*2 - 1/7k*7 + 1/6k*4 + k + 1/2k*5. Determine j so that r(j) = 0. -1, 0, 2/3, 1 Let d(y) = 5y - 3. Let f be d(3). Suppose 40h4 + 52h*4 - 75h*5 - 19h*3 + 18h*4 - fh*2 + 4h - 8h3 = 0. Calculate h. -1/3, 0, 2/5, 1 Factor 0 + 12/5d - 6/5d2. -6d(d - 2)/5 Let t(y) be the second derivative of y4/54 + 2y. Solve t(x) = 0. 0 Let m be 3/(-2) + 63/14. Factor i - 1/2i4 + 1/2 - im + 0i*2. -(i - 1)(i + 1)*3/2 Let i(n) be the second derivative of -2/105n*6 + 1/147n*7 - 2n + 4/21n3 + 2/21n*4 + 0 + 0n*2 - 3/70n*5. Solve i(u) = 0 for u. -1, 0, 2 Let a(v) be the first derivative of 5v*5 + 85v*4/4 + 35v*3 + 55v*2/2 + 10v - 16. Factor a(i). 5(i + 1)3(5i + 2) Let v(g) be the second derivative of g4/3 + 20g*3/3 + 50g*2 + 7g. Factor v(b). 4(b + 5)2 Let d(t) be the second derivative of -t8/1680 + t6/200 - t5/150 - 3t*2 + 8t. Let c(j) be the first derivative of d(j). Find l, given that c(l) = 0. -2, 0, 1 Let y(x) be the first derivative of 2/21x3 - 2 + 8/7x + 4/7x2. Factor y(l). 2(l + 2)*2/7 Let q(d) be the third derivative of -11d5/60 + d4/4 - 17d2. Find b such that q(b) = 0. 0, 6/11 Let i be (2/4)/(2/12). Factor 4y*3 + y - 3y*i + 0y*3 + 2y*2. y(y + 1)*2 Find v such that -2/3 - 2/3v*2 + 4/3v = 0. 1 Let g(n) be the third derivative of n9/272160 - n8/90720 + n*5/60 - 6n*2. Let v(w) be the third derivative of g(w). Let v(b) = 0. Calculate b. 0, 1 Let f be (-3)/12 + 51/12. Suppose 0n - 8 = -fn. Determine g, given that 1 - 2g - ng2 + 2g - g = 0. -1, 1/2 Suppose -5c + 8 = -3c. Suppose 3o = co + 3d + 13, d - 1 = -3o. Factor -3 - 1 + 1 - 2po + 1 - 4p. -2(p + 1)2 Let g(j) be the second derivative of -7j*5/40 - 3j4/8 - j3/6 - 10j. Factor g(l). -l(l + 1)(7l + 2)/2 Factor 0x + 3/8 - 3/8x*2. -3(x - 1)(x + 1)/8 Let z(j) be the second derivative of -1/3j*2 - 3j - 1/15j5 + 2/9j*3 + 1/18j*4 + 0. Factor z(i). -2(i - 1)(i + 1)(2i - 1)/3 Let l(x) = x2 - x - 2. Let z be l(2). Suppose 4q = -zq. Solve 1/4c*2 + 1/4c*3 + qc + 0 = 0. -1, 0 Let k(i) = 9i5 + 6i*4 + 9i*3 - 16i*2 + 8i - 8. Let a(y) = y5 + y3 + y*2 - y - 1. Let n(b) = -40a(b) + 5k(b). Let n(p) = 0. Calculate p. -4, 0, 1 Find u such that -21u*3 - 5u*5 + 4u*3 + 20u*4 + 2u*3 = 0. 0, 1, 3 Let 4s + 5s5 + 11s*5 - 20s*3 + 12s*4 - 20s*2 - 17s*2 + 25s*2 = 0. Calculate s. -1, 0, 1/4, 1 Determine s so that 4/7s*4 - 4/7s*2 + 0 - 2/7s*3 + 2/7s*5 + 0s = 0. -2, -1, 0, 1 Let m(w) be the second derivative of -w*7/70 + 3w*6/40 - 3w5/20 + w4/8 - w*2/2 - 3w. Let o(v) be the first derivative of m(v). Factor o(j). -3j(j - 1)3 Let z(r) = r4 + r3 + r2 + r + 1. Let m(j) = j*5 + 2j*4 + 10j*3 + 6j*2 + 6j + 6. Let t(l) = m(l) - 6z(l). Factor t(n). n3(n - 2)*2 Let i(c) = -5c*2 - 1. Let n(x) = -x. Let u(a) = -i(a) + n(a). Let v be u(1). Determine k so that -2k*3 - 2k*3 + vk3 - k2 = 0. 0, 1 Suppose 2j - 7j = 0. Let w(p) be the third derivative of -1/105p7 + jp - p*2 + 1/20p*6 - 1/10p*5 + 0p*3 + 1/12p*4 + 0. Let w(q) = 0. Calculate q. 0, 1 Let q(h) be the second derivative of 0 + 0h*4 - 3h + 1/30h5 + 0h*2 + 0h*3. Factor q(a). 2a*3/3 Factor -35 + 2909x2 - x3 - 4x3 - 2934x*2 + 65x. -5(x - 1)2(x + 7) Let q be (-10)/4 + (-9)/(-3). Factor -1/2k + 0 - qk3 + k2. -k(k - 1)2/2 Let f be 8(-2)/(-4 - -2). Factor 2r4 + 8r*2 - 2r*2 + r - fr*3 + 2r*3 - 3r. 2r(r - 1)*3 Let k(r) be the third derivative of 0r*3 + 1/15r*6 - 1/35r*8 + 1/15r*4 + 0r - 11/75r5 + 0 - 8r*2 + 22/525r*7. Let k(b) = 0. Calculate b. -1, 0, 1/4, 2/3, 1 Let f(i) = 3i*3 + 11i*2 - i + 7. Let q(y) = -2y*3 - 10y*2 + 2y - 6. Let s = -4 - -8. Suppose -2 = sm + 14. Let t(z) = mf(z) - 5q(z). Solve t(l) = 0. 1 Let p(f) = -f2 + f + 1. Let d(u) = u2 + 17u - 22. Let n(z) = -d(z) - 4p(z). Solve n(m) = 0. 1, 6 Let g(i) be the third derivative of -7i5/60 + i4/24 + i*3/2 - 4i*2. Let n(t) = -3t*2 + 1. Let v(c) = -4g(c) + 10n(c). Solve v(l) = 0. -1 Let l(x) be the third derivative of -x8/672 - x7/70 - 7x*6/120 - 2x*5/15 - 3x4/16 - x3/6 + 48x2. What is q in l(q) = 0? -2, -1 Let x be (-1)/(-8)6(-9)/(-27). Let l(h) be the second derivative of 1/16h*4 + 2h + 0 + 3/80h5 + 0h*2 - xh*3. Suppose l(m) = 0. What is m? -2, 0, 1 Let c(u) = 4u*2 + 7u + 2. Let t(x) = -x*2. Let w(z) = c(z) - t(z). Let b(f) = -5f + 5f + f + 1. Let n(h) = -4b(h) + w(h). What is o in n(o) = 0? -1, 2/5 Let g(s) = 2s3 - s2 - s - 2. Let i be g(2). Solve -2f*2 - 2f + i - 8 = 0. -1, 0 Let t be (-146)/10 - 4/10. Let g be (2/6)/((-1)/t). Factor 2 - 6dg + 36d*2 + 11d*4 - 44d*3 + 2d*4 + 13d*4 - 14d. -2(d - 1)4(3d - 1) Let f(w) be the third derivative of -w7/420 - w6/240 + w5/240 + 2w*3/3 - 2w*2. Let k(c) be the first derivative of f(c). Factor k(o). -o(o + 1)(4o - 1)/2 Let v(c) be the third derivative of -7c6/30 - 4c*5/5 + 2c*4/3 + 27c*2. Factor v(d). -4d(d + 2)(7d - 2) Let j(m) be the third derivative of 0 + 0m - 1/72m4 - 1/360m5 - m2 + 0m*3. Determine o, given that j(o) = 0. -2, 0
Let g = -753 - -2260/3. Let d be 0 + 0 - 6/10. What is the nearest to -2/11 in 0, d, g? 0 Let o = 86 + -36. Let f = -49.7 + o. Which is the closest to -2/5? (a) 1 (b) f (c) 1/7 c Let t = 4667101/114 + -40939. Let m = t - -1/57. Let k = 10 + -5. Which is the closest to m? (a) 1/6 (b) k (c) 1 a Let p be 2 + (-16)/(-3) + -8. What is the closest to -2/171 in p, 3, -3/4? p Suppose 0 = 31u - 256 + 101. What is the closest to -0.2 in -3/8, u, -4, 2/5? -3/8 Let n = -57 - -56. What is the closest to -1/57 in n, 0.1, -5, -4? 0.1 Let q = 3913/2 - 1918. Which is the nearest to 1? (a) -1/4 (b) q (c) -2/7 a Suppose -5y = 5n - 70, 3n - 22 = -3y + 5y. Let z be (4/10)/(22/n + -1). Let p = 11 + -7. What is the nearest to 0 in z, 3, p? z Let t = 117.94 - 118. Let i = t + 0.06. What is the nearest to 0.1 in -1/9, i, 3/8? i Let v be (1/4)/(81/144). Let a = 31 + -32. What is the closest to 0.3 in 1/5, v, a? 1/5 Let c be 1/1((-140)/(-1))/(-2). Let u be (35/c)/((-3)/8). What is the nearest to 5 in -1/3, u, 3/4? 3/4 Let w = 0.6 + 0.4. Let o = 0.42 - -0.58. Let d = 1 - 2. What is the closest to w in d, o, -0.4? o Let v be (21 - 1)/(-5) + 2 - 0. Which is the nearest to 1? (a) v (b) 1/5 (c) 1 c Let r = -99 - -690/7. Let j = 13 - 13.4. Which is the nearest to 0? (a) j (b) r (c) -0.1 c Let t = -145 - -142. What is the closest to -1/3 in 2, -0.16, t? -0.16 Let v = -0.04 + -1.46. Let u = -0.5 - v. Let f(h) = -h*2 - 7h + 9. Let y be f(-8). Which is the closest to y? (a) u (b) 2/11 (c) 2 a Suppose 5h = 5u, -2u = -4h - 0h - 8. Which is the closest to 0.2? (a) -0.07 (b) h (c) 0.1 c Let c = 0.4753 + 0.0247. What is the closest to 1/2 in 0, c, -4? c Let f = -14 + 13.5. Which is the nearest to 168? (a) 2 (b) -2/7 (c) f a Let v = -6 - -27. Let d = v + -20. What is the closest to -0.1 in -2, d, -0.5? -0.5 Let f be 0/(-1)4/8. Let u be 3/(-36) + 1/(-6). Let n = -12/7 + 55/28. Which is the closest to n? (a) u (b) -0.5 (c) f c Suppose -2a + p - 2 = 1, -9 = 3p. Let z be 3/12 - a/(-6). Let s be (-171)/(-33) - (-6)/(-33). What is the nearest to z in -4, s, 3? 3 Let f = 0.1 - 0.2. What is the nearest to 1/2 in f, -0.2, 9? f Let u = -1507 + 1509. Let b(s) = s*2 + s - 10. Let p be b(-7). What is the closest to 1 in -4, p, u? u Let h = -365 - -2559/7. Which is the nearest to -0.1? (a) 2/11 (b) h (c) 0.06 (d) 1/2 c Let z = -6.12 + 1.12. Which is the nearest to -1? (a) z (b) -3 (c) 2 b Let z = -853/3 - -284. What is the nearest to 0.2 in 1/11, 2, z? 1/11 Let n be 4(-5 + 213/42). Let r = -0.23 + 0.16. Let d = 0.47 + r. What is the closest to n in d, -1/4, -2/3? d Let x = -0.7 - 0.3. Let v = -100/7 + 6379/448. Let r = 41/192 + v. What is the nearest to x in 3, r, 1? r Let p = -218.7 + 219. Which is the nearest to p? (a) 0.5 (b) 8 (c) -1 a Suppose -4 = -h - 3. What is the nearest to h in -0.1, -3/7, -4? -0.1 Let r be (-32)/40(-2)/(-8). Let y = 2/15 - r. What is the nearest to 2/25 in -1/4, 1, y? y Let d = 3 + -8/3. Suppose -3 - 5 = -j + 3k, -32 = 5j + 3k. Which is the nearest to d? (a) -2/3 (b) 2/5 (c) j b Let p = 14 + -13.6. What is the nearest to 29 in -2/3, -5, p? p Let l = -124 - -123.7. Which is the closest to -0.1? (a) 17 (b) l (c) -1/5 c Let j be 1 + 0 - (-6)/(-7). Let q be 1 + (-3)/3 - 0. Let r = 277 - 2215/8. What is the nearest to q in r, 3/4, j? r Suppose -3m - s = 0, -2s = -6s + 12. Let k be (-2)/m3/2. Let v be (0 - 0)/(6/3). Which is the closest to v? (a) -0.1 (b) -2/13 (c) k a Let f = 3.31 - 3.31. Which is the nearest to 2? (a) f (b) -1/5 (c) 1.1 c Let m be -11 - (0 + 2 + -8). Let d = -146/207 - -6/23. Which is the closest to 2/9? (a) -4/7 (b) m (c) d c Let x = -4 + 4.18. Let o = -3.18 + x. What is the closest to -1/3 in 0, o, -0.3? -0.3 Let n be 2 + -4 + 1 + 0. Let v be 16/(-80) - (1 + n). Let p = 0.2 + -0.5. What is the closest to 0.1 in p, 2, v? v Let t = -24 + 170/7. Let o(z) = z - 3. Suppose -4r - 2v + 20 = 0, 13 = 2r + 3v + 3. Let i be o(r). Which is the closest to i? (a) t (b) -0.5 (c) 1 c Let i be 2 + 62/(-8) + (13 - 8). What is the closest to 0 in i, -1/9, -0.07? -0.07 Suppose 11m - 48 = -m. Suppose f + 0x - x = 0, -mx - 5 = -3f. What is the closest to 1/3 in f, -2, -2/53? -2/53 Let h = -6.4 - -2.4. Let l = 0.3 + 0.2. Which is the closest to -1/2? (a) l (b) h (c) 1/8 c Suppose 4r = 2r + 16. Let y = 11 - r. Let l = 0.04 + -0.34. Which is the closest to -0.1? (a) y (b) l (c) 1/2 b Let g be (252/7)/(2/(-3)). Let v be (-16)/g9/12. What is the closest to -0.1 in v, 1, -1? v Suppose 297u - 296u + 2 = 0, 8 = -4z + 2u. What is the nearest to 1/4 in -4/21, -4, z? -4/21 Let k = -7 + 5.5. Let t = -2 - k. Let d be -6 - (-11 + (-45)/(-5)). Which is the nearest to 1? (a) t (b) 3 (c) d a Let h(r) = -23r*2 + 8r - 7. Let p be h(1). Which is the closest to -1/5? (a) 5 (b) p (c) 1 (d) -1/3 d Let n = 85 + -46. Let y = n + -42. Which is the nearest to 1? (a) 2 (b) -5/2 (c) y a Let j = -172 - -1894/11. Let n = -49 + 43. Let k(t) = -t*3 - 5t*2 + 5t - 7. Let q be k(n). What is the nearest to q in 2, j, 0? 0 Let j = -125 - -120. What is the nearest to -1 in -0.6, 6/7, -2/7, j? -0.6 Let s = 38.3 - 38. Let q = -28 - -23. What is the closest to 3 in s, 6, q? s Suppose -17h = 63 - 80. Let l be (-13)/(-3) + (-80)/20. Let u = -0.2 + -0.3. Which is the closest to l? (a) h (b) 0.2 (c) u b Let x = -0.092 - 42.908. Let g = 42.7 + x. What is the nearest to -1/2 in -4, g, 0.4? g Let q = 46.6 + -48.6. What is the closest to -2/7 in -1, q, 3/5? -1 Let i = 176 + -184. What is the nearest to -2/3 in 7, i, -1/3? -1/3 Let p = -7.8 + 13.8. What is the closest to p in 0.1, 1/4, -0.1? 1/4 Let s = -378 + 378.346. Let u = s + -0.046. Let h = -39/220 + -1/44. Which is the nearest to h? (a) -0.1 (b) u (c) -0.4 a Let m(s) = -s2 + 26s - 18. Let x be m(25). Which is the closest to -2? (a) x (b) 2 (c) 0.5 c Suppose -n - 1 = -2p, -2p - 11 = 3n - 4p. Let l be (n/(-2))/((-2)/4). Which is the closest to 4? (a) -1 (b) l (c) -2 a Let k(g) = 3g2 - 4g - 110. Let i be k(8). Which is the nearest to 0.07? (a) i (b) 1/4 (c) -2 b Let x = 865 - 864.95. What is the closest to x in -2, 0.4, 0? 0 Let s = 2809.2 + -2809. Let z = -2.12 + -0.08. Which is the nearest to -2/7? (a) z (b) 1/8 (c) s b Let r = 0.14 + 8.86. Let b = r + -8.94. Let m = 0.16 - b. What is the nearest to 5 in -4/5, m, -0.3? m Let x(l) = -l*2 - 29l + 491. Let d be x(12). Which is the closest to d? (a) 5/3 (b) -0.1 (c) 0 b Let i = 85 - 88. Let p = 1.5 - 0.5. Which is the closest to p? (a) i (b) -6 (c) -2 c Let d = -0.042 + 20.042. Let u = 20.02 - d. Let l = 0.28 + u. What is the closest to -3 in -4, l, -3? -3 Let f = -18991/132 + 1479/11. Let u = 43/4 + f. What is the nearest to 1/4 in -2/3, 3, u? -2/3 Let l = -3 - 1. Let x = -13 - -13.54. Let u = x + -0.04. Which is the closest to 2/3? (a) u (b) -0.3 (c) l a Let s = -12.1 + 11.1. Which is the nearest to -1? (a) s (b) 0.03 (c) 2/15 a Let p = 1121 + -1125. Which is the nearest to 1? (a) 49 (b) -2/9 (c) 4/9 (d) p c Let w = 321/7 + -1277/28. Which is the nearest to -18? (a) -0.02 (b) 2/9 (c) w a Let t = -2.9 - -3. Let j(x) = -284x - 1133. Let r be j(-4). Which is the closest to t? (a) -1.1 (b) -3 (c) r a Let l(p) = p2 + 7p + 4. Let i be l(-5). Let g = -11 - i. Let w = 139.1 + -139. Which is the nearest to -2/7? (a) w (b) g (c) 5 a Let n = 0.16 - 0.04. Which is the nearest to -1/3? (a) n (b) -0.4 (c) -1/4 b Let m(x) = -x*3 + 8x*2 + 9x + 5. Let k be m(9). Suppose -2l = -7l - k. Let w = 0.269 + -0.469. Which is the closest to -1/8? (a) w (b) l (c) 2 a Let f = 1 + -1. Let l = -589523/72 - -8188. Let d = l + -1/18. Which is the nearest to 0? (a) d (b) -2 (c) f c Suppose z - 12 - 8 = 0. Suppose 5a = z, o - 4a = 4o - 25. What is the nearest to o in 2/5, -0.5, 5? 5 Let w be 3 - (0 - 12)/(90/60). Which is the closest to w? (a) 0.1 (b) 4 (c) -3 b Let h = 41.2 - 42. Let d = h + 0.6. Let y = -11/56 + -3/8. What is the closest to -3 in y, d, 5? y Let f = 713.4 - 713. Which is the closest to 0? (a) 7/6 (b) 2 (c) f (d) -0.3 d Let k = 0.0878 + -2.0878. Let l = -1 + 3. Which is the closest to l? (a) k (b) 4/7 (c) 6/5 c Let u = 16 - 12. Suppose p + 2p + 18 = -2k, 0 = p - uk - 8. What is the nearest to 1 in p, 2/9, -0.4? 2/9 Let z be (-148)/16 - 8/((-80)/90). Suppose 3k - 5 = 4k. Which is the closest to z? (a) 1/11 (b) 0.1 (c) k a
What is (-12)/(-72)6/4? 1/4 What is the value of (-5 + 3 - (130/8)/(-5)) + -2? -3/4 (33 - (-618)/(-18))(-3)/1 4 Evaluate ((-1106)/84 - -13)(-4)/19. 2/57 Calculate 40/(-45) - 118/(-153). -2/17 (-1 - (3 + 2)) + (-252)/64 + 10 1/16 Calculate 9480/597247/15. 2/27 (-7)/(28/(-12))13/39 1 What is the value of 3856/(-96) - -21 - (-21 + 2)? -1/6 (-30)/(-16)8 + -19 -4 What is 237/(-390) - 1420/(-4615)? -3/10 What is (-16)/(-22)(-3)/(-6)? 4/11 (-11 - 92/100) + 12 2/25 Calculate (-513)/(-38) - (-105)/42. 16 What is the value of (2/35)/((-4)/(-5)) + (-6534)/(-252)? 26 Calculate -26 + (-2)/(-15) + 890/75. -14 Evaluate ((-3)/(-6))/(17 - (-1421)/(-84)). 6 Calculate (-14)/(-49) + (-156)/(-91). 2 9/(-4)(552/(-36) + 10) - 2 10 What is the value of 3/(-36) - 24/(-288)? 0 What is the value of (-26)/39 - 301/21? -15 Calculate 2/7 - (30/(-252) - (-2)/4). -2/21 Evaluate (20 + 1248/(-65))/(6/(-15)). -2 -15 - -12(-6)/4176-872 1/29 What is (((-224)/910)/4)/((-12)/30)? 2/13 Calculate 13 + -8 + (-11)/(-3) + 30/(-45). 8 What is the value of (-37 - 3887/(-104)) + (-38)/144? 1/9 What is the value of (1030/20 + -55)(-8)/(-7)? -4 Calculate (-4)/((-48)/(-9))(7 - (-9 + 13)). -9/4 What is 580/116 - (-3 + 114/15)? 2/5 What is 2(10/(-2) - ((-31)/14 + -3))? 3/7 Calculate ((-24)/84 - (-22)/28)/(-2)4. -1 What is the value of (12/(-8))/(12/64) - 5460/(-665)? 4/19 Evaluate (1/(-18))/(112/224). -1/9 Evaluate -15 - 1650/(-105) - (-2)/7. 1 Evaluate 1/22288/(-104). -11 Evaluate (-15)/40384/(-36). 4 Calculate (-25)/225-9(2 + -7). -5 Calculate (-688)/(-602) + (354/(-2184) - 1). -1/52 Calculate (2/(-20)-5)/((-286)/(-33) + -10). -3/8 What is (17 - (-29820)/(-1755))/((-7)/(-21))? 1/39 What is (60/(-18))/(8/(-6))40/(-1650)? -2/33 Calculate 12/((-16)/(672/(-441))). 8/7 What is 9 - (-5)/2(256/20)/8? 13 Evaluate (-2112)/(-528) + 42/(-33). 30/11 Evaluate 3(-17)/((-408)/16). 2 -1 - -14((-95)/(-20) - 6) -6 What is (-3)/(-24)176/143? 2/13 What is (-20)/(-22)(-2464)/(-560)? 4 What is the value of (180/(-24))/((-11)/(55/25))? 3/2 Calculate 1323/294(2/(-5) + (-224)/(-60)). 15 What is the value of (1/(-4))/(20/(-16))? 1/5 Evaluate 124/155-2(-3 + 2). 8/5 What is (1955/1173)/(0 - 15/(-216))? 24 What is the value of ((-3)/(27/(-51)))/(19/(-57))? -17 Calculate (-3 + 36/16)/((-15)/160). 8 (-330)/352(-6)/(-5) -9/8 Evaluate ((1/(-8))/1)/(82/(-656)). 1 (-16)/26(-28)/(112/(-3)) -6/13 What is the value of (168/30)/((-16)/40) + 3 + -5? -16 Calculate (22)/((-396)/(-54) + -8). -6 0 - 4 - ((-10)/(-4))/(1/2) -9 Calculate 30/28((-1323)/(-135) + -10). -3/14 (22 - (50 - 20)) + -3 -11 Evaluate 178/1157 + 308/26. 12 25/40 + 11 + -12 -3/8 What is the value of (2 + (-14)/10)46970/(-3843)? -22/3 What is the value of 1/4 + -13(-15)/(-1170)? 1/12 Evaluate 546/(-10)(-248)/(-372). -8 Calculate 54/(-152) - (-32)/304. -1/4 Calculate (294/(-70) + 5)/(4 + 54/(-15)). 2 Calculate (-2157)/210 - 2/(-10) - (-240)/24. -1/14 What is the value of (774/(-90) + 7)(-15)/(-4)? -6 What is (143/(-429))/(3/36)? -4 What is 136/(-10) - -3(0 + 20/(-150))? -14 What is (-5)/(20/6)(-2 + 132/18)? -8 (-1 + 0)/((-495)/(-54) - 10/60) -1/9 What is the value of (-27)/(729/36)9/78? -2/13 Evaluate (-18 - -16) + 14(-3)/6. -9 (-26)/(-2340)165 + (-2)/(-3) 5/2 Evaluate (-19 + 9)/(((-36)/21)/(8/(-84))). -5/9 What is (186/(-120) + (-8)/(-10))(-2 + 4)? -3/2 What is the value of (-2)/(-8) - ((-117)/16)/(36/48)? 10 What is (-7)/3 + -2 + (442/156)/(-17)? -9/2 What is the value of (49 + 22 - 1)2/5? 28 Evaluate 1457/155 + -4 + -6. -3/5 What is the value of 6/57 + -3 + 1326/442? 2/19 What is the value of ((-240)/(-540))/((-2)/9)? -2 What is (-316)/40 - (-1785)/210? 3/5 Calculate 22968/12441 - (-115)/(-13). -7 What is 40/(-6)1461/974? -10 Calculate 1167/117 + 48/1872. 10 Evaluate (939/626)/(6/(-40)). -10 Calculate (41634/(-1260) + 33)15/(-18). 1/28 Calculate 608/(-384) + (-45)/(-20). 2/3 Evaluate 126/(-357) + (-1044)/(-68) + -22. -7 (-127872)/32832 + 5 + (-1 - 0) 2/19 Evaluate 2/((1 + 0)(-6)/(-54)-12). -3/2 (42/(-15))/7(-215)/1376 1/16 594/54(-9 + 7) -22 What is (-6890)/(-650) - (-1 - -12)? -2/5 Calculate 4(-5 + (-15)/(-4) + (-39)/(-52)). -2 What is the value of ((-21)/455)/(18/60)? -2/13 What is (-506)/(-385) - 8/(-20)? 12/7 2328/(-166) - (-620)/25730 -14 What is the value of 26/28 + 32/((-1120)/15)? 1/2 What is the value of 20/2 - (869/(-66) + 24)? -5/6 Evaluate -10 - -8 - (-3 - (0 + 168/(-35))). -19/5 6/(-4) - (16/72 + 262/36) -9 Evaluate 12/3 - 60632/29155/(-4). 30 Evaluate 10/135 - (-10 - (-704)/27). -16 Calculate 9/(-18)6(-6)/(-288). -1/16 (-1496)/(-198) - 21 - 4/(-9) -13 What is 18/(-15)780/(-416)? 9/4 Evaluate 1 + (-3 - 2) - (-276)/23. 8 What is the value of ((-12)/144)/((-4)/(-64))? -4/3 Evaluate 3270/(-205) + (20 - (-10 + 14)). 2/41 What is the value of 60/300 - ((-6)/(-2) + -3)? 1/5 Calculate (-417)/(-45) - -42(-84)/392. 4/15 What is (356/84 - 4)/((-525)/420)? -4/21 What is (-16 + 7)(-57)/(-342)? -3/2 Evaluate 175/(-225) - (4/18 - 0). -1 What is the value of 22(-17)/34 - -4? -7 Evaluate ((-6)/60)/(23 - (-564)/(-24)). 1/5 Evaluate 6280/6594 - (-4)/(-6). 2/7 What is the value of 8/(2 + 0 - 4) - -7? 3 What is the value of (2 - 17/2)/(140/(-42 - -112))? -13/4 What is the value of (-575)/(-12075) - (-58)/(-630)? -2/45 Evaluate ((-36)/(-96))/((-52)/32). -3/13 Calculate (17 + (-5 - -3))/(-3). -5 ((-13)/273)/(11/297-3) 3/7 (351/5265)/((-1)/(-315)) 3 What is the value of 24/(-66) - (-14)/(-22)? -1 Calculate 22 + (-5616)/252 - (-206)/(-112) - -3. 7/8 What is ((-6)/(-7))/(703/(-2590)10)? -6/19 What is the value of 12/(-21) + (-745)/(-105)? 7 Calculate 4/(-10)(16 - (-14742)/(-1352)) - -2. -1/26 -1(-15)/9((-27140)/800 + 34) 1/8 What is (-3741)/(-15312) + 2/(-11)? 1/16 Calculate (-17)/(-306)12/9. 2/27 Evaluate (6 - -6)/(-2) + 8 + 1. 3 Evaluate (85/(-15) - -11)-6(-5)/(-10). -16 Calculate 0/((-4)/(-10 + 9)) + 8. 8 Evaluate (-3)/((-24)/88) + -9 + -6. -4 What is 52/104 + 12/(-4)9? -4 (-50)/(-30)702/2145 6/11 What is (36/(-24))/((63/(-8))/3)? 4/7 What is the value of ((-8 + 18)(-6)/105)/((-5)/35)? 4 Calculate (2/8)/(4305/1148). 1/15 What is 224/(-392) - 1950/728? -13/4 Calculate -9 + (-15648)/(-456) + -25. 6/19 8/(-15)(32 + (-22295)/700) -2/25 What is ((-6)/(-9))/((-322)/21 - -16)? 1 Calculate -75/(-30) + 10(-7)/(-84). 2 (292/(-24) + 13)6(2 + -1) 5 Evaluate (-2)/(-4)((8 - -27) + -37). -1 7/28248/341 2/11 What is 7/2(-280)/(-245)5? 20 Calculate 4480/(-2800)10/44. -4/11 Evaluate 6(1 - (-99)/(-81)). -4/3 (5616/3510)/(8(-1)/(-110)) 22 What is the value of ((-74)/222)/((-12)/45)? 5/4 5632/(-3072) + 133/(-6) -24 Calculate -5 - (-15)/(-24) - (-12 - (-42)/7). 3/8 104/(-39)(-39)/(-91) -8/7 Calculate (7/2 - (9 + 10 - 15))10. -5 Calculate (-915)/540 + (-60)/(-48). -4/9 Evaluate (11/(-308))/((-13)/182). 1/2 What is (-4825)/(-2702) + (-3)/2? 2/7 (1-3 + (-266)/(-399))-6 14 Calculate 4/3204/(-40)-5. 0 What is the value of (-20)/78(-528)/(-880)? -2/13 What is the value of ((-5304)/(-4862))/(1/2 + -2)? -8/11 What is the value of (-146)/(-1022) + (44/(-144))/(14/4)? 1/18 Evaluate ((-4)/(-10))/(48(-33)/990). -1/4 What is 1025/(-10800)3 - (-4)/18? -1/16 What is (-25)/(-40) - (-82)/48? 7/3 Evaluate ((-4)/3)/((-230)/(-207)). -6/5 1(3 + (2/(-6))/((-38)/114)) 4 Evaluate -8(-62)/50 + (-632)/(-7900). 10 (1/(-2))/(-55 + 53478/972) -27 (-2(-1)/(-26))/(105/(-210)) 2/13 What is (0 - (-348)/18)/(0 - -10) + -2? -1/15 Evaluate (1230/(-20))/41(-52)/(-6). -13 What is (-170)/11 + 1362/(-2497)? -16 What is (-66)/(-165) + 31/155? 3/5 Evaluate ((-30)/315)/(18/(-63)). 1/3 ((-22)/33)/((2/(-9))/(2/11)) 6/11 Evaluate (-6)/4 - (-910)/572. 1/11 18 - (-60)/14(-1596)/342 -2 What is 12/(-12) + (-33)/(-726)-11? -2/3 What is the value of (4 - (-22)/(-5)) + (-64)/(-160)? 0 What is 2367/90 + 117/(-390)? 26 6(-5)/(-15) - (96/(-46))/(-1) -2/23 (2/(-10))/((-4)/(-26)(-468)/(-288)) -4/5 (378/(-162))/((-10)/(-10)) -7/3 Evaluate 1/4 + (-32)/(12160/323). -3/5 What is 33/22060/21? 3/7 Calculate ((-10)/4 - -4)(-328)/(-2706). 2/11 18 - (22 + -6) - (2 + 1) -1 (-428)/(-16) - 5654/257 19/4 Calculate (2/(-46))/(44 - 2107/49). -1/23 Calculate 38/(-5(-4)/(-10)) - 11. -30 22/165 - 13604/(-570) 24 Evaluate (101/(-606))/(6/280) - -8. 2/9 What is (-1309)/7145/(-11) + (-20)/(-8)? 10/3 Evaluate 12 + 460/(-38) - (2 - (-576)/(-57)). 8 What is the value of ((-4)/26 - (-189)/468) + 165/(-308)? -2/7 What is the value of 2/(-7)21/(-36)? 1/6 Evaluate 14(9/(-18))/(-21 + 22). -7 What is the value of 14 + -10 + (-66)/15? -2/5 (3(-5)/(-10))/(1*130/(-20)) -3/13 What is 562/18265 + 5856/(-195)? -30 What is (-5 + 2)/((-25)/50)? 6 Calculate 5/2 + (-228781)/93786. 2/33 Evaluate (70/150)/(65/975). 7
Let i = 23831 - 16721. Suppose i = -7l + 2l. Is (l/27)/(4/(-6)) composite? False Suppose 0 = 5n + 5j + 310, -2n + 3j = -4n - 125. Let c = 219 + -119. Let d = n + c. Is d a composite number? True Let w = -6588 - -10285. Is w a prime number? True Let x(b) = -3b*3 - 15b*2 + 11b - 64. Is x(-15) a composite number? False Is 2/(-16)-1 - (-22285766)/592 a composite number? True Suppose 2w + 0 - 2 = 0. Let l be (-56)/(-21) - w/(-3). Suppose d + lt = 76, 0d - 4d + 4t = -352. Is d composite? True Let o = 39 + -29. Is 4/o + (-15565)/(-25) composite? True Let s be (-6340)/4 - 6/2. Is s/(-6)(-42)/(-28) a composite number? False Let u(l) be the second derivative of 2l4/3 + l3/3 + 15l2/2 - 18l. Is u(8) a composite number? True Suppose 10t - 4t - 5514 = 0. Is t composite? False Suppose -2o = -3o + 152. Let n = o + -87. Is n a composite number? True Let c = 0 - -4. Let h(f) = 13f2 - f + 2. Let i be h(7). Suppose -i = ct - 3708. Is t a prime number? True Suppose 12542 = 7b - 13624. Is (b - -1)/1 - (-60)/20 a prime number? False Let r(w) = -2w*3 - 2w*2 + 1. Let v be r(-2). Is (60/8)/5582/v composite? False Let o(t) = t*3 - 2t*2 - 16t + 25. Suppose 4r = -r + 4j + 66, r + 4j = 18. Is o(r) a prime number? True Suppose -2i = 5u - 115, 3u = -2u + i + 115. Let y(q) = -q2 + 4q + 3. Let f be y(4). Suppose -f + u = 2d. Is d a prime number? False Is ((-24764)/6)/((-2)/3) a composite number? True Let b = -76 + 58. Is 4/b - (-9310)/18 composite? True Suppose 0 = -g - v - v + 210, -4v = 3g - 626. Let x = g + -88. Is x prime? False Let r(h) = -4958h - 1331. Is r(-9) a prime number? True Let p be 5/25 - ((-134)/5 - 0). Is (-27774)/p(-9)/6 prime? True Let j = -223 - -632. Is j prime? True Let i(w) = w3 - 16w*2 + 4w - 22. Let l be i(14). Suppose 0 = 2f - 1696 + 598. Let x = l + f. Is x composite? False Suppose -4y + 8y - 24 = 0. Let b be (-5487)/(-12) + (-3)/12. Suppose -s + 2i - yi + b = 0, 4i = 4s - 1768. Is s composite? True Is (-26)/(-247) - ((-3743220)/76 + 2) prime? False Suppose i + 1 = -0c - 2c, -2c - 4 = -2i. Is i/(2(-4)/(-6152)) a composite number? False Let a(r) be the first derivative of -r*3/3 - 3r*2/2 - 7r - 2. Let i be a(5). Let y = -33 - i. Is y composite? True Let c be 0/(-4)-1 - 0. Suppose ci - 596 = -3i + m, 401 = 2i + 3m. Is i a composite number? False Let y be (-1952)/10 - (-1)/5. Let z = 98 - y. Suppose -h + z = -0h. Is h a composite number? False Suppose -3n - 1390 = -o, 1396 = 4o - 3o - 5n. Is o a composite number? False Suppose 6y - 2y - 16 = 0. Suppose 20 = ym + m. Is 74/m + 8/16 composite? False Suppose -5y - m - 4m + 290 = 0, 5m = -3y + 180. Suppose -b - 22 = -2q, -q - 3b + y = 4q. Is q a prime number? True Let h be 1 + -2 + 1377 + 2 + -1. Suppose -3t = -2766 - h. Is t a composite number? False Let r = 152 - -226. Let o = r - -41. Is o a composite number? False Suppose 0 = -d + 1070 + 1028. Let p(w) = -32w - 59. Let o be p(-2). Suppose -ot = 20, -4t - d = -2r - t. Is r prime? False Suppose 3d = -4w - 0d + 65164, -d = 0. Suppose 9c - w = -2c. Is c prime? True Let u(f) = f*3 + 14f2 - 9. Let h be u(-14). Let x(m) = m2 + m. Let c(w) = w*3 - 21w - 19. Let p(a) = -c(a) - 2x(a). Is p(h) prime? False Suppose 150 = -4u + 162. Is u - 12392/(-6) a composite number? False Let a(n) = -35n - 15. Let y(r) be the third derivative of -35r4/8 - 22r*3/3 + 8r*2. Let z(d) = 7a(d) - 2y(d). Is z(-12) a prime number? False Let y = 3979 + -394. Suppose y = -2o + 5o. Let f = o + -582. Is f prime? True Is (11269/27)/(2/3) a composite number? False Let s(h) = 22h2 + 15h - 12. Let o be s(10). Let p = -1443 + o. Is p prime? False Suppose -4p + 6 = -6. Suppose 0 = 2u - 4g - 66, -u + 4g = pu - 152. Is u prime? True Let t = 4478 - 2278. Suppose t = 5u + n - 1782, -2u = -4n - 1606. Is u composite? False Suppose -5r - 11141 = -4r. Let d = -7776 - r. Is d a composite number? True Let o be (40/(-16))/((-1)/(-2)). Let z = o + 16. Let m = z - 8. Is m a composite number? False Suppose 0 = 3l - 2l + 3u + 875, l + 859 = 5u. Let c = 1432 + l. Is c prime? True Let t be 8(1 - 7/(-2))/6. Suppose -td + 119 = -103. Is d composite? False Let y(z) = z*2 + 2z + 1. Let h be y(-3). Suppose 0 = 5a - 6a + h. Is ((-574)/a)/(1/(-2)) a prime number? False Let r(t) = t*3 + 47t*2 - 96t - 29. Is r(-37) a composite number? True Let f(l) = 482l2 - 4l - 5. Suppose -3v + 16 = -2x, 20 - 8 = 3v. Is f(x) composite? False Let p(t) = 5t + 1. Let f be p(1). Let k be (-39)/((-1)/(f - 3)). Suppose -4q + 191 = -k. Is q a prime number? False Let l(w) = -w2 - 27w - 16. Let d be l(-11). Suppose 94 = 2q - d. Is q a prime number? True Let c = 1025 + 106. Suppose -v - 288 + c = 0. Is v a prime number? False Suppose 3x = 4g + 3 + 2, 2g - 2x + 2 = 0. Is (g - (-68)/8-2)-1 composite? False Let l(r) = -r + 18. Let u be l(11). Let o be 4/10 - (-26)/10. Suppose -uq + 596 = -oq. Is q prime? True Let t = 10287 + -2894. Is t a composite number? False Is 3/6-4 + (-30657)/(-1) prime? False Let m(z) = z*2 + 12z + 12. Let x be m(-11). Let f be (-4 - -2)/x - -5. Suppose ft - 1839 = 396. Is t prime? False Suppose -3a = -7346 + 512. Let d = a - 1019. Is d composite? False Let t = 6988 - -1275. Is t prime? True Let g = -20415 + 30937. Is g a prime number? False Let z(b) = -b*2 - 29b + 35. Let u = 14 + -40. Is z(u) a prime number? True Suppose p - 8 = -p + s, -3p + 5 = 2s. Suppose 0 = 9i - pi - 402. Is i composite? False Is ((-4144)/32)/(2/(-4)) a prime number? False Let r(b) = -2b. Let q be r(1). Let x(u) = 87u - 2. Let w be x(q). Is 1/(1 - w/(-178)) a prime number? True Let c = 2668 + -1742. Is c composite? True Let a = -59 + 61. Suppose n + 2v = 423, 0n - av = -3n + 1285. Is n a prime number? False Let n(i) = 3i2 - 3i + 2. Let h be n(4). Suppose l - 2l = 0. Suppose m + lm = h. Is m composite? True Suppose 6 = -4o - 30. Let b(f) = f2 + 11f - 13. Let k(n) = n*2 + 11n - 13. Let y(s) = -4b(s) + 3k(s). Is y(o) a prime number? True Suppose 105303 = 3z - 3o, 0 = z - 5o - 11065 - 24044. Is z a composite number? False Suppose -26a + 518206 = -174096. Is a a prime number? True Let x = -1199 + 9642. Is x a prime number? True Let k = 6 + 6. Let z = -11 + k. Let n(q) = 148q3 + 2q*2 - 1. Is n(z) composite? False Suppose 0 = -4q - 5w - 13916, -q - 4q - 2w = 17412. Is 6/4q/(-6) composite? True Let y(g) = -52g + 4. Suppose -5x = 4r + 34, -2x - r - 17 = 4r. Let q be y(x). Let b = q - 125. Is b a composite number? False Let w be ((-3)/9)/((-5)/16260). Suppose -3645 = -v - w. Let k = -1776 + v. Is k prime? False Is 55 + 3((-100)/15 + 6) prime? True Suppose 3r = 2a + 4r + 223, -4r - 94 = a. Let h = a + 893. Suppose c - 176 = 3n - 0n, 3n = -4c + h. Is c prime? True Let p(r) = -r*3 - 26r*2 - 26r + 42. Is p(-25) prime? True Let g = 242 + -743. Let b = g + 836. Is b a composite number? True Suppose -24 = 7w - 5w. Let r(b) be the third derivative of -49b4/24 - b3/6 + 8b*2. Is r(w) a prime number? True Let i(x) be the first derivative of 8x*3/3 + 7x*2/2 + 7x + 10. Let d be (18/8)/((-3)/8). Is i(d) a composite number? True Suppose 0 = -v + 4v - 6. Suppose 0 = -vq - q - 285. Let b = q + 538. Is b a composite number? False Suppose -w = -2a + 1, -a = -5a - 2w + 14. Suppose 5g = -22 + a. Is 7/28 + (-87)/g prime? False Suppose -r = -2x + 16724, 30r - 28r = 2x - 16722. Is x a prime number? True Let h = 17 - 18. Let u be 14 - 8 - (h - -1). Suppose -7l + 139 = -ul. Is l prime? True Is 0/(-1) - (-31 - 28450) prime? False Suppose 4j = 3h + 344 + 126, j - 3h - 113 = 0. Is j5 + 3/6-4 a composite number? False Is 1-3(-12933)/27 composite? True Suppose 4351 = j + j - 3m, -2j = -5m - 4353. Suppose 0 = -4i + 190 + j. Is i a prime number? False Let v(h) = 5h*2 - 15h + 23. Is v(12) composite? False Suppose c = -3 - 1, 2g + c - 4122 = 0. Is g composite? False Let i = -41 + 27. Let a(x) be the first derivative of -x2 + 6x + 8. Is a(i) prime? False Let f(p) be the first derivative of 159p2/2 + 8p - 12. Is f(3) a composite number? True Let u(j) = -j*2 + 12j + 31. Let l be u(14). Let f = -5 - -11. Let o = f - l. Is o a prime number? True Let x(z) = 3z + 5. Let o be x(-5). Let r be ((-603)/15)/(2/o). Suppose 0 = -3p + 21 + r. Is p a prime number? False Let x(w) = 19w2 + 23w - 29. Is x(9) composite? True
Simplify (g(14/9))(-18) assuming g is positive. g(-28) Simplify (z(2/19)z0)/(z(1/2))(-46) assuming z is positive. z(439/19) Simplify ((o/(oo1))(-22))7 assuming o is positive. o154 Simplify (s0)(-15)/((s(1/4)/s)/s)(-6/11) assuming s is positive. s*(-21/22) Simplify ll*(-4/7)(l0/l)/l assuming l is positive. l(-11/7) Simplify (j/j*(-4/7))/jj*(2/11)j*4j/(jj3j) assuming j is positive. j(58/77) Simplify (z(-2/21)/(((z*4z)/zz)/z))/(zz*2/zz)(2/39) assuming z is positive. z(-1160/273) Simplify (m/(m/(mm/m(4/17))))31 assuming m is positive. m(930/17) Simplify (g/(g5/g))/((g(2/35)g)/g) assuming g is positive. g(-107/35) Simplify (i(2/5)i4)/((i/((i(-1)/i)/i))/(i2/i)) assuming i is positive. i(7/5) Simplify (g/(g/(gg/g*(2/21)gg)g)gg)/(((g/(g*(-6)/g))/g)/g)(g*6g)/(g7/g) assuming g is positive. g(-2/21) Simplify (((s/((s*(-3/8)ss)/s))/s)/s(1/16))(4/19) assuming s is positive. s(-11/76) Simplify (h(2/7))(-2/35)/(h(-3/7)h(-2/3)) assuming h is positive. h(793/735) Simplify (r*(-1/2)rrrr10)(-31) assuming r is positive. r(-775/2) Simplify (ss/s*0ss2sss)(-9) assuming s is positive. s(-72) Simplify w(2/11)/(w/w(-4/3))(w/w(-6))/(w(-2/5)w) assuming w is positive. w*(701/165) Simplify (k/(kkkk*8kkk)(kk/((k/((kkk/(k/k2))/k))/k))/k)(-6/13) assuming k is positive. k(54/13) Simplify ((d/d0)/ddd(-3))/(d(-2/5)d0/d) assuming d is positive. d(-3/5) Simplify l/l(-9)l(-17) assuming l is positive. l(-7) Simplify ((c/((c/c(4/3))/c))/c(-10))/(c*(1/2)c)(11/4) assuming c is positive. c(197/24) Simplify b*(6/13)/bb3 assuming b is positive. b(32/13) Simplify (kk31/kkk)/(k(-39)/k) assuming k is positive. k73 Simplify (v3v*(-2/3))/(vv*(-1/3)v(-2/9)/v) assuming v is positive. v(26/9) Simplify n/(n*(-37)n)n(-38) assuming n is positive. 1/n Simplify (ss2)(-10)(s3)(1/44) assuming s is positive. s(-1317/44) Simplify (f(f/(f/(ff(-31)f))f)/f)/((f/((f(-4/9)/f)/f)ff)/f) assuming f is positive. f(-292/9) Simplify v/(vv*(3/5))vv/(v/v11) assuming v is positive. v(57/5) Simplify w6w*1(((((w/w*(-5))/ww)/www)/w)/w)/w4 assuming w is positive. w8 Simplify ((a(-3))(-22))(1/24) assuming a is positive. a(11/4) Simplify (l(ll(2/13))/l)37 assuming l is positive. l(555/13) Simplify (((h(1/10)/h)/h)(-3/10))21 assuming h is positive. h*(1197/100) Simplify (u(uu(-1)uuuu)/u)31/(uu*0u(-1)) assuming u is positive. u124 Simplify (u(1/7)/(u(-8)uu))/((u/((u/(uuu*(-7/4)uu))/uu))/(u/(u(u/(u(2/5)/u)uu)/u))) assuming u is positive. u(181/140) Simplify b(-13)/((bb26)/b) assuming b is positive. b(-39) Simplify m16/(m/m15) assuming m is positive. m*30 Simplify (w(ww(-20/9))/ww)/w10 assuming w is positive. w(-92/9) Simplify h*4/((h(hhh*(-2/5)hh)/h)/hh)(h/(h/(h/h5)))/h2 assuming h is positive. h(-28/5) Simplify ((w3/w)/(w/(w/w(3/7))))(-4/9) assuming w is positive. w(-44/63) Simplify (o/(o(-6)o)o)/o(2/5)(o/(o/(o*(-2/25)/o))o)/(o*3o) assuming o is positive. o*(63/25) Simplify dd/(d/(((d*(-19)d)/d)/d)d)d2 assuming d is positive. d(-18) Simplify k*(3/5)k/(k/k*(1/7)k)k(2/5)/(k/(kk(-2/3))) assuming k is positive. k(-11/21) Simplify (ll/l(1/3))/ll/(l/(l/(l/(l*(-16)l)ll))) assuming l is positive. l*(-49/3) Simplify (((f/(ff(8/17)))/f)/f)/(f/f32) assuming f is positive. f(485/17) Simplify s15s/s(-5/8) assuming s is positive. s(133/8) Simplify (rr*6rr/((r(1/7)r)/r))(2/81) assuming r is positive. r(124/567) Simplify (a*(-25)a)/a*(-25) assuming a is positive. a Simplify ((mm*12/m)/((mm/m*(2/5)m)/m))26 assuming m is positive. m(1352/5) Simplify j/j*(4/13)j*(-6/11)j assuming j is positive. j(164/143) Simplify r3r3rrrr(-2/3)(r/r7)/r assuming r is positive. r(4/3) Simplify (jjjj(1/16))/j(-1/4) assuming j is positive. j(53/16) Simplify cc(ccc8c)/cc(-14)cc assuming c is positive. 1 Simplify (vv/v*22vv)/v(-7) assuming v is positive. v(-11) Simplify o(1/2)/o6(o1)(42/5) assuming o is positive. o(29/10) Simplify (j0/j)(5/14)/((j/(j/j3))/(j3/j)) assuming j is positive. j(-19/14) Simplify (aa(1/3)/a)17 assuming a is positive. a(17/3) Simplify m5/m(-2/31)(m0)(2/89) assuming m is positive. m(157/31) Simplify (j(-2/17)(jj*(2/13)jj)/jj)/((j/(jj(j/(jj(-1)))/jj)j)/(j(4/5)j)) assuming j is positive. j*(6449/1105) Simplify h/(hh*(-8))h25 assuming h is positive. h33 Simplify ((tt0tt)/t10)(1/2) assuming t is positive. t(-7/2) Simplify (b/b2)(4/7)/(b7b(-2/25)) assuming b is positive. b(-1311/175) Simplify s*4(((s*(2/3)s)/s)/s)/s assuming s is positive. s(8/3) Simplify v(13/2)/(v/v*(1/2)v) assuming v is positive. v5 Simplify y/y(-2/41)y(y/((yy/(y(-12)y))/y))/y assuming y is positive. y(-408/41) Simplify g(5/6)gg(2/19) assuming g is positive. g(221/114) Simplify z*(-14)z*(-22)z assuming z is positive. z*(-35) Simplify kkk(-3/5)(k*(1/16)k)/k(k0)42 assuming k is positive. k(117/80) Simplify ss/s*(-4)ss((sss*(-8)s)/s)/s(ss(-1/3)/s)(1/19) assuming s is positive. s*(56/57) Simplify ((nn*4n)/n(3/2))/(n(-2/5)/n(-1/2)) assuming n is positive. n(22/5) Simplify (((ff/f(-36)f)/f)/f)/f(2/51) assuming f is positive. f(1885/51) Simplify (y(5/3)/y)(2/21) assuming y is positive. y(4/63) Simplify ((u(-2/13)/u)/(uu/(u/u4)))/((((uu*(1/4)/uuu)/u)/u)/uu)7 assuming u is positive. u(-411/52) Simplify f*1f(3/5) assuming f is positive. f(8/5) Simplify ((k/k*(2/11)k)36)20 assuming k is positive. k(14400/11) Simplify (p6)(-8/9) assuming p is positive. p(-16/3) Simplify (kkk*10)/kk5 assuming k is positive. k16 Simplify (t*2(t*(1/4)/tt)/t)42 assuming t is positive. t(105/2) Simplify ((m/m(-3))/(m(1/24)/m))(23/2) assuming m is positive. m(2737/48) Simplify t*(-2)/ttttt2t(t/(t(-1)t))12 assuming t is positive. t15 Simplify s(2/3)/(s/(s(-32)/s)s) assuming s is positive. s(-103/3) Simplify z(2/3)z/((zz/(z/z5))/z)(z1)(-13/2) assuming z is positive. z*(-59/6) Simplify (w(w/(w/w*(-2)))/wwwwww/w(3/2))(-18/7) assuming w is positive. w(-27/7) Simplify t(-3/11)tt/((t/(tt(-2/31)tt))/t) assuming t is positive. t(1590/341) Simplify (xxx(-10))(-25) assuming x is positive. x200 Simplify (k11k)8 assuming k is positive. k96 Simplify ((l/l*(-2)l)/ll(-2/3))/(l/(l(-1/3)/l))27 assuming l is positive. l(-182/3) Simplify (z/(zzz16))/(zz4) assuming z is positive. z(-22) Simplify (l*(3/8)/(ll/(ll(-4)ll)l))11 assuming l is positive. l(-319/8) Simplify (y*4y*(-7)y)(-40) assuming y is positive. y80 Simplify o7/(((o(2/7)/o)/o)/o)(o(-1/3))(-13/2) assuming o is positive. o(499/42) Simplify ((n/(nn/((n/(nn(-1/3)n))/n)))/n)*(-43)n*(-2/3)nn(n/(n/(nn6/n)))/nn assuming n is positive. n165 Simplify (u(-1/2))(-5)/(u(5/3)u(-2/9)) assuming u is positive. u(19/18) Simplify ((m/(m/(m/(m(mm(3/4))/m)m)))/(mm/(m/(mm*5))m))/(mm(-1/6)m/(m/(mm(mm(-4/5)/m)/mm)m)) assuming m is positive. m(-527/60) Simplify (aaa17a/(aa14a))(-23) assuming a is positive. a(-92) Simplify u*(1/8)u/(((u/(u/u*(2/9)))/uu)/u) assuming u is positive. u(137/72) Simplify m(-3/16)m12 assuming m is positive. m(189/16) Simplify (q0/q(-4))(3/16) assuming q is positive. q(3/4) Simplify (r(2/21)/r2)/(rr*(-2/7)r)(-2/47) assuming r is positive. r(-1808/987) Simplify g*(-2/11)g*(-3)(g(-2/7))(9/10) assuming g is positive. g(-1324/385) Simplify (g2)*(-1/32)/((gg/((ggg/(g*3g)g)/g)gg)/gg/g(4/3)) assuming g is positive. g(-179/48) Simplify k*6/(kk*5)(kk(-6))/(k(-4/7)/k) assuming k is positive. k(-24/7) Simplify (w/w(1/11))(-1/18) assuming w is positive. w(-5/99) Simplify ((h(-6)/h)/(((hhh/((h/h7)/hh))/h)/h))(-2/21) assuming h is positive. h(4/3) Simplify (nnn/((nnn*(-2/9))/n)n*(2/5))/(nn(-1/5))(-2/61) assuming n is positive. n(1454/549) Simplify o(-1/2)o(1/3) assuming o is positive. o*(-1/6)
Let q be (-9)/(-2)(1 - -5). Suppose 0 = -3h + 5u - q, 26 = -h - 2u - 2u. List the prime factors of (-52)/(-14) - h/49. 2 Let j(n) = n + 21. What are the prime factors of j(-15)? 2, 3 Let v(r) = r2 + 6r + 2. Let q(w) = 5w3 - w2 + w + 1. Let c be q(-1). Let f be v(c). Suppose f = b - 6. What are the prime factors of b? 2 Suppose 5q = -4a + 48, 2a + q = a + 12. What are the prime factors of 4/(a/(-9)) - -39? 2, 3 Let v be 14/3 - (-18)/(-27). Suppose 3b = -5y + 74, -vy - 100 = -3b + 19. List the prime factors of b. 3, 11 List the prime factors of 1914/1455/2. 3, 11 Let q = 8 - -10. Suppose 5z + 9 + 26 = 0. Let h = q + z. List the prime factors of h. 11 Suppose t + 0h - 3 = -4h, -4t = 3h - 51. Let a be (4/(-10))/(3/t). Let k(b) = 3b2 + 2b - 2. What are the prime factors of k(a)? 2, 3 Let z(s) = s*2 + 5s - 2. Let r be z(4). Suppose -n - 135 + 44 = 3u, -u - r = 4n. Let i = -20 - u. List the prime factors of i. 2, 5 Let o be 1 - (-2 + 1)1. Suppose -20 = -3t + t - 4b, -ob = -4t + 10. Let v = t + 4. List the prime factors of v. 2 Suppose -3v - v + 20 = 0. Let c be -1 - 1(0 - 1). Suppose c = vh - 5 - 15. List the prime factors of h. 2 Let l be 22/45. Suppose lt = 1 + 9. List the prime factors of 12/4 - (-6)/t. 2, 3 Suppose 0 = 4y - 5b - 131, 2y + b - 105 + 22 = 0. List the prime factors of y. 3, 13 Suppose -4k + 30 = k. Let t = k - 10. List the prime factors of (t/3)/(2/(-15)). 2, 5 Suppose 28 = -2c - 0c. Let z = 22 + c. Let s = z + -5. List the prime factors of s. 3 Suppose -4h + 11 = -5. Suppose -10 = m + hm. List the prime factors of m(0 - (0 + 1)). 2 Suppose -x = -4x + 9. Suppose -1 = -2w + o, 2o = 4w - 3w - 8. What are the prime factors of x + (0/w)/3? 3 Suppose -10 = -3u - 4z, 0 = 2u - u + 2z. Let p = -6 + u. Suppose -3h + 21 = -3r, 5h - 15 = -pr + 5r. List the prime factors of h. 2 Suppose 1061 = 4w + 321. What are the prime factors of w? 5, 37 Let q(f) = f3 + 4f2 + f + 4. Let h be q(-4). Let r(y) = y2 + y - 3. Let l be r(2). Suppose lb - 2z = z + 63, h = z. What are the prime factors of b? 3, 7 Suppose -4 + 12 = p. Let m = 4 + p. List the prime factors of m. 2, 3 Let s(x) = 5x3 - 15x*2 + 15x*2 - 2x + 1. What are the prime factors of s(1)? 2 List the prime factors of ((-4)/(-6))/(2/114). 2, 19 Let p = 67 - 41. Suppose 0 = 4h - 2h - p. What are the prime factors of h? 13 Suppose 2y - 19 + 7 = 0. Suppose yh - 3h = 75. What are the prime factors of h? 5 Suppose -s = 2x - 209, -3x + 2s = -3s - 320. What are the prime factors of x? 3, 5, 7 Suppose -3c - 28 = -5c. What are the prime factors of c? 2, 7 Let g = 8 - 8. Let p be (g(-1)/(-3))/2. Suppose po - 4o + 16 = -2k, -2k = -5o + 22. List the prime factors of o. 2, 3 List the prime factors of (11/3 + -4)-45. 3, 5 What are the prime factors of (-5508)/(-119) + (-2)/7? 2, 23 Suppose 5r - 24 + 114 = 0. Let j = r + 34. What are the prime factors of j? 2 Suppose 7b - 2b = 10. Let u(l) = 3 - 4 + bl + 0l - 3. List the prime factors of u(7). 2, 5 Suppose -t + 0d - d - 5 = 0, -d - 5 = -t. Suppose 2k = -t + 10, 0 = 4j + 4k - 40. What are the prime factors of j? 5 Suppose -32 = -3w + w. Suppose -s = s - w. List the prime factors of s. 2 Let h be (-125)/56/(-15). List the prime factors of (-2)/h - (-362)/10. 2, 3 Let v be (3/3)/(2/24). Suppose -2x + v = -s + 3, 10 = 2x - 2s. Suppose -z + n + 1 = 0, xz - 2n - 18 + 8 = 0. What are the prime factors of z? 2 Let l = 3 - 0. Suppose -2 - 1 = j, -15 = -k - lj. List the prime factors of k. 2, 3 Let i(r) = 3r*3 + 2r*2 - 1. Let c be i(1). Suppose t - 10 = -ct. List the prime factors of -3(t - 4) + 2. 2 Let k(o) be the first derivative of -o4/2 - 2o*3/3 - 3o*2/2 - o - 1. What are the prime factors of k(-2)? 13 Let n be 51/12 + (-1)/4. Suppose -14 + 6 = -nv. Suppose 18 = 5d - 2p - 2, -4p + 8 = -vd. List the prime factors of d. 2, 3 Let f be 2/(-3) - 22/(-6). Let k(s) = -2s + 3s*2 + 3 - 3 + f. What are the prime factors of k(2)? 11 Let w be (3 - 1)(-204)/8. Let u = w - -75. What are the prime factors of u? 2, 3 Suppose -43 - 25 = -f. List the prime factors of f. 2, 17 Let o be (-14)/(-6) + 3/(-9). Suppose 18 = of + f. Suppose -4q - f = 5r - 38, 4r - 30 = -q. What are the prime factors of r? 2 Let v = 28 - -16. Let i = -28 + v. List the prime factors of i. 2 Let h = 7 - -17. Let g be (-24)/2 - (4 - 2). Let j = g + h. What are the prime factors of j? 2, 5 Let f(t) = t - 16. Let i be f(7). Let r = 10 + i. Let a(j) = 22j3 + j2 - 1. What are the prime factors of a(r)? 2, 11 Let k(g) = g2 + 11g - 9. Suppose -2a = 2q + 22, -3q = -0q - 4a + 33. Let i be k(q). Let b = i - -23. List the prime factors of b. 2, 7 Suppose 0 = 4p + h + 263, 2p - 345 = 7p - 2h. Let o = -38 - p. List the prime factors of o. 29 Let d = 276 - 81. Suppose -k = -3z - 134, 5z + 0k = -4k - d. Let h = -31 - z. List the prime factors of h. 2, 3 Let j(p) = p2 + 10p - 9. Let a be j(-11). What are the prime factors of (3/a)/(1/10)? 3, 5 Suppose -2q = 4p + 317 + 493, -4q - 605 = 3p. What are the prime factors of (2 + -1)/((-7)/p)? 29 Let t(h) = -h*2 - 2h + 3. Let l be t(-3). Let g(n) = 13n + 1. Let c be g(1). Suppose -c = -2q - l. What are the prime factors of q? 7 Let r be 3 - 3(6 + -1). What are the prime factors of (-63)/(-12) + 3/r? 5 Let a(n) = 1 - 32n + 34n - 1. List the prime factors of a(8). 2 Let k = 8 + -22. Let y = 0 - k. What are the prime factors of y? 2, 7 Let k = -6 + 9. Suppose 0 = -5f - 2w + 82, 0w + 50 = kf + 2w. List the prime factors of f. 2 Suppose -n + 4n = -3s + 18, 0 = -2n + 2s + 4. Suppose 2t = nm - 4 - 14, -6 = m + 3t. Suppose 0 = ml + 2l - 40. What are the prime factors of l? 2 Suppose 0 = -0d + 3d - 15, 2d = 3a - 101. What are the prime factors of a? 37 Suppose 525 = 5u - 2m - 1412, -12 = -3m. List the prime factors of u. 389 Let m = 14 + -36. What are the prime factors of (-1)/(-1 + m/(-23))? 23 Let k = 10 - -14. Suppose -5l + k = -2l. What are the prime factors of l? 2 Let h(f) = -10f - 46. Let a(x) = 7x + 31. Let j(p) = -7a(p) - 5h(p). What are the prime factors of j(-7)? 2, 3 Suppose -5r + 227 = -28. List the prime factors of r. 3, 17 Let h = 0 - 0. Suppose hz - 4z - 2t + 2 = 0, -4z - 5t + 5 = 0. Suppose z = -4a + 46 - 2. List the prime factors of a. 11 Suppose -4a = -8a + 76. What are the prime factors of a? 19 Let l = 555 - 837. List the prime factors of l/(-18) - (-2)/(-3). 3, 5 Let a(g) = g2 + 8. List the prime factors of a(-6). 2, 11 Let z = 0 + 14. Suppose 5g - 34 = u, 3g + 3u = 38 - z. What are the prime factors of g? 7 Let t(f) = -f*3 - 12f*2 - 11f + 26. List the prime factors of t(-11). 2, 13 Suppose 5q - 163 = 4r, -4q = -3r + q - 116. Let a = -4 - r. What are the prime factors of a? 43 Let p(w) = -w*3 + 4w*2 - 3w + 4. Let u be p(3). Suppose -4q - q = ul + 60, 3q + 39 = -3l. List the prime factors of (-26)/q - (-9)/12. 2 Let d(q) = q*2 + q - 4. Let k be d(-3). Suppose -ku = -7 - 19. List the prime factors of u. 13 Suppose -x - 4 = -2x - 3n, 3n = -5x + 20. List the prime factors of x. 2 Suppose 3v - 75 = -2q, 4q = v + v + 158. What are the prime factors of q? 3, 13 Let s be (-1 + (14/6 - 1))12. Suppose -5q + 15 = -0q. Suppose 0 = i + 3i - s, 9 = b + qi. List the prime factors of b. 2, 3 Let y(h) = h*3 + 6h*2 - 5. Let m be y(-5). Suppose 0 = -3v - v + m. Suppose a - 4a + 4o + 17 = 0, 2a + vo + 4 = 0. List the prime factors of a. 3 Let t(l) be the first derivative of -l*4/4 + 2l*3 + 11l*2/2 - 8l - 1. What are the prime factors of t(7)? 2, 5 Let m = 493 - 350. List the prime factors of m. 11, 13 Let j(d) = -d - 5. Let c be j(-8). Suppose -23 = -5v + u, v + 0u = cu - 1. Suppose -2l + 2i = 2l - 28, -vl + i + 41 = 0. List the prime factors of l. 3 Let t(w) = -w - 26. Let p(o) = 2o + 27. Let d(j) = 5p(j) + 6t(j). Let b(i) = 2i - 10. Let m(x) = 7b(x) - 3d(x). List the prime factors of m(9). 11 List the prime factors of 3198/91 + 2/(-14). 5, 7 Suppose 3q + 20 = 7q. Let i = q - 4. Let g = i - -7. What are the prime factors of g? 2 Let o(j) = j3 + 12j*2 + 14j + 12. List the prime factors of o(-10). 2, 3 Suppose 2z + 40 = 2q, 31 = -4q + 3z + 106. List the prime factors of q. 3, 5 Suppose -2s - 3s + 239 = h, 4h - 16 = 0. What are the prime factors of s? 47 Let y(x) = 14x - 28. What are the prime factors of y(7)? 2, 5, 7
Calculate the greatest common divisor of 74 and 74. 74 Calculate the highest common factor of 608 and 988. 76 What is the greatest common divisor of 1326 and 312? 78 What is the highest common factor of 90 and 162? 18 Calculate the highest common factor of 3686 and 194. 194 What is the highest common divisor of 1166 and 530? 106 What is the greatest common divisor of 518 and 322? 14 What is the greatest common divisor of 672 and 42? 42 Calculate the greatest common factor of 35 and 2835. 35 What is the highest common factor of 8 and 36? 4 Calculate the highest common factor of 340 and 40. 20 Calculate the greatest common divisor of 1017 and 63. 9 Calculate the highest common factor of 2784 and 29. 29 Calculate the greatest common factor of 10 and 1570. 10 What is the highest common divisor of 23 and 3197? 23 What is the greatest common divisor of 3876 and 1368? 228 What is the greatest common factor of 40 and 56? 8 What is the highest common divisor of 1110 and 30? 30 What is the highest common divisor of 6004 and 1422? 158 What is the greatest common divisor of 6825 and 91? 91 Calculate the highest common divisor of 116 and 400. 4 What is the highest common factor of 2233 and 14? 7 What is the greatest common divisor of 130 and 11674? 26 What is the highest common factor of 108 and 54? 54 What is the highest common factor of 10075 and 100? 25 Calculate the greatest common divisor of 24 and 96. 24 What is the highest common factor of 140 and 260? 20 Calculate the highest common factor of 6 and 2334. 6 What is the greatest common factor of 333 and 2627? 37 What is the highest common divisor of 1984 and 279? 31 Calculate the highest common divisor of 492 and 13407. 123 What is the highest common divisor of 170 and 10? 10 What is the highest common divisor of 1602 and 4? 2 What is the greatest common factor of 6110 and 188? 94 Calculate the highest common factor of 9 and 192. 3 Calculate the greatest common factor of 732 and 3. 3 Calculate the highest common divisor of 186 and 12. 6 Calculate the greatest common divisor of 36 and 126. 18 What is the highest common divisor of 19840 and 256? 128 Calculate the highest common divisor of 5 and 2095. 5 What is the highest common divisor of 52 and 52000? 52 What is the highest common divisor of 55 and 5335? 55 Calculate the greatest common factor of 1334 and 506. 46 What is the greatest common factor of 288 and 128? 32 Calculate the greatest common factor of 45 and 2871. 9 What is the greatest common factor of 80 and 632? 8 Calculate the highest common divisor of 27 and 18. 9 What is the highest common factor of 190 and 20? 10 What is the greatest common divisor of 138 and 736? 46 Calculate the highest common factor of 44 and 55. 11 Calculate the greatest common factor of 4605 and 30. 15 What is the greatest common divisor of 590 and 10? 10 What is the highest common factor of 12 and 256? 4 What is the highest common divisor of 480 and 2370? 30 Calculate the greatest common factor of 1127 and 49. 49 What is the highest common factor of 64 and 3568? 16 What is the greatest common factor of 365 and 115? 5 Calculate the greatest common divisor of 13 and 19487. 13 Calculate the greatest common factor of 1925 and 150. 25 What is the highest common divisor of 363 and 297? 33 Calculate the highest common factor of 1501 and 158. 79 Calculate the greatest common factor of 36 and 153. 9 Calculate the highest common divisor of 3703 and 161. 161 What is the greatest common factor of 105 and 42? 21 Calculate the greatest common divisor of 3 and 47. 1 Calculate the greatest common factor of 610 and 13786. 122 Calculate the greatest common divisor of 17 and 1241. 17 What is the greatest common divisor of 91 and 455? 91 What is the highest common divisor of 174 and 4814? 58 Calculate the highest common divisor of 109 and 13189. 109 Calculate the greatest common divisor of 703 and 1121. 19 What is the highest common divisor of 404 and 1717? 101 Calculate the greatest common factor of 64 and 224. 32 What is the highest common factor of 1196 and 161? 23 What is the highest common divisor of 7996 and 4? 4 Calculate the highest common divisor of 3126 and 12. 6 Calculate the greatest common divisor of 9070 and 50. 10 What is the greatest common divisor of 28 and 1190? 14 Calculate the highest common divisor of 56336 and 7. 7 Calculate the highest common factor of 91 and 2899. 13 Calculate the highest common divisor of 315 and 4788. 63 Calculate the greatest common factor of 70 and 2590. 70 Calculate the greatest common divisor of 70 and 140. 70 What is the highest common factor of 20 and 12? 4 What is the highest common factor of 2227 and 85? 17 What is the highest common factor of 531 and 708? 177 Calculate the greatest common factor of 18 and 261. 9 Calculate the highest common factor of 62 and 186. 62 Calculate the highest common factor of 4 and 44. 4 What is the greatest common factor of 56 and 21? 7 What is the highest common factor of 12 and 102? 6 What is the highest common factor of 2740 and 50? 10 What is the greatest common factor of 88 and 2266? 22 Calculate the greatest common factor of 5055 and 15. 15 Calculate the highest common divisor of 714 and 42. 42 Calculate the highest common factor of 3456 and 486. 54 Calculate the highest common factor of 16 and 4304. 16 Calculate the greatest common divisor of 405 and 135. 135 Calculate the highest common factor of 40 and 4920. 40 What is the highest common factor of 101 and 1313? 101 Calculate the greatest common factor of 368 and 414. 46 What is the greatest common factor of 412 and 4? 4 What is the greatest common divisor of 190 and 30? 10 Calculate the highest common factor of 774 and 54. 18 Calculate the greatest common divisor of 1232 and 2816. 176 What is the greatest common divisor of 882 and 1008? 126 Calculate the greatest common divisor of 10 and 90. 10 Calculate the highest common factor of 140 and 820. 20 What is the highest common divisor of 102 and 96? 6 Calculate the greatest common divisor of 30108 and 12. 12 Calculate the greatest common factor of 22 and 649. 11 Calculate the highest common factor of 34 and 680. 34 What is the highest common factor of 35 and 21? 7 What is the highest common divisor of 10 and 295? 5 Calculate the highest common factor of 3013 and 23. 23 Calculate the highest common divisor of 1479 and 174. 87 Calculate the highest common factor of 432 and 112. 16 What is the highest common divisor of 68 and 5882? 34 What is the highest common divisor of 13 and 2? 1 Calculate the highest common divisor of 10062 and 9. 9 What is the greatest common factor of 9 and 531? 9 Calculate the greatest common factor of 126315 and 63. 63 What is the highest common divisor of 160 and 115? 5 What is the highest common factor of 280 and 3010? 70 Calculate the greatest common divisor of 168 and 6. 6 What is the highest common divisor of 63 and 1233? 9 Calculate the greatest common divisor of 984 and 144. 24 Calculate the greatest common factor of 80 and 752. 16 Calculate the highest common factor of 336 and 228. 12 Calculate the greatest common factor of 74 and 41218. 74 Calculate the highest common factor of 561 and 33. 33 Calculate the highest common factor of 504 and 84. 84 What is the greatest common divisor of 11 and 1? 1 What is the greatest common divisor of 161 and 14? 7 Calculate the greatest common factor of 4771 and 26. 13 What is the highest common divisor of 27 and 3375? 27 What is the greatest common divisor of 2286 and 12? 6 Calculate the highest common factor of 2390 and 10. 10 Calculate the greatest common factor of 1011 and 6. 3 Calculate the greatest common divisor of 72 and 60. 12 Calculate the greatest common divisor of 225 and 600. 75 What is the highest common divisor of 128 and 192? 64 What is the greatest common factor of 376 and 4042? 94 What is the greatest common factor of 4 and 28? 4 Calculate the greatest common divisor of 118 and 10. 2 What is the greatest common divisor of 3528 and 7? 7 Calculate the highest common divisor of 774 and 1462. 86 What is the highest common factor of 154 and 22? 22 What is the highest common divisor of 17714 and 68? 34 What is the highest common factor of 224 and 280? 56 Calculate the highest common divisor of 261 and 957. 87 Calculate the highest common factor of 29 and 232. 29 Calculate the greatest common factor of 545 and 218. 109 What is the greatest common divisor of 78 and 19578? 78 What is the highest common factor of 116 and 8? 4 Calculate the greatest common factor of 670 and 410. 10
Put -1, 10, 5 in decreasing order. 10, 5, -1 Sort -4, 0, 9, -2, -7 in ascending order. -7, -4, -2, 0, 9 Put 446, -5, 6 in decreasing order. 446, 6, -5 Put 21, -36, 1 in descending order. 21, 1, -36 Sort -0.3, -2/15, 1, -14/9 in descending order. 1, -2/15, -0.3, -14/9 Sort 27, -8, 0 in ascending order. -8, 0, 27 Sort 0.7, -0.2, -3. -3, -0.2, 0.7 Sort -1, 0.4, -0.1 in increasing order. -1, -0.1, 0.4 Sort -2.1, 2/9, 3/4, 2 in decreasing order. 2, 3/4, 2/9, -2.1 Put 1/3, 3/2, 0.2, 11, 10/11 in ascending order. 0.2, 1/3, 10/11, 3/2, 11 Put -1, -3, -1/3 in descending order. -1/3, -1, -3 Sort -4, -5, 77. -5, -4, 77 Put -0.5, 4, -2, 2/3, -109 in ascending order. -109, -2, -0.5, 2/3, 4 Sort -6, 5, 77 in decreasing order. 77, 5, -6 Put 9, 5, -5, -1 in decreasing order. 9, 5, -1, -5 Sort -0.4, -36, -3, 3/7 in ascending order. -36, -3, -0.4, 3/7 Sort -2/13, -1/22, -3. -3, -2/13, -1/22 Sort 5, 2, -12, -4 in decreasing order. 5, 2, -4, -12 Sort 1, -5, -4. -5, -4, 1 Sort 1, 418, 2 in increasing order. 1, 2, 418 Put -101, 0.5, 2, -0.1, -2/3 in increasing order. -101, -2/3, -0.1, 0.5, 2 Sort -4, 11, 3, -3, -76 in descending order. 11, 3, -3, -4, -76 Put 4, -43, 2, -5 in ascending order. -43, -5, 2, 4 Put -12, 5, 6 in decreasing order. 6, 5, -12 Put 0, 2.5, -2, 0.5 in increasing order. -2, 0, 0.5, 2.5 Sort 9, 0.5, -0.4, -1/3 in ascending order. -0.4, -1/3, 0.5, 9 Sort 1, -1, 12/31, -4 in descending order. 1, 12/31, -1, -4 Sort 1, -12, 2 in descending order. 2, 1, -12 Put 2, 3, 0, 11, -5 in decreasing order. 11, 3, 2, 0, -5 Sort 3, 2, -11, -3, 8 in ascending order. -11, -3, 2, 3, 8 Sort -3, 1, 100, 5. -3, 1, 5, 100 Put -4, -5, 1, -9 in ascending order. -9, -5, -4, 1 Sort 14, 0, 0.1, -1/7 in descending order. 14, 0.1, 0, -1/7 Put 62, -4, -5, -3, -2 in descending order. 62, -2, -3, -4, -5 Sort 4, -0.12, 5, -246. -246, -0.12, 4, 5 Put -3/5, 1.7, 2, -1 in decreasing order. 2, 1.7, -3/5, -1 Sort -73, -4, 4. -73, -4, 4 Sort 0, 4, -129, -2 in decreasing order. 4, 0, -2, -129 Put -5, 10, 4, -2 in ascending order. -5, -2, 4, 10 Sort -3, 3.5, 0.3, -3/4 in descending order. 3.5, 0.3, -3/4, -3 Sort 1/26, 9, 10 in ascending order. 1/26, 9, 10 Sort -1/10, -5, 7/2, 2/47 in decreasing order. 7/2, 2/47, -1/10, -5 Sort 1/2, -2, 1/3, -3/5. -2, -3/5, 1/3, 1/2 Put 0.9, 10, -3, -2 in ascending order. -3, -2, 0.9, 10 Sort -1, -89, 2, -2 in increasing order. -89, -2, -1, 2 Sort 0.05, 0, -2/21, -1, -3 in increasing order. -3, -1, -2/21, 0, 0.05 Sort 300, -30, -3 in increasing order. -30, -3, 300 Sort -0.165, 4, 1, 2/11. -0.165, 2/11, 1, 4 Put 4, -2/11, 946 in descending order. 946, 4, -2/11 Put -5, -2/11, 0, 3/7 in decreasing order. 3/7, 0, -2/11, -5 Sort 55.21, -2/5, 0.1 in ascending order. -2/5, 0.1, 55.21 Sort 2, 229, 1, -5, 3 in increasing order. -5, 1, 2, 3, 229 Put -4, -3, 3, -0.1 in descending order. 3, -0.1, -3, -4 Put 13, -40, 0 in ascending order. -40, 0, 13 Put 0.1, -1/79, 10 in ascending order. -1/79, 0.1, 10 Sort 7, -7, 5 in descending order. 7, 5, -7 Sort -3, 0, -109, -2/9, 0.3 in descending order. 0.3, 0, -2/9, -3, -109 Put -12, 5, 11 in descending order. 11, 5, -12 Put 1, -1/5, -2/5, 5, 0.4 in increasing order. -2/5, -1/5, 0.4, 1, 5 Sort -21, 13, 4. -21, 4, 13 Sort -4, -84, 2. -84, -4, 2 Put -322, -4, -5 in decreasing order. -4, -5, -322 Sort 407, -26, -4. -26, -4, 407 Sort -11, 5, 32 in descending order. 32, 5, -11 Sort -4, -2583, -1. -2583, -4, -1 Put 18, -2, -6 in ascending order. -6, -2, 18 Put 3, -2, -259 in ascending order. -259, -2, 3 Sort -4, 6/11, -0.3, 2, 30 in descending order. 30, 2, 6/11, -0.3, -4 Sort 3, -2, -3, -5, -44 in descending order. 3, -2, -3, -5, -44 Sort -1, 7, -4, 5, -8 in increasing order. -8, -4, -1, 5, 7 Sort 3, -6, -89 in descending order. 3, -6, -89 Put -3, -7, -6/5 in increasing order. -7, -3, -6/5 Sort -19, 9, 0, -5 in increasing order. -19, -5, 0, 9 Sort -0.0462, 1/7, -5. -5, -0.0462, 1/7 Put -10, 1, 3, -16/7 in decreasing order. 3, 1, -16/7, -10 Sort 11, 4, 0.002 in ascending order. 0.002, 4, 11 Sort 1/4, -0.02, 0.4, -3 in descending order. 0.4, 1/4, -0.02, -3 Sort 2.4, -6/7, 1, -2 in increasing order. -2, -6/7, 1, 2.4 Sort 4, -258/29, -4, 0.3. -258/29, -4, 0.3, 4 Put 5, -6, 0.49 in increasing order. -6, 0.49, 5 Put 4, -4, -12, 6, -1 in descending order. 6, 4, -1, -4, -12 Put 1/12, 0.5, -18 in increasing order. -18, 1/12, 0.5 Sort 4, 15, -1, -4. -4, -1, 4, 15 Sort 4, -4, 0, 1, 3. -4, 0, 1, 3, 4 Sort 15, -5, 5, -795 in decreasing order. 15, 5, -5, -795 Sort -17, 3, -9, 2, 1. -17, -9, 1, 2, 3 Sort 0.5, -47, 5 in ascending order. -47, 0.5, 5 Sort 25, 1, -6, -5, -1 in descending order. 25, 1, -1, -5, -6 Put 4, -1, -3, -10 in decreasing order. 4, -1, -3, -10 Sort 12, -5, 1, -1 in increasing order. -5, -1, 1, 12 Sort -0.2, -9/5, -1/6 in descending order. -1/6, -0.2, -9/5 Put 1.13, -2/9, 4, -14 in increasing order. -14, -2/9, 1.13, 4 Sort 3, 0, -4, -1, -5. -5, -4, -1, 0, 3 Sort -4, 2, 39, -9 in descending order. 39, 2, -4, -9 Sort -1, 13, 1/9. -1, 1/9, 13 Sort -0.5, -1/6, -4, 16/3 in decreasing order. 16/3, -1/6, -0.5, -4 Sort -8, -1, 26 in increasing order. -8, -1, 26 Sort -0.2, -24, -4, 4/7 in ascending order. -24, -4, -0.2, 4/7 Put -0.4, 2, -3 in decreasing order. 2, -0.4, -3 Put 88, 0, -45 in increasing order. -45, 0, 88 Put -3, -11, -0.3, 2/17, -1 in descending order. 2/17, -0.3, -1, -3, -11 Put 2, 37, 1 in descending order. 37, 2, 1 Put -4/5, -0.004, -5, -2/17 in descending order. -0.004, -2/17, -4/5, -5 Put 0, -6, 1 in decreasing order. 1, 0, -6 Put -12, -3, 7, -7 in descending order. 7, -3, -7, -12 Put 103, 5, -5 in decreasing order. 103, 5, -5 Put 4, -38, -5, -1 in increasing order. -38, -5, -1, 4 Put 11, -10, -6, 1 in descending order. 11, 1, -6, -10 Put 6/7, 0.5, -122/3 in decreasing order. 6/7, 0.5, -122/3 Put 1, -0.3, 4, 0, -32/15 in increasing order. -32/15, -0.3, 0, 1, 4 Put -0.07, 5, -0.02, 1/11, 9 in ascending order. -0.07, -0.02, 1/11, 5, 9 Put 2/7, 3/50, -1/2 in increasing order. -1/2, 3/50, 2/7 Sort -4, 97, -9, 1 in ascending order. -9, -4, 1, 97 Put -14, 4, 0.3, 5 in increasing order. -14, 0.3, 4, 5 Put 5, -26, 4 in ascending order. -26, 4, 5 Put -1, 5, -76 in increasing order. -76, -1, 5 Sort -10, 3, -3, 0, 5. -10, -3, 0, 3, 5 Put -0.1, 0, -11 in decreasing order. 0, -0.1, -11 Put 0.8, -1/6, 3/8, 1.48 in decreasing order. 1.48, 0.8, 3/8, -1/6 Sort -18, 5, 16.7, 3/4. -18, 3/4, 5, 16.7 Sort -6, 15, 5, -4 in decreasing order. 15, 5, -4, -6 Sort -0.4, 2, 1/7, 1, 6 in descending order. 6, 2, 1, 1/7, -0.4 Put -1/9, -33, 0.5 in decreasing order. 0.5, -1/9, -33 Put -115, 22, -4 in ascending order. -115, -4, 22 Sort -3, 9, 3, -4 in decreasing order. 9, 3, -3, -4 Sort 0.4, -24/13, -1/3, -2 in decreasing order. 0.4, -1/3, -24/13, -2 Sort -22, -6, 6 in descending order. 6, -6, -22 Sort 93, -5, -6, 4 in decreasing order. 93, 4, -5, -6 Put 15, -4, -40 in increasing order. -40, -4, 15 Sort -5, 0, 0.4, -981 in descending order. 0.4, 0, -5, -981 Sort 3, -0.5, 15, 0.4 in increasing order. -0.5, 0.4, 3, 15 Put 4, -5, -565, 2, -3 in descending order. 4, 2, -3, -5, -565 Sort -4, 13, 1/7 in ascending order. -4, 1/7, 13 Sort -10, 3, -4 in decreasing order. 3, -4, -10 Put 4, -121, -3, 3, 1 in descending order. 4, 3, 1, -3, -121 Sort 2, -4, 5, -16, 4. -16, -4, 2, 4, 5 Put -4, 0, 2553 in descending order. 2553, 0, -4 Put -7, 3, -4, 1, 8 in increasing order. -7, -4, 1, 3, 8 Sort 66, -2/3, 0. -2/3, 0, 66 Put 487/2, -2/23, 1 in descending order. 487/2, 1, -2/23 Sort -1/18, -0.06, 0. -0.06, -1/18, 0 Sort -4.66, 3, 3/7 in decreasing order. 3, 3/7, -4.66 Put -3, 0, -14, -4 in ascending order. -14, -4, -3, 0 Put 1, 516, 5 in increasing order. 1, 5, 516 Put 0, 2, 0.5, 28.2 in decreasing order. 28.2, 2, 0.5, 0 Put -5, 91, -2 in ascending order. -5, -2, 91 Put -0.2, 12, -4, -1.1, 0.03 in ascending order. -4, -1.1, -0.2, 0.03, 12 Put -33, -4, -3, 47, 1 in descending order. 47, 1, -3, -4, -33 Put -1178, -3, 2 in descending order. 2, -3, -1178 Put -5, 55, -2 in increasing order. -5, -2, 55 Put 1, -5, 6, 2, 5 in decreasing order. 6, 5, 2, 1, -5 Sort -1/4, 0.03, 0.11 in decreasing order. 0.11, 0.03, -1/4 Sort 8, -7, 3, -4 in descending order. 8, 3, -4, -7 Sort -13.86, -2, 1, -3 in increasing order. -13.86, -3, -2, 1 Put -0.5, 4, -279, 1 in decreasing order. 4, 1, -0.5, -279 Sort -4, -3, 2133 in decreasing order. 2133, -3, -4 Put 1, -1, 155, 0 in descending order. 155, 1, 0, -1 Sort 0, 12, -290. -290, 0, 12 Put 5, -5, -44 in ascending order. -44, -5, 5 Sort -7, -0.05, -3, 2 in descending order. 2, -0.05, -3, -7 Sort 5/3, -1, -93/2 in ascending order. -93/2, -1, 5/3 Sort 9, -16, -1, 5 in increasing order. -16, -1, 5, 9
Let s = -251 + 250.9753. Let m = -0.0547 - s. Let h be 29/(-84) - (-2)/8. What is the fourth smallest value in -0.3, h, 2/11, m? 2/11 Let g = -353.6 + 354.6. Which is the second smallest value? (a) g (b) 5 (c) -2/43 a Let x = -13382 + 13385. Which is the second smallest value? (a) 1/4 (b) -2293 (c) x a Let u be (-66)/(-432) - 6/16. Suppose -s - 4s - 10 = 4b, -2b - s = 2. Suppose c - 6c = b. What is the second smallest value in 0.4, u, 5, c? c Let y = 0.11 + -0.27. Let s = 2.84 - y. Let n = s + -3.3. What is the third biggest value in n, 1/7, 0.5? n Suppose -890 = -5d + k + 754, -3k - 1642 = -5d. What is the fourth smallest value in -0.5, 0.1, -1/7, d? d Let r = 0.25 + -0.49. Let z = 0.64 + r. Let g = 29 + -28.96. Which is the third smallest value? (a) g (b) z (c) -6/11 b Let x = 0.16 - -16.84. Let k(r) = r2 + 5524r + 38614. Let s be k(-7). What is the third smallest value in s, x, 1/2? x Let k = 168/5 - 33. Let u be (98/(-6))/((-160)/60). Let i = u + -37/8. Which is the third smallest value? (a) i (b) 0 (c) k a Let g = -11 - -15. Suppose 3158m = -2963 - 195. Which is the smallest value? (a) -5 (b) m (c) -0.5 (d) g a Let k = 87 - 104. Let o be (k - -3 - -5)2/3. Let z be (-192)/(-135) - (-2)/(-9). Which is the second smallest value? (a) z (b) 0.1 (c) o (d) -2/5 d Suppose 22j - 20j - 4 = 0, 0 = -4z + 5j - 882. What is the smallest value in z, -2, -4? z Let r be ((-2)/7)/((-12)/(-21)). Let t be 6/51275/5355. Which is the smallest value? (a) t (b) -0.4 (c) r c Let k = 0.2 - 0. Let s = 0.37 - 0.39. Let y(n) = 72n - 1723. Let o be y(24). Which is the smallest value? (a) o (b) k (c) s c Let d be -1(-28)/1060 + 22/110. Which is the second biggest value? (a) 5 (b) d (c) 0 b Let r = -497153/12 + 41429. Let v be 45/(-39) + (1 - 0). Which is the third smallest value? (a) r (b) v (c) 1/3 c Let b = 1.95 + -2. Let x = -5076.6 - -5077. What is the second biggest value in b, x, -3/2? b Let v = -4.0753 + -0.0247. Which is the third smallest value? (a) -1/4 (b) -7 (c) v a Let w be 39/18242/108. What is the third biggest value in -1/3, 0.09, 5, 21, w? 0.09 Suppose -58a - 224 = -65a. Suppose -18 = 2t - 2z - 3z, -3t + 5z = a. Let r = 101/7 + t. What is the fourth smallest value in 1, 3, r, -5? 3 Let t = 16 + -2. Let r = -43 + t. Let x = 28 + r. What is the third biggest value in -0.5, 0.1, x? x Let v = 48 + -48.19. Let u = 4.19 + v. Let p = 71/219 + 2/219. Which is the smallest value? (a) p (b) -4 (c) u b Suppose 10 = 10s - 5s, 4j + 5s - 10 = 0. What is the second biggest value in 3.7, -2, 1/5, j, 1/3? 1/3 Let n be ((-12)/40)/((1274/(-260))/49). Let r = 1 + -1. Which is the second biggest value? (a) n (b) r (c) -2 (d) -0.4 b Let m(j) = -4j*2 - 97j - 20. Let p be m(-24). Suppose 2r = 4t + 30, 8r - 11r = pt + 45. Which is the third smallest value? (a) t (b) 0.5 (c) -18 b Let d = 23 - 19. Let k = -1.1847 + 3.1847. Suppose 3r = -0r + 27. What is the fourth smallest value in r, d, 0.5, k? r Suppose 0 = 4k + m - 2m - 7, -3m + 12 = -k. Suppose -h = -2g + 2, 0 = -kh + 2g + 3g - 10. Which is the second smallest value? (a) -3 (b) 0.3 (c) h a Let h = -62 + 61.5. Let f = 759.3 + -759. Which is the second biggest value? (a) h (b) f (c) -4 (d) 7 b Suppose -5w = 6 - 11. Suppose 5r + 3m + 11 = 4r, m = -2r - 7. Which is the third smallest value? (a) -1 (b) w (c) r (d) 4 b Let s be (-30)/(-4)(-476)/71426. Let n be (-7)/12 - 2/(-6). Which is the third smallest value? (a) 1 (b) n (c) s a Let u = -15.6 - -16. Let k = 7.02 - 7. Let a = -4.1 + 3.1. What is the second biggest value in 0.2, a, u, k? 0.2 Let p = -0.0399 - -156.0399. Let l = 158 - p. Which is the fourth biggest value? (a) 0.6 (b) l (c) 0.2 (d) 0.4 c Let w = -269.64 + -0.36. Let o = w - -273. What is the biggest value in o, 2, 5? 5 Let x = 0.1 - -1.1. Let s = -1159.747 + 0.747. Let y = 1159.3 + s. What is the fourth smallest value in 1/5, x, -5, y? x Let p = 0 + 3. Let r = 220 + -215. Let y = -10 + r. Which is the third biggest value? (a) y (b) -3/4 (c) p (d) 1 b Let h = -0.0123 - 211.9877. Let i = h - -211.95. Let b = 127/45 - 13/5. What is the biggest value in 0, b, i? b Suppose 11y - 8 = 15y. Let u be ((-24)/8)/(-27)(y - 0). Which is the second biggest value? (a) 2/7 (b) 1/31 (c) u b Suppose 156 = 4x + 132. Let u be 2/(-1)(x + -7). What is the biggest value in u, 8, 3/4, 1/6? 8 Let z = 135 + -93. Let d = -4.45 - -51.45. Let x = d - z. Which is the second biggest value? (a) -3/2 (b) x (c) 0 c Let p = -8 - -7.5. Suppose 7q = q. Suppose 0 = -2s + 5s + f - 5, q = -2f + 10. Which is the second smallest value? (a) 2/3 (b) p (c) s c Let h = -4033 + 4032.72. Which is the second smallest value? (a) -0.04 (b) -0.4 (c) -0.3 (d) h c Let b be 30/8 + 4/16. Let m be 1(60/45)/(8/18). Suppose bs = 5z - 0z - 70, 0 = ms + 15. What is the third biggest value in z, 1/7, 5? 1/7 Let b = -1111/679 + 131/97. What is the third smallest value in b, -5/9, 1, 0.8? 0.8 Let l be (-2)/189/(-6). Let n = -251 - -251.1. What is the smallest value in n, l, -3/4, 2/17? -3/4 Let u(k) = -2k2 - k. Let a(r) = 7r*2 - 4r - 20. Let o(c) = -a(c) - 2u(c). Let q be o(4). What is the second smallest value in 2/15, -0.4, 0.4, q? -0.4 Let f = 5661 - 5660.99. What is the second biggest value in 1/5, 0, -0.3, f? f Let l be ((-30)/8 - -2) + (-12)/(-16). Let h = 5 + -8. What is the second biggest value in h, l, -6, 4? l Let l be (-5)/3(-112)/(-770). Let t = l - -52/33. Which is the third smallest value? (a) t (b) -0.1 (c) -1 (d) 0.7 d Let i = -3.178 - -2.958. What is the third smallest value in -0.3, i, -0.1? -0.1 Let k(q) = -q*3 - 2q*2 + 3q - 4. Let b be k(-3). Let w be -1 - -4 - (3 + b). Let i = 556.06 + -556. What is the smallest value in -0.2, i, w? -0.2 Let s be (-4)/(-6)(-15)/40. Let h = -115/72 + 11/8. Let o be (-70)/17 - (-68)/17. Which is the third biggest value? (a) s (b) h (c) o a Let o = 0 - -1. Let u = 581 + -640.5. Let s = u + 59. Which is the second smallest value? (a) 2/13 (b) o (c) s a Let z = 3359 - 3355. Which is the fifth smallest value? (a) 5 (b) -2 (c) -6 (d) 0.4 (e) z a Let m = -28.074 + 28. Let x = m - -0.174. Let z = -4 + 5. What is the second biggest value in -1, -0.4, z, x? x Suppose -2z + x = -x + 10, 3z + 5x + 7 = 0. Let k be (6/12)/(-4 - z/2). Let c = -0.1 + 0.22. What is the third smallest value in c, -0.5, 0.2, k? c Let j = -22.2 - -12. Let o = -2 + -8.4. Let w = j - o. Which is the third biggest value? (a) 1/3 (b) -4 (c) w (d) -5 b Let y = -10756 - -10755. Let k be 2 - (24/3)/2. Which is the fourth biggest value? (a) y (b) 0.3 (c) k (d) -6 d Let x = 7104 + -7101. Which is the second biggest value? (a) x (b) -2 (c) 4 (d) -5 (e) -0.18 a Let z = -318.4 - -314.9. What is the third smallest value in 4, -6, z? 4 Let a be 4/6(-31)/2. Let m = 25283/31535 - 11/6307. What is the fourth smallest value in m, -2/9, 4, a? 4 Let r = 41/101 - 631/808. Let c = 7.5 + -1.5. Let b = c - 1. What is the third smallest value in b, 1, 1/8, r? 1 Let b be (-1266)/240 - 18/30 - -6. What is the third smallest value in -0.1, b, -1/11, -1, 4? -1/11 Let s = 111970/3 + -38009. Let h = s - -686. Which is the third biggest value? (a) h (b) -4 (c) -0.4 (d) 0 c Suppose z + 255 + 269 = 0. Let o = 1047/2 + z. Let y = -4.91 + 5. Which is the second biggest value? (a) 3/4 (b) y (c) o b Let k be -9 + (-7 - 9210/(-60)). Let a = -0.01 - -0.45. What is the third smallest value in k, -3, a, 0.3? 0.3 Let q be (-11)/12 + (-2)/(-3). Suppose -x - 20 = h, -30x + 25 = -4h - 29x. What is the smallest value in h, -0.1, q? h Let q = -644 + 644.04. Let o be 0 + -5 - (-1)/629. Which is the biggest value? (a) o (b) q (c) -1 (d) 1 d Let u be -3 + (-2 - 664/(-352)4). Which is the second biggest value? (a) u (b) -6 (c) 2/7 c Let g = -56 + 64. Let h(v) = -v + 9. Let o(q) = 3q - 28. Let b(p) = 17h(p) + 6o(p). Let f be b(g). What is the second smallest value in 4, f, -0.4, -1/4? -0.4 Suppose -5n = -4k + 74, 41k = 43k + 5*n - 52. What is the biggest value in k, 0, -3/7? k Let t = -267 - -272. Let g = -3.94 + 3.54. Let r = 15 - -4. What is the second smallest value in g, r, t? t Let j = 28240/7 + -4034. Which is the second smallest value? (a) 5/4 (b) j (c) 194 a Let q = 10.47 - 1.97. Let d = q - 8.8. Let f be 7/6 - 2/4. Which is the second biggest value? (a) -2 (b) f (c) d c
Evaluate 1/((-10)/(-880)8). 11 What is 1416/590-155/10? -18 ((-3)/(84/(-8)))/(-2)32/16 -2/7 Evaluate (-3)/4(3094/(-204))/(-91). -1/8 Evaluate ((-14)/3)/(16/39249). -7/3 (-28)/(-882)9/(-12)112/(-36) 2/27 Calculate (-6)/3815/(-5)1/3. 3/19 ((-120)/32)/(60(-8)/(-3456)) -27 What is the value of (-1)/98-7(-24)/(-2)? 6/7 243/(-9)(-2)/(-6) -9 (((-140)/(-245))/(4/(-6)))/((-18)/(-63)) -3 What is 148/(-37)(-6)/(-4)? -6 What is the value of ((-174)/(-36105)83)/(3/(-5))? -2/3 Evaluate 7(-32)/(-560)6/(-3). -4/5 Calculate (((-116)/(-145))/(2/45))/((-3)/3). -18 ((-7)/7)/(72/(-1026)(-3)/4) -19 Evaluate (79/395)/(4/10)6/(-1). -3 What is ((56/8)/(-42))/(9/(-6))? 1/9 What is the value of (((-4)/8)/(1/(-4)))/(182/(-1729))? -19 Calculate (-2)/((-2)/2)((-286)/(-506))/(-13). -2/23 What is (-12)/((-20)/5)13/(-312)3? -3/8 What is the value of (-2)/((-4)/51)44/(-1716)-26? 17 Calculate ((-6)/(-12))/((-7)/126). -9 Calculate (1947/(-893))/((-1)/7). 7 Evaluate (708/(-413))/((-4)/(-14)). -6 Calculate (4/7861/(-61))/((-4)/(-6)). -1/13 (15/8)/((-26)/((-1768)/153)) 5/6 Evaluate 70/(-15)2724/(-1589). 8 What is the value of (-5)/((-80)/(-12))32/(-156)? 2/13 ((-35)/((-910)/52))/((-4)/(-2)23) 1/23 Evaluate (((-228)/(-3591))/(6/81))/((-4)/21). -9/2 Evaluate 48/(-252)314. -8 What is 19/(4104/81)6? 9/4 ((-3)/3)/(13/(221/425)) -1/25 What is ((-60)/(-18))/((-235)/1128)? -16 What is the value of -125/7510? -8 34(-46)/(-1196)-13 -17 Evaluate (52/(-585))/(26/65). -2/9 Calculate 1/(-4)-6(-44)/6. -11 ((-308)/(-56))/((-13/6)/(-1)) 11 (70290/55)/71(-1)/31 -6 ((-6)/(-8))/(((-1881)/(-154))/(24/14)) 2/19 Evaluate (2/6-3)/((90/(-24))/3). 4/5 What is ((-1)/(-2))/(((-9)/(-90))/((-6)/(-15)))? 2 Evaluate ((-13)/546-14)/(5/(-150)). -10 ((-330)/(-616))/(7/(-112)2) -30/7 Calculate (-2172)/199105/3. -2/11 What is the value of ((-96)/(-560))/((-54)/930/(-28))? 2/75 Evaluate (5852/(-8))/11(-10)/(-140)-4. 19 Calculate -4((-16)/(-2))/96-33. 11 What is ((-18)/(-3213)9)/(6/21)? 3/17 Evaluate (((-2)/1)/(-12))/((-268)/268). -1/6 What is 2/(((-51)/68)/3)? -8 (-10)/(-3)(528/(-128))/(-11) 5/4 Calculate (-414)/(-276)28/2. 21 Calculate -153/(-6)16/(-320). -3/8 Calculate (0/(-3750))/(((-10)/(-6))/((-1)/3)). 0 (7/20)/(105/30) 1/10 What is ((-2400)/15)/16(-2)/4? 5 Calculate -415/100(-95)/171. 1/3 What is 2672/90185/(-100)-3? 2/45 Evaluate (21/(840/(-620)))/(5/(-10)1). 31 What is the value of 30/316/(-20)-5? 15 What is the value of ((4/6)/(4/6))/((-42)/168)? -4 What is the value of ((-135)/601)/((-99)/(-24))? -6/11 Calculate 26/271719(-154)/(-378). 2/27 (-7)/37644/(-4459) 4 13/26((-160)/(-7))/(-8) -10/7 Calculate (13/6)/((-9)/(-18)). 1 What is 14/(-6)((-324)/(-9))/12? -7 What is the value of (((-12)/(-23))/2)/(93/(-806)-26)? 2/23 What is the value of (1/(-12)-2)/((-3945)/1052)? -2/45 What is ((-128)/(-3))/329/(-28)? -3/7 1/(-2)2(-885)/177 5 What is the value of (15)/(-3((-169)/39)/(-13))? -5 Evaluate ((-181)/(-2715))/(1/(-5))(-33)/3. 11/3 What is 38/(-247)2457/(-54)? 7 105/(-55)42/147 -6/11 What is ((-1)/(-10)6)/(18/(810/3))? 9 ((675/(-825))/(4/22))/(9/(-30)) 15 Calculate ((-4)/(-10))/(2915/1325). 2/11 Calculate 30/72904/(-565). -2/3 What is ((-1)/(-2))/(53/390)? 13 Evaluate 1/(38/209(-3)/242). -22 ((-9)/(-12))/((-24)/16-1)-1 -1/2 Calculate (-2)/(-8)612/2448. 1/16 (2120/(-2544))/(-10(-4)/(-32)) 2/3 Calculate ((-4725)/50)/(-63)4/(-26). -3/13 What is the value of ((-3)/1)/(12/(-16))(-20)/10? -8 What is the value of -128417/(-272)? 24 What is -5((-8)/(-60))/(42/(-6))? 2/21 Calculate (-22)/605-6610/42. 4/7 Calculate ((-24)/(-20))/(-3)(-26)/((-390)/525). -14 (-28)/704/2 -4/5 What is ((-450)/44)/580/100? -18/11 What is 276/113855/2? 2/33 What is -81(-29)/(-15950)252? -8/11 (-5)/4280/4025 -2/23 Calculate (531/20178)/((1/(-12))/((-2)/6)). 2/19 What is the value of (54/(-9))/96-6? 3/8 -1(-1)/(-2)(-126)/(-504)2 -1/4 What is (195/15)/(-572)4? -1/11 What is 6/(-5)((-420)/(-18))/(-2)? 14 Calculate ((-256)/6)/16(-2)/((-176)/(-55)). 5/3 (-12)/(-18)336/(-112) -2 What is the value of ((-12)/(36/(-3)))/(-7)? -1/7 Evaluate 1-28(-18)/(-2646). -4/21 What is (1014/9968)/((-5)/(-8))? 2/89 Calculate ((-33668)/3101)/((-8)/(-14)). -19 (9/(-8)296/(-222))/(21/8) 4/7 What is the value of 6/((-44)/16(-3)/11)? 8 Calculate (((-8)/70)/(36/(-378)))/(1/5). 6 ((-16)/(-42)462/1232)/((-7)/1) -1/49 16/218/((-80)/5) -1/7 Calculate (-65)/(-260)1/(1/100). 25 Evaluate -2226/429-3. 4 What is the value of (24/(-16))/((-45)/330)? 11 What is (-6)/(-7)(-183)/366? -3/7 What is the value of (1/2)/(-34/216)? -9 What is (40/(-24))/(630/108)? -2/7 Evaluate (62(-12)/(-32))/((-894)/(-1192)). 31 What is ((-2)/12)/(51/3978)? -13 Calculate (-5945)/(-82)6/15. 29 Calculate (((-96)/(-18))/4)/(8/432-3). -24 What is the value of (-5)/(175/6)1265/253? -6/7 -84-2639/(-3042) -28 Calculate (0/10)/((-14)/705). 0 What is (1/(-1))/((-4)/(-20)25/10)? -2 What is 2896/181(-1)/6(-18)/(-4)? -12 What is ((-540)/810)/((-1)/2)? 4/3 What is the value of 6/460/9(-720)/(-600)? 12 What is the value of ((-144)/(-256))/(9/(-24))? -3/2 Calculate 3440/774018/20. 2/5 (45/75)/(33/605) 11 What is the value of (-12)/21(-66)/(-165)(-490)/8? 14 What is the value of ((-18)/15)/((-312)/(-1664))? -32/5 What is the value of 20727/(-127323)((-2)/7)/(-1)? -2/43 (0/((-16)/243))/((-15)/5) 0 Calculate (4/(-26))/((-2288)/4056). 3/11 What is (1/1)/((-4)/16)? -4 Calculate 17/17((-8)/(-5))/((-1)/10). -16 8/2330/((-2880)/24) -2/23 Evaluate (143/((-12584)/(-5016)))/((9/(-2))/(-3)). 38 ((-1188)/(-132))/(2(-3)/(-6)) 9 What is the value of (-2)/3-630/15? 8 What is (-75)/45-2(-3)/(-14)? 5/7 Calculate (3582/(-4378))/((-3)/2). 6/11 What is (77/22)/(721/4944)? 24 What is (-396)/(-88)(-12)/(-27)-6? -12 Calculate 4(-3)/(-9)6/((-2)/1). -4 54/15850/(-5520) -6/23 Calculate (6/(-45))/((-1)/((-72)/480)). -1/50 Calculate (1/(-2))/((15/40)/(780/(-80))). 13 What is the value of 5/(40/720036)? 25 Evaluate 16/10(-1450)/(-696)-3. -10 What is ((-190)/380)/(35/14)? -1/5 ((-300)/330)/((-58)/319) 5 What is the value of (-280)/1400(-5)/9-10? -10/9 What is 180/225(-70)/(-8)? 7 What is the value of (14/(-147)3)/(((-3)/(-1))/(-42))? 4 288/(-72)(-2)/((-16)/42) -21 What is 4/5(-741)/1482? -2/5 What is ((-74)/1036)/((-1)/7)? 1/2 Evaluate (-5)/(((-161)/(-644))/(3/(-24))). 5/2 What is ((-8)/6428)/((-2)/(-4))? -7 What is (35/((-11025)/(-28)))/(12/10)? 2/27 ((-195)/60)/(-13)(-16)/5 -4/5 ((-43)/(-129))/(1/1-1) -1/3 What is 3/(-7)((-665)/399)/((-15)/2)? -2/21 Evaluate ((-2)/3)/(-1)(-927)/(-206). 3 What is 78/(-56)2/(-4)? 1/2 12/(-2)(-22)/(-924)-14 2 ((-9300)/160)/933/5 -3/8 What is (12523/(-3578))/((-3)/(-12)1)? -14 What is the value of ((-9)/(-6))/((40/(-2))/80)? -6 (12/(-10))/((9/(-33))/((-394)/2167)) -4/5 Evaluate 8/48(-9)/84. -3/4 What is (-68)/85350/28? -10 Evaluate (12/(-24))/(4/(-16)(-60)/(-10)). 1/3 What is the value of (-12)/1561/(-244)? 1/5 (1/(-4))/((-143)/(-7436)) -13 What is (5-2)/(41(-80)/9840)? 30 10/(-20)(-7)/(-441)9 -1/14 Calculate (3/(-16))/110(-7)/(-105). -1/8 What is the value of (0/(-1))/((6/21)/(3/21))? 0 8/210-3(-5)/1010 4/7 Calculate (-1)/(3/(-3))-2790/13365. -2/11 12/(-8)-3(1232/(-33))/7 -24 Evaluate ((-36)/612)/((-78)/442). 1/3 What is ((-54)/72)/(-1)11/(968/(-32))? -3/11 Evaluate (((-612)/(-24))/17)/(18/(-168)). -14 8-145/(-2800)50/(-265) -2/53 Calculate ((-3672)/1632)/(4/4). -9/4 ((805/92)/(-35))/((-13)/(-4)) -1/13 Evaluate (-8)/303635/254. -2 Evaluate (-4)/((9/(-3))/(-9)(-48)/(-64)). -16 (10/8)/((-198)/(-132)2/60) 25 Evaluate 4/14200/100. 4/7 (-2)/(-2)-1(-852)/852 1 (-13)/5214/(((-24)/(-4))/3) -7/4 -454/63014/60 -2/25 What is (-76)/14442/(-1)? 2/19 What is 1062/477927/(-7)? -6/7 Calculate 1242/(-552)4/6. -3/2 Evaluate (1/(-5))/(((-100)/125)/4). 1 What is the value of (6/(-7))/(((-124)/(-62))/((-56)/(-6)))? -4 (1/14)/(2/(-12)) -3/7 (30/90)/(2/35)28/70 7/3 What is ((-1)/39)/((-278)/1807)? 1/6 What is 9/180(-1)/3? 0 Calculate 12/(-2)(-30)/1480(-24)/(-54). 2/37 What is (70/210)/(10/(-240))? -8 What is the value of 8/(41/(451/(-22)))? -4 Evaluate ((-5)/(-855)-3)/(((-35)/(-2))/35). -2/57 ((-717)/3346)/((-30)/14) 1/10 Evaluate ((-1026)/342)/(-67/20). 10/7 What is the value of (-2)/(-2)31/(-248)-112? 14 Calculate ((-1)/(-2))/((12/(-126))/(128/56)). -12 What is (680/(-544))/(5/48)? -12 Evaluate (-25)/(7000/(-128))56/16. 8/5 (-13212/(-720))/(1/10) 22 What is the value of (-31552)/92806/(-17)? 6/5 Evaluate -1(-2)/6-9(-15)/(-20). -9/4 Calculate (-11)/6344/2838. -2/9 Evaluate -35(-9)/(-45)-2. 14 What is (-14)/560706/(-7)? 3/2 What is the value of (992/(-768))/31*(-1)/(2/(-4))? -1/12